1 2000-08-29 Allan Rae <rae@lyx.org>
3 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
5 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
6 (EnableDocumentLayout): removed
7 (DisableDocumentLayout): removed
8 (build): make use of ButtonController's read-only handling to
9 de/activate various objects. Replaces both of the above functions.
11 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
12 (readOnly): was read_only
13 (refresh): fixed dumb mistakes with read_only_ handling
15 * src/frontends/xforms/forms/form_document.fd:
16 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
17 tabbed dialogs so the tabs look more like tabs and so its easier to
18 work out which is the current tab.
20 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
21 segfault with form_table
23 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
25 2000-08-28 Juergen Vigna <jug@sad.it>
27 * acconfig.h: added USE_PSPELL.
29 * src/config.h.in: added USE_PSPELL.
31 * autogen.sh: added pspell.m4
33 * config/pspell.m4: new file.
35 * src/spellchecker.C: implemented support for pspell libary.
37 2000-08-25 Juergen Vigna <jug@sad.it>
39 * src/LyXAction.C (init): renamed LFUN_TABLE to
40 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
42 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
44 * src/lyxscreen.h: add force_clear variable and fuction to force
45 a clear area when redrawing in LyXText.
47 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
49 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
51 * some whitespace and comment changes.
53 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
55 * src/buffer.C: up te LYX_FORMAT to 2.17
57 2000-08-23 Juergen Vigna <jug@sad.it>
59 * src/BufferView_pimpl.C (tripleClick): disable this when in a
62 * src/insets/insettabular.C (pasteSelection): delete the insets
63 LyXText as it is not valid anymore.
64 (copySelection): new function.
65 (pasteSelection): new function.
66 (cutSelection): new function.
67 (LocalDispatch): implemented cut/copy/paste of cell selections.
69 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
72 * src/LyXAction.C (init): a NEW_TABULAR define too much.
74 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
77 2000-08-22 Juergen Vigna <jug@sad.it>
79 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
80 ifdef form_table out if NEW_TABULAR.
82 2000-08-21 Juergen Vigna <jug@sad.it>
84 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
85 (draw): fixed draw position so that the cursor is positioned in the
87 (InsetMotionNotify): hide/show cursor so the position is updated.
88 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
89 using cellstart() function where it should be used.
91 * src/insets/insettext.C (draw): ditto.
93 * src/tabular.C: fixed initialization of some missing variables and
94 made BoxType into an enum.
96 2000-08-22 Marko Vendelin <markov@ioc.ee>
97 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
98 stock menu item using action numerical value, not its string
102 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
104 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
105 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
107 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
109 * src/frontends/xforms/GUIRunTime.C: new file
111 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
112 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
114 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
116 * src/frontends/kde/GUIRunTime.C: new file
118 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
119 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
121 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
123 * src/frontends/gnome/GUIRunTime.C: new file
125 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
128 * src/frontends/GUIRunTime.h: removed constructor and destructor,
129 small change to documetentation.
131 * src/frontends/GUIRunTime.C: removed file
133 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
135 * src/lyxparagraph.h: enable NEW_TABULAR as default
137 * src/lyxfunc.C (processKeySym): remove some commented code
139 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
140 NEW_TABULAR around the fd_form_table_options.
142 * src/lyx_gui.C (runTime): call the static member function as
143 GUIRunTime::runTime().
145 2000-08-21 Allan Rae <rae@lyx.org>
147 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
150 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
152 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
154 2000-08-21 Allan Rae <rae@lyx.org>
156 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
158 * src/frontends/xforms/FormPreferences.C (build): use setOK
159 * src/frontends/xforms/FormDocument.C (build): use setOK
160 (FormDocument): use the appropriate policy.
162 2000-08-21 Allan Rae <rae@lyx.org>
164 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
165 automatic [de]activation of arbitrary objects when in a read-only state.
167 * src/frontends/ButtonPolicies.h: More documentation
168 (isReadOnly): added to support the above.
170 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
172 2000-08-18 Juergen Vigna <jug@sad.it>
174 * src/insets/insettabular.C (getStatus): changed to return func_status.
176 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
177 display toggle menu entries if they are.
179 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
180 new document layout now.
182 * src/lyxfunc.C: ditto
184 * src/lyx_gui_misc.C: ditto
186 * src/lyx_gui.C: ditto
188 * lib/ui/default.ui: removed paper and quotes layout as they are now
189 all in the document layout tabbed folder.
191 * src/frontends/xforms/forms/form_document.fd: added Restore
192 button and callbacks for all inputs for Allan's ButtonPolicy.
194 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
195 (CheckChoiceClass): added missing params setting on class change.
196 (UpdateLayoutDocument): added for updating the layout on params.
197 (build): forgot to RETURN_ALWAYS input_doc_spacing.
198 (FormDocument): Implemented Allan's ButtonPolicy with the
201 2000-08-17 Allan Rae <rae@lyx.org>
203 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
204 so we can at least see the credits again.
206 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
207 controller calls for the appropriate callbacks. Note that since Ok
208 calls apply followed by cancel, and apply isn't a valid input for the
209 APPLIED state, the bc_ calls have to be made in the static callback not
210 within each of the real callbacks.
212 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
213 (setOk): renamed from setOkay()
215 2000-08-17 Juergen Vigna <jug@sad.it>
217 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
218 in the implementation part.
219 (composeUIInfo): don't show optional menu-items.
221 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
223 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
225 * src/bufferview_funcs.C (CurrentState): fixed to show also the
226 text-state when in a text-inset.
228 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
230 2000-08-17 Marko Vendelin <markov@ioc.ee>
231 * src/frontends/gnome/FormIndex.C
232 * src/frontends/gnome/FormIndex.h
233 * src/frontends/gnome/FormToc.C
234 * src/frontends/gnome/FormToc.h
235 * src/frontends/gnome/dialogs
236 * src/frontends/gnome/diatoc_callbacks.c
237 * src/frontends/gnome/diatoc_callbacks.h
238 * src/frontends/gnome/diainsertindex_callbacks.h
239 * src/frontends/gnome/diainsertindex_callbacks.c
240 * src/frontends/gnome/diainsertindex_interface.c
241 * src/frontends/gnome/diainsertindex_interface.h
242 * src/frontends/gnome/diatoc_interface.h
243 * src/frontends/gnome/diatoc_interface.c
244 * src/frontends/gnome/Makefile.am: Table of Contents and
245 Insert Index dialogs implementation for Gnome frontend
247 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
249 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
251 * src/frontends/gnome/diainserturl_interface.c: make the dialog
254 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
256 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
257 destructor. Don't definde if you don't need it
258 (processEvents): made static, non-blocking events processing for
260 (runTime): static method. event loop for xforms
261 * similar as above for kde and gnome.
263 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
265 (runTime): new method calss the real frontends runtime func.
267 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
269 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
271 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
273 2000-08-16 Juergen Vigna <jug@sad.it>
275 * src/lyx_gui.C (runTime): added GUII RunTime support.
277 * src/frontends/Makefile.am:
278 * src/frontends/GUIRunTime.[Ch]:
279 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
280 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
281 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
283 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
285 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
286 as this is already set in ${FRONTEND_INCLUDE} if needed.
288 * configure.in (CPPFLAGS): setting the include dir for the frontend
289 directory and don't set FRONTEND=xforms for now as this is executed
292 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
294 * src/frontends/kde/Makefile.am:
295 * src/frontends/kde/FormUrl.C:
296 * src/frontends/kde/FormUrl.h:
297 * src/frontends/kde/formurldialog.h:
298 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
300 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
302 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
304 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
306 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
309 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
311 * src/WorkArea.C (work_area_handler): more work to get te
312 FL_KEYBOARD to work with xforms 0.88 too, please test.
314 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
316 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
318 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
321 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
323 * src/Timeout.h: remove Qt::emit hack.
325 * several files: changes to allo doc++ compilation
327 * src/lyxfunc.C (processKeySym): new method
328 (processKeyEvent): comment out if FL_REVISION < 89
330 * src/WorkArea.C: change some debugging levels.
331 (WorkArea): set wantkey to FL_KEY_ALL
332 (work_area_handler): enable the FL_KEYBOARD clause, this enables
333 clearer code and the use of compose with XForms 0.89. Change to
334 use signals instead of calling methods in bufferview directly.
336 * src/Painter.C: change some debugging levels.
338 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
341 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
342 (workAreaKeyPress): new method
344 2000-08-14 Juergen Vigna <jug@sad.it>
346 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
348 * config/kde.m4: addes some features
350 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
351 include missing xforms dialogs.
353 * src/Timeout.h: a hack to be able to compile with qt/kde.
355 * sigc++/.cvsignore: added acinclude.m4
357 * lib/.cvsignore: added listerros
359 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
360 xforms tree as objects are needed for other frontends.
362 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
363 linking with not yet implemented xforms objects.
365 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
367 2000-08-14 Baruch Even <baruch.even@writeme.com>
369 * src/frontends/xforms/FormGraphics.h:
370 * src/frontends/xforms/FormGraphics.C:
371 * src/frontends/xforms/RadioButtonGroup.h:
372 * src/frontends/xforms/RadioButtonGroup.C:
373 * src/insets/insetgraphics.h:
374 * src/insets/insetgraphics.C:
375 * src/insets/insetgraphicsParams.h:
376 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
377 instead of spaces, and various other indentation issues to make the
378 sources more consistent.
380 2000-08-14 Marko Vendelin <markov@ioc.ee>
382 * src/frontends/gnome/dialogs/diaprint.glade
383 * src/frontends/gnome/FormPrint.C
384 * src/frontends/gnome/FormPrint.h
385 * src/frontends/gnome/diaprint_callbacks.c
386 * src/frontends/gnome/diaprint_callbacks.h
387 * src/frontends/gnome/diaprint_interface.c
388 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
391 * src/frontends/gnome/dialogs/diainserturl.glade
392 * src/frontends/gnome/FormUrl.C
393 * src/frontends/gnome/FormUrl.h
394 * src/frontends/gnome/diainserturl_callbacks.c
395 * src/frontends/gnome/diainserturl_callbacks.h
396 * src/frontends/gnome/diainserturl_interface.c
397 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
400 * src/frontends/gnome/Dialogs.C
401 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
402 all other dialogs. Copy all unimplemented dialogs from Xforms
405 * src/frontends/gnome/support.c
406 * src/frontends/gnome/support.h: support files generated by Glade
410 * config/gnome.m4: Gnome configuration scripts
412 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
413 configure --help message
415 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
416 only if there are no events pendling in Gnome/Gtk. This enhances
417 the performance of menus.
420 2000-08-14 Allan Rae <rae@lyx.org>
422 * lib/Makefile.am: listerrors cleaning
424 * lib/listerrors: removed -- generated file
425 * acinclude.m4: ditto
426 * sigc++/acinclude.m4: ditto
428 * src/frontends/xforms/forms/form_citation.fd:
429 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
432 * src/frontends/xforms/forms/makefile: I renamed the `install` target
433 `updatesrc` and now we have a `test` target that does what `updatesrc`
434 used to do. I didn't like having an install target that wasn't related
437 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
438 on all except FormGraphics. This may yet happen. Followed by a major
439 cleanup including using FL_TRANSIENT for most of the dialogs. More
440 changes to come when the ButtonController below is introduced.
442 * src/frontends/xforms/ButtonController.h: New file for managing up to
443 four buttons on a dialog according to an externally defined policy.
444 * src/frontends/xforms/Makefile.am: added above
446 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
447 Apply and Cancel/Close buttons and everything in between and beyond.
448 * src/frontends/Makefile.am: added above.
450 * src/frontends/xforms/forms/form_preferences.fd:
451 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
452 and removed variable 'status' as a result. Fixed the set_minsize thing.
453 Use the new screen-font-update after checking screen fonts were changed
454 Added a "Restore" button to restore the original lyxrc values while
455 editing. This restores everything not just the last input changed.
456 That's still a tricky one. As is the "LyX: this shouldn't happen..."
458 * src/LyXAction.C: screen-font-update added for updating buffers after
459 screen font settings have been changed.
460 * src/commandtags.h: ditto
461 * src/lyxfunc.C: ditto
463 * forms/lyx.fd: removed screen fonts dialog.
464 * src/lyx_gui.C: ditto
465 * src/menus.[Ch]: ditto
466 * src/lyx.[Ch]: ditto
467 * src/lyx_cb.C: ditto + code from here moved to make
468 screen-font-update. And people wonder why progress on GUII is
469 slow. Look at how scattered this stuff was! It takes forever
472 * forms/fdfix.sh: Fixup the spacing after commas.
473 * forms/makefile: Remove date from generated files. Fewer clashes now.
474 * forms/bullet_forms.C.patch: included someones handwritten changes
476 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
477 once I've discovered why LyXRC was made noncopyable.
478 * src/lyx_main.C: ditto
480 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
482 * src/frontends/xforms/forms/fdfix.sh:
483 * src/frontends/xforms/forms/fdfixh.sed:
484 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
485 * src/frontends/xforms/Form*.[hC]:
486 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
487 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
488 provide a destructor for the struct FD_form_xxxx. Another version of
489 the set_[max|min]size workaround and a few other cleanups. Actually,
490 Angus' patch from 20000809.
492 2000-08-13 Baruch Even <baruch.even@writeme.com>
494 * src/insets/insetgraphics.C (Clone): Added several fields that needed
497 2000-08-11 Juergen Vigna <jug@sad.it>
499 * src/insets/insetgraphics.C (InsetGraphics): changing init
500 order because of warnings.
502 * src/frontends/xforms/forms/makefile: adding patching .C with
505 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
506 from .C.patch to .c.patch
508 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
509 order because of warning.
511 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
513 * src/frontends/Liason.C (setMinibuffer): new helper function
515 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
517 * src/lyxfunc.C (Dispatch): calling new Document-Layout
519 * lib/ui/default.ui: commented out PaperLayout entry
521 * src/frontends/xforms/form_document.[Ch]: new added files
523 * src/frontends/xforms/FormDocument.[Ch]: ditto
525 * src/frontends/xforms/forms/form_document.fd: ditto
527 * src/frontends/xforms/forms/form_document.C.patch: ditto
529 2000-08-10 Juergen Vigna <jug@sad.it>
531 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
532 (InsetGraphics): initialized cacheHandle to 0.
533 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
535 2000-08-10 Baruch Even <baruch.even@writeme.com>
537 * src/graphics/GraphicsCache.h:
538 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
539 correctly as a cache.
541 * src/graphics/GraphicsCacheItem.h:
542 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
545 * src/graphics/GraphicsCacheItem_pimpl.h:
546 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
549 * src/insets/insetgraphics.h:
550 * src/insets/insetgraphics.C: Changed from using a signal notification
551 to polling when image is not loaded.
553 2000-08-10 Allan Rae <rae@lyx.org>
555 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
556 that there are two functions that have to been taken out of line by
557 hand and aren't taken care of in the script. (Just a reminder note)
559 * sigc++/macros/*.h.m4: Updated as above.
561 2000-08-09 Juergen Vigna <jug@sad.it>
563 * src/insets/insettext.C (draw): small fix for clearing rectangle.
565 * src/insets/insettabular.C: make drawing of single cell smarter.
567 2000-08-09 Marko Vendelin <markov@ioc.ee>
568 * src/frontends/gnome/Menubar_pimpl.C
569 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
570 implementation: new files
572 * src/frontends/gnome/mainapp.C
573 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
576 * src/main.C: create Gnome main window
578 * src/frontends/xforms/Menubar_pimpl.h
579 * src/frontends/Menubar.C
580 * src/frontends/Menubar.h: added method Menubar::update that calls
581 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
583 * src/LyXView.C: calls Menubar::update to update the state
586 * src/frontends/gnome/Makefile.am: added new files
588 * src/frontends/Makefile.am: added frontend compiler options
590 2000-08-08 Juergen Vigna <jug@sad.it>
592 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
594 * src/bufferlist.C (close):
595 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
596 documents if exiting without saving.
598 * src/buffer.C (save): use removeAutosaveFile()
600 * src/support/filetools.C (removeAutosaveFile): new function.
602 * src/lyx_cb.C (MenuWrite): returns a bool now.
603 (MenuWriteAs): check if file could really be saved and revert to the
605 (MenuWriteAs): removing old autosavefile if existant.
607 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
608 before Goto toggle declaration, because of compiler warning.
610 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
612 * src/lyxfunc.C (MenuNew): small fix.
614 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
616 * src/bufferlist.C (newFile):
617 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
619 * src/lyxrc.C: added new_ask_filename tag
621 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
623 * src/lyx.fd: removed code pertaining to form_ref
624 * src/lyx.[Ch]: ditto
625 * src/lyx_cb.C: ditto
626 * src/lyx_gui.C: ditto
627 * src/lyx_gui_misc.C: ditto
629 * src/BufferView_pimpl.C (restorePosition): update buffer only
632 * src/commandtags.h (LFUN_REFTOGGLE): removed
633 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
634 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
635 (LFUN_REFBACK): renamed LFUN_REF_BACK
637 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
639 * src/lyxfunc.C (Dispatch): ditto.
640 InsertRef dialog is now GUI-independent.
642 * src/texrow.C: added using std::endl;
644 * src/insets/insetref.[Ch]: strip out large amounts of code.
645 The inset is now a container and this functionality is now
646 managed by a new FormRef dialog
648 * src/frontends/Dialogs.h (showRef, createRef): new signals
650 * src/frontends/xforms/FormIndex.[Ch],
651 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
652 when setting dialog's min/max size
653 * src/frontends/xforms/FormIndex.[Ch]: ditto
655 * src/frontends/xforms/FormRef.[Ch],
656 src/frontends/xforms/forms/form_ref.fd: new xforms
657 implementation of an InsetRef dialog
659 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
662 * src/graphics/XPM_Renderer.C (isImageFormatOK):
663 ios::nocreate is not part of the standard. Removed.
665 2000-08-07 Baruch Even <baruch.even@writeme.com>
667 * src/graphics/Renderer.h:
668 * src/graphics/Renderer.C: Added base class for rendering of different
669 image formats into Pixmaps.
671 * src/graphics/XPM_Renderer.h:
672 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
673 in a different class.
675 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
676 easily add support for other formats.
678 * src/insets/figinset.C: plugged a leak of an X resource.
680 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
682 * src/CutAndPaste.[Ch]: make all metods static.
684 * development/Code_rules/Rules: more work, added section on
685 Exceptions, and a References section.
687 * a lot of header files: work to make doc++ able to generate the
688 source documentation, some workarounds of doc++ problems. Doc++ is
689 now able to generate the documentation.
691 2000-08-07 Juergen Vigna <jug@sad.it>
693 * src/insets/insettabular.C (recomputeTextInsets): removed function
695 * src/tabular.C (SetWidthOfMulticolCell):
697 (calculate_width_of_column_NMC): fixed return value so that it really
698 only returns true if the column-width has changed (there where
699 problems with muliticolumn-cells in this column).
701 2000-08-04 Juergen Vigna <jug@sad.it>
703 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
704 also on the scrollstatus of the inset.
705 (workAreaMotionNotify): ditto.
707 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
709 2000-08-01 Juergen Vigna <jug@sad.it>
711 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
714 * src/LyXAction.C (init):
715 * src/insets/inset.C (LocalDispatch): added support for
718 * src/insets/inset.C (scroll): new functions.
720 * src/insets/insettext.C (removeNewlines): new function.
721 (SetAutoBreakRows): removes forced newlines in the text of the
722 paragraph if autoBreakRows is set to false.
724 * src/tabular.C (Latex): generates a parbox around the cell contents
727 * src/frontends/xforms/FormTabular.C (local_update): removed
728 the radio_useparbox button.
730 * src/tabular.C (UseParbox): new function
732 2000-08-06 Baruch Even <baruch.even@writeme.com>
734 * src/graphics/GraphicsCache.h:
735 * src/graphics/GraphicsCache.C:
736 * src/graphics/GraphicsCacheItem.h:
737 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
740 * src/insets/insetgraphics.h:
741 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
742 drawing of the inline image.
744 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
745 into the wrong position.
747 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
750 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
752 * src/support/translator.h: move all typedefs to public section
754 * src/support/filetools.C (MakeLatexName): return string const
757 (FileOpenSearch): ditto
759 (LibFileSearch): ditto
760 (i18nLibFileSearch): ditto
763 (CreateTmpDir): ditto
764 (CreateBufferTmpDir): ditto
765 (CreateLyXTmpDir): ditto
770 (OnlyFilename): ditto
772 (NormalizePath): ditto
774 (GetFileContents): ditto
775 (ReplaceEnvironmentPath): ditto
778 (ChangeExtension): ditto
779 (MakeDisplayPath): ditto
780 (do_popen): return cmdret const
781 (findtexfile): return string const
783 * src/support/DebugStream.h: add some /// to please doc++
785 * src/frontends/DialogBase.h (endif): add some /// to please doc++
787 * src/texrow.C (same_rownumber): functor to use with find_if
788 (getIdFromRow): rewritten to use find_if and to not update the
789 positions. return true if row is found
790 (increasePos): new method, use to update positions
792 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
794 * src/lyxlex_pimpl.C (verifyTable): new method
797 (GetString): return string const
798 (pushTable): rewrite to use std::stack
800 (setFile): better check
803 * src/lyxlex.h: make LyXLex noncopyable
805 * src/lyxlex.C (text): return char const * const
806 (GetString): return string const
807 (getLongString): return string const
809 * src/lyx_gui_misc.C (askForText): return pair<...> const
811 * src/lastfiles.[Ch] (operator): return string const
813 * src/buffer.C (parseSingleLyXformat2Token): pass string to
814 istringstream not char const *.
815 move token.end() out of loop.
816 (readFile): move initializaton of token
818 * src/BufferView2.C (insertErrors): run texrow.increasePos if
819 getIdFromRow is successful.
821 * lib/bind/emacs.bind: don't include menus bind
823 * development/Code_rules/Rules: the beginnings of making this
824 better and covering more of the unwritten rules that we have.
826 * development/Code_rules/Recommendations: a couple of wording
829 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
831 * src/support/strerror.c: remove C++ comment.
833 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
835 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
836 LFUN_INDEX_INSERT_LAST
838 * src/texrow.C (getIdFromRow): changed from const_iterator to
839 iterator, allowing code to compile with DEC cxx
841 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
842 stores part of the class, as suggested by Allan. Will allow
844 (apply): test to apply uses InsetCommandParams operator!=
846 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
847 (apply): test to apply uses InsetCommandParams operator!=
849 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
850 stores part of the class.
851 (update): removed limits on min/max size.
853 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
854 (apply): test to apply uses InsetCommandParams operator!=
856 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
857 (Read, Write, scanCommand, getCommand): moved functionality
858 into InsetCommandParams.
860 (getScreenLabel): made pure virtual
861 new InsetCommandParams operators== and !=
863 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
864 c-tors based on InsetCommandParams. Removed others.
865 * src/insets/insetinclude.[Ch]: ditto
866 * src/insets/insetlabel.[Ch]: ditto
867 * src/insets/insetparent.[Ch]: ditto
868 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
870 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
871 insets derived from InsetCommand created using similar c-tors
872 based on InsetCommandParams
873 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
874 * src/menus.C (ShowRefsMenu): ditto
875 * src/paragraph.C (Clone): ditto
876 * src/text2.C (SetCounter): ditto
877 * src/lyxfunc.C (Dispatch) ditto
878 Also recreated old InsetIndex behaviour exactly. Can now
879 index-insert at the start of a paragraph and index-insert-last
880 without launching the pop-up.
882 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
884 * lib/lyxrc.example: mark te pdf options as non functional.
886 * src/support/lstrings.C (strToInt): move initalization of tmpstr
887 (isStrDbl): move tmpstr.end() out of loop.
888 (strToDbl): move intialization of tmpstr
889 (lowercase): return string const and move tmp.end() out of loop.
890 (uppercase): return string const and move tmp.edn() out of loop.
891 (prefixIs): add assertion
896 (containsOnly): ditto
897 (containsOnly): ditto
898 (containsOnly): ditto
899 (countChar): make last arg char not char const
900 (token): return string const
901 (subst): return string const, move tmp.end() out of loop.
902 (subst): return string const, add assertion
903 (strip): return string const
904 (frontStrip): return string const, add assertion
905 (frontStrip): return string const
910 * src/support/lstrings.C: add inclde "LAssert.h"
911 (isStrInt): move tmpstr.end() out of loop.
913 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
914 toollist.end() out of loop.
915 (deactivate): move toollist.end() out of loop.
916 (update): move toollist.end() out of loop.
917 (updateLayoutList): move tc.end() out of loop.
918 (add): move toollist.end() out of loop.
920 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
921 md.end() out of loop.
923 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
925 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
928 * src/paragraph.C (Erase): move fontlist.end() out of loop.
929 (Erase): move insetlist.end() out of loop.
931 * src/lyx_sendfax_main.C: make show_logfile static and to take a
932 ref to const string as first arg. Move initialization of some
933 variables, whitespace changes.
935 * src/kbmap.C (defkey): move table.end() out of loop.
936 (kb_keymap): move table.end() out of loop.
937 (findbinding): move table.end() out of loop.
939 * src/MenuBackend.C (hasMenu): move end() out of loop.
940 (getMenu): move end() out of loop.
941 (getMenu): move menulist_.end() out of loop.
943 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
945 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
948 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
949 (getFromLyXName): move infotab.end() out of loop.
951 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
952 -fvtable-thunks -ffunction-sections -fdata-sections
954 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
956 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
959 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
961 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
963 * src/frontends/xforms/FormCitation.[Ch],
964 src/frontends/xforms/FormIndex.[Ch],
965 src/frontends/xforms/FormToc.[Ch],
966 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
968 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
970 * src/commandtags.h: renamed, created some flags for citation
973 * src/lyx_gui_misc.C: stripped out old FD_index_form code
975 * src/lyxfunc.C (dispatch): use signals to insert index entry
977 * src/frontends/Dialogs.h: new signal createIndex
979 * src/frontends/xforms/FormCommand.[Ch],
980 src/frontends/xforms/FormCitation.[Ch],
981 src/frontends/xforms/FormToc.[Ch],
982 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
984 * src/insets/insetindex.[Ch]: GUI-independent
986 * src/frontends/xforms/FormIndex.[Ch],
987 * src/frontends/xforms/forms/form_index.fd: xforms implementation
990 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
992 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
993 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
995 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
997 * src/insets/insetref.C (Latex): rewrite so that there is now
998 question that a initialization is requested.
1000 * src/insets/insetcommand.h: reenable the hide signal
1002 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1004 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1005 fix handling of shortcuts (many bugs :)
1006 (add_lastfiles): ditto.
1008 * lib/ui/default.ui: fix a few shortcuts.
1010 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1012 * Makefile.am: Fix ``rpmdist'' target to return the exit
1013 status of the ``rpm'' command, instead of the last command in
1014 the chain (the ``rm lyx.xpm'' command, which always returns
1017 2000-08-02 Allan Rae <rae@lyx.org>
1019 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1020 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1021 * src/frontends/xforms/FormToc.C (FormToc): ditto
1023 * src/frontends/xforms/Makefile.am: A few forgotten files
1025 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1026 Signals-not-copyable-problem Lars' started commenting out.
