1 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
3 * README: add mention of broken ghostscript versions, remove
4 reference to non-existent BUGS file
6 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
8 * src/support/lstrings.C (compare_no_case): small fix. When passed
9 length, should use it in the size comparison.
11 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13 * src/lyxlookup.C: do not condition on FL_REVISION.
16 * src/sp_form.C: fix the font size of some text entries
18 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
19 after TOC when there is no TOC.
21 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
22 bind file if it has not been done yet.
23 (read): remove local bindFile variable. Try to fix the handling of
24 RC_BIND and RC_BINDFILE.
26 * src/lyx_main.C (init): use readBindFileIfNeeded().
28 * lib/languages: Change description of german to "German (new
31 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
33 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
34 "Apply" buttons if arg is non-zero.
36 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
37 launching the popup if sufficient info is passed to
40 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
42 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
43 labels (disabled in 1.1.6).
45 * src/lyxrc.[Ch]: New variable label_init_length
47 * mathed/formula.C (LocalDispatch): Preserve the label when
48 changing from display math to eqnarray (however, the label
49 do not appear at the first line, as one might expects, but at the
51 (LocalDispatch): When inserting a label to a formula which already
52 have a label, the old label is used as default value.
53 Also, if the label is changed, then all references to the label
56 * src/mathed/math_iter.C (setLabel): Allow to set the label
57 even if it is empty. This is needed to allow deletion of a label
60 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
61 refernces only if the old label appears once in the document.
63 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
65 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
66 <gehlert@Rcs1.urz.tu-dresden.de>
68 * src/frontends/xforms/FormBase.C: comment out debug.h
70 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
71 code in xform_helpers instead.
72 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
74 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
75 Use N_(), rather than _() when creating strings to pass to browseFile()
76 because browseFile calls gettext() itself now.
78 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
79 display the filename correctly.
81 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
83 * src/converter.C (Move): New method. Used to move file or files
84 from temp dir to the output dir. (this fixes the bug that
85 exporting linuxdoc/docbook document to html would not move all
86 html file from temp directory).
88 * src/support/filetools.C (DirList): Fixed.
90 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
92 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
94 * src/converter.C (Add): Remove $$i when setting latex_command.
96 * src/text.C (IsBoundary): Return false when pos = 0.
98 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
100 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
102 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
104 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
105 need to empty the fields to turn off use of the geometry package!
107 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
109 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
110 (Buffer const &), not a (BufferParams const &) and so fix a crash
111 caused by using current_view before it had been initialised. Not
112 the best way to do this, but much easier than changing
113 Inset::Clone(Buffer const &) to Inset::Clone().
116 * src/tabular.C: changed call to CopyIntoMinibuffer().
118 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
120 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
122 * src/lyxfunc.C (getStatus): disable insertion of floats in a
125 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
127 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
128 changed filter for screen fonts input filter from int to float
130 * src/frontends/xforms/input_validators.c: removed.
131 * src/frontends/xforms/input_validators.C: new file. Can now call C++
132 functions from within the filter functions.
134 * src/frontends/xforms/input_validators.[Ch]
135 (fl_unsigned_float_filter): new filter function.
137 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
138 confused now! And if you think I'm going to do this in
139 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
141 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
143 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
145 * src/WorkArea.C (work_area_handler): don't handle button requests
146 if xbutton.button == 0
148 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
150 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
151 It creates a lot of interesting problems.
153 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
155 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
156 the menu exists in the current menubar before opening it.
158 * src/MenuBackend.C (hasSubmenu): new method.
160 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
161 action value by offsetting actions by a large constant (so that
162 bogs choice result will be less than this constant).
164 * lib/bind/fi_menus.bind: more cleanup to menus.
165 * lib/bind/sciword.bind: ditto.
166 * lib/bind/xemacs.bind: ditto.
167 * lib/bind/emacs.bind: ditto.
168 * lib/bind/pt_menus.bind: ditto.
169 * lib/bind/hu_menus.bind: ditto.
171 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
173 * INSTALL: update PROBLEMS section.
175 * src/lyxlookup.h: remove condition on xforms version, since we
176 should not include it if not appropriate.
178 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
180 * src/LColor.C: "latex text" -> "latex inset" (from
183 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
185 * src/frontends/kde/FormTabularCreate.C:
186 * src/frontends/kde/citationdlg.C:
187 * src/frontends/kde/copyrightdlg.C:
188 * src/frontends/kde/paradlg.C:
189 * src/frontends/kde/paraextradlg.C:
190 * src/frontends/kde/parageneraldlg.C:
191 * src/frontends/kde/printdlg.C:
192 * src/frontends/kde/refdlg.C:
193 * src/frontends/kde/tabcreatedlg.C:
194 * src/frontends/kde/tocdlg.C:
195 * src/frontends/kde/urldlg.C: add necessary headers
198 * src/frontends/kde/dlg/emptytable.C:
199 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
200 default parameters (from Angus Leeming)
202 * src/frontends/kde/dlg/moc/.cvsignore:
203 * src/frontends/kde/dlg/.cvsignore:
204 * src/frontends/kde/moc/.cvsignore: fix the library name
207 * src/frontends/kde/paradlg.C:
208 * src/frontends/kde/parageneraldlg.C:
209 * src/frontends/kde/dlg/para.dlg:
210 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
212 * src/frontends/kde/dlg/README: clarified qtarch version
214 * src/frontends/kde/dlg/Makefile.am: removed the
215 dlg rules as they created spontaneous rebuilds
216 (not a good idea as it requires qtarch)
218 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
220 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
221 fixlevel along with xforms version.
223 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
224 xforms version is strictly less than 0.89.5.
225 * src/lyx_gui.C (LyXGUI): ditto.
226 * src/LyXView.C (show): ditto.
228 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
230 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
231 movement in inset in RTL text.
232 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
233 (workAreaButtonRelease): Do not open a float when there is a selection.
235 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
237 * src/spellchecker.C (RunSpellChecker): Open all floats before
240 * src/text.C (InsertChar): Consider "," as a part of a number
241 (for LTR numbers in RTL text code).
242 (IsBoundary): Fixed (and simplified).
243 (InsertChar): Recalculate cursor boundary.
246 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
248 * src/spellchecker.C: fix figures with pspell enabled
250 * src/insets/figinset.C: workaround for gs hang xforms bug
252 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
254 * lib/bind/??_menus.bind: comment out the entries corresponding to
255 real menus. They should be eventually removed, but I'll let the
256 language maintainers do that.
258 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
260 * src/frontends/kde/parageneraldlg.C:
261 * src/frontends/kde/parageneraldlg.h: don't use
262 a derived class for SpaceAbove/Below
264 * src/frontends/kde/dlg/README: add some info
266 * src/frontends/kde/dlg/*: update data files, update
269 * src/frontends/kde/dlg/moc/Makefile.am: add
272 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
274 * configure.in: add new KDE Makefiles
275 * src/vspace.h: return GlueLength not a normal one
276 * src/support/lstrings.h:
277 * src/support/lstrings.C: add isStrUnsignedInt(),
280 * src/frontends/kde/*: big reorganisation, update
281 FormParagraph, add FormTabCreate
283 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
285 * lib/ui/default.ui: small grammatical change.
287 * src/frontends/xforms/xform_macros.h: removed.
289 * src/frontends/xforms/FormBase.C:
290 * src/frontends/xforms/FormPreferences.C:
291 * src/frontends/xforms/Makefile.am: changes associated with removing
292 xform_macros.h. Should make Lars' debugging a little easier.
294 * src/frontends/xforms/FormPreferences.C:
295 * src/frontends/xforms/FormPreferences.h:
296 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
297 longer use X11 color name database. HSV and RGB dials/sliders.
298 Please let this be the end of this!
300 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
302 * Several files: Allow compilation when the compiler doesn't
305 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
308 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
309 command line options.
311 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
313 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
314 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
317 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
319 * src/frontends/xforms/FormRef.C (updateBrowser):
320 * src/frontends/xforms/forms/form_ref.fd: try clicking on
321 different insets with the sort key active. Now apply this patch!
323 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
325 * src/frontends/xforms/FormPrint.C: set to valid()
326 when we update from the passed parameters.
328 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
330 * src/LColor.C (getFromGUIName): internationalise the comparison.
332 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
333 FormPreferences choice.
335 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
338 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
340 * src/lyxrc.C: more detail for the printer program config
343 * src/LColor.C: ert->latex text. LColor needs a big revamp
344 but will have to wait till after 1.1.6
346 * src/buffer.C: bring up a dialog if we load a document
347 with an un-installed text class, rather than just complain
350 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
352 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
353 the browser form for a combox in a tabbed folder. Bug fix courtesy of
354 Steve Lamont <spl@ncmir.ucsd.edu>.
356 * src/frontends/xforms/FormDocument.C (build):
357 * src/frontends/xforms/FormPreferences.C (Language::build):
358 pass tabfolders to Combox::add() in order to use this work around.
360 * src/frontends/xforms/FormCitation.C (connect): remove max size
362 (update): sort list of bibliography keys.
364 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
366 No max size limitation. Same popup for new and existing insets. Fixes
367 bugs reported by Rob Lahaye.
369 * src/frontends/xforms/FormCitation.C (c-tor):
370 * src/frontends/xforms/FormCopyright.C (c-tor):
371 * src/frontends/xforms/FormError.C (c-tor):
372 * src/frontends/xforms/FormGraphics.C (c-tor):
373 * src/frontends/xforms/FormIndex.C (c-tor):
374 * src/frontends/xforms/FormRef.C (c-tor):
375 * src/frontends/xforms/FormToc.C (c-tor):
376 * src/frontends/xforms/FormUrl.C (c-tor):
377 use correct policy for ButtonController.
379 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
381 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
384 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
386 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
387 Some resizing changes.
389 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
391 * configure.in: fix typo
393 * lib/languages: add ukraninian and change no to no_NO
395 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
397 * src/bufferview_funcs.C (FontSize): use setLyXSize
399 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
401 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
402 to check for systems where mkstemp() is available but not declared
403 in headers. The new autoconf macro lyx_CHECK_DECL can be used
404 to check for declarations in headers.
406 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
408 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
410 * forms/makefile: added bibforms.fd, include_form.fd.
411 Removed lyx_sendfax.fd.
413 * src/LaTeXLog.C (ShowLatexLog):
414 * src/LyXAction.C (init):
415 * src/bufferparams.C (readLanguage): altered messages as suggested by
418 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
421 * src/credits.C: made fd_form_credits non-static, so that it can be
422 redrawn should the xforms colors be re-mapped.
423 * src/spellchecker.C ditto fd_form_spell_options.
425 * src/filedlg.[Ch] (redraw):
426 * src/intl.[Ch] (redraw):
427 * src/lyxfr0.[Ch] (redraw):
428 * src/insets/figinset.[Ch] (redraw):
429 * src/insets/insetexternal.[Ch] (redraw):
430 new methods, connected to Dialogs::redrawGUI.
432 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
433 to be connected to Dialogs::redrawGUI.
435 * src/frontends/xforms/FormCitation.C (build):
436 * src/frontends/xforms/FormCopyright.C (build):
437 * src/frontends/xforms/FormError.C (build):
438 * src/frontends/xforms/FormGraphics.C (build):
439 * src/frontends/xforms/FormIndex.C (build):
440 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
441 * src/frontends/xforms/FormToc.C (build):
442 * src/frontends/xforms/FormUrl.C (build):
443 use the ButtonController correctly.
445 * src/frontends/xforms/FormCopyright.C (build):
446 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
447 the .fd file and into build().
449 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
451 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
453 * src/frontends/xforms/forms/form_citation.fd:
454 * src/frontends/xforms/forms/form_copyright.fd:
455 * src/frontends/xforms/forms/form_error.fd:
456 * src/frontends/xforms/forms/form_graphics.fd:
457 * src/frontends/xforms/forms/form_index.fd:
458 * src/frontends/xforms/forms/form_toc.fd:
459 * src/frontends/xforms/forms/form_url.fd:
460 renamed some of the objects. Named others explicitly for the first time.
461 Added Restore and Apply buttons where appropriate.
463 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
466 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
468 * src/version.h: try the pre2 again
470 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
472 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
474 * src/frontends/kde/FormParagraph.C: added using directive.
476 * src/frontends/kde/paradlg.C: added config.h and using directive.
478 * src/frontends/kde/paradlg.h: added std::qualifier.
480 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
482 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
484 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
486 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
488 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
490 * src/version.h: set back to 1.1.6cvs
492 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
494 * src/version.h: set to 1.1.6pre2
496 2000-11-20 Marko Vendelin <markov@ioc.ee>
498 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
500 * src/frontends/gnome/Makefile.am: updated list of XForms object files
502 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
504 * src/LColor.C (init):
505 * src/lyxrc.C (getDescription): changed some comments as suggested by
508 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
509 disconnect the redrawGUI signal in best-practice fashion.
511 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
512 long_opts_tab to reflect the change in name of this tabfolder, as
513 suggested by John Levon.
514 (connect, disconnect): new methods. Don't do much at present other than
515 ensuring that we can't resize the dialog. This just makes xforms go
517 (lots of methods in Colors): made void rather than bool. The idea is
518 to have an isOk() function that keeps track of whether any input is
519 genuinely invalid and should therefore block Save, Apply.
520 Easier to manipulate the counters rapidly.
521 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
522 compiler will like this code. Much cleaner way of doing things.
524 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
526 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
527 rather than simple counters, following suggestion by John Levon.
529 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
530 than engraved frame + text.
532 * src/frontends/xforms/forms/makefile: removed spurious command.
534 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
536 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
538 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
541 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
543 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
544 see what Lars has changed and what is just white space!
545 Now used X directly to ascertain the RGB color associated with the
547 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
549 Added some sort capability.
550 The X11 color name database input is only displayed if the database
551 isn't found in the standard place.
552 Got rid of struct compare_converter; it wasn't used.
553 Probably some other stuff that I've forgotten.
555 * src/frontends/xforms/FormPreferences.h: changed the names of some
556 methods in the Colors struct. Added a couple of structs to help sort
557 colors by name and by RGBColor.
559 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
560 functions into a new class RWInfo.
562 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
563 The dialog is now almost navigable using the keyboard. Unfortunately,
564 the cursor has to be inside a browser for it to be activated. There is
565 no visual feedback for the key shortcuts to the arrow keys (use
566 Alt-appropriate arrow key, Alt-x).
568 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
571 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
572 xform_helpers.[Ch]. See above.
574 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
576 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
578 * src/screen.C (setCursorColor): new method. Sets the color of the
580 (ShowManualCursor): call it.
581 Constify some local variables.
583 * src/LColor.[Ch] (LColor): add entry for cursor
584 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
587 2000-11-19 Juergen Vigna <jug@sad.it>
589 * src/insets/insettabular.C (draw): fixed text border redraw problem.
590 (calculate_dimensions_of_cells): try to boost up when inserting chars.
592 2000-11-15 Rob Lahaye <lahaye@postech.edu>
594 * lib/ui/default.ui: OptItem used for Fax entry
596 2000-11-17 Matej Cepl <cepl@bigfoot.com>
598 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
600 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
602 * src/vspace.C (nextToken): fix so it can handle length phrases like
603 "10mm+-20mm", "40inplus16mmminus10cm" etc.
605 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
607 * src/frontends/xforms/FormPreferences.C: constify several variables
608 (BrowserLyX): rewrite to not need the choice variable
609 (Modify): rewrite to not need the choide variable
610 (compare_converter): make operator const
612 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
613 correct the writing of \set_color
614 (getDescription): return a const string
616 * src/kbsequence.[Ch] (addkey): remove dead code
618 * src/Painter.C (text): remove some commented code
620 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
622 * src/ColorHandler.[Ch]: removed some header files from .h file.
623 Included LColor.h in .C file.
625 * src/LColor.[Ch]: made class copyable so that I could create a
626 system_lcolor instance.
628 * src/Painter.h: removed LColor.h.
630 * src/lyx_gui.C (create_forms): used AddName.
632 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
633 of user preferences/lyxrc file.
635 * src/lyxrc.C (output): output changes to lcolor.
637 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
639 Moved class xformColor to files xform_helpers.[Ch]. These files,
640 Color.[Ch], could now be moved into src if they would be useful to
643 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
644 Also moved FormPreferences::browseFile here as it can be used by any
645 xform dialog with a "Browse" button. FormGraphics is a perfect example.
647 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
648 ReadableFile): changed the FormPreferences methods a little and moved
649 them here as they'll be useful elsewhere also.
651 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
652 Removed some header files and used forward declarations instead.
654 Removed some methods as they'll be useful elsewhere (see above).
656 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
657 Can also now modify the LyX LColors. However, for reasons that I don't
658 yet understand, it appears that we can use
659 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
660 present. The problem appears to lie in ColorHandler, because I can
661 change the color using LColor.SetColor(). Similarly, when reading in a
662 preferences file with some set_color instances, I'll get a warning
663 like: Color sea green is undefined or may not be redefined
664 Bad lyxrc set_color for sea green
666 Once the buffer is loaded, however, I can happily change to this color.
668 Finally, it appears that I have to set the color of "inset frame"
669 explicitly, or it oscillates from "black" to "indian red" with each
672 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
674 * ANNOUNCE: corrected a spelling mistake.
676 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
679 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
681 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
683 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
686 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
687 match the requirements from the standard better. This is required
688 to work with gnu libstdc++-v3
690 * src/frontends/xforms/FormPreferences.C: add explict pair
691 arguments to browse calls. include support/lyxmanip.h remvoe
692 extern fmt. whitespace changes. reorder variables in
693 FormPreferences.h, to match initalizaton order.
695 * several files: constify more local variables.
697 * src/buffer.C: remove some commented functions.
699 * src/DepTable.C (remove_files_with_extension): temporary
700 work around for gcc 2.97
701 * src/filedlg.C (find): ditto
702 * src/Variables.C (set): ditto
703 * src/LyXAction.C (searchActionArg): ditto
704 (retrieveActionArg): ditto
706 * configure.in: check for mktemp too
708 * UPGRADING: prepare for 1.1.6
710 * Makefile.am (lgbtags): add backup tags for when etags are
711 different than usual.
713 * ANNOUNCE: prepare for 1.1.6
715 * src/support/tempname.C (make_tempfile): new function, wrapper
716 around mkstemp and mktemp. Only mkstemp has been tested.
719 2000-11-14 Rob Lahaye <lahaye@postech.edu>
721 * default.ui: capitalized some menu items to improve shortcuts.
723 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
725 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
727 * src/frontends/xforms/Dialogs.C: add "using" directive.
729 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
731 * src/filedlg.C (Select): highlight suggested file in browser, if
734 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
735 each tab folder is encapsulated in its own class.
736 The Language keymaps are now chosen using a text input and a
737 browser button, rather than a Combox.
738 All the browser buttons are now functional, although LyXFileDlg
739 still needs to be modified to make it straighhtforward to return a
740 directory if that is what is desired.
742 * src/frontends/xforms/forms/form_preferences.fd: use text input
743 and browse button to input the Language keymaps. Add a few
744 callbacks for the browse buttons.
746 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
748 * src/support/tempname.C (tempName): small changes to make it
749 safer. remove the '.' before XXXXXX
751 * src/support/filetools.C (TmpFileName): remove func
754 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
755 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
756 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
757 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
759 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
762 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
765 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
766 for bp (this fixes a reproducible hard crash)
768 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
771 * src/frontends/xforms/FormBase.h: make bp_ private
772 (FormBaseBI): remove default for bp
775 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
778 * src/frontends/xforms/Color.C (RGBColor): made several vars
779 const, changed initialization of j to allow it to be const
782 * several files: added const to local variables.
784 * src/lyx_cb.C: removed several function prototypes and moved them
788 (UpdateLayoutPreamble):
790 (MenuInsertLabel): add BufferView as arguemnt
791 (LayoutsCB): make tmp const
793 * src/layout_forms.h: regenerated
795 * src/debug.C: add Debug::FILES
796 (showLevel) (showTags): translate the desc
798 * src/debug.h: add FILES as debug target
800 * src/bufferlist.C: use current_view as an interim measure becuase
801 of added arguments to MenuWrite and MenuWriteAs
803 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
805 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
807 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
808 libstdc++ is compiled with.
810 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
812 * lib/layouts/docbook-book.layout
813 * lib/layouts/docbook.layout
814 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
815 those paragraphs are expresse as SGML comments <!-- -->.
817 * src/LaTeXFeatures.h
818 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
819 parameter, this allows to express all the include files as relative
820 paths to the master buffer. The verbatim insert works as the other
823 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
825 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
827 (MakeDocBookFile): top_element is always written. Some clean up, as
828 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
830 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
831 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
832 a reference is written instead of the name.
833 (Validate): use the relative path for the filename.
835 * src/insets/insetlabel.C (DocBook): write end tag, for XML
838 * src/support/filetools.h
839 * src/support/filetools.C (IsSGMLFilename): added.
842 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
844 * development/OS2/quick_fix.patch:
846 * README.OS2: quick update to the OS/2 port.
848 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
850 * src/converter.C: add "using" directive.
852 * src/frontends/xforms/FormPreferences.C: add "using" directive.
853 (compare_converter): add "int" as return type.
855 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
858 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
860 * src/lyx_gui.C (create_forms): map the xform colours, should a
861 mapping exist. Ie, call XformColor::read().
863 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
864 and struct HSV as HSVColor.
865 (XformColor::read, XformColor::write) : new methods that
866 input/output any changes to the cform GUI colors.
868 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
871 * src/frontends/xforms/FormPreferences.C Lots of little changes
872 associated with the changed name of the RGB and HSV structs. Can
873 now save changes to xforms GUI to file. Commented out
874 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
875 used currently anyway.
877 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
879 * src/converter.C: A lot of changes:
880 - It is no longer possible to choose between two or more ways to
881 export to some format (the new code uses only the shortest path).
882 However, it is still possible to choose between pdflatex/ps2pdf
883 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
884 - Added several methods that makes the FormPreferences code simpler.
885 - Changed the tokens $$FName and $$OutName to $$i and $$o.
887 * src/exporter.C (Export): lyxrc.use_pdf is set before
888 makeLaTeXFile is called. This works but not very nice.
890 * src/frontends/xforms/FormPreferences.C: The formats/converters
891 tabs are now fully functional.
893 * src/buffer.C (getTocList): Add numbers to the captions.
895 * lib/lyxrc.example: Removed fax section
897 * src/support/rename.C (rename): Delete the old file if lyx::copy
900 2000-11-13 Rob Lahaye <lahaye@postech.edu>
902 * lib/ui/default.ui: minor polishing.
904 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
906 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
909 * lib/Makefile.am (DOCINST): do not install everything in the
910 documentation directory.
912 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
914 * src/bufferlist.C (newFile): set the filename to the constructed
917 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
918 constructed "newfileXX.lyx" name to the dialog
920 * src/frontends/DialogBase.h: make update() non-abstract so
921 KDE doesn't need to implement two update methods for every form
923 * src/frontends/kde/Makefile.am: add missing xforms objects
926 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
928 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
930 * src/frontends/xforms/Color.[Ch]: new files, defining the color
931 structs RGB and HSV. May not be the best place for these files.
932 Perhaps move them into src ?
934 * src/frontends/xforms/Makefile.am: added new files.
936 * src/frontends/xforms/forms/form_preferences.fd:
937 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
938 replaced all instances of "colour" with "color"!
940 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
943 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
944 tab. Can now alter the colors of the xform's GUI on the fly. With
945 the aid of a single static Signal (see below), can "Apply" these
946 changes to all currently open dialogs. (Well, to all of the NEW
947 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
948 subsequently opened dialogs will, of course, also have the new
949 color scheme. Cannot yet save (or load) the choices to file, so
950 they are lost when exiting LyX.
952 * src/frontends/Dialogs.h:
953 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
954 Used to trigger a redraw of any dialogs connected to it because,
955 for example, the GUI colours have been re-mapped.
957 * src/frontends/xforms/FormBase.[Ch]:
958 * src/frontends/xforms/FormDocument.[Ch]:
959 * src/frontends/xforms/FormParagraph.[Ch]:
960 * src/frontends/xforms/FormPreferences.[Ch]:
961 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
962 method, to be connected to Dialogs::redrawGUI. Method must be
963 virtual, because dialogs with tabbed folders need to redraw the
964 forms of each tab folder.
966 * src/LyXView.C (d-tor):
967 * src/frontends/xforms/FormBase.C (d-tor): connected
968 Dialogs::redrawGUI signal to redraw().
970 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
971 removed Assert, because it is identical to that in FormBase.
973 2000-11-10 Rob Lahaye <lahaye@postech.edu>
975 * lib/ui/default.ui: minor polishing.
977 2000-11-10 Juergen Vigna <jug@sad.it>
979 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
980 (deleteLyXText): ditto
982 * src/insets/insettabular.C (InsetButtonPress): don't clear the
983 selection on mouse-button-3.
985 * src/insets/insettabular.h: new function clearSelection(), use this
986 functions inside insettabular.C.
988 * src/insets/insettabular.C (TabularFeatures): clear the selection
989 on remove_row/column.
991 * src/insets/inset.C (scroll): fixed some scroll stuff.
993 * src/insets/insettabular.C (draw): fixed another minor draw problem.
995 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
997 * lib/CREDITS: add Yves Bastide
999 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1001 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1002 check whether C library functions are in the global namespace.
1004 * configure.in: calls it.
1006 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1007 #ifndef __GLIBCPP__.
1009 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1011 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1012 iterators to prevent crash.
1014 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1016 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1018 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1019 shortcut for xforms CB to the preemptive or post-handler function.
1021 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1022 removed the HIDDEN_TIMER as it's no longer used.
1023 Various other small changes.
1025 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1026 preemptive handler to obtain feedback, rather than the post-handler.
1027 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1029 Formats tab is now complete. Converters tab is nearly so.
1031 2000-11-09 Juergen Vigna <jug@sad.it>
1033 * src/insets/insettext.C (~InsetText):
1036 (SetParagraphData): set cache.second to 0 after deleting it!
1037 (getLyXText): check if cache.second is not 0 if finding it.
1039 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1041 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1042 lyxlex to parse the rgb.txt file.
1045 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1046 replace the default '#' comment character.
1048 * src/support/tempname.C: add "using" directive
1049 * src/frontends/ButtonPolicies.C: ditto.
1051 * src/support/filetools.C (DirList): add an explicit cast to avoid
1052 a compile error (probably not the right fix)
1054 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1056 * src/support/filetools.C (DirList): implement using system functions
1058 * src/support/tempname.C: new file
1060 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1062 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1064 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1067 * src/frontends/xforms/ButtonController.C: new file
1069 * src/os2_defines.h: remove getcwd define
1071 * src/lyxvc.C: include support/lyxlib.h
1072 (showLog): use lyx::tempName
1074 * src/lyx_cb.C: comment out includes that we don't need
1075 (AutoSave): use lyx::tempName
1077 * src/filedlg.C: include support/lyxlib.h
1078 (Reread): use lyx::getcwd
1080 * src/converter.C: include support/filetools.h
1081 (add_options): change to static inline, make tail const
1082 (Add): make old_viewer const
1083 (GetAllFormats): make it a const method, use const_iterator
1084 (enable): make static inline
1085 (SplitFormat): make using_format const
1087 * src/LaTeX.C (run): use lyx::getcwd
1089 * configure.in: check for mkstemp as well
1091 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1093 * src/converter.[Ch] (GetAllCommands): new method.
1095 * src/support/filetools.[Ch] (DirList): new method.
1097 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1098 functionality to the converters tab.
1099 The formats tab is now nearly complete.
1100 The kbmap choices in Languages tab now display the contents of
1101 system_lyxdir/kbd/*.kmap in readable form.
1103 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1104 Moved some variables into the class.
1106 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1107 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1108 colour of active folder to lighter grey instead. Any takers?
1109 (form_colours): added an "Apply" button.
1110 (form_converters): added a "Flags" input field.
1111 (form_formats): added a "Shortcut" input field. Note that we can't use
1112 names such as "input_shortcut" as this buggers up the sed script stuff.
1114 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1122 * src/lyx_sendfax_main.C:
1125 * src/spellchecker.C:
1126 * src/insets/figinset.C:
1127 * src/insets/insetbib.C:
1128 * src/insets/insetexternal.C:
1129 * src/insets/insetinclude.C:
1130 * src/insets/insetinfo.C:
1131 * src/mathed/math_panel.C:
1132 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1133 all "daughter" dialogs now have identical "feel".
1135 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1137 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1138 used (and was only used in one place prior to this patch. Incorrectly!)
1140 * src/frontends/xforms/FormDocument.C: changed some instances of
1141 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1142 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1143 for options_->input_float_placement. This fixes a bug reported by
1146 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1147 functionality into d-tor.
1149 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1150 input of numerals also.
1152 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1153 fl_set_form_atclose(). Can now close dialog from window manager,
1154 fixing a bug reported by Rob Lahaye.
1156 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1158 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1159 are no longer dark. Haven't yet worked out how to lighten the colour of
1160 the active tabfolder. Any ideas anybody?
1161 Adjusted Colours tab a little.
1162 Added Shortcut field to converters tab. Note that we can't create an
1163 fdesign label like "input_shortcut" as this buggers up the sed-script
1166 * src/frontends/xforms/FormPreferences.[Ch]:
1167 (feedback): fixed crash due to to ob=0.
1168 (LanguagesXXX): the kbmap choices now contain the files
1169 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1170 be replaced by an input with a file browse button, but since the browse
1171 buttons don'y yet work, this'll do for the moment.
1172 (FormatsXXX): think that this is now nearly fully functional.
1173 Some points/questions though:
1174 1. Does "Apply" remove formats if no longer present?
1175 2. I think that the browser should list the GUI names rather than the
1177 3. Must ensure that we can't delete Formats used by an existing
1180 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1181 if this is the best way to do this.
1183 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1185 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1187 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1188 for variable assignment.
1190 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1192 * src/lib/ui/default.ui: added sub/superscripts to menu as
1193 Insert->Special characters and cleaned-up the file a bit
1195 2000-11-07 Allan Rae <rae@lyx.org>
1197 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1198 ob isn't 0 before using it. See comments in function.
1200 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1202 * src/frontends/xforms/form_*.C: regenerated
1204 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1206 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1208 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1209 compiling with gcc-2.96
1211 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1213 * src/support/lyxstring.C: add a couple "using" directives.
1215 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1216 a .c_str() here too for good measure.
1217 * src/Spacing.C (set): ditto.
1218 * src/lyxfunc.C (Dispatch): ditto.
1220 * src/insets/insettabular.C (copySelection): change .str() to
1221 .str().c_str() to fix problems with lyxstring.
1222 * src/support/filetools.C (GetFileContents): ditto.
1223 * src/buffer.C (asciiParagraph): ditto.
1224 * src/paragraph.C (String): ditto.
1226 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1227 * lib/bind/sciword.bind: ditto.
1229 * src/LyXAction.C (init): remove "symbol-insert" function, which
1230 shared LFUN_INSERT_MATH with "math-insert".
1232 * lib/configure.m4: == is not a valid operator for command test.
1234 * src/lyxrc.C: add using directive.
1236 * src/converter.h: add std:: qualifier.
1238 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1240 * src/converter.[Ch] and other files: Change the Format class to a
1241 real class, and create two instances: formats and system_format.
1243 * src/lyxrc.C (output): Output the difference between formats and
1246 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1247 (buildFormats): Insert formats into browser.
1248 (inputFormats): Made the browser and add button functional.
1249 (applyFormats): Update formats from format_vec.
1251 * src/converter.C: Changed all (*it). to it->
1252 (Format::dummy): New method.
1253 (Format::importer): New format flag.
1254 (Formats::GetAllFormats): New method.
1255 (Formats::Add): Delete format from the map if prettyname is empty.
1256 (Converter::Convert): Print an error message if moving the file fails.
1257 (Converter::GetReachableTo): New method
1259 * src/MenuBackend.[Ch]: Add support for importformats tag.
1261 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1263 * lib/configure.m4: Add word->tex and ps->fax converters.
1265 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1266 Return fax to file menu.
1270 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1272 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1275 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1278 * src/lyxfunc.C (processKeyEvent): removed
1280 * src/bufferlist.C (emergencyWrite): removed the out commented
1281 emergency write code.
1283 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1285 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1287 * many files: change formatting to be a bit more uniform for
1288 if,while,for,switch statements, remove some parantesis not needed.
1291 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1293 * config/kde.m4: make config more robust when KDEDIR is set
1295 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1297 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1298 not returned a pixmap for "math-insert".
1300 * src/LyXAction.C (init): sort the entries a bit.
1302 2000-11-03 Juergen Vigna <jug@sad.it>
1304 * src/insets/insettabular.h: added fixed number to update codes so
1305 that update is only in one direction.
1307 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1310 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1311 before call to edit because of redraw.
1313 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1315 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1317 * lib/ui/default.ui: Populate "edit_float" menu
1319 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1321 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1322 "floats-operate". The name is ugly (and the func also), but this
1323 is just a band-aid until we switch to new insets.
1325 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1327 * lib/ui/default.ui: update again the menu layout (fix some
1330 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1332 * src/MenuBackend.h (fulllabel): new method.
1334 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1335 the menu shortcuts of a menu are unique and whether they
1336 correspond to a letter of the label.
1337 (expand): call checkShortcuts when debugging.
1339 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1341 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1343 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1345 * lib/examples/*.lyx : '\language default' => '\language english'
1347 * lib/examples/it_splash.lyx : except where it should be italian
1349 * lib/templates/*.lyx : the same
1351 * doc/*.lyx* : the same
1353 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1355 * lib/bind/menus.bind: remove the Layout menu entries, which I
1356 somehow forgot earlier.
1358 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1360 * lib/ui/old-default.ui: keep the old one here for reference (to
1363 * lib/ui/default.ui: update the menu layout
1365 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1367 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1368 Can now Apply to different insets without closing the dialog.
1370 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1371 Can't actually DO anything with them yet, but I'd like a little
1374 * src/frontends/xforms/input_validators.[ch]
1375 (fl_lowercase_filter): new.
1377 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1379 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1380 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1382 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1384 2000-11-02 Juergen Vigna <jug@sad.it>
1386 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1387 on char insertion as it has already be updated by bv->updateInset().
1389 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1390 if an inset inside was updated.
1392 * lib/configure.cmd: commented out fax-search code
1394 2000-11-01 Yves Bastide <stid@acm.org>
1396 * src/tabular.C (OldFormatRead): set tabular language to the
1399 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1401 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1402 class names with non-letter characters (from Yves Bastide).
1404 * lib/ui/default.ui: change Item to OptItem in import menu.
1405 Comment out fax stuff.
1407 * lib/configure.m4: comment out fax-related stuff.
1409 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1411 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1412 useful xforms helper functions. At present contains only formatted().
1413 Input a string and it returns it with line breaks so that in fits
1416 * src/frontends/xforms/Makefile.am: add new files.
1418 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1419 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1422 * src/frontends/xforms/FormPreferences.[Ch]:
1423 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1424 but lots of little clean ups. Removed enum State. Make use of
1425 formatted(). Constify lots of methods. Perhaps best of all: removed
1426 requirement for that horrible reinterpret_cast from pointer to long in
1429 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1431 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1432 conditionalize build on xforms < 0.89
1434 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1436 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1438 * src/LyXAction.C (init): comment out fax
1440 * src/lyxrc.h: comment out the fax enums
1441 comment out the fax variables
1443 * src/commandtags.h: comment out LFUN_FAX
1445 * src/lyxrc.C: disable fax variables.
1446 (read): disable parsing of fax variables
1447 (output): disable writing of fax variables
1448 (getFeedback): now description for fax variables
1450 * src/lyxfunc.C: comment out MenuFax
1451 (Dispatch): disable LFUN_FAX
1453 * src/lyx_cb.C (MenuFax): comment out
1455 * src/WorkArea.C: add <cctype>
1456 (work_area_handler): better key handling, should be ok now.
1457 for accented chars + etc
1459 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1460 lyx_sendfax.h and lyx_sendfax_man.C
1462 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1463 (show): don't call InitLyXLookup when using xforms 0.89
1465 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1467 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1469 * src/support/filetools.C (GetFileContents): close to dummy change
1471 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1473 * src/trans.C (AddDeadkey): workaround stupid compilers.
1475 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1477 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1478 of two-sided document.
1480 2000-10-31 Juergen Vigna <jug@sad.it>
1482 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1484 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1485 xposition to the Edit call.
1487 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1489 * src/trans.C (AddDeadkey): cast explicitly to char.
1491 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1493 * src/tabular.C (AsciiBottomHLine): simplify?
1494 (AsciiTopHLine): simplify?
1495 (print_n_chars): simplify
1496 (DocBook): remove most of the << endl; we should flush the stream
1497 as seldom as possible.
1499 (TeXBottomHLine): ditto
1500 (TeXTopHLine): ditto
1502 (write_attribute): try a templified version.
1503 (set_row_column_number_info): lesson scope of variables
1505 * src/support/lstrings.h (tostr): new specialization of tostr
1507 * src/trans.C (AddDeadkey): slightly cleaner fix.
1509 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1511 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1512 '%%' in Toc menu labels.
1515 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1516 font_norm is iso10646-1.
1518 * src/font.C (ascent): Fixed for 16bit fonts
1519 (descent,lbearing,rbearing): ditto
1521 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1523 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1524 (getFeedback): new static method.
1526 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1527 Now use combox rather than choice to display languages.
1528 Feedback is now output using a new timer callback mechanism, identical
1529 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1531 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1533 * src/minibuffer.C: fix for older compilers
1535 2000-10-30 Juergen Vigna <jug@sad.it>
1537 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1538 has to be Left of the inset otherwise LyXText won't find it!
1540 * src/BufferView2.C (open_new_inset): delete the inset if it can
1543 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1545 * lyx.man: fix typo.
1547 2000-10-29 Marko Vendelin <markov@ioc.ee>
1548 * src/frontends/gnome/FormCitation.C
1549 * src/frontends/gnome/FormCitation.h
1550 * src/frontends/gnome/FormCopyright.C
1551 * src/frontends/gnome/FormCopyright.h
1552 * src/frontends/gnome/FormError.C
1553 * src/frontends/gnome/FormError.h
1554 * src/frontends/gnome/FormIndex.C
1555 * src/frontends/gnome/FormIndex.h
1556 * src/frontends/gnome/FormPrint.C
1557 * src/frontends/gnome/FormPrint.h
1558 * src/frontends/gnome/FormRef.C
1559 * src/frontends/gnome/FormRef.h
1560 * src/frontends/gnome/FormToc.C
1561 * src/frontends/gnome/FormToc.h
1562 * src/frontends/gnome/FormUrl.C
1563 * src/frontends/gnome/FormUrl.h
1564 * src/frontends/gnome/Menubar_pimpl.C
1565 * src/frontends/gnome/mainapp.C
1566 * src/frontends/gnome/mainapp.h
1567 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1568 changing update() to updateSlot() where appropriate
1570 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1572 * src/frontends/xforms/FormPreferences.[Ch]:
1573 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1576 2000-10-28 Juergen Vigna <jug@sad.it>
1578 * src/insets/insettabular.C (draw): fixed drawing bug.
1580 * src/insets/insettext.C (clear):
1582 (SetParagraphData): clearing the TEXT buffers when deleting the
1583 paragraphs used by it.
1585 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1587 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1589 2000-10-27 Juergen Vigna <jug@sad.it>
1591 * src/tabular.C (~LyXTabular): removed not needed anymore.
1593 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1596 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1598 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1601 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1604 * src/frontends/xforms/FormPreferences.[Ch]:
1605 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1606 Reorganised as modules based on tabs. Much easier to follow the
1607 flow and to add new tabs. Added warning and feedback messages.
1610 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1612 * src/tabular.h (DocBook): add std:: qualifier.
1614 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1616 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1617 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1620 * insettabular.C (DocBook): uses the tabular methods to export
1623 * src/insets/insettext.h
1624 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1626 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1628 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1631 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1632 moved misplaced AllowInput two lines up.
1634 * src/buffer.C (readFile): compare float with float, not with int
1636 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1638 * src/minibuffer.C: add "using SigC::slot" statement.
1640 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1642 * src/frontends/xforms/forms/README: updated section about make.
1644 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1645 Tidied some forms up, made two of form_tabular's tabs more
1646 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1647 fixed translation problem with "Column".
