1 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
3 * src/frontends/kde/formprintdialog.C: add
4 file browser for selecting postscript output
6 * src/frontends/kde/formprintdialogdata.C:
7 * src/frontends/kde/formprintdialogdata.h: re-generate
10 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
12 * src/frontends/gnome/Makefile.am:
13 * src/frontends/kde/Makefile.am: FormCommand.C
14 disappeared from xforms
16 * src/frontends/kde/FormCitation.C:
17 * src/frontends/kde/FormIndex.C: read-only
20 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
22 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
25 * src/bufferlist.C: add using directive.
27 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
29 * src/support/lyxfunctional.h: version of class_fun for void
30 returns added, const versions of back_inseter_fun and compare_fun
33 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
35 * src/frontends/xforms/FormInset.C (showInset): fix typo.
37 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
41 * lib/CREDITS: update to add all the contributors we've forgotten.
42 I have obviously missed some, so tell me whether there were
45 2000-10-13 Marko Vendelin <markov@ioc.ee>
47 * src/frontends/gnome/FormCitation.C
48 * src/frontends/gnome/FormCitation.h
49 * src/frontends/gnome/FormError.C
50 * src/frontends/gnome/FormIndex.C
51 * src/frontends/gnome/FormRef.C
52 * src/frontends/gnome/FormRef.h
53 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
55 * src/frontends/gnome/FormCitation.C
56 * src/frontends/gnome/FormCopyright.C
57 * src/frontends/gnome/FormError.C
58 * src/frontends/gnome/FormIndex.C
59 * src/frontends/gnome/FormRef.C
60 * src/frontends/gnome/FormToc.C
61 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
64 * src/frontends/gnome/Menubar_pimpl.C
65 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
68 2000-10-11 Baruch Even <baruch.even@writeme.com>
71 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
72 to convey its real action.
74 * src/minibuffer.C (peek_event): Added action when mouse clicks to
75 clear the minibuffer and prepare to enter a command.
77 * src/mathed/formula.C (LocalDispatch): Changed to conform with
78 the rename from ExecCommand to PrepareForCommand.
79 * src/lyxfunc.C (Dispatch): ditto.
81 2000-10-11 Baruch Even <baruch.even@writeme.com>
83 * src/buffer.C (writeFile): Added test for errors on writing, this
84 catches all errors and not only file system full errors as intended.
86 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
88 * src/lyx_gui.C (create_forms): better fix for crash with
91 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
93 * src/frontends/kde/Makefile.am:
94 * src/frontends/kde/FormCopyright.C:
95 * src/frontends/kde/formcopyrightdialog.C:
96 * src/frontends/kde/formcopyrightdialog.h:
97 * src/frontends/kde/formcopyrightdialogdata.C:
98 * src/frontends/kde/formcopyrightdialogdata.h:
99 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
100 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
101 copyright to use qtarch
103 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
105 * src/encoding.C (read): Fixed bug that caused an error message at
108 * po/Makefile.in.in: Fixed rule for ext_l10n.h
110 * lib/lyxrc.example: Fixed hebrew example.
112 2000-10-13 Allan Rae <rae@lyx.org>
114 * src/frontends/xforms/FormPreferences.C (input): reworking the
116 (build, update, apply): New inputs in various tabfolders
118 * src/frontends/xforms/FormToc.C: use new button policy.
119 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
120 dialogs that either can't use any existing policy or where it just
123 * src/frontends/xforms/FormTabular.h: removed copyright notice that
126 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
127 added a bool parameter which is ignored.
129 * src/buffer.C (setReadonly):
130 * src/BufferView_pimpl.C (buffer):
131 * src/frontends/kde/FormCopyright.h (update):
132 * src/frontends/kde/FormCitation.[Ch] (update):
133 * src/frontends/kde/FormIndex.[Ch] (update):
134 * src/frontends/kde/FormPrint.[Ch] (update):
135 * src/frontends/kde/FormRef.[Ch] (update):
136 * src/frontends/kde/FormToc.[Ch] (update):
137 * src/frontends/kde/FormUrl.[Ch] (update):
138 * src/frontends/gnome/FormCopyright.h (update):
139 * src/frontends/gnome/FormCitation.[Ch] (update):
140 * src/frontends/gnome/FormError.[Ch] (update):
141 * src/frontends/gnome/FormIndex.[Ch] (update):
142 * src/frontends/gnome/FormPrint.[Ch] (update):
143 * src/frontends/gnome/FormRef.h (update):
144 * src/frontends/gnome/FormToc.[Ch] (update):
145 * src/frontends/gnome/FormUrl.[Ch] (update):
146 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
147 to updateBufferDependent and DialogBase
149 * src/frontends/xforms/FormCitation.[hC]:
150 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
151 * src/frontends/xforms/FormError.[Ch]:
152 * src/frontends/xforms/FormGraphics.[Ch]:
153 * src/frontends/xforms/FormIndex.[Ch]:
154 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
155 and fixed readOnly handling.
156 * src/frontends/xforms/FormPrint.[Ch]:
157 * src/frontends/xforms/FormRef.[Ch]:
158 * src/frontends/xforms/FormTabular.[Ch]:
159 * src/frontends/xforms/FormToc.[Ch]:
160 * src/frontends/xforms/FormUrl.[Ch]:
161 * src/frontends/xforms/FormInset.[Ch]:
162 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
163 form of updateBufferDependent.
165 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
166 if form()->visible just in case someone does stuff to the form in a
169 * src/frontends/DialogBase.h (enum): removed enum since we can now use
170 the buttoncontroller for everything the enum used to be used for.
171 (update) It would seem we need to force all dialogs to use a bool
172 parameter or have two update functions. I chose to go with one.
173 I did try removing update() from here and FormBase and defining the
174 appropriate update signatures in FormBaseB[DI] but then ran into the
175 problem of the update() call in FormBase::show(). Whatever I did
176 to get around that would require another function and that just
177 got more confusing. Hence the decision to make everyone have an
178 update(bool). An alternative might have been to override show() in
179 FormBaseB[DI] and that would allow the different and appropriate
182 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
183 true == buffer change occurred. I decided against using a default
184 template parameter since not all compilers support that at present.
186 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
188 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
189 army knife" by removing functionality.
190 (clearStore): removed. All such housekeeping on hide()ing the dialog
191 is to be carried out by overloaded disconnect() methods.
192 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
193 superceded by Baruch's neat test (FormGraphics) to update an existing
194 dialog if a new signal is recieved rather than block all new signals
196 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
197 only to Inset dialogs.
198 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
199 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
201 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
203 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
204 as a base class to all inset dialogs. Used solely to connect/disconnect
205 the Inset::hide signal and to define what action to take on receipt of
206 a UpdateBufferDependent signal.
207 (FormCommand): now derived from FormInset.
209 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
212 * src/frontends/xforms/FormCopyright.[Ch]:
213 * src/frontends/xforms/FormPreferences.[Ch]:
214 now derived from FormBaseBI.
216 * src/frontends/xforms/FormDocument.[Ch]:
217 * src/frontends/xforms/FormParagraph.[Ch]:
218 * src/frontends/xforms/FormPrint.[Ch]:
219 now derived from FormBaseBD.
221 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
223 * src/frontends/xforms/FormCitation.[Ch]:
224 * src/frontends/xforms/FormError.[Ch]:
225 * src/frontends/xforms/FormRef.[Ch]:
226 * src/frontends/xforms/FormToc.[Ch]:
227 (clearStore): reworked as disconnect().
229 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
232 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
234 * src/converter.C (runLaTeX): constify buffer argument
237 * src/frontends/support/Makefile.am (INCLUDES): fix.
239 * src/buffer.h: add std:: qualifier
240 * src/insets/figinset.C (addpidwait): ditto
241 * src/MenuBackend.C: ditto
242 * src/buffer.C: ditto
243 * src/bufferlist.C: ditto
244 * src/layout.C: ditto
245 * src/lyxfunc.C: ditto
247 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
249 * src/lyxtext.h (bidi_level): change return type to
250 LyXParagraph::size_type.
252 * src/lyxparagraph.h: change size_type to
253 TextContainer::difference_type. This should really be
254 TextContainer::size_type, but we need currently to support signed
257 2000-10-11 Marko Vendelin <markov@ioc.ee>
258 * src/frontends/gnome/FormError.h
259 * src/frontends/gnome/FormRef.C
260 * src/frontends/gnome/FormRef.h
261 * src/frontends/gnome/FormError.C
262 * src/frontends/gnome/Makefile.am
263 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
264 to Gnome frontend. Both dialogs use "action" area.
266 2000-10-12 Baruch Even <baruch.even@writeme.com>
268 * src/graphics/GraphicsCacheItem_pimpl.C:
269 * src/graphics/Renderer.C:
270 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
273 2000-10-12 Juergen Vigna <jug@sad.it>
275 * src/insets/insettext.C (draw): fixed drawing bug (specifically
276 visible when selecting).
278 * development/Code_rules/Rules: fixed some typos.
280 2000-10-09 Baruch Even <baruch.even@writeme.com>
282 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
283 compiling on egcs 1.1.2 possible.
285 * src/filedlg.C (comp_direntry::operator() ): ditto.
287 2000-08-31 Baruch Even <baruch.even@writeme.com>
289 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
292 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
293 transient it now only gets freed when the object is destructed.
295 2000-08-24 Baruch Even <baruch.even@writeme.com>
297 * src/frontends/FormGraphics.h:
298 * src/frontends/FormGraphics.C: Changed to use ButtonController and
301 2000-08-20 Baruch Even <baruch.even@writeme.com>
303 * src/insets/insetgraphics.C:
304 (draw): Added messages to the drawn rectangle to report status.
305 (updateInset): Disabled the use of the inline graphics,
308 2000-08-17 Baruch Even <baruch.even@writeme.com>
310 * src/frontends/support: Directory added for the support of GUII LyX.
312 * src/frontends/support/LyXImage.h:
313 * src/frontends/support/LyXImage.C: Base class for GUII holding of
316 * src/frontends/support/LyXImage_X.h:
317 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
318 version of LyXImage, this uses the Xlib Pixmap.
323 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
324 replacement to Pixmap.
326 * src/insets/insetgraphics.h:
327 * src/insets/insetgraphics.C:
328 * src/graphics/GraphicsCacheItem.h:
329 * src/graphics/GraphicsCacheItem.C:
330 * src/graphics/GraphicsCacheItem_pimpl.h:
331 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
334 * src/graphics/GraphicsCacheItem.h:
335 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
336 another copy of the object.
338 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
339 of cacheHandle, this fixed a bug that sent LyX crashing.
341 * src/graphics/XPM_Renderer.h:
342 * src/graphics/XPM_Renderer.C:
343 * src/graphics/EPS_Renderer.h:
344 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
346 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
348 * src/lyxfunc.C (processKeySym): only handle the
349 lockinginset/inset stuff if we have a buffer and text loaded...
351 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
353 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
355 * src/support/lyxfunctional.h: add operator= that takes a reference
357 * src/lyxserver.C (mkfifo): make first arg const
359 * src/layout.h: renamed name(...) to setName(...) to work around
362 * src/buffer.C (setFileName): had to change name of function to
363 work around bugs in egcs. (renamed from fileName)
365 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
367 * src/support/translator.h: move helper template classes to
368 lyxfunctional.h, include "support/lyxfunctional.h"
370 * src/support/lyxmanip.h: add delaration of fmt
372 * src/support/lyxfunctional.h: new file
373 (class_fun_t): new template class
374 (class_fun): helper template function
375 (back_insert_fun_iterator): new template class
376 (back_inserter_fun): helper template function
377 (compare_memfun_t): new template class
378 (compare_memfun): helper template function
379 (equal_1st_in_pair): moved here from translator
380 (equal_2nd_in_pair): moved here from translator
382 * src/support/fmt.C: new file
383 (fmt): new func, can be used for a printf substitute when still
384 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
386 * src/support/StrPool.C: add some comments
388 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
391 * src/insets/figinset.C (addpidwait): use std::copy with
392 ostream_iterator to fill the pidwaitlist
394 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
396 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
399 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
402 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
404 * src/frontends/xforms/FormDocument.C (build): remove c_str()
405 (class_update): ditto
407 (CheckChoiceClass): move initialization of tc and tct
409 * src/tabular.C: remove current_view
410 (OldFormatRead): similar to right below [istream::ignore]
412 * src/lyxlex_pimpl.C (next): add code for faster skipping of
413 chars, unfortunately this is buggy on gcc 2.95.2, so currently
414 unused [istream::ignore]
416 * src/lyxfunc.C: include "support/lyxfunctional.h"
417 (getInsetByCode): use std::find_if and compare_memfun
419 * src/lyxfont.C (stateText): remove c_str()
421 * src/lyx_main.C (setDebuggingLevel): make static
422 (commandLineHelp): make static
424 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
425 Screen* together with fl_get_display() and fl_screen
427 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
428 togheter with fl_get_display() and fl_screen
429 (create_forms): remove c_str()
431 * src/layout.C: include "support/lyxfunctional.h"
432 (hasLayout): use std::find_if and compare_memfun
433 (GetLayout): use std::find_if and comapre_memfun
434 (delete_layout): use std::remove_if and compare_memfun
435 (NumberOfClass): use std:.find_if and compare_memfun
437 * src/gettext.h: change for the new functions
439 * src/gettext.C: new file, make _(char const * str) and _(string
440 const & str) real functions.
442 * src/font.C (width): rewrite slightly to avoid one extra variable
444 * src/debug.C: initialize Debug::ANY here
446 * src/commandtags.h: update number comments
448 * src/combox.h (get): make const func
450 (getline): make const
452 * src/combox.C (input_cb): handle case where fl_get_input can
455 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
456 "support/lyxfunctional.h", remove current_view variable.
457 (resize): use std::for_each with std::mem_fun
458 (getFileNames): use std::copy with back_inserter_fun
459 (getBuffer): change arg type to unsigned int
460 (emergencyWriteAll): call emergencyWrite with std::for_each and
462 (emergencyWrite): new method, the for loop in emergencyWriteAll
464 (exists): use std::find_if with compare_memfun
465 (getBuffer): use std::find_if and compare_memfun
467 * src/buffer.h: add typedefs for iterator_category, value_type
468 difference_type, pointer and reference for inset_iterator
469 add postfix ++ for inset_iterator
470 make inset_iterator::getPos() const
472 * src/buffer.C: added support/lyxmanip.h
473 (readFile): use lyxerr << fmt instead of printf
474 (makeLaTeXFile): use std::copy to write out encodings
476 * src/Painter.C (text): rewrite slightly to avoid extra font variable
478 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
479 free and the char * temp.
480 (hasMenu): use std::find_if and compare_memfun
483 * src/Makefile.am (lyx_SOURCES): added gettext.C
485 * src/LyXAction.C (retrieveActionArg): clear the arg, use
486 string::insert small change to avoid temporary
488 * src/LColor.C (getGUIName): remove c_str()
490 * several files: change all occurrences of fl_display to
493 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
494 that -pedantic is not used for gcc 2.97 (cvs gcc)
496 * boost/Makefile.am: begin slowly to prepare for a real boost lib
498 2000-10-11 Allan Rae <rae@lyx.org>
500 * src/frontends/xforms/FormPreferences.C (input): template path must be
501 a readable directory. It doesn't need to be writeable.
502 (build, delete, update, apply): New inputs in the various tabfolders
504 * src/frontends/xforms/forms/form_preferences.fd:
505 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
506 several new entries to existing folders. Shuffled some existing stuff
509 * src/frontends/xforms/forms/form_print.fd:
510 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
511 Should probably rework PrinterParams as well. Note that the switch to
512 collated is effectively the same as !unsorted so changing PrinterParams
513 will require a lot of fiddly changes to reverse the existing logic.
515 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
517 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
519 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
521 2000-10-10 Allan Rae <rae@lyx.org>
524 * src/lyxfunc.C (Dispatch):
526 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
529 * src/lyxrc.C (output): Only write the differences between system lyxrc
530 and the users settings.
533 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
535 I'll rewrite this later, after 1.1.6 probably, to keep a single
536 LyXRC but two instances of a LyXRCStruct.
538 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
540 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
542 * src/tabular.h: add a few std:: qualifiers.
544 * src/encoding.C: add using directive.
545 * src/language.C: ditto.
547 * src/insets/insetquotes.C (Validate): use languages->lang()
548 instead of only language.
550 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
552 * lib/languages: New file.
554 * lib/encodings: New file.
556 * src/language.C (Languages): New class.
557 (read): New method. Reads the languages from the 'languages' file.
559 * src/encoding.C (Encodings): New class.
560 (read): New method. Reads the encodings from the 'encodings' file.
562 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
565 * src/bufferparams.h and a lot of files: Deleted the member language,
566 and renamed language_info to language
568 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
569 * src/lyxfont.C (latexWriteStartChanges): ditto.
570 * src/paragraph.C (validate,TeXOnePar): ditto.
572 * src/lyxfont.C (update): Restored deleted code.
574 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
576 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
578 * src/BufferView_pimpl.C (buffer): cleaned up a little.
580 * src/insets/figinset.[Ch]:
581 * src/insets/insetinclude.[Ch]:
582 * src/insets/insetinclude.[Ch]:
583 * src/insets/insetparent.[Ch]:
584 * src/insets/insetref.[Ch]:
585 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
588 * src/mathed/formula.[Ch]:
589 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
591 * src/buffer.C (parseSingleLyXformat2Token, readInset):
592 * src/lyx_cb.C (FigureApplyCB):
593 * src/lyxfunc.C (getStatus, Dispatch):
594 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
597 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
599 * src/converter.[Ch] (Formats::View):
600 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
602 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
603 *current_view->buffer(). This will change later, but this patch is way
606 2000-10-09 Juergen Vigna <jug@sad.it>
608 * src/text.C (GetRow): small fix.
610 * src/BufferView_pimpl.C (cursorPrevious):
611 (cursorNext): added LyXText parameter to function.
613 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
614 keypress depending on cursor position.
616 2000-10-06 Juergen Vigna <jug@sad.it>
618 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
619 (copySelection): redone this function and also copy ascii representa-
622 * src/tabular.C (Ascii):
626 (print_n_chars): new functions to realize the ascii export of tabulars.
628 2000-10-05 Juergen Vigna <jug@sad.it>
630 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
631 if we don't have a buffer.
633 2000-10-10 Allan Rae <rae@lyx.org>
635 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
636 with closing dialog. It seems that nested tabfolders require hiding
637 of inner tabfolders before hiding the dialog itself. Actually all I
638 did was hide the active outer folder.
640 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
641 unless there really is a buffer. hideBufferDependent is called
644 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
645 POTFILES.in stays in $(srcdir).
647 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
649 * lib/lyxrc.example: Few changes.
651 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
653 * src/BufferView_pimpl.C (buffer): only need one the
654 updateBufferDependent signal to be emitted once! Moved to the end of
655 the method to allow bv_->text to be updated first.
657 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
658 and hSignal_ with Dialogs * and BufferDependency variables.
659 New Buffer * parent_, initialised when the dialog is launched. Used to
660 check whether to update() or hide() dialog in the new, private
661 updateOrHide() method that is connected to the updateBufferDependent
662 signal. Daughter classes dictate what to do using the
663 ChangedBufferAction enum, passed to the c-tor.
665 * src/frontends/xforms/FormCitation.C:
666 * src/frontends/xforms/FormCommand.C:
667 * src/frontends/xforms/FormCopyright.C:
668 * src/frontends/xforms/FormDocument.C:
669 * src/frontends/xforms/FormError.C:
670 * src/frontends/xforms/FormIndex.C:
671 * src/frontends/xforms/FormPreferences.C:
672 * src/frontends/xforms/FormPrint.C:
673 * src/frontends/xforms/FormRef.C:
674 * src/frontends/xforms/FormToc.C:
675 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
678 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
679 ChangedBufferAction enum.
681 * src/frontends/xforms/FormParagraph.[Ch]
682 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
685 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
687 * lib/bind/cua.bind: fix a bit.
688 * lib/bind/emacs.bind: ditto.
690 * lib/bind/menus.bind: remove real menu entries from there.
692 * src/spellchecker.C: make sure we only include strings.h when
695 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
697 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
698 function. It enlarges the maximum number of pup when needed.
699 (add_toc2): Open a new menu if maximum number of items per menu has
702 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
704 * src/frontends/kde/FormPrint.C: fix error reporting
706 * src/frontends/xforms/FormDocument.C: fix compiler
709 * lib/.cvsignore: add Literate.nw
711 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
714 * bufferview_funcs.[Ch]
717 * text2.C: Add support for numbers in RTL text.
719 2000-10-06 Allan Rae <rae@lyx.org>
721 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
722 to be gettext.m4 friendly again. ext_l10n.h is now
723 generated into $top_srcdir instead of $top_builddir
724 so that lyx.pot will be built correctly -- without
725 duplicate parsing of ext_l10n.h.
727 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
729 * src/frontends/kde/FormCitation.C: make the dialog
732 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
734 * config/kde.m4: fix consecutive ./configure runs,
735 look for qtarch, fix library order
737 * src/frontends/kde/Makefile.am: tidy up,
738 add Print dialog, add .dlg dependencies
740 * src/frontends/kde/FormPrint.C:
741 * src/frontends/kde/FormPrint.h:
742 * src/frontends/kde/formprintdialog.C:
743 * src/frontends/kde/formprintdialog.h:
744 * src/frontends/kde/formprintdialogdata.C:
745 * src/frontends/kde/formprintdialogdata.h:
746 * src/frontends/kde/dlg/formprintdialog.dlg: add
749 * src/frontends/kde/dlg/README: Added explanatory readme
751 * src/frontends/kde/dlg/checkinitorder.pl: small perl
752 script to double-check qtarch's output
754 * src/frontends/kde/formindexdialog.C:
755 * src/frontends/kde/formindexdialogdata.C:
756 * src/frontends/kde/formindexdialogdata.h:
757 * src/frontends/kde/dlg/formindexdialog.dlg: update
758 for qtarch, minor fixes
760 2000-10-05 Allan Rae <rae@lyx.org>
762 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
763 dialogs when switching buffers update them instead. It's up to each
764 dialog to decide if it should still be visible or not.
765 update() should return a bool to control visiblity within show().
766 Or perhaps better to set a member variable and use that to control
769 * lib/build-listerrors: create an empty "listerrors" file just to stop
770 make trying to regenerate it all the time if you don't have noweb
773 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
775 * po/Makefile.in.in (ext_l10n.h): added a rule to build
776 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
777 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
778 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
779 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
781 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
783 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
785 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
786 deleting buffer. Closes all buffer-dependent dialogs.
788 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
790 * src/frontends/xforms/FormCitation.[Ch]:
791 * src/frontends/xforms/FormPreferences.[Ch]:
792 * src/frontends/xforms/FormPrint.[Ch]:
793 * src/frontends/xforms/FormRef.[Ch]:
794 * src/frontends/xforms/FormUrl.[Ch]: ditto
796 * src/frontends/xforms/FormDocument.[Ch]:
797 * src/frontends/xforms/forms/form_document.C.patch:
798 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
799 pass through a single input() function.
801 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
803 * lib/build-listerrors: return status as OK
805 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
807 * lib/lyxrc.example: Updated to new export code
809 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
811 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
814 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
817 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
819 * lib/layouts/amsbook.layout: ditto.
821 * boost/Makefile.am: fix typo.
823 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
825 (add_lastfiles): removed.
826 (add_documents): removed.
827 (add_formats): removed.
829 * src/frontends/Menubar.C: remove useless "using" directive.
831 * src/MenuBackend.h: add a new MenuItem constructor.
833 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
836 2000-10-04 Allan Rae <rae@lyx.org>
838 * lib/Makefile.am (listerrors):
839 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
840 I haven't got notangle installed so Kayvan please test. The output
841 should end up in $builddir. This also allows people who don't have
842 noweb installed to complete the make process without error.
844 * src/frontends/xforms/FormCommand.[Ch] (showInset):
845 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
846 by JMarc's picky compiler.
848 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
851 * src/insets/insettabular.C (setPos): change for loop to not use
852 sequencing operator. Please check this Jürgen.
854 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
856 * src/insets/insetcite.C (getScreenLabel): ditto
857 * src/support/filetools.C (QuoteName): ditto
858 (ChangeExtension): ditto
860 * src/BufferView_pimpl.C (scrollCB): make heigt int
862 * src/BufferView2.C (insertInset): comment out unused arg
864 * boost/Makefile.am (EXTRADIST): new variable
866 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
868 * src/exporter.C (IsExportable): Fixed
870 * lib/configure.m4: Small fix
872 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
874 * src/insets/insetbutton.C (width): Changed to work with no GUI.
875 * src/insets/insetbib.C (bibitemWidest): ditto.
876 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
878 2000-10-03 Juergen Vigna <jug@sad.it>
880 * src/BufferView2.C (theLockingInset): removed const because of
881 Agnus's compile problems.
883 * src/insets/insettext.C (LocalDispatch): set the language of the
884 surronding paragraph on inserting the first character.
886 * various files: changed use of BufferView::the_locking_inset.
888 * src/BufferView2.C (theLockingInset):
889 (theLockingInset): new functions.
891 * src/BufferView.h: removed the_locking_inset.
893 * src/lyxtext.h: added the_locking_inset
895 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
897 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
899 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
901 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
902 * src/mathed/math_cursor.C (IsAlpha): ditto.
903 * src/mathed/math_inset.C (strnew): ditto.
904 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
905 (IMetrics): cxp set but never used; removed.
906 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
907 that the variable in question has been removed also!
910 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
911 using the Buffer * passed to Latex(), using the BufferView * passed to
912 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
914 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
915 Linuxdoc() and DocBook() rather than the stored Buffer * master.
917 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
918 * src/buffer.C (readInset): used new InsetBibtex c-tor
919 * (getBibkeyList): used new InsetBibtex::getKeys
921 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
924 * lib/build-listerrors
926 * src/exporter.C: Add literate programming support to the export code
929 * src/lyx_cb.C: Remove old literate code.
931 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
934 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
935 * src/converter.C (View, Convert): Use QuoteName.
937 * src/insets/figinset.C (Preview): Use Formats::View.
939 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
941 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
943 * src/lyxfunc.C (Dispatch): move declaration of text variable at
944 the top of the function, because compaq cxx complains that the
945 "goto exit_with_message" when the function is disabled bypasses
947 (MenuNew): try a better fix for the generation of new file names.
948 This time, I used AddName() instead of AddPath(), hoping Juergen
951 2000-10-03 Allan Rae <rae@lyx.org>
953 * src/frontends/xforms/forms/form_preferences.fd:
954 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
955 nested tabfolders has begun. The old "Miscellaneous" was renamed as
956 "Look and Feel"->"General" but will need to be split up further into
957 general output and general input tabs. Current plan is for four outer
958 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
959 stuff; "Inputs" for input and import configuration; "Outputs" for
960 output and export configuration; and one more whatever is left over
961 called "General". The leftovers at present look like being which
962 viewers to use, spellchecker, language support and might be better
963 named "Support". I've put "Paths" in "Inputs" for the moment as this
964 seems reasonable for now at least.
965 One problem remains: X error kills LyX when you close Preferences.
967 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
969 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
970 qualifier from form()
971 * src/frontends/xforms/FormCitation.[Ch]:
972 * src/frontends/xforms/FormCopyright.[Ch]:
973 * src/frontends/xforms/FormDocument.[Ch]:
974 * src/frontends/xforms/FormError.[Ch]:
975 * src/frontends/xforms/FormIndex.[Ch]:
976 * src/frontends/xforms/FormPreferences.[Ch]:
977 * src/frontends/xforms/FormPrint.[Ch]:
978 * src/frontends/xforms/FormRef.[Ch]:
979 * src/frontends/xforms/FormToc.[Ch]:
980 * src/frontends/xforms/FormUrl.[Ch]: ditto.
982 * src/frontends/xforms/FormCitation.[Ch]:
983 * src/frontends/xforms/FormIndex.[Ch]:
984 * src/frontends/xforms/FormRef.[Ch]:
985 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
986 with Allan's naming policy
988 * src/frontends/xforms/FormCitation.C: some static casts to remove
991 2000-10-02 Juergen Vigna <jug@sad.it>
993 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
994 now you can type or do stuff inside the table-cell also when in dummy
995 position, fixed visible cursor.
997 * src/insets/insettext.C (Edit): fixing cursor-view position.
999 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1000 be used for equal functions in lyxfunc and insettext.
1002 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1004 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1006 * src/frontends/gnome/FormCitation.h:
1007 * src/frontends/gnome/FormCopyright.h:
1008 * src/frontends/gnome/FormIndex.h:
1009 * src/frontends/gnome/FormPrint.h:
1010 * src/frontends/gnome/FormToc.h:
1011 * src/frontends/gnome/FormUrl.h:
1012 * src/frontends/kde/FormCitation.h:
1013 * src/frontends/kde/FormCopyright.h:
1014 * src/frontends/kde/FormIndex.h:
1015 * src/frontends/kde/FormRef.h:
1016 * src/frontends/kde/FormToc.h:
1017 * src/frontends/kde/FormUrl.h: fix remaining users of
1020 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1022 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1023 from depth argument.
1024 (DocBookHandleCaption): ditto.
1025 (DocBookHandleFootnote): ditto.
1026 (SimpleDocBookOnePar): ditto.
1028 * src/frontends/xforms/FormDocument.h (form): remove extra
1029 FormDocument:: qualifier.
1031 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1033 * sigc++/handle.h: ditto.
1035 * src/lyx_gui_misc.C: add "using" directive.
1037 * src/cheaders/cstddef: new file, needed by the boost library (for
1040 2000-10-02 Juergen Vigna <jug@sad.it>
1042 * src/insets/insettext.C (SetFont): better support.
1044 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1046 * src/screen.C (DrawOneRow): some uint refixes!
1048 2000-10-02 Allan Rae <rae@lyx.org>
1050 * boost/.cvsignore: ignore Makefile as well
1052 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1053 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1055 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1056 Left this one out by accident.
1058 * src/frontends/xforms/FormBase.h (restore): default to calling
1059 update() since that will restore the original/currently-applied values.
1060 Any input() triggered error messages will require the derived classes
1061 to redefine restore().
1063 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1064 avoid a segfault. combo_doc_class is the main concern.
1066 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1068 * Simplify build-listerrors in view of GUI-less export ability!
1070 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1072 * src/lyx_main.C (easyParse): Disable gui when exporting
1074 * src/insets/figinset.C:
1077 * src/lyx_gui_misc.C
1078 * src/tabular.C: Changes to allow no-gui.
1080 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1082 * src/support/utility.hpp: removed file
1083 * src/support/block.h: removed file
1085 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1088 * src/mathed/formula.C: add support/lyxlib.h
1089 * src/mathed/formulamacro.C: ditto
1091 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1092 * src/lyxparagraph.h: ditto
1094 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1095 * src/frontends/Makefile.am (INCLUDES): ditto
1096 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1097 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1098 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1099 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1100 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1101 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1103 * src/BufferView.h: use boost/utility.hpp
1104 * src/LColor.h: ditto
1105 * src/LaTeX.h: ditto
1106 * src/LyXAction.h: ditto
1107 * src/LyXView.h: ditto
1108 * src/bufferlist.h: ditto
1109 * src/lastfiles.h: ditto
1110 * src/layout.h: ditto
1111 * src/lyx_gui.h: ditto
1112 * src/lyx_main.h: ditto
1113 * src/lyxlex.h: ditto
1114 * src/lyxrc.h: ditto
1115 * src/frontends/ButtonPolicies.h: ditto
1116 * src/frontends/Dialogs.h: ditto
1117 * src/frontends/xforms/FormBase.h: ditto
1118 * src/frontends/xforms/FormGraphics.h: ditto
1119 * src/frontends/xforms/FormParagraph.h: ditto
1120 * src/frontends/xforms/FormTabular.h: ditto
1121 * src/graphics/GraphicsCache.h: ditto
1122 * src/graphics/Renderer.h: ditto
1123 * src/insets/ExternalTemplate.h: ditto
1124 * src/insets/insetcommand.h: ditto
1125 * src/support/path.h: ditto
1127 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1128 and introduce clause for 2.97.
1130 * boost/libs/README: new file
1132 * boost/boost/utility.hpp: new file
1134 * boost/boost/config.hpp: new file
1136 * boost/boost/array.hpp: new file
1138 * boost/Makefile.am: new file
1140 * boost/.cvsignore: new file
1142 * configure.in (AC_OUTPUT): add boost/Makefile
1144 * Makefile.am (SUBDIRS): add boost
1146 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1148 * src/support/lstrings.C (suffixIs): Fixed.
1150 2000-10-01 Allan Rae <rae@lyx.org>
1152 * src/PrinterParams.h: moved things around to avoid the "can't
1153 inline call" warning.
1155 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1156 into doc++ documentation.
1158 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1160 * src/frontends/xforms/FormRef.C: make use of button controller
1161 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1162 cleaned up button controller usage.
1163 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1164 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1165 use the button controller
1167 * src/frontends/xforms/forms/*.fd: and associated generated files
1168 updated to reflect changes to FormBase. Some other FormXxxx files
1169 also got minor updates to reflect changes to FormBase.
1171 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1172 (hide): made virtual.
1173 (input): return a bool. true == valid input
1174 (RestoreCB, restore): new
1175 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1176 Changes to allow derived dialogs to use a ButtonController and
1177 make sense when doing so: OK button calls ok() and so on.
1179 * src/frontends/xforms/ButtonController.h (class ButtonController):
1180 Switch from template implementation to taking Policy parameter.
1181 Allows FormBase to provide a ButtonController for any dialog.
1183 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1184 Probably should rename connect and disconnect.
1185 (apply): use the radio button groups
1186 (form): needed by FormBase
1187 (build): setup the radio button groups
1189 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1191 * several files: type changes to reduce the number of warnings and
1192 to unify type hangling a bit. Still much to do.
1194 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1196 * lib/images/*: rename a bunch of icons to match Dekel converter
1199 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1202 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1204 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1206 * sigc++/handle.h: ditto for class Handle.
1208 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1210 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1212 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1214 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1215 removal of the "default" language.
1217 * src/combox.h (getline): Check that sel > 0
1219 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1221 * lib/examples/docbook_example.lyx
1222 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1224 * lib/layouts/docbook-book.layout: new docbook book layout.
