1 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3 * config/kde.m4: fix consecutive ./configure runs,
4 look for qtarch, fix library order
6 * src/frontends/kde/Makefile.am: tidy up,
7 add Print dialog, add .dlg dependencies
9 * src/frontends/kde/FormPrint.C:
10 * src/frontends/kde/FormPrint.h:
11 * src/frontends/kde/formprintdialog.C:
12 * src/frontends/kde/formprintdialog.h:
13 * src/frontends/kde/formprintdialogdata.C:
14 * src/frontends/kde/formprintdialogdata.h:
15 * src/frontends/kde/dlg/formprintdialog.dlg: add
18 * src/frontends/kde/dlg/README: Added explanatory readme
20 * src/frontends/kde/dlg/checkinitorder.pl: small perl
21 script to double-check qtarch's output
23 * src/frontends/kde/formindexdialog.C:
24 * src/frontends/kde/formindexdialogdata.C:
25 * src/frontends/kde/formindexdialogdata.h:
26 * src/frontends/kde/dlg/formindexdialog.dlg: update
27 for qtarch, minor fixes
29 2000-10-05 Allan Rae <rae@lyx.org>
31 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
32 dialogs when switching buffers update them instead. It's up to each
33 dialog to decide if it should still be visible or not.
34 update() should return a bool to control visiblity within show().
35 Or perhaps better to set a member variable and use that to control
38 * lib/build-listerrors: create an empty "listerrors" file just to stop
39 make trying to regenerate it all the time if you don't have noweb
42 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
44 * po/Makefile.in.in (ext_l10n.h): added a rule to build
45 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
46 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
47 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
48 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
50 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
52 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
54 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
55 deleting buffer. Closes all buffer-dependent dialogs.
57 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
59 * src/frontends/xforms/FormCitation.[Ch]:
60 * src/frontends/xforms/FormPreferences.[Ch]:
61 * src/frontends/xforms/FormPrint.[Ch]:
62 * src/frontends/xforms/FormRef.[Ch]:
63 * src/frontends/xforms/FormUrl.[Ch]: ditto
65 * src/frontends/xforms/FormDocument.[Ch]:
66 * src/frontends/xforms/forms/form_document.C.patch:
67 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
68 pass through a single input() function.
70 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
72 * lib/build-listerrors: return status as OK
74 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
76 * lib/lyxrc.example: Updated to new export code
78 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
80 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
83 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
86 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
88 * lib/layouts/amsbook.layout: ditto.
90 * boost/Makefile.am: fix typo.
92 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
94 (add_lastfiles): removed.
95 (add_documents): removed.
96 (add_formats): removed.
98 * src/frontends/Menubar.C: remove useless "using" directive.
100 * src/MenuBackend.h: add a new MenuItem constructor.
102 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
105 2000-10-04 Allan Rae <rae@lyx.org>
107 * lib/Makefile.am (listerrors):
108 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
109 I haven't got notangle installed so Kayvan please test. The output
110 should end up in $builddir. This also allows people who don't have
111 noweb installed to complete the make process without error.
113 * src/frontends/xforms/FormCommand.[Ch] (showInset):
114 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
115 by JMarc's picky compiler.
117 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
120 * src/insets/insettabular.C (setPos): change for loop to not use
121 sequencing operator. Please check this Jürgen.
123 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
125 * src/insets/insetcite.C (getScreenLabel): ditto
126 * src/support/filetools.C (QuoteName): ditto
127 (ChangeExtension): ditto
129 * src/BufferView_pimpl.C (scrollCB): make heigt int
131 * src/BufferView2.C (insertInset): comment out unused arg
133 * boost/Makefile.am (EXTRADIST): new variable
135 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
137 * src/exporter.C (IsExportable): Fixed
139 * lib/configure.m4: Small fix
141 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
143 * src/insets/insetbutton.C (width): Changed to work with no GUI.
144 * src/insets/insetbib.C (bibitemWidest): ditto.
145 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
147 2000-10-03 Juergen Vigna <jug@sad.it>
149 * src/BufferView2.C (theLockingInset): removed const because of
150 Agnus's compile problems.
152 * src/insets/insettext.C (LocalDispatch): set the language of the
153 surronding paragraph on inserting the first character.
155 * various files: changed use of BufferView::the_locking_inset.
157 * src/BufferView2.C (theLockingInset):
158 (theLockingInset): new functions.
160 * src/BufferView.h: removed the_locking_inset.
162 * src/lyxtext.h: added the_locking_inset
164 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
166 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
168 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
170 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
171 * src/mathed/math_cursor.C (IsAlpha): ditto.
172 * src/mathed/math_inset.C (strnew): ditto.
173 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
174 (IMetrics): cxp set but never used; removed.
175 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
176 that the variable in question has been removed also!
179 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
180 using the Buffer * passed to Latex(), using the BufferView * passed to
181 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
183 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
184 Linuxdoc() and DocBook() rather than the stored Buffer * master.
186 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
187 * src/buffer.C (readInset): used new InsetBibtex c-tor
188 * (getBibkeyList): used new InsetBibtex::getKeys
190 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
193 * lib/build-listerrors
195 * src/exporter.C: Add literate programming support to the export code
198 * src/lyx_cb.C: Remove old literate code.
200 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
203 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
204 * src/converter.C (View, Convert): Use QuoteName.
206 * src/insets/figinset.C (Preview): Use Formats::View.
208 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
210 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
212 * src/lyxfunc.C (Dispatch): move declaration of text variable at
213 the top of the function, because compaq cxx complains that the
214 "goto exit_with_message" when the function is disabled bypasses
216 (MenuNew): try a better fix for the generation of new file names.
217 This time, I used AddName() instead of AddPath(), hoping Juergen
220 2000-10-03 Allan Rae <rae@lyx.org>
222 * src/frontends/xforms/forms/form_preferences.fd:
223 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
224 nested tabfolders has begun. The old "Miscellaneous" was renamed as
225 "Look and Feel"->"General" but will need to be split up further into
226 general output and general input tabs. Current plan is for four outer
227 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
228 stuff; "Inputs" for input and import configuration; "Outputs" for
229 output and export configuration; and one more whatever is left over
230 called "General". The leftovers at present look like being which
231 viewers to use, spellchecker, language support and might be better
232 named "Support". I've put "Paths" in "Inputs" for the moment as this
233 seems reasonable for now at least.
234 One problem remains: X error kills LyX when you close Preferences.
236 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
238 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
239 qualifier from form()
240 * src/frontends/xforms/FormCitation.[Ch]:
241 * src/frontends/xforms/FormCopyright.[Ch]:
242 * src/frontends/xforms/FormDocument.[Ch]:
243 * src/frontends/xforms/FormError.[Ch]:
244 * src/frontends/xforms/FormIndex.[Ch]:
245 * src/frontends/xforms/FormPreferences.[Ch]:
246 * src/frontends/xforms/FormPrint.[Ch]:
247 * src/frontends/xforms/FormRef.[Ch]:
248 * src/frontends/xforms/FormToc.[Ch]:
249 * src/frontends/xforms/FormUrl.[Ch]: ditto.
251 * src/frontends/xforms/FormCitation.[Ch]:
252 * src/frontends/xforms/FormIndex.[Ch]:
253 * src/frontends/xforms/FormRef.[Ch]:
254 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
255 with Allan's naming policy
257 * src/frontends/xforms/FormCitation.C: some static casts to remove
260 2000-10-02 Juergen Vigna <jug@sad.it>
262 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
263 now you can type or do stuff inside the table-cell also when in dummy
264 position, fixed visible cursor.
266 * src/insets/insettext.C (Edit): fixing cursor-view position.
268 * src/lyxfunc.C (Dispatch): use * text variable so that it can
269 be used for equal functions in lyxfunc and insettext.
271 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
273 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
275 * src/frontends/gnome/FormCitation.h:
276 * src/frontends/gnome/FormCopyright.h:
277 * src/frontends/gnome/FormIndex.h:
278 * src/frontends/gnome/FormPrint.h:
279 * src/frontends/gnome/FormToc.h:
280 * src/frontends/gnome/FormUrl.h:
281 * src/frontends/kde/FormCitation.h:
282 * src/frontends/kde/FormCopyright.h:
283 * src/frontends/kde/FormIndex.h:
284 * src/frontends/kde/FormRef.h:
285 * src/frontends/kde/FormToc.h:
286 * src/frontends/kde/FormUrl.h: fix remaining users of
289 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
291 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
293 (DocBookHandleCaption): ditto.
294 (DocBookHandleFootnote): ditto.
295 (SimpleDocBookOnePar): ditto.
297 * src/frontends/xforms/FormDocument.h (form): remove extra
298 FormDocument:: qualifier.
300 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
302 * sigc++/handle.h: ditto.
304 * src/lyx_gui_misc.C: add "using" directive.
306 * src/cheaders/cstddef: new file, needed by the boost library (for
309 2000-10-02 Juergen Vigna <jug@sad.it>
311 * src/insets/insettext.C (SetFont): better support.
313 * src/insets/insettabular.C (draw): fixed drawing of single cell.
315 * src/screen.C (DrawOneRow): some uint refixes!
317 2000-10-02 Allan Rae <rae@lyx.org>
319 * boost/.cvsignore: ignore Makefile as well
321 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
322 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
324 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
325 Left this one out by accident.
327 * src/frontends/xforms/FormBase.h (restore): default to calling
328 update() since that will restore the original/currently-applied values.
329 Any input() triggered error messages will require the derived classes
330 to redefine restore().
332 * src/frontends/xforms/FormDocument.C: initialize a few variables to
333 avoid a segfault. combo_doc_class is the main concern.
335 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
337 * Simplify build-listerrors in view of GUI-less export ability!
339 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
341 * src/lyx_main.C (easyParse): Disable gui when exporting
343 * src/insets/figinset.C:
347 * src/tabular.C: Changes to allow no-gui.
349 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
351 * src/support/utility.hpp: removed file
352 * src/support/block.h: removed file
354 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
357 * src/mathed/formula.C: add support/lyxlib.h
358 * src/mathed/formulamacro.C: ditto
360 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
361 * src/lyxparagraph.h: ditto
363 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
364 * src/frontends/Makefile.am (INCLUDES): ditto
365 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
366 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
367 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
368 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
369 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
370 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
372 * src/BufferView.h: use boost/utility.hpp
373 * src/LColor.h: ditto
375 * src/LyXAction.h: ditto
376 * src/LyXView.h: ditto
377 * src/bufferlist.h: ditto
378 * src/lastfiles.h: ditto
379 * src/layout.h: ditto
380 * src/lyx_gui.h: ditto
381 * src/lyx_main.h: ditto
382 * src/lyxlex.h: ditto
384 * src/frontends/ButtonPolicies.h: ditto
385 * src/frontends/Dialogs.h: ditto
386 * src/frontends/xforms/FormBase.h: ditto
387 * src/frontends/xforms/FormGraphics.h: ditto
388 * src/frontends/xforms/FormParagraph.h: ditto
389 * src/frontends/xforms/FormTabular.h: ditto
390 * src/graphics/GraphicsCache.h: ditto
391 * src/graphics/Renderer.h: ditto
392 * src/insets/ExternalTemplate.h: ditto
393 * src/insets/insetcommand.h: ditto
394 * src/support/path.h: ditto
396 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
397 and introduce clause for 2.97.
399 * boost/libs/README: new file
401 * boost/boost/utility.hpp: new file
403 * boost/boost/config.hpp: new file
405 * boost/boost/array.hpp: new file
407 * boost/Makefile.am: new file
409 * boost/.cvsignore: new file
411 * configure.in (AC_OUTPUT): add boost/Makefile
413 * Makefile.am (SUBDIRS): add boost
415 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
417 * src/support/lstrings.C (suffixIs): Fixed.
419 2000-10-01 Allan Rae <rae@lyx.org>
421 * src/PrinterParams.h: moved things around to avoid the "can't
422 inline call" warning.
424 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
425 into doc++ documentation.
427 * src/frontends/xforms/FormCommand.[Ch]: support button policy
429 * src/frontends/xforms/FormRef.C: make use of button controller
430 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
431 cleaned up button controller usage.
432 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
433 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
434 use the button controller
436 * src/frontends/xforms/forms/*.fd: and associated generated files
437 updated to reflect changes to FormBase. Some other FormXxxx files
438 also got minor updates to reflect changes to FormBase.
440 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
441 (hide): made virtual.
442 (input): return a bool. true == valid input
443 (RestoreCB, restore): new
444 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
445 Changes to allow derived dialogs to use a ButtonController and
446 make sense when doing so: OK button calls ok() and so on.
448 * src/frontends/xforms/ButtonController.h (class ButtonController):
449 Switch from template implementation to taking Policy parameter.
450 Allows FormBase to provide a ButtonController for any dialog.
452 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
453 Probably should rename connect and disconnect.
454 (apply): use the radio button groups
455 (form): needed by FormBase
456 (build): setup the radio button groups
458 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
460 * several files: type changes to reduce the number of warnings and
461 to unify type hangling a bit. Still much to do.
463 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
465 * lib/images/*: rename a bunch of icons to match Dekel converter
468 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
471 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
473 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
475 * sigc++/handle.h: ditto for class Handle.
477 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
479 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
481 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
483 * src/intl.C (InitKeyMapper): Correct the value of n due to the
484 removal of the "default" language.
486 * src/combox.h (getline): Check that sel > 0
488 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
490 * lib/examples/docbook_example.lyx
491 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
493 * lib/layouts/docbook-book.layout: new docbook book layout.
495 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
497 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
499 * src/insets/figinset.C (DocBook):fixed small typo.
501 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
503 * src/insets/insetinclude.h: string include_label doesn't need to be
506 2000-09-29 Allan Rae <rae@lyx.org>
508 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
509 Allow derived type to control connection and disconnection from signals
510 of its choice if desired.
512 2000-09-28 Juergen Vigna <jug@sad.it>
514 * src/insets/insettabular.C (update): fixed cursor setting when
515 the_locking_inset changed.
516 (draw): made this a bit cleaner.
517 (InsetButtonPress): fixed!
519 * various files: added LyXText Parameter to fitCursor call.
521 * src/BufferView.C (fitCursor): added LyXText parameter.
523 * src/insets/insettabular.C (draw): small draw fix.
525 * src/tabular.C: right setting of left/right celllines.
527 * src/tabular.[Ch]: fixed various types in funcions and structures.
528 * src/insets/insettabular.C: ditto
529 * src/frontends/xforms/FormTabular.C: ditto
531 2000-09-28 Allan Rae <rae@lyx.org>
533 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
534 that the #ifdef's had been applied to part of what should have been
535 a complete condition. It's possible there are other tests that
536 were specific to tables that are also wrong now that InsetTabular is
537 being used. Now we need to fix the output of '\n' after a table in a
538 float for the same reason as the original condition:
539 "don't insert this if we would be adding it before or after a table
540 in a float. This little trick is needed in order to allow use of
541 tables in \subfigures or \subtables."
542 Juergen can you check this?
544 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
546 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
547 outputed to the ostream.
549 * several files: fixed types based on warnings from cxx
551 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
553 * src/frontends/kde/Makefile.am: fix rule for
554 formindexdialogdata_moc.C
556 * src/.cvsignore: add ext_l10n.h to ignore
558 * acconfig.h: stop messing with __STRICT_ANSI__
559 * config/gnome.m4: remove option to set -ansi
560 * config/kde.m4: remove option to set -ansi
561 * config/lyxinclude.m4: don't set -ansi
563 2000-09-27 Juergen Vigna <jug@sad.it>
565 * various files: remove "default" language check.
567 * src/insets/insetquotes.C: removed use of current_view.
569 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
570 the one should have red ears by now!
572 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
573 in more then one paragraph. Fixed cursor-movement/selection.
575 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
576 paragraphs inside a text inset.
578 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
579 text-inset if this owner is an inset.
581 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
583 * src/Bullet.h: changed type of font, character and size to int
585 * src/buffer.C (asciiParagraph): remove actcell and fname1.
587 * src/insets/inseturl.[Ch]:
588 * src/insets/insetref.[Ch]:
589 * src/insets/insetlabel.[Ch]: add linelen to Ascii
591 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
593 * src/buffer.C (readFile): block-if statement rearranged to minimise
594 bloat. Patch does not reverse Jean-Marc's change ;-)
596 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
597 Class rewritten to store pointers to hide/update signals directly,
598 rather than Dialogs *. Also defined an enum to ease use. All xforms
599 forms can now be derived from this class.
601 * src/frontends/xforms/FormCommand.[Ch]
602 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
604 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
607 * src/frontends/xforms/forms/form_citation.fd
608 * src/frontends/xforms/forms/form_copyright.fd
609 * src/frontends/xforms/forms/form_error.fd
610 * src/frontends/xforms/forms/form_index.fd
611 * src/frontends/xforms/forms/form_ref.fd
612 * src/frontends/xforms/forms/form_toc.fd
613 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
615 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
617 * src/insets/insetfoot.C: removed redundent using directive.
619 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
621 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
622 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
624 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
625 created in the constructors in different groups. Then set() just
626 have to show the groups as needed. This fixes the redraw problems
627 (and is how the old menu code worked).
629 * src/support/lyxlib.h: declare the methods as static when we do
632 2000-09-26 Juergen Vigna <jug@sad.it>
634 * src/buffer.C (asciiParagraph): new function.
635 (writeFileAscii): new function with parameter ostream.
636 (writeFileAscii): use now asciiParagraph.
638 * various inset files: added the linelen parameter to the Ascii-func.
640 * src/tabular.C (Write): fixed error in writing file introduced by
641 the last changes from Lars.
643 * lib/bind/menus.bind: removed not supported functions.
645 * src/insets/insettext.C (Ascii): implemented this function.
647 * src/insets/lyxinset.h (Ascii): added linelen parameter.
649 * src/tabular.C (write_attribute[int,string,bool]): new functions.
650 (Write): use of the write_attribute functions.
652 * src/bufferlist.C (close): fixed reasking question!
654 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
656 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
657 new files use the everwhere possible.
660 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
661 src/log_form.C src/lyx.C:
664 * src/buffer.C (runLaTeX): remove func
666 * src/PaperLayout.C: removed file
667 * src/ParagraphExtra.C: likewise
668 * src/bullet_forms.C: likewise
669 * src/bullet_forms.h: likewise
670 * src/bullet_forms_cb.C: likewise
672 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
673 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
676 * several files: remove all traces of the old fd_form_paragraph,
677 and functions belonging to that.
679 * several files: remove all traces of the old fd_form_document,
680 and functions belonging to that.
682 * several files: constify local variables were possible.
684 * several files: remove all code that was dead when NEW_EXPORT was
687 * several files: removed string::c_str in as many places as
690 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
691 (e): be a bit more outspoken when patching
692 (updatesrc): only move files if changed.
694 * forms/layout_forms.h.patch: regenerated
696 * forms/layout_forms.fd: remove form_document and form_paragraph
697 and form_quotes and form_paper and form_table_options and
700 * forms/form1.fd: remove form_table
702 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
703 the fdui->... rewrite. Update some comments to xforms 0.88
705 * forms/bullet_forms.C.patch: removed file
706 * forms/bullet_forms.fd: likewise
707 * forms/bullet_forms.h.patch: likewise
709 * development/Code_rules/Rules: added a section on switch
710 statements. Updated some comment to xforms 0.88.
712 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
714 * src/buffer.C (readFile): make sure that the whole version number
715 is read after \lyxformat (even when it contains a comma)
717 * lib/ui/default.ui: change shortcut of math menu to M-a.
719 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
721 * src/vspace.C (nextToken): use isStrDbl() to check for proper
724 * src/LyXView.C (updateWindowTitle): show the full files name in
725 window title, limited to 30 characters.
727 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
728 When a number of characters has been given, we should not assume
729 that the string is 0-terminated.
731 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
732 calls (fixes some memory leaks)
734 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
735 trans member on exit.
737 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
739 * src/converter.C (GetReachable): fix typo.
741 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
742 understand ',' instead of '.'.
743 (GetInteger): rewrite to use strToInt().
745 2000-09-26 Juergen Vigna <jug@sad.it>
747 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
748 better visibility and error-message on wrong VSpace input.
750 * src/language.C (initL): added english again.
752 2000-09-25 Juergen Vigna <jug@sad.it>
754 * src/frontends/kde/Dialogs.C (Dialogs):
755 * src/frontends/gnome/Dialogs.C (Dialogs):
756 * src/frontends/kde/Makefile.am:
757 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
759 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
761 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
763 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
765 * src/frontends/xforms/FormParagraph.C:
766 * src/frontends/xforms/FormParagraph.h:
767 * src/frontends/xforms/form_paragraph.C:
768 * src/frontends/xforms/form_paragraph.h:
769 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
772 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
774 * src/tabular.C (OldFormatRead): forgot to delete the temporary
775 Paragraph-Data after use.
777 * src/insets/insettext.C (LocalDispatch): don't set the layout on
778 non breakable paragraphs.
780 2000-09-25 Garst R. Reese <reese@isn.net>
782 * src/language.C (initL): added missing language_country codes.
784 2000-09-25 Juergen Vigna <jug@sad.it>
786 * src/insets/insettext.C (InsetText):
787 (deleteLyXText): remove the not released LyXText structure!
789 2000-09-24 Marko Vendelin <markov@ioc.ee>
791 * src/frontends/gnome/mainapp.C
792 * src/frontends/gnome/mainapp.h: added support for keyboard
795 * src/frontends/gnome/FormCitation.C
796 * src/frontends/gnome/FormCitation.h
797 * src/frontends/gnome/Makefile.am
798 * src/frontends/gnome/pixbutton.h: completed the rewrite of
799 FormCitation to use "action area" in mainapp window
801 * src/frontends/gnome/Menubar_pimpl.C
802 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
805 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
807 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
808 width/descent/ascent values if name is empty.
809 (mathed_string_height): Use std::max.
811 2000-09-25 Allan Rae <rae@lyx.org>
813 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
814 segfault. This will be completely redesigned soon.
816 * sigc++: updated libsigc++. Fixes struct timespec bug.
818 * development/tools/makeLyXsigc.sh: .cvsignore addition
820 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
822 * several files: removed almost all traces of the old table
825 * src/TableLayout.C: removed file
827 2000-09-22 Juergen Vigna <jug@sad.it>
829 * src/frontends/kde/Dialogs.C: added credits forms.
831 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
833 * src/frontends/gnome/Dialogs.C: added some forms.
835 * src/spellchecker.C (init_spell_checker): set language in pspell code
836 (RunSpellChecker): some modifications for setting language string.
838 * src/language.[Ch]: added language_country code.
840 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
842 * src/frontends/Dialogs.h: added new signal showError.
843 Rearranged existing signals in some sort of alphabetical order.
845 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
846 FormError.[Ch], form_error.[Ch]
847 * src/frontends/xforms/forms/makefile: added new file form_error.fd
848 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
850 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
851 dialogs. I think that this can be used as the base to all these
854 * src/frontends/xforms/FormError.[Ch]
855 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
856 implementation of InsetError dialog.
858 * src/insets/inseterror.[Ch]: rendered GUI-independent.
860 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
861 * src/frontends/kde/Makefile.am: ditto
863 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
865 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
866 macrobf. This fixes a bug of invisible text.
868 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
870 * lib/doc/LaTeXConfig.lyx.in: updated.
872 * src/language.C (initL): remove language "francais" and change a
873 bit the names of the two other french variations.
875 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
876 string that may not be 0-terminated.
878 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
880 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
882 2000-09-20 Marko Vendelin <markov@ioc.ee>
884 * src/frontends/gnome/FormCitation.C
885 * src/frontends/gnome/FormIndex.C
886 * src/frontends/gnome/FormToc.C
887 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
888 the variable initialization to shut up the warnings
890 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
892 * src/table.[Ch]: deleted files
894 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
897 2000-09-18 Juergen Vigna <jug@sad.it>
899 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
900 problems with selection. Inserted new LFUN_PASTESELECTION.
901 (InsetButtonPress): inserted handling of middle mouse-button paste.
903 * src/spellchecker.C: changed word to word.c_str().
905 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
907 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
908 included in the ``make dist'' tarball.
910 2000-09-15 Juergen Vigna <jug@sad.it>
912 * src/CutAndPaste.C (cutSelection): small fix return the right
913 end position after cut inside one paragraph only.
915 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
916 we are locked as otherwise we don't have a valid cursor position!
918 * src/insets/figinset.C (draw): small bugfix but why is this needed???
920 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
922 * src/frontends/kde/FormRef.C: added using directive.
923 * src/frontends/kde/FormToc.C: ditto
925 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
927 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
929 2000-09-19 Marko Vendelin <markov@ioc.ee>
931 * src/frontends/gnome/Menubar_pimpl.C
932 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
933 Toc, ViewFormats, UpdateFormats, and ExportFormats.
935 * src/frontends/gnome/mainapp.C
936 * src/frontends/gnome/mainapp.h: support for menu update used
939 * src/frontends/gnome/mainapp.C
940 * src/frontends/gnome/mainapp.h: support for "action" area in the
941 main window. This area is used by small simple dialogs, such as
944 * src/frontends/gnome/FormIndex.C
945 * src/frontends/gnome/FormIndex.h
946 * src/frontends/gnome/FormUrl.C
947 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
950 * src/frontends/gnome/FormCitation.C
951 * src/frontends/gnome/FormCitation.h: rewrite to use main window
952 action area. Only "Insert new citation" is implemented.
954 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
956 * src/buffer.C (Dispatch): fix call to Dispatch
957 * src/insets/insetref.C (Edit): likewise
958 * src/insets/insetparent.C (Edit): likewise
959 * src/insets/insetinclude.C (include_cb): likewise
960 * src/frontends/xforms/FormUrl.C (apply): likewise
961 * src/frontends/xforms/FormToc.C (apply): likewise
962 * src/frontends/xforms/FormRef.C (apply): likewise
963 * src/frontends/xforms/FormIndex.C (apply): likewise
964 * src/frontends/xforms/FormCitation.C (apply): likewise
965 * src/lyxserver.C (callback): likewise
966 * src/lyxfunc.C (processKeySym): likewise
969 * src/lyx_cb.C (LayoutsCB): likewise
971 * Makefile.am (sourcedoc): small change
973 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
975 * src/main.C (main): Don't make an empty GUIRunTime object. all
976 methods are static. constify a bit remove unneded using + headers.
978 * src/tabular.C: some more const to local vars move some loop vars
980 * src/spellchecker.C: added some c_str after some word for pspell
982 * src/frontends/GUIRunTime.h: add new static method setDefaults
983 * src/frontends/xforms/GUIRunTime.C (setDefaults):
984 * src/frontends/kde/GUIRunTime.C (setDefaults):
985 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
987 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
988 with strnew in arg, use correct emptystring when calling SetName.
990 * several files: remove all commented code with relation to
991 HAVE_SSTREAM beeing false. We now only support stringstream and
994 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
996 * src/lyxfunc.C: construct correctly the automatic new file
999 * src/text2.C (IsStringInText): change type of variable i to shut
1002 * src/support/sstream.h: do not use namespaces if the compiler
1003 does not support them.
1005 2000-09-15 Marko Vendelin <markov@ioc.ee>
1006 * src/frontends/gnome/FormCitation.C
1007 * src/frontends/gnome/FormCitation.h
1008 * src/frontends/gnome/diainsertcitation_interface.c
1009 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1010 regexp support to FormCitation [Gnome].
1012 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1015 * configure.in: remove unused KDE/GTKGUI define
1017 * src/frontends/kde/FormRef.C
1018 * src/frontends/kde/FormRef.h
1019 * src/frontends/kde/formrefdialog.C
1020 * src/frontends/kde/formrefdialog.h: double click will
1021 go to reference, now it is possible to change a cross-ref
1024 * src/frontends/kde/FormToc.C
1025 * src/frontends/kde/FormToc.h
1026 * src/frontends/kde/formtocdialog.C
1027 * src/frontends/kde/formtocdialog.h: add a depth
1030 * src/frontends/kde/Makefile.am: add QtLyXView.h
1033 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1035 * src/frontends/kde/FormCitation.h: added some using directives.
1037 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1039 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1042 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1045 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1047 * src/buffer.C (pop_tag): revert for the second time a change by
1048 Lars, who seems to really hate having non-local loop variables :)
1050 * src/Lsstream.h: add "using" statements.
1052 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1053 * src/buffer.C (writeFile): ditto
1055 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1057 * src/buffer.C (writeFile): try to fix the locale modified format
1058 number to always be as we want it.
1060 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1061 in XForms 0.89. C-space is now working again.
1063 * src/Lsstream.h src/support/sstream.h: new files.
1065 * also commented out all cases where strstream were used.
1067 * src/Bullet.h (c_str): remove method.
1069 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1071 * a lot of files: get rid of "char const *" and "char *" is as
1072 many places as possible. We only want to use them in interaction
1073 with system of other libraries, not inside lyx.
1075 * a lot of files: return const object is not of pod type. This
1076 helps ensure that temporary objects is not modified. And fits well
1077 with "programming by contract".
1079 * configure.in: check for the locale header too
1081 * Makefile.am (sourcedoc): new tag for generation of doc++
1084 2000-09-14 Juergen Vigna <jug@sad.it>
1086 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1087 callback to check which combo called it and do the right action.
1089 * src/combox.C (combo_cb): added combo * to the callbacks.
1090 (Hide): moved call of callback after Ungrab of the pointer.
1092 * src/intl.h: removed LCombo2 function.
1094 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1095 function as this can now be handled in one function.
1097 * src/combox.h: added Combox * to callback prototype.
1099 * src/frontends/xforms/Toolbar_pimpl.C:
1100 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1102 2000-09-14 Garst Reese <reese@isn.net>
1104 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1105 moved usepackage{xxx}'s to beginning of file. Changed left margin
1106 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1107 underlining from title. Thanks to John Culleton for useful suggestions.
1109 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1111 * src/lyxlex_pimpl.C (setFile): change error message to debug
1114 2000-09-13 Juergen Vigna <jug@sad.it>
1116 * src/frontends/xforms/FormDocument.C: implemented choice_class
1117 as combox and give callback to combo_language so OK/Apply is activated
1120 * src/bufferlist.C (newFile): small fix so already named files
1121 (via an open call) are not requested to be named again on the
1124 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1126 * src/frontends/kde/Makefile.am
1127 * src/frontends/kde/FormRef.C
1128 * src/frontends/kde/FormRef.h
1129 * src/frontends/kde/formrefdialog.C
1130 * src/frontends/kde/formrefdialog.h: implement
1133 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1135 * src/frontends/kde/formtocdialog.C
1136 * src/frontends/kde/formtocdialog.h
1137 * src/frontends/kde/FormToc.C
1138 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1140 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1142 * src/frontends/kde/FormCitation.C: fix thinko
1143 where we didn't always display the reference text
1146 * src/frontends/kde/formurldialog.C
1147 * src/frontends/kde/formurldialog.h
1148 * src/frontends/kde/FormUrl.C
1149 * src/frontends/kde/FormUrl.h: minor cleanups
1151 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1153 * src/frontends/kde/Makefile.am
1154 * src/frontends/kde/FormToc.C
1155 * src/frontends/kde/FormToc.h
1156 * src/frontends/kde/FormCitation.C
1157 * src/frontends/kde/FormCitation.h
1158 * src/frontends/kde/FormIndex.C
1159 * src/frontends/kde/FormIndex.h
1160 * src/frontends/kde/formtocdialog.C
1161 * src/frontends/kde/formtocdialog.h
1162 * src/frontends/kde/formcitationdialog.C
1163 * src/frontends/kde/formcitationdialog.h
1164 * src/frontends/kde/formindexdialog.C
1165 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1167 2000-09-12 Juergen Vigna <jug@sad.it>
1169 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1172 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1174 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1177 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1179 * src/converter.C (Add, Convert): Added support for converter flags:
1180 needaux, resultdir, resultfile.