1649 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1651 * src/minibuffer.h: use Timeout instead of the xforms timer
1653 (setTimer) rewrite for the Timeout, change to unsigned arg
1654 (set): change to unsigned timer arg
1657 * src/minibuffer.C (TimerCB): removed func
1658 (C_MiniBuffer_TimerCB): removed func
1659 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1660 (peek_event): use a switch statement
1661 (add): don't use fl_add_timer.
1662 (Set): rewrite to use the Timeout
1665 * src/Timeout.[Ch] (setType): return a Timeout &
1666 (setTimeout): ditto, change to unsigned arg for timeout
1668 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1670 * src/mathed/formula.C (mathed_string_width): Use string instead
1671 of a constant size char array.
1673 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1675 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1676 the two recently added operator<< for SMInput and State.
1678 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1680 (OkCancelPolicy): ditto
1681 (OkCancelReadOnlyPolicy): ditto
1682 (NoRepeatedApplyReadOnlyPolicy): ditto
1683 (OkApplyCancelReadOnlyPolicy): ditto
1684 (OkApplyCancelPolicy): ditto
1685 (NoRepeatedApplyPolicy): ditto
1687 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1689 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1690 add the usual std:: qualifiers.
1692 2000-10-25 Juergen Vigna <jug@sad.it>
1694 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1696 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1698 * src/support/filetools.C (MakeRelPath): change some types to
1701 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1702 ButtonPolicy::SMInput and ButtonPolicy::State.
1704 * src/FontLoader.C (reset): small cleanup
1705 (unload): small cleanup
1707 * src/FontInfo.C (getFontname): initialize error to 10000.0
1709 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1711 * src/frontends/xforms/FormPreferences.[Ch]:
1712 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1713 TeX encoding and default paper size sections.
1715 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1717 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1720 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1721 make the message_ empty.
1722 (FormError): don't initialize message_ in initializer list.
1724 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1726 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1728 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1730 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1732 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1734 * src/frontends/kde/*data.[Ch]: _("") is not
1737 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1739 * src/buffer.C: removed redundant using directive.
1741 * src/frontends/DialogBase.h: revert to original definition of
1744 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1745 stuff into two classes, one for each dialog, requires a new
1746 element in the dialogs vector, FormTabularCreate.
1748 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1751 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1752 method. Continues Allan's idea, but means that derived classes
1753 don't need to worry about "update or hide?".
1755 * src/frontends/xforms/FormError.C (showInset): add connection
1758 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1759 one for each dialog. FormTabular now contains main tabular dialog
1762 * src/frontends/xforms/FormTabularCreate.[Ch]:
1763 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1766 * src/frontends/xforms/FormGraphics.[Ch]:
1767 * src/frontends/xforms/forms/form_graphics.fd
1768 * src/frontends/xforms/FormTabular.[Ch]:
1769 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1770 classes of FormInset.
1772 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1773 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1775 * src/frontends/xforms/Makefile.am:
1776 * src/frontends/xforms/forms/makefile: added new files.
1778 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1779 variable. added Signal0 hide signal, in keeping with other GUI-I
1782 * src/support/lstrings.h: removed redundant std:: qualifier as
1783 it's already declared in Lsstream.h.
1785 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1787 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1791 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1793 * src/tabular.C (Ascii): minimize scope of cell.
1795 * src/BufferView2.C (nextWord): return string() instead of 0;
1797 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1799 * src/converter.h: add a std:: qualifier
1801 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1803 * src/importer.[Ch]: New files. Used for importing files into LyX.
1805 * src/lyxfunc.C (doImport): Use the new Importer class.
1807 * src/converter.h: Add shortcut member to the Format class.
1808 Used for holding the menu shortcut.
1810 * src/converter.C and other files: Made a distinction between
1811 format name and format extension. New formats can be defined using
1812 the \format lyxrc tag.
1813 Added two new converter flags: latex and disable.
1815 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1817 * src/support/lyxlib.h: unify namespace/struct implementation.
1818 Remove extra declarations.
1820 * src/support/chdir.C (chdir): remove version taking char const *
1822 * src/support/rename.C: ditto.
1823 * src/support/lyxsum.C: ditto.
1825 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1827 * src/frontends/xforms/FormBase.[Ch]:
1828 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1829 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1830 work only for the next call to fl_show_form(). The correct place to set
1831 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1832 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1833 from FormBase have the minimum size set; no more stupid crashes with
1836 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1838 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1840 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1842 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1844 * src/support/lyxlib.h: changed second argument of mkdir to
1845 unsigned long int (unsigned int would probably have been enough,
1846 but...). Removed <sys/types.h> header.
1847 * src/support/mkdir.C (mkdir): ditto.
1851 2000-10-19 Juergen Vigna <jug@sad.it>
1853 * src/lyxfunc.C (MenuNew): small fix (form John)
1855 * src/screen.C (Update): removed unneeded code.
1857 * src/tabular.C (Ascii): refixed int != uint bug!
1859 * src/support/lyxlib.h: added sys/types.h include for now permits
1860 compiling, but I don't like this!
1862 2000-10-18 Juergen Vigna <jug@sad.it>
1864 * src/text2.C (ClearSelection): if we clear the selection we need
1865 more refresh so set the status apropriately
1867 * src/insets/insettext.C (draw): hopefully finally fixed draw
1870 2000-10-12 Juergen Vigna <jug@sad.it>
1872 * src/insets/insettext.C (draw): another small fix and make a block
1873 so that variables are localized.
1875 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1877 * src/support/lstrings.C (lowercase, uppercase):
1878 use explicit casts to remove compiler warnings.
1880 * src/support/LRegex.C (Impl):
1881 * src/support/StrPool.C (add):
1882 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1883 (AddPath, MakeDisplayPath):
1884 * src/support/lstrings.C (prefixIs, subst):
1885 use correct type to remove compiler warnings.
1887 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1889 * src/support/lyxlib.h:
1890 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1891 portability and to remove compiler warning with DEC cxx.
1893 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1895 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1897 * src/minibuffer.C (peek_event): retun 1 when there has been a
1898 mouseclick in the minibuffer.
1902 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1904 * src/frontends/xforms/FormParagraph.C: more space above/below
1907 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1909 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1910 a char only if real_current_font was changed.
1912 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1914 * NEWS: update somewhat for 1.1.6
1916 * lib/ui/default.ui: clean up.
1918 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1920 * lib/CREDITS: clean up
1922 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1924 * src/combox.[Ch] (select): changed argument back to int
1925 * src/combox.C (peek_event): removed num_bytes as it is declared but
1928 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1929 modified calls to Combox::select() to remove warnings about type
1932 * src/insets/insetbutton.C (width): explicit cast to remove warning
1933 about type conversion.
1935 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1938 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1939 sel_pos_end, refering to cursor position are changed to
1940 LyXParagraph::size_type.
1942 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1943 consistent with LyXCursor::pos().
1944 (inset_pos): changed to LyXParagraph::size_type for same reason.
1946 * src/insets/insettext.C (resizeLyXText): changed some temporary
1947 variables refing to cursor position to LyXParagraph::size_type.
1949 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1951 * src/frontends/kde/<various>: The Great Renaming,
1954 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1956 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1958 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1960 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1961 0 when there are no arguments.
1963 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1965 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1966 to segfaults when pressing Ok in InsetBibtex dialog.
1968 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1970 * forms/layout_forms.fd:
1971 * src/layout_forms.C (create_form_form_character): small change to use
1972 labelframe rather than engraved frame + text
1974 * src/lyx_gui.C (create_forms): initialise choice_language with some
1975 arbitrary value to prevent segfault when dialog is shown.
1977 2000-10-16 Baruch Even <baruch.even@writeme.com>
1979 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1980 is no resulting file. This pertains only to LaTeX output.
1982 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1984 * src/text.C (Backspace): Make sure that the row of the cursor is
1987 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1990 * src/lyx_gui.C (init): Prevent a crash when only one font from
1991 menu/popup fonts is not found.
1993 * lib/lyxrc.example: Add an example for binding a key for language
1996 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1998 * src/converter.C (GetReachable): Changed the returned type to
2000 (IsReachable): New method
2002 * src/MenuBackend.C (expand): Handle formats that appear more
2005 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2007 * src/frontends/support/Makefile.am
2008 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2011 * lib/CREDITS: add Garst Reese.
2013 * src/support/snprintf.h: add extern "C" {} around the definitions.
2015 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2017 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2020 * src/frontends/xforms/FormDocument.C:
2021 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2022 compile without "conversion to integral type of smaller size"
2025 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2027 * src/text.C (GetColumnNearX): Fixed disabled code.
2029 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2031 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2034 * src/support/snprintf.[ch]: new files
2036 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2038 * src/frontends/kde/formprintdialog.C: add
2039 file browser for selecting postscript output
2041 * src/frontends/kde/formprintdialogdata.C:
2042 * src/frontends/kde/formprintdialogdata.h: re-generate
2045 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2047 * src/frontends/gnome/Makefile.am:
2048 * src/frontends/kde/Makefile.am: FormCommand.C
2049 disappeared from xforms
2051 * src/frontends/kde/FormCitation.C:
2052 * src/frontends/kde/FormIndex.C: read-only
2055 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2057 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2060 * src/bufferlist.C: add using directive.
2062 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2064 * src/support/lyxfunctional.h: version of class_fun for void
2065 returns added, const versions of back_inseter_fun and compare_fun
2068 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2070 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2072 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2074 * ChangeLog: cleanup.
2076 * lib/CREDITS: update to add all the contributors we've forgotten.
2077 I have obviously missed some, so tell me whether there were
2080 2000-10-13 Marko Vendelin <markov@ioc.ee>
2082 * src/frontends/gnome/FormCitation.C
2083 * src/frontends/gnome/FormCitation.h
2084 * src/frontends/gnome/FormError.C
2085 * src/frontends/gnome/FormIndex.C
2086 * src/frontends/gnome/FormRef.C
2087 * src/frontends/gnome/FormRef.h
2088 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2090 * src/frontends/gnome/FormCitation.C
2091 * src/frontends/gnome/FormCopyright.C
2092 * src/frontends/gnome/FormError.C
2093 * src/frontends/gnome/FormIndex.C
2094 * src/frontends/gnome/FormRef.C
2095 * src/frontends/gnome/FormToc.C
2096 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2099 * src/frontends/gnome/Menubar_pimpl.C
2100 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2103 2000-10-11 Baruch Even <baruch.even@writeme.com>
2106 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2107 to convey its real action.
2109 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2110 clear the minibuffer and prepare to enter a command.
2112 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2113 the rename from ExecCommand to PrepareForCommand.
2114 * src/lyxfunc.C (Dispatch): ditto.
2116 2000-10-11 Baruch Even <baruch.even@writeme.com>
2118 * src/buffer.C (writeFile): Added test for errors on writing, this
2119 catches all errors and not only file system full errors as intended.
2121 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2123 * src/lyx_gui.C (create_forms): better fix for crash with
2124 translated interface.
2126 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2128 * src/frontends/kde/Makefile.am:
2129 * src/frontends/kde/FormCopyright.C:
2130 * src/frontends/kde/formcopyrightdialog.C:
2131 * src/frontends/kde/formcopyrightdialog.h:
2132 * src/frontends/kde/formcopyrightdialogdata.C:
2133 * src/frontends/kde/formcopyrightdialogdata.h:
2134 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2135 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2136 copyright to use qtarch
2138 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2140 * src/encoding.C (read): Fixed bug that caused an error message at
2141 the end of the file.
2143 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2145 * lib/lyxrc.example: Fixed hebrew example.
2147 2000-10-13 Allan Rae <rae@lyx.org>
2149 * src/frontends/xforms/FormPreferences.C (input): reworking the
2151 (build, update, apply): New inputs in various tabfolders
2153 * src/frontends/xforms/FormToc.C: use new button policy.
2154 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2155 dialogs that either can't use any existing policy or where it just
2158 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2161 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2162 added a bool parameter which is ignored.
2164 * src/buffer.C (setReadonly):
2165 * src/BufferView_pimpl.C (buffer):
2166 * src/frontends/kde/FormCopyright.h (update):
2167 * src/frontends/kde/FormCitation.[Ch] (update):
2168 * src/frontends/kde/FormIndex.[Ch] (update):
2169 * src/frontends/kde/FormPrint.[Ch] (update):
2170 * src/frontends/kde/FormRef.[Ch] (update):
2171 * src/frontends/kde/FormToc.[Ch] (update):
2172 * src/frontends/kde/FormUrl.[Ch] (update):
2173 * src/frontends/gnome/FormCopyright.h (update):
2174 * src/frontends/gnome/FormCitation.[Ch] (update):
2175 * src/frontends/gnome/FormError.[Ch] (update):
2176 * src/frontends/gnome/FormIndex.[Ch] (update):
2177 * src/frontends/gnome/FormPrint.[Ch] (update):
2178 * src/frontends/gnome/FormRef.h (update):
2179 * src/frontends/gnome/FormToc.[Ch] (update):
2180 * src/frontends/gnome/FormUrl.[Ch] (update):
2181 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2182 to updateBufferDependent and DialogBase
2184 * src/frontends/xforms/FormCitation.[hC]:
2185 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2186 * src/frontends/xforms/FormError.[Ch]:
2187 * src/frontends/xforms/FormGraphics.[Ch]:
2188 * src/frontends/xforms/FormIndex.[Ch]:
2189 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2190 and fixed readOnly handling.
2191 * src/frontends/xforms/FormPrint.[Ch]:
2192 * src/frontends/xforms/FormRef.[Ch]:
2193 * src/frontends/xforms/FormTabular.[Ch]:
2194 * src/frontends/xforms/FormToc.[Ch]:
2195 * src/frontends/xforms/FormUrl.[Ch]:
2196 * src/frontends/xforms/FormInset.[Ch]:
2197 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2198 form of updateBufferDependent.
2200 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2201 if form()->visible just in case someone does stuff to the form in a
2204 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2205 the buttoncontroller for everything the enum used to be used for.
2206 (update) It would seem we need to force all dialogs to use a bool
2207 parameter or have two update functions. I chose to go with one.
2208 I did try removing update() from here and FormBase and defining the
2209 appropriate update signatures in FormBaseB[DI] but then ran into the
2210 problem of the update() call in FormBase::show(). Whatever I did
2211 to get around that would require another function and that just
2212 got more confusing. Hence the decision to make everyone have an
2213 update(bool). An alternative might have been to override show() in
2214 FormBaseB[DI] and that would allow the different and appropriate
2217 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2218 true == buffer change occurred. I decided against using a default
2219 template parameter since not all compilers support that at present.
2221 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2223 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2224 army knife" by removing functionality.
2225 (clearStore): removed. All such housekeeping on hide()ing the dialog
2226 is to be carried out by overloaded disconnect() methods.
2227 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2228 superceded by Baruch's neat test (FormGraphics) to update an existing
2229 dialog if a new signal is recieved rather than block all new signals
2231 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2232 only to Inset dialogs.
2233 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2234 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2236 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2238 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2239 as a base class to all inset dialogs. Used solely to connect/disconnect
2240 the Inset::hide signal and to define what action to take on receipt of
2241 a UpdateBufferDependent signal.
2242 (FormCommand): now derived from FormInset.
2244 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2247 * src/frontends/xforms/FormCopyright.[Ch]:
2248 * src/frontends/xforms/FormPreferences.[Ch]:
2249 now derived from FormBaseBI.
2251 * src/frontends/xforms/FormDocument.[Ch]:
2252 * src/frontends/xforms/FormParagraph.[Ch]:
2253 * src/frontends/xforms/FormPrint.[Ch]:
2254 now derived from FormBaseBD.
2256 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2258 * src/frontends/xforms/FormCitation.[Ch]:
2259 * src/frontends/xforms/FormError.[Ch]:
2260 * src/frontends/xforms/FormRef.[Ch]:
2261 * src/frontends/xforms/FormToc.[Ch]:
2262 (clearStore): reworked as disconnect().
2264 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2267 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2269 * src/converter.C (runLaTeX): constify buffer argument
2272 * src/frontends/support/Makefile.am (INCLUDES): fix.
2274 * src/buffer.h: add std:: qualifier
2275 * src/insets/figinset.C (addpidwait): ditto
2276 * src/MenuBackend.C: ditto
2277 * src/buffer.C: ditto
2278 * src/bufferlist.C: ditto
2279 * src/layout.C: ditto
2280 * src/lyxfunc.C: ditto
2282 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2284 * src/lyxtext.h (bidi_level): change return type to
2285 LyXParagraph::size_type.
2287 * src/lyxparagraph.h: change size_type to
2288 TextContainer::difference_type. This should really be
2289 TextContainer::size_type, but we need currently to support signed
2292 2000-10-11 Marko Vendelin <markov@ioc.ee>
2293 * src/frontends/gnome/FormError.h
2294 * src/frontends/gnome/FormRef.C
2295 * src/frontends/gnome/FormRef.h
2296 * src/frontends/gnome/FormError.C
2297 * src/frontends/gnome/Makefile.am
2298 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2299 to Gnome frontend. Both dialogs use "action" area.
2301 2000-10-12 Baruch Even <baruch.even@writeme.com>
2303 * src/graphics/GraphicsCacheItem_pimpl.C:
2304 * src/graphics/Renderer.C:
2305 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2308 2000-10-12 Juergen Vigna <jug@sad.it>
2310 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2311 visible when selecting).
2313 * development/Code_rules/Rules: fixed some typos.
2315 2000-10-09 Baruch Even <baruch.even@writeme.com>
2317 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2318 compiling on egcs 1.1.2 possible.
2320 * src/filedlg.C (comp_direntry::operator() ): ditto.
2322 2000-08-31 Baruch Even <baruch.even@writeme.com>
2324 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2327 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2328 transient it now only gets freed when the object is destructed.
2330 2000-08-24 Baruch Even <baruch.even@writeme.com>
2332 * src/frontends/FormGraphics.h:
2333 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2336 2000-08-20 Baruch Even <baruch.even@writeme.com>
2338 * src/insets/insetgraphics.C:
2339 (draw): Added messages to the drawn rectangle to report status.
2340 (updateInset): Disabled the use of the inline graphics,
2343 2000-08-17 Baruch Even <baruch.even@writeme.com>
2345 * src/frontends/support: Directory added for the support of GUII LyX.
2347 * src/frontends/support/LyXImage.h:
2348 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2351 * src/frontends/support/LyXImage_X.h:
2352 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2353 version of LyXImage, this uses the Xlib Pixmap.
2355 * src/PainterBase.h:
2356 * src/PainterBase.C:
2358 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2359 replacement to Pixmap.
2361 * src/insets/insetgraphics.h:
2362 * src/insets/insetgraphics.C:
2363 * src/graphics/GraphicsCacheItem.h:
2364 * src/graphics/GraphicsCacheItem.C:
2365 * src/graphics/GraphicsCacheItem_pimpl.h:
2366 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2369 * src/graphics/GraphicsCacheItem.h:
2370 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2371 another copy of the object.
2373 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2374 of cacheHandle, this fixed a bug that sent LyX crashing.
2376 * src/graphics/XPM_Renderer.h:
2377 * src/graphics/XPM_Renderer.C:
2378 * src/graphics/EPS_Renderer.h:
2379 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2381 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2383 * src/lyxfunc.C (processKeySym): only handle the
2384 lockinginset/inset stuff if we have a buffer and text loaded...
2386 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2388 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2390 * src/support/lyxfunctional.h: add operator= that takes a reference
2392 * src/lyxserver.C (mkfifo): make first arg const
2394 * src/layout.h: renamed name(...) to setName(...) to work around
2397 * src/buffer.C (setFileName): had to change name of function to
2398 work around bugs in egcs. (renamed from fileName)
2400 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2402 * src/support/translator.h: move helper template classes to
2403 lyxfunctional.h, include "support/lyxfunctional.h"
2405 * src/support/lyxmanip.h: add delaration of fmt
2407 * src/support/lyxfunctional.h: new file
2408 (class_fun_t): new template class
2409 (class_fun): helper template function
2410 (back_insert_fun_iterator): new template class
2411 (back_inserter_fun): helper template function
2412 (compare_memfun_t): new template class
2413 (compare_memfun): helper template function
2414 (equal_1st_in_pair): moved here from translator
2415 (equal_2nd_in_pair): moved here from translator
2417 * src/support/fmt.C: new file
2418 (fmt): new func, can be used for a printf substitute when still
2419 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2421 * src/support/StrPool.C: add some comments
2423 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2426 * src/insets/figinset.C (addpidwait): use std::copy with
2427 ostream_iterator to fill the pidwaitlist
2429 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2431 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2434 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2437 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2439 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2440 (class_update): ditto
2441 (BulletPanel): ditto
2442 (CheckChoiceClass): move initialization of tc and tct
2444 * src/tabular.C: remove current_view
2445 (OldFormatRead): similar to right below [istream::ignore]
2447 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2448 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2449 unused [istream::ignore]
2451 * src/lyxfunc.C: include "support/lyxfunctional.h"
2452 (getInsetByCode): use std::find_if and compare_memfun
2454 * src/lyxfont.C (stateText): remove c_str()
2456 * src/lyx_main.C (setDebuggingLevel): make static
2457 (commandLineHelp): make static
2459 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2460 Screen* together with fl_get_display() and fl_screen
2462 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2463 togheter with fl_get_display() and fl_screen
2464 (create_forms): remove c_str()
2466 * src/layout.C: include "support/lyxfunctional.h"
2467 (hasLayout): use std::find_if and compare_memfun
2468 (GetLayout): use std::find_if and comapre_memfun
2469 (delete_layout): use std::remove_if and compare_memfun
2470 (NumberOfClass): use std:.find_if and compare_memfun
2472 * src/gettext.h: change for the new functions
2474 * src/gettext.C: new file, make _(char const * str) and _(string
2475 const & str) real functions.
2477 * src/font.C (width): rewrite slightly to avoid one extra variable
2479 * src/debug.C: initialize Debug::ANY here
2481 * src/commandtags.h: update number comments
2483 * src/combox.h (get): make const func
2485 (getline): make const
2487 * src/combox.C (input_cb): handle case where fl_get_input can
2490 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2491 "support/lyxfunctional.h", remove current_view variable.
2492 (resize): use std::for_each with std::mem_fun
2493 (getFileNames): use std::copy with back_inserter_fun
2494 (getBuffer): change arg type to unsigned int
2495 (emergencyWriteAll): call emergencyWrite with std::for_each and
2497 (emergencyWrite): new method, the for loop in emergencyWriteAll
2499 (exists): use std::find_if with compare_memfun
2500 (getBuffer): use std::find_if and compare_memfun
2502 * src/buffer.h: add typedefs for iterator_category, value_type
2503 difference_type, pointer and reference for inset_iterator
2504 add postfix ++ for inset_iterator
2505 make inset_iterator::getPos() const
2507 * src/buffer.C: added support/lyxmanip.h
2508 (readFile): use lyxerr << fmt instead of printf
2509 (makeLaTeXFile): use std::copy to write out encodings
2511 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2513 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2514 free and the char * temp.
2515 (hasMenu): use std::find_if and compare_memfun
2518 * src/Makefile.am (lyx_SOURCES): added gettext.C
2520 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2521 string::insert small change to avoid temporary
2523 * src/LColor.C (getGUIName): remove c_str()
2525 * several files: change all occurrences of fl_display to
2528 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2529 that -pedantic is not used for gcc 2.97 (cvs gcc)
2531 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2533 2000-10-11 Allan Rae <rae@lyx.org>
2535 * src/frontends/xforms/FormPreferences.C (input): template path must be
2536 a readable directory. It doesn't need to be writeable.
2537 (build, delete, update, apply): New inputs in the various tabfolders
2539 * src/frontends/xforms/forms/form_preferences.fd:
2540 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2541 several new entries to existing folders. Shuffled some existing stuff
2544 * src/frontends/xforms/forms/form_print.fd:
2545 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2546 Should probably rework PrinterParams as well. Note that the switch to
2547 collated is effectively the same as !unsorted so changing PrinterParams
2548 will require a lot of fiddly changes to reverse the existing logic.
2550 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2552 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2554 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2556 2000-10-10 Allan Rae <rae@lyx.org>
2559 * src/lyxfunc.C (Dispatch):
2561 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2564 * src/lyxrc.C (output): Only write the differences between system lyxrc
2565 and the users settings.
2568 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2570 I'll rewrite this later, after 1.1.6 probably, to keep a single
2571 LyXRC but two instances of a LyXRCStruct.
2573 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2575 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2577 * src/tabular.h: add a few std:: qualifiers.
2579 * src/encoding.C: add using directive.
2580 * src/language.C: ditto.
2582 * src/insets/insetquotes.C (Validate): use languages->lang()
2583 instead of only language.
2585 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2587 * lib/languages: New file.
2589 * lib/encodings: New file.
2591 * src/language.C (Languages): New class.
2592 (read): New method. Reads the languages from the 'languages' file.
2594 * src/encoding.C (Encodings): New class.
2595 (read): New method. Reads the encodings from the 'encodings' file.
2597 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2600 * src/bufferparams.h and a lot of files: Deleted the member language,
2601 and renamed language_info to language
2603 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2604 * src/lyxfont.C (latexWriteStartChanges): ditto.
2605 * src/paragraph.C (validate,TeXOnePar): ditto.
2607 * src/lyxfont.C (update): Restored deleted code.
2609 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2611 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2613 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2615 * src/insets/figinset.[Ch]:
2616 * src/insets/insetinclude.[Ch]:
2617 * src/insets/insetinclude.[Ch]:
2618 * src/insets/insetparent.[Ch]:
2619 * src/insets/insetref.[Ch]:
2620 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2622 * src/insets/*.[Ch]:
2623 * src/mathed/formula.[Ch]:
2624 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2626 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2627 * src/lyx_cb.C (FigureApplyCB):
2628 * src/lyxfunc.C (getStatus, Dispatch):
2629 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2632 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2634 * src/converter.[Ch] (Formats::View):
2635 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2637 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2638 *current_view->buffer(). This will change later, but this patch is way
2641 2000-10-09 Juergen Vigna <jug@sad.it>
2643 * src/text.C (GetRow): small fix.
2645 * src/BufferView_pimpl.C (cursorPrevious):
2646 (cursorNext): added LyXText parameter to function.
2648 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2649 keypress depending on cursor position.
2651 2000-10-06 Juergen Vigna <jug@sad.it>
2653 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2654 (copySelection): redone this function and also copy ascii representa-
2657 * src/tabular.C (Ascii):
2661 (print_n_chars): new functions to realize the ascii export of tabulars.
2663 2000-10-05 Juergen Vigna <jug@sad.it>
2665 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2666 if we don't have a buffer.
2668 2000-10-10 Allan Rae <rae@lyx.org>
2670 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2671 with closing dialog. It seems that nested tabfolders require hiding
2672 of inner tabfolders before hiding the dialog itself. Actually all I
2673 did was hide the active outer folder.
2675 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2676 unless there really is a buffer. hideBufferDependent is called
2679 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2680 POTFILES.in stays in $(srcdir).
2682 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2684 * lib/lyxrc.example: Few changes.
2686 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2688 * src/BufferView_pimpl.C (buffer): only need one the
2689 updateBufferDependent signal to be emitted once! Moved to the end of
2690 the method to allow bv_->text to be updated first.
2692 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2693 and hSignal_ with Dialogs * and BufferDependency variables.
2694 New Buffer * parent_, initialised when the dialog is launched. Used to
2695 check whether to update() or hide() dialog in the new, private
2696 updateOrHide() method that is connected to the updateBufferDependent
2697 signal. Daughter classes dictate what to do using the
2698 ChangedBufferAction enum, passed to the c-tor.
2700 * src/frontends/xforms/FormCitation.C:
2701 * src/frontends/xforms/FormCommand.C:
2702 * src/frontends/xforms/FormCopyright.C:
2703 * src/frontends/xforms/FormDocument.C:
2704 * src/frontends/xforms/FormError.C:
2705 * src/frontends/xforms/FormIndex.C:
2706 * src/frontends/xforms/FormPreferences.C:
2707 * src/frontends/xforms/FormPrint.C:
2708 * src/frontends/xforms/FormRef.C:
2709 * src/frontends/xforms/FormToc.C:
2710 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2713 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2714 ChangedBufferAction enum.
2716 * src/frontends/xforms/FormParagraph.[Ch]
2717 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2720 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2722 * lib/bind/cua.bind: fix a bit.
2723 * lib/bind/emacs.bind: ditto.
2725 * lib/bind/menus.bind: remove real menu entries from there.
2727 * src/spellchecker.C: make sure we only include strings.h when
2730 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2732 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2733 function. It enlarges the maximum number of pup when needed.
2734 (add_toc2): Open a new menu if maximum number of items per menu has
2737 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2739 * src/frontends/kde/FormPrint.C: fix error reporting
2741 * src/frontends/xforms/FormDocument.C: fix compiler
2744 * lib/.cvsignore: add Literate.nw
2746 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2749 * bufferview_funcs.[Ch]
2752 * text2.C: Add support for numbers in RTL text.
2754 2000-10-06 Allan Rae <rae@lyx.org>
2756 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2757 to be gettext.m4 friendly again. ext_l10n.h is now
2758 generated into $top_srcdir instead of $top_builddir
2759 so that lyx.pot will be built correctly -- without
2760 duplicate parsing of ext_l10n.h.
2762 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2764 * src/frontends/kde/FormCitation.C: make the dialog
2765 behave more sensibly
2767 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2769 * config/kde.m4: fix consecutive ./configure runs,
2770 look for qtarch, fix library order
2772 * src/frontends/kde/Makefile.am: tidy up,
2773 add Print dialog, add .dlg dependencies
2775 * src/frontends/kde/FormPrint.C:
2776 * src/frontends/kde/FormPrint.h:
2777 * src/frontends/kde/formprintdialog.C:
2778 * src/frontends/kde/formprintdialog.h:
2779 * src/frontends/kde/formprintdialogdata.C:
2780 * src/frontends/kde/formprintdialogdata.h:
2781 * src/frontends/kde/dlg/formprintdialog.dlg: add
2784 * src/frontends/kde/dlg/README: Added explanatory readme
2786 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2787 script to double-check qtarch's output
2789 * src/frontends/kde/formindexdialog.C:
2790 * src/frontends/kde/formindexdialogdata.C:
2791 * src/frontends/kde/formindexdialogdata.h:
2792 * src/frontends/kde/dlg/formindexdialog.dlg: update
2793 for qtarch, minor fixes
2795 2000-10-05 Allan Rae <rae@lyx.org>
2797 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2798 dialogs when switching buffers update them instead. It's up to each
2799 dialog to decide if it should still be visible or not.
2800 update() should return a bool to control visiblity within show().
2801 Or perhaps better to set a member variable and use that to control
2804 * lib/build-listerrors: create an empty "listerrors" file just to stop
2805 make trying to regenerate it all the time if you don't have noweb
2808 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2810 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2811 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2812 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2813 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2814 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2816 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2818 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2820 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2821 deleting buffer. Closes all buffer-dependent dialogs.
2823 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2825 * src/frontends/xforms/FormCitation.[Ch]:
2826 * src/frontends/xforms/FormPreferences.[Ch]:
2827 * src/frontends/xforms/FormPrint.[Ch]:
2828 * src/frontends/xforms/FormRef.[Ch]:
2829 * src/frontends/xforms/FormUrl.[Ch]: ditto
2831 * src/frontends/xforms/FormDocument.[Ch]:
2832 * src/frontends/xforms/forms/form_document.C.patch:
2833 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2834 pass through a single input() function.
2836 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2838 * lib/build-listerrors: return status as OK
2840 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2842 * lib/lyxrc.example: Updated to new export code
2844 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2846 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2849 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2852 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2853 LyX-Code is defined.
2854 * lib/layouts/amsbook.layout: ditto.
2856 * boost/Makefile.am: fix typo.
2858 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2860 (add_lastfiles): removed.
2861 (add_documents): removed.
2862 (add_formats): removed.
2864 * src/frontends/Menubar.C: remove useless "using" directive.
2866 * src/MenuBackend.h: add a new MenuItem constructor.
2868 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2871 2000-10-04 Allan Rae <rae@lyx.org>
2873 * lib/Makefile.am (listerrors):
2874 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2875 I haven't got notangle installed so Kayvan please test. The output
2876 should end up in $builddir. This also allows people who don't have
2877 noweb installed to complete the make process without error.
2879 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2880 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2881 by JMarc's picky compiler.
2883 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2886 * src/insets/insettabular.C (setPos): change for loop to not use
2887 sequencing operator. Please check this Jürgen.
2889 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2891 * src/insets/insetcite.C (getScreenLabel): ditto
2892 * src/support/filetools.C (QuoteName): ditto
2893 (ChangeExtension): ditto
2895 * src/BufferView_pimpl.C (scrollCB): make heigt int
2897 * src/BufferView2.C (insertInset): comment out unused arg
2899 * boost/Makefile.am (EXTRADIST): new variable
2901 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2903 * src/exporter.C (IsExportable): Fixed
2905 * lib/configure.m4: Small fix
2907 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2909 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2910 * src/insets/insetbib.C (bibitemWidest): ditto.
2911 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2913 2000-10-03 Juergen Vigna <jug@sad.it>
2915 * src/BufferView2.C (theLockingInset): removed const because of
2916 Agnus's compile problems.
2918 * src/insets/insettext.C (LocalDispatch): set the language of the
2919 surronding paragraph on inserting the first character.
2921 * various files: changed use of BufferView::the_locking_inset.
2923 * src/BufferView2.C (theLockingInset):
2924 (theLockingInset): new functions.
2926 * src/BufferView.h: removed the_locking_inset.
2928 * src/lyxtext.h: added the_locking_inset
2930 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2932 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2934 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2936 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2937 * src/mathed/math_cursor.C (IsAlpha): ditto.
2938 * src/mathed/math_inset.C (strnew): ditto.
2939 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2940 (IMetrics): cxp set but never used; removed.
2941 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2942 that the variable in question has been removed also!
2945 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2946 using the Buffer * passed to Latex(), using the BufferView * passed to
2947 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2949 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2950 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2952 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2953 * src/buffer.C (readInset): used new InsetBibtex c-tor
2954 * (getBibkeyList): used new InsetBibtex::getKeys
2956 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2959 * lib/build-listerrors
2961 * src/exporter.C: Add literate programming support to the export code
2964 * src/lyx_cb.C: Remove old literate code.
2966 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2969 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2970 * src/converter.C (View, Convert): Use QuoteName.
2972 * src/insets/figinset.C (Preview): Use Formats::View.
2974 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2976 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2978 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2979 the top of the function, because compaq cxx complains that the
2980 "goto exit_with_message" when the function is disabled bypasses
2982 (MenuNew): try a better fix for the generation of new file names.
2983 This time, I used AddName() instead of AddPath(), hoping Juergen
2986 2000-10-03 Allan Rae <rae@lyx.org>
2988 * src/frontends/xforms/forms/form_preferences.fd:
2989 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2990 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2991 "Look and Feel"->"General" but will need to be split up further into
2992 general output and general input tabs. Current plan is for four outer
2993 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2994 stuff; "Inputs" for input and import configuration; "Outputs" for
2995 output and export configuration; and one more whatever is left over
2996 called "General". The leftovers at present look like being which
2997 viewers to use, spellchecker, language support and might be better
2998 named "Support". I've put "Paths" in "Inputs" for the moment as this
2999 seems reasonable for now at least.
3000 One problem remains: X error kills LyX when you close Preferences.
3002 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3004 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3005 qualifier from form()
3006 * src/frontends/xforms/FormCitation.[Ch]:
3007 * src/frontends/xforms/FormCopyright.[Ch]:
3008 * src/frontends/xforms/FormDocument.[Ch]:
3009 * src/frontends/xforms/FormError.[Ch]:
3010 * src/frontends/xforms/FormIndex.[Ch]:
3011 * src/frontends/xforms/FormPreferences.[Ch]:
3012 * src/frontends/xforms/FormPrint.[Ch]:
3013 * src/frontends/xforms/FormRef.[Ch]:
3014 * src/frontends/xforms/FormToc.[Ch]:
3015 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3017 * src/frontends/xforms/FormCitation.[Ch]:
3018 * src/frontends/xforms/FormIndex.[Ch]:
3019 * src/frontends/xforms/FormRef.[Ch]:
3020 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3021 with Allan's naming policy
3023 * src/frontends/xforms/FormCitation.C: some static casts to remove
3026 2000-10-02 Juergen Vigna <jug@sad.it>
3028 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3029 now you can type or do stuff inside the table-cell also when in dummy
3030 position, fixed visible cursor.
3032 * src/insets/insettext.C (Edit): fixing cursor-view position.
3034 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3035 be used for equal functions in lyxfunc and insettext.
3037 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3039 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3041 * src/frontends/gnome/FormCitation.h:
3042 * src/frontends/gnome/FormCopyright.h:
3043 * src/frontends/gnome/FormIndex.h:
3044 * src/frontends/gnome/FormPrint.h:
3045 * src/frontends/gnome/FormToc.h:
3046 * src/frontends/gnome/FormUrl.h:
3047 * src/frontends/kde/FormCitation.h:
3048 * src/frontends/kde/FormCopyright.h:
3049 * src/frontends/kde/FormIndex.h:
3050 * src/frontends/kde/FormRef.h:
3051 * src/frontends/kde/FormToc.h:
3052 * src/frontends/kde/FormUrl.h: fix remaining users of
3055 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3057 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3058 from depth argument.
3059 (DocBookHandleCaption): ditto.
3060 (DocBookHandleFootnote): ditto.
3061 (SimpleDocBookOnePar): ditto.
3063 * src/frontends/xforms/FormDocument.h (form): remove extra
3064 FormDocument:: qualifier.
3066 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3068 * sigc++/handle.h: ditto.
3070 * src/lyx_gui_misc.C: add "using" directive.
3072 * src/cheaders/cstddef: new file, needed by the boost library (for
3075 2000-10-02 Juergen Vigna <jug@sad.it>
3077 * src/insets/insettext.C (SetFont): better support.
3079 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3081 * src/screen.C (DrawOneRow): some uint refixes!
3083 2000-10-02 Allan Rae <rae@lyx.org>
3085 * boost/.cvsignore: ignore Makefile as well
3087 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3088 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3090 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3091 Left this one out by accident.
3093 * src/frontends/xforms/FormBase.h (restore): default to calling
3094 update() since that will restore the original/currently-applied values.
3095 Any input() triggered error messages will require the derived classes
3096 to redefine restore().
3098 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3099 avoid a segfault. combo_doc_class is the main concern.
3101 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3103 * Simplify build-listerrors in view of GUI-less export ability!
3105 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3107 * src/lyx_main.C (easyParse): Disable gui when exporting
3109 * src/insets/figinset.C:
3112 * src/lyx_gui_misc.C
3113 * src/tabular.C: Changes to allow no-gui.
3115 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3117 * src/support/utility.hpp: removed file
3118 * src/support/block.h: removed file
3120 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3123 * src/mathed/formula.C: add support/lyxlib.h
3124 * src/mathed/formulamacro.C: ditto
3126 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3127 * src/lyxparagraph.h: ditto
3129 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3130 * src/frontends/Makefile.am (INCLUDES): ditto
3131 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3132 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3133 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3134 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3135 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3136 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3138 * src/BufferView.h: use boost/utility.hpp
3139 * src/LColor.h: ditto
3140 * src/LaTeX.h: ditto
3141 * src/LyXAction.h: ditto
3142 * src/LyXView.h: ditto
3143 * src/bufferlist.h: ditto
3144 * src/lastfiles.h: ditto
3145 * src/layout.h: ditto
3146 * src/lyx_gui.h: ditto
3147 * src/lyx_main.h: ditto
3148 * src/lyxlex.h: ditto
3149 * src/lyxrc.h: ditto
3150 * src/frontends/ButtonPolicies.h: ditto
3151 * src/frontends/Dialogs.h: ditto
3152 * src/frontends/xforms/FormBase.h: ditto
3153 * src/frontends/xforms/FormGraphics.h: ditto
3154 * src/frontends/xforms/FormParagraph.h: ditto
3155 * src/frontends/xforms/FormTabular.h: ditto
3156 * src/graphics/GraphicsCache.h: ditto
3157 * src/graphics/Renderer.h: ditto
3158 * src/insets/ExternalTemplate.h: ditto
3159 * src/insets/insetcommand.h: ditto
3160 * src/support/path.h: ditto
3162 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3163 and introduce clause for 2.97.