1226 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1228 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1230 * src/insets/figinset.C (DocBook):fixed small typo.
1232 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1234 * src/insets/insetinclude.h: string include_label doesn't need to be
1237 2000-09-29 Allan Rae <rae@lyx.org>
1239 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1240 Allow derived type to control connection and disconnection from signals
1241 of its choice if desired.
1243 2000-09-28 Juergen Vigna <jug@sad.it>
1245 * src/insets/insettabular.C (update): fixed cursor setting when
1246 the_locking_inset changed.
1247 (draw): made this a bit cleaner.
1248 (InsetButtonPress): fixed!
1250 * various files: added LyXText Parameter to fitCursor call.
1252 * src/BufferView.C (fitCursor): added LyXText parameter.
1254 * src/insets/insettabular.C (draw): small draw fix.
1256 * src/tabular.C: right setting of left/right celllines.
1258 * src/tabular.[Ch]: fixed various types in funcions and structures.
1259 * src/insets/insettabular.C: ditto
1260 * src/frontends/xforms/FormTabular.C: ditto
1262 2000-09-28 Allan Rae <rae@lyx.org>
1264 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1265 that the #ifdef's had been applied to part of what should have been
1266 a complete condition. It's possible there are other tests that
1267 were specific to tables that are also wrong now that InsetTabular is
1268 being used. Now we need to fix the output of '\n' after a table in a
1269 float for the same reason as the original condition:
1270 "don't insert this if we would be adding it before or after a table
1271 in a float. This little trick is needed in order to allow use of
1272 tables in \subfigures or \subtables."
1273 Juergen can you check this?
1275 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1277 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1278 outputed to the ostream.
1280 * several files: fixed types based on warnings from cxx
1282 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1284 * src/frontends/kde/Makefile.am: fix rule for
1285 formindexdialogdata_moc.C
1287 * src/.cvsignore: add ext_l10n.h to ignore
1289 * acconfig.h: stop messing with __STRICT_ANSI__
1290 * config/gnome.m4: remove option to set -ansi
1291 * config/kde.m4: remove option to set -ansi
1292 * config/lyxinclude.m4: don't set -ansi
1294 2000-09-27 Juergen Vigna <jug@sad.it>
1296 * various files: remove "default" language check.
1298 * src/insets/insetquotes.C: removed use of current_view.
1300 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1301 the one should have red ears by now!
1303 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1304 in more then one paragraph. Fixed cursor-movement/selection.
1306 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1307 paragraphs inside a text inset.
1309 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1310 text-inset if this owner is an inset.
1312 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1314 * src/Bullet.h: changed type of font, character and size to int
1316 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1318 * src/insets/inseturl.[Ch]:
1319 * src/insets/insetref.[Ch]:
1320 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1322 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1324 * src/buffer.C (readFile): block-if statement rearranged to minimise
1325 bloat. Patch does not reverse Jean-Marc's change ;-)
1327 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1328 Class rewritten to store pointers to hide/update signals directly,
1329 rather than Dialogs *. Also defined an enum to ease use. All xforms
1330 forms can now be derived from this class.
1332 * src/frontends/xforms/FormCommand.[Ch]
1333 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1335 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1338 * src/frontends/xforms/forms/form_citation.fd
1339 * src/frontends/xforms/forms/form_copyright.fd
1340 * src/frontends/xforms/forms/form_error.fd
1341 * src/frontends/xforms/forms/form_index.fd
1342 * src/frontends/xforms/forms/form_ref.fd
1343 * src/frontends/xforms/forms/form_toc.fd
1344 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1346 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1348 * src/insets/insetfoot.C: removed redundent using directive.
1350 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1352 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1353 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1355 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1356 created in the constructors in different groups. Then set() just
1357 have to show the groups as needed. This fixes the redraw problems
1358 (and is how the old menu code worked).
1360 * src/support/lyxlib.h: declare the methods as static when we do
1361 not have namespaces.
1363 2000-09-26 Juergen Vigna <jug@sad.it>
1365 * src/buffer.C (asciiParagraph): new function.
1366 (writeFileAscii): new function with parameter ostream.
1367 (writeFileAscii): use now asciiParagraph.
1369 * various inset files: added the linelen parameter to the Ascii-func.
1371 * src/tabular.C (Write): fixed error in writing file introduced by
1372 the last changes from Lars.
1374 * lib/bind/menus.bind: removed not supported functions.
1376 * src/insets/insettext.C (Ascii): implemented this function.
1378 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1380 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1381 (Write): use of the write_attribute functions.
1383 * src/bufferlist.C (close): fixed reasking question!
1385 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1387 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1388 new files use the everwhere possible.
1391 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1392 src/log_form.C src/lyx.C:
1395 * src/buffer.C (runLaTeX): remove func
1397 * src/PaperLayout.C: removed file
1398 * src/ParagraphExtra.C: likewise
1399 * src/bullet_forms.C: likewise
1400 * src/bullet_forms.h: likewise
1401 * src/bullet_forms_cb.C: likewise
1403 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1404 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1407 * several files: remove all traces of the old fd_form_paragraph,
1408 and functions belonging to that.
1410 * several files: remove all traces of the old fd_form_document,
1411 and functions belonging to that.
1413 * several files: constify local variables were possible.
1415 * several files: remove all code that was dead when NEW_EXPORT was
1418 * several files: removed string::c_str in as many places as
1421 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1422 (e): be a bit more outspoken when patching
1423 (updatesrc): only move files if changed.
1425 * forms/layout_forms.h.patch: regenerated
1427 * forms/layout_forms.fd: remove form_document and form_paragraph
1428 and form_quotes and form_paper and form_table_options and
1429 form_paragraph_extra
1431 * forms/form1.fd: remove form_table
1433 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1434 the fdui->... rewrite. Update some comments to xforms 0.88
1436 * forms/bullet_forms.C.patch: removed file
1437 * forms/bullet_forms.fd: likewise
1438 * forms/bullet_forms.h.patch: likewise
1440 * development/Code_rules/Rules: added a section on switch
1441 statements. Updated some comment to xforms 0.88.
1443 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1445 * src/buffer.C (readFile): make sure that the whole version number
1446 is read after \lyxformat (even when it contains a comma)
1448 * lib/ui/default.ui: change shortcut of math menu to M-a.
1450 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1452 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1455 * src/LyXView.C (updateWindowTitle): show the full files name in
1456 window title, limited to 30 characters.
1458 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1459 When a number of characters has been given, we should not assume
1460 that the string is 0-terminated.
1462 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1463 calls (fixes some memory leaks)
1465 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1466 trans member on exit.
1468 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1470 * src/converter.C (GetReachable): fix typo.
1472 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1473 understand ',' instead of '.'.
1474 (GetInteger): rewrite to use strToInt().
1476 2000-09-26 Juergen Vigna <jug@sad.it>
1478 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1479 better visibility and error-message on wrong VSpace input.
1481 * src/language.C (initL): added english again.
1483 2000-09-25 Juergen Vigna <jug@sad.it>
1485 * src/frontends/kde/Dialogs.C (Dialogs):
1486 * src/frontends/gnome/Dialogs.C (Dialogs):
1487 * src/frontends/kde/Makefile.am:
1488 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1490 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1492 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1494 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1496 * src/frontends/xforms/FormParagraph.C:
1497 * src/frontends/xforms/FormParagraph.h:
1498 * src/frontends/xforms/form_paragraph.C:
1499 * src/frontends/xforms/form_paragraph.h:
1500 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1503 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1505 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1506 Paragraph-Data after use.
1508 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1509 non breakable paragraphs.
1511 2000-09-25 Garst R. Reese <reese@isn.net>
1513 * src/language.C (initL): added missing language_country codes.
1515 2000-09-25 Juergen Vigna <jug@sad.it>
1517 * src/insets/insettext.C (InsetText):
1518 (deleteLyXText): remove the not released LyXText structure!
1520 2000-09-24 Marko Vendelin <markov@ioc.ee>
1522 * src/frontends/gnome/mainapp.C
1523 * src/frontends/gnome/mainapp.h: added support for keyboard
1526 * src/frontends/gnome/FormCitation.C
1527 * src/frontends/gnome/FormCitation.h
1528 * src/frontends/gnome/Makefile.am
1529 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1530 FormCitation to use "action area" in mainapp window
1532 * src/frontends/gnome/Menubar_pimpl.C
1533 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1536 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1538 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1539 width/descent/ascent values if name is empty.
1540 (mathed_string_height): Use std::max.
1542 2000-09-25 Allan Rae <rae@lyx.org>
1544 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1545 segfault. This will be completely redesigned soon.
1547 * sigc++: updated libsigc++. Fixes struct timespec bug.
1549 * development/tools/makeLyXsigc.sh: .cvsignore addition
1551 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1553 * several files: removed almost all traces of the old table
1556 * src/TableLayout.C: removed file
1558 2000-09-22 Juergen Vigna <jug@sad.it>
1560 * src/frontends/kde/Dialogs.C: added credits forms.
1562 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1564 * src/frontends/gnome/Dialogs.C: added some forms.
1566 * src/spellchecker.C (init_spell_checker): set language in pspell code
1567 (RunSpellChecker): some modifications for setting language string.
1569 * src/language.[Ch]: added language_country code.
1571 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1573 * src/frontends/Dialogs.h: added new signal showError.
1574 Rearranged existing signals in some sort of alphabetical order.
1576 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1577 FormError.[Ch], form_error.[Ch]
1578 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1579 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1581 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1582 dialogs. I think that this can be used as the base to all these
1585 * src/frontends/xforms/FormError.[Ch]
1586 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1587 implementation of InsetError dialog.
1589 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1591 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1592 * src/frontends/kde/Makefile.am: ditto
1594 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1596 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1597 macrobf. This fixes a bug of invisible text.
1599 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1601 * lib/doc/LaTeXConfig.lyx.in: updated.
1603 * src/language.C (initL): remove language "francais" and change a
1604 bit the names of the two other french variations.
1606 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1607 string that may not be 0-terminated.
1609 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1611 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1613 2000-09-20 Marko Vendelin <markov@ioc.ee>
1615 * src/frontends/gnome/FormCitation.C
1616 * src/frontends/gnome/FormIndex.C
1617 * src/frontends/gnome/FormToc.C
1618 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1619 the variable initialization to shut up the warnings
1621 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1623 * src/table.[Ch]: deleted files
1625 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1628 2000-09-18 Juergen Vigna <jug@sad.it>
1630 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1631 problems with selection. Inserted new LFUN_PASTESELECTION.
1632 (InsetButtonPress): inserted handling of middle mouse-button paste.
1634 * src/spellchecker.C: changed word to word.c_str().
1636 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1638 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1639 included in the ``make dist'' tarball.
1641 2000-09-15 Juergen Vigna <jug@sad.it>
1643 * src/CutAndPaste.C (cutSelection): small fix return the right
1644 end position after cut inside one paragraph only.
1646 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1647 we are locked as otherwise we don't have a valid cursor position!
1649 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1651 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1653 * src/frontends/kde/FormRef.C: added using directive.
1654 * src/frontends/kde/FormToc.C: ditto
1656 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1658 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1660 2000-09-19 Marko Vendelin <markov@ioc.ee>
1662 * src/frontends/gnome/Menubar_pimpl.C
1663 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1664 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1666 * src/frontends/gnome/mainapp.C
1667 * src/frontends/gnome/mainapp.h: support for menu update used
1670 * src/frontends/gnome/mainapp.C
1671 * src/frontends/gnome/mainapp.h: support for "action" area in the
1672 main window. This area is used by small simple dialogs, such as
1675 * src/frontends/gnome/FormIndex.C
1676 * src/frontends/gnome/FormIndex.h
1677 * src/frontends/gnome/FormUrl.C
1678 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1681 * src/frontends/gnome/FormCitation.C
1682 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1683 action area. Only "Insert new citation" is implemented.
1685 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1687 * src/buffer.C (Dispatch): fix call to Dispatch
1688 * src/insets/insetref.C (Edit): likewise
1689 * src/insets/insetparent.C (Edit): likewise
1690 * src/insets/insetinclude.C (include_cb): likewise
1691 * src/frontends/xforms/FormUrl.C (apply): likewise
1692 * src/frontends/xforms/FormToc.C (apply): likewise
1693 * src/frontends/xforms/FormRef.C (apply): likewise
1694 * src/frontends/xforms/FormIndex.C (apply): likewise
1695 * src/frontends/xforms/FormCitation.C (apply): likewise
1696 * src/lyxserver.C (callback): likewise
1697 * src/lyxfunc.C (processKeySym): likewise
1698 (Dispatch): likewise
1699 (Dispatch): likewise
1700 * src/lyx_cb.C (LayoutsCB): likewise
1702 * Makefile.am (sourcedoc): small change
1704 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1706 * src/main.C (main): Don't make an empty GUIRunTime object. all
1707 methods are static. constify a bit remove unneded using + headers.
1709 * src/tabular.C: some more const to local vars move some loop vars
1711 * src/spellchecker.C: added some c_str after some word for pspell
1713 * src/frontends/GUIRunTime.h: add new static method setDefaults
1714 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1715 * src/frontends/kde/GUIRunTime.C (setDefaults):
1716 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1718 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1719 with strnew in arg, use correct emptystring when calling SetName.
1721 * several files: remove all commented code with relation to
1722 HAVE_SSTREAM beeing false. We now only support stringstream and
1725 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1727 * src/lyxfunc.C: construct correctly the automatic new file
1730 * src/text2.C (IsStringInText): change type of variable i to shut
1733 * src/support/sstream.h: do not use namespaces if the compiler
1734 does not support them.
1736 2000-09-15 Marko Vendelin <markov@ioc.ee>
1737 * src/frontends/gnome/FormCitation.C
1738 * src/frontends/gnome/FormCitation.h
1739 * src/frontends/gnome/diainsertcitation_interface.c
1740 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1741 regexp support to FormCitation [Gnome].
1743 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1746 * configure.in: remove unused KDE/GTKGUI define
1748 * src/frontends/kde/FormRef.C
1749 * src/frontends/kde/FormRef.h
1750 * src/frontends/kde/formrefdialog.C
1751 * src/frontends/kde/formrefdialog.h: double click will
1752 go to reference, now it is possible to change a cross-ref
1755 * src/frontends/kde/FormToc.C
1756 * src/frontends/kde/FormToc.h
1757 * src/frontends/kde/formtocdialog.C
1758 * src/frontends/kde/formtocdialog.h: add a depth
1761 * src/frontends/kde/Makefile.am: add QtLyXView.h
1764 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1766 * src/frontends/kde/FormCitation.h: added some using directives.
1768 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1770 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1773 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1776 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1778 * src/buffer.C (pop_tag): revert for the second time a change by
1779 Lars, who seems to really hate having non-local loop variables :)
1781 * src/Lsstream.h: add "using" statements.
1783 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1784 * src/buffer.C (writeFile): ditto
1786 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1788 * src/buffer.C (writeFile): try to fix the locale modified format
1789 number to always be as we want it.
1791 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1792 in XForms 0.89. C-space is now working again.
1794 * src/Lsstream.h src/support/sstream.h: new files.
1796 * also commented out all cases where strstream were used.
1798 * src/Bullet.h (c_str): remove method.
1800 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1802 * a lot of files: get rid of "char const *" and "char *" is as
1803 many places as possible. We only want to use them in interaction
1804 with system of other libraries, not inside lyx.
1806 * a lot of files: return const object is not of pod type. This
1807 helps ensure that temporary objects is not modified. And fits well
1808 with "programming by contract".
1810 * configure.in: check for the locale header too
1812 * Makefile.am (sourcedoc): new tag for generation of doc++
1815 2000-09-14 Juergen Vigna <jug@sad.it>
1817 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1818 callback to check which combo called it and do the right action.
1820 * src/combox.C (combo_cb): added combo * to the callbacks.
1821 (Hide): moved call of callback after Ungrab of the pointer.
1823 * src/intl.h: removed LCombo2 function.
1825 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1826 function as this can now be handled in one function.
1828 * src/combox.h: added Combox * to callback prototype.
1830 * src/frontends/xforms/Toolbar_pimpl.C:
1831 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1833 2000-09-14 Garst Reese <reese@isn.net>
1835 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1836 moved usepackage{xxx}'s to beginning of file. Changed left margin
1837 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1838 underlining from title. Thanks to John Culleton for useful suggestions.
1840 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1842 * src/lyxlex_pimpl.C (setFile): change error message to debug
1845 2000-09-13 Juergen Vigna <jug@sad.it>
1847 * src/frontends/xforms/FormDocument.C: implemented choice_class
1848 as combox and give callback to combo_language so OK/Apply is activated
1851 * src/bufferlist.C (newFile): small fix so already named files
1852 (via an open call) are not requested to be named again on the
1855 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1857 * src/frontends/kde/Makefile.am
1858 * src/frontends/kde/FormRef.C
1859 * src/frontends/kde/FormRef.h
1860 * src/frontends/kde/formrefdialog.C
1861 * src/frontends/kde/formrefdialog.h: implement
1864 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1866 * src/frontends/kde/formtocdialog.C
1867 * src/frontends/kde/formtocdialog.h
1868 * src/frontends/kde/FormToc.C
1869 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1871 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1873 * src/frontends/kde/FormCitation.C: fix thinko
1874 where we didn't always display the reference text
1877 * src/frontends/kde/formurldialog.C
1878 * src/frontends/kde/formurldialog.h
1879 * src/frontends/kde/FormUrl.C
1880 * src/frontends/kde/FormUrl.h: minor cleanups
1882 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1884 * src/frontends/kde/Makefile.am
1885 * src/frontends/kde/FormToc.C
1886 * src/frontends/kde/FormToc.h
1887 * src/frontends/kde/FormCitation.C
1888 * src/frontends/kde/FormCitation.h
1889 * src/frontends/kde/FormIndex.C
1890 * src/frontends/kde/FormIndex.h
1891 * src/frontends/kde/formtocdialog.C
1892 * src/frontends/kde/formtocdialog.h
1893 * src/frontends/kde/formcitationdialog.C
1894 * src/frontends/kde/formcitationdialog.h
1895 * src/frontends/kde/formindexdialog.C
1896 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1898 2000-09-12 Juergen Vigna <jug@sad.it>
1900 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1903 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1905 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1908 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1910 * src/converter.C (Add, Convert): Added support for converter flags:
1911 needaux, resultdir, resultfile.
1912 (Convert): Added new parameter view_file.
1913 (dvips_options): Fixed letter paper option.
1915 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1916 (Export, GetExportableFormats, GetViewableFormats): Added support
1919 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1921 (easyParse): Fixed to work with new export code.
1923 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1926 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1928 * lib/bind/*.bind: Replaced
1929 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1930 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1932 2000-09-11 Juergen Vigna <jug@sad.it>
1934 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1936 * src/main.C (main): now GUII defines global guiruntime!
1938 * src/frontends/gnome/GUIRunTime.C (initApplication):
1939 * src/frontends/kde/GUIRunTime.C (initApplication):
1940 * src/frontends/xforms/GUIRunTime.C (initApplication):
1941 * src/frontends/GUIRunTime.h: added new function initApplication.
1943 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1945 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1947 2000-09-08 Juergen Vigna <jug@sad.it>
1949 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1950 we have already "Reset".
1952 * src/language.C (initL): inserted "default" language and made this
1953 THE default language (and not american!)
1955 * src/paragraph.C: inserted handling of "default" language!
1957 * src/lyxfont.C: ditto
1961 * src/paragraph.C: output the \\par only if we have a following
1962 paragraph otherwise it's not needed.
1964 2000-09-05 Juergen Vigna <jug@sad.it>
1966 * config/pspell.m4: added entry to lyx-flags
1968 * src/spellchecker.C: modified version from Kevin for using pspell
1970 2000-09-01 Marko Vendelin <markov@ioc.ee>
1971 * src/frontends/gnome/Makefile.am
1972 * src/frontends/gnome/FormCitation.C
1973 * src/frontends/gnome/FormCitation.h
1974 * src/frontends/gnome/diainsertcitation_callbacks.c
1975 * src/frontends/gnome/diainsertcitation_callbacks.h
1976 * src/frontends/gnome/diainsertcitation_interface.c
1977 * src/frontends/gnome/diainsertcitation_interface.h
1978 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1979 dialog for Gnome frontend
1981 * src/main.C: Gnome libraries require keeping application name
1982 and its version as strings
1984 * src/frontends/gnome/mainapp.C: Change the name of the main window
1985 from GnomeLyX to PACKAGE
1987 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1989 * src/frontends/Liason.C: add "using: declaration.
1991 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1993 * src/mathed/math_macro.C (Metrics): Set the size of the template
1995 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1997 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1999 * src/converter.C (add_options): New function.
2000 (SetViewer): Change $$FName into '$$FName'.
2001 (View): Add options when running xdvi
2002 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2003 (Convert): The 3rd parameter is now the desired filename. Converts
2004 calls to lyx::rename if necessary.
2005 Add options when running dvips.
2006 (dvi_papersize,dvips_options): New methods.
2008 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2010 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2011 using a call to Converter::dvips_options.
2012 Fixed to work with nex export code.
2014 * src/support/copy.C
2015 * src/support/rename.C: New files
2017 * src/support/syscall.h
2018 * src/support/syscall.C: Added Starttype SystemDontWait.
2020 * lib/ui/default.ui: Changed to work with new export code
2022 * lib/configure.m4: Changed to work with new export code
2024 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2026 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2028 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2029 so that code compiles with DEC cxx.
2031 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2032 to work correctly! Also now supports the additional elements
2035 2000-09-01 Allan Rae <rae@lyx.org>
2037 * src/frontends/ButtonPolicies.C: renamed all the references to
2038 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2040 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2041 since it's a const not a type.
2043 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2045 2000-08-31 Juergen Vigna <jug@sad.it>
2047 * src/insets/figinset.C: Various changes to look if the filename has
2048 an extension and if not add it for inline previewing.
2050 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2052 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2053 make buttonStatus and isReadOnly be const methods. (also reflect
2054 this in derived classes.)
2056 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2057 (nextState): change to be static inline, pass the StateMachine as
2059 (PreferencesPolicy): remove casts
2060 (OkCancelPolicy): remvoe casts
2061 (OkCancelReadOnlyPolicy): remove casts
2062 (NoRepeatedApplyReadOnlyPolicy): remove casts
2063 (OkApplyCancelReadOnlyPolicy): remove casts
2064 (OkApplyCancelPolicy): remove casts
2065 (NoRepeatedApplyPolicy): remove casts
2067 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2069 * src/converter.C: added some using directives
2071 * src/frontends/ButtonPolicies.C: changes to overcome
2072 "need lvalue" error with DEC c++
2074 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2075 to WMHideCB for DEC c++
2077 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2079 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2080 to BulletBMTableCB for DEC c++
2082 2000-08-31 Allan Rae <rae@lyx.org>
2084 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2085 character dialog separately from old document dialogs combo_language.
2088 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2090 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2091 Removed LFUN_REF_CREATE.
2093 * src/MenuBackend.C: Added new tags: toc and references
2095 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2096 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2098 (add_toc, add_references): New methods.
2099 (create_submenu): Handle correctly the case when there is a
2100 seperator after optional menu items.
2102 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2103 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2104 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2106 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2108 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2110 * src/converter.[Ch]: New file for converting between different
2113 * src/export.[Ch]: New file for exporting a LyX file to different
2116 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2117 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2118 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2119 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2120 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2121 RunDocBook, MenuExport.
2123 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2124 Exporter::Preview methods if NEW_EXPORT is defined.
2126 * src/buffer.C (Dispatch): Use Exporter::Export.
2128 * src/lyxrc.C: Added new tags: \converter and \viewer.
2131 * src/LyXAction.C: Define new lyx-function: buffer-update.
2132 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2133 when NEW_EXPORT is defined.
2135 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2137 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2139 * lib/ui/default.ui: Added submenus "view" and "update" to the
2142 * src/filetools.C (GetExtension): New function.
2144 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2146 2000-08-29 Allan Rae <rae@lyx.org>
2148 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2150 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2151 (EnableDocumentLayout): removed
2152 (DisableDocumentLayout): removed
2153 (build): make use of ButtonController's read-only handling to
2154 de/activate various objects. Replaces both of the above functions.
2156 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2157 (readOnly): was read_only
2158 (refresh): fixed dumb mistakes with read_only_ handling
2160 * src/frontends/xforms/forms/form_document.fd:
2161 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2162 tabbed dialogs so the tabs look more like tabs and so its easier to
2163 work out which is the current tab.
2165 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2166 segfault with form_table
2168 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2170 2000-08-28 Juergen Vigna <jug@sad.it>
2172 * acconfig.h: added USE_PSPELL.
2174 * src/config.h.in: added USE_PSPELL.
2176 * autogen.sh: added pspell.m4
2178 * config/pspell.m4: new file.
2180 * src/spellchecker.C: implemented support for pspell libary.
2182 2000-08-25 Juergen Vigna <jug@sad.it>
2184 * src/LyXAction.C (init): renamed LFUN_TABLE to
2185 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2187 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2189 * src/lyxscreen.h: add force_clear variable and fuction to force
2190 a clear area when redrawing in LyXText.
2192 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2194 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2196 * some whitespace and comment changes.
2198 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2200 * src/buffer.C: up te LYX_FORMAT to 2.17
2202 2000-08-23 Juergen Vigna <jug@sad.it>
2204 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2207 * src/insets/insettabular.C (pasteSelection): delete the insets
2208 LyXText as it is not valid anymore.
2209 (copySelection): new function.
2210 (pasteSelection): new function.
2211 (cutSelection): new function.
2212 (LocalDispatch): implemented cut/copy/paste of cell selections.
2214 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2215 don't have a LyXText.
2217 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2219 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2222 2000-08-22 Juergen Vigna <jug@sad.it>
2224 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2225 ifdef form_table out if NEW_TABULAR.
2227 2000-08-21 Juergen Vigna <jug@sad.it>
2229 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2230 (draw): fixed draw position so that the cursor is positioned in the
2232 (InsetMotionNotify): hide/show cursor so the position is updated.
2233 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2234 using cellstart() function where it should be used.
2236 * src/insets/insettext.C (draw): ditto.
2238 * src/tabular.C: fixed initialization of some missing variables and
2239 made BoxType into an enum.
2241 2000-08-22 Marko Vendelin <markov@ioc.ee>
2242 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2243 stock menu item using action numerical value, not its string
2247 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2249 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2250 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2252 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2254 * src/frontends/xforms/GUIRunTime.C: new file
2256 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2257 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2259 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2261 * src/frontends/kde/GUIRunTime.C: new file
2263 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2264 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2266 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2268 * src/frontends/gnome/GUIRunTime.C: new file
2270 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2273 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2274 small change to documetentation.
2276 * src/frontends/GUIRunTime.C: removed file
2278 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2280 * src/lyxparagraph.h: enable NEW_TABULAR as default
2282 * src/lyxfunc.C (processKeySym): remove some commented code
2284 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2285 NEW_TABULAR around the fd_form_table_options.
2287 * src/lyx_gui.C (runTime): call the static member function as
2288 GUIRunTime::runTime().
2290 2000-08-21 Allan Rae <rae@lyx.org>
2292 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2295 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2297 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2299 2000-08-21 Allan Rae <rae@lyx.org>
2301 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2302 keep Garst happy ;-)
2303 * src/frontends/xforms/FormPreferences.C (build): use setOK
2304 * src/frontends/xforms/FormDocument.C (build): use setOK
2305 (FormDocument): use the appropriate policy.
2307 2000-08-21 Allan Rae <rae@lyx.org>
2309 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2310 automatic [de]activation of arbitrary objects when in a read-only state.
2312 * src/frontends/ButtonPolicies.h: More documentation
2313 (isReadOnly): added to support the above.
2315 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2317 2000-08-18 Juergen Vigna <jug@sad.it>
2319 * src/insets/insettabular.C (getStatus): changed to return func_status.
2321 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2322 display toggle menu entries if they are.
2324 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2325 new document layout now.
2327 * src/lyxfunc.C: ditto
2329 * src/lyx_gui_misc.C: ditto
2331 * src/lyx_gui.C: ditto
2333 * lib/ui/default.ui: removed paper and quotes layout as they are now
2334 all in the document layout tabbed folder.
2336 * src/frontends/xforms/forms/form_document.fd: added Restore
2337 button and callbacks for all inputs for Allan's ButtonPolicy.
2339 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2340 (CheckChoiceClass): added missing params setting on class change.
2341 (UpdateLayoutDocument): added for updating the layout on params.
2342 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2343 (FormDocument): Implemented Allan's ButtonPolicy with the
2346 2000-08-17 Allan Rae <rae@lyx.org>
2348 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2349 so we can at least see the credits again.
2351 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2352 controller calls for the appropriate callbacks. Note that since Ok
2353 calls apply followed by cancel, and apply isn't a valid input for the
2354 APPLIED state, the bc_ calls have to be made in the static callback not
2355 within each of the real callbacks.
2357 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2358 (setOk): renamed from setOkay()
2360 2000-08-17 Juergen Vigna <jug@sad.it>
2362 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2363 in the implementation part.
2364 (composeUIInfo): don't show optional menu-items.
2366 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2368 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2370 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2371 text-state when in a text-inset.
2373 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2375 2000-08-17 Marko Vendelin <markov@ioc.ee>
2376 * src/frontends/gnome/FormIndex.C
2377 * src/frontends/gnome/FormIndex.h
2378 * src/frontends/gnome/FormToc.C
2379 * src/frontends/gnome/FormToc.h
2380 * src/frontends/gnome/dialogs
2381 * src/frontends/gnome/diatoc_callbacks.c
2382 * src/frontends/gnome/diatoc_callbacks.h
2383 * src/frontends/gnome/diainsertindex_callbacks.h
2384 * src/frontends/gnome/diainsertindex_callbacks.c
2385 * src/frontends/gnome/diainsertindex_interface.c
2386 * src/frontends/gnome/diainsertindex_interface.h
2387 * src/frontends/gnome/diatoc_interface.h
2388 * src/frontends/gnome/diatoc_interface.c
2389 * src/frontends/gnome/Makefile.am: Table of Contents and
2390 Insert Index dialogs implementation for Gnome frontend
2392 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2394 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2396 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2399 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2401 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2402 destructor. Don't definde if you don't need it
2403 (processEvents): made static, non-blocking events processing for
2405 (runTime): static method. event loop for xforms
2406 * similar as above for kde and gnome.
2408 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2409 new Pimpl is correct
2410 (runTime): new method calss the real frontends runtime func.
2412 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2414 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2416 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2418 2000-08-16 Juergen Vigna <jug@sad.it>
2420 * src/lyx_gui.C (runTime): added GUII RunTime support.
2422 * src/frontends/Makefile.am:
2423 * src/frontends/GUIRunTime.[Ch]:
2424 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2425 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2426 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2428 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2430 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2431 as this is already set in ${FRONTEND_INCLUDE} if needed.
2433 * configure.in (CPPFLAGS): setting the include dir for the frontend
2434 directory and don't set FRONTEND=xforms for now as this is executed
2437 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2439 * src/frontends/kde/Makefile.am:
2440 * src/frontends/kde/FormUrl.C:
2441 * src/frontends/kde/FormUrl.h:
2442 * src/frontends/kde/formurldialog.h:
2443 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2445 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2447 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2449 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2451 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2454 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2456 * src/WorkArea.C (work_area_handler): more work to get te
2457 FL_KEYBOARD to work with xforms 0.88 too, please test.
2459 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2461 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2463 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2466 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2468 * src/Timeout.h: remove Qt::emit hack.
2470 * several files: changes to allo doc++ compilation
2472 * src/lyxfunc.C (processKeySym): new method
2473 (processKeyEvent): comment out if FL_REVISION < 89
2475 * src/WorkArea.C: change some debugging levels.
2476 (WorkArea): set wantkey to FL_KEY_ALL
2477 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2478 clearer code and the use of compose with XForms 0.89. Change to
2479 use signals instead of calling methods in bufferview directly.
2481 * src/Painter.C: change some debugging levels.
2483 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2486 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2487 (workAreaKeyPress): new method
2489 2000-08-14 Juergen Vigna <jug@sad.it>
2491 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2493 * config/kde.m4: addes some features
2495 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2496 include missing xforms dialogs.
2498 * src/Timeout.h: a hack to be able to compile with qt/kde.
2500 * sigc++/.cvsignore: added acinclude.m4
2502 * lib/.cvsignore: added listerros
2504 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2505 xforms tree as objects are needed for other frontends.
2507 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2508 linking with not yet implemented xforms objects.
2510 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2512 2000-08-14 Baruch Even <baruch.even@writeme.com>
2514 * src/frontends/xforms/FormGraphics.h:
2515 * src/frontends/xforms/FormGraphics.C:
2516 * src/frontends/xforms/RadioButtonGroup.h:
2517 * src/frontends/xforms/RadioButtonGroup.C:
2518 * src/insets/insetgraphics.h:
2519 * src/insets/insetgraphics.C:
2520 * src/insets/insetgraphicsParams.h:
2521 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2522 instead of spaces, and various other indentation issues to make the
2523 sources more consistent.
2525 2000-08-14 Marko Vendelin <markov@ioc.ee>
2527 * src/frontends/gnome/dialogs/diaprint.glade
2528 * src/frontends/gnome/FormPrint.C
2529 * src/frontends/gnome/FormPrint.h
2530 * src/frontends/gnome/diaprint_callbacks.c
2531 * src/frontends/gnome/diaprint_callbacks.h
2532 * src/frontends/gnome/diaprint_interface.c
2533 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2536 * src/frontends/gnome/dialogs/diainserturl.glade
2537 * src/frontends/gnome/FormUrl.C
2538 * src/frontends/gnome/FormUrl.h
2539 * src/frontends/gnome/diainserturl_callbacks.c
2540 * src/frontends/gnome/diainserturl_callbacks.h
2541 * src/frontends/gnome/diainserturl_interface.c
2542 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2543 Gnome implementation
2545 * src/frontends/gnome/Dialogs.C
2546 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2547 all other dialogs. Copy all unimplemented dialogs from Xforms
2550 * src/frontends/gnome/support.c
2551 * src/frontends/gnome/support.h: support files generated by Glade
2555 * config/gnome.m4: Gnome configuration scripts
2557 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2558 configure --help message
2560 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2561 only if there are no events pendling in Gnome/Gtk. This enhances
2562 the performance of menus.
