1 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/Bullet.h: changed type of font, character and size to int
5 * src/buffer.C (asciiParagraph): remove actcell and fname1.
7 * src/insets/inseturl.[Ch]:
8 * src/insets/insetref.[Ch]:
9 * src/insets/insetlabel.[Ch]: add linelen to Ascii
11 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
13 * src/buffer.C (readFile): block-if statement rearranged to minimise
14 bloat. Patch does not reverse Jean-Marc's change ;-)
16 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
17 Class rewritten to store pointers to hide/update signals directly,
18 rather than Dialogs *. Also defined an enum to ease use. All xforms
19 forms can now be derived from this class.
21 * src/frontends/xforms/FormCommand.[Ch]
22 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
24 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
27 * src/frontends/xforms/forms/form_citation.fd
28 * src/frontends/xforms/forms/form_copyright.fd
29 * src/frontends/xforms/forms/form_error.fd
30 * src/frontends/xforms/forms/form_index.fd
31 * src/frontends/xforms/forms/form_ref.fd
32 * src/frontends/xforms/forms/form_toc.fd
33 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
35 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
37 * src/insets/insetfoot.C: removed redundent using directive.
39 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
41 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
42 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
44 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
45 created in the constructors in different groups. Then set() just
46 have to show the groups as needed. This fixes the redraw problems
47 (and is how the old menu code worked).
49 * src/support/lyxlib.h: declare the methods as static when we do
52 2000-09-26 Juergen Vigna <jug@sad.it>
54 * src/buffer.C (asciiParagraph): new function.
55 (writeFileAscii): new function with parameter ostream.
56 (writeFileAscii): use now asciiParagraph.
58 * various inset files: added the linelen parameter to the Ascii-func.
60 * src/tabular.C (Write): fixed error in writing file introduced by
61 the last changes from Lars.
63 * lib/bind/menus.bind: removed not supported functions.
65 * src/insets/insettext.C (Ascii): implemented this function.
67 * src/insets/lyxinset.h (Ascii): added linelen parameter.
69 * src/tabular.C (write_attribute[int,string,bool]): new functions.
70 (Write): use of the write_attribute functions.
72 * src/bufferlist.C (close): fixed reasking question!
74 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
76 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
77 new files use the everwhere possible.
80 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
81 src/log_form.C src/lyx.C:
84 * src/buffer.C (runLaTeX): remove func
86 * src/PaperLayout.C: removed file
87 * src/ParagraphExtra.C: likewise
88 * src/bullet_forms.C: likewise
89 * src/bullet_forms.h: likewise
90 * src/bullet_forms_cb.C: likewise
92 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
93 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
96 * several files: remove all traces of the old fd_form_paragraph,
97 and functions belonging to that.
99 * several files: remove all traces of the old fd_form_document,
100 and functions belonging to that.
102 * several files: constify local variables were possible.
104 * several files: remove all code that was dead when NEW_EXPORT was
107 * several files: removed string::c_str in as many places as
110 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
111 (e): be a bit more outspoken when patching
112 (updatesrc): only move files if changed.
114 * forms/layout_forms.h.patch: regenerated
116 * forms/layout_forms.fd: remove form_document and form_paragraph
117 and form_quotes and form_paper and form_table_options and
120 * forms/form1.fd: remove form_table
122 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
123 the fdui->... rewrite. Update some comments to xforms 0.88
125 * forms/bullet_forms.C.patch: removed file
126 * forms/bullet_forms.fd: likewise
127 * forms/bullet_forms.h.patch: likewise
129 * development/Code_rules/Rules: added a section on switch
130 statements. Updated some comment to xforms 0.88.
132 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
134 * src/buffer.C (readFile): make sure that the whole version number
135 is read after \lyxformat (even when it contains a comma)
137 * lib/ui/default.ui: change shortcut of math menu to M-a.
139 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
141 * src/vspace.C (nextToken): use isStrDbl() to check for proper
144 * src/LyXView.C (updateWindowTitle): show the full files name in
145 window title, limited to 30 characters.
147 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
148 When a number of characters has been given, we should not assume
149 that the string is 0-terminated.
151 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
152 calls (fixes some memory leaks)
154 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
155 trans member on exit.
157 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
159 * src/converter.C (GetReachable): fix typo.
161 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
162 understand ',' instead of '.'.
163 (GetInteger): rewrite to use strToInt().
165 2000-09-26 Juergen Vigna <jug@sad.it>
167 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
168 better visibility and error-message on wrong VSpace input.
170 * src/language.C (initL): added english again.
172 2000-09-25 Juergen Vigna <jug@sad.it>
174 * src/frontends/kde/Dialogs.C (Dialogs):
175 * src/frontends/gnome/Dialogs.C (Dialogs):
176 * src/frontends/kde/Makefile.am:
177 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
179 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
181 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
183 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
185 * src/frontends/xforms/FormParagraph.C:
186 * src/frontends/xforms/FormParagraph.h:
187 * src/frontends/xforms/form_paragraph.C:
188 * src/frontends/xforms/form_paragraph.h:
189 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
192 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
194 * src/tabular.C (OldFormatRead): forgot to delete the temporary
195 Paragraph-Data after use.
197 * src/insets/insettext.C (LocalDispatch): don't set the layout on
198 non breakable paragraphs.
200 2000-09-25 Garst R. Reese <reese@isn.net>
202 * src/language.C (initL): added missing language_country codes.
204 2000-09-25 Juergen Vigna <jug@sad.it>
206 * src/insets/insettext.C (InsetText):
207 (deleteLyXText): remove the not released LyXText structure!
209 2000-09-24 Marko Vendelin <markov@ioc.ee>
211 * src/frontends/gnome/mainapp.C
212 * src/frontends/gnome/mainapp.h: added support for keyboard
215 * src/frontends/gnome/FormCitation.C
216 * src/frontends/gnome/FormCitation.h
217 * src/frontends/gnome/Makefile.am
218 * src/frontends/gnome/pixbutton.h: completed the rewrite of
219 FormCitation to use "action area" in mainapp window
221 * src/frontends/gnome/Menubar_pimpl.C
222 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
225 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
227 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
228 width/descent/ascent values if name is empty.
229 (mathed_string_height): Use std::max.
231 2000-09-25 Allan Rae <rae@lyx.org>
233 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
234 segfault. This will be completely redesigned soon.
236 * sigc++: updated libsigc++. Fixes struct timespec bug.
238 * development/tools/makeLyXsigc.sh: .cvsignore addition
240 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
242 * several files: removed almost all traces of the old table
245 * src/TableLayout.C: removed file
247 2000-09-22 Juergen Vigna <jug@sad.it>
249 * src/frontends/kde/Dialogs.C: added credits forms.
251 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
253 * src/frontends/gnome/Dialogs.C: added some forms.
255 * src/spellchecker.C (init_spell_checker): set language in pspell code
256 (RunSpellChecker): some modifications for setting language string.
258 * src/language.[Ch]: added language_country code.
260 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
262 * src/frontends/Dialogs.h: added new signal showError.
263 Rearranged existing signals in some sort of alphabetical order.
265 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
266 FormError.[Ch], form_error.[Ch]
267 * src/frontends/xforms/forms/makefile: added new file form_error.fd
268 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
270 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
271 dialogs. I think that this can be used as the base to all these
274 * src/frontends/xforms/FormError.[Ch]
275 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
276 implementation of InsetError dialog.
278 * src/insets/inseterror.[Ch]: rendered GUI-independent.
280 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
281 * src/frontends/kde/Makefile.am: ditto
283 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
285 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
286 macrobf. This fixes a bug of invisible text.
288 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
290 * lib/doc/LaTeXConfig.lyx.in: updated.
292 * src/language.C (initL): remove language "francais" and change a
293 bit the names of the two other french variations.
295 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
296 string that may not be 0-terminated.
298 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
300 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
302 2000-09-20 Marko Vendelin <markov@ioc.ee>
304 * src/frontends/gnome/FormCitation.C
305 * src/frontends/gnome/FormIndex.C
306 * src/frontends/gnome/FormToc.C
307 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
308 the variable initialization to shut up the warnings
310 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
312 * src/table.[Ch]: deleted files
314 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
317 2000-09-18 Juergen Vigna <jug@sad.it>
319 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
320 problems with selection. Inserted new LFUN_PASTESELECTION.
321 (InsetButtonPress): inserted handling of middle mouse-button paste.
323 * src/spellchecker.C: changed word to word.c_str().
325 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
327 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
328 included in the ``make dist'' tarball.
330 2000-09-15 Juergen Vigna <jug@sad.it>
332 * src/CutAndPaste.C (cutSelection): small fix return the right
333 end position after cut inside one paragraph only.
335 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
336 we are locked as otherwise we don't have a valid cursor position!
338 * src/insets/figinset.C (draw): small bugfix but why is this needed???
340 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
342 * src/frontends/kde/FormRef.C: added using directive.
343 * src/frontends/kde/FormToc.C: ditto
345 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
347 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
350 2000-09-19 Marko Vendelin <markov@ioc.ee>
352 * src/frontends/gnome/Menubar_pimpl.C
353 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
354 Toc, ViewFormats, UpdateFormats, and ExportFormats.
356 * src/frontends/gnome/mainapp.C
357 * src/frontends/gnome/mainapp.h: support for menu update used
360 * src/frontends/gnome/mainapp.C
361 * src/frontends/gnome/mainapp.h: support for "action" area in the
362 main window. This area is used by small simple dialogs, such as
365 * src/frontends/gnome/FormIndex.C
366 * src/frontends/gnome/FormIndex.h
367 * src/frontends/gnome/FormUrl.C
368 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
371 * src/frontends/gnome/FormCitation.C
372 * src/frontends/gnome/FormCitation.h: rewrite to use main window
373 action area. Only "Insert new citation" is implemented.
377 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
379 * src/buffer.C (Dispatch): fix call to Dispatch
380 * src/insets/insetref.C (Edit): likewise
381 * src/insets/insetparent.C (Edit): likewise
382 * src/insets/insetinclude.C (include_cb): likewise
383 * src/frontends/xforms/FormUrl.C (apply): likewise
384 * src/frontends/xforms/FormToc.C (apply): likewise
385 * src/frontends/xforms/FormRef.C (apply): likewise
386 * src/frontends/xforms/FormIndex.C (apply): likewise
387 * src/frontends/xforms/FormCitation.C (apply): likewise
388 * src/lyxserver.C (callback): likewise
389 * src/lyxfunc.C (processKeySym): likewise
392 * src/lyx_cb.C (LayoutsCB): likewise
394 * Makefile.am (sourcedoc): small change
396 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
398 * src/main.C (main): Don't make an empty GUIRunTime object. all
399 methods are static. constify a bit remove unneded using + headers.
401 * src/tabular.C: some more const to local vars move some loop vars
403 * src/spellchecker.C: added some c_str after some word for pspell
405 * src/frontends/GUIRunTime.h: add new static method setDefaults
406 * src/frontends/xforms/GUIRunTime.C (setDefaults):
407 * src/frontends/kde/GUIRunTime.C (setDefaults):
408 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
410 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
411 with strnew in arg, use correct emptystring when calling SetName.
413 * several files: remove all commented code with relation to
414 HAVE_SSTREAM beeing false. We now only support stringstream and
417 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
419 * src/lyxfunc.C: construct correctly the automatic new file
422 * src/text2.C (IsStringInText): change type of variable i to shut
425 * src/support/sstream.h: do not use namespaces if the compiler
426 does not support them.