3165 * boost/libs/README: new file
3167 * boost/boost/utility.hpp: new file
3169 * boost/boost/config.hpp: new file
3171 * boost/boost/array.hpp: new file
3173 * boost/Makefile.am: new file
3175 * boost/.cvsignore: new file
3177 * configure.in (AC_OUTPUT): add boost/Makefile
3179 * Makefile.am (SUBDIRS): add boost
3181 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3183 * src/support/lstrings.C (suffixIs): Fixed.
3185 2000-10-01 Allan Rae <rae@lyx.org>
3187 * src/PrinterParams.h: moved things around to avoid the "can't
3188 inline call" warning.
3190 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3191 into doc++ documentation.
3193 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3195 * src/frontends/xforms/FormRef.C: make use of button controller
3196 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3197 cleaned up button controller usage.
3198 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3199 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3200 use the button controller
3202 * src/frontends/xforms/forms/*.fd: and associated generated files
3203 updated to reflect changes to FormBase. Some other FormXxxx files
3204 also got minor updates to reflect changes to FormBase.
3206 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3207 (hide): made virtual.
3208 (input): return a bool. true == valid input
3209 (RestoreCB, restore): new
3210 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3211 Changes to allow derived dialogs to use a ButtonController and
3212 make sense when doing so: OK button calls ok() and so on.
3214 * src/frontends/xforms/ButtonController.h (class ButtonController):
3215 Switch from template implementation to taking Policy parameter.
3216 Allows FormBase to provide a ButtonController for any dialog.
3218 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3219 Probably should rename connect and disconnect.
3220 (apply): use the radio button groups
3221 (form): needed by FormBase
3222 (build): setup the radio button groups
3224 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3226 * several files: type changes to reduce the number of warnings and
3227 to unify type hangling a bit. Still much to do.
3229 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3231 * lib/images/*: rename a bunch of icons to match Dekel converter
3234 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3237 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3239 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3241 * sigc++/handle.h: ditto for class Handle.
3243 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3245 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3247 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3249 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3250 removal of the "default" language.
3252 * src/combox.h (getline): Check that sel > 0
3254 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3256 * lib/examples/docbook_example.lyx
3257 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3259 * lib/layouts/docbook-book.layout: new docbook book layout.
3261 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3263 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3265 * src/insets/figinset.C (DocBook):fixed small typo.
3267 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3269 * src/insets/insetinclude.h: string include_label doesn't need to be
3272 2000-09-29 Allan Rae <rae@lyx.org>
3274 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3275 Allow derived type to control connection and disconnection from signals
3276 of its choice if desired.
3278 2000-09-28 Juergen Vigna <jug@sad.it>
3280 * src/insets/insettabular.C (update): fixed cursor setting when
3281 the_locking_inset changed.
3282 (draw): made this a bit cleaner.
3283 (InsetButtonPress): fixed!
3285 * various files: added LyXText Parameter to fitCursor call.
3287 * src/BufferView.C (fitCursor): added LyXText parameter.
3289 * src/insets/insettabular.C (draw): small draw fix.
3291 * src/tabular.C: right setting of left/right celllines.
3293 * src/tabular.[Ch]: fixed various types in funcions and structures.
3294 * src/insets/insettabular.C: ditto
3295 * src/frontends/xforms/FormTabular.C: ditto
3297 2000-09-28 Allan Rae <rae@lyx.org>
3299 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3300 that the #ifdef's had been applied to part of what should have been
3301 a complete condition. It's possible there are other tests that
3302 were specific to tables that are also wrong now that InsetTabular is
3303 being used. Now we need to fix the output of '\n' after a table in a
3304 float for the same reason as the original condition:
3305 "don't insert this if we would be adding it before or after a table
3306 in a float. This little trick is needed in order to allow use of
3307 tables in \subfigures or \subtables."
3308 Juergen can you check this?
3310 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3312 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3313 output to the ostream.
3315 * several files: fixed types based on warnings from cxx
3317 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3319 * src/frontends/kde/Makefile.am: fix rule for
3320 formindexdialogdata_moc.C
3322 * src/.cvsignore: add ext_l10n.h to ignore
3324 * acconfig.h: stop messing with __STRICT_ANSI__
3325 * config/gnome.m4: remove option to set -ansi
3326 * config/kde.m4: remove option to set -ansi
3327 * config/lyxinclude.m4: don't set -ansi
3329 2000-09-27 Juergen Vigna <jug@sad.it>
3331 * various files: remove "default" language check.
3333 * src/insets/insetquotes.C: removed use of current_view.
3335 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3336 the one should have red ears by now!
3338 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3339 in more then one paragraph. Fixed cursor-movement/selection.
3341 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3342 paragraphs inside a text inset.
3344 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3345 text-inset if this owner is an inset.
3347 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3349 * src/Bullet.h: changed type of font, character and size to int
3351 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3353 * src/insets/inseturl.[Ch]:
3354 * src/insets/insetref.[Ch]:
3355 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3357 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3359 * src/buffer.C (readFile): block-if statement rearranged to minimise
3360 bloat. Patch does not reverse Jean-Marc's change ;-)
3362 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3363 Class rewritten to store pointers to hide/update signals directly,
3364 rather than Dialogs *. Also defined an enum to ease use. All xforms
3365 forms can now be derived from this class.
3367 * src/frontends/xforms/FormCommand.[Ch]
3368 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3370 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3373 * src/frontends/xforms/forms/form_citation.fd
3374 * src/frontends/xforms/forms/form_copyright.fd
3375 * src/frontends/xforms/forms/form_error.fd
3376 * src/frontends/xforms/forms/form_index.fd
3377 * src/frontends/xforms/forms/form_ref.fd
3378 * src/frontends/xforms/forms/form_toc.fd
3379 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3381 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3383 * src/insets/insetfoot.C: removed redundent using directive.
3385 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3387 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3388 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3390 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3391 created in the constructors in different groups. Then set() just
3392 have to show the groups as needed. This fixes the redraw problems
3393 (and is how the old menu code worked).
3395 * src/support/lyxlib.h: declare the methods as static when we do
3396 not have namespaces.
3398 2000-09-26 Juergen Vigna <jug@sad.it>
3400 * src/buffer.C (asciiParagraph): new function.
3401 (writeFileAscii): new function with parameter ostream.
3402 (writeFileAscii): use now asciiParagraph.
3404 * various inset files: added the linelen parameter to the Ascii-func.
3406 * src/tabular.C (Write): fixed error in writing file introduced by
3407 the last changes from Lars.
3409 * lib/bind/menus.bind: removed not supported functions.
3411 * src/insets/insettext.C (Ascii): implemented this function.
3413 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3415 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3416 (Write): use of the write_attribute functions.
3418 * src/bufferlist.C (close): fixed reasking question!
3420 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3422 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3423 new files use the everwhere possible.
3426 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3427 src/log_form.C src/lyx.C:
3430 * src/buffer.C (runLaTeX): remove func
3432 * src/PaperLayout.C: removed file
3433 * src/ParagraphExtra.C: likewise
3434 * src/bullet_forms.C: likewise
3435 * src/bullet_forms.h: likewise
3436 * src/bullet_forms_cb.C: likewise
3438 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3439 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3442 * several files: remove all traces of the old fd_form_paragraph,
3443 and functions belonging to that.
3445 * several files: remove all traces of the old fd_form_document,
3446 and functions belonging to that.
3448 * several files: constify local variables were possible.
3450 * several files: remove all code that was dead when NEW_EXPORT was
3453 * several files: removed string::c_str in as many places as
3456 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3457 (e): be a bit more outspoken when patching
3458 (updatesrc): only move files if changed.
3460 * forms/layout_forms.h.patch: regenerated
3462 * forms/layout_forms.fd: remove form_document and form_paragraph
3463 and form_quotes and form_paper and form_table_options and
3464 form_paragraph_extra
3466 * forms/form1.fd: remove form_table
3468 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3469 the fdui->... rewrite. Update some comments to xforms 0.88
3471 * forms/bullet_forms.C.patch: removed file
3472 * forms/bullet_forms.fd: likewise
3473 * forms/bullet_forms.h.patch: likewise
3475 * development/Code_rules/Rules: added a section on switch
3476 statements. Updated some comment to xforms 0.88.
3478 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3480 * src/buffer.C (readFile): make sure that the whole version number
3481 is read after \lyxformat (even when it contains a comma)
3483 * lib/ui/default.ui: change shortcut of math menu to M-a.
3485 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3487 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3490 * src/LyXView.C (updateWindowTitle): show the full files name in
3491 window title, limited to 30 characters.
3493 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3494 When a number of characters has been given, we should not assume
3495 that the string is 0-terminated.
3497 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3498 calls (fixes some memory leaks)
3500 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3501 trans member on exit.
3503 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3505 * src/converter.C (GetReachable): fix typo.
3507 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3508 understand ',' instead of '.'.
3509 (GetInteger): rewrite to use strToInt().
3511 2000-09-26 Juergen Vigna <jug@sad.it>
3513 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3514 better visibility and error-message on wrong VSpace input.
3516 * src/language.C (initL): added english again.
3518 2000-09-25 Juergen Vigna <jug@sad.it>
3520 * src/frontends/kde/Dialogs.C (Dialogs):
3521 * src/frontends/gnome/Dialogs.C (Dialogs):
3522 * src/frontends/kde/Makefile.am:
3523 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3525 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3527 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3529 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3531 * src/frontends/xforms/FormParagraph.C:
3532 * src/frontends/xforms/FormParagraph.h:
3533 * src/frontends/xforms/form_paragraph.C:
3534 * src/frontends/xforms/form_paragraph.h:
3535 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3538 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3540 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3541 Paragraph-Data after use.
3543 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3544 non breakable paragraphs.
3546 2000-09-25 Garst R. Reese <reese@isn.net>
3548 * src/language.C (initL): added missing language_country codes.
3550 2000-09-25 Juergen Vigna <jug@sad.it>
3552 * src/insets/insettext.C (InsetText):
3553 (deleteLyXText): remove the not released LyXText structure!
3555 2000-09-24 Marko Vendelin <markov@ioc.ee>
3557 * src/frontends/gnome/mainapp.C
3558 * src/frontends/gnome/mainapp.h: added support for keyboard
3561 * src/frontends/gnome/FormCitation.C
3562 * src/frontends/gnome/FormCitation.h
3563 * src/frontends/gnome/Makefile.am
3564 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3565 FormCitation to use "action area" in mainapp window
3567 * src/frontends/gnome/Menubar_pimpl.C
3568 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3571 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3573 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3574 width/descent/ascent values if name is empty.
3575 (mathed_string_height): Use std::max.
3577 2000-09-25 Allan Rae <rae@lyx.org>
3579 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3580 segfault. This will be completely redesigned soon.
3582 * sigc++: updated libsigc++. Fixes struct timespec bug.
3584 * development/tools/makeLyXsigc.sh: .cvsignore addition
3586 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3588 * several files: removed almost all traces of the old table
3591 * src/TableLayout.C: removed file
3593 2000-09-22 Juergen Vigna <jug@sad.it>
3595 * src/frontends/kde/Dialogs.C: added credits forms.
3597 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3599 * src/frontends/gnome/Dialogs.C: added some forms.
3601 * src/spellchecker.C (init_spell_checker): set language in pspell code
3602 (RunSpellChecker): some modifications for setting language string.
3604 * src/language.[Ch]: added language_country code.
3606 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3608 * src/frontends/Dialogs.h: added new signal showError.
3609 Rearranged existing signals in some sort of alphabetical order.
3611 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3612 FormError.[Ch], form_error.[Ch]
3613 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3614 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3616 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3617 dialogs. I think that this can be used as the base to all these
3620 * src/frontends/xforms/FormError.[Ch]
3621 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3622 implementation of InsetError dialog.
3624 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3626 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3627 * src/frontends/kde/Makefile.am: ditto
3629 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3631 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3632 macrobf. This fixes a bug of invisible text.
3634 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3636 * lib/doc/LaTeXConfig.lyx.in: updated.
3638 * src/language.C (initL): remove language "francais" and change a
3639 bit the names of the two other french variations.
3641 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3642 string that may not be 0-terminated.
3644 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3646 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3648 2000-09-20 Marko Vendelin <markov@ioc.ee>
3650 * src/frontends/gnome/FormCitation.C
3651 * src/frontends/gnome/FormIndex.C
3652 * src/frontends/gnome/FormToc.C
3653 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3654 the variable initialization to shut up the warnings
3656 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3658 * src/table.[Ch]: deleted files
3660 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3663 2000-09-18 Juergen Vigna <jug@sad.it>
3665 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3666 problems with selection. Inserted new LFUN_PASTESELECTION.
3667 (InsetButtonPress): inserted handling of middle mouse-button paste.
3669 * src/spellchecker.C: changed word to word.c_str().
3671 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3673 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3674 included in the ``make dist'' tarball.
3676 2000-09-15 Juergen Vigna <jug@sad.it>
3678 * src/CutAndPaste.C (cutSelection): small fix return the right
3679 end position after cut inside one paragraph only.
3681 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3682 we are locked as otherwise we don't have a valid cursor position!
3684 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3686 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3688 * src/frontends/kde/FormRef.C: added using directive.
3689 * src/frontends/kde/FormToc.C: ditto
3691 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3693 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3695 2000-09-19 Marko Vendelin <markov@ioc.ee>
3697 * src/frontends/gnome/Menubar_pimpl.C
3698 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3699 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3701 * src/frontends/gnome/mainapp.C
3702 * src/frontends/gnome/mainapp.h: support for menu update used
3705 * src/frontends/gnome/mainapp.C
3706 * src/frontends/gnome/mainapp.h: support for "action" area in the
3707 main window. This area is used by small simple dialogs, such as
3710 * src/frontends/gnome/FormIndex.C
3711 * src/frontends/gnome/FormIndex.h
3712 * src/frontends/gnome/FormUrl.C
3713 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3716 * src/frontends/gnome/FormCitation.C
3717 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3718 action area. Only "Insert new citation" is implemented.
3720 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3722 * src/buffer.C (Dispatch): fix call to Dispatch
3723 * src/insets/insetref.C (Edit): likewise
3724 * src/insets/insetparent.C (Edit): likewise
3725 * src/insets/insetinclude.C (include_cb): likewise
3726 * src/frontends/xforms/FormUrl.C (apply): likewise
3727 * src/frontends/xforms/FormToc.C (apply): likewise
3728 * src/frontends/xforms/FormRef.C (apply): likewise
3729 * src/frontends/xforms/FormIndex.C (apply): likewise
3730 * src/frontends/xforms/FormCitation.C (apply): likewise
3731 * src/lyxserver.C (callback): likewise
3732 * src/lyxfunc.C (processKeySym): likewise
3733 (Dispatch): likewise
3734 (Dispatch): likewise
3735 * src/lyx_cb.C (LayoutsCB): likewise
3737 * Makefile.am (sourcedoc): small change
3739 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3741 * src/main.C (main): Don't make an empty GUIRunTime object. all
3742 methods are static. constify a bit remove unneded using + headers.
3744 * src/tabular.C: some more const to local vars move some loop vars
3746 * src/spellchecker.C: added some c_str after some word for pspell
3748 * src/frontends/GUIRunTime.h: add new static method setDefaults
3749 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3750 * src/frontends/kde/GUIRunTime.C (setDefaults):
3751 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3753 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3754 with strnew in arg, use correct emptystring when calling SetName.
3756 * several files: remove all commented code with relation to
3757 HAVE_SSTREAM beeing false. We now only support stringstream and
3760 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3762 * src/lyxfunc.C: construct correctly the automatic new file
3765 * src/text2.C (IsStringInText): change type of variable i to shut
3768 * src/support/sstream.h: do not use namespaces if the compiler
3769 does not support them.
3771 2000-09-15 Marko Vendelin <markov@ioc.ee>
3772 * src/frontends/gnome/FormCitation.C
3773 * src/frontends/gnome/FormCitation.h
3774 * src/frontends/gnome/diainsertcitation_interface.c
3775 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3776 regexp support to FormCitation [Gnome].
3778 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3781 * configure.in: remove unused KDE/GTKGUI define
3783 * src/frontends/kde/FormRef.C
3784 * src/frontends/kde/FormRef.h
3785 * src/frontends/kde/formrefdialog.C
3786 * src/frontends/kde/formrefdialog.h: double click will
3787 go to reference, now it is possible to change a cross-ref
3790 * src/frontends/kde/FormToc.C
3791 * src/frontends/kde/FormToc.h
3792 * src/frontends/kde/formtocdialog.C
3793 * src/frontends/kde/formtocdialog.h: add a depth
3796 * src/frontends/kde/Makefile.am: add QtLyXView.h
3799 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3801 * src/frontends/kde/FormCitation.h: added some using directives.
3803 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3805 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3808 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3811 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3813 * src/buffer.C (pop_tag): revert for the second time a change by
3814 Lars, who seems to really hate having non-local loop variables :)
3816 * src/Lsstream.h: add "using" statements.
3818 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3819 * src/buffer.C (writeFile): ditto
3821 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3823 * src/buffer.C (writeFile): try to fix the locale modified format
3824 number to always be as we want it.
3826 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3827 in XForms 0.89. C-space is now working again.
3829 * src/Lsstream.h src/support/sstream.h: new files.
3831 * also commented out all cases where strstream were used.
3833 * src/Bullet.h (c_str): remove method.
3835 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3837 * a lot of files: get rid of "char const *" and "char *" is as
3838 many places as possible. We only want to use them in interaction
3839 with system of other libraries, not inside lyx.
3841 * a lot of files: return const object is not of pod type. This
3842 helps ensure that temporary objects is not modified. And fits well
3843 with "programming by contract".
3845 * configure.in: check for the locale header too
3847 * Makefile.am (sourcedoc): new tag for generation of doc++
3850 2000-09-14 Juergen Vigna <jug@sad.it>
3852 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3853 callback to check which combo called it and do the right action.
3855 * src/combox.C (combo_cb): added combo * to the callbacks.
3856 (Hide): moved call of callback after Ungrab of the pointer.
3858 * src/intl.h: removed LCombo2 function.
3860 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3861 function as this can now be handled in one function.
3863 * src/combox.h: added Combox * to callback prototype.
3865 * src/frontends/xforms/Toolbar_pimpl.C:
3866 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3868 2000-09-14 Garst Reese <reese@isn.net>
3870 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3871 moved usepackage{xxx}'s to beginning of file. Changed left margin
3872 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3873 underlining from title. Thanks to John Culleton for useful suggestions.
3875 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3877 * src/lyxlex_pimpl.C (setFile): change error message to debug
3880 2000-09-13 Juergen Vigna <jug@sad.it>
3882 * src/frontends/xforms/FormDocument.C: implemented choice_class
3883 as combox and give callback to combo_language so OK/Apply is activated
3886 * src/bufferlist.C (newFile): small fix so already named files
3887 (via an open call) are not requested to be named again on the
3890 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3892 * src/frontends/kde/Makefile.am
3893 * src/frontends/kde/FormRef.C
3894 * src/frontends/kde/FormRef.h
3895 * src/frontends/kde/formrefdialog.C
3896 * src/frontends/kde/formrefdialog.h: implement
3899 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3901 * src/frontends/kde/formtocdialog.C
3902 * src/frontends/kde/formtocdialog.h
3903 * src/frontends/kde/FormToc.C
3904 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3906 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3908 * src/frontends/kde/FormCitation.C: fix thinko
3909 where we didn't always display the reference text
3912 * src/frontends/kde/formurldialog.C
3913 * src/frontends/kde/formurldialog.h
3914 * src/frontends/kde/FormUrl.C
3915 * src/frontends/kde/FormUrl.h: minor cleanups
3917 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3919 * src/frontends/kde/Makefile.am
3920 * src/frontends/kde/FormToc.C
3921 * src/frontends/kde/FormToc.h
3922 * src/frontends/kde/FormCitation.C
3923 * src/frontends/kde/FormCitation.h
3924 * src/frontends/kde/FormIndex.C
3925 * src/frontends/kde/FormIndex.h
3926 * src/frontends/kde/formtocdialog.C
3927 * src/frontends/kde/formtocdialog.h
3928 * src/frontends/kde/formcitationdialog.C
3929 * src/frontends/kde/formcitationdialog.h
3930 * src/frontends/kde/formindexdialog.C
3931 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3933 2000-09-12 Juergen Vigna <jug@sad.it>
3935 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3938 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3940 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3943 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3945 * src/converter.C (Add, Convert): Added support for converter flags:
3946 needaux, resultdir, resultfile.
3947 (Convert): Added new parameter view_file.
3948 (dvips_options): Fixed letter paper option.
3950 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3951 (Export, GetExportableFormats, GetViewableFormats): Added support
3954 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3956 (easyParse): Fixed to work with new export code.
3958 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3961 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3963 * lib/bind/*.bind: Replaced
3964 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3965 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3967 2000-09-11 Juergen Vigna <jug@sad.it>
3969 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3971 * src/main.C (main): now GUII defines global guiruntime!
3973 * src/frontends/gnome/GUIRunTime.C (initApplication):
3974 * src/frontends/kde/GUIRunTime.C (initApplication):
3975 * src/frontends/xforms/GUIRunTime.C (initApplication):
3976 * src/frontends/GUIRunTime.h: added new function initApplication.
3978 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3980 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3982 2000-09-08 Juergen Vigna <jug@sad.it>
3984 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3985 we have already "Reset".
3987 * src/language.C (initL): inserted "default" language and made this
3988 THE default language (and not american!)
3990 * src/paragraph.C: inserted handling of "default" language!
3992 * src/lyxfont.C: ditto
3996 * src/paragraph.C: output the \\par only if we have a following
3997 paragraph otherwise it's not needed.
3999 2000-09-05 Juergen Vigna <jug@sad.it>
4001 * config/pspell.m4: added entry to lyx-flags
4003 * src/spellchecker.C: modified version from Kevin for using pspell
4005 2000-09-01 Marko Vendelin <markov@ioc.ee>
4006 * src/frontends/gnome/Makefile.am
4007 * src/frontends/gnome/FormCitation.C
4008 * src/frontends/gnome/FormCitation.h
4009 * src/frontends/gnome/diainsertcitation_callbacks.c
4010 * src/frontends/gnome/diainsertcitation_callbacks.h
4011 * src/frontends/gnome/diainsertcitation_interface.c
4012 * src/frontends/gnome/diainsertcitation_interface.h
4013 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4014 dialog for Gnome frontend
4016 * src/main.C: Gnome libraries require keeping application name
4017 and its version as strings
4019 * src/frontends/gnome/mainapp.C: Change the name of the main window
4020 from GnomeLyX to PACKAGE
4022 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4024 * src/frontends/Liason.C: add "using: declaration.
4026 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4028 * src/mathed/math_macro.C (Metrics): Set the size of the template
4030 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4032 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4034 * src/converter.C (add_options): New function.
4035 (SetViewer): Change $$FName into '$$FName'.
4036 (View): Add options when running xdvi
4037 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4038 (Convert): The 3rd parameter is now the desired filename. Converts
4039 calls to lyx::rename if necessary.
4040 Add options when running dvips.
4041 (dvi_papersize,dvips_options): New methods.
4043 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4045 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4046 using a call to Converter::dvips_options.
4047 Fixed to work with nex export code.
4049 * src/support/copy.C
4050 * src/support/rename.C: New files
4052 * src/support/syscall.h
4053 * src/support/syscall.C: Added Starttype SystemDontWait.
4055 * lib/ui/default.ui: Changed to work with new export code
4057 * lib/configure.m4: Changed to work with new export code
4059 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4061 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4063 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4064 so that code compiles with DEC cxx.
4066 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4067 to work correctly! Also now supports the additional elements
4070 2000-09-01 Allan Rae <rae@lyx.org>
4072 * src/frontends/ButtonPolicies.C: renamed all the references to
4073 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4075 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4076 since it's a const not a type.
4078 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4080 2000-08-31 Juergen Vigna <jug@sad.it>
4082 * src/insets/figinset.C: Various changes to look if the filename has
4083 an extension and if not add it for inline previewing.
4085 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4087 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4088 make buttonStatus and isReadOnly be const methods. (also reflect
4089 this in derived classes.)
4091 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4092 (nextState): change to be static inline, pass the StateMachine as
4094 (PreferencesPolicy): remove casts
4095 (OkCancelPolicy): remvoe casts
4096 (OkCancelReadOnlyPolicy): remove casts
4097 (NoRepeatedApplyReadOnlyPolicy): remove casts
4098 (OkApplyCancelReadOnlyPolicy): remove casts
4099 (OkApplyCancelPolicy): remove casts
4100 (NoRepeatedApplyPolicy): remove casts
4102 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4104 * src/converter.C: added some using directives
4106 * src/frontends/ButtonPolicies.C: changes to overcome
4107 "need lvalue" error with DEC c++
4109 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4110 to WMHideCB for DEC c++
4112 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4114 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4115 to BulletBMTableCB for DEC c++
4117 2000-08-31 Allan Rae <rae@lyx.org>
4119 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4120 character dialog separately from old document dialogs combo_language.
4123 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4125 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4126 Removed LFUN_REF_CREATE.
4128 * src/MenuBackend.C: Added new tags: toc and references
4130 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4131 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4133 (add_toc, add_references): New methods.
4134 (create_submenu): Handle correctly the case when there is a
4135 seperator after optional menu items.
4137 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4138 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4139 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4141 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4143 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4145 * src/converter.[Ch]: New file for converting between different
4148 * src/export.[Ch]: New file for exporting a LyX file to different
4151 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4152 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4153 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4154 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4155 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4156 RunDocBook, MenuExport.
4158 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4159 Exporter::Preview methods if NEW_EXPORT is defined.
4161 * src/buffer.C (Dispatch): Use Exporter::Export.
4163 * src/lyxrc.C: Added new tags: \converter and \viewer.
4166 * src/LyXAction.C: Define new lyx-function: buffer-update.
4167 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4168 when NEW_EXPORT is defined.
4170 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4172 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4174 * lib/ui/default.ui: Added submenus "view" and "update" to the
4177 * src/filetools.C (GetExtension): New function.
4179 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4181 2000-08-29 Allan Rae <rae@lyx.org>
4183 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4185 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4186 (EnableDocumentLayout): removed
4187 (DisableDocumentLayout): removed
4188 (build): make use of ButtonController's read-only handling to
4189 de/activate various objects. Replaces both of the above functions.
4191 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4192 (readOnly): was read_only
4193 (refresh): fixed dumb mistakes with read_only_ handling
4195 * src/frontends/xforms/forms/form_document.fd:
4196 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4197 tabbed dialogs so the tabs look more like tabs and so its easier to
4198 work out which is the current tab.
4200 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4201 segfault with form_table
4203 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4205 2000-08-28 Juergen Vigna <jug@sad.it>
4207 * acconfig.h: added USE_PSPELL.
4209 * src/config.h.in: added USE_PSPELL.
4211 * autogen.sh: added pspell.m4
4213 * config/pspell.m4: new file.
4215 * src/spellchecker.C: implemented support for pspell libary.
4217 2000-08-25 Juergen Vigna <jug@sad.it>
4219 * src/LyXAction.C (init): renamed LFUN_TABLE to
4220 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4222 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4224 * src/lyxscreen.h: add force_clear variable and fuction to force
4225 a clear area when redrawing in LyXText.
4227 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4229 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4231 * some whitespace and comment changes.
4233 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4235 * src/buffer.C: up te LYX_FORMAT to 2.17
4237 2000-08-23 Juergen Vigna <jug@sad.it>
4239 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4242 * src/insets/insettabular.C (pasteSelection): delete the insets
4243 LyXText as it is not valid anymore.
4244 (copySelection): new function.
4245 (pasteSelection): new function.
4246 (cutSelection): new function.
4247 (LocalDispatch): implemented cut/copy/paste of cell selections.
4249 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4250 don't have a LyXText.
4252 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4254 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4257 2000-08-22 Juergen Vigna <jug@sad.it>
4259 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4260 ifdef form_table out if NEW_TABULAR.
4262 2000-08-21 Juergen Vigna <jug@sad.it>
4264 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4265 (draw): fixed draw position so that the cursor is positioned in the
4267 (InsetMotionNotify): hide/show cursor so the position is updated.
4268 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4269 using cellstart() function where it should be used.
4271 * src/insets/insettext.C (draw): ditto.
4273 * src/tabular.C: fixed initialization of some missing variables and
4274 made BoxType into an enum.
4276 2000-08-22 Marko Vendelin <markov@ioc.ee>
4277 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4278 stock menu item using action numerical value, not its string
4282 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4284 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4285 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4287 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4289 * src/frontends/xforms/GUIRunTime.C: new file
4291 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4292 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4294 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4296 * src/frontends/kde/GUIRunTime.C: new file
4298 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4299 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4301 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4303 * src/frontends/gnome/GUIRunTime.C: new file
4305 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4308 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4309 small change to documetentation.
4311 * src/frontends/GUIRunTime.C: removed file
4313 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4315 * src/lyxparagraph.h: enable NEW_TABULAR as default
4317 * src/lyxfunc.C (processKeySym): remove some commented code
4319 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4320 NEW_TABULAR around the fd_form_table_options.
4322 * src/lyx_gui.C (runTime): call the static member function as
4323 GUIRunTime::runTime().
4325 2000-08-21 Allan Rae <rae@lyx.org>
4327 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4330 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4332 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4334 2000-08-21 Allan Rae <rae@lyx.org>
4336 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4337 keep Garst happy ;-)
4338 * src/frontends/xforms/FormPreferences.C (build): use setOK
4339 * src/frontends/xforms/FormDocument.C (build): use setOK
4340 (FormDocument): use the appropriate policy.
4342 2000-08-21 Allan Rae <rae@lyx.org>
4344 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4345 automatic [de]activation of arbitrary objects when in a read-only state.
4347 * src/frontends/ButtonPolicies.h: More documentation
4348 (isReadOnly): added to support the above.
4350 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4352 2000-08-18 Juergen Vigna <jug@sad.it>
4354 * src/insets/insettabular.C (getStatus): changed to return func_status.
4356 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4357 display toggle menu entries if they are.
4359 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4360 new document layout now.
4362 * src/lyxfunc.C: ditto
4364 * src/lyx_gui_misc.C: ditto
4366 * src/lyx_gui.C: ditto
4368 * lib/ui/default.ui: removed paper and quotes layout as they are now
4369 all in the document layout tabbed folder.
4371 * src/frontends/xforms/forms/form_document.fd: added Restore
4372 button and callbacks for all inputs for Allan's ButtonPolicy.
4374 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4375 (CheckChoiceClass): added missing params setting on class change.
4376 (UpdateLayoutDocument): added for updating the layout on params.
4377 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4378 (FormDocument): Implemented Allan's ButtonPolicy with the
4381 2000-08-17 Allan Rae <rae@lyx.org>
4383 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4384 so we can at least see the credits again.
4386 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4387 controller calls for the appropriate callbacks. Note that since Ok
4388 calls apply followed by cancel, and apply isn't a valid input for the
4389 APPLIED state, the bc_ calls have to be made in the static callback not
4390 within each of the real callbacks.
4392 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4393 (setOk): renamed from setOkay()
4395 2000-08-17 Juergen Vigna <jug@sad.it>
4397 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4398 in the implementation part.
4399 (composeUIInfo): don't show optional menu-items.
4401 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4403 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4405 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4406 text-state when in a text-inset.
4408 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4410 2000-08-17 Marko Vendelin <markov@ioc.ee>
4411 * src/frontends/gnome/FormIndex.C
4412 * src/frontends/gnome/FormIndex.h
4413 * src/frontends/gnome/FormToc.C
4414 * src/frontends/gnome/FormToc.h
4415 * src/frontends/gnome/dialogs
4416 * src/frontends/gnome/diatoc_callbacks.c
4417 * src/frontends/gnome/diatoc_callbacks.h
4418 * src/frontends/gnome/diainsertindex_callbacks.h
4419 * src/frontends/gnome/diainsertindex_callbacks.c
4420 * src/frontends/gnome/diainsertindex_interface.c
4421 * src/frontends/gnome/diainsertindex_interface.h
4422 * src/frontends/gnome/diatoc_interface.h
4423 * src/frontends/gnome/diatoc_interface.c
4424 * src/frontends/gnome/Makefile.am: Table of Contents and
4425 Insert Index dialogs implementation for Gnome frontend
4427 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4429 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4431 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4434 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4436 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4437 destructor. Don't definde if you don't need it
4438 (processEvents): made static, non-blocking events processing for
4440 (runTime): static method. event loop for xforms
4441 * similar as above for kde and gnome.
4443 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4444 new Pimpl is correct
4445 (runTime): new method calss the real frontends runtime func.
4447 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4449 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4451 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4453 2000-08-16 Juergen Vigna <jug@sad.it>
4455 * src/lyx_gui.C (runTime): added GUII RunTime support.
4457 * src/frontends/Makefile.am:
4458 * src/frontends/GUIRunTime.[Ch]:
4459 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4460 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4461 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4463 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4465 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4466 as this is already set in ${FRONTEND_INCLUDE} if needed.
4468 * configure.in (CPPFLAGS): setting the include dir for the frontend
4469 directory and don't set FRONTEND=xforms for now as this is executed
4472 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4474 * src/frontends/kde/Makefile.am:
4475 * src/frontends/kde/FormUrl.C:
4476 * src/frontends/kde/FormUrl.h:
4477 * src/frontends/kde/formurldialog.h:
4478 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4480 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4482 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4484 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4486 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4489 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4491 * src/WorkArea.C (work_area_handler): more work to get te
4492 FL_KEYBOARD to work with xforms 0.88 too, please test.
4494 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4496 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4498 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4501 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4503 * src/Timeout.h: remove Qt::emit hack.
4505 * several files: changes to allo doc++ compilation
4507 * src/lyxfunc.C (processKeySym): new method
4508 (processKeyEvent): comment out if FL_REVISION < 89
4510 * src/WorkArea.C: change some debugging levels.
4511 (WorkArea): set wantkey to FL_KEY_ALL
4512 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4513 clearer code and the use of compose with XForms 0.89. Change to
4514 use signals instead of calling methods in bufferview directly.
4516 * src/Painter.C: change some debugging levels.
4518 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4521 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4522 (workAreaKeyPress): new method
4524 2000-08-14 Juergen Vigna <jug@sad.it>
4526 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4528 * config/kde.m4: addes some features
4530 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4531 include missing xforms dialogs.
4533 * src/Timeout.h: a hack to be able to compile with qt/kde.
4535 * sigc++/.cvsignore: added acinclude.m4
4537 * lib/.cvsignore: added listerros
4539 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4540 xforms tree as objects are needed for other frontends.
4542 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4543 linking with not yet implemented xforms objects.
4545 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4547 2000-08-14 Baruch Even <baruch.even@writeme.com>
4549 * src/frontends/xforms/FormGraphics.h:
4550 * src/frontends/xforms/FormGraphics.C:
4551 * src/frontends/xforms/RadioButtonGroup.h:
4552 * src/frontends/xforms/RadioButtonGroup.C:
4553 * src/insets/insetgraphics.h:
4554 * src/insets/insetgraphics.C:
4555 * src/insets/insetgraphicsParams.h:
4556 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4557 instead of spaces, and various other indentation issues to make the
4558 sources more consistent.
4560 2000-08-14 Marko Vendelin <markov@ioc.ee>
4562 * src/frontends/gnome/dialogs/diaprint.glade
4563 * src/frontends/gnome/FormPrint.C
4564 * src/frontends/gnome/FormPrint.h
4565 * src/frontends/gnome/diaprint_callbacks.c
4566 * src/frontends/gnome/diaprint_callbacks.h
4567 * src/frontends/gnome/diaprint_interface.c
4568 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4571 * src/frontends/gnome/dialogs/diainserturl.glade
4572 * src/frontends/gnome/FormUrl.C
4573 * src/frontends/gnome/FormUrl.h
4574 * src/frontends/gnome/diainserturl_callbacks.c
4575 * src/frontends/gnome/diainserturl_callbacks.h
4576 * src/frontends/gnome/diainserturl_interface.c
4577 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4578 Gnome implementation
4580 * src/frontends/gnome/Dialogs.C
4581 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4582 all other dialogs. Copy all unimplemented dialogs from Xforms
4585 * src/frontends/gnome/support.c
4586 * src/frontends/gnome/support.h: support files generated by Glade
4590 * config/gnome.m4: Gnome configuration scripts
4592 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4593 configure --help message
4595 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4596 only if there are no events pendling in Gnome/Gtk. This enhances
4597 the performance of menus.
4600 2000-08-14 Allan Rae <rae@lyx.org>
4602 * lib/Makefile.am: listerrors cleaning
4604 * lib/listerrors: removed -- generated file
4605 * acinclude.m4: ditto
4606 * sigc++/acinclude.m4: ditto
4608 * src/frontends/xforms/forms/form_citation.fd:
4609 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4612 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4613 `updatesrc` and now we have a `test` target that does what `updatesrc`
4614 used to do. I didn't like having an install target that wasn't related
4617 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4618 on all except FormGraphics. This may yet happen. Followed by a major
4619 cleanup including using FL_TRANSIENT for most of the dialogs. More
4620 changes to come when the ButtonController below is introduced.
4622 * src/frontends/xforms/ButtonController.h: New file for managing up to
4623 four buttons on a dialog according to an externally defined policy.
4624 * src/frontends/xforms/Makefile.am: added above
4626 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4627 Apply and Cancel/Close buttons and everything in between and beyond.
4628 * src/frontends/Makefile.am: added above.
4630 * src/frontends/xforms/forms/form_preferences.fd:
4631 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4632 and removed variable 'status' as a result. Fixed the set_minsize thing.
4633 Use the new screen-font-update after checking screen fonts were changed
4634 Added a "Restore" button to restore the original lyxrc values while
4635 editing. This restores everything not just the last input changed.
4636 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4638 * src/LyXAction.C: screen-font-update added for updating buffers after
4639 screen font settings have been changed.
4640 * src/commandtags.h: ditto
4641 * src/lyxfunc.C: ditto
4643 * forms/lyx.fd: removed screen fonts dialog.
4644 * src/lyx_gui.C: ditto
4645 * src/menus.[Ch]: ditto
4646 * src/lyx.[Ch]: ditto
4647 * src/lyx_cb.C: ditto + code from here moved to make
4648 screen-font-update. And people wonder why progress on GUII is
4649 slow. Look at how scattered this stuff was! It takes forever
4652 * forms/fdfix.sh: Fixup the spacing after commas.
4653 * forms/makefile: Remove date from generated files. Fewer clashes now.
4654 * forms/bullet_forms.C.patch: included someones handwritten changes
4656 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4657 once I've discovered why LyXRC was made noncopyable.
4658 * src/lyx_main.C: ditto
4660 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4662 * src/frontends/xforms/forms/fdfix.sh:
4663 * src/frontends/xforms/forms/fdfixh.sed:
4664 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4665 * src/frontends/xforms/Form*.[hC]:
4666 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4667 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4668 provide a destructor for the struct FD_form_xxxx. Another version of
4669 the set_[max|min]size workaround and a few other cleanups. Actually,
4670 Angus' patch from 20000809.
4672 2000-08-13 Baruch Even <baruch.even@writeme.com>
4674 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4677 2000-08-11 Juergen Vigna <jug@sad.it>
4679 * src/insets/insetgraphics.C (InsetGraphics): changing init
4680 order because of warnings.
4682 * src/frontends/xforms/forms/makefile: adding patching .C with
4685 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4686 from .C.patch to .c.patch
4688 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4689 order because of warning.
4691 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4693 * src/frontends/Liason.C (setMinibuffer): new helper function
4695 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4697 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4699 * lib/ui/default.ui: commented out PaperLayout entry
4701 * src/frontends/xforms/form_document.[Ch]: new added files
4703 * src/frontends/xforms/FormDocument.[Ch]: ditto
4705 * src/frontends/xforms/forms/form_document.fd: ditto
4707 * src/frontends/xforms/forms/form_document.C.patch: ditto
4709 2000-08-10 Juergen Vigna <jug@sad.it>
4711 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4712 (InsetGraphics): initialized cacheHandle to 0.
4713 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4715 2000-08-10 Baruch Even <baruch.even@writeme.com>
4717 * src/graphics/GraphicsCache.h:
4718 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4719 correctly as a cache.
4721 * src/graphics/GraphicsCacheItem.h:
4722 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4725 * src/graphics/GraphicsCacheItem_pimpl.h:
4726 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4729 * src/insets/insetgraphics.h:
4730 * src/insets/insetgraphics.C: Changed from using a signal notification
4731 to polling when image is not loaded.