1181 (Convert): Added new parameter view_file.
1182 (dvips_options): Fixed letter paper option.
1184 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1185 (Export, GetExportableFormats, GetViewableFormats): Added support
1188 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1190 (easyParse): Fixed to work with new export code.
1192 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1195 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1197 * lib/bind/*.bind: Replaced
1198 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1199 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1201 2000-09-11 Juergen Vigna <jug@sad.it>
1203 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1205 * src/main.C (main): now GUII defines global guiruntime!
1207 * src/frontends/gnome/GUIRunTime.C (initApplication):
1208 * src/frontends/kde/GUIRunTime.C (initApplication):
1209 * src/frontends/xforms/GUIRunTime.C (initApplication):
1210 * src/frontends/GUIRunTime.h: added new function initApplication.
1212 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1214 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1216 2000-09-08 Juergen Vigna <jug@sad.it>
1218 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1219 we have already "Reset".
1221 * src/language.C (initL): inserted "default" language and made this
1222 THE default language (and not american!)
1224 * src/paragraph.C: inserted handling of "default" language!
1226 * src/lyxfont.C: ditto
1230 * src/paragraph.C: output the \\par only if we have a following
1231 paragraph otherwise it's not needed.
1233 2000-09-05 Juergen Vigna <jug@sad.it>
1235 * config/pspell.m4: added entry to lyx-flags
1237 * src/spellchecker.C: modified version from Kevin for using pspell
1239 2000-09-01 Marko Vendelin <markov@ioc.ee>
1240 * src/frontends/gnome/Makefile.am
1241 * src/frontends/gnome/FormCitation.C
1242 * src/frontends/gnome/FormCitation.h
1243 * src/frontends/gnome/diainsertcitation_callbacks.c
1244 * src/frontends/gnome/diainsertcitation_callbacks.h
1245 * src/frontends/gnome/diainsertcitation_interface.c
1246 * src/frontends/gnome/diainsertcitation_interface.h
1247 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1248 dialog for Gnome frontend
1250 * src/main.C: Gnome libraries require keeping application name
1251 and its version as strings
1253 * src/frontends/gnome/mainapp.C: Change the name of the main window
1254 from GnomeLyX to PACKAGE
1256 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1258 * src/frontends/Liason.C: add "using: declaration.
1260 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1262 * src/mathed/math_macro.C (Metrics): Set the size of the template
1264 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1266 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1268 * src/converter.C (add_options): New function.
1269 (SetViewer): Change $$FName into '$$FName'.
1270 (View): Add options when running xdvi
1271 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1272 (Convert): The 3rd parameter is now the desired filename. Converts
1273 calls to lyx::rename if necessary.
1274 Add options when running dvips.
1275 (dvi_papersize,dvips_options): New methods.
1277 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1279 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1280 using a call to Converter::dvips_options.
1281 Fixed to work with nex export code.
1283 * src/support/copy.C
1284 * src/support/rename.C: New files
1286 * src/support/syscall.h
1287 * src/support/syscall.C: Added Starttype SystemDontWait.
1289 * lib/ui/default.ui: Changed to work with new export code
1291 * lib/configure.m4: Changed to work with new export code
1293 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1295 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1297 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1298 so that code compiles with DEC cxx.
1300 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1301 to work correctly! Also now supports the additional elements
1304 2000-09-01 Allan Rae <rae@lyx.org>
1306 * src/frontends/ButtonPolicies.C: renamed all the references to
1307 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1309 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1310 since it's a const not a type.
1312 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1314 2000-08-31 Juergen Vigna <jug@sad.it>
1316 * src/insets/figinset.C: Various changes to look if the filename has
1317 an extension and if not add it for inline previewing.
1319 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1321 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1322 make buttonStatus and isReadOnly be const methods. (also reflect
1323 this in derived classes.)
1325 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1326 (nextState): change to be static inline, pass the StateMachine as
1328 (PreferencesPolicy): remove casts
1329 (OkCancelPolicy): remvoe casts
1330 (OkCancelReadOnlyPolicy): remove casts
1331 (NoRepeatedApplyReadOnlyPolicy): remove casts
1332 (OkApplyCancelReadOnlyPolicy): remove casts
1333 (OkApplyCancelPolicy): remove casts
1334 (NoRepeatedApplyPolicy): remove casts
1336 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1338 * src/converter.C: added some using directives
1340 * src/frontends/ButtonPolicies.C: changes to overcome
1341 "need lvalue" error with DEC c++
1343 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1344 to WMHideCB for DEC c++
1346 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1348 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1349 to BulletBMTableCB for DEC c++
1351 2000-08-31 Allan Rae <rae@lyx.org>
1353 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1354 character dialog separately from old document dialogs combo_language.
1357 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1359 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1360 Removed LFUN_REF_CREATE.
1362 * src/MenuBackend.C: Added new tags: toc and references
1364 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1365 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1367 (add_toc, add_references): New methods.
1368 (create_submenu): Handle correctly the case when there is a
1369 seperator after optional menu items.
1371 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1372 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1373 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1375 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1377 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1379 * src/converter.[Ch]: New file for converting between different
1382 * src/export.[Ch]: New file for exporting a LyX file to different
1385 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1386 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1387 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1388 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1389 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1390 RunDocBook, MenuExport.
1392 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1393 Exporter::Preview methods if NEW_EXPORT is defined.
1395 * src/buffer.C (Dispatch): Use Exporter::Export.
1397 * src/lyxrc.C: Added new tags: \converter and \viewer.
1400 * src/LyXAction.C: Define new lyx-function: buffer-update.
1401 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1402 when NEW_EXPORT is defined.
1404 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1406 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1408 * lib/ui/default.ui: Added submenus "view" and "update" to the
1411 * src/filetools.C (GetExtension): New function.
1413 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1415 2000-08-29 Allan Rae <rae@lyx.org>
1417 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1419 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1420 (EnableDocumentLayout): removed
1421 (DisableDocumentLayout): removed
1422 (build): make use of ButtonController's read-only handling to
1423 de/activate various objects. Replaces both of the above functions.
1425 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1426 (readOnly): was read_only
1427 (refresh): fixed dumb mistakes with read_only_ handling
1429 * src/frontends/xforms/forms/form_document.fd:
1430 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1431 tabbed dialogs so the tabs look more like tabs and so its easier to
1432 work out which is the current tab.
1434 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1435 segfault with form_table
1437 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1439 2000-08-28 Juergen Vigna <jug@sad.it>
1441 * acconfig.h: added USE_PSPELL.
1443 * src/config.h.in: added USE_PSPELL.
1445 * autogen.sh: added pspell.m4
1447 * config/pspell.m4: new file.
1449 * src/spellchecker.C: implemented support for pspell libary.
1451 2000-08-25 Juergen Vigna <jug@sad.it>
1453 * src/LyXAction.C (init): renamed LFUN_TABLE to
1454 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1456 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1458 * src/lyxscreen.h: add force_clear variable and fuction to force
1459 a clear area when redrawing in LyXText.
1461 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1463 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1465 * some whitespace and comment changes.
1467 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1469 * src/buffer.C: up te LYX_FORMAT to 2.17
1471 2000-08-23 Juergen Vigna <jug@sad.it>
1473 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1476 * src/insets/insettabular.C (pasteSelection): delete the insets
1477 LyXText as it is not valid anymore.
1478 (copySelection): new function.
1479 (pasteSelection): new function.
1480 (cutSelection): new function.
1481 (LocalDispatch): implemented cut/copy/paste of cell selections.
1483 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1484 don't have a LyXText.
1486 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1488 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1491 2000-08-22 Juergen Vigna <jug@sad.it>
1493 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1494 ifdef form_table out if NEW_TABULAR.
1496 2000-08-21 Juergen Vigna <jug@sad.it>
1498 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1499 (draw): fixed draw position so that the cursor is positioned in the
1501 (InsetMotionNotify): hide/show cursor so the position is updated.
1502 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1503 using cellstart() function where it should be used.
1505 * src/insets/insettext.C (draw): ditto.
1507 * src/tabular.C: fixed initialization of some missing variables and
1508 made BoxType into an enum.
1510 2000-08-22 Marko Vendelin <markov@ioc.ee>
1511 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1512 stock menu item using action numerical value, not its string
1516 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1518 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1519 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1521 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1523 * src/frontends/xforms/GUIRunTime.C: new file
1525 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1526 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1528 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1530 * src/frontends/kde/GUIRunTime.C: new file
1532 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1533 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1535 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1537 * src/frontends/gnome/GUIRunTime.C: new file
1539 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1542 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1543 small change to documetentation.
1545 * src/frontends/GUIRunTime.C: removed file
1547 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1549 * src/lyxparagraph.h: enable NEW_TABULAR as default
1551 * src/lyxfunc.C (processKeySym): remove some commented code
1553 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1554 NEW_TABULAR around the fd_form_table_options.
1556 * src/lyx_gui.C (runTime): call the static member function as
1557 GUIRunTime::runTime().
1559 2000-08-21 Allan Rae <rae@lyx.org>
1561 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1564 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1566 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1568 2000-08-21 Allan Rae <rae@lyx.org>
1570 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1571 keep Garst happy ;-)
1572 * src/frontends/xforms/FormPreferences.C (build): use setOK
1573 * src/frontends/xforms/FormDocument.C (build): use setOK
1574 (FormDocument): use the appropriate policy.
1576 2000-08-21 Allan Rae <rae@lyx.org>
1578 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1579 automatic [de]activation of arbitrary objects when in a read-only state.
1581 * src/frontends/ButtonPolicies.h: More documentation
1582 (isReadOnly): added to support the above.
1584 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1586 2000-08-18 Juergen Vigna <jug@sad.it>
1588 * src/insets/insettabular.C (getStatus): changed to return func_status.
1590 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1591 display toggle menu entries if they are.
1593 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1594 new document layout now.
1596 * src/lyxfunc.C: ditto
1598 * src/lyx_gui_misc.C: ditto
1600 * src/lyx_gui.C: ditto
1602 * lib/ui/default.ui: removed paper and quotes layout as they are now
1603 all in the document layout tabbed folder.
1605 * src/frontends/xforms/forms/form_document.fd: added Restore
1606 button and callbacks for all inputs for Allan's ButtonPolicy.
1608 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1609 (CheckChoiceClass): added missing params setting on class change.
1610 (UpdateLayoutDocument): added for updating the layout on params.
1611 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1612 (FormDocument): Implemented Allan's ButtonPolicy with the
1615 2000-08-17 Allan Rae <rae@lyx.org>
1617 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1618 so we can at least see the credits again.
1620 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1621 controller calls for the appropriate callbacks. Note that since Ok
1622 calls apply followed by cancel, and apply isn't a valid input for the
1623 APPLIED state, the bc_ calls have to be made in the static callback not
1624 within each of the real callbacks.
1626 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1627 (setOk): renamed from setOkay()
1629 2000-08-17 Juergen Vigna <jug@sad.it>
1631 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1632 in the implementation part.
1633 (composeUIInfo): don't show optional menu-items.
1635 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1637 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1639 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1640 text-state when in a text-inset.
1642 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1644 2000-08-17 Marko Vendelin <markov@ioc.ee>
1645 * src/frontends/gnome/FormIndex.C
1646 * src/frontends/gnome/FormIndex.h
1647 * src/frontends/gnome/FormToc.C
1648 * src/frontends/gnome/FormToc.h
1649 * src/frontends/gnome/dialogs
1650 * src/frontends/gnome/diatoc_callbacks.c
1651 * src/frontends/gnome/diatoc_callbacks.h
1652 * src/frontends/gnome/diainsertindex_callbacks.h
1653 * src/frontends/gnome/diainsertindex_callbacks.c
1654 * src/frontends/gnome/diainsertindex_interface.c
1655 * src/frontends/gnome/diainsertindex_interface.h
1656 * src/frontends/gnome/diatoc_interface.h
1657 * src/frontends/gnome/diatoc_interface.c
1658 * src/frontends/gnome/Makefile.am: Table of Contents and
1659 Insert Index dialogs implementation for Gnome frontend
1661 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1663 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1665 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1668 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1670 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1671 destructor. Don't definde if you don't need it
1672 (processEvents): made static, non-blocking events processing for
1674 (runTime): static method. event loop for xforms
1675 * similar as above for kde and gnome.
1677 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1678 new Pimpl is correct
1679 (runTime): new method calss the real frontends runtime func.
1681 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1683 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1685 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1687 2000-08-16 Juergen Vigna <jug@sad.it>
1689 * src/lyx_gui.C (runTime): added GUII RunTime support.
1691 * src/frontends/Makefile.am:
1692 * src/frontends/GUIRunTime.[Ch]:
1693 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1694 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1695 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1697 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1699 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1700 as this is already set in ${FRONTEND_INCLUDE} if needed.
1702 * configure.in (CPPFLAGS): setting the include dir for the frontend
1703 directory and don't set FRONTEND=xforms for now as this is executed
1706 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1708 * src/frontends/kde/Makefile.am:
1709 * src/frontends/kde/FormUrl.C:
1710 * src/frontends/kde/FormUrl.h:
1711 * src/frontends/kde/formurldialog.h:
1712 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1714 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1716 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1718 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1720 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1723 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1725 * src/WorkArea.C (work_area_handler): more work to get te
1726 FL_KEYBOARD to work with xforms 0.88 too, please test.
1728 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1730 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1732 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1735 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1737 * src/Timeout.h: remove Qt::emit hack.
1739 * several files: changes to allo doc++ compilation
1741 * src/lyxfunc.C (processKeySym): new method
1742 (processKeyEvent): comment out if FL_REVISION < 89
1744 * src/WorkArea.C: change some debugging levels.
1745 (WorkArea): set wantkey to FL_KEY_ALL
1746 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1747 clearer code and the use of compose with XForms 0.89. Change to
1748 use signals instead of calling methods in bufferview directly.
1750 * src/Painter.C: change some debugging levels.
1752 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1755 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1756 (workAreaKeyPress): new method
1758 2000-08-14 Juergen Vigna <jug@sad.it>
1760 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1762 * config/kde.m4: addes some features
1764 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1765 include missing xforms dialogs.
1767 * src/Timeout.h: a hack to be able to compile with qt/kde.
1769 * sigc++/.cvsignore: added acinclude.m4
1771 * lib/.cvsignore: added listerros
1773 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1774 xforms tree as objects are needed for other frontends.
1776 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1777 linking with not yet implemented xforms objects.
1779 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1781 2000-08-14 Baruch Even <baruch.even@writeme.com>
1783 * src/frontends/xforms/FormGraphics.h:
1784 * src/frontends/xforms/FormGraphics.C:
1785 * src/frontends/xforms/RadioButtonGroup.h:
1786 * src/frontends/xforms/RadioButtonGroup.C:
1787 * src/insets/insetgraphics.h:
1788 * src/insets/insetgraphics.C:
1789 * src/insets/insetgraphicsParams.h:
1790 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1791 instead of spaces, and various other indentation issues to make the
1792 sources more consistent.
1794 2000-08-14 Marko Vendelin <markov@ioc.ee>
1796 * src/frontends/gnome/dialogs/diaprint.glade
1797 * src/frontends/gnome/FormPrint.C
1798 * src/frontends/gnome/FormPrint.h
1799 * src/frontends/gnome/diaprint_callbacks.c
1800 * src/frontends/gnome/diaprint_callbacks.h
1801 * src/frontends/gnome/diaprint_interface.c
1802 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1805 * src/frontends/gnome/dialogs/diainserturl.glade
1806 * src/frontends/gnome/FormUrl.C
1807 * src/frontends/gnome/FormUrl.h
1808 * src/frontends/gnome/diainserturl_callbacks.c
1809 * src/frontends/gnome/diainserturl_callbacks.h
1810 * src/frontends/gnome/diainserturl_interface.c
1811 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1812 Gnome implementation
1814 * src/frontends/gnome/Dialogs.C
1815 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1816 all other dialogs. Copy all unimplemented dialogs from Xforms
1819 * src/frontends/gnome/support.c
1820 * src/frontends/gnome/support.h: support files generated by Glade
1824 * config/gnome.m4: Gnome configuration scripts
1826 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1827 configure --help message
1829 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1830 only if there are no events pendling in Gnome/Gtk. This enhances
1831 the performance of menus.
1834 2000-08-14 Allan Rae <rae@lyx.org>
1836 * lib/Makefile.am: listerrors cleaning
1838 * lib/listerrors: removed -- generated file
1839 * acinclude.m4: ditto
1840 * sigc++/acinclude.m4: ditto
1842 * src/frontends/xforms/forms/form_citation.fd:
1843 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1846 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1847 `updatesrc` and now we have a `test` target that does what `updatesrc`
1848 used to do. I didn't like having an install target that wasn't related
1851 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1852 on all except FormGraphics. This may yet happen. Followed by a major
1853 cleanup including using FL_TRANSIENT for most of the dialogs. More
1854 changes to come when the ButtonController below is introduced.
1856 * src/frontends/xforms/ButtonController.h: New file for managing up to
1857 four buttons on a dialog according to an externally defined policy.
1858 * src/frontends/xforms/Makefile.am: added above
1860 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1861 Apply and Cancel/Close buttons and everything in between and beyond.
1862 * src/frontends/Makefile.am: added above.
1864 * src/frontends/xforms/forms/form_preferences.fd:
1865 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1866 and removed variable 'status' as a result. Fixed the set_minsize thing.
1867 Use the new screen-font-update after checking screen fonts were changed
1868 Added a "Restore" button to restore the original lyxrc values while
1869 editing. This restores everything not just the last input changed.
1870 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1872 * src/LyXAction.C: screen-font-update added for updating buffers after
1873 screen font settings have been changed.
1874 * src/commandtags.h: ditto
1875 * src/lyxfunc.C: ditto
1877 * forms/lyx.fd: removed screen fonts dialog.
1878 * src/lyx_gui.C: ditto
1879 * src/menus.[Ch]: ditto
1880 * src/lyx.[Ch]: ditto
1881 * src/lyx_cb.C: ditto + code from here moved to make
1882 screen-font-update. And people wonder why progress on GUII is
1883 slow. Look at how scattered this stuff was! It takes forever
1886 * forms/fdfix.sh: Fixup the spacing after commas.
1887 * forms/makefile: Remove date from generated files. Fewer clashes now.
1888 * forms/bullet_forms.C.patch: included someones handwritten changes
1890 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1891 once I've discovered why LyXRC was made noncopyable.
1892 * src/lyx_main.C: ditto
1894 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1896 * src/frontends/xforms/forms/fdfix.sh:
1897 * src/frontends/xforms/forms/fdfixh.sed:
1898 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1899 * src/frontends/xforms/Form*.[hC]:
1900 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1901 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1902 provide a destructor for the struct FD_form_xxxx. Another version of
1903 the set_[max|min]size workaround and a few other cleanups. Actually,
1904 Angus' patch from 20000809.
1906 2000-08-13 Baruch Even <baruch.even@writeme.com>
1908 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1911 2000-08-11 Juergen Vigna <jug@sad.it>
1913 * src/insets/insetgraphics.C (InsetGraphics): changing init
1914 order because of warnings.
1916 * src/frontends/xforms/forms/makefile: adding patching .C with
1919 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1920 from .C.patch to .c.patch
1922 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1923 order because of warning.
1925 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1927 * src/frontends/Liason.C (setMinibuffer): new helper function
1929 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1931 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1933 * lib/ui/default.ui: commented out PaperLayout entry
1935 * src/frontends/xforms/form_document.[Ch]: new added files
1937 * src/frontends/xforms/FormDocument.[Ch]: ditto
1939 * src/frontends/xforms/forms/form_document.fd: ditto
1941 * src/frontends/xforms/forms/form_document.C.patch: ditto
1943 2000-08-10 Juergen Vigna <jug@sad.it>
1945 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1946 (InsetGraphics): initialized cacheHandle to 0.
1947 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1949 2000-08-10 Baruch Even <baruch.even@writeme.com>
1951 * src/graphics/GraphicsCache.h:
1952 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1953 correctly as a cache.
1955 * src/graphics/GraphicsCacheItem.h:
1956 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1959 * src/graphics/GraphicsCacheItem_pimpl.h:
1960 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1963 * src/insets/insetgraphics.h:
1964 * src/insets/insetgraphics.C: Changed from using a signal notification
1965 to polling when image is not loaded.
1967 2000-08-10 Allan Rae <rae@lyx.org>
1969 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1970 that there are two functions that have to been taken out of line by
1971 hand and aren't taken care of in the script. (Just a reminder note)
1973 * sigc++/macros/*.h.m4: Updated as above.
1975 2000-08-09 Juergen Vigna <jug@sad.it>
1977 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1979 * src/insets/insettabular.C: make drawing of single cell smarter.
1981 2000-08-09 Marko Vendelin <markov@ioc.ee>
1982 * src/frontends/gnome/Menubar_pimpl.C
1983 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1984 implementation: new files
1986 * src/frontends/gnome/mainapp.C
1987 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1990 * src/main.C: create Gnome main window
1992 * src/frontends/xforms/Menubar_pimpl.h
1993 * src/frontends/Menubar.C
1994 * src/frontends/Menubar.h: added method Menubar::update that calls
1995 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1997 * src/LyXView.C: calls Menubar::update to update the state
2000 * src/frontends/gnome/Makefile.am: added new files
2002 * src/frontends/Makefile.am: added frontend compiler options
2004 2000-08-08 Juergen Vigna <jug@sad.it>
2006 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2008 * src/bufferlist.C (close):
2009 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2010 documents if exiting without saving.
2012 * src/buffer.C (save): use removeAutosaveFile()
2014 * src/support/filetools.C (removeAutosaveFile): new function.
2016 * src/lyx_cb.C (MenuWrite): returns a bool now.
2017 (MenuWriteAs): check if file could really be saved and revert to the
2019 (MenuWriteAs): removing old autosavefile if existant.
2021 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2022 before Goto toggle declaration, because of compiler warning.
2024 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2026 * src/lyxfunc.C (MenuNew): small fix.
2028 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2030 * src/bufferlist.C (newFile):
2031 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2033 * src/lyxrc.C: added new_ask_filename tag
2035 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2037 * src/lyx.fd: removed code pertaining to form_ref
2038 * src/lyx.[Ch]: ditto
2039 * src/lyx_cb.C: ditto
2040 * src/lyx_gui.C: ditto
2041 * src/lyx_gui_misc.C: ditto
2043 * src/BufferView_pimpl.C (restorePosition): update buffer only
2046 * src/commandtags.h (LFUN_REFTOGGLE): removed
2047 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2048 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2049 (LFUN_REFBACK): renamed LFUN_REF_BACK
2051 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2052 * src/menus.C: ditto
2053 * src/lyxfunc.C (Dispatch): ditto.
2054 InsertRef dialog is now GUI-independent.
2056 * src/texrow.C: added using std::endl;
2058 * src/insets/insetref.[Ch]: strip out large amounts of code.
2059 The inset is now a container and this functionality is now
2060 managed by a new FormRef dialog
2062 * src/frontends/Dialogs.h (showRef, createRef): new signals
2064 * src/frontends/xforms/FormIndex.[Ch],
2065 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2066 when setting dialog's min/max size
2067 * src/frontends/xforms/FormIndex.[Ch]: ditto
2069 * src/frontends/xforms/FormRef.[Ch],
2070 src/frontends/xforms/forms/form_ref.fd: new xforms
2071 implementation of an InsetRef dialog
2073 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2076 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2077 ios::nocreate is not part of the standard. Removed.
2079 2000-08-07 Baruch Even <baruch.even@writeme.com>
2081 * src/graphics/Renderer.h:
2082 * src/graphics/Renderer.C: Added base class for rendering of different
2083 image formats into Pixmaps.
2085 * src/graphics/XPM_Renderer.h:
2086 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2087 in a different class.
2089 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2090 easily add support for other formats.
2092 * src/insets/figinset.C: plugged a leak of an X resource.
2094 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2096 * src/CutAndPaste.[Ch]: make all metods static.
2098 * development/Code_rules/Rules: more work, added section on
2099 Exceptions, and a References section.
2101 * a lot of header files: work to make doc++ able to generate the
2102 source documentation, some workarounds of doc++ problems. Doc++ is
2103 now able to generate the documentation.
2105 2000-08-07 Juergen Vigna <jug@sad.it>
2107 * src/insets/insettabular.C (recomputeTextInsets): removed function
2109 * src/tabular.C (SetWidthOfMulticolCell):
2111 (calculate_width_of_column_NMC): fixed return value so that it really
2112 only returns true if the column-width has changed (there where
2113 problems with muliticolumn-cells in this column).
2115 2000-08-04 Juergen Vigna <jug@sad.it>
2117 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2118 also on the scrollstatus of the inset.
2119 (workAreaMotionNotify): ditto.
2121 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2123 2000-08-01 Juergen Vigna <jug@sad.it>
2125 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2127 * src/commandtags.h:
2128 * src/LyXAction.C (init):
2129 * src/insets/inset.C (LocalDispatch): added support for
2132 * src/insets/inset.C (scroll): new functions.
2134 * src/insets/insettext.C (removeNewlines): new function.
2135 (SetAutoBreakRows): removes forced newlines in the text of the
2136 paragraph if autoBreakRows is set to false.
2138 * src/tabular.C (Latex): generates a parbox around the cell contents
2141 * src/frontends/xforms/FormTabular.C (local_update): removed
2142 the radio_useparbox button.
2144 * src/tabular.C (UseParbox): new function
2146 2000-08-06 Baruch Even <baruch.even@writeme.com>
2148 * src/graphics/GraphicsCache.h:
2149 * src/graphics/GraphicsCache.C:
2150 * src/graphics/GraphicsCacheItem.h:
2151 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2154 * src/insets/insetgraphics.h:
2155 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2156 drawing of the inline image.
2158 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2159 into the wrong position.
2161 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2164 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2166 * src/support/translator.h: move all typedefs to public section
2168 * src/support/filetools.C (MakeLatexName): return string const
2170 (TmpFileName): ditto
2171 (FileOpenSearch): ditto
2173 (LibFileSearch): ditto
2174 (i18nLibFileSearch): ditto
2177 (CreateTmpDir): ditto
2178 (CreateBufferTmpDir): ditto
2179 (CreateLyXTmpDir): ditto
2182 (MakeAbsPath): ditto
2184 (OnlyFilename): ditto
2186 (NormalizePath): ditto
2187 (CleanupPath): ditto
2188 (GetFileContents): ditto
2189 (ReplaceEnvironmentPath): ditto
2190 (MakeRelPath): ditto
2192 (ChangeExtension): ditto
2193 (MakeDisplayPath): ditto
2194 (do_popen): return cmdret const
2195 (findtexfile): return string const
2197 * src/support/DebugStream.h: add some /// to please doc++
2199 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2201 * src/texrow.C (same_rownumber): functor to use with find_if
2202 (getIdFromRow): rewritten to use find_if and to not update the
2203 positions. return true if row is found
2204 (increasePos): new method, use to update positions
2206 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2208 * src/lyxlex_pimpl.C (verifyTable): new method
2211 (GetString): return string const
2212 (pushTable): rewrite to use std::stack
2214 (setFile): better check
2217 * src/lyxlex.h: make LyXLex noncopyable
2219 * src/lyxlex.C (text): return char const * const
2220 (GetString): return string const
2221 (getLongString): return string const
2223 * src/lyx_gui_misc.C (askForText): return pair<...> const
2225 * src/lastfiles.[Ch] (operator): return string const
2227 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2228 istringstream not char const *.
2229 move token.end() out of loop.
2230 (readFile): move initializaton of token
2232 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2233 getIdFromRow is successful.
2235 * lib/bind/emacs.bind: don't include menus bind
2237 * development/Code_rules/Rules: the beginnings of making this
2238 better and covering more of the unwritten rules that we have.
2240 * development/Code_rules/Recommendations: a couple of wording
2243 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2245 * src/support/strerror.c: remove C++ comment.
2247 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2249 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2250 LFUN_INDEX_INSERT_LAST
2252 * src/texrow.C (getIdFromRow): changed from const_iterator to
2253 iterator, allowing code to compile with DEC cxx
2255 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2256 stores part of the class, as suggested by Allan. Will allow
2258 (apply): test to apply uses InsetCommandParams operator!=
2260 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2261 (apply): test to apply uses InsetCommandParams operator!=
2263 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2264 stores part of the class.
2265 (update): removed limits on min/max size.
2267 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2268 (apply): test to apply uses InsetCommandParams operator!=
2270 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2271 (Read, Write, scanCommand, getCommand): moved functionality
2272 into InsetCommandParams.
2274 (getScreenLabel): made pure virtual
2275 new InsetCommandParams operators== and !=
2277 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2278 c-tors based on InsetCommandParams. Removed others.
2279 * src/insets/insetinclude.[Ch]: ditto
2280 * src/insets/insetlabel.[Ch]: ditto
2281 * src/insets/insetparent.[Ch]: ditto
2282 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2284 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2285 insets derived from InsetCommand created using similar c-tors
2286 based on InsetCommandParams
2287 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2288 * src/menus.C (ShowRefsMenu): ditto
2289 * src/paragraph.C (Clone): ditto
2290 * src/text2.C (SetCounter): ditto
2291 * src/lyxfunc.C (Dispatch) ditto
2292 Also recreated old InsetIndex behaviour exactly. Can now
2293 index-insert at the start of a paragraph and index-insert-last
2294 without launching the pop-up.
2296 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2298 * lib/lyxrc.example: mark te pdf options as non functional.
2300 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2301 (isStrDbl): move tmpstr.end() out of loop.
2302 (strToDbl): move intialization of tmpstr
2303 (lowercase): return string const and move tmp.end() out of loop.
2304 (uppercase): return string const and move tmp.edn() out of loop.
2305 (prefixIs): add assertion
2310 (containsOnly): ditto
2311 (containsOnly): ditto
2312 (containsOnly): ditto
2313 (countChar): make last arg char not char const
2314 (token): return string const
2315 (subst): return string const, move tmp.end() out of loop.
2316 (subst): return string const, add assertion
2317 (strip): return string const
2318 (frontStrip): return string const, add assertion
2319 (frontStrip): return string const
2324 * src/support/lstrings.C: add inclde "LAssert.h"
2325 (isStrInt): move tmpstr.end() out of loop.
2327 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2328 toollist.end() out of loop.
2329 (deactivate): move toollist.end() out of loop.
2330 (update): move toollist.end() out of loop.
2331 (updateLayoutList): move tc.end() out of loop.
2332 (add): move toollist.end() out of loop.
2334 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2335 md.end() out of loop.
2337 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2339 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2342 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2343 (Erase): move insetlist.end() out of loop.
2345 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2346 ref to const string as first arg. Move initialization of some
2347 variables, whitespace changes.
2349 * src/kbmap.C (defkey): move table.end() out of loop.
2350 (kb_keymap): move table.end() out of loop.
2351 (findbinding): move table.end() out of loop.
2353 * src/MenuBackend.C (hasMenu): move end() out of loop.
2354 (getMenu): move end() out of loop.
2355 (getMenu): move menulist_.end() out of loop.
2357 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2359 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2362 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2363 (getFromLyXName): move infotab.end() out of loop.
2365 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2366 -fvtable-thunks -ffunction-sections -fdata-sections
2368 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2370 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2373 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2375 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2377 * src/frontends/xforms/FormCitation.[Ch],
2378 src/frontends/xforms/FormIndex.[Ch],
2379 src/frontends/xforms/FormToc.[Ch],
2380 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2382 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2384 * src/commandtags.h: renamed, created some flags for citation
2387 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2389 * src/lyxfunc.C (dispatch): use signals to insert index entry
2391 * src/frontends/Dialogs.h: new signal createIndex
2393 * src/frontends/xforms/FormCommand.[Ch],
2394 src/frontends/xforms/FormCitation.[Ch],
2395 src/frontends/xforms/FormToc.[Ch],
2396 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2398 * src/insets/insetindex.[Ch]: GUI-independent
2400 * src/frontends/xforms/FormIndex.[Ch],
2401 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2404 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2406 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2407 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2409 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2411 * src/insets/insetref.C (Latex): rewrite so that there is now
2412 question that a initialization is requested.