428 2000-09-15 Marko Vendelin <markov@ioc.ee>
429 * src/frontends/gnome/FormCitation.C
430 * src/frontends/gnome/FormCitation.h
431 * src/frontends/gnome/diainsertcitation_interface.c
432 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
433 regexp support to FormCitation [Gnome].
435 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
438 * configure.in: remove unused KDE/GTKGUI define
440 * src/frontends/kde/FormRef.C
441 * src/frontends/kde/FormRef.h
442 * src/frontends/kde/formrefdialog.C
443 * src/frontends/kde/formrefdialog.h: double click will
444 go to reference, now it is possible to change a cross-ref
447 * src/frontends/kde/FormToc.C
448 * src/frontends/kde/FormToc.h
449 * src/frontends/kde/formtocdialog.C
450 * src/frontends/kde/formtocdialog.h: add a depth
453 * src/frontends/kde/Makefile.am: add QtLyXView.h
456 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
458 * src/frontends/kde/FormCitation.h: added some using directives.
460 * src/frontends/kde/FormToc.h: corrected definition of doTree.
462 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
465 * src/mathed/math_defs.h: redefine SetAlign to use string rather
468 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
470 * src/buffer.C (pop_tag): revert for the second time a change by
471 Lars, who seems to really hate having non-local loop variables :)
473 * src/Lsstream.h: add "using" statements.
475 * src/support/copy.C (copy): add a bunch of std:: qualifiers
476 * src/buffer.C (writeFile): ditto
478 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
480 * src/buffer.C (writeFile): try to fix the locale modified format
481 number to always be as we want it.
483 * src/WorkArea.C (work_area_handler): try to workaround the bugs
484 in XForms 0.89. C-space is now working again.
486 * src/Lsstream.h src/support/sstream.h: new files.
488 * also commented out all cases where strstream were used.
490 * src/Bullet.h (c_str): remove method.
492 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
494 * a lot of files: get rid of "char const *" and "char *" is as
495 many places as possible. We only want to use them in interaction
496 with system of other libraries, not inside lyx.
498 * a lot of files: return const object is not of pod type. This
499 helps ensure that temporary objects is not modified. And fits well
500 with "programming by contract".
502 * configure.in: check for the locale header too
504 * Makefile.am (sourcedoc): new tag for generation of doc++
507 2000-09-14 Juergen Vigna <jug@sad.it>
509 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
510 callback to check which combo called it and do the right action.
512 * src/combox.C (combo_cb): added combo * to the callbacks.
513 (Hide): moved call of callback after Ungrab of the pointer.
515 * src/intl.h: removed LCombo2 function.
517 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
518 function as this can now be handled in one function.
520 * src/combox.h: added Combox * to callback prototype.
522 * src/frontends/xforms/Toolbar_pimpl.C:
523 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
525 2000-09-14 Garst Reese <reese@isn.net>
527 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
528 moved usepackage{xxx}'s to beginning of file. Changed left margin
529 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
530 underlining from title. Thanks to John Culleton for useful suggestions.
532 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
534 * src/lyxlex_pimpl.C (setFile): change error message to debug
537 2000-09-13 Juergen Vigna <jug@sad.it>
539 * src/frontends/xforms/FormDocument.C: implemented choice_class
540 as combox and give callback to combo_language so OK/Apply is activated
543 * src/bufferlist.C (newFile): small fix so already named files
544 (via an open call) are not requested to be named again on the
547 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
549 * src/frontends/kde/Makefile.am
550 * src/frontends/kde/FormRef.C
551 * src/frontends/kde/FormRef.h
552 * src/frontends/kde/formrefdialog.C
553 * src/frontends/kde/formrefdialog.h: implement
556 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
558 * src/frontends/kde/formtocdialog.C
559 * src/frontends/kde/formtocdialog.h
560 * src/frontends/kde/FormToc.C
561 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
563 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
565 * src/frontends/kde/FormCitation.C: fix thinko
566 where we didn't always display the reference text
569 * src/frontends/kde/formurldialog.C
570 * src/frontends/kde/formurldialog.h
571 * src/frontends/kde/FormUrl.C
572 * src/frontends/kde/FormUrl.h: minor cleanups
574 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
576 * src/frontends/kde/Makefile.am
577 * src/frontends/kde/FormToc.C
578 * src/frontends/kde/FormToc.h
579 * src/frontends/kde/FormCitation.C
580 * src/frontends/kde/FormCitation.h
581 * src/frontends/kde/FormIndex.C
582 * src/frontends/kde/FormIndex.h
583 * src/frontends/kde/formtocdialog.C
584 * src/frontends/kde/formtocdialog.h
585 * src/frontends/kde/formcitationdialog.C
586 * src/frontends/kde/formcitationdialog.h
587 * src/frontends/kde/formindexdialog.C
588 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
590 2000-09-12 Juergen Vigna <jug@sad.it>
592 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
595 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
597 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
600 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
602 * src/converter.C (Add, Convert): Added support for converter flags:
603 needaux, resultdir, resultfile.
604 (Convert): Added new parameter view_file.
605 (dvips_options): Fixed letter paper option.
607 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
608 (Export, GetExportableFormats, GetViewableFormats): Added support
611 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
613 (easyParse): Fixed to work with new export code.
615 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
618 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
620 * lib/bind/*.bind: Replaced
621 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
622 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
624 2000-09-11 Juergen Vigna <jug@sad.it>
626 * src/lyx_gui.C (runTime): uses global guiruntime variable.
628 * src/main.C (main): now GUII defines global guiruntime!
630 * src/frontends/gnome/GUIRunTime.C (initApplication):
631 * src/frontends/kde/GUIRunTime.C (initApplication):
632 * src/frontends/xforms/GUIRunTime.C (initApplication):
633 * src/frontends/GUIRunTime.h: added new function initApplication.
635 * src/spellchecker.C (sc_accept_word): change to add_to_session.
637 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
639 2000-09-08 Juergen Vigna <jug@sad.it>
641 * src/lyx_gui.C (create_forms): don't display the "default" entry as
642 we have already "Reset".
644 * src/language.C (initL): inserted "default" language and made this
645 THE default language (and not american!)
647 * src/paragraph.C: inserted handling of "default" language!
649 * src/lyxfont.C: ditto
653 * src/paragraph.C: output the \\par only if we have a following
654 paragraph otherwise it's not needed.
656 2000-09-05 Juergen Vigna <jug@sad.it>
658 * config/pspell.m4: added entry to lyx-flags
660 * src/spellchecker.C: modified version from Kevin for using pspell
662 2000-09-01 Marko Vendelin <markov@ioc.ee>
663 * src/frontends/gnome/Makefile.am
664 * src/frontends/gnome/FormCitation.C
665 * src/frontends/gnome/FormCitation.h
666 * src/frontends/gnome/diainsertcitation_callbacks.c
667 * src/frontends/gnome/diainsertcitation_callbacks.h
668 * src/frontends/gnome/diainsertcitation_interface.c
669 * src/frontends/gnome/diainsertcitation_interface.h
670 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
671 dialog for Gnome frontend
673 * src/main.C: Gnome libraries require keeping application name
674 and its version as strings
676 * src/frontends/gnome/mainapp.C: Change the name of the main window
677 from GnomeLyX to PACKAGE
679 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
681 * src/frontends/Liason.C: add "using: declaration.
683 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
685 * src/mathed/math_macro.C (Metrics): Set the size of the template
687 * src/mathed/formulamacro.C (Latex): Fixed the returned value
689 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
691 * src/converter.C (add_options): New function.
692 (SetViewer): Change $$FName into '$$FName'.
693 (View): Add options when running xdvi
694 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
695 (Convert): The 3rd parameter is now the desired filename. Converts
696 calls to lyx::rename if necessary.
697 Add options when running dvips.
698 (dvi_papersize,dvips_options): New methods.
700 * src/exporter.C (Export): Use getLatexName() instead of fileName().
702 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
703 using a call to Converter::dvips_options.
704 Fixed to work with nex export code.
707 * src/support/rename.C: New files
709 * src/support/syscall.h
710 * src/support/syscall.C: Added Starttype SystemDontWait.
712 * lib/ui/default.ui: Changed to work with new export code
714 * lib/configure.m4: Changed to work with new export code
716 * src/encoding.C: Changed latex name for iso8859_7 encoding.
718 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
720 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
721 so that code compiles with DEC cxx.
723 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
724 to work correctly! Also now supports the additional elements
727 2000-09-01 Allan Rae <rae@lyx.org>
729 * src/frontends/ButtonPolicies.C: renamed all the references to
730 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
732 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
733 since it's a const not a type.
735 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
737 2000-08-31 Juergen Vigna <jug@sad.it>
739 * src/insets/figinset.C: Various changes to look if the filename has
740 an extension and if not add it for inline previewing.
742 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
744 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
745 make buttonStatus and isReadOnly be const methods. (also reflect
746 this in derived classes.)
748 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
749 (nextState): change to be static inline, pass the StateMachine as
751 (PreferencesPolicy): remove casts
752 (OkCancelPolicy): remvoe casts
753 (OkCancelReadOnlyPolicy): remove casts
754 (NoRepeatedApplyReadOnlyPolicy): remove casts
755 (OkApplyCancelReadOnlyPolicy): remove casts
756 (OkApplyCancelPolicy): remove casts
757 (NoRepeatedApplyPolicy): remove casts
759 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
761 * src/converter.C: added some using directives
763 * src/frontends/ButtonPolicies.C: changes to overcome
764 "need lvalue" error with DEC c++
766 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
767 to WMHideCB for DEC c++
769 * src/frontends/xforms/Menubar_pimpl.C: added using directive
771 * src/frontends/xforms/forms/form_document.C.patch: use C callback
772 to BulletBMTableCB for DEC c++
774 2000-08-31 Allan Rae <rae@lyx.org>
776 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
777 character dialog separately from old document dialogs combo_language.
780 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
782 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
783 Removed LFUN_REF_CREATE.
785 * src/MenuBackend.C: Added new tags: toc and references
787 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
788 (add_lastfiles, add_documents, add_formats): Removed the unused smn
790 (add_toc, add_references): New methods.
791 (create_submenu): Handle correctly the case when there is a
792 seperator after optional menu items.
794 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
795 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
796 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
798 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
800 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
802 * src/converter.[Ch]: New file for converting between different
805 * src/export.[Ch]: New file for exporting a LyX file to different
808 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
809 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
810 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
811 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
812 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
813 RunDocBook, MenuExport.
815 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
816 Exporter::Preview methods if NEW_EXPORT is defined.
818 * src/buffer.C (Dispatch): Use Exporter::Export.
820 * src/lyxrc.C: Added new tags: \converter and \viewer.
823 * src/LyXAction.C: Define new lyx-function: buffer-update.
824 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
825 when NEW_EXPORT is defined.
827 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
829 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
831 * lib/ui/default.ui: Added submenus "view" and "update" to the
834 * src/filetools.C (GetExtension): New function.
836 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
838 2000-08-29 Allan Rae <rae@lyx.org>
840 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
842 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
843 (EnableDocumentLayout): removed
844 (DisableDocumentLayout): removed
845 (build): make use of ButtonController's read-only handling to
846 de/activate various objects. Replaces both of the above functions.
848 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
849 (readOnly): was read_only
850 (refresh): fixed dumb mistakes with read_only_ handling
852 * src/frontends/xforms/forms/form_document.fd:
853 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
854 tabbed dialogs so the tabs look more like tabs and so its easier to
855 work out which is the current tab.
857 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
858 segfault with form_table
860 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
862 2000-08-28 Juergen Vigna <jug@sad.it>
864 * acconfig.h: added USE_PSPELL.