4733 2000-08-10 Allan Rae <rae@lyx.org>
4735 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4736 that there are two functions that have to been taken out of line by
4737 hand and aren't taken care of in the script. (Just a reminder note)
4739 * sigc++/macros/*.h.m4: Updated as above.
4741 2000-08-09 Juergen Vigna <jug@sad.it>
4743 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4745 * src/insets/insettabular.C: make drawing of single cell smarter.
4747 2000-08-09 Marko Vendelin <markov@ioc.ee>
4748 * src/frontends/gnome/Menubar_pimpl.C
4749 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4750 implementation: new files
4752 * src/frontends/gnome/mainapp.C
4753 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4756 * src/main.C: create Gnome main window
4758 * src/frontends/xforms/Menubar_pimpl.h
4759 * src/frontends/Menubar.C
4760 * src/frontends/Menubar.h: added method Menubar::update that calls
4761 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4763 * src/LyXView.C: calls Menubar::update to update the state
4766 * src/frontends/gnome/Makefile.am: added new files
4768 * src/frontends/Makefile.am: added frontend compiler options
4770 2000-08-08 Juergen Vigna <jug@sad.it>
4772 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4774 * src/bufferlist.C (close):
4775 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4776 documents if exiting without saving.
4778 * src/buffer.C (save): use removeAutosaveFile()
4780 * src/support/filetools.C (removeAutosaveFile): new function.
4782 * src/lyx_cb.C (MenuWrite): returns a bool now.
4783 (MenuWriteAs): check if file could really be saved and revert to the
4785 (MenuWriteAs): removing old autosavefile if existant.
4787 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4788 before Goto toggle declaration, because of compiler warning.
4790 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4792 * src/lyxfunc.C (MenuNew): small fix.
4794 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4796 * src/bufferlist.C (newFile):
4797 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4799 * src/lyxrc.C: added new_ask_filename tag
4801 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4803 * src/lyx.fd: removed code pertaining to form_ref
4804 * src/lyx.[Ch]: ditto
4805 * src/lyx_cb.C: ditto
4806 * src/lyx_gui.C: ditto
4807 * src/lyx_gui_misc.C: ditto
4809 * src/BufferView_pimpl.C (restorePosition): update buffer only
4812 * src/commandtags.h (LFUN_REFTOGGLE): removed
4813 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4814 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4815 (LFUN_REFBACK): renamed LFUN_REF_BACK
4817 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4818 * src/menus.C: ditto
4819 * src/lyxfunc.C (Dispatch): ditto.
4820 InsertRef dialog is now GUI-independent.
4822 * src/texrow.C: added using std::endl;
4824 * src/insets/insetref.[Ch]: strip out large amounts of code.
4825 The inset is now a container and this functionality is now
4826 managed by a new FormRef dialog
4828 * src/frontends/Dialogs.h (showRef, createRef): new signals
4830 * src/frontends/xforms/FormIndex.[Ch],
4831 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4832 when setting dialog's min/max size
4833 * src/frontends/xforms/FormIndex.[Ch]: ditto
4835 * src/frontends/xforms/FormRef.[Ch],
4836 src/frontends/xforms/forms/form_ref.fd: new xforms
4837 implementation of an InsetRef dialog
4839 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4842 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4843 ios::nocreate is not part of the standard. Removed.
4845 2000-08-07 Baruch Even <baruch.even@writeme.com>
4847 * src/graphics/Renderer.h:
4848 * src/graphics/Renderer.C: Added base class for rendering of different
4849 image formats into Pixmaps.
4851 * src/graphics/XPM_Renderer.h:
4852 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4853 in a different class.
4855 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4856 easily add support for other formats.
4858 * src/insets/figinset.C: plugged a leak of an X resource.
4860 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4862 * src/CutAndPaste.[Ch]: make all metods static.
4864 * development/Code_rules/Rules: more work, added section on
4865 Exceptions, and a References section.
4867 * a lot of header files: work to make doc++ able to generate the
4868 source documentation, some workarounds of doc++ problems. Doc++ is
4869 now able to generate the documentation.
4871 2000-08-07 Juergen Vigna <jug@sad.it>
4873 * src/insets/insettabular.C (recomputeTextInsets): removed function
4875 * src/tabular.C (SetWidthOfMulticolCell):
4877 (calculate_width_of_column_NMC): fixed return value so that it really
4878 only returns true if the column-width has changed (there where
4879 problems with muliticolumn-cells in this column).
4881 2000-08-04 Juergen Vigna <jug@sad.it>
4883 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4884 also on the scrollstatus of the inset.
4885 (workAreaMotionNotify): ditto.
4887 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4889 2000-08-01 Juergen Vigna <jug@sad.it>
4891 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4893 * src/commandtags.h:
4894 * src/LyXAction.C (init):
4895 * src/insets/inset.C (LocalDispatch): added support for
4898 * src/insets/inset.C (scroll): new functions.
4900 * src/insets/insettext.C (removeNewlines): new function.
4901 (SetAutoBreakRows): removes forced newlines in the text of the
4902 paragraph if autoBreakRows is set to false.
4904 * src/tabular.C (Latex): generates a parbox around the cell contents
4907 * src/frontends/xforms/FormTabular.C (local_update): removed
4908 the radio_useparbox button.
4910 * src/tabular.C (UseParbox): new function
4912 2000-08-06 Baruch Even <baruch.even@writeme.com>
4914 * src/graphics/GraphicsCache.h:
4915 * src/graphics/GraphicsCache.C:
4916 * src/graphics/GraphicsCacheItem.h:
4917 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4920 * src/insets/insetgraphics.h:
4921 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4922 and the drawing of the inline image.
4924 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4925 loaded into the wrong position.
4927 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4930 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4932 * src/support/translator.h: move all typedefs to public section
4934 * src/support/filetools.C (MakeLatexName): return string const
4936 (TmpFileName): ditto
4937 (FileOpenSearch): ditto
4939 (LibFileSearch): ditto
4940 (i18nLibFileSearch): ditto
4943 (CreateTmpDir): ditto
4944 (CreateBufferTmpDir): ditto
4945 (CreateLyXTmpDir): ditto
4948 (MakeAbsPath): ditto
4950 (OnlyFilename): ditto
4952 (NormalizePath): ditto
4953 (CleanupPath): ditto
4954 (GetFileContents): ditto
4955 (ReplaceEnvironmentPath): ditto
4956 (MakeRelPath): ditto
4958 (ChangeExtension): ditto
4959 (MakeDisplayPath): ditto
4960 (do_popen): return cmdret const
4961 (findtexfile): return string const
4963 * src/support/DebugStream.h: add some /// to please doc++
4965 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4967 * src/texrow.C (same_rownumber): functor to use with find_if
4968 (getIdFromRow): rewritten to use find_if and to not update the
4969 positions. return true if row is found
4970 (increasePos): new method, use to update positions
4972 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4974 * src/lyxlex_pimpl.C (verifyTable): new method
4977 (GetString): return string const
4978 (pushTable): rewrite to use std::stack
4980 (setFile): better check
4983 * src/lyxlex.h: make LyXLex noncopyable
4985 * src/lyxlex.C (text): return char const * const
4986 (GetString): return string const
4987 (getLongString): return string const
4989 * src/lyx_gui_misc.C (askForText): return pair<...> const
4991 * src/lastfiles.[Ch] (operator): return string const
4993 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4994 istringstream not char const *.
4995 move token.end() out of loop.
4996 (readFile): move initializaton of token
4998 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4999 getIdFromRow is successful.
5001 * lib/bind/emacs.bind: don't include menus bind
5003 * development/Code_rules/Rules: the beginnings of making this
5004 better and covering more of the unwritten rules that we have.
5006 * development/Code_rules/Recommendations: a couple of wording
5009 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5011 * src/support/strerror.c: remove C++ comment.
5013 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5015 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5016 LFUN_INDEX_INSERT_LAST
5018 * src/texrow.C (getIdFromRow): changed from const_iterator to
5019 iterator, allowing code to compile with DEC cxx
5021 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5022 stores part of the class, as suggested by Allan. Will allow
5024 (apply): test to apply uses InsetCommandParams operator!=
5026 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5027 (apply): test to apply uses InsetCommandParams operator!=
5029 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5030 stores part of the class.
5031 (update): removed limits on min/max size.
5033 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5034 (apply): test to apply uses InsetCommandParams operator!=
5036 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5037 (Read, Write, scanCommand, getCommand): moved functionality
5038 into InsetCommandParams.
5040 (getScreenLabel): made pure virtual
5041 new InsetCommandParams operators== and !=
5043 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5044 c-tors based on InsetCommandParams. Removed others.
5045 * src/insets/insetinclude.[Ch]: ditto
5046 * src/insets/insetlabel.[Ch]: ditto
5047 * src/insets/insetparent.[Ch]: ditto
5048 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5050 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5051 insets derived from InsetCommand created using similar c-tors
5052 based on InsetCommandParams
5053 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5054 * src/menus.C (ShowRefsMenu): ditto
5055 * src/paragraph.C (Clone): ditto
5056 * src/text2.C (SetCounter): ditto
5057 * src/lyxfunc.C (Dispatch) ditto
5058 Also recreated old InsetIndex behaviour exactly. Can now
5059 index-insert at the start of a paragraph and index-insert-last
5060 without launching the pop-up.
5062 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5064 * lib/lyxrc.example: mark te pdf options as non functional.
5066 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5067 (isStrDbl): move tmpstr.end() out of loop.
5068 (strToDbl): move intialization of tmpstr
5069 (lowercase): return string const and move tmp.end() out of loop.
5070 (uppercase): return string const and move tmp.edn() out of loop.
5071 (prefixIs): add assertion
5076 (containsOnly): ditto
5077 (containsOnly): ditto
5078 (containsOnly): ditto
5079 (countChar): make last arg char not char const
5080 (token): return string const
5081 (subst): return string const, move tmp.end() out of loop.
5082 (subst): return string const, add assertion
5083 (strip): return string const
5084 (frontStrip): return string const, add assertion
5085 (frontStrip): return string const
5090 * src/support/lstrings.C: add inclde "LAssert.h"
5091 (isStrInt): move tmpstr.end() out of loop.
5093 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5094 toollist.end() out of loop.
5095 (deactivate): move toollist.end() out of loop.
5096 (update): move toollist.end() out of loop.
5097 (updateLayoutList): move tc.end() out of loop.
5098 (add): move toollist.end() out of loop.
5100 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5101 md.end() out of loop.
5103 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5105 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5108 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5109 (Erase): move insetlist.end() out of loop.
5111 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5112 ref to const string as first arg. Move initialization of some
5113 variables, whitespace changes.
5115 * src/kbmap.C (defkey): move table.end() out of loop.
5116 (kb_keymap): move table.end() out of loop.
5117 (findbinding): move table.end() out of loop.
5119 * src/MenuBackend.C (hasMenu): move end() out of loop.
5120 (getMenu): move end() out of loop.
5121 (getMenu): move menulist_.end() out of loop.
5123 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5125 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5128 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5129 (getFromLyXName): move infotab.end() out of loop.
5131 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5132 -fvtable-thunks -ffunction-sections -fdata-sections
5134 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5136 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5139 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5141 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5143 * src/frontends/xforms/FormCitation.[Ch],
5144 src/frontends/xforms/FormIndex.[Ch],
5145 src/frontends/xforms/FormToc.[Ch],
5146 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5148 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5150 * src/commandtags.h: renamed, created some flags for citation
5153 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5155 * src/lyxfunc.C (dispatch): use signals to insert index entry
5157 * src/frontends/Dialogs.h: new signal createIndex
5159 * src/frontends/xforms/FormCommand.[Ch],
5160 src/frontends/xforms/FormCitation.[Ch],
5161 src/frontends/xforms/FormToc.[Ch],
5162 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5164 * src/insets/insetindex.[Ch]: GUI-independent
5166 * src/frontends/xforms/FormIndex.[Ch],
5167 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5170 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5172 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5173 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5175 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5177 * src/insets/insetref.C (Latex): rewrite so that there is now
5178 question that a initialization is requested.
5180 * src/insets/insetcommand.h: reenable the hide signal
5182 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5184 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5185 fix handling of shortcuts (many bugs :)
5186 (add_lastfiles): ditto.
5188 * lib/ui/default.ui: fix a few shortcuts.
5190 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5192 * Makefile.am: Fix ``rpmdist'' target to return the exit
5193 status of the ``rpm'' command, instead of the last command in
5194 the chain (the ``rm lyx.xpm'' command, which always returns
5197 2000-08-02 Allan Rae <rae@lyx.org>
5199 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5200 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5201 * src/frontends/xforms/FormToc.C (FormToc): ditto
5203 * src/frontends/xforms/Makefile.am: A few forgotten files
5205 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5206 Signals-not-copyable-problem Lars' started commenting out.
5208 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5210 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5212 * src/insets/insetcommand.h: Signals is not copyable so anoter
5213 scheme for automatic hiding of forms must be used.
5215 * src/frontends/xforms/FormCitation.h: don't inerit from
5216 noncopyable, FormCommand already does that.
5217 * src/frontends/xforms/FormToc.h: ditto
5218 * src/frontends/xforms/FormUrl.h: ditto
5220 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5222 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5224 * src/insets/insetcommand.h (hide): new SigC::Signal0
5225 (d-tor) new virtual destructor emits hide signal
5227 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5228 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5230 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5231 LOF and LOT. Inset is now GUI-independent
5233 * src/insets/insetloa.[Ch]: redundant
5234 * src/insets/insetlof.[Ch]: ditto
5235 * src/insets/insetlot.[Ch]: ditto
5237 * src/frontends/xforms/forms/form_url.fd: tweaked!
5238 * src/frontends/xforms/forms/form_citation.fd: ditto
5240 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5241 dialogs dealing with InsetCommand insets
5243 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5244 FormCommand base class
5245 * src/frontends/xforms/FormUrl.[Ch]: ditto
5247 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5249 * src/frontends/xforms/FormToc.[Ch]: ditto
5251 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5252 passed a generic InsetCommand pointer
5253 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5255 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5256 and modified InsetTOC class
5257 * src/buffer.C: ditto
5259 * forms/lyx.fd: strip out old FD_form_toc code
5260 * src/lyx_gui_misc.C: ditto
5261 * src/lyx_gui.C: ditto
5262 * src/lyx_cb.C: ditto
5263 * src/lyx.[Ch]: ditto
5265 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5267 * src/support/utility.hpp: tr -d '\r'
5269 2000-08-01 Juergen Vigna <jug@sad.it>
5271 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5273 * src/commandtags.h:
5274 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5275 LFUN_TABULAR_FEATURES.
5277 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5278 LFUN_LAYOUT_TABULAR.
5280 * src/insets/insettabular.C (getStatus): implemented helper function.
5282 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5284 2000-07-31 Juergen Vigna <jug@sad.it>
5286 * src/text.C (draw): fixed screen update problem for text-insets.
5288 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5289 something changed probably this has to be added in various other
5292 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5294 2000-07-31 Baruch Even <baruch.even@writeme.com>
5296 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5297 templates to satisfy compaq cxx.
5300 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5302 * src/support/translator.h (equal_1st_in_pair::operator()): take
5303 const ref pair_type as arg.
5304 (equal_2nd_in_pair::operator()): ditto
5305 (Translator::~Translator): remove empty d-tor.
5307 * src/graphics/GraphicsCache.C: move include config.h to top, also
5308 put initialization of GraphicsCache::singleton here.
5309 (~GraphicsCache): move here
5310 (addFile): take const ref as arg
5313 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5315 * src/BufferView2.C (insertLyXFile): change te with/without header
5318 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5320 * src/frontends/xforms/FormGraphics.C (apply): add some
5321 static_cast. Not very nice, but required by compaq cxx.
5323 * src/frontends/xforms/RadioButtonGroup.h: include header
5324 <utility> instead of <pair.h>
5326 * src/insets/insetgraphicsParams.C: add using directive.
5327 (readResize): change return type to void.
5328 (readOrigin): ditto.
5330 * src/lyxfunc.C (getStatus): add missing break for build-program
5331 function; add test for Literate for export functions.
5333 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5334 entries in Options menu.
5336 2000-07-31 Baruch Even <baruch.even@writeme.com>
5338 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5339 protect against auto-allocation; release icon when needed.
5341 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5343 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5344 on usual typewriter.
5346 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5347 earlier czech.kmap), useful only for programming.
5349 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5351 * src/frontends/xforms/FormCitation.h: fix conditioning around
5354 2000-07-31 Juergen Vigna <jug@sad.it>
5356 * src/frontends/xforms/FormTabular.C (local_update): changed
5357 radio_linebreaks to radio_useparbox and added radio_useminipage.
5359 * src/tabular.C: made support for using minipages/parboxes.
5361 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5363 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5365 (descent): so the cursor is in the middle.
5366 (width): bit smaller box.
5368 * src/insets/insetgraphics.h: added display() function.
5370 2000-07-31 Baruch Even <baruch.even@writeme.com>
5372 * src/frontends/Dialogs.h: Added showGraphics signals.
5374 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5375 xforms form definition of the graphics dialog.
5377 * src/frontends/xforms/FormGraphics.h:
5378 * src/frontends/xforms/FormGraphics.C: Added files, the
5379 GUIndependent code of InsetGraphics
5381 * src/insets/insetgraphics.h:
5382 * src/insets/insetgraphics.C: Major writing to make it work.
5384 * src/insets/insetgraphicsParams.h:
5385 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5386 struct between InsetGraphics and GUI.
5388 * src/LaTeXFeatures.h:
5389 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5390 support for graphicx package.
5392 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5393 for the graphics inset.
5395 * src/support/translator.h: Added file, used in
5396 InsetGraphicsParams. this is a template to translate between two
5399 * src/frontends/xforms/RadioButtonGroup.h:
5400 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5401 way to easily control a radio button group.
5403 2000-07-28 Juergen Vigna <jug@sad.it>
5405 * src/insets/insettabular.C (LocalDispatch):
5406 (TabularFeatures): added support for lyx-functions of tabular features.
5407 (cellstart): refixed this function after someone wrongly changed it.
5409 * src/commandtags.h:
5410 * src/LyXAction.C (init): added support for tabular-features
5412 2000-07-28 Allan Rae <rae@lyx.org>
5414 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5415 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5416 triggers the callback for input checking. As a result we sometimes get
5417 "LyX: This shouldn't happen..." printed to cerr.
5418 (input): Started using status variable since I only free() on
5419 destruction. Some input checking for paths and font sizes.
5421 * src/frontends/xforms/FormPreferences.h: Use status to control
5422 activation of Ok and Apply
5424 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5425 callback. Also resized to stop segfaults with 0.88. The problem is
5426 that xforms-0.88 requires the folder to be wide enough to fit all the
5427 tabs. If it isn't it causes all sorts of problems.
5429 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5431 * src/frontends/xforms/forms/README: Reflect reality.
5433 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5434 * src/frontends/xforms/forms/makefile: ditto.
5436 * src/commandtags.h: Get access to new Preferences dialog
5437 * src/LyXAction.C: ditto
5438 * src/lyxfunc.C: ditto
5439 * lib/ui/default.ui: ditto
5441 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5443 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5445 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5448 * src/frontends/xforms/form_url.[Ch]: added.
5450 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5452 * src/insets/insetbib.h: fixed bug in previous commit
5454 * src/frontends/xforms/FormUrl.h: ditto
5456 * src/frontends/xforms/FormPrint.h: ditto
5458 * src/frontends/xforms/FormPreferences.h: ditto
5460 * src/frontends/xforms/FormCopyright.h: ditto
5462 * src/frontends/xforms/FormCitation.C: ditto
5464 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5465 private copyconstructor and private default contructor
5467 * src/support/Makefile.am: add utility.hpp
5469 * src/support/utility.hpp: new file from boost
5471 * src/insets/insetbib.h: set owner in clone
5473 * src/frontends/xforms/FormCitation.C: added missing include
5476 * src/insets/form_url.[Ch]: removed
5478 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5480 * development/lyx.spec.in
5481 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5482 file/directory re-organization.
5484 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5486 * src/insets/insetcommand.[Ch]: moved the string data and
5487 associated manipulation methods into a new stand-alone class
5488 InsetCommandParams. This class has two additional methods
5489 getAsString() and setFromString() allowing the contents to be
5490 moved around as a single string.
5491 (addContents) method removed.
5492 (setContents) method no longer virtual.
5494 * src/buffer.C (readInset): made use of new InsetCitation,
5495 InsetUrl constructors based on InsetCommandParams.
5497 * src/commandtags.h: add LFUN_INSERT_URL
5499 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5500 independent InsetUrl and use InsetCommandParams to extract
5501 string info and create new Insets.
5503 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5505 * src/frontends/xforms/FormCitation.C (apply): uses
5508 * src/frontends/xforms/form_url.C
5509 * src/frontends/xforms/form_url.h
5510 * src/frontends/xforms/FormUrl.h
5511 * src/frontends/xforms/FormUrl.C
5512 * src/frontends/xforms/forms/form_url.fd: new files
5514 * src/insets/insetcite.[Ch]: removed unused constructors.
5516 * src/insets/insetinclude.[Ch]: no longer store filename
5518 * src/insets/inseturl.[Ch]: GUI-independent.
5520 2000-07-26 Juergen Vigna <jug@sad.it>
5521 * renamed frontend from gtk to gnome as it is that what is realized
5522 and did the necessary changes in the files.
5524 2000-07-26 Marko Vendelin <markov@ioc.ee>
5526 * configure.in: cleaning up gnome configuration scripts
5528 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5530 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5531 shortcuts syndrom by redrawing them explicitely (a better solution
5532 would be appreciated).
5534 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5536 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5539 * src/lyx_cb.C (MenuExport): change html export to do the right
5540 thing depending of the document type (instead of having
5541 html-linuxdoc and html-docbook).
5542 * src/lyxfunc.C (getStatus): update for html
5543 * lib/ui/default.ui: simplify due to the above change.
5544 * src/menus.C (ShowFileMenu): update too (in case we need it).
5546 * src/MenuBackend.C (read): if a menu is defined twice, add the
5547 new entries to the exiting one.
5549 2000-07-26 Juergen Vigna <jug@sad.it>
5551 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5553 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5554 and return a bool if it did actual save the file.
5555 (AutoSave): don't autosave a unnamed doc.
5557 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5558 check if this is an UNNAMED new file and react to it.
5559 (newFile): set buffer to unnamed and change to not mark a new
5560 buffer dirty if I didn't do anything with it.
5562 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5564 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5566 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5567 friend as per Angus's patch posted to lyx-devel.
5569 * src/ext_l10n.h: updated
5571 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5572 gettext on the style string right before inserting them into the
5575 * autogen.sh: add code to extract style strings form layout files,
5576 not good enough yet.
5578 * src/frontends/gtk/.cvsignore: add MAKEFILE
5580 * src/MenuBackend.C (read): run the label strings through gettext
5581 before storing them in the containers.
5583 * src/ext_l10n.h: new file
5585 * autogen.sh : generate the ext_l10n.h file here
5587 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5589 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5592 * lib/ui/default.ui: fix a couple of typos.
5594 * config/gnome/gtk.m4: added (and added to the list of files in
5597 * src/insets/insetinclude.C (unique_id): fix when we are using
5598 lyxstring instead of basic_string<>.
5599 * src/insets/insettext.C (LocalDispatch): ditto.
5600 * src/support/filetools.C: ditto.
5602 * lib/configure.m4: create the ui/ directory if necessary.
5604 * src/LyXView.[Ch] (updateToolbar): new method.
5606 * src/BufferView_pimpl.C (buffer): update the toolbar when
5607 opening/closing buffer.
5609 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5611 * src/LyXAction.C (getActionName): enhance to return also the name
5612 and options of pseudo-actions.
5613 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5615 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5616 as an example of what is possible). Used in File->Build too (more
5617 useful) and in the import/export menus (to mimick the complicated
5618 handling of linuxdoc and friends). Try to update all the entries.
5620 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5623 * src/MenuBackend.C (read): Parse the new OptItem tag.
5625 * src/MenuBackend.h: Add a new optional_ data member (used if the
5626 entry should be omitted when the lyxfunc is disabled).
5628 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5629 function, used as a shortcut.
5630 (create_submenu): align correctly the shortcuts on the widest
5633 * src/MenuBackend.h: MenuItem.label() only returns the label of
5634 the menu without shortcut; new method shortcut().
5636 2000-07-14 Marko Vendelin <markov@ioc.ee>
5638 * src/frontends/gtk/Dialogs.C:
5639 * src/frontends/gtk/FormCopyright.C:
5640 * src/frontends/gtk/FormCopyright.h:
5641 * src/frontends/gtk/Makefile.am: added these source-files for the
5642 Gtk/Gnome support of the Copyright-Dialog.
5644 * src/main.C: added Gnome::Main initialization if using
5645 Gtk/Gnome frontend-GUI.
5647 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5649 * config/gnome/aclocal-include.m4
5650 * config/gnome/compiler-flags.m4
5651 * config/gnome/curses.m4
5652 * config/gnome/gnome--.m4
5653 * config/gnome/gnome-bonobo-check.m4
5654 * config/gnome/gnome-common.m4
5655 * config/gnome/gnome-fileutils.m4
5656 * config/gnome/gnome-ghttp-check.m4
5657 * config/gnome/gnome-gnorba-check.m4
5658 * config/gnome/gnome-guile-checks.m4
5659 * config/gnome/gnome-libgtop-check.m4
5660 * config/gnome/gnome-objc-checks.m4
5661 * config/gnome/gnome-orbit-check.m4
5662 * config/gnome/gnome-print-check.m4
5663 * config/gnome/gnome-pthread-check.m4
5664 * config/gnome/gnome-support.m4
5665 * config/gnome/gnome-undelfs.m4
5666 * config/gnome/gnome-vfs.m4
5667 * config/gnome/gnome-x-checks.m4
5668 * config/gnome/gnome-xml-check.m4
5669 * config/gnome/gnome.m4
5670 * config/gnome/gperf-check.m4
5671 * config/gnome/gtk--.m4
5672 * config/gnome/linger.m4
5673 * config/gnome/need-declaration.m4: added configuration scripts
5674 for Gtk/Gnome frontend-GUI
5676 * configure.in: added support for the --with-frontend=gtk option
5678 * autogen.sh: added config/gnome/* to list of config-files
5680 * acconfig.h: added define for GTKGUI-support
5682 * config/lyxinclude.m4: added --with-frontend[=value] option value
5683 for Gtk/Gnome frontend-GUI support.
5685 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5687 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5691 * src/paragraph.C (GetChar): remove non-const version
5693 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5694 (search_kw): use it.
5696 * src/lyx_main.C (init): if "preferences" exist, read that instead
5698 (ReadRcFile): return bool if the file could be read ok.
5699 (ReadUIFile): add a check to see if lex file is set ok.
5701 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5702 bastring can be used instead of lyxstring (still uses the old code
5703 if std::string is good enough or if lyxstring is used.)
5705 * src/encoding.C: make the arrays static, move ininle functions
5707 * src/encoding.h: from here.
5709 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5710 (parseSingleLyXformat2Token): move inset parsing to separate method
5711 (readInset): new private method
5713 * src/Variables.h: remove virtual from get().
5715 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5716 access to NEW_INSETS and NEW_TABULAR
5718 * src/MenuBackend.h: remove superfluous forward declaration of
5719 MenuItem. Add documentations tags "///", remove empty MenuItem
5720 destructor, remove private default contructor.
5722 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5724 (read): more string mlabel and mname to where they are used
5725 (read): remove unused variables mlabel and mname
5726 (defaults): unconditional clear, make menusetup take advantage of
5727 add returning Menu &.
5729 * src/LyXView.h: define NEW_MENUBAR as default
5731 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5732 to NEW_INSETS and NEW_TABULAR.
5733 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5734 defined. Change some of the "xxxx-inset-insert" functions names to
5737 * several files: more enahncements to NEW_INSETS and the resulting
5740 * lib/lyxrc.example (\date_insert_format): move to misc section
5742 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5743 bastring and use AC_CACHE_CHECK.
5744 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5745 the system have the newest methods. uses AC_CACHE_CHECK
5746 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5747 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5748 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5750 * configure.in: add LYX_CXX_GOOD_STD_STRING
5752 * acinclude.m4: recreated
5754 2000-07-24 Amir Karger <karger@lyx.org>
5756 * README: add Hebrew, Arabic kmaps
5759 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5761 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5764 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5766 * Lot of files: add pragma interface/implementation.
5768 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5770 * lib/ui/default.ui: new file (ans new directory). Contains the
5771 default menu and toolbar.
5773 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5774 global space. Toolbars are now read (as menus) in ui files.
5776 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5778 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5779 is disabled because the document is read-only. We want to have the
5780 toggle state of the function anyway.
5781 (getStatus): add code for LFUN_VC* functions (mimicking what is
5782 done in old-style menus)
5784 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5785 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5787 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5788 * src/BufferView_pimpl.C: ditto.
5789 * src/lyxfunc.C: ditto.
5791 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5792 default). This replaces old-style menus by new ones.
5794 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5795 MenuItem. Contain the data structure of a menu.
5797 * src/insets/insettext.C: use LyXView::setLayout instead of
5798 accessing directly the toolbar combox.
5799 * src/lyxfunc.C (Dispatch): ditto.
5801 * src/LyXView.C (setLayout): new method, which just calls
5802 Toolbar::setLayout().
5803 (updateLayoutChoice): move part of this method in Toolbar.
5805 * src/toolbar.[Ch]: removed.
5807 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5808 implementation the toolbar.
5810 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5811 the toolbar. It might make sense to merge it with ToolbarDefaults
5813 (setLayout): new function.
5814 (updateLayoutList): ditto.
5815 (openLayoutList): ditto.
5817 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5818 xforms implementation of the toolbar.
5819 (get_toolbar_func): comment out, since I do not
5820 know what it is good for.
5822 * src/ToolbarDefaults.h: Add the ItemType enum.
5824 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5825 for a list of allocated C strings. Used in Menubar xforms
5826 implementation to avoid memory leaks.
5828 * src/support/lstrings.[Ch] (uppercase): new version taking and
5832 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5833 * lib/bind/emacs.bind: ditto.
5835 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5837 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5838 forward decl of LyXView.
5840 * src/toolbar.C (toolbarItem): moved from toolbar.h
5841 (toolbarItem::clean): ditto
5842 (toolbarItem::~toolbarItem): ditto
5843 (toolbarItem::operator): ditto
5845 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5847 * src/paragraph.h: control the NEW_TABULAR define from here
5849 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5850 USE_TABULAR_INSETS to NEW_TABULAR
5852 * src/ToolbarDefaults.C: add include "lyxlex.h"
5854 * files using the old table/tabular: use NEW_TABULAR to control
5855 compilation of old tabular stuff.
5857 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5860 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5861 planemet in reading of old style floats, fix the \end_deeper
5862 problem when reading old style floats.
5864 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5866 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5868 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5870 * lib/bind/sciword.bind: updated.
5872 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5874 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5875 layout write problem
5877 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5879 * src/Makefile.am (INCLUDES): remove image directory from include
5882 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5883 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5885 * src/LyXView.C (create_form_form_main): read the application icon
5888 * lib/images/*.xpm: change the icons to use transparent color for
5891 * src/toolbar.C (update): change the color of the button when it
5894 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5896 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5897 setting explicitely the minibuffer.
5898 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5900 * src/LyXView.C (showState): new function. Shows font information
5901 in minibuffer and update toolbar state.
5902 (LyXView): call Toolbar::update after creating the
5905 * src/toolbar.C: change toollist to be a vector instead of a
5907 (BubbleTimerCB): get help string directly from the callback
5908 argument of the corresponding icon (which is the action)
5909 (set): remove unnecessary ugliness.
5910 (update): new function. update the icons (depressed, disabled)
5911 depending of the status of the corresponding action.
5913 * src/toolbar.h: remove help in toolbarItem
5915 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5917 * src/Painter.C (text): Added code for using symbol glyphs from
5918 iso10646 fonts. Currently diabled.
5920 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5923 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5924 magyar,turkish and usorbian.
5926 * src/paragraph.C (isMultiLingual): Made more efficient.
5928 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5931 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5932 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5933 Also changed the prototype to "bool math_insert_greek(char)".
5935 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5937 * lots of files: apply the NEW_INSETS on all code that will not be
5938 needed when we move to use the new insets. Enable the define in
5939 lyxparagrah.h to try it.
5941 * src/insets/insettabular.C (cellstart): change to be a static
5943 (InsetTabular): initialize buffer in the initializer list.
5945 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5947 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5948 form_print.h out of the header file. Replaced with forward
5949 declarations of the relevant struct.
5951 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5954 * src/commandtags.h: do not include "debug.h" which does not
5955 belong there. #include it in some other places because of this
5958 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5960 * src/insets/insetcaption.C: add a couple "using" directives.
5962 * src/toolbar.C (add): get the help text directly from lyxaction.
5964 (setPixmap): new function. Loads from disk and sets a pixmap on a
5965 botton; the name of the pixmap file is derived from the command
5968 * src/toolbar.h: remove members isBitmap and pixmap from
5971 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5972 * lib/images/: move many files from images/banner.xpm.
5974 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5976 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5977 * src/toolbar.C: ditto.
5978 * configure.in: ditto.
5979 * INSTALL: document.
5981 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5982 the spellchecker popup is closed from the WM.
5984 2000-07-19 Juergen Vigna <jug@sad.it>
5986 * src/insets/insetfloat.C (Write): small fix because we use the
5987 insetname for the type now!
5989 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5991 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5994 * src/frontends/Dialogs.h: removed hideCitation signal
5996 * src/insets/insetcite.h: added hide signal
5998 * src/insets/insetcite.C (~InsetCitation): emits new signal
5999 (getScreenLabel): "intelligent" label should now fit on the screen!
6001 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6003 * src/frontends/xforms/FormCitation.C (showInset): connects
6004 hide() to the inset's hide signal
6005 (show): modified to use fl_set_object_position rather than
6006 fl_set_object_geometry wherever possible
6008 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6010 * src/insets/lyxinset.h: add caption code
6012 * src/insets/insetfloat.C (type): new method
6014 * src/insets/insetcaption.C (Write): new method
6016 (LyxCode): new method
6018 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6019 to get it right together with using the FloatList.
6021 * src/commandtags.h: add LFUN_INSET_CAPTION
6022 * src/lyxfunc.C (Dispatch): handle it
6024 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6027 * src/Variables.[Ch]: make expand take a const reference, remove
6028 the destructor, some whitespace changes.
6030 * src/LyXAction.C (init): add caption-inset-insert
6032 * src/FloatList.C (FloatList): update the default floats a bit.
6034 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6036 * src/Variables.[Ch]: new files. Intended to be used for language
6037 specific strings (like \chaptername) and filename substitution in
6040 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6042 * lib/kbd/american.kmap: update
6044 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6046 * src/bufferparams.[Ch]: remove member allowAccents.
6048 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6050 * src/LaTeXLog.C: use the log_form.h header.
6051 * src/lyx_gui.C: ditto.
6052 * src/lyx_gui_misc.C: ditto.
6053 * src/lyxvc.h: ditto.
6055 * forms/log_form.fd: new file, created from latexoptions.fd. I
6056 kept the log popup and nuked the options form.
6058 * src/{la,}texoptions.[Ch]: removed.
6059 * src/lyx_cb.C (LaTeXOptions): ditto
6061 * src/lyx_gui.C (create_forms): do not handle the
6062 fd_latex_options form.
6064 2000-07-18 Juergen Vigna <jug@sad.it>
6066 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6067 name of the inset so that it can be requested outside (text2.C).
6069 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6072 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6074 * src/mathed/formula.h (ConvertFont): constify
6076 * src/mathed/formula.C (Read): add warning if \end_inset is not
6077 found on expected place.
6079 * src/insets/lyxinset.h (ConvertFont): consify
6081 * src/insets/insetquotes.C (ConvertFont): constify
6082 * src/insets/insetquotes.h: ditto
6084 * src/insets/insetinfo.h: add labelfont
6086 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6087 (ascent): use labelfont
6091 (Write): make .lyx file a bit nicer
6093 * src/insets/insetfloat.C (Write): simplify somewhat...
6094 (Read): add warning if arg is not found
6096 * src/insets/insetcollapsable.C: add using std::max
6097 (Read): move string token and add warning in arg is not found
6098 (draw): use std::max to get the right ty
6099 (getMaxWidth): simplify by using std::max
6101 * src/insets/insetsection.h: new file
6102 * src/insets/insetsection.C: new file
6103 * src/insets/insetcaption.h: new file
6104 * src/insets/insetcaption.C: new file
6106 * src/insets/inset.C (ConvertFont): constify signature
6108 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6109 insetcaption.[Ch] and insetsection.[Ch]
6111 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6112 uses to use LABEL_COUNTER_CHAPTER instead.
6113 * src/text2.C (SetCounter): here
6115 * src/counters.h: new file
6116 * src/counters.C: new file
6117 * src/Sectioning.h: new file
6118 * src/Sectioning.C: new file
6120 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6122 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6124 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6127 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6130 2000-07-17 Juergen Vigna <jug@sad.it>
6132 * src/tabular.C (Validate): check if array-package is needed.
6133 (SetVAlignment): added support for vertical alignment.
6134 (SetLTFoot): better support for longtable header/footers
6135 (Latex): modified to support added features.
6137 * src/LaTeXFeatures.[Ch]: added array-package.
6139 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6141 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6144 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6146 * configure.in: do not forget to put a space after -isystem.
6148 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6150 * lib/kbd/arabic.kmap: a few fixes.
6152 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6154 * some whitespace chagnes to a number of files.
6156 * src/support/DebugStream.h: change to make it easier for
6157 doc++ to parse correctly.
6158 * src/support/lyxstring.h: ditto
6160 * src/mathed/math_utils.C (compara): change to have only one
6162 (MathedLookupBOP): change because of the above.
6164 * src/mathed/math_delim.C (math_deco_compare): change to have only
6166 (search_deco): change becasue of the above.
6168 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6169 instead of manually coded one.
6171 * src/insets/insetquotes.C (Read): read the \end_inset too
6173 * src/insets/insetlatex.h: remove file
6174 * src/insets/insetlatex.C: remove file
6176 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6178 (InsetPrintIndex): remove destructor
6180 * src/insets/insetinclude.h: remove default constructor
6182 * src/insets/insetfloat.C: work to make it work better
6184 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6186 * src/insets/insetcite.h (InsetCitation): remove default constructor
6188 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6190 * src/text.C (GetColumnNearX): comment out some currently unused code.
6192 * src/paragraph.C (writeFile): move some initializations closer to
6194 (CutIntoMinibuffer): small change to use new matchIT operator
6198 (InsertInset): ditto
6201 (InsetIterator): ditto
6202 (Erase): small change to use new matchFT operator
6204 (GetFontSettings): ditto
6205 (HighestFontInRange): ditto
6208 * src/lyxparagraph.h: some chars changed to value_type
6209 (matchIT): because of some stronger checking (perhaps too strong)
6210 in SGI STL, the two operator() unified to one.
6213 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6215 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6216 the last inset read added
6217 (parseSingleLyXformat2Token): some more (future) compability code added
6218 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6219 (parseSingleLyXformat2Token): set last_inset_read
6220 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6221 (parseSingleLyXformat2Token): don't double intializw string next_token
6223 * src/TextCache.C (text_fits::operator()): add const's to the signature
6224 (has_buffer::operator()): ditto
6226 * src/Floating.h: add some comments on the class
6228 * src/FloatList.[Ch] (typeExist): new method
6231 * src/BackStack.h: added default constructor, wanted by Gcc.
6233 2000-07-14 Juergen Vigna <jug@sad.it>
6235 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6237 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6239 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6240 do a redraw when the window is resized!
6241 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6243 * src/insets/insettext.C (resizeLyXText): added function to correctly
6244 being able to resize the LyXWindow.
6246 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6248 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6250 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6251 crashes when closing dialog to a deleted inset.
6253 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6254 method! Now similar to other insets.
6256 2000-07-13 Juergen Vigna <jug@sad.it>
6258 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6260 * lib/examples/Literate.lyx: small patch!
6262 * src/insets/insetbib.C (Read): added this function because of wrong
6263 Write (without [begin|end]_inset).
6265 2000-07-11 Juergen Vigna <jug@sad.it>
6267 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6268 as the insertInset could not be good!
6270 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6271 the bool param should not be last.
6273 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6275 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6276 did submit that to Karl).