2414 * src/insets/insetcommand.h: reenable the hide signal
2416 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2418 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2419 fix handling of shortcuts (many bugs :)
2420 (add_lastfiles): ditto.
2422 * lib/ui/default.ui: fix a few shortcuts.
2424 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2426 * Makefile.am: Fix ``rpmdist'' target to return the exit
2427 status of the ``rpm'' command, instead of the last command in
2428 the chain (the ``rm lyx.xpm'' command, which always returns
2431 2000-08-02 Allan Rae <rae@lyx.org>
2433 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2434 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2435 * src/frontends/xforms/FormToc.C (FormToc): ditto
2437 * src/frontends/xforms/Makefile.am: A few forgotten files
2439 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2440 Signals-not-copyable-problem Lars' started commenting out.
2442 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2444 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2446 * src/insets/insetcommand.h: Signals is not copyable so anoter
2447 scheme for automatic hiding of forms must be used.
2449 * src/frontends/xforms/FormCitation.h: don't inerit from
2450 noncopyable, FormCommand already does that.
2451 * src/frontends/xforms/FormToc.h: ditto
2452 * src/frontends/xforms/FormUrl.h: ditto
2454 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2456 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2458 * src/insets/insetcommand.h (hide): new SigC::Signal0
2459 (d-tor) new virtual destructor emits hide signal
2461 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2462 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2464 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2465 LOF and LOT. Inset is now GUI-independent
2467 * src/insets/insetloa.[Ch]: redundant
2468 * src/insets/insetlof.[Ch]: ditto
2469 * src/insets/insetlot.[Ch]: ditto
2471 * src/frontends/xforms/forms/form_url.fd: tweaked!
2472 * src/frontends/xforms/forms/form_citation.fd: ditto
2474 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2475 dialogs dealing with InsetCommand insets
2477 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2478 FormCommand base class
2479 * src/frontends/xforms/FormUrl.[Ch]: ditto
2481 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2483 * src/frontends/xforms/FormToc.[Ch]: ditto
2485 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2486 passed a generic InsetCommand pointer
2487 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2489 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2490 and modified InsetTOC class
2491 * src/buffer.C: ditto
2493 * forms/lyx.fd: strip out old FD_form_toc code
2494 * src/lyx_gui_misc.C: ditto
2495 * src/lyx_gui.C: ditto
2496 * src/lyx_cb.C: ditto
2497 * src/lyx.[Ch]: ditto
2499 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2501 * src/support/utility.hpp: tr -d '\r'
2503 2000-08-01 Juergen Vigna <jug@sad.it>
2505 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2507 * src/commandtags.h:
2508 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2509 LFUN_TABULAR_FEATURES.
2511 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2512 LFUN_LAYOUT_TABULAR.
2514 * src/insets/insettabular.C (getStatus): implemented helper function.
2516 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2518 2000-07-31 Juergen Vigna <jug@sad.it>
2520 * src/text.C (draw): fixed screen update problem for text-insets.
2522 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2523 something changed probably this has to be added in various other
2526 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2528 2000-07-31 Baruch Even <baruch.even@writeme.com>
2530 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2531 templates to satisfy compaq cxx.
2534 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2536 * src/support/translator.h (equal_1st_in_pair::operator()): take
2537 const ref pair_type as arg.
2538 (equal_2nd_in_pair::operator()): ditto
2539 (Translator::~Translator): remove empty d-tor.
2541 * src/graphics/GraphicsCache.C: move include config.h to top, also
2542 put initialization of GraphicsCache::singleton here.
2543 (~GraphicsCache): move here
2544 (addFile): take const ref as arg
2547 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2549 * src/BufferView2.C (insertLyXFile): change te with/without header
2552 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2554 * src/frontends/xforms/FormGraphics.C (apply): add some
2555 static_cast. Not very nice, but required by compaq cxx.
2557 * src/frontends/xforms/RadioButtonGroup.h: include header
2558 <utility> instead of <pair.h>
2560 * src/insets/insetgraphicsParams.C: add using directive.
2561 (readResize): change return type to void.
2562 (readOrigin): ditto.
2564 * src/lyxfunc.C (getStatus): add missing break for build-program
2565 function; add test for Literate for export functions.
2567 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2568 entries in Options menu.
2570 2000-07-31 Baruch Even <baruch.even@writeme.com>
2572 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2573 protect against auto-allocation; release icon when needed.
2575 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2577 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2578 on usual typewriter.
2580 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2581 earlier czech.kmap), useful only for programming.
2583 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2585 * src/frontends/xforms/FormCitation.h: fix conditioning around
2588 2000-07-31 Juergen Vigna <jug@sad.it>
2590 * src/frontends/xforms/FormTabular.C (local_update): changed
2591 radio_linebreaks to radio_useparbox and added radio_useminipage.
2593 * src/tabular.C: made support for using minipages/parboxes.
2595 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2597 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2599 (descent): so the cursor is in the middle.
2600 (width): bit smaller box.
2602 * src/insets/insetgraphics.h: added display() function.
2604 2000-07-31 Baruch Even <baruch.even@writeme.com>
2606 * src/frontends/Dialogs.h: Added showGraphics signals.
2608 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2609 xforms form definition of the graphics dialog.
2611 * src/frontends/xforms/FormGraphics.h:
2612 * src/frontends/xforms/FormGraphics.C: Added files, the
2613 GUIndependent code of InsetGraphics
2615 * src/insets/insetgraphics.h:
2616 * src/insets/insetgraphics.C: Major writing to make it work.
2618 * src/insets/insetgraphicsParams.h:
2619 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2620 struct between InsetGraphics and GUI.
2622 * src/LaTeXFeatures.h:
2623 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2624 support for graphicx package.
2626 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2627 for the graphics inset.
2629 * src/support/translator.h: Added file, used in
2630 InsetGraphicsParams. this is a template to translate between two
2633 * src/frontends/xforms/RadioButtonGroup.h:
2634 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2635 way to easily control a radio button group.
2637 2000-07-28 Juergen Vigna <jug@sad.it>
2639 * src/insets/insettabular.C (LocalDispatch):
2640 (TabularFeatures): added support for lyx-functions of tabular features.
2641 (cellstart): refixed this function after someone wrongly changed it.
2643 * src/commandtags.h:
2644 * src/LyXAction.C (init): added support for tabular-features
2646 2000-07-28 Allan Rae <rae@lyx.org>
2648 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2649 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2650 triggers the callback for input checking. As a result we sometimes get
2651 "LyX: This shouldn't happen..." printed to cerr.
2652 (input): Started using status variable since I only free() on
2653 destruction. Some input checking for paths and font sizes.
2655 * src/frontends/xforms/FormPreferences.h: Use status to control
2656 activation of Ok and Apply
2658 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2659 callback. Also resized to stop segfaults with 0.88. The problem is
2660 that xforms-0.88 requires the folder to be wide enough to fit all the
2661 tabs. If it isn't it causes all sorts of problems.
2663 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2665 * src/frontends/xforms/forms/README: Reflect reality.
2667 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2668 * src/frontends/xforms/forms/makefile: ditto.
2670 * src/commandtags.h: Get access to new Preferences dialog
2671 * src/LyXAction.C: ditto
2672 * src/lyxfunc.C: ditto
2673 * lib/ui/default.ui: ditto
2675 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2677 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2679 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2682 * src/frontends/xforms/form_url.[Ch]: added.
2684 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2686 * src/insets/insetbib.h: fixed bug in previous commit
2688 * src/frontends/xforms/FormUrl.h: ditto
2690 * src/frontends/xforms/FormPrint.h: ditto
2692 * src/frontends/xforms/FormPreferences.h: ditto
2694 * src/frontends/xforms/FormCopyright.h: ditto
2696 * src/frontends/xforms/FormCitation.C: ditto
2698 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2699 private copyconstructor and private default contructor
2701 * src/support/Makefile.am: add utility.hpp
2703 * src/support/utility.hpp: new file from boost
2705 * src/insets/insetbib.h: set owner in clone
2707 * src/frontends/xforms/FormCitation.C: added missing include
2710 * src/insets/form_url.[Ch]: removed
2712 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2714 * development/lyx.spec.in
2715 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2716 file/directory re-organization.
2718 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2720 * src/insets/insetcommand.[Ch]: moved the string data and
2721 associated manipulation methods into a new stand-alone class
2722 InsetCommandParams. This class has two additional methods
2723 getAsString() and setFromString() allowing the contents to be
2724 moved around as a single string.
2725 (addContents) method removed.
2726 (setContents) method no longer virtual.
2728 * src/buffer.C (readInset): made use of new InsetCitation,
2729 InsetUrl constructors based on InsetCommandParams.
2731 * src/commandtags.h: add LFUN_INSERT_URL
2733 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2734 independent InsetUrl and use InsetCommandParams to extract
2735 string info and create new Insets.
2737 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2739 * src/frontends/xforms/FormCitation.C (apply): uses
2742 * src/frontends/xforms/form_url.C
2743 * src/frontends/xforms/form_url.h
2744 * src/frontends/xforms/FormUrl.h
2745 * src/frontends/xforms/FormUrl.C
2746 * src/frontends/xforms/forms/form_url.fd: new files
2748 * src/insets/insetcite.[Ch]: removed unused constructors.
2750 * src/insets/insetinclude.[Ch]: no longer store filename
2752 * src/insets/inseturl.[Ch]: GUI-independent.
2754 2000-07-26 Juergen Vigna <jug@sad.it>
2755 * renamed frontend from gtk to gnome as it is that what is realized
2756 and did the necessary changes in the files.
2758 2000-07-26 Marko Vendelin <markov@ioc.ee>
2760 * configure.in: cleaning up gnome configuration scripts
2762 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2764 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2765 shortcuts syndrom by redrawing them explicitely (a better solution
2766 would be appreciated).
2768 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2770 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2773 * src/lyx_cb.C (MenuExport): change html export to do the right
2774 thing depending of the document type (instead of having
2775 html-linuxdoc and html-docbook).
2776 * src/lyxfunc.C (getStatus): update for html
2777 * lib/ui/default.ui: simplify due to the above change.
2778 * src/menus.C (ShowFileMenu): update too (in case we need it).
2780 * src/MenuBackend.C (read): if a menu is defined twice, add the
2781 new entries to the exiting one.
2783 2000-07-26 Juergen Vigna <jug@sad.it>
2785 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2787 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2788 and return a bool if it did actual save the file.
2789 (AutoSave): don't autosave a unnamed doc.
2791 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2792 check if this is an UNNAMED new file and react to it.
2793 (newFile): set buffer to unnamed and change to not mark a new
2794 buffer dirty if I didn't do anything with it.
2796 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2798 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2800 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2801 friend as per Angus's patch posted to lyx-devel.
2803 * src/ext_l10n.h: updated
2805 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2806 gettext on the style string right before inserting them into the
2809 * autogen.sh: add code to extract style strings form layout files,
2810 not good enough yet.
2812 * src/frontends/gtk/.cvsignore: add MAKEFILE
2814 * src/MenuBackend.C (read): run the label strings through gettext
2815 before storing them in the containers.
2817 * src/ext_l10n.h: new file
2819 * autogen.sh : generate the ext_l10n.h file here
2821 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2823 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2826 * lib/ui/default.ui: fix a couple of typos.
2828 * config/gnome/gtk.m4: added (and added to the list of files in
2831 * src/insets/insetinclude.C (unique_id): fix when we are using
2832 lyxstring instead of basic_string<>.
2833 * src/insets/insettext.C (LocalDispatch): ditto.
2834 * src/support/filetools.C: ditto.
2836 * lib/configure.m4: create the ui/ directory if necessary.
2838 * src/LyXView.[Ch] (updateToolbar): new method.
2840 * src/BufferView_pimpl.C (buffer): update the toolbar when
2841 opening/closing buffer.
2843 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2845 * src/LyXAction.C (getActionName): enhance to return also the name
2846 and options of pseudo-actions.
2847 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2849 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2850 as an example of what is possible). Used in File->Build too (more
2851 useful) and in the import/export menus (to mimick the complicated
2852 handling of linuxdoc and friends). Try to update all the entries.
2854 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2857 * src/MenuBackend.C (read): Parse the new OptItem tag.
2859 * src/MenuBackend.h: Add a new optional_ data member (used if the
2860 entry should be omitted when the lyxfunc is disabled).
2862 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2863 function, used as a shortcut.
2864 (create_submenu): align correctly the shortcuts on the widest
2867 * src/MenuBackend.h: MenuItem.label() only returns the label of
2868 the menu without shortcut; new method shortcut().
2870 2000-07-14 Marko Vendelin <markov@ioc.ee>
2872 * src/frontends/gtk/Dialogs.C:
2873 * src/frontends/gtk/FormCopyright.C:
2874 * src/frontends/gtk/FormCopyright.h:
2875 * src/frontends/gtk/Makefile.am: added these source-files for the
2876 Gtk/Gnome support of the Copyright-Dialog.
2878 * src/main.C: added Gnome::Main initialization if using
2879 Gtk/Gnome frontend-GUI.
2881 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2883 * config/gnome/aclocal-include.m4
2884 * config/gnome/compiler-flags.m4
2885 * config/gnome/curses.m4
2886 * config/gnome/gnome--.m4
2887 * config/gnome/gnome-bonobo-check.m4
2888 * config/gnome/gnome-common.m4
2889 * config/gnome/gnome-fileutils.m4
2890 * config/gnome/gnome-ghttp-check.m4
2891 * config/gnome/gnome-gnorba-check.m4
2892 * config/gnome/gnome-guile-checks.m4
2893 * config/gnome/gnome-libgtop-check.m4
2894 * config/gnome/gnome-objc-checks.m4
2895 * config/gnome/gnome-orbit-check.m4
2896 * config/gnome/gnome-print-check.m4
2897 * config/gnome/gnome-pthread-check.m4
2898 * config/gnome/gnome-support.m4
2899 * config/gnome/gnome-undelfs.m4
2900 * config/gnome/gnome-vfs.m4
2901 * config/gnome/gnome-x-checks.m4
2902 * config/gnome/gnome-xml-check.m4
2903 * config/gnome/gnome.m4
2904 * config/gnome/gperf-check.m4
2905 * config/gnome/gtk--.m4
2906 * config/gnome/linger.m4
2907 * config/gnome/need-declaration.m4: added configuration scripts
2908 for Gtk/Gnome frontend-GUI
2910 * configure.in: added support for the --with-frontend=gtk option
2912 * autogen.sh: added config/gnome/* to list of config-files
2914 * acconfig.h: added define for GTKGUI-support
2916 * config/lyxinclude.m4: added --with-frontend[=value] option value
2917 for Gtk/Gnome frontend-GUI support.
2919 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2921 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2925 * src/paragraph.C (GetChar): remove non-const version
2927 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2928 (search_kw): use it.
2930 * src/lyx_main.C (init): if "preferences" exist, read that instead
2932 (ReadRcFile): return bool if the file could be read ok.
2933 (ReadUIFile): add a check to see if lex file is set ok.
2935 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2936 bastring can be used instead of lyxstring (still uses the old code
2937 if std::string is good enough or if lyxstring is used.)
2939 * src/encoding.C: make the arrays static, move ininle functions
2941 * src/encoding.h: from here.
2943 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2944 (parseSingleLyXformat2Token): move inset parsing to separate method
2945 (readInset): new private method
2947 * src/Variables.h: remove virtual from get().
2949 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2950 access to NEW_INSETS and NEW_TABULAR
2952 * src/MenuBackend.h: remove superfluous forward declaration of
2953 MenuItem. Add documentations tags "///", remove empty MenuItem
2954 destructor, remove private default contructor.
2956 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2958 (read): more string mlabel and mname to where they are used
2959 (read): remove unused variables mlabel and mname
2960 (defaults): unconditional clear, make menusetup take advantage of
2961 add returning Menu &.
2963 * src/LyXView.h: define NEW_MENUBAR as default
2965 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2966 to NEW_INSETS and NEW_TABULAR.
2967 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2968 defined. Change some of the "xxxx-inset-insert" functions names to
2971 * several files: more enahncements to NEW_INSETS and the resulting
2974 * lib/lyxrc.example (\date_insert_format): move to misc section
2976 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2977 bastring and use AC_CACHE_CHECK.
2978 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2979 the system have the newest methods. uses AC_CACHE_CHECK
2980 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2981 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2982 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2984 * configure.in: add LYX_CXX_GOOD_STD_STRING
2986 * acinclude.m4: recreated
2988 2000-07-24 Amir Karger
2990 * README: add Hebrew, Arabic kmaps
2993 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2995 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2998 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3000 * Lot of files: add pragma interface/implementation.
3002 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3004 * lib/ui/default.ui: new file (ans new directory). Contains the
3005 default menu and toolbar.
3007 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3008 global space. Toolbars are now read (as menus) in ui files.
3010 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3012 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3013 is disabled because the document is read-only. We want to have the
3014 toggle state of the function anyway.
3015 (getStatus): add code for LFUN_VC* functions (mimicking what is
3016 done in old-style menus)
3018 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3019 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3021 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3022 * src/BufferView_pimpl.C: ditto.
3023 * src/lyxfunc.C: ditto.
3025 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3026 default). This replaces old-style menus by new ones.
3028 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3029 MenuItem. Contain the data structure of a menu.
3031 * src/insets/insettext.C: use LyXView::setLayout instead of
3032 accessing directly the toolbar combox.
3033 * src/lyxfunc.C (Dispatch): ditto.
3035 * src/LyXView.C (setLayout): new method, which just calls
3036 Toolbar::setLayout().
3037 (updateLayoutChoice): move part of this method in Toolbar.
3039 * src/toolbar.[Ch]: removed.
3041 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3042 implementation the toolbar.
3044 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3045 the toolbar. It might make sense to merge it with ToolbarDefaults
3047 (setLayout): new function.
3048 (updateLayoutList): ditto.
3049 (openLayoutList): ditto.
3051 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3052 xforms implementation of the toolbar.
3053 (get_toolbar_func): comment out, since I do not
3054 know what it is good for.
3056 * src/ToolbarDefaults.h: Add the ItemType enum.
3058 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3059 for a list of allocated C strings. Used in Menubar xforms
3060 implementation to avoid memory leaks.
3062 * src/support/lstrings.[Ch] (uppercase): new version taking and
3066 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3067 * lib/bind/emacs.bind: ditto.
3069 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3071 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3072 forward decl of LyXView.
3074 * src/toolbar.C (toolbarItem): moved from toolbar.h
3075 (toolbarItem::clean): ditto
3076 (toolbarItem::~toolbarItem): ditto
3077 (toolbarItem::operator): ditto
3079 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3081 * src/paragraph.h: control the NEW_TABULAR define from here
3083 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3084 USE_TABULAR_INSETS to NEW_TABULAR
3086 * src/ToolbarDefaults.C: add include "lyxlex.h"
3088 * files using the old table/tabular: use NEW_TABULAR to control
3089 compilation of old tabular stuff.
3091 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3094 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3095 planemet in reading of old style floats, fix the \end_deeper
3096 problem when reading old style floats.
3098 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3100 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3102 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3104 * lib/bind/sciword.bind: updated.
3106 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3108 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3109 layout write problem
3111 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3113 * src/Makefile.am (INCLUDES): remove image directory from include
3116 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3117 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3119 * src/LyXView.C (create_form_form_main): read the application icon
3122 * lib/images/*.xpm: change the icons to use transparent color for
3125 * src/toolbar.C (update): change the color of the button when it
3128 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3130 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3131 setting explicitely the minibuffer.
3132 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3134 * src/LyXView.C (showState): new function. Shows font information
3135 in minibuffer and update toolbar state.
3136 (LyXView): call Toolbar::update after creating the
3139 * src/toolbar.C: change toollist to be a vector instead of a
3141 (BubbleTimerCB): get help string directly from the callback
3142 argument of the corresponding icon (which is the action)
3143 (set): remove unnecessary ugliness.
3144 (update): new function. update the icons (depressed, disabled)
3145 depending of the status of the corresponding action.
3147 * src/toolbar.h: remove help in toolbarItem
3149 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3151 * src/Painter.C (text): Added code for using symbol glyphs from
3152 iso10646 fonts. Currently diabled.
3154 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3157 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3158 magyar,turkish and usorbian.
3160 * src/paragraph.C (isMultiLingual): Made more efficient.
3162 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3165 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3166 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3167 Also changed the prototype to "bool math_insert_greek(char)".
3169 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3171 * lots of files: apply the NEW_INSETS on all code that will not be
3172 needed when we move to use the new insets. Enable the define in
3173 lyxparagrah.h to try it.
3175 * src/insets/insettabular.C (cellstart): change to be a static
3177 (InsetTabular): initialize buffer in the initializer list.
3179 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3181 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3182 form_print.h out of the header file. Replaced with forward
3183 declarations of the relevant struct.
3185 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3188 * src/commandtags.h: do not include "debug.h" which does not
3189 belong there. #include it in some other places because of this
3192 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3194 * src/insets/insetcaption.C: add a couple "using" directives.
3196 * src/toolbar.C (add): get the help text directly from lyxaction.
3198 (setPixmap): new function. Loads from disk and sets a pixmap on a
3199 botton; the name of the pixmap file is derived from the command
3202 * src/toolbar.h: remove members isBitmap and pixmap from
3205 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3206 * lib/images/: move many files from images/banner.xpm.
3208 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3210 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3211 * src/toolbar.C: ditto.
3212 * configure.in: ditto.
3213 * INSTALL: document.
3215 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3216 the spellchecker popup is closed from the WM.
3218 2000-07-19 Juergen Vigna <jug@sad.it>
3220 * src/insets/insetfloat.C (Write): small fix because we use the
3221 insetname for the type now!
3223 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3225 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3228 * src/frontends/Dialogs.h: removed hideCitation signal
3230 * src/insets/insetcite.h: added hide signal
3232 * src/insets/insetcite.C (~InsetCitation): emits new signal
3233 (getScreenLabel): "intelligent" label should now fit on the screen!
3235 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3237 * src/frontends/xforms/FormCitation.C (showInset): connects
3238 hide() to the inset's hide signal
3239 (show): modified to use fl_set_object_position rather than
3240 fl_set_object_geometry wherever possible
3242 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3244 * src/insets/lyxinset.h: add caption code
3246 * src/insets/insetfloat.C (type): new method
3248 * src/insets/insetcaption.C (Write): new method
3250 (LyxCode): new method
3252 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3253 to get it right together with using the FloatList.
3255 * src/commandtags.h: add LFUN_INSET_CAPTION
3256 * src/lyxfunc.C (Dispatch): handle it
3258 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3261 * src/Variables.[Ch]: make expand take a const reference, remove
3262 the destructor, some whitespace changes.
3264 * src/LyXAction.C (init): add caption-inset-insert
3266 * src/FloatList.C (FloatList): update the default floats a bit.
3268 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3270 * src/Variables.[Ch]: new files. Intended to be used for language
3271 specific strings (like \chaptername) and filename substitution in
3274 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3276 * lib/kbd/american.kmap: update
3278 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3280 * src/bufferparams.[Ch]: remove member allowAccents.
3282 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3284 * src/LaTeXLog.C: use the log_form.h header.
3285 * src/lyx_gui.C: ditto.
3286 * src/lyx_gui_misc.C: ditto.
3287 * src/lyxvc.h: ditto.
3289 * forms/log_form.fd: new file, created from latexoptions.fd. I
3290 kept the log popup and nuked the options form.
3292 * src/{la,}texoptions.[Ch]: removed.
3293 * src/lyx_cb.C (LaTeXOptions): ditto
3295 * src/lyx_gui.C (create_forms): do not handle the
3296 fd_latex_options form.
3298 2000-07-18 Juergen Vigna <jug@sad.it>
3300 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3301 name of the inset so that it can be requested outside (text2.C).
3303 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3306 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3308 * src/mathed/formula.h (ConvertFont): constify
3310 * src/mathed/formula.C (Read): add warning if \end_inset is not
3311 found on expected place.
3313 * src/insets/lyxinset.h (ConvertFont): consify
3315 * src/insets/insetquotes.C (ConvertFont): constify
3316 * src/insets/insetquotes.h: ditto
3318 * src/insets/insetinfo.h: add labelfont
3320 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3321 (ascent): use labelfont
3325 (Write): make .lyx file a bit nicer
3327 * src/insets/insetfloat.C (Write): simplify somewhat...
3328 (Read): add warning if arg is not found
3330 * src/insets/insetcollapsable.C: add using std::max
3331 (Read): move string token and add warning in arg is not found
3332 (draw): use std::max to get the right ty
3333 (getMaxWidth): simplify by using std::max
3335 * src/insets/insetsection.h: new file
3336 * src/insets/insetsection.C: new file
3337 * src/insets/insetcaption.h: new file
3338 * src/insets/insetcaption.C: new file
3340 * src/insets/inset.C (ConvertFont): constify signature
3342 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3343 insetcaption.[Ch] and insetsection.[Ch]
3345 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3346 uses to use LABEL_COUNTER_CHAPTER instead.
3347 * src/text2.C (SetCounter): here
3349 * src/counters.h: new file
3350 * src/counters.C: new file
3351 * src/Sectioning.h: new file
3352 * src/Sectioning.C: new file
3354 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3356 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3358 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3361 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3364 2000-07-17 Juergen Vigna <jug@sad.it>
3366 * src/tabular.C (Validate): check if array-package is needed.
3367 (SetVAlignment): added support for vertical alignment.
3368 (SetLTFoot): better support for longtable header/footers
3369 (Latex): modified to support added features.
3371 * src/LaTeXFeatures.[Ch]: added array-package.
3373 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3375 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3378 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3380 * configure.in: do not forget to put a space after -isystem.
3382 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3384 * lib/kbd/arabic.kmap: a few fixes.
3386 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3388 * some whitespace chagnes to a number of files.
3390 * src/support/DebugStream.h: change to make it easier for
3391 doc++ to parse correctly.
3392 * src/support/lyxstring.h: ditto
3394 * src/mathed/math_utils.C (compara): change to have only one
3396 (MathedLookupBOP): change because of the above.
3398 * src/mathed/math_delim.C (math_deco_compare): change to have only
3400 (search_deco): change becasue of the above.
3402 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3403 instead of manually coded one.
3405 * src/insets/insetquotes.C (Read): read the \end_inset too
3407 * src/insets/insetlatex.h: remove file
3408 * src/insets/insetlatex.C: remove file
3410 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3412 (InsetPrintIndex): remove destructor
3414 * src/insets/insetinclude.h: remove default constructor
3416 * src/insets/insetfloat.C: work to make it work better
3418 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3420 * src/insets/insetcite.h (InsetCitation): remove default constructor
3422 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3424 * src/text.C (GetColumnNearX): comment out some currently unused code.
3426 * src/paragraph.C (writeFile): move some initializations closer to
3428 (CutIntoMinibuffer): small change to use new matchIT operator
3432 (InsertInset): ditto
3435 (InsetIterator): ditto
3436 (Erase): small change to use new matchFT operator
3438 (GetFontSettings): ditto
3439 (HighestFontInRange): ditto
3442 * src/lyxparagraph.h: some chars changed to value_type
3443 (matchIT): because of some stronger checking (perhaps too strong)
3444 in SGI STL, the two operator() unified to one.
3447 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3449 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3450 the last inset read added
3451 (parseSingleLyXformat2Token): some more (future) compability code added
3452 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3453 (parseSingleLyXformat2Token): set last_inset_read
3454 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3455 (parseSingleLyXformat2Token): don't double intializw string next_token
3457 * src/TextCache.C (text_fits::operator()): add const's to the signature
3458 (has_buffer::operator()): ditto
3460 * src/Floating.h: add some comments on the class
3462 * src/FloatList.[Ch] (typeExist): new method
3465 * src/BackStack.h: added default constructor, wanted by Gcc.
3467 2000-07-14 Juergen Vigna <jug@sad.it>
3469 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3471 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3473 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3474 do a redraw when the window is resized!
3475 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3477 * src/insets/insettext.C (resizeLyXText): added function to correctly
3478 being able to resize the LyXWindow.
3480 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3482 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3484 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3485 crashes when closing dialog to a deleted inset.
3487 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3488 method! Now similar to other insets.
3490 2000-07-13 Juergen Vigna <jug@sad.it>
3492 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3494 * lib/examples/Literate.lyx: small patch!
3496 * src/insets/insetbib.C (Read): added this function because of wrong
3497 Write (without [begin|end]_inset).
3499 2000-07-11 Juergen Vigna <jug@sad.it>
3501 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3502 as the insertInset could not be good!
3504 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3505 the bool param should not be last.
3507 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3509 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3510 did submit that to Karl).
3512 * configure.in: use -isystem instead of -I for X headers. This
3513 fixes a problem on solaris with a recent gcc;
3514 put the front-end code after the X detection code;
3515 configure in sigc++ before lib/
3517 * src/lyx_main.C (commandLineHelp): remove -display from command
3520 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3522 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3523 Also put in Makefile rules for building the ``listerrors''
3524 program for parsing errors from literate programs written in LyX.
3526 * lib/build-listerrors: Added small shell script as part of compile
3527 process. This builds a working ``listerrors'' binary if noweb is
3528 installed and either 1) the VNC X server is installed on the machine,
3529 or 2) the user is compiling from within a GUI. The existence of a GUI
3530 is necessary to use the ``lyx --export'' feature for now. This
3531 hack can be removed once ``lyx --export'' no longer requires a GUI to
3534 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3536 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3537 now passed back correctly from gcc and placed "under" error
3538 buttons in a Literate LyX source.
3540 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3542 * src/text.C (GetColumnNearX): Better behavior when a RTL
3543 paragraph is ended by LTR text.
3545 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3548 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3550 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3551 true when clipboard is empty.
3553 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3555 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3556 row of the paragraph.
3557 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3558 to prevent calculation of bidi tables
3560 2000-07-07 Juergen Vigna <jug@sad.it>
3562 * src/screen.C (ToggleSelection): added y_offset and x_offset
3565 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3568 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3570 * src/insets/insettext.C: fixed Layout-Display!
3572 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3574 * configure.in: add check for strings.h header.
3576 * src/spellchecker.C: include <strings.h> in order to have a
3577 definition for bzero().
3579 2000-07-07 Juergen Vigna <jug@sad.it>
3581 * src/insets/insettext.C (draw): set the status of the bv->text to
3582 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3584 * src/screen.C (DrawOneRow):
3585 (DrawFromTo): redraw the actual row if something has changed in it
3588 * src/text.C (draw): call an update of the toplevel-inset if something
3589 has changed inside while drawing.
3591 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3593 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3595 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3596 processing inside class.
3598 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3599 processing inside class.
3601 * src/insets/insetindex.h new struct Holder, consistent with other
3604 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3605 citation dialog from main code and placed it in src/frontends/xforms.
3606 Dialog launched through signals instead of callbacks
3608 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3610 * lyx.man: update the options description.
3612 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3614 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3615 handle neg values, set min width to 590, add doc about -display
3617 2000-07-05 Juergen Vigna <jug@sad.it>
3619 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3620 calls to BufferView *.
3622 * src/insets/insettext.C (checkAndActivateInset): small fix non
3623 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3625 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3626 their \end_inset token!
3628 2000-07-04 edscott <edscott@imp.mx>
3630 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3631 lib/lyxrc.example: added option \wheel_jump
3633 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3635 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3636 remove support for -width,-height,-xpos and -ypos.