866 * src/config.h.in: added USE_PSPELL.
868 * autogen.sh: added pspell.m4
870 * config/pspell.m4: new file.
872 * src/spellchecker.C: implemented support for pspell libary.
874 2000-08-25 Juergen Vigna <jug@sad.it>
876 * src/LyXAction.C (init): renamed LFUN_TABLE to
877 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
879 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
881 * src/lyxscreen.h: add force_clear variable and fuction to force
882 a clear area when redrawing in LyXText.
884 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
886 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
888 * some whitespace and comment changes.
890 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
892 * src/buffer.C: up te LYX_FORMAT to 2.17
894 2000-08-23 Juergen Vigna <jug@sad.it>
896 * src/BufferView_pimpl.C (tripleClick): disable this when in a
899 * src/insets/insettabular.C (pasteSelection): delete the insets
900 LyXText as it is not valid anymore.
901 (copySelection): new function.
902 (pasteSelection): new function.
903 (cutSelection): new function.
904 (LocalDispatch): implemented cut/copy/paste of cell selections.
906 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
907 don't have a LyXText.
909 * src/LyXAction.C (init): a NEW_TABULAR define too much.
911 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
914 2000-08-22 Juergen Vigna <jug@sad.it>
916 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
917 ifdef form_table out if NEW_TABULAR.
919 2000-08-21 Juergen Vigna <jug@sad.it>
921 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
922 (draw): fixed draw position so that the cursor is positioned in the
924 (InsetMotionNotify): hide/show cursor so the position is updated.
925 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
926 using cellstart() function where it should be used.
928 * src/insets/insettext.C (draw): ditto.
930 * src/tabular.C: fixed initialization of some missing variables and
931 made BoxType into an enum.
933 2000-08-22 Marko Vendelin <markov@ioc.ee>
934 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
935 stock menu item using action numerical value, not its string
939 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
941 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
942 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
944 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
946 * src/frontends/xforms/GUIRunTime.C: new file
948 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
949 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
951 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
953 * src/frontends/kde/GUIRunTime.C: new file
955 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
956 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
958 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
960 * src/frontends/gnome/GUIRunTime.C: new file
962 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
965 * src/frontends/GUIRunTime.h: removed constructor and destructor,
966 small change to documetentation.
968 * src/frontends/GUIRunTime.C: removed file
970 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
972 * src/lyxparagraph.h: enable NEW_TABULAR as default
974 * src/lyxfunc.C (processKeySym): remove some commented code
976 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
977 NEW_TABULAR around the fd_form_table_options.
979 * src/lyx_gui.C (runTime): call the static member function as
980 GUIRunTime::runTime().
982 2000-08-21 Allan Rae <rae@lyx.org>
984 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
987 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
989 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
991 2000-08-21 Allan Rae <rae@lyx.org>
993 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
995 * src/frontends/xforms/FormPreferences.C (build): use setOK
996 * src/frontends/xforms/FormDocument.C (build): use setOK
997 (FormDocument): use the appropriate policy.
999 2000-08-21 Allan Rae <rae@lyx.org>
1001 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1002 automatic [de]activation of arbitrary objects when in a read-only state.
1004 * src/frontends/ButtonPolicies.h: More documentation
1005 (isReadOnly): added to support the above.
1007 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1009 2000-08-18 Juergen Vigna <jug@sad.it>
1011 * src/insets/insettabular.C (getStatus): changed to return func_status.
1013 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1014 display toggle menu entries if they are.
1016 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1017 new document layout now.
1019 * src/lyxfunc.C: ditto
1021 * src/lyx_gui_misc.C: ditto
1023 * src/lyx_gui.C: ditto
1025 * lib/ui/default.ui: removed paper and quotes layout as they are now
1026 all in the document layout tabbed folder.
1028 * src/frontends/xforms/forms/form_document.fd: added Restore
1029 button and callbacks for all inputs for Allan's ButtonPolicy.
1031 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1032 (CheckChoiceClass): added missing params setting on class change.
1033 (UpdateLayoutDocument): added for updating the layout on params.
1034 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1035 (FormDocument): Implemented Allan's ButtonPolicy with the
1038 2000-08-17 Allan Rae <rae@lyx.org>
1040 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1041 so we can at least see the credits again.
1043 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1044 controller calls for the appropriate callbacks. Note that since Ok
1045 calls apply followed by cancel, and apply isn't a valid input for the
1046 APPLIED state, the bc_ calls have to be made in the static callback not
1047 within each of the real callbacks.
1049 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1050 (setOk): renamed from setOkay()
1052 2000-08-17 Juergen Vigna <jug@sad.it>
1054 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1055 in the implementation part.
1056 (composeUIInfo): don't show optional menu-items.
1058 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1060 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1062 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1063 text-state when in a text-inset.
1065 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1067 2000-08-17 Marko Vendelin <markov@ioc.ee>
1068 * src/frontends/gnome/FormIndex.C
1069 * src/frontends/gnome/FormIndex.h
1070 * src/frontends/gnome/FormToc.C
1071 * src/frontends/gnome/FormToc.h
1072 * src/frontends/gnome/dialogs
1073 * src/frontends/gnome/diatoc_callbacks.c
1074 * src/frontends/gnome/diatoc_callbacks.h
1075 * src/frontends/gnome/diainsertindex_callbacks.h
1076 * src/frontends/gnome/diainsertindex_callbacks.c
1077 * src/frontends/gnome/diainsertindex_interface.c
1078 * src/frontends/gnome/diainsertindex_interface.h
1079 * src/frontends/gnome/diatoc_interface.h
1080 * src/frontends/gnome/diatoc_interface.c
1081 * src/frontends/gnome/Makefile.am: Table of Contents and
1082 Insert Index dialogs implementation for Gnome frontend
1084 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1086 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1088 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1091 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1093 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1094 destructor. Don't definde if you don't need it
1095 (processEvents): made static, non-blocking events processing for
1097 (runTime): static method. event loop for xforms
1098 * similar as above for kde and gnome.
1100 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1101 new Pimpl is correct
1102 (runTime): new method calss the real frontends runtime func.
1104 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1106 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1108 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1110 2000-08-16 Juergen Vigna <jug@sad.it>
1112 * src/lyx_gui.C (runTime): added GUII RunTime support.
1114 * src/frontends/Makefile.am:
1115 * src/frontends/GUIRunTime.[Ch]:
1116 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1117 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1118 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1120 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1122 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1123 as this is already set in ${FRONTEND_INCLUDE} if needed.
1125 * configure.in (CPPFLAGS): setting the include dir for the frontend
1126 directory and don't set FRONTEND=xforms for now as this is executed
1129 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1131 * src/frontends/kde/Makefile.am:
1132 * src/frontends/kde/FormUrl.C:
1133 * src/frontends/kde/FormUrl.h:
1134 * src/frontends/kde/formurldialog.h:
1135 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1137 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1139 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1141 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1143 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1146 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1148 * src/WorkArea.C (work_area_handler): more work to get te
1149 FL_KEYBOARD to work with xforms 0.88 too, please test.
1151 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1153 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1155 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1158 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1160 * src/Timeout.h: remove Qt::emit hack.
1162 * several files: changes to allo doc++ compilation
1164 * src/lyxfunc.C (processKeySym): new method
1165 (processKeyEvent): comment out if FL_REVISION < 89
1167 * src/WorkArea.C: change some debugging levels.
1168 (WorkArea): set wantkey to FL_KEY_ALL
1169 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1170 clearer code and the use of compose with XForms 0.89. Change to
1171 use signals instead of calling methods in bufferview directly.
1173 * src/Painter.C: change some debugging levels.
1175 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1178 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1179 (workAreaKeyPress): new method
1181 2000-08-14 Juergen Vigna <jug@sad.it>
1183 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1185 * config/kde.m4: addes some features
1187 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1188 include missing xforms dialogs.
1190 * src/Timeout.h: a hack to be able to compile with qt/kde.
1192 * sigc++/.cvsignore: added acinclude.m4
1194 * lib/.cvsignore: added listerros
1196 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1197 xforms tree as objects are needed for other frontends.
1199 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1200 linking with not yet implemented xforms objects.
1202 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1204 2000-08-14 Baruch Even <baruch.even@writeme.com>
1206 * src/frontends/xforms/FormGraphics.h:
1207 * src/frontends/xforms/FormGraphics.C:
1208 * src/frontends/xforms/RadioButtonGroup.h:
1209 * src/frontends/xforms/RadioButtonGroup.C:
1210 * src/insets/insetgraphics.h:
1211 * src/insets/insetgraphics.C:
1212 * src/insets/insetgraphicsParams.h:
1213 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1214 instead of spaces, and various other indentation issues to make the
1215 sources more consistent.
1217 2000-08-14 Marko Vendelin <markov@ioc.ee>
1219 * src/frontends/gnome/dialogs/diaprint.glade
1220 * src/frontends/gnome/FormPrint.C
1221 * src/frontends/gnome/FormPrint.h
1222 * src/frontends/gnome/diaprint_callbacks.c
1223 * src/frontends/gnome/diaprint_callbacks.h
1224 * src/frontends/gnome/diaprint_interface.c
1225 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1228 * src/frontends/gnome/dialogs/diainserturl.glade
1229 * src/frontends/gnome/FormUrl.C
1230 * src/frontends/gnome/FormUrl.h
1231 * src/frontends/gnome/diainserturl_callbacks.c
1232 * src/frontends/gnome/diainserturl_callbacks.h
1233 * src/frontends/gnome/diainserturl_interface.c
1234 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1235 Gnome implementation
1237 * src/frontends/gnome/Dialogs.C
1238 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1239 all other dialogs. Copy all unimplemented dialogs from Xforms
1242 * src/frontends/gnome/support.c
1243 * src/frontends/gnome/support.h: support files generated by Glade
1247 * config/gnome.m4: Gnome configuration scripts
1249 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1250 configure --help message
1252 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1253 only if there are no events pendling in Gnome/Gtk. This enhances
1254 the performance of menus.
1257 2000-08-14 Allan Rae <rae@lyx.org>
1259 * lib/Makefile.am: listerrors cleaning
1261 * lib/listerrors: removed -- generated file
1262 * acinclude.m4: ditto
1263 * sigc++/acinclude.m4: ditto
1265 * src/frontends/xforms/forms/form_citation.fd:
1266 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1269 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1270 `updatesrc` and now we have a `test` target that does what `updatesrc`
1271 used to do. I didn't like having an install target that wasn't related
1274 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1275 on all except FormGraphics. This may yet happen. Followed by a major
1276 cleanup including using FL_TRANSIENT for most of the dialogs. More
1277 changes to come when the ButtonController below is introduced.
1279 * src/frontends/xforms/ButtonController.h: New file for managing up to
1280 four buttons on a dialog according to an externally defined policy.
1281 * src/frontends/xforms/Makefile.am: added above
1283 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1284 Apply and Cancel/Close buttons and everything in between and beyond.
1285 * src/frontends/Makefile.am: added above.
1287 * src/frontends/xforms/forms/form_preferences.fd:
1288 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1289 and removed variable 'status' as a result. Fixed the set_minsize thing.
1290 Use the new screen-font-update after checking screen fonts were changed
1291 Added a "Restore" button to restore the original lyxrc values while
1292 editing. This restores everything not just the last input changed.
1293 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1295 * src/LyXAction.C: screen-font-update added for updating buffers after
1296 screen font settings have been changed.
1297 * src/commandtags.h: ditto
1298 * src/lyxfunc.C: ditto
1300 * forms/lyx.fd: removed screen fonts dialog.