1028 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1030 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1032 * src/insets/insetcommand.h: Signals is not copyable so anoter
1033 scheme for automatic hiding of forms must be used.
1035 * src/frontends/xforms/FormCitation.h: don't inerit from
1036 noncopyable, FormCommand already does that.
1037 * src/frontends/xforms/FormToc.h: ditto
1038 * src/frontends/xforms/FormUrl.h: ditto
1040 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1042 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1044 * src/insets/insetcommand.h (hide): new SigC::Signal0
1045 (d-tor) new virtual destructor emits hide signal
1047 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1048 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1050 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1051 LOF and LOT. Inset is now GUI-independent
1053 * src/insets/insetloa.[Ch]: redundant
1054 * src/insets/insetlof.[Ch]: ditto
1055 * src/insets/insetlot.[Ch]: ditto
1057 * src/frontends/xforms/forms/form_url.fd: tweaked!
1058 * src/frontends/xforms/forms/form_citation.fd: ditto
1060 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1061 dialogs dealing with InsetCommand insets
1063 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1064 FormCommand base class
1065 * src/frontends/xforms/FormUrl.[Ch]: ditto
1067 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1069 * src/frontends/xforms/FormToc.[Ch]: ditto
1071 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1072 passed a generic InsetCommand pointer
1073 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1075 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1076 and modified InsetTOC class
1077 * src/buffer.C: ditto
1079 * forms/lyx.fd: strip out old FD_form_toc code
1080 * src/lyx_gui_misc.C: ditto
1081 * src/lyx_gui.C: ditto
1082 * src/lyx_cb.C: ditto
1083 * src/lyx.[Ch]: ditto
1085 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1087 * src/support/utility.hpp: tr -d '\r'
1089 2000-08-01 Juergen Vigna <jug@sad.it>
1091 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1093 * src/commandtags.h:
1094 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1095 LFUN_TABULAR_FEATURES.
1097 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1098 LFUN_LAYOUT_TABULAR.
1100 * src/insets/insettabular.C (getStatus): implemented helper function.
1102 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1104 2000-07-31 Juergen Vigna <jug@sad.it>
1106 * src/text.C (draw): fixed screen update problem for text-insets.
1108 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1109 something changed probably this has to be added in various other
1112 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1114 2000-07-31 Baruch Even <baruch.even@writeme.com>
1116 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1117 templates to satisfy compaq cxx.
1120 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1122 * src/support/translator.h (equal_1st_in_pair::operator()): take
1123 const ref pair_type as arg.
1124 (equal_2nd_in_pair::operator()): ditto
1125 (Translator::~Translator): remove empty d-tor.
1127 * src/graphics/GraphicsCache.C: move include config.h to top, also
1128 put initialization of GraphicsCache::singleton here.
1129 (~GraphicsCache): move here
1130 (addFile): take const ref as arg
1133 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1135 * src/BufferView2.C (insertLyXFile): change te with/without header
1138 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1140 * src/frontends/xforms/FormGraphics.C (apply): add some
1141 static_cast. Not very nice, but required by compaq cxx.
1143 * src/frontends/xforms/RadioButtonGroup.h: include header
1144 <utility> instead of <pair.h>
1146 * src/insets/insetgraphicsParams.C: add using directive.
1147 (readResize): change return type to void.
1148 (readOrigin): ditto.
1150 * src/lyxfunc.C (getStatus): add missing break for build-program
1151 function; add test for Literate for export functions.
1153 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1154 entries in Options menu.
1156 2000-07-31 Baruch Even <baruch.even@writeme.com>
1158 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1159 protect against auto-allocation; release icon when needed.
1161 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1163 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1164 on usual typewriter.
1166 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1167 earlier czech.kmap), useful only for programming.
1169 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1171 * src/frontends/xforms/FormCitation.h: fix conditioning around
1174 2000-07-31 Juergen Vigna <jug@sad.it>
1176 * src/frontends/xforms/FormTabular.C (local_update): changed
1177 radio_linebreaks to radio_useparbox and added radio_useminipage.
1179 * src/tabular.C: made support for using minipages/parboxes.
1181 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1183 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1185 (descent): so the cursor is in the middle.
1186 (width): bit smaller box.
1188 * src/insets/insetgraphics.h: added display() function.
1190 2000-07-31 Baruch Even <baruch.even@writeme.com>
1192 * src/frontends/Dialogs.h: Added showGraphics signals.
1194 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1195 xforms form definition of the graphics dialog.
1197 * src/frontends/xforms/FormGraphics.h:
1198 * src/frontends/xforms/FormGraphics.C: Added files, the
1199 GUIndependent code of InsetGraphics
1201 * src/insets/insetgraphics.h:
1202 * src/insets/insetgraphics.C: Major writing to make it work.
1204 * src/insets/insetgraphicsParams.h:
1205 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1206 struct between InsetGraphics and GUI.
1208 * src/LaTeXFeatures.h:
1209 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1210 support for graphicx package.
1212 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1213 for the graphics inset.
1215 * src/support/translator.h: Added file, used in
1216 InsetGraphicsParams. this is a template to translate between two
1219 * src/frontends/xforms/RadioButtonGroup.h:
1220 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1221 way to easily control a radio button group.
1223 2000-07-28 Juergen Vigna <jug@sad.it>
1225 * src/insets/insettabular.C (LocalDispatch):
1226 (TabularFeatures): added support for lyx-functions of tabular features.
1227 (cellstart): refixed this function after someone wrongly changed it.
1229 * src/commandtags.h:
1230 * src/LyXAction.C (init): added support for tabular-features
1232 2000-07-28 Allan Rae <rae@lyx.org>
1234 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1235 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1236 triggers the callback for input checking. As a result we sometimes get
1237 "LyX: This shouldn't happen..." printed to cerr.
1238 (input): Started using status variable since I only free() on
1239 destruction. Some input checking for paths and font sizes.
1241 * src/frontends/xforms/FormPreferences.h: Use status to control
1242 activation of Ok and Apply
1244 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1245 callback. Also resized to stop segfaults with 0.88. The problem is
1246 that xforms-0.88 requires the folder to be wide enough to fit all the
1247 tabs. If it isn't it causes all sorts of problems.
1249 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1251 * src/frontends/xforms/forms/README: Reflect reality.
1253 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1254 * src/frontends/xforms/forms/makefile: ditto.
1256 * src/commandtags.h: Get access to new Preferences dialog
1257 * src/LyXAction.C: ditto
1258 * src/lyxfunc.C: ditto
1259 * lib/ui/default.ui: ditto
1261 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1263 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1265 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1268 * src/frontends/xforms/form_url.[Ch]: added.
1270 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1272 * src/insets/insetbib.h: fixed bug in previous commit
1274 * src/frontends/xforms/FormUrl.h: ditto
1276 * src/frontends/xforms/FormPrint.h: ditto
1278 * src/frontends/xforms/FormPreferences.h: ditto
1280 * src/frontends/xforms/FormCopyright.h: ditto
1282 * src/frontends/xforms/FormCitation.C: ditto
1284 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1285 private copyconstructor and private default contructor
1287 * src/support/Makefile.am: add utility.hpp
1289 * src/support/utility.hpp: new file from boost
1291 * src/insets/insetbib.h: set owner in clone
1293 * src/frontends/xforms/FormCitation.C: added missing include
1296 * src/insets/form_url.[Ch]: removed
1298 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1300 * development/lyx.spec.in
1301 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1302 file/directory re-organization.
1304 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1306 * src/insets/insetcommand.[Ch]: moved the string data and
1307 associated manipulation methods into a new stand-alone class
1308 InsetCommandParams. This class has two additional methods
1309 getAsString() and setFromString() allowing the contents to be
1310 moved around as a single string.
1311 (addContents) method removed.
1312 (setContents) method no longer virtual.
1314 * src/buffer.C (readInset): made use of new InsetCitation,
1315 InsetUrl constructors based on InsetCommandParams.
1317 * src/commandtags.h: add LFUN_INSERT_URL
1319 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1320 independent InsetUrl and use InsetCommandParams to extract
1321 string info and create new Insets.
1323 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1325 * src/frontends/xforms/FormCitation.C (apply): uses
1328 * src/frontends/xforms/form_url.C
1329 * src/frontends/xforms/form_url.h
1330 * src/frontends/xforms/FormUrl.h
1331 * src/frontends/xforms/FormUrl.C
1332 * src/frontends/xforms/forms/form_url.fd: new files
1334 * src/insets/insetcite.[Ch]: removed unused constructors.
1336 * src/insets/insetinclude.[Ch]: no longer store filename
1338 * src/insets/inseturl.[Ch]: GUI-independent.
1340 2000-07-26 Juergen Vigna <jug@sad.it>
1341 * renamed frontend from gtk to gnome as it is that what is realized
1342 and did the necessary changes in the files.
1344 2000-07-26 Marko Vendelin <markov@ioc.ee>
1346 * configure.in: cleaning up gnome configuration scripts
1348 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1350 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1351 shortcuts syndrom by redrawing them explicitely (a better solution
1352 would be appreciated).
1354 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1356 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1359 * src/lyx_cb.C (MenuExport): change html export to do the right
1360 thing depending of the document type (instead of having
1361 html-linuxdoc and html-docbook).
1362 * src/lyxfunc.C (getStatus): update for html
1363 * lib/ui/default.ui: simplify due to the above change.
1364 * src/menus.C (ShowFileMenu): update too (in case we need it).
1366 * src/MenuBackend.C (read): if a menu is defined twice, add the
1367 new entries to the exiting one.
1369 2000-07-26 Juergen Vigna <jug@sad.it>
1371 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1373 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1374 and return a bool if it did actual save the file.
1375 (AutoSave): don't autosave a unnamed doc.
1377 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1378 check if this is an UNNAMED new file and react to it.
1379 (newFile): set buffer to unnamed and change to not mark a new
1380 buffer dirty if I didn't do anything with it.
1382 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1384 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1386 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1387 friend as per Angus's patch posted to lyx-devel.
1389 * src/ext_l10n.h: updated
1391 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1392 gettext on the style string right before inserting them into the
1395 * autogen.sh: add code to extract style strings form layout files,
1396 not good enough yet.
1398 * src/frontends/gtk/.cvsignore: add MAKEFILE
1400 * src/MenuBackend.C (read): run the label strings through gettext
1401 before storing them in the containers.
1403 * src/ext_l10n.h: new file
1405 * autogen.sh : generate the ext_l10n.h file here
1407 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1409 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1412 * lib/ui/default.ui: fix a couple of typos.
1414 * config/gnome/gtk.m4: added (and added to the list of files in
1417 * src/insets/insetinclude.C (unique_id): fix when we are using
1418 lyxstring instead of basic_string<>.
1419 * src/insets/insettext.C (LocalDispatch): ditto.
1420 * src/support/filetools.C: ditto.
1422 * lib/configure.m4: create the ui/ directory if necessary.
1424 * src/LyXView.[Ch] (updateToolbar): new method.
1426 * src/BufferView_pimpl.C (buffer): update the toolbar when
1427 opening/closing buffer.
1429 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1431 * src/LyXAction.C (getActionName): enhance to return also the name
1432 and options of pseudo-actions.
1433 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1435 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1436 as an example of what is possible). Used in File->Build too (more
1437 useful) and in the import/export menus (to mimick the complicated
1438 handling of linuxdoc and friends). Try to update all the entries.
1440 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1443 * src/MenuBackend.C (read): Parse the new OptItem tag.
1445 * src/MenuBackend.h: Add a new optional_ data member (used if the
1446 entry should be omitted when the lyxfunc is disabled).
1448 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1449 function, used as a shortcut.
1450 (create_submenu): align correctly the shortcuts on the widest
1453 * src/MenuBackend.h: MenuItem.label() only returns the label of
1454 the menu without shortcut; new method shortcut().
1456 2000-07-14 Marko Vendelin <markov@ioc.ee>
1458 * src/frontends/gtk/Dialogs.C:
1459 * src/frontends/gtk/FormCopyright.C:
1460 * src/frontends/gtk/FormCopyright.h:
1461 * src/frontends/gtk/Makefile.am: added these source-files for the
1462 Gtk/Gnome support of the Copyright-Dialog.
1464 * src/main.C: added Gnome::Main initialization if using
1465 Gtk/Gnome frontend-GUI.
1467 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1469 * config/gnome/aclocal-include.m4
1470 * config/gnome/compiler-flags.m4
1471 * config/gnome/curses.m4
1472 * config/gnome/gnome--.m4
1473 * config/gnome/gnome-bonobo-check.m4
1474 * config/gnome/gnome-common.m4
1475 * config/gnome/gnome-fileutils.m4
1476 * config/gnome/gnome-ghttp-check.m4
1477 * config/gnome/gnome-gnorba-check.m4
1478 * config/gnome/gnome-guile-checks.m4
1479 * config/gnome/gnome-libgtop-check.m4
1480 * config/gnome/gnome-objc-checks.m4
1481 * config/gnome/gnome-orbit-check.m4
1482 * config/gnome/gnome-print-check.m4
1483 * config/gnome/gnome-pthread-check.m4
1484 * config/gnome/gnome-support.m4
1485 * config/gnome/gnome-undelfs.m4
1486 * config/gnome/gnome-vfs.m4
1487 * config/gnome/gnome-x-checks.m4
1488 * config/gnome/gnome-xml-check.m4
1489 * config/gnome/gnome.m4
1490 * config/gnome/gperf-check.m4
1491 * config/gnome/gtk--.m4
1492 * config/gnome/linger.m4
1493 * config/gnome/need-declaration.m4: added configuration scripts
1494 for Gtk/Gnome frontend-GUI
1496 * configure.in: added support for the --with-frontend=gtk option
1498 * autogen.sh: added config/gnome/* to list of config-files
1500 * acconfig.h: added define for GTKGUI-support
1502 * config/lyxinclude.m4: added --with-frontend[=value] option value
1503 for Gtk/Gnome frontend-GUI support.
1505 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1507 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1511 * src/paragraph.C (GetChar): remove non-const version
1513 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1514 (search_kw): use it.
1516 * src/lyx_main.C (init): if "preferences" exist, read that instead
1518 (ReadRcFile): return bool if the file could be read ok.
1519 (ReadUIFile): add a check to see if lex file is set ok.
1521 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1522 bastring can be used instead of lyxstring (still uses the old code
1523 if std::string is good enough or if lyxstring is used.)
1525 * src/encoding.C: make the arrays static, move ininle functions
1527 * src/encoding.h: from here.
1529 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1530 (parseSingleLyXformat2Token): move inset parsing to separate method
1531 (readInset): new private method
1533 * src/Variables.h: remove virtual from get().
1535 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1536 access to NEW_INSETS and NEW_TABULAR
1538 * src/MenuBackend.h: remove superfluous forward declaration of
1539 MenuItem. Add documentations tags "///", remove empty MenuItem
1540 destructor, remove private default contructor.
1542 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1544 (read): more string mlabel and mname to where they are used
1545 (read): remove unused variables mlabel and mname
1546 (defaults): unconditional clear, make menusetup take advantage of
1547 add returning Menu &.
1549 * src/LyXView.h: define NEW_MENUBAR as default
1551 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1552 to NEW_INSETS and NEW_TABULAR.
1553 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1554 defined. Change some of the "xxxx-inset-insert" functions names to
1557 * several files: more enahncements to NEW_INSETS and the resulting
1560 * lib/lyxrc.example (\date_insert_format): move to misc section
1562 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1563 bastring and use AC_CACHE_CHECK.
1564 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1565 the system have the newest methods. uses AC_CACHE_CHECK
1566 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1567 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1568 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1570 * configure.in: add LYX_CXX_GOOD_STD_STRING
1572 * acinclude.m4: recreated
1574 2000-07-24 Amir Karger
1576 * README: add Hebrew, Arabic kmaps
1579 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1581 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1584 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1586 * Lot of files: add pragma interface/implementation.
1588 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1590 * lib/ui/default.ui: new file (ans new directory). Contains the
1591 default menu and toolbar.
1593 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1594 global space. Toolbars are now read (as menus) in ui files.
1596 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1598 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1599 is disabled because the document is read-only. We want to have the
1600 toggle state of the function anyway.
1601 (getStatus): add code for LFUN_VC* functions (mimicking what is
1602 done in old-style menus)
1604 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1605 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1607 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1608 * src/BufferView_pimpl.C: ditto.
1609 * src/lyxfunc.C: ditto.
1611 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1612 default). This replaces old-style menus by new ones.
1614 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1615 MenuItem. Contain the data structure of a menu.
1617 * src/insets/insettext.C: use LyXView::setLayout instead of
1618 accessing directly the toolbar combox.
1619 * src/lyxfunc.C (Dispatch): ditto.
1621 * src/LyXView.C (setLayout): new method, which just calls
1622 Toolbar::setLayout().
1623 (updateLayoutChoice): move part of this method in Toolbar.
1625 * src/toolbar.[Ch]: removed.
1627 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1628 implementation the toolbar.
1630 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1631 the toolbar. It might make sense to merge it with ToolbarDefaults
1633 (setLayout): new function.
1634 (updateLayoutList): ditto.
1635 (openLayoutList): ditto.
1637 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1638 xforms implementation of the toolbar.
1639 (get_toolbar_func): comment out, since I do not
1640 know what it is good for.
1642 * src/ToolbarDefaults.h: Add the ItemType enum.
1644 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1645 for a list of allocated C strings. Used in Menubar xforms
1646 implementation to avoid memory leaks.
1648 * src/support/lstrings.[Ch] (uppercase): new version taking and
1652 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1653 * lib/bind/emacs.bind: ditto.
1655 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1657 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1658 forward decl of LyXView.
1660 * src/toolbar.C (toolbarItem): moved from toolbar.h
1661 (toolbarItem::clean): ditto
1662 (toolbarItem::~toolbarItem): ditto
1663 (toolbarItem::operator): ditto
1665 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1667 * src/paragraph.h: control the NEW_TABULAR define from here
1669 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1670 USE_TABULAR_INSETS to NEW_TABULAR
1672 * src/ToolbarDefaults.C: add include "lyxlex.h"
1674 * files using the old table/tabular: use NEW_TABULAR to control
1675 compilation of old tabular stuff.
1677 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1680 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1681 planemet in reading of old style floats, fix the \end_deeper
1682 problem when reading old style floats.
1684 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1686 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1688 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1690 * lib/bind/sciword.bind: updated.
1692 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1694 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1695 layout write problem
1697 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1699 * src/Makefile.am (INCLUDES): remove image directory from include
1702 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1703 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1705 * src/LyXView.C (create_form_form_main): read the application icon
1708 * lib/images/*.xpm: change the icons to use transparent color for
1711 * src/toolbar.C (update): change the color of the button when it
1714 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1716 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1717 setting explicitely the minibuffer.
1718 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1720 * src/LyXView.C (showState): new function. Shows font information
1721 in minibuffer and update toolbar state.
1722 (LyXView): call Toolbar::update after creating the
1725 * src/toolbar.C: change toollist to be a vector instead of a
1727 (BubbleTimerCB): get help string directly from the callback
1728 argument of the corresponding icon (which is the action)
1729 (set): remove unnecessary ugliness.
1730 (update): new function. update the icons (depressed, disabled)
1731 depending of the status of the corresponding action.
1733 * src/toolbar.h: remove help in toolbarItem
1735 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1737 * src/Painter.C (text): Added code for using symbol glyphs from
1738 iso10646 fonts. Currently diabled.
1740 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1743 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1744 magyar,turkish and usorbian.
1746 * src/paragraph.C (isMultiLingual): Made more efficient.
1748 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1751 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1752 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1753 Also changed the prototype to "bool math_insert_greek(char)".
1755 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1757 * lots of files: apply the NEW_INSETS on all code that will not be
1758 needed when we move to use the new insets. Enable the define in
1759 lyxparagrah.h to try it.
1761 * src/insets/insettabular.C (cellstart): change to be a static
1763 (InsetTabular): initialize buffer in the initializer list.
1765 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1767 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1768 form_print.h out of the header file. Replaced with forward
1769 declarations of the relevant struct.
1771 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1774 * src/commandtags.h: do not include "debug.h" which does not
1775 belong there. #include it in some other places because of this
1778 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1780 * src/insets/insetcaption.C: add a couple "using" directives.
1782 * src/toolbar.C (add): get the help text directly from lyxaction.
1784 (setPixmap): new function. Loads from disk and sets a pixmap on a
1785 botton; the name of the pixmap file is derived from the command
1788 * src/toolbar.h: remove members isBitmap and pixmap from
1791 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1792 * lib/images/: move many files from images/banner.xpm.
1794 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1796 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1797 * src/toolbar.C: ditto.
1798 * configure.in: ditto.
1799 * INSTALL: document.
1801 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1802 the spellchecker popup is closed from the WM.
1804 2000-07-19 Juergen Vigna <jug@sad.it>
1806 * src/insets/insetfloat.C (Write): small fix because we use the
1807 insetname for the type now!
1809 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1811 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1814 * src/frontends/Dialogs.h: removed hideCitation signal
1816 * src/insets/insetcite.h: added hide signal
1818 * src/insets/insetcite.C (~InsetCitation): emits new signal
1819 (getScreenLabel): "intelligent" label should now fit on the screen!
1821 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1823 * src/frontends/xforms/FormCitation.C (showInset): connects
1824 hide() to the inset's hide signal
1825 (show): modified to use fl_set_object_position rather than
1826 fl_set_object_geometry wherever possible
1828 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1830 * src/insets/lyxinset.h: add caption code
1832 * src/insets/insetfloat.C (type): new method
1834 * src/insets/insetcaption.C (Write): new method
1836 (LyxCode): new method
1838 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1839 to get it right together with using the FloatList.
1841 * src/commandtags.h: add LFUN_INSET_CAPTION
1842 * src/lyxfunc.C (Dispatch): handle it
1844 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1847 * src/Variables.[Ch]: make expand take a const reference, remove
1848 the destructor, some whitespace changes.
1850 * src/LyXAction.C (init): add caption-inset-insert
1852 * src/FloatList.C (FloatList): update the default floats a bit.
1854 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1856 * src/Variables.[Ch]: new files. Intended to be used for language
1857 specific strings (like \chaptername) and filename substitution in
1860 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1862 * lib/kbd/american.kmap: update
1864 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1866 * src/bufferparams.[Ch]: remove member allowAccents.
1868 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1870 * src/LaTeXLog.C: use the log_form.h header.
1871 * src/lyx_gui.C: ditto.
1872 * src/lyx_gui_misc.C: ditto.
1873 * src/lyxvc.h: ditto.
1875 * forms/log_form.fd: new file, created from latexoptions.fd. I
1876 kept the log popup and nuked the options form.
1878 * src/{la,}texoptions.[Ch]: removed.
1879 * src/lyx_cb.C (LaTeXOptions): ditto
1881 * src/lyx_gui.C (create_forms): do not handle the
1882 fd_latex_options form.
1884 2000-07-18 Juergen Vigna <jug@sad.it>
1886 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1887 name of the inset so that it can be requested outside (text2.C).
1889 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1892 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1894 * src/mathed/formula.h (ConvertFont): constify
1896 * src/mathed/formula.C (Read): add warning if \end_inset is not
1897 found on expected place.
1899 * src/insets/lyxinset.h (ConvertFont): consify
1901 * src/insets/insetquotes.C (ConvertFont): constify
1902 * src/insets/insetquotes.h: ditto
1904 * src/insets/insetinfo.h: add labelfont
1906 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1907 (ascent): use labelfont
1911 (Write): make .lyx file a bit nicer
1913 * src/insets/insetfloat.C (Write): simplify somewhat...
1914 (Read): add warning if arg is not found
1916 * src/insets/insetcollapsable.C: add using std::max
1917 (Read): move string token and add warning in arg is not found
1918 (draw): use std::max to get the right ty
1919 (getMaxWidth): simplify by using std::max
1921 * src/insets/insetsection.h: new file
1922 * src/insets/insetsection.C: new file
1923 * src/insets/insetcaption.h: new file
1924 * src/insets/insetcaption.C: new file
1926 * src/insets/inset.C (ConvertFont): constify signature
1928 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1929 insetcaption.[Ch] and insetsection.[Ch]
1931 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1932 uses to use LABEL_COUNTER_CHAPTER instead.
1933 * src/text2.C (SetCounter): here
1935 * src/counters.h: new file
1936 * src/counters.C: new file
1937 * src/Sectioning.h: new file
1938 * src/Sectioning.C: new file
1940 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1942 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1944 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1947 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1950 2000-07-17 Juergen Vigna <jug@sad.it>
1952 * src/tabular.C (Validate): check if array-package is needed.
1953 (SetVAlignment): added support for vertical alignment.
1954 (SetLTFoot): better support for longtable header/footers
1955 (Latex): modified to support added features.
1957 * src/LaTeXFeatures.[Ch]: added array-package.
1959 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1961 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1964 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1966 * configure.in: do not forget to put a space after -isystem.
1968 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1970 * lib/kbd/arabic.kmap: a few fixes.
1972 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1974 * some whitespace chagnes to a number of files.
1976 * src/support/DebugStream.h: change to make it easier for
1977 doc++ to parse correctly.
1978 * src/support/lyxstring.h: ditto
1980 * src/mathed/math_utils.C (compara): change to have only one
1982 (MathedLookupBOP): change because of the above.
1984 * src/mathed/math_delim.C (math_deco_compare): change to have only
1986 (search_deco): change becasue of the above.
1988 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1989 instead of manually coded one.
1991 * src/insets/insetquotes.C (Read): read the \end_inset too
1993 * src/insets/insetlatex.h: remove file
1994 * src/insets/insetlatex.C: remove file
1996 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1998 (InsetPrintIndex): remove destructor
2000 * src/insets/insetinclude.h: remove default constructor
2002 * src/insets/insetfloat.C: work to make it work better
2004 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2006 * src/insets/insetcite.h (InsetCitation): remove default constructor
2008 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2010 * src/text.C (GetColumnNearX): comment out some currently unused code.
2012 * src/paragraph.C (writeFile): move some initializations closer to
2014 (CutIntoMinibuffer): small change to use new matchIT operator
2018 (InsertInset): ditto
2021 (InsetIterator): ditto
2022 (Erase): small change to use new matchFT operator
2024 (GetFontSettings): ditto
2025 (HighestFontInRange): ditto
2028 * src/lyxparagraph.h: some chars changed to value_type
2029 (matchIT): because of some stronger checking (perhaps too strong)
2030 in SGI STL, the two operator() unified to one.
2033 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2035 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2036 the last inset read added
2037 (parseSingleLyXformat2Token): some more (future) compability code added
2038 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2039 (parseSingleLyXformat2Token): set last_inset_read
2040 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2041 (parseSingleLyXformat2Token): don't double intializw string next_token
2043 * src/TextCache.C (text_fits::operator()): add const's to the signature
2044 (has_buffer::operator()): ditto
2046 * src/Floating.h: add some comments on the class
2048 * src/FloatList.[Ch] (typeExist): new method
2051 * src/BackStack.h: added default constructor, wanted by Gcc.