2565 2000-08-14 Allan Rae <rae@lyx.org>
2567 * lib/Makefile.am: listerrors cleaning
2569 * lib/listerrors: removed -- generated file
2570 * acinclude.m4: ditto
2571 * sigc++/acinclude.m4: ditto
2573 * src/frontends/xforms/forms/form_citation.fd:
2574 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2577 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2578 `updatesrc` and now we have a `test` target that does what `updatesrc`
2579 used to do. I didn't like having an install target that wasn't related
2582 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2583 on all except FormGraphics. This may yet happen. Followed by a major
2584 cleanup including using FL_TRANSIENT for most of the dialogs. More
2585 changes to come when the ButtonController below is introduced.
2587 * src/frontends/xforms/ButtonController.h: New file for managing up to
2588 four buttons on a dialog according to an externally defined policy.
2589 * src/frontends/xforms/Makefile.am: added above
2591 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2592 Apply and Cancel/Close buttons and everything in between and beyond.
2593 * src/frontends/Makefile.am: added above.
2595 * src/frontends/xforms/forms/form_preferences.fd:
2596 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2597 and removed variable 'status' as a result. Fixed the set_minsize thing.
2598 Use the new screen-font-update after checking screen fonts were changed
2599 Added a "Restore" button to restore the original lyxrc values while
2600 editing. This restores everything not just the last input changed.
2601 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2603 * src/LyXAction.C: screen-font-update added for updating buffers after
2604 screen font settings have been changed.
2605 * src/commandtags.h: ditto
2606 * src/lyxfunc.C: ditto
2608 * forms/lyx.fd: removed screen fonts dialog.
2609 * src/lyx_gui.C: ditto
2610 * src/menus.[Ch]: ditto
2611 * src/lyx.[Ch]: ditto
2612 * src/lyx_cb.C: ditto + code from here moved to make
2613 screen-font-update. And people wonder why progress on GUII is
2614 slow. Look at how scattered this stuff was! It takes forever
2617 * forms/fdfix.sh: Fixup the spacing after commas.
2618 * forms/makefile: Remove date from generated files. Fewer clashes now.
2619 * forms/bullet_forms.C.patch: included someones handwritten changes
2621 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2622 once I've discovered why LyXRC was made noncopyable.
2623 * src/lyx_main.C: ditto
2625 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2627 * src/frontends/xforms/forms/fdfix.sh:
2628 * src/frontends/xforms/forms/fdfixh.sed:
2629 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2630 * src/frontends/xforms/Form*.[hC]:
2631 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2632 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2633 provide a destructor for the struct FD_form_xxxx. Another version of
2634 the set_[max|min]size workaround and a few other cleanups. Actually,
2635 Angus' patch from 20000809.
2637 2000-08-13 Baruch Even <baruch.even@writeme.com>
2639 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2642 2000-08-11 Juergen Vigna <jug@sad.it>
2644 * src/insets/insetgraphics.C (InsetGraphics): changing init
2645 order because of warnings.
2647 * src/frontends/xforms/forms/makefile: adding patching .C with
2650 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2651 from .C.patch to .c.patch
2653 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2654 order because of warning.
2656 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2658 * src/frontends/Liason.C (setMinibuffer): new helper function
2660 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2662 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2664 * lib/ui/default.ui: commented out PaperLayout entry
2666 * src/frontends/xforms/form_document.[Ch]: new added files
2668 * src/frontends/xforms/FormDocument.[Ch]: ditto
2670 * src/frontends/xforms/forms/form_document.fd: ditto
2672 * src/frontends/xforms/forms/form_document.C.patch: ditto
2674 2000-08-10 Juergen Vigna <jug@sad.it>
2676 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2677 (InsetGraphics): initialized cacheHandle to 0.
2678 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2680 2000-08-10 Baruch Even <baruch.even@writeme.com>
2682 * src/graphics/GraphicsCache.h:
2683 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2684 correctly as a cache.
2686 * src/graphics/GraphicsCacheItem.h:
2687 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2690 * src/graphics/GraphicsCacheItem_pimpl.h:
2691 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2694 * src/insets/insetgraphics.h:
2695 * src/insets/insetgraphics.C: Changed from using a signal notification
2696 to polling when image is not loaded.
2698 2000-08-10 Allan Rae <rae@lyx.org>
2700 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2701 that there are two functions that have to been taken out of line by
2702 hand and aren't taken care of in the script. (Just a reminder note)
2704 * sigc++/macros/*.h.m4: Updated as above.
2706 2000-08-09 Juergen Vigna <jug@sad.it>
2708 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2710 * src/insets/insettabular.C: make drawing of single cell smarter.
2712 2000-08-09 Marko Vendelin <markov@ioc.ee>
2713 * src/frontends/gnome/Menubar_pimpl.C
2714 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2715 implementation: new files
2717 * src/frontends/gnome/mainapp.C
2718 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2721 * src/main.C: create Gnome main window
2723 * src/frontends/xforms/Menubar_pimpl.h
2724 * src/frontends/Menubar.C
2725 * src/frontends/Menubar.h: added method Menubar::update that calls
2726 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2728 * src/LyXView.C: calls Menubar::update to update the state
2731 * src/frontends/gnome/Makefile.am: added new files
2733 * src/frontends/Makefile.am: added frontend compiler options
2735 2000-08-08 Juergen Vigna <jug@sad.it>
2737 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2739 * src/bufferlist.C (close):
2740 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2741 documents if exiting without saving.
2743 * src/buffer.C (save): use removeAutosaveFile()
2745 * src/support/filetools.C (removeAutosaveFile): new function.
2747 * src/lyx_cb.C (MenuWrite): returns a bool now.
2748 (MenuWriteAs): check if file could really be saved and revert to the
2750 (MenuWriteAs): removing old autosavefile if existant.
2752 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2753 before Goto toggle declaration, because of compiler warning.
2755 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2757 * src/lyxfunc.C (MenuNew): small fix.
2759 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2761 * src/bufferlist.C (newFile):
2762 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2764 * src/lyxrc.C: added new_ask_filename tag
2766 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2768 * src/lyx.fd: removed code pertaining to form_ref
2769 * src/lyx.[Ch]: ditto
2770 * src/lyx_cb.C: ditto
2771 * src/lyx_gui.C: ditto
2772 * src/lyx_gui_misc.C: ditto
2774 * src/BufferView_pimpl.C (restorePosition): update buffer only
2777 * src/commandtags.h (LFUN_REFTOGGLE): removed
2778 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2779 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2780 (LFUN_REFBACK): renamed LFUN_REF_BACK
2782 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2783 * src/menus.C: ditto
2784 * src/lyxfunc.C (Dispatch): ditto.
2785 InsertRef dialog is now GUI-independent.
2787 * src/texrow.C: added using std::endl;
2789 * src/insets/insetref.[Ch]: strip out large amounts of code.
2790 The inset is now a container and this functionality is now
2791 managed by a new FormRef dialog
2793 * src/frontends/Dialogs.h (showRef, createRef): new signals
2795 * src/frontends/xforms/FormIndex.[Ch],
2796 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2797 when setting dialog's min/max size
2798 * src/frontends/xforms/FormIndex.[Ch]: ditto
2800 * src/frontends/xforms/FormRef.[Ch],
2801 src/frontends/xforms/forms/form_ref.fd: new xforms
2802 implementation of an InsetRef dialog
2804 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2807 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2808 ios::nocreate is not part of the standard. Removed.
2810 2000-08-07 Baruch Even <baruch.even@writeme.com>
2812 * src/graphics/Renderer.h:
2813 * src/graphics/Renderer.C: Added base class for rendering of different
2814 image formats into Pixmaps.
2816 * src/graphics/XPM_Renderer.h:
2817 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2818 in a different class.
2820 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2821 easily add support for other formats.
2823 * src/insets/figinset.C: plugged a leak of an X resource.
2825 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2827 * src/CutAndPaste.[Ch]: make all metods static.
2829 * development/Code_rules/Rules: more work, added section on
2830 Exceptions, and a References section.
2832 * a lot of header files: work to make doc++ able to generate the
2833 source documentation, some workarounds of doc++ problems. Doc++ is
2834 now able to generate the documentation.
2836 2000-08-07 Juergen Vigna <jug@sad.it>
2838 * src/insets/insettabular.C (recomputeTextInsets): removed function
2840 * src/tabular.C (SetWidthOfMulticolCell):
2842 (calculate_width_of_column_NMC): fixed return value so that it really
2843 only returns true if the column-width has changed (there where
2844 problems with muliticolumn-cells in this column).
2846 2000-08-04 Juergen Vigna <jug@sad.it>
2848 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2849 also on the scrollstatus of the inset.
2850 (workAreaMotionNotify): ditto.
2852 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2854 2000-08-01 Juergen Vigna <jug@sad.it>
2856 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2858 * src/commandtags.h:
2859 * src/LyXAction.C (init):
2860 * src/insets/inset.C (LocalDispatch): added support for
2863 * src/insets/inset.C (scroll): new functions.
2865 * src/insets/insettext.C (removeNewlines): new function.
2866 (SetAutoBreakRows): removes forced newlines in the text of the
2867 paragraph if autoBreakRows is set to false.
2869 * src/tabular.C (Latex): generates a parbox around the cell contents
2872 * src/frontends/xforms/FormTabular.C (local_update): removed
2873 the radio_useparbox button.
2875 * src/tabular.C (UseParbox): new function
2877 2000-08-06 Baruch Even <baruch.even@writeme.com>
2879 * src/graphics/GraphicsCache.h:
2880 * src/graphics/GraphicsCache.C:
2881 * src/graphics/GraphicsCacheItem.h:
2882 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2885 * src/insets/insetgraphics.h:
2886 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
2887 and the drawing of the inline image.
2889 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
2890 loaded into the wrong position.
2892 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2895 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2897 * src/support/translator.h: move all typedefs to public section
2899 * src/support/filetools.C (MakeLatexName): return string const
2901 (TmpFileName): ditto
2902 (FileOpenSearch): ditto
2904 (LibFileSearch): ditto
2905 (i18nLibFileSearch): ditto
2908 (CreateTmpDir): ditto
2909 (CreateBufferTmpDir): ditto
2910 (CreateLyXTmpDir): ditto
2913 (MakeAbsPath): ditto
2915 (OnlyFilename): ditto
2917 (NormalizePath): ditto
2918 (CleanupPath): ditto
2919 (GetFileContents): ditto
2920 (ReplaceEnvironmentPath): ditto
2921 (MakeRelPath): ditto
2923 (ChangeExtension): ditto
2924 (MakeDisplayPath): ditto
2925 (do_popen): return cmdret const
2926 (findtexfile): return string const
2928 * src/support/DebugStream.h: add some /// to please doc++
2930 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2932 * src/texrow.C (same_rownumber): functor to use with find_if
2933 (getIdFromRow): rewritten to use find_if and to not update the
2934 positions. return true if row is found
2935 (increasePos): new method, use to update positions
2937 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2939 * src/lyxlex_pimpl.C (verifyTable): new method
2942 (GetString): return string const
2943 (pushTable): rewrite to use std::stack
2945 (setFile): better check
2948 * src/lyxlex.h: make LyXLex noncopyable
2950 * src/lyxlex.C (text): return char const * const
2951 (GetString): return string const
2952 (getLongString): return string const
2954 * src/lyx_gui_misc.C (askForText): return pair<...> const
2956 * src/lastfiles.[Ch] (operator): return string const
2958 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2959 istringstream not char const *.
2960 move token.end() out of loop.
2961 (readFile): move initializaton of token
2963 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2964 getIdFromRow is successful.
2966 * lib/bind/emacs.bind: don't include menus bind
2968 * development/Code_rules/Rules: the beginnings of making this
2969 better and covering more of the unwritten rules that we have.
2971 * development/Code_rules/Recommendations: a couple of wording
2974 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2976 * src/support/strerror.c: remove C++ comment.
2978 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2980 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2981 LFUN_INDEX_INSERT_LAST
2983 * src/texrow.C (getIdFromRow): changed from const_iterator to
2984 iterator, allowing code to compile with DEC cxx
2986 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2987 stores part of the class, as suggested by Allan. Will allow
2989 (apply): test to apply uses InsetCommandParams operator!=
2991 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2992 (apply): test to apply uses InsetCommandParams operator!=
2994 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2995 stores part of the class.
2996 (update): removed limits on min/max size.
2998 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2999 (apply): test to apply uses InsetCommandParams operator!=
3001 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3002 (Read, Write, scanCommand, getCommand): moved functionality
3003 into InsetCommandParams.
3005 (getScreenLabel): made pure virtual
3006 new InsetCommandParams operators== and !=
3008 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3009 c-tors based on InsetCommandParams. Removed others.
3010 * src/insets/insetinclude.[Ch]: ditto
3011 * src/insets/insetlabel.[Ch]: ditto
3012 * src/insets/insetparent.[Ch]: ditto
3013 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3015 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3016 insets derived from InsetCommand created using similar c-tors
3017 based on InsetCommandParams
3018 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3019 * src/menus.C (ShowRefsMenu): ditto
3020 * src/paragraph.C (Clone): ditto
3021 * src/text2.C (SetCounter): ditto
3022 * src/lyxfunc.C (Dispatch) ditto
3023 Also recreated old InsetIndex behaviour exactly. Can now
3024 index-insert at the start of a paragraph and index-insert-last
3025 without launching the pop-up.
3027 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3029 * lib/lyxrc.example: mark te pdf options as non functional.
3031 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3032 (isStrDbl): move tmpstr.end() out of loop.
3033 (strToDbl): move intialization of tmpstr
3034 (lowercase): return string const and move tmp.end() out of loop.
3035 (uppercase): return string const and move tmp.edn() out of loop.
3036 (prefixIs): add assertion
3041 (containsOnly): ditto
3042 (containsOnly): ditto
3043 (containsOnly): ditto
3044 (countChar): make last arg char not char const
3045 (token): return string const
3046 (subst): return string const, move tmp.end() out of loop.
3047 (subst): return string const, add assertion
3048 (strip): return string const
3049 (frontStrip): return string const, add assertion
3050 (frontStrip): return string const
3055 * src/support/lstrings.C: add inclde "LAssert.h"
3056 (isStrInt): move tmpstr.end() out of loop.
3058 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3059 toollist.end() out of loop.
3060 (deactivate): move toollist.end() out of loop.
3061 (update): move toollist.end() out of loop.
3062 (updateLayoutList): move tc.end() out of loop.
3063 (add): move toollist.end() out of loop.
3065 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3066 md.end() out of loop.
3068 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3070 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3073 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3074 (Erase): move insetlist.end() out of loop.
3076 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3077 ref to const string as first arg. Move initialization of some
3078 variables, whitespace changes.
3080 * src/kbmap.C (defkey): move table.end() out of loop.
3081 (kb_keymap): move table.end() out of loop.
3082 (findbinding): move table.end() out of loop.
3084 * src/MenuBackend.C (hasMenu): move end() out of loop.
3085 (getMenu): move end() out of loop.
3086 (getMenu): move menulist_.end() out of loop.
3088 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3090 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3093 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3094 (getFromLyXName): move infotab.end() out of loop.
3096 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3097 -fvtable-thunks -ffunction-sections -fdata-sections
3099 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3101 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3104 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3106 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3108 * src/frontends/xforms/FormCitation.[Ch],
3109 src/frontends/xforms/FormIndex.[Ch],
3110 src/frontends/xforms/FormToc.[Ch],
3111 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3113 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3115 * src/commandtags.h: renamed, created some flags for citation
3118 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3120 * src/lyxfunc.C (dispatch): use signals to insert index entry
3122 * src/frontends/Dialogs.h: new signal createIndex
3124 * src/frontends/xforms/FormCommand.[Ch],
3125 src/frontends/xforms/FormCitation.[Ch],
3126 src/frontends/xforms/FormToc.[Ch],
3127 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3129 * src/insets/insetindex.[Ch]: GUI-independent
3131 * src/frontends/xforms/FormIndex.[Ch],
3132 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3135 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3137 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3138 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3140 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3142 * src/insets/insetref.C (Latex): rewrite so that there is now
3143 question that a initialization is requested.
3145 * src/insets/insetcommand.h: reenable the hide signal
3147 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3149 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3150 fix handling of shortcuts (many bugs :)
3151 (add_lastfiles): ditto.
3153 * lib/ui/default.ui: fix a few shortcuts.
3155 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3157 * Makefile.am: Fix ``rpmdist'' target to return the exit
3158 status of the ``rpm'' command, instead of the last command in
3159 the chain (the ``rm lyx.xpm'' command, which always returns
3162 2000-08-02 Allan Rae <rae@lyx.org>
3164 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3165 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3166 * src/frontends/xforms/FormToc.C (FormToc): ditto
3168 * src/frontends/xforms/Makefile.am: A few forgotten files
3170 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3171 Signals-not-copyable-problem Lars' started commenting out.
3173 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3175 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3177 * src/insets/insetcommand.h: Signals is not copyable so anoter
3178 scheme for automatic hiding of forms must be used.
3180 * src/frontends/xforms/FormCitation.h: don't inerit from
3181 noncopyable, FormCommand already does that.
3182 * src/frontends/xforms/FormToc.h: ditto
3183 * src/frontends/xforms/FormUrl.h: ditto
3185 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3187 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3189 * src/insets/insetcommand.h (hide): new SigC::Signal0
3190 (d-tor) new virtual destructor emits hide signal
3192 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3193 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3195 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3196 LOF and LOT. Inset is now GUI-independent
3198 * src/insets/insetloa.[Ch]: redundant
3199 * src/insets/insetlof.[Ch]: ditto
3200 * src/insets/insetlot.[Ch]: ditto
3202 * src/frontends/xforms/forms/form_url.fd: tweaked!
3203 * src/frontends/xforms/forms/form_citation.fd: ditto
3205 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3206 dialogs dealing with InsetCommand insets
3208 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3209 FormCommand base class
3210 * src/frontends/xforms/FormUrl.[Ch]: ditto
3212 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3214 * src/frontends/xforms/FormToc.[Ch]: ditto
3216 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3217 passed a generic InsetCommand pointer
3218 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3220 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3221 and modified InsetTOC class
3222 * src/buffer.C: ditto
3224 * forms/lyx.fd: strip out old FD_form_toc code
3225 * src/lyx_gui_misc.C: ditto
3226 * src/lyx_gui.C: ditto
3227 * src/lyx_cb.C: ditto
3228 * src/lyx.[Ch]: ditto
3230 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3232 * src/support/utility.hpp: tr -d '\r'
3234 2000-08-01 Juergen Vigna <jug@sad.it>
3236 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3238 * src/commandtags.h:
3239 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3240 LFUN_TABULAR_FEATURES.
3242 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3243 LFUN_LAYOUT_TABULAR.
3245 * src/insets/insettabular.C (getStatus): implemented helper function.
3247 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3249 2000-07-31 Juergen Vigna <jug@sad.it>
3251 * src/text.C (draw): fixed screen update problem for text-insets.
3253 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3254 something changed probably this has to be added in various other
3257 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3259 2000-07-31 Baruch Even <baruch.even@writeme.com>
3261 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3262 templates to satisfy compaq cxx.
3265 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3267 * src/support/translator.h (equal_1st_in_pair::operator()): take
3268 const ref pair_type as arg.
3269 (equal_2nd_in_pair::operator()): ditto
3270 (Translator::~Translator): remove empty d-tor.
3272 * src/graphics/GraphicsCache.C: move include config.h to top, also
3273 put initialization of GraphicsCache::singleton here.
3274 (~GraphicsCache): move here
3275 (addFile): take const ref as arg
3278 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3280 * src/BufferView2.C (insertLyXFile): change te with/without header
3283 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3285 * src/frontends/xforms/FormGraphics.C (apply): add some
3286 static_cast. Not very nice, but required by compaq cxx.
3288 * src/frontends/xforms/RadioButtonGroup.h: include header
3289 <utility> instead of <pair.h>
3291 * src/insets/insetgraphicsParams.C: add using directive.
3292 (readResize): change return type to void.
3293 (readOrigin): ditto.
3295 * src/lyxfunc.C (getStatus): add missing break for build-program
3296 function; add test for Literate for export functions.
3298 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3299 entries in Options menu.
3301 2000-07-31 Baruch Even <baruch.even@writeme.com>
3303 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3304 protect against auto-allocation; release icon when needed.
3306 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3308 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3309 on usual typewriter.
3311 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3312 earlier czech.kmap), useful only for programming.
3314 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3316 * src/frontends/xforms/FormCitation.h: fix conditioning around
3319 2000-07-31 Juergen Vigna <jug@sad.it>
3321 * src/frontends/xforms/FormTabular.C (local_update): changed
3322 radio_linebreaks to radio_useparbox and added radio_useminipage.
3324 * src/tabular.C: made support for using minipages/parboxes.
3326 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3328 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3330 (descent): so the cursor is in the middle.
3331 (width): bit smaller box.
3333 * src/insets/insetgraphics.h: added display() function.
3335 2000-07-31 Baruch Even <baruch.even@writeme.com>
3337 * src/frontends/Dialogs.h: Added showGraphics signals.
3339 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3340 xforms form definition of the graphics dialog.
3342 * src/frontends/xforms/FormGraphics.h:
3343 * src/frontends/xforms/FormGraphics.C: Added files, the
3344 GUIndependent code of InsetGraphics
3346 * src/insets/insetgraphics.h:
3347 * src/insets/insetgraphics.C: Major writing to make it work.
3349 * src/insets/insetgraphicsParams.h:
3350 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3351 struct between InsetGraphics and GUI.
3353 * src/LaTeXFeatures.h:
3354 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3355 support for graphicx package.
3357 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3358 for the graphics inset.
3360 * src/support/translator.h: Added file, used in
3361 InsetGraphicsParams. this is a template to translate between two
3364 * src/frontends/xforms/RadioButtonGroup.h:
3365 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3366 way to easily control a radio button group.
3368 2000-07-28 Juergen Vigna <jug@sad.it>
3370 * src/insets/insettabular.C (LocalDispatch):
3371 (TabularFeatures): added support for lyx-functions of tabular features.
3372 (cellstart): refixed this function after someone wrongly changed it.
3374 * src/commandtags.h:
3375 * src/LyXAction.C (init): added support for tabular-features
3377 2000-07-28 Allan Rae <rae@lyx.org>
3379 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3380 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3381 triggers the callback for input checking. As a result we sometimes get
3382 "LyX: This shouldn't happen..." printed to cerr.
3383 (input): Started using status variable since I only free() on
3384 destruction. Some input checking for paths and font sizes.
3386 * src/frontends/xforms/FormPreferences.h: Use status to control
3387 activation of Ok and Apply
3389 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3390 callback. Also resized to stop segfaults with 0.88. The problem is
3391 that xforms-0.88 requires the folder to be wide enough to fit all the
3392 tabs. If it isn't it causes all sorts of problems.
3394 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3396 * src/frontends/xforms/forms/README: Reflect reality.
3398 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3399 * src/frontends/xforms/forms/makefile: ditto.
3401 * src/commandtags.h: Get access to new Preferences dialog
3402 * src/LyXAction.C: ditto
3403 * src/lyxfunc.C: ditto
3404 * lib/ui/default.ui: ditto
3406 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3408 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3410 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3413 * src/frontends/xforms/form_url.[Ch]: added.
3415 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3417 * src/insets/insetbib.h: fixed bug in previous commit
3419 * src/frontends/xforms/FormUrl.h: ditto
3421 * src/frontends/xforms/FormPrint.h: ditto
3423 * src/frontends/xforms/FormPreferences.h: ditto
3425 * src/frontends/xforms/FormCopyright.h: ditto
3427 * src/frontends/xforms/FormCitation.C: ditto
3429 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3430 private copyconstructor and private default contructor
3432 * src/support/Makefile.am: add utility.hpp
3434 * src/support/utility.hpp: new file from boost
3436 * src/insets/insetbib.h: set owner in clone
3438 * src/frontends/xforms/FormCitation.C: added missing include
3441 * src/insets/form_url.[Ch]: removed
3443 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3445 * development/lyx.spec.in
3446 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3447 file/directory re-organization.
3449 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3451 * src/insets/insetcommand.[Ch]: moved the string data and
3452 associated manipulation methods into a new stand-alone class
3453 InsetCommandParams. This class has two additional methods
3454 getAsString() and setFromString() allowing the contents to be
3455 moved around as a single string.
3456 (addContents) method removed.
3457 (setContents) method no longer virtual.
3459 * src/buffer.C (readInset): made use of new InsetCitation,
3460 InsetUrl constructors based on InsetCommandParams.
3462 * src/commandtags.h: add LFUN_INSERT_URL
3464 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3465 independent InsetUrl and use InsetCommandParams to extract
3466 string info and create new Insets.
3468 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3470 * src/frontends/xforms/FormCitation.C (apply): uses
3473 * src/frontends/xforms/form_url.C
3474 * src/frontends/xforms/form_url.h
3475 * src/frontends/xforms/FormUrl.h
3476 * src/frontends/xforms/FormUrl.C
3477 * src/frontends/xforms/forms/form_url.fd: new files
3479 * src/insets/insetcite.[Ch]: removed unused constructors.
3481 * src/insets/insetinclude.[Ch]: no longer store filename
3483 * src/insets/inseturl.[Ch]: GUI-independent.
3485 2000-07-26 Juergen Vigna <jug@sad.it>
3486 * renamed frontend from gtk to gnome as it is that what is realized
3487 and did the necessary changes in the files.
3489 2000-07-26 Marko Vendelin <markov@ioc.ee>
3491 * configure.in: cleaning up gnome configuration scripts
3493 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3495 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3496 shortcuts syndrom by redrawing them explicitely (a better solution
3497 would be appreciated).
3499 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3501 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3504 * src/lyx_cb.C (MenuExport): change html export to do the right
3505 thing depending of the document type (instead of having
3506 html-linuxdoc and html-docbook).
3507 * src/lyxfunc.C (getStatus): update for html
3508 * lib/ui/default.ui: simplify due to the above change.
3509 * src/menus.C (ShowFileMenu): update too (in case we need it).
3511 * src/MenuBackend.C (read): if a menu is defined twice, add the
3512 new entries to the exiting one.
3514 2000-07-26 Juergen Vigna <jug@sad.it>
3516 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3518 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3519 and return a bool if it did actual save the file.
3520 (AutoSave): don't autosave a unnamed doc.
3522 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3523 check if this is an UNNAMED new file and react to it.
3524 (newFile): set buffer to unnamed and change to not mark a new
3525 buffer dirty if I didn't do anything with it.
3527 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3529 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3531 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3532 friend as per Angus's patch posted to lyx-devel.
3534 * src/ext_l10n.h: updated
3536 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3537 gettext on the style string right before inserting them into the
3540 * autogen.sh: add code to extract style strings form layout files,
3541 not good enough yet.
3543 * src/frontends/gtk/.cvsignore: add MAKEFILE
3545 * src/MenuBackend.C (read): run the label strings through gettext
3546 before storing them in the containers.
3548 * src/ext_l10n.h: new file
3550 * autogen.sh : generate the ext_l10n.h file here
3552 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3554 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3557 * lib/ui/default.ui: fix a couple of typos.
3559 * config/gnome/gtk.m4: added (and added to the list of files in
3562 * src/insets/insetinclude.C (unique_id): fix when we are using
3563 lyxstring instead of basic_string<>.
3564 * src/insets/insettext.C (LocalDispatch): ditto.
3565 * src/support/filetools.C: ditto.
3567 * lib/configure.m4: create the ui/ directory if necessary.
3569 * src/LyXView.[Ch] (updateToolbar): new method.
3571 * src/BufferView_pimpl.C (buffer): update the toolbar when
3572 opening/closing buffer.
3574 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3576 * src/LyXAction.C (getActionName): enhance to return also the name
3577 and options of pseudo-actions.
3578 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3580 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3581 as an example of what is possible). Used in File->Build too (more
3582 useful) and in the import/export menus (to mimick the complicated
3583 handling of linuxdoc and friends). Try to update all the entries.
3585 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3588 * src/MenuBackend.C (read): Parse the new OptItem tag.
3590 * src/MenuBackend.h: Add a new optional_ data member (used if the
3591 entry should be omitted when the lyxfunc is disabled).
3593 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3594 function, used as a shortcut.
3595 (create_submenu): align correctly the shortcuts on the widest
3598 * src/MenuBackend.h: MenuItem.label() only returns the label of
3599 the menu without shortcut; new method shortcut().
3601 2000-07-14 Marko Vendelin <markov@ioc.ee>
3603 * src/frontends/gtk/Dialogs.C:
3604 * src/frontends/gtk/FormCopyright.C:
3605 * src/frontends/gtk/FormCopyright.h:
3606 * src/frontends/gtk/Makefile.am: added these source-files for the
3607 Gtk/Gnome support of the Copyright-Dialog.
3609 * src/main.C: added Gnome::Main initialization if using
3610 Gtk/Gnome frontend-GUI.
3612 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3614 * config/gnome/aclocal-include.m4
3615 * config/gnome/compiler-flags.m4
3616 * config/gnome/curses.m4
3617 * config/gnome/gnome--.m4
3618 * config/gnome/gnome-bonobo-check.m4
3619 * config/gnome/gnome-common.m4
3620 * config/gnome/gnome-fileutils.m4
3621 * config/gnome/gnome-ghttp-check.m4
3622 * config/gnome/gnome-gnorba-check.m4
3623 * config/gnome/gnome-guile-checks.m4
3624 * config/gnome/gnome-libgtop-check.m4
3625 * config/gnome/gnome-objc-checks.m4
3626 * config/gnome/gnome-orbit-check.m4
3627 * config/gnome/gnome-print-check.m4
3628 * config/gnome/gnome-pthread-check.m4
3629 * config/gnome/gnome-support.m4
3630 * config/gnome/gnome-undelfs.m4
3631 * config/gnome/gnome-vfs.m4
3632 * config/gnome/gnome-x-checks.m4
3633 * config/gnome/gnome-xml-check.m4
3634 * config/gnome/gnome.m4
3635 * config/gnome/gperf-check.m4
3636 * config/gnome/gtk--.m4
3637 * config/gnome/linger.m4
3638 * config/gnome/need-declaration.m4: added configuration scripts
3639 for Gtk/Gnome frontend-GUI
3641 * configure.in: added support for the --with-frontend=gtk option
3643 * autogen.sh: added config/gnome/* to list of config-files
3645 * acconfig.h: added define for GTKGUI-support
3647 * config/lyxinclude.m4: added --with-frontend[=value] option value
3648 for Gtk/Gnome frontend-GUI support.
3650 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3652 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3656 * src/paragraph.C (GetChar): remove non-const version
3658 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3659 (search_kw): use it.
3661 * src/lyx_main.C (init): if "preferences" exist, read that instead
3663 (ReadRcFile): return bool if the file could be read ok.
3664 (ReadUIFile): add a check to see if lex file is set ok.
3666 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3667 bastring can be used instead of lyxstring (still uses the old code
3668 if std::string is good enough or if lyxstring is used.)
3670 * src/encoding.C: make the arrays static, move ininle functions
3672 * src/encoding.h: from here.
3674 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3675 (parseSingleLyXformat2Token): move inset parsing to separate method
3676 (readInset): new private method
3678 * src/Variables.h: remove virtual from get().
3680 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3681 access to NEW_INSETS and NEW_TABULAR
3683 * src/MenuBackend.h: remove superfluous forward declaration of
3684 MenuItem. Add documentations tags "///", remove empty MenuItem
3685 destructor, remove private default contructor.
3687 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3689 (read): more string mlabel and mname to where they are used
3690 (read): remove unused variables mlabel and mname
3691 (defaults): unconditional clear, make menusetup take advantage of
3692 add returning Menu &.
3694 * src/LyXView.h: define NEW_MENUBAR as default
3696 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3697 to NEW_INSETS and NEW_TABULAR.
3698 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3699 defined. Change some of the "xxxx-inset-insert" functions names to
3702 * several files: more enahncements to NEW_INSETS and the resulting
3705 * lib/lyxrc.example (\date_insert_format): move to misc section
3707 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3708 bastring and use AC_CACHE_CHECK.
3709 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3710 the system have the newest methods. uses AC_CACHE_CHECK
3711 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3712 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3713 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3715 * configure.in: add LYX_CXX_GOOD_STD_STRING
3717 * acinclude.m4: recreated
3719 2000-07-24 Amir Karger <karger@lyx.org>
3721 * README: add Hebrew, Arabic kmaps
3724 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3726 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3729 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3731 * Lot of files: add pragma interface/implementation.
3733 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3735 * lib/ui/default.ui: new file (ans new directory). Contains the
3736 default menu and toolbar.
3738 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3739 global space. Toolbars are now read (as menus) in ui files.
3741 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3743 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3744 is disabled because the document is read-only. We want to have the
3745 toggle state of the function anyway.
3746 (getStatus): add code for LFUN_VC* functions (mimicking what is
3747 done in old-style menus)
3749 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3750 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3752 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3753 * src/BufferView_pimpl.C: ditto.
3754 * src/lyxfunc.C: ditto.
3756 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3757 default). This replaces old-style menus by new ones.
3759 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3760 MenuItem. Contain the data structure of a menu.
3762 * src/insets/insettext.C: use LyXView::setLayout instead of
3763 accessing directly the toolbar combox.
3764 * src/lyxfunc.C (Dispatch): ditto.
3766 * src/LyXView.C (setLayout): new method, which just calls
3767 Toolbar::setLayout().
3768 (updateLayoutChoice): move part of this method in Toolbar.
3770 * src/toolbar.[Ch]: removed.
3772 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3773 implementation the toolbar.
3775 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3776 the toolbar. It might make sense to merge it with ToolbarDefaults
3778 (setLayout): new function.
3779 (updateLayoutList): ditto.
3780 (openLayoutList): ditto.
3782 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3783 xforms implementation of the toolbar.
3784 (get_toolbar_func): comment out, since I do not
3785 know what it is good for.
3787 * src/ToolbarDefaults.h: Add the ItemType enum.
3789 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3790 for a list of allocated C strings. Used in Menubar xforms
3791 implementation to avoid memory leaks.
3793 * src/support/lstrings.[Ch] (uppercase): new version taking and
3797 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3798 * lib/bind/emacs.bind: ditto.
3800 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3802 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3803 forward decl of LyXView.