1301 * src/lyx_gui.C: ditto
1302 * src/menus.[Ch]: ditto
1303 * src/lyx.[Ch]: ditto
1304 * src/lyx_cb.C: ditto + code from here moved to make
1305 screen-font-update. And people wonder why progress on GUII is
1306 slow. Look at how scattered this stuff was! It takes forever
1309 * forms/fdfix.sh: Fixup the spacing after commas.
1310 * forms/makefile: Remove date from generated files. Fewer clashes now.
1311 * forms/bullet_forms.C.patch: included someones handwritten changes
1313 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1314 once I've discovered why LyXRC was made noncopyable.
1315 * src/lyx_main.C: ditto
1317 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1319 * src/frontends/xforms/forms/fdfix.sh:
1320 * src/frontends/xforms/forms/fdfixh.sed:
1321 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1322 * src/frontends/xforms/Form*.[hC]:
1323 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1324 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1325 provide a destructor for the struct FD_form_xxxx. Another version of
1326 the set_[max|min]size workaround and a few other cleanups. Actually,
1327 Angus' patch from 20000809.
1329 2000-08-13 Baruch Even <baruch.even@writeme.com>
1331 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1334 2000-08-11 Juergen Vigna <jug@sad.it>
1336 * src/insets/insetgraphics.C (InsetGraphics): changing init
1337 order because of warnings.
1339 * src/frontends/xforms/forms/makefile: adding patching .C with
1342 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1343 from .C.patch to .c.patch
1345 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1346 order because of warning.
1348 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1350 * src/frontends/Liason.C (setMinibuffer): new helper function
1352 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1354 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1356 * lib/ui/default.ui: commented out PaperLayout entry
1358 * src/frontends/xforms/form_document.[Ch]: new added files
1360 * src/frontends/xforms/FormDocument.[Ch]: ditto
1362 * src/frontends/xforms/forms/form_document.fd: ditto
1364 * src/frontends/xforms/forms/form_document.C.patch: ditto
1366 2000-08-10 Juergen Vigna <jug@sad.it>
1368 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1369 (InsetGraphics): initialized cacheHandle to 0.
1370 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1372 2000-08-10 Baruch Even <baruch.even@writeme.com>
1374 * src/graphics/GraphicsCache.h:
1375 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1376 correctly as a cache.
1378 * src/graphics/GraphicsCacheItem.h:
1379 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1382 * src/graphics/GraphicsCacheItem_pimpl.h:
1383 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1386 * src/insets/insetgraphics.h:
1387 * src/insets/insetgraphics.C: Changed from using a signal notification
1388 to polling when image is not loaded.
1390 2000-08-10 Allan Rae <rae@lyx.org>
1392 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1393 that there are two functions that have to been taken out of line by
1394 hand and aren't taken care of in the script. (Just a reminder note)
1396 * sigc++/macros/*.h.m4: Updated as above.
1398 2000-08-09 Juergen Vigna <jug@sad.it>
1400 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1402 * src/insets/insettabular.C: make drawing of single cell smarter.
1404 2000-08-09 Marko Vendelin <markov@ioc.ee>
1405 * src/frontends/gnome/Menubar_pimpl.C
1406 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1407 implementation: new files
1409 * src/frontends/gnome/mainapp.C
1410 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1413 * src/main.C: create Gnome main window
1415 * src/frontends/xforms/Menubar_pimpl.h
1416 * src/frontends/Menubar.C
1417 * src/frontends/Menubar.h: added method Menubar::update that calls
1418 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1420 * src/LyXView.C: calls Menubar::update to update the state
1423 * src/frontends/gnome/Makefile.am: added new files
1425 * src/frontends/Makefile.am: added frontend compiler options
1427 2000-08-08 Juergen Vigna <jug@sad.it>
1429 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1431 * src/bufferlist.C (close):
1432 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1433 documents if exiting without saving.
1435 * src/buffer.C (save): use removeAutosaveFile()
1437 * src/support/filetools.C (removeAutosaveFile): new function.
1439 * src/lyx_cb.C (MenuWrite): returns a bool now.
1440 (MenuWriteAs): check if file could really be saved and revert to the
1442 (MenuWriteAs): removing old autosavefile if existant.
1444 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1445 before Goto toggle declaration, because of compiler warning.
1447 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1449 * src/lyxfunc.C (MenuNew): small fix.
1451 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1453 * src/bufferlist.C (newFile):
1454 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1456 * src/lyxrc.C: added new_ask_filename tag
1458 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1460 * src/lyx.fd: removed code pertaining to form_ref
1461 * src/lyx.[Ch]: ditto
1462 * src/lyx_cb.C: ditto
1463 * src/lyx_gui.C: ditto
1464 * src/lyx_gui_misc.C: ditto
1466 * src/BufferView_pimpl.C (restorePosition): update buffer only
1469 * src/commandtags.h (LFUN_REFTOGGLE): removed
1470 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1471 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1472 (LFUN_REFBACK): renamed LFUN_REF_BACK
1474 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1475 * src/menus.C: ditto
1476 * src/lyxfunc.C (Dispatch): ditto.
1477 InsertRef dialog is now GUI-independent.
1479 * src/texrow.C: added using std::endl;
1481 * src/insets/insetref.[Ch]: strip out large amounts of code.
1482 The inset is now a container and this functionality is now
1483 managed by a new FormRef dialog
1485 * src/frontends/Dialogs.h (showRef, createRef): new signals
1487 * src/frontends/xforms/FormIndex.[Ch],
1488 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1489 when setting dialog's min/max size
1490 * src/frontends/xforms/FormIndex.[Ch]: ditto
1492 * src/frontends/xforms/FormRef.[Ch],
1493 src/frontends/xforms/forms/form_ref.fd: new xforms
1494 implementation of an InsetRef dialog
1496 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1499 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1500 ios::nocreate is not part of the standard. Removed.
1502 2000-08-07 Baruch Even <baruch.even@writeme.com>
1504 * src/graphics/Renderer.h:
1505 * src/graphics/Renderer.C: Added base class for rendering of different
1506 image formats into Pixmaps.
1508 * src/graphics/XPM_Renderer.h:
1509 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1510 in a different class.
1512 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1513 easily add support for other formats.
1515 * src/insets/figinset.C: plugged a leak of an X resource.
1517 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1519 * src/CutAndPaste.[Ch]: make all metods static.
1521 * development/Code_rules/Rules: more work, added section on
1522 Exceptions, and a References section.
1524 * a lot of header files: work to make doc++ able to generate the
1525 source documentation, some workarounds of doc++ problems. Doc++ is
1526 now able to generate the documentation.
1528 2000-08-07 Juergen Vigna <jug@sad.it>
1530 * src/insets/insettabular.C (recomputeTextInsets): removed function
1532 * src/tabular.C (SetWidthOfMulticolCell):
1534 (calculate_width_of_column_NMC): fixed return value so that it really
1535 only returns true if the column-width has changed (there where
1536 problems with muliticolumn-cells in this column).
1538 2000-08-04 Juergen Vigna <jug@sad.it>
1540 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1541 also on the scrollstatus of the inset.
1542 (workAreaMotionNotify): ditto.
1544 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1546 2000-08-01 Juergen Vigna <jug@sad.it>
1548 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1550 * src/commandtags.h:
1551 * src/LyXAction.C (init):
1552 * src/insets/inset.C (LocalDispatch): added support for
1555 * src/insets/inset.C (scroll): new functions.
1557 * src/insets/insettext.C (removeNewlines): new function.
1558 (SetAutoBreakRows): removes forced newlines in the text of the
1559 paragraph if autoBreakRows is set to false.
1561 * src/tabular.C (Latex): generates a parbox around the cell contents
1564 * src/frontends/xforms/FormTabular.C (local_update): removed
1565 the radio_useparbox button.
1567 * src/tabular.C (UseParbox): new function
1569 2000-08-06 Baruch Even <baruch.even@writeme.com>
1571 * src/graphics/GraphicsCache.h:
1572 * src/graphics/GraphicsCache.C:
1573 * src/graphics/GraphicsCacheItem.h:
1574 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1577 * src/insets/insetgraphics.h:
1578 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1579 drawing of the inline image.
1581 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1582 into the wrong position.
1584 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1587 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1589 * src/support/translator.h: move all typedefs to public section
1591 * src/support/filetools.C (MakeLatexName): return string const
1593 (TmpFileName): ditto
1594 (FileOpenSearch): ditto
1596 (LibFileSearch): ditto
1597 (i18nLibFileSearch): ditto
1600 (CreateTmpDir): ditto
1601 (CreateBufferTmpDir): ditto
1602 (CreateLyXTmpDir): ditto
1605 (MakeAbsPath): ditto
1607 (OnlyFilename): ditto
1609 (NormalizePath): ditto
1610 (CleanupPath): ditto
1611 (GetFileContents): ditto
1612 (ReplaceEnvironmentPath): ditto
1613 (MakeRelPath): ditto
1615 (ChangeExtension): ditto
1616 (MakeDisplayPath): ditto
1617 (do_popen): return cmdret const
1618 (findtexfile): return string const
1620 * src/support/DebugStream.h: add some /// to please doc++
1622 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1624 * src/texrow.C (same_rownumber): functor to use with find_if
1625 (getIdFromRow): rewritten to use find_if and to not update the
1626 positions. return true if row is found
1627 (increasePos): new method, use to update positions
1629 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1631 * src/lyxlex_pimpl.C (verifyTable): new method
1634 (GetString): return string const
1635 (pushTable): rewrite to use std::stack
1637 (setFile): better check
1640 * src/lyxlex.h: make LyXLex noncopyable
1642 * src/lyxlex.C (text): return char const * const
1643 (GetString): return string const
1644 (getLongString): return string const
1646 * src/lyx_gui_misc.C (askForText): return pair<...> const
1648 * src/lastfiles.[Ch] (operator): return string const
1650 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1651 istringstream not char const *.
1652 move token.end() out of loop.
1653 (readFile): move initializaton of token
1655 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1656 getIdFromRow is successful.
1658 * lib/bind/emacs.bind: don't include menus bind
1660 * development/Code_rules/Rules: the beginnings of making this
1661 better and covering more of the unwritten rules that we have.
1663 * development/Code_rules/Recommendations: a couple of wording
1666 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1668 * src/support/strerror.c: remove C++ comment.
1670 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1672 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1673 LFUN_INDEX_INSERT_LAST
1675 * src/texrow.C (getIdFromRow): changed from const_iterator to
1676 iterator, allowing code to compile with DEC cxx
1678 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1679 stores part of the class, as suggested by Allan. Will allow
1681 (apply): test to apply uses InsetCommandParams operator!=
1683 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1684 (apply): test to apply uses InsetCommandParams operator!=
1686 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1687 stores part of the class.
1688 (update): removed limits on min/max size.
1690 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1691 (apply): test to apply uses InsetCommandParams operator!=
1693 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1694 (Read, Write, scanCommand, getCommand): moved functionality
1695 into InsetCommandParams.
1697 (getScreenLabel): made pure virtual
1698 new InsetCommandParams operators== and !=
1700 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1701 c-tors based on InsetCommandParams. Removed others.
1702 * src/insets/insetinclude.[Ch]: ditto
1703 * src/insets/insetlabel.[Ch]: ditto
1704 * src/insets/insetparent.[Ch]: ditto
1705 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1707 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1708 insets derived from InsetCommand created using similar c-tors
1709 based on InsetCommandParams
1710 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1711 * src/menus.C (ShowRefsMenu): ditto
1712 * src/paragraph.C (Clone): ditto
1713 * src/text2.C (SetCounter): ditto
1714 * src/lyxfunc.C (Dispatch) ditto
1715 Also recreated old InsetIndex behaviour exactly. Can now
1716 index-insert at the start of a paragraph and index-insert-last
1717 without launching the pop-up.