3638 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3640 * src/encoding.[Ch]: New files.
3642 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3643 (text): Call to the underline() method only when needed.
3645 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3647 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3648 encoding(s) for the document.
3650 * src/bufferparams.C (BufferParams): Changed default value of
3653 * src/language.C (newLang): Removed.
3654 (items[]): Added encoding information for all defined languages.
3656 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3657 encoding choice button.
3659 * src/lyxrc.h (font_norm_type): New member variable.
3660 (set_font_norm_type): New method.
3662 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3663 paragraphs with different encodings.
3665 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3666 (TransformChar): Changed to work correctly with Arabic points.
3667 (draw): Added support for drawing Arabic points.
3668 (draw): Removed code for drawing underbars (this is done by
3671 * src/support/textutils.h (IsPrintableNonspace): New function.
3673 * src/BufferView_pimpl.h: Added "using SigC::Object".
3674 * src/LyXView.h: ditto.
3676 * src/insets/insetinclude.h (include_label): Changed to mutable.
3678 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3680 * src/mathed/math_iter.h: remove empty destructor
3682 * src/mathed/math_cursor.h: remove empty destructor
3684 * src/insets/lyxinset.h: add THEOREM_CODE
3686 * src/insets/insettheorem.[Ch]: new files
3688 * src/insets/insetminipage.C: (InsertInset): remove
3690 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3692 (InsertInset): remove
3694 * src/insets/insetlist.C: (InsertList): remove
3696 * src/insets/insetfootlike.[Ch]: new files
3698 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3701 (InsertInset): ditto
3703 * src/insets/insetert.C: remove include Painter.h, reindent
3704 (InsertInset): move to header
3706 * src/insets/insetcollapsable.h: remove explicit from default
3707 contructor, remove empty destructor, add InsertInset
3709 * src/insets/insetcollapsable.C (InsertInset): new func
3711 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3713 * src/vspace.h: add explicit to constructor
3715 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3716 \textcompwordmark, please test this.
3718 * src/lyxrc.C: set ascii_linelen to 65 by default
3720 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3722 * src/commandtags.h: add LFUN_INSET_THEOREM
3724 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3725 (makeLinuxDocFile): remove _some_ of the nice logic
3726 (makeDocBookFile): ditto
3728 * src/Painter.[Ch]: (~Painter): removed
3730 * src/LyXAction.C (init): entry for insettheorem added
3732 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3734 (deplog): code to detect files generated by LaTeX, needs testing
3737 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3739 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3741 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3743 * src/LaTeX.C (deplog): Add a check for files that are going to be
3744 created by the first latex run, part of the project to remove the
3747 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3748 contents to the extension list.
3750 2000-07-04 Juergen Vigna <jug@sad.it>
3752 * src/text.C (NextBreakPoint): added support for needFullRow()
3754 * src/insets/lyxinset.h: added needFullRow()
3756 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3759 * src/insets/insettext.C: lots of changes for update!
3761 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3763 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3765 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3767 * src/insets/insetinclude.C (InsetInclude): fixed
3768 initialization of include_label.
3769 (unique_id): now returns a string.
3771 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3773 * src/LaTeXFeatures.h: new member IncludedFiles, for
3774 a map of key, included file name.
3776 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3777 with the included files for inclusion in SGML preamble,
3778 i. e., linuxdoc and docbook.
3781 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3782 nice (is the generated linuxdoc code to be exported?), that
3783 allows to remove column, and only_body that will be true for
3784 slave documents. Insets are allowed inside SGML font type.
3785 New handling of the SGML preamble for included files.
3786 (makeDocBookFile): the same for docbook.
3788 * src/insets/insetinclude.h:
3789 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3791 (DocBook): new export methods.
3793 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3794 and makeDocBookFile.
3796 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3797 formats to export with command line argument -x.
3799 2000-06-29 Juergen Vigna <jug@sad.it>
3801 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3802 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3804 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3805 region could already been cleared by an inset!
3807 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3809 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3812 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3814 (cursorToggle): remove special handling of lyx focus.
3816 2000-06-28 Juergen Vigna <jug@sad.it>
3818 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3821 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3823 * src/insets/insetindex.C (Edit): add a callback when popup is
3826 * src/insets/insettext.C (LocalDispatch):
3827 * src/insets/insetmarginal.h:
3828 * src/insets/insetlist.h:
3829 * src/insets/insetfoot.h:
3830 * src/insets/insetfloat.h:
3831 * src/insets/insetert.h: add a missing std:: qualifier.
3833 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3835 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3838 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3840 * src/insets/insettext.C (Read): remove tmptok unused variable
3841 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3842 (InsertInset): change for new InsetInset code
3844 * src/insets/insettext.h: add TEXT inline method
3846 * src/insets/insettext.C: remove TEXT macro
3848 * src/insets/insetmarginal.C (Write): new method
3849 (Latex): change output slightly
3851 * src/insets/insetfoot.C (Write): new method
3852 (Latex): change output slightly (don't use endl when no need)
3854 * src/insets/insetert.C (Write): new method
3856 * src/insets/insetcollapsable.h: make button_length, button_top_y
3857 and button_bottm_y protected.
3859 * src/insets/insetcollapsable.C (Write): simplify code by using
3860 tostr. Also do not output the float name, the children class
3861 should to that to get control over own arguments
3863 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3864 src/insets/insetminipage.[Ch]:
3867 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3869 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3871 * src/Makefile.am (lyx_SOURCES): add the new files
3873 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3874 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3875 * src/commandtags.h: ditto
3877 * src/LaTeXFeatures.h: add a std::set of used floattypes
3879 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3881 * src/FloatList.[Ch] src/Floating.h: new files
3883 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3885 * src/lyx_cb.C (TableApplyCB): ditto
3887 * src/text2.C: ditto
3888 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3889 (parseSingleLyXformat2Token): ditto + add code for
3890 backwards compability for old float styles + add code for new insets
3892 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3894 (InsertInset(size_type, Inset *, LyXFont)): new method
3895 (InsetChar(size_type, char)): changed to use the other InsetChar
3896 with a LyXFont(ALL_INHERIT).
3897 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3898 insert the META_INSET.
3900 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3902 * sigc++/thread.h (Threads): from here
3904 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3905 definition out of line
3906 * sigc++/scope.h: from here
3908 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3910 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3911 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3913 * Makefile.am (bindist): new target.
3915 * INSTALL: add instructions for doing a binary distribution.
3917 * development/tools/README.bin.example: update a bit.
3919 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3922 * lib/lyxrc.example: new lyxrc tag \set_color.
3924 * src/lyxfunc.C (Dispatch):
3925 * src/commandtags.h:
3926 * src/LyXAction.C: new lyxfunc "set-color".
3928 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3929 and an x11name given as strings.
3931 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3932 cache when a color is changed.
3934 2000-06-26 Juergen Vigna <jug@sad.it>
3936 * src/lyxrow.C (width): added this functions and variable.
3938 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3941 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3943 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3945 * images/undo_bw.xpm: new icon.
3946 * images/redo_bw.xpm: ditto.
3948 * configure.in (INSTALL_SCRIPT): change value to
3949 ${INSTALL} to avoid failures of install-script target.
3950 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3952 * src/BufferView.h: add a magic "friend" declaration to please
3955 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3957 * forms/cite.fd: modified to allow resizing without messing
3960 * src/insetcite.C: Uses code from cite.fd almost without
3962 User can now resize dialog in the x-direction.
3963 Resizing the dialog in the y-direction is prevented, as the
3964 code does this intelligently already.
3966 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3968 * INSTALL: remove obsolete entry in "problems" section.
3970 * lib/examples/sl_*.lyx: update of the slovenian examples.
3972 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3974 2000-06-23 Juergen Vigna <jug@sad.it>
3976 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3978 * src/buffer.C (resize): delete the LyXText of textinsets.
3980 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3982 * src/insets/lyxinset.h: added another parameter 'cleared' to
3983 the draw() function.
3985 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3986 unlocking inset in inset.
3988 2000-06-22 Juergen Vigna <jug@sad.it>
3990 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3991 of insets and moved first to LyXText.
3993 * src/mathed/formulamacro.[Ch]:
3994 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3996 2000-06-21 Juergen Vigna <jug@sad.it>
3998 * src/text.C (GetVisibleRow): look if I should clear the area or not
3999 using Inset::doClearArea() function.
4001 * src/insets/lyxinset.h: added doClearArea() function and
4002 modified draw(Painter &, ...) to draw(BufferView *, ...)
4004 * src/text2.C (UpdateInset): return bool insted of int
4006 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4008 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4009 combox in the character popup
4011 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4012 BufferParams const & params
4014 2000-06-20 Juergen Vigna <jug@sad.it>
4016 * src/insets/insettext.C (SetParagraphData): set insetowner on
4019 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4021 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4022 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4024 (form_main_): remove
4026 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4027 (create_form_form_main): remove FD_form_main stuff, connect to
4028 autosave_timeout signal
4030 * src/LyXView.[Ch] (getMainForm): remove
4031 (UpdateTimerCB): remove
4032 * src/BufferView_pimpl.h: inherit from SigC::Object
4034 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4035 signal instead of callback
4037 * src/BufferView.[Ch] (cursorToggleCB): remove
4039 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4041 * src/BufferView_pimpl.C: changes because of the one below
4043 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4044 instead of storing a pointer to a LyXText.
4046 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4048 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4050 * src/lyxparagraph.h
4052 * src/paragraph.C: Changed fontlist to a sorted vector.
4054 2000-06-19 Juergen Vigna <jug@sad.it>
4056 * src/BufferView.h: added screen() function.
4058 * src/insets/insettext.C (LocalDispatch): some selection code
4061 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4063 * src/insets/insettext.C (SetParagraphData):
4065 (InsetText): fixes for multiple paragraphs.
4067 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4069 * development/lyx.spec.in: Call configure with ``--without-warnings''
4070 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4071 This should be fine, however, since we generally don't want to be
4072 verbose when making an RPM.
4074 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4076 * lib/scripts/fig2pstex.py: New file
4078 2000-06-16 Juergen Vigna <jug@sad.it>
4080 * src/insets/insettabular.C (UpdateLocal):
4081 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4082 (LocalDispatch): Changed all functions to use LyXText.
4084 2000-06-15 Juergen Vigna <jug@sad.it>
4086 * src/text.C (SetHeightOfRow): call inset::update before requesting
4089 * src/insets/insettext.C (update):
4090 * src/insets/insettabular.C (update): added implementation
4092 * src/insets/lyxinset.h: added update function
4094 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4096 * src/text.C (SelectNextWord): protect against null pointers with
4097 old-style string streams. (fix from Paul Theo Gonciari
4100 * src/cite.[Ch]: remove erroneous files.
4102 * lib/configure.m4: update the list of created directories.
4104 * src/lyxrow.C: include <config.h>
4105 * src/lyxcursor.C: ditto.
4107 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4109 * lib/examples/decimal.lyx: new example file from Mike.
4111 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4112 to find template definitions (from Dekel)
4114 * src/frontends/.cvsignore: add a few things.
4116 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4118 * src/Timeout.C (TimeOut): remove default argument.
4120 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4123 * src/insets/ExternalTemplate.C: add a "using" directive.
4125 * src/lyx_main.h: remove the act_ struct, which seems unused
4128 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4130 * LyX Developers Meeting: All files changed, due to random C++ (by
4131 coincidence) code generator script.
4133 - external inset (cool!)
4134 - initial online editing of preferences
4135 - insettabular breaks insettext(s contents)
4137 - some DocBook fixes
4138 - example files update
4139 - other cool stuff, create a diff and look for yourself.
4141 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4143 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4144 -1 this is a non-line-breaking textinset.
4146 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4147 if there is no width set.
4149 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4151 * Lots of files: Merged the dialogbase branch.
4153 2000-06-09 Allan Rae <rae@lyx.org>
4155 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4156 and the Dispatch methods that used it.
4158 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4159 access to functions formerly kept in Dispatch.
4161 2000-05-19 Allan Rae <rae@lyx.org>
4163 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4164 made to_page and count_copies integers again. from_page remains a
4165 string however because I want to allow entry of a print range like
4166 "1,4,22-25" using this field.
4168 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4169 and printer-params-get. These aren't useful from the minibuffer but
4170 could be used by a script/LyXServer app provided it passes a suitable
4171 auto_mem_buffer. I guess I should take a look at how the LyXServer
4172 works and make it support xtl buffers.
4174 * sigc++/: updated to libsigc++-1.0.1
4176 * src/xtl/: updated to xtl-1.3.pl.11
4178 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4179 those changes done to the files in src/ are actually recreated when
4180 they get regenerated. Please don't ever accept a patch that changes a
4181 dialog unless that patch includes the changes to the corresponding *.fd
4184 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4185 stringOnlyContains, renamed it and generalised it.
4187 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4188 branch. Removed the remaining old form_print code.
4190 2000-04-26 Allan Rae <rae@lyx.org>
4192 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4193 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4195 2000-04-25 Allan Rae <rae@lyx.org>
4197 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4198 against a base of xtl-1.3.pl.4
4200 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4201 filter the Id: entries so they still show the xtl version number
4204 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4205 into the src/xtl code. Patch still pending with José (XTL)
4207 2000-04-24 Allan Rae <rae@lyx.org>
4209 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4210 both more generic and much safer. Use the new template functions.
4211 * src/buffer.[Ch] (Dispatch): ditto.
4213 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4214 and mem buffer more intelligently. Also a little general cleanup.
4217 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4218 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4219 * src/xtl/Makefile.am: ditto.
4220 * src/xtl/.cvsignore: ditto.
4221 * src/Makefile.am: ditto.
4223 * src/PrinterParams.h: Removed the macros member functions. Added a
4224 testInvariant member function. A bit of tidying up and commenting.
4225 Included Angus's idea for fixing operation with egcs-1.1.2.
4227 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4228 cool expansion of XTL's mem_buffer to support automatic memory
4229 management within the buffer itself. Removed the various macros and
4230 replaced them with template functions that use either auto_mem_buffer
4231 or mem_buffer depending on a #define. The mem_buffer support will
4232 disappear as soon as the auto_mem_buffer is confirmed to be good on
4233 other platforms/compilers. That is, it's there so you've got something
4236 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4237 effectively forked XTL. However I expect José will include my code
4238 into the next major release. Also fixed a memory leak.
4239 * src/xtl/text.h: ditto.
4240 * src/xtl/xdr.h: ditto.
4241 * src/xtl/giop.h: ditto.
4243 2000-04-16 Allan Rae <rae@lyx.org>
4245 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4246 by autogen.sh and removed by maintainer-clean anyway.
4247 * .cvsignore, sigc++/.cvsignore: Support the above.
4249 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4251 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4253 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4254 macros, renamed static callback-target member functions to suit new
4255 scheme and made them public.
4256 * src/frontends/xforms/forms/form_print.fd: ditto.
4257 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4259 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4262 * src/xtl/: New directory containing a minimal distribution of XTL.
4263 This is XTL-1.3.pl.4.
4265 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4267 2000-04-15 Allan Rae <rae@lyx.org>
4269 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4271 * sigc++/: Updated to libsigc++-1.0.0
4273 2000-04-14 Allan Rae <rae@lyx.org>
4275 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4276 use the generic ones in future. I'll modify my conversion script.
4278 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4280 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4281 (CloseAllBufferRelatedDialogs): Renamed.
4282 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4284 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4285 of the generic ones. These are the same ones my conversion script
4288 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4289 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4290 * src/buffer.C (Dispatch): ditto
4292 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4293 functions for updating and hiding buffer dependent dialogs.
4294 * src/BufferView.C (buffer): ditto
4295 * src/buffer.C (setReadonly): ditto
4296 * src/lyxfunc.C (CloseBuffer): ditto
4298 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4299 Dialogs.h, and hence all the SigC stuff, into every file that includes
4300 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4302 * src/BufferView2.C: reduce the number of headers included by buffer.h
4304 2000-04-11 Allan Rae <rae@lyx.org>
4306 * src/frontends/xforms/xform_macros.h: A small collection of macros
4307 for building C callbacks.
4309 * src/frontends/xforms/Makefile.am: Added above file.
4311 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4312 scheme again. This time it should work for JMarc. If this is
4313 successful I'll revise my conversion script to automate some of this.
4314 The static member functions in the class also have to be public for
4315 this scheme will work. If the scheme works (it's almost identical to
4316 the way BufferView::cursorToggleCB is handled so it should work) then
4317 FormCopyright and FormPrint will be ready for inclusion into the main
4318 trunk immediately after 1.1.5 is released -- provided we're prepared
4319 for complaints about lame compilers not handling XTL.
4321 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4323 2000-04-07 Allan Rae <rae@lyx.org>
4325 * config/lyxinclude.m4: A bit more tidying up (Angus)
4327 * src/LString.h: JMarc's <string> header fix
4329 * src/PrinterParams.h: Used string for most data to remove some
4330 ugly code in the Print dialog and avoid even uglier code when
4331 appending the ints to a string for output.
4333 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4334 and moved "default:" back to the end of switch statement. Cleaned
4335 up the printing so it uses the right function calls and so the
4336 "print to file" option actually puts the file in the right directory.
4338 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4340 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4341 and Ok+Apply button control into a separate method: input (Angus).
4342 (input) Cleaned it up and improved it to be very thorough now.
4343 (All CB) static_cast used instead of C style cast (Angus). This will
4344 probably change again once we've worked out how to keep gcc-2.8.1 happy
4345 with real C callbacks.
4346 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4347 ignore some of the bool settings and has random numbers instead. Needs
4348 some more investigation. Added other input length checks and checking
4349 of file and printer names.
4351 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4352 would link (Angus). Seems the old code doesn't compile with the pragma
4353 statement either. Separated callback entries from internal methods.
4355 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4357 2000-03-17 Allan Rae <rae@lyx.org>
4359 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4360 need it? Maybe it could go in Dialogs instead? I could make it a
4361 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4362 values to get the bool return value.
4363 (Dispatch): New overloaded method for xtl support.
4365 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4366 extern "C" callback instead of static member functions. Hopefully,
4367 JMarc will be able to compile this. I haven't changed
4368 forms/form_copyright.fd yet. Breaking one of my own rules already.
4370 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4371 because they aren't useful from the minibuffer. Maybe a LyXServer
4372 might want a help message though?
4374 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4376 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4377 xtl which needs both rtti and exceptions.
4379 * src/support/Makefile.am:
4380 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4382 * src/frontends/xforms/input_validators.[ch]: input filters and
4383 validators. These conrol what keys are valid in input boxes.
4384 Use them and write some more. Much better idea than waiting till
4385 after the user has pressed Ok to say that the input fields don't make
4388 * src/frontends/xforms/Makefile.am:
4389 * src/frontends/xforms/forms/form_print.fd:
4390 * src/frontends/xforms/forms/makefile:
4391 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4392 new scheme. Still have to make sure I haven't missed anything from
4393 the current implementation.
4395 * src/Makefile.am, src/PrinterParams.h: New data store.
4397 * other files: Added a couple of copyright notices.
4399 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4401 * src/insets/insetbib.h: move Holder struct in public space.
4403 * src/frontends/include/DialogBase.h: use SigC:: only when
4404 SIGC_CXX_NAMESPACES is defined.
4405 * src/frontends/include/Dialogs.h: ditto.
4407 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4409 * src/frontends/xforms/FormCopyright.[Ch]: do not
4410 mention SigC:: explicitely.
4412 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4414 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4415 deals with testing KDE in main configure.in
4416 * configure.in: ditto.
4418 2000-02-22 Allan Rae <rae@lyx.org>
4420 * Lots of files: Merged from HEAD
4422 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4423 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4425 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4427 * sigc++/: new minidist.
4429 2000-02-14 Allan Rae <rae@lyx.org>
4431 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4433 2000-02-08 Juergen Vigna <jug@sad.it>
4435 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4436 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4438 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4439 for this port and so it is much easier for other people to port
4440 dialogs in a common development environment.
4442 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4443 the QT/KDE implementation.
4445 * src/frontends/kde/Dialogs.C:
4446 * src/frontends/kde/FormCopyright.C:
4447 * src/frontends/kde/FormCopyright.h:
4448 * src/frontends/kde/Makefile.am:
4449 * src/frontends/kde/formcopyrightdialog.C:
4450 * src/frontends/kde/formcopyrightdialog.h:
4451 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4452 for the kde support of the Copyright-Dialog.
4454 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4455 subdir-substitution instead of hardcoded 'xforms' as we now have also
4458 * src/frontends/include/DialogBase.h (Object): just commented the
4459 label after #endif (nasty warning and I don't like warnings ;)
4461 * src/main.C (main): added KApplication initialization if using
4464 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4465 For now only the KDE event-loop is added if frontend==kde.
4467 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4469 * configure.in: added support for the --with-frontend[=value] option
4471 * autogen.sh: added kde.m4 file to list of config-files
4473 * acconfig.h: added define for KDEGUI-support
4475 * config/kde.m4: added configuration functions for KDE-port
4477 * config/lyxinclude.m4: added --with-frontend[=value] option with
4478 support for xforms and KDE.
4480 2000-02-08 Allan Rae <rae@lyx.org>
4482 * all Makefile.am: Fixed up so the make targets dist, distclean,
4483 install and uninstall all work even if builddir != srcdir. Still
4484 have a new sigc++ minidist update to come.
4486 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4488 2000-02-01 Allan Rae <rae@lyx.org>
4490 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4491 Many mods to get builddir != srcdir working.
4493 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4494 for building on NT and so we can do the builddir != srcdir stuff.
4496 2000-01-30 Allan Rae <rae@lyx.org>
4498 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4499 This will stay in "rae" branch. We probably don't really need it in
4500 the main trunk as anyone who wants to help programming it should get
4501 a full library installed also. So they can check both included and
4502 system supplied library compilation.
4504 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4505 Added a 'mini' distribution of libsigc++. If you feel the urge to
4506 change something in these directories - Resist it. If you can't
4507 resist the urge then you should modify the following script and rebuild
4508 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4509 all happen. Still uses a hacked version of libsigc++'s configure.in.
4510 I'm quite happy with the results. I'm not sure the extra work to turn
4511 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4512 worth the trouble and would probably lead to extra maintenance
4514 I haven't tested the following important make targets: install, dist.
4515 Not ready for prime time but very close. Maybe 1.1.5.
4517 * development/tools/makeLyXsigc.sh: A shell script to automatically
4518 generate our mini-dist of libsigc++. It can only be used with a CVS
4519 checkout of libsigc++ not a tarball distribution. It's well commented.
4520 This will end up as part of the libsigc++ distribution so other apps
4521 can easily have an included mini-dist. If someone makes mods to the
4522 sigc++ subpackage without modifying this script to generate those
4523 changes I'll be very upset!
4525 * src/frontends/: Started the gui/system indep structure.
4527 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4528 to access the gui-indep dialogs are in this class. Much improved
4529 design compared to previous revision. Lars, please refrain from
4530 moving this header into src/ like you did with Popups.h last time.
4532 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4534 * src/frontends/xforms/: Started the gui-indep system with a single
4535 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4538 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4539 Here you'll find a very useful makefile and automated fdfix.sh that
4540 makes updating dailogs a no-brainer -- provided you follow the rules
4541 set out in the README. I'm thinking about adding another script to
4542 automatically generate skeleton code for a new dialog given just the
4545 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4546 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4547 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4549 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4551 * src/support/LSubstring.C (operator): simplify
4553 * src/lyxtext.h: removed bparams, use buffer_->params instead
4555 * src/lyxrow.h: make Row a real class, move all variables to
4556 private and use accessors.
4558 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4560 (isRightToLeftPar): ditto
4561 (ChangeLanguage): ditto
4562 (isMultiLingual): ditto
4565 (SimpleTeXOnePar): ditto
4566 (TeXEnvironment): ditto
4567 (GetEndLabel): ditto
4569 (SetOnlyLayout): ditto
4570 (BreakParagraph): ditto
4571 (BreakParagraphConservative): ditto
4572 (GetFontSettings): ditto
4574 (CopyIntoMinibuffer): ditto
4575 (CutIntoMinibuffer): ditto
4576 (PasteParagraph): ditto
4577 (SetPExtraType): ditto
4578 (UnsetPExtraType): ditto
4579 (DocBookContTableRows): ditto
4580 (SimpleDocBookOneTablePar): ditto
4582 (TeXFootnote): ditto
4583 (SimpleTeXOneTablePar): ditto
4584 (TeXContTableRows): ditto
4585 (SimpleTeXSpecialChars): ditto
4588 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4589 to private and use accessors.
4591 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4592 this, we did not use it anymore and has not been for ages. Just a
4593 waste of cpu cycles.
4595 * src/language.h: make Language a real class, move all variables
4596 to private and use accessors.
4598 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4599 (create_view): remove
4600 (update): some changes for new timer
4601 (cursorToggle): use new timer
4602 (beforeChange): change for new timer
4604 * src/BufferView.h (cursorToggleCB): removed last paramter because
4607 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4608 (cursorToggleCB): change because of new timer code
4610 * lib/CREDITS: updated own mailaddress
4612 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4614 * src/support/filetools.C (PutEnv): fix the code in case neither
4615 putenv() nor setenv() have been found.
4617 * INSTALL: mention the install-strip Makefile target.
4619 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4620 read-only documents.
4622 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4624 * lib/reLyX/configure.in (VERSION): avoid using a previously
4625 generated reLyX wrapper to find out $prefix.
4627 * lib/examples/eu_adibide_lyx-atua.lyx:
4628 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4629 translation of the Tutorial (Dooteo)
4631 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4633 * forms/cite.fd: new citation dialog
4635 * src/insetcite.[Ch]: the new citation dialog is moved into
4638 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4641 * src/insets/insetcommand.h: data members made private.
4643 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4645 * LyX 1.1.5 released
4647 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4649 * src/version.h (LYX_RELEASE): to 1.1.5
4651 * src/spellchecker.C (RunSpellChecker): return false if the
4652 spellchecker dies upon creation.
4654 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4656 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4657 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4661 * lib/CREDITS: update entry for Martin Vermeer.
4663 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4665 * src/text.C (draw): Draw foreign language bars at the bottom of
4666 the row instead of at the baseline.
4668 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4670 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4672 * lib/bind/de_menus.bind: updated
4674 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4676 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4678 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4680 * src/menus.C (Limit_string_length): New function
4681 (ShowTocMenu): Limit the number of items/length of items in the
4684 * src/paragraph.C (String): Correct result for a paragraph inside
4687 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4689 * src/bufferlist.C (close): test of buf->getuser() == NULL
4691 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4693 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4694 Do not call to SetCursor when the paragraph is a closed footnote!
4696 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4698 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4701 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4703 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4706 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4707 reference popup, that activates the reference-back action
4709 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4711 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4712 the menus. Also fixed a bug.
4714 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4715 the math panels when switching buffers (unless new buffer is readonly).
4717 * src/BufferView.C (NoSavedPositions)
4718 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4720 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4722 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4723 less of dvi dirty or not.
4725 * src/trans_mgr.[Ch] (insert): change first parameter to string
4728 * src/chset.[Ch] (encodeString): add const to first parameter
4730 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4732 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4736 * src/LaTeX.C (deplog): better searching for dependency files in
4737 the latex log. Uses now regexps.
4739 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4740 instead of the box hack or \hfill.
4742 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4744 * src/lyxfunc.C (doImportHelper): do not create the file before
4745 doing the actual import.
4746 (doImportASCIIasLines): create a new file before doing the insert.
4747 (doImportASCIIasParagraphs): ditto.
4749 * lib/lyxrc.example: remove mention of non-existing commands
4751 * lyx.man: remove mention of color-related switches.
4753 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4755 * src/lyx_gui.C: remove all the color-related ressources, which
4756 are not used anymore.
4758 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4761 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4763 * src/lyxrc.C (read): Add a missing break in the switch
4765 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4767 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4769 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4772 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4774 * src/text.C (draw): draw bars under foreign language words.
4776 * src/LColor.[Ch]: add LColor::language
4778 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4780 * src/lyxcursor.h (boundary): New member variable
4782 * src/text.C (IsBoundary): New methods
4784 * src/text.C: Use the above for currect cursor movement when there
4785 is both RTL & LTR text.
4787 * src/text2.C: ditto
4789 * src/bufferview_funcs.C (ToggleAndShow): ditto
4791 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4793 * src/text.C (DeleteLineForward): set selection to true to avoid
4794 that DeleteEmptyParagraphMechanism does some magic. This is how it
4795 is done in all other functions, and seems reasonable.
4796 (DeleteWordForward): do not jump over non-word stuff, since
4797 CursorRightOneWord() already does it.
4799 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4800 DeleteWordBackward, since they seem safe to me (since selection is
4801 set to "true") DeleteEmptyParagraphMechanism does nothing.
4803 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4805 * src/lyx_main.C (easyParse): simplify the code by factoring the
4806 part that removes parameters from the command line.
4807 (LyX): check wether wrong command line options have been given.
4809 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4811 * src/lyx_main.C : add support for specifying user LyX
4812 directory via command line option -userdir.
4814 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4816 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4817 the number of items per popup.
4818 (Add_to_refs_menu): Ditto.
4820 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4822 * src/lyxparagraph.h: renamed ClearParagraph() to
4823 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4824 textclass as parameter, and do nothing if free_spacing is
4825 true. This fixes part of the line-delete-forward problems.
4827 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4828 (pasteSelection): ditto.
4829 (SwitchLayoutsBetweenClasses): more translatable strings.
4831 * src/text2.C (CutSelection): use StripLeadingSpaces.
4832 (PasteSelection): ditto.
4833 (DeleteEmptyParagraphMechanism): ditto.
4835 2000-05-26 Juergen Vigna <jug@sad.it>
4837 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4838 is not needed in tabular insets.
4840 * src/insets/insettabular.C (TabularFeatures): added missing features.
4842 * src/tabular.C (DeleteColumn):
4844 (AppendRow): implemented this functions
4845 (cellsturct::operator=): clone the inset too;
4847 2000-05-23 Juergen Vigna <jug@sad.it>
4849 * src/insets/insettabular.C (LocalDispatch): better selection support
4850 when having multicolumn-cells.
4852 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4854 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4856 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4858 * src/ColorHandler.C (getGCForeground): put more test into _()
4860 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4863 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4866 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4868 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4869 there are no labels, or when buffer is readonly.
4871 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4872 there are no labels, buffer is SGML, or when buffer is readonly.
4874 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4876 * src/LColor.C (LColor): change a couple of grey40 to grey60
4877 (LColor): rewore initalization to make compiles go some magnitude
4879 (getGUIName): don't use gettext until we need the string.
4881 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4883 * src/Bullet.[Ch]: Fixed a small bug.
4885 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4887 * src/paragraph.C (String): Several fixes/improvements
4889 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4891 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4893 * src/paragraph.C (String): give more correct output.
4895 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4897 * src/lyxfont.C (stateText) Do not output the language if it is
4898 eqaul to the language of the document.
4900 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4901 between two paragraphs with the same language.
4903 * src/paragraph.C (getParLanguage) Return a correct answer for an
4904 empty dummy paragraph.
4906 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4909 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4912 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4913 the menus/popup, if requested fonts are unavailable.
4915 2000-05-22 Juergen Vigna <jug@sad.it>
4917 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4918 movement support (Up/Down/Tab/Shift-Tab).
4919 (LocalDispatch): added also preliminari cursor-selection.
4921 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4923 * src/paragraph.C (PasteParagraph): Hopefully now right!
4925 2000-05-22 Garst R. Reese <reese@isn.net>
4927 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4928 of list, change all references to Environment to Command
4929 * tex/hollywood.cls : rewrite environments as commands, add
4930 \uppercase to interiorshot and exteriorshot to force uppecase.