3805 * src/toolbar.C (toolbarItem): moved from toolbar.h
3806 (toolbarItem::clean): ditto
3807 (toolbarItem::~toolbarItem): ditto
3808 (toolbarItem::operator): ditto
3810 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3812 * src/paragraph.h: control the NEW_TABULAR define from here
3814 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3815 USE_TABULAR_INSETS to NEW_TABULAR
3817 * src/ToolbarDefaults.C: add include "lyxlex.h"
3819 * files using the old table/tabular: use NEW_TABULAR to control
3820 compilation of old tabular stuff.
3822 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3825 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3826 planemet in reading of old style floats, fix the \end_deeper
3827 problem when reading old style floats.
3829 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3831 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3833 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3835 * lib/bind/sciword.bind: updated.
3837 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3839 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3840 layout write problem
3842 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3844 * src/Makefile.am (INCLUDES): remove image directory from include
3847 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3848 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3850 * src/LyXView.C (create_form_form_main): read the application icon
3853 * lib/images/*.xpm: change the icons to use transparent color for
3856 * src/toolbar.C (update): change the color of the button when it
3859 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3861 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3862 setting explicitely the minibuffer.
3863 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3865 * src/LyXView.C (showState): new function. Shows font information
3866 in minibuffer and update toolbar state.
3867 (LyXView): call Toolbar::update after creating the
3870 * src/toolbar.C: change toollist to be a vector instead of a
3872 (BubbleTimerCB): get help string directly from the callback
3873 argument of the corresponding icon (which is the action)
3874 (set): remove unnecessary ugliness.
3875 (update): new function. update the icons (depressed, disabled)
3876 depending of the status of the corresponding action.
3878 * src/toolbar.h: remove help in toolbarItem
3880 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3882 * src/Painter.C (text): Added code for using symbol glyphs from
3883 iso10646 fonts. Currently diabled.
3885 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3888 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3889 magyar,turkish and usorbian.
3891 * src/paragraph.C (isMultiLingual): Made more efficient.
3893 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3896 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3897 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3898 Also changed the prototype to "bool math_insert_greek(char)".
3900 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3902 * lots of files: apply the NEW_INSETS on all code that will not be
3903 needed when we move to use the new insets. Enable the define in
3904 lyxparagrah.h to try it.
3906 * src/insets/insettabular.C (cellstart): change to be a static
3908 (InsetTabular): initialize buffer in the initializer list.
3910 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3912 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3913 form_print.h out of the header file. Replaced with forward
3914 declarations of the relevant struct.
3916 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3919 * src/commandtags.h: do not include "debug.h" which does not
3920 belong there. #include it in some other places because of this
3923 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3925 * src/insets/insetcaption.C: add a couple "using" directives.
3927 * src/toolbar.C (add): get the help text directly from lyxaction.
3929 (setPixmap): new function. Loads from disk and sets a pixmap on a
3930 botton; the name of the pixmap file is derived from the command
3933 * src/toolbar.h: remove members isBitmap and pixmap from
3936 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3937 * lib/images/: move many files from images/banner.xpm.
3939 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3941 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3942 * src/toolbar.C: ditto.
3943 * configure.in: ditto.
3944 * INSTALL: document.
3946 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3947 the spellchecker popup is closed from the WM.
3949 2000-07-19 Juergen Vigna <jug@sad.it>
3951 * src/insets/insetfloat.C (Write): small fix because we use the
3952 insetname for the type now!
3954 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3956 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3959 * src/frontends/Dialogs.h: removed hideCitation signal
3961 * src/insets/insetcite.h: added hide signal
3963 * src/insets/insetcite.C (~InsetCitation): emits new signal
3964 (getScreenLabel): "intelligent" label should now fit on the screen!
3966 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3968 * src/frontends/xforms/FormCitation.C (showInset): connects
3969 hide() to the inset's hide signal
3970 (show): modified to use fl_set_object_position rather than
3971 fl_set_object_geometry wherever possible
3973 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3975 * src/insets/lyxinset.h: add caption code
3977 * src/insets/insetfloat.C (type): new method
3979 * src/insets/insetcaption.C (Write): new method
3981 (LyxCode): new method
3983 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3984 to get it right together with using the FloatList.
3986 * src/commandtags.h: add LFUN_INSET_CAPTION
3987 * src/lyxfunc.C (Dispatch): handle it
3989 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3992 * src/Variables.[Ch]: make expand take a const reference, remove
3993 the destructor, some whitespace changes.
3995 * src/LyXAction.C (init): add caption-inset-insert
3997 * src/FloatList.C (FloatList): update the default floats a bit.
3999 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4001 * src/Variables.[Ch]: new files. Intended to be used for language
4002 specific strings (like \chaptername) and filename substitution in
4005 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4007 * lib/kbd/american.kmap: update
4009 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4011 * src/bufferparams.[Ch]: remove member allowAccents.
4013 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4015 * src/LaTeXLog.C: use the log_form.h header.
4016 * src/lyx_gui.C: ditto.
4017 * src/lyx_gui_misc.C: ditto.
4018 * src/lyxvc.h: ditto.
4020 * forms/log_form.fd: new file, created from latexoptions.fd. I
4021 kept the log popup and nuked the options form.
4023 * src/{la,}texoptions.[Ch]: removed.
4024 * src/lyx_cb.C (LaTeXOptions): ditto
4026 * src/lyx_gui.C (create_forms): do not handle the
4027 fd_latex_options form.
4029 2000-07-18 Juergen Vigna <jug@sad.it>
4031 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4032 name of the inset so that it can be requested outside (text2.C).
4034 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4037 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4039 * src/mathed/formula.h (ConvertFont): constify
4041 * src/mathed/formula.C (Read): add warning if \end_inset is not
4042 found on expected place.
4044 * src/insets/lyxinset.h (ConvertFont): consify
4046 * src/insets/insetquotes.C (ConvertFont): constify
4047 * src/insets/insetquotes.h: ditto
4049 * src/insets/insetinfo.h: add labelfont
4051 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4052 (ascent): use labelfont
4056 (Write): make .lyx file a bit nicer
4058 * src/insets/insetfloat.C (Write): simplify somewhat...
4059 (Read): add warning if arg is not found
4061 * src/insets/insetcollapsable.C: add using std::max
4062 (Read): move string token and add warning in arg is not found
4063 (draw): use std::max to get the right ty
4064 (getMaxWidth): simplify by using std::max
4066 * src/insets/insetsection.h: new file
4067 * src/insets/insetsection.C: new file
4068 * src/insets/insetcaption.h: new file
4069 * src/insets/insetcaption.C: new file
4071 * src/insets/inset.C (ConvertFont): constify signature
4073 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4074 insetcaption.[Ch] and insetsection.[Ch]
4076 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4077 uses to use LABEL_COUNTER_CHAPTER instead.
4078 * src/text2.C (SetCounter): here
4080 * src/counters.h: new file
4081 * src/counters.C: new file
4082 * src/Sectioning.h: new file
4083 * src/Sectioning.C: new file
4085 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4087 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4089 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4092 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4095 2000-07-17 Juergen Vigna <jug@sad.it>
4097 * src/tabular.C (Validate): check if array-package is needed.
4098 (SetVAlignment): added support for vertical alignment.
4099 (SetLTFoot): better support for longtable header/footers
4100 (Latex): modified to support added features.
4102 * src/LaTeXFeatures.[Ch]: added array-package.
4104 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4106 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4109 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4111 * configure.in: do not forget to put a space after -isystem.
4113 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4115 * lib/kbd/arabic.kmap: a few fixes.
4117 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4119 * some whitespace chagnes to a number of files.
4121 * src/support/DebugStream.h: change to make it easier for
4122 doc++ to parse correctly.
4123 * src/support/lyxstring.h: ditto
4125 * src/mathed/math_utils.C (compara): change to have only one
4127 (MathedLookupBOP): change because of the above.
4129 * src/mathed/math_delim.C (math_deco_compare): change to have only
4131 (search_deco): change becasue of the above.
4133 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4134 instead of manually coded one.
4136 * src/insets/insetquotes.C (Read): read the \end_inset too
4138 * src/insets/insetlatex.h: remove file
4139 * src/insets/insetlatex.C: remove file
4141 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4143 (InsetPrintIndex): remove destructor
4145 * src/insets/insetinclude.h: remove default constructor
4147 * src/insets/insetfloat.C: work to make it work better
4149 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4151 * src/insets/insetcite.h (InsetCitation): remove default constructor
4153 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4155 * src/text.C (GetColumnNearX): comment out some currently unused code.
4157 * src/paragraph.C (writeFile): move some initializations closer to
4159 (CutIntoMinibuffer): small change to use new matchIT operator
4163 (InsertInset): ditto
4166 (InsetIterator): ditto
4167 (Erase): small change to use new matchFT operator
4169 (GetFontSettings): ditto
4170 (HighestFontInRange): ditto
4173 * src/lyxparagraph.h: some chars changed to value_type
4174 (matchIT): because of some stronger checking (perhaps too strong)
4175 in SGI STL, the two operator() unified to one.
4178 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4180 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4181 the last inset read added
4182 (parseSingleLyXformat2Token): some more (future) compability code added
4183 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4184 (parseSingleLyXformat2Token): set last_inset_read
4185 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4186 (parseSingleLyXformat2Token): don't double intializw string next_token
4188 * src/TextCache.C (text_fits::operator()): add const's to the signature
4189 (has_buffer::operator()): ditto
4191 * src/Floating.h: add some comments on the class
4193 * src/FloatList.[Ch] (typeExist): new method
4196 * src/BackStack.h: added default constructor, wanted by Gcc.
4198 2000-07-14 Juergen Vigna <jug@sad.it>
4200 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4202 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4204 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4205 do a redraw when the window is resized!
4206 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4208 * src/insets/insettext.C (resizeLyXText): added function to correctly
4209 being able to resize the LyXWindow.
4211 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4213 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4215 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4216 crashes when closing dialog to a deleted inset.
4218 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4219 method! Now similar to other insets.
4221 2000-07-13 Juergen Vigna <jug@sad.it>
4223 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4225 * lib/examples/Literate.lyx: small patch!
4227 * src/insets/insetbib.C (Read): added this function because of wrong
4228 Write (without [begin|end]_inset).
4230 2000-07-11 Juergen Vigna <jug@sad.it>
4232 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4233 as the insertInset could not be good!
4235 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4236 the bool param should not be last.
4238 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4240 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4241 did submit that to Karl).
4243 * configure.in: use -isystem instead of -I for X headers. This
4244 fixes a problem on solaris with a recent gcc;
4245 put the front-end code after the X detection code;
4246 configure in sigc++ before lib/
4248 * src/lyx_main.C (commandLineHelp): remove -display from command
4251 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4253 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4254 Also put in Makefile rules for building the ``listerrors''
4255 program for parsing errors from literate programs written in LyX.
4257 * lib/build-listerrors: Added small shell script as part of compile
4258 process. This builds a working ``listerrors'' binary if noweb is
4259 installed and either 1) the VNC X server is installed on the machine,
4260 or 2) the user is compiling from within a GUI. The existence of a GUI
4261 is necessary to use the ``lyx --export'' feature for now. This
4262 hack can be removed once ``lyx --export'' no longer requires a GUI to
4265 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4267 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4268 now passed back correctly from gcc and placed "under" error
4269 buttons in a Literate LyX source.
4271 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4273 * src/text.C (GetColumnNearX): Better behavior when a RTL
4274 paragraph is ended by LTR text.
4276 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4279 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4281 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4282 true when clipboard is empty.
4284 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4286 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4287 row of the paragraph.
4288 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4289 to prevent calculation of bidi tables
4291 2000-07-07 Juergen Vigna <jug@sad.it>
4293 * src/screen.C (ToggleSelection): added y_offset and x_offset
4296 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4299 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4301 * src/insets/insettext.C: fixed Layout-Display!
4303 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4305 * configure.in: add check for strings.h header.
4307 * src/spellchecker.C: include <strings.h> in order to have a
4308 definition for bzero().
4310 2000-07-07 Juergen Vigna <jug@sad.it>
4312 * src/insets/insettext.C (draw): set the status of the bv->text to
4313 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4315 * src/screen.C (DrawOneRow):
4316 (DrawFromTo): redraw the actual row if something has changed in it
4319 * src/text.C (draw): call an update of the toplevel-inset if something
4320 has changed inside while drawing.
4322 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4324 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4326 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4327 processing inside class.
4329 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4330 processing inside class.
4332 * src/insets/insetindex.h new struct Holder, consistent with other
4335 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4336 citation dialog from main code and placed it in src/frontends/xforms.
4337 Dialog launched through signals instead of callbacks
4339 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4341 * lyx.man: update the options description.
4343 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4345 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4346 handle neg values, set min width to 590, add doc about -display
4348 2000-07-05 Juergen Vigna <jug@sad.it>
4350 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4351 calls to BufferView *.
4353 * src/insets/insettext.C (checkAndActivateInset): small fix non
4354 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4356 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4357 their \end_inset token!
4359 2000-07-04 edscott <edscott@imp.mx>
4361 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4362 lib/lyxrc.example: added option \wheel_jump
4364 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4366 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4367 remove support for -width,-height,-xpos and -ypos.
4369 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4371 * src/encoding.[Ch]: New files.
4373 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4374 (text): Call to the underline() method only when needed.
4376 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4378 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4379 encoding(s) for the document.
4381 * src/bufferparams.C (BufferParams): Changed default value of
4384 * src/language.C (newLang): Removed.
4385 (items[]): Added encoding information for all defined languages.
4387 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4388 encoding choice button.
4390 * src/lyxrc.h (font_norm_type): New member variable.
4391 (set_font_norm_type): New method.
4393 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4394 paragraphs with different encodings.
4396 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4397 (TransformChar): Changed to work correctly with Arabic points.
4398 (draw): Added support for drawing Arabic points.
4399 (draw): Removed code for drawing underbars (this is done by
4402 * src/support/textutils.h (IsPrintableNonspace): New function.
4404 * src/BufferView_pimpl.h: Added "using SigC::Object".
4405 * src/LyXView.h: ditto.
4407 * src/insets/insetinclude.h (include_label): Changed to mutable.
4409 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4411 * src/mathed/math_iter.h: remove empty destructor
4413 * src/mathed/math_cursor.h: remove empty destructor
4415 * src/insets/lyxinset.h: add THEOREM_CODE
4417 * src/insets/insettheorem.[Ch]: new files
4419 * src/insets/insetminipage.C: (InsertInset): remove
4421 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4423 (InsertInset): remove
4425 * src/insets/insetlist.C: (InsertList): remove
4427 * src/insets/insetfootlike.[Ch]: new files
4429 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4432 (InsertInset): ditto
4434 * src/insets/insetert.C: remove include Painter.h, reindent
4435 (InsertInset): move to header
4437 * src/insets/insetcollapsable.h: remove explicit from default
4438 contructor, remove empty destructor, add InsertInset
4440 * src/insets/insetcollapsable.C (InsertInset): new func
4442 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4444 * src/vspace.h: add explicit to constructor
4446 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4447 \textcompwordmark, please test this.
4449 * src/lyxrc.C: set ascii_linelen to 65 by default
4451 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4453 * src/commandtags.h: add LFUN_INSET_THEOREM
4455 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4456 (makeLinuxDocFile): remove _some_ of the nice logic
4457 (makeDocBookFile): ditto
4459 * src/Painter.[Ch]: (~Painter): removed
4461 * src/LyXAction.C (init): entry for insettheorem added
4463 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4465 (deplog): code to detect files generated by LaTeX, needs testing
4468 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4470 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4472 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4474 * src/LaTeX.C (deplog): Add a check for files that are going to be
4475 created by the first latex run, part of the project to remove the
4478 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4479 contents to the extension list.
4481 2000-07-04 Juergen Vigna <jug@sad.it>
4483 * src/text.C (NextBreakPoint): added support for needFullRow()
4485 * src/insets/lyxinset.h: added needFullRow()
4487 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4490 * src/insets/insettext.C: lots of changes for update!
4492 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4494 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4496 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4498 * src/insets/insetinclude.C (InsetInclude): fixed
4499 initialization of include_label.
4500 (unique_id): now returns a string.
4502 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4504 * src/LaTeXFeatures.h: new member IncludedFiles, for
4505 a map of key, included file name.
4507 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4508 with the included files for inclusion in SGML preamble,
4509 i. e., linuxdoc and docbook.
4512 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4513 nice (is the generated linuxdoc code to be exported?), that
4514 allows to remove column, and only_body that will be true for
4515 slave documents. Insets are allowed inside SGML font type.
4516 New handling of the SGML preamble for included files.
4517 (makeDocBookFile): the same for docbook.
4519 * src/insets/insetinclude.h:
4520 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4522 (DocBook): new export methods.
4524 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4525 and makeDocBookFile.
4527 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4528 formats to export with command line argument -x.
4530 2000-06-29 Juergen Vigna <jug@sad.it>
4532 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4533 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4535 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4536 region could already been cleared by an inset!
4538 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4540 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4543 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4545 (cursorToggle): remove special handling of lyx focus.
4547 2000-06-28 Juergen Vigna <jug@sad.it>
4549 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4552 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4554 * src/insets/insetindex.C (Edit): add a callback when popup is
4557 * src/insets/insettext.C (LocalDispatch):
4558 * src/insets/insetmarginal.h:
4559 * src/insets/insetlist.h:
4560 * src/insets/insetfoot.h:
4561 * src/insets/insetfloat.h:
4562 * src/insets/insetert.h: add a missing std:: qualifier.
4564 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4566 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4569 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4571 * src/insets/insettext.C (Read): remove tmptok unused variable
4572 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4573 (InsertInset): change for new InsetInset code
4575 * src/insets/insettext.h: add TEXT inline method
4577 * src/insets/insettext.C: remove TEXT macro
4579 * src/insets/insetmarginal.C (Write): new method
4580 (Latex): change output slightly
4582 * src/insets/insetfoot.C (Write): new method
4583 (Latex): change output slightly (don't use endl when no need)
4585 * src/insets/insetert.C (Write): new method
4587 * src/insets/insetcollapsable.h: make button_length, button_top_y
4588 and button_bottm_y protected.
4590 * src/insets/insetcollapsable.C (Write): simplify code by using
4591 tostr. Also do not output the float name, the children class
4592 should to that to get control over own arguments
4594 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4595 src/insets/insetminipage.[Ch]:
4598 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4600 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4602 * src/Makefile.am (lyx_SOURCES): add the new files
4604 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4605 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4606 * src/commandtags.h: ditto
4608 * src/LaTeXFeatures.h: add a std::set of used floattypes
4610 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4612 * src/FloatList.[Ch] src/Floating.h: new files
4614 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4616 * src/lyx_cb.C (TableApplyCB): ditto
4618 * src/text2.C: ditto
4619 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4620 (parseSingleLyXformat2Token): ditto + add code for
4621 backwards compability for old float styles + add code for new insets
4623 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4625 (InsertInset(size_type, Inset *, LyXFont)): new method
4626 (InsetChar(size_type, char)): changed to use the other InsetChar
4627 with a LyXFont(ALL_INHERIT).
4628 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4629 insert the META_INSET.
4631 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4633 * sigc++/thread.h (Threads): from here
4635 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4636 definition out of line
4637 * sigc++/scope.h: from here
4639 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4641 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4642 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4644 * Makefile.am (bindist): new target.
4646 * INSTALL: add instructions for doing a binary distribution.
4648 * development/tools/README.bin.example: update a bit.
4650 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4653 * lib/lyxrc.example: new lyxrc tag \set_color.
4655 * src/lyxfunc.C (Dispatch):
4656 * src/commandtags.h:
4657 * src/LyXAction.C: new lyxfunc "set-color".
4659 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4660 and an x11name given as strings.
4662 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4663 cache when a color is changed.
4665 2000-06-26 Juergen Vigna <jug@sad.it>
4667 * src/lyxrow.C (width): added this functions and variable.
4669 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4672 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4674 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4676 * images/undo_bw.xpm: new icon.
4677 * images/redo_bw.xpm: ditto.
4679 * configure.in (INSTALL_SCRIPT): change value to
4680 ${INSTALL} to avoid failures of install-script target.
4681 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4683 * src/BufferView.h: add a magic "friend" declaration to please
4686 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4688 * forms/cite.fd: modified to allow resizing without messing
4691 * src/insetcite.C: Uses code from cite.fd almost without
4693 User can now resize dialog in the x-direction.
4694 Resizing the dialog in the y-direction is prevented, as the
4695 code does this intelligently already.
4697 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4699 * INSTALL: remove obsolete entry in "problems" section.
4701 * lib/examples/sl_*.lyx: update of the slovenian examples.
4703 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4705 2000-06-23 Juergen Vigna <jug@sad.it>
4707 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4709 * src/buffer.C (resize): delete the LyXText of textinsets.
4711 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4713 * src/insets/lyxinset.h: added another parameter 'cleared' to
4714 the draw() function.
4716 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4717 unlocking inset in inset.
4719 2000-06-22 Juergen Vigna <jug@sad.it>
4721 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4722 of insets and moved first to LyXText.
4724 * src/mathed/formulamacro.[Ch]:
4725 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4727 2000-06-21 Juergen Vigna <jug@sad.it>
4729 * src/text.C (GetVisibleRow): look if I should clear the area or not
4730 using Inset::doClearArea() function.
4732 * src/insets/lyxinset.h: added doClearArea() function and
4733 modified draw(Painter &, ...) to draw(BufferView *, ...)
4735 * src/text2.C (UpdateInset): return bool insted of int
4737 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4739 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4740 combox in the character popup
4742 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4743 BufferParams const & params
4745 2000-06-20 Juergen Vigna <jug@sad.it>
4747 * src/insets/insettext.C (SetParagraphData): set insetowner on
4750 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4752 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4753 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4755 (form_main_): remove
4757 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4758 (create_form_form_main): remove FD_form_main stuff, connect to
4759 autosave_timeout signal
4761 * src/LyXView.[Ch] (getMainForm): remove
4762 (UpdateTimerCB): remove
4763 * src/BufferView_pimpl.h: inherit from SigC::Object
4765 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4766 signal instead of callback
4768 * src/BufferView.[Ch] (cursorToggleCB): remove
4770 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4772 * src/BufferView_pimpl.C: changes because of the one below
4774 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4775 instead of storing a pointer to a LyXText.
4777 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4779 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4781 * src/lyxparagraph.h
4783 * src/paragraph.C: Changed fontlist to a sorted vector.
4785 2000-06-19 Juergen Vigna <jug@sad.it>
4787 * src/BufferView.h: added screen() function.
4789 * src/insets/insettext.C (LocalDispatch): some selection code
4792 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4794 * src/insets/insettext.C (SetParagraphData):
4796 (InsetText): fixes for multiple paragraphs.
4798 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4800 * development/lyx.spec.in: Call configure with ``--without-warnings''
4801 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4802 This should be fine, however, since we generally don't want to be
4803 verbose when making an RPM.
4805 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4807 * lib/scripts/fig2pstex.py: New file
4809 2000-06-16 Juergen Vigna <jug@sad.it>
4811 * src/insets/insettabular.C (UpdateLocal):
4812 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4813 (LocalDispatch): Changed all functions to use LyXText.
4815 2000-06-15 Juergen Vigna <jug@sad.it>
4817 * src/text.C (SetHeightOfRow): call inset::update before requesting
4820 * src/insets/insettext.C (update):
4821 * src/insets/insettabular.C (update): added implementation
4823 * src/insets/lyxinset.h: added update function
4825 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4827 * src/text.C (SelectNextWord): protect against null pointers with
4828 old-style string streams. (fix from Paul Theo Gonciari
4831 * src/cite.[Ch]: remove erroneous files.
4833 * lib/configure.m4: update the list of created directories.
4835 * src/lyxrow.C: include <config.h>
4836 * src/lyxcursor.C: ditto.
4838 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4840 * lib/examples/decimal.lyx: new example file from Mike.
4842 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4843 to find template definitions (from Dekel)
4845 * src/frontends/.cvsignore: add a few things.
4847 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4849 * src/Timeout.C (TimeOut): remove default argument.
4851 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4854 * src/insets/ExternalTemplate.C: add a "using" directive.
4856 * src/lyx_main.h: remove the act_ struct, which seems unused
4859 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4861 * LyX Developers Meeting: All files changed, due to random C++ (by
4862 coincidence) code generator script.
4864 - external inset (cool!)
4865 - initial online editing of preferences
4866 - insettabular breaks insettext(s contents)
4868 - some DocBook fixes
4869 - example files update
4870 - other cool stuff, create a diff and look for yourself.
4872 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4874 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4875 -1 this is a non-line-breaking textinset.
4877 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4878 if there is no width set.
4880 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4882 * Lots of files: Merged the dialogbase branch.
4884 2000-06-09 Allan Rae <rae@lyx.org>
4886 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4887 and the Dispatch methods that used it.
4889 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4890 access to functions formerly kept in Dispatch.
4892 2000-05-19 Allan Rae <rae@lyx.org>
4894 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4895 made to_page and count_copies integers again. from_page remains a
4896 string however because I want to allow entry of a print range like
4897 "1,4,22-25" using this field.
4899 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4900 and printer-params-get. These aren't useful from the minibuffer but
4901 could be used by a script/LyXServer app provided it passes a suitable
4902 auto_mem_buffer. I guess I should take a look at how the LyXServer
4903 works and make it support xtl buffers.
4905 * sigc++/: updated to libsigc++-1.0.1
4907 * src/xtl/: updated to xtl-1.3.pl.11
4909 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4910 those changes done to the files in src/ are actually recreated when
4911 they get regenerated. Please don't ever accept a patch that changes a
4912 dialog unless that patch includes the changes to the corresponding *.fd
4915 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4916 stringOnlyContains, renamed it and generalised it.
4918 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4919 branch. Removed the remaining old form_print code.
4921 2000-04-26 Allan Rae <rae@lyx.org>
4923 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4924 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4926 2000-04-25 Allan Rae <rae@lyx.org>
4928 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4929 against a base of xtl-1.3.pl.4
4931 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4932 filter the Id: entries so they still show the xtl version number
4935 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4936 into the src/xtl code. Patch still pending with José (XTL)
4938 2000-04-24 Allan Rae <rae@lyx.org>
4940 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4941 both more generic and much safer. Use the new template functions.
4942 * src/buffer.[Ch] (Dispatch): ditto.
4944 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4945 and mem buffer more intelligently. Also a little general cleanup.
4948 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4949 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4950 * src/xtl/Makefile.am: ditto.
4951 * src/xtl/.cvsignore: ditto.
4952 * src/Makefile.am: ditto.
4954 * src/PrinterParams.h: Removed the macros member functions. Added a
4955 testInvariant member function. A bit of tidying up and commenting.
4956 Included Angus's idea for fixing operation with egcs-1.1.2.
4958 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4959 cool expansion of XTL's mem_buffer to support automatic memory
4960 management within the buffer itself. Removed the various macros and
4961 replaced them with template functions that use either auto_mem_buffer
4962 or mem_buffer depending on a #define. The mem_buffer support will
4963 disappear as soon as the auto_mem_buffer is confirmed to be good on
4964 other platforms/compilers. That is, it's there so you've got something
4967 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4968 effectively forked XTL. However I expect José will include my code
4969 into the next major release. Also fixed a memory leak.
4970 * src/xtl/text.h: ditto.
4971 * src/xtl/xdr.h: ditto.
4972 * src/xtl/giop.h: ditto.
4974 2000-04-16 Allan Rae <rae@lyx.org>
4976 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4977 by autogen.sh and removed by maintainer-clean anyway.
4978 * .cvsignore, sigc++/.cvsignore: Support the above.
4980 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4982 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4984 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4985 macros, renamed static callback-target member functions to suit new
4986 scheme and made them public.
4987 * src/frontends/xforms/forms/form_print.fd: ditto.
4988 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4990 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4993 * src/xtl/: New directory containing a minimal distribution of XTL.
4994 This is XTL-1.3.pl.4.
4996 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4998 2000-04-15 Allan Rae <rae@lyx.org>
5000 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5002 * sigc++/: Updated to libsigc++-1.0.0
5004 2000-04-14 Allan Rae <rae@lyx.org>
5006 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5007 use the generic ones in future. I'll modify my conversion script.
5009 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5011 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5012 (CloseAllBufferRelatedDialogs): Renamed.
5013 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5015 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5016 of the generic ones. These are the same ones my conversion script
5019 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5020 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5021 * src/buffer.C (Dispatch): ditto
5023 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5024 functions for updating and hiding buffer dependent dialogs.
5025 * src/BufferView.C (buffer): ditto
5026 * src/buffer.C (setReadonly): ditto
5027 * src/lyxfunc.C (CloseBuffer): ditto
5029 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5030 Dialogs.h, and hence all the SigC stuff, into every file that includes
5031 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5033 * src/BufferView2.C: reduce the number of headers included by buffer.h
5035 2000-04-11 Allan Rae <rae@lyx.org>
5037 * src/frontends/xforms/xform_macros.h: A small collection of macros
5038 for building C callbacks.
5040 * src/frontends/xforms/Makefile.am: Added above file.
5042 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5043 scheme again. This time it should work for JMarc. If this is
5044 successful I'll revise my conversion script to automate some of this.
5045 The static member functions in the class also have to be public for
5046 this scheme will work. If the scheme works (it's almost identical to
5047 the way BufferView::cursorToggleCB is handled so it should work) then
5048 FormCopyright and FormPrint will be ready for inclusion into the main
5049 trunk immediately after 1.1.5 is released -- provided we're prepared
5050 for complaints about lame compilers not handling XTL.
5052 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5054 2000-04-07 Allan Rae <rae@lyx.org>
5056 * config/lyxinclude.m4: A bit more tidying up (Angus)
5058 * src/LString.h: JMarc's <string> header fix
5060 * src/PrinterParams.h: Used string for most data to remove some
5061 ugly code in the Print dialog and avoid even uglier code when
5062 appending the ints to a string for output.
5064 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5065 and moved "default:" back to the end of switch statement. Cleaned
5066 up the printing so it uses the right function calls and so the
5067 "print to file" option actually puts the file in the right directory.
5069 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5071 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5072 and Ok+Apply button control into a separate method: input (Angus).
5073 (input) Cleaned it up and improved it to be very thorough now.
5074 (All CB) static_cast used instead of C style cast (Angus). This will
5075 probably change again once we've worked out how to keep gcc-2.8.1 happy
5076 with real C callbacks.
5077 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5078 ignore some of the bool settings and has random numbers instead. Needs
5079 some more investigation. Added other input length checks and checking
5080 of file and printer names.
5082 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5083 would link (Angus). Seems the old code doesn't compile with the pragma
5084 statement either. Separated callback entries from internal methods.
5086 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5088 2000-03-17 Allan Rae <rae@lyx.org>
5090 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5091 need it? Maybe it could go in Dialogs instead? I could make it a
5092 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5093 values to get the bool return value.
5094 (Dispatch): New overloaded method for xtl support.
5096 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5097 extern "C" callback instead of static member functions. Hopefully,
5098 JMarc will be able to compile this. I haven't changed
5099 forms/form_copyright.fd yet. Breaking one of my own rules already.
5101 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5102 because they aren't useful from the minibuffer. Maybe a LyXServer
5103 might want a help message though?
5105 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5107 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5108 xtl which needs both rtti and exceptions.
5110 * src/support/Makefile.am:
5111 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5113 * src/frontends/xforms/input_validators.[ch]: input filters and
5114 validators. These conrol what keys are valid in input boxes.
5115 Use them and write some more. Much better idea than waiting till
5116 after the user has pressed Ok to say that the input fields don't make
5119 * src/frontends/xforms/Makefile.am:
5120 * src/frontends/xforms/forms/form_print.fd:
5121 * src/frontends/xforms/forms/makefile:
5122 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5123 new scheme. Still have to make sure I haven't missed anything from
5124 the current implementation.
5126 * src/Makefile.am, src/PrinterParams.h: New data store.
5128 * other files: Added a couple of copyright notices.
5130 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5132 * src/insets/insetbib.h: move Holder struct in public space.
5134 * src/frontends/include/DialogBase.h: use SigC:: only when
5135 SIGC_CXX_NAMESPACES is defined.
5136 * src/frontends/include/Dialogs.h: ditto.
5138 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5140 * src/frontends/xforms/FormCopyright.[Ch]: do not
5141 mention SigC:: explicitely.
5143 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5145 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5146 deals with testing KDE in main configure.in
5147 * configure.in: ditto.
5149 2000-02-22 Allan Rae <rae@lyx.org>
5151 * Lots of files: Merged from HEAD
5153 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5154 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5156 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5158 * sigc++/: new minidist.
5160 2000-02-14 Allan Rae <rae@lyx.org>
5162 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5164 2000-02-08 Juergen Vigna <jug@sad.it>
5166 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5167 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5169 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5170 for this port and so it is much easier for other people to port
5171 dialogs in a common development environment.
5173 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5174 the QT/KDE implementation.
5176 * src/frontends/kde/Dialogs.C:
5177 * src/frontends/kde/FormCopyright.C:
5178 * src/frontends/kde/FormCopyright.h:
5179 * src/frontends/kde/Makefile.am:
5180 * src/frontends/kde/formcopyrightdialog.C:
5181 * src/frontends/kde/formcopyrightdialog.h:
5182 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5183 for the kde support of the Copyright-Dialog.
5185 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5186 subdir-substitution instead of hardcoded 'xforms' as we now have also
5189 * src/frontends/include/DialogBase.h (Object): just commented the
5190 label after #endif (nasty warning and I don't like warnings ;)
5192 * src/main.C (main): added KApplication initialization if using
5195 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5196 For now only the KDE event-loop is added if frontend==kde.
5198 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5200 * configure.in: added support for the --with-frontend[=value] option
5202 * autogen.sh: added kde.m4 file to list of config-files
5204 * acconfig.h: added define for KDEGUI-support
5206 * config/kde.m4: added configuration functions for KDE-port
5208 * config/lyxinclude.m4: added --with-frontend[=value] option with
5209 support for xforms and KDE.
5211 2000-02-08 Allan Rae <rae@lyx.org>
5213 * all Makefile.am: Fixed up so the make targets dist, distclean,
5214 install and uninstall all work even if builddir != srcdir. Still
5215 have a new sigc++ minidist update to come.
5217 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5219 2000-02-01 Allan Rae <rae@lyx.org>
5221 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5222 Many mods to get builddir != srcdir working.