2053 2000-07-14 Juergen Vigna <jug@sad.it>
2055 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2057 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2059 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2060 do a redraw when the window is resized!
2061 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2063 * src/insets/insettext.C (resizeLyXText): added function to correctly
2064 being able to resize the LyXWindow.
2066 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2068 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2070 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2071 crashes when closing dialog to a deleted inset.
2073 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2074 method! Now similar to other insets.
2076 2000-07-13 Juergen Vigna <jug@sad.it>
2078 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2080 * lib/examples/Literate.lyx: small patch!
2082 * src/insets/insetbib.C (Read): added this function because of wrong
2083 Write (without [begin|end]_inset).
2085 2000-07-11 Juergen Vigna <jug@sad.it>
2087 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2088 as the insertInset could not be good!
2090 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2091 the bool param should not be last.
2093 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2095 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2096 did submit that to Karl).
2098 * configure.in: use -isystem instead of -I for X headers. This
2099 fixes a problem on solaris with a recent gcc;
2100 put the front-end code after the X detection code;
2101 configure in sigc++ before lib/
2103 * src/lyx_main.C (commandLineHelp): remove -display from command
2106 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2108 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2109 Also put in Makefile rules for building the ``listerrors''
2110 program for parsing errors from literate programs written in LyX.
2112 * lib/build-listerrors: Added small shell script as part of compile
2113 process. This builds a working ``listerrors'' binary if noweb is
2114 installed and either 1) the VNC X server is installed on the machine,
2115 or 2) the user is compiling from within a GUI. The existence of a GUI
2116 is necessary to use the ``lyx --export'' feature for now. This
2117 hack can be removed once ``lyx --export'' no longer requires a GUI to
2120 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2122 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2123 now passed back correctly from gcc and placed "under" error
2124 buttons in a Literate LyX source.
2126 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2128 * src/text.C (GetColumnNearX): Better behavior when a RTL
2129 paragraph is ended by LTR text.
2131 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2134 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2136 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2137 true when clipboard is empty.
2139 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2141 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2142 row of the paragraph.
2143 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2144 to prevent calculation of bidi tables
2146 2000-07-07 Juergen Vigna <jug@sad.it>
2148 * src/screen.C (ToggleSelection): added y_offset and x_offset
2151 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2154 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2156 * src/insets/insettext.C: fixed Layout-Display!
2158 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2160 * configure.in: add check for strings.h header.
2162 * src/spellchecker.C: include <strings.h> in order to have a
2163 definition for bzero().
2165 2000-07-07 Juergen Vigna <jug@sad.it>
2167 * src/insets/insettext.C (draw): set the status of the bv->text to
2168 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2170 * src/screen.C (DrawOneRow):
2171 (DrawFromTo): redraw the actual row if something has changed in it
2174 * src/text.C (draw): call an update of the toplevel-inset if something
2175 has changed inside while drawing.
2177 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2179 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2181 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2182 processing inside class.
2184 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2185 processing inside class.
2187 * src/insets/insetindex.h new struct Holder, consistent with other
2190 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2191 citation dialog from main code and placed it in src/frontends/xforms.
2192 Dialog launched through signals instead of callbacks
2194 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2196 * lyx.man: update the options description.
2198 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2200 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2201 handle neg values, set min width to 590, add doc about -display
2203 2000-07-05 Juergen Vigna <jug@sad.it>
2205 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2206 calls to BufferView *.
2208 * src/insets/insettext.C (checkAndActivateInset): small fix non
2209 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2211 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2212 their \end_inset token!
2214 2000-07-04 edscott <edscott@imp.mx>
2216 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2217 lib/lyxrc.example: added option \wheel_jump
2219 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2221 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2222 remove support for -width,-height,-xpos and -ypos.
2224 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2226 * src/encoding.[Ch]: New files.
2228 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2229 (text): Call to the underline() method only when needed.
2231 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2233 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2234 encoding(s) for the document.
2236 * src/bufferparams.C (BufferParams): Changed default value of
2239 * src/language.C (newLang): Removed.
2240 (items[]): Added encoding information for all defined languages.
2242 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2243 encoding choice button.
2245 * src/lyxrc.h (font_norm_type): New member variable.
2246 (set_font_norm_type): New method.
2248 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2249 paragraphs with different encodings.
2251 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2252 (TransformChar): Changed to work correctly with Arabic points.
2253 (draw): Added support for drawing Arabic points.
2254 (draw): Removed code for drawing underbars (this is done by
2257 * src/support/textutils.h (IsPrintableNonspace): New function.
2259 * src/BufferView_pimpl.h: Added "using SigC::Object".
2260 * src/LyXView.h: ditto.
2262 * src/insets/insetinclude.h (include_label): Changed to mutable.
2264 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2266 * src/mathed/math_iter.h: remove empty destructor
2268 * src/mathed/math_cursor.h: remove empty destructor
2270 * src/insets/lyxinset.h: add THEOREM_CODE
2272 * src/insets/insettheorem.[Ch]: new files
2274 * src/insets/insetminipage.C: (InsertInset): remove
2276 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2278 (InsertInset): remove
2280 * src/insets/insetlist.C: (InsertList): remove
2282 * src/insets/insetfootlike.[Ch]: new files
2284 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2287 (InsertInset): ditto
2289 * src/insets/insetert.C: remove include Painter.h, reindent
2290 (InsertInset): move to header
2292 * src/insets/insetcollapsable.h: remove explicit from default
2293 contructor, remove empty destructor, add InsertInset
2295 * src/insets/insetcollapsable.C (InsertInset): new func
2297 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2299 * src/vspace.h: add explicit to constructor
2301 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2302 \textcompwordmark, please test this.
2304 * src/lyxrc.C: set ascii_linelen to 65 by default
2306 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2308 * src/commandtags.h: add LFUN_INSET_THEOREM
2310 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2311 (makeLinuxDocFile): remove _some_ of the nice logic
2312 (makeDocBookFile): ditto
2314 * src/Painter.[Ch]: (~Painter): removed
2316 * src/LyXAction.C (init): entry for insettheorem added
2318 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2320 (deplog): code to detect files generated by LaTeX, needs testing
2323 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2325 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2327 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2329 * src/LaTeX.C (deplog): Add a check for files that are going to be
2330 created by the first latex run, part of the project to remove the
2333 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2334 contents to the extension list.
2336 2000-07-04 Juergen Vigna <jug@sad.it>
2338 * src/text.C (NextBreakPoint): added support for needFullRow()
2340 * src/insets/lyxinset.h: added needFullRow()
2342 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2345 * src/insets/insettext.C: lots of changes for update!
2347 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2349 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2351 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2353 * src/insets/insetinclude.C (InsetInclude): fixed
2354 initialization of include_label.
2355 (unique_id): now returns a string.
2357 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2359 * src/LaTeXFeatures.h: new member IncludedFiles, for
2360 a map of key, included file name.
2362 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2363 with the included files for inclusion in SGML preamble,
2364 i. e., linuxdoc and docbook.
2367 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2368 nice (is the generated linuxdoc code to be exported?), that
2369 allows to remove column, and only_body that will be true for
2370 slave documents. Insets are allowed inside SGML font type.
2371 New handling of the SGML preamble for included files.
2372 (makeDocBookFile): the same for docbook.
2374 * src/insets/insetinclude.h:
2375 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2377 (DocBook): new export methods.
2379 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2380 and makeDocBookFile.
2382 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2383 formats to export with command line argument -x.
2385 2000-06-29 Juergen Vigna <jug@sad.it>
2387 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2388 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2390 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2391 region could already been cleared by an inset!
2393 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2395 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2398 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2400 (cursorToggle): remove special handling of lyx focus.
2402 2000-06-28 Juergen Vigna <jug@sad.it>
2404 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2407 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2409 * src/insets/insetindex.C (Edit): add a callback when popup is
2412 * src/insets/insettext.C (LocalDispatch):
2413 * src/insets/insetmarginal.h:
2414 * src/insets/insetlist.h:
2415 * src/insets/insetfoot.h:
2416 * src/insets/insetfloat.h:
2417 * src/insets/insetert.h: add a missing std:: qualifier.
2419 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2421 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2424 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2426 * src/insets/insettext.C (Read): remove tmptok unused variable
2427 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2428 (InsertInset): change for new InsetInset code
2430 * src/insets/insettext.h: add TEXT inline method
2432 * src/insets/insettext.C: remove TEXT macro
2434 * src/insets/insetmarginal.C (Write): new method
2435 (Latex): change output slightly
2437 * src/insets/insetfoot.C (Write): new method
2438 (Latex): change output slightly (don't use endl when no need)
2440 * src/insets/insetert.C (Write): new method
2442 * src/insets/insetcollapsable.h: make button_length, button_top_y
2443 and button_bottm_y protected.
2445 * src/insets/insetcollapsable.C (Write): simplify code by using
2446 tostr. Also do not output the float name, the children class
2447 should to that to get control over own arguments
2449 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2450 src/insets/insetminipage.[Ch]:
2453 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2455 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2457 * src/Makefile.am (lyx_SOURCES): add the new files
2459 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2460 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2461 * src/commandtags.h: ditto
2463 * src/LaTeXFeatures.h: add a std::set of used floattypes
2465 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2467 * src/FloatList.[Ch] src/Floating.h: new files
2469 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2471 * src/lyx_cb.C (TableApplyCB): ditto
2473 * src/text2.C: ditto
2474 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2475 (parseSingleLyXformat2Token): ditto + add code for
2476 backwards compability for old float styles + add code for new insets
2478 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2480 (InsertInset(size_type, Inset *, LyXFont)): new method
2481 (InsetChar(size_type, char)): changed to use the other InsetChar
2482 with a LyXFont(ALL_INHERIT).
2483 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2484 insert the META_INSET.
2486 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2488 * sigc++/thread.h (Threads): from here
2490 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2491 definition out of line
2492 * sigc++/scope.h: from here
2494 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2496 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2497 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2499 * Makefile.am (bindist): new target.
2501 * INSTALL: add instructions for doing a binary distribution.
2503 * development/tools/README.bin.example: update a bit.
2505 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2508 * lib/lyxrc.example: new lyxrc tag \set_color.
2510 * src/lyxfunc.C (Dispatch):
2511 * src/commandtags.h:
2512 * src/LyXAction.C: new lyxfunc "set-color".
2514 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2515 and an x11name given as strings.
2517 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2518 cache when a color is changed.
2520 2000-06-26 Juergen Vigna <jug@sad.it>
2522 * src/lyxrow.C (width): added this functions and variable.
2524 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2527 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2529 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2531 * images/undo_bw.xpm: new icon.
2532 * images/redo_bw.xpm: ditto.
2534 * configure.in (INSTALL_SCRIPT): change value to
2535 ${INSTALL} to avoid failures of install-script target.
2536 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2538 * src/BufferView.h: add a magic "friend" declaration to please
2541 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2543 * forms/cite.fd: modified to allow resizing without messing
2546 * src/insetcite.C: Uses code from cite.fd almost without
2548 User can now resize dialog in the x-direction.
2549 Resizing the dialog in the y-direction is prevented, as the
2550 code does this intelligently already.
2552 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2554 * INSTALL: remove obsolete entry in "problems" section.
2556 * lib/examples/sl_*.lyx: update of the slovenian examples.
2558 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2560 2000-06-23 Juergen Vigna <jug@sad.it>
2562 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2564 * src/buffer.C (resize): delete the LyXText of textinsets.
2566 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2568 * src/insets/lyxinset.h: added another parameter 'cleared' to
2569 the draw() function.
2571 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2572 unlocking inset in inset.
2574 2000-06-22 Juergen Vigna <jug@sad.it>
2576 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2577 of insets and moved first to LyXText.
2579 * src/mathed/formulamacro.[Ch]:
2580 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2582 2000-06-21 Juergen Vigna <jug@sad.it>
2584 * src/text.C (GetVisibleRow): look if I should clear the area or not
2585 using Inset::doClearArea() function.
2587 * src/insets/lyxinset.h: added doClearArea() function and
2588 modified draw(Painter &, ...) to draw(BufferView *, ...)
2590 * src/text2.C (UpdateInset): return bool insted of int
2592 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2594 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2595 combox in the character popup
2597 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2598 BufferParams const & params
2600 2000-06-20 Juergen Vigna <jug@sad.it>
2602 * src/insets/insettext.C (SetParagraphData): set insetowner on
2605 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2607 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2608 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2610 (form_main_): remove
2612 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2613 (create_form_form_main): remove FD_form_main stuff, connect to
2614 autosave_timeout signal
2616 * src/LyXView.[Ch] (getMainForm): remove
2617 (UpdateTimerCB): remove
2618 * src/BufferView_pimpl.h: inherit from SigC::Object
2620 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2621 signal instead of callback
2623 * src/BufferView.[Ch] (cursorToggleCB): remove
2625 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2627 * src/BufferView_pimpl.C: changes because of the one below
2629 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2630 instead of storing a pointer to a LyXText.
2632 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2634 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2636 * src/lyxparagraph.h
2638 * src/paragraph.C: Changed fontlist to a sorted vector.
2640 2000-06-19 Juergen Vigna <jug@sad.it>
2642 * src/BufferView.h: added screen() function.
2644 * src/insets/insettext.C (LocalDispatch): some selection code
2647 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2649 * src/insets/insettext.C (SetParagraphData):
2651 (InsetText): fixes for multiple paragraphs.
2653 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2655 * development/lyx.spec.in: Call configure with ``--without-warnings''
2656 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2657 This should be fine, however, since we generally don't want to be
2658 verbose when making an RPM.
2660 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2662 * lib/scripts/fig2pstex.py: New file
2664 2000-06-16 Juergen Vigna <jug@sad.it>
2666 * src/insets/insettabular.C (UpdateLocal):
2667 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2668 (LocalDispatch): Changed all functions to use LyXText.
2670 2000-06-15 Juergen Vigna <jug@sad.it>
2672 * src/text.C (SetHeightOfRow): call inset::update before requesting
2675 * src/insets/insettext.C (update):
2676 * src/insets/insettabular.C (update): added implementation
2678 * src/insets/lyxinset.h: added update function
2680 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2682 * src/text.C (SelectNextWord): protect against null pointers with
2683 old-style string streams. (fix from Paul Theo Gonciari
2686 * src/cite.[Ch]: remove erroneous files.
2688 * lib/configure.m4: update the list of created directories.
2690 * src/lyxrow.C: include <config.h>
2691 * src/lyxcursor.C: ditto.
2693 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2695 * lib/examples/decimal.lyx: new example file from Mike.
2697 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2698 to find template definitions (from Dekel)
2700 * src/frontends/.cvsignore: add a few things.
2702 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2704 * src/Timeout.C (TimeOut): remove default argument.
2706 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2709 * src/insets/ExternalTemplate.C: add a "using" directive.
2711 * src/lyx_main.h: remove the act_ struct, which seems unused
2714 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2716 * LyX Developers Meeting: All files changed, due to random C++ (by
2717 coincidence) code generator script.
2719 - external inset (cool!)
2720 - initial online editing of preferences
2721 - insettabular breaks insettext(s contents)
2723 - some DocBook fixes
2724 - example files update
2725 - other cool stuff, create a diff and look for yourself.
2727 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2729 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2730 -1 this is a non-line-breaking textinset.
2732 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2733 if there is no width set.
2735 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2737 * Lots of files: Merged the dialogbase branch.
2739 2000-06-09 Allan Rae <rae@lyx.org>
2741 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2742 and the Dispatch methods that used it.
2744 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2745 access to functions formerly kept in Dispatch.
2747 2000-05-19 Allan Rae <rae@lyx.org>
2749 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2750 made to_page and count_copies integers again. from_page remains a
2751 string however because I want to allow entry of a print range like
2752 "1,4,22-25" using this field.
2754 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2755 and printer-params-get. These aren't useful from the minibuffer but
2756 could be used by a script/LyXServer app provided it passes a suitable
2757 auto_mem_buffer. I guess I should take a look at how the LyXServer
2758 works and make it support xtl buffers.
2760 * sigc++/: updated to libsigc++-1.0.1
2762 * src/xtl/: updated to xtl-1.3.pl.11
2764 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2765 those changes done to the files in src/ are actually recreated when
2766 they get regenerated. Please don't ever accept a patch that changes a
2767 dialog unless that patch includes the changes to the corresponding *.fd
2770 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2771 stringOnlyContains, renamed it and generalised it.
2773 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2774 branch. Removed the remaining old form_print code.
2776 2000-04-26 Allan Rae <rae@lyx.org>
2778 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2779 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2781 2000-04-25 Allan Rae <rae@lyx.org>
2783 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2784 against a base of xtl-1.3.pl.4
2786 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2787 filter the Id: entries so they still show the xtl version number
2790 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2791 into the src/xtl code. Patch still pending with José (XTL)
2793 2000-04-24 Allan Rae <rae@lyx.org>
2795 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2796 both more generic and much safer. Use the new template functions.
2797 * src/buffer.[Ch] (Dispatch): ditto.
2799 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2800 and mem buffer more intelligently. Also a little general cleanup.
2803 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2804 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2805 * src/xtl/Makefile.am: ditto.
2806 * src/xtl/.cvsignore: ditto.
2807 * src/Makefile.am: ditto.
2809 * src/PrinterParams.h: Removed the macros member functions. Added a
2810 testInvariant member function. A bit of tidying up and commenting.
2811 Included Angus's idea for fixing operation with egcs-1.1.2.
2813 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2814 cool expansion of XTL's mem_buffer to support automatic memory
2815 management within the buffer itself. Removed the various macros and
2816 replaced them with template functions that use either auto_mem_buffer
2817 or mem_buffer depending on a #define. The mem_buffer support will
2818 disappear as soon as the auto_mem_buffer is confirmed to be good on
2819 other platforms/compilers. That is, it's there so you've got something
2822 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2823 effectively forked XTL. However I expect José will include my code
2824 into the next major release. Also fixed a memory leak.
2825 * src/xtl/text.h: ditto.
2826 * src/xtl/xdr.h: ditto.
2827 * src/xtl/giop.h: ditto.
2829 2000-04-16 Allan Rae <rae@lyx.org>
2831 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2832 by autogen.sh and removed by maintainer-clean anyway.
2833 * .cvsignore, sigc++/.cvsignore: Support the above.
2835 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2837 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2839 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2840 macros, renamed static callback-target member functions to suit new
2841 scheme and made them public.
2842 * src/frontends/xforms/forms/form_print.fd: ditto.
2843 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2845 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2848 * src/xtl/: New directory containing a minimal distribution of XTL.
2849 This is XTL-1.3.pl.4.
2851 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2853 2000-04-15 Allan Rae <rae@lyx.org>
2855 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2857 * sigc++/: Updated to libsigc++-1.0.0
2859 2000-04-14 Allan Rae <rae@lyx.org>
2861 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2862 use the generic ones in future. I'll modify my conversion script.
2864 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2866 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2867 (CloseAllBufferRelatedDialogs): Renamed.
2868 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2870 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2871 of the generic ones. These are the same ones my conversion script
2874 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2875 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2876 * src/buffer.C (Dispatch): ditto
2878 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2879 functions for updating and hiding buffer dependent dialogs.
2880 * src/BufferView.C (buffer): ditto
2881 * src/buffer.C (setReadonly): ditto
2882 * src/lyxfunc.C (CloseBuffer): ditto
2884 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2885 Dialogs.h, and hence all the SigC stuff, into every file that includes
2886 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2888 * src/BufferView2.C: reduce the number of headers included by buffer.h
2890 2000-04-11 Allan Rae <rae@lyx.org>
2892 * src/frontends/xforms/xform_macros.h: A small collection of macros
2893 for building C callbacks.
2895 * src/frontends/xforms/Makefile.am: Added above file.
2897 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2898 scheme again. This time it should work for JMarc. If this is
2899 successful I'll revise my conversion script to automate some of this.
2900 The static member functions in the class also have to be public for
2901 this scheme will work. If the scheme works (it's almost identical to
2902 the way BufferView::cursorToggleCB is handled so it should work) then
2903 FormCopyright and FormPrint will be ready for inclusion into the main
2904 trunk immediately after 1.1.5 is released -- provided we're prepared
2905 for complaints about lame compilers not handling XTL.
2907 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2909 2000-04-07 Allan Rae <rae@lyx.org>
2911 * config/lyxinclude.m4: A bit more tidying up (Angus)
2913 * src/LString.h: JMarc's <string> header fix
2915 * src/PrinterParams.h: Used string for most data to remove some
2916 ugly code in the Print dialog and avoid even uglier code when
2917 appending the ints to a string for output.
2919 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2920 and moved "default:" back to the end of switch statement. Cleaned
2921 up the printing so it uses the right function calls and so the
2922 "print to file" option actually puts the file in the right directory.
2924 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2926 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2927 and Ok+Apply button control into a separate method: input (Angus).
2928 (input) Cleaned it up and improved it to be very thorough now.
2929 (All CB) static_cast used instead of C style cast (Angus). This will
2930 probably change again once we've worked out how to keep gcc-2.8.1 happy
2931 with real C callbacks.
2932 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2933 ignore some of the bool settings and has random numbers instead. Needs
2934 some more investigation. Added other input length checks and checking
2935 of file and printer names.
2937 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2938 would link (Angus). Seems the old code doesn't compile with the pragma
2939 statement either. Separated callback entries from internal methods.
2941 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2943 2000-03-17 Allan Rae <rae@lyx.org>
2945 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2946 need it? Maybe it could go in Dialogs instead? I could make it a
2947 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2948 values to get the bool return value.
2949 (Dispatch): New overloaded method for xtl support.
2951 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2952 extern "C" callback instead of static member functions. Hopefully,
2953 JMarc will be able to compile this. I haven't changed
2954 forms/form_copyright.fd yet. Breaking one of my own rules already.
2956 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2957 because they aren't useful from the minibuffer. Maybe a LyXServer
2958 might want a help message though?
2960 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2962 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2963 xtl which needs both rtti and exceptions.
2965 * src/support/Makefile.am:
2966 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2968 * src/frontends/xforms/input_validators.[ch]: input filters and
2969 validators. These conrol what keys are valid in input boxes.
2970 Use them and write some more. Much better idea than waiting till
2971 after the user has pressed Ok to say that the input fields don't make
2974 * src/frontends/xforms/Makefile.am:
2975 * src/frontends/xforms/forms/form_print.fd:
2976 * src/frontends/xforms/forms/makefile:
2977 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2978 new scheme. Still have to make sure I haven't missed anything from
2979 the current implementation.
2981 * src/Makefile.am, src/PrinterParams.h: New data store.
2983 * other files: Added a couple of copyright notices.
2985 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2987 * src/insets/insetbib.h: move Holder struct in public space.
2989 * src/frontends/include/DialogBase.h: use SigC:: only when
2990 SIGC_CXX_NAMESPACES is defined.
2991 * src/frontends/include/Dialogs.h: ditto.
2993 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2995 * src/frontends/xforms/FormCopyright.[Ch]: do not
2996 mention SigC:: explicitely.
2998 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3000 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3001 deals with testing KDE in main configure.in
3002 * configure.in: ditto.
3004 2000-02-22 Allan Rae <rae@lyx.org>
3006 * Lots of files: Merged from HEAD
3008 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3009 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3011 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3013 * sigc++/: new minidist.
3015 2000-02-14 Allan Rae <rae@lyx.org>
3017 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3019 2000-02-08 Juergen Vigna <jug@sad.it>
3021 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3022 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3024 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3025 for this port and so it is much easier for other people to port
3026 dialogs in a common development environment.
3028 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3029 the QT/KDE implementation.
3031 * src/frontends/kde/Dialogs.C:
3032 * src/frontends/kde/FormCopyright.C:
3033 * src/frontends/kde/FormCopyright.h:
3034 * src/frontends/kde/Makefile.am:
3035 * src/frontends/kde/formcopyrightdialog.C:
3036 * src/frontends/kde/formcopyrightdialog.h:
3037 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3038 for the kde support of the Copyright-Dialog.
3040 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3041 subdir-substitution instead of hardcoded 'xforms' as we now have also
3044 * src/frontends/include/DialogBase.h (Object): just commented the
3045 label after #endif (nasty warning and I don't like warnings ;)
3047 * src/main.C (main): added KApplication initialization if using
3050 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3051 For now only the KDE event-loop is added if frontend==kde.
3053 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3055 * configure.in: added support for the --with-frontend[=value] option
3057 * autogen.sh: added kde.m4 file to list of config-files
3059 * acconfig.h: added define for KDEGUI-support
3061 * config/kde.m4: added configuration functions for KDE-port
3063 * config/lyxinclude.m4: added --with-frontend[=value] option with
3064 support for xforms and KDE.
3066 2000-02-08 Allan Rae <rae@lyx.org>
3068 * all Makefile.am: Fixed up so the make targets dist, distclean,
3069 install and uninstall all work even if builddir != srcdir. Still
3070 have a new sigc++ minidist update to come.
3072 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3074 2000-02-01 Allan Rae <rae@lyx.org>
3076 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3077 Many mods to get builddir != srcdir working.
3079 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3080 for building on NT and so we can do the builddir != srcdir stuff.
3082 2000-01-30 Allan Rae <rae@lyx.org>
3084 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3085 This will stay in "rae" branch. We probably don't really need it in
3086 the main trunk as anyone who wants to help programming it should get
3087 a full library installed also. So they can check both included and
3088 system supplied library compilation.
3090 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3091 Added a 'mini' distribution of libsigc++. If you feel the urge to
3092 change something in these directories - Resist it. If you can't
3093 resist the urge then you should modify the following script and rebuild
3094 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3095 all happen. Still uses a hacked version of libsigc++'s configure.in.
3096 I'm quite happy with the results. I'm not sure the extra work to turn
3097 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3098 worth the trouble and would probably lead to extra maintenance
3100 I haven't tested the following important make targets: install, dist.
3101 Not ready for prime time but very close. Maybe 1.1.5.
3103 * development/tools/makeLyXsigc.sh: A shell script to automatically
3104 generate our mini-dist of libsigc++. It can only be used with a CVS
3105 checkout of libsigc++ not a tarball distribution. It's well commented.
3106 This will end up as part of the libsigc++ distribution so other apps
3107 can easily have an included mini-dist. If someone makes mods to the
3108 sigc++ subpackage without modifying this script to generate those
3109 changes I'll be very upset!
3111 * src/frontends/: Started the gui/system indep structure.
3113 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3114 to access the gui-indep dialogs are in this class. Much improved
3115 design compared to previous revision. Lars, please refrain from
3116 moving this header into src/ like you did with Popups.h last time.
3118 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3120 * src/frontends/xforms/: Started the gui-indep system with a single
3121 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3124 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3125 Here you'll find a very useful makefile and automated fdfix.sh that
3126 makes updating dailogs a no-brainer -- provided you follow the rules
3127 set out in the README. I'm thinking about adding another script to
3128 automatically generate skeleton code for a new dialog given just the
3131 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3132 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3133 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3135 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3137 * src/support/LSubstring.C (operator): simplify
3139 * src/lyxtext.h: removed bparams, use buffer_->params instead
3141 * src/lyxrow.h: make Row a real class, move all variables to
3142 private and use accessors.