4931 * tex/broadway.cls : rewrite environments as commands. Tweak
4934 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4936 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4937 size of items: use a constant intead of the hardcoded 40, and more
4938 importantly do not remove the %m and %x tags added at the end.
4939 (Add_to_refs_menu): use vector::size_type instead of
4940 unsigned int as basic types for the variables. _Please_ do not
4941 assume that size_t is equal to unsigned int. On an alpha, this is
4942 unsigned long, which is _not_ the same.
4944 * src/language.C (initL): remove language "hungarian", since it
4945 seems that "magyar" is better.
4947 2000-05-22 Juergen Vigna <jug@sad.it>
4949 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4951 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4954 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4955 next was deleted but not set to 0.
4957 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4959 * src/language.C (initL): change the initialization of languages
4960 so that compiles goes _fast_.
4962 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4965 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4967 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4971 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4973 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4975 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4979 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4982 * src/insets/insetlo*.[Ch]: Made editable
4984 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4986 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4987 the current selection.
4989 * src/BufferView_pimpl.C (stuffClipboard): new method
4991 * src/BufferView.C (stuffClipboard): new method
4993 * src/paragraph.C (String): new method
4995 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4996 LColor::ignore when lyxname is not found.
4998 * src/BufferView.C (pasteSelection): new method
5000 * src/BufferView_pimpl.C (pasteSelection): new method
5002 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5004 * src/WorkArea.C (request_clipboard_cb): new static function
5005 (getClipboard): new method
5006 (putClipboard): new method
5008 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5010 * LyX 1.1.5pre2 released
5012 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5014 * src/vspace.C (operator=): removed
5015 (operator=): removed
5017 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5019 * src/layout.C (NumberOfClass): manually set the type in make_pair
5020 (NumberOfLayout): ditto
5022 * src/language.C: use the Language constructor for ignore_lang
5024 * src/language.h: add constructors to struct Language
5026 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5028 * src/text2.C (SetCursorIntern): comment out #warning
5030 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5032 * src/mathed/math_iter.h: initialize sx and sw to 0
5034 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5036 * forms/lyx.fd: Redesign of form_ref
5038 * src/LaTeXFeatures.[Ch]
5042 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5045 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5046 and Buffer::inset_iterator.
5048 * src/menus.C: Added new menus: TOC and Refs.
5050 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5052 * src/buffer.C (getTocList): New method.
5054 * src/BufferView2.C (ChangeRefs): New method.
5056 * src/buffer.C (getLabelList): New method. It replaces the old
5057 getReferenceList. The return type is vector<string> instead of
5060 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5061 the old getLabel() and GetNumberOfLabels() methods.
5062 * src/insets/insetlabel.C (getLabelList): ditto
5063 * src/mathed/formula.C (getLabelList): ditto
5065 * src/paragraph.C (String): New method.
5067 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5068 Uses the new getTocList() method.
5069 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5070 which automatically updates the contents of the browser.
5071 (RefUpdateCB): Use the new getLabelList method.
5073 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5075 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5077 * src/spellchecker.C: Added using std::reverse;
5079 2000-05-19 Juergen Vigna <jug@sad.it>
5081 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5083 * src/insets/insettext.C (computeTextRows): small fix for display of
5084 1 character after a newline.
5086 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5089 2000-05-18 Juergen Vigna <jug@sad.it>
5091 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5092 when changing width of column.
5094 * src/tabular.C (set_row_column_number_info): setting of
5095 autobreak rows if necessary.
5097 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5099 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5101 * src/vc-backend.*: renamed stat() to status() and vcstat to
5102 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5103 compilation broke. The new name seems more relevant, anyway.
5105 2000-05-17 Juergen Vigna <jug@sad.it>
5107 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5108 which was wrong if the removing caused removing of rows!
5110 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5111 (pushToken): new function.
5113 * src/text2.C (CutSelection): fix problem discovered with purify
5115 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5117 * src/debug.C (showTags): enlarge the first column, now that we
5118 have 6-digits debug codes.
5120 * lib/layouts/hollywood.layout:
5121 * lib/tex/hollywood.cls:
5122 * lib/tex/brodway.cls:
5123 * lib/layouts/brodway.layout: more commands and fewer
5124 environments. Preambles moved in the .cls files. Broadway now has
5125 more options on scene numbering and less whitespace (from Garst)
5127 * src/insets/insetbib.C (getKeys): make sure that we are in the
5128 document directory, in case the bib file is there.
5130 * src/insets/insetbib.C (Latex): revert bogus change.
5132 2000-05-16 Juergen Vigna <jug@sad.it>
5134 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5135 the TabularLayout on cursor move.
5137 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5139 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5142 (draw): fixed cursor position and drawing so that the cursor is
5143 visible when before the tabular-inset.
5145 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5146 when creating from old insettext.
5148 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5150 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5152 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5153 * lib/tex/brodway.cls: ditto
5155 * lib/layouts/brodway.layout: change alignment of parenthical
5158 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5160 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5161 versions 0.88 and 0.89 are supported.
5163 2000-05-15 Juergen Vigna <jug@sad.it>
5165 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5168 * src/insets/insettext.C (computeTextRows): redone completely this
5169 function in a much cleaner way, because of problems when having a
5171 (draw): added a frame border when the inset is locked.
5172 (SetDrawLockedFrame): this sets if we draw the border or not.
5173 (SetFrameColor): this sets the frame color (default=insetframe).
5175 * src/insets/lyxinset.h: added x() and y() functions which return
5176 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5177 function which is needed to see if we have a locking inset of some
5178 type in this inset (needed for now in insettabular).
5180 * src/vspace.C (inPixels): the same function also without a BufferView
5181 parameter as so it is easier to use it in some ocasions.
5183 * src/lyxfunc.C: changed all places where insertInset was used so
5184 that now if it couldn't be inserted it is deleted!
5186 * src/TabularLayout.C:
5187 * src/TableLayout.C: added support for new tabular-inset!
5189 * src/BufferView2.C (insertInset): this now returns a bool if the
5190 inset was really inserted!!!
5192 * src/tabular.C (GetLastCellInRow):
5193 (GetFirstCellInRow): new helper functions.
5194 (Latex): implemented for new tabular class.
5198 (TeXTopHLine): new Latex() helper functions.
5200 2000-05-12 Juergen Vigna <jug@sad.it>
5202 * src/mathed/formulamacro.C (Read):
5203 * src/mathed/formula.C (Read): read also the \end_inset here!
5205 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5207 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5208 crush when saving formulae with unbalanced parenthesis.
5210 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5212 * src/layout.C: Add new keyword "endlabelstring" to layout file
5214 * src/text.C (GetVisibleRow): Draw endlabel string.
5216 * lib/layouts/broadway.layout
5217 * lib/layouts/hollywood.layout: Added endlabel for the
5218 Parenthetical layout.
5220 * lib/layouts/heb-article.layout: Do not use slanted font shape
5221 for Theorem like environments.
5223 * src/buffer.C (makeLaTeXFile): Always add "american" to
5224 the UsedLanguages list if document language is RTL.
5226 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5228 * add addendum to README.OS2 and small patch (from SMiyata)
5230 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5232 * many files: correct the calls to ChangeExtension().
5234 * src/support/filetools.C (ChangeExtension): remove the no_path
5235 argument, which does not belong there. Use OnlyFileName() instead.
5237 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5238 files when LaTeXing a non-nice latex file.
5240 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5241 a chain of "if". Return false when deadkeys are not handled.
5243 * src/lyx_main.C (LyX): adapted the code for default bindings.
5245 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5246 bindings for basic functionality (except deadkeys).
5247 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5249 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5250 several methods: handle override_x_deadkeys.
5252 * src/lyxrc.h: remove the "bindings" map, which did not make much
5253 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5255 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5257 * src/lyxfont.C (stateText): use a saner method to determine
5258 whether the font is "default". Seems to fix the crash with DEC
5261 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5263 2000-05-08 Juergen Vigna <jug@sad.it>
5265 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5266 TabularLayoutMenu with mouse-button-3
5267 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5269 * src/TabularLayout.C: added this file for having a Layout for
5272 2000-05-05 Juergen Vigna <jug@sad.it>
5274 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5275 recalculating inset-widths.
5276 (TabularFeatures): activated this function so that I can change
5277 tabular-features via menu.
5279 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5280 that I can test some functions with the Table menu.
5282 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5284 * src/lyxfont.C (stateText): guard against stupid c++libs.
5286 * src/tabular.C: add using std::vector
5287 some whitespace changes, + removed som autogenerated code.
5289 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5291 2000-05-05 Juergen Vigna <jug@sad.it>
5293 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5294 row, columns and cellstructures.
5296 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5298 * lib/lyxrc.example: remove obsolete entries.
5300 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5301 reading of protected_separator for free_spacing.
5303 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5305 * src/text.C (draw): do not display an exclamation mark in the
5306 margin for margin notes. This is confusing, ugly and
5309 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5310 AMS math' is checked.
5312 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5313 name to see whether including the amsmath package is needed.
5315 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5317 * src/paragraph.C (validate): Compute UsedLanguages correctly
5318 (don't insert the american language if it doesn't appear in the
5321 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5322 The argument of \thanks{} command is considered moving argument
5324 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5327 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5329 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5330 for appendix/minipage/depth. The lines can be now both in the footnote
5331 frame, and outside the frame.
5333 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5336 2000-05-05 Juergen Vigna <jug@sad.it>
5338 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5339 neede only in tabular.[Ch].
5341 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5343 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5345 (Write): write '~' for PROTECTED_SEPARATOR
5347 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5349 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5352 * src/mathed/formula.C (drawStr): rename size to siz.
5354 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5355 possibly fix a bug by not changing the pflags = flags to piflags =
5358 2000-05-05 Juergen Vigna <jug@sad.it>
5360 * src/insets/insetbib.C: moved using directive
5362 * src/ImportNoweb.C: small fix for being able to compile (missing
5365 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5367 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5368 to use clear, since we don't depend on this in the code. Add test
5371 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5373 * (various *.C files): add using std::foo directives to please dec
5376 * replace calls to string::clear() to string::erase() (Angus)
5378 * src/cheaders/cmath: modified to provide std::abs.
5380 2000-05-04 Juergen Vigna <jug@sad.it>
5382 * src/insets/insettext.C: Prepared all for inserting of multiple
5383 paragraphs. Still display stuff to do (alignment and other things),
5384 but I would like to use LyXText to do this when we cleaned out the
5385 table-support stuff.
5387 * src/insets/insettabular.C: Changed lot of stuff and added lots
5388 of functionality still a lot to do.
5390 * src/tabular.C: Various functions changed name and moved to be
5391 const functions. Added new Read and Write functions and changed
5392 lots of things so it works good with tabular-insets (also removed
5393 some stuff which is not needed anymore * hacks *).
5395 * src/lyxcursor.h: added operators == and != which just look if
5396 par and pos are (not) equal.
5398 * src/buffer.C (latexParagraphs): inserted this function to latex
5399 all paragraphs form par to endpar as then I can use this too for
5402 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5403 so that I can call this to from text insets with their own cursor.
5405 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5406 output off all paragraphs (because of the fix below)!
5408 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5409 the very last paragraph (this could be also the last paragraph of an
5412 * src/texrow.h: added rows() call which returns the count-variable.
5414 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5416 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5418 * lib/configure.m4: better autodetection of DocBook tools.
5420 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5422 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5424 * src/lyx_cb.C: add using std::reverse;
5426 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5429 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5430 selected files. Should fix repeated errors from generated files.
5432 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5434 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5436 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5437 the spellchecker popup.
5439 * lib/lyxrc.example: Removed the \number_inset section
5441 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5443 * src/insets/figinset.C (various): Use IsFileReadable() to make
5444 sure that the file actually exist. Relying on ghostscripts errors
5445 is a bad idea since they can lead to X server crashes.
5447 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5449 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5452 * lib/lyxrc.example: smallish typo in description of
5453 \view_dvi_paper_option
5455 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5458 * src/lyxfunc.C: doImportHelper to factor out common code of the
5459 various import methods. New functions doImportASCIIasLines,
5460 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5461 doImportLinuxDoc for the format specific parts.
5464 * buffer.C: Dispatch returns now a bool to indicate success
5467 * lyx_gui.C: Add getLyXView() for member access
5469 * lyx_main.C: Change logic for batch commands: First try
5470 Buffer::Dispatch (possibly without GUI), if that fails, use
5473 * lyx_main.C: Add support for --import command line switch.
5474 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5475 Available Formats: Everything accepted by 'buffer-import <format>'
5477 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5479 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5482 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5483 documents will be reformatted upon reentry.
5485 2000-04-27 Juergen Vigna <jug@sad.it>
5487 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5488 correctly only last pos this was a bug.
5490 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5492 * release of lyx-1.1.5pre1
5494 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5496 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5498 * src/menus.C: revert the change of naming (Figure->Graphic...)
5499 from 2000-04-11. It was incomplete and bad.
5501 * src/LColor.[Ch]: add LColor::depthbar.
5502 * src/text.C (GetVisibleRow): use it.
5504 * README: update the languages list.
5506 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5508 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5511 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5513 * README: remove sections that were just wrong.
5515 * src/text2.C (GetRowNearY): remove currentrow code
5517 * src/text.C (GetRow): remove currentrow code
5519 * src/screen.C (Update): rewritten a bit.
5520 (SmallUpdate): removed func
5522 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5524 (FullRebreak): return bool
5525 (currentrow): remove var
5526 (currentrow_y): ditto
5528 * src/lyxscreen.h (Draw): change arg to unsigned long
5529 (FitCursor): return bool
5530 (FitManualCursor): ditto
5531 (Smallpdate): remove func
5532 (first): change to unsigned long
5533 (DrawOneRow): change second arg to long (from long &)
5534 (screen_refresh_y): remove var
5535 (scree_refresh_row): ditto
5537 * src/lyxrow.h: change baseline to usigned int from unsigned
5538 short, this brings some implicit/unsigned issues out in the open.
5540 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5542 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5543 instead of smallUpdate.
5545 * src/lyxcursor.h: change y to unsigned long
5547 * src/buffer.h: don't call updateScrollbar after fitcursor
5549 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5550 where they are used. Removed "\\direction", this was not present
5551 in 1.1.4 and is already obsolete. Commented out some code that I
5552 believe to never be called.
5553 (runLiterate): don't call updateScrollbar after fitCursor
5555 (buildProgram): ditto
5558 * src/WorkArea.h (workWidth): change return val to unsigned
5561 (redraw): remove the button redraws
5562 (setScrollbarValue): change for scrollbar
5563 (getScrollbarValue): change for scrollbar
5564 (getScrollbarBounds): change for scrollbar
5566 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5567 (C_WorkArea_down_cb): removed func
5568 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5569 (resize): change for scrollbar
5570 (setScrollbar): ditto
5571 (setScrollbarBounds): ditto
5572 (setScrollbarIncrements): ditto
5573 (up_cb): removed func
5574 (down_cb): removed func
5575 (scroll_cb): change for scrollbar
5576 (work_area_handler): ditto
5578 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5579 when FitCursor did something.
5580 (updateScrollbar): some unsigned changes
5581 (downCB): removed func
5582 (scrollUpOnePage): removed func
5583 (scrollDownOnePage): remvoed func
5584 (workAreaMotionNotify): don't call screen->FitCursor but use
5585 fitCursor instead. and bool return val
5586 (workAreaButtonPress): ditto
5587 (workAreaButtonRelease): some unsigned changes
5588 (checkInsetHit): ditto
5589 (workAreaExpose): ditto
5590 (update): parts rewritten, comments about the signed char arg added
5591 (smallUpdate): removed func
5592 (cursorPrevious): call needed updateScrollbar
5595 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5598 * src/BufferView.[Ch] (upCB): removed func
5599 (downCB): removed func
5600 (smallUpdate): removed func
5602 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5604 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5605 currentrow, currentrow_y optimization. This did not help a lot and
5606 if we want to do this kind of optimization we should rather use
5607 cursor.row instead of the currentrow.
5609 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5610 buffer spacing and klyx spacing support.
5612 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5614 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5617 2000-04-26 Juergen Vigna <jug@sad.it>
5619 * src/insets/figinset.C: fixes to Lars sstream changes!
5621 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5623 * A lot of files: Added Ascii(ostream &) methods to all inset
5624 classes. Used when exporting to ASCII.
5626 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5627 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5630 * src/text2.C (ToggleFree): Disabled implicit word selection when
5631 there is a change in the language
5633 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5634 no output was generated for end-of-sentence inset.
5636 * src/insets/lyxinset.h
5639 * src/paragraph.C: Removed the insetnumber code
5641 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5643 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5645 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5646 no_babel and no_epsfig completely from the file.
5647 (parseSingleLyXformat2Token): add handling for per-paragraph
5648 spacing as written by klyx.
5650 * src/insets/figinset.C: applied patch by Andre. Made it work with
5653 2000-04-20 Juergen Vigna <jug@sad.it>
5655 * src/insets/insettext.C (cutSelection):
5656 (copySelection): Fixed with selection from right to left.
5657 (draw): now the rows are not recalculated at every draw.
5658 (computeTextRows): for now reset the inset-owner here (this is
5659 important for an undo or copy where the inset-owner is not set
5662 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5663 motion to the_locking_inset screen->first was forgotten, this was
5664 not important till we got multiline insets.
5666 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5668 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5669 code seems to be alright (it is code changed by Dekel, and the
5670 intent is indeed that all macros should be defined \protect'ed)
5672 * NEWS: a bit of reorganisation of the new user-visible features.
5674 2000-04-19 Juergen Vigna <jug@sad.it>
5676 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5677 position. Set the inset_owner of the used paragraph so that it knows
5678 that it is inside an inset. Fixed cursor handling with mouse and
5679 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5680 and cleanups to make TextInsets work better.
5682 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5683 Changed parameters of various functions and added LockInsetInInset().
5685 * src/insets/insettext.C:
5687 * src/insets/insetcollapsable.h:
5688 * src/insets/insetcollapsable.C:
5689 * src/insets/insetfoot.h:
5690 * src/insets/insetfoot.C:
5691 * src/insets/insetert.h:
5692 * src/insets/insetert.C: cleaned up the code so that it works now
5693 correctly with insettext.
5695 * src/insets/inset.C:
5696 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5697 that insets in insets are supported right.
5700 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5702 * src/paragraph.C: some small fixes
5704 * src/debug.h: inserted INSETS debug info
5706 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5707 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5709 * src/commandtags.h:
5710 * src/LyXAction.C: insert code for InsetTabular.
5712 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5713 not Button1MotionMask.
5714 (workAreaButtonRelease): send always a InsetButtonRelease event to
5716 (checkInsetHit): some setCursor fixes (always with insets).
5718 * src/BufferView2.C (lockInset): returns a bool now and extended for
5719 locking insets inside insets.
5720 (showLockedInsetCursor): it is important to have the cursor always
5721 before the locked inset.
5722 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5724 * src/BufferView.h: made lockInset return a bool.
5726 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5728 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5729 that is used also internally but can be called as public to have back
5730 a cursor pos which is not set internally.
5731 (SetCursorIntern): Changed to use above function.
5733 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5735 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5740 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5741 patches for things that should be in or should be changed.
5743 * src/* [insetfiles]: change "usigned char fragile" to bool
5744 fragile. There was only one point that could that be questioned
5745 and that is commented in formulamacro.C. Grep for "CHECK".
5747 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5748 (DeleteBuffer): take it out of CutAndPaste and make it static.
5750 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5752 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5753 output the spacing envir commands. Also the new commands used in
5754 the LaTeX output makes the result better.
5756 * src/Spacing.C (writeEnvirBegin): new method
5757 (writeEnvirEnd): new method
5759 2000-04-18 Juergen Vigna <jug@sad.it>
5761 * src/CutAndPaste.C: made textclass a static member of the class
5762 as otherwise it is not accesed right!!!
5764 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5766 * forms/layout_forms.fd
5767 * src/layout_forms.h
5768 * src/layout_forms.C (create_form_form_character)
5769 * src/lyx_cb.C (UserFreeFont)
5770 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5771 documents (in the layout->character popup).
5773 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5775 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5776 \spell_command was in fact not honored (from Kevin Atkinson).
5778 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5781 * src/lyx_gui.h: make lyxViews private (Angus)
5783 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5785 * src/mathed/math_write.C
5786 (MathMatrixInset::Write) Put \protect before \begin{array} and
5787 \end{array} if fragile
5788 (MathParInset::Write): Put \protect before \\ if fragile
5790 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5793 initialization if the LyXColorHandler must be done after the
5794 connections to the XServer has been established.
5796 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5797 get the background pixel from the lyxColorhandler so that the
5798 figures are rendered with the correct background color.
5799 (NextToken): removed functions.
5800 (GetPSSizes): use ifs >> string instead of NextToken.
5802 * src/Painter.[Ch]: the color cache moved out of this file.
5804 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5807 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5809 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5810 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5812 * src/BufferView.C (enterView): new func
5813 (leaveView): new func
5815 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5817 (leaveView): new func, undefines xterm cursor when approp.
5819 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5820 (AllowInput): delete the Workarea cursor handling from this func.
5822 * src/Painter.C (underline): draw a slimer underline in most cases.
5824 * src/lyx_main.C (error_handler): use extern "C"
5826 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5828 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5829 sent directly to me.
5831 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5832 to the list by Dekel.
5834 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5837 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5838 methods from lyx_cb.here.
5840 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5843 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5845 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5846 instead of using current_view directly.
5848 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5850 * src/LyXAction.C (init): add the paragraph-spacing command.
5852 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5854 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5856 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5857 different from the documents.
5859 * src/text.C (SetHeightOfRow): take paragraph spacing into
5860 account, paragraph spacing takes precedence over buffer spacing
5861 (GetVisibleRow): ditto
5863 * src/paragraph.C (writeFile): output the spacing parameter too.
5864 (validate): set the correct features if spacing is used in the
5866 (Clear): set spacing to default
5867 (MakeSameLayout): spacing too
5868 (HasSameLayout): spacing too
5869 (SetLayout): spacing too
5870 (TeXOnePar): output the spacing commands
5872 * src/lyxparagraph.h: added a spacing variable for use with
5873 per-paragraph spacing.
5875 * src/Spacing.h: add a Default spacing and a method to check if
5876 the current spacing is default. also added an operator==
5878 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5881 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5883 * src/lyxserver.C (callback): fix dispatch of functions
5885 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5886 printf() into lyxerr call.
5888 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5891 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5892 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5893 the "Float" from each of the subitems.
5894 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5896 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5897 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5898 documented the change so that the workaround can be nuked later.
5900 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5903 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5905 * src/buffer.C (getLatexName): ditto
5906 (setReadonly): ditto
5908 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5910 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5911 avoid some uses of current_view. Added also a bufferParams()
5912 method to get at this.
5914 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5916 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5918 * src/lyxparagraph.[Ch]: removed
5919 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5920 with operators used by lower_bound and
5921 upper_bound in InsetTable's
5922 Make struct InsetTable private again. Used matchpos.
5924 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5926 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5927 document, the language of existing text is changed (unless the
5928 document is multi-lingual)
5930 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5932 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5934 * A lot of files: A rewrite of the Right-to-Left support.
5936 2000-04-10 Juergen Vigna <jug@sad.it>
5938 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5939 misplaced cursor when inset in inset is locked.
5941 * src/insets/insettext.C (LocalDispatch): small fix so that a
5942 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5944 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5945 footnote font should be decreased in size twice when displaying.
5947 * src/insets/insettext.C (GetDrawFont): inserted this function as
5948 the drawing-font may differ from the real paragraph font.
5950 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5951 insets (inset in inset!).
5953 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5954 function here because we don't want footnotes inside footnotes.
5956 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5958 (init): now set the inset_owner in paragraph.C
5959 (LocalDispatch): added some resetPos() in the right position
5962 (pasteSelection): changed to use the new CutAndPaste-Class.
5964 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5965 which tells if it is allowed to insert another inset inside this one.
5967 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5968 SwitchLayoutsBetweenClasses.
5970 * src/text2.C (InsertInset): checking of the new paragraph-function
5972 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5973 is not needed anymore here!
5976 (PasteSelection): redone (also with #ifdef) so that now this uses
5977 the CutAndPaste-Class.
5978 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5981 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5982 from/to text/insets.
5984 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5985 so that the paragraph knows if it is inside an (text)-inset.
5986 (InsertFromMinibuffer): changed return-value to bool as now it
5987 may happen that an inset is not inserted in the paragraph.
5988 (InsertInsetAllowed): this checks if it is allowed to insert an
5989 inset in this paragraph.
5991 (BreakParagraphConservative):
5992 (BreakParagraph) : small change for the above change of the return
5993 value of InsertFromMinibuffer.
5995 * src/lyxparagraph.h: added inset_owner and the functions to handle
5996 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5998 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6000 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6001 functions from BufferView to BufferView::Pimpl to ease maintence.
6003 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6004 correctly. Also use SetCursorIntern instead of SetCursor.
6006 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6009 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6011 * src/WorkArea.C (belowMouse): manually implement below mouse.
6013 * src/*: Add "explicit" on several constructors, I added probably
6014 some unneeded ones. A couple of changes to code because of this.
6016 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6017 implementation and private parts from the users of BufferView. Not
6020 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6021 implementation and private parts from the users of LyXLex. Not
6024 * src/BufferView_pimpl.[Ch]: new files
6026 * src/lyxlex_pimpl.[Ch]: new files
6028 * src/LyXView.[Ch]: some inline functions move out-of-line
6030 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6032 * src/lyxparagraph.h: make struct InsetTable public.
6034 * src/support/lyxstring.h: change lyxstring::difference_type to be
6035 ptrdiff_t. Add std:: modifiers to streams.
6037 * src/font.C: include the <cctype> header, for islower() and
6040 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6042 * src/font.[Ch]: new files. Contains the metric functions for
6043 fonts, takes a LyXFont as parameter. Better separation of concepts.
6045 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6046 changes because of this.
6048 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6050 * src/*: compile with -Winline and move functions that don't
6053 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6056 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6058 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6059 (various files changed because of this)
6061 * src/Painter.C (text): fixed the drawing of smallcaps.
6063 * src/lyxfont.[Ch] (drawText): removed unused member func.
6066 * src/*.C: added needed "using" statements and "std::" qualifiers.
6068 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6070 * src/*.h: removed all use of "using" from header files use
6071 qualifier std:: instead.
6073 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6075 * src/text.C (Backspace): some additional cleanups (we already
6076 know whether cursor.pos is 0 or not).
6078 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6079 automake does not provide one).
6081 * src/bmtable.h: replace C++ comments with C comments.
6083 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6085 * src/screen.C (ShowCursor): Change the shape of the cursor if
6086 the current language is not equal to the language of the document.
6087 (If the cursor change its shape unexpectedly, then you've found a bug)
6089 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6092 * src/insets/insetnumber.[Ch]: New files.
6094 * src/LyXAction.C (init)
6095 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6098 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6100 * src/lyxparagraph.h
6101 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6102 (the vector is kept sorted).
6104 * src/text.C (GetVisibleRow): Draw selection correctly when there
6105 is both LTR and RTL text.
6107 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6108 which is much faster.
6110 * src/text.C (GetVisibleRow and other): Do not draw the last space
6111 in a row if the direction of the last letter is not equal to the
6112 direction of the paragraph.
6114 * src/lyxfont.C (latexWriteStartChanges):
6115 Check that font language is not equal to basefont language.
6116 (latexWriteEndChanges): ditto
6118 * src/lyx_cb.C (StyleReset): Don't change the language while using
6119 the font-default command.
6121 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6122 empty paragraph before a footnote.
6124 * src/insets/insetcommand.C (draw): Increase x correctly.
6126 * src/screen.C (ShowCursor): Change cursor shape if
6127 current language != document language.
6129 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6131 2000-03-31 Juergen Vigna <jug@sad.it>
6133 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6134 (Clone): changed mode how the paragraph-data is copied to the
6135 new clone-paragraph.
6137 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6138 GetInset(pos) with no inset anymore there (in inset UNDO)
6140 * src/insets/insetcommand.C (draw): small fix as here x is
6141 incremented not as much as width() returns (2 before, 2 behind = 4)
6143 2000-03-30 Juergen Vigna <jug@sad.it>
6145 * src/insets/insettext.C (InsetText): small fix in initialize
6146 widthOffset (should not be done in the init() function)
6148 2000-03-29 Amir Karger <karger@lyx.org>
6150 * lib/examples/it_ItemizeBullets.lyx: translation by
6153 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6155 2000-03-29 Juergen Vigna <jug@sad.it>
6157 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6159 * src/insets/insetfoot.C (Clone): small change as for the below
6160 new init function in the text-inset
6162 * src/insets/insettext.C (init): new function as I've seen that
6163 clone did not copy the Paragraph-Data!
6164 (LocalDispatch): Added code so that now we have some sort of Undo
6165 functionality (well actually we HAVE Undo ;)
6167 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6169 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6171 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6174 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6176 * src/main.C: added a runtime check that verifies that the xforms
6177 header used when building LyX and the library used when running
6178 LyX match. Exit with a message if they don't match. This is a
6179 version number check only.
6181 * src/buffer.C (save): Don't allocate memory on the heap for
6182 struct utimbuf times.
6184 * *: some using changes, use iosfwd instead of the real headers.
6186 * src/lyxfont.C use char const * instead of string for the static
6187 strings. Rewrite some functions to use sstream.
6189 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6191 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6194 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6196 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6197 of Geodesy (from Martin Vermeer)
6199 * lib/layouts/svjour.inc: include file for the Springer svjour
6200 class. It can be used to support journals other than JoG.
6202 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6203 Miskiewicz <misiek@pld.org.pl>)
6204 * lib/reLyX/Makefile.am: ditto.
6206 2000-03-27 Juergen Vigna <jug@sad.it>
6208 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6209 also some modifications with operations on selected text.
6211 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6212 problems with clicking on insets (last famous words ;)
6214 * src/insets/insetcommand.C (draw):
6215 (width): Changed to have a bit of space before and after the inset so
6216 that the blinking cursor can be seen (otherwise it was hidden)
6218 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6220 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6221 would not be added to the link list when an installed gettext (not
6222 part of libc) is found.
6224 2000-03-24 Juergen Vigna <jug@sad.it>
6226 * src/insets/insetcollapsable.C (Edit):
6227 * src/mathed/formula.C (InsetButtonRelease):
6228 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6231 * src/BufferView.C (workAreaButtonPress):
6232 (workAreaButtonRelease):
6233 (checkInsetHit): Finally fixed the clicking on insets be handled
6236 * src/insets/insetert.C (Edit): inserted this call so that ERT
6237 insets work always with LaTeX-font
6239 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6241 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6242 caused lyx to startup with no GUI in place, causing in a crash
6243 upon startup when called with arguments.
6245 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6247 * src/FontLoader.C: better initialization of dummyXFontStruct.
6249 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6251 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6252 for linuxdoc and docbook import and export format options.
6254 * lib/lyxrc.example Example of default values for the previous flags.
6256 * src/lyx_cb.C Use those flags instead of the hardwired values for
6257 linuxdoc and docbook export.
6259 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6262 * src/menus.C Added menus entries for the new import/exports formats.
6264 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6266 * src/lyxrc.*: Added support for running without Gui
6269 * src/FontLoader.C: sensible defaults if no fonts are needed
6271 * src/lyx_cb.C: New function ShowMessage (writes either to the
6272 minibuffer or cout in case of no gui
6273 New function AskOverwrite for common stuff
6274 Consequently various changes to call these functions
6276 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6277 wild guess at sensible screen resolution when having no gui
6279 * src/lyxfont.C: no gui, no fonts... set some defaults
6281 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6283 * src/LColor.C: made the command inset background a bit lighter.