5224 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5225 for building on NT and so we can do the builddir != srcdir stuff.
5227 2000-01-30 Allan Rae <rae@lyx.org>
5229 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5230 This will stay in "rae" branch. We probably don't really need it in
5231 the main trunk as anyone who wants to help programming it should get
5232 a full library installed also. So they can check both included and
5233 system supplied library compilation.
5235 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5236 Added a 'mini' distribution of libsigc++. If you feel the urge to
5237 change something in these directories - Resist it. If you can't
5238 resist the urge then you should modify the following script and rebuild
5239 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5240 all happen. Still uses a hacked version of libsigc++'s configure.in.
5241 I'm quite happy with the results. I'm not sure the extra work to turn
5242 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5243 worth the trouble and would probably lead to extra maintenance
5245 I haven't tested the following important make targets: install, dist.
5246 Not ready for prime time but very close. Maybe 1.1.5.
5248 * development/tools/makeLyXsigc.sh: A shell script to automatically
5249 generate our mini-dist of libsigc++. It can only be used with a CVS
5250 checkout of libsigc++ not a tarball distribution. It's well commented.
5251 This will end up as part of the libsigc++ distribution so other apps
5252 can easily have an included mini-dist. If someone makes mods to the
5253 sigc++ subpackage without modifying this script to generate those
5254 changes I'll be very upset!
5256 * src/frontends/: Started the gui/system indep structure.
5258 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5259 to access the gui-indep dialogs are in this class. Much improved
5260 design compared to previous revision. Lars, please refrain from
5261 moving this header into src/ like you did with Popups.h last time.
5263 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5265 * src/frontends/xforms/: Started the gui-indep system with a single
5266 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5269 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5270 Here you'll find a very useful makefile and automated fdfix.sh that
5271 makes updating dailogs a no-brainer -- provided you follow the rules
5272 set out in the README. I'm thinking about adding another script to
5273 automatically generate skeleton code for a new dialog given just the
5276 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5277 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5278 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5280 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5282 * src/support/LSubstring.C (operator): simplify
5284 * src/lyxtext.h: removed bparams, use buffer_->params instead
5286 * src/lyxrow.h: make Row a real class, move all variables to
5287 private and use accessors.
5289 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5291 (isRightToLeftPar): ditto
5292 (ChangeLanguage): ditto
5293 (isMultiLingual): ditto
5296 (SimpleTeXOnePar): ditto
5297 (TeXEnvironment): ditto
5298 (GetEndLabel): ditto
5300 (SetOnlyLayout): ditto
5301 (BreakParagraph): ditto
5302 (BreakParagraphConservative): ditto
5303 (GetFontSettings): ditto
5305 (CopyIntoMinibuffer): ditto
5306 (CutIntoMinibuffer): ditto
5307 (PasteParagraph): ditto
5308 (SetPExtraType): ditto
5309 (UnsetPExtraType): ditto
5310 (DocBookContTableRows): ditto
5311 (SimpleDocBookOneTablePar): ditto
5313 (TeXFootnote): ditto
5314 (SimpleTeXOneTablePar): ditto
5315 (TeXContTableRows): ditto
5316 (SimpleTeXSpecialChars): ditto
5319 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5320 to private and use accessors.
5322 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5323 this, we did not use it anymore and has not been for ages. Just a
5324 waste of cpu cycles.
5326 * src/language.h: make Language a real class, move all variables
5327 to private and use accessors.
5329 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5330 (create_view): remove
5331 (update): some changes for new timer
5332 (cursorToggle): use new timer
5333 (beforeChange): change for new timer
5335 * src/BufferView.h (cursorToggleCB): removed last paramter because
5338 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5339 (cursorToggleCB): change because of new timer code
5341 * lib/CREDITS: updated own mailaddress
5343 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5345 * src/support/filetools.C (PutEnv): fix the code in case neither
5346 putenv() nor setenv() have been found.
5348 * INSTALL: mention the install-strip Makefile target.
5350 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5351 read-only documents.
5353 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5355 * lib/reLyX/configure.in (VERSION): avoid using a previously
5356 generated reLyX wrapper to find out $prefix.
5358 * lib/examples/eu_adibide_lyx-atua.lyx:
5359 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5360 translation of the Tutorial (Dooteo)
5362 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5364 * forms/cite.fd: new citation dialog
5366 * src/insetcite.[Ch]: the new citation dialog is moved into
5369 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5372 * src/insets/insetcommand.h: data members made private.
5374 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5376 * LyX 1.1.5 released
5378 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5380 * src/version.h (LYX_RELEASE): to 1.1.5
5382 * src/spellchecker.C (RunSpellChecker): return false if the
5383 spellchecker dies upon creation.
5385 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5387 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5388 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5392 * lib/CREDITS: update entry for Martin Vermeer.
5394 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5396 * src/text.C (draw): Draw foreign language bars at the bottom of
5397 the row instead of at the baseline.
5399 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5401 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5403 * lib/bind/de_menus.bind: updated
5405 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5407 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5409 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5411 * src/menus.C (Limit_string_length): New function
5412 (ShowTocMenu): Limit the number of items/length of items in the
5415 * src/paragraph.C (String): Correct result for a paragraph inside
5418 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5420 * src/bufferlist.C (close): test of buf->getuser() == NULL
5422 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5424 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5425 Do not call to SetCursor when the paragraph is a closed footnote!
5427 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5429 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5432 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5434 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5437 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5438 reference popup, that activates the reference-back action
5440 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5442 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5443 the menus. Also fixed a bug.
5445 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5446 the math panels when switching buffers (unless new buffer is readonly).
5448 * src/BufferView.C (NoSavedPositions)
5449 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5451 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5453 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5454 less of dvi dirty or not.
5456 * src/trans_mgr.[Ch] (insert): change first parameter to string
5459 * src/chset.[Ch] (encodeString): add const to first parameter
5461 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5463 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5467 * src/LaTeX.C (deplog): better searching for dependency files in
5468 the latex log. Uses now regexps.
5470 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5471 instead of the box hack or \hfill.
5473 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5475 * src/lyxfunc.C (doImportHelper): do not create the file before
5476 doing the actual import.
5477 (doImportASCIIasLines): create a new file before doing the insert.
5478 (doImportASCIIasParagraphs): ditto.
5480 * lib/lyxrc.example: remove mention of non-existing commands
5482 * lyx.man: remove mention of color-related switches.
5484 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5486 * src/lyx_gui.C: remove all the color-related ressources, which
5487 are not used anymore.
5489 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5492 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5494 * src/lyxrc.C (read): Add a missing break in the switch
5496 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5498 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5500 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5503 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5505 * src/text.C (draw): draw bars under foreign language words.
5507 * src/LColor.[Ch]: add LColor::language
5509 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5511 * src/lyxcursor.h (boundary): New member variable
5513 * src/text.C (IsBoundary): New methods
5515 * src/text.C: Use the above for currect cursor movement when there
5516 is both RTL & LTR text.
5518 * src/text2.C: ditto
5520 * src/bufferview_funcs.C (ToggleAndShow): ditto
5522 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5524 * src/text.C (DeleteLineForward): set selection to true to avoid
5525 that DeleteEmptyParagraphMechanism does some magic. This is how it
5526 is done in all other functions, and seems reasonable.
5527 (DeleteWordForward): do not jump over non-word stuff, since
5528 CursorRightOneWord() already does it.
5530 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5531 DeleteWordBackward, since they seem safe to me (since selection is
5532 set to "true") DeleteEmptyParagraphMechanism does nothing.
5534 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5536 * src/lyx_main.C (easyParse): simplify the code by factoring the
5537 part that removes parameters from the command line.
5538 (LyX): check wether wrong command line options have been given.
5540 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5542 * src/lyx_main.C : add support for specifying user LyX
5543 directory via command line option -userdir.
5545 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5547 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5548 the number of items per popup.
5549 (Add_to_refs_menu): Ditto.
5551 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5553 * src/lyxparagraph.h: renamed ClearParagraph() to
5554 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5555 textclass as parameter, and do nothing if free_spacing is
5556 true. This fixes part of the line-delete-forward problems.
5558 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5559 (pasteSelection): ditto.
5560 (SwitchLayoutsBetweenClasses): more translatable strings.
5562 * src/text2.C (CutSelection): use StripLeadingSpaces.
5563 (PasteSelection): ditto.
5564 (DeleteEmptyParagraphMechanism): ditto.
5566 2000-05-26 Juergen Vigna <jug@sad.it>
5568 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5569 is not needed in tabular insets.
5571 * src/insets/insettabular.C (TabularFeatures): added missing features.
5573 * src/tabular.C (DeleteColumn):
5575 (AppendRow): implemented this functions
5576 (cellsturct::operator=): clone the inset too;
5578 2000-05-23 Juergen Vigna <jug@sad.it>
5580 * src/insets/insettabular.C (LocalDispatch): better selection support
5581 when having multicolumn-cells.
5583 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5585 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5587 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5589 * src/ColorHandler.C (getGCForeground): put more test into _()
5591 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5594 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5597 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5599 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5600 there are no labels, or when buffer is readonly.
5602 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5603 there are no labels, buffer is SGML, or when buffer is readonly.
5605 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5607 * src/LColor.C (LColor): change a couple of grey40 to grey60
5608 (LColor): rewore initalization to make compiles go some magnitude
5610 (getGUIName): don't use gettext until we need the string.
5612 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5614 * src/Bullet.[Ch]: Fixed a small bug.
5616 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5618 * src/paragraph.C (String): Several fixes/improvements
5620 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5622 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5624 * src/paragraph.C (String): give more correct output.
5626 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5628 * src/lyxfont.C (stateText) Do not output the language if it is
5629 eqaul to the language of the document.
5631 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5632 between two paragraphs with the same language.
5634 * src/paragraph.C (getParLanguage) Return a correct answer for an
5635 empty dummy paragraph.
5637 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5640 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5643 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5644 the menus/popup, if requested fonts are unavailable.
5646 2000-05-22 Juergen Vigna <jug@sad.it>
5648 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5649 movement support (Up/Down/Tab/Shift-Tab).
5650 (LocalDispatch): added also preliminari cursor-selection.
5652 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5654 * src/paragraph.C (PasteParagraph): Hopefully now right!
5656 2000-05-22 Garst R. Reese <reese@isn.net>
5658 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5659 of list, change all references to Environment to Command
5660 * tex/hollywood.cls : rewrite environments as commands, add
5661 \uppercase to interiorshot and exteriorshot to force uppecase.
5662 * tex/broadway.cls : rewrite environments as commands. Tweak
5665 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5667 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5668 size of items: use a constant intead of the hardcoded 40, and more
5669 importantly do not remove the %m and %x tags added at the end.
5670 (Add_to_refs_menu): use vector::size_type instead of
5671 unsigned int as basic types for the variables. _Please_ do not
5672 assume that size_t is equal to unsigned int. On an alpha, this is
5673 unsigned long, which is _not_ the same.
5675 * src/language.C (initL): remove language "hungarian", since it
5676 seems that "magyar" is better.
5678 2000-05-22 Juergen Vigna <jug@sad.it>
5680 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5682 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5685 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5686 next was deleted but not set to 0.
5688 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5690 * src/language.C (initL): change the initialization of languages
5691 so that compiles goes _fast_.
5693 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5696 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5698 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5702 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5704 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5706 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5710 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5713 * src/insets/insetlo*.[Ch]: Made editable
5715 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5717 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5718 the current selection.
5720 * src/BufferView_pimpl.C (stuffClipboard): new method
5722 * src/BufferView.C (stuffClipboard): new method
5724 * src/paragraph.C (String): new method
5726 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5727 LColor::ignore when lyxname is not found.
5729 * src/BufferView.C (pasteSelection): new method
5731 * src/BufferView_pimpl.C (pasteSelection): new method
5733 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5735 * src/WorkArea.C (request_clipboard_cb): new static function
5736 (getClipboard): new method
5737 (putClipboard): new method
5739 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5741 * LyX 1.1.5pre2 released
5743 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5745 * src/vspace.C (operator=): removed
5746 (operator=): removed
5748 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5750 * src/layout.C (NumberOfClass): manually set the type in make_pair
5751 (NumberOfLayout): ditto
5753 * src/language.C: use the Language constructor for ignore_lang
5755 * src/language.h: add constructors to struct Language
5757 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5759 * src/text2.C (SetCursorIntern): comment out #warning
5761 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5763 * src/mathed/math_iter.h: initialize sx and sw to 0
5765 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5767 * forms/lyx.fd: Redesign of form_ref
5769 * src/LaTeXFeatures.[Ch]
5773 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5776 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5777 and Buffer::inset_iterator.
5779 * src/menus.C: Added new menus: TOC and Refs.
5781 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5783 * src/buffer.C (getTocList): New method.
5785 * src/BufferView2.C (ChangeRefs): New method.
5787 * src/buffer.C (getLabelList): New method. It replaces the old
5788 getReferenceList. The return type is vector<string> instead of
5791 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5792 the old getLabel() and GetNumberOfLabels() methods.
5793 * src/insets/insetlabel.C (getLabelList): ditto
5794 * src/mathed/formula.C (getLabelList): ditto
5796 * src/paragraph.C (String): New method.
5798 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5799 Uses the new getTocList() method.
5800 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5801 which automatically updates the contents of the browser.
5802 (RefUpdateCB): Use the new getLabelList method.
5804 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5806 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5808 * src/spellchecker.C: Added using std::reverse;
5810 2000-05-19 Juergen Vigna <jug@sad.it>
5812 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5814 * src/insets/insettext.C (computeTextRows): small fix for display of
5815 1 character after a newline.
5817 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5820 2000-05-18 Juergen Vigna <jug@sad.it>
5822 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5823 when changing width of column.
5825 * src/tabular.C (set_row_column_number_info): setting of
5826 autobreak rows if necessary.
5828 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5830 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5832 * src/vc-backend.*: renamed stat() to status() and vcstat to
5833 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5834 compilation broke. The new name seems more relevant, anyway.
5836 2000-05-17 Juergen Vigna <jug@sad.it>
5838 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5839 which was wrong if the removing caused removing of rows!
5841 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5842 (pushToken): new function.
5844 * src/text2.C (CutSelection): fix problem discovered with purify
5846 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5848 * src/debug.C (showTags): enlarge the first column, now that we
5849 have 6-digits debug codes.
5851 * lib/layouts/hollywood.layout:
5852 * lib/tex/hollywood.cls:
5853 * lib/tex/brodway.cls:
5854 * lib/layouts/brodway.layout: more commands and fewer
5855 environments. Preambles moved in the .cls files. Broadway now has
5856 more options on scene numbering and less whitespace (from Garst)
5858 * src/insets/insetbib.C (getKeys): make sure that we are in the
5859 document directory, in case the bib file is there.
5861 * src/insets/insetbib.C (Latex): revert bogus change.
5863 2000-05-16 Juergen Vigna <jug@sad.it>
5865 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5866 the TabularLayout on cursor move.
5868 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5870 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5873 (draw): fixed cursor position and drawing so that the cursor is
5874 visible when before the tabular-inset.
5876 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5877 when creating from old insettext.
5879 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5881 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5883 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5884 * lib/tex/brodway.cls: ditto
5886 * lib/layouts/brodway.layout: change alignment of parenthical
5889 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5891 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5892 versions 0.88 and 0.89 are supported.
5894 2000-05-15 Juergen Vigna <jug@sad.it>
5896 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5899 * src/insets/insettext.C (computeTextRows): redone completely this
5900 function in a much cleaner way, because of problems when having a
5902 (draw): added a frame border when the inset is locked.
5903 (SetDrawLockedFrame): this sets if we draw the border or not.
5904 (SetFrameColor): this sets the frame color (default=insetframe).
5906 * src/insets/lyxinset.h: added x() and y() functions which return
5907 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5908 function which is needed to see if we have a locking inset of some
5909 type in this inset (needed for now in insettabular).
5911 * src/vspace.C (inPixels): the same function also without a BufferView
5912 parameter as so it is easier to use it in some ocasions.
5914 * src/lyxfunc.C: changed all places where insertInset was used so
5915 that now if it couldn't be inserted it is deleted!
5917 * src/TabularLayout.C:
5918 * src/TableLayout.C: added support for new tabular-inset!
5920 * src/BufferView2.C (insertInset): this now returns a bool if the
5921 inset was really inserted!!!
5923 * src/tabular.C (GetLastCellInRow):
5924 (GetFirstCellInRow): new helper functions.
5925 (Latex): implemented for new tabular class.
5929 (TeXTopHLine): new Latex() helper functions.
5931 2000-05-12 Juergen Vigna <jug@sad.it>
5933 * src/mathed/formulamacro.C (Read):
5934 * src/mathed/formula.C (Read): read also the \end_inset here!
5936 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5938 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5939 crush when saving formulae with unbalanced parenthesis.
5941 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5943 * src/layout.C: Add new keyword "endlabelstring" to layout file
5945 * src/text.C (GetVisibleRow): Draw endlabel string.
5947 * lib/layouts/broadway.layout
5948 * lib/layouts/hollywood.layout: Added endlabel for the
5949 Parenthetical layout.
5951 * lib/layouts/heb-article.layout: Do not use slanted font shape
5952 for Theorem like environments.
5954 * src/buffer.C (makeLaTeXFile): Always add "american" to
5955 the UsedLanguages list if document language is RTL.
5957 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5959 * add addendum to README.OS2 and small patch (from SMiyata)
5961 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5963 * many files: correct the calls to ChangeExtension().
5965 * src/support/filetools.C (ChangeExtension): remove the no_path
5966 argument, which does not belong there. Use OnlyFileName() instead.
5968 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5969 files when LaTeXing a non-nice latex file.
5971 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5972 a chain of "if". Return false when deadkeys are not handled.
5974 * src/lyx_main.C (LyX): adapted the code for default bindings.
5976 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5977 bindings for basic functionality (except deadkeys).
5978 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5980 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5981 several methods: handle override_x_deadkeys.
5983 * src/lyxrc.h: remove the "bindings" map, which did not make much
5984 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5986 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5988 * src/lyxfont.C (stateText): use a saner method to determine
5989 whether the font is "default". Seems to fix the crash with DEC
5992 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5994 2000-05-08 Juergen Vigna <jug@sad.it>
5996 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5997 TabularLayoutMenu with mouse-button-3
5998 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6000 * src/TabularLayout.C: added this file for having a Layout for
6003 2000-05-05 Juergen Vigna <jug@sad.it>
6005 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6006 recalculating inset-widths.
6007 (TabularFeatures): activated this function so that I can change
6008 tabular-features via menu.
6010 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6011 that I can test some functions with the Table menu.
6013 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6015 * src/lyxfont.C (stateText): guard against stupid c++libs.
6017 * src/tabular.C: add using std::vector
6018 some whitespace changes, + removed som autogenerated code.
6020 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6022 2000-05-05 Juergen Vigna <jug@sad.it>
6024 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6025 row, columns and cellstructures.
6027 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6029 * lib/lyxrc.example: remove obsolete entries.
6031 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6032 reading of protected_separator for free_spacing.
6034 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6036 * src/text.C (draw): do not display an exclamation mark in the
6037 margin for margin notes. This is confusing, ugly and
6040 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6041 AMS math' is checked.
6043 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6044 name to see whether including the amsmath package is needed.
6046 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6048 * src/paragraph.C (validate): Compute UsedLanguages correctly
6049 (don't insert the american language if it doesn't appear in the
6052 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6053 The argument of \thanks{} command is considered moving argument
6055 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6058 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6060 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6061 for appendix/minipage/depth. The lines can be now both in the footnote
6062 frame, and outside the frame.
6064 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6067 2000-05-05 Juergen Vigna <jug@sad.it>
6069 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6070 neede only in tabular.[Ch].
6072 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6074 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6076 (Write): write '~' for PROTECTED_SEPARATOR
6078 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6080 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6083 * src/mathed/formula.C (drawStr): rename size to siz.
6085 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6086 possibly fix a bug by not changing the pflags = flags to piflags =
6089 2000-05-05 Juergen Vigna <jug@sad.it>
6091 * src/insets/insetbib.C: moved using directive
6093 * src/ImportNoweb.C: small fix for being able to compile (missing
6096 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6098 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6099 to use clear, since we don't depend on this in the code. Add test
6102 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6104 * (various *.C files): add using std::foo directives to please dec
6107 * replace calls to string::clear() to string::erase() (Angus)
6109 * src/cheaders/cmath: modified to provide std::abs.
6111 2000-05-04 Juergen Vigna <jug@sad.it>
6113 * src/insets/insettext.C: Prepared all for inserting of multiple
6114 paragraphs. Still display stuff to do (alignment and other things),
6115 but I would like to use LyXText to do this when we cleaned out the
6116 table-support stuff.
6118 * src/insets/insettabular.C: Changed lot of stuff and added lots
6119 of functionality still a lot to do.
6121 * src/tabular.C: Various functions changed name and moved to be
6122 const functions. Added new Read and Write functions and changed
6123 lots of things so it works good with tabular-insets (also removed
6124 some stuff which is not needed anymore * hacks *).
6126 * src/lyxcursor.h: added operators == and != which just look if
6127 par and pos are (not) equal.
6129 * src/buffer.C (latexParagraphs): inserted this function to latex
6130 all paragraphs form par to endpar as then I can use this too for
6133 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6134 so that I can call this to from text insets with their own cursor.
6136 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6137 output off all paragraphs (because of the fix below)!
6139 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6140 the very last paragraph (this could be also the last paragraph of an
6143 * src/texrow.h: added rows() call which returns the count-variable.
6145 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6147 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6149 * lib/configure.m4: better autodetection of DocBook tools.
6151 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6153 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6155 * src/lyx_cb.C: add using std::reverse;
6157 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6160 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6161 selected files. Should fix repeated errors from generated files.
6163 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6165 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6167 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6168 the spellchecker popup.
6170 * lib/lyxrc.example: Removed the \number_inset section
6172 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6174 * src/insets/figinset.C (various): Use IsFileReadable() to make
6175 sure that the file actually exist. Relying on ghostscripts errors
6176 is a bad idea since they can lead to X server crashes.
6178 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6180 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6183 * lib/lyxrc.example: smallish typo in description of
6184 \view_dvi_paper_option
6186 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6189 * src/lyxfunc.C: doImportHelper to factor out common code of the
6190 various import methods. New functions doImportASCIIasLines,
6191 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6192 doImportLinuxDoc for the format specific parts.
6195 * buffer.C: Dispatch returns now a bool to indicate success
6198 * lyx_gui.C: Add getLyXView() for member access
6200 * lyx_main.C: Change logic for batch commands: First try
6201 Buffer::Dispatch (possibly without GUI), if that fails, use
6204 * lyx_main.C: Add support for --import command line switch.
6205 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6206 Available Formats: Everything accepted by 'buffer-import <format>'
6208 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6210 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6213 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6214 documents will be reformatted upon reentry.
6216 2000-04-27 Juergen Vigna <jug@sad.it>
6218 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6219 correctly only last pos this was a bug.
6221 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6223 * release of lyx-1.1.5pre1
6225 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6227 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6229 * src/menus.C: revert the change of naming (Figure->Graphic...)
6230 from 2000-04-11. It was incomplete and bad.
6232 * src/LColor.[Ch]: add LColor::depthbar.
6233 * src/text.C (GetVisibleRow): use it.
6235 * README: update the languages list.
6237 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6239 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6242 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6244 * README: remove sections that were just wrong.
6246 * src/text2.C (GetRowNearY): remove currentrow code
6248 * src/text.C (GetRow): remove currentrow code
6250 * src/screen.C (Update): rewritten a bit.
6251 (SmallUpdate): removed func
6253 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6255 (FullRebreak): return bool
6256 (currentrow): remove var
6257 (currentrow_y): ditto
6259 * src/lyxscreen.h (Draw): change arg to unsigned long
6260 (FitCursor): return bool
6261 (FitManualCursor): ditto
6262 (Smallpdate): remove func
6263 (first): change to unsigned long
6264 (DrawOneRow): change second arg to long (from long &)
6265 (screen_refresh_y): remove var
6266 (scree_refresh_row): ditto
6268 * src/lyxrow.h: change baseline to usigned int from unsigned
6269 short, this brings some implicit/unsigned issues out in the open.
6271 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6273 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6274 instead of smallUpdate.
6276 * src/lyxcursor.h: change y to unsigned long
6278 * src/buffer.h: don't call updateScrollbar after fitcursor
6280 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6281 where they are used. Removed "\\direction", this was not present
6282 in 1.1.4 and is already obsolete. Commented out some code that I
6283 believe to never be called.
6284 (runLiterate): don't call updateScrollbar after fitCursor
6286 (buildProgram): ditto
6289 * src/WorkArea.h (workWidth): change return val to unsigned
6292 (redraw): remove the button redraws
6293 (setScrollbarValue): change for scrollbar
6294 (getScrollbarValue): change for scrollbar
6295 (getScrollbarBounds): change for scrollbar
6297 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6298 (C_WorkArea_down_cb): removed func
6299 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6300 (resize): change for scrollbar
6301 (setScrollbar): ditto
6302 (setScrollbarBounds): ditto
6303 (setScrollbarIncrements): ditto
6304 (up_cb): removed func
6305 (down_cb): removed func
6306 (scroll_cb): change for scrollbar
6307 (work_area_handler): ditto
6309 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6310 when FitCursor did something.
6311 (updateScrollbar): some unsigned changes
6312 (downCB): removed func
6313 (scrollUpOnePage): removed func
6314 (scrollDownOnePage): remvoed func
6315 (workAreaMotionNotify): don't call screen->FitCursor but use
6316 fitCursor instead. and bool return val
6317 (workAreaButtonPress): ditto
6318 (workAreaButtonRelease): some unsigned changes
6319 (checkInsetHit): ditto
6320 (workAreaExpose): ditto
6321 (update): parts rewritten, comments about the signed char arg added
6322 (smallUpdate): removed func
6323 (cursorPrevious): call needed updateScrollbar
6326 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6329 * src/BufferView.[Ch] (upCB): removed func
6330 (downCB): removed func
6331 (smallUpdate): removed func
6333 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6335 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6336 currentrow, currentrow_y optimization. This did not help a lot and
6337 if we want to do this kind of optimization we should rather use
6338 cursor.row instead of the currentrow.
6340 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6341 buffer spacing and klyx spacing support.
6343 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6345 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6348 2000-04-26 Juergen Vigna <jug@sad.it>
6350 * src/insets/figinset.C: fixes to Lars sstream changes!
6352 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6354 * A lot of files: Added Ascii(ostream &) methods to all inset
6355 classes. Used when exporting to ASCII.
6357 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6358 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6361 * src/text2.C (ToggleFree): Disabled implicit word selection when
6362 there is a change in the language
6364 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6365 no output was generated for end-of-sentence inset.
6367 * src/insets/lyxinset.h
6370 * src/paragraph.C: Removed the insetnumber code
6372 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6374 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6376 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6377 no_babel and no_epsfig completely from the file.
6378 (parseSingleLyXformat2Token): add handling for per-paragraph
6379 spacing as written by klyx.
6381 * src/insets/figinset.C: applied patch by Andre. Made it work with
6384 2000-04-20 Juergen Vigna <jug@sad.it>
6386 * src/insets/insettext.C (cutSelection):
6387 (copySelection): Fixed with selection from right to left.
6388 (draw): now the rows are not recalculated at every draw.
6389 (computeTextRows): for now reset the inset-owner here (this is
6390 important for an undo or copy where the inset-owner is not set
6393 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6394 motion to the_locking_inset screen->first was forgotten, this was
6395 not important till we got multiline insets.
6397 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6399 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6400 code seems to be alright (it is code changed by Dekel, and the
6401 intent is indeed that all macros should be defined \protect'ed)
6403 * NEWS: a bit of reorganisation of the new user-visible features.
6405 2000-04-19 Juergen Vigna <jug@sad.it>
6407 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6408 position. Set the inset_owner of the used paragraph so that it knows
6409 that it is inside an inset. Fixed cursor handling with mouse and
6410 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6411 and cleanups to make TextInsets work better.
6413 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6414 Changed parameters of various functions and added LockInsetInInset().
6416 * src/insets/insettext.C:
6418 * src/insets/insetcollapsable.h:
6419 * src/insets/insetcollapsable.C:
6420 * src/insets/insetfoot.h:
6421 * src/insets/insetfoot.C:
6422 * src/insets/insetert.h:
6423 * src/insets/insetert.C: cleaned up the code so that it works now
6424 correctly with insettext.
6426 * src/insets/inset.C:
6427 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6428 that insets in insets are supported right.
6431 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6433 * src/paragraph.C: some small fixes
6435 * src/debug.h: inserted INSETS debug info
6437 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6438 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6440 * src/commandtags.h:
6441 * src/LyXAction.C: insert code for InsetTabular.
6443 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6444 not Button1MotionMask.
6445 (workAreaButtonRelease): send always a InsetButtonRelease event to
6447 (checkInsetHit): some setCursor fixes (always with insets).
6449 * src/BufferView2.C (lockInset): returns a bool now and extended for
6450 locking insets inside insets.
6451 (showLockedInsetCursor): it is important to have the cursor always
6452 before the locked inset.
6453 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6455 * src/BufferView.h: made lockInset return a bool.
6457 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6459 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6460 that is used also internally but can be called as public to have back
6461 a cursor pos which is not set internally.
6462 (SetCursorIntern): Changed to use above function.
6464 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6466 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6471 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6472 patches for things that should be in or should be changed.
6474 * src/* [insetfiles]: change "usigned char fragile" to bool
6475 fragile. There was only one point that could that be questioned
6476 and that is commented in formulamacro.C. Grep for "CHECK".
6478 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6479 (DeleteBuffer): take it out of CutAndPaste and make it static.
6481 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6483 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6484 output the spacing envir commands. Also the new commands used in
6485 the LaTeX output makes the result better.
6487 * src/Spacing.C (writeEnvirBegin): new method
6488 (writeEnvirEnd): new method
6490 2000-04-18 Juergen Vigna <jug@sad.it>
6492 * src/CutAndPaste.C: made textclass a static member of the class
6493 as otherwise it is not accesed right!!!
6495 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6497 * forms/layout_forms.fd
6498 * src/layout_forms.h
6499 * src/layout_forms.C (create_form_form_character)
6500 * src/lyx_cb.C (UserFreeFont)
6501 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6502 documents (in the layout->character popup).
6504 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6506 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6507 \spell_command was in fact not honored (from Kevin Atkinson).
6509 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6512 * src/lyx_gui.h: make lyxViews private (Angus)
6514 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6516 * src/mathed/math_write.C
6517 (MathMatrixInset::Write) Put \protect before \begin{array} and
6518 \end{array} if fragile
6519 (MathParInset::Write): Put \protect before \\ if fragile
6521 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6523 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6524 initialization if the LyXColorHandler must be done after the
6525 connections to the XServer has been established.
6527 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6528 get the background pixel from the lyxColorhandler so that the
6529 figures are rendered with the correct background color.
6530 (NextToken): removed functions.
6531 (GetPSSizes): use ifs >> string instead of NextToken.
6533 * src/Painter.[Ch]: the color cache moved out of this file.
6535 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6538 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6540 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6541 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6543 * src/BufferView.C (enterView): new func
6544 (leaveView): new func
6546 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6548 (leaveView): new func, undefines xterm cursor when approp.
6550 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6551 (AllowInput): delete the Workarea cursor handling from this func.
6553 * src/Painter.C (underline): draw a slimer underline in most cases.
6555 * src/lyx_main.C (error_handler): use extern "C"
6557 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6559 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6560 sent directly to me.
6562 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6563 to the list by Dekel.
6565 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6568 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6569 methods from lyx_cb.here.
6571 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6574 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6576 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6577 instead of using current_view directly.
6579 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6581 * src/LyXAction.C (init): add the paragraph-spacing command.
6583 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6585 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6587 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6588 different from the documents.
6590 * src/text.C (SetHeightOfRow): take paragraph spacing into
6591 account, paragraph spacing takes precedence over buffer spacing
6592 (GetVisibleRow): ditto
6594 * src/paragraph.C (writeFile): output the spacing parameter too.
6595 (validate): set the correct features if spacing is used in the
6597 (Clear): set spacing to default
6598 (MakeSameLayout): spacing too
6599 (HasSameLayout): spacing too
6600 (SetLayout): spacing too
6601 (TeXOnePar): output the spacing commands
6603 * src/lyxparagraph.h: added a spacing variable for use with
6604 per-paragraph spacing.
6606 * src/Spacing.h: add a Default spacing and a method to check if
6607 the current spacing is default. also added an operator==
6609 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6612 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6614 * src/lyxserver.C (callback): fix dispatch of functions
6616 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6617 printf() into lyxerr call.
6619 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6622 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6623 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6624 the "Float" from each of the subitems.
6625 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6627 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6628 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6629 documented the change so that the workaround can be nuked later.
6631 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6634 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6636 * src/buffer.C (getLatexName): ditto
6637 (setReadonly): ditto
6639 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6641 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6642 avoid some uses of current_view. Added also a bufferParams()
6643 method to get at this.
6645 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6647 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6649 * src/lyxparagraph.[Ch]: removed
6650 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6651 with operators used by lower_bound and
6652 upper_bound in InsetTable's
6653 Make struct InsetTable private again. Used matchpos.
6655 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6657 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6658 document, the language of existing text is changed (unless the
6659 document is multi-lingual)
6661 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6663 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6665 * A lot of files: A rewrite of the Right-to-Left support.
6667 2000-04-10 Juergen Vigna <jug@sad.it>
6669 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6670 misplaced cursor when inset in inset is locked.
6672 * src/insets/insettext.C (LocalDispatch): small fix so that a
6673 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6675 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6676 footnote font should be decreased in size twice when displaying.
6678 * src/insets/insettext.C (GetDrawFont): inserted this function as
6679 the drawing-font may differ from the real paragraph font.
6681 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6682 insets (inset in inset!).
6684 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6685 function here because we don't want footnotes inside footnotes.
6687 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6689 (init): now set the inset_owner in paragraph.C
6690 (LocalDispatch): added some resetPos() in the right position
6693 (pasteSelection): changed to use the new CutAndPaste-Class.
6695 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6696 which tells if it is allowed to insert another inset inside this one.
6698 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6699 SwitchLayoutsBetweenClasses.
6701 * src/text2.C (InsertInset): checking of the new paragraph-function
6703 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6704 is not needed anymore here!