3144 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3146 (isRightToLeftPar): ditto
3147 (ChangeLanguage): ditto
3148 (isMultiLingual): ditto
3151 (SimpleTeXOnePar): ditto
3152 (TeXEnvironment): ditto
3153 (GetEndLabel): ditto
3155 (SetOnlyLayout): ditto
3156 (BreakParagraph): ditto
3157 (BreakParagraphConservative): ditto
3158 (GetFontSettings): ditto
3160 (CopyIntoMinibuffer): ditto
3161 (CutIntoMinibuffer): ditto
3162 (PasteParagraph): ditto
3163 (SetPExtraType): ditto
3164 (UnsetPExtraType): ditto
3165 (DocBookContTableRows): ditto
3166 (SimpleDocBookOneTablePar): ditto
3168 (TeXFootnote): ditto
3169 (SimpleTeXOneTablePar): ditto
3170 (TeXContTableRows): ditto
3171 (SimpleTeXSpecialChars): ditto
3174 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3175 to private and use accessors.
3177 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3178 this, we did not use it anymore and has not been for ages. Just a
3179 waste of cpu cycles.
3181 * src/language.h: make Language a real class, move all variables
3182 to private and use accessors.
3184 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3185 (create_view): remove
3186 (update): some changes for new timer
3187 (cursorToggle): use new timer
3188 (beforeChange): change for new timer
3190 * src/BufferView.h (cursorToggleCB): removed last paramter because
3193 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3194 (cursorToggleCB): change because of new timer code
3196 * lib/CREDITS: updated own mailaddress
3198 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3200 * src/support/filetools.C (PutEnv): fix the code in case neither
3201 putenv() nor setenv() have been found.
3203 * INSTALL: mention the install-strip Makefile target.
3205 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3206 read-only documents.
3208 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3210 * lib/reLyX/configure.in (VERSION): avoid using a previously
3211 generated reLyX wrapper to find out $prefix.
3213 * lib/examples/eu_adibide_lyx-atua.lyx:
3214 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3215 translation of the Tutorial (Dooteo)
3217 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3219 * forms/cite.fd: new citation dialog
3221 * src/insetcite.[Ch]: the new citation dialog is moved into
3224 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3227 * src/insets/insetcommand.h: data members made private.
3229 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3231 * LyX 1.1.5 released
3233 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3235 * src/version.h (LYX_RELEASE): to 1.1.5
3237 * src/spellchecker.C (RunSpellChecker): return false if the
3238 spellchecker dies upon creation.
3240 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3242 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3243 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3247 * lib/CREDITS: update entry for Martin Vermeer.
3249 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3251 * src/text.C (draw): Draw foreign language bars at the bottom of
3252 the row instead of at the baseline.
3254 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3256 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3258 * lib/bind/de_menus.bind: updated
3260 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3262 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3264 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3266 * src/menus.C (Limit_string_length): New function
3267 (ShowTocMenu): Limit the number of items/length of items in the
3270 * src/paragraph.C (String): Correct result for a paragraph inside
3273 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3275 * src/bufferlist.C (close): test of buf->getuser() == NULL
3277 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3279 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3280 Do not call to SetCursor when the paragraph is a closed footnote!
3282 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3284 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3287 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3289 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3292 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3293 reference popup, that activates the reference-back action
3295 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3297 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3298 the menus. Also fixed a bug.
3300 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3301 the math panels when switching buffers (unless new buffer is readonly).
3303 * src/BufferView.C (NoSavedPositions)
3304 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3306 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3308 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3309 less of dvi dirty or not.
3311 * src/trans_mgr.[Ch] (insert): change first parameter to string
3314 * src/chset.[Ch] (encodeString): add const to first parameter
3316 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3318 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3322 * src/LaTeX.C (deplog): better searching for dependency files in
3323 the latex log. Uses now regexps.
3325 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3326 instead of the box hack or \hfill.
3328 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3330 * src/lyxfunc.C (doImportHelper): do not create the file before
3331 doing the actual import.
3332 (doImportASCIIasLines): create a new file before doing the insert.
3333 (doImportASCIIasParagraphs): ditto.
3335 * lib/lyxrc.example: remove mention of non-existing commands
3337 * lyx.man: remove mention of color-related switches.
3339 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3341 * src/lyx_gui.C: remove all the color-related ressources, which
3342 are not used anymore.
3344 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3347 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3349 * src/lyxrc.C (read): Add a missing break in the switch
3351 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3353 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3355 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3358 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3360 * src/text.C (draw): draw bars under foreign language words.
3362 * src/LColor.[Ch]: add LColor::language
3364 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3366 * src/lyxcursor.h (boundary): New member variable
3368 * src/text.C (IsBoundary): New methods
3370 * src/text.C: Use the above for currect cursor movement when there
3371 is both RTL & LTR text.
3373 * src/text2.C: ditto
3375 * src/bufferview_funcs.C (ToggleAndShow): ditto
3377 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3379 * src/text.C (DeleteLineForward): set selection to true to avoid
3380 that DeleteEmptyParagraphMechanism does some magic. This is how it
3381 is done in all other functions, and seems reasonable.
3382 (DeleteWordForward): do not jump over non-word stuff, since
3383 CursorRightOneWord() already does it.
3385 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3386 DeleteWordBackward, since they seem safe to me (since selection is
3387 set to "true") DeleteEmptyParagraphMechanism does nothing.
3389 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3391 * src/lyx_main.C (easyParse): simplify the code by factoring the
3392 part that removes parameters from the command line.
3393 (LyX): check wether wrong command line options have been given.
3395 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3397 * src/lyx_main.C : add support for specifying user LyX
3398 directory via command line option -userdir.
3400 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3402 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3403 the number of items per popup.
3404 (Add_to_refs_menu): Ditto.
3406 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3408 * src/lyxparagraph.h: renamed ClearParagraph() to
3409 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3410 textclass as parameter, and do nothing if free_spacing is
3411 true. This fixes part of the line-delete-forward problems.
3413 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3414 (pasteSelection): ditto.
3415 (SwitchLayoutsBetweenClasses): more translatable strings.
3417 * src/text2.C (CutSelection): use StripLeadingSpaces.
3418 (PasteSelection): ditto.
3419 (DeleteEmptyParagraphMechanism): ditto.
3421 2000-05-26 Juergen Vigna <jug@sad.it>
3423 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3424 is not needed in tabular insets.
3426 * src/insets/insettabular.C (TabularFeatures): added missing features.
3428 * src/tabular.C (DeleteColumn):
3430 (AppendRow): implemented this functions
3431 (cellsturct::operator=): clone the inset too;
3433 2000-05-23 Juergen Vigna <jug@sad.it>
3435 * src/insets/insettabular.C (LocalDispatch): better selection support
3436 when having multicolumn-cells.
3438 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3440 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3442 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3444 * src/ColorHandler.C (getGCForeground): put more test into _()
3446 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3449 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3452 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3454 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3455 there are no labels, or when buffer is readonly.
3457 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3458 there are no labels, buffer is SGML, or when buffer is readonly.
3460 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3462 * src/LColor.C (LColor): change a couple of grey40 to grey60
3463 (LColor): rewore initalization to make compiles go some magnitude
3465 (getGUIName): don't use gettext until we need the string.
3467 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3469 * src/Bullet.[Ch]: Fixed a small bug.
3471 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3473 * src/paragraph.C (String): Several fixes/improvements
3475 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3477 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3479 * src/paragraph.C (String): give more correct output.
3481 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3483 * src/lyxfont.C (stateText) Do not output the language if it is
3484 eqaul to the language of the document.
3486 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3487 between two paragraphs with the same language.
3489 * src/paragraph.C (getParLanguage) Return a correct answer for an
3490 empty dummy paragraph.
3492 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3495 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3498 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3499 the menus/popup, if requested fonts are unavailable.
3501 2000-05-22 Juergen Vigna <jug@sad.it>
3503 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3504 movement support (Up/Down/Tab/Shift-Tab).
3505 (LocalDispatch): added also preliminari cursor-selection.
3507 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3509 * src/paragraph.C (PasteParagraph): Hopefully now right!
3511 2000-05-22 Garst R. Reese <reese@isn.net>
3513 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3514 of list, change all references to Environment to Command
3515 * tex/hollywood.cls : rewrite environments as commands, add
3516 \uppercase to interiorshot and exteriorshot to force uppecase.
3517 * tex/broadway.cls : rewrite environments as commands. Tweak
3520 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3522 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3523 size of items: use a constant intead of the hardcoded 40, and more
3524 importantly do not remove the %m and %x tags added at the end.
3525 (Add_to_refs_menu): use vector::size_type instead of
3526 unsigned int as basic types for the variables. _Please_ do not
3527 assume that size_t is equal to unsigned int. On an alpha, this is
3528 unsigned long, which is _not_ the same.
3530 * src/language.C (initL): remove language "hungarian", since it
3531 seems that "magyar" is better.
3533 2000-05-22 Juergen Vigna <jug@sad.it>
3535 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3537 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3540 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3541 next was deleted but not set to 0.
3543 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3545 * src/language.C (initL): change the initialization of languages
3546 so that compiles goes _fast_.
3548 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3551 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3553 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3557 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3559 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3561 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3565 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3568 * src/insets/insetlo*.[Ch]: Made editable
3570 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3572 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3573 the current selection.
3575 * src/BufferView_pimpl.C (stuffClipboard): new method
3577 * src/BufferView.C (stuffClipboard): new method
3579 * src/paragraph.C (String): new method
3581 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3582 LColor::ignore when lyxname is not found.
3584 * src/BufferView.C (pasteSelection): new method
3586 * src/BufferView_pimpl.C (pasteSelection): new method
3588 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3590 * src/WorkArea.C (request_clipboard_cb): new static function
3591 (getClipboard): new method
3592 (putClipboard): new method
3594 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3596 * LyX 1.1.5pre2 released
3598 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3600 * src/vspace.C (operator=): removed
3601 (operator=): removed
3603 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3605 * src/layout.C (NumberOfClass): manually set the type in make_pair
3606 (NumberOfLayout): ditto
3608 * src/language.C: use the Language constructor for ignore_lang
3610 * src/language.h: add constructors to struct Language
3612 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3614 * src/text2.C (SetCursorIntern): comment out #warning
3616 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3618 * src/mathed/math_iter.h: initialize sx and sw to 0
3620 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3622 * forms/lyx.fd: Redesign of form_ref
3624 * src/LaTeXFeatures.[Ch]
3628 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3631 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3632 and Buffer::inset_iterator.
3634 * src/menus.C: Added new menus: TOC and Refs.
3636 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3638 * src/buffer.C (getTocList): New method.
3640 * src/BufferView2.C (ChangeRefs): New method.
3642 * src/buffer.C (getLabelList): New method. It replaces the old
3643 getReferenceList. The return type is vector<string> instead of
3646 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3647 the old getLabel() and GetNumberOfLabels() methods.
3648 * src/insets/insetlabel.C (getLabelList): ditto
3649 * src/mathed/formula.C (getLabelList): ditto
3651 * src/paragraph.C (String): New method.
3653 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3654 Uses the new getTocList() method.
3655 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3656 which automatically updates the contents of the browser.
3657 (RefUpdateCB): Use the new getLabelList method.
3659 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3661 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3663 * src/spellchecker.C: Added using std::reverse;
3665 2000-05-19 Juergen Vigna <jug@sad.it>
3667 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3669 * src/insets/insettext.C (computeTextRows): small fix for display of
3670 1 character after a newline.
3672 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3675 2000-05-18 Juergen Vigna <jug@sad.it>
3677 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3678 when changing width of column.
3680 * src/tabular.C (set_row_column_number_info): setting of
3681 autobreak rows if necessary.
3683 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3685 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3687 * src/vc-backend.*: renamed stat() to status() and vcstat to
3688 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3689 compilation broke. The new name seems more relevant, anyway.
3691 2000-05-17 Juergen Vigna <jug@sad.it>
3693 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3694 which was wrong if the removing caused removing of rows!
3696 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3697 (pushToken): new function.
3699 * src/text2.C (CutSelection): fix problem discovered with purify
3701 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3703 * src/debug.C (showTags): enlarge the first column, now that we
3704 have 6-digits debug codes.
3706 * lib/layouts/hollywood.layout:
3707 * lib/tex/hollywood.cls:
3708 * lib/tex/brodway.cls:
3709 * lib/layouts/brodway.layout: more commands and fewer
3710 environments. Preambles moved in the .cls files. Broadway now has
3711 more options on scene numbering and less whitespace (from Garst)
3713 * src/insets/insetbib.C (getKeys): make sure that we are in the
3714 document directory, in case the bib file is there.
3716 * src/insets/insetbib.C (Latex): revert bogus change.
3718 2000-05-16 Juergen Vigna <jug@sad.it>
3720 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3721 the TabularLayout on cursor move.
3723 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3725 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3728 (draw): fixed cursor position and drawing so that the cursor is
3729 visible when before the tabular-inset.
3731 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3732 when creating from old insettext.
3734 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3736 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3738 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3739 * lib/tex/brodway.cls: ditto
3741 * lib/layouts/brodway.layout: change alignment of parenthical
3744 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3746 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3747 versions 0.88 and 0.89 are supported.
3749 2000-05-15 Juergen Vigna <jug@sad.it>
3751 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3754 * src/insets/insettext.C (computeTextRows): redone completely this
3755 function in a much cleaner way, because of problems when having a
3757 (draw): added a frame border when the inset is locked.
3758 (SetDrawLockedFrame): this sets if we draw the border or not.
3759 (SetFrameColor): this sets the frame color (default=insetframe).
3761 * src/insets/lyxinset.h: added x() and y() functions which return
3762 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3763 function which is needed to see if we have a locking inset of some
3764 type in this inset (needed for now in insettabular).
3766 * src/vspace.C (inPixels): the same function also without a BufferView
3767 parameter as so it is easier to use it in some ocasions.
3769 * src/lyxfunc.C: changed all places where insertInset was used so
3770 that now if it couldn't be inserted it is deleted!
3772 * src/TabularLayout.C:
3773 * src/TableLayout.C: added support for new tabular-inset!
3775 * src/BufferView2.C (insertInset): this now returns a bool if the
3776 inset was really inserted!!!
3778 * src/tabular.C (GetLastCellInRow):
3779 (GetFirstCellInRow): new helper functions.
3780 (Latex): implemented for new tabular class.
3784 (TeXTopHLine): new Latex() helper functions.
3786 2000-05-12 Juergen Vigna <jug@sad.it>
3788 * src/mathed/formulamacro.C (Read):
3789 * src/mathed/formula.C (Read): read also the \end_inset here!
3791 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3793 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3794 crush when saving formulae with unbalanced parenthesis.
3796 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3798 * src/layout.C: Add new keyword "endlabelstring" to layout file
3800 * src/text.C (GetVisibleRow): Draw endlabel string.
3802 * lib/layouts/broadway.layout
3803 * lib/layouts/hollywood.layout: Added endlabel for the
3804 Parenthetical layout.
3806 * lib/layouts/heb-article.layout: Do not use slanted font shape
3807 for Theorem like environments.
3809 * src/buffer.C (makeLaTeXFile): Always add "american" to
3810 the UsedLanguages list if document language is RTL.
3812 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3814 * add addendum to README.OS2 and small patch (from SMiyata)
3816 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3818 * many files: correct the calls to ChangeExtension().
3820 * src/support/filetools.C (ChangeExtension): remove the no_path
3821 argument, which does not belong there. Use OnlyFileName() instead.
3823 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3824 files when LaTeXing a non-nice latex file.
3826 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3827 a chain of "if". Return false when deadkeys are not handled.
3829 * src/lyx_main.C (LyX): adapted the code for default bindings.
3831 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3832 bindings for basic functionality (except deadkeys).
3833 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3835 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3836 several methods: handle override_x_deadkeys.
3838 * src/lyxrc.h: remove the "bindings" map, which did not make much
3839 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3841 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3843 * src/lyxfont.C (stateText): use a saner method to determine
3844 whether the font is "default". Seems to fix the crash with DEC
3847 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3849 2000-05-08 Juergen Vigna <jug@sad.it>
3851 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3852 TabularLayoutMenu with mouse-button-3
3853 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3855 * src/TabularLayout.C: added this file for having a Layout for
3858 2000-05-05 Juergen Vigna <jug@sad.it>
3860 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3861 recalculating inset-widths.
3862 (TabularFeatures): activated this function so that I can change
3863 tabular-features via menu.
3865 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3866 that I can test some functions with the Table menu.
3868 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3870 * src/lyxfont.C (stateText): guard against stupid c++libs.
3872 * src/tabular.C: add using std::vector
3873 some whitespace changes, + removed som autogenerated code.
3875 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3877 2000-05-05 Juergen Vigna <jug@sad.it>
3879 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3880 row, columns and cellstructures.
3882 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3884 * lib/lyxrc.example: remove obsolete entries.
3886 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3887 reading of protected_separator for free_spacing.
3889 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3891 * src/text.C (draw): do not display an exclamation mark in the
3892 margin for margin notes. This is confusing, ugly and
3895 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3896 AMS math' is checked.
3898 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3899 name to see whether including the amsmath package is needed.
3901 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3903 * src/paragraph.C (validate): Compute UsedLanguages correctly
3904 (don't insert the american language if it doesn't appear in the
3907 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3908 The argument of \thanks{} command is considered moving argument
3910 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3913 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3915 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3916 for appendix/minipage/depth. The lines can be now both in the footnote
3917 frame, and outside the frame.
3919 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3922 2000-05-05 Juergen Vigna <jug@sad.it>
3924 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3925 neede only in tabular.[Ch].
3927 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3929 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3931 (Write): write '~' for PROTECTED_SEPARATOR
3933 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3935 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3938 * src/mathed/formula.C (drawStr): rename size to siz.
3940 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3941 possibly fix a bug by not changing the pflags = flags to piflags =
3944 2000-05-05 Juergen Vigna <jug@sad.it>
3946 * src/insets/insetbib.C: moved using directive
3948 * src/ImportNoweb.C: small fix for being able to compile (missing
3951 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3953 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3954 to use clear, since we don't depend on this in the code. Add test
3957 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3959 * (various *.C files): add using std::foo directives to please dec
3962 * replace calls to string::clear() to string::erase() (Angus)
3964 * src/cheaders/cmath: modified to provide std::abs.
3966 2000-05-04 Juergen Vigna <jug@sad.it>
3968 * src/insets/insettext.C: Prepared all for inserting of multiple
3969 paragraphs. Still display stuff to do (alignment and other things),
3970 but I would like to use LyXText to do this when we cleaned out the
3971 table-support stuff.
3973 * src/insets/insettabular.C: Changed lot of stuff and added lots
3974 of functionality still a lot to do.
3976 * src/tabular.C: Various functions changed name and moved to be
3977 const functions. Added new Read and Write functions and changed
3978 lots of things so it works good with tabular-insets (also removed
3979 some stuff which is not needed anymore * hacks *).
3981 * src/lyxcursor.h: added operators == and != which just look if
3982 par and pos are (not) equal.
3984 * src/buffer.C (latexParagraphs): inserted this function to latex
3985 all paragraphs form par to endpar as then I can use this too for
3988 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3989 so that I can call this to from text insets with their own cursor.
3991 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3992 output off all paragraphs (because of the fix below)!
3994 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3995 the very last paragraph (this could be also the last paragraph of an
3998 * src/texrow.h: added rows() call which returns the count-variable.
4000 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4002 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4004 * lib/configure.m4: better autodetection of DocBook tools.
4006 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4008 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4010 * src/lyx_cb.C: add using std::reverse;
4012 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4015 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4016 selected files. Should fix repeated errors from generated files.
4018 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4020 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4022 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4023 the spellchecker popup.
4025 * lib/lyxrc.example: Removed the \number_inset section
4027 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4029 * src/insets/figinset.C (various): Use IsFileReadable() to make
4030 sure that the file actually exist. Relying on ghostscripts errors
4031 is a bad idea since they can lead to X server crashes.
4033 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4035 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4038 * lib/lyxrc.example: smallish typo in description of
4039 \view_dvi_paper_option
4041 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4044 * src/lyxfunc.C: doImportHelper to factor out common code of the
4045 various import methods. New functions doImportASCIIasLines,
4046 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4047 doImportLinuxDoc for the format specific parts.
4050 * buffer.C: Dispatch returns now a bool to indicate success
4053 * lyx_gui.C: Add getLyXView() for member access
4055 * lyx_main.C: Change logic for batch commands: First try
4056 Buffer::Dispatch (possibly without GUI), if that fails, use
4059 * lyx_main.C: Add support for --import command line switch.
4060 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4061 Available Formats: Everything accepted by 'buffer-import <format>'
4063 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4065 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4068 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4069 documents will be reformatted upon reentry.
4071 2000-04-27 Juergen Vigna <jug@sad.it>
4073 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4074 correctly only last pos this was a bug.
4076 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4078 * release of lyx-1.1.5pre1
4080 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4082 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4084 * src/menus.C: revert the change of naming (Figure->Graphic...)
4085 from 2000-04-11. It was incomplete and bad.
4087 * src/LColor.[Ch]: add LColor::depthbar.
4088 * src/text.C (GetVisibleRow): use it.
4090 * README: update the languages list.
4092 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4094 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4097 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4099 * README: remove sections that were just wrong.
4101 * src/text2.C (GetRowNearY): remove currentrow code
4103 * src/text.C (GetRow): remove currentrow code
4105 * src/screen.C (Update): rewritten a bit.
4106 (SmallUpdate): removed func
4108 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4110 (FullRebreak): return bool
4111 (currentrow): remove var
4112 (currentrow_y): ditto
4114 * src/lyxscreen.h (Draw): change arg to unsigned long
4115 (FitCursor): return bool
4116 (FitManualCursor): ditto
4117 (Smallpdate): remove func
4118 (first): change to unsigned long
4119 (DrawOneRow): change second arg to long (from long &)
4120 (screen_refresh_y): remove var
4121 (scree_refresh_row): ditto
4123 * src/lyxrow.h: change baseline to usigned int from unsigned
4124 short, this brings some implicit/unsigned issues out in the open.
4126 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4128 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4129 instead of smallUpdate.
4131 * src/lyxcursor.h: change y to unsigned long
4133 * src/buffer.h: don't call updateScrollbar after fitcursor
4135 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4136 where they are used. Removed "\\direction", this was not present
4137 in 1.1.4 and is already obsolete. Commented out some code that I
4138 believe to never be called.
4139 (runLiterate): don't call updateScrollbar after fitCursor
4141 (buildProgram): ditto
4144 * src/WorkArea.h (workWidth): change return val to unsigned
4147 (redraw): remove the button redraws
4148 (setScrollbarValue): change for scrollbar
4149 (getScrollbarValue): change for scrollbar
4150 (getScrollbarBounds): change for scrollbar
4152 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4153 (C_WorkArea_down_cb): removed func
4154 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4155 (resize): change for scrollbar
4156 (setScrollbar): ditto
4157 (setScrollbarBounds): ditto
4158 (setScrollbarIncrements): ditto
4159 (up_cb): removed func
4160 (down_cb): removed func
4161 (scroll_cb): change for scrollbar
4162 (work_area_handler): ditto
4164 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4165 when FitCursor did something.
4166 (updateScrollbar): some unsigned changes
4167 (downCB): removed func
4168 (scrollUpOnePage): removed func
4169 (scrollDownOnePage): remvoed func
4170 (workAreaMotionNotify): don't call screen->FitCursor but use
4171 fitCursor instead. and bool return val
4172 (workAreaButtonPress): ditto
4173 (workAreaButtonRelease): some unsigned changes
4174 (checkInsetHit): ditto
4175 (workAreaExpose): ditto
4176 (update): parts rewritten, comments about the signed char arg added
4177 (smallUpdate): removed func
4178 (cursorPrevious): call needed updateScrollbar
4181 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4184 * src/BufferView.[Ch] (upCB): removed func
4185 (downCB): removed func
4186 (smallUpdate): removed func
4188 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4190 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4191 currentrow, currentrow_y optimization. This did not help a lot and
4192 if we want to do this kind of optimization we should rather use
4193 cursor.row instead of the currentrow.
4195 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4196 buffer spacing and klyx spacing support.
4198 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4200 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4203 2000-04-26 Juergen Vigna <jug@sad.it>
4205 * src/insets/figinset.C: fixes to Lars sstream changes!
4207 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4209 * A lot of files: Added Ascii(ostream &) methods to all inset
4210 classes. Used when exporting to ASCII.
4212 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4213 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4216 * src/text2.C (ToggleFree): Disabled implicit word selection when
4217 there is a change in the language
4219 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4220 no output was generated for end-of-sentence inset.
4222 * src/insets/lyxinset.h
4225 * src/paragraph.C: Removed the insetnumber code
4227 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4229 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4231 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4232 no_babel and no_epsfig completely from the file.
4233 (parseSingleLyXformat2Token): add handling for per-paragraph
4234 spacing as written by klyx.
4236 * src/insets/figinset.C: applied patch by Andre. Made it work with
4239 2000-04-20 Juergen Vigna <jug@sad.it>
4241 * src/insets/insettext.C (cutSelection):
4242 (copySelection): Fixed with selection from right to left.
4243 (draw): now the rows are not recalculated at every draw.
4244 (computeTextRows): for now reset the inset-owner here (this is
4245 important for an undo or copy where the inset-owner is not set
4248 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4249 motion to the_locking_inset screen->first was forgotten, this was
4250 not important till we got multiline insets.
4252 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4254 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4255 code seems to be alright (it is code changed by Dekel, and the
4256 intent is indeed that all macros should be defined \protect'ed)
4258 * NEWS: a bit of reorganisation of the new user-visible features.
4260 2000-04-19 Juergen Vigna <jug@sad.it>
4262 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4263 position. Set the inset_owner of the used paragraph so that it knows
4264 that it is inside an inset. Fixed cursor handling with mouse and
4265 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4266 and cleanups to make TextInsets work better.
4268 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4269 Changed parameters of various functions and added LockInsetInInset().
4271 * src/insets/insettext.C:
4273 * src/insets/insetcollapsable.h:
4274 * src/insets/insetcollapsable.C:
4275 * src/insets/insetfoot.h:
4276 * src/insets/insetfoot.C:
4277 * src/insets/insetert.h:
4278 * src/insets/insetert.C: cleaned up the code so that it works now
4279 correctly with insettext.
4281 * src/insets/inset.C:
4282 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4283 that insets in insets are supported right.
4286 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4288 * src/paragraph.C: some small fixes
4290 * src/debug.h: inserted INSETS debug info
4292 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4293 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4295 * src/commandtags.h:
4296 * src/LyXAction.C: insert code for InsetTabular.
4298 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4299 not Button1MotionMask.
4300 (workAreaButtonRelease): send always a InsetButtonRelease event to
4302 (checkInsetHit): some setCursor fixes (always with insets).
4304 * src/BufferView2.C (lockInset): returns a bool now and extended for
4305 locking insets inside insets.