6285 2000-03-20 Hartmut Goebel <goebel@noris.net>
6287 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6288 stdstruct.inc. Koma-Script added some title elements which
6289 otherwise have been listed below "bibliography". This split allows
6290 adding title elements to where they belong.
6292 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6293 define the additional tilte elements and then include
6296 * many other layout files: changed to include stdtitle.inc just
6297 before stdstruct.inc.
6299 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6301 * src/buffer.C: (save) Added the option to store all backup files
6302 in a single directory
6304 * src/lyxrc.[Ch]: Added variable \backupdir_path
6306 * lib/lyxrc.example: Added descriptions of recently added variables
6308 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6309 bibtex inset, not closing the bibtex popup when deleting the inset)
6311 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6313 * src/lyx_cb.C: add a couple using directives.
6315 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6316 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6317 import based on the filename.
6319 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6320 file would be imported at start, if the filename where of a sgml file.
6322 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6324 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6326 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6327 * src/lyxfont.h Replaced the member variable bits.direction by the
6328 member variable lang. Made many changes in other files.
6329 This allows having a multi-lingual document
6331 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6332 that change the current language to <l>.
6333 Removed the command "font-rtl"
6335 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6336 format for Hebrew documents)
6338 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6339 When auto_mathmode is "true", pressing a digit key in normal mode
6340 will cause entering into mathmode.
6341 If auto_mathmode is "rtl" then this behavior will be active only
6342 when writing right-to-left text.
6344 * src/text2.C (InsertStringA) The string is inserted using the
6347 * src/paragraph.C (GetEndLabel) Gives a correct result for
6348 footnote paragraphs.
6350 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6352 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6354 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6355 front of PasteParagraph. Never insert a ' '. This should at least
6356 fix some cause for the segfaults that we have been experiencing,
6357 it also fixes backspace behaviour slightly. (Phu!)
6359 * src/support/lstrings.C (compare_no_case): some change to make it
6360 compile with gcc 2.95.2 and stdlibc++-v3
6362 * src/text2.C (MeltFootnoteEnvironment): change type o
6363 first_footnote_par_is_not_empty to bool.
6365 * src/lyxparagraph.h: make text private. Changes in other files
6367 (fitToSize): new function
6368 (setContentsFromPar): new function
6369 (clearContents): new function
6370 (SetChar): new function
6372 * src/paragraph.C (readSimpleWholeFile): deleted.
6374 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6375 the file, just use a simple string instead. Also read the file in
6376 a more maintainable manner.
6378 * src/text2.C (InsertStringA): deleted.
6379 (InsertStringB): deleted.
6381 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6383 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6384 RedoParagraphs from the doublespace handling part, just set status
6385 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6386 done, but perhaps not like this.)
6388 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6390 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6391 character when inserting an inset.
6393 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6395 * src/bufferparams.C (readLanguage): now takes "default" into
6398 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6399 also initialize the toplevel_keymap with the default bindings from
6402 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6404 * all files using lyxrc: have lyxrc as a real variable and not a
6405 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6408 * src/lyxrc.C: remove double call to defaultKeyBindings
6410 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6411 toolbar defauls using lyxlex. Remove enums, structs, functions
6414 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6415 toolbar defaults. Also store default keybindings in a map.
6417 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6418 storing the toolbar defaults without any xforms dependencies.
6420 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6421 applied. Changed to use iterators.
6423 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6425 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6426 systems that don't have LINGUAS set to begin with.
6428 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6430 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6431 the list by Dekel Tsur.
6433 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6435 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6436 * src/insets/form_graphics.C: ditto.
6438 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6440 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6442 * src/bufferparams.C (readLanguage): use the new language map
6444 * src/intl.C (InitKeyMapper): use the new language map
6446 * src/lyx_gui.C (create_forms): use the new language map
6448 * src/language.[Ch]: New files. Used for holding the information
6449 about each language. Now! Use this new language map enhance it and
6450 make it really usable for our needs.
6452 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6454 * screen.C (ShowCursor): Removed duplicate code.
6455 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6456 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6458 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6461 * src/text.C Added TransformChar method. Used for rendering Arabic
6462 text correctly (change the glyphs of the letter according to the
6463 position in the word)
6468 * src/lyxrc.C Added lyxrc command {language_command_begin,
6469 language_command_end,language_command_ltr,language_command_rtl,
6470 language_package} which allows the use of either arabtex or Omega
6473 * src/lyx_gui.C (init)
6475 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6476 to use encoding for menu fonts which is different than the encoding
6479 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6480 do not load the babel package.
6481 To write an English document with Hebrew/Arabic, change the document
6482 language to "english".
6484 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6485 (alphaCounter): changed to return char
6486 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6488 * lib/lyxrc.example Added examples for Hebrew/Arabic
6491 * src/layout.C Added layout command endlabeltype
6493 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6495 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6497 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6499 * src/mathed/math_delim.C (search_deco): return a
6500 math_deco_struct* instead of index.
6502 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6504 * All files with a USE_OSTREAM_ONLY within: removed all code that
6505 was unused when USE_OSTREAM_ONLY is defined.
6507 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6508 of any less. Removed header and using.
6510 * src/text.C (GetVisibleRow): draw the string "Page Break
6511 (top/bottom)" on screen when drawing a pagebreak line.
6513 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6515 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6517 * src/mathed/math_macro.C (draw): do some cast magic.
6520 * src/mathed/math_defs.h: change byte* argument to byte const*.
6522 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6524 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6525 know it is right to return InsetFoot* too, but cxx does not like
6528 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6530 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6532 * src/mathed/math_delim.C: change == to proper assignment.
6534 2000-03-09 Juergen Vigna <jug@sad.it>
6536 * src/insets/insettext.C (setPos): fixed various cursor positioning
6537 problems (via mouse and cursor-keys)
6538 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6539 inset (still a small display problem but it works ;)
6541 * src/insets/insetcollapsable.C (draw): added button_top_y and
6542 button_bottom_y to have correct values for clicking on the inset.
6544 * src/support/lyxalgo.h: commented out 'using std::less'
6546 2000-03-08 Juergen Vigna <jug@sad.it>
6548 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6549 Button-Release event closes as it is alos the Release-Event
6552 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6554 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6556 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6557 can add multiple spaces in Scrap (literate programming) styles...
6558 which, by the way, is how I got hooked on LyX to begin with.
6560 * src/mathed/formula.C (Write): Added dummy variable to an
6561 inset::Latex() call.
6562 (Latex): Add free_spacing boolean to inset::Latex()
6564 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6566 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6567 virtual function to include the free_spacing boolean from
6568 the containing paragraph's style.
6570 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6571 Added free_spacing boolean arg to match inset.h
6573 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6574 Added free_spacing boolean arg to match inset.h
6576 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6577 Added free_spacing boolean and made sure that if in a free_spacing
6578 paragraph, that we output normal space if there is a protected space.
6580 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6581 Added free_spacing boolean arg to match inset.h
6583 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6584 Added free_spacing boolean arg to match inset.h
6586 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6587 Added free_spacing boolean arg to match inset.h
6589 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6590 Added free_spacing boolean arg to match inset.h
6592 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6593 Added free_spacing boolean arg to match inset.h
6595 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6596 free_spacing boolean arg to match inset.h
6598 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6599 Added free_spacing boolean arg to match inset.h
6601 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6602 Added free_spacing boolean arg to match inset.h
6604 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6605 Added free_spacing boolean arg to match inset.h
6607 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6608 Added free_spacing boolean arg to match inset.h
6610 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6611 Added free_spacing boolean arg to match inset.h
6613 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6614 free_spacing boolean arg to match inset.h
6616 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6617 free_spacing boolean arg to match inset.h
6619 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6620 ignore free_spacing paragraphs. The user's spaces are left
6623 * src/text.C (InsertChar): Fixed the free_spacing layout
6624 attribute behavior. Now, if free_spacing is set, you can
6625 add multiple spaces in a paragraph with impunity (and they
6626 get output verbatim).
6627 (SelectSelectedWord): Added dummy argument to inset::Latex()
6630 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6633 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6634 paragraph layouts now only input a simple space instead.
6635 Special character insets don't make any sense in free-spacing
6638 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6639 hard-spaces in the *input* file to simple spaces if the layout
6640 is free-spacing. This converts old files which had to have
6641 hard-spaces in free-spacing layouts where a simple space was
6643 (writeFileAscii): Added free_spacing check to pass to the newly
6644 reworked inset::Latex(...) methods. The inset::Latex() code
6645 ensures that hard-spaces in free-spacing paragraphs get output
6646 as spaces (rather than "~").
6648 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6650 * src/mathed/math_delim.C (draw): draw the empty placeholder
6651 delims with a onoffdash line.
6652 (struct math_deco_compare): struct that holds the "functors" used
6653 for the sort and the binary search in math_deco_table.
6654 (class init_deco_table): class used for initial sort of the
6656 (search_deco): use lower_bound to do a binary search in the
6659 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6661 * src/lyxrc.C: a small secret thingie...
6663 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6664 and to not flush the stream as often as it used to.
6666 * src/support/lyxalgo.h: new file
6667 (sorted): template function used for checking if a sequence is
6668 sorted or not. Two versions with and without user supplied
6669 compare. Uses same compare as std::sort.
6671 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6672 it and give warning on lyxerr.
6674 (struct compare_tags): struct with function operators used for
6675 checking if sorted, sorting and lower_bound.
6676 (search_kw): use lower_bound instead of manually implemented
6679 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6681 * src/insets/insetcollapsable.h: fix Clone() declaration.
6682 * src/insets/insetfoot.h: ditto.
6684 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6686 2000-03-08 Juergen Vigna <jug@sad.it>
6688 * src/insets/lyxinset.h: added owner call which tells us if
6689 this inset is inside another inset. Changed also the return-type
6690 of Editable to an enum so it tells clearer what the return-value is.
6692 * src/insets/insettext.C (computeTextRows): fixed computing of
6693 textinsets which split automatically on more rows.
6695 * src/insets/insetert.[Ch]: changed this to be of BaseType
6698 * src/insets/insetfoot.[Ch]: added footnote inset
6700 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6701 collapsable insets (like footnote, ert, ...)
6703 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6705 * src/lyxdraw.h: remvoe file
6707 * src/lyxdraw.C: remove file
6709 * src/insets/insettext.C: added <algorithm>.
6711 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6713 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6714 (matrix_cb): case MM_OK use string stream
6716 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6719 * src/mathed/math_macro.C (draw): use string stream
6720 (Metrics): use string stream
6722 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6723 directly to the ostream.
6725 * src/vspace.C (asString): use string stream.
6726 (asString): use string stream
6727 (asLatexString): use string stream
6729 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6730 setting Spacing::Other.
6732 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6733 sprintf when creating the stretch vale.
6735 * src/text2.C (alphaCounter): changed to return a string and to
6736 not use a static variable internally. Also fixed a one-off bug.
6737 (SetCounter): changed the drawing of the labels to use string
6738 streams instead of sprintf.
6740 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6741 manipulator to use a scheme that does not require library support.
6742 This is also the way it is done in the new GNU libstdc++. Should
6743 work with DEC cxx now.
6745 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6747 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6748 end. This fixes a bug.
6750 * src/mathed (all files concerned with file writing): apply the
6751 USE_OSTREAM_ONLY changes to mathed too.
6753 * src/support/DebugStream.h: make the constructor explicit.
6755 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6756 count and ostream squashed.
6758 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6760 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6762 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6763 ostringstream uses STL strings, and we might not.
6765 * src/insets/insetspecialchar.C: add using directive.
6766 * src/insets/insettext.C: ditto.
6768 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6770 * lib/layouts/seminar.layout: feeble attempt at a layout for
6771 seminar.cls, far from completet and could really use some looking
6772 at from people used to write layout files.
6774 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6775 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6776 a lot nicer and works nicely with ostreams.
6778 * src/mathed/formula.C (draw): a slightly different solution that
6779 the one posted to the list, but I think this one works too. (font
6780 size wrong in headers.)
6782 * src/insets/insettext.C (computeTextRows): some fiddling on
6783 Jürgens turf, added some comments that he should read.
6785 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6786 used and it gave compiler warnings.
6787 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6790 * src/lyx_gui.C (create_forms): do the right thing when
6791 show_banner is true/false.
6793 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6794 show_banner is false.
6796 * most file writing files: Now use iostreams to do almost all of
6797 the writing. Also instead of passing string &, we now use
6798 stringstreams. mathed output is still not adapted to iostreams.
6799 This change can be turned off by commenting out all the occurences
6800 of the "#define USE_OSTREAM_ONLY 1" lines.
6802 * src/WorkArea.C (createPixmap): don't output debug messages.
6803 (WorkArea): don't output debug messages.
6805 * lib/lyxrc.example: added a comment about the new variable
6808 * development/Code_rules/Rules: Added some more commente about how
6809 to build class interfaces and on how better encapsulation can be
6812 2000-03-03 Juergen Vigna <jug@sad.it>
6814 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6815 automatically with the width of the LyX-Window
6817 * src/insets/insettext.C (computeTextRows): fixed update bug in
6818 displaying text-insets (scrollvalues where not initialized!)
6820 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6822 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6823 id in the check of the result from lower_bound is not enough since
6824 lower_bound can return last too, and then res->id will not be a
6827 * all insets and some code that use them: I have conditionalized
6828 removed the Latex(string & out, ...) this means that only the
6829 Latex(ostream &, ...) will be used. This is a work in progress to
6830 move towards using streams for all output of files.
6832 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6835 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6837 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6838 routine (this fixes bug where greek letters were surrounded by too
6841 * src/support/filetools.C (findtexfile): change a bit the search
6842 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6843 no longer passed to kpsewhich, we may have to change that later.
6845 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6846 warning options to avoid problems with X header files (from Angus
6848 * acinclude.m4: regenerated.
6850 2000-03-02 Juergen Vigna <jug@sad.it>
6852 * src/insets/insettext.C (WriteParagraphData): Using the
6853 par->writeFile() function for writing paragraph-data.
6854 (Read): Using buffer->parseSingleLyXformat2Token()-function
6855 for parsing paragraph data!
6857 * src/buffer.C (readLyXformat2): removed all parse data and using
6858 the new parseSingleLyXformat2Token()-function.
6859 (parseSingleLyXformat2Token): added this function to parse (read)
6860 lyx-file-format (this is called also from text-insets now!)
6862 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6864 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6867 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6868 directly instead of going through a func. One very bad thing: a
6869 static LyXFindReplace, but I don't know where to place it.
6871 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6872 string instead of char[]. Also changed to static.
6873 (GetSelectionOrWordAtCursor): changed to static inline
6874 (SetSelectionOverLenChars): ditto.
6876 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6877 current_view and global variables. both classes has changed names
6878 and LyXFindReplace is not inherited from SearchForm.
6880 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6881 fl_form_search form.
6883 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6885 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6887 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6888 bound (from Kayvan).
6890 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6892 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6894 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6896 * some things that I should comment but the local pub says head to
6899 * comment out all code that belongs to the Roff code for Ascii
6900 export of tables. (this is unused)
6902 * src/LyXView.C: use correct type for global variable
6903 current_layout. (LyXTextClass::size_type)
6905 * some code to get the new insetgraphics closer to working I'd be
6906 grateful for any help.
6908 * src/BufferView2.C (insertInset): use the return type of
6909 NumberOfLayout properly. (also changes in other files)
6911 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6912 this as a test. I want to know what breaks because of this.
6914 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6916 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6918 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6919 to use a \makebox in the label, this allows proper justification
6920 with out using protected spaces or multiple hfills. Now it is
6921 "label" for left justified, "\hfill label\hfill" for center, and
6922 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6923 should be changed accordingly.
6925 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6927 * src/lyxtext.h: change SetLayout() to take a
6928 LyXTextClass::size_type instead of a char (when there is more than
6929 127 layouts in a class); also change type of copylayouttype.
6930 * src/text2.C (SetLayout): ditto.
6931 * src/LyXView.C (updateLayoutChoice): ditto.
6933 * src/LaTeX.C (scanLogFile): errors where the line number was not
6934 given just after the '!'-line were ignored (from Dekel Tsur).
6936 * lib/lyxrc.example: fix description of \date_insert_format
6938 * lib/layouts/llncs.layout: new layout, contributed by Martin
6941 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6944 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6945 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6946 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6947 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6948 paragraph.C, text.C, text2.C)
6950 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6952 * src/insets/insettext.C (LocalDispatch): remove extra break
6955 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6956 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6958 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6959 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6961 * src/insets/insetbib.h: move InsetBibkey::Holder and
6962 InsetCitation::Holder in public space.
6964 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6966 * src/insets/insettext.h: small change to get the new files from
6967 Juergen to compile (use "string", not "class string").
6969 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6970 const & as parameter to LocalDispatch, use LyXFont const & as
6971 paramter to some other func. This also had impacto on lyxinsets.h
6972 and the two mathed insets.
6974 2000-02-24 Juergen Vigna <jug@sad.it>
6977 * src/commandtags.h:
6979 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6983 * src/BufferView2.C: added/updated code for various inset-functions
6985 * src/insets/insetert.[Ch]: added implementation of InsetERT
6987 * src/insets/insettext.[Ch]: added implementation of InsetText
6989 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6990 (draw): added preliminary code for inset scrolling not finshed yet
6992 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6993 as it is in lyxfunc.C now
6995 * src/insets/lyxinset.h: Added functions for text-insets
6997 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6999 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7000 BufferView and reimplement the list as a queue put inside its own
7003 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7005 * several files: use the new interface to the "updateinsetlist"
7007 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7009 (work_area_handler): call BufferView::trippleClick on trippleclick.
7011 * src/BufferView.C (doubleClick): new function, selects word on
7013 (trippleClick): new function, selects line on trippleclick.
7015 2000-02-22 Allan Rae <rae@lyx.org>
7017 * lib/bind/xemacs.bind: buffer-previous not supported
7019 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7021 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7024 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7026 * src/bufferlist.C: get rid of current_view from this file
7028 * src/spellchecker.C: get rid of current_view from this file
7030 * src/vspace.C: get rid of current_view from this file
7031 (inPixels): added BufferView parameter for this func
7032 (asLatexCommand): added a BufferParams for this func
7034 * src/text.C src/text2.C: get rid of current_view from these
7037 * src/lyxfont.C (getFontDirection): move this function here from
7040 * src/bufferparams.C (getDocumentDirection): move this function
7043 * src/paragraph.C (getParDirection): move this function here from
7045 (getLetterDirection): ditto
7047 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7049 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7050 resize due to wrong pixmap beeing used. Also took the opurtunity
7051 to make the LyXScreen stateless on regard to WorkArea and some
7052 general cleanup in the same files.
7054 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7056 * src/Makefile.am: add missing direction.h
7058 * src/PainterBase.h: made the width functions const.
7060 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7063 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7065 * src/insets/insetlatexaccent.C (draw): make the accents draw
7066 better, at present this will only work well with iso8859-1.
7068 * several files: remove the old drawing code, now we use the new
7071 * several files: remove support for mono_video, reverse_video and
7074 2000-02-17 Juergen Vigna <jug@sad.it>
7076 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7077 int ** as we have to return the pointer, otherwise we have only
7078 NULL pointers in the returning function.
7080 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7082 * src/LaTeX.C (operator()): quote file name when running latex.
7084 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7086 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7087 (bubble tip), this removes our special handling of this.
7089 * Remove all code that is unused now that we have the new
7090 workarea. (Code that are not active when NEW_WA is defined.)
7092 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7094 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7096 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7097 nonexisting layout; correctly redirect obsoleted layouts.
7099 * lib/lyxrc.example: document \view_dvi_paper_option
7101 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7104 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7105 (PreviewDVI): handle the view_dvi_paper_option variable.
7106 [Both from Roland Krause]
7108 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7110 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7111 char const *, int, LyXFont)
7112 (text(int, int, string, LyXFont)): ditto
7114 * src/text.C (InsertCharInTable): attempt to fix the double-space
7115 feature in tables too.
7116 (BackspaceInTable): ditto.
7117 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7119 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7121 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7123 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7124 newly found text in textcache to this.
7125 (buffer): set the owner of the text put into the textcache to 0
7127 * src/insets/figinset.C (draw): fixed the drawing of figures with
7130 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7131 drawing of mathframe, hfills, protected space, table lines. I have
7132 now no outstanding drawing problems with the new Painter code.
7134 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7136 * src/PainterBase.C (ellipse, circle): do not specify the default
7139 * src/LColor.h: add using directive.
7141 * src/Painter.[Ch]: change return type of methods from Painter& to
7142 PainterBase&. Add a using directive.
7144 * src/WorkArea.C: wrap xforms callbacks in C functions
7147 * lib/layouts/foils.layout: font fix and simplifications from Carl
7150 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7152 * a lot of files: The Painter, LColor and WorkArea from the old
7153 devel branch has been ported to lyx-devel. Some new files and a
7154 lot of #ifdeffed code. The new workarea is enabled by default, but
7155 if you want to test the new Painter and LColor you have to compile
7156 with USE_PAINTER defined (do this in config.h f.ex.) There are
7157 still some rought edges, and I'd like some help to clear those
7158 out. It looks stable (loads and displays the Userguide very well).
7161 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7163 * src/buffer.C (pop_tag): revert to the previous implementation
7164 (use a global variable for both loops).
7166 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7168 * src/lyxrc.C (LyXRC): change slightly default date format.
7170 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7171 there is an English text with a footnote that starts with a Hebrew
7172 paragraph, or vice versa.
7173 (TeXFootnote): ditto.
7175 * src/text.C (LeftMargin): allow for negative values for
7176 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7179 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7180 for input encoding (cyrillic)
7182 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7184 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7187 * src/toolbar.C (set): ditto
7188 * src/insets/insetbib.C (create_form_citation_form): ditto
7190 * lib/CREDITS: added Dekel Tsur.
7192 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7193 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7194 hebrew supports files from Dekel Tsur.
7196 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7197 <tzafrir@technion.ac.il>
7199 * src/lyxrc.C: put \date_insert_format at the right place.
7201 * src/buffer.C (makeLaTeXFile): fix the handling of
7202 BufferParams::sides when writing out latex files.
7204 * src/BufferView2.C: add a "using" directive.
7206 * src/support/lyxsum.C (sum): when we use lyxstring,
7207 ostringstream::str needs an additional .c_str().
7209 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7211 * src/support/filetools.C (ChangeExtension): patch from Etienne
7214 * src/TextCache.C (show): remove const_cast and make second
7215 parameter non-const LyXText *.
7217 * src/TextCache.h: use non const LyXText in show.
7219 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7222 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7224 * src/support/lyxsum.C: rework to be more flexible.
7226 * several places: don't check if a pointer is 0 if you are going
7229 * src/text.C: remove some dead code.
7231 * src/insets/figinset.C: remove some dead code
7233 * src/buffer.C: move the BufferView funcs to BufferView2.C
7234 remove all support for insetlatexdel
7235 remove support for oldpapersize stuff
7236 made some member funcs const
7238 * src/kbmap.C: use a std::list to store the bindings in.
7240 * src/BufferView2.C: new file
7242 * src/kbsequence.[Ch]: new files
7244 * src/LyXAction.C + others: remove all trace of buffer-previous
7246 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7247 only have one copy in the binary of this table.
7249 * hebrew patch: moved some functions from LyXText to more
7250 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7252 * several files: remove support for XForms older than 0.88
7254 remove some #if 0 #endif code
7256 * src/TextCache.[Ch]: new file. Holds the textcache.
7258 * src/BufferView.C: changes to use the new TextCache interface.
7259 (waitForX): remove the now unused code.
7261 * src/BackStack.h: remove some commented code
7263 * lib/bind/emacs.bind: remove binding for buffer-previous
7265 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7267 * applied the hebrew patch.
7269 * src/lyxrow.h: make sure that all Row variables are initialized.
7271 * src/text2.C (TextHandleUndo): comment out a delete, this might
7272 introduce a memory leak, but should also help us to not try to
7273 read freed memory. We need to look at this one.
7275 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7276 (LyXParagraph): initalize footnotekind.
7278 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7279 forgot this when applying the patch. Please heed the warnings.
7281 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7282 (aka. reformat problem)
7284 * src/bufferlist.C (exists): made const, and use const_iterator
7285 (isLoaded): new func.
7286 (release): use std::find to find the correct buffer.
7288 * src/bufferlist.h: made getState a const func.
7289 made empty a const func.
7290 made exists a const func.
7293 2000-02-01 Juergen Vigna <jug@sad.it>
7295 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7297 * po/it.po: updated a bit the italian po file and also changed the
7298 'file nuovo' for newfile to 'filenuovo' without a space, this did
7301 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7302 for the new insert_date command.
7304 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7305 from jdblair, to insert a date into the current text conforming to
7306 a strftime format (for now only considering the locale-set and not
7307 the document-language).
7309 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7311 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7312 Bounds Read error seen by purify. The problem was that islower is
7313 a macros which takes an unsigned char and uses it as an index for
7314 in array of characters properties (and is thus subject to the
7318 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7319 correctly the paper sides radio buttons.
7320 (UpdateDocumentButtons): ditto.
7322 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7324 * src/kbmap.C (getsym + others): change to return unsigned int,
7325 returning a long can give problems on 64 bit systems. (I assume
7326 that int is 32bit on 64bit systems)
7328 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7330 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7331 LyXLookupString to be zero-terminated. Really fixes problems seen
7334 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7336 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7337 write a (char*)0 to the lyxerr stream.
7339 * src/lastfiles.C: move algorithm before the using statemets.
7341 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7343 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7344 complains otherwise).
7345 * src/table.C: ditto
7347 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7350 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7351 that I removed earlier... It is really needed.
7353 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7355 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7357 * INSTALL: update xforms home page URL.
7359 * lib/configure.m4: fix a bug with unreadable layout files.
7361 * src/table.C (calculate_width_of_column): add "using std::max"
7364 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7366 * several files: marked several lines with "DEL LINE", this is
7367 lines that can be deleted without changing anything.
7368 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7369 checks this anyway */
7372 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7374 * src/DepTable.C (update): add a "+" at the end when the checksum
7375 is different. (debugging string only)
7377 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7378 the next inset to not be displayed. This should also fix the list
7379 of labels in the "Insert Crossreference" dialog.
7381 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7383 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7384 when regex was not found.
7386 * src/support/lstrings.C (lowercase): use handcoded transform always.
7389 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7390 old_cursor.par->prev could be 0.
7392 * several files: changed post inc/dec to pre inc/dec
7394 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7395 write the lastfiles to file.
7397 * src/BufferView.C (buffer): only show TextCache info when debugging
7399 (resizeCurrentBuffer): ditto
7400 (workAreaExpose): ditto
7402 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7404 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7406 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7407 a bit better by removing the special case for \i and \j.
7409 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7411 * src/lyx_main.C (easyParse): remove test for bad comand line
7412 options, since this broke all xforms-related parsing.
7414 * src/kbmap.C (getsym): set return type to unsigned long, as
7415 declared in header. On an alpha, long is _not_ the same as int.
7417 * src/support/LOstream.h: add a "using std::flush;"
7419 * src/insets/figinset.C: ditto.
7421 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7423 * src/bufferlist.C (write): use blinding fast file copy instead of
7424 "a char at a time", now we are doing it the C++ way.
7426 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7427 std::list<int> instead.
7428 (addpidwait): reflect move to std::list<int>
7429 (sigchldchecker): ditto
7431 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7434 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7435 that obviously was wrong...
7437 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7438 c, this avoids warnings with purify and islower.
7440 * src/insets/figinset.C: rename struct queue to struct
7441 queue_element and rewrite to use a std::queue. gsqueue is now a
7442 std::queue<queue_element>
7443 (runqueue): reflect move to std::queue
7446 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7447 we would get "1" "0" instead of "true" "false. Also make the tostr
7450 2000-01-21 Juergen Vigna <jug@sad.it>
7452 * src/buffer.C (writeFileAscii): Disabled code for special groff
7453 handling of tabulars till I fix this in table.C
7455 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7457 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7459 * src/support/lyxlib.h: ditto.
7461 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7463 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7464 and 'j' look better. This might fix the "macron" bug that has been
7467 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7468 functions as one template function. Delete the old versions.
7470 * src/support/lyxsum.C: move using std::ifstream inside
7473 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7476 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7478 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7480 * src/insets/figinset.C (InitFigures): use new instead of malloc
7481 to allocate memory for figures and bitmaps.
7482 (DoneFigures): use delete[] instead of free to deallocate memory
7483 for figures and bitmaps.
7484 (runqueue): use new to allocate
7485 (getfigdata): use new/delete[] instead of malloc/free
7486 (RegisterFigure): ditto
7488 * some files: moved some declarations closer to first use, small
7489 whitespace changes use preincrement instead of postincrement where
7490 it does not make a difference.
7492 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7493 step on the way to use stl::containers for key maps.
7495 * src/bufferlist.h: add a typedef for const_iterator and const
7496 versions of begin and end.
7498 * src/bufferlist.[Ch]: change name of member variable _state to
7499 state_. (avoid reserved names)
7501 (getFileNames): returns the filenames of the buffers in a vector.
7503 * configure.in (ALL_LINGUAS): added ro
7505 * src/support/putenv.C: new file
7507 * src/support/mkdir.C: new file
7509 2000-01-20 Allan Rae <rae@lyx.org>
7511 * lib/layouts/IEEEtran.layout: Added several theorem environments
7513 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7514 couple of minor additions.
7516 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7517 (except for those in footnotes of course)
7519 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7521 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7523 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7524 std::sort and std::lower_bound instead of qsort and handwritten
7526 (struct compara): struct that holds the functors used by std::sort
7527 and std::lower_bound in MathedLookupBOP.
7529 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7531 * src/support/LAssert.h: do not do partial specialization. We do
7534 * src/support/lyxlib.h: note that lyx::getUserName() and
7535 lyx::date() are not in use right now. Should these be suppressed?
7537 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7538 (makeLinuxDocFile): do not put date and user name in linuxdoc
7541 * src/support/lyxlib.h (kill): change first argument to long int,
7542 since that's what solaris uses.
7544 * src/support/kill.C (kill): fix declaration to match prototype.
7546 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7547 actually check whether namespaces are supported. This is not what
7550 * src/support/lyxsum.C: add a using directive.
7552 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7554 * src/support/kill.C: if we have namespace support we don't have
7555 to include lyxlib.h.
7557 * src/support/lyxlib.h: use namespace lyx if supported.
7559 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7561 * src/support/date.C: new file
7563 * src/support/chdir.C: new file
7565 * src/support/getUserName.C: new file
7567 * src/support/getcwd.C: new file
7569 * src/support/abort.C: new file
7571 * src/support/kill.C: new file
7573 * src/support/lyxlib.h: moved all the functions in this file
7574 insede struct lyx. Added also kill and abort to this struct. This
7575 is a way to avoid the "kill is not defined in <csignal>", we make
7576 C++ wrappers for functions that are not ANSI C or ANSI C++.
7578 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7579 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7580 lyx it has been renamed to sum.
7582 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7584 * src/text.C: add using directives for std::min and std::max.
7586 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7588 * src/texrow.C (getIdFromRow): actually return something useful in
7589 id and pos. Hopefully fixes the bug with positionning of errorbox
7592 * src/lyx_main.C (easyParse): output an error and exit if an
7593 incorrect command line option has been given.
7595 * src/spellchecker.C (ispell_check_word): document a memory leak.
7597 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7598 where a "struct utimbuf" is allocated with "new" and deleted with
7601 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7603 * src/text2.C (CutSelection): don't delete double spaces.
7604 (PasteSelection): ditto
7605 (CopySelection): ditto
7607 * src/text.C (Backspace): don't delete double spaces.