6278 * configure.in: use -isystem instead of -I for X headers. This
6279 fixes a problem on solaris with a recent gcc;
6280 put the front-end code after the X detection code;
6281 configure in sigc++ before lib/
6283 * src/lyx_main.C (commandLineHelp): remove -display from command
6286 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6288 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6289 Also put in Makefile rules for building the ``listerrors''
6290 program for parsing errors from literate programs written in LyX.
6292 * lib/build-listerrors: Added small shell script as part of compile
6293 process. This builds a working ``listerrors'' binary if noweb is
6294 installed and either 1) the VNC X server is installed on the machine,
6295 or 2) the user is compiling from within a GUI. The existence of a GUI
6296 is necessary to use the ``lyx --export'' feature for now. This
6297 hack can be removed once ``lyx --export'' no longer requires a GUI to
6300 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6302 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6303 now passed back correctly from gcc and placed "under" error
6304 buttons in a Literate LyX source.
6306 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6308 * src/text.C (GetColumnNearX): Better behavior when a RTL
6309 paragraph is ended by LTR text.
6311 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6314 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6316 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6317 true when clipboard is empty.
6319 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6321 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6322 row of the paragraph.
6323 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6324 to prevent calculation of bidi tables
6326 2000-07-07 Juergen Vigna <jug@sad.it>
6328 * src/screen.C (ToggleSelection): added y_offset and x_offset
6331 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6334 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6336 * src/insets/insettext.C: fixed Layout-Display!
6338 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6340 * configure.in: add check for strings.h header.
6342 * src/spellchecker.C: include <strings.h> in order to have a
6343 definition for bzero().
6345 2000-07-07 Juergen Vigna <jug@sad.it>
6347 * src/insets/insettext.C (draw): set the status of the bv->text to
6348 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6350 * src/screen.C (DrawOneRow):
6351 (DrawFromTo): redraw the actual row if something has changed in it
6354 * src/text.C (draw): call an update of the toplevel-inset if something
6355 has changed inside while drawing.
6357 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6359 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6361 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6362 processing inside class.
6364 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6365 processing inside class.
6367 * src/insets/insetindex.h new struct Holder, consistent with other
6370 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6371 citation dialog from main code and placed it in src/frontends/xforms.
6372 Dialog launched through signals instead of callbacks
6374 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6376 * lyx.man: update the options description.
6378 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6380 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6381 handle neg values, set min width to 590, add doc about -display
6383 2000-07-05 Juergen Vigna <jug@sad.it>
6385 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6386 calls to BufferView *.
6388 * src/insets/insettext.C (checkAndActivateInset): small fix non
6389 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6391 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6392 their \end_inset token!
6394 2000-07-04 edscott <edscott@imp.mx>
6396 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6397 lib/lyxrc.example: added option \wheel_jump
6399 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6401 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6402 remove support for -width,-height,-xpos and -ypos.
6404 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6406 * src/encoding.[Ch]: New files.
6408 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6409 (text): Call to the underline() method only when needed.
6411 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6413 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6414 encoding(s) for the document.
6416 * src/bufferparams.C (BufferParams): Changed default value of
6419 * src/language.C (newLang): Removed.
6420 (items[]): Added encoding information for all defined languages.
6422 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6423 encoding choice button.
6425 * src/lyxrc.h (font_norm_type): New member variable.
6426 (set_font_norm_type): New method.
6428 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6429 paragraphs with different encodings.
6431 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6432 (TransformChar): Changed to work correctly with Arabic points.
6433 (draw): Added support for drawing Arabic points.
6434 (draw): Removed code for drawing underbars (this is done by
6437 * src/support/textutils.h (IsPrintableNonspace): New function.
6439 * src/BufferView_pimpl.h: Added "using SigC::Object".
6440 * src/LyXView.h: ditto.
6442 * src/insets/insetinclude.h (include_label): Changed to mutable.
6444 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6446 * src/mathed/math_iter.h: remove empty destructor
6448 * src/mathed/math_cursor.h: remove empty destructor
6450 * src/insets/lyxinset.h: add THEOREM_CODE
6452 * src/insets/insettheorem.[Ch]: new files
6454 * src/insets/insetminipage.C: (InsertInset): remove
6456 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6458 (InsertInset): remove
6460 * src/insets/insetlist.C: (InsertList): remove
6462 * src/insets/insetfootlike.[Ch]: new files
6464 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6467 (InsertInset): ditto
6469 * src/insets/insetert.C: remove include Painter.h, reindent
6470 (InsertInset): move to header
6472 * src/insets/insetcollapsable.h: remove explicit from default
6473 contructor, remove empty destructor, add InsertInset
6475 * src/insets/insetcollapsable.C (InsertInset): new func
6477 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6479 * src/vspace.h: add explicit to constructor
6481 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6482 \textcompwordmark, please test this.
6484 * src/lyxrc.C: set ascii_linelen to 65 by default
6486 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6488 * src/commandtags.h: add LFUN_INSET_THEOREM
6490 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6491 (makeLinuxDocFile): remove _some_ of the nice logic
6492 (makeDocBookFile): ditto
6494 * src/Painter.[Ch]: (~Painter): removed
6496 * src/LyXAction.C (init): entry for insettheorem added
6498 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6500 (deplog): code to detect files generated by LaTeX, needs testing
6503 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6505 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6507 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6509 * src/LaTeX.C (deplog): Add a check for files that are going to be
6510 created by the first latex run, part of the project to remove the
6513 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6514 contents to the extension list.
6516 2000-07-04 Juergen Vigna <jug@sad.it>
6518 * src/text.C (NextBreakPoint): added support for needFullRow()
6520 * src/insets/lyxinset.h: added needFullRow()
6522 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6525 * src/insets/insettext.C: lots of changes for update!
6527 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6529 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6531 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6533 * src/insets/insetinclude.C (InsetInclude): fixed
6534 initialization of include_label.
6535 (unique_id): now returns a string.
6537 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6539 * src/LaTeXFeatures.h: new member IncludedFiles, for
6540 a map of key, included file name.
6542 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6543 with the included files for inclusion in SGML preamble,
6544 i. e., linuxdoc and docbook.
6547 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6548 nice (is the generated linuxdoc code to be exported?), that
6549 allows to remove column, and only_body that will be true for
6550 slave documents. Insets are allowed inside SGML font type.
6551 New handling of the SGML preamble for included files.
6552 (makeDocBookFile): the same for docbook.
6554 * src/insets/insetinclude.h:
6555 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6557 (DocBook): new export methods.
6559 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6560 and makeDocBookFile.
6562 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6563 formats to export with command line argument -x.
6565 2000-06-29 Juergen Vigna <jug@sad.it>
6567 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6568 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6570 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6571 region could already been cleared by an inset!
6573 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6575 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6578 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6580 (cursorToggle): remove special handling of lyx focus.
6582 2000-06-28 Juergen Vigna <jug@sad.it>
6584 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6587 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6589 * src/insets/insetindex.C (Edit): add a callback when popup is
6592 * src/insets/insettext.C (LocalDispatch):
6593 * src/insets/insetmarginal.h:
6594 * src/insets/insetlist.h:
6595 * src/insets/insetfoot.h:
6596 * src/insets/insetfloat.h:
6597 * src/insets/insetert.h: add a missing std:: qualifier.
6599 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6601 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6604 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6606 * src/insets/insettext.C (Read): remove tmptok unused variable
6607 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6608 (InsertInset): change for new InsetInset code
6610 * src/insets/insettext.h: add TEXT inline method
6612 * src/insets/insettext.C: remove TEXT macro
6614 * src/insets/insetmarginal.C (Write): new method
6615 (Latex): change output slightly
6617 * src/insets/insetfoot.C (Write): new method
6618 (Latex): change output slightly (don't use endl when no need)
6620 * src/insets/insetert.C (Write): new method
6622 * src/insets/insetcollapsable.h: make button_length, button_top_y
6623 and button_bottm_y protected.
6625 * src/insets/insetcollapsable.C (Write): simplify code by using
6626 tostr. Also do not output the float name, the children class
6627 should to that to get control over own arguments
6629 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6630 src/insets/insetminipage.[Ch]:
6633 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6635 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6637 * src/Makefile.am (lyx_SOURCES): add the new files
6639 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6640 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6641 * src/commandtags.h: ditto
6643 * src/LaTeXFeatures.h: add a std::set of used floattypes
6645 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6647 * src/FloatList.[Ch] src/Floating.h: new files
6649 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6651 * src/lyx_cb.C (TableApplyCB): ditto
6653 * src/text2.C: ditto
6654 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6655 (parseSingleLyXformat2Token): ditto + add code for
6656 backwards compability for old float styles + add code for new insets
6658 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6660 (InsertInset(size_type, Inset *, LyXFont)): new method
6661 (InsetChar(size_type, char)): changed to use the other InsetChar
6662 with a LyXFont(ALL_INHERIT).
6663 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6664 insert the META_INSET.
6666 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6668 * sigc++/thread.h (Threads): from here
6670 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6671 definition out of line
6672 * sigc++/scope.h: from here
6674 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6676 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6677 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6679 * Makefile.am (bindist): new target.
6681 * INSTALL: add instructions for doing a binary distribution.
6683 * development/tools/README.bin.example: update a bit.
6685 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6688 * lib/lyxrc.example: new lyxrc tag \set_color.
6690 * src/lyxfunc.C (Dispatch):
6691 * src/commandtags.h:
6692 * src/LyXAction.C: new lyxfunc "set-color".
6694 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6695 and an x11name given as strings.
6697 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6698 cache when a color is changed.
6700 2000-06-26 Juergen Vigna <jug@sad.it>
6702 * src/lyxrow.C (width): added this functions and variable.
6704 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6707 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6709 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6711 * images/undo_bw.xpm: new icon.
6712 * images/redo_bw.xpm: ditto.
6714 * configure.in (INSTALL_SCRIPT): change value to
6715 ${INSTALL} to avoid failures of install-script target.
6716 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6718 * src/BufferView.h: add a magic "friend" declaration to please
6721 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6723 * forms/cite.fd: modified to allow resizing without messing
6726 * src/insetcite.C: Uses code from cite.fd almost without
6728 User can now resize dialog in the x-direction.
6729 Resizing the dialog in the y-direction is prevented, as the
6730 code does this intelligently already.
6732 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6734 * INSTALL: remove obsolete entry in "problems" section.
6736 * lib/examples/sl_*.lyx: update of the slovenian examples.
6738 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6740 2000-06-23 Juergen Vigna <jug@sad.it>
6742 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6744 * src/buffer.C (resize): delete the LyXText of textinsets.
6746 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6748 * src/insets/lyxinset.h: added another parameter 'cleared' to
6749 the draw() function.
6751 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6752 unlocking inset in inset.
6754 2000-06-22 Juergen Vigna <jug@sad.it>
6756 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6757 of insets and moved first to LyXText.
6759 * src/mathed/formulamacro.[Ch]:
6760 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6762 2000-06-21 Juergen Vigna <jug@sad.it>
6764 * src/text.C (GetVisibleRow): look if I should clear the area or not
6765 using Inset::doClearArea() function.
6767 * src/insets/lyxinset.h: added doClearArea() function and
6768 modified draw(Painter &, ...) to draw(BufferView *, ...)
6770 * src/text2.C (UpdateInset): return bool insted of int
6772 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6774 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6775 combox in the character popup
6777 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6778 BufferParams const & params
6780 2000-06-20 Juergen Vigna <jug@sad.it>
6782 * src/insets/insettext.C (SetParagraphData): set insetowner on
6785 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6787 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6788 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6790 (form_main_): remove
6792 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6793 (create_form_form_main): remove FD_form_main stuff, connect to
6794 autosave_timeout signal
6796 * src/LyXView.[Ch] (getMainForm): remove
6797 (UpdateTimerCB): remove
6798 * src/BufferView_pimpl.h: inherit from SigC::Object
6800 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6801 signal instead of callback
6803 * src/BufferView.[Ch] (cursorToggleCB): remove
6805 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6807 * src/BufferView_pimpl.C: changes because of the one below
6809 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6810 instead of storing a pointer to a LyXText.
6812 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6814 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6816 * src/lyxparagraph.h
6818 * src/paragraph.C: Changed fontlist to a sorted vector.
6820 2000-06-19 Juergen Vigna <jug@sad.it>
6822 * src/BufferView.h: added screen() function.
6824 * src/insets/insettext.C (LocalDispatch): some selection code
6827 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6829 * src/insets/insettext.C (SetParagraphData):
6831 (InsetText): fixes for multiple paragraphs.
6833 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6835 * development/lyx.spec.in: Call configure with ``--without-warnings''
6836 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6837 This should be fine, however, since we generally don't want to be
6838 verbose when making an RPM.
6840 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6842 * lib/scripts/fig2pstex.py: New file
6844 2000-06-16 Juergen Vigna <jug@sad.it>
6846 * src/insets/insettabular.C (UpdateLocal):
6847 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6848 (LocalDispatch): Changed all functions to use LyXText.
6850 2000-06-15 Juergen Vigna <jug@sad.it>
6852 * src/text.C (SetHeightOfRow): call inset::update before requesting
6855 * src/insets/insettext.C (update):
6856 * src/insets/insettabular.C (update): added implementation
6858 * src/insets/lyxinset.h: added update function
6860 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6862 * src/text.C (SelectNextWord): protect against null pointers with
6863 old-style string streams. (fix from Paul Theo Gonciari
6866 * src/cite.[Ch]: remove erroneous files.
6868 * lib/configure.m4: update the list of created directories.
6870 * src/lyxrow.C: include <config.h>
6871 * src/lyxcursor.C: ditto.
6873 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6875 * lib/examples/decimal.lyx: new example file from Mike.
6877 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6878 to find template definitions (from Dekel)
6880 * src/frontends/.cvsignore: add a few things.
6882 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6884 * src/Timeout.C (TimeOut): remove default argument.
6886 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6889 * src/insets/ExternalTemplate.C: add a "using" directive.
6891 * src/lyx_main.h: remove the act_ struct, which seems unused
6894 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6896 * LyX Developers Meeting: All files changed, due to random C++ (by
6897 coincidence) code generator script.
6899 - external inset (cool!)
6900 - initial online editing of preferences
6901 - insettabular breaks insettext(s contents)
6903 - some DocBook fixes
6904 - example files update
6905 - other cool stuff, create a diff and look for yourself.
6907 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6909 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6910 -1 this is a non-line-breaking textinset.
6912 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6913 if there is no width set.
6915 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6917 * Lots of files: Merged the dialogbase branch.
6919 2000-06-09 Allan Rae <rae@lyx.org>
6921 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6922 and the Dispatch methods that used it.
6924 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6925 access to functions formerly kept in Dispatch.
6927 2000-05-19 Allan Rae <rae@lyx.org>
6929 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6930 made to_page and count_copies integers again. from_page remains a
6931 string however because I want to allow entry of a print range like
6932 "1,4,22-25" using this field.
6934 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6935 and printer-params-get. These aren't useful from the minibuffer but
6936 could be used by a script/LyXServer app provided it passes a suitable
6937 auto_mem_buffer. I guess I should take a look at how the LyXServer
6938 works and make it support xtl buffers.
6940 * sigc++/: updated to libsigc++-1.0.1
6942 * src/xtl/: updated to xtl-1.3.pl.11
6944 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6945 those changes done to the files in src/ are actually recreated when
6946 they get regenerated. Please don't ever accept a patch that changes a
6947 dialog unless that patch includes the changes to the corresponding *.fd
6950 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6951 stringOnlyContains, renamed it and generalised it.
6953 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6954 branch. Removed the remaining old form_print code.
6956 2000-04-26 Allan Rae <rae@lyx.org>
6958 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6959 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6961 2000-04-25 Allan Rae <rae@lyx.org>
6963 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6964 against a base of xtl-1.3.pl.4
6966 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6967 filter the Id: entries so they still show the xtl version number
6970 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6971 into the src/xtl code. Patch still pending with José (XTL)
6973 2000-04-24 Allan Rae <rae@lyx.org>
6975 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6976 both more generic and much safer. Use the new template functions.
6977 * src/buffer.[Ch] (Dispatch): ditto.
6979 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6980 and mem buffer more intelligently. Also a little general cleanup.
6983 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6984 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6985 * src/xtl/Makefile.am: ditto.
6986 * src/xtl/.cvsignore: ditto.
6987 * src/Makefile.am: ditto.
6989 * src/PrinterParams.h: Removed the macros member functions. Added a
6990 testInvariant member function. A bit of tidying up and commenting.
6991 Included Angus's idea for fixing operation with egcs-1.1.2.
6993 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6994 cool expansion of XTL's mem_buffer to support automatic memory
6995 management within the buffer itself. Removed the various macros and
6996 replaced them with template functions that use either auto_mem_buffer
6997 or mem_buffer depending on a #define. The mem_buffer support will
6998 disappear as soon as the auto_mem_buffer is confirmed to be good on
6999 other platforms/compilers. That is, it's there so you've got something
7002 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7003 effectively forked XTL. However I expect José will include my code
7004 into the next major release. Also fixed a memory leak.
7005 * src/xtl/text.h: ditto.
7006 * src/xtl/xdr.h: ditto.
7007 * src/xtl/giop.h: ditto.
7009 2000-04-16 Allan Rae <rae@lyx.org>
7011 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7012 by autogen.sh and removed by maintainer-clean anyway.
7013 * .cvsignore, sigc++/.cvsignore: Support the above.
7015 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7017 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7019 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7020 macros, renamed static callback-target member functions to suit new
7021 scheme and made them public.
7022 * src/frontends/xforms/forms/form_print.fd: ditto.
7023 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7025 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7028 * src/xtl/: New directory containing a minimal distribution of XTL.
7029 This is XTL-1.3.pl.4.
7031 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7033 2000-04-15 Allan Rae <rae@lyx.org>
7035 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7037 * sigc++/: Updated to libsigc++-1.0.0
7039 2000-04-14 Allan Rae <rae@lyx.org>
7041 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7042 use the generic ones in future. I'll modify my conversion script.
7044 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7046 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7047 (CloseAllBufferRelatedDialogs): Renamed.
7048 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7050 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7051 of the generic ones. These are the same ones my conversion script
7054 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7055 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7056 * src/buffer.C (Dispatch): ditto
7058 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7059 functions for updating and hiding buffer dependent dialogs.
7060 * src/BufferView.C (buffer): ditto
7061 * src/buffer.C (setReadonly): ditto
7062 * src/lyxfunc.C (CloseBuffer): ditto
7064 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7065 Dialogs.h, and hence all the SigC stuff, into every file that includes
7066 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7068 * src/BufferView2.C: reduce the number of headers included by buffer.h
7070 2000-04-11 Allan Rae <rae@lyx.org>
7072 * src/frontends/xforms/xform_macros.h: A small collection of macros
7073 for building C callbacks.
7075 * src/frontends/xforms/Makefile.am: Added above file.
7077 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7078 scheme again. This time it should work for JMarc. If this is
7079 successful I'll revise my conversion script to automate some of this.
7080 The static member functions in the class also have to be public for
7081 this scheme will work. If the scheme works (it's almost identical to
7082 the way BufferView::cursorToggleCB is handled so it should work) then
7083 FormCopyright and FormPrint will be ready for inclusion into the main
7084 trunk immediately after 1.1.5 is released -- provided we're prepared
7085 for complaints about lame compilers not handling XTL.
7087 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7089 2000-04-07 Allan Rae <rae@lyx.org>
7091 * config/lyxinclude.m4: A bit more tidying up (Angus)
7093 * src/LString.h: JMarc's <string> header fix
7095 * src/PrinterParams.h: Used string for most data to remove some
7096 ugly code in the Print dialog and avoid even uglier code when
7097 appending the ints to a string for output.
7099 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7100 and moved "default:" back to the end of switch statement. Cleaned
7101 up the printing so it uses the right function calls and so the
7102 "print to file" option actually puts the file in the right directory.
7104 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7106 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7107 and Ok+Apply button control into a separate method: input (Angus).
7108 (input) Cleaned it up and improved it to be very thorough now.
7109 (All CB) static_cast used instead of C style cast (Angus). This will
7110 probably change again once we've worked out how to keep gcc-2.8.1 happy
7111 with real C callbacks.
7112 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7113 ignore some of the bool settings and has random numbers instead. Needs
7114 some more investigation. Added other input length checks and checking
7115 of file and printer names.
7117 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7118 would link (Angus). Seems the old code doesn't compile with the pragma
7119 statement either. Separated callback entries from internal methods.
7121 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7123 2000-03-17 Allan Rae <rae@lyx.org>
7125 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7126 need it? Maybe it could go in Dialogs instead? I could make it a
7127 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7128 values to get the bool return value.
7129 (Dispatch): New overloaded method for xtl support.
7131 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7132 extern "C" callback instead of static member functions. Hopefully,
7133 JMarc will be able to compile this. I haven't changed
7134 forms/form_copyright.fd yet. Breaking one of my own rules already.
7136 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7137 because they aren't useful from the minibuffer. Maybe a LyXServer
7138 might want a help message though?
7140 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7142 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7143 xtl which needs both rtti and exceptions.
7145 * src/support/Makefile.am:
7146 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7148 * src/frontends/xforms/input_validators.[ch]: input filters and
7149 validators. These conrol what keys are valid in input boxes.
7150 Use them and write some more. Much better idea than waiting till
7151 after the user has pressed Ok to say that the input fields don't make
7154 * src/frontends/xforms/Makefile.am:
7155 * src/frontends/xforms/forms/form_print.fd:
7156 * src/frontends/xforms/forms/makefile:
7157 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7158 new scheme. Still have to make sure I haven't missed anything from
7159 the current implementation.
7161 * src/Makefile.am, src/PrinterParams.h: New data store.
7163 * other files: Added a couple of copyright notices.
7165 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7167 * src/insets/insetbib.h: move Holder struct in public space.
7169 * src/frontends/include/DialogBase.h: use SigC:: only when
7170 SIGC_CXX_NAMESPACES is defined.
7171 * src/frontends/include/Dialogs.h: ditto.
7173 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7175 * src/frontends/xforms/FormCopyright.[Ch]: do not
7176 mention SigC:: explicitely.
7178 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7180 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7181 deals with testing KDE in main configure.in
7182 * configure.in: ditto.
7184 2000-02-22 Allan Rae <rae@lyx.org>
7186 * Lots of files: Merged from HEAD
7188 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7189 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7191 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7193 * sigc++/: new minidist.
7195 2000-02-14 Allan Rae <rae@lyx.org>
7197 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7199 2000-02-08 Juergen Vigna <jug@sad.it>
7201 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7202 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7204 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7205 for this port and so it is much easier for other people to port
7206 dialogs in a common development environment.
7208 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7209 the QT/KDE implementation.
7211 * src/frontends/kde/Dialogs.C:
7212 * src/frontends/kde/FormCopyright.C:
7213 * src/frontends/kde/FormCopyright.h:
7214 * src/frontends/kde/Makefile.am:
7215 * src/frontends/kde/formcopyrightdialog.C:
7216 * src/frontends/kde/formcopyrightdialog.h:
7217 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7218 for the kde support of the Copyright-Dialog.
7220 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7221 subdir-substitution instead of hardcoded 'xforms' as we now have also
7224 * src/frontends/include/DialogBase.h (Object): just commented the
7225 label after #endif (nasty warning and I don't like warnings ;)
7227 * src/main.C (main): added KApplication initialization if using
7230 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7231 For now only the KDE event-loop is added if frontend==kde.
7233 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7235 * configure.in: added support for the --with-frontend[=value] option
7237 * autogen.sh: added kde.m4 file to list of config-files
7239 * acconfig.h: added define for KDEGUI-support
7241 * config/kde.m4: added configuration functions for KDE-port
7243 * config/lyxinclude.m4: added --with-frontend[=value] option with
7244 support for xforms and KDE.
7246 2000-02-08 Allan Rae <rae@lyx.org>
7248 * all Makefile.am: Fixed up so the make targets dist, distclean,
7249 install and uninstall all work even if builddir != srcdir. Still
7250 have a new sigc++ minidist update to come.
7252 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7254 2000-02-01 Allan Rae <rae@lyx.org>
7256 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7257 Many mods to get builddir != srcdir working.
7259 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7260 for building on NT and so we can do the builddir != srcdir stuff.
7262 2000-01-30 Allan Rae <rae@lyx.org>
7264 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7265 This will stay in "rae" branch. We probably don't really need it in
7266 the main trunk as anyone who wants to help programming it should get
7267 a full library installed also. So they can check both included and
7268 system supplied library compilation.
7270 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7271 Added a 'mini' distribution of libsigc++. If you feel the urge to
7272 change something in these directories - Resist it. If you can't
7273 resist the urge then you should modify the following script and rebuild
7274 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7275 all happen. Still uses a hacked version of libsigc++'s configure.in.
7276 I'm quite happy with the results. I'm not sure the extra work to turn
7277 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7278 worth the trouble and would probably lead to extra maintenance
7280 I haven't tested the following important make targets: install, dist.
7281 Not ready for prime time but very close. Maybe 1.1.5.
7283 * development/tools/makeLyXsigc.sh: A shell script to automatically
7284 generate our mini-dist of libsigc++. It can only be used with a CVS
7285 checkout of libsigc++ not a tarball distribution. It's well commented.
7286 This will end up as part of the libsigc++ distribution so other apps
7287 can easily have an included mini-dist. If someone makes mods to the
7288 sigc++ subpackage without modifying this script to generate those
7289 changes I'll be very upset!
7291 * src/frontends/: Started the gui/system indep structure.
7293 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7294 to access the gui-indep dialogs are in this class. Much improved
7295 design compared to previous revision. Lars, please refrain from
7296 moving this header into src/ like you did with Popups.h last time.
7298 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7300 * src/frontends/xforms/: Started the gui-indep system with a single
7301 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7304 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7305 Here you'll find a very useful makefile and automated fdfix.sh that
7306 makes updating dailogs a no-brainer -- provided you follow the rules
7307 set out in the README. I'm thinking about adding another script to
7308 automatically generate skeleton code for a new dialog given just the
7311 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7312 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7313 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7315 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7317 * src/support/LSubstring.C (operator): simplify
7319 * src/lyxtext.h: removed bparams, use buffer_->params instead
7321 * src/lyxrow.h: make Row a real class, move all variables to
7322 private and use accessors.
7324 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7326 (isRightToLeftPar): ditto
7327 (ChangeLanguage): ditto
7328 (isMultiLingual): ditto
7331 (SimpleTeXOnePar): ditto
7332 (TeXEnvironment): ditto
7333 (GetEndLabel): ditto
7335 (SetOnlyLayout): ditto
7336 (BreakParagraph): ditto
7337 (BreakParagraphConservative): ditto
7338 (GetFontSettings): ditto
7340 (CopyIntoMinibuffer): ditto
7341 (CutIntoMinibuffer): ditto
7342 (PasteParagraph): ditto
7343 (SetPExtraType): ditto
7344 (UnsetPExtraType): ditto
7345 (DocBookContTableRows): ditto
7346 (SimpleDocBookOneTablePar): ditto
7348 (TeXFootnote): ditto
7349 (SimpleTeXOneTablePar): ditto
7350 (TeXContTableRows): ditto
7351 (SimpleTeXSpecialChars): ditto
7354 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7355 to private and use accessors.
7357 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7358 this, we did not use it anymore and has not been for ages. Just a
7359 waste of cpu cycles.
7361 * src/language.h: make Language a real class, move all variables
7362 to private and use accessors.
7364 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7365 (create_view): remove
7366 (update): some changes for new timer
7367 (cursorToggle): use new timer
7368 (beforeChange): change for new timer
7370 * src/BufferView.h (cursorToggleCB): removed last paramter because
7373 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7374 (cursorToggleCB): change because of new timer code
7376 * lib/CREDITS: updated own mailaddress
7378 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7380 * src/support/filetools.C (PutEnv): fix the code in case neither
7381 putenv() nor setenv() have been found.
7383 * INSTALL: mention the install-strip Makefile target.
7385 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7386 read-only documents.
7388 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7390 * lib/reLyX/configure.in (VERSION): avoid using a previously
7391 generated reLyX wrapper to find out $prefix.
7393 * lib/examples/eu_adibide_lyx-atua.lyx:
7394 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7395 translation of the Tutorial (Dooteo)
7397 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7399 * forms/cite.fd: new citation dialog
7401 * src/insetcite.[Ch]: the new citation dialog is moved into
7404 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7407 * src/insets/insetcommand.h: data members made private.
7409 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7411 * LyX 1.1.5 released
7413 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7415 * src/version.h (LYX_RELEASE): to 1.1.5
7417 * src/spellchecker.C (RunSpellChecker): return false if the
7418 spellchecker dies upon creation.
7420 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7422 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7423 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7427 * lib/CREDITS: update entry for Martin Vermeer.
7429 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7431 * src/text.C (draw): Draw foreign language bars at the bottom of
7432 the row instead of at the baseline.
7434 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7436 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7438 * lib/bind/de_menus.bind: updated
7440 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7442 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7444 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7446 * src/menus.C (Limit_string_length): New function
7447 (ShowTocMenu): Limit the number of items/length of items in the
7450 * src/paragraph.C (String): Correct result for a paragraph inside
7453 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7455 * src/bufferlist.C (close): test of buf->getuser() == NULL
7457 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7459 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7460 Do not call to SetCursor when the paragraph is a closed footnote!
7462 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7464 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7467 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7469 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7472 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7473 reference popup, that activates the reference-back action
7475 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7477 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7478 the menus. Also fixed a bug.
7480 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7481 the math panels when switching buffers (unless new buffer is readonly).
7483 * src/BufferView.C (NoSavedPositions)
7484 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7486 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7488 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7489 less of dvi dirty or not.
7491 * src/trans_mgr.[Ch] (insert): change first parameter to string
7494 * src/chset.[Ch] (encodeString): add const to first parameter
7496 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7498 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7502 * src/LaTeX.C (deplog): better searching for dependency files in
7503 the latex log. Uses now regexps.
7505 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7506 instead of the box hack or \hfill.
7508 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7510 * src/lyxfunc.C (doImportHelper): do not create the file before
7511 doing the actual import.
7512 (doImportASCIIasLines): create a new file before doing the insert.
7513 (doImportASCIIasParagraphs): ditto.
7515 * lib/lyxrc.example: remove mention of non-existing commands
7517 * lyx.man: remove mention of color-related switches.
7519 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7521 * src/lyx_gui.C: remove all the color-related ressources, which
7522 are not used anymore.
7524 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7527 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7529 * src/lyxrc.C (read): Add a missing break in the switch
7531 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7533 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7535 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7538 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7540 * src/text.C (draw): draw bars under foreign language words.
7542 * src/LColor.[Ch]: add LColor::language
7544 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7546 * src/lyxcursor.h (boundary): New member variable
7548 * src/text.C (IsBoundary): New methods
7550 * src/text.C: Use the above for currect cursor movement when there
7551 is both RTL & LTR text.
7553 * src/text2.C: ditto
7555 * src/bufferview_funcs.C (ToggleAndShow): ditto
7557 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7559 * src/text.C (DeleteLineForward): set selection to true to avoid
7560 that DeleteEmptyParagraphMechanism does some magic. This is how it
7561 is done in all other functions, and seems reasonable.
7562 (DeleteWordForward): do not jump over non-word stuff, since
7563 CursorRightOneWord() already does it.
7565 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7566 DeleteWordBackward, since they seem safe to me (since selection is
7567 set to "true") DeleteEmptyParagraphMechanism does nothing.
7569 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7571 * src/lyx_main.C (easyParse): simplify the code by factoring the
7572 part that removes parameters from the command line.
7573 (LyX): check wether wrong command line options have been given.
7575 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7577 * src/lyx_main.C : add support for specifying user LyX
7578 directory via command line option -userdir.
7580 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7582 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7583 the number of items per popup.
7584 (Add_to_refs_menu): Ditto.
7586 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7588 * src/lyxparagraph.h: renamed ClearParagraph() to
7589 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7590 textclass as parameter, and do nothing if free_spacing is
7591 true. This fixes part of the line-delete-forward problems.
7593 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7594 (pasteSelection): ditto.
7595 (SwitchLayoutsBetweenClasses): more translatable strings.
7597 * src/text2.C (CutSelection): use StripLeadingSpaces.
7598 (PasteSelection): ditto.
7599 (DeleteEmptyParagraphMechanism): ditto.
7601 2000-05-26 Juergen Vigna <jug@sad.it>
7603 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7604 is not needed in tabular insets.
7606 * src/insets/insettabular.C (TabularFeatures): added missing features.
7608 * src/tabular.C (DeleteColumn):
7610 (AppendRow): implemented this functions
7611 (cellsturct::operator=): clone the inset too;
7613 2000-05-23 Juergen Vigna <jug@sad.it>
7615 * src/insets/insettabular.C (LocalDispatch): better selection support
7616 when having multicolumn-cells.
7618 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7620 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7622 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7624 * src/ColorHandler.C (getGCForeground): put more test into _()
7626 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7629 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7632 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7634 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7635 there are no labels, or when buffer is readonly.
7637 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7638 there are no labels, buffer is SGML, or when buffer is readonly.
7640 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7642 * src/LColor.C (LColor): change a couple of grey40 to grey60
7643 (LColor): rewore initalization to make compiles go some magnitude
7645 (getGUIName): don't use gettext until we need the string.
7647 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7649 * src/Bullet.[Ch]: Fixed a small bug.
7651 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7653 * src/paragraph.C (String): Several fixes/improvements
7655 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7657 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7659 * src/paragraph.C (String): give more correct output.
7661 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7663 * src/lyxfont.C (stateText) Do not output the language if it is
7664 eqaul to the language of the document.
7666 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7667 between two paragraphs with the same language.
7669 * src/paragraph.C (getParLanguage) Return a correct answer for an
7670 empty dummy paragraph.
7672 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7675 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7678 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7679 the menus/popup, if requested fonts are unavailable.
7681 2000-05-22 Juergen Vigna <jug@sad.it>
7683 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7684 movement support (Up/Down/Tab/Shift-Tab).
7685 (LocalDispatch): added also preliminari cursor-selection.
7687 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7689 * src/paragraph.C (PasteParagraph): Hopefully now right!
7691 2000-05-22 Garst R. Reese <reese@isn.net>
7693 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7694 of list, change all references to Environment to Command
7695 * tex/hollywood.cls : rewrite environments as commands, add
7696 \uppercase to interiorshot and exteriorshot to force uppecase.
7697 * tex/broadway.cls : rewrite environments as commands. Tweak
7700 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7702 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7703 size of items: use a constant intead of the hardcoded 40, and more
7704 importantly do not remove the %m and %x tags added at the end.
7705 (Add_to_refs_menu): use vector::size_type instead of
7706 unsigned int as basic types for the variables. _Please_ do not
7707 assume that size_t is equal to unsigned int. On an alpha, this is
7708 unsigned long, which is _not_ the same.
7710 * src/language.C (initL): remove language "hungarian", since it
7711 seems that "magyar" is better.
7713 2000-05-22 Juergen Vigna <jug@sad.it>
7715 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7717 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7720 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7721 next was deleted but not set to 0.
7723 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7725 * src/language.C (initL): change the initialization of languages
7726 so that compiles goes _fast_.
7728 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7731 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7733 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7737 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7739 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7741 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7745 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7748 * src/insets/insetlo*.[Ch]: Made editable
7750 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7752 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7753 the current selection.
7755 * src/BufferView_pimpl.C (stuffClipboard): new method
7757 * src/BufferView.C (stuffClipboard): new method
7759 * src/paragraph.C (String): new method
7761 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7762 LColor::ignore when lyxname is not found.
7764 * src/BufferView.C (pasteSelection): new method
7766 * src/BufferView_pimpl.C (pasteSelection): new method
7768 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7770 * src/WorkArea.C (request_clipboard_cb): new static function
7771 (getClipboard): new method
7772 (putClipboard): new method
7774 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7776 * LyX 1.1.5pre2 released
7778 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7780 * src/vspace.C (operator=): removed
7781 (operator=): removed
7783 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7785 * src/layout.C (NumberOfClass): manually set the type in make_pair
7786 (NumberOfLayout): ditto
7788 * src/language.C: use the Language constructor for ignore_lang
7790 * src/language.h: add constructors to struct Language
7792 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7794 * src/text2.C (SetCursorIntern): comment out #warning
7796 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7798 * src/mathed/math_iter.h: initialize sx and sw to 0
7800 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7802 * forms/lyx.fd: Redesign of form_ref
7804 * src/LaTeXFeatures.[Ch]
7808 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7811 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7812 and Buffer::inset_iterator.
7814 * src/menus.C: Added new menus: TOC and Refs.
7816 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7818 * src/buffer.C (getTocList): New method.
7820 * src/BufferView2.C (ChangeRefs): New method.
7822 * src/buffer.C (getLabelList): New method. It replaces the old
7823 getReferenceList. The return type is vector<string> instead of
7826 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7827 the old getLabel() and GetNumberOfLabels() methods.
7828 * src/insets/insetlabel.C (getLabelList): ditto
7829 * src/mathed/formula.C (getLabelList): ditto
7831 * src/paragraph.C (String): New method.
7833 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7834 Uses the new getTocList() method.
7835 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7836 which automatically updates the contents of the browser.
7837 (RefUpdateCB): Use the new getLabelList method.
7839 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7841 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7843 * src/spellchecker.C: Added using std::reverse;
7845 2000-05-19 Juergen Vigna <jug@sad.it>
7847 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7849 * src/insets/insettext.C (computeTextRows): small fix for display of
7850 1 character after a newline.
7852 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7855 2000-05-18 Juergen Vigna <jug@sad.it>
7857 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7858 when changing width of column.
7860 * src/tabular.C (set_row_column_number_info): setting of
7861 autobreak rows if necessary.
7863 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7865 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7867 * src/vc-backend.*: renamed stat() to status() and vcstat to
7868 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7869 compilation broke. The new name seems more relevant, anyway.
7871 2000-05-17 Juergen Vigna <jug@sad.it>
7873 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7874 which was wrong if the removing caused removing of rows!
7876 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7877 (pushToken): new function.
7879 * src/text2.C (CutSelection): fix problem discovered with purify
7881 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7883 * src/debug.C (showTags): enlarge the first column, now that we
7884 have 6-digits debug codes.
7886 * lib/layouts/hollywood.layout:
7887 * lib/tex/hollywood.cls:
7888 * lib/tex/brodway.cls:
7889 * lib/layouts/brodway.layout: more commands and fewer
7890 environments. Preambles moved in the .cls files. Broadway now has
7891 more options on scene numbering and less whitespace (from Garst)
7893 * src/insets/insetbib.C (getKeys): make sure that we are in the
7894 document directory, in case the bib file is there.
7896 * src/insets/insetbib.C (Latex): revert bogus change.
7898 2000-05-16 Juergen Vigna <jug@sad.it>
7900 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7901 the TabularLayout on cursor move.
7903 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7905 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7908 (draw): fixed cursor position and drawing so that the cursor is
7909 visible when before the tabular-inset.
7911 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7912 when creating from old insettext.
7914 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7916 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7918 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7919 * lib/tex/brodway.cls: ditto
7921 * lib/layouts/brodway.layout: change alignment of parenthical
7924 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7926 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7927 versions 0.88 and 0.89 are supported.
7929 2000-05-15 Juergen Vigna <jug@sad.it>
7931 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7934 * src/insets/insettext.C (computeTextRows): redone completely this
7935 function in a much cleaner way, because of problems when having a
7937 (draw): added a frame border when the inset is locked.
7938 (SetDrawLockedFrame): this sets if we draw the border or not.
7939 (SetFrameColor): this sets the frame color (default=insetframe).
7941 * src/insets/lyxinset.h: added x() and y() functions which return
7942 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7943 function which is needed to see if we have a locking inset of some
7944 type in this inset (needed for now in insettabular).
7946 * src/vspace.C (inPixels): the same function also without a BufferView
7947 parameter as so it is easier to use it in some ocasions.
7949 * src/lyxfunc.C: changed all places where insertInset was used so
7950 that now if it couldn't be inserted it is deleted!
7952 * src/TabularLayout.C:
7953 * src/TableLayout.C: added support for new tabular-inset!
7955 * src/BufferView2.C (insertInset): this now returns a bool if the
7956 inset was really inserted!!!
7958 * src/tabular.C (GetLastCellInRow):
7959 (GetFirstCellInRow): new helper functions.
7960 (Latex): implemented for new tabular class.