6707 (PasteSelection): redone (also with #ifdef) so that now this uses
6708 the CutAndPaste-Class.
6709 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6712 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6713 from/to text/insets.
6715 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6716 so that the paragraph knows if it is inside an (text)-inset.
6717 (InsertFromMinibuffer): changed return-value to bool as now it
6718 may happen that an inset is not inserted in the paragraph.
6719 (InsertInsetAllowed): this checks if it is allowed to insert an
6720 inset in this paragraph.
6722 (BreakParagraphConservative):
6723 (BreakParagraph) : small change for the above change of the return
6724 value of InsertFromMinibuffer.
6726 * src/lyxparagraph.h: added inset_owner and the functions to handle
6727 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6729 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6731 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6732 functions from BufferView to BufferView::Pimpl to ease maintence.
6734 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6735 correctly. Also use SetCursorIntern instead of SetCursor.
6737 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6740 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6742 * src/WorkArea.C (belowMouse): manually implement below mouse.
6744 * src/*: Add "explicit" on several constructors, I added probably
6745 some unneeded ones. A couple of changes to code because of this.
6747 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6748 implementation and private parts from the users of BufferView. Not
6751 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6752 implementation and private parts from the users of LyXLex. Not
6755 * src/BufferView_pimpl.[Ch]: new files
6757 * src/lyxlex_pimpl.[Ch]: new files
6759 * src/LyXView.[Ch]: some inline functions move out-of-line
6761 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6763 * src/lyxparagraph.h: make struct InsetTable public.
6765 * src/support/lyxstring.h: change lyxstring::difference_type to be
6766 ptrdiff_t. Add std:: modifiers to streams.
6768 * src/font.C: include the <cctype> header, for islower() and
6771 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6773 * src/font.[Ch]: new files. Contains the metric functions for
6774 fonts, takes a LyXFont as parameter. Better separation of concepts.
6776 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6777 changes because of this.
6779 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6781 * src/*: compile with -Winline and move functions that don't
6784 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6787 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6789 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6790 (various files changed because of this)
6792 * src/Painter.C (text): fixed the drawing of smallcaps.
6794 * src/lyxfont.[Ch] (drawText): removed unused member func.
6797 * src/*.C: added needed "using" statements and "std::" qualifiers.
6799 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6801 * src/*.h: removed all use of "using" from header files use
6802 qualifier std:: instead.
6804 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6806 * src/text.C (Backspace): some additional cleanups (we already
6807 know whether cursor.pos is 0 or not).
6809 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6810 automake does not provide one).
6812 * src/bmtable.h: replace C++ comments with C comments.
6814 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6816 * src/screen.C (ShowCursor): Change the shape of the cursor if
6817 the current language is not equal to the language of the document.
6818 (If the cursor change its shape unexpectedly, then you've found a bug)
6820 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6823 * src/insets/insetnumber.[Ch]: New files.
6825 * src/LyXAction.C (init)
6826 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6829 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6831 * src/lyxparagraph.h
6832 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6833 (the vector is kept sorted).
6835 * src/text.C (GetVisibleRow): Draw selection correctly when there
6836 is both LTR and RTL text.
6838 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6839 which is much faster.
6841 * src/text.C (GetVisibleRow and other): Do not draw the last space
6842 in a row if the direction of the last letter is not equal to the
6843 direction of the paragraph.
6845 * src/lyxfont.C (latexWriteStartChanges):
6846 Check that font language is not equal to basefont language.
6847 (latexWriteEndChanges): ditto
6849 * src/lyx_cb.C (StyleReset): Don't change the language while using
6850 the font-default command.
6852 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6853 empty paragraph before a footnote.
6855 * src/insets/insetcommand.C (draw): Increase x correctly.
6857 * src/screen.C (ShowCursor): Change cursor shape if
6858 current language != document language.
6860 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6862 2000-03-31 Juergen Vigna <jug@sad.it>
6864 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6865 (Clone): changed mode how the paragraph-data is copied to the
6866 new clone-paragraph.
6868 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6869 GetInset(pos) with no inset anymore there (in inset UNDO)
6871 * src/insets/insetcommand.C (draw): small fix as here x is
6872 incremented not as much as width() returns (2 before, 2 behind = 4)
6874 2000-03-30 Juergen Vigna <jug@sad.it>
6876 * src/insets/insettext.C (InsetText): small fix in initialize
6877 widthOffset (should not be done in the init() function)
6879 2000-03-29 Amir Karger <karger@lyx.org>
6881 * lib/examples/it_ItemizeBullets.lyx: translation by
6884 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6886 2000-03-29 Juergen Vigna <jug@sad.it>
6888 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6890 * src/insets/insetfoot.C (Clone): small change as for the below
6891 new init function in the text-inset
6893 * src/insets/insettext.C (init): new function as I've seen that
6894 clone did not copy the Paragraph-Data!
6895 (LocalDispatch): Added code so that now we have some sort of Undo
6896 functionality (well actually we HAVE Undo ;)
6898 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6900 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6902 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6905 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6907 * src/main.C: added a runtime check that verifies that the xforms
6908 header used when building LyX and the library used when running
6909 LyX match. Exit with a message if they don't match. This is a
6910 version number check only.
6912 * src/buffer.C (save): Don't allocate memory on the heap for
6913 struct utimbuf times.
6915 * *: some using changes, use iosfwd instead of the real headers.
6917 * src/lyxfont.C use char const * instead of string for the static
6918 strings. Rewrite some functions to use sstream.
6920 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6922 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6925 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6927 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6928 of Geodesy (from Martin Vermeer)
6930 * lib/layouts/svjour.inc: include file for the Springer svjour
6931 class. It can be used to support journals other than JoG.
6933 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6934 Miskiewicz <misiek@pld.org.pl>)
6935 * lib/reLyX/Makefile.am: ditto.
6937 2000-03-27 Juergen Vigna <jug@sad.it>
6939 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6940 also some modifications with operations on selected text.
6942 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6943 problems with clicking on insets (last famous words ;)
6945 * src/insets/insetcommand.C (draw):
6946 (width): Changed to have a bit of space before and after the inset so
6947 that the blinking cursor can be seen (otherwise it was hidden)
6949 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6951 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6952 would not be added to the link list when an installed gettext (not
6953 part of libc) is found.
6955 2000-03-24 Juergen Vigna <jug@sad.it>
6957 * src/insets/insetcollapsable.C (Edit):
6958 * src/mathed/formula.C (InsetButtonRelease):
6959 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6962 * src/BufferView.C (workAreaButtonPress):
6963 (workAreaButtonRelease):
6964 (checkInsetHit): Finally fixed the clicking on insets be handled
6967 * src/insets/insetert.C (Edit): inserted this call so that ERT
6968 insets work always with LaTeX-font
6970 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6972 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6973 caused lyx to startup with no GUI in place, causing in a crash
6974 upon startup when called with arguments.
6976 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6978 * src/FontLoader.C: better initialization of dummyXFontStruct.
6980 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6982 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6983 for linuxdoc and docbook import and export format options.
6985 * lib/lyxrc.example Example of default values for the previous flags.
6987 * src/lyx_cb.C Use those flags instead of the hardwired values for
6988 linuxdoc and docbook export.
6990 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6993 * src/menus.C Added menus entries for the new import/exports formats.
6995 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6997 * src/lyxrc.*: Added support for running without Gui
7000 * src/FontLoader.C: sensible defaults if no fonts are needed
7002 * src/lyx_cb.C: New function ShowMessage (writes either to the
7003 minibuffer or cout in case of no gui
7004 New function AskOverwrite for common stuff
7005 Consequently various changes to call these functions
7007 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7008 wild guess at sensible screen resolution when having no gui
7010 * src/lyxfont.C: no gui, no fonts... set some defaults
7012 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7014 * src/LColor.C: made the command inset background a bit lighter.
7016 2000-03-20 Hartmut Goebel <goebel@noris.net>
7018 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7019 stdstruct.inc. Koma-Script added some title elements which
7020 otherwise have been listed below "bibliography". This split allows
7021 adding title elements to where they belong.
7023 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7024 define the additional title elements and then include
7027 * many other layout files: changed to include stdtitle.inc just
7028 before stdstruct.inc.
7030 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7032 * src/buffer.C: (save) Added the option to store all backup files
7033 in a single directory
7035 * src/lyxrc.[Ch]: Added variable \backupdir_path
7037 * lib/lyxrc.example: Added descriptions of recently added variables
7039 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7040 bibtex inset, not closing the bibtex popup when deleting the inset)
7042 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7044 * src/lyx_cb.C: add a couple using directives.
7046 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7047 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7048 import based on the filename.
7050 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7051 file would be imported at start, if the filename where of a sgml file.
7053 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7055 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7057 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7058 * src/lyxfont.h Replaced the member variable bits.direction by the
7059 member variable lang. Made many changes in other files.
7060 This allows having a multi-lingual document
7062 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7063 that change the current language to <l>.
7064 Removed the command "font-rtl"
7066 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7067 format for Hebrew documents)
7069 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7070 When auto_mathmode is "true", pressing a digit key in normal mode
7071 will cause entering into mathmode.
7072 If auto_mathmode is "rtl" then this behavior will be active only
7073 when writing right-to-left text.
7075 * src/text2.C (InsertStringA) The string is inserted using the
7078 * src/paragraph.C (GetEndLabel) Gives a correct result for
7079 footnote paragraphs.
7081 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7083 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7085 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7086 front of PasteParagraph. Never insert a ' '. This should at least
7087 fix some cause for the segfaults that we have been experiencing,
7088 it also fixes backspace behaviour slightly. (Phu!)
7090 * src/support/lstrings.C (compare_no_case): some change to make it
7091 compile with gcc 2.95.2 and stdlibc++-v3
7093 * src/text2.C (MeltFootnoteEnvironment): change type o
7094 first_footnote_par_is_not_empty to bool.
7096 * src/lyxparagraph.h: make text private. Changes in other files
7098 (fitToSize): new function
7099 (setContentsFromPar): new function
7100 (clearContents): new function
7101 (SetChar): new function
7103 * src/paragraph.C (readSimpleWholeFile): deleted.
7105 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7106 the file, just use a simple string instead. Also read the file in
7107 a more maintainable manner.
7109 * src/text2.C (InsertStringA): deleted.
7110 (InsertStringB): deleted.
7112 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7114 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7115 RedoParagraphs from the doublespace handling part, just set status
7116 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7117 done, but perhaps not like this.)
7119 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7121 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7122 character when inserting an inset.
7124 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7126 * src/bufferparams.C (readLanguage): now takes "default" into
7129 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7130 also initialize the toplevel_keymap with the default bindings from
7133 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7135 * all files using lyxrc: have lyxrc as a real variable and not a
7136 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7139 * src/lyxrc.C: remove double call to defaultKeyBindings
7141 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7142 toolbar defauls using lyxlex. Remove enums, structs, functions
7145 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7146 toolbar defaults. Also store default keybindings in a map.
7148 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7149 storing the toolbar defaults without any xforms dependencies.
7151 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7152 applied. Changed to use iterators.
7154 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7156 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7157 systems that don't have LINGUAS set to begin with.
7159 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7161 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7162 the list by Dekel Tsur.
7164 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7166 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7167 * src/insets/form_graphics.C: ditto.
7169 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7171 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7173 * src/bufferparams.C (readLanguage): use the new language map
7175 * src/intl.C (InitKeyMapper): use the new language map
7177 * src/lyx_gui.C (create_forms): use the new language map
7179 * src/language.[Ch]: New files. Used for holding the information
7180 about each language. Now! Use this new language map enhance it and
7181 make it really usable for our needs.
7183 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7185 * screen.C (ShowCursor): Removed duplicate code.
7186 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7187 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7189 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7192 * src/text.C Added TransformChar method. Used for rendering Arabic
7193 text correctly (change the glyphs of the letter according to the
7194 position in the word)
7199 * src/lyxrc.C Added lyxrc command {language_command_begin,
7200 language_command_end,language_command_ltr,language_command_rtl,
7201 language_package} which allows the use of either arabtex or Omega
7204 * src/lyx_gui.C (init)
7206 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7207 to use encoding for menu fonts which is different than the encoding
7210 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7211 do not load the babel package.
7212 To write an English document with Hebrew/Arabic, change the document
7213 language to "english".
7215 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7216 (alphaCounter): changed to return char
7217 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7219 * lib/lyxrc.example Added examples for Hebrew/Arabic
7222 * src/layout.C Added layout command endlabeltype
7224 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7226 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7228 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7230 * src/mathed/math_delim.C (search_deco): return a
7231 math_deco_struct* instead of index.
7233 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7235 * All files with a USE_OSTREAM_ONLY within: removed all code that
7236 was unused when USE_OSTREAM_ONLY is defined.
7238 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7239 of any less. Removed header and using.
7241 * src/text.C (GetVisibleRow): draw the string "Page Break
7242 (top/bottom)" on screen when drawing a pagebreak line.
7244 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7246 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7248 * src/mathed/math_macro.C (draw): do some cast magic.
7251 * src/mathed/math_defs.h: change byte* argument to byte const*.
7253 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7255 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7256 know it is right to return InsetFoot* too, but cxx does not like
7259 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7261 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7263 * src/mathed/math_delim.C: change == to proper assignment.
7265 2000-03-09 Juergen Vigna <jug@sad.it>
7267 * src/insets/insettext.C (setPos): fixed various cursor positioning
7268 problems (via mouse and cursor-keys)
7269 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7270 inset (still a small display problem but it works ;)
7272 * src/insets/insetcollapsable.C (draw): added button_top_y and
7273 button_bottom_y to have correct values for clicking on the inset.
7275 * src/support/lyxalgo.h: commented out 'using std::less'
7277 2000-03-08 Juergen Vigna <jug@sad.it>
7279 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7280 Button-Release event closes as it is alos the Release-Event
7283 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7285 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7287 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7288 can add multiple spaces in Scrap (literate programming) styles...
7289 which, by the way, is how I got hooked on LyX to begin with.
7291 * src/mathed/formula.C (Write): Added dummy variable to an
7292 inset::Latex() call.
7293 (Latex): Add free_spacing boolean to inset::Latex()
7295 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7297 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7298 virtual function to include the free_spacing boolean from
7299 the containing paragraph's style.
7301 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7302 Added free_spacing boolean arg to match inset.h
7304 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7305 Added free_spacing boolean arg to match inset.h
7307 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7308 Added free_spacing boolean and made sure that if in a free_spacing
7309 paragraph, that we output normal space if there is a protected space.
7311 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7312 Added free_spacing boolean arg to match inset.h
7314 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7315 Added free_spacing boolean arg to match inset.h
7317 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7318 Added free_spacing boolean arg to match inset.h
7320 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7321 Added free_spacing boolean arg to match inset.h
7323 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7324 Added free_spacing boolean arg to match inset.h
7326 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7327 free_spacing boolean arg to match inset.h
7329 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7330 Added free_spacing boolean arg to match inset.h
7332 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7333 Added free_spacing boolean arg to match inset.h
7335 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7336 Added free_spacing boolean arg to match inset.h
7338 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7339 Added free_spacing boolean arg to match inset.h
7341 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7342 Added free_spacing boolean arg to match inset.h
7344 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7345 free_spacing boolean arg to match inset.h
7347 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7348 free_spacing boolean arg to match inset.h
7350 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7351 ignore free_spacing paragraphs. The user's spaces are left
7354 * src/text.C (InsertChar): Fixed the free_spacing layout
7355 attribute behavior. Now, if free_spacing is set, you can
7356 add multiple spaces in a paragraph with impunity (and they
7357 get output verbatim).
7358 (SelectSelectedWord): Added dummy argument to inset::Latex()
7361 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7364 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7365 paragraph layouts now only input a simple space instead.
7366 Special character insets don't make any sense in free-spacing
7369 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7370 hard-spaces in the *input* file to simple spaces if the layout
7371 is free-spacing. This converts old files which had to have
7372 hard-spaces in free-spacing layouts where a simple space was
7374 (writeFileAscii): Added free_spacing check to pass to the newly
7375 reworked inset::Latex(...) methods. The inset::Latex() code
7376 ensures that hard-spaces in free-spacing paragraphs get output
7377 as spaces (rather than "~").
7379 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7381 * src/mathed/math_delim.C (draw): draw the empty placeholder
7382 delims with a onoffdash line.
7383 (struct math_deco_compare): struct that holds the "functors" used
7384 for the sort and the binary search in math_deco_table.
7385 (class init_deco_table): class used for initial sort of the
7387 (search_deco): use lower_bound to do a binary search in the
7390 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7392 * src/lyxrc.C: a small secret thingie...
7394 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7395 and to not flush the stream as often as it used to.
7397 * src/support/lyxalgo.h: new file
7398 (sorted): template function used for checking if a sequence is
7399 sorted or not. Two versions with and without user supplied
7400 compare. Uses same compare as std::sort.
7402 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7403 it and give warning on lyxerr.
7405 (struct compare_tags): struct with function operators used for
7406 checking if sorted, sorting and lower_bound.
7407 (search_kw): use lower_bound instead of manually implemented
7410 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7412 * src/insets/insetcollapsable.h: fix Clone() declaration.
7413 * src/insets/insetfoot.h: ditto.
7415 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7417 2000-03-08 Juergen Vigna <jug@sad.it>
7419 * src/insets/lyxinset.h: added owner call which tells us if
7420 this inset is inside another inset. Changed also the return-type
7421 of Editable to an enum so it tells clearer what the return-value is.
7423 * src/insets/insettext.C (computeTextRows): fixed computing of
7424 textinsets which split automatically on more rows.
7426 * src/insets/insetert.[Ch]: changed this to be of BaseType
7429 * src/insets/insetfoot.[Ch]: added footnote inset
7431 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7432 collapsable insets (like footnote, ert, ...)
7434 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7436 * src/lyxdraw.h: remvoe file
7438 * src/lyxdraw.C: remove file
7440 * src/insets/insettext.C: added <algorithm>.
7442 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7444 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7445 (matrix_cb): case MM_OK use string stream
7447 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7450 * src/mathed/math_macro.C (draw): use string stream
7451 (Metrics): use string stream
7453 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7454 directly to the ostream.
7456 * src/vspace.C (asString): use string stream.
7457 (asString): use string stream
7458 (asLatexString): use string stream
7460 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7461 setting Spacing::Other.
7463 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7464 sprintf when creating the stretch vale.
7466 * src/text2.C (alphaCounter): changed to return a string and to
7467 not use a static variable internally. Also fixed a one-off bug.
7468 (SetCounter): changed the drawing of the labels to use string
7469 streams instead of sprintf.
7471 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7472 manipulator to use a scheme that does not require library support.
7473 This is also the way it is done in the new GNU libstdc++. Should
7474 work with DEC cxx now.
7476 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7478 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7479 end. This fixes a bug.
7481 * src/mathed (all files concerned with file writing): apply the
7482 USE_OSTREAM_ONLY changes to mathed too.
7484 * src/support/DebugStream.h: make the constructor explicit.
7486 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7487 count and ostream squashed.
7489 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7491 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7493 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7494 ostringstream uses STL strings, and we might not.
7496 * src/insets/insetspecialchar.C: add using directive.
7497 * src/insets/insettext.C: ditto.
7499 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7501 * lib/layouts/seminar.layout: feeble attempt at a layout for
7502 seminar.cls, far from completet and could really use some looking
7503 at from people used to write layout files.
7505 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7506 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7507 a lot nicer and works nicely with ostreams.
7509 * src/mathed/formula.C (draw): a slightly different solution that
7510 the one posted to the list, but I think this one works too. (font
7511 size wrong in headers.)
7513 * src/insets/insettext.C (computeTextRows): some fiddling on
7514 Jürgens turf, added some comments that he should read.
7516 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7517 used and it gave compiler warnings.
7518 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7521 * src/lyx_gui.C (create_forms): do the right thing when
7522 show_banner is true/false.
7524 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7525 show_banner is false.
7527 * most file writing files: Now use iostreams to do almost all of
7528 the writing. Also instead of passing string &, we now use
7529 stringstreams. mathed output is still not adapted to iostreams.
7530 This change can be turned off by commenting out all the occurences
7531 of the "#define USE_OSTREAM_ONLY 1" lines.
7533 * src/WorkArea.C (createPixmap): don't output debug messages.
7534 (WorkArea): don't output debug messages.
7536 * lib/lyxrc.example: added a comment about the new variable
7539 * development/Code_rules/Rules: Added some more commente about how
7540 to build class interfaces and on how better encapsulation can be
7543 2000-03-03 Juergen Vigna <jug@sad.it>
7545 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7546 automatically with the width of the LyX-Window
7548 * src/insets/insettext.C (computeTextRows): fixed update bug in
7549 displaying text-insets (scrollvalues where not initialized!)
7551 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7553 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7554 id in the check of the result from lower_bound is not enough since
7555 lower_bound can return last too, and then res->id will not be a
7558 * all insets and some code that use them: I have conditionalized
7559 removed the Latex(string & out, ...) this means that only the
7560 Latex(ostream &, ...) will be used. This is a work in progress to
7561 move towards using streams for all output of files.
7563 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7566 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7568 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7569 routine (this fixes bug where greek letters were surrounded by too
7572 * src/support/filetools.C (findtexfile): change a bit the search
7573 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7574 no longer passed to kpsewhich, we may have to change that later.
7576 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7577 warning options to avoid problems with X header files (from Angus
7579 * acinclude.m4: regenerated.
7581 2000-03-02 Juergen Vigna <jug@sad.it>
7583 * src/insets/insettext.C (WriteParagraphData): Using the
7584 par->writeFile() function for writing paragraph-data.
7585 (Read): Using buffer->parseSingleLyXformat2Token()-function
7586 for parsing paragraph data!
7588 * src/buffer.C (readLyXformat2): removed all parse data and using
7589 the new parseSingleLyXformat2Token()-function.
7590 (parseSingleLyXformat2Token): added this function to parse (read)
7591 lyx-file-format (this is called also from text-insets now!)
7593 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7595 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7598 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7599 directly instead of going through a func. One very bad thing: a
7600 static LyXFindReplace, but I don't know where to place it.
7602 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7603 string instead of char[]. Also changed to static.
7604 (GetSelectionOrWordAtCursor): changed to static inline
7605 (SetSelectionOverLenChars): ditto.
7607 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7608 current_view and global variables. both classes has changed names
7609 and LyXFindReplace is not inherited from SearchForm.
7611 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7612 fl_form_search form.
7614 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7616 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7618 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7619 bound (from Kayvan).
7621 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7623 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7625 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7627 * some things that I should comment but the local pub says head to
7630 * comment out all code that belongs to the Roff code for Ascii
7631 export of tables. (this is unused)
7633 * src/LyXView.C: use correct type for global variable
7634 current_layout. (LyXTextClass::size_type)
7636 * some code to get the new insetgraphics closer to working I'd be
7637 grateful for any help.
7639 * src/BufferView2.C (insertInset): use the return type of
7640 NumberOfLayout properly. (also changes in other files)
7642 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7643 this as a test. I want to know what breaks because of this.
7645 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7647 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7649 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7650 to use a \makebox in the label, this allows proper justification
7651 with out using protected spaces or multiple hfills. Now it is
7652 "label" for left justified, "\hfill label\hfill" for center, and
7653 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7654 should be changed accordingly.
7656 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7658 * src/lyxtext.h: change SetLayout() to take a
7659 LyXTextClass::size_type instead of a char (when there is more than
7660 127 layouts in a class); also change type of copylayouttype.
7661 * src/text2.C (SetLayout): ditto.
7662 * src/LyXView.C (updateLayoutChoice): ditto.
7664 * src/LaTeX.C (scanLogFile): errors where the line number was not
7665 given just after the '!'-line were ignored (from Dekel Tsur).
7667 * lib/lyxrc.example: fix description of \date_insert_format
7669 * lib/layouts/llncs.layout: new layout, contributed by Martin
7672 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7674 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7675 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7676 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7677 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7678 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7679 paragraph.C, text.C, text2.C)
7681 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7683 * src/insets/insettext.C (LocalDispatch): remove extra break
7686 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7687 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7689 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7690 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7692 * src/insets/insetbib.h: move InsetBibkey::Holder and
7693 InsetCitation::Holder in public space.
7695 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7697 * src/insets/insettext.h: small change to get the new files from
7698 Juergen to compile (use "string", not "class string").
7700 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7701 const & as parameter to LocalDispatch, use LyXFont const & as
7702 paramter to some other func. This also had impacto on lyxinsets.h
7703 and the two mathed insets.
7705 2000-02-24 Juergen Vigna <jug@sad.it>
7708 * src/commandtags.h:
7710 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7714 * src/BufferView2.C: added/updated code for various inset-functions
7716 * src/insets/insetert.[Ch]: added implementation of InsetERT
7718 * src/insets/insettext.[Ch]: added implementation of InsetText
7720 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7721 (draw): added preliminary code for inset scrolling not finshed yet
7723 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7724 as it is in lyxfunc.C now
7726 * src/insets/lyxinset.h: Added functions for text-insets
7728 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7730 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7731 BufferView and reimplement the list as a queue put inside its own
7734 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7736 * several files: use the new interface to the "updateinsetlist"
7738 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7740 (work_area_handler): call BufferView::trippleClick on trippleclick.
7742 * src/BufferView.C (doubleClick): new function, selects word on
7744 (trippleClick): new function, selects line on trippleclick.
7746 2000-02-22 Allan Rae <rae@lyx.org>
7748 * lib/bind/xemacs.bind: buffer-previous not supported
7750 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7752 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7755 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7757 * src/bufferlist.C: get rid of current_view from this file
7759 * src/spellchecker.C: get rid of current_view from this file
7761 * src/vspace.C: get rid of current_view from this file
7762 (inPixels): added BufferView parameter for this func
7763 (asLatexCommand): added a BufferParams for this func
7765 * src/text.C src/text2.C: get rid of current_view from these
7768 * src/lyxfont.C (getFontDirection): move this function here from
7771 * src/bufferparams.C (getDocumentDirection): move this function
7774 * src/paragraph.C (getParDirection): move this function here from
7776 (getLetterDirection): ditto
7778 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7780 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7781 resize due to wrong pixmap beeing used. Also took the opurtunity
7782 to make the LyXScreen stateless on regard to WorkArea and some
7783 general cleanup in the same files.
7785 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7787 * src/Makefile.am: add missing direction.h
7789 * src/PainterBase.h: made the width functions const.
7791 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7794 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7796 * src/insets/insetlatexaccent.C (draw): make the accents draw
7797 better, at present this will only work well with iso8859-1.
7799 * several files: remove the old drawing code, now we use the new
7802 * several files: remove support for mono_video, reverse_video and
7805 2000-02-17 Juergen Vigna <jug@sad.it>
7807 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7808 int ** as we have to return the pointer, otherwise we have only
7809 NULL pointers in the returning function.
7811 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7813 * src/LaTeX.C (operator()): quote file name when running latex.
7815 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7817 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7818 (bubble tip), this removes our special handling of this.
7820 * Remove all code that is unused now that we have the new
7821 workarea. (Code that are not active when NEW_WA is defined.)
7823 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7825 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7827 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7828 nonexisting layout; correctly redirect obsoleted layouts.
7830 * lib/lyxrc.example: document \view_dvi_paper_option
7832 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7835 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7836 (PreviewDVI): handle the view_dvi_paper_option variable.
7837 [Both from Roland Krause]
7839 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7841 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7842 char const *, int, LyXFont)
7843 (text(int, int, string, LyXFont)): ditto
7845 * src/text.C (InsertCharInTable): attempt to fix the double-space
7846 feature in tables too.
7847 (BackspaceInTable): ditto.
7848 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7850 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7852 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7854 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7855 newly found text in textcache to this.
7856 (buffer): set the owner of the text put into the textcache to 0
7858 * src/insets/figinset.C (draw): fixed the drawing of figures with
7861 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7862 drawing of mathframe, hfills, protected space, table lines. I have
7863 now no outstanding drawing problems with the new Painter code.
7865 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7867 * src/PainterBase.C (ellipse, circle): do not specify the default
7870 * src/LColor.h: add using directive.
7872 * src/Painter.[Ch]: change return type of methods from Painter& to
7873 PainterBase&. Add a using directive.
7875 * src/WorkArea.C: wrap xforms callbacks in C functions
7878 * lib/layouts/foils.layout: font fix and simplifications from Carl
7881 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7883 * a lot of files: The Painter, LColor and WorkArea from the old
7884 devel branch has been ported to lyx-devel. Some new files and a
7885 lot of #ifdeffed code. The new workarea is enabled by default, but
7886 if you want to test the new Painter and LColor you have to compile
7887 with USE_PAINTER defined (do this in config.h f.ex.) There are
7888 still some rought edges, and I'd like some help to clear those
7889 out. It looks stable (loads and displays the Userguide very well).
7892 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7894 * src/buffer.C (pop_tag): revert to the previous implementation
7895 (use a global variable for both loops).
7897 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7899 * src/lyxrc.C (LyXRC): change slightly default date format.
7901 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7902 there is an English text with a footnote that starts with a Hebrew
7903 paragraph, or vice versa.
7904 (TeXFootnote): ditto.
7906 * src/text.C (LeftMargin): allow for negative values for
7907 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7910 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7911 for input encoding (cyrillic)
7913 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7915 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7918 * src/toolbar.C (set): ditto
7919 * src/insets/insetbib.C (create_form_citation_form): ditto
7921 * lib/CREDITS: added Dekel Tsur.
7923 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7924 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7925 hebrew supports files from Dekel Tsur.
7927 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7928 <tzafrir@technion.ac.il>
7930 * src/lyxrc.C: put \date_insert_format at the right place.
7932 * src/buffer.C (makeLaTeXFile): fix the handling of
7933 BufferParams::sides when writing out latex files.
7935 * src/BufferView2.C: add a "using" directive.
7937 * src/support/lyxsum.C (sum): when we use lyxstring,
7938 ostringstream::str needs an additional .c_str().
7940 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7942 * src/support/filetools.C (ChangeExtension): patch from Etienne
7945 * src/TextCache.C (show): remove const_cast and make second
7946 parameter non-const LyXText *.
7948 * src/TextCache.h: use non const LyXText in show.
7950 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7953 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7955 * src/support/lyxsum.C: rework to be more flexible.
7957 * several places: don't check if a pointer is 0 if you are going
7960 * src/text.C: remove some dead code.
7962 * src/insets/figinset.C: remove some dead code
7964 * src/buffer.C: move the BufferView funcs to BufferView2.C
7965 remove all support for insetlatexdel
7966 remove support for oldpapersize stuff
7967 made some member funcs const
7969 * src/kbmap.C: use a std::list to store the bindings in.
7971 * src/BufferView2.C: new file
7973 * src/kbsequence.[Ch]: new files
7975 * src/LyXAction.C + others: remove all trace of buffer-previous
7977 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7978 only have one copy in the binary of this table.
7980 * hebrew patch: moved some functions from LyXText to more
7981 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7983 * several files: remove support for XForms older than 0.88
7985 remove some #if 0 #endif code
7987 * src/TextCache.[Ch]: new file. Holds the textcache.
7989 * src/BufferView.C: changes to use the new TextCache interface.
7990 (waitForX): remove the now unused code.
7992 * src/BackStack.h: remove some commented code
7994 * lib/bind/emacs.bind: remove binding for buffer-previous
7996 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7998 * applied the hebrew patch.
8000 * src/lyxrow.h: make sure that all Row variables are initialized.
8002 * src/text2.C (TextHandleUndo): comment out a delete, this might
8003 introduce a memory leak, but should also help us to not try to
8004 read freed memory. We need to look at this one.
8006 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8007 (LyXParagraph): initalize footnotekind.
8009 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8010 forgot this when applying the patch. Please heed the warnings.
8012 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8013 (aka. reformat problem)
8015 * src/bufferlist.C (exists): made const, and use const_iterator
8016 (isLoaded): new func.
8017 (release): use std::find to find the correct buffer.
8019 * src/bufferlist.h: made getState a const func.
8020 made empty a const func.
8021 made exists a const func.
8024 2000-02-01 Juergen Vigna <jug@sad.it>
8026 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8028 * po/it.po: updated a bit the italian po file and also changed the
8029 'file nuovo' for newfile to 'filenuovo' without a space, this did
8032 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8033 for the new insert_date command.
8035 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8036 from jdblair, to insert a date into the current text conforming to
8037 a strftime format (for now only considering the locale-set and not
8038 the document-language).
8040 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8042 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8043 Bounds Read error seen by purify. The problem was that islower is
8044 a macros which takes an unsigned char and uses it as an index for
8045 in array of characters properties (and is thus subject to the
8049 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8050 correctly the paper sides radio buttons.
8051 (UpdateDocumentButtons): ditto.
8053 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8055 * src/kbmap.C (getsym + others): change to return unsigned int,
8056 returning a long can give problems on 64 bit systems. (I assume
8057 that int is 32bit on 64bit systems)
8059 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8061 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8062 LyXLookupString to be zero-terminated. Really fixes problems seen
8065 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8067 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8068 write a (char*)0 to the lyxerr stream.
8070 * src/lastfiles.C: move algorithm before the using statemets.
8072 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8074 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8075 complains otherwise).
8076 * src/table.C: ditto
8078 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8081 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8082 that I removed earlier... It is really needed.
8084 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8086 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8088 * INSTALL: update xforms home page URL.
8090 * lib/configure.m4: fix a bug with unreadable layout files.
8092 * src/table.C (calculate_width_of_column): add "using std::max"
8095 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8097 * several files: marked several lines with "DEL LINE", this is
8098 lines that can be deleted without changing anything.
8099 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8100 checks this anyway */
8103 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8105 * src/DepTable.C (update): add a "+" at the end when the checksum
8106 is different. (debugging string only)
8108 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8109 the next inset to not be displayed. This should also fix the list
8110 of labels in the "Insert Crossreference" dialog.
8112 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8114 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8115 when regex was not found.
8117 * src/support/lstrings.C (lowercase): use handcoded transform always.
8120 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8121 old_cursor.par->prev could be 0.
8123 * several files: changed post inc/dec to pre inc/dec
8125 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8126 write the lastfiles to file.
8128 * src/BufferView.C (buffer): only show TextCache info when debugging
8130 (resizeCurrentBuffer): ditto
8131 (workAreaExpose): ditto
8133 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8135 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8137 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8138 a bit better by removing the special case for \i and \j.