7609 * src/lyxlex.C (next): fix a bug that were only present with
7610 conformant std::istream::get to read comment lines, use
7611 std::istream::getline instead. This seems to fix the problem.
7613 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7615 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7616 allowed to insert space before space" editing problem. Please read
7617 commends at the beginning of the function. Comments about usage
7620 * src/text.C (InsertChar): fix for the "not allowed to insert
7621 space before space" editing problem.
7623 * src/text2.C (DeleteEmptyParagraphMechanism): when
7624 IsEmptyTableRow can only return false this last "else if" will
7625 always be a no-op. Commented out.
7627 * src/text.C (RedoParagraph): As far as I can understand tmp
7628 cursor is not really needed.
7630 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7631 present it could only return false anyway.
7632 (several functions): Did something not so smart...added a const
7633 specifier on a lot of methods.
7635 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7636 and add a tmp->text.resize. The LyXParagraph constructor does the
7638 (BreakParagraphConservative): ditto
7640 * src/support/path.h (Path): add a define so that the wrong usage
7641 "Path("/tmp") will be flagged as a compilation error:
7642 "`unnamed_Path' undeclared (first use this function)"
7644 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7646 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7647 which was bogus for several reasons.
7649 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7653 * autogen.sh: do not use "type -path" (what's that anyway?).
7655 * src/support/filetools.C (findtexfile): remove extraneous space
7656 which caused a kpsewhich warning (at least with kpathsea version
7659 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7661 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7663 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7665 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7667 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7669 * src/paragraph.C (BreakParagraph): do not reserve space on text
7670 if we don't need to (otherwise, if pos_end < pos, we end up
7671 reserving huge amounts of memory due to bad unsigned karma).
7672 (BreakParagraphConservative): ditto, although I have not seen
7673 evidence the bug can happen here.
7675 * src/lyxparagraph.h: add a using std::list.
7677 2000-01-11 Juergen Vigna <jug@sad.it>
7679 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7682 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7684 * src/vc-backend.C (doVCCommand): change to be static and take one
7685 more parameter: the path to chdir too be fore executing the command.
7686 (retrive): new function equiv to "co -r"
7688 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7689 file_not_found_hook is true.
7691 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7693 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7694 if a file is readwrite,readonly...anything else.
7696 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7698 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7699 (CreatePostscript): name change from MenuRunDVIPS (or something)
7700 (PreviewPostscript): name change from MenuPreviewPS
7701 (PreviewDVI): name change from MenuPreviewDVI
7703 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7704 \view_pdf_command., \pdf_to_ps_command
7706 * lib/configure.m4: added search for PDF viewer, and search for
7707 PDF to PS converter.
7708 (lyxrc.defaults output): add \pdflatex_command,
7709 \view_pdf_command and \pdf_to_ps_command.
7711 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7713 * src/bufferlist.C (write): we don't use blocksize for anything so
7716 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7718 * src/support/block.h: disable operator T* (), since it causes
7719 problems with both compilers I tried. See comments in the file.
7721 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7724 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7725 variable LYX_DIR_10x to LYX_DIR_11x.
7727 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7729 * INSTALL: document --with-lyxname.
7732 * configure.in: new configure flag --with-lyxname which allows to
7733 choose the name under which lyx is installed. Default is "lyx", of
7734 course. It used to be possible to do this with --program-suffix,
7735 but the later has in fact a different meaning for autoconf.
7737 * src/support/lstrings.h (lstrchr): reformat a bit.
7739 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7740 * src/mathed/math_defs.h: ditto.
7742 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7744 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7745 true, decides if we create a backup file or not when saving. New
7746 tag and variable \pdf_mode, defaults to false. New tag and
7747 variable \pdflatex_command, defaults to pdflatex. New tag and
7748 variable \view_pdf_command, defaults to xpdf. New tag and variable
7749 \pdf_to_ps_command, defaults to pdf2ps.
7751 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7753 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7754 does not have a BufferView.
7755 (unlockInset): ditto + don't access the_locking_inset if the
7756 buffer does not have a BufferView.
7758 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7759 certain circumstances so that we don't continue a keyboard
7760 operation long after the key was released. Try f.ex. to load a
7761 large document, press PageDown for some seconds and then release
7762 it. Before this change the document would contine to scroll for
7763 some time, with this change it stops imidiatly.
7765 * src/support/block.h: don't allocate more space than needed. As
7766 long as we don't try to write to the arr[x] in a array_type arr[x]
7767 it is perfectly ok. (if you write to it you might segfault).
7768 added operator value_type*() so that is possible to pass the array
7769 to functions expecting a C-pointer.
7771 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7774 * intl/*: updated to gettext 0.10.35, tried to add our own
7775 required modifications. Please verify.
7777 * po/*: updated to gettext 0.10.35, tried to add our own required
7778 modifications. Please verify.
7780 * src/support/lstrings.C (tostr): go at fixing the problem with
7781 cxx and stringstream. When stringstream is used return
7782 oss.str().c_str() so that problems with lyxstring and basic_string
7783 are avoided. Note that the best solution would be for cxx to use
7784 basic_string all the way, but it is not conformant yet. (it seems)
7786 * src/lyx_cb.C + other files: moved several global functions to
7787 class BufferView, some have been moved to BufferView.[Ch] others
7788 are still located in lyx_cb.C. Code changes because of this. (part
7789 of "get rid of current_view project".)
7791 * src/buffer.C + other files: moved several Buffer functions to
7792 class BufferView, the functions are still present in buffer.C.
7793 Code changes because of this.
7795 * config/lcmessage.m4: updated to most recent. used when creating
7798 * config/progtest.m4: updated to most recent. used when creating
7801 * config/gettext.m4: updated to most recent. applied patch for
7804 * config/gettext.m4.patch: new file that shows what changes we
7805 have done to the local copy of gettext.m4.
7807 * config/libtool.m4: new file, used in creation of acinclude.m4
7809 * config/lyxinclude.m4: new file, this is the lyx created m4
7810 macros, used in making acinclude.m4.
7812 * autogen.sh: GNU m4 discovered as a separate task not as part of
7813 the lib/configure creation.
7814 Generate acinlucde from files in config. Actually cat
7815 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7816 easier to upgrade .m4 files that really are external.
7818 * src/Spacing.h: moved using std::istringstream to right after
7819 <sstream>. This should fix the problem seen with some compilers.
7821 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7823 * src/lyx_cb.C: began some work to remove the dependency a lot of
7824 functions have on BufferView::text, even if not really needed.
7825 (GetCurrentTextClass): removed this func, it only hid the
7828 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7829 forgot this in last commit.
7831 * src/Bullet.C (bulletEntry): use static char const *[] for the
7832 tables, becuase of this the return arg had to change to string.
7834 (~Bullet): removed unneeded destructor
7836 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7837 (insetSleep): moved from Buffer
7838 (insetWakeup): moved from Buffer
7839 (insetUnlock): moved from Buffer
7841 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7842 from Buffer to BufferView.
7844 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7846 * config/ltmain.sh: updated to version 1.3.4 of libtool
7848 * config/ltconfig: updated to version 1.3.4 of libtool
7850 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7853 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7854 Did I get that right?
7856 * src/lyxlex.h: add a "using" directive or two.
7857 * src/Spacing.h: ditto.
7858 * src/insets/figinset.C: ditto.
7859 * src/support/filetools.C: ditto.
7860 * src/support/lstrings.C: ditto.
7861 * src/BufferView.C: ditto.
7862 * src/bufferlist.C: ditto.
7863 * src/lyx_cb.C: ditto.
7864 * src/lyxlex.C: ditto.
7866 * NEWS: add some changes for 1.1.4.
7868 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7870 * src/BufferView.C: first go at a TextCache to speed up switching
7873 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7875 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7876 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7877 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7878 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7881 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7882 members of the struct are correctly initialized to 0 (detected by
7884 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7885 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7887 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7888 pidwait, since it was allocated with "new". This was potentially
7889 very bad. Thanks to Michael Schmitt for running purify for us.
7892 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7894 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7896 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7898 1999-12-30 Allan Rae <rae@lyx.org>
7900 * lib/templates/IEEEtran.lyx: minor change
7902 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7903 src/mathed/formula.C (LocalDispatch): askForText changes
7905 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7906 know when a user has cancelled input. Fixes annoying problems with
7907 inserting labels and version control.
7909 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7911 * src/support/lstrings.C (tostr): rewritten to use strstream and
7914 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/support/filetools.C (IsFileWriteable): use fstream to check
7917 (IsDirWriteable): use fileinfo to check
7919 * src/support/filetools.h (FilePtr): whole class deleted
7921 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7923 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7925 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7927 * src/bufferlist.C (write): use ifstream and ofstream instead of
7930 * src/Spacing.h: use istrstream instead of sscanf
7932 * src/mathed/math_defs.h: change first arg to istream from FILE*
7934 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7936 * src/mathed/math_parser.C: have yyis to be an istream
7937 (LexGetArg): use istream (yyis)
7939 (mathed_parse): ditto
7940 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7942 * src/mathed/formula.C (Read): rewritten to use istream
7944 * src/mathed/formulamacro.C (Read): rewritten to use istream
7946 * src/lyxlex.h (~LyXLex): deleted desturctor
7947 (getStream): new function, returns an istream
7948 (getFile): deleted funtion
7949 (IsOK): return is.good();
7951 * src/lyxlex.C (LyXLex): delete file and owns_file
7952 (setFile): open an filebuf and assign that to a istream instead of
7954 (setStream): new function, takes an istream as arg.
7955 (setFile): deleted function
7956 (EatLine): rewritten us use istream instead of FILE*
7960 * src/table.C (LyXTable): use istream instead of FILE*
7961 (Read): rewritten to take an istream instead of FILE*
7963 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7965 * src/buffer.C (Dispatch): remove an extraneous break statement.
7967 * src/support/filetools.C (QuoteName): change to do simple
7968 'quoting'. More work is necessary. Also changed to do nothing
7969 under emx (needs fix too).
7970 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7972 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7973 config.h.in to the AC_DEFINE_UNQUOTED() call.
7974 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7975 needs char * as argument (because Solaris 7 declares it like
7978 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7979 remove definition of BZERO.
7981 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7983 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7984 defined, "lyxregex.h" if not.
7986 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7988 (REGEX): new variable that is set to regex.c lyxregex.h when
7989 AM_CONDITIONAL USE_REGEX is set.
7990 (libsupport_la_SOURCES): add $(REGEX)
7992 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7995 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7998 * configure.in: add call to LYX_REGEX
8000 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8001 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8003 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8005 * lib/bind/fi_menus.bind: new file, from
8006 pauli.virtanen@saunalahti.fi.
8008 * src/buffer.C (getBibkeyList): pass the parameter delim to
8009 InsetInclude::getKeys and InsetBibtex::getKeys.
8011 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8012 is passed to Buffer::getBibkeyList
8014 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8015 instead of the hardcoded comma.
8017 * src/insets/insetbib.C (getKeys): make sure that there are not
8018 leading blanks in bibtex keys. Normal latex does not care, but
8019 harvard.sty seems to dislike blanks at the beginning of citation
8020 keys. In particular, the retturn value of the function is
8022 * INSTALL: make it clear that libstdc++ is needed and that gcc
8023 2.7.x probably does not work.
8025 * src/support/filetools.C (findtexfile): make debug message go to
8027 * src/insets/insetbib.C (getKeys): ditto
8029 * src/debug.C (showTags): make sure that the output is correctly
8032 * configure.in: add a comment for TWO_COLOR_ICON define.
8034 * acconfig.h: remove all the entries that already defined in
8035 configure.in or acinclude.m4.
8037 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8038 to avoid user name, date and copyright.
8040 1999-12-21 Juergen Vigna <jug@sad.it>
8042 * src/table.C (Read): Now read bogus row format informations
8043 if the format is < 5 so that afterwards the table can
8044 be read by lyx but without any format-info. Fixed the
8045 crash we experienced when not doing this.
8047 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8049 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8050 (RedoDrawingOfParagraph): ditto
8051 (RedoParagraphs): ditto
8052 (RemoveTableRow): ditto
8054 * src/text.C (Fill): rename arg paperwidth -> paper_width
8056 * src/buffer.C (insertLyXFile): rename var filename -> fname
8057 (writeFile): rename arg filename -> fname
8058 (writeFileAscii): ditto
8059 (makeLaTeXFile): ditto
8060 (makeLinuxDocFile): ditto
8061 (makeDocBookFile): ditto
8063 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8066 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8068 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8071 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8072 compiled by a C compiler not C++.
8074 * src/layout.h (LyXTextClass): added typedef for const_iterator
8075 (LyXTextClassList): added typedef for const_iterator + member
8076 functions begin and end.
8078 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8079 iterators to fill the choice_class.
8080 (updateLayoutChoice): rewritten to use iterators to fill the
8081 layoutlist in the toolbar.
8083 * src/BufferView.h (BufferView::work_area_width): removed unused
8086 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8088 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8089 (sgmlCloseTag): ditto
8091 * src/support/lstrings.h: return type of countChar changed to
8094 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8095 what version of this func to use. Also made to return unsigned int.
8097 * configure.in: call LYX_STD_COUNT
8099 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8100 conforming std::count.
8102 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8104 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8105 and a subscript would give bad display (patch from Dekel Tsur
8106 <dekel@math.tau.ac.il>).
8108 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8110 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8113 * src/chset.h: add a few 'using' directives
8115 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8116 triggered when no buffer is active
8118 * src/layout.C: removed `break' after `return' in switch(), since
8121 * src/lyx_main.C (init): make sure LyX can be ran in place even
8122 when libtool has done its magic with shared libraries. Fix the
8123 test for the case when the system directory has not been found.
8125 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8126 name for the latex file.
8127 (MenuMakeHTML): ditto
8129 * src/buffer.h: add an optional boolean argument, which is passed
8132 1999-12-20 Allan Rae <rae@lyx.org>
8134 * lib/templates/IEEEtran.lyx: small correction and update.
8136 * configure.in: Attempted to use LYX_PATH_HEADER
8138 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8140 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8141 input from JMarc. Now use preprocessor to find the header.
8142 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8143 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8144 LYX_STL_STRING_FWD. See comments in file.
8146 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8148 * The global MiniBuffer * minibuffer variable is dead.
8150 * The global FD_form_main * fd_form_main variable is dead.
8152 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8154 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8156 * src/table.h: add the LOstream.h header
8157 * src/debug.h: ditto
8159 * src/LyXAction.h: change the explaination of the ReadOnly
8160 attribute: is indicates that the function _can_ be used.
8162 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8165 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8167 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8173 * src/paragraph.C (GetWord): assert on pos>=0
8176 * src/support/lyxstring.C: condition the use of an invariant on
8178 * src/support/lyxstring.h: ditto
8180 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8181 Use LAssert.h instead of plain assert().
8183 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8185 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8186 * src/support/filetools.C: ditto
8188 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8191 * INSTALL: document the new configure flags
8193 * configure.in: suppress --with-debug; add --enable-assertions
8195 * acinclude.m4: various changes in alignment of help strings.
8197 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8199 * src/kbmap.C: commented out the use of the hash map in kb_map,
8200 beginning of movement to a stl::container.
8202 * several files: removed code that was not in effect when
8203 MOVE_TEXT was defined.
8205 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8206 for escaping should not be used. We can discuss if the string
8207 should be enclosed in f.ex. [] instead of "".
8209 * src/trans_mgr.C (insert): use the new returned value from
8210 encodeString to get deadkeys and keymaps done correctly.
8212 * src/chset.C (encodeString): changed to return a pair, to tell
8213 what to use if we know the string.
8215 * src/lyxscreen.h (fillArc): new function.
8217 * src/FontInfo.C (resize): rewritten to use more std::string like
8218 structore, especially string::replace.
8220 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8223 * configure.in (chmod +x some scripts): remove config/gcc-hack
8225 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8227 * src/buffer.C (writeFile): change once again the top comment in a
8228 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8229 instead of an hardcoded version number.
8230 (makeDocBookFile): ditto
8232 * src/version.h: add new define LYX_DOCVERSION
8234 * po/de.po: update from Pit Sütterlin
8235 * lib/bind/de_menus.bind: ditto.
8237 * src/lyxfunc.C (Dispatch): call MenuExport()
8238 * src/buffer.C (Dispatch): ditto
8240 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8241 LyXFunc::Dispatch().
8242 (MenuExport): new function, moved from
8243 LyXFunc::Dispatch().
8245 * src/trans_mgr.C (insert): small cleanup
8246 * src/chset.C (loadFile): ditto
8248 * lib/kbd/iso8859-1.cdef: add missing backslashes
8250 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8252 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8253 help with placing the manually drawn accents better.
8255 (Draw): x2 and hg changed to float to minimize rounding errors and
8256 help place the accents better.
8258 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8259 unsigned short to char is just wrong...cast the char to unsigned
8260 char instead so that the two values can compare sanely. This
8261 should also make the display of insetlatexaccents better and
8262 perhaps also some other insets.
8264 (lbearing): new function
8267 1999-12-15 Allan Rae <rae@lyx.org>
8269 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8270 header that provides a wrapper around the very annoying SGI STL header
8273 * src/support/lyxstring.C, src/LString.h:
8274 removed old SGI-STL-compatability attempts.
8276 * configure.in: Use LYX_STL_STRING_FWD.
8278 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8279 stl_string_fwd.h is around and try to determine it's location.
8280 Major improvement over previous SGI STL 3.2 compatability.
8281 Three small problems remain with this function due to my zero
8282 knowledge of autoconf. JMarc and lgb see the comments in the code.
8284 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8286 * src/broken_const.h, config/hack-gcc, config/README: removed
8288 * configure.in: remove --with-gcc-hack option; do not call
8291 * INSTALL: remove documentation of --with-broken-const and
8294 * acconfig.h: remove all trace of BROKEN_CONST define
8296 * src/buffer.C (makeDocBookFile): update version number in output
8298 (SimpleDocBookOnePar): fix an assert when trying to a character
8299 access beyond string length
8302 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8304 * po/de.po: fix the Export menu
8306 * lyx.man: update the description of -dbg
8308 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8309 (commandLineHelp): updated
8310 (easyParse): show list of available debug levels if -dbg is passed
8313 * src/Makefile.am: add debug.C
8315 * src/debug.h: moved some code to debug.C
8317 * src/debug.C: new file. Contains code to set and show debug
8320 * src/layout.C: remove 'break' after 'continue' in switch
8321 statements, since these cannot be reached.
8323 1999-12-13 Allan Rae <rae@lyx.org>
8325 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8326 (in_word_set): hash() -> math_hash()
8328 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8330 * acconfig.h: Added a test for whether we are using exceptions in the
8331 current compilation run. If so USING_EXCEPTIONS is defined.
8333 * config.in: Check for existance of stl_string_fwd.h
8334 * src/LString.h: If compiling --with-included-string and SGI's
8335 STL version 3.2 is present (see above test) we need to block their
8336 forward declaration of string and supply a __get_c_string().
8337 However, it turns out this is only necessary if compiling with
8338 exceptions enabled so I've a bit more to add yet.
8340 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8341 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8342 src/support/LRegex.h, src/undo.h:
8343 Shuffle the order of the included files a little to ensure that
8344 LString.h gets included before anything that includes stl_string_fwd.h
8346 * src/support/lyxstring.C: We need to #include LString.h instead of
8347 lyxstring.h to get the necessary definition of __get_c_string.
8348 (__get_c_string): New function. This is defined static just like SGI's
8349 although why they need to do this I'm not sure. Perhaps it should be
8350 in lstrings.C instead.
8352 * lib/templates/IEEEtran.lyx: New template file.
8354 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8356 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8357 * intl/Makefile.in (MKINSTALLDIRS): ditto
8359 * src/LyXAction.C (init): changed to hold the LFUN data in a
8360 automatic array in stead of in callso to newFunc, this speeds up
8361 compilation a lot. Also all the memory used by the array is
8362 returned when the init is completed.
8364 * a lot of files: compiled with -Wold-style-cast, changed most of
8365 the reported offenders to C++ style casts. Did not change the
8366 offenders in C files.
8368 * src/trans.h (Match): change argument type to unsigned int.
8370 * src/support/DebugStream.C: fix some types on the streambufs so
8371 that it works on a conforming implementation.
8373 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8375 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8377 * src/support/lyxstring.C: remove the inline added earlier since
8378 they cause a bunch of unsatisfied symbols when linking with dec
8379 cxx. Cxx likes to have the body of inlines at the place where they
8382 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8383 accessing negative bounds in array. This fixes the crash when
8384 inserting accented characters.
8385 * src/trans.h (Match): ditto
8387 * src/buffer.C (Dispatch): since this is a void, it should not try
8388 to return anything...
8390 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8392 * src/buffer.h: removed the two friends from Buffer. Some changes
8393 because of this. Buffer::getFileName and Buffer::setFileName
8394 renamed to Buffer::fileName() and Buffer::fileName(...).
8396 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8398 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8399 and Buffer::update(short) to BufferView. This move is currently
8400 controlled by a define MOVE_TEXT, this will be removed when all
8401 shows to be ok. This move paves the way for better separation
8402 between buffer contents and buffer view. One side effect is that
8403 the BufferView needs a rebreak when swiching buffers, if we want
8404 to avoid this we can add a cache that holds pointers to LyXText's
8405 that is not currently in use.
8407 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8410 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8412 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8414 * lyx_main.C: new command line option -x (or --execute) and
8415 -e (or --export). Now direct conversion from .lyx to .tex
8416 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8417 Unfortunately, X is still needed and the GUI pops up during the
8420 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8422 * src/Spacing.C: add a using directive to bring stream stuff into
8424 * src/paragraph.C: ditto
8425 * src/buffer.C: ditto
8427 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8428 from Lars' announcement).
8430 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8431 example files from Tino Meinen.
8433 1999-12-06 Allan Rae <rae@lyx.org>
8435 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8437 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8439 * src/support/lyxstring.C: added a lot of inline for no good
8442 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8443 latexWriteEndChanges, they were not used.
8445 * src/layout.h (operator<<): output operator for PageSides
8447 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8449 * some example files: loaded in LyX 1.0.4 and saved again to update
8450 certain constructs (table format)
8452 * a lot of files: did the change to use fstream/iostream for all
8453 writing of files. Done with a close look at Andre Poenitz's patch.
8455 * some files: whitespace changes.
8457 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8459 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8460 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8461 architecture, we provide our own. It is used unconditionnally, but
8462 I do not think this is a performance problem. Thanks to Angus
8463 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8464 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8466 (GetInset): use my_memcpy.
8470 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8471 it is easier to understand, but it uses less TeX-only constructs now.
8473 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8474 elements contain spaces
8476 * lib/configure: regenerated
8478 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8479 elements contain spaces; display the list of programs that are
8482 * autogen.sh: make sure lib/configure is executable
8484 * lib/examples/*: rename the tutorial examples to begin with the
8485 two-letters language code.
8487 * src/lyxfunc.C (getStatus): do not query current font if no
8490 * src/lyx_cb.C (RunScript): use QuoteName
8491 (MenuRunDvips): ditto
8492 (PrintApplyCB): ditto
8494 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8495 around argument, so that it works well with the current shell.
8496 Does not work properly with OS/2 shells currently.
8498 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8499 * src/LyXSendto.C (SendtoApplyCB): ditto
8500 * src/lyxfunc.C (Dispatch): ditto
8501 * src/buffer.C (runLaTeX): ditto
8502 (runLiterate): ditto
8503 (buildProgram): ditto
8505 * src/lyx_cb.C (RunScript): ditto
8506 (MenuMakeLaTeX): ditto
8508 * src/buffer.h (getLatexName): new method
8510 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8512 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8514 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8515 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8516 (create_math_panel): ditto
8518 * src/lyxfunc.C (getStatus): re-activate the code which gets
8519 current font and cursor; add test for export to html.
8521 * src/lyxrc.C (read): remove unreachable break statements; add a
8524 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8526 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8528 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8529 introduced by faulty regex.
8530 * src/buffer.C: ditto
8531 * src/lastfiles.C: ditto
8532 * src/paragraph.C: ditto
8533 * src/table.C: ditto
8534 * src/vspace.C: ditto
8535 * src/insets/figinset.C: ditto
8536 Note: most of these is absolutely harmless, except the one in
8537 src/mathed formula.C.
8539 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8541 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8542 operation, yielding correct results for the reLyX command.
8544 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8546 * src/support/filetools.C (ExpandPath): removed an over eager
8548 (ReplaceEnvironmentPath): ditto
8550 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8551 shows that we are doing something fishy in our code...
8555 * src/lyxrc.C (read): use a double switch trick to get more help
8556 from the compiler. (the same trick is used in layout.C)
8557 (write): new function. opens a ofstream and pass that to output
8558 (output): new function, takes a ostream and writes the lyxrc
8559 elemts to it. uses a dummy switch to make sure no elements are
8562 * src/lyxlex.h: added a struct pushpophelper for use in functions
8563 with more than one exit point.
8565 * src/lyxlex.[Ch] (GetInteger): made it const
8569 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8571 * src/layout.[hC] : LayoutTags splitted into several enums, new
8572 methods created, better error handling cleaner use of lyxlex. Read
8575 * src/bmtable.[Ch]: change some member prototypes because of the
8576 image const changes.
8578 * commandtags.h, src/LyXAction.C (init): new function:
8579 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8580 This file is not read automatically but you can add \input
8581 preferences to your lyxrc if you want to. We need to discuss how
8584 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8585 in .aux, also remove .bib and .bst files from dependencies when
8588 * src/BufferView.C, src/LyXView.C: add const_cast several places
8589 because of changes to images.
8591 * lib/images/*: same change as for images/*
8593 * lib/lyxrc.example: Default for accept_compound is false not no.
8595 * images/*: changed to be const, however I have som misgivings
8596 about this change so it might be changed back.
8598 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8600 * lib/configure, po/POTFILES.in: regenerated
8602 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8604 * config/lib_configure.m4: removed
8606 * lib/configure.m4: new file (was config/lib_configure.m4)
8608 * configure.in: do not test for rtti, since we do not use it.
8610 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8612 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8613 doubling of allocated space scheme. This makes it faster for large
8614 strings end to use less memory for small strings. xtra rememoved.
8616 * src/insets/figinset.C (waitalarm): commented out.
8617 (GhostscriptMsg): use static_cast
8618 (GhostscriptMsg): use new instead of malloc to allocate memory for
8619 cmap. also delete the memory after use.
8621 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8623 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8624 for changes in bibtex database or style.
8625 (runBibTeX): remove all .bib and .bst files from dep before we
8627 (run): use scanAuc in when dep file already exist.
8629 * src/DepTable.C (remove_files_with_extension): new method
8632 * src/DepTable.[Ch]: made many of the methods const.
8634 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8636 * src/bufferparams.C: make sure that the default textclass is
8637 "article". It used to be the first one by description order, but
8638 now the first one is "docbook".
8640 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8641 string; call Debug::value.
8642 (easyParse): pass complete argument to setDebuggingLevel().
8644 * src/debug.h (value): fix the code that parses debug levels.
8646 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8649 * src/LyXAction.C: use Debug::ACTION as debug channel.
8651 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8653 * NEWS: updated for the future 1.1.3 release.
8655 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8656 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8657 it should. This is of course a controversial change (since many
8658 people will find that their lyx workscreen is suddenly full of
8659 red), but done for the sake of correctness.
8661 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8662 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8664 * src/insets/inseterror.h, src/insets/inseturl.h,
8665 src/insets/insetinfo.h, src/insets/figinset.h,
8666 src/mathed/formulamacro.h, src/mathed/math_macro.h
8667 (EditMessage): add a missing const and add _() to make sure that
8670 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8671 src/insets/insetbib.C, src/support/filetools.C: add `using'
8674 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8675 doing 'Insert index of last word' at the beginning of a paragraph.
8677 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8679 * several files: white-space changes.
8681 * src/mathed/formula.C: removed IsAlpha and IsDigit
8683 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8684 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8687 * src/insets/figinset.C (GetPSSizes): don't break when
8688 "EndComments" is seen. But break when a boundingbox is read.
8690 * all classes inherited from Inset: return value of Clone
8691 changed back to Inset *.
8693 * all classes inherited form MathInset: return value of Clone
8694 changed back to MathedInset *.
8696 * src/insets/figinset.C (runqueue): use a ofstream to output the
8697 gs/ps file. Might need some setpresicion or setw. However I can
8698 see no problem with the current code.
8699 (runqueue): use sleep instead of the alarm/signal code. I just
8700 can't see the difference.
8702 * src/paragraph.C (LyXParagraph): reserve space in the new
8703 paragraph and resize the inserted paragraph to just fit.
8705 * src/lyxfunc.h (operator|=): added operator for func_status.
8707 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8708 check for readable file.
8710 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8711 check for readable file.
8712 (MenuMakeLinuxDoc): ditto
8713 (MenuMakeDocBook): ditto
8714 (MenuMakeAscii): ditto
8715 (InsertAsciiFile): split the test for openable and readable
8717 * src/bmtable.C (draw_bitmaptable): use
8718 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8720 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8721 findtexfile from LaTeX to filetools.
8723 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8724 instead of FilePtr. Needs to be verified by a literate user.
8726 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8728 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8729 (EditMessage): likewise.
8731 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8732 respectively as \textasciitilde and \textasciicircum.
8734 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8736 * src/support/lyxstring.h: made the methods that take iterators
8739 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8740 (regexMatch): made is use the real regex class.
8742 * src/support/Makefile.am: changed to use libtool
8744 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8746 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8748 (MathIsInset ++): changed several macros to be inline functions
8751 * src/mathed/Makefile.am: changed to use libtool
8753 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8755 * src/insets/inset* : Clone changed to const and return type is
8756 the true insettype not just Inset*.
8758 * src/insets/Makefile.am: changed to use libtool
8760 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8762 * src/undo.[Ch] : added empty() and changed some of the method
8765 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8767 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8768 setID use block<> for the bullets array, added const several places.
8770 * src/lyxfunc.C (getStatus): new function
8772 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8773 LyXAction, added const to several funtions.
8775 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8776 a std::map, and to store the dir items in a vector.
8778 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8781 * src/LyXView.[Ch] + other files : changed currentView to view.
8783 * src/LyXAction.[Ch] : ported from the old devel branch.
8785 * src/.cvsignore: added .libs and a.out
8787 * configure.in : changes to use libtool.
8789 * acinclude.m4 : inserted libtool.m4
8791 * .cvsignore: added libtool
8793 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8795 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8796 file name in insets and mathed directories (otherwise the
8797 dependency is not taken in account under cygwin).
8799 * src/text2.C (InsertString[AB]): make sure that we do not try to
8800 read characters past the string length.
8802 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8804 * lib/doc/LaTeXConfig.lyx.in,
8805 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8807 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8808 file saying who created them and when this heppened; this is
8809 useless and annoys tools like cvs.
8811 * lib/layouts/g-brief-{en,de}.layout,
8812 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8813 from Thomas Hartkens <thomas@hartkens.de>.
8815 * src/{insets,mathed}/Makefile.am: do not declare an empty
8816 LDFLAGS, so that it can be set at configure time (useful on Irix
8819 * lib/reLyX/configure.in: make sure that the prefix is set
8820 correctly in LYX_DIR.
8822 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8824 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8825 be used by 'command-sequence' this allows to bind a key to a
8826 sequence of LyX-commands
8827 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8829 * src/LyXAction.C: add "command-sequence"
8831 * src/LyXFunction.C: handling of "command-sequence"
8833 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8834 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8836 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8838 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8840 * src/buffer.C (writeFile): Do not output a comment giving user
8841 and date at the beginning of a .lyx file. This is useless and
8842 annoys cvs anyway; update version number to 1.1.
8844 * src/Makefile.am (LYX_DIR): add this definition, so that a
8845 default path is hardcoded in LyX.