7964 (TeXTopHLine): new Latex() helper functions.
7966 2000-05-12 Juergen Vigna <jug@sad.it>
7968 * src/mathed/formulamacro.C (Read):
7969 * src/mathed/formula.C (Read): read also the \end_inset here!
7971 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7973 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7974 crush when saving formulae with unbalanced parenthesis.
7976 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7978 * src/layout.C: Add new keyword "endlabelstring" to layout file
7980 * src/text.C (GetVisibleRow): Draw endlabel string.
7982 * lib/layouts/broadway.layout
7983 * lib/layouts/hollywood.layout: Added endlabel for the
7984 Parenthetical layout.
7986 * lib/layouts/heb-article.layout: Do not use slanted font shape
7987 for Theorem like environments.
7989 * src/buffer.C (makeLaTeXFile): Always add "american" to
7990 the UsedLanguages list if document language is RTL.
7992 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7994 * add addendum to README.OS2 and small patch (from SMiyata)
7996 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7998 * many files: correct the calls to ChangeExtension().
8000 * src/support/filetools.C (ChangeExtension): remove the no_path
8001 argument, which does not belong there. Use OnlyFileName() instead.
8003 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8004 files when LaTeXing a non-nice latex file.
8006 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8007 a chain of "if". Return false when deadkeys are not handled.
8009 * src/lyx_main.C (LyX): adapted the code for default bindings.
8011 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8012 bindings for basic functionality (except deadkeys).
8013 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8015 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8016 several methods: handle override_x_deadkeys.
8018 * src/lyxrc.h: remove the "bindings" map, which did not make much
8019 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8021 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8023 * src/lyxfont.C (stateText): use a saner method to determine
8024 whether the font is "default". Seems to fix the crash with DEC
8027 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8029 2000-05-08 Juergen Vigna <jug@sad.it>
8031 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8032 TabularLayoutMenu with mouse-button-3
8033 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8035 * src/TabularLayout.C: added this file for having a Layout for
8038 2000-05-05 Juergen Vigna <jug@sad.it>
8040 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8041 recalculating inset-widths.
8042 (TabularFeatures): activated this function so that I can change
8043 tabular-features via menu.
8045 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8046 that I can test some functions with the Table menu.
8048 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8050 * src/lyxfont.C (stateText): guard against stupid c++libs.
8052 * src/tabular.C: add using std::vector
8053 some whitespace changes, + removed som autogenerated code.
8055 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8057 2000-05-05 Juergen Vigna <jug@sad.it>
8059 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8060 row, columns and cellstructures.
8062 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8064 * lib/lyxrc.example: remove obsolete entries.
8066 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8067 reading of protected_separator for free_spacing.
8069 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8071 * src/text.C (draw): do not display an exclamation mark in the
8072 margin for margin notes. This is confusing, ugly and
8075 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8076 AMS math' is checked.
8078 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8079 name to see whether including the amsmath package is needed.
8081 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8083 * src/paragraph.C (validate): Compute UsedLanguages correctly
8084 (don't insert the american language if it doesn't appear in the
8087 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8088 The argument of \thanks{} command is considered moving argument
8090 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8093 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8095 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8096 for appendix/minipage/depth. The lines can be now both in the footnote
8097 frame, and outside the frame.
8099 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8102 2000-05-05 Juergen Vigna <jug@sad.it>
8104 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8105 neede only in tabular.[Ch].
8107 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8109 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8111 (Write): write '~' for PROTECTED_SEPARATOR
8113 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8115 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8118 * src/mathed/formula.C (drawStr): rename size to siz.
8120 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8121 possibly fix a bug by not changing the pflags = flags to piflags =
8124 2000-05-05 Juergen Vigna <jug@sad.it>
8126 * src/insets/insetbib.C: moved using directive
8128 * src/ImportNoweb.C: small fix for being able to compile (missing
8131 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8133 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8134 to use clear, since we don't depend on this in the code. Add test
8137 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8139 * (various *.C files): add using std::foo directives to please dec
8142 * replace calls to string::clear() to string::erase() (Angus)
8144 * src/cheaders/cmath: modified to provide std::abs.
8146 2000-05-04 Juergen Vigna <jug@sad.it>
8148 * src/insets/insettext.C: Prepared all for inserting of multiple
8149 paragraphs. Still display stuff to do (alignment and other things),
8150 but I would like to use LyXText to do this when we cleaned out the
8151 table-support stuff.
8153 * src/insets/insettabular.C: Changed lot of stuff and added lots
8154 of functionality still a lot to do.
8156 * src/tabular.C: Various functions changed name and moved to be
8157 const functions. Added new Read and Write functions and changed
8158 lots of things so it works good with tabular-insets (also removed
8159 some stuff which is not needed anymore * hacks *).
8161 * src/lyxcursor.h: added operators == and != which just look if
8162 par and pos are (not) equal.
8164 * src/buffer.C (latexParagraphs): inserted this function to latex
8165 all paragraphs form par to endpar as then I can use this too for
8168 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8169 so that I can call this to from text insets with their own cursor.
8171 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8172 output off all paragraphs (because of the fix below)!
8174 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8175 the very last paragraph (this could be also the last paragraph of an
8178 * src/texrow.h: added rows() call which returns the count-variable.
8180 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8182 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8184 * lib/configure.m4: better autodetection of DocBook tools.
8186 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8188 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8190 * src/lyx_cb.C: add using std::reverse;
8192 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8195 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8196 selected files. Should fix repeated errors from generated files.
8198 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8200 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8202 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8203 the spellchecker popup.
8205 * lib/lyxrc.example: Removed the \number_inset section
8207 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8209 * src/insets/figinset.C (various): Use IsFileReadable() to make
8210 sure that the file actually exist. Relying on ghostscripts errors
8211 is a bad idea since they can lead to X server crashes.
8213 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8215 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8218 * lib/lyxrc.example: smallish typo in description of
8219 \view_dvi_paper_option
8221 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8224 * src/lyxfunc.C: doImportHelper to factor out common code of the
8225 various import methods. New functions doImportASCIIasLines,
8226 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8227 doImportLinuxDoc for the format specific parts.
8230 * buffer.C: Dispatch returns now a bool to indicate success
8233 * lyx_gui.C: Add getLyXView() for member access
8235 * lyx_main.C: Change logic for batch commands: First try
8236 Buffer::Dispatch (possibly without GUI), if that fails, use
8239 * lyx_main.C: Add support for --import command line switch.
8240 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8241 Available Formats: Everything accepted by 'buffer-import <format>'
8243 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8245 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8248 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8249 documents will be reformatted upon reentry.
8251 2000-04-27 Juergen Vigna <jug@sad.it>
8253 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8254 correctly only last pos this was a bug.
8256 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8258 * release of lyx-1.1.5pre1
8260 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8262 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8264 * src/menus.C: revert the change of naming (Figure->Graphic...)
8265 from 2000-04-11. It was incomplete and bad.
8267 * src/LColor.[Ch]: add LColor::depthbar.
8268 * src/text.C (GetVisibleRow): use it.
8270 * README: update the languages list.
8272 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8274 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8277 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8279 * README: remove sections that were just wrong.
8281 * src/text2.C (GetRowNearY): remove currentrow code
8283 * src/text.C (GetRow): remove currentrow code
8285 * src/screen.C (Update): rewritten a bit.
8286 (SmallUpdate): removed func
8288 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8290 (FullRebreak): return bool
8291 (currentrow): remove var
8292 (currentrow_y): ditto
8294 * src/lyxscreen.h (Draw): change arg to unsigned long
8295 (FitCursor): return bool
8296 (FitManualCursor): ditto
8297 (Smallpdate): remove func
8298 (first): change to unsigned long
8299 (DrawOneRow): change second arg to long (from long &)
8300 (screen_refresh_y): remove var
8301 (scree_refresh_row): ditto
8303 * src/lyxrow.h: change baseline to usigned int from unsigned
8304 short, this brings some implicit/unsigned issues out in the open.
8306 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8308 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8309 instead of smallUpdate.
8311 * src/lyxcursor.h: change y to unsigned long
8313 * src/buffer.h: don't call updateScrollbar after fitcursor
8315 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8316 where they are used. Removed "\\direction", this was not present
8317 in 1.1.4 and is already obsolete. Commented out some code that I
8318 believe to never be called.
8319 (runLiterate): don't call updateScrollbar after fitCursor
8321 (buildProgram): ditto
8324 * src/WorkArea.h (workWidth): change return val to unsigned
8327 (redraw): remove the button redraws
8328 (setScrollbarValue): change for scrollbar
8329 (getScrollbarValue): change for scrollbar
8330 (getScrollbarBounds): change for scrollbar
8332 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8333 (C_WorkArea_down_cb): removed func
8334 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8335 (resize): change for scrollbar
8336 (setScrollbar): ditto
8337 (setScrollbarBounds): ditto
8338 (setScrollbarIncrements): ditto
8339 (up_cb): removed func
8340 (down_cb): removed func
8341 (scroll_cb): change for scrollbar
8342 (work_area_handler): ditto
8344 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8345 when FitCursor did something.
8346 (updateScrollbar): some unsigned changes
8347 (downCB): removed func
8348 (scrollUpOnePage): removed func
8349 (scrollDownOnePage): remvoed func
8350 (workAreaMotionNotify): don't call screen->FitCursor but use
8351 fitCursor instead. and bool return val
8352 (workAreaButtonPress): ditto
8353 (workAreaButtonRelease): some unsigned changes
8354 (checkInsetHit): ditto
8355 (workAreaExpose): ditto
8356 (update): parts rewritten, comments about the signed char arg added
8357 (smallUpdate): removed func
8358 (cursorPrevious): call needed updateScrollbar
8361 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8364 * src/BufferView.[Ch] (upCB): removed func
8365 (downCB): removed func
8366 (smallUpdate): removed func
8368 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8370 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8371 currentrow, currentrow_y optimization. This did not help a lot and
8372 if we want to do this kind of optimization we should rather use
8373 cursor.row instead of the currentrow.
8375 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8376 buffer spacing and klyx spacing support.
8378 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8380 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8383 2000-04-26 Juergen Vigna <jug@sad.it>
8385 * src/insets/figinset.C: fixes to Lars sstream changes!
8387 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8389 * A lot of files: Added Ascii(ostream &) methods to all inset
8390 classes. Used when exporting to ASCII.
8392 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8393 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8396 * src/text2.C (ToggleFree): Disabled implicit word selection when
8397 there is a change in the language
8399 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8400 no output was generated for end-of-sentence inset.
8402 * src/insets/lyxinset.h
8405 * src/paragraph.C: Removed the insetnumber code
8407 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8409 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8411 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8412 no_babel and no_epsfig completely from the file.
8413 (parseSingleLyXformat2Token): add handling for per-paragraph
8414 spacing as written by klyx.
8416 * src/insets/figinset.C: applied patch by Andre. Made it work with
8419 2000-04-20 Juergen Vigna <jug@sad.it>
8421 * src/insets/insettext.C (cutSelection):
8422 (copySelection): Fixed with selection from right to left.
8423 (draw): now the rows are not recalculated at every draw.
8424 (computeTextRows): for now reset the inset-owner here (this is
8425 important for an undo or copy where the inset-owner is not set
8428 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8429 motion to the_locking_inset screen->first was forgotten, this was
8430 not important till we got multiline insets.
8432 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8434 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8435 code seems to be alright (it is code changed by Dekel, and the
8436 intent is indeed that all macros should be defined \protect'ed)
8438 * NEWS: a bit of reorganisation of the new user-visible features.
8440 2000-04-19 Juergen Vigna <jug@sad.it>
8442 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8443 position. Set the inset_owner of the used paragraph so that it knows
8444 that it is inside an inset. Fixed cursor handling with mouse and
8445 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8446 and cleanups to make TextInsets work better.
8448 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8449 Changed parameters of various functions and added LockInsetInInset().
8451 * src/insets/insettext.C:
8453 * src/insets/insetcollapsable.h:
8454 * src/insets/insetcollapsable.C:
8455 * src/insets/insetfoot.h:
8456 * src/insets/insetfoot.C:
8457 * src/insets/insetert.h:
8458 * src/insets/insetert.C: cleaned up the code so that it works now
8459 correctly with insettext.
8461 * src/insets/inset.C:
8462 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8463 that insets in insets are supported right.
8466 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8468 * src/paragraph.C: some small fixes
8470 * src/debug.h: inserted INSETS debug info
8472 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8473 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8475 * src/commandtags.h:
8476 * src/LyXAction.C: insert code for InsetTabular.
8478 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8479 not Button1MotionMask.
8480 (workAreaButtonRelease): send always a InsetButtonRelease event to
8482 (checkInsetHit): some setCursor fixes (always with insets).
8484 * src/BufferView2.C (lockInset): returns a bool now and extended for
8485 locking insets inside insets.
8486 (showLockedInsetCursor): it is important to have the cursor always
8487 before the locked inset.
8488 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8490 * src/BufferView.h: made lockInset return a bool.
8492 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8494 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8495 that is used also internally but can be called as public to have back
8496 a cursor pos which is not set internally.
8497 (SetCursorIntern): Changed to use above function.
8499 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8501 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8506 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8507 patches for things that should be in or should be changed.
8509 * src/* [insetfiles]: change "usigned char fragile" to bool
8510 fragile. There was only one point that could that be questioned
8511 and that is commented in formulamacro.C. Grep for "CHECK".
8513 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8514 (DeleteBuffer): take it out of CutAndPaste and make it static.
8516 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8518 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8519 output the spacing envir commands. Also the new commands used in
8520 the LaTeX output makes the result better.
8522 * src/Spacing.C (writeEnvirBegin): new method
8523 (writeEnvirEnd): new method
8525 2000-04-18 Juergen Vigna <jug@sad.it>
8527 * src/CutAndPaste.C: made textclass a static member of the class
8528 as otherwise it is not accesed right!!!
8530 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8532 * forms/layout_forms.fd
8533 * src/layout_forms.h
8534 * src/layout_forms.C (create_form_form_character)
8535 * src/lyx_cb.C (UserFreeFont)
8536 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8537 documents (in the layout->character popup).
8539 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8541 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8542 \spell_command was in fact not honored (from Kevin Atkinson).
8544 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8547 * src/lyx_gui.h: make lyxViews private (Angus)
8549 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8551 * src/mathed/math_write.C
8552 (MathMatrixInset::Write) Put \protect before \begin{array} and
8553 \end{array} if fragile
8554 (MathParInset::Write): Put \protect before \\ if fragile
8556 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8558 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8559 initialization if the LyXColorHandler must be done after the
8560 connections to the XServer has been established.
8562 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8563 get the background pixel from the lyxColorhandler so that the
8564 figures are rendered with the correct background color.
8565 (NextToken): removed functions.
8566 (GetPSSizes): use ifs >> string instead of NextToken.
8568 * src/Painter.[Ch]: the color cache moved out of this file.
8570 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8573 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8575 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8576 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8578 * src/BufferView.C (enterView): new func
8579 (leaveView): new func
8581 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8583 (leaveView): new func, undefines xterm cursor when approp.
8585 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8586 (AllowInput): delete the Workarea cursor handling from this func.
8588 * src/Painter.C (underline): draw a slimer underline in most cases.
8590 * src/lyx_main.C (error_handler): use extern "C"
8592 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8594 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8595 sent directly to me.
8597 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8598 to the list by Dekel.
8600 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8603 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8604 methods from lyx_cb.here.
8606 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8609 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8611 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8612 instead of using current_view directly.
8614 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8616 * src/LyXAction.C (init): add the paragraph-spacing command.
8618 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8620 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8622 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8623 different from the documents.
8625 * src/text.C (SetHeightOfRow): take paragraph spacing into
8626 account, paragraph spacing takes precedence over buffer spacing
8627 (GetVisibleRow): ditto
8629 * src/paragraph.C (writeFile): output the spacing parameter too.
8630 (validate): set the correct features if spacing is used in the
8632 (Clear): set spacing to default
8633 (MakeSameLayout): spacing too
8634 (HasSameLayout): spacing too
8635 (SetLayout): spacing too
8636 (TeXOnePar): output the spacing commands
8638 * src/lyxparagraph.h: added a spacing variable for use with
8639 per-paragraph spacing.
8641 * src/Spacing.h: add a Default spacing and a method to check if
8642 the current spacing is default. also added an operator==
8644 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8647 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8649 * src/lyxserver.C (callback): fix dispatch of functions
8651 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8652 printf() into lyxerr call.
8654 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8657 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8658 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8659 the "Float" from each of the subitems.
8660 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8662 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8663 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8664 documented the change so that the workaround can be nuked later.
8666 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8669 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8671 * src/buffer.C (getLatexName): ditto
8672 (setReadonly): ditto
8674 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8676 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8677 avoid some uses of current_view. Added also a bufferParams()
8678 method to get at this.
8680 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8682 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8684 * src/lyxparagraph.[Ch]: removed
8685 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8686 with operators used by lower_bound and
8687 upper_bound in InsetTable's
8688 Make struct InsetTable private again. Used matchpos.
8690 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8692 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8693 document, the language of existing text is changed (unless the
8694 document is multi-lingual)
8696 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8698 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8700 * A lot of files: A rewrite of the Right-to-Left support.
8702 2000-04-10 Juergen Vigna <jug@sad.it>
8704 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8705 misplaced cursor when inset in inset is locked.
8707 * src/insets/insettext.C (LocalDispatch): small fix so that a
8708 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8710 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8711 footnote font should be decreased in size twice when displaying.
8713 * src/insets/insettext.C (GetDrawFont): inserted this function as
8714 the drawing-font may differ from the real paragraph font.
8716 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8717 insets (inset in inset!).
8719 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8720 function here because we don't want footnotes inside footnotes.
8722 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8724 (init): now set the inset_owner in paragraph.C
8725 (LocalDispatch): added some resetPos() in the right position
8728 (pasteSelection): changed to use the new CutAndPaste-Class.
8730 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8731 which tells if it is allowed to insert another inset inside this one.
8733 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8734 SwitchLayoutsBetweenClasses.
8736 * src/text2.C (InsertInset): checking of the new paragraph-function
8738 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8739 is not needed anymore here!
8742 (PasteSelection): redone (also with #ifdef) so that now this uses
8743 the CutAndPaste-Class.
8744 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8747 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8748 from/to text/insets.
8750 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8751 so that the paragraph knows if it is inside an (text)-inset.
8752 (InsertFromMinibuffer): changed return-value to bool as now it
8753 may happen that an inset is not inserted in the paragraph.
8754 (InsertInsetAllowed): this checks if it is allowed to insert an
8755 inset in this paragraph.
8757 (BreakParagraphConservative):
8758 (BreakParagraph) : small change for the above change of the return
8759 value of InsertFromMinibuffer.
8761 * src/lyxparagraph.h: added inset_owner and the functions to handle
8762 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8764 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8766 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8767 functions from BufferView to BufferView::Pimpl to ease maintence.
8769 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8770 correctly. Also use SetCursorIntern instead of SetCursor.
8772 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8775 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8777 * src/WorkArea.C (belowMouse): manually implement below mouse.
8779 * src/*: Add "explicit" on several constructors, I added probably
8780 some unneeded ones. A couple of changes to code because of this.
8782 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8783 implementation and private parts from the users of BufferView. Not
8786 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8787 implementation and private parts from the users of LyXLex. Not
8790 * src/BufferView_pimpl.[Ch]: new files
8792 * src/lyxlex_pimpl.[Ch]: new files
8794 * src/LyXView.[Ch]: some inline functions move out-of-line
8796 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8798 * src/lyxparagraph.h: make struct InsetTable public.
8800 * src/support/lyxstring.h: change lyxstring::difference_type to be
8801 ptrdiff_t. Add std:: modifiers to streams.
8803 * src/font.C: include the <cctype> header, for islower() and
8806 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8808 * src/font.[Ch]: new files. Contains the metric functions for
8809 fonts, takes a LyXFont as parameter. Better separation of concepts.
8811 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8812 changes because of this.
8814 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8816 * src/*: compile with -Winline and move functions that don't
8819 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8822 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8824 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8825 (various files changed because of this)
8827 * src/Painter.C (text): fixed the drawing of smallcaps.
8829 * src/lyxfont.[Ch] (drawText): removed unused member func.
8832 * src/*.C: added needed "using" statements and "std::" qualifiers.
8834 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8836 * src/*.h: removed all use of "using" from header files use
8837 qualifier std:: instead.
8839 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8841 * src/text.C (Backspace): some additional cleanups (we already
8842 know whether cursor.pos is 0 or not).
8844 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8845 automake does not provide one).
8847 * src/bmtable.h: replace C++ comments with C comments.
8849 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8851 * src/screen.C (ShowCursor): Change the shape of the cursor if
8852 the current language is not equal to the language of the document.
8853 (If the cursor change its shape unexpectedly, then you've found a bug)
8855 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8858 * src/insets/insetnumber.[Ch]: New files.
8860 * src/LyXAction.C (init)
8861 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8864 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8866 * src/lyxparagraph.h
8867 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8868 (the vector is kept sorted).
8870 * src/text.C (GetVisibleRow): Draw selection correctly when there
8871 is both LTR and RTL text.
8873 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8874 which is much faster.
8876 * src/text.C (GetVisibleRow and other): Do not draw the last space
8877 in a row if the direction of the last letter is not equal to the
8878 direction of the paragraph.
8880 * src/lyxfont.C (latexWriteStartChanges):
8881 Check that font language is not equal to basefont language.
8882 (latexWriteEndChanges): ditto
8884 * src/lyx_cb.C (StyleReset): Don't change the language while using
8885 the font-default command.
8887 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8888 empty paragraph before a footnote.
8890 * src/insets/insetcommand.C (draw): Increase x correctly.
8892 * src/screen.C (ShowCursor): Change cursor shape if
8893 current language != document language.
8895 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8897 2000-03-31 Juergen Vigna <jug@sad.it>
8899 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8900 (Clone): changed mode how the paragraph-data is copied to the
8901 new clone-paragraph.
8903 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8904 GetInset(pos) with no inset anymore there (in inset UNDO)
8906 * src/insets/insetcommand.C (draw): small fix as here x is
8907 incremented not as much as width() returns (2 before, 2 behind = 4)
8909 2000-03-30 Juergen Vigna <jug@sad.it>
8911 * src/insets/insettext.C (InsetText): small fix in initialize
8912 widthOffset (should not be done in the init() function)
8914 2000-03-29 Amir Karger <karger@lyx.org>
8916 * lib/examples/it_ItemizeBullets.lyx: translation by
8919 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8921 2000-03-29 Juergen Vigna <jug@sad.it>
8923 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8925 * src/insets/insetfoot.C (Clone): small change as for the below
8926 new init function in the text-inset
8928 * src/insets/insettext.C (init): new function as I've seen that
8929 clone did not copy the Paragraph-Data!
8930 (LocalDispatch): Added code so that now we have some sort of Undo
8931 functionality (well actually we HAVE Undo ;)
8933 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8935 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8937 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8940 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8942 * src/main.C: added a runtime check that verifies that the xforms
8943 header used when building LyX and the library used when running
8944 LyX match. Exit with a message if they don't match. This is a
8945 version number check only.
8947 * src/buffer.C (save): Don't allocate memory on the heap for
8948 struct utimbuf times.
8950 * *: some using changes, use iosfwd instead of the real headers.
8952 * src/lyxfont.C use char const * instead of string for the static
8953 strings. Rewrite some functions to use sstream.
8955 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8957 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8960 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8962 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8963 of Geodesy (from Martin Vermeer)
8965 * lib/layouts/svjour.inc: include file for the Springer svjour
8966 class. It can be used to support journals other than JoG.
8968 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8969 Miskiewicz <misiek@pld.org.pl>)
8970 * lib/reLyX/Makefile.am: ditto.
8972 2000-03-27 Juergen Vigna <jug@sad.it>
8974 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8975 also some modifications with operations on selected text.
8977 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8978 problems with clicking on insets (last famous words ;)
8980 * src/insets/insetcommand.C (draw):
8981 (width): Changed to have a bit of space before and after the inset so
8982 that the blinking cursor can be seen (otherwise it was hidden)
8984 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8986 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8987 would not be added to the link list when an installed gettext (not
8988 part of libc) is found.
8990 2000-03-24 Juergen Vigna <jug@sad.it>
8992 * src/insets/insetcollapsable.C (Edit):
8993 * src/mathed/formula.C (InsetButtonRelease):
8994 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8997 * src/BufferView.C (workAreaButtonPress):
8998 (workAreaButtonRelease):
8999 (checkInsetHit): Finally fixed the clicking on insets be handled
9002 * src/insets/insetert.C (Edit): inserted this call so that ERT
9003 insets work always with LaTeX-font
9005 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9007 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9008 caused lyx to startup with no GUI in place, causing in a crash
9009 upon startup when called with arguments.
9011 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9013 * src/FontLoader.C: better initialization of dummyXFontStruct.
9015 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9017 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9018 for linuxdoc and docbook import and export format options.
9020 * lib/lyxrc.example Example of default values for the previous flags.
9022 * src/lyx_cb.C Use those flags instead of the hardwired values for
9023 linuxdoc and docbook export.
9025 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9028 * src/menus.C Added menus entries for the new import/exports formats.
9030 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9032 * src/lyxrc.*: Added support for running without Gui
9035 * src/FontLoader.C: sensible defaults if no fonts are needed
9037 * src/lyx_cb.C: New function ShowMessage (writes either to the
9038 minibuffer or cout in case of no gui
9039 New function AskOverwrite for common stuff
9040 Consequently various changes to call these functions
9042 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9043 wild guess at sensible screen resolution when having no gui
9045 * src/lyxfont.C: no gui, no fonts... set some defaults
9047 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9049 * src/LColor.C: made the command inset background a bit lighter.
9051 2000-03-20 Hartmut Goebel <goebel@noris.net>
9053 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9054 stdstruct.inc. Koma-Script added some title elements which
9055 otherwise have been listed below "bibliography". This split allows
9056 adding title elements to where they belong.
9058 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9059 define the additional title elements and then include
9062 * many other layout files: changed to include stdtitle.inc just
9063 before stdstruct.inc.
9065 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9067 * src/buffer.C: (save) Added the option to store all backup files
9068 in a single directory
9070 * src/lyxrc.[Ch]: Added variable \backupdir_path
9072 * lib/lyxrc.example: Added descriptions of recently added variables
9074 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9075 bibtex inset, not closing the bibtex popup when deleting the inset)
9077 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9079 * src/lyx_cb.C: add a couple using directives.
9081 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9082 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9083 import based on the filename.
9085 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9086 file would be imported at start, if the filename where of a sgml file.
9088 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9090 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9092 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9093 * src/lyxfont.h Replaced the member variable bits.direction by the
9094 member variable lang. Made many changes in other files.
9095 This allows having a multi-lingual document
9097 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9098 that change the current language to <l>.
9099 Removed the command "font-rtl"
9101 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9102 format for Hebrew documents)
9104 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9105 When auto_mathmode is "true", pressing a digit key in normal mode
9106 will cause entering into mathmode.
9107 If auto_mathmode is "rtl" then this behavior will be active only
9108 when writing right-to-left text.
9110 * src/text2.C (InsertStringA) The string is inserted using the
9113 * src/paragraph.C (GetEndLabel) Gives a correct result for
9114 footnote paragraphs.
9116 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9118 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9120 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9121 front of PasteParagraph. Never insert a ' '. This should at least
9122 fix some cause for the segfaults that we have been experiencing,
9123 it also fixes backspace behaviour slightly. (Phu!)
9125 * src/support/lstrings.C (compare_no_case): some change to make it
9126 compile with gcc 2.95.2 and stdlibc++-v3
9128 * src/text2.C (MeltFootnoteEnvironment): change type o
9129 first_footnote_par_is_not_empty to bool.
9131 * src/lyxparagraph.h: make text private. Changes in other files
9133 (fitToSize): new function
9134 (setContentsFromPar): new function
9135 (clearContents): new function
9136 (SetChar): new function
9138 * src/paragraph.C (readSimpleWholeFile): deleted.
9140 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9141 the file, just use a simple string instead. Also read the file in
9142 a more maintainable manner.
9144 * src/text2.C (InsertStringA): deleted.
9145 (InsertStringB): deleted.
9147 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9149 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9150 RedoParagraphs from the doublespace handling part, just set status
9151 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9152 done, but perhaps not like this.)
9154 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9156 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9157 character when inserting an inset.
9159 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9161 * src/bufferparams.C (readLanguage): now takes "default" into
9164 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9165 also initialize the toplevel_keymap with the default bindings from
9168 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9170 * all files using lyxrc: have lyxrc as a real variable and not a
9171 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9174 * src/lyxrc.C: remove double call to defaultKeyBindings
9176 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9177 toolbar defauls using lyxlex. Remove enums, structs, functions
9180 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9181 toolbar defaults. Also store default keybindings in a map.
9183 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9184 storing the toolbar defaults without any xforms dependencies.
9186 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9187 applied. Changed to use iterators.
9189 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9191 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9192 systems that don't have LINGUAS set to begin with.
9194 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9196 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9197 the list by Dekel Tsur.
9199 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9201 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9202 * src/insets/form_graphics.C: ditto.
9204 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9206 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9208 * src/bufferparams.C (readLanguage): use the new language map
9210 * src/intl.C (InitKeyMapper): use the new language map
9212 * src/lyx_gui.C (create_forms): use the new language map
9214 * src/language.[Ch]: New files. Used for holding the information
9215 about each language. Now! Use this new language map enhance it and
9216 make it really usable for our needs.
9218 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9220 * screen.C (ShowCursor): Removed duplicate code.
9221 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9222 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9224 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9227 * src/text.C Added TransformChar method. Used for rendering Arabic
9228 text correctly (change the glyphs of the letter according to the
9229 position in the word)
9234 * src/lyxrc.C Added lyxrc command {language_command_begin,
9235 language_command_end,language_command_ltr,language_command_rtl,
9236 language_package} which allows the use of either arabtex or Omega
9239 * src/lyx_gui.C (init)
9241 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9242 to use encoding for menu fonts which is different than the encoding
9245 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9246 do not load the babel package.
9247 To write an English document with Hebrew/Arabic, change the document
9248 language to "english".
9250 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9251 (alphaCounter): changed to return char
9252 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9254 * lib/lyxrc.example Added examples for Hebrew/Arabic
9257 * src/layout.C Added layout command endlabeltype
9259 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9261 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9263 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9265 * src/mathed/math_delim.C (search_deco): return a
9266 math_deco_struct* instead of index.
9268 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9270 * All files with a USE_OSTREAM_ONLY within: removed all code that
9271 was unused when USE_OSTREAM_ONLY is defined.
9273 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9274 of any less. Removed header and using.
9276 * src/text.C (GetVisibleRow): draw the string "Page Break
9277 (top/bottom)" on screen when drawing a pagebreak line.
9279 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9281 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9283 * src/mathed/math_macro.C (draw): do some cast magic.
9286 * src/mathed/math_defs.h: change byte* argument to byte const*.
9288 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9290 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9291 know it is right to return InsetFoot* too, but cxx does not like
9294 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9296 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9298 * src/mathed/math_delim.C: change == to proper assignment.
9300 2000-03-09 Juergen Vigna <jug@sad.it>
9302 * src/insets/insettext.C (setPos): fixed various cursor positioning
9303 problems (via mouse and cursor-keys)
9304 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9305 inset (still a small display problem but it works ;)
9307 * src/insets/insetcollapsable.C (draw): added button_top_y and
9308 button_bottom_y to have correct values for clicking on the inset.
9310 * src/support/lyxalgo.h: commented out 'using std::less'
9312 2000-03-08 Juergen Vigna <jug@sad.it>
9314 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9315 Button-Release event closes as it is alos the Release-Event
9318 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9320 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9322 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9323 can add multiple spaces in Scrap (literate programming) styles...
9324 which, by the way, is how I got hooked on LyX to begin with.
9326 * src/mathed/formula.C (Write): Added dummy variable to an
9327 inset::Latex() call.
9328 (Latex): Add free_spacing boolean to inset::Latex()
9330 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9332 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9333 virtual function to include the free_spacing boolean from
9334 the containing paragraph's style.
9336 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9337 Added free_spacing boolean arg to match inset.h
9339 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9340 Added free_spacing boolean arg to match inset.h
9342 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9343 Added free_spacing boolean and made sure that if in a free_spacing
9344 paragraph, that we output normal space if there is a protected space.
9346 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9347 Added free_spacing boolean arg to match inset.h
9349 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9350 Added free_spacing boolean arg to match inset.h
9352 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9353 Added free_spacing boolean arg to match inset.h
9355 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9356 Added free_spacing boolean arg to match inset.h
9358 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9359 Added free_spacing boolean arg to match inset.h
9361 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9362 free_spacing boolean arg to match inset.h
9364 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9365 Added free_spacing boolean arg to match inset.h
9367 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9368 Added free_spacing boolean arg to match inset.h
9370 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9371 Added free_spacing boolean arg to match inset.h
9373 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9374 Added free_spacing boolean arg to match inset.h
9376 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9377 Added free_spacing boolean arg to match inset.h
9379 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9380 free_spacing boolean arg to match inset.h
9382 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9383 free_spacing boolean arg to match inset.h
9385 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9386 ignore free_spacing paragraphs. The user's spaces are left
9389 * src/text.C (InsertChar): Fixed the free_spacing layout
9390 attribute behavior. Now, if free_spacing is set, you can
9391 add multiple spaces in a paragraph with impunity (and they
9392 get output verbatim).
9393 (SelectSelectedWord): Added dummy argument to inset::Latex()
9396 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9399 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9400 paragraph layouts now only input a simple space instead.
9401 Special character insets don't make any sense in free-spacing
9404 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9405 hard-spaces in the *input* file to simple spaces if the layout
9406 is free-spacing. This converts old files which had to have
9407 hard-spaces in free-spacing layouts where a simple space was
9409 (writeFileAscii): Added free_spacing check to pass to the newly
9410 reworked inset::Latex(...) methods. The inset::Latex() code
9411 ensures that hard-spaces in free-spacing paragraphs get output
9412 as spaces (rather than "~").
9414 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9416 * src/mathed/math_delim.C (draw): draw the empty placeholder
9417 delims with a onoffdash line.
9418 (struct math_deco_compare): struct that holds the "functors" used
9419 for the sort and the binary search in math_deco_table.
9420 (class init_deco_table): class used for initial sort of the
9422 (search_deco): use lower_bound to do a binary search in the
9425 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9427 * src/lyxrc.C: a small secret thingie...
9429 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9430 and to not flush the stream as often as it used to.
9432 * src/support/lyxalgo.h: new file
9433 (sorted): template function used for checking if a sequence is
9434 sorted or not. Two versions with and without user supplied
9435 compare. Uses same compare as std::sort.
9437 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9438 it and give warning on lyxerr.
9440 (struct compare_tags): struct with function operators used for
9441 checking if sorted, sorting and lower_bound.
9442 (search_kw): use lower_bound instead of manually implemented
9445 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9447 * src/insets/insetcollapsable.h: fix Clone() declaration.
9448 * src/insets/insetfoot.h: ditto.
9450 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9452 2000-03-08 Juergen Vigna <jug@sad.it>
9454 * src/insets/lyxinset.h: added owner call which tells us if
9455 this inset is inside another inset. Changed also the return-type
9456 of Editable to an enum so it tells clearer what the return-value is.
9458 * src/insets/insettext.C (computeTextRows): fixed computing of
9459 textinsets which split automatically on more rows.
9461 * src/insets/insetert.[Ch]: changed this to be of BaseType
9464 * src/insets/insetfoot.[Ch]: added footnote inset
9466 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9467 collapsable insets (like footnote, ert, ...)
9469 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9471 * src/lyxdraw.h: remvoe file
9473 * src/lyxdraw.C: remove file
9475 * src/insets/insettext.C: added <algorithm>.
9477 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9479 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9480 (matrix_cb): case MM_OK use string stream
9482 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9485 * src/mathed/math_macro.C (draw): use string stream
9486 (Metrics): use string stream
9488 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9489 directly to the ostream.
9491 * src/vspace.C (asString): use string stream.
9492 (asString): use string stream
9493 (asLatexString): use string stream
9495 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9496 setting Spacing::Other.
9498 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9499 sprintf when creating the stretch vale.
9501 * src/text2.C (alphaCounter): changed to return a string and to
9502 not use a static variable internally. Also fixed a one-off bug.
9503 (SetCounter): changed the drawing of the labels to use string
9504 streams instead of sprintf.
9506 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9507 manipulator to use a scheme that does not require library support.
9508 This is also the way it is done in the new GNU libstdc++. Should
9509 work with DEC cxx now.
9511 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9513 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9514 end. This fixes a bug.
9516 * src/mathed (all files concerned with file writing): apply the
9517 USE_OSTREAM_ONLY changes to mathed too.
9519 * src/support/DebugStream.h: make the constructor explicit.
9521 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9522 count and ostream squashed.
9524 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9526 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9528 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9529 ostringstream uses STL strings, and we might not.
9531 * src/insets/insetspecialchar.C: add using directive.
9532 * src/insets/insettext.C: ditto.
9534 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9536 * lib/layouts/seminar.layout: feeble attempt at a layout for
9537 seminar.cls, far from completet and could really use some looking
9538 at from people used to write layout files.
9540 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9541 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9542 a lot nicer and works nicely with ostreams.
9544 * src/mathed/formula.C (draw): a slightly different solution that
9545 the one posted to the list, but I think this one works too. (font
9546 size wrong in headers.)
9548 * src/insets/insettext.C (computeTextRows): some fiddling on
9549 Jürgens turf, added some comments that he should read.
9551 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9552 used and it gave compiler warnings.
9553 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9556 * src/lyx_gui.C (create_forms): do the right thing when
9557 show_banner is true/false.
9559 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9560 show_banner is false.
9562 * most file writing files: Now use iostreams to do almost all of
9563 the writing. Also instead of passing string &, we now use
9564 stringstreams. mathed output is still not adapted to iostreams.
9565 This change can be turned off by commenting out all the occurences
9566 of the "#define USE_OSTREAM_ONLY 1" lines.
9568 * src/WorkArea.C (createPixmap): don't output debug messages.
9569 (WorkArea): don't output debug messages.
9571 * lib/lyxrc.example: added a comment about the new variable
9574 * development/Code_rules/Rules: Added some more commente about how
9575 to build class interfaces and on how better encapsulation can be
9578 2000-03-03 Juergen Vigna <jug@sad.it>
9580 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9581 automatically with the width of the LyX-Window
9583 * src/insets/insettext.C (computeTextRows): fixed update bug in
9584 displaying text-insets (scrollvalues where not initialized!)
9586 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9588 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9589 id in the check of the result from lower_bound is not enough since
9590 lower_bound can return last too, and then res->id will not be a
9593 * all insets and some code that use them: I have conditionalized
9594 removed the Latex(string & out, ...) this means that only the
9595 Latex(ostream &, ...) will be used. This is a work in progress to
9596 move towards using streams for all output of files.
9598 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9601 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9603 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9604 routine (this fixes bug where greek letters were surrounded by too
9607 * src/support/filetools.C (findtexfile): change a bit the search
9608 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9609 no longer passed to kpsewhich, we may have to change that later.
9611 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9612 warning options to avoid problems with X header files (from Angus
9614 * acinclude.m4: regenerated.
9616 2000-03-02 Juergen Vigna <jug@sad.it>
9618 * src/insets/insettext.C (WriteParagraphData): Using the
9619 par->writeFile() function for writing paragraph-data.
9620 (Read): Using buffer->parseSingleLyXformat2Token()-function
9621 for parsing paragraph data!
9623 * src/buffer.C (readLyXformat2): removed all parse data and using
9624 the new parseSingleLyXformat2Token()-function.
9625 (parseSingleLyXformat2Token): added this function to parse (read)
9626 lyx-file-format (this is called also from text-insets now!)
9628 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9630 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9633 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9634 directly instead of going through a func. One very bad thing: a
9635 static LyXFindReplace, but I don't know where to place it.
9637 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9638 string instead of char[]. Also changed to static.
9639 (GetSelectionOrWordAtCursor): changed to static inline
9640 (SetSelectionOverLenChars): ditto.
9642 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9643 current_view and global variables. both classes has changed names
9644 and LyXFindReplace is not inherited from SearchForm.
9646 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9647 fl_form_search form.
9649 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9651 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9653 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9654 bound (from Kayvan).