8140 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8142 * src/lyx_main.C (easyParse): remove test for bad comand line
8143 options, since this broke all xforms-related parsing.
8145 * src/kbmap.C (getsym): set return type to unsigned long, as
8146 declared in header. On an alpha, long is _not_ the same as int.
8148 * src/support/LOstream.h: add a "using std::flush;"
8150 * src/insets/figinset.C: ditto.
8152 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8154 * src/bufferlist.C (write): use blinding fast file copy instead of
8155 "a char at a time", now we are doing it the C++ way.
8157 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8158 std::list<int> instead.
8159 (addpidwait): reflect move to std::list<int>
8160 (sigchldchecker): ditto
8162 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8165 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8166 that obviously was wrong...
8168 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8169 c, this avoids warnings with purify and islower.
8171 * src/insets/figinset.C: rename struct queue to struct
8172 queue_element and rewrite to use a std::queue. gsqueue is now a
8173 std::queue<queue_element>
8174 (runqueue): reflect move to std::queue
8177 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8178 we would get "1" "0" instead of "true" "false. Also make the tostr
8181 2000-01-21 Juergen Vigna <jug@sad.it>
8183 * src/buffer.C (writeFileAscii): Disabled code for special groff
8184 handling of tabulars till I fix this in table.C
8186 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8188 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8190 * src/support/lyxlib.h: ditto.
8192 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8194 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8195 and 'j' look better. This might fix the "macron" bug that has been
8198 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8199 functions as one template function. Delete the old versions.
8201 * src/support/lyxsum.C: move using std::ifstream inside
8204 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8207 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8209 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8211 * src/insets/figinset.C (InitFigures): use new instead of malloc
8212 to allocate memory for figures and bitmaps.
8213 (DoneFigures): use delete[] instead of free to deallocate memory
8214 for figures and bitmaps.
8215 (runqueue): use new to allocate
8216 (getfigdata): use new/delete[] instead of malloc/free
8217 (RegisterFigure): ditto
8219 * some files: moved some declarations closer to first use, small
8220 whitespace changes use preincrement instead of postincrement where
8221 it does not make a difference.
8223 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8224 step on the way to use stl::containers for key maps.
8226 * src/bufferlist.h: add a typedef for const_iterator and const
8227 versions of begin and end.
8229 * src/bufferlist.[Ch]: change name of member variable _state to
8230 state_. (avoid reserved names)
8232 (getFileNames): returns the filenames of the buffers in a vector.
8234 * configure.in (ALL_LINGUAS): added ro
8236 * src/support/putenv.C: new file
8238 * src/support/mkdir.C: new file
8240 2000-01-20 Allan Rae <rae@lyx.org>
8242 * lib/layouts/IEEEtran.layout: Added several theorem environments
8244 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8245 couple of minor additions.
8247 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8248 (except for those in footnotes of course)
8250 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8252 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8254 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8255 std::sort and std::lower_bound instead of qsort and handwritten
8257 (struct compara): struct that holds the functors used by std::sort
8258 and std::lower_bound in MathedLookupBOP.
8260 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8262 * src/support/LAssert.h: do not do partial specialization. We do
8265 * src/support/lyxlib.h: note that lyx::getUserName() and
8266 lyx::date() are not in use right now. Should these be suppressed?
8268 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8269 (makeLinuxDocFile): do not put date and user name in linuxdoc
8272 * src/support/lyxlib.h (kill): change first argument to long int,
8273 since that's what solaris uses.
8275 * src/support/kill.C (kill): fix declaration to match prototype.
8277 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8278 actually check whether namespaces are supported. This is not what
8281 * src/support/lyxsum.C: add a using directive.
8283 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8285 * src/support/kill.C: if we have namespace support we don't have
8286 to include lyxlib.h.
8288 * src/support/lyxlib.h: use namespace lyx if supported.
8290 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8292 * src/support/date.C: new file
8294 * src/support/chdir.C: new file
8296 * src/support/getUserName.C: new file
8298 * src/support/getcwd.C: new file
8300 * src/support/abort.C: new file
8302 * src/support/kill.C: new file
8304 * src/support/lyxlib.h: moved all the functions in this file
8305 insede struct lyx. Added also kill and abort to this struct. This
8306 is a way to avoid the "kill is not defined in <csignal>", we make
8307 C++ wrappers for functions that are not ANSI C or ANSI C++.
8309 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8310 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8311 lyx it has been renamed to sum.
8313 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8315 * src/text.C: add using directives for std::min and std::max.
8317 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8319 * src/texrow.C (getIdFromRow): actually return something useful in
8320 id and pos. Hopefully fixes the bug with positionning of errorbox
8323 * src/lyx_main.C (easyParse): output an error and exit if an
8324 incorrect command line option has been given.
8326 * src/spellchecker.C (ispell_check_word): document a memory leak.
8328 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8329 where a "struct utimbuf" is allocated with "new" and deleted with
8332 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8334 * src/text2.C (CutSelection): don't delete double spaces.
8335 (PasteSelection): ditto
8336 (CopySelection): ditto
8338 * src/text.C (Backspace): don't delete double spaces.
8340 * src/lyxlex.C (next): fix a bug that were only present with
8341 conformant std::istream::get to read comment lines, use
8342 std::istream::getline instead. This seems to fix the problem.
8344 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8346 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8347 allowed to insert space before space" editing problem. Please read
8348 commends at the beginning of the function. Comments about usage
8351 * src/text.C (InsertChar): fix for the "not allowed to insert
8352 space before space" editing problem.
8354 * src/text2.C (DeleteEmptyParagraphMechanism): when
8355 IsEmptyTableRow can only return false this last "else if" will
8356 always be a no-op. Commented out.
8358 * src/text.C (RedoParagraph): As far as I can understand tmp
8359 cursor is not really needed.
8361 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8362 present it could only return false anyway.
8363 (several functions): Did something not so smart...added a const
8364 specifier on a lot of methods.
8366 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8367 and add a tmp->text.resize. The LyXParagraph constructor does the
8369 (BreakParagraphConservative): ditto
8371 * src/support/path.h (Path): add a define so that the wrong usage
8372 "Path("/tmp") will be flagged as a compilation error:
8373 "`unnamed_Path' undeclared (first use this function)"
8375 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8377 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8378 which was bogus for several reasons.
8380 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8384 * autogen.sh: do not use "type -path" (what's that anyway?).
8386 * src/support/filetools.C (findtexfile): remove extraneous space
8387 which caused a kpsewhich warning (at least with kpathsea version
8390 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8392 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8394 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8396 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8398 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8400 * src/paragraph.C (BreakParagraph): do not reserve space on text
8401 if we don't need to (otherwise, if pos_end < pos, we end up
8402 reserving huge amounts of memory due to bad unsigned karma).
8403 (BreakParagraphConservative): ditto, although I have not seen
8404 evidence the bug can happen here.
8406 * src/lyxparagraph.h: add a using std::list.
8408 2000-01-11 Juergen Vigna <jug@sad.it>
8410 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8413 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8415 * src/vc-backend.C (doVCCommand): change to be static and take one
8416 more parameter: the path to chdir too be fore executing the command.
8417 (retrive): new function equiv to "co -r"
8419 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8420 file_not_found_hook is true.
8422 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8424 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8425 if a file is readwrite,readonly...anything else.
8427 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8429 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8430 (CreatePostscript): name change from MenuRunDVIPS (or something)
8431 (PreviewPostscript): name change from MenuPreviewPS
8432 (PreviewDVI): name change from MenuPreviewDVI
8434 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8435 \view_pdf_command., \pdf_to_ps_command
8437 * lib/configure.m4: added search for PDF viewer, and search for
8438 PDF to PS converter.
8439 (lyxrc.defaults output): add \pdflatex_command,
8440 \view_pdf_command and \pdf_to_ps_command.
8442 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8444 * src/bufferlist.C (write): we don't use blocksize for anything so
8447 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8449 * src/support/block.h: disable operator T* (), since it causes
8450 problems with both compilers I tried. See comments in the file.
8452 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8455 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8456 variable LYX_DIR_10x to LYX_DIR_11x.
8458 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8460 * INSTALL: document --with-lyxname.
8463 * configure.in: new configure flag --with-lyxname which allows to
8464 choose the name under which lyx is installed. Default is "lyx", of
8465 course. It used to be possible to do this with --program-suffix,
8466 but the later has in fact a different meaning for autoconf.
8468 * src/support/lstrings.h (lstrchr): reformat a bit.
8470 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8471 * src/mathed/math_defs.h: ditto.
8473 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8475 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8476 true, decides if we create a backup file or not when saving. New
8477 tag and variable \pdf_mode, defaults to false. New tag and
8478 variable \pdflatex_command, defaults to pdflatex. New tag and
8479 variable \view_pdf_command, defaults to xpdf. New tag and variable
8480 \pdf_to_ps_command, defaults to pdf2ps.
8482 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8484 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8485 does not have a BufferView.
8486 (unlockInset): ditto + don't access the_locking_inset if the
8487 buffer does not have a BufferView.
8489 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8490 certain circumstances so that we don't continue a keyboard
8491 operation long after the key was released. Try f.ex. to load a
8492 large document, press PageDown for some seconds and then release
8493 it. Before this change the document would contine to scroll for
8494 some time, with this change it stops imidiatly.
8496 * src/support/block.h: don't allocate more space than needed. As
8497 long as we don't try to write to the arr[x] in a array_type arr[x]
8498 it is perfectly ok. (if you write to it you might segfault).
8499 added operator value_type*() so that is possible to pass the array
8500 to functions expecting a C-pointer.
8502 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8505 * intl/*: updated to gettext 0.10.35, tried to add our own
8506 required modifications. Please verify.
8508 * po/*: updated to gettext 0.10.35, tried to add our own required
8509 modifications. Please verify.
8511 * src/support/lstrings.C (tostr): go at fixing the problem with
8512 cxx and stringstream. When stringstream is used return
8513 oss.str().c_str() so that problems with lyxstring and basic_string
8514 are avoided. Note that the best solution would be for cxx to use
8515 basic_string all the way, but it is not conformant yet. (it seems)
8517 * src/lyx_cb.C + other files: moved several global functions to
8518 class BufferView, some have been moved to BufferView.[Ch] others
8519 are still located in lyx_cb.C. Code changes because of this. (part
8520 of "get rid of current_view project".)
8522 * src/buffer.C + other files: moved several Buffer functions to
8523 class BufferView, the functions are still present in buffer.C.
8524 Code changes because of this.
8526 * config/lcmessage.m4: updated to most recent. used when creating
8529 * config/progtest.m4: updated to most recent. used when creating
8532 * config/gettext.m4: updated to most recent. applied patch for
8535 * config/gettext.m4.patch: new file that shows what changes we
8536 have done to the local copy of gettext.m4.
8538 * config/libtool.m4: new file, used in creation of acinclude.m4
8540 * config/lyxinclude.m4: new file, this is the lyx created m4
8541 macros, used in making acinclude.m4.
8543 * autogen.sh: GNU m4 discovered as a separate task not as part of
8544 the lib/configure creation.
8545 Generate acinlucde from files in config. Actually cat
8546 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8547 easier to upgrade .m4 files that really are external.
8549 * src/Spacing.h: moved using std::istringstream to right after
8550 <sstream>. This should fix the problem seen with some compilers.
8552 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * src/lyx_cb.C: began some work to remove the dependency a lot of
8555 functions have on BufferView::text, even if not really needed.
8556 (GetCurrentTextClass): removed this func, it only hid the
8559 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8560 forgot this in last commit.
8562 * src/Bullet.C (bulletEntry): use static char const *[] for the
8563 tables, becuase of this the return arg had to change to string.
8565 (~Bullet): removed unneeded destructor
8567 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8568 (insetSleep): moved from Buffer
8569 (insetWakeup): moved from Buffer
8570 (insetUnlock): moved from Buffer
8572 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8573 from Buffer to BufferView.
8575 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8577 * config/ltmain.sh: updated to version 1.3.4 of libtool
8579 * config/ltconfig: updated to version 1.3.4 of libtool
8581 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8584 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8585 Did I get that right?
8587 * src/lyxlex.h: add a "using" directive or two.
8588 * src/Spacing.h: ditto.
8589 * src/insets/figinset.C: ditto.
8590 * src/support/filetools.C: ditto.
8591 * src/support/lstrings.C: ditto.
8592 * src/BufferView.C: ditto.
8593 * src/bufferlist.C: ditto.
8594 * src/lyx_cb.C: ditto.
8595 * src/lyxlex.C: ditto.
8597 * NEWS: add some changes for 1.1.4.
8599 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8601 * src/BufferView.C: first go at a TextCache to speed up switching
8604 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8606 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8607 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8608 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8609 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8612 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8613 members of the struct are correctly initialized to 0 (detected by
8615 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8616 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8618 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8619 pidwait, since it was allocated with "new". This was potentially
8620 very bad. Thanks to Michael Schmitt for running purify for us.
8623 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8625 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8627 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8629 1999-12-30 Allan Rae <rae@lyx.org>
8631 * lib/templates/IEEEtran.lyx: minor change
8633 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8634 src/mathed/formula.C (LocalDispatch): askForText changes
8636 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8637 know when a user has cancelled input. Fixes annoying problems with
8638 inserting labels and version control.
8640 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8642 * src/support/lstrings.C (tostr): rewritten to use strstream and
8645 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8647 * src/support/filetools.C (IsFileWriteable): use fstream to check
8648 (IsDirWriteable): use fileinfo to check
8650 * src/support/filetools.h (FilePtr): whole class deleted
8652 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8654 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8656 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8658 * src/bufferlist.C (write): use ifstream and ofstream instead of
8661 * src/Spacing.h: use istrstream instead of sscanf
8663 * src/mathed/math_defs.h: change first arg to istream from FILE*
8665 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8667 * src/mathed/math_parser.C: have yyis to be an istream
8668 (LexGetArg): use istream (yyis)
8670 (mathed_parse): ditto
8671 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8673 * src/mathed/formula.C (Read): rewritten to use istream
8675 * src/mathed/formulamacro.C (Read): rewritten to use istream
8677 * src/lyxlex.h (~LyXLex): deleted desturctor
8678 (getStream): new function, returns an istream
8679 (getFile): deleted funtion
8680 (IsOK): return is.good();
8682 * src/lyxlex.C (LyXLex): delete file and owns_file
8683 (setFile): open an filebuf and assign that to a istream instead of
8685 (setStream): new function, takes an istream as arg.
8686 (setFile): deleted function
8687 (EatLine): rewritten us use istream instead of FILE*
8691 * src/table.C (LyXTable): use istream instead of FILE*
8692 (Read): rewritten to take an istream instead of FILE*
8694 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8696 * src/buffer.C (Dispatch): remove an extraneous break statement.
8698 * src/support/filetools.C (QuoteName): change to do simple
8699 'quoting'. More work is necessary. Also changed to do nothing
8700 under emx (needs fix too).
8701 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8703 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8704 config.h.in to the AC_DEFINE_UNQUOTED() call.
8705 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8706 needs char * as argument (because Solaris 7 declares it like
8709 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8710 remove definition of BZERO.
8712 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8714 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8715 defined, "lyxregex.h" if not.
8717 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8719 (REGEX): new variable that is set to regex.c lyxregex.h when
8720 AM_CONDITIONAL USE_REGEX is set.
8721 (libsupport_la_SOURCES): add $(REGEX)
8723 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8726 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8729 * configure.in: add call to LYX_REGEX
8731 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8732 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8734 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8736 * lib/bind/fi_menus.bind: new file, from
8737 pauli.virtanen@saunalahti.fi.
8739 * src/buffer.C (getBibkeyList): pass the parameter delim to
8740 InsetInclude::getKeys and InsetBibtex::getKeys.
8742 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8743 is passed to Buffer::getBibkeyList
8745 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8746 instead of the hardcoded comma.
8748 * src/insets/insetbib.C (getKeys): make sure that there are not
8749 leading blanks in bibtex keys. Normal latex does not care, but
8750 harvard.sty seems to dislike blanks at the beginning of citation
8751 keys. In particular, the retturn value of the function is
8753 * INSTALL: make it clear that libstdc++ is needed and that gcc
8754 2.7.x probably does not work.
8756 * src/support/filetools.C (findtexfile): make debug message go to
8758 * src/insets/insetbib.C (getKeys): ditto
8760 * src/debug.C (showTags): make sure that the output is correctly
8763 * configure.in: add a comment for TWO_COLOR_ICON define.
8765 * acconfig.h: remove all the entries that already defined in
8766 configure.in or acinclude.m4.
8768 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8769 to avoid user name, date and copyright.
8771 1999-12-21 Juergen Vigna <jug@sad.it>
8773 * src/table.C (Read): Now read bogus row format informations
8774 if the format is < 5 so that afterwards the table can
8775 be read by lyx but without any format-info. Fixed the
8776 crash we experienced when not doing this.
8778 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8780 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8781 (RedoDrawingOfParagraph): ditto
8782 (RedoParagraphs): ditto
8783 (RemoveTableRow): ditto
8785 * src/text.C (Fill): rename arg paperwidth -> paper_width
8787 * src/buffer.C (insertLyXFile): rename var filename -> fname
8788 (writeFile): rename arg filename -> fname
8789 (writeFileAscii): ditto
8790 (makeLaTeXFile): ditto
8791 (makeLinuxDocFile): ditto
8792 (makeDocBookFile): ditto
8794 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8797 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8799 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8802 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8803 compiled by a C compiler not C++.
8805 * src/layout.h (LyXTextClass): added typedef for const_iterator
8806 (LyXTextClassList): added typedef for const_iterator + member
8807 functions begin and end.
8809 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8810 iterators to fill the choice_class.
8811 (updateLayoutChoice): rewritten to use iterators to fill the
8812 layoutlist in the toolbar.
8814 * src/BufferView.h (BufferView::work_area_width): removed unused
8817 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8819 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8820 (sgmlCloseTag): ditto
8822 * src/support/lstrings.h: return type of countChar changed to
8825 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8826 what version of this func to use. Also made to return unsigned int.
8828 * configure.in: call LYX_STD_COUNT
8830 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8831 conforming std::count.
8833 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8835 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8836 and a subscript would give bad display (patch from Dekel Tsur
8837 <dekel@math.tau.ac.il>).
8839 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8841 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8844 * src/chset.h: add a few 'using' directives
8846 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8847 triggered when no buffer is active
8849 * src/layout.C: removed `break' after `return' in switch(), since
8852 * src/lyx_main.C (init): make sure LyX can be ran in place even
8853 when libtool has done its magic with shared libraries. Fix the
8854 test for the case when the system directory has not been found.
8856 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8857 name for the latex file.
8858 (MenuMakeHTML): ditto
8860 * src/buffer.h: add an optional boolean argument, which is passed
8863 1999-12-20 Allan Rae <rae@lyx.org>
8865 * lib/templates/IEEEtran.lyx: small correction and update.
8867 * configure.in: Attempted to use LYX_PATH_HEADER
8869 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8871 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8872 input from JMarc. Now use preprocessor to find the header.
8873 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8874 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8875 LYX_STL_STRING_FWD. See comments in file.
8877 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8879 * The global MiniBuffer * minibuffer variable is dead.
8881 * The global FD_form_main * fd_form_main variable is dead.
8883 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8885 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8887 * src/table.h: add the LOstream.h header
8888 * src/debug.h: ditto
8890 * src/LyXAction.h: change the explaination of the ReadOnly
8891 attribute: is indicates that the function _can_ be used.
8893 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8896 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8898 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8904 * src/paragraph.C (GetWord): assert on pos>=0
8907 * src/support/lyxstring.C: condition the use of an invariant on
8909 * src/support/lyxstring.h: ditto
8911 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8912 Use LAssert.h instead of plain assert().
8914 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8916 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8917 * src/support/filetools.C: ditto
8919 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8922 * INSTALL: document the new configure flags
8924 * configure.in: suppress --with-debug; add --enable-assertions
8926 * acinclude.m4: various changes in alignment of help strings.
8928 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8930 * src/kbmap.C: commented out the use of the hash map in kb_map,
8931 beginning of movement to a stl::container.
8933 * several files: removed code that was not in effect when
8934 MOVE_TEXT was defined.
8936 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8937 for escaping should not be used. We can discuss if the string
8938 should be enclosed in f.ex. [] instead of "".
8940 * src/trans_mgr.C (insert): use the new returned value from
8941 encodeString to get deadkeys and keymaps done correctly.
8943 * src/chset.C (encodeString): changed to return a pair, to tell
8944 what to use if we know the string.
8946 * src/lyxscreen.h (fillArc): new function.
8948 * src/FontInfo.C (resize): rewritten to use more std::string like
8949 structore, especially string::replace.
8951 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8954 * configure.in (chmod +x some scripts): remove config/gcc-hack
8956 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8958 * src/buffer.C (writeFile): change once again the top comment in a
8959 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8960 instead of an hardcoded version number.
8961 (makeDocBookFile): ditto
8963 * src/version.h: add new define LYX_DOCVERSION
8965 * po/de.po: update from Pit Sütterlin
8966 * lib/bind/de_menus.bind: ditto.
8968 * src/lyxfunc.C (Dispatch): call MenuExport()
8969 * src/buffer.C (Dispatch): ditto
8971 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8972 LyXFunc::Dispatch().
8973 (MenuExport): new function, moved from
8974 LyXFunc::Dispatch().
8976 * src/trans_mgr.C (insert): small cleanup
8977 * src/chset.C (loadFile): ditto
8979 * lib/kbd/iso8859-1.cdef: add missing backslashes
8981 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8983 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8984 help with placing the manually drawn accents better.
8986 (Draw): x2 and hg changed to float to minimize rounding errors and
8987 help place the accents better.
8989 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8990 unsigned short to char is just wrong...cast the char to unsigned
8991 char instead so that the two values can compare sanely. This
8992 should also make the display of insetlatexaccents better and
8993 perhaps also some other insets.
8995 (lbearing): new function
8998 1999-12-15 Allan Rae <rae@lyx.org>
9000 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9001 header that provides a wrapper around the very annoying SGI STL header
9004 * src/support/lyxstring.C, src/LString.h:
9005 removed old SGI-STL-compatability attempts.
9007 * configure.in: Use LYX_STL_STRING_FWD.
9009 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9010 stl_string_fwd.h is around and try to determine it's location.
9011 Major improvement over previous SGI STL 3.2 compatability.
9012 Three small problems remain with this function due to my zero
9013 knowledge of autoconf. JMarc and lgb see the comments in the code.
9015 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9017 * src/broken_const.h, config/hack-gcc, config/README: removed
9019 * configure.in: remove --with-gcc-hack option; do not call
9022 * INSTALL: remove documentation of --with-broken-const and
9025 * acconfig.h: remove all trace of BROKEN_CONST define
9027 * src/buffer.C (makeDocBookFile): update version number in output
9029 (SimpleDocBookOnePar): fix an assert when trying to a character
9030 access beyond string length
9033 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9035 * po/de.po: fix the Export menu
9037 * lyx.man: update the description of -dbg
9039 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9040 (commandLineHelp): updated
9041 (easyParse): show list of available debug levels if -dbg is passed
9044 * src/Makefile.am: add debug.C
9046 * src/debug.h: moved some code to debug.C
9048 * src/debug.C: new file. Contains code to set and show debug
9051 * src/layout.C: remove 'break' after 'continue' in switch
9052 statements, since these cannot be reached.
9054 1999-12-13 Allan Rae <rae@lyx.org>
9056 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9057 (in_word_set): hash() -> math_hash()
9059 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9061 * acconfig.h: Added a test for whether we are using exceptions in the
9062 current compilation run. If so USING_EXCEPTIONS is defined.
9064 * config.in: Check for existance of stl_string_fwd.h
9065 * src/LString.h: If compiling --with-included-string and SGI's
9066 STL version 3.2 is present (see above test) we need to block their
9067 forward declaration of string and supply a __get_c_string().
9068 However, it turns out this is only necessary if compiling with
9069 exceptions enabled so I've a bit more to add yet.
9071 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9072 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9073 src/support/LRegex.h, src/undo.h:
9074 Shuffle the order of the included files a little to ensure that
9075 LString.h gets included before anything that includes stl_string_fwd.h
9077 * src/support/lyxstring.C: We need to #include LString.h instead of
9078 lyxstring.h to get the necessary definition of __get_c_string.
9079 (__get_c_string): New function. This is defined static just like SGI's
9080 although why they need to do this I'm not sure. Perhaps it should be
9081 in lstrings.C instead.
9083 * lib/templates/IEEEtran.lyx: New template file.
9085 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9087 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9088 * intl/Makefile.in (MKINSTALLDIRS): ditto
9090 * src/LyXAction.C (init): changed to hold the LFUN data in a
9091 automatic array in stead of in callso to newFunc, this speeds up
9092 compilation a lot. Also all the memory used by the array is
9093 returned when the init is completed.
9095 * a lot of files: compiled with -Wold-style-cast, changed most of
9096 the reported offenders to C++ style casts. Did not change the
9097 offenders in C files.
9099 * src/trans.h (Match): change argument type to unsigned int.
9101 * src/support/DebugStream.C: fix some types on the streambufs so
9102 that it works on a conforming implementation.
9104 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9106 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9108 * src/support/lyxstring.C: remove the inline added earlier since
9109 they cause a bunch of unsatisfied symbols when linking with dec
9110 cxx. Cxx likes to have the body of inlines at the place where they
9113 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9114 accessing negative bounds in array. This fixes the crash when
9115 inserting accented characters.
9116 * src/trans.h (Match): ditto
9118 * src/buffer.C (Dispatch): since this is a void, it should not try
9119 to return anything...
9121 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9123 * src/buffer.h: removed the two friends from Buffer. Some changes
9124 because of this. Buffer::getFileName and Buffer::setFileName
9125 renamed to Buffer::fileName() and Buffer::fileName(...).
9127 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9129 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9130 and Buffer::update(short) to BufferView. This move is currently
9131 controlled by a define MOVE_TEXT, this will be removed when all
9132 shows to be ok. This move paves the way for better separation
9133 between buffer contents and buffer view. One side effect is that
9134 the BufferView needs a rebreak when swiching buffers, if we want
9135 to avoid this we can add a cache that holds pointers to LyXText's
9136 that is not currently in use.
9138 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9141 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9143 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9145 * lyx_main.C: new command line option -x (or --execute) and
9146 -e (or --export). Now direct conversion from .lyx to .tex
9147 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9148 Unfortunately, X is still needed and the GUI pops up during the
9151 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9153 * src/Spacing.C: add a using directive to bring stream stuff into
9155 * src/paragraph.C: ditto
9156 * src/buffer.C: ditto
9158 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9159 from Lars' announcement).
9161 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9162 example files from Tino Meinen.
9164 1999-12-06 Allan Rae <rae@lyx.org>
9166 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9168 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9170 * src/support/lyxstring.C: added a lot of inline for no good
9173 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9174 latexWriteEndChanges, they were not used.
9176 * src/layout.h (operator<<): output operator for PageSides
9178 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9180 * some example files: loaded in LyX 1.0.4 and saved again to update
9181 certain constructs (table format)
9183 * a lot of files: did the change to use fstream/iostream for all
9184 writing of files. Done with a close look at Andre Poenitz's patch.
9186 * some files: whitespace changes.
9188 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9190 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9191 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9192 architecture, we provide our own. It is used unconditionnally, but
9193 I do not think this is a performance problem. Thanks to Angus
9194 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9195 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9197 (GetInset): use my_memcpy.
9201 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9202 it is easier to understand, but it uses less TeX-only constructs now.
9204 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9205 elements contain spaces
9207 * lib/configure: regenerated
9209 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9210 elements contain spaces; display the list of programs that are
9213 * autogen.sh: make sure lib/configure is executable
9215 * lib/examples/*: rename the tutorial examples to begin with the
9216 two-letters language code.
9218 * src/lyxfunc.C (getStatus): do not query current font if no
9221 * src/lyx_cb.C (RunScript): use QuoteName
9222 (MenuRunDvips): ditto
9223 (PrintApplyCB): ditto
9225 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9226 around argument, so that it works well with the current shell.
9227 Does not work properly with OS/2 shells currently.
9229 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9230 * src/LyXSendto.C (SendtoApplyCB): ditto
9231 * src/lyxfunc.C (Dispatch): ditto
9232 * src/buffer.C (runLaTeX): ditto
9233 (runLiterate): ditto
9234 (buildProgram): ditto
9236 * src/lyx_cb.C (RunScript): ditto
9237 (MenuMakeLaTeX): ditto
9239 * src/buffer.h (getLatexName): new method
9241 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9243 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9245 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9246 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9247 (create_math_panel): ditto
9249 * src/lyxfunc.C (getStatus): re-activate the code which gets
9250 current font and cursor; add test for export to html.
9252 * src/lyxrc.C (read): remove unreachable break statements; add a
9255 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9257 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9259 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9260 introduced by faulty regex.
9261 * src/buffer.C: ditto
9262 * src/lastfiles.C: ditto
9263 * src/paragraph.C: ditto
9264 * src/table.C: ditto
9265 * src/vspace.C: ditto
9266 * src/insets/figinset.C: ditto
9267 Note: most of these is absolutely harmless, except the one in
9268 src/mathed formula.C.
9270 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9272 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9273 operation, yielding correct results for the reLyX command.
9275 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9277 * src/support/filetools.C (ExpandPath): removed an over eager
9279 (ReplaceEnvironmentPath): ditto
9281 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9282 shows that we are doing something fishy in our code...
9286 * src/lyxrc.C (read): use a double switch trick to get more help
9287 from the compiler. (the same trick is used in layout.C)
9288 (write): new function. opens a ofstream and pass that to output
9289 (output): new function, takes a ostream and writes the lyxrc
9290 elemts to it. uses a dummy switch to make sure no elements are
9293 * src/lyxlex.h: added a struct pushpophelper for use in functions
9294 with more than one exit point.
9296 * src/lyxlex.[Ch] (GetInteger): made it const
9300 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9302 * src/layout.[hC] : LayoutTags splitted into several enums, new
9303 methods created, better error handling cleaner use of lyxlex. Read
9306 * src/bmtable.[Ch]: change some member prototypes because of the
9307 image const changes.
9309 * commandtags.h, src/LyXAction.C (init): new function:
9310 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9311 This file is not read automatically but you can add \input
9312 preferences to your lyxrc if you want to. We need to discuss how
9315 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9316 in .aux, also remove .bib and .bst files from dependencies when
9319 * src/BufferView.C, src/LyXView.C: add const_cast several places
9320 because of changes to images.
9322 * lib/images/*: same change as for images/*
9324 * lib/lyxrc.example: Default for accept_compound is false not no.
9326 * images/*: changed to be const, however I have som misgivings
9327 about this change so it might be changed back.
9329 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9331 * lib/configure, po/POTFILES.in: regenerated
9333 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9335 * config/lib_configure.m4: removed
9337 * lib/configure.m4: new file (was config/lib_configure.m4)
9339 * configure.in: do not test for rtti, since we do not use it.
9341 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9343 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9344 doubling of allocated space scheme. This makes it faster for large
9345 strings end to use less memory for small strings. xtra rememoved.
9347 * src/insets/figinset.C (waitalarm): commented out.
9348 (GhostscriptMsg): use static_cast
9349 (GhostscriptMsg): use new instead of malloc to allocate memory for
9350 cmap. also delete the memory after use.
9352 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9354 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9355 for changes in bibtex database or style.
9356 (runBibTeX): remove all .bib and .bst files from dep before we
9358 (run): use scanAuc in when dep file already exist.
9360 * src/DepTable.C (remove_files_with_extension): new method
9363 * src/DepTable.[Ch]: made many of the methods const.
9365 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9367 * src/bufferparams.C: make sure that the default textclass is
9368 "article". It used to be the first one by description order, but
9369 now the first one is "docbook".
9371 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9372 string; call Debug::value.
9373 (easyParse): pass complete argument to setDebuggingLevel().
9375 * src/debug.h (value): fix the code that parses debug levels.
9377 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9380 * src/LyXAction.C: use Debug::ACTION as debug channel.
9382 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9384 * NEWS: updated for the future 1.1.3 release.
9386 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9387 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9388 it should. This is of course a controversial change (since many
9389 people will find that their lyx workscreen is suddenly full of
9390 red), but done for the sake of correctness.
9392 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9393 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9395 * src/insets/inseterror.h, src/insets/inseturl.h,
9396 src/insets/insetinfo.h, src/insets/figinset.h,
9397 src/mathed/formulamacro.h, src/mathed/math_macro.h
9398 (EditMessage): add a missing const and add _() to make sure that
9401 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9402 src/insets/insetbib.C, src/support/filetools.C: add `using'
9405 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9406 doing 'Insert index of last word' at the beginning of a paragraph.
9408 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9410 * several files: white-space changes.
9412 * src/mathed/formula.C: removed IsAlpha and IsDigit
9414 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9415 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9418 * src/insets/figinset.C (GetPSSizes): don't break when
9419 "EndComments" is seen. But break when a boundingbox is read.
9421 * all classes inherited from Inset: return value of Clone
9422 changed back to Inset *.
9424 * all classes inherited form MathInset: return value of Clone
9425 changed back to MathedInset *.
9427 * src/insets/figinset.C (runqueue): use a ofstream to output the
9428 gs/ps file. Might need some setpresicion or setw. However I can
9429 see no problem with the current code.
9430 (runqueue): use sleep instead of the alarm/signal code. I just
9431 can't see the difference.
9433 * src/paragraph.C (LyXParagraph): reserve space in the new
9434 paragraph and resize the inserted paragraph to just fit.
9436 * src/lyxfunc.h (operator|=): added operator for func_status.
9438 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9439 check for readable file.
9441 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9442 check for readable file.
9443 (MenuMakeLinuxDoc): ditto
9444 (MenuMakeDocBook): ditto
9445 (MenuMakeAscii): ditto
9446 (InsertAsciiFile): split the test for openable and readable
9448 * src/bmtable.C (draw_bitmaptable): use
9449 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9451 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9452 findtexfile from LaTeX to filetools.
9454 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9455 instead of FilePtr. Needs to be verified by a literate user.
9457 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9459 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9460 (EditMessage): likewise.
9462 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9463 respectively as \textasciitilde and \textasciicircum.
9465 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9467 * src/support/lyxstring.h: made the methods that take iterators
9470 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9471 (regexMatch): made is use the real regex class.