4306 (showLockedInsetCursor): it is important to have the cursor always
4307 before the locked inset.
4308 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4310 * src/BufferView.h: made lockInset return a bool.
4312 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4314 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4315 that is used also internally but can be called as public to have back
4316 a cursor pos which is not set internally.
4317 (SetCursorIntern): Changed to use above function.
4319 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4321 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4326 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4327 patches for things that should be in or should be changed.
4329 * src/* [insetfiles]: change "usigned char fragile" to bool
4330 fragile. There was only one point that could that be questioned
4331 and that is commented in formulamacro.C. Grep for "CHECK".
4333 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4334 (DeleteBuffer): take it out of CutAndPaste and make it static.
4336 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4338 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4339 output the spacing envir commands. Also the new commands used in
4340 the LaTeX output makes the result better.
4342 * src/Spacing.C (writeEnvirBegin): new method
4343 (writeEnvirEnd): new method
4345 2000-04-18 Juergen Vigna <jug@sad.it>
4347 * src/CutAndPaste.C: made textclass a static member of the class
4348 as otherwise it is not accesed right!!!
4350 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4352 * forms/layout_forms.fd
4353 * src/layout_forms.h
4354 * src/layout_forms.C (create_form_form_character)
4355 * src/lyx_cb.C (UserFreeFont)
4356 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4357 documents (in the layout->character popup).
4359 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4361 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4362 \spell_command was in fact not honored (from Kevin Atkinson).
4364 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4367 * src/lyx_gui.h: make lyxViews private (Angus)
4369 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4371 * src/mathed/math_write.C
4372 (MathMatrixInset::Write) Put \protect before \begin{array} and
4373 \end{array} if fragile
4374 (MathParInset::Write): Put \protect before \\ if fragile
4376 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4378 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4379 initialization if the LyXColorHandler must be done after the
4380 connections to the XServer has been established.
4382 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4383 get the background pixel from the lyxColorhandler so that the
4384 figures are rendered with the correct background color.
4385 (NextToken): removed functions.
4386 (GetPSSizes): use ifs >> string instead of NextToken.
4388 * src/Painter.[Ch]: the color cache moved out of this file.
4390 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4393 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4395 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4396 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4398 * src/BufferView.C (enterView): new func
4399 (leaveView): new func
4401 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4403 (leaveView): new func, undefines xterm cursor when approp.
4405 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4406 (AllowInput): delete the Workarea cursor handling from this func.
4408 * src/Painter.C (underline): draw a slimer underline in most cases.
4410 * src/lyx_main.C (error_handler): use extern "C"
4412 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4414 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4415 sent directly to me.
4417 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4418 to the list by Dekel.
4420 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4423 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4424 methods from lyx_cb.here.
4426 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4429 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4431 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4432 instead of using current_view directly.
4434 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4436 * src/LyXAction.C (init): add the paragraph-spacing command.
4438 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4440 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4442 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4443 different from the documents.
4445 * src/text.C (SetHeightOfRow): take paragraph spacing into
4446 account, paragraph spacing takes precedence over buffer spacing
4447 (GetVisibleRow): ditto
4449 * src/paragraph.C (writeFile): output the spacing parameter too.
4450 (validate): set the correct features if spacing is used in the
4452 (Clear): set spacing to default
4453 (MakeSameLayout): spacing too
4454 (HasSameLayout): spacing too
4455 (SetLayout): spacing too
4456 (TeXOnePar): output the spacing commands
4458 * src/lyxparagraph.h: added a spacing variable for use with
4459 per-paragraph spacing.
4461 * src/Spacing.h: add a Default spacing and a method to check if
4462 the current spacing is default. also added an operator==
4464 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4467 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4469 * src/lyxserver.C (callback): fix dispatch of functions
4471 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4472 printf() into lyxerr call.
4474 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4477 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4478 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4479 the "Float" from each of the subitems.
4480 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4482 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4483 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4484 documented the change so that the workaround can be nuked later.
4486 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4489 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4491 * src/buffer.C (getLatexName): ditto
4492 (setReadonly): ditto
4494 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4496 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4497 avoid some uses of current_view. Added also a bufferParams()
4498 method to get at this.
4500 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4502 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4504 * src/lyxparagraph.[Ch]: removed
4505 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4506 with operators used by lower_bound and
4507 upper_bound in InsetTable's
4508 Make struct InsetTable private again. Used matchpos.
4510 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4512 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4513 document, the language of existing text is changed (unless the
4514 document is multi-lingual)
4516 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4518 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4520 * A lot of files: A rewrite of the Right-to-Left support.
4522 2000-04-10 Juergen Vigna <jug@sad.it>
4524 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4525 misplaced cursor when inset in inset is locked.
4527 * src/insets/insettext.C (LocalDispatch): small fix so that a
4528 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4530 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4531 footnote font should be decreased in size twice when displaying.
4533 * src/insets/insettext.C (GetDrawFont): inserted this function as
4534 the drawing-font may differ from the real paragraph font.
4536 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4537 insets (inset in inset!).
4539 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4540 function here because we don't want footnotes inside footnotes.
4542 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4544 (init): now set the inset_owner in paragraph.C
4545 (LocalDispatch): added some resetPos() in the right position
4548 (pasteSelection): changed to use the new CutAndPaste-Class.
4550 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4551 which tells if it is allowed to insert another inset inside this one.
4553 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4554 SwitchLayoutsBetweenClasses.
4556 * src/text2.C (InsertInset): checking of the new paragraph-function
4558 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4559 is not needed anymore here!
4562 (PasteSelection): redone (also with #ifdef) so that now this uses
4563 the CutAndPaste-Class.
4564 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4567 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4568 from/to text/insets.
4570 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4571 so that the paragraph knows if it is inside an (text)-inset.
4572 (InsertFromMinibuffer): changed return-value to bool as now it
4573 may happen that an inset is not inserted in the paragraph.
4574 (InsertInsetAllowed): this checks if it is allowed to insert an
4575 inset in this paragraph.
4577 (BreakParagraphConservative):
4578 (BreakParagraph) : small change for the above change of the return
4579 value of InsertFromMinibuffer.
4581 * src/lyxparagraph.h: added inset_owner and the functions to handle
4582 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4584 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4586 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4587 functions from BufferView to BufferView::Pimpl to ease maintence.
4589 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4590 correctly. Also use SetCursorIntern instead of SetCursor.
4592 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4595 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4597 * src/WorkArea.C (belowMouse): manually implement below mouse.
4599 * src/*: Add "explicit" on several constructors, I added probably
4600 some unneeded ones. A couple of changes to code because of this.
4602 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4603 implementation and private parts from the users of BufferView. Not
4606 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4607 implementation and private parts from the users of LyXLex. Not
4610 * src/BufferView_pimpl.[Ch]: new files
4612 * src/lyxlex_pimpl.[Ch]: new files
4614 * src/LyXView.[Ch]: some inline functions move out-of-line
4616 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4618 * src/lyxparagraph.h: make struct InsetTable public.
4620 * src/support/lyxstring.h: change lyxstring::difference_type to be
4621 ptrdiff_t. Add std:: modifiers to streams.
4623 * src/font.C: include the <cctype> header, for islower() and
4626 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4628 * src/font.[Ch]: new files. Contains the metric functions for
4629 fonts, takes a LyXFont as parameter. Better separation of concepts.
4631 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4632 changes because of this.
4634 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4636 * src/*: compile with -Winline and move functions that don't
4639 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4642 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4644 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4645 (various files changed because of this)
4647 * src/Painter.C (text): fixed the drawing of smallcaps.
4649 * src/lyxfont.[Ch] (drawText): removed unused member func.
4652 * src/*.C: added needed "using" statements and "std::" qualifiers.
4654 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4656 * src/*.h: removed all use of "using" from header files use
4657 qualifier std:: instead.
4659 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4661 * src/text.C (Backspace): some additional cleanups (we already
4662 know whether cursor.pos is 0 or not).
4664 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4665 automake does not provide one).
4667 * src/bmtable.h: replace C++ comments with C comments.
4669 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4671 * src/screen.C (ShowCursor): Change the shape of the cursor if
4672 the current language is not equal to the language of the document.
4673 (If the cursor change its shape unexpectedly, then you've found a bug)
4675 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4678 * src/insets/insetnumber.[Ch]: New files.
4680 * src/LyXAction.C (init)
4681 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4684 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4686 * src/lyxparagraph.h
4687 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4688 (the vector is kept sorted).
4690 * src/text.C (GetVisibleRow): Draw selection correctly when there
4691 is both LTR and RTL text.
4693 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4694 which is much faster.
4696 * src/text.C (GetVisibleRow and other): Do not draw the last space
4697 in a row if the direction of the last letter is not equal to the
4698 direction of the paragraph.
4700 * src/lyxfont.C (latexWriteStartChanges):
4701 Check that font language is not equal to basefont language.
4702 (latexWriteEndChanges): ditto
4704 * src/lyx_cb.C (StyleReset): Don't change the language while using
4705 the font-default command.
4707 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4708 empty paragraph before a footnote.
4710 * src/insets/insetcommand.C (draw): Increase x correctly.
4712 * src/screen.C (ShowCursor): Change cursor shape if
4713 current language != document language.
4715 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4717 2000-03-31 Juergen Vigna <jug@sad.it>
4719 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4720 (Clone): changed mode how the paragraph-data is copied to the
4721 new clone-paragraph.
4723 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4724 GetInset(pos) with no inset anymore there (in inset UNDO)
4726 * src/insets/insetcommand.C (draw): small fix as here x is
4727 incremented not as much as width() returns (2 before, 2 behind = 4)
4729 2000-03-30 Juergen Vigna <jug@sad.it>
4731 * src/insets/insettext.C (InsetText): small fix in initialize
4732 widthOffset (should not be done in the init() function)
4734 2000-03-29 Amir Karger <karger@lyx.org>
4736 * lib/examples/it_ItemizeBullets.lyx: translation by
4739 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4741 2000-03-29 Juergen Vigna <jug@sad.it>
4743 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4745 * src/insets/insetfoot.C (Clone): small change as for the below
4746 new init function in the text-inset
4748 * src/insets/insettext.C (init): new function as I've seen that
4749 clone did not copy the Paragraph-Data!
4750 (LocalDispatch): Added code so that now we have some sort of Undo
4751 functionality (well actually we HAVE Undo ;)
4753 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4755 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4757 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4760 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4762 * src/main.C: added a runtime check that verifies that the xforms
4763 header used when building LyX and the library used when running
4764 LyX match. Exit with a message if they don't match. This is a
4765 version number check only.
4767 * src/buffer.C (save): Don't allocate memory on the heap for
4768 struct utimbuf times.
4770 * *: some using changes, use iosfwd instead of the real headers.
4772 * src/lyxfont.C use char const * instead of string for the static
4773 strings. Rewrite some functions to use sstream.
4775 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4777 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4780 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4782 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4783 of Geodesy (from Martin Vermeer)
4785 * lib/layouts/svjour.inc: include file for the Springer svjour
4786 class. It can be used to support journals other than JoG.
4788 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4789 Miskiewicz <misiek@pld.org.pl>)
4790 * lib/reLyX/Makefile.am: ditto.
4792 2000-03-27 Juergen Vigna <jug@sad.it>
4794 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4795 also some modifications with operations on selected text.
4797 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4798 problems with clicking on insets (last famous words ;)
4800 * src/insets/insetcommand.C (draw):
4801 (width): Changed to have a bit of space before and after the inset so
4802 that the blinking cursor can be seen (otherwise it was hidden)
4804 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4806 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4807 would not be added to the link list when an installed gettext (not
4808 part of libc) is found.
4810 2000-03-24 Juergen Vigna <jug@sad.it>
4812 * src/insets/insetcollapsable.C (Edit):
4813 * src/mathed/formula.C (InsetButtonRelease):
4814 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4817 * src/BufferView.C (workAreaButtonPress):
4818 (workAreaButtonRelease):
4819 (checkInsetHit): Finally fixed the clicking on insets be handled
4822 * src/insets/insetert.C (Edit): inserted this call so that ERT
4823 insets work always with LaTeX-font
4825 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4827 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4828 caused lyx to startup with no GUI in place, causing in a crash
4829 upon startup when called with arguments.
4831 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4833 * src/FontLoader.C: better initialization of dummyXFontStruct.
4835 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4837 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4838 for linuxdoc and docbook import and export format options.
4840 * lib/lyxrc.example Example of default values for the previous flags.
4842 * src/lyx_cb.C Use those flags instead of the hardwired values for
4843 linuxdoc and docbook export.
4845 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4848 * src/menus.C Added menus entries for the new import/exports formats.
4850 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4852 * src/lyxrc.*: Added support for running without Gui
4855 * src/FontLoader.C: sensible defaults if no fonts are needed
4857 * src/lyx_cb.C: New function ShowMessage (writes either to the
4858 minibuffer or cout in case of no gui
4859 New function AskOverwrite for common stuff
4860 Consequently various changes to call these functions
4862 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4863 wild guess at sensible screen resolution when having no gui
4865 * src/lyxfont.C: no gui, no fonts... set some defaults
4867 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4869 * src/LColor.C: made the command inset background a bit lighter.
4871 2000-03-20 Hartmut Goebel <goebel@noris.net>
4873 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4874 stdstruct.inc. Koma-Script added some title elements which
4875 otherwise have been listed below "bibliography". This split allows
4876 adding title elements to where they belong.
4878 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4879 define the additional tilte elements and then include
4882 * many other layout files: changed to include stdtitle.inc just
4883 before stdstruct.inc.
4885 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4887 * src/buffer.C: (save) Added the option to store all backup files
4888 in a single directory
4890 * src/lyxrc.[Ch]: Added variable \backupdir_path
4892 * lib/lyxrc.example: Added descriptions of recently added variables
4894 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4895 bibtex inset, not closing the bibtex popup when deleting the inset)
4897 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4899 * src/lyx_cb.C: add a couple using directives.
4901 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4902 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4903 import based on the filename.
4905 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4906 file would be imported at start, if the filename where of a sgml file.
4908 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4910 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4912 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4913 * src/lyxfont.h Replaced the member variable bits.direction by the
4914 member variable lang. Made many changes in other files.
4915 This allows having a multi-lingual document
4917 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4918 that change the current language to <l>.
4919 Removed the command "font-rtl"
4921 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4922 format for Hebrew documents)
4924 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4925 When auto_mathmode is "true", pressing a digit key in normal mode
4926 will cause entering into mathmode.
4927 If auto_mathmode is "rtl" then this behavior will be active only
4928 when writing right-to-left text.
4930 * src/text2.C (InsertStringA) The string is inserted using the
4933 * src/paragraph.C (GetEndLabel) Gives a correct result for
4934 footnote paragraphs.
4936 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4938 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4940 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4941 front of PasteParagraph. Never insert a ' '. This should at least
4942 fix some cause for the segfaults that we have been experiencing,
4943 it also fixes backspace behaviour slightly. (Phu!)
4945 * src/support/lstrings.C (compare_no_case): some change to make it
4946 compile with gcc 2.95.2 and stdlibc++-v3
4948 * src/text2.C (MeltFootnoteEnvironment): change type o
4949 first_footnote_par_is_not_empty to bool.
4951 * src/lyxparagraph.h: make text private. Changes in other files
4953 (fitToSize): new function
4954 (setContentsFromPar): new function
4955 (clearContents): new function
4956 (SetChar): new function
4958 * src/paragraph.C (readSimpleWholeFile): deleted.
4960 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4961 the file, just use a simple string instead. Also read the file in
4962 a more maintainable manner.
4964 * src/text2.C (InsertStringA): deleted.
4965 (InsertStringB): deleted.
4967 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4969 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4970 RedoParagraphs from the doublespace handling part, just set status
4971 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4972 done, but perhaps not like this.)
4974 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4976 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4977 character when inserting an inset.
4979 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4981 * src/bufferparams.C (readLanguage): now takes "default" into
4984 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4985 also initialize the toplevel_keymap with the default bindings from
4988 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4990 * all files using lyxrc: have lyxrc as a real variable and not a
4991 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4994 * src/lyxrc.C: remove double call to defaultKeyBindings
4996 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4997 toolbar defauls using lyxlex. Remove enums, structs, functions
5000 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5001 toolbar defaults. Also store default keybindings in a map.
5003 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5004 storing the toolbar defaults without any xforms dependencies.
5006 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5007 applied. Changed to use iterators.
5009 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5011 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5012 systems that don't have LINGUAS set to begin with.
5014 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5016 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5017 the list by Dekel Tsur.
5019 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5021 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5022 * src/insets/form_graphics.C: ditto.
5024 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5026 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5028 * src/bufferparams.C (readLanguage): use the new language map
5030 * src/intl.C (InitKeyMapper): use the new language map
5032 * src/lyx_gui.C (create_forms): use the new language map
5034 * src/language.[Ch]: New files. Used for holding the information
5035 about each language. Now! Use this new language map enhance it and
5036 make it really usable for our needs.
5038 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5040 * screen.C (ShowCursor): Removed duplicate code.
5041 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5042 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5044 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5047 * src/text.C Added TransformChar method. Used for rendering Arabic
5048 text correctly (change the glyphs of the letter according to the
5049 position in the word)
5054 * src/lyxrc.C Added lyxrc command {language_command_begin,
5055 language_command_end,language_command_ltr,language_command_rtl,
5056 language_package} which allows the use of either arabtex or Omega
5059 * src/lyx_gui.C (init)
5061 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5062 to use encoding for menu fonts which is different than the encoding
5065 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5066 do not load the babel package.
5067 To write an English document with Hebrew/Arabic, change the document
5068 language to "english".
5070 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5071 (alphaCounter): changed to return char
5072 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5074 * lib/lyxrc.example Added examples for Hebrew/Arabic
5077 * src/layout.C Added layout command endlabeltype
5079 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5081 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5083 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5085 * src/mathed/math_delim.C (search_deco): return a
5086 math_deco_struct* instead of index.
5088 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5090 * All files with a USE_OSTREAM_ONLY within: removed all code that
5091 was unused when USE_OSTREAM_ONLY is defined.
5093 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5094 of any less. Removed header and using.
5096 * src/text.C (GetVisibleRow): draw the string "Page Break
5097 (top/bottom)" on screen when drawing a pagebreak line.
5099 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5101 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5103 * src/mathed/math_macro.C (draw): do some cast magic.
5106 * src/mathed/math_defs.h: change byte* argument to byte const*.
5108 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5110 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5111 know it is right to return InsetFoot* too, but cxx does not like
5114 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5116 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5118 * src/mathed/math_delim.C: change == to proper assignment.
5120 2000-03-09 Juergen Vigna <jug@sad.it>
5122 * src/insets/insettext.C (setPos): fixed various cursor positioning
5123 problems (via mouse and cursor-keys)
5124 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5125 inset (still a small display problem but it works ;)
5127 * src/insets/insetcollapsable.C (draw): added button_top_y and
5128 button_bottom_y to have correct values for clicking on the inset.
5130 * src/support/lyxalgo.h: commented out 'using std::less'
5132 2000-03-08 Juergen Vigna <jug@sad.it>
5134 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5135 Button-Release event closes as it is alos the Release-Event
5138 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5140 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5142 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5143 can add multiple spaces in Scrap (literate programming) styles...
5144 which, by the way, is how I got hooked on LyX to begin with.
5146 * src/mathed/formula.C (Write): Added dummy variable to an
5147 inset::Latex() call.
5148 (Latex): Add free_spacing boolean to inset::Latex()
5150 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5152 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5153 virtual function to include the free_spacing boolean from
5154 the containing paragraph's style.
5156 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5157 Added free_spacing boolean arg to match inset.h
5159 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5160 Added free_spacing boolean arg to match inset.h
5162 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5163 Added free_spacing boolean and made sure that if in a free_spacing
5164 paragraph, that we output normal space if there is a protected space.
5166 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5167 Added free_spacing boolean arg to match inset.h
5169 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5170 Added free_spacing boolean arg to match inset.h
5172 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5173 Added free_spacing boolean arg to match inset.h
5175 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5176 Added free_spacing boolean arg to match inset.h
5178 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5179 Added free_spacing boolean arg to match inset.h
5181 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5182 free_spacing boolean arg to match inset.h
5184 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5185 Added free_spacing boolean arg to match inset.h
5187 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5188 Added free_spacing boolean arg to match inset.h
5190 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5191 Added free_spacing boolean arg to match inset.h
5193 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5194 Added free_spacing boolean arg to match inset.h
5196 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5197 Added free_spacing boolean arg to match inset.h
5199 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5200 free_spacing boolean arg to match inset.h
5202 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5203 free_spacing boolean arg to match inset.h
5205 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5206 ignore free_spacing paragraphs. The user's spaces are left
5209 * src/text.C (InsertChar): Fixed the free_spacing layout
5210 attribute behavior. Now, if free_spacing is set, you can
5211 add multiple spaces in a paragraph with impunity (and they
5212 get output verbatim).
5213 (SelectSelectedWord): Added dummy argument to inset::Latex()
5216 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5219 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5220 paragraph layouts now only input a simple space instead.
5221 Special character insets don't make any sense in free-spacing
5224 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5225 hard-spaces in the *input* file to simple spaces if the layout
5226 is free-spacing. This converts old files which had to have
5227 hard-spaces in free-spacing layouts where a simple space was
5229 (writeFileAscii): Added free_spacing check to pass to the newly
5230 reworked inset::Latex(...) methods. The inset::Latex() code
5231 ensures that hard-spaces in free-spacing paragraphs get output
5232 as spaces (rather than "~").
5234 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5236 * src/mathed/math_delim.C (draw): draw the empty placeholder
5237 delims with a onoffdash line.
5238 (struct math_deco_compare): struct that holds the "functors" used
5239 for the sort and the binary search in math_deco_table.
5240 (class init_deco_table): class used for initial sort of the
5242 (search_deco): use lower_bound to do a binary search in the
5245 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5247 * src/lyxrc.C: a small secret thingie...
5249 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5250 and to not flush the stream as often as it used to.
5252 * src/support/lyxalgo.h: new file
5253 (sorted): template function used for checking if a sequence is
5254 sorted or not. Two versions with and without user supplied
5255 compare. Uses same compare as std::sort.
5257 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5258 it and give warning on lyxerr.
5260 (struct compare_tags): struct with function operators used for
5261 checking if sorted, sorting and lower_bound.
5262 (search_kw): use lower_bound instead of manually implemented
5265 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5267 * src/insets/insetcollapsable.h: fix Clone() declaration.
5268 * src/insets/insetfoot.h: ditto.
5270 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5272 2000-03-08 Juergen Vigna <jug@sad.it>
5274 * src/insets/lyxinset.h: added owner call which tells us if
5275 this inset is inside another inset. Changed also the return-type
5276 of Editable to an enum so it tells clearer what the return-value is.
5278 * src/insets/insettext.C (computeTextRows): fixed computing of
5279 textinsets which split automatically on more rows.
5281 * src/insets/insetert.[Ch]: changed this to be of BaseType
5284 * src/insets/insetfoot.[Ch]: added footnote inset
5286 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5287 collapsable insets (like footnote, ert, ...)
5289 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5291 * src/lyxdraw.h: remvoe file
5293 * src/lyxdraw.C: remove file
5295 * src/insets/insettext.C: added <algorithm>.
5297 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5299 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5300 (matrix_cb): case MM_OK use string stream
5302 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5305 * src/mathed/math_macro.C (draw): use string stream
5306 (Metrics): use string stream
5308 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5309 directly to the ostream.
5311 * src/vspace.C (asString): use string stream.
5312 (asString): use string stream
5313 (asLatexString): use string stream
5315 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5316 setting Spacing::Other.
5318 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5319 sprintf when creating the stretch vale.
5321 * src/text2.C (alphaCounter): changed to return a string and to
5322 not use a static variable internally. Also fixed a one-off bug.
5323 (SetCounter): changed the drawing of the labels to use string
5324 streams instead of sprintf.
5326 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5327 manipulator to use a scheme that does not require library support.
5328 This is also the way it is done in the new GNU libstdc++. Should
5329 work with DEC cxx now.
5331 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5333 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5334 end. This fixes a bug.
5336 * src/mathed (all files concerned with file writing): apply the
5337 USE_OSTREAM_ONLY changes to mathed too.
5339 * src/support/DebugStream.h: make the constructor explicit.
5341 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5342 count and ostream squashed.
5344 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5346 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5348 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5349 ostringstream uses STL strings, and we might not.
5351 * src/insets/insetspecialchar.C: add using directive.
5352 * src/insets/insettext.C: ditto.
5354 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5356 * lib/layouts/seminar.layout: feeble attempt at a layout for
5357 seminar.cls, far from completet and could really use some looking
5358 at from people used to write layout files.
5360 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5361 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5362 a lot nicer and works nicely with ostreams.
5364 * src/mathed/formula.C (draw): a slightly different solution that
5365 the one posted to the list, but I think this one works too. (font
5366 size wrong in headers.)
5368 * src/insets/insettext.C (computeTextRows): some fiddling on
5369 Jürgens turf, added some comments that he should read.
5371 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5372 used and it gave compiler warnings.
5373 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5376 * src/lyx_gui.C (create_forms): do the right thing when
5377 show_banner is true/false.
5379 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5380 show_banner is false.
5382 * most file writing files: Now use iostreams to do almost all of
5383 the writing. Also instead of passing string &, we now use
5384 stringstreams. mathed output is still not adapted to iostreams.
5385 This change can be turned off by commenting out all the occurences
5386 of the "#define USE_OSTREAM_ONLY 1" lines.
5388 * src/WorkArea.C (createPixmap): don't output debug messages.
5389 (WorkArea): don't output debug messages.
5391 * lib/lyxrc.example: added a comment about the new variable
5394 * development/Code_rules/Rules: Added some more commente about how
5395 to build class interfaces and on how better encapsulation can be
5398 2000-03-03 Juergen Vigna <jug@sad.it>
5400 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5401 automatically with the width of the LyX-Window
5403 * src/insets/insettext.C (computeTextRows): fixed update bug in
5404 displaying text-insets (scrollvalues where not initialized!)
5406 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5408 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5409 id in the check of the result from lower_bound is not enough since
5410 lower_bound can return last too, and then res->id will not be a
5413 * all insets and some code that use them: I have conditionalized
5414 removed the Latex(string & out, ...) this means that only the
5415 Latex(ostream &, ...) will be used. This is a work in progress to
5416 move towards using streams for all output of files.
5418 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5421 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5423 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5424 routine (this fixes bug where greek letters were surrounded by too
5427 * src/support/filetools.C (findtexfile): change a bit the search
5428 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5429 no longer passed to kpsewhich, we may have to change that later.
5431 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5432 warning options to avoid problems with X header files (from Angus
5434 * acinclude.m4: regenerated.
5436 2000-03-02 Juergen Vigna <jug@sad.it>
5438 * src/insets/insettext.C (WriteParagraphData): Using the
5439 par->writeFile() function for writing paragraph-data.
5440 (Read): Using buffer->parseSingleLyXformat2Token()-function
5441 for parsing paragraph data!
5443 * src/buffer.C (readLyXformat2): removed all parse data and using
5444 the new parseSingleLyXformat2Token()-function.