9656 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9658 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9660 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9662 * some things that I should comment but the local pub says head to
9665 * comment out all code that belongs to the Roff code for Ascii
9666 export of tables. (this is unused)
9668 * src/LyXView.C: use correct type for global variable
9669 current_layout. (LyXTextClass::size_type)
9671 * some code to get the new insetgraphics closer to working I'd be
9672 grateful for any help.
9674 * src/BufferView2.C (insertInset): use the return type of
9675 NumberOfLayout properly. (also changes in other files)
9677 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9678 this as a test. I want to know what breaks because of this.
9680 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9682 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9684 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9685 to use a \makebox in the label, this allows proper justification
9686 with out using protected spaces or multiple hfills. Now it is
9687 "label" for left justified, "\hfill label\hfill" for center, and
9688 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9689 should be changed accordingly.
9691 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9693 * src/lyxtext.h: change SetLayout() to take a
9694 LyXTextClass::size_type instead of a char (when there is more than
9695 127 layouts in a class); also change type of copylayouttype.
9696 * src/text2.C (SetLayout): ditto.
9697 * src/LyXView.C (updateLayoutChoice): ditto.
9699 * src/LaTeX.C (scanLogFile): errors where the line number was not
9700 given just after the '!'-line were ignored (from Dekel Tsur).
9702 * lib/lyxrc.example: fix description of \date_insert_format
9704 * lib/layouts/llncs.layout: new layout, contributed by Martin
9707 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9709 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9710 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9711 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9712 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9713 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9714 paragraph.C, text.C, text2.C)
9716 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9718 * src/insets/insettext.C (LocalDispatch): remove extra break
9721 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9722 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9724 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9725 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9727 * src/insets/insetbib.h: move InsetBibkey::Holder and
9728 InsetCitation::Holder in public space.
9730 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9732 * src/insets/insettext.h: small change to get the new files from
9733 Juergen to compile (use "string", not "class string").
9735 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9736 const & as parameter to LocalDispatch, use LyXFont const & as
9737 paramter to some other func. This also had impacto on lyxinsets.h
9738 and the two mathed insets.
9740 2000-02-24 Juergen Vigna <jug@sad.it>
9743 * src/commandtags.h:
9745 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9749 * src/BufferView2.C: added/updated code for various inset-functions
9751 * src/insets/insetert.[Ch]: added implementation of InsetERT
9753 * src/insets/insettext.[Ch]: added implementation of InsetText
9755 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9756 (draw): added preliminary code for inset scrolling not finshed yet
9758 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9759 as it is in lyxfunc.C now
9761 * src/insets/lyxinset.h: Added functions for text-insets
9763 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9765 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9766 BufferView and reimplement the list as a queue put inside its own
9769 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9771 * several files: use the new interface to the "updateinsetlist"
9773 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9775 (work_area_handler): call BufferView::trippleClick on trippleclick.
9777 * src/BufferView.C (doubleClick): new function, selects word on
9779 (trippleClick): new function, selects line on trippleclick.
9781 2000-02-22 Allan Rae <rae@lyx.org>
9783 * lib/bind/xemacs.bind: buffer-previous not supported
9785 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9787 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9790 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9792 * src/bufferlist.C: get rid of current_view from this file
9794 * src/spellchecker.C: get rid of current_view from this file
9796 * src/vspace.C: get rid of current_view from this file
9797 (inPixels): added BufferView parameter for this func
9798 (asLatexCommand): added a BufferParams for this func
9800 * src/text.C src/text2.C: get rid of current_view from these
9803 * src/lyxfont.C (getFontDirection): move this function here from
9806 * src/bufferparams.C (getDocumentDirection): move this function
9809 * src/paragraph.C (getParDirection): move this function here from
9811 (getLetterDirection): ditto
9813 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9815 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9816 resize due to wrong pixmap beeing used. Also took the opurtunity
9817 to make the LyXScreen stateless on regard to WorkArea and some
9818 general cleanup in the same files.
9820 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9822 * src/Makefile.am: add missing direction.h
9824 * src/PainterBase.h: made the width functions const.
9826 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9829 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9831 * src/insets/insetlatexaccent.C (draw): make the accents draw
9832 better, at present this will only work well with iso8859-1.
9834 * several files: remove the old drawing code, now we use the new
9837 * several files: remove support for mono_video, reverse_video and
9840 2000-02-17 Juergen Vigna <jug@sad.it>
9842 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9843 int ** as we have to return the pointer, otherwise we have only
9844 NULL pointers in the returning function.
9846 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9848 * src/LaTeX.C (operator()): quote file name when running latex.
9850 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9852 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9853 (bubble tip), this removes our special handling of this.
9855 * Remove all code that is unused now that we have the new
9856 workarea. (Code that are not active when NEW_WA is defined.)
9858 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9860 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9862 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9863 nonexisting layout; correctly redirect obsoleted layouts.
9865 * lib/lyxrc.example: document \view_dvi_paper_option
9867 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9870 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9871 (PreviewDVI): handle the view_dvi_paper_option variable.
9872 [Both from Roland Krause]
9874 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9876 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9877 char const *, int, LyXFont)
9878 (text(int, int, string, LyXFont)): ditto
9880 * src/text.C (InsertCharInTable): attempt to fix the double-space
9881 feature in tables too.
9882 (BackspaceInTable): ditto.
9883 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9885 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9887 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9889 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9890 newly found text in textcache to this.
9891 (buffer): set the owner of the text put into the textcache to 0
9893 * src/insets/figinset.C (draw): fixed the drawing of figures with
9896 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9897 drawing of mathframe, hfills, protected space, table lines. I have
9898 now no outstanding drawing problems with the new Painter code.
9900 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9902 * src/PainterBase.C (ellipse, circle): do not specify the default
9905 * src/LColor.h: add using directive.
9907 * src/Painter.[Ch]: change return type of methods from Painter& to
9908 PainterBase&. Add a using directive.
9910 * src/WorkArea.C: wrap xforms callbacks in C functions
9913 * lib/layouts/foils.layout: font fix and simplifications from Carl
9916 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9918 * a lot of files: The Painter, LColor and WorkArea from the old
9919 devel branch has been ported to lyx-devel. Some new files and a
9920 lot of #ifdeffed code. The new workarea is enabled by default, but
9921 if you want to test the new Painter and LColor you have to compile
9922 with USE_PAINTER defined (do this in config.h f.ex.) There are
9923 still some rought edges, and I'd like some help to clear those
9924 out. It looks stable (loads and displays the Userguide very well).
9927 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9929 * src/buffer.C (pop_tag): revert to the previous implementation
9930 (use a global variable for both loops).
9932 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9934 * src/lyxrc.C (LyXRC): change slightly default date format.
9936 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9937 there is an English text with a footnote that starts with a Hebrew
9938 paragraph, or vice versa.
9939 (TeXFootnote): ditto.
9941 * src/text.C (LeftMargin): allow for negative values for
9942 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9945 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9946 for input encoding (cyrillic)
9948 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9950 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9953 * src/toolbar.C (set): ditto
9954 * src/insets/insetbib.C (create_form_citation_form): ditto
9956 * lib/CREDITS: added Dekel Tsur.
9958 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9959 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9960 hebrew supports files from Dekel Tsur.
9962 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9963 <tzafrir@technion.ac.il>
9965 * src/lyxrc.C: put \date_insert_format at the right place.
9967 * src/buffer.C (makeLaTeXFile): fix the handling of
9968 BufferParams::sides when writing out latex files.
9970 * src/BufferView2.C: add a "using" directive.
9972 * src/support/lyxsum.C (sum): when we use lyxstring,
9973 ostringstream::str needs an additional .c_str().
9975 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9977 * src/support/filetools.C (ChangeExtension): patch from Etienne
9980 * src/TextCache.C (show): remove const_cast and make second
9981 parameter non-const LyXText *.
9983 * src/TextCache.h: use non const LyXText in show.
9985 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9988 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9990 * src/support/lyxsum.C: rework to be more flexible.
9992 * several places: don't check if a pointer is 0 if you are going
9995 * src/text.C: remove some dead code.
9997 * src/insets/figinset.C: remove some dead code
9999 * src/buffer.C: move the BufferView funcs to BufferView2.C
10000 remove all support for insetlatexdel
10001 remove support for oldpapersize stuff
10002 made some member funcs const
10004 * src/kbmap.C: use a std::list to store the bindings in.
10006 * src/BufferView2.C: new file
10008 * src/kbsequence.[Ch]: new files
10010 * src/LyXAction.C + others: remove all trace of buffer-previous
10012 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10013 only have one copy in the binary of this table.
10015 * hebrew patch: moved some functions from LyXText to more
10016 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10018 * several files: remove support for XForms older than 0.88
10019 whitespace changes.
10020 remove some #if 0 #endif code
10022 * src/TextCache.[Ch]: new file. Holds the textcache.
10024 * src/BufferView.C: changes to use the new TextCache interface.
10025 (waitForX): remove the now unused code.
10027 * src/BackStack.h: remove some commented code
10029 * lib/bind/emacs.bind: remove binding for buffer-previous
10031 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10033 * applied the hebrew patch.
10035 * src/lyxrow.h: make sure that all Row variables are initialized.
10037 * src/text2.C (TextHandleUndo): comment out a delete, this might
10038 introduce a memory leak, but should also help us to not try to
10039 read freed memory. We need to look at this one.
10041 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10042 (LyXParagraph): initalize footnotekind.
10044 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10045 forgot this when applying the patch. Please heed the warnings.
10047 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10048 (aka. reformat problem)
10050 * src/bufferlist.C (exists): made const, and use const_iterator
10051 (isLoaded): new func.
10052 (release): use std::find to find the correct buffer.
10054 * src/bufferlist.h: made getState a const func.
10055 made empty a const func.
10056 made exists a const func.
10059 2000-02-01 Juergen Vigna <jug@sad.it>
10061 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10063 * po/it.po: updated a bit the italian po file and also changed the
10064 'file nuovo' for newfile to 'filenuovo' without a space, this did
10067 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10068 for the new insert_date command.
10070 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10071 from jdblair, to insert a date into the current text conforming to
10072 a strftime format (for now only considering the locale-set and not
10073 the document-language).
10075 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10077 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10078 Bounds Read error seen by purify. The problem was that islower is
10079 a macros which takes an unsigned char and uses it as an index for
10080 in array of characters properties (and is thus subject to the
10084 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10085 correctly the paper sides radio buttons.
10086 (UpdateDocumentButtons): ditto.
10088 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10090 * src/kbmap.C (getsym + others): change to return unsigned int,
10091 returning a long can give problems on 64 bit systems. (I assume
10092 that int is 32bit on 64bit systems)
10094 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10096 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10097 LyXLookupString to be zero-terminated. Really fixes problems seen
10098 by purify, I think.
10100 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10102 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10103 write a (char*)0 to the lyxerr stream.
10105 * src/lastfiles.C: move algorithm before the using statemets.
10107 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10109 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10110 complains otherwise).
10111 * src/table.C: ditto
10113 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10116 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10117 that I removed earlier... It is really needed.
10119 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10121 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10123 * INSTALL: update xforms home page URL.
10125 * lib/configure.m4: fix a bug with unreadable layout files.
10127 * src/table.C (calculate_width_of_column): add "using std::max"
10130 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10132 * several files: marked several lines with "DEL LINE", this is
10133 lines that can be deleted without changing anything.
10134 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10135 checks this anyway */
10138 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10140 * src/DepTable.C (update): add a "+" at the end when the checksum
10141 is different. (debugging string only)
10143 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10144 the next inset to not be displayed. This should also fix the list
10145 of labels in the "Insert Crossreference" dialog.
10147 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10149 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10150 when regex was not found.
10152 * src/support/lstrings.C (lowercase): use handcoded transform always.
10155 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10156 old_cursor.par->prev could be 0.
10158 * several files: changed post inc/dec to pre inc/dec
10160 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10161 write the lastfiles to file.
10163 * src/BufferView.C (buffer): only show TextCache info when debugging
10165 (resizeCurrentBuffer): ditto
10166 (workAreaExpose): ditto
10168 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10170 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10172 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10173 a bit better by removing the special case for \i and \j.
10175 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10177 * src/lyx_main.C (easyParse): remove test for bad comand line
10178 options, since this broke all xforms-related parsing.
10180 * src/kbmap.C (getsym): set return type to unsigned long, as
10181 declared in header. On an alpha, long is _not_ the same as int.
10183 * src/support/LOstream.h: add a "using std::flush;"
10185 * src/insets/figinset.C: ditto.
10187 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10189 * src/bufferlist.C (write): use blinding fast file copy instead of
10190 "a char at a time", now we are doing it the C++ way.
10192 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10193 std::list<int> instead.
10194 (addpidwait): reflect move to std::list<int>
10195 (sigchldchecker): ditto
10197 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10200 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10201 that obviously was wrong...
10203 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10204 c, this avoids warnings with purify and islower.
10206 * src/insets/figinset.C: rename struct queue to struct
10207 queue_element and rewrite to use a std::queue. gsqueue is now a
10208 std::queue<queue_element>
10209 (runqueue): reflect move to std::queue
10212 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10213 we would get "1" "0" instead of "true" "false. Also make the tostr
10216 2000-01-21 Juergen Vigna <jug@sad.it>
10218 * src/buffer.C (writeFileAscii): Disabled code for special groff
10219 handling of tabulars till I fix this in table.C
10221 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10223 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10225 * src/support/lyxlib.h: ditto.
10227 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10229 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10230 and 'j' look better. This might fix the "macron" bug that has been
10233 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10234 functions as one template function. Delete the old versions.
10236 * src/support/lyxsum.C: move using std::ifstream inside
10239 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10242 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10244 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10246 * src/insets/figinset.C (InitFigures): use new instead of malloc
10247 to allocate memory for figures and bitmaps.
10248 (DoneFigures): use delete[] instead of free to deallocate memory
10249 for figures and bitmaps.
10250 (runqueue): use new to allocate
10251 (getfigdata): use new/delete[] instead of malloc/free
10252 (RegisterFigure): ditto
10254 * some files: moved some declarations closer to first use, small
10255 whitespace changes use preincrement instead of postincrement where
10256 it does not make a difference.
10258 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10259 step on the way to use stl::containers for key maps.
10261 * src/bufferlist.h: add a typedef for const_iterator and const
10262 versions of begin and end.
10264 * src/bufferlist.[Ch]: change name of member variable _state to
10265 state_. (avoid reserved names)
10267 (getFileNames): returns the filenames of the buffers in a vector.
10269 * configure.in (ALL_LINGUAS): added ro
10271 * src/support/putenv.C: new file
10273 * src/support/mkdir.C: new file
10275 2000-01-20 Allan Rae <rae@lyx.org>
10277 * lib/layouts/IEEEtran.layout: Added several theorem environments
10279 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10280 couple of minor additions.
10282 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10283 (except for those in footnotes of course)
10285 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10287 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10289 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10290 std::sort and std::lower_bound instead of qsort and handwritten
10292 (struct compara): struct that holds the functors used by std::sort
10293 and std::lower_bound in MathedLookupBOP.
10295 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10297 * src/support/LAssert.h: do not do partial specialization. We do
10298 not really need it.
10300 * src/support/lyxlib.h: note that lyx::getUserName() and
10301 lyx::date() are not in use right now. Should these be suppressed?
10303 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10304 (makeLinuxDocFile): do not put date and user name in linuxdoc
10307 * src/support/lyxlib.h (kill): change first argument to long int,
10308 since that's what solaris uses.
10310 * src/support/kill.C (kill): fix declaration to match prototype.
10312 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10313 actually check whether namespaces are supported. This is not what
10316 * src/support/lyxsum.C: add a using directive.
10318 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10320 * src/support/kill.C: if we have namespace support we don't have
10321 to include lyxlib.h.
10323 * src/support/lyxlib.h: use namespace lyx if supported.
10325 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10327 * src/support/date.C: new file
10329 * src/support/chdir.C: new file
10331 * src/support/getUserName.C: new file
10333 * src/support/getcwd.C: new file
10335 * src/support/abort.C: new file
10337 * src/support/kill.C: new file
10339 * src/support/lyxlib.h: moved all the functions in this file
10340 insede struct lyx. Added also kill and abort to this struct. This
10341 is a way to avoid the "kill is not defined in <csignal>", we make
10342 C++ wrappers for functions that are not ANSI C or ANSI C++.
10344 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10345 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10346 lyx it has been renamed to sum.
10348 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10350 * src/text.C: add using directives for std::min and std::max.
10352 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10354 * src/texrow.C (getIdFromRow): actually return something useful in
10355 id and pos. Hopefully fixes the bug with positionning of errorbox
10358 * src/lyx_main.C (easyParse): output an error and exit if an
10359 incorrect command line option has been given.
10361 * src/spellchecker.C (ispell_check_word): document a memory leak.
10363 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10364 where a "struct utimbuf" is allocated with "new" and deleted with
10367 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10369 * src/text2.C (CutSelection): don't delete double spaces.
10370 (PasteSelection): ditto
10371 (CopySelection): ditto
10373 * src/text.C (Backspace): don't delete double spaces.
10375 * src/lyxlex.C (next): fix a bug that were only present with
10376 conformant std::istream::get to read comment lines, use
10377 std::istream::getline instead. This seems to fix the problem.
10379 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10381 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10382 allowed to insert space before space" editing problem. Please read
10383 commends at the beginning of the function. Comments about usage
10386 * src/text.C (InsertChar): fix for the "not allowed to insert
10387 space before space" editing problem.
10389 * src/text2.C (DeleteEmptyParagraphMechanism): when
10390 IsEmptyTableRow can only return false this last "else if" will
10391 always be a no-op. Commented out.
10393 * src/text.C (RedoParagraph): As far as I can understand tmp
10394 cursor is not really needed.
10396 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10397 present it could only return false anyway.
10398 (several functions): Did something not so smart...added a const
10399 specifier on a lot of methods.
10401 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10402 and add a tmp->text.resize. The LyXParagraph constructor does the
10404 (BreakParagraphConservative): ditto
10406 * src/support/path.h (Path): add a define so that the wrong usage
10407 "Path("/tmp") will be flagged as a compilation error:
10408 "`unnamed_Path' undeclared (first use this function)"
10410 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10412 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10413 which was bogus for several reasons.
10415 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10417 (runBibTeX): ditto.
10419 * autogen.sh: do not use "type -path" (what's that anyway?).
10421 * src/support/filetools.C (findtexfile): remove extraneous space
10422 which caused a kpsewhich warning (at least with kpathsea version
10425 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10427 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10429 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10431 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10433 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10435 * src/paragraph.C (BreakParagraph): do not reserve space on text
10436 if we don't need to (otherwise, if pos_end < pos, we end up
10437 reserving huge amounts of memory due to bad unsigned karma).
10438 (BreakParagraphConservative): ditto, although I have not seen
10439 evidence the bug can happen here.
10441 * src/lyxparagraph.h: add a using std::list.
10443 2000-01-11 Juergen Vigna <jug@sad.it>
10445 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10446 could not be found.
10448 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10450 * src/vc-backend.C (doVCCommand): change to be static and take one
10451 more parameter: the path to chdir too be fore executing the command.
10452 (retrive): new function equiv to "co -r"
10454 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10455 file_not_found_hook is true.
10457 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10459 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10460 if a file is readwrite,readonly...anything else.
10462 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10464 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10465 (CreatePostscript): name change from MenuRunDVIPS (or something)
10466 (PreviewPostscript): name change from MenuPreviewPS
10467 (PreviewDVI): name change from MenuPreviewDVI
10469 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10470 \view_pdf_command., \pdf_to_ps_command
10472 * lib/configure.m4: added search for PDF viewer, and search for
10473 PDF to PS converter.
10474 (lyxrc.defaults output): add \pdflatex_command,
10475 \view_pdf_command and \pdf_to_ps_command.
10477 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10479 * src/bufferlist.C (write): we don't use blocksize for anything so
10482 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10484 * src/support/block.h: disable operator T* (), since it causes
10485 problems with both compilers I tried. See comments in the file.
10487 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10490 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10491 variable LYX_DIR_10x to LYX_DIR_11x.
10493 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10495 * INSTALL: document --with-lyxname.
10498 * configure.in: new configure flag --with-lyxname which allows to
10499 choose the name under which lyx is installed. Default is "lyx", of
10500 course. It used to be possible to do this with --program-suffix,
10501 but the later has in fact a different meaning for autoconf.
10503 * src/support/lstrings.h (lstrchr): reformat a bit.
10505 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10506 * src/mathed/math_defs.h: ditto.
10508 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10510 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10511 true, decides if we create a backup file or not when saving. New
10512 tag and variable \pdf_mode, defaults to false. New tag and
10513 variable \pdflatex_command, defaults to pdflatex. New tag and
10514 variable \view_pdf_command, defaults to xpdf. New tag and variable
10515 \pdf_to_ps_command, defaults to pdf2ps.
10517 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10519 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10520 does not have a BufferView.
10521 (unlockInset): ditto + don't access the_locking_inset if the
10522 buffer does not have a BufferView.
10524 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10525 certain circumstances so that we don't continue a keyboard
10526 operation long after the key was released. Try f.ex. to load a
10527 large document, press PageDown for some seconds and then release
10528 it. Before this change the document would contine to scroll for
10529 some time, with this change it stops imidiatly.
10531 * src/support/block.h: don't allocate more space than needed. As
10532 long as we don't try to write to the arr[x] in a array_type arr[x]
10533 it is perfectly ok. (if you write to it you might segfault).
10534 added operator value_type*() so that is possible to pass the array
10535 to functions expecting a C-pointer.
10537 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10540 * intl/*: updated to gettext 0.10.35, tried to add our own
10541 required modifications. Please verify.
10543 * po/*: updated to gettext 0.10.35, tried to add our own required
10544 modifications. Please verify.
10546 * src/support/lstrings.C (tostr): go at fixing the problem with
10547 cxx and stringstream. When stringstream is used return
10548 oss.str().c_str() so that problems with lyxstring and basic_string
10549 are avoided. Note that the best solution would be for cxx to use
10550 basic_string all the way, but it is not conformant yet. (it seems)
10552 * src/lyx_cb.C + other files: moved several global functions to
10553 class BufferView, some have been moved to BufferView.[Ch] others
10554 are still located in lyx_cb.C. Code changes because of this. (part
10555 of "get rid of current_view project".)
10557 * src/buffer.C + other files: moved several Buffer functions to
10558 class BufferView, the functions are still present in buffer.C.
10559 Code changes because of this.
10561 * config/lcmessage.m4: updated to most recent. used when creating
10564 * config/progtest.m4: updated to most recent. used when creating
10567 * config/gettext.m4: updated to most recent. applied patch for
10570 * config/gettext.m4.patch: new file that shows what changes we
10571 have done to the local copy of gettext.m4.
10573 * config/libtool.m4: new file, used in creation of acinclude.m4
10575 * config/lyxinclude.m4: new file, this is the lyx created m4
10576 macros, used in making acinclude.m4.
10578 * autogen.sh: GNU m4 discovered as a separate task not as part of
10579 the lib/configure creation.
10580 Generate acinlucde from files in config. Actually cat
10581 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10582 easier to upgrade .m4 files that really are external.
10584 * src/Spacing.h: moved using std::istringstream to right after
10585 <sstream>. This should fix the problem seen with some compilers.
10587 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10589 * src/lyx_cb.C: began some work to remove the dependency a lot of
10590 functions have on BufferView::text, even if not really needed.
10591 (GetCurrentTextClass): removed this func, it only hid the
10594 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10595 forgot this in last commit.
10597 * src/Bullet.C (bulletEntry): use static char const *[] for the
10598 tables, becuase of this the return arg had to change to string.
10599 (bulletSize): ditto
10600 (~Bullet): removed unneeded destructor
10602 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10603 (insetSleep): moved from Buffer
10604 (insetWakeup): moved from Buffer
10605 (insetUnlock): moved from Buffer
10607 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10608 from Buffer to BufferView.
10610 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10612 * config/ltmain.sh: updated to version 1.3.4 of libtool
10614 * config/ltconfig: updated to version 1.3.4 of libtool
10616 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10619 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10620 Did I get that right?
10622 * src/lyxlex.h: add a "using" directive or two.
10623 * src/Spacing.h: ditto.
10624 * src/insets/figinset.C: ditto.
10625 * src/support/filetools.C: ditto.
10626 * src/support/lstrings.C: ditto.
10627 * src/BufferView.C: ditto.
10628 * src/bufferlist.C: ditto.
10629 * src/lyx_cb.C: ditto.
10630 * src/lyxlex.C: ditto.
10632 * NEWS: add some changes for 1.1.4.
10634 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10636 * src/BufferView.C: first go at a TextCache to speed up switching
10639 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10641 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10642 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10643 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10644 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10647 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10648 members of the struct are correctly initialized to 0 (detected by
10650 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10651 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10653 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10654 pidwait, since it was allocated with "new". This was potentially
10655 very bad. Thanks to Michael Schmitt for running purify for us.
10658 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10660 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10662 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10664 1999-12-30 Allan Rae <rae@lyx.org>
10666 * lib/templates/IEEEtran.lyx: minor change
10668 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10669 src/mathed/formula.C (LocalDispatch): askForText changes
10671 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10672 know when a user has cancelled input. Fixes annoying problems with
10673 inserting labels and version control.
10675 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10677 * src/support/lstrings.C (tostr): rewritten to use strstream and
10680 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10682 * src/support/filetools.C (IsFileWriteable): use fstream to check
10683 (IsDirWriteable): use fileinfo to check
10685 * src/support/filetools.h (FilePtr): whole class deleted
10687 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10689 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10691 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10693 * src/bufferlist.C (write): use ifstream and ofstream instead of
10696 * src/Spacing.h: use istrstream instead of sscanf
10698 * src/mathed/math_defs.h: change first arg to istream from FILE*
10700 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10702 * src/mathed/math_parser.C: have yyis to be an istream
10703 (LexGetArg): use istream (yyis)
10705 (mathed_parse): ditto
10706 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10708 * src/mathed/formula.C (Read): rewritten to use istream
10710 * src/mathed/formulamacro.C (Read): rewritten to use istream
10712 * src/lyxlex.h (~LyXLex): deleted desturctor
10713 (getStream): new function, returns an istream
10714 (getFile): deleted funtion
10715 (IsOK): return is.good();
10717 * src/lyxlex.C (LyXLex): delete file and owns_file
10718 (setFile): open an filebuf and assign that to a istream instead of
10720 (setStream): new function, takes an istream as arg.
10721 (setFile): deleted function
10722 (EatLine): rewritten us use istream instead of FILE*
10726 * src/table.C (LyXTable): use istream instead of FILE*
10727 (Read): rewritten to take an istream instead of FILE*
10729 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10731 * src/buffer.C (Dispatch): remove an extraneous break statement.
10733 * src/support/filetools.C (QuoteName): change to do simple
10734 'quoting'. More work is necessary. Also changed to do nothing
10735 under emx (needs fix too).
10736 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10738 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10739 config.h.in to the AC_DEFINE_UNQUOTED() call.
10740 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10741 needs char * as argument (because Solaris 7 declares it like
10744 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10745 remove definition of BZERO.
10747 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10749 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10750 defined, "lyxregex.h" if not.
10752 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10754 (REGEX): new variable that is set to regex.c lyxregex.h when
10755 AM_CONDITIONAL USE_REGEX is set.
10756 (libsupport_la_SOURCES): add $(REGEX)
10758 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10761 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10764 * configure.in: add call to LYX_REGEX
10766 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10767 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10769 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10771 * lib/bind/fi_menus.bind: new file, from
10772 pauli.virtanen@saunalahti.fi.
10774 * src/buffer.C (getBibkeyList): pass the parameter delim to
10775 InsetInclude::getKeys and InsetBibtex::getKeys.
10777 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10778 is passed to Buffer::getBibkeyList
10780 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10781 instead of the hardcoded comma.
10783 * src/insets/insetbib.C (getKeys): make sure that there are not
10784 leading blanks in bibtex keys. Normal latex does not care, but
10785 harvard.sty seems to dislike blanks at the beginning of citation
10786 keys. In particular, the retturn value of the function is
10788 * INSTALL: make it clear that libstdc++ is needed and that gcc
10789 2.7.x probably does not work.
10791 * src/support/filetools.C (findtexfile): make debug message go to
10793 * src/insets/insetbib.C (getKeys): ditto
10795 * src/debug.C (showTags): make sure that the output is correctly
10798 * configure.in: add a comment for TWO_COLOR_ICON define.
10800 * acconfig.h: remove all the entries that already defined in
10801 configure.in or acinclude.m4.
10803 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10804 to avoid user name, date and copyright.
10806 1999-12-21 Juergen Vigna <jug@sad.it>
10808 * src/table.C (Read): Now read bogus row format informations
10809 if the format is < 5 so that afterwards the table can
10810 be read by lyx but without any format-info. Fixed the
10811 crash we experienced when not doing this.
10813 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10815 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10816 (RedoDrawingOfParagraph): ditto
10817 (RedoParagraphs): ditto
10818 (RemoveTableRow): ditto
10820 * src/text.C (Fill): rename arg paperwidth -> paper_width
10822 * src/buffer.C (insertLyXFile): rename var filename -> fname
10823 (writeFile): rename arg filename -> fname
10824 (writeFileAscii): ditto
10825 (makeLaTeXFile): ditto
10826 (makeLinuxDocFile): ditto
10827 (makeDocBookFile): ditto
10829 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10832 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10834 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10837 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10838 compiled by a C compiler not C++.
10840 * src/layout.h (LyXTextClass): added typedef for const_iterator
10841 (LyXTextClassList): added typedef for const_iterator + member
10842 functions begin and end.
10844 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10845 iterators to fill the choice_class.
10846 (updateLayoutChoice): rewritten to use iterators to fill the
10847 layoutlist in the toolbar.
10849 * src/BufferView.h (BufferView::work_area_width): removed unused
10852 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10854 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10855 (sgmlCloseTag): ditto
10857 * src/support/lstrings.h: return type of countChar changed to
10860 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10861 what version of this func to use. Also made to return unsigned int.
10863 * configure.in: call LYX_STD_COUNT
10865 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10866 conforming std::count.
10868 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10870 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10871 and a subscript would give bad display (patch from Dekel Tsur
10872 <dekel@math.tau.ac.il>).
10874 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10876 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10879 * src/chset.h: add a few 'using' directives
10881 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10882 triggered when no buffer is active
10884 * src/layout.C: removed `break' after `return' in switch(), since
10887 * src/lyx_main.C (init): make sure LyX can be ran in place even
10888 when libtool has done its magic with shared libraries. Fix the
10889 test for the case when the system directory has not been found.
10891 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10892 name for the latex file.
10893 (MenuMakeHTML): ditto
10895 * src/buffer.h: add an optional boolean argument, which is passed
10896 to ChangeExtension.
10898 1999-12-20 Allan Rae <rae@lyx.org>
10900 * lib/templates/IEEEtran.lyx: small correction and update.
10902 * configure.in: Attempted to use LYX_PATH_HEADER
10904 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10906 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10907 input from JMarc. Now use preprocessor to find the header.
10908 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10909 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10910 LYX_STL_STRING_FWD. See comments in file.
10912 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10914 * The global MiniBuffer * minibuffer variable is dead.
10916 * The global FD_form_main * fd_form_main variable is dead.
10918 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10920 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10922 * src/table.h: add the LOstream.h header
10923 * src/debug.h: ditto
10925 * src/LyXAction.h: change the explaination of the ReadOnly
10926 attribute: is indicates that the function _can_ be used.
10928 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10931 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10933 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10939 * src/paragraph.C (GetWord): assert on pos>=0
10942 * src/support/lyxstring.C: condition the use of an invariant on
10944 * src/support/lyxstring.h: ditto
10946 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10947 Use LAssert.h instead of plain assert().
10949 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10951 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10952 * src/support/filetools.C: ditto
10954 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10957 * INSTALL: document the new configure flags
10959 * configure.in: suppress --with-debug; add --enable-assertions
10961 * acinclude.m4: various changes in alignment of help strings.
10963 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10965 * src/kbmap.C: commented out the use of the hash map in kb_map,
10966 beginning of movement to a stl::container.
10968 * several files: removed code that was not in effect when
10969 MOVE_TEXT was defined.
10971 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10972 for escaping should not be used. We can discuss if the string
10973 should be enclosed in f.ex. [] instead of "".
10975 * src/trans_mgr.C (insert): use the new returned value from
10976 encodeString to get deadkeys and keymaps done correctly.
10978 * src/chset.C (encodeString): changed to return a pair, to tell
10979 what to use if we know the string.
10981 * src/lyxscreen.h (fillArc): new function.
10983 * src/FontInfo.C (resize): rewritten to use more std::string like
10984 structore, especially string::replace.
10986 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10989 * configure.in (chmod +x some scripts): remove config/gcc-hack
10991 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10993 * src/buffer.C (writeFile): change once again the top comment in a
10994 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10995 instead of an hardcoded version number.
10996 (makeDocBookFile): ditto
10998 * src/version.h: add new define LYX_DOCVERSION
11000 * po/de.po: update from Pit Sütterlin
11001 * lib/bind/de_menus.bind: ditto.
11003 * src/lyxfunc.C (Dispatch): call MenuExport()
11004 * src/buffer.C (Dispatch): ditto
11006 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11007 LyXFunc::Dispatch().
11008 (MenuExport): new function, moved from
11009 LyXFunc::Dispatch().
11011 * src/trans_mgr.C (insert): small cleanup
11012 * src/chset.C (loadFile): ditto
11014 * lib/kbd/iso8859-1.cdef: add missing backslashes
11016 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11018 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11019 help with placing the manually drawn accents better.
11021 (Draw): x2 and hg changed to float to minimize rounding errors and
11022 help place the accents better.
11024 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11025 unsigned short to char is just wrong...cast the char to unsigned
11026 char instead so that the two values can compare sanely. This
11027 should also make the display of insetlatexaccents better and
11028 perhaps also some other insets.
11030 (lbearing): new function
11033 1999-12-15 Allan Rae <rae@lyx.org>
11035 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11036 header that provides a wrapper around the very annoying SGI STL header
11039 * src/support/lyxstring.C, src/LString.h:
11040 removed old SGI-STL-compatability attempts.
11042 * configure.in: Use LYX_STL_STRING_FWD.
11044 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11045 stl_string_fwd.h is around and try to determine it's location.
11046 Major improvement over previous SGI STL 3.2 compatability.
11047 Three small problems remain with this function due to my zero
11048 knowledge of autoconf. JMarc and lgb see the comments in the code.
11050 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11052 * src/broken_const.h, config/hack-gcc, config/README: removed
11054 * configure.in: remove --with-gcc-hack option; do not call
11057 * INSTALL: remove documentation of --with-broken-const and
11060 * acconfig.h: remove all trace of BROKEN_CONST define
11062 * src/buffer.C (makeDocBookFile): update version number in output
11064 (SimpleDocBookOnePar): fix an assert when trying to a character
11065 access beyond string length
11068 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11070 * po/de.po: fix the Export menu
11072 * lyx.man: update the description of -dbg
11074 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11075 (commandLineHelp): updated
11076 (easyParse): show list of available debug levels if -dbg is passed
11079 * src/Makefile.am: add debug.C
11081 * src/debug.h: moved some code to debug.C
11083 * src/debug.C: new file. Contains code to set and show debug
11086 * src/layout.C: remove 'break' after 'continue' in switch
11087 statements, since these cannot be reached.
11089 1999-12-13 Allan Rae <rae@lyx.org>
11091 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11092 (in_word_set): hash() -> math_hash()
11094 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11096 * acconfig.h: Added a test for whether we are using exceptions in the
11097 current compilation run. If so USING_EXCEPTIONS is defined.
11099 * config.in: Check for existance of stl_string_fwd.h
11100 * src/LString.h: If compiling --with-included-string and SGI's
11101 STL version 3.2 is present (see above test) we need to block their
11102 forward declaration of string and supply a __get_c_string().
11103 However, it turns out this is only necessary if compiling with
11104 exceptions enabled so I've a bit more to add yet.
11106 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11107 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11108 src/support/LRegex.h, src/undo.h:
11109 Shuffle the order of the included files a little to ensure that
11110 LString.h gets included before anything that includes stl_string_fwd.h
11112 * src/support/lyxstring.C: We need to #include LString.h instead of
11113 lyxstring.h to get the necessary definition of __get_c_string.
11114 (__get_c_string): New function. This is defined static just like SGI's
11115 although why they need to do this I'm not sure. Perhaps it should be
11116 in lstrings.C instead.
11118 * lib/templates/IEEEtran.lyx: New template file.
11120 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11122 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11123 * intl/Makefile.in (MKINSTALLDIRS): ditto
11125 * src/LyXAction.C (init): changed to hold the LFUN data in a
11126 automatic array in stead of in callso to newFunc, this speeds up
11127 compilation a lot. Also all the memory used by the array is
11128 returned when the init is completed.
11130 * a lot of files: compiled with -Wold-style-cast, changed most of
11131 the reported offenders to C++ style casts. Did not change the
11132 offenders in C files.
11134 * src/trans.h (Match): change argument type to unsigned int.
11136 * src/support/DebugStream.C: fix some types on the streambufs so
11137 that it works on a conforming implementation.
11139 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11141 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11143 * src/support/lyxstring.C: remove the inline added earlier since
11144 they cause a bunch of unsatisfied symbols when linking with dec
11145 cxx. Cxx likes to have the body of inlines at the place where they
11148 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11149 accessing negative bounds in array. This fixes the crash when
11150 inserting accented characters.
11151 * src/trans.h (Match): ditto
11153 * src/buffer.C (Dispatch): since this is a void, it should not try
11154 to return anything...
11156 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11158 * src/buffer.h: removed the two friends from Buffer. Some changes
11159 because of this. Buffer::getFileName and Buffer::setFileName
11160 renamed to Buffer::fileName() and Buffer::fileName(...).
11162 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11164 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11165 and Buffer::update(short) to BufferView. This move is currently
11166 controlled by a define MOVE_TEXT, this will be removed when all
11167 shows to be ok. This move paves the way for better separation
11168 between buffer contents and buffer view. One side effect is that
11169 the BufferView needs a rebreak when swiching buffers, if we want
11170 to avoid this we can add a cache that holds pointers to LyXText's
11171 that is not currently in use.
11173 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11176 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11178 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11180 * lyx_main.C: new command line option -x (or --execute) and
11181 -e (or --export). Now direct conversion from .lyx to .tex
11182 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11183 Unfortunately, X is still needed and the GUI pops up during the
11186 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11188 * src/Spacing.C: add a using directive to bring stream stuff into
11190 * src/paragraph.C: ditto
11191 * src/buffer.C: ditto
11193 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11194 from Lars' announcement).
11196 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11197 example files from Tino Meinen.
11199 1999-12-06 Allan Rae <rae@lyx.org>
11201 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11203 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11205 * src/support/lyxstring.C: added a lot of inline for no good
11208 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11209 latexWriteEndChanges, they were not used.
11211 * src/layout.h (operator<<): output operator for PageSides
11213 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11215 * some example files: loaded in LyX 1.0.4 and saved again to update
11216 certain constructs (table format)
11218 * a lot of files: did the change to use fstream/iostream for all
11219 writing of files. Done with a close look at Andre Poenitz's patch.
11221 * some files: whitespace changes.
11223 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11225 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11226 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11227 architecture, we provide our own. It is used unconditionnally, but
11228 I do not think this is a performance problem. Thanks to Angus
11229 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11230 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11232 (GetInset): use my_memcpy.
11236 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11237 it is easier to understand, but it uses less TeX-only constructs now.
11239 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11240 elements contain spaces
11242 * lib/configure: regenerated
11244 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11245 elements contain spaces; display the list of programs that are
11248 * autogen.sh: make sure lib/configure is executable
11250 * lib/examples/*: rename the tutorial examples to begin with the
11251 two-letters language code.
11253 * src/lyxfunc.C (getStatus): do not query current font if no
11256 * src/lyx_cb.C (RunScript): use QuoteName
11257 (MenuRunDvips): ditto
11258 (PrintApplyCB): ditto
11260 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11261 around argument, so that it works well with the current shell.