1719 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1721 * lib/lyxrc.example: mark te pdf options as non functional.
1723 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1724 (isStrDbl): move tmpstr.end() out of loop.
1725 (strToDbl): move intialization of tmpstr
1726 (lowercase): return string const and move tmp.end() out of loop.
1727 (uppercase): return string const and move tmp.edn() out of loop.
1728 (prefixIs): add assertion
1733 (containsOnly): ditto
1734 (containsOnly): ditto
1735 (containsOnly): ditto
1736 (countChar): make last arg char not char const
1737 (token): return string const
1738 (subst): return string const, move tmp.end() out of loop.
1739 (subst): return string const, add assertion
1740 (strip): return string const
1741 (frontStrip): return string const, add assertion
1742 (frontStrip): return string const
1747 * src/support/lstrings.C: add inclde "LAssert.h"
1748 (isStrInt): move tmpstr.end() out of loop.
1750 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1751 toollist.end() out of loop.
1752 (deactivate): move toollist.end() out of loop.
1753 (update): move toollist.end() out of loop.
1754 (updateLayoutList): move tc.end() out of loop.
1755 (add): move toollist.end() out of loop.
1757 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1758 md.end() out of loop.
1760 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1762 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1765 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1766 (Erase): move insetlist.end() out of loop.
1768 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1769 ref to const string as first arg. Move initialization of some
1770 variables, whitespace changes.
1772 * src/kbmap.C (defkey): move table.end() out of loop.
1773 (kb_keymap): move table.end() out of loop.
1774 (findbinding): move table.end() out of loop.
1776 * src/MenuBackend.C (hasMenu): move end() out of loop.
1777 (getMenu): move end() out of loop.
1778 (getMenu): move menulist_.end() out of loop.
1780 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1782 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1785 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1786 (getFromLyXName): move infotab.end() out of loop.
1788 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1789 -fvtable-thunks -ffunction-sections -fdata-sections
1791 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1793 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1796 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1798 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1800 * src/frontends/xforms/FormCitation.[Ch],
1801 src/frontends/xforms/FormIndex.[Ch],
1802 src/frontends/xforms/FormToc.[Ch],
1803 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1805 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1807 * src/commandtags.h: renamed, created some flags for citation
1810 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1812 * src/lyxfunc.C (dispatch): use signals to insert index entry
1814 * src/frontends/Dialogs.h: new signal createIndex
1816 * src/frontends/xforms/FormCommand.[Ch],
1817 src/frontends/xforms/FormCitation.[Ch],
1818 src/frontends/xforms/FormToc.[Ch],
1819 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1821 * src/insets/insetindex.[Ch]: GUI-independent
1823 * src/frontends/xforms/FormIndex.[Ch],
1824 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1827 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1829 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1830 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1832 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1834 * src/insets/insetref.C (Latex): rewrite so that there is now
1835 question that a initialization is requested.
1837 * src/insets/insetcommand.h: reenable the hide signal
1839 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1841 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1842 fix handling of shortcuts (many bugs :)
1843 (add_lastfiles): ditto.
1845 * lib/ui/default.ui: fix a few shortcuts.
1847 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1849 * Makefile.am: Fix ``rpmdist'' target to return the exit
1850 status of the ``rpm'' command, instead of the last command in
1851 the chain (the ``rm lyx.xpm'' command, which always returns
1854 2000-08-02 Allan Rae <rae@lyx.org>
1856 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1857 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1858 * src/frontends/xforms/FormToc.C (FormToc): ditto
1860 * src/frontends/xforms/Makefile.am: A few forgotten files
1862 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1863 Signals-not-copyable-problem Lars' started commenting out.
1865 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1867 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1869 * src/insets/insetcommand.h: Signals is not copyable so anoter
1870 scheme for automatic hiding of forms must be used.
1872 * src/frontends/xforms/FormCitation.h: don't inerit from
1873 noncopyable, FormCommand already does that.
1874 * src/frontends/xforms/FormToc.h: ditto
1875 * src/frontends/xforms/FormUrl.h: ditto
1877 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1879 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1881 * src/insets/insetcommand.h (hide): new SigC::Signal0
1882 (d-tor) new virtual destructor emits hide signal
1884 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1885 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1887 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1888 LOF and LOT. Inset is now GUI-independent
1890 * src/insets/insetloa.[Ch]: redundant
1891 * src/insets/insetlof.[Ch]: ditto
1892 * src/insets/insetlot.[Ch]: ditto
1894 * src/frontends/xforms/forms/form_url.fd: tweaked!
1895 * src/frontends/xforms/forms/form_citation.fd: ditto
1897 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1898 dialogs dealing with InsetCommand insets
1900 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1901 FormCommand base class
1902 * src/frontends/xforms/FormUrl.[Ch]: ditto
1904 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1906 * src/frontends/xforms/FormToc.[Ch]: ditto
1908 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1909 passed a generic InsetCommand pointer
1910 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1912 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1913 and modified InsetTOC class
1914 * src/buffer.C: ditto
1916 * forms/lyx.fd: strip out old FD_form_toc code
1917 * src/lyx_gui_misc.C: ditto
1918 * src/lyx_gui.C: ditto
1919 * src/lyx_cb.C: ditto
1920 * src/lyx.[Ch]: ditto
1922 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1924 * src/support/utility.hpp: tr -d '\r'
1926 2000-08-01 Juergen Vigna <jug@sad.it>
1928 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1930 * src/commandtags.h:
1931 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1932 LFUN_TABULAR_FEATURES.
1934 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1935 LFUN_LAYOUT_TABULAR.
1937 * src/insets/insettabular.C (getStatus): implemented helper function.
1939 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1941 2000-07-31 Juergen Vigna <jug@sad.it>
1943 * src/text.C (draw): fixed screen update problem for text-insets.
1945 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1946 something changed probably this has to be added in various other
1949 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1951 2000-07-31 Baruch Even <baruch.even@writeme.com>
1953 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1954 templates to satisfy compaq cxx.
1957 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1959 * src/support/translator.h (equal_1st_in_pair::operator()): take
1960 const ref pair_type as arg.
1961 (equal_2nd_in_pair::operator()): ditto
1962 (Translator::~Translator): remove empty d-tor.
1964 * src/graphics/GraphicsCache.C: move include config.h to top, also
1965 put initialization of GraphicsCache::singleton here.
1966 (~GraphicsCache): move here
1967 (addFile): take const ref as arg
1970 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1972 * src/BufferView2.C (insertLyXFile): change te with/without header
1975 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1977 * src/frontends/xforms/FormGraphics.C (apply): add some
1978 static_cast. Not very nice, but required by compaq cxx.
1980 * src/frontends/xforms/RadioButtonGroup.h: include header
1981 <utility> instead of <pair.h>
1983 * src/insets/insetgraphicsParams.C: add using directive.
1984 (readResize): change return type to void.
1985 (readOrigin): ditto.
1987 * src/lyxfunc.C (getStatus): add missing break for build-program
1988 function; add test for Literate for export functions.
1990 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1991 entries in Options menu.
1993 2000-07-31 Baruch Even <baruch.even@writeme.com>
1995 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1996 protect against auto-allocation; release icon when needed.
1998 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2000 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2001 on usual typewriter.
2003 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2004 earlier czech.kmap), useful only for programming.
2006 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2008 * src/frontends/xforms/FormCitation.h: fix conditioning around
2011 2000-07-31 Juergen Vigna <jug@sad.it>
2013 * src/frontends/xforms/FormTabular.C (local_update): changed
2014 radio_linebreaks to radio_useparbox and added radio_useminipage.
2016 * src/tabular.C: made support for using minipages/parboxes.
2018 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2020 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2022 (descent): so the cursor is in the middle.
2023 (width): bit smaller box.
2025 * src/insets/insetgraphics.h: added display() function.
2027 2000-07-31 Baruch Even <baruch.even@writeme.com>
2029 * src/frontends/Dialogs.h: Added showGraphics signals.
2031 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2032 xforms form definition of the graphics dialog.
2034 * src/frontends/xforms/FormGraphics.h:
2035 * src/frontends/xforms/FormGraphics.C: Added files, the
2036 GUIndependent code of InsetGraphics
2038 * src/insets/insetgraphics.h:
2039 * src/insets/insetgraphics.C: Major writing to make it work.
2041 * src/insets/insetgraphicsParams.h:
2042 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2043 struct between InsetGraphics and GUI.
2045 * src/LaTeXFeatures.h:
2046 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2047 support for graphicx package.
2049 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2050 for the graphics inset.
2052 * src/support/translator.h: Added file, used in
2053 InsetGraphicsParams. this is a template to translate between two
2056 * src/frontends/xforms/RadioButtonGroup.h:
2057 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2058 way to easily control a radio button group.
2060 2000-07-28 Juergen Vigna <jug@sad.it>
2062 * src/insets/insettabular.C (LocalDispatch):
2063 (TabularFeatures): added support for lyx-functions of tabular features.
2064 (cellstart): refixed this function after someone wrongly changed it.
2066 * src/commandtags.h:
2067 * src/LyXAction.C (init): added support for tabular-features
2069 2000-07-28 Allan Rae <rae@lyx.org>
2071 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2072 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2073 triggers the callback for input checking. As a result we sometimes get
2074 "LyX: This shouldn't happen..." printed to cerr.
2075 (input): Started using status variable since I only free() on
2076 destruction. Some input checking for paths and font sizes.
2078 * src/frontends/xforms/FormPreferences.h: Use status to control
2079 activation of Ok and Apply
2081 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2082 callback. Also resized to stop segfaults with 0.88. The problem is
2083 that xforms-0.88 requires the folder to be wide enough to fit all the
2084 tabs. If it isn't it causes all sorts of problems.
2086 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2088 * src/frontends/xforms/forms/README: Reflect reality.
2090 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2091 * src/frontends/xforms/forms/makefile: ditto.
2093 * src/commandtags.h: Get access to new Preferences dialog
2094 * src/LyXAction.C: ditto
2095 * src/lyxfunc.C: ditto
2096 * lib/ui/default.ui: ditto
2098 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2100 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2102 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2105 * src/frontends/xforms/form_url.[Ch]: added.
2107 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2109 * src/insets/insetbib.h: fixed bug in previous commit
2111 * src/frontends/xforms/FormUrl.h: ditto
2113 * src/frontends/xforms/FormPrint.h: ditto
2115 * src/frontends/xforms/FormPreferences.h: ditto
2117 * src/frontends/xforms/FormCopyright.h: ditto
2119 * src/frontends/xforms/FormCitation.C: ditto
2121 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2122 private copyconstructor and private default contructor
2124 * src/support/Makefile.am: add utility.hpp
2126 * src/support/utility.hpp: new file from boost
2128 * src/insets/insetbib.h: set owner in clone
2130 * src/frontends/xforms/FormCitation.C: added missing include
2133 * src/insets/form_url.[Ch]: removed
2135 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2137 * development/lyx.spec.in
2138 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2139 file/directory re-organization.
2141 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2143 * src/insets/insetcommand.[Ch]: moved the string data and
2144 associated manipulation methods into a new stand-alone class
2145 InsetCommandParams. This class has two additional methods
2146 getAsString() and setFromString() allowing the contents to be
2147 moved around as a single string.
2148 (addContents) method removed.
2149 (setContents) method no longer virtual.