5445 (parseSingleLyXformat2Token): added this function to parse (read)
5446 lyx-file-format (this is called also from text-insets now!)
5448 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5450 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5453 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5454 directly instead of going through a func. One very bad thing: a
5455 static LyXFindReplace, but I don't know where to place it.
5457 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5458 string instead of char[]. Also changed to static.
5459 (GetSelectionOrWordAtCursor): changed to static inline
5460 (SetSelectionOverLenChars): ditto.
5462 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5463 current_view and global variables. both classes has changed names
5464 and LyXFindReplace is not inherited from SearchForm.
5466 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5467 fl_form_search form.
5469 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5471 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5473 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5474 bound (from Kayvan).
5476 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5478 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5480 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5482 * some things that I should comment but the local pub says head to
5485 * comment out all code that belongs to the Roff code for Ascii
5486 export of tables. (this is unused)
5488 * src/LyXView.C: use correct type for global variable
5489 current_layout. (LyXTextClass::size_type)
5491 * some code to get the new insetgraphics closer to working I'd be
5492 grateful for any help.
5494 * src/BufferView2.C (insertInset): use the return type of
5495 NumberOfLayout properly. (also changes in other files)
5497 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5498 this as a test. I want to know what breaks because of this.
5500 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5502 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5504 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5505 to use a \makebox in the label, this allows proper justification
5506 with out using protected spaces or multiple hfills. Now it is
5507 "label" for left justified, "\hfill label\hfill" for center, and
5508 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5509 should be changed accordingly.
5511 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5513 * src/lyxtext.h: change SetLayout() to take a
5514 LyXTextClass::size_type instead of a char (when there is more than
5515 127 layouts in a class); also change type of copylayouttype.
5516 * src/text2.C (SetLayout): ditto.
5517 * src/LyXView.C (updateLayoutChoice): ditto.
5519 * src/LaTeX.C (scanLogFile): errors where the line number was not
5520 given just after the '!'-line were ignored (from Dekel Tsur).
5522 * lib/lyxrc.example: fix description of \date_insert_format
5524 * lib/layouts/llncs.layout: new layout, contributed by Martin
5527 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5529 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5530 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5531 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5532 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5533 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5534 paragraph.C, text.C, text2.C)
5536 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5538 * src/insets/insettext.C (LocalDispatch): remove extra break
5541 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5542 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5544 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5545 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5547 * src/insets/insetbib.h: move InsetBibkey::Holder and
5548 InsetCitation::Holder in public space.
5550 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5552 * src/insets/insettext.h: small change to get the new files from
5553 Juergen to compile (use "string", not "class string").
5555 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5556 const & as parameter to LocalDispatch, use LyXFont const & as
5557 paramter to some other func. This also had impacto on lyxinsets.h
5558 and the two mathed insets.
5560 2000-02-24 Juergen Vigna <jug@sad.it>
5563 * src/commandtags.h:
5565 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5569 * src/BufferView2.C: added/updated code for various inset-functions
5571 * src/insets/insetert.[Ch]: added implementation of InsetERT
5573 * src/insets/insettext.[Ch]: added implementation of InsetText
5575 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5576 (draw): added preliminary code for inset scrolling not finshed yet
5578 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5579 as it is in lyxfunc.C now
5581 * src/insets/lyxinset.h: Added functions for text-insets
5583 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5585 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5586 BufferView and reimplement the list as a queue put inside its own
5589 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5591 * several files: use the new interface to the "updateinsetlist"
5593 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5595 (work_area_handler): call BufferView::trippleClick on trippleclick.
5597 * src/BufferView.C (doubleClick): new function, selects word on
5599 (trippleClick): new function, selects line on trippleclick.
5601 2000-02-22 Allan Rae <rae@lyx.org>
5603 * lib/bind/xemacs.bind: buffer-previous not supported
5605 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5607 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5610 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5612 * src/bufferlist.C: get rid of current_view from this file
5614 * src/spellchecker.C: get rid of current_view from this file
5616 * src/vspace.C: get rid of current_view from this file
5617 (inPixels): added BufferView parameter for this func
5618 (asLatexCommand): added a BufferParams for this func
5620 * src/text.C src/text2.C: get rid of current_view from these
5623 * src/lyxfont.C (getFontDirection): move this function here from
5626 * src/bufferparams.C (getDocumentDirection): move this function
5629 * src/paragraph.C (getParDirection): move this function here from
5631 (getLetterDirection): ditto
5633 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5635 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5636 resize due to wrong pixmap beeing used. Also took the opurtunity
5637 to make the LyXScreen stateless on regard to WorkArea and some
5638 general cleanup in the same files.
5640 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5642 * src/Makefile.am: add missing direction.h
5644 * src/PainterBase.h: made the width functions const.
5646 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5649 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5651 * src/insets/insetlatexaccent.C (draw): make the accents draw
5652 better, at present this will only work well with iso8859-1.
5654 * several files: remove the old drawing code, now we use the new
5657 * several files: remove support for mono_video, reverse_video and
5660 2000-02-17 Juergen Vigna <jug@sad.it>
5662 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5663 int ** as we have to return the pointer, otherwise we have only
5664 NULL pointers in the returning function.
5666 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5668 * src/LaTeX.C (operator()): quote file name when running latex.
5670 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5672 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5673 (bubble tip), this removes our special handling of this.
5675 * Remove all code that is unused now that we have the new
5676 workarea. (Code that are not active when NEW_WA is defined.)
5678 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5680 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5682 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5683 nonexisting layout; correctly redirect obsoleted layouts.
5685 * lib/lyxrc.example: document \view_dvi_paper_option
5687 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5690 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5691 (PreviewDVI): handle the view_dvi_paper_option variable.
5692 [Both from Roland Krause]
5694 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5696 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5697 char const *, int, LyXFont)
5698 (text(int, int, string, LyXFont)): ditto
5700 * src/text.C (InsertCharInTable): attempt to fix the double-space
5701 feature in tables too.
5702 (BackspaceInTable): ditto.
5703 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5705 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5707 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5709 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5710 newly found text in textcache to this.
5711 (buffer): set the owner of the text put into the textcache to 0
5713 * src/insets/figinset.C (draw): fixed the drawing of figures with
5716 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5717 drawing of mathframe, hfills, protected space, table lines. I have
5718 now no outstanding drawing problems with the new Painter code.
5720 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5722 * src/PainterBase.C (ellipse, circle): do not specify the default
5725 * src/LColor.h: add using directive.
5727 * src/Painter.[Ch]: change return type of methods from Painter& to
5728 PainterBase&. Add a using directive.
5730 * src/WorkArea.C: wrap xforms callbacks in C functions
5733 * lib/layouts/foils.layout: font fix and simplifications from Carl
5736 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5738 * a lot of files: The Painter, LColor and WorkArea from the old
5739 devel branch has been ported to lyx-devel. Some new files and a
5740 lot of #ifdeffed code. The new workarea is enabled by default, but
5741 if you want to test the new Painter and LColor you have to compile
5742 with USE_PAINTER defined (do this in config.h f.ex.) There are
5743 still some rought edges, and I'd like some help to clear those
5744 out. It looks stable (loads and displays the Userguide very well).
5747 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5749 * src/buffer.C (pop_tag): revert to the previous implementation
5750 (use a global variable for both loops).
5752 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5754 * src/lyxrc.C (LyXRC): change slightly default date format.
5756 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5757 there is an English text with a footnote that starts with a Hebrew
5758 paragraph, or vice versa.
5759 (TeXFootnote): ditto.
5761 * src/text.C (LeftMargin): allow for negative values for
5762 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5765 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5766 for input encoding (cyrillic)
5768 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5770 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5773 * src/toolbar.C (set): ditto
5774 * src/insets/insetbib.C (create_form_citation_form): ditto
5776 * lib/CREDITS: added Dekel Tsur.
5778 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5779 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5780 hebrew supports files from Dekel Tsur.
5782 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5783 <tzafrir@technion.ac.il>
5785 * src/lyxrc.C: put \date_insert_format at the right place.
5787 * src/buffer.C (makeLaTeXFile): fix the handling of
5788 BufferParams::sides when writing out latex files.
5790 * src/BufferView2.C: add a "using" directive.
5792 * src/support/lyxsum.C (sum): when we use lyxstring,
5793 ostringstream::str needs an additional .c_str().
5795 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5797 * src/support/filetools.C (ChangeExtension): patch from Etienne
5800 * src/TextCache.C (show): remove const_cast and make second
5801 parameter non-const LyXText *.
5803 * src/TextCache.h: use non const LyXText in show.
5805 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5808 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5810 * src/support/lyxsum.C: rework to be more flexible.
5812 * several places: don't check if a pointer is 0 if you are going
5815 * src/text.C: remove some dead code.
5817 * src/insets/figinset.C: remove some dead code
5819 * src/buffer.C: move the BufferView funcs to BufferView2.C
5820 remove all support for insetlatexdel
5821 remove support for oldpapersize stuff
5822 made some member funcs const
5824 * src/kbmap.C: use a std::list to store the bindings in.
5826 * src/BufferView2.C: new file
5828 * src/kbsequence.[Ch]: new files
5830 * src/LyXAction.C + others: remove all trace of buffer-previous
5832 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5833 only have one copy in the binary of this table.
5835 * hebrew patch: moved some functions from LyXText to more
5836 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5838 * several files: remove support for XForms older than 0.88
5840 remove some #if 0 #endif code
5842 * src/TextCache.[Ch]: new file. Holds the textcache.
5844 * src/BufferView.C: changes to use the new TextCache interface.
5845 (waitForX): remove the now unused code.
5847 * src/BackStack.h: remove some commented code
5849 * lib/bind/emacs.bind: remove binding for buffer-previous
5851 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5853 * applied the hebrew patch.
5855 * src/lyxrow.h: make sure that all Row variables are initialized.
5857 * src/text2.C (TextHandleUndo): comment out a delete, this might
5858 introduce a memory leak, but should also help us to not try to
5859 read freed memory. We need to look at this one.
5861 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5862 (LyXParagraph): initalize footnotekind.
5864 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5865 forgot this when applying the patch. Please heed the warnings.
5867 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5868 (aka. reformat problem)
5870 * src/bufferlist.C (exists): made const, and use const_iterator
5871 (isLoaded): new func.
5872 (release): use std::find to find the correct buffer.
5874 * src/bufferlist.h: made getState a const func.
5875 made empty a const func.
5876 made exists a const func.
5879 2000-02-01 Juergen Vigna <jug@sad.it>
5881 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5883 * po/it.po: updated a bit the italian po file and also changed the
5884 'file nuovo' for newfile to 'filenuovo' without a space, this did
5887 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5888 for the new insert_date command.
5890 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5891 from jdblair, to insert a date into the current text conforming to
5892 a strftime format (for now only considering the locale-set and not
5893 the document-language).
5895 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5897 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5898 Bounds Read error seen by purify. The problem was that islower is
5899 a macros which takes an unsigned char and uses it as an index for
5900 in array of characters properties (and is thus subject to the
5904 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5905 correctly the paper sides radio buttons.
5906 (UpdateDocumentButtons): ditto.
5908 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5910 * src/kbmap.C (getsym + others): change to return unsigned int,
5911 returning a long can give problems on 64 bit systems. (I assume
5912 that int is 32bit on 64bit systems)
5914 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5916 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5917 LyXLookupString to be zero-terminated. Really fixes problems seen
5920 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5922 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5923 write a (char*)0 to the lyxerr stream.
5925 * src/lastfiles.C: move algorithm before the using statemets.
5927 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5929 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5930 complains otherwise).
5931 * src/table.C: ditto
5933 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5936 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5937 that I removed earlier... It is really needed.
5939 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5941 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5943 * INSTALL: update xforms home page URL.
5945 * lib/configure.m4: fix a bug with unreadable layout files.
5947 * src/table.C (calculate_width_of_column): add "using std::max"
5950 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5952 * several files: marked several lines with "DEL LINE", this is
5953 lines that can be deleted without changing anything.
5954 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5955 checks this anyway */
5958 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5960 * src/DepTable.C (update): add a "+" at the end when the checksum
5961 is different. (debugging string only)
5963 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5964 the next inset to not be displayed. This should also fix the list
5965 of labels in the "Insert Crossreference" dialog.
5967 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5969 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5970 when regex was not found.
5972 * src/support/lstrings.C (lowercase): use handcoded transform always.
5975 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5976 old_cursor.par->prev could be 0.
5978 * several files: changed post inc/dec to pre inc/dec
5980 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5981 write the lastfiles to file.
5983 * src/BufferView.C (buffer): only show TextCache info when debugging
5985 (resizeCurrentBuffer): ditto
5986 (workAreaExpose): ditto
5988 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5990 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5992 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5993 a bit better by removing the special case for \i and \j.
5995 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5997 * src/lyx_main.C (easyParse): remove test for bad comand line
5998 options, since this broke all xforms-related parsing.
6000 * src/kbmap.C (getsym): set return type to unsigned long, as
6001 declared in header. On an alpha, long is _not_ the same as int.
6003 * src/support/LOstream.h: add a "using std::flush;"
6005 * src/insets/figinset.C: ditto.
6007 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6009 * src/bufferlist.C (write): use blinding fast file copy instead of
6010 "a char at a time", now we are doing it the C++ way.
6012 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6013 std::list<int> instead.
6014 (addpidwait): reflect move to std::list<int>
6015 (sigchldchecker): ditto
6017 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6020 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6021 that obviously was wrong...
6023 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6024 c, this avoids warnings with purify and islower.
6026 * src/insets/figinset.C: rename struct queue to struct
6027 queue_element and rewrite to use a std::queue. gsqueue is now a
6028 std::queue<queue_element>
6029 (runqueue): reflect move to std::queue
6032 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6033 we would get "1" "0" instead of "true" "false. Also make the tostr
6036 2000-01-21 Juergen Vigna <jug@sad.it>
6038 * src/buffer.C (writeFileAscii): Disabled code for special groff
6039 handling of tabulars till I fix this in table.C
6041 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6043 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6045 * src/support/lyxlib.h: ditto.
6047 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6049 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6050 and 'j' look better. This might fix the "macron" bug that has been
6053 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6054 functions as one template function. Delete the old versions.
6056 * src/support/lyxsum.C: move using std::ifstream inside
6059 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6062 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6064 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6066 * src/insets/figinset.C (InitFigures): use new instead of malloc
6067 to allocate memory for figures and bitmaps.
6068 (DoneFigures): use delete[] instead of free to deallocate memory
6069 for figures and bitmaps.
6070 (runqueue): use new to allocate
6071 (getfigdata): use new/delete[] instead of malloc/free
6072 (RegisterFigure): ditto
6074 * some files: moved some declarations closer to first use, small
6075 whitespace changes use preincrement instead of postincrement where
6076 it does not make a difference.
6078 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6079 step on the way to use stl::containers for key maps.
6081 * src/bufferlist.h: add a typedef for const_iterator and const
6082 versions of begin and end.
6084 * src/bufferlist.[Ch]: change name of member variable _state to
6085 state_. (avoid reserved names)
6087 (getFileNames): returns the filenames of the buffers in a vector.
6089 * configure.in (ALL_LINGUAS): added ro
6091 * src/support/putenv.C: new file
6093 * src/support/mkdir.C: new file
6095 2000-01-20 Allan Rae <rae@lyx.org>
6097 * lib/layouts/IEEEtran.layout: Added several theorem environments
6099 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6100 couple of minor additions.
6102 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6103 (except for those in footnotes of course)
6105 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6107 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6109 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6110 std::sort and std::lower_bound instead of qsort and handwritten
6112 (struct compara): struct that holds the functors used by std::sort
6113 and std::lower_bound in MathedLookupBOP.
6115 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6117 * src/support/LAssert.h: do not do partial specialization. We do
6120 * src/support/lyxlib.h: note that lyx::getUserName() and
6121 lyx::date() are not in use right now. Should these be suppressed?
6123 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6124 (makeLinuxDocFile): do not put date and user name in linuxdoc
6127 * src/support/lyxlib.h (kill): change first argument to long int,
6128 since that's what solaris uses.
6130 * src/support/kill.C (kill): fix declaration to match prototype.
6132 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6133 actually check whether namespaces are supported. This is not what
6136 * src/support/lyxsum.C: add a using directive.
6138 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6140 * src/support/kill.C: if we have namespace support we don't have
6141 to include lyxlib.h.
6143 * src/support/lyxlib.h: use namespace lyx if supported.
6145 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6147 * src/support/date.C: new file
6149 * src/support/chdir.C: new file
6151 * src/support/getUserName.C: new file
6153 * src/support/getcwd.C: new file
6155 * src/support/abort.C: new file
6157 * src/support/kill.C: new file
6159 * src/support/lyxlib.h: moved all the functions in this file
6160 insede struct lyx. Added also kill and abort to this struct. This
6161 is a way to avoid the "kill is not defined in <csignal>", we make
6162 C++ wrappers for functions that are not ANSI C or ANSI C++.
6164 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6165 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6166 lyx it has been renamed to sum.
6168 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6170 * src/text.C: add using directives for std::min and std::max.
6172 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6174 * src/texrow.C (getIdFromRow): actually return something useful in
6175 id and pos. Hopefully fixes the bug with positionning of errorbox
6178 * src/lyx_main.C (easyParse): output an error and exit if an
6179 incorrect command line option has been given.
6181 * src/spellchecker.C (ispell_check_word): document a memory leak.
6183 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6184 where a "struct utimbuf" is allocated with "new" and deleted with
6187 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6189 * src/text2.C (CutSelection): don't delete double spaces.
6190 (PasteSelection): ditto
6191 (CopySelection): ditto
6193 * src/text.C (Backspace): don't delete double spaces.
6195 * src/lyxlex.C (next): fix a bug that were only present with
6196 conformant std::istream::get to read comment lines, use
6197 std::istream::getline instead. This seems to fix the problem.
6199 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6201 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6202 allowed to insert space before space" editing problem. Please read
6203 commends at the beginning of the function. Comments about usage
6206 * src/text.C (InsertChar): fix for the "not allowed to insert
6207 space before space" editing problem.
6209 * src/text2.C (DeleteEmptyParagraphMechanism): when
6210 IsEmptyTableRow can only return false this last "else if" will
6211 always be a no-op. Commented out.
6213 * src/text.C (RedoParagraph): As far as I can understand tmp
6214 cursor is not really needed.
6216 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6217 present it could only return false anyway.
6218 (several functions): Did something not so smart...added a const
6219 specifier on a lot of methods.
6221 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6222 and add a tmp->text.resize. The LyXParagraph constructor does the
6224 (BreakParagraphConservative): ditto
6226 * src/support/path.h (Path): add a define so that the wrong usage
6227 "Path("/tmp") will be flagged as a compilation error:
6228 "`unnamed_Path' undeclared (first use this function)"
6230 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6232 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6233 which was bogus for several reasons.
6235 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6239 * autogen.sh: do not use "type -path" (what's that anyway?).
6241 * src/support/filetools.C (findtexfile): remove extraneous space
6242 which caused a kpsewhich warning (at least with kpathsea version
6245 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6247 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6249 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6251 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6253 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6255 * src/paragraph.C (BreakParagraph): do not reserve space on text
6256 if we don't need to (otherwise, if pos_end < pos, we end up
6257 reserving huge amounts of memory due to bad unsigned karma).
6258 (BreakParagraphConservative): ditto, although I have not seen
6259 evidence the bug can happen here.
6261 * src/lyxparagraph.h: add a using std::list.
6263 2000-01-11 Juergen Vigna <jug@sad.it>
6265 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6268 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6270 * src/vc-backend.C (doVCCommand): change to be static and take one
6271 more parameter: the path to chdir too be fore executing the command.
6272 (retrive): new function equiv to "co -r"
6274 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6275 file_not_found_hook is true.
6277 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6279 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6280 if a file is readwrite,readonly...anything else.
6282 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6284 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6285 (CreatePostscript): name change from MenuRunDVIPS (or something)
6286 (PreviewPostscript): name change from MenuPreviewPS
6287 (PreviewDVI): name change from MenuPreviewDVI
6289 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6290 \view_pdf_command., \pdf_to_ps_command
6292 * lib/configure.m4: added search for PDF viewer, and search for
6293 PDF to PS converter.
6294 (lyxrc.defaults output): add \pdflatex_command,
6295 \view_pdf_command and \pdf_to_ps_command.
6297 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6299 * src/bufferlist.C (write): we don't use blocksize for anything so
6302 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6304 * src/support/block.h: disable operator T* (), since it causes
6305 problems with both compilers I tried. See comments in the file.
6307 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6310 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6311 variable LYX_DIR_10x to LYX_DIR_11x.
6313 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6315 * INSTALL: document --with-lyxname.
6318 * configure.in: new configure flag --with-lyxname which allows to
6319 choose the name under which lyx is installed. Default is "lyx", of
6320 course. It used to be possible to do this with --program-suffix,
6321 but the later has in fact a different meaning for autoconf.
6323 * src/support/lstrings.h (lstrchr): reformat a bit.
6325 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6326 * src/mathed/math_defs.h: ditto.
6328 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6330 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6331 true, decides if we create a backup file or not when saving. New
6332 tag and variable \pdf_mode, defaults to false. New tag and
6333 variable \pdflatex_command, defaults to pdflatex. New tag and
6334 variable \view_pdf_command, defaults to xpdf. New tag and variable
6335 \pdf_to_ps_command, defaults to pdf2ps.
6337 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6339 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6340 does not have a BufferView.
6341 (unlockInset): ditto + don't access the_locking_inset if the
6342 buffer does not have a BufferView.
6344 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6345 certain circumstances so that we don't continue a keyboard
6346 operation long after the key was released. Try f.ex. to load a
6347 large document, press PageDown for some seconds and then release
6348 it. Before this change the document would contine to scroll for
6349 some time, with this change it stops imidiatly.
6351 * src/support/block.h: don't allocate more space than needed. As
6352 long as we don't try to write to the arr[x] in a array_type arr[x]
6353 it is perfectly ok. (if you write to it you might segfault).
6354 added operator value_type*() so that is possible to pass the array
6355 to functions expecting a C-pointer.
6357 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6360 * intl/*: updated to gettext 0.10.35, tried to add our own
6361 required modifications. Please verify.
6363 * po/*: updated to gettext 0.10.35, tried to add our own required
6364 modifications. Please verify.
6366 * src/support/lstrings.C (tostr): go at fixing the problem with
6367 cxx and stringstream. When stringstream is used return
6368 oss.str().c_str() so that problems with lyxstring and basic_string
6369 are avoided. Note that the best solution would be for cxx to use
6370 basic_string all the way, but it is not conformant yet. (it seems)
6372 * src/lyx_cb.C + other files: moved several global functions to
6373 class BufferView, some have been moved to BufferView.[Ch] others
6374 are still located in lyx_cb.C. Code changes because of this. (part
6375 of "get rid of current_view project".)
6377 * src/buffer.C + other files: moved several Buffer functions to
6378 class BufferView, the functions are still present in buffer.C.
6379 Code changes because of this.
6381 * config/lcmessage.m4: updated to most recent. used when creating
6384 * config/progtest.m4: updated to most recent. used when creating
6387 * config/gettext.m4: updated to most recent. applied patch for
6390 * config/gettext.m4.patch: new file that shows what changes we
6391 have done to the local copy of gettext.m4.
6393 * config/libtool.m4: new file, used in creation of acinclude.m4
6395 * config/lyxinclude.m4: new file, this is the lyx created m4
6396 macros, used in making acinclude.m4.
6398 * autogen.sh: GNU m4 discovered as a separate task not as part of
6399 the lib/configure creation.
6400 Generate acinlucde from files in config. Actually cat
6401 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6402 easier to upgrade .m4 files that really are external.
6404 * src/Spacing.h: moved using std::istringstream to right after
6405 <sstream>. This should fix the problem seen with some compilers.
6407 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6409 * src/lyx_cb.C: began some work to remove the dependency a lot of
6410 functions have on BufferView::text, even if not really needed.
6411 (GetCurrentTextClass): removed this func, it only hid the
6414 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6415 forgot this in last commit.
6417 * src/Bullet.C (bulletEntry): use static char const *[] for the
6418 tables, becuase of this the return arg had to change to string.
6420 (~Bullet): removed unneeded destructor
6422 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6423 (insetSleep): moved from Buffer
6424 (insetWakeup): moved from Buffer
6425 (insetUnlock): moved from Buffer
6427 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6428 from Buffer to BufferView.
6430 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6432 * config/ltmain.sh: updated to version 1.3.4 of libtool
6434 * config/ltconfig: updated to version 1.3.4 of libtool
6436 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6439 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6440 Did I get that right?
6442 * src/lyxlex.h: add a "using" directive or two.
6443 * src/Spacing.h: ditto.
6444 * src/insets/figinset.C: ditto.
6445 * src/support/filetools.C: ditto.
6446 * src/support/lstrings.C: ditto.
6447 * src/BufferView.C: ditto.
6448 * src/bufferlist.C: ditto.
6449 * src/lyx_cb.C: ditto.
6450 * src/lyxlex.C: ditto.
6452 * NEWS: add some changes for 1.1.4.
6454 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6456 * src/BufferView.C: first go at a TextCache to speed up switching
6459 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6461 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6462 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6463 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6464 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6467 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6468 members of the struct are correctly initialized to 0 (detected by
6470 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6471 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6473 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6474 pidwait, since it was allocated with "new". This was potentially
6475 very bad. Thanks to Michael Schmitt for running purify for us.
6478 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6480 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6482 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6484 1999-12-30 Allan Rae <rae@lyx.org>
6486 * lib/templates/IEEEtran.lyx: minor change
6488 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6489 src/mathed/formula.C (LocalDispatch): askForText changes
6491 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6492 know when a user has cancelled input. Fixes annoying problems with
6493 inserting labels and version control.
6495 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6497 * src/support/lstrings.C (tostr): rewritten to use strstream and
6500 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6502 * src/support/filetools.C (IsFileWriteable): use fstream to check
6503 (IsDirWriteable): use fileinfo to check
6505 * src/support/filetools.h (FilePtr): whole class deleted
6507 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6509 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6511 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6513 * src/bufferlist.C (write): use ifstream and ofstream instead of
6516 * src/Spacing.h: use istrstream instead of sscanf
6518 * src/mathed/math_defs.h: change first arg to istream from FILE*
6520 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6522 * src/mathed/math_parser.C: have yyis to be an istream
6523 (LexGetArg): use istream (yyis)
6525 (mathed_parse): ditto
6526 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6528 * src/mathed/formula.C (Read): rewritten to use istream
6530 * src/mathed/formulamacro.C (Read): rewritten to use istream
6532 * src/lyxlex.h (~LyXLex): deleted desturctor
6533 (getStream): new function, returns an istream
6534 (getFile): deleted funtion
6535 (IsOK): return is.good();
6537 * src/lyxlex.C (LyXLex): delete file and owns_file
6538 (setFile): open an filebuf and assign that to a istream instead of
6540 (setStream): new function, takes an istream as arg.