8847 * configure.in: Use LYX_GNU_GETTEXT.
8849 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8850 AM_GNU_GETTEXT with a bug fixed.
8852 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8854 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8856 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8857 which is used to point to LyX data is now LYX_DIR_11x.
8859 * lyx.man: convert to a unix text file; small updates.
8861 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8863 * src/support/LSubstring.[Ch]: made the second arg of most of the
8864 constructors be a const reference.
8866 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8869 * src/support/lyxstring.[Ch] (swap): added missing member function
8870 and specialization of swap(str, str);
8872 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8874 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8875 trace of the old one.
8877 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8878 put the member definitions in undo.C.
8880 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8881 NEW_TEXT and have now only code that was included when this was
8884 * src/intl.C (LCombo): use static_cast
8886 (DispatchCallback): ditto
8888 * src/definitions.h: removed whole file
8890 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8892 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8893 parsing and stores in a std:map. a regex defines the file format.
8894 removed unneeded members.
8896 * src/bufferparams.h: added several enums from definitions.h here.
8897 Removed unsused destructor. Changed some types to use proper enum
8898 types. use block to have the temp_bullets and user_defined_bullets
8899 and to make the whole class assignable.
8901 * src/bufferparams.C (Copy): removed this functions, use a default
8904 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8907 * src/buffer.C (readLyXformat2): commend out all that have with
8908 oldpapersize to do. also comment out all that hve to do with
8909 insetlatex and insetlatexdel.
8910 (setOldPaperStuff): commented out
8912 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8914 * src/LyXAction.C: remove use of inset-latex-insert
8916 * src/mathed/math_panel.C (button_cb): use static_cast
8918 * src/insets/Makefile.am (insets_o_SOURCES): removed
8921 * src/support/lyxstring.C (helper): use the unsigned long
8922 specifier, UL, instead of a static_cast.
8924 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8926 * src/support/block.h: new file. to be used as a c-style array in
8927 classes, so that the class can be assignable.
8929 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8931 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8932 NULL, make sure to return an empty string (it is not possible to
8933 set a string to NULL).
8935 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8937 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8939 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8941 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8942 link line, so that Irix users (for example) can set it explicitely to
8945 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8946 it can be overidden at make time (static or dynamic link, for
8949 * src/vc-backend.C, src/LaTeXFeatures.h,
8950 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8951 statements to bring templates to global namespace.
8953 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8955 * src/support/lyxstring.C (operator[] const): make it standard
8958 * src/minibuffer.C (Init): changed to reflect that more
8959 information is given from the lyxvc and need not be provided here.
8961 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8963 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8965 * src/LyXView.C (UpdateTimerCB): use static_cast
8966 (KeyPressMask_raw_callback): ditto
8968 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8969 buffer_, a lot of changes because of this. currentBuffer() ->
8970 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8971 also changes to other files because of this.
8973 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8975 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8976 have no support for RCS and partial support for CVS, will be
8979 * src/insets/ several files: changes because of function name
8980 changes in Bufferview and LyXView.
8982 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8984 * src/support/LSubstring.[Ch]: new files. These implement a
8985 Substring that can be very convenient to use. i.e. is this
8987 string a = "Mary had a little sheep";
8988 Substring(a, "sheep") = "lamb";
8989 a is now "Mary has a little lamb".
8991 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8992 out patterns and subpatterns of strings. It is used by LSubstring
8993 and also by vc-backend.C
8995 * src/support/lyxstring.C: went over all the assertions used and
8996 tried to correct the wrong ones and flag which of them is required
8997 by the standard. some bugs found because of this. Also removed a
8998 couple of assertions.
9000 * src/support/Makefile.am (libsupport_a_SOURCES): added
9001 LSubstring.[Ch] and LRegex.[Ch]
9003 * src/support/FileInfo.h: have struct stat buf as an object and
9004 not a pointer to one, some changes because of this.
9006 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9007 information in layout when adding the layouts preamble to the
9010 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9013 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9014 because of bug in OS/2.
9016 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9018 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9019 \verbatim@font instead of \ttfamily, so that it can be redefined.
9021 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9022 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9023 src/layout.h, src/text2.C: add 'using' directive to bring the
9024 STL templates we need from the std:: namespace to the global one.
9025 Needed by DEC cxx in strict ansi mode.
9027 * src/support/LIstream.h,src/support/LOstream.h,
9028 src/support/lyxstring.h,src/table.h,
9029 src/lyxlookup.h: do not include <config.h> in header
9030 files. This should be done in the .C files only.
9032 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9036 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9038 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9039 from Kayvan to fix the tth invokation.
9041 * development/lyx.spec.in: updates from Kayvan to reflect the
9042 changes of file names.
9044 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9046 * src/text2.C (InsertStringB): use std::copy
9047 (InsertStringA): use std::copy
9049 * src/bufferlist.C: use a vector to store the buffers in. This is
9050 an internal change and should not affect any other thing.
9052 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9055 * src/text.C (Fill): fix potential bug, one off bug.
9057 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9059 * src/Makefile.am (lyx_main.o): add more files it depends on.
9061 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9063 * src/support/lyxstring.C: use size_t for the reference count,
9064 size, reserved memory and xtra.
9065 (internal_compare): new private member function. Now the compare
9066 functions should work for std::strings that have embedded '\0'
9068 (compare): all compare functions rewritten to use
9071 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9073 * src/support/lyxstring.C (compare): pass c_str()
9074 (compare): pass c_str
9075 (compare): pass c_str
9077 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9079 * src/support/DebugStream.C: <config.h> was not included correctly.
9081 * lib/configure: forgot to re-generate it :( I'll make this file
9082 auto generated soon.
9084 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9086 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9089 * src/support/lyxstring.C: some changes from length() to rep->sz.
9090 avoids a function call.
9092 * src/support/filetools.C (SpaceLess): yet another version of the
9093 algorithm...now per Jean-Marc's suggestions.
9095 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9097 * src/layout.C (less_textclass_desc): functor for use in sorting
9099 (LyXTextClass::Read): sort the textclasses after reading.
9101 * src/support/filetools.C (SpaceLess): new version of the
9102 SpaceLess functions. What problems does this one give? Please
9105 * images/banner_bw.xbm: made the arrays unsigned char *
9107 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9109 * src/support/lyxstring.C (find): remove bogus assertion in the
9110 two versions of find where this has not been done yet.
9112 * src/support/lyxlib.h: add missing int return type to
9115 * src/menus.C (ShowFileMenu): disable exporting to html if no
9116 html export command is present.
9118 * config/lib_configure.m4: add a test for an HTML converter. The
9119 programs checked for are, in this order: tth, latex2html and
9122 * lib/configure: generated from config/lib_configure.m4.
9124 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9125 html converter. The parameters are now passed through $$FName and
9126 $$OutName, instead of standard input/output.
9128 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9130 * lib/lyxrc.example: update description of \html_command.
9131 add "quotes" around \screen_font_xxx font setting examples to help
9132 people who use fonts with spaces in their names.
9134 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9136 * Distribution files: updates for v1.1.2
9138 * src/support/lyxstring.C (find): remove bogus assert and return
9139 npos for the same condition.
9141 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9143 * added patch for OS/2 from SMiyata.
9145 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9147 * src/text2.C (CutSelection): make space_wrapped a bool
9148 (CutSelection): dont declare int i until we have to.
9149 (alphaCounter): return a char const *.
9151 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9153 * src/support/syscall.C (Systemcalls::kill):
9154 src/support/filetools.C (PutEnv, PutEnvPath):
9155 src/lyx_cb.C (addNewlineAndDepth):
9156 src/FontInfo.C (FontInfo::resize): condition some #warning
9157 directives with WITH_WARNINGS.
9160 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9162 * src/layout.[Ch] + several files: access to class variables
9163 limited and made accessor functions instead a lot of code changed
9164 becuase of this. Also instead of returning pointers often a const
9165 reference is returned instead.
9167 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9169 * src/Makefile.am (dist-hook): added used to remove the CVS from
9170 cheaders upon creating a dist
9171 (EXTRA_DIST): added cheaders
9173 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9174 a character not as a small integer.
9176 * src/support/lyxstring.C (find): removed Assert and added i >=
9177 rep->sz to the first if.
9179 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9181 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9182 src/LyXView.C src/buffer.C src/bufferparams.C
9183 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9184 src/text2.C src/insets/insetinclude.C:
9185 lyxlayout renamed to textclasslist.
9187 * src/layout.C: some lyxerr changes.
9189 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9190 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9191 (LyXLayoutList): removed all traces of this class.
9192 (LyXTextClass::Read): rewrote LT_STYLE
9193 (LyXTextClass::hasLayout): new function
9194 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9195 both const and nonconst version.
9196 (LyXTextClass::delete_layout): new function.
9197 (LyXTextClassList::Style): bug fix. do the right thing if layout
9199 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9200 (LyXTextClassList::NameOfLayout): ditto
9201 (LyXTextClassList::Load): ditto
9203 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9205 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9207 * src/LyXAction.C (LookupFunc): added a workaround for sun
9208 compiler, on the other hand...we don't know if the current code
9209 compiles on sun at all...
9211 * src/support/filetools.C (CleanupPath): subst fix
9213 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9216 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9217 complained about this one?
9219 * src/insets/insetinclude.C (Latex): subst fix
9221 * src/insets/insetbib.C (getKeys): subst fix
9223 * src/LyXSendto.C (SendtoApplyCB): subst fix
9225 * src/lyx_main.C (init): subst fix
9227 * src/layout.C (Read): subst fix
9229 * src/lyx_sendfax_main.C (button_send): subst fix
9231 * src/buffer.C (RoffAsciiTable): subst fix
9233 * src/lyx_cb.C (MenuFax): subst fix
9234 (PrintApplyCB): subst fix
9236 1999-10-26 Juergen Vigna <jug@sad.it>
9238 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9240 (Read): Cleaned up this code so now we read only format vestion >= 5
9242 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9244 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9245 come nobody has complained about this one?
9247 * src/insets/insetinclude.C (Latex): subst fix
9249 * src/insets/insetbib.C (getKeys): subst fix
9251 * src/lyx_main.C (init): subst fix
9253 * src/layout.C (Read): subst fix
9255 * src/buffer.C (RoffAsciiTable): subst fix
9257 * src/lyx_cb.C (MenuFax): subst fix.
9259 * src/layout.[hC] + some other files: rewrote to use
9260 std::container to store textclasses and layouts in.
9261 Simplified, removed a lot of code. Make all classes
9262 assignable. Further simplifications and review of type
9263 use still to be one.
9265 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9266 lastfiles to create the lastfiles partr of the menu.
9268 * src/lastfiles.[Ch]: rewritten to use deque to store the
9269 lastfiles in. Uses fstream for reading and writing. Simplifies
9272 * src/support/syscall.C: remove explicit cast.
9274 * src/BufferView.C (CursorToggleCB): removed code snippets that
9276 use explicat C++ style casts instead of C style casts. also use
9277 u_vdata instea of passing pointers in longs.
9279 * src/PaperLayout.C: removed code snippets that were commented out.
9281 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9283 * src/lyx_main.C: removed code snippets that wer commented out.
9285 * src/paragraph.C: removed code snippets that were commented out.
9287 * src/lyxvc.C (logClose): use static_cast
9289 (viewLog): remove explicit cast to void*
9290 (showLog): removed old commented code
9292 * src/menus.C: use static_cast instead of C style casts. use
9293 u_vdata instead of u_ldata. remove explicit cast to (long) for
9294 pointers. Removed old code that was commented out.
9296 * src/insets/inset.C: removed old commented func
9298 * src/insets/insetref.C (InsetRef): removed old code that had been
9299 commented out for a long time.
9301 (escape): removed C style cast
9303 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9305 * src/insets/insetlatex.C (Draw): removed old commented code
9306 (Read): rewritten to use string
9308 * src/insets/insetlabel.C (escape): removed C style cast
9310 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9312 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9315 * src/insets/insetinclude.h: removed a couple of stupid bools
9317 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9318 (Clone): remove C style cast
9319 (getKeys): changed list to lst because of std::list
9321 * src/insets/inseterror.C (Draw): removed som old commented code.
9323 * src/insets/insetcommand.C (Draw): removed some old commented code.
9325 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9326 commented out forever.
9327 (bibitem_cb): use static_cast instead of C style cast
9328 use of vdata changed to u_vdata.
9330 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9332 (CloseUrlCB): use static_cast instead of C style cast.
9333 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9335 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9336 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9337 (CloseInfoCB): static_cast from ob->u_vdata instead.
9338 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9341 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9342 (C_InsetError_CloseErrorCB): forward the ob parameter
9343 (CloseErrorCB): static_cast from ob->u_vdata instead.
9345 * src/vspace.h: include LString.h since we use string in this class.
9347 * src/vspace.C (lyx_advance): changed name from advance because of
9348 nameclash with stl. And since we cannot use namespaces yet...I
9349 used a lyx_ prefix instead. Expect this to change when we begin
9352 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9354 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9355 and removed now defunct constructor and deconstructor.
9357 * src/BufferView.h: have backstack as a object not as a pointer.
9358 removed initialization from constructor. added include for BackStack
9360 * development/lyx.spec.in (%build): add CFLAGS also.
9362 * src/screen.C (drawFrame): removed another warning.
9364 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9366 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9367 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9368 README and ANNOUNCE a bit for the next release. More work is
9371 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9372 unbreakable if we are in freespacing mode (LyX-Code), but not in
9375 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9377 * src/BackStack.h: fixed initialization order in constructor
9379 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9381 * acinclude.m4 (VERSION): new rules for when a version is
9382 development, added also a variable for prerelease.
9383 (warnings): we set with_warnings=yes for prereleases
9384 (lyx_opt): prereleases compile with same optimization as development
9385 (CXXFLAGS): only use pedantic if we are a development version
9387 * src/BufferView.C (restorePosition): don't do anything if the
9390 * src/BackStack.h: added member empty, use this to test if there
9391 is anything to pop...
9393 1999-10-25 Juergen Vigna <jug@sad.it>
9396 * forms/layout_forms.fd +
9397 * forms/latexoptions.fd +
9398 * lyx.fd: changed for various form resize issues
9400 * src/mathed/math_panel.C +
9401 * src/insets/inseterror.C +
9402 * src/insets/insetinfo.C +
9403 * src/insets/inseturl.C +
9404 * src/insets/inseturl.h +
9407 * src/PaperLayout.C +
9408 * src/ParagraphExtra.C +
9409 * src/TableLayout.C +
9411 * src/layout_forms.C +
9418 * src/menus.C: fixed various resize issues. So now forms can be
9419 resized savely or not be resized at all.
9421 * forms/form_url.fd +
9422 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9425 * src/insets/Makefile.am: added files form_url.[Ch]
9427 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9429 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9430 (and presumably 6.2).
9432 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9433 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9434 remaining static member callbacks.
9436 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9439 * src/support/lyxstring.h: declare struct Srep as friend of
9440 lyxstring, since DEC cxx complains otherwise.
9442 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9444 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9446 * src/LaTeX.C (run): made run_bibtex also depend on files with
9448 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9449 are put into the dependency file.
9451 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9452 the code has shown itself to work
9453 (create_ispell_pipe): removed another warning, added a comment
9456 * src/minibuffer.C (ExecutingCB): removed code that has been
9457 commented out a long time
9459 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9460 out code + a warning.
9462 * src/support/lyxstring.h: comment out the three private
9463 operators, when compiling with string ansi conforming compilers
9466 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9468 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9469 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9472 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9475 * src/mathed/math_panel.C (create_math_panel): remove explicit
9478 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9481 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9482 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9483 to XCreatePixmapFromBitmapData
9484 (fl_set_bmtable_data): change the last argument to be unsigned
9486 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9487 and bh to be unsigned int, remove explicit casts in call to
9488 XReadBitmapFileData.
9490 * images/arrows.xbm: made the arrays unsigned char *
9491 * images/varsz.xbm: ditto
9492 * images/misc.xbm: ditto
9493 * images/greek.xbm: ditto
9494 * images/dots.xbm: ditto
9495 * images/brel.xbm: ditto
9496 * images/bop.xbm: ditto
9498 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9500 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9501 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9502 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9504 (LYX_CXX_CHEADERS): added <clocale> to the test.
9506 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9508 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9510 * src/support/lyxstring.C (append): fixed something that must be a
9511 bug, rep->assign was used instead of rep->append.
9513 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9516 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9517 lyx insert double chars. Fix spotted by Kayvan.
9519 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9521 * Fixed the tth support. I messed up with the Emacs patch apply feature
9522 and omitted the changes in lyxrc.C.
9524 1999-10-22 Juergen Vigna <jug@sad.it>
9526 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9528 * src/lyx_cb.C (MenuInsertRef) +
9529 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9530 the form cannot be resized under it limits (fixes a segfault)
9532 * src/lyx.C (create_form_form_ref) +
9533 * forms/lyx.fd: Changed Gravity on name input field so that it is
9536 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9538 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9539 <ostream> and <istream>.
9541 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9542 whether <fstream> provides the latest standard features, or if we
9543 have an oldstyle library (like in egcs).
9544 (LYX_CXX_STL_STRING): fix the test.
9546 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9547 code on MODERN_STL_STREAM.
9549 * src/support/lyxstring.h: use L{I,O}stream.h.
9551 * src/support/L{I,O}stream.h: new files, designed to setup
9552 correctly streams for our use
9553 - includes the right header depending on STL capabilities
9554 - puts std::ostream and std::endl (for LOStream.h) or
9555 std::istream (LIStream.h) in toplevel namespace.
9557 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9559 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9560 was a bib file that had been changed we ensure that bibtex is run.
9561 (runBibTeX): enhanced to extract the names of the bib files and
9562 getting their absolute path and enter them into the dep file.
9563 (findtexfile): static func that is used to look for tex-files,
9564 checks for absolute patchs and tries also with kpsewhich.
9565 Alternative ways of finding the correct files are wanted. Will
9567 (do_popen): function that runs a command using popen and returns
9568 the whole output of that command in a string. Should be moved to
9571 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9572 file with extension ext has changed.
9574 * src/insets/figinset.C: added ifdef guards around the fl_free
9575 code that jug commented out. Now it is commented out when
9576 compiling with XForms == 0.89.
9578 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9579 to lyxstring.C, and only keep a forward declaration in
9580 lyxstring.h. Simplifies the header file a bit and should help a
9581 bit on compile time too. Also changes to Srep will not mandate a
9582 recompile of code just using string.
9583 (~lyxstring): definition moved here since it uses srep.
9584 (size): definition moved here since it uses srep.
9586 * src/support/lyxstring.h: removed a couple of "inline" that should
9589 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9591 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9594 1999-10-21 Juergen Vigna <jug@sad.it>
9596 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9597 set to left if I just remove the width entry (or it is empty).
9599 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9600 paragraph when having dummy paragraphs.
9602 1999-10-20 Juergen Vigna <jug@sad.it>
9604 * src/insets/figinset.C: just commented some fl_free_form calls
9605 and added warnings so that this calls should be activated later
9606 again. This avoids for now a segfault, but we have a memory leak!
9608 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9609 'const char * argument' to 'string argument', this should
9610 fix some Asserts() in lyxstring.C.
9612 * src/lyxfunc.h: Removed the function argAsString(const char *)
9613 as it is not used anymore.
9615 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9617 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9620 * src/Literate.h: some funcs moved from public to private to make
9621 interface clearer. Unneeded args removed.
9623 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9625 (scanBuildLogFile): ditto
9627 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9628 normal TeX Error. Still room for improvement.
9630 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9632 * src/buffer.C (insertErrors): changes to make the error
9633 desctription show properly.
9635 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9638 * src/support/lyxstring.C (helper): changed to use
9639 sizeof(object->rep->ref).
9640 (operator>>): changed to use a pointer instead.
9642 * src/support/lyxstring.h: changed const reference & to value_type
9643 const & lets see if that helps.
9645 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9647 * Makefile.am (rpmdist): fixed to have non static package and
9650 * src/support/lyxstring.C: removed the compilation guards
9652 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9655 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9656 conditional compile of lyxstring.Ch
9658 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9659 stupid check, but it is a lot better than the bastring hack.
9660 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9662 * several files: changed string::erase into string::clear. Not
9665 * src/chset.C (encodeString): use a char temporary instead
9667 * src/table.C (TexEndOfCell): added tostr around
9668 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9669 (TexEndOfCell): ditto
9670 (TexEndOfCell): ditto
9671 (TexEndOfCell): ditto
9672 (DocBookEndOfCell): ditto
9673 (DocBookEndOfCell): ditto
9674 (DocBookEndOfCell): ditto
9675 (DocBookEndOfCell): ditto
9677 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9679 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9681 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9682 (MenuBuildProg): added tostr around ret
9683 (MenuRunChktex): added tostr around ret
9684 (DocumentApplyCB): added tostr around ret
9686 * src/chset.C (encodeString): added tostr around t->ic
9688 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9689 (makeLaTeXFile): added tostr around tocdepth
9690 (makeLaTeXFile): added tostr around ftcound - 1
9692 * src/insets/insetbib.C (setCounter): added tostr around counter.
9694 * src/support/lyxstring.h: added an operator+=(int) to catch more
9697 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9698 (lyxstring): We DON'T allow NULL pointers.
9700 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9702 * src/mathed/math_macro.C (MathMacroArgument::Write,
9703 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9704 when writing them out.
9706 * src/LString.C: remove, since it is not used anymore.
9708 * src/support/lyxstring.C: condition the content to
9709 USE_INCLUDED_STRING macro.
9711 * src/mathed/math_symbols.C, src/support/lstrings.C,
9712 src/support/lyxstring.C: add `using' directive to specify what
9713 we need in <algorithm>. I do not think that we need to
9714 conditionalize this, but any thought is appreciated.
9716 * many files: change all callback functions to "C" linkage
9717 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9718 strict_ansi. Those who were static are now global.
9719 The case of callbacks which are static class members is
9720 trickier, since we have to make C wrappers around them (see
9721 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9722 did not finish this yet, since it defeats the purpose of
9723 encapsulation, and I am not sure what the best route is.
9725 1999-10-19 Juergen Vigna <jug@sad.it>
9727 * src/support/lyxstring.C (lyxstring): we permit to have a null
9728 pointer as assignment value and just don't assign it.
9730 * src/vspace.C (nextToken): corrected this function substituting
9731 find_first(_not)_of with find_last_of.
9733 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9734 (TableOptCloseCB) (TableSpeCloseCB):
9735 inserted fl_set_focus call for problem with fl_hide_form() in
9738 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9740 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9743 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9745 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9746 LyXLex::next() and not eatline() to get its argument.
9748 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9750 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9751 instead, use fstreams for io of the depfile, removed unneeded
9752 functions and variables.
9754 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9755 vector instead, removed all functions and variables that is not in
9758 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9760 * src/buffer.C (insertErrors): use new interface to TeXError
9762 * Makefile.am (rpmdist): added a rpmdist target
9764 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9765 per Kayvan's instructions.
9767 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9769 * src/Makefile.am: add a definition for localedir, so that locales
9770 are found after installation (Kayvan)
9772 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9774 * development/.cvsignore: new file.
9776 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9778 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9779 C++ compiler provides wrappers for C headers and use our alternate
9782 * configure.in: use LYX_CXX_CHEADERS.
9784 * src/cheader/: new directory, populated with cname headers from
9785 libstdc++-2.8.1. They are a bit old, but probably good enough for
9786 what we want (support compilers who lack them).
9788 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9789 from includes. It turns out is was stupid.
9791 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9793 * lib/Makefile.am (install-data-local): forgot a ';'
9794 (install-data-local): forgot a '\'
9795 (libinstalldirs): needed after all. reintroduced.
9797 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9799 * configure.in (AC_OUTPUT): added lyx.spec
9801 * development/lyx.spec: removed file
9803 * development/lyx.spec.in: new file
9805 * po/*.po: merged with lyx.pot becuase of make distcheck
9807 * lib/Makefile.am (dist-hook): added dist-hook so that
9808 documentation files will be included when doing a make
9809 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9810 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9812 more: tried to make install do the right thing, exclude CVS dirs
9815 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9816 Path would fit in more nicely.
9818 * all files that used to use pathstack: uses now Path instead.
9819 This change was a lot easier than expected.
9821 * src/support/path.h: new file
9823 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9825 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9827 * src/support/lyxstring.C (getline): Default arg was given for
9830 * Configure.cmd: removed file
9832 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9834 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9835 streams classes and types, add the proper 'using' statements when
9836 MODERN_STL is defined.
9838 * src/debug.h: move the << operator definition after the inclusion
9841 * src/support/filetools.C: include "LAssert.h", which is needed
9844 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9847 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9848 include "debug.h" to define a proper ostream.
9850 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9852 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9853 method to the SystemCall class which can kill a process, but it's
9854 not fully implemented yet.
9856 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9858 * src/support/FileInfo.h: Better documentation
9860 * src/lyxfunc.C: Added support for buffer-export html
9862 * src/menus.C: Added Export->As HTML...
9864 * lib/bind/*.bind: Added short-cut for buffer-export html
9866 * src/lyxrc.*: Added support for new \tth_command
9868 * lib/lyxrc.example: Added stuff for new \tth_command
9870 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9872 * lib/Makefile.am (IMAGES): removed images/README
9873 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9874 installes in correct place. Check permisions is installed
9877 * src/LaTeX.C: some no-op changes moved declaration of some
9880 * src/LaTeX.h (LATEX_H): changed include guard name
9882 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9884 * lib/reLyX/Makefile.am: install noweb2lyx.
9886 * lib/Makefile.am: install configure.
9888 * lib/reLyX/configure.in: declare a config aux dir; set package
9889 name to lyx (not sure what the best solution is); generate noweb2lyx.
9891 * lib/layouts/egs.layout: fix the bibliography layout.
9893 1999-10-08 Jürgen Vigna <jug@sad.it>
9895 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9896 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9897 it returned without continuing to search the path.
9899 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9901 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9902 also fixes a bug. It is not allowed to do tricks with std::strings
9903 like: string a("hei"); &a[e]; this will not give what you
9904 think... Any reason for the complexity in this func?
9906 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9908 * Updated README and INSTALL a bit, mostly to check that my
9909 CVS rights are correctly set up.
9911 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9913 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9914 does not allow '\0' chars but lyxstring and std::string does.
9916 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9918 * autogen.sh (AUTOCONF): let the autogen script create the
9919 POTFILES.in file too. POTFILES.in should perhaps now not be
9920 included in the cvs module.
9922 * some more files changed to use C++ includes instead of C ones.
9924 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9926 (Reread): added tostr to nlink. buggy output otherwise.
9927 (Reread): added a string() around szMode when assigning to Buffer,
9928 without this I got a log of garbled info strings.
9930 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9933 * I have added several ostream & operator<<(ostream &, some_type)
9934 functions. This has been done to avoid casting and warnings when
9935 outputting enums to lyxerr. This as thus eliminated a lot of
9936 explicit casts and has made the code clearer. Among the enums
9937 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9938 mathed enums, some font enum the Debug::type enum.
9940 * src/support/lyxstring.h (clear): missing method. equivalent of
9943 * all files that contained "stderr": rewrote constructs that used
9944 stderr to use lyxerr instead. (except bmtable)
9946 * src/support/DebugStream.h (level): and the passed t with
9947 Debug::ANY to avoid spurious bits set.
9949 * src/debug.h (Debug::type value): made it accept strings of the
9952 * configure.in (Check for programs): Added a check for kpsewhich,
9953 the latex generation will use this later to better the dicovery of
9956 * src/BufferView.C (create_view): we don't need to cast this to
9957 (void*) that is done automatically.
9958 (WorkAreaButtonPress): removed some dead code.
9960 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9962 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9963 is not overwritten when translated (David Sua'rez de Lis).
9965 * lib/CREDITS: Added David Sua'rez de Lis
9967 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9969 * src/bufferparams.C (BufferParams): default input encoding is now
9972 * acinclude.m4 (cross_compiling): comment out macro
9973 LYX_GXX_STRENGTH_REDUCE.
9975 * acconfig.h: make sure that const is not defined (to empty) when
9976 we are compiling C++. Remove commented out code using SIZEOF_xx
9979 * configure.in : move the test for const and inline as late as
9980 possible so that these C tests do not interefere with C++ ones.
9981 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9982 has not been proven.
9984 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9986 * src/table.C (getDocBookAlign): remove bad default value for
9989 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9991 (ShowFileMenu2): ditto.
9993 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9996 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9998 * Most files: finished the change from the old error code to use
9999 DebugStream for all lyxerr debugging. Only minor changes remain
10000 (e.g. the setting of debug levels using strings instead of number)
10002 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10004 * src/layout.C (Add): Changed to use compare_no_case instead of
10007 * src/FontInfo.C: changed loop variable type too string::size_type.
10009 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10011 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10012 set ETAGS_ARGS to --c++
10014 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10016 * src/table.C (DocBookEndOfCell): commented out two unused variables
10018 * src/paragraph.C: commented out four unused variables.
10020 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10021 insed a if clause with type string::size_type.
10023 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10026 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10028 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10029 variable, also changed loop to go from 0 to lenght + 1, instead of
10030 -1 to length. This should be correct.
10032 * src/LaTeX.C (scanError): use string::size_type as loop variable
10035 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10036 (l.896) since y_tmp and row was not used anyway.
10038 * src/insets/insetref.C (escape): use string::size_type as loop
10041 * src/insets/insetquotes.C (Width): use string::size_type as loop
10043 (Draw): use string::size_type as loop variable type.
10045 * src/insets/insetlatexaccent.C (checkContents): use
10046 string::size_type as loop variable type.
10048 * src/insets/insetlabel.C (escape): use string::size_type as loop
10051 * src/insets/insetinfo.C: added an extern for current_view.
10053 * src/insets/insetcommand.C (scanCommand): use string::size_type
10054 as loop variable type.
10056 * most files: removed the RCS tags. With them we had to recompile
10057 a lot of files after a simple cvs commit. Also we have never used
10058 them for anything meaningful.
10060 * most files: tags-query-replace NULL 0. As adviced several plases
10061 we now use "0" instead of "NULL" in our code.
10063 * src/support/filetools.C (SpaceLess): use string::size_type as
10064 loop variable type.
10066 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10068 * src/paragraph.C: fixed up some more string stuff.
10070 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10072 * src/support/filetools.h: make modestr a std::string.
10074 * src/filetools.C (GetEnv): made ch really const.
10076 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10077 made code that used these use max/min from <algorithm> instead.
10079 * changed several c library include files to their equivalent c++
10080 library include files. All is not changed yet.
10082 * created a support subdir in src, put lyxstring and lstrings
10083 there + the extra files atexit, fileblock, strerror. Created
10084 Makefile.am. edited configure.in and src/Makefile.am to use this
10085 new subdir. More files moved to support.
10087 * imported som of the functions from repository lyx, filetools
10089 * ran tags-query-replace on LString -> string, corrected the bogus
10090 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10091 is still some errors in there. This is errors where too much or
10092 too litle get deleted from strings (string::erase, string::substr,
10093 string::replace), there can also be some off by one errors, or
10094 just plain wrong use of functions from lstrings. Viewing of quotes
10097 * LyX is now running fairly well with string, but there are
10098 certainly some bugs yet (see above) also string is quite different
10099 from LString among others in that it does not allow null pointers
10100 passed in and will abort if it gets any.
10102 * Added the revtex4 files I forgot when setting up the repository.
10104 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10106 * All over: Tried to clean everything up so that only the files
10107 that we really need are included in the cvs repository.
10108 * Switched to use automake.
10109 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10110 * Install has not been checked.
10112 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10114 * po/pt.po: Three errors:
10115 l.533 and l.538 format specification error
10116 l. 402 duplicate entry, I just deleted it.