2151 * src/buffer.C (readInset): made use of new InsetCitation,
2152 InsetUrl constructors based on InsetCommandParams.
2154 * src/commandtags.h: add LFUN_INSERT_URL
2156 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2157 independent InsetUrl and use InsetCommandParams to extract
2158 string info and create new Insets.
2160 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2162 * src/frontends/xforms/FormCitation.C (apply): uses
2165 * src/frontends/xforms/form_url.C
2166 * src/frontends/xforms/form_url.h
2167 * src/frontends/xforms/FormUrl.h
2168 * src/frontends/xforms/FormUrl.C
2169 * src/frontends/xforms/forms/form_url.fd: new files
2171 * src/insets/insetcite.[Ch]: removed unused constructors.
2173 * src/insets/insetinclude.[Ch]: no longer store filename
2175 * src/insets/inseturl.[Ch]: GUI-independent.
2177 2000-07-26 Juergen Vigna <jug@sad.it>
2178 * renamed frontend from gtk to gnome as it is that what is realized
2179 and did the necessary changes in the files.
2181 2000-07-26 Marko Vendelin <markov@ioc.ee>
2183 * configure.in: cleaning up gnome configuration scripts
2185 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2187 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2188 shortcuts syndrom by redrawing them explicitely (a better solution
2189 would be appreciated).
2191 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2193 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2196 * src/lyx_cb.C (MenuExport): change html export to do the right
2197 thing depending of the document type (instead of having
2198 html-linuxdoc and html-docbook).
2199 * src/lyxfunc.C (getStatus): update for html
2200 * lib/ui/default.ui: simplify due to the above change.
2201 * src/menus.C (ShowFileMenu): update too (in case we need it).
2203 * src/MenuBackend.C (read): if a menu is defined twice, add the
2204 new entries to the exiting one.
2206 2000-07-26 Juergen Vigna <jug@sad.it>
2208 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2210 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2211 and return a bool if it did actual save the file.
2212 (AutoSave): don't autosave a unnamed doc.
2214 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2215 check if this is an UNNAMED new file and react to it.
2216 (newFile): set buffer to unnamed and change to not mark a new
2217 buffer dirty if I didn't do anything with it.
2219 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2221 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2223 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2224 friend as per Angus's patch posted to lyx-devel.
2226 * src/ext_l10n.h: updated
2228 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2229 gettext on the style string right before inserting them into the
2232 * autogen.sh: add code to extract style strings form layout files,
2233 not good enough yet.
2235 * src/frontends/gtk/.cvsignore: add MAKEFILE
2237 * src/MenuBackend.C (read): run the label strings through gettext
2238 before storing them in the containers.
2240 * src/ext_l10n.h: new file
2242 * autogen.sh : generate the ext_l10n.h file here
2244 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2246 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2249 * lib/ui/default.ui: fix a couple of typos.
2251 * config/gnome/gtk.m4: added (and added to the list of files in
2254 * src/insets/insetinclude.C (unique_id): fix when we are using
2255 lyxstring instead of basic_string<>.
2256 * src/insets/insettext.C (LocalDispatch): ditto.
2257 * src/support/filetools.C: ditto.
2259 * lib/configure.m4: create the ui/ directory if necessary.
2261 * src/LyXView.[Ch] (updateToolbar): new method.
2263 * src/BufferView_pimpl.C (buffer): update the toolbar when
2264 opening/closing buffer.
2266 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2268 * src/LyXAction.C (getActionName): enhance to return also the name
2269 and options of pseudo-actions.
2270 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2272 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2273 as an example of what is possible). Used in File->Build too (more
2274 useful) and in the import/export menus (to mimick the complicated
2275 handling of linuxdoc and friends). Try to update all the entries.
2277 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2280 * src/MenuBackend.C (read): Parse the new OptItem tag.
2282 * src/MenuBackend.h: Add a new optional_ data member (used if the
2283 entry should be omitted when the lyxfunc is disabled).
2285 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2286 function, used as a shortcut.
2287 (create_submenu): align correctly the shortcuts on the widest
2290 * src/MenuBackend.h: MenuItem.label() only returns the label of
2291 the menu without shortcut; new method shortcut().
2293 2000-07-14 Marko Vendelin <markov@ioc.ee>
2295 * src/frontends/gtk/Dialogs.C:
2296 * src/frontends/gtk/FormCopyright.C:
2297 * src/frontends/gtk/FormCopyright.h:
2298 * src/frontends/gtk/Makefile.am: added these source-files for the
2299 Gtk/Gnome support of the Copyright-Dialog.
2301 * src/main.C: added Gnome::Main initialization if using
2302 Gtk/Gnome frontend-GUI.
2304 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2306 * config/gnome/aclocal-include.m4
2307 * config/gnome/compiler-flags.m4
2308 * config/gnome/curses.m4
2309 * config/gnome/gnome--.m4
2310 * config/gnome/gnome-bonobo-check.m4
2311 * config/gnome/gnome-common.m4
2312 * config/gnome/gnome-fileutils.m4
2313 * config/gnome/gnome-ghttp-check.m4
2314 * config/gnome/gnome-gnorba-check.m4
2315 * config/gnome/gnome-guile-checks.m4
2316 * config/gnome/gnome-libgtop-check.m4
2317 * config/gnome/gnome-objc-checks.m4
2318 * config/gnome/gnome-orbit-check.m4
2319 * config/gnome/gnome-print-check.m4
2320 * config/gnome/gnome-pthread-check.m4
2321 * config/gnome/gnome-support.m4
2322 * config/gnome/gnome-undelfs.m4
2323 * config/gnome/gnome-vfs.m4
2324 * config/gnome/gnome-x-checks.m4
2325 * config/gnome/gnome-xml-check.m4
2326 * config/gnome/gnome.m4
2327 * config/gnome/gperf-check.m4
2328 * config/gnome/gtk--.m4
2329 * config/gnome/linger.m4
2330 * config/gnome/need-declaration.m4: added configuration scripts
2331 for Gtk/Gnome frontend-GUI
2333 * configure.in: added support for the --with-frontend=gtk option
2335 * autogen.sh: added config/gnome/* to list of config-files
2337 * acconfig.h: added define for GTKGUI-support
2339 * config/lyxinclude.m4: added --with-frontend[=value] option value
2340 for Gtk/Gnome frontend-GUI support.
2342 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2344 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2348 * src/paragraph.C (GetChar): remove non-const version
2350 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2351 (search_kw): use it.
2353 * src/lyx_main.C (init): if "preferences" exist, read that instead
2355 (ReadRcFile): return bool if the file could be read ok.
2356 (ReadUIFile): add a check to see if lex file is set ok.
2358 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2359 bastring can be used instead of lyxstring (still uses the old code
2360 if std::string is good enough or if lyxstring is used.)
2362 * src/encoding.C: make the arrays static, move ininle functions
2364 * src/encoding.h: from here.
2366 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2367 (parseSingleLyXformat2Token): move inset parsing to separate method
2368 (readInset): new private method
2370 * src/Variables.h: remove virtual from get().
2372 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2373 access to NEW_INSETS and NEW_TABULAR
2375 * src/MenuBackend.h: remove superfluous forward declaration of
2376 MenuItem. Add documentations tags "///", remove empty MenuItem
2377 destructor, remove private default contructor.
2379 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2381 (read): more string mlabel and mname to where they are used
2382 (read): remove unused variables mlabel and mname
2383 (defaults): unconditional clear, make menusetup take advantage of
2384 add returning Menu &.
2386 * src/LyXView.h: define NEW_MENUBAR as default
2388 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2389 to NEW_INSETS and NEW_TABULAR.
2390 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2391 defined. Change some of the "xxxx-inset-insert" functions names to
2394 * several files: more enahncements to NEW_INSETS and the resulting
2397 * lib/lyxrc.example (\date_insert_format): move to misc section
2399 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2400 bastring and use AC_CACHE_CHECK.
2401 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2402 the system have the newest methods. uses AC_CACHE_CHECK
2403 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2404 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2405 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2407 * configure.in: add LYX_CXX_GOOD_STD_STRING
2409 * acinclude.m4: recreated
2411 2000-07-24 Amir Karger
2413 * README: add Hebrew, Arabic kmaps
2416 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2418 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2421 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2423 * Lot of files: add pragma interface/implementation.
2425 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2427 * lib/ui/default.ui: new file (ans new directory). Contains the
2428 default menu and toolbar.
2430 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2431 global space. Toolbars are now read (as menus) in ui files.
2433 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2435 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2436 is disabled because the document is read-only. We want to have the
2437 toggle state of the function anyway.
2438 (getStatus): add code for LFUN_VC* functions (mimicking what is
2439 done in old-style menus)
2441 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2442 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2444 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2445 * src/BufferView_pimpl.C: ditto.
2446 * src/lyxfunc.C: ditto.
2448 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2449 default). This replaces old-style menus by new ones.
2451 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2452 MenuItem. Contain the data structure of a menu.
2454 * src/insets/insettext.C: use LyXView::setLayout instead of
2455 accessing directly the toolbar combox.
2456 * src/lyxfunc.C (Dispatch): ditto.
2458 * src/LyXView.C (setLayout): new method, which just calls
2459 Toolbar::setLayout().
2460 (updateLayoutChoice): move part of this method in Toolbar.
2462 * src/toolbar.[Ch]: removed.
2464 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2465 implementation the toolbar.
2467 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2468 the toolbar. It might make sense to merge it with ToolbarDefaults
2470 (setLayout): new function.
2471 (updateLayoutList): ditto.
2472 (openLayoutList): ditto.
2474 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2475 xforms implementation of the toolbar.
2476 (get_toolbar_func): comment out, since I do not
2477 know what it is good for.
2479 * src/ToolbarDefaults.h: Add the ItemType enum.
2481 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2482 for a list of allocated C strings. Used in Menubar xforms
2483 implementation to avoid memory leaks.
2485 * src/support/lstrings.[Ch] (uppercase): new version taking and
2489 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2490 * lib/bind/emacs.bind: ditto.
2492 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2494 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2495 forward decl of LyXView.
2497 * src/toolbar.C (toolbarItem): moved from toolbar.h
2498 (toolbarItem::clean): ditto
2499 (toolbarItem::~toolbarItem): ditto
2500 (toolbarItem::operator): ditto
2502 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2504 * src/paragraph.h: control the NEW_TABULAR define from here
2506 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2507 USE_TABULAR_INSETS to NEW_TABULAR
2509 * src/ToolbarDefaults.C: add include "lyxlex.h"
2511 * files using the old table/tabular: use NEW_TABULAR to control
2512 compilation of old tabular stuff.
2514 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2517 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2518 planemet in reading of old style floats, fix the \end_deeper
2519 problem when reading old style floats.
2521 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2523 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2525 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2527 * lib/bind/sciword.bind: updated.
2529 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2531 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2532 layout write problem
2534 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2536 * src/Makefile.am (INCLUDES): remove image directory from include
2539 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2540 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2542 * src/LyXView.C (create_form_form_main): read the application icon
2545 * lib/images/*.xpm: change the icons to use transparent color for
2548 * src/toolbar.C (update): change the color of the button when it
2551 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2553 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2554 setting explicitely the minibuffer.
2555 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2557 * src/LyXView.C (showState): new function. Shows font information
2558 in minibuffer and update toolbar state.
2559 (LyXView): call Toolbar::update after creating the
2562 * src/toolbar.C: change toollist to be a vector instead of a
2564 (BubbleTimerCB): get help string directly from the callback
2565 argument of the corresponding icon (which is the action)
2566 (set): remove unnecessary ugliness.
2567 (update): new function. update the icons (depressed, disabled)
2568 depending of the status of the corresponding action.