6541 (setFile): deleted function
6542 (EatLine): rewritten us use istream instead of FILE*
6546 * src/table.C (LyXTable): use istream instead of FILE*
6547 (Read): rewritten to take an istream instead of FILE*
6549 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6551 * src/buffer.C (Dispatch): remove an extraneous break statement.
6553 * src/support/filetools.C (QuoteName): change to do simple
6554 'quoting'. More work is necessary. Also changed to do nothing
6555 under emx (needs fix too).
6556 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6558 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6559 config.h.in to the AC_DEFINE_UNQUOTED() call.
6560 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6561 needs char * as argument (because Solaris 7 declares it like
6564 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6565 remove definition of BZERO.
6567 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6569 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6570 defined, "lyxregex.h" if not.
6572 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6574 (REGEX): new variable that is set to regex.c lyxregex.h when
6575 AM_CONDITIONAL USE_REGEX is set.
6576 (libsupport_la_SOURCES): add $(REGEX)
6578 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6581 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6584 * configure.in: add call to LYX_REGEX
6586 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6587 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6589 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6591 * lib/bind/fi_menus.bind: new file, from
6592 pauli.virtanen@saunalahti.fi.
6594 * src/buffer.C (getBibkeyList): pass the parameter delim to
6595 InsetInclude::getKeys and InsetBibtex::getKeys.
6597 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6598 is passed to Buffer::getBibkeyList
6600 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6601 instead of the hardcoded comma.
6603 * src/insets/insetbib.C (getKeys): make sure that there are not
6604 leading blanks in bibtex keys. Normal latex does not care, but
6605 harvard.sty seems to dislike blanks at the beginning of citation
6606 keys. In particular, the retturn value of the function is
6608 * INSTALL: make it clear that libstdc++ is needed and that gcc
6609 2.7.x probably does not work.
6611 * src/support/filetools.C (findtexfile): make debug message go to
6613 * src/insets/insetbib.C (getKeys): ditto
6615 * src/debug.C (showTags): make sure that the output is correctly
6618 * configure.in: add a comment for TWO_COLOR_ICON define.
6620 * acconfig.h: remove all the entries that already defined in
6621 configure.in or acinclude.m4.
6623 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6624 to avoid user name, date and copyright.
6626 1999-12-21 Juergen Vigna <jug@sad.it>
6628 * src/table.C (Read): Now read bogus row format informations
6629 if the format is < 5 so that afterwards the table can
6630 be read by lyx but without any format-info. Fixed the
6631 crash we experienced when not doing this.
6633 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6635 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6636 (RedoDrawingOfParagraph): ditto
6637 (RedoParagraphs): ditto
6638 (RemoveTableRow): ditto
6640 * src/text.C (Fill): rename arg paperwidth -> paper_width
6642 * src/buffer.C (insertLyXFile): rename var filename -> fname
6643 (writeFile): rename arg filename -> fname
6644 (writeFileAscii): ditto
6645 (makeLaTeXFile): ditto
6646 (makeLinuxDocFile): ditto
6647 (makeDocBookFile): ditto
6649 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6652 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6654 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6657 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6658 compiled by a C compiler not C++.
6660 * src/layout.h (LyXTextClass): added typedef for const_iterator
6661 (LyXTextClassList): added typedef for const_iterator + member
6662 functions begin and end.
6664 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6665 iterators to fill the choice_class.
6666 (updateLayoutChoice): rewritten to use iterators to fill the
6667 layoutlist in the toolbar.
6669 * src/BufferView.h (BufferView::work_area_width): removed unused
6672 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6674 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6675 (sgmlCloseTag): ditto
6677 * src/support/lstrings.h: return type of countChar changed to
6680 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6681 what version of this func to use. Also made to return unsigned int.
6683 * configure.in: call LYX_STD_COUNT
6685 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6686 conforming std::count.
6688 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6690 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6691 and a subscript would give bad display (patch from Dekel Tsur
6692 <dekel@math.tau.ac.il>).
6694 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6696 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6699 * src/chset.h: add a few 'using' directives
6701 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6702 triggered when no buffer is active
6704 * src/layout.C: removed `break' after `return' in switch(), since
6707 * src/lyx_main.C (init): make sure LyX can be ran in place even
6708 when libtool has done its magic with shared libraries. Fix the
6709 test for the case when the system directory has not been found.
6711 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6712 name for the latex file.
6713 (MenuMakeHTML): ditto
6715 * src/buffer.h: add an optional boolean argument, which is passed
6718 1999-12-20 Allan Rae <rae@lyx.org>
6720 * lib/templates/IEEEtran.lyx: small correction and update.
6722 * configure.in: Attempted to use LYX_PATH_HEADER
6724 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6726 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6727 input from JMarc. Now use preprocessor to find the header.
6728 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6729 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6730 LYX_STL_STRING_FWD. See comments in file.
6732 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6734 * The global MiniBuffer * minibuffer variable is dead.
6736 * The global FD_form_main * fd_form_main variable is dead.
6738 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6740 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6742 * src/table.h: add the LOstream.h header
6743 * src/debug.h: ditto
6745 * src/LyXAction.h: change the explaination of the ReadOnly
6746 attribute: is indicates that the function _can_ be used.
6748 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6751 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6753 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6759 * src/paragraph.C (GetWord): assert on pos>=0
6762 * src/support/lyxstring.C: condition the use of an invariant on
6764 * src/support/lyxstring.h: ditto
6766 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6767 Use LAssert.h instead of plain assert().
6769 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6771 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6772 * src/support/filetools.C: ditto
6774 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6777 * INSTALL: document the new configure flags
6779 * configure.in: suppress --with-debug; add --enable-assertions
6781 * acinclude.m4: various changes in alignment of help strings.
6783 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6785 * src/kbmap.C: commented out the use of the hash map in kb_map,
6786 beginning of movement to a stl::container.
6788 * several files: removed code that was not in effect when
6789 MOVE_TEXT was defined.
6791 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6792 for escaping should not be used. We can discuss if the string
6793 should be enclosed in f.ex. [] instead of "".
6795 * src/trans_mgr.C (insert): use the new returned value from
6796 encodeString to get deadkeys and keymaps done correctly.
6798 * src/chset.C (encodeString): changed to return a pair, to tell
6799 what to use if we know the string.
6801 * src/lyxscreen.h (fillArc): new function.
6803 * src/FontInfo.C (resize): rewritten to use more std::string like
6804 structore, especially string::replace.
6806 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6809 * configure.in (chmod +x some scripts): remove config/gcc-hack
6811 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6813 * src/buffer.C (writeFile): change once again the top comment in a
6814 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6815 instead of an hardcoded version number.
6816 (makeDocBookFile): ditto
6818 * src/version.h: add new define LYX_DOCVERSION
6820 * po/de.po: update from Pit Sütterlin
6821 * lib/bind/de_menus.bind: ditto.
6823 * src/lyxfunc.C (Dispatch): call MenuExport()
6824 * src/buffer.C (Dispatch): ditto
6826 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6827 LyXFunc::Dispatch().
6828 (MenuExport): new function, moved from
6829 LyXFunc::Dispatch().
6831 * src/trans_mgr.C (insert): small cleanup
6832 * src/chset.C (loadFile): ditto
6834 * lib/kbd/iso8859-1.cdef: add missing backslashes
6836 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6838 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6839 help with placing the manually drawn accents better.
6841 (Draw): x2 and hg changed to float to minimize rounding errors and
6842 help place the accents better.
6844 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6845 unsigned short to char is just wrong...cast the char to unsigned
6846 char instead so that the two values can compare sanely. This
6847 should also make the display of insetlatexaccents better and
6848 perhaps also some other insets.
6850 (lbearing): new function
6853 1999-12-15 Allan Rae <rae@lyx.org>
6855 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6856 header that provides a wrapper around the very annoying SGI STL header
6859 * src/support/lyxstring.C, src/LString.h:
6860 removed old SGI-STL-compatability attempts.
6862 * configure.in: Use LYX_STL_STRING_FWD.
6864 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6865 stl_string_fwd.h is around and try to determine it's location.
6866 Major improvement over previous SGI STL 3.2 compatability.
6867 Three small problems remain with this function due to my zero
6868 knowledge of autoconf. JMarc and lgb see the comments in the code.
6870 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6872 * src/broken_const.h, config/hack-gcc, config/README: removed
6874 * configure.in: remove --with-gcc-hack option; do not call
6877 * INSTALL: remove documentation of --with-broken-const and
6880 * acconfig.h: remove all trace of BROKEN_CONST define
6882 * src/buffer.C (makeDocBookFile): update version number in output
6884 (SimpleDocBookOnePar): fix an assert when trying to a character
6885 access beyond string length
6888 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6890 * po/de.po: fix the Export menu
6892 * lyx.man: update the description of -dbg
6894 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6895 (commandLineHelp): updated
6896 (easyParse): show list of available debug levels if -dbg is passed
6899 * src/Makefile.am: add debug.C
6901 * src/debug.h: moved some code to debug.C
6903 * src/debug.C: new file. Contains code to set and show debug
6906 * src/layout.C: remove 'break' after 'continue' in switch
6907 statements, since these cannot be reached.
6909 1999-12-13 Allan Rae <rae@lyx.org>
6911 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6912 (in_word_set): hash() -> math_hash()
6914 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6916 * acconfig.h: Added a test for whether we are using exceptions in the
6917 current compilation run. If so USING_EXCEPTIONS is defined.
6919 * config.in: Check for existance of stl_string_fwd.h
6920 * src/LString.h: If compiling --with-included-string and SGI's
6921 STL version 3.2 is present (see above test) we need to block their
6922 forward declaration of string and supply a __get_c_string().
6923 However, it turns out this is only necessary if compiling with
6924 exceptions enabled so I've a bit more to add yet.
6926 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6927 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6928 src/support/LRegex.h, src/undo.h:
6929 Shuffle the order of the included files a little to ensure that
6930 LString.h gets included before anything that includes stl_string_fwd.h
6932 * src/support/lyxstring.C: We need to #include LString.h instead of
6933 lyxstring.h to get the necessary definition of __get_c_string.
6934 (__get_c_string): New function. This is defined static just like SGI's
6935 although why they need to do this I'm not sure. Perhaps it should be
6936 in lstrings.C instead.
6938 * lib/templates/IEEEtran.lyx: New template file.
6940 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6942 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6943 * intl/Makefile.in (MKINSTALLDIRS): ditto
6945 * src/LyXAction.C (init): changed to hold the LFUN data in a
6946 automatic array in stead of in callso to newFunc, this speeds up
6947 compilation a lot. Also all the memory used by the array is
6948 returned when the init is completed.
6950 * a lot of files: compiled with -Wold-style-cast, changed most of
6951 the reported offenders to C++ style casts. Did not change the
6952 offenders in C files.
6954 * src/trans.h (Match): change argument type to unsigned int.
6956 * src/support/DebugStream.C: fix some types on the streambufs so
6957 that it works on a conforming implementation.
6959 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6961 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6963 * src/support/lyxstring.C: remove the inline added earlier since
6964 they cause a bunch of unsatisfied symbols when linking with dec
6965 cxx. Cxx likes to have the body of inlines at the place where they
6968 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6969 accessing negative bounds in array. This fixes the crash when
6970 inserting accented characters.
6971 * src/trans.h (Match): ditto
6973 * src/buffer.C (Dispatch): since this is a void, it should not try
6974 to return anything...
6976 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6978 * src/buffer.h: removed the two friends from Buffer. Some changes
6979 because of this. Buffer::getFileName and Buffer::setFileName
6980 renamed to Buffer::fileName() and Buffer::fileName(...).
6982 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6984 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6985 and Buffer::update(short) to BufferView. This move is currently
6986 controlled by a define MOVE_TEXT, this will be removed when all
6987 shows to be ok. This move paves the way for better separation
6988 between buffer contents and buffer view. One side effect is that
6989 the BufferView needs a rebreak when swiching buffers, if we want
6990 to avoid this we can add a cache that holds pointers to LyXText's
6991 that is not currently in use.
6993 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6996 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6998 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7000 * lyx_main.C: new command line option -x (or --execute) and
7001 -e (or --export). Now direct conversion from .lyx to .tex
7002 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7003 Unfortunately, X is still needed and the GUI pops up during the
7006 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7008 * src/Spacing.C: add a using directive to bring stream stuff into
7010 * src/paragraph.C: ditto
7011 * src/buffer.C: ditto
7013 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7014 from Lars' announcement).
7016 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7017 example files from Tino Meinen.
7019 1999-12-06 Allan Rae <rae@lyx.org>
7021 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7023 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7025 * src/support/lyxstring.C: added a lot of inline for no good
7028 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7029 latexWriteEndChanges, they were not used.
7031 * src/layout.h (operator<<): output operator for PageSides
7033 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7035 * some example files: loaded in LyX 1.0.4 and saved again to update
7036 certain constructs (table format)
7038 * a lot of files: did the change to use fstream/iostream for all
7039 writing of files. Done with a close look at Andre Poenitz's patch.
7041 * some files: whitespace changes.
7043 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7045 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7046 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7047 architecture, we provide our own. It is used unconditionnally, but
7048 I do not think this is a performance problem. Thanks to Angus
7049 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7050 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7052 (GetInset): use my_memcpy.
7056 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7057 it is easier to understand, but it uses less TeX-only constructs now.
7059 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7060 elements contain spaces
7062 * lib/configure: regenerated
7064 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7065 elements contain spaces; display the list of programs that are
7068 * autogen.sh: make sure lib/configure is executable
7070 * lib/examples/*: rename the tutorial examples to begin with the
7071 two-letters language code.
7073 * src/lyxfunc.C (getStatus): do not query current font if no
7076 * src/lyx_cb.C (RunScript): use QuoteName
7077 (MenuRunDvips): ditto
7078 (PrintApplyCB): ditto
7080 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7081 around argument, so that it works well with the current shell.
7082 Does not work properly with OS/2 shells currently.
7084 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7085 * src/LyXSendto.C (SendtoApplyCB): ditto
7086 * src/lyxfunc.C (Dispatch): ditto
7087 * src/buffer.C (runLaTeX): ditto
7088 (runLiterate): ditto
7089 (buildProgram): ditto
7091 * src/lyx_cb.C (RunScript): ditto
7092 (MenuMakeLaTeX): ditto
7094 * src/buffer.h (getLatexName): new method
7096 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7098 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7100 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7101 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7102 (create_math_panel): ditto
7104 * src/lyxfunc.C (getStatus): re-activate the code which gets
7105 current font and cursor; add test for export to html.
7107 * src/lyxrc.C (read): remove unreachable break statements; add a
7110 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7112 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7114 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7115 introduced by faulty regex.
7116 * src/buffer.C: ditto
7117 * src/lastfiles.C: ditto
7118 * src/paragraph.C: ditto
7119 * src/table.C: ditto
7120 * src/vspace.C: ditto
7121 * src/insets/figinset.C: ditto
7122 Note: most of these is absolutely harmless, except the one in
7123 src/mathed formula.C.
7125 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7127 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7128 operation, yielding correct results for the reLyX command.
7130 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7132 * src/support/filetools.C (ExpandPath): removed an over eager
7134 (ReplaceEnvironmentPath): ditto
7136 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7137 shows that we are doing something fishy in our code...
7141 * src/lyxrc.C (read): use a double switch trick to get more help
7142 from the compiler. (the same trick is used in layout.C)
7143 (write): new function. opens a ofstream and pass that to output
7144 (output): new function, takes a ostream and writes the lyxrc
7145 elemts to it. uses a dummy switch to make sure no elements are
7148 * src/lyxlex.h: added a struct pushpophelper for use in functions
7149 with more than one exit point.
7151 * src/lyxlex.[Ch] (GetInteger): made it const
7155 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7157 * src/layout.[hC] : LayoutTags splitted into several enums, new
7158 methods created, better error handling cleaner use of lyxlex. Read
7161 * src/bmtable.[Ch]: change some member prototypes because of the
7162 image const changes.
7164 * commandtags.h, src/LyXAction.C (init): new function:
7165 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7166 This file is not read automatically but you can add \input
7167 preferences to your lyxrc if you want to. We need to discuss how
7170 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7171 in .aux, also remove .bib and .bst files from dependencies when
7174 * src/BufferView.C, src/LyXView.C: add const_cast several places
7175 because of changes to images.
7177 * lib/images/*: same change as for images/*
7179 * lib/lyxrc.example: Default for accept_compound is false not no.
7181 * images/*: changed to be const, however I have som misgivings
7182 about this change so it might be changed back.
7184 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7186 * lib/configure, po/POTFILES.in: regenerated
7188 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7190 * config/lib_configure.m4: removed
7192 * lib/configure.m4: new file (was config/lib_configure.m4)
7194 * configure.in: do not test for rtti, since we do not use it.
7196 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7198 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7199 doubling of allocated space scheme. This makes it faster for large
7200 strings end to use less memory for small strings. xtra rememoved.
7202 * src/insets/figinset.C (waitalarm): commented out.
7203 (GhostscriptMsg): use static_cast
7204 (GhostscriptMsg): use new instead of malloc to allocate memory for
7205 cmap. also delete the memory after use.
7207 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7209 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7210 for changes in bibtex database or style.
7211 (runBibTeX): remove all .bib and .bst files from dep before we
7213 (run): use scanAuc in when dep file already exist.
7215 * src/DepTable.C (remove_files_with_extension): new method
7218 * src/DepTable.[Ch]: made many of the methods const.
7220 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7222 * src/bufferparams.C: make sure that the default textclass is
7223 "article". It used to be the first one by description order, but
7224 now the first one is "docbook".
7226 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7227 string; call Debug::value.
7228 (easyParse): pass complete argument to setDebuggingLevel().
7230 * src/debug.h (value): fix the code that parses debug levels.
7232 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7235 * src/LyXAction.C: use Debug::ACTION as debug channel.
7237 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7239 * NEWS: updated for the future 1.1.3 release.
7241 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7242 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7243 it should. This is of course a controversial change (since many
7244 people will find that their lyx workscreen is suddenly full of
7245 red), but done for the sake of correctness.
7247 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7248 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7250 * src/insets/inseterror.h, src/insets/inseturl.h,
7251 src/insets/insetinfo.h, src/insets/figinset.h,
7252 src/mathed/formulamacro.h, src/mathed/math_macro.h
7253 (EditMessage): add a missing const and add _() to make sure that
7256 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7257 src/insets/insetbib.C, src/support/filetools.C: add `using'
7260 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7261 doing 'Insert index of last word' at the beginning of a paragraph.
7263 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7265 * several files: white-space changes.
7267 * src/mathed/formula.C: removed IsAlpha and IsDigit
7269 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7270 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7273 * src/insets/figinset.C (GetPSSizes): don't break when
7274 "EndComments" is seen. But break when a boundingbox is read.
7276 * all classes inherited from Inset: return value of Clone
7277 changed back to Inset *.
7279 * all classes inherited form MathInset: return value of Clone
7280 changed back to MathedInset *.
7282 * src/insets/figinset.C (runqueue): use a ofstream to output the
7283 gs/ps file. Might need some setpresicion or setw. However I can
7284 see no problem with the current code.
7285 (runqueue): use sleep instead of the alarm/signal code. I just
7286 can't see the difference.
7288 * src/paragraph.C (LyXParagraph): reserve space in the new
7289 paragraph and resize the inserted paragraph to just fit.
7291 * src/lyxfunc.h (operator|=): added operator for func_status.
7293 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7294 check for readable file.
7296 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7297 check for readable file.
7298 (MenuMakeLinuxDoc): ditto
7299 (MenuMakeDocBook): ditto
7300 (MenuMakeAscii): ditto
7301 (InsertAsciiFile): split the test for openable and readable
7303 * src/bmtable.C (draw_bitmaptable): use
7304 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7306 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7307 findtexfile from LaTeX to filetools.
7309 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7310 instead of FilePtr. Needs to be verified by a literate user.
7312 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7314 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7315 (EditMessage): likewise.
7317 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7318 respectively as \textasciitilde and \textasciicircum.
7320 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7322 * src/support/lyxstring.h: made the methods that take iterators
7325 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7326 (regexMatch): made is use the real regex class.
7328 * src/support/Makefile.am: changed to use libtool
7330 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7332 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7334 (MathIsInset ++): changed several macros to be inline functions
7337 * src/mathed/Makefile.am: changed to use libtool
7339 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7341 * src/insets/inset* : Clone changed to const and return type is
7342 the true insettype not just Inset*.
7344 * src/insets/Makefile.am: changed to use libtool
7346 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7348 * src/undo.[Ch] : added empty() and changed some of the method
7351 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7353 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7354 setID use block<> for the bullets array, added const several places.
7356 * src/lyxfunc.C (getStatus): new function
7358 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7359 LyXAction, added const to several funtions.
7361 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7362 a std::map, and to store the dir items in a vector.
7364 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7367 * src/LyXView.[Ch] + other files : changed currentView to view.
7369 * src/LyXAction.[Ch] : ported from the old devel branch.
7371 * src/.cvsignore: added .libs and a.out
7373 * configure.in : changes to use libtool.
7375 * acinclude.m4 : inserted libtool.m4
7377 * .cvsignore: added libtool
7379 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7381 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7382 file name in insets and mathed directories (otherwise the
7383 dependency is not taken in account under cygwin).
7385 * src/text2.C (InsertString[AB]): make sure that we do not try to
7386 read characters past the string length.
7388 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7390 * lib/doc/LaTeXConfig.lyx.in,
7391 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7393 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7394 file saying who created them and when this heppened; this is
7395 useless and annoys tools like cvs.
7397 * lib/layouts/g-brief-{en,de}.layout,
7398 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7399 from Thomas Hartkens <thomas@hartkens.de>.
7401 * src/{insets,mathed}/Makefile.am: do not declare an empty
7402 LDFLAGS, so that it can be set at configure time (useful on Irix
7405 * lib/reLyX/configure.in: make sure that the prefix is set
7406 correctly in LYX_DIR.
7408 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7410 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7411 be used by 'command-sequence' this allows to bind a key to a
7412 sequence of LyX-commands
7413 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7415 * src/LyXAction.C: add "command-sequence"
7417 * src/LyXFunction.C: handling of "command-sequence"
7419 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7420 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7422 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7424 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7426 * src/buffer.C (writeFile): Do not output a comment giving user
7427 and date at the beginning of a .lyx file. This is useless and
7428 annoys cvs anyway; update version number to 1.1.
7430 * src/Makefile.am (LYX_DIR): add this definition, so that a
7431 default path is hardcoded in LyX.
7433 * configure.in: Use LYX_GNU_GETTEXT.
7435 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7436 AM_GNU_GETTEXT with a bug fixed.
7438 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7440 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7442 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7443 which is used to point to LyX data is now LYX_DIR_11x.
7445 * lyx.man: convert to a unix text file; small updates.
7447 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7449 * src/support/LSubstring.[Ch]: made the second arg of most of the
7450 constructors be a const reference.
7452 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7455 * src/support/lyxstring.[Ch] (swap): added missing member function
7456 and specialization of swap(str, str);
7458 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7460 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7461 trace of the old one.
7463 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7464 put the member definitions in undo.C.
7466 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7467 NEW_TEXT and have now only code that was included when this was
7470 * src/intl.C (LCombo): use static_cast
7472 (DispatchCallback): ditto
7474 * src/definitions.h: removed whole file
7476 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7478 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7479 parsing and stores in a std:map. a regex defines the file format.
7480 removed unneeded members.
7482 * src/bufferparams.h: added several enums from definitions.h here.
7483 Removed unsused destructor. Changed some types to use proper enum
7484 types. use block to have the temp_bullets and user_defined_bullets
7485 and to make the whole class assignable.
7487 * src/bufferparams.C (Copy): removed this functions, use a default
7490 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7493 * src/buffer.C (readLyXformat2): commend out all that have with
7494 oldpapersize to do. also comment out all that hve to do with
7495 insetlatex and insetlatexdel.
7496 (setOldPaperStuff): commented out
7498 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7500 * src/LyXAction.C: remove use of inset-latex-insert
7502 * src/mathed/math_panel.C (button_cb): use static_cast
7504 * src/insets/Makefile.am (insets_o_SOURCES): removed
7507 * src/support/lyxstring.C (helper): use the unsigned long
7508 specifier, UL, instead of a static_cast.
7510 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7512 * src/support/block.h: new file. to be used as a c-style array in
7513 classes, so that the class can be assignable.
7515 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7517 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7518 NULL, make sure to return an empty string (it is not possible to
7519 set a string to NULL).
7521 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7523 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7525 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7527 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7528 link line, so that Irix users (for example) can set it explicitely to
7531 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7532 it can be overidden at make time (static or dynamic link, for
7535 * src/vc-backend.C, src/LaTeXFeatures.h,
7536 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7537 statements to bring templates to global namespace.
7539 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7541 * src/support/lyxstring.C (operator[] const): make it standard
7544 * src/minibuffer.C (Init): changed to reflect that more
7545 information is given from the lyxvc and need not be provided here.
7547 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7549 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7551 * src/LyXView.C (UpdateTimerCB): use static_cast
7552 (KeyPressMask_raw_callback): ditto
7554 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7555 buffer_, a lot of changes because of this. currentBuffer() ->
7556 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7557 also changes to other files because of this.
7559 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7561 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7562 have no support for RCS and partial support for CVS, will be
7565 * src/insets/ several files: changes because of function name
7566 changes in Bufferview and LyXView.
7568 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7570 * src/support/LSubstring.[Ch]: new files. These implement a
7571 Substring that can be very convenient to use. i.e. is this
7573 string a = "Mary had a little sheep";
7574 Substring(a, "sheep") = "lamb";
7575 a is now "Mary has a little lamb".
7577 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7578 out patterns and subpatterns of strings. It is used by LSubstring
7579 and also by vc-backend.C
7581 * src/support/lyxstring.C: went over all the assertions used and
7582 tried to correct the wrong ones and flag which of them is required
7583 by the standard. some bugs found because of this. Also removed a
7584 couple of assertions.
7586 * src/support/Makefile.am (libsupport_a_SOURCES): added
7587 LSubstring.[Ch] and LRegex.[Ch]
7589 * src/support/FileInfo.h: have struct stat buf as an object and
7590 not a pointer to one, some changes because of this.
7592 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7593 information in layout when adding the layouts preamble to the
7596 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7599 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7600 because of bug in OS/2.
7602 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7604 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7605 \verbatim@font instead of \ttfamily, so that it can be redefined.
7607 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7608 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7609 src/layout.h, src/text2.C: add 'using' directive to bring the
7610 STL templates we need from the std:: namespace to the global one.
7611 Needed by DEC cxx in strict ansi mode.
7613 * src/support/LIstream.h,src/support/LOstream.h,
7614 src/support/lyxstring.h,src/table.h,
7615 src/lyxlookup.h: do not include <config.h> in header
7616 files. This should be done in the .C files only.
7618 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7622 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7624 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7625 from Kayvan to fix the tth invokation.
7627 * development/lyx.spec.in: updates from Kayvan to reflect the
7628 changes of file names.