9473 * src/support/Makefile.am: changed to use libtool
9475 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9477 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9479 (MathIsInset ++): changed several macros to be inline functions
9482 * src/mathed/Makefile.am: changed to use libtool
9484 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9486 * src/insets/inset* : Clone changed to const and return type is
9487 the true insettype not just Inset*.
9489 * src/insets/Makefile.am: changed to use libtool
9491 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9493 * src/undo.[Ch] : added empty() and changed some of the method
9496 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9498 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9499 setID use block<> for the bullets array, added const several places.
9501 * src/lyxfunc.C (getStatus): new function
9503 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9504 LyXAction, added const to several funtions.
9506 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9507 a std::map, and to store the dir items in a vector.
9509 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9512 * src/LyXView.[Ch] + other files : changed currentView to view.
9514 * src/LyXAction.[Ch] : ported from the old devel branch.
9516 * src/.cvsignore: added .libs and a.out
9518 * configure.in : changes to use libtool.
9520 * acinclude.m4 : inserted libtool.m4
9522 * .cvsignore: added libtool
9524 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9526 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9527 file name in insets and mathed directories (otherwise the
9528 dependency is not taken in account under cygwin).
9530 * src/text2.C (InsertString[AB]): make sure that we do not try to
9531 read characters past the string length.
9533 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9535 * lib/doc/LaTeXConfig.lyx.in,
9536 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9538 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9539 file saying who created them and when this heppened; this is
9540 useless and annoys tools like cvs.
9542 * lib/layouts/g-brief-{en,de}.layout,
9543 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9544 from Thomas Hartkens <thomas@hartkens.de>.
9546 * src/{insets,mathed}/Makefile.am: do not declare an empty
9547 LDFLAGS, so that it can be set at configure time (useful on Irix
9550 * lib/reLyX/configure.in: make sure that the prefix is set
9551 correctly in LYX_DIR.
9553 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9555 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9556 be used by 'command-sequence' this allows to bind a key to a
9557 sequence of LyX-commands
9558 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9560 * src/LyXAction.C: add "command-sequence"
9562 * src/LyXFunction.C: handling of "command-sequence"
9564 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9565 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9567 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9569 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9571 * src/buffer.C (writeFile): Do not output a comment giving user
9572 and date at the beginning of a .lyx file. This is useless and
9573 annoys cvs anyway; update version number to 1.1.
9575 * src/Makefile.am (LYX_DIR): add this definition, so that a
9576 default path is hardcoded in LyX.
9578 * configure.in: Use LYX_GNU_GETTEXT.
9580 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9581 AM_GNU_GETTEXT with a bug fixed.
9583 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9585 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9587 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9588 which is used to point to LyX data is now LYX_DIR_11x.
9590 * lyx.man: convert to a unix text file; small updates.
9592 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9594 * src/support/LSubstring.[Ch]: made the second arg of most of the
9595 constructors be a const reference.
9597 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9600 * src/support/lyxstring.[Ch] (swap): added missing member function
9601 and specialization of swap(str, str);
9603 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9605 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9606 trace of the old one.
9608 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9609 put the member definitions in undo.C.
9611 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9612 NEW_TEXT and have now only code that was included when this was
9615 * src/intl.C (LCombo): use static_cast
9617 (DispatchCallback): ditto
9619 * src/definitions.h: removed whole file
9621 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9623 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9624 parsing and stores in a std:map. a regex defines the file format.
9625 removed unneeded members.
9627 * src/bufferparams.h: added several enums from definitions.h here.
9628 Removed unsused destructor. Changed some types to use proper enum
9629 types. use block to have the temp_bullets and user_defined_bullets
9630 and to make the whole class assignable.
9632 * src/bufferparams.C (Copy): removed this functions, use a default
9635 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9638 * src/buffer.C (readLyXformat2): commend out all that have with
9639 oldpapersize to do. also comment out all that hve to do with
9640 insetlatex and insetlatexdel.
9641 (setOldPaperStuff): commented out
9643 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9645 * src/LyXAction.C: remove use of inset-latex-insert
9647 * src/mathed/math_panel.C (button_cb): use static_cast
9649 * src/insets/Makefile.am (insets_o_SOURCES): removed
9652 * src/support/lyxstring.C (helper): use the unsigned long
9653 specifier, UL, instead of a static_cast.
9655 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9657 * src/support/block.h: new file. to be used as a c-style array in
9658 classes, so that the class can be assignable.
9660 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9662 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9663 NULL, make sure to return an empty string (it is not possible to
9664 set a string to NULL).
9666 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9668 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9670 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9672 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9673 link line, so that Irix users (for example) can set it explicitely to
9676 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9677 it can be overidden at make time (static or dynamic link, for
9680 * src/vc-backend.C, src/LaTeXFeatures.h,
9681 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9682 statements to bring templates to global namespace.
9684 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9686 * src/support/lyxstring.C (operator[] const): make it standard
9689 * src/minibuffer.C (Init): changed to reflect that more
9690 information is given from the lyxvc and need not be provided here.
9692 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9694 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9696 * src/LyXView.C (UpdateTimerCB): use static_cast
9697 (KeyPressMask_raw_callback): ditto
9699 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9700 buffer_, a lot of changes because of this. currentBuffer() ->
9701 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9702 also changes to other files because of this.
9704 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9706 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9707 have no support for RCS and partial support for CVS, will be
9710 * src/insets/ several files: changes because of function name
9711 changes in Bufferview and LyXView.
9713 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9715 * src/support/LSubstring.[Ch]: new files. These implement a
9716 Substring that can be very convenient to use. i.e. is this
9718 string a = "Mary had a little sheep";
9719 Substring(a, "sheep") = "lamb";
9720 a is now "Mary has a little lamb".
9722 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9723 out patterns and subpatterns of strings. It is used by LSubstring
9724 and also by vc-backend.C
9726 * src/support/lyxstring.C: went over all the assertions used and
9727 tried to correct the wrong ones and flag which of them is required
9728 by the standard. some bugs found because of this. Also removed a
9729 couple of assertions.
9731 * src/support/Makefile.am (libsupport_a_SOURCES): added
9732 LSubstring.[Ch] and LRegex.[Ch]
9734 * src/support/FileInfo.h: have struct stat buf as an object and
9735 not a pointer to one, some changes because of this.
9737 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9738 information in layout when adding the layouts preamble to the
9741 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9744 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9745 because of bug in OS/2.
9747 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9749 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9750 \verbatim@font instead of \ttfamily, so that it can be redefined.
9752 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9753 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9754 src/layout.h, src/text2.C: add 'using' directive to bring the
9755 STL templates we need from the std:: namespace to the global one.
9756 Needed by DEC cxx in strict ansi mode.
9758 * src/support/LIstream.h,src/support/LOstream.h,
9759 src/support/lyxstring.h,src/table.h,
9760 src/lyxlookup.h: do not include <config.h> in header
9761 files. This should be done in the .C files only.
9763 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9767 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9769 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9770 from Kayvan to fix the tth invokation.
9772 * development/lyx.spec.in: updates from Kayvan to reflect the
9773 changes of file names.
9775 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9777 * src/text2.C (InsertStringB): use std::copy
9778 (InsertStringA): use std::copy
9780 * src/bufferlist.C: use a vector to store the buffers in. This is
9781 an internal change and should not affect any other thing.
9783 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9786 * src/text.C (Fill): fix potential bug, one off bug.
9788 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9790 * src/Makefile.am (lyx_main.o): add more files it depends on.
9792 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9794 * src/support/lyxstring.C: use size_t for the reference count,
9795 size, reserved memory and xtra.
9796 (internal_compare): new private member function. Now the compare
9797 functions should work for std::strings that have embedded '\0'
9799 (compare): all compare functions rewritten to use
9802 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9804 * src/support/lyxstring.C (compare): pass c_str()
9805 (compare): pass c_str
9806 (compare): pass c_str
9808 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9810 * src/support/DebugStream.C: <config.h> was not included correctly.
9812 * lib/configure: forgot to re-generate it :( I'll make this file
9813 auto generated soon.
9815 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9817 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9820 * src/support/lyxstring.C: some changes from length() to rep->sz.
9821 avoids a function call.
9823 * src/support/filetools.C (SpaceLess): yet another version of the
9824 algorithm...now per Jean-Marc's suggestions.
9826 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9828 * src/layout.C (less_textclass_desc): functor for use in sorting
9830 (LyXTextClass::Read): sort the textclasses after reading.
9832 * src/support/filetools.C (SpaceLess): new version of the
9833 SpaceLess functions. What problems does this one give? Please
9836 * images/banner_bw.xbm: made the arrays unsigned char *
9838 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9840 * src/support/lyxstring.C (find): remove bogus assertion in the
9841 two versions of find where this has not been done yet.
9843 * src/support/lyxlib.h: add missing int return type to
9846 * src/menus.C (ShowFileMenu): disable exporting to html if no
9847 html export command is present.
9849 * config/lib_configure.m4: add a test for an HTML converter. The
9850 programs checked for are, in this order: tth, latex2html and
9853 * lib/configure: generated from config/lib_configure.m4.
9855 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9856 html converter. The parameters are now passed through $$FName and
9857 $$OutName, instead of standard input/output.
9859 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9861 * lib/lyxrc.example: update description of \html_command.
9862 add "quotes" around \screen_font_xxx font setting examples to help
9863 people who use fonts with spaces in their names.
9865 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9867 * Distribution files: updates for v1.1.2
9869 * src/support/lyxstring.C (find): remove bogus assert and return
9870 npos for the same condition.
9872 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9874 * added patch for OS/2 from SMiyata.
9876 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9878 * src/text2.C (CutSelection): make space_wrapped a bool
9879 (CutSelection): dont declare int i until we have to.
9880 (alphaCounter): return a char const *.
9882 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9884 * src/support/syscall.C (Systemcalls::kill):
9885 src/support/filetools.C (PutEnv, PutEnvPath):
9886 src/lyx_cb.C (addNewlineAndDepth):
9887 src/FontInfo.C (FontInfo::resize): condition some #warning
9888 directives with WITH_WARNINGS.
9891 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9893 * src/layout.[Ch] + several files: access to class variables
9894 limited and made accessor functions instead a lot of code changed
9895 becuase of this. Also instead of returning pointers often a const
9896 reference is returned instead.
9898 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9900 * src/Makefile.am (dist-hook): added used to remove the CVS from
9901 cheaders upon creating a dist
9902 (EXTRA_DIST): added cheaders
9904 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9905 a character not as a small integer.
9907 * src/support/lyxstring.C (find): removed Assert and added i >=
9908 rep->sz to the first if.
9910 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9912 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9913 src/LyXView.C src/buffer.C src/bufferparams.C
9914 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9915 src/text2.C src/insets/insetinclude.C:
9916 lyxlayout renamed to textclasslist.
9918 * src/layout.C: some lyxerr changes.
9920 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9921 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9922 (LyXLayoutList): removed all traces of this class.
9923 (LyXTextClass::Read): rewrote LT_STYLE
9924 (LyXTextClass::hasLayout): new function
9925 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9926 both const and nonconst version.
9927 (LyXTextClass::delete_layout): new function.
9928 (LyXTextClassList::Style): bug fix. do the right thing if layout
9930 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9931 (LyXTextClassList::NameOfLayout): ditto
9932 (LyXTextClassList::Load): ditto
9934 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9936 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9938 * src/LyXAction.C (LookupFunc): added a workaround for sun
9939 compiler, on the other hand...we don't know if the current code
9940 compiles on sun at all...
9942 * src/support/filetools.C (CleanupPath): subst fix
9944 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9947 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9948 complained about this one?
9950 * src/insets/insetinclude.C (Latex): subst fix
9952 * src/insets/insetbib.C (getKeys): subst fix
9954 * src/LyXSendto.C (SendtoApplyCB): subst fix
9956 * src/lyx_main.C (init): subst fix
9958 * src/layout.C (Read): subst fix
9960 * src/lyx_sendfax_main.C (button_send): subst fix
9962 * src/buffer.C (RoffAsciiTable): subst fix
9964 * src/lyx_cb.C (MenuFax): subst fix
9965 (PrintApplyCB): subst fix
9967 1999-10-26 Juergen Vigna <jug@sad.it>
9969 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9971 (Read): Cleaned up this code so now we read only format vestion >= 5
9973 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9975 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9976 come nobody has complained about this one?
9978 * src/insets/insetinclude.C (Latex): subst fix
9980 * src/insets/insetbib.C (getKeys): subst fix
9982 * src/lyx_main.C (init): subst fix
9984 * src/layout.C (Read): subst fix
9986 * src/buffer.C (RoffAsciiTable): subst fix
9988 * src/lyx_cb.C (MenuFax): subst fix.
9990 * src/layout.[hC] + some other files: rewrote to use
9991 std::container to store textclasses and layouts in.
9992 Simplified, removed a lot of code. Make all classes
9993 assignable. Further simplifications and review of type
9994 use still to be one.
9996 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9997 lastfiles to create the lastfiles partr of the menu.
9999 * src/lastfiles.[Ch]: rewritten to use deque to store the
10000 lastfiles in. Uses fstream for reading and writing. Simplifies
10003 * src/support/syscall.C: remove explicit cast.
10005 * src/BufferView.C (CursorToggleCB): removed code snippets that
10006 were commented out.
10007 use explicat C++ style casts instead of C style casts. also use
10008 u_vdata instea of passing pointers in longs.
10010 * src/PaperLayout.C: removed code snippets that were commented out.
10012 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10014 * src/lyx_main.C: removed code snippets that wer commented out.
10016 * src/paragraph.C: removed code snippets that were commented out.
10018 * src/lyxvc.C (logClose): use static_cast
10020 (viewLog): remove explicit cast to void*
10021 (showLog): removed old commented code
10023 * src/menus.C: use static_cast instead of C style casts. use
10024 u_vdata instead of u_ldata. remove explicit cast to (long) for
10025 pointers. Removed old code that was commented out.
10027 * src/insets/inset.C: removed old commented func
10029 * src/insets/insetref.C (InsetRef): removed old code that had been
10030 commented out for a long time.
10032 (escape): removed C style cast
10034 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10036 * src/insets/insetlatex.C (Draw): removed old commented code
10037 (Read): rewritten to use string
10039 * src/insets/insetlabel.C (escape): removed C style cast
10041 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10043 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10044 old commented code.
10046 * src/insets/insetinclude.h: removed a couple of stupid bools
10048 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10049 (Clone): remove C style cast
10050 (getKeys): changed list to lst because of std::list
10052 * src/insets/inseterror.C (Draw): removed som old commented code.
10054 * src/insets/insetcommand.C (Draw): removed some old commented code.
10056 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10057 commented out forever.
10058 (bibitem_cb): use static_cast instead of C style cast
10059 use of vdata changed to u_vdata.
10061 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10063 (CloseUrlCB): use static_cast instead of C style cast.
10064 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10066 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10067 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10068 (CloseInfoCB): static_cast from ob->u_vdata instead.
10069 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10072 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10073 (C_InsetError_CloseErrorCB): forward the ob parameter
10074 (CloseErrorCB): static_cast from ob->u_vdata instead.
10076 * src/vspace.h: include LString.h since we use string in this class.
10078 * src/vspace.C (lyx_advance): changed name from advance because of
10079 nameclash with stl. And since we cannot use namespaces yet...I
10080 used a lyx_ prefix instead. Expect this to change when we begin
10083 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10085 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10086 and removed now defunct constructor and deconstructor.
10088 * src/BufferView.h: have backstack as a object not as a pointer.
10089 removed initialization from constructor. added include for BackStack
10091 * development/lyx.spec.in (%build): add CFLAGS also.
10093 * src/screen.C (drawFrame): removed another warning.
10095 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10097 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10098 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10099 README and ANNOUNCE a bit for the next release. More work is
10102 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10103 unbreakable if we are in freespacing mode (LyX-Code), but not in
10106 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10108 * src/BackStack.h: fixed initialization order in constructor
10110 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10112 * acinclude.m4 (VERSION): new rules for when a version is
10113 development, added also a variable for prerelease.
10114 (warnings): we set with_warnings=yes for prereleases
10115 (lyx_opt): prereleases compile with same optimization as development
10116 (CXXFLAGS): only use pedantic if we are a development version
10118 * src/BufferView.C (restorePosition): don't do anything if the
10119 backstack is empty.
10121 * src/BackStack.h: added member empty, use this to test if there
10122 is anything to pop...
10124 1999-10-25 Juergen Vigna <jug@sad.it>
10127 * forms/layout_forms.fd +
10128 * forms/latexoptions.fd +
10129 * lyx.fd: changed for various form resize issues
10131 * src/mathed/math_panel.C +
10132 * src/insets/inseterror.C +
10133 * src/insets/insetinfo.C +
10134 * src/insets/inseturl.C +
10135 * src/insets/inseturl.h +
10137 * src/LyXSendto.C +
10138 * src/PaperLayout.C +
10139 * src/ParagraphExtra.C +
10140 * src/TableLayout.C +
10142 * src/layout_forms.C +
10149 * src/menus.C: fixed various resize issues. So now forms can be
10150 resized savely or not be resized at all.
10152 * forms/form_url.fd +
10153 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10156 * src/insets/Makefile.am: added files form_url.[Ch]
10158 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10160 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10161 (and presumably 6.2).
10163 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10164 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10165 remaining static member callbacks.
10167 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10170 * src/support/lyxstring.h: declare struct Srep as friend of
10171 lyxstring, since DEC cxx complains otherwise.
10173 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10175 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10177 * src/LaTeX.C (run): made run_bibtex also depend on files with
10179 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10180 are put into the dependency file.
10182 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10183 the code has shown itself to work
10184 (create_ispell_pipe): removed another warning, added a comment
10187 * src/minibuffer.C (ExecutingCB): removed code that has been
10188 commented out a long time
10190 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10191 out code + a warning.
10193 * src/support/lyxstring.h: comment out the three private
10194 operators, when compiling with string ansi conforming compilers
10195 they make problems.
10197 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10199 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10200 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10203 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10206 * src/mathed/math_panel.C (create_math_panel): remove explicit
10209 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10212 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10213 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10214 to XCreatePixmapFromBitmapData
10215 (fl_set_bmtable_data): change the last argument to be unsigned
10217 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10218 and bh to be unsigned int, remove explicit casts in call to
10219 XReadBitmapFileData.
10221 * images/arrows.xbm: made the arrays unsigned char *
10222 * images/varsz.xbm: ditto
10223 * images/misc.xbm: ditto
10224 * images/greek.xbm: ditto
10225 * images/dots.xbm: ditto
10226 * images/brel.xbm: ditto
10227 * images/bop.xbm: ditto
10229 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10231 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10232 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10233 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10235 (LYX_CXX_CHEADERS): added <clocale> to the test.
10237 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10239 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10241 * src/support/lyxstring.C (append): fixed something that must be a
10242 bug, rep->assign was used instead of rep->append.
10244 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10247 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10248 lyx insert double chars. Fix spotted by Kayvan.
10250 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10252 * Fixed the tth support. I messed up with the Emacs patch apply feature
10253 and omitted the changes in lyxrc.C.
10255 1999-10-22 Juergen Vigna <jug@sad.it>
10257 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10259 * src/lyx_cb.C (MenuInsertRef) +
10260 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10261 the form cannot be resized under it limits (fixes a segfault)
10263 * src/lyx.C (create_form_form_ref) +
10264 * forms/lyx.fd: Changed Gravity on name input field so that it is
10267 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10269 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10270 <ostream> and <istream>.
10272 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10273 whether <fstream> provides the latest standard features, or if we
10274 have an oldstyle library (like in egcs).
10275 (LYX_CXX_STL_STRING): fix the test.
10277 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10278 code on MODERN_STL_STREAM.
10280 * src/support/lyxstring.h: use L{I,O}stream.h.
10282 * src/support/L{I,O}stream.h: new files, designed to setup
10283 correctly streams for our use
10284 - includes the right header depending on STL capabilities
10285 - puts std::ostream and std::endl (for LOStream.h) or
10286 std::istream (LIStream.h) in toplevel namespace.
10288 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10290 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10291 was a bib file that had been changed we ensure that bibtex is run.
10292 (runBibTeX): enhanced to extract the names of the bib files and
10293 getting their absolute path and enter them into the dep file.
10294 (findtexfile): static func that is used to look for tex-files,
10295 checks for absolute patchs and tries also with kpsewhich.
10296 Alternative ways of finding the correct files are wanted. Will
10298 (do_popen): function that runs a command using popen and returns
10299 the whole output of that command in a string. Should be moved to
10302 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10303 file with extension ext has changed.
10305 * src/insets/figinset.C: added ifdef guards around the fl_free
10306 code that jug commented out. Now it is commented out when
10307 compiling with XForms == 0.89.
10309 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10310 to lyxstring.C, and only keep a forward declaration in
10311 lyxstring.h. Simplifies the header file a bit and should help a
10312 bit on compile time too. Also changes to Srep will not mandate a
10313 recompile of code just using string.
10314 (~lyxstring): definition moved here since it uses srep.
10315 (size): definition moved here since it uses srep.
10317 * src/support/lyxstring.h: removed a couple of "inline" that should
10320 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10322 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10325 1999-10-21 Juergen Vigna <jug@sad.it>
10327 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10328 set to left if I just remove the width entry (or it is empty).
10330 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10331 paragraph when having dummy paragraphs.
10333 1999-10-20 Juergen Vigna <jug@sad.it>
10335 * src/insets/figinset.C: just commented some fl_free_form calls
10336 and added warnings so that this calls should be activated later
10337 again. This avoids for now a segfault, but we have a memory leak!
10339 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10340 'const char * argument' to 'string argument', this should
10341 fix some Asserts() in lyxstring.C.
10343 * src/lyxfunc.h: Removed the function argAsString(const char *)
10344 as it is not used anymore.
10346 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10348 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10351 * src/Literate.h: some funcs moved from public to private to make
10352 interface clearer. Unneeded args removed.
10354 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10356 (scanBuildLogFile): ditto
10358 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10359 normal TeX Error. Still room for improvement.
10361 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10363 * src/buffer.C (insertErrors): changes to make the error
10364 desctription show properly.
10366 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10369 * src/support/lyxstring.C (helper): changed to use
10370 sizeof(object->rep->ref).
10371 (operator>>): changed to use a pointer instead.
10373 * src/support/lyxstring.h: changed const reference & to value_type
10374 const & lets see if that helps.
10376 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10378 * Makefile.am (rpmdist): fixed to have non static package and
10381 * src/support/lyxstring.C: removed the compilation guards
10383 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10386 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10387 conditional compile of lyxstring.Ch
10389 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10390 stupid check, but it is a lot better than the bastring hack.
10391 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10393 * several files: changed string::erase into string::clear. Not
10396 * src/chset.C (encodeString): use a char temporary instead
10398 * src/table.C (TexEndOfCell): added tostr around
10399 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10400 (TexEndOfCell): ditto
10401 (TexEndOfCell): ditto
10402 (TexEndOfCell): ditto
10403 (DocBookEndOfCell): ditto
10404 (DocBookEndOfCell): ditto
10405 (DocBookEndOfCell): ditto
10406 (DocBookEndOfCell): ditto
10408 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10410 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10412 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10413 (MenuBuildProg): added tostr around ret
10414 (MenuRunChktex): added tostr around ret
10415 (DocumentApplyCB): added tostr around ret
10417 * src/chset.C (encodeString): added tostr around t->ic
10419 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10420 (makeLaTeXFile): added tostr around tocdepth
10421 (makeLaTeXFile): added tostr around ftcound - 1
10423 * src/insets/insetbib.C (setCounter): added tostr around counter.
10425 * src/support/lyxstring.h: added an operator+=(int) to catch more
10428 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10429 (lyxstring): We DON'T allow NULL pointers.
10431 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10433 * src/mathed/math_macro.C (MathMacroArgument::Write,
10434 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10435 when writing them out.
10437 * src/LString.C: remove, since it is not used anymore.
10439 * src/support/lyxstring.C: condition the content to
10440 USE_INCLUDED_STRING macro.
10442 * src/mathed/math_symbols.C, src/support/lstrings.C,
10443 src/support/lyxstring.C: add `using' directive to specify what
10444 we need in <algorithm>. I do not think that we need to
10445 conditionalize this, but any thought is appreciated.
10447 * many files: change all callback functions to "C" linkage
10448 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10449 strict_ansi. Those who were static are now global.
10450 The case of callbacks which are static class members is
10451 trickier, since we have to make C wrappers around them (see
10452 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10453 did not finish this yet, since it defeats the purpose of
10454 encapsulation, and I am not sure what the best route is.
10456 1999-10-19 Juergen Vigna <jug@sad.it>
10458 * src/support/lyxstring.C (lyxstring): we permit to have a null
10459 pointer as assignment value and just don't assign it.
10461 * src/vspace.C (nextToken): corrected this function substituting
10462 find_first(_not)_of with find_last_of.
10464 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10465 (TableOptCloseCB) (TableSpeCloseCB):
10466 inserted fl_set_focus call for problem with fl_hide_form() in
10469 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10471 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10474 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10476 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10477 LyXLex::next() and not eatline() to get its argument.
10479 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10481 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10482 instead, use fstreams for io of the depfile, removed unneeded
10483 functions and variables.
10485 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10486 vector instead, removed all functions and variables that is not in
10489 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10491 * src/buffer.C (insertErrors): use new interface to TeXError
10493 * Makefile.am (rpmdist): added a rpmdist target
10495 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10496 per Kayvan's instructions.
10498 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10500 * src/Makefile.am: add a definition for localedir, so that locales
10501 are found after installation (Kayvan)
10503 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10505 * development/.cvsignore: new file.
10507 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10509 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10510 C++ compiler provides wrappers for C headers and use our alternate
10513 * configure.in: use LYX_CXX_CHEADERS.
10515 * src/cheader/: new directory, populated with cname headers from
10516 libstdc++-2.8.1. They are a bit old, but probably good enough for
10517 what we want (support compilers who lack them).
10519 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10520 from includes. It turns out is was stupid.
10522 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10524 * lib/Makefile.am (install-data-local): forgot a ';'
10525 (install-data-local): forgot a '\'
10526 (libinstalldirs): needed after all. reintroduced.
10528 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10530 * configure.in (AC_OUTPUT): added lyx.spec
10532 * development/lyx.spec: removed file
10534 * development/lyx.spec.in: new file
10536 * po/*.po: merged with lyx.pot becuase of make distcheck
10538 * lib/Makefile.am (dist-hook): added dist-hook so that
10539 documentation files will be included when doing a make
10540 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10541 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10543 more: tried to make install do the right thing, exclude CVS dirs
10546 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10547 Path would fit in more nicely.
10549 * all files that used to use pathstack: uses now Path instead.
10550 This change was a lot easier than expected.
10552 * src/support/path.h: new file
10554 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10556 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10558 * src/support/lyxstring.C (getline): Default arg was given for
10561 * Configure.cmd: removed file
10563 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10565 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10566 streams classes and types, add the proper 'using' statements when
10567 MODERN_STL is defined.
10569 * src/debug.h: move the << operator definition after the inclusion
10572 * src/support/filetools.C: include "LAssert.h", which is needed
10575 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10578 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10579 include "debug.h" to define a proper ostream.
10581 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10583 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10584 method to the SystemCall class which can kill a process, but it's
10585 not fully implemented yet.
10587 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10589 * src/support/FileInfo.h: Better documentation
10591 * src/lyxfunc.C: Added support for buffer-export html
10593 * src/menus.C: Added Export->As HTML...
10595 * lib/bind/*.bind: Added short-cut for buffer-export html
10597 * src/lyxrc.*: Added support for new \tth_command
10599 * lib/lyxrc.example: Added stuff for new \tth_command
10601 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10603 * lib/Makefile.am (IMAGES): removed images/README
10604 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10605 installes in correct place. Check permisions is installed
10608 * src/LaTeX.C: some no-op changes moved declaration of some
10611 * src/LaTeX.h (LATEX_H): changed include guard name
10613 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10615 * lib/reLyX/Makefile.am: install noweb2lyx.
10617 * lib/Makefile.am: install configure.
10619 * lib/reLyX/configure.in: declare a config aux dir; set package
10620 name to lyx (not sure what the best solution is); generate noweb2lyx.
10622 * lib/layouts/egs.layout: fix the bibliography layout.
10624 1999-10-08 Jürgen Vigna <jug@sad.it>
10626 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10627 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10628 it returned without continuing to search the path.
10630 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10632 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10633 also fixes a bug. It is not allowed to do tricks with std::strings
10634 like: string a("hei"); &a[e]; this will not give what you
10635 think... Any reason for the complexity in this func?
10637 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10639 * Updated README and INSTALL a bit, mostly to check that my
10640 CVS rights are correctly set up.
10642 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10644 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10645 does not allow '\0' chars but lyxstring and std::string does.
10647 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10649 * autogen.sh (AUTOCONF): let the autogen script create the
10650 POTFILES.in file too. POTFILES.in should perhaps now not be
10651 included in the cvs module.
10653 * some more files changed to use C++ includes instead of C ones.
10655 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10657 (Reread): added tostr to nlink. buggy output otherwise.
10658 (Reread): added a string() around szMode when assigning to Buffer,
10659 without this I got a log of garbled info strings.
10661 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10664 * I have added several ostream & operator<<(ostream &, some_type)
10665 functions. This has been done to avoid casting and warnings when
10666 outputting enums to lyxerr. This as thus eliminated a lot of
10667 explicit casts and has made the code clearer. Among the enums
10668 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10669 mathed enums, some font enum the Debug::type enum.
10671 * src/support/lyxstring.h (clear): missing method. equivalent of
10674 * all files that contained "stderr": rewrote constructs that used
10675 stderr to use lyxerr instead. (except bmtable)
10677 * src/support/DebugStream.h (level): and the passed t with
10678 Debug::ANY to avoid spurious bits set.
10680 * src/debug.h (Debug::type value): made it accept strings of the
10681 type INFO,INIT,KEY.
10683 * configure.in (Check for programs): Added a check for kpsewhich,
10684 the latex generation will use this later to better the dicovery of
10687 * src/BufferView.C (create_view): we don't need to cast this to
10688 (void*) that is done automatically.
10689 (WorkAreaButtonPress): removed some dead code.
10691 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10693 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10694 is not overwritten when translated (David Sua'rez de Lis).
10696 * lib/CREDITS: Added David Sua'rez de Lis
10698 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10700 * src/bufferparams.C (BufferParams): default input encoding is now
10703 * acinclude.m4 (cross_compiling): comment out macro
10704 LYX_GXX_STRENGTH_REDUCE.
10706 * acconfig.h: make sure that const is not defined (to empty) when
10707 we are compiling C++. Remove commented out code using SIZEOF_xx
10710 * configure.in : move the test for const and inline as late as
10711 possible so that these C tests do not interefere with C++ ones.
10712 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10713 has not been proven.
10715 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10717 * src/table.C (getDocBookAlign): remove bad default value for
10718 isColumn parameter.
10720 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10722 (ShowFileMenu2): ditto.
10724 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10725 of files to ignore.
10727 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10729 * Most files: finished the change from the old error code to use
10730 DebugStream for all lyxerr debugging. Only minor changes remain
10731 (e.g. the setting of debug levels using strings instead of number)
10733 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10735 * src/layout.C (Add): Changed to use compare_no_case instead of
10738 * src/FontInfo.C: changed loop variable type too string::size_type.
10740 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10742 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10743 set ETAGS_ARGS to --c++
10745 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10747 * src/table.C (DocBookEndOfCell): commented out two unused variables
10749 * src/paragraph.C: commented out four unused variables.
10751 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10752 insed a if clause with type string::size_type.
10754 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10757 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10759 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10760 variable, also changed loop to go from 0 to lenght + 1, instead of
10761 -1 to length. This should be correct.
10763 * src/LaTeX.C (scanError): use string::size_type as loop variable
10766 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10767 (l.896) since y_tmp and row was not used anyway.
10769 * src/insets/insetref.C (escape): use string::size_type as loop
10772 * src/insets/insetquotes.C (Width): use string::size_type as loop
10774 (Draw): use string::size_type as loop variable type.
10776 * src/insets/insetlatexaccent.C (checkContents): use
10777 string::size_type as loop variable type.
10779 * src/insets/insetlabel.C (escape): use string::size_type as loop
10782 * src/insets/insetinfo.C: added an extern for current_view.
10784 * src/insets/insetcommand.C (scanCommand): use string::size_type
10785 as loop variable type.
10787 * most files: removed the RCS tags. With them we had to recompile
10788 a lot of files after a simple cvs commit. Also we have never used
10789 them for anything meaningful.
10791 * most files: tags-query-replace NULL 0. As adviced several plases
10792 we now use "0" instead of "NULL" in our code.
10794 * src/support/filetools.C (SpaceLess): use string::size_type as
10795 loop variable type.
10797 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10799 * src/paragraph.C: fixed up some more string stuff.
10801 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10803 * src/support/filetools.h: make modestr a std::string.
10805 * src/filetools.C (GetEnv): made ch really const.
10807 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10808 made code that used these use max/min from <algorithm> instead.
10810 * changed several c library include files to their equivalent c++
10811 library include files. All is not changed yet.
10813 * created a support subdir in src, put lyxstring and lstrings
10814 there + the extra files atexit, fileblock, strerror. Created
10815 Makefile.am. edited configure.in and src/Makefile.am to use this
10816 new subdir. More files moved to support.
10818 * imported som of the functions from repository lyx, filetools
10820 * ran tags-query-replace on LString -> string, corrected the bogus
10821 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10822 is still some errors in there. This is errors where too much or
10823 too litle get deleted from strings (string::erase, string::substr,
10824 string::replace), there can also be some off by one errors, or
10825 just plain wrong use of functions from lstrings. Viewing of quotes
10828 * LyX is now running fairly well with string, but there are
10829 certainly some bugs yet (see above) also string is quite different
10830 from LString among others in that it does not allow null pointers
10831 passed in and will abort if it gets any.
10833 * Added the revtex4 files I forgot when setting up the repository.
10835 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10837 * All over: Tried to clean everything up so that only the files
10838 that we really need are included in the cvs repository.
10839 * Switched to use automake.
10840 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10841 * Install has not been checked.
10843 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10845 * po/pt.po: Three errors:
10846 l.533 and l.538 format specification error
10847 l. 402 duplicate entry, I just deleted it.