2570 * src/toolbar.h: remove help in toolbarItem
2572 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2574 * src/Painter.C (text): Added code for using symbol glyphs from
2575 iso10646 fonts. Currently diabled.
2577 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2580 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2581 magyar,turkish and usorbian.
2583 * src/paragraph.C (isMultiLingual): Made more efficient.
2585 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2588 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2589 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2590 Also changed the prototype to "bool math_insert_greek(char)".
2592 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2594 * lots of files: apply the NEW_INSETS on all code that will not be
2595 needed when we move to use the new insets. Enable the define in
2596 lyxparagrah.h to try it.
2598 * src/insets/insettabular.C (cellstart): change to be a static
2600 (InsetTabular): initialize buffer in the initializer list.
2602 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2604 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2605 form_print.h out of the header file. Replaced with forward
2606 declarations of the relevant struct.
2608 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2611 * src/commandtags.h: do not include "debug.h" which does not
2612 belong there. #include it in some other places because of this
2615 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2617 * src/insets/insetcaption.C: add a couple "using" directives.
2619 * src/toolbar.C (add): get the help text directly from lyxaction.
2621 (setPixmap): new function. Loads from disk and sets a pixmap on a
2622 botton; the name of the pixmap file is derived from the command
2625 * src/toolbar.h: remove members isBitmap and pixmap from
2628 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2629 * lib/images/: move many files from images/banner.xpm.
2631 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2633 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2634 * src/toolbar.C: ditto.
2635 * configure.in: ditto.
2636 * INSTALL: document.
2638 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2639 the spellchecker popup is closed from the WM.
2641 2000-07-19 Juergen Vigna <jug@sad.it>
2643 * src/insets/insetfloat.C (Write): small fix because we use the
2644 insetname for the type now!
2646 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2648 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2651 * src/frontends/Dialogs.h: removed hideCitation signal
2653 * src/insets/insetcite.h: added hide signal
2655 * src/insets/insetcite.C (~InsetCitation): emits new signal
2656 (getScreenLabel): "intelligent" label should now fit on the screen!
2658 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2660 * src/frontends/xforms/FormCitation.C (showInset): connects
2661 hide() to the inset's hide signal
2662 (show): modified to use fl_set_object_position rather than
2663 fl_set_object_geometry wherever possible
2665 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2667 * src/insets/lyxinset.h: add caption code
2669 * src/insets/insetfloat.C (type): new method
2671 * src/insets/insetcaption.C (Write): new method
2673 (LyxCode): new method
2675 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2676 to get it right together with using the FloatList.
2678 * src/commandtags.h: add LFUN_INSET_CAPTION
2679 * src/lyxfunc.C (Dispatch): handle it
2681 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2684 * src/Variables.[Ch]: make expand take a const reference, remove
2685 the destructor, some whitespace changes.
2687 * src/LyXAction.C (init): add caption-inset-insert
2689 * src/FloatList.C (FloatList): update the default floats a bit.
2691 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2693 * src/Variables.[Ch]: new files. Intended to be used for language
2694 specific strings (like \chaptername) and filename substitution in
2697 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2699 * lib/kbd/american.kmap: update
2701 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2703 * src/bufferparams.[Ch]: remove member allowAccents.
2705 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2707 * src/LaTeXLog.C: use the log_form.h header.
2708 * src/lyx_gui.C: ditto.
2709 * src/lyx_gui_misc.C: ditto.
2710 * src/lyxvc.h: ditto.
2712 * forms/log_form.fd: new file, created from latexoptions.fd. I
2713 kept the log popup and nuked the options form.
2715 * src/{la,}texoptions.[Ch]: removed.
2716 * src/lyx_cb.C (LaTeXOptions): ditto
2718 * src/lyx_gui.C (create_forms): do not handle the
2719 fd_latex_options form.
2721 2000-07-18 Juergen Vigna <jug@sad.it>
2723 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2724 name of the inset so that it can be requested outside (text2.C).
2726 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2729 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2731 * src/mathed/formula.h (ConvertFont): constify
2733 * src/mathed/formula.C (Read): add warning if \end_inset is not
2734 found on expected place.
2736 * src/insets/lyxinset.h (ConvertFont): consify
2738 * src/insets/insetquotes.C (ConvertFont): constify
2739 * src/insets/insetquotes.h: ditto
2741 * src/insets/insetinfo.h: add labelfont
2743 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2744 (ascent): use labelfont
2748 (Write): make .lyx file a bit nicer
2750 * src/insets/insetfloat.C (Write): simplify somewhat...
2751 (Read): add warning if arg is not found
2753 * src/insets/insetcollapsable.C: add using std::max
2754 (Read): move string token and add warning in arg is not found
2755 (draw): use std::max to get the right ty
2756 (getMaxWidth): simplify by using std::max
2758 * src/insets/insetsection.h: new file
2759 * src/insets/insetsection.C: new file
2760 * src/insets/insetcaption.h: new file
2761 * src/insets/insetcaption.C: new file
2763 * src/insets/inset.C (ConvertFont): constify signature
2765 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2766 insetcaption.[Ch] and insetsection.[Ch]
2768 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2769 uses to use LABEL_COUNTER_CHAPTER instead.
2770 * src/text2.C (SetCounter): here
2772 * src/counters.h: new file
2773 * src/counters.C: new file
2774 * src/Sectioning.h: new file
2775 * src/Sectioning.C: new file
2777 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2779 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2781 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2784 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2787 2000-07-17 Juergen Vigna <jug@sad.it>
2789 * src/tabular.C (Validate): check if array-package is needed.
2790 (SetVAlignment): added support for vertical alignment.
2791 (SetLTFoot): better support for longtable header/footers
2792 (Latex): modified to support added features.
2794 * src/LaTeXFeatures.[Ch]: added array-package.
2796 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2798 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2801 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2803 * configure.in: do not forget to put a space after -isystem.
2805 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2807 * lib/kbd/arabic.kmap: a few fixes.
2809 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2811 * some whitespace chagnes to a number of files.
2813 * src/support/DebugStream.h: change to make it easier for
2814 doc++ to parse correctly.
2815 * src/support/lyxstring.h: ditto
2817 * src/mathed/math_utils.C (compara): change to have only one
2819 (MathedLookupBOP): change because of the above.
2821 * src/mathed/math_delim.C (math_deco_compare): change to have only
2823 (search_deco): change becasue of the above.
2825 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2826 instead of manually coded one.
2828 * src/insets/insetquotes.C (Read): read the \end_inset too
2830 * src/insets/insetlatex.h: remove file
2831 * src/insets/insetlatex.C: remove file
2833 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2835 (InsetPrintIndex): remove destructor
2837 * src/insets/insetinclude.h: remove default constructor
2839 * src/insets/insetfloat.C: work to make it work better
2841 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2843 * src/insets/insetcite.h (InsetCitation): remove default constructor
2845 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2847 * src/text.C (GetColumnNearX): comment out some currently unused code.
2849 * src/paragraph.C (writeFile): move some initializations closer to
2851 (CutIntoMinibuffer): small change to use new matchIT operator
2855 (InsertInset): ditto
2858 (InsetIterator): ditto
2859 (Erase): small change to use new matchFT operator
2861 (GetFontSettings): ditto
2862 (HighestFontInRange): ditto
2865 * src/lyxparagraph.h: some chars changed to value_type
2866 (matchIT): because of some stronger checking (perhaps too strong)
2867 in SGI STL, the two operator() unified to one.
2870 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2872 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2873 the last inset read added
2874 (parseSingleLyXformat2Token): some more (future) compability code added
2875 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2876 (parseSingleLyXformat2Token): set last_inset_read
2877 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2878 (parseSingleLyXformat2Token): don't double intializw string next_token
2880 * src/TextCache.C (text_fits::operator()): add const's to the signature
2881 (has_buffer::operator()): ditto
2883 * src/Floating.h: add some comments on the class
2885 * src/FloatList.[Ch] (typeExist): new method
2888 * src/BackStack.h: added default constructor, wanted by Gcc.
2890 2000-07-14 Juergen Vigna <jug@sad.it>
2892 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2894 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2896 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2897 do a redraw when the window is resized!
2898 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2900 * src/insets/insettext.C (resizeLyXText): added function to correctly
2901 being able to resize the LyXWindow.
2903 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2905 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2907 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2908 crashes when closing dialog to a deleted inset.
2910 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2911 method! Now similar to other insets.
2913 2000-07-13 Juergen Vigna <jug@sad.it>
2915 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2917 * lib/examples/Literate.lyx: small patch!
2919 * src/insets/insetbib.C (Read): added this function because of wrong
2920 Write (without [begin|end]_inset).
2922 2000-07-11 Juergen Vigna <jug@sad.it>
2924 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2925 as the insertInset could not be good!
2927 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2928 the bool param should not be last.
2930 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2932 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2933 did submit that to Karl).
2935 * configure.in: use -isystem instead of -I for X headers. This
2936 fixes a problem on solaris with a recent gcc;
2937 put the front-end code after the X detection code;
2938 configure in sigc++ before lib/
2940 * src/lyx_main.C (commandLineHelp): remove -display from command
2943 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2945 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2946 Also put in Makefile rules for building the ``listerrors''
2947 program for parsing errors from literate programs written in LyX.
2949 * lib/build-listerrors: Added small shell script as part of compile
2950 process. This builds a working ``listerrors'' binary if noweb is
2951 installed and either 1) the VNC X server is installed on the machine,
2952 or 2) the user is compiling from within a GUI. The existence of a GUI
2953 is necessary to use the ``lyx --export'' feature for now. This
2954 hack can be removed once ``lyx --export'' no longer requires a GUI to
2957 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2959 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2960 now passed back correctly from gcc and placed "under" error
2961 buttons in a Literate LyX source.
2963 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2965 * src/text.C (GetColumnNearX): Better behavior when a RTL
2966 paragraph is ended by LTR text.
2968 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2971 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2973 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2974 true when clipboard is empty.
2976 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2978 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2979 row of the paragraph.
2980 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2981 to prevent calculation of bidi tables
2983 2000-07-07 Juergen Vigna <jug@sad.it>
2985 * src/screen.C (ToggleSelection): added y_offset and x_offset
2988 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2991 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2993 * src/insets/insettext.C: fixed Layout-Display!
2995 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2997 * configure.in: add check for strings.h header.
2999 * src/spellchecker.C: include <strings.h> in order to have a
3000 definition for bzero().
3002 2000-07-07 Juergen Vigna <jug@sad.it>
3004 * src/insets/insettext.C (draw): set the status of the bv->text to
3005 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3007 * src/screen.C (DrawOneRow):
3008 (DrawFromTo): redraw the actual row if something has changed in it
3011 * src/text.C (draw): call an update of the toplevel-inset if something
3012 has changed inside while drawing.
3014 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3016 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3018 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3019 processing inside class.
3021 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3022 processing inside class.
3024 * src/insets/insetindex.h new struct Holder, consistent with other
3027 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3028 citation dialog from main code and placed it in src/frontends/xforms.
3029 Dialog launched through signals instead of callbacks
3031 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3033 * lyx.man: update the options description.
3035 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3037 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3038 handle neg values, set min width to 590, add doc about -display
3040 2000-07-05 Juergen Vigna <jug@sad.it>
3042 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3043 calls to BufferView *.
3045 * src/insets/insettext.C (checkAndActivateInset): small fix non
3046 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3048 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3049 their \end_inset token!
3051 2000-07-04 edscott <edscott@imp.mx>
3053 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3054 lib/lyxrc.example: added option \wheel_jump
3056 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3058 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3059 remove support for -width,-height,-xpos and -ypos.