7630 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7632 * src/text2.C (InsertStringB): use std::copy
7633 (InsertStringA): use std::copy
7635 * src/bufferlist.C: use a vector to store the buffers in. This is
7636 an internal change and should not affect any other thing.
7638 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7641 * src/text.C (Fill): fix potential bug, one off bug.
7643 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7645 * src/Makefile.am (lyx_main.o): add more files it depends on.
7647 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7649 * src/support/lyxstring.C: use size_t for the reference count,
7650 size, reserved memory and xtra.
7651 (internal_compare): new private member function. Now the compare
7652 functions should work for std::strings that have embedded '\0'
7654 (compare): all compare functions rewritten to use
7657 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7659 * src/support/lyxstring.C (compare): pass c_str()
7660 (compare): pass c_str
7661 (compare): pass c_str
7663 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7665 * src/support/DebugStream.C: <config.h> was not included correctly.
7667 * lib/configure: forgot to re-generate it :( I'll make this file
7668 auto generated soon.
7670 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7672 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7675 * src/support/lyxstring.C: some changes from length() to rep->sz.
7676 avoids a function call.
7678 * src/support/filetools.C (SpaceLess): yet another version of the
7679 algorithm...now per Jean-Marc's suggestions.
7681 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7683 * src/layout.C (less_textclass_desc): functor for use in sorting
7685 (LyXTextClass::Read): sort the textclasses after reading.
7687 * src/support/filetools.C (SpaceLess): new version of the
7688 SpaceLess functions. What problems does this one give? Please
7691 * images/banner_bw.xbm: made the arrays unsigned char *
7693 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7695 * src/support/lyxstring.C (find): remove bogus assertion in the
7696 two versions of find where this has not been done yet.
7698 * src/support/lyxlib.h: add missing int return type to
7701 * src/menus.C (ShowFileMenu): disable exporting to html if no
7702 html export command is present.
7704 * config/lib_configure.m4: add a test for an HTML converter. The
7705 programs checked for are, in this order: tth, latex2html and
7708 * lib/configure: generated from config/lib_configure.m4.
7710 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7711 html converter. The parameters are now passed through $$FName and
7712 $$OutName, instead of standard input/output.
7714 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7716 * lib/lyxrc.example: update description of \html_command.
7717 add "quotes" around \screen_font_xxx font setting examples to help
7718 people who use fonts with spaces in their names.
7720 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7722 * Distribution files: updates for v1.1.2
7724 * src/support/lyxstring.C (find): remove bogus assert and return
7725 npos for the same condition.
7727 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7729 * added patch for OS/2 from SMiyata.
7731 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7733 * src/text2.C (CutSelection): make space_wrapped a bool
7734 (CutSelection): dont declare int i until we have to.
7735 (alphaCounter): return a char const *.
7737 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7739 * src/support/syscall.C (Systemcalls::kill):
7740 src/support/filetools.C (PutEnv, PutEnvPath):
7741 src/lyx_cb.C (addNewlineAndDepth):
7742 src/FontInfo.C (FontInfo::resize): condition some #warning
7743 directives with WITH_WARNINGS.
7746 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7748 * src/layout.[Ch] + several files: access to class variables
7749 limited and made accessor functions instead a lot of code changed
7750 becuase of this. Also instead of returning pointers often a const
7751 reference is returned instead.
7753 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7755 * src/Makefile.am (dist-hook): added used to remove the CVS from
7756 cheaders upon creating a dist
7757 (EXTRA_DIST): added cheaders
7759 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7760 a character not as a small integer.
7762 * src/support/lyxstring.C (find): removed Assert and added i >=
7763 rep->sz to the first if.
7765 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7767 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7768 src/LyXView.C src/buffer.C src/bufferparams.C
7769 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7770 src/text2.C src/insets/insetinclude.C:
7771 lyxlayout renamed to textclasslist.
7773 * src/layout.C: some lyxerr changes.
7775 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7776 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7777 (LyXLayoutList): removed all traces of this class.
7778 (LyXTextClass::Read): rewrote LT_STYLE
7779 (LyXTextClass::hasLayout): new function
7780 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7781 both const and nonconst version.
7782 (LyXTextClass::delete_layout): new function.
7783 (LyXTextClassList::Style): bug fix. do the right thing if layout
7785 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7786 (LyXTextClassList::NameOfLayout): ditto
7787 (LyXTextClassList::Load): ditto
7789 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7791 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7793 * src/LyXAction.C (LookupFunc): added a workaround for sun
7794 compiler, on the other hand...we don't know if the current code
7795 compiles on sun at all...
7797 * src/support/filetools.C (CleanupPath): subst fix
7799 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7802 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7803 complained about this one?
7805 * src/insets/insetinclude.C (Latex): subst fix
7807 * src/insets/insetbib.C (getKeys): subst fix
7809 * src/LyXSendto.C (SendtoApplyCB): subst fix
7811 * src/lyx_main.C (init): subst fix
7813 * src/layout.C (Read): subst fix
7815 * src/lyx_sendfax_main.C (button_send): subst fix
7817 * src/buffer.C (RoffAsciiTable): subst fix
7819 * src/lyx_cb.C (MenuFax): subst fix
7820 (PrintApplyCB): subst fix
7822 1999-10-26 Juergen Vigna <jug@sad.it>
7824 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7826 (Read): Cleaned up this code so now we read only format vestion >= 5
7828 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7830 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7831 come nobody has complained about this one?
7833 * src/insets/insetinclude.C (Latex): subst fix
7835 * src/insets/insetbib.C (getKeys): subst fix
7837 * src/lyx_main.C (init): subst fix
7839 * src/layout.C (Read): subst fix
7841 * src/buffer.C (RoffAsciiTable): subst fix
7843 * src/lyx_cb.C (MenuFax): subst fix.
7845 * src/layout.[hC] + some other files: rewrote to use
7846 std::container to store textclasses and layouts in.
7847 Simplified, removed a lot of code. Make all classes
7848 assignable. Further simplifications and review of type
7849 use still to be one.
7851 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7852 lastfiles to create the lastfiles partr of the menu.
7854 * src/lastfiles.[Ch]: rewritten to use deque to store the
7855 lastfiles in. Uses fstream for reading and writing. Simplifies
7858 * src/support/syscall.C: remove explicit cast.
7860 * src/BufferView.C (CursorToggleCB): removed code snippets that
7862 use explicat C++ style casts instead of C style casts. also use
7863 u_vdata instea of passing pointers in longs.
7865 * src/PaperLayout.C: removed code snippets that were commented out.
7867 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7869 * src/lyx_main.C: removed code snippets that wer commented out.
7871 * src/paragraph.C: removed code snippets that were commented out.
7873 * src/lyxvc.C (logClose): use static_cast
7875 (viewLog): remove explicit cast to void*
7876 (showLog): removed old commented code
7878 * src/menus.C: use static_cast instead of C style casts. use
7879 u_vdata instead of u_ldata. remove explicit cast to (long) for
7880 pointers. Removed old code that was commented out.
7882 * src/insets/inset.C: removed old commented func
7884 * src/insets/insetref.C (InsetRef): removed old code that had been
7885 commented out for a long time.
7887 (escape): removed C style cast
7889 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7891 * src/insets/insetlatex.C (Draw): removed old commented code
7892 (Read): rewritten to use string
7894 * src/insets/insetlabel.C (escape): removed C style cast
7896 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7898 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7901 * src/insets/insetinclude.h: removed a couple of stupid bools
7903 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7904 (Clone): remove C style cast
7905 (getKeys): changed list to lst because of std::list
7907 * src/insets/inseterror.C (Draw): removed som old commented code.
7909 * src/insets/insetcommand.C (Draw): removed some old commented code.
7911 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7912 commented out forever.
7913 (bibitem_cb): use static_cast instead of C style cast
7914 use of vdata changed to u_vdata.
7916 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7918 (CloseUrlCB): use static_cast instead of C style cast.
7919 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7921 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7922 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7923 (CloseInfoCB): static_cast from ob->u_vdata instead.
7924 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7927 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7928 (C_InsetError_CloseErrorCB): forward the ob parameter
7929 (CloseErrorCB): static_cast from ob->u_vdata instead.
7931 * src/vspace.h: include LString.h since we use string in this class.
7933 * src/vspace.C (lyx_advance): changed name from advance because of
7934 nameclash with stl. And since we cannot use namespaces yet...I
7935 used a lyx_ prefix instead. Expect this to change when we begin
7938 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7940 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7941 and removed now defunct constructor and deconstructor.
7943 * src/BufferView.h: have backstack as a object not as a pointer.
7944 removed initialization from constructor. added include for BackStack
7946 * development/lyx.spec.in (%build): add CFLAGS also.
7948 * src/screen.C (drawFrame): removed another warning.
7950 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7952 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7953 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7954 README and ANNOUNCE a bit for the next release. More work is
7957 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7958 unbreakable if we are in freespacing mode (LyX-Code), but not in
7961 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7963 * src/BackStack.h: fixed initialization order in constructor
7965 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7967 * acinclude.m4 (VERSION): new rules for when a version is
7968 development, added also a variable for prerelease.
7969 (warnings): we set with_warnings=yes for prereleases
7970 (lyx_opt): prereleases compile with same optimization as development
7971 (CXXFLAGS): only use pedantic if we are a development version
7973 * src/BufferView.C (restorePosition): don't do anything if the
7976 * src/BackStack.h: added member empty, use this to test if there
7977 is anything to pop...
7979 1999-10-25 Juergen Vigna <jug@sad.it>
7982 * forms/layout_forms.fd +
7983 * forms/latexoptions.fd +
7984 * lyx.fd: changed for various form resize issues
7986 * src/mathed/math_panel.C +
7987 * src/insets/inseterror.C +
7988 * src/insets/insetinfo.C +
7989 * src/insets/inseturl.C +
7990 * src/insets/inseturl.h +
7993 * src/PaperLayout.C +
7994 * src/ParagraphExtra.C +
7995 * src/TableLayout.C +
7997 * src/layout_forms.C +
8004 * src/menus.C: fixed various resize issues. So now forms can be
8005 resized savely or not be resized at all.
8007 * forms/form_url.fd +
8008 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8011 * src/insets/Makefile.am: added files form_url.[Ch]
8013 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8015 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8016 (and presumably 6.2).
8018 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8019 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8020 remaining static member callbacks.
8022 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8025 * src/support/lyxstring.h: declare struct Srep as friend of
8026 lyxstring, since DEC cxx complains otherwise.
8028 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8030 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8032 * src/LaTeX.C (run): made run_bibtex also depend on files with
8034 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8035 are put into the dependency file.
8037 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8038 the code has shown itself to work
8039 (create_ispell_pipe): removed another warning, added a comment
8042 * src/minibuffer.C (ExecutingCB): removed code that has been
8043 commented out a long time
8045 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8046 out code + a warning.
8048 * src/support/lyxstring.h: comment out the three private
8049 operators, when compiling with string ansi conforming compilers
8052 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8054 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8055 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8058 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8061 * src/mathed/math_panel.C (create_math_panel): remove explicit
8064 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8067 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8068 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8069 to XCreatePixmapFromBitmapData
8070 (fl_set_bmtable_data): change the last argument to be unsigned
8072 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8073 and bh to be unsigned int, remove explicit casts in call to
8074 XReadBitmapFileData.
8076 * images/arrows.xbm: made the arrays unsigned char *
8077 * images/varsz.xbm: ditto
8078 * images/misc.xbm: ditto
8079 * images/greek.xbm: ditto
8080 * images/dots.xbm: ditto
8081 * images/brel.xbm: ditto
8082 * images/bop.xbm: ditto
8084 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8086 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8087 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8088 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8090 (LYX_CXX_CHEADERS): added <clocale> to the test.
8092 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8094 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8096 * src/support/lyxstring.C (append): fixed something that must be a
8097 bug, rep->assign was used instead of rep->append.
8099 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8102 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8103 lyx insert double chars. Fix spotted by Kayvan.
8105 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8107 * Fixed the tth support. I messed up with the Emacs patch apply feature
8108 and omitted the changes in lyxrc.C.
8110 1999-10-22 Juergen Vigna <jug@sad.it>
8112 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8114 * src/lyx_cb.C (MenuInsertRef) +
8115 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8116 the form cannot be resized under it limits (fixes a segfault)
8118 * src/lyx.C (create_form_form_ref) +
8119 * forms/lyx.fd: Changed Gravity on name input field so that it is
8122 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8124 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8125 <ostream> and <istream>.
8127 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8128 whether <fstream> provides the latest standard features, or if we
8129 have an oldstyle library (like in egcs).
8130 (LYX_CXX_STL_STRING): fix the test.
8132 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8133 code on MODERN_STL_STREAM.
8135 * src/support/lyxstring.h: use L{I,O}stream.h.
8137 * src/support/L{I,O}stream.h: new files, designed to setup
8138 correctly streams for our use
8139 - includes the right header depending on STL capabilities
8140 - puts std::ostream and std::endl (for LOStream.h) or
8141 std::istream (LIStream.h) in toplevel namespace.
8143 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8145 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8146 was a bib file that had been changed we ensure that bibtex is run.
8147 (runBibTeX): enhanced to extract the names of the bib files and
8148 getting their absolute path and enter them into the dep file.
8149 (findtexfile): static func that is used to look for tex-files,
8150 checks for absolute patchs and tries also with kpsewhich.
8151 Alternative ways of finding the correct files are wanted. Will
8153 (do_popen): function that runs a command using popen and returns
8154 the whole output of that command in a string. Should be moved to
8157 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8158 file with extension ext has changed.
8160 * src/insets/figinset.C: added ifdef guards around the fl_free
8161 code that jug commented out. Now it is commented out when
8162 compiling with XForms == 0.89.
8164 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8165 to lyxstring.C, and only keep a forward declaration in
8166 lyxstring.h. Simplifies the header file a bit and should help a
8167 bit on compile time too. Also changes to Srep will not mandate a
8168 recompile of code just using string.
8169 (~lyxstring): definition moved here since it uses srep.
8170 (size): definition moved here since it uses srep.
8172 * src/support/lyxstring.h: removed a couple of "inline" that should
8175 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8177 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8180 1999-10-21 Juergen Vigna <jug@sad.it>
8182 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8183 set to left if I just remove the width entry (or it is empty).
8185 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8186 paragraph when having dummy paragraphs.
8188 1999-10-20 Juergen Vigna <jug@sad.it>
8190 * src/insets/figinset.C: just commented some fl_free_form calls
8191 and added warnings so that this calls should be activated later
8192 again. This avoids for now a segfault, but we have a memory leak!
8194 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8195 'const char * argument' to 'string argument', this should
8196 fix some Asserts() in lyxstring.C.
8198 * src/lyxfunc.h: Removed the function argAsString(const char *)
8199 as it is not used anymore.
8201 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8203 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8206 * src/Literate.h: some funcs moved from public to private to make
8207 interface clearer. Unneeded args removed.
8209 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8211 (scanBuildLogFile): ditto
8213 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8214 normal TeX Error. Still room for improvement.
8216 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8218 * src/buffer.C (insertErrors): changes to make the error
8219 desctription show properly.
8221 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8224 * src/support/lyxstring.C (helper): changed to use
8225 sizeof(object->rep->ref).
8226 (operator>>): changed to use a pointer instead.
8228 * src/support/lyxstring.h: changed const reference & to value_type
8229 const & lets see if that helps.
8231 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8233 * Makefile.am (rpmdist): fixed to have non static package and
8236 * src/support/lyxstring.C: removed the compilation guards
8238 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8241 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8242 conditional compile of lyxstring.Ch
8244 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8245 stupid check, but it is a lot better than the bastring hack.
8246 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8248 * several files: changed string::erase into string::clear. Not
8251 * src/chset.C (encodeString): use a char temporary instead
8253 * src/table.C (TexEndOfCell): added tostr around
8254 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8255 (TexEndOfCell): ditto
8256 (TexEndOfCell): ditto
8257 (TexEndOfCell): ditto
8258 (DocBookEndOfCell): ditto
8259 (DocBookEndOfCell): ditto
8260 (DocBookEndOfCell): ditto
8261 (DocBookEndOfCell): ditto
8263 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8265 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8267 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8268 (MenuBuildProg): added tostr around ret
8269 (MenuRunChktex): added tostr around ret
8270 (DocumentApplyCB): added tostr around ret
8272 * src/chset.C (encodeString): added tostr around t->ic
8274 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8275 (makeLaTeXFile): added tostr around tocdepth
8276 (makeLaTeXFile): added tostr around ftcound - 1
8278 * src/insets/insetbib.C (setCounter): added tostr around counter.
8280 * src/support/lyxstring.h: added an operator+=(int) to catch more
8283 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8284 (lyxstring): We DON'T allow NULL pointers.
8286 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8288 * src/mathed/math_macro.C (MathMacroArgument::Write,
8289 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8290 when writing them out.
8292 * src/LString.C: remove, since it is not used anymore.
8294 * src/support/lyxstring.C: condition the content to
8295 USE_INCLUDED_STRING macro.
8297 * src/mathed/math_symbols.C, src/support/lstrings.C,
8298 src/support/lyxstring.C: add `using' directive to specify what
8299 we need in <algorithm>. I do not think that we need to
8300 conditionalize this, but any thought is appreciated.
8302 * many files: change all callback functions to "C" linkage
8303 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8304 strict_ansi. Those who were static are now global.
8305 The case of callbacks which are static class members is
8306 trickier, since we have to make C wrappers around them (see
8307 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8308 did not finish this yet, since it defeats the purpose of
8309 encapsulation, and I am not sure what the best route is.
8311 1999-10-19 Juergen Vigna <jug@sad.it>
8313 * src/support/lyxstring.C (lyxstring): we permit to have a null
8314 pointer as assignment value and just don't assign it.
8316 * src/vspace.C (nextToken): corrected this function substituting
8317 find_first(_not)_of with find_last_of.
8319 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8320 (TableOptCloseCB) (TableSpeCloseCB):
8321 inserted fl_set_focus call for problem with fl_hide_form() in
8324 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8326 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8329 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8331 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8332 LyXLex::next() and not eatline() to get its argument.
8334 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8336 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8337 instead, use fstreams for io of the depfile, removed unneeded
8338 functions and variables.
8340 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8341 vector instead, removed all functions and variables that is not in
8344 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8346 * src/buffer.C (insertErrors): use new interface to TeXError
8348 * Makefile.am (rpmdist): added a rpmdist target
8350 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8351 per Kayvan's instructions.
8353 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8355 * src/Makefile.am: add a definition for localedir, so that locales
8356 are found after installation (Kayvan)
8358 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8360 * development/.cvsignore: new file.
8362 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8364 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8365 C++ compiler provides wrappers for C headers and use our alternate
8368 * configure.in: use LYX_CXX_CHEADERS.
8370 * src/cheader/: new directory, populated with cname headers from
8371 libstdc++-2.8.1. They are a bit old, but probably good enough for
8372 what we want (support compilers who lack them).
8374 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8375 from includes. It turns out is was stupid.
8377 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8379 * lib/Makefile.am (install-data-local): forgot a ';'
8380 (install-data-local): forgot a '\'
8381 (libinstalldirs): needed after all. reintroduced.
8383 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8385 * configure.in (AC_OUTPUT): added lyx.spec
8387 * development/lyx.spec: removed file
8389 * development/lyx.spec.in: new file
8391 * po/*.po: merged with lyx.pot becuase of make distcheck
8393 * lib/Makefile.am (dist-hook): added dist-hook so that
8394 documentation files will be included when doing a make
8395 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8396 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8398 more: tried to make install do the right thing, exclude CVS dirs
8401 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8402 Path would fit in more nicely.
8404 * all files that used to use pathstack: uses now Path instead.
8405 This change was a lot easier than expected.
8407 * src/support/path.h: new file
8409 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8411 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8413 * src/support/lyxstring.C (getline): Default arg was given for
8416 * Configure.cmd: removed file
8418 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8420 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8421 streams classes and types, add the proper 'using' statements when
8422 MODERN_STL is defined.
8424 * src/debug.h: move the << operator definition after the inclusion
8427 * src/support/filetools.C: include "LAssert.h", which is needed
8430 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8433 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8434 include "debug.h" to define a proper ostream.
8436 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8438 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8439 method to the SystemCall class which can kill a process, but it's
8440 not fully implemented yet.
8442 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8444 * src/support/FileInfo.h: Better documentation
8446 * src/lyxfunc.C: Added support for buffer-export html
8448 * src/menus.C: Added Export->As HTML...
8450 * lib/bind/*.bind: Added short-cut for buffer-export html
8452 * src/lyxrc.*: Added support for new \tth_command
8454 * lib/lyxrc.example: Added stuff for new \tth_command
8456 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * lib/Makefile.am (IMAGES): removed images/README
8459 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8460 installes in correct place. Check permisions is installed
8463 * src/LaTeX.C: some no-op changes moved declaration of some
8466 * src/LaTeX.h (LATEX_H): changed include guard name
8468 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8470 * lib/reLyX/Makefile.am: install noweb2lyx.
8472 * lib/Makefile.am: install configure.
8474 * lib/reLyX/configure.in: declare a config aux dir; set package
8475 name to lyx (not sure what the best solution is); generate noweb2lyx.
8477 * lib/layouts/egs.layout: fix the bibliography layout.
8479 1999-10-08 Jürgen Vigna <jug@sad.it>
8481 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8482 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8483 it returned without continuing to search the path.
8485 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8487 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8488 also fixes a bug. It is not allowed to do tricks with std::strings
8489 like: string a("hei"); &a[e]; this will not give what you
8490 think... Any reason for the complexity in this func?
8492 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8494 * Updated README and INSTALL a bit, mostly to check that my
8495 CVS rights are correctly set up.
8497 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8499 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8500 does not allow '\0' chars but lyxstring and std::string does.
8502 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8504 * autogen.sh (AUTOCONF): let the autogen script create the
8505 POTFILES.in file too. POTFILES.in should perhaps now not be
8506 included in the cvs module.
8508 * some more files changed to use C++ includes instead of C ones.
8510 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8512 (Reread): added tostr to nlink. buggy output otherwise.
8513 (Reread): added a string() around szMode when assigning to Buffer,
8514 without this I got a log of garbled info strings.
8516 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8519 * I have added several ostream & operator<<(ostream &, some_type)
8520 functions. This has been done to avoid casting and warnings when
8521 outputting enums to lyxerr. This as thus eliminated a lot of
8522 explicit casts and has made the code clearer. Among the enums
8523 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8524 mathed enums, some font enum the Debug::type enum.
8526 * src/support/lyxstring.h (clear): missing method. equivalent of
8529 * all files that contained "stderr": rewrote constructs that used
8530 stderr to use lyxerr instead. (except bmtable)
8532 * src/support/DebugStream.h (level): and the passed t with
8533 Debug::ANY to avoid spurious bits set.
8535 * src/debug.h (Debug::type value): made it accept strings of the
8538 * configure.in (Check for programs): Added a check for kpsewhich,
8539 the latex generation will use this later to better the dicovery of
8542 * src/BufferView.C (create_view): we don't need to cast this to
8543 (void*) that is done automatically.
8544 (WorkAreaButtonPress): removed some dead code.
8546 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8548 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8549 is not overwritten when translated (David Sua'rez de Lis).
8551 * lib/CREDITS: Added David Sua'rez de Lis
8553 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8555 * src/bufferparams.C (BufferParams): default input encoding is now
8558 * acinclude.m4 (cross_compiling): comment out macro
8559 LYX_GXX_STRENGTH_REDUCE.
8561 * acconfig.h: make sure that const is not defined (to empty) when
8562 we are compiling C++. Remove commented out code using SIZEOF_xx
8565 * configure.in : move the test for const and inline as late as
8566 possible so that these C tests do not interefere with C++ ones.
8567 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8568 has not been proven.
8570 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8572 * src/table.C (getDocBookAlign): remove bad default value for
8575 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8577 (ShowFileMenu2): ditto.
8579 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8582 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8584 * Most files: finished the change from the old error code to use
8585 DebugStream for all lyxerr debugging. Only minor changes remain
8586 (e.g. the setting of debug levels using strings instead of number)
8588 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8590 * src/layout.C (Add): Changed to use compare_no_case instead of
8593 * src/FontInfo.C: changed loop variable type too string::size_type.
8595 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8597 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8598 set ETAGS_ARGS to --c++
8600 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8602 * src/table.C (DocBookEndOfCell): commented out two unused variables
8604 * src/paragraph.C: commented out four unused variables.
8606 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8607 insed a if clause with type string::size_type.
8609 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8612 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8614 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8615 variable, also changed loop to go from 0 to lenght + 1, instead of
8616 -1 to length. This should be correct.
8618 * src/LaTeX.C (scanError): use string::size_type as loop variable
8621 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8622 (l.896) since y_tmp and row was not used anyway.
8624 * src/insets/insetref.C (escape): use string::size_type as loop
8627 * src/insets/insetquotes.C (Width): use string::size_type as loop
8629 (Draw): use string::size_type as loop variable type.
8631 * src/insets/insetlatexaccent.C (checkContents): use
8632 string::size_type as loop variable type.
8634 * src/insets/insetlabel.C (escape): use string::size_type as loop
8637 * src/insets/insetinfo.C: added an extern for current_view.
8639 * src/insets/insetcommand.C (scanCommand): use string::size_type
8640 as loop variable type.
8642 * most files: removed the RCS tags. With them we had to recompile
8643 a lot of files after a simple cvs commit. Also we have never used
8644 them for anything meaningful.
8646 * most files: tags-query-replace NULL 0. As adviced several plases
8647 we now use "0" instead of "NULL" in our code.
8649 * src/support/filetools.C (SpaceLess): use string::size_type as
8652 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8654 * src/paragraph.C: fixed up some more string stuff.
8656 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8658 * src/support/filetools.h: make modestr a std::string.
8660 * src/filetools.C (GetEnv): made ch really const.
8662 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8663 made code that used these use max/min from <algorithm> instead.
8665 * changed several c library include files to their equivalent c++
8666 library include files. All is not changed yet.
8668 * created a support subdir in src, put lyxstring and lstrings
8669 there + the extra files atexit, fileblock, strerror. Created
8670 Makefile.am. edited configure.in and src/Makefile.am to use this
8671 new subdir. More files moved to support.
8673 * imported som of the functions from repository lyx, filetools
8675 * ran tags-query-replace on LString -> string, corrected the bogus
8676 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8677 is still some errors in there. This is errors where too much or
8678 too litle get deleted from strings (string::erase, string::substr,
8679 string::replace), there can also be some off by one errors, or
8680 just plain wrong use of functions from lstrings. Viewing of quotes
8683 * LyX is now running fairly well with string, but there are
8684 certainly some bugs yet (see above) also string is quite different
8685 from LString among others in that it does not allow null pointers
8686 passed in and will abort if it gets any.
8688 * Added the revtex4 files I forgot when setting up the repository.
8690 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8692 * All over: Tried to clean everything up so that only the files
8693 that we really need are included in the cvs repository.
8694 * Switched to use automake.
8695 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8696 * Install has not been checked.
8698 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8700 * po/pt.po: Three errors:
8701 l.533 and l.538 format specification error
8702 l. 402 duplicate entry, I just deleted it.