11262 Does not work properly with OS/2 shells currently.
11264 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11265 * src/LyXSendto.C (SendtoApplyCB): ditto
11266 * src/lyxfunc.C (Dispatch): ditto
11267 * src/buffer.C (runLaTeX): ditto
11268 (runLiterate): ditto
11269 (buildProgram): ditto
11271 * src/lyx_cb.C (RunScript): ditto
11272 (MenuMakeLaTeX): ditto
11274 * src/buffer.h (getLatexName): new method
11276 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11278 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11280 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11281 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11282 (create_math_panel): ditto
11284 * src/lyxfunc.C (getStatus): re-activate the code which gets
11285 current font and cursor; add test for export to html.
11287 * src/lyxrc.C (read): remove unreachable break statements; add a
11290 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11292 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11294 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11295 introduced by faulty regex.
11296 * src/buffer.C: ditto
11297 * src/lastfiles.C: ditto
11298 * src/paragraph.C: ditto
11299 * src/table.C: ditto
11300 * src/vspace.C: ditto
11301 * src/insets/figinset.C: ditto
11302 Note: most of these is absolutely harmless, except the one in
11303 src/mathed formula.C.
11305 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11307 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11308 operation, yielding correct results for the reLyX command.
11310 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11312 * src/support/filetools.C (ExpandPath): removed an over eager
11314 (ReplaceEnvironmentPath): ditto
11316 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11317 shows that we are doing something fishy in our code...
11318 (BubblePost): ditto
11321 * src/lyxrc.C (read): use a double switch trick to get more help
11322 from the compiler. (the same trick is used in layout.C)
11323 (write): new function. opens a ofstream and pass that to output
11324 (output): new function, takes a ostream and writes the lyxrc
11325 elemts to it. uses a dummy switch to make sure no elements are
11328 * src/lyxlex.h: added a struct pushpophelper for use in functions
11329 with more than one exit point.
11331 * src/lyxlex.[Ch] (GetInteger): made it const
11335 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11337 * src/layout.[hC] : LayoutTags splitted into several enums, new
11338 methods created, better error handling cleaner use of lyxlex. Read
11341 * src/bmtable.[Ch]: change some member prototypes because of the
11342 image const changes.
11344 * commandtags.h, src/LyXAction.C (init): new function:
11345 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11346 This file is not read automatically but you can add \input
11347 preferences to your lyxrc if you want to. We need to discuss how
11350 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11351 in .aux, also remove .bib and .bst files from dependencies when
11354 * src/BufferView.C, src/LyXView.C: add const_cast several places
11355 because of changes to images.
11357 * lib/images/*: same change as for images/*
11359 * lib/lyxrc.example: Default for accept_compound is false not no.
11361 * images/*: changed to be const, however I have som misgivings
11362 about this change so it might be changed back.
11364 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11366 * lib/configure, po/POTFILES.in: regenerated
11368 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11370 * config/lib_configure.m4: removed
11372 * lib/configure.m4: new file (was config/lib_configure.m4)
11374 * configure.in: do not test for rtti, since we do not use it.
11376 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11378 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11379 doubling of allocated space scheme. This makes it faster for large
11380 strings end to use less memory for small strings. xtra rememoved.
11382 * src/insets/figinset.C (waitalarm): commented out.
11383 (GhostscriptMsg): use static_cast
11384 (GhostscriptMsg): use new instead of malloc to allocate memory for
11385 cmap. also delete the memory after use.
11387 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11389 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11390 for changes in bibtex database or style.
11391 (runBibTeX): remove all .bib and .bst files from dep before we
11393 (run): use scanAuc in when dep file already exist.
11395 * src/DepTable.C (remove_files_with_extension): new method
11396 (exist): new method
11398 * src/DepTable.[Ch]: made many of the methods const.
11400 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11402 * src/bufferparams.C: make sure that the default textclass is
11403 "article". It used to be the first one by description order, but
11404 now the first one is "docbook".
11406 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11407 string; call Debug::value.
11408 (easyParse): pass complete argument to setDebuggingLevel().
11410 * src/debug.h (value): fix the code that parses debug levels.
11412 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11415 * src/LyXAction.C: use Debug::ACTION as debug channel.
11417 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11419 * NEWS: updated for the future 1.1.3 release.
11421 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11422 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11423 it should. This is of course a controversial change (since many
11424 people will find that their lyx workscreen is suddenly full of
11425 red), but done for the sake of correctness.
11427 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11428 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11430 * src/insets/inseterror.h, src/insets/inseturl.h,
11431 src/insets/insetinfo.h, src/insets/figinset.h,
11432 src/mathed/formulamacro.h, src/mathed/math_macro.h
11433 (EditMessage): add a missing const and add _() to make sure that
11434 translation happens
11436 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11437 src/insets/insetbib.C, src/support/filetools.C: add `using'
11438 directives for cxx.
11440 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11441 doing 'Insert index of last word' at the beginning of a paragraph.
11443 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11445 * several files: white-space changes.
11447 * src/mathed/formula.C: removed IsAlpha and IsDigit
11449 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11450 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11453 * src/insets/figinset.C (GetPSSizes): don't break when
11454 "EndComments" is seen. But break when a boundingbox is read.
11456 * all classes inherited from Inset: return value of Clone
11457 changed back to Inset *.
11459 * all classes inherited form MathInset: return value of Clone
11460 changed back to MathedInset *.
11462 * src/insets/figinset.C (runqueue): use a ofstream to output the
11463 gs/ps file. Might need some setpresicion or setw. However I can
11464 see no problem with the current code.
11465 (runqueue): use sleep instead of the alarm/signal code. I just
11466 can't see the difference.
11468 * src/paragraph.C (LyXParagraph): reserve space in the new
11469 paragraph and resize the inserted paragraph to just fit.
11471 * src/lyxfunc.h (operator|=): added operator for func_status.
11473 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11474 check for readable file.
11476 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11477 check for readable file.
11478 (MenuMakeLinuxDoc): ditto
11479 (MenuMakeDocBook): ditto
11480 (MenuMakeAscii): ditto
11481 (InsertAsciiFile): split the test for openable and readable
11483 * src/bmtable.C (draw_bitmaptable): use
11484 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11486 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11487 findtexfile from LaTeX to filetools.
11489 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11490 instead of FilePtr. Needs to be verified by a literate user.
11492 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11494 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11495 (EditMessage): likewise.
11497 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11498 respectively as \textasciitilde and \textasciicircum.
11500 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11502 * src/support/lyxstring.h: made the methods that take iterators
11503 use const_iterator.
11505 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11506 (regexMatch): made is use the real regex class.
11508 * src/support/Makefile.am: changed to use libtool
11510 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11512 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11514 (MathIsInset ++): changed several macros to be inline functions
11517 * src/mathed/Makefile.am: changed to use libtool
11519 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11521 * src/insets/inset* : Clone changed to const and return type is
11522 the true insettype not just Inset*.
11524 * src/insets/Makefile.am: changed to use libtool
11526 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11528 * src/undo.[Ch] : added empty() and changed some of the method
11531 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11533 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11534 setID use block<> for the bullets array, added const several places.
11536 * src/lyxfunc.C (getStatus): new function
11538 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11539 LyXAction, added const to several funtions.
11541 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11542 a std::map, and to store the dir items in a vector.
11544 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11547 * src/LyXView.[Ch] + other files : changed currentView to view.
11549 * src/LyXAction.[Ch] : ported from the old devel branch.
11551 * src/.cvsignore: added .libs and a.out
11553 * configure.in : changes to use libtool.
11555 * acinclude.m4 : inserted libtool.m4
11557 * .cvsignore: added libtool
11559 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11561 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11562 file name in insets and mathed directories (otherwise the
11563 dependency is not taken in account under cygwin).
11565 * src/text2.C (InsertString[AB]): make sure that we do not try to
11566 read characters past the string length.
11568 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11570 * lib/doc/LaTeXConfig.lyx.in,
11571 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11573 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11574 file saying who created them and when this heppened; this is
11575 useless and annoys tools like cvs.
11577 * lib/layouts/g-brief-{en,de}.layout,
11578 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11579 from Thomas Hartkens <thomas@hartkens.de>.
11581 * src/{insets,mathed}/Makefile.am: do not declare an empty
11582 LDFLAGS, so that it can be set at configure time (useful on Irix
11585 * lib/reLyX/configure.in: make sure that the prefix is set
11586 correctly in LYX_DIR.
11588 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11590 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11591 be used by 'command-sequence' this allows to bind a key to a
11592 sequence of LyX-commands
11593 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11595 * src/LyXAction.C: add "command-sequence"
11597 * src/LyXFunction.C: handling of "command-sequence"
11599 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11600 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11602 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11604 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11606 * src/buffer.C (writeFile): Do not output a comment giving user
11607 and date at the beginning of a .lyx file. This is useless and
11608 annoys cvs anyway; update version number to 1.1.
11610 * src/Makefile.am (LYX_DIR): add this definition, so that a
11611 default path is hardcoded in LyX.
11613 * configure.in: Use LYX_GNU_GETTEXT.
11615 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11616 AM_GNU_GETTEXT with a bug fixed.
11618 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11620 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11622 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11623 which is used to point to LyX data is now LYX_DIR_11x.
11625 * lyx.man: convert to a unix text file; small updates.
11627 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11629 * src/support/LSubstring.[Ch]: made the second arg of most of the
11630 constructors be a const reference.
11632 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11635 * src/support/lyxstring.[Ch] (swap): added missing member function
11636 and specialization of swap(str, str);
11638 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11640 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11641 trace of the old one.
11643 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11644 put the member definitions in undo.C.
11646 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11647 NEW_TEXT and have now only code that was included when this was
11650 * src/intl.C (LCombo): use static_cast
11652 (DispatchCallback): ditto
11654 * src/definitions.h: removed whole file
11656 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11658 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11659 parsing and stores in a std:map. a regex defines the file format.
11660 removed unneeded members.
11662 * src/bufferparams.h: added several enums from definitions.h here.
11663 Removed unsused destructor. Changed some types to use proper enum
11664 types. use block to have the temp_bullets and user_defined_bullets
11665 and to make the whole class assignable.
11667 * src/bufferparams.C (Copy): removed this functions, use a default
11668 assignment instead.
11670 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11673 * src/buffer.C (readLyXformat2): commend out all that have with
11674 oldpapersize to do. also comment out all that hve to do with
11675 insetlatex and insetlatexdel.
11676 (setOldPaperStuff): commented out
11678 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11680 * src/LyXAction.C: remove use of inset-latex-insert
11682 * src/mathed/math_panel.C (button_cb): use static_cast
11684 * src/insets/Makefile.am (insets_o_SOURCES): removed
11687 * src/support/lyxstring.C (helper): use the unsigned long
11688 specifier, UL, instead of a static_cast.
11690 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11692 * src/support/block.h: new file. to be used as a c-style array in
11693 classes, so that the class can be assignable.
11695 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11697 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11698 NULL, make sure to return an empty string (it is not possible to
11699 set a string to NULL).
11701 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11703 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11705 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11707 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11708 link line, so that Irix users (for example) can set it explicitely to
11711 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11712 it can be overidden at make time (static or dynamic link, for
11715 * src/vc-backend.C, src/LaTeXFeatures.h,
11716 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11717 statements to bring templates to global namespace.
11719 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11721 * src/support/lyxstring.C (operator[] const): make it standard
11724 * src/minibuffer.C (Init): changed to reflect that more
11725 information is given from the lyxvc and need not be provided here.
11727 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11729 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11731 * src/LyXView.C (UpdateTimerCB): use static_cast
11732 (KeyPressMask_raw_callback): ditto
11734 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11735 buffer_, a lot of changes because of this. currentBuffer() ->
11736 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11737 also changes to other files because of this.
11739 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11741 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11742 have no support for RCS and partial support for CVS, will be
11745 * src/insets/ several files: changes because of function name
11746 changes in Bufferview and LyXView.
11748 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11750 * src/support/LSubstring.[Ch]: new files. These implement a
11751 Substring that can be very convenient to use. i.e. is this
11753 string a = "Mary had a little sheep";
11754 Substring(a, "sheep") = "lamb";
11755 a is now "Mary has a little lamb".
11757 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11758 out patterns and subpatterns of strings. It is used by LSubstring
11759 and also by vc-backend.C
11761 * src/support/lyxstring.C: went over all the assertions used and
11762 tried to correct the wrong ones and flag which of them is required
11763 by the standard. some bugs found because of this. Also removed a
11764 couple of assertions.
11766 * src/support/Makefile.am (libsupport_a_SOURCES): added
11767 LSubstring.[Ch] and LRegex.[Ch]
11769 * src/support/FileInfo.h: have struct stat buf as an object and
11770 not a pointer to one, some changes because of this.
11772 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11773 information in layout when adding the layouts preamble to the
11774 textclass preamble.
11776 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11779 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11780 because of bug in OS/2.
11782 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11784 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11785 \verbatim@font instead of \ttfamily, so that it can be redefined.
11787 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11788 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11789 src/layout.h, src/text2.C: add 'using' directive to bring the
11790 STL templates we need from the std:: namespace to the global one.
11791 Needed by DEC cxx in strict ansi mode.
11793 * src/support/LIstream.h,src/support/LOstream.h,
11794 src/support/lyxstring.h,src/table.h,
11795 src/lyxlookup.h: do not include <config.h> in header
11796 files. This should be done in the .C files only.
11798 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11802 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11804 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11805 from Kayvan to fix the tth invokation.
11807 * development/lyx.spec.in: updates from Kayvan to reflect the
11808 changes of file names.
11810 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11812 * src/text2.C (InsertStringB): use std::copy
11813 (InsertStringA): use std::copy
11815 * src/bufferlist.C: use a vector to store the buffers in. This is
11816 an internal change and should not affect any other thing.
11818 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11821 * src/text.C (Fill): fix potential bug, one off bug.
11823 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11825 * src/Makefile.am (lyx_main.o): add more files it depends on.
11827 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11829 * src/support/lyxstring.C: use size_t for the reference count,
11830 size, reserved memory and xtra.
11831 (internal_compare): new private member function. Now the compare
11832 functions should work for std::strings that have embedded '\0'
11834 (compare): all compare functions rewritten to use
11837 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11839 * src/support/lyxstring.C (compare): pass c_str()
11840 (compare): pass c_str
11841 (compare): pass c_str
11843 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11845 * src/support/DebugStream.C: <config.h> was not included correctly.
11847 * lib/configure: forgot to re-generate it :( I'll make this file
11848 auto generated soon.
11850 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11852 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11855 * src/support/lyxstring.C: some changes from length() to rep->sz.
11856 avoids a function call.
11858 * src/support/filetools.C (SpaceLess): yet another version of the
11859 algorithm...now per Jean-Marc's suggestions.
11861 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11863 * src/layout.C (less_textclass_desc): functor for use in sorting
11865 (LyXTextClass::Read): sort the textclasses after reading.
11867 * src/support/filetools.C (SpaceLess): new version of the
11868 SpaceLess functions. What problems does this one give? Please
11871 * images/banner_bw.xbm: made the arrays unsigned char *
11873 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11875 * src/support/lyxstring.C (find): remove bogus assertion in the
11876 two versions of find where this has not been done yet.
11878 * src/support/lyxlib.h: add missing int return type to
11881 * src/menus.C (ShowFileMenu): disable exporting to html if no
11882 html export command is present.
11884 * config/lib_configure.m4: add a test for an HTML converter. The
11885 programs checked for are, in this order: tth, latex2html and
11888 * lib/configure: generated from config/lib_configure.m4.
11890 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11891 html converter. The parameters are now passed through $$FName and
11892 $$OutName, instead of standard input/output.
11894 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11896 * lib/lyxrc.example: update description of \html_command.
11897 add "quotes" around \screen_font_xxx font setting examples to help
11898 people who use fonts with spaces in their names.
11900 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11902 * Distribution files: updates for v1.1.2
11904 * src/support/lyxstring.C (find): remove bogus assert and return
11905 npos for the same condition.
11907 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11909 * added patch for OS/2 from SMiyata.
11911 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11913 * src/text2.C (CutSelection): make space_wrapped a bool
11914 (CutSelection): dont declare int i until we have to.
11915 (alphaCounter): return a char const *.
11917 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11919 * src/support/syscall.C (Systemcalls::kill):
11920 src/support/filetools.C (PutEnv, PutEnvPath):
11921 src/lyx_cb.C (addNewlineAndDepth):
11922 src/FontInfo.C (FontInfo::resize): condition some #warning
11923 directives with WITH_WARNINGS.
11926 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11928 * src/layout.[Ch] + several files: access to class variables
11929 limited and made accessor functions instead a lot of code changed
11930 becuase of this. Also instead of returning pointers often a const
11931 reference is returned instead.
11933 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11935 * src/Makefile.am (dist-hook): added used to remove the CVS from
11936 cheaders upon creating a dist
11937 (EXTRA_DIST): added cheaders
11939 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11940 a character not as a small integer.
11942 * src/support/lyxstring.C (find): removed Assert and added i >=
11943 rep->sz to the first if.
11945 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11947 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11948 src/LyXView.C src/buffer.C src/bufferparams.C
11949 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11950 src/text2.C src/insets/insetinclude.C:
11951 lyxlayout renamed to textclasslist.
11953 * src/layout.C: some lyxerr changes.
11955 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11956 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11957 (LyXLayoutList): removed all traces of this class.
11958 (LyXTextClass::Read): rewrote LT_STYLE
11959 (LyXTextClass::hasLayout): new function
11960 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11961 both const and nonconst version.
11962 (LyXTextClass::delete_layout): new function.
11963 (LyXTextClassList::Style): bug fix. do the right thing if layout
11965 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11966 (LyXTextClassList::NameOfLayout): ditto
11967 (LyXTextClassList::Load): ditto
11969 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11971 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11973 * src/LyXAction.C (LookupFunc): added a workaround for sun
11974 compiler, on the other hand...we don't know if the current code
11975 compiles on sun at all...
11977 * src/support/filetools.C (CleanupPath): subst fix
11979 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11982 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11983 complained about this one?
11985 * src/insets/insetinclude.C (Latex): subst fix
11987 * src/insets/insetbib.C (getKeys): subst fix
11989 * src/LyXSendto.C (SendtoApplyCB): subst fix
11991 * src/lyx_main.C (init): subst fix
11993 * src/layout.C (Read): subst fix
11995 * src/lyx_sendfax_main.C (button_send): subst fix
11997 * src/buffer.C (RoffAsciiTable): subst fix
11999 * src/lyx_cb.C (MenuFax): subst fix
12000 (PrintApplyCB): subst fix
12002 1999-10-26 Juergen Vigna <jug@sad.it>
12004 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12006 (Read): Cleaned up this code so now we read only format vestion >= 5
12008 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12010 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12011 come nobody has complained about this one?
12013 * src/insets/insetinclude.C (Latex): subst fix
12015 * src/insets/insetbib.C (getKeys): subst fix
12017 * src/lyx_main.C (init): subst fix
12019 * src/layout.C (Read): subst fix
12021 * src/buffer.C (RoffAsciiTable): subst fix
12023 * src/lyx_cb.C (MenuFax): subst fix.
12025 * src/layout.[hC] + some other files: rewrote to use
12026 std::container to store textclasses and layouts in.
12027 Simplified, removed a lot of code. Make all classes
12028 assignable. Further simplifications and review of type
12029 use still to be one.
12031 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12032 lastfiles to create the lastfiles partr of the menu.
12034 * src/lastfiles.[Ch]: rewritten to use deque to store the
12035 lastfiles in. Uses fstream for reading and writing. Simplifies
12038 * src/support/syscall.C: remove explicit cast.
12040 * src/BufferView.C (CursorToggleCB): removed code snippets that
12041 were commented out.
12042 use explicat C++ style casts instead of C style casts. also use
12043 u_vdata instea of passing pointers in longs.
12045 * src/PaperLayout.C: removed code snippets that were commented out.
12047 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12049 * src/lyx_main.C: removed code snippets that wer commented out.
12051 * src/paragraph.C: removed code snippets that were commented out.
12053 * src/lyxvc.C (logClose): use static_cast
12055 (viewLog): remove explicit cast to void*
12056 (showLog): removed old commented code
12058 * src/menus.C: use static_cast instead of C style casts. use
12059 u_vdata instead of u_ldata. remove explicit cast to (long) for
12060 pointers. Removed old code that was commented out.
12062 * src/insets/inset.C: removed old commented func
12064 * src/insets/insetref.C (InsetRef): removed old code that had been
12065 commented out for a long time.
12067 (escape): removed C style cast
12069 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12071 * src/insets/insetlatex.C (Draw): removed old commented code
12072 (Read): rewritten to use string
12074 * src/insets/insetlabel.C (escape): removed C style cast
12076 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12078 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12079 old commented code.
12081 * src/insets/insetinclude.h: removed a couple of stupid bools
12083 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12084 (Clone): remove C style cast
12085 (getKeys): changed list to lst because of std::list
12087 * src/insets/inseterror.C (Draw): removed som old commented code.
12089 * src/insets/insetcommand.C (Draw): removed some old commented code.
12091 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12092 commented out forever.
12093 (bibitem_cb): use static_cast instead of C style cast
12094 use of vdata changed to u_vdata.
12096 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12098 (CloseUrlCB): use static_cast instead of C style cast.
12099 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12101 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12102 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12103 (CloseInfoCB): static_cast from ob->u_vdata instead.
12104 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12107 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12108 (C_InsetError_CloseErrorCB): forward the ob parameter
12109 (CloseErrorCB): static_cast from ob->u_vdata instead.
12111 * src/vspace.h: include LString.h since we use string in this class.
12113 * src/vspace.C (lyx_advance): changed name from advance because of
12114 nameclash with stl. And since we cannot use namespaces yet...I
12115 used a lyx_ prefix instead. Expect this to change when we begin
12118 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12120 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12121 and removed now defunct constructor and deconstructor.
12123 * src/BufferView.h: have backstack as a object not as a pointer.
12124 removed initialization from constructor. added include for BackStack
12126 * development/lyx.spec.in (%build): add CFLAGS also.
12128 * src/screen.C (drawFrame): removed another warning.
12130 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12132 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12133 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12134 README and ANNOUNCE a bit for the next release. More work is
12137 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12138 unbreakable if we are in freespacing mode (LyX-Code), but not in
12141 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12143 * src/BackStack.h: fixed initialization order in constructor
12145 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12147 * acinclude.m4 (VERSION): new rules for when a version is
12148 development, added also a variable for prerelease.
12149 (warnings): we set with_warnings=yes for prereleases
12150 (lyx_opt): prereleases compile with same optimization as development
12151 (CXXFLAGS): only use pedantic if we are a development version
12153 * src/BufferView.C (restorePosition): don't do anything if the
12154 backstack is empty.
12156 * src/BackStack.h: added member empty, use this to test if there
12157 is anything to pop...
12159 1999-10-25 Juergen Vigna <jug@sad.it>
12162 * forms/layout_forms.fd +
12163 * forms/latexoptions.fd +
12164 * lyx.fd: changed for various form resize issues
12166 * src/mathed/math_panel.C +
12167 * src/insets/inseterror.C +
12168 * src/insets/insetinfo.C +
12169 * src/insets/inseturl.C +
12170 * src/insets/inseturl.h +
12172 * src/LyXSendto.C +
12173 * src/PaperLayout.C +
12174 * src/ParagraphExtra.C +
12175 * src/TableLayout.C +
12177 * src/layout_forms.C +
12184 * src/menus.C: fixed various resize issues. So now forms can be
12185 resized savely or not be resized at all.
12187 * forms/form_url.fd +
12188 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12191 * src/insets/Makefile.am: added files form_url.[Ch]
12193 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12195 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12196 (and presumably 6.2).
12198 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12199 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12200 remaining static member callbacks.
12202 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12205 * src/support/lyxstring.h: declare struct Srep as friend of
12206 lyxstring, since DEC cxx complains otherwise.
12208 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12210 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12212 * src/LaTeX.C (run): made run_bibtex also depend on files with
12214 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12215 are put into the dependency file.
12217 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12218 the code has shown itself to work
12219 (create_ispell_pipe): removed another warning, added a comment
12222 * src/minibuffer.C (ExecutingCB): removed code that has been
12223 commented out a long time
12225 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12226 out code + a warning.
12228 * src/support/lyxstring.h: comment out the three private
12229 operators, when compiling with string ansi conforming compilers
12230 they make problems.
12232 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12234 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12235 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12238 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12241 * src/mathed/math_panel.C (create_math_panel): remove explicit
12244 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12247 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12248 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12249 to XCreatePixmapFromBitmapData
12250 (fl_set_bmtable_data): change the last argument to be unsigned
12252 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12253 and bh to be unsigned int, remove explicit casts in call to
12254 XReadBitmapFileData.
12256 * images/arrows.xbm: made the arrays unsigned char *
12257 * images/varsz.xbm: ditto
12258 * images/misc.xbm: ditto
12259 * images/greek.xbm: ditto
12260 * images/dots.xbm: ditto
12261 * images/brel.xbm: ditto
12262 * images/bop.xbm: ditto
12264 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12266 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12267 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12268 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12270 (LYX_CXX_CHEADERS): added <clocale> to the test.
12272 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12274 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12276 * src/support/lyxstring.C (append): fixed something that must be a
12277 bug, rep->assign was used instead of rep->append.
12279 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12282 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12283 lyx insert double chars. Fix spotted by Kayvan.
12285 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12287 * Fixed the tth support. I messed up with the Emacs patch apply feature
12288 and omitted the changes in lyxrc.C.
12290 1999-10-22 Juergen Vigna <jug@sad.it>
12292 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12294 * src/lyx_cb.C (MenuInsertRef) +
12295 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12296 the form cannot be resized under it limits (fixes a segfault)
12298 * src/lyx.C (create_form_form_ref) +
12299 * forms/lyx.fd: Changed Gravity on name input field so that it is
12302 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12304 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12305 <ostream> and <istream>.
12307 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12308 whether <fstream> provides the latest standard features, or if we
12309 have an oldstyle library (like in egcs).
12310 (LYX_CXX_STL_STRING): fix the test.
12312 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12313 code on MODERN_STL_STREAM.
12315 * src/support/lyxstring.h: use L{I,O}stream.h.
12317 * src/support/L{I,O}stream.h: new files, designed to setup
12318 correctly streams for our use
12319 - includes the right header depending on STL capabilities
12320 - puts std::ostream and std::endl (for LOStream.h) or
12321 std::istream (LIStream.h) in toplevel namespace.
12323 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12325 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12326 was a bib file that had been changed we ensure that bibtex is run.
12327 (runBibTeX): enhanced to extract the names of the bib files and
12328 getting their absolute path and enter them into the dep file.
12329 (findtexfile): static func that is used to look for tex-files,
12330 checks for absolute patchs and tries also with kpsewhich.
12331 Alternative ways of finding the correct files are wanted. Will
12333 (do_popen): function that runs a command using popen and returns
12334 the whole output of that command in a string. Should be moved to
12337 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12338 file with extension ext has changed.
12340 * src/insets/figinset.C: added ifdef guards around the fl_free
12341 code that jug commented out. Now it is commented out when
12342 compiling with XForms == 0.89.
12344 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12345 to lyxstring.C, and only keep a forward declaration in
12346 lyxstring.h. Simplifies the header file a bit and should help a
12347 bit on compile time too. Also changes to Srep will not mandate a
12348 recompile of code just using string.
12349 (~lyxstring): definition moved here since it uses srep.
12350 (size): definition moved here since it uses srep.
12352 * src/support/lyxstring.h: removed a couple of "inline" that should
12355 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12357 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12360 1999-10-21 Juergen Vigna <jug@sad.it>
12362 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12363 set to left if I just remove the width entry (or it is empty).
12365 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12366 paragraph when having dummy paragraphs.
12368 1999-10-20 Juergen Vigna <jug@sad.it>
12370 * src/insets/figinset.C: just commented some fl_free_form calls
12371 and added warnings so that this calls should be activated later
12372 again. This avoids for now a segfault, but we have a memory leak!
12374 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12375 'const char * argument' to 'string argument', this should
12376 fix some Asserts() in lyxstring.C.
12378 * src/lyxfunc.h: Removed the function argAsString(const char *)
12379 as it is not used anymore.
12381 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12383 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12386 * src/Literate.h: some funcs moved from public to private to make
12387 interface clearer. Unneeded args removed.
12389 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12391 (scanBuildLogFile): ditto
12393 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12394 normal TeX Error. Still room for improvement.
12396 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12398 * src/buffer.C (insertErrors): changes to make the error
12399 desctription show properly.
12401 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12404 * src/support/lyxstring.C (helper): changed to use
12405 sizeof(object->rep->ref).
12406 (operator>>): changed to use a pointer instead.
12408 * src/support/lyxstring.h: changed const reference & to value_type
12409 const & lets see if that helps.
12411 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12413 * Makefile.am (rpmdist): fixed to have non static package and
12416 * src/support/lyxstring.C: removed the compilation guards
12418 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12421 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12422 conditional compile of lyxstring.Ch
12424 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12425 stupid check, but it is a lot better than the bastring hack.
12426 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12428 * several files: changed string::erase into string::clear. Not
12431 * src/chset.C (encodeString): use a char temporary instead
12433 * src/table.C (TexEndOfCell): added tostr around
12434 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12435 (TexEndOfCell): ditto
12436 (TexEndOfCell): ditto
12437 (TexEndOfCell): ditto
12438 (DocBookEndOfCell): ditto
12439 (DocBookEndOfCell): ditto
12440 (DocBookEndOfCell): ditto
12441 (DocBookEndOfCell): ditto
12443 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12445 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12447 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12448 (MenuBuildProg): added tostr around ret
12449 (MenuRunChktex): added tostr around ret
12450 (DocumentApplyCB): added tostr around ret
12452 * src/chset.C (encodeString): added tostr around t->ic
12454 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12455 (makeLaTeXFile): added tostr around tocdepth
12456 (makeLaTeXFile): added tostr around ftcound - 1
12458 * src/insets/insetbib.C (setCounter): added tostr around counter.
12460 * src/support/lyxstring.h: added an operator+=(int) to catch more
12463 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12464 (lyxstring): We DON'T allow NULL pointers.
12466 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12468 * src/mathed/math_macro.C (MathMacroArgument::Write,
12469 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12470 when writing them out.
12472 * src/LString.C: remove, since it is not used anymore.
12474 * src/support/lyxstring.C: condition the content to
12475 USE_INCLUDED_STRING macro.
12477 * src/mathed/math_symbols.C, src/support/lstrings.C,
12478 src/support/lyxstring.C: add `using' directive to specify what
12479 we need in <algorithm>. I do not think that we need to
12480 conditionalize this, but any thought is appreciated.
12482 * many files: change all callback functions to "C" linkage
12483 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12484 strict_ansi. Those who were static are now global.
12485 The case of callbacks which are static class members is
12486 trickier, since we have to make C wrappers around them (see
12487 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12488 did not finish this yet, since it defeats the purpose of
12489 encapsulation, and I am not sure what the best route is.
12491 1999-10-19 Juergen Vigna <jug@sad.it>
12493 * src/support/lyxstring.C (lyxstring): we permit to have a null
12494 pointer as assignment value and just don't assign it.
12496 * src/vspace.C (nextToken): corrected this function substituting
12497 find_first(_not)_of with find_last_of.
12499 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12500 (TableOptCloseCB) (TableSpeCloseCB):
12501 inserted fl_set_focus call for problem with fl_hide_form() in
12504 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12506 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12509 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12511 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12512 LyXLex::next() and not eatline() to get its argument.
12514 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12516 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12517 instead, use fstreams for io of the depfile, removed unneeded
12518 functions and variables.
12520 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12521 vector instead, removed all functions and variables that is not in
12524 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12526 * src/buffer.C (insertErrors): use new interface to TeXError
12528 * Makefile.am (rpmdist): added a rpmdist target
12530 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12531 per Kayvan's instructions.
12533 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12535 * src/Makefile.am: add a definition for localedir, so that locales
12536 are found after installation (Kayvan)
12538 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12540 * development/.cvsignore: new file.
12542 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12544 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12545 C++ compiler provides wrappers for C headers and use our alternate
12548 * configure.in: use LYX_CXX_CHEADERS.
12550 * src/cheader/: new directory, populated with cname headers from
12551 libstdc++-2.8.1. They are a bit old, but probably good enough for
12552 what we want (support compilers who lack them).
12554 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12555 from includes. It turns out is was stupid.
12557 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12559 * lib/Makefile.am (install-data-local): forgot a ';'
12560 (install-data-local): forgot a '\'
12561 (libinstalldirs): needed after all. reintroduced.
12563 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12565 * configure.in (AC_OUTPUT): added lyx.spec
12567 * development/lyx.spec: removed file
12569 * development/lyx.spec.in: new file
12571 * po/*.po: merged with lyx.pot becuase of make distcheck
12573 * lib/Makefile.am (dist-hook): added dist-hook so that
12574 documentation files will be included when doing a make
12575 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12576 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12578 more: tried to make install do the right thing, exclude CVS dirs
12581 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12582 Path would fit in more nicely.
12584 * all files that used to use pathstack: uses now Path instead.
12585 This change was a lot easier than expected.
12587 * src/support/path.h: new file
12589 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12591 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12593 * src/support/lyxstring.C (getline): Default arg was given for
12596 * Configure.cmd: removed file
12598 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12600 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12601 streams classes and types, add the proper 'using' statements when
12602 MODERN_STL is defined.
12604 * src/debug.h: move the << operator definition after the inclusion
12607 * src/support/filetools.C: include "LAssert.h", which is needed
12610 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12613 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12614 include "debug.h" to define a proper ostream.
12616 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12618 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12619 method to the SystemCall class which can kill a process, but it's
12620 not fully implemented yet.
12622 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12624 * src/support/FileInfo.h: Better documentation
12626 * src/lyxfunc.C: Added support for buffer-export html
12628 * src/menus.C: Added Export->As HTML...
12630 * lib/bind/*.bind: Added short-cut for buffer-export html
12632 * src/lyxrc.*: Added support for new \tth_command
12634 * lib/lyxrc.example: Added stuff for new \tth_command
12636 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12638 * lib/Makefile.am (IMAGES): removed images/README
12639 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12640 installes in correct place. Check permisions is installed
12643 * src/LaTeX.C: some no-op changes moved declaration of some
12646 * src/LaTeX.h (LATEX_H): changed include guard name
12648 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12650 * lib/reLyX/Makefile.am: install noweb2lyx.
12652 * lib/Makefile.am: install configure.
12654 * lib/reLyX/configure.in: declare a config aux dir; set package
12655 name to lyx (not sure what the best solution is); generate noweb2lyx.
12657 * lib/layouts/egs.layout: fix the bibliography layout.
12659 1999-10-08 Jürgen Vigna <jug@sad.it>
12661 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12662 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12663 it returned without continuing to search the path.
12665 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12667 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12668 also fixes a bug. It is not allowed to do tricks with std::strings
12669 like: string a("hei"); &a[e]; this will not give what you
12670 think... Any reason for the complexity in this func?
12672 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12674 * Updated README and INSTALL a bit, mostly to check that my
12675 CVS rights are correctly set up.
12677 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12679 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12680 does not allow '\0' chars but lyxstring and std::string does.
12682 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12684 * autogen.sh (AUTOCONF): let the autogen script create the
12685 POTFILES.in file too. POTFILES.in should perhaps now not be
12686 included in the cvs module.
12688 * some more files changed to use C++ includes instead of C ones.
12690 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12692 (Reread): added tostr to nlink. buggy output otherwise.
12693 (Reread): added a string() around szMode when assigning to Buffer,
12694 without this I got a log of garbled info strings.
12696 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12699 * I have added several ostream & operator<<(ostream &, some_type)
12700 functions. This has been done to avoid casting and warnings when
12701 outputting enums to lyxerr. This as thus eliminated a lot of
12702 explicit casts and has made the code clearer. Among the enums
12703 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12704 mathed enums, some font enum the Debug::type enum.
12706 * src/support/lyxstring.h (clear): missing method. equivalent of
12709 * all files that contained "stderr": rewrote constructs that used
12710 stderr to use lyxerr instead. (except bmtable)
12712 * src/support/DebugStream.h (level): and the passed t with
12713 Debug::ANY to avoid spurious bits set.
12715 * src/debug.h (Debug::type value): made it accept strings of the
12716 type INFO,INIT,KEY.
12718 * configure.in (Check for programs): Added a check for kpsewhich,
12719 the latex generation will use this later to better the dicovery of
12722 * src/BufferView.C (create_view): we don't need to cast this to
12723 (void*) that is done automatically.
12724 (WorkAreaButtonPress): removed some dead code.
12726 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12728 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12729 is not overwritten when translated (David Sua'rez de Lis).
12731 * lib/CREDITS: Added David Sua'rez de Lis
12733 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12735 * src/bufferparams.C (BufferParams): default input encoding is now
12738 * acinclude.m4 (cross_compiling): comment out macro
12739 LYX_GXX_STRENGTH_REDUCE.
12741 * acconfig.h: make sure that const is not defined (to empty) when
12742 we are compiling C++. Remove commented out code using SIZEOF_xx
12745 * configure.in : move the test for const and inline as late as
12746 possible so that these C tests do not interefere with C++ ones.
12747 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12748 has not been proven.
12750 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12752 * src/table.C (getDocBookAlign): remove bad default value for
12753 isColumn parameter.
12755 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12757 (ShowFileMenu2): ditto.
12759 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12760 of files to ignore.
12762 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12764 * Most files: finished the change from the old error code to use
12765 DebugStream for all lyxerr debugging. Only minor changes remain
12766 (e.g. the setting of debug levels using strings instead of number)
12768 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12770 * src/layout.C (Add): Changed to use compare_no_case instead of
12773 * src/FontInfo.C: changed loop variable type too string::size_type.
12775 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12777 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12778 set ETAGS_ARGS to --c++
12780 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12782 * src/table.C (DocBookEndOfCell): commented out two unused variables
12784 * src/paragraph.C: commented out four unused variables.
12786 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12787 insed a if clause with type string::size_type.
12789 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12792 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12794 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12795 variable, also changed loop to go from 0 to lenght + 1, instead of
12796 -1 to length. This should be correct.
12798 * src/LaTeX.C (scanError): use string::size_type as loop variable
12801 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12802 (l.896) since y_tmp and row was not used anyway.
12804 * src/insets/insetref.C (escape): use string::size_type as loop
12807 * src/insets/insetquotes.C (Width): use string::size_type as loop
12809 (Draw): use string::size_type as loop variable type.
12811 * src/insets/insetlatexaccent.C (checkContents): use
12812 string::size_type as loop variable type.
12814 * src/insets/insetlabel.C (escape): use string::size_type as loop
12817 * src/insets/insetinfo.C: added an extern for current_view.
12819 * src/insets/insetcommand.C (scanCommand): use string::size_type
12820 as loop variable type.
12822 * most files: removed the RCS tags. With them we had to recompile
12823 a lot of files after a simple cvs commit. Also we have never used
12824 them for anything meaningful.
12826 * most files: tags-query-replace NULL 0. As adviced several plases
12827 we now use "0" instead of "NULL" in our code.
12829 * src/support/filetools.C (SpaceLess): use string::size_type as
12830 loop variable type.
12832 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12834 * src/paragraph.C: fixed up some more string stuff.
12836 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12838 * src/support/filetools.h: make modestr a std::string.
12840 * src/filetools.C (GetEnv): made ch really const.
12842 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12843 made code that used these use max/min from <algorithm> instead.
12845 * changed several c library include files to their equivalent c++
12846 library include files. All is not changed yet.
12848 * created a support subdir in src, put lyxstring and lstrings
12849 there + the extra files atexit, fileblock, strerror. Created
12850 Makefile.am. edited configure.in and src/Makefile.am to use this
12851 new subdir. More files moved to support.
12853 * imported som of the functions from repository lyx, filetools
12855 * ran tags-query-replace on LString -> string, corrected the bogus
12856 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12857 is still some errors in there. This is errors where too much or
12858 too litle get deleted from strings (string::erase, string::substr,
12859 string::replace), there can also be some off by one errors, or
12860 just plain wrong use of functions from lstrings. Viewing of quotes
12863 * LyX is now running fairly well with string, but there are
12864 certainly some bugs yet (see above) also string is quite different
12865 from LString among others in that it does not allow null pointers
12866 passed in and will abort if it gets any.
12868 * Added the revtex4 files I forgot when setting up the repository.
12870 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12872 * All over: Tried to clean everything up so that only the files
12873 that we really need are included in the cvs repository.
12874 * Switched to use automake.
12875 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12876 * Install has not been checked.
12878 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12880 * po/pt.po: Three errors:
12881 l.533 and l.538 format specification error
12882 l. 402 duplicate entry, I just deleted it.