3061 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3063 * src/encoding.[Ch]: New files.
3065 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3066 (text): Call to the underline() method only when needed.
3068 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3070 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3071 encoding(s) for the document.
3073 * src/bufferparams.C (BufferParams): Changed default value of
3076 * src/language.C (newLang): Removed.
3077 (items[]): Added encoding information for all defined languages.
3079 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3080 encoding choice button.
3082 * src/lyxrc.h (font_norm_type): New member variable.
3083 (set_font_norm_type): New method.
3085 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3086 paragraphs with different encodings.
3088 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3089 (TransformChar): Changed to work correctly with Arabic points.
3090 (draw): Added support for drawing Arabic points.
3091 (draw): Removed code for drawing underbars (this is done by
3094 * src/support/textutils.h (IsPrintableNonspace): New function.
3096 * src/BufferView_pimpl.h: Added "using SigC::Object".
3097 * src/LyXView.h: ditto.
3099 * src/insets/insetinclude.h (include_label): Changed to mutable.
3101 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3103 * src/mathed/math_iter.h: remove empty destructor
3105 * src/mathed/math_cursor.h: remove empty destructor
3107 * src/insets/lyxinset.h: add THEOREM_CODE
3109 * src/insets/insettheorem.[Ch]: new files
3111 * src/insets/insetminipage.C: (InsertInset): remove
3113 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3115 (InsertInset): remove
3117 * src/insets/insetlist.C: (InsertList): remove
3119 * src/insets/insetfootlike.[Ch]: new files
3121 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3124 (InsertInset): ditto
3126 * src/insets/insetert.C: remove include Painter.h, reindent
3127 (InsertInset): move to header
3129 * src/insets/insetcollapsable.h: remove explicit from default
3130 contructor, remove empty destructor, add InsertInset
3132 * src/insets/insetcollapsable.C (InsertInset): new func
3134 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3136 * src/vspace.h: add explicit to constructor
3138 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3139 \textcompwordmark, please test this.
3141 * src/lyxrc.C: set ascii_linelen to 65 by default
3143 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3145 * src/commandtags.h: add LFUN_INSET_THEOREM
3147 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3148 (makeLinuxDocFile): remove _some_ of the nice logic
3149 (makeDocBookFile): ditto
3151 * src/Painter.[Ch]: (~Painter): removed
3153 * src/LyXAction.C (init): entry for insettheorem added
3155 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3157 (deplog): code to detect files generated by LaTeX, needs testing
3160 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3162 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3164 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3166 * src/LaTeX.C (deplog): Add a check for files that are going to be
3167 created by the first latex run, part of the project to remove the
3170 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3171 contents to the extension list.
3173 2000-07-04 Juergen Vigna <jug@sad.it>
3175 * src/text.C (NextBreakPoint): added support for needFullRow()
3177 * src/insets/lyxinset.h: added needFullRow()
3179 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3182 * src/insets/insettext.C: lots of changes for update!
3184 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3186 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3188 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3190 * src/insets/insetinclude.C (InsetInclude): fixed
3191 initialization of include_label.
3192 (unique_id): now returns a string.
3194 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3196 * src/LaTeXFeatures.h: new member IncludedFiles, for
3197 a map of key, included file name.
3199 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3200 with the included files for inclusion in SGML preamble,
3201 i. e., linuxdoc and docbook.
3204 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3205 nice (is the generated linuxdoc code to be exported?), that
3206 allows to remove column, and only_body that will be true for
3207 slave documents. Insets are allowed inside SGML font type.
3208 New handling of the SGML preamble for included files.
3209 (makeDocBookFile): the same for docbook.
3211 * src/insets/insetinclude.h:
3212 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3214 (DocBook): new export methods.
3216 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3217 and makeDocBookFile.
3219 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3220 formats to export with command line argument -x.
3222 2000-06-29 Juergen Vigna <jug@sad.it>
3224 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3225 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3227 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3228 region could already been cleared by an inset!
3230 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3232 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3235 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3237 (cursorToggle): remove special handling of lyx focus.
3239 2000-06-28 Juergen Vigna <jug@sad.it>
3241 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3244 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3246 * src/insets/insetindex.C (Edit): add a callback when popup is
3249 * src/insets/insettext.C (LocalDispatch):
3250 * src/insets/insetmarginal.h:
3251 * src/insets/insetlist.h:
3252 * src/insets/insetfoot.h:
3253 * src/insets/insetfloat.h:
3254 * src/insets/insetert.h: add a missing std:: qualifier.
3256 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3258 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3261 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3263 * src/insets/insettext.C (Read): remove tmptok unused variable
3264 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3265 (InsertInset): change for new InsetInset code
3267 * src/insets/insettext.h: add TEXT inline method
3269 * src/insets/insettext.C: remove TEXT macro
3271 * src/insets/insetmarginal.C (Write): new method
3272 (Latex): change output slightly
3274 * src/insets/insetfoot.C (Write): new method
3275 (Latex): change output slightly (don't use endl when no need)
3277 * src/insets/insetert.C (Write): new method
3279 * src/insets/insetcollapsable.h: make button_length, button_top_y
3280 and button_bottm_y protected.
3282 * src/insets/insetcollapsable.C (Write): simplify code by using
3283 tostr. Also do not output the float name, the children class
3284 should to that to get control over own arguments
3286 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3287 src/insets/insetminipage.[Ch]:
3290 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3292 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3294 * src/Makefile.am (lyx_SOURCES): add the new files
3296 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3297 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3298 * src/commandtags.h: ditto
3300 * src/LaTeXFeatures.h: add a std::set of used floattypes
3302 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3304 * src/FloatList.[Ch] src/Floating.h: new files
3306 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3308 * src/lyx_cb.C (TableApplyCB): ditto
3310 * src/text2.C: ditto
3311 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3312 (parseSingleLyXformat2Token): ditto + add code for
3313 backwards compability for old float styles + add code for new insets
3315 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3317 (InsertInset(size_type, Inset *, LyXFont)): new method
3318 (InsetChar(size_type, char)): changed to use the other InsetChar
3319 with a LyXFont(ALL_INHERIT).
3320 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3321 insert the META_INSET.
3323 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3325 * sigc++/thread.h (Threads): from here
3327 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3328 definition out of line
3329 * sigc++/scope.h: from here
3331 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3333 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3334 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3336 * Makefile.am (bindist): new target.
3338 * INSTALL: add instructions for doing a binary distribution.
3340 * development/tools/README.bin.example: update a bit.
3342 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3345 * lib/lyxrc.example: new lyxrc tag \set_color.
3347 * src/lyxfunc.C (Dispatch):
3348 * src/commandtags.h:
3349 * src/LyXAction.C: new lyxfunc "set-color".
3351 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3352 and an x11name given as strings.
3354 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3355 cache when a color is changed.
3357 2000-06-26 Juergen Vigna <jug@sad.it>
3359 * src/lyxrow.C (width): added this functions and variable.
3361 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3364 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3366 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3368 * images/undo_bw.xpm: new icon.
3369 * images/redo_bw.xpm: ditto.
3371 * configure.in (INSTALL_SCRIPT): change value to
3372 ${INSTALL} to avoid failures of install-script target.
3373 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3375 * src/BufferView.h: add a magic "friend" declaration to please
3378 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3380 * forms/cite.fd: modified to allow resizing without messing
3383 * src/insetcite.C: Uses code from cite.fd almost without
3385 User can now resize dialog in the x-direction.
3386 Resizing the dialog in the y-direction is prevented, as the
3387 code does this intelligently already.
3389 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3391 * INSTALL: remove obsolete entry in "problems" section.
3393 * lib/examples/sl_*.lyx: update of the slovenian examples.
3395 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3397 2000-06-23 Juergen Vigna <jug@sad.it>
3399 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3401 * src/buffer.C (resize): delete the LyXText of textinsets.
3403 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3405 * src/insets/lyxinset.h: added another parameter 'cleared' to
3406 the draw() function.
3408 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3409 unlocking inset in inset.
3411 2000-06-22 Juergen Vigna <jug@sad.it>
3413 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3414 of insets and moved first to LyXText.
3416 * src/mathed/formulamacro.[Ch]:
3417 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3419 2000-06-21 Juergen Vigna <jug@sad.it>
3421 * src/text.C (GetVisibleRow): look if I should clear the area or not
3422 using Inset::doClearArea() function.
3424 * src/insets/lyxinset.h: added doClearArea() function and
3425 modified draw(Painter &, ...) to draw(BufferView *, ...)
3427 * src/text2.C (UpdateInset): return bool insted of int
3429 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3431 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3432 combox in the character popup
3434 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3435 BufferParams const & params
3437 2000-06-20 Juergen Vigna <jug@sad.it>
3439 * src/insets/insettext.C (SetParagraphData): set insetowner on
3442 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3444 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3445 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3447 (form_main_): remove
3449 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3450 (create_form_form_main): remove FD_form_main stuff, connect to
3451 autosave_timeout signal
3453 * src/LyXView.[Ch] (getMainForm): remove
3454 (UpdateTimerCB): remove
3455 * src/BufferView_pimpl.h: inherit from SigC::Object
3457 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3458 signal instead of callback
3460 * src/BufferView.[Ch] (cursorToggleCB): remove
3462 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3464 * src/BufferView_pimpl.C: changes because of the one below
3466 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3467 instead of storing a pointer to a LyXText.
3469 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3471 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3473 * src/lyxparagraph.h
3475 * src/paragraph.C: Changed fontlist to a sorted vector.
3477 2000-06-19 Juergen Vigna <jug@sad.it>
3479 * src/BufferView.h: added screen() function.
3481 * src/insets/insettext.C (LocalDispatch): some selection code
3484 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3486 * src/insets/insettext.C (SetParagraphData):
3488 (InsetText): fixes for multiple paragraphs.
3490 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3492 * development/lyx.spec.in: Call configure with ``--without-warnings''
3493 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3494 This should be fine, however, since we generally don't want to be
3495 verbose when making an RPM.
3497 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3499 * lib/scripts/fig2pstex.py: New file
3501 2000-06-16 Juergen Vigna <jug@sad.it>
3503 * src/insets/insettabular.C (UpdateLocal):
3504 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3505 (LocalDispatch): Changed all functions to use LyXText.
3507 2000-06-15 Juergen Vigna <jug@sad.it>
3509 * src/text.C (SetHeightOfRow): call inset::update before requesting
3512 * src/insets/insettext.C (update):
3513 * src/insets/insettabular.C (update): added implementation
3515 * src/insets/lyxinset.h: added update function
3517 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3519 * src/text.C (SelectNextWord): protect against null pointers with
3520 old-style string streams. (fix from Paul Theo Gonciari
3523 * src/cite.[Ch]: remove erroneous files.
3525 * lib/configure.m4: update the list of created directories.
3527 * src/lyxrow.C: include <config.h>
3528 * src/lyxcursor.C: ditto.
3530 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3532 * lib/examples/decimal.lyx: new example file from Mike.
3534 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3535 to find template definitions (from Dekel)
3537 * src/frontends/.cvsignore: add a few things.
3539 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3541 * src/Timeout.C (TimeOut): remove default argument.
3543 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3546 * src/insets/ExternalTemplate.C: add a "using" directive.
3548 * src/lyx_main.h: remove the act_ struct, which seems unused
3551 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3553 * LyX Developers Meeting: All files changed, due to random C++ (by
3554 coincidence) code generator script.
3556 - external inset (cool!)
3557 - initial online editing of preferences
3558 - insettabular breaks insettext(s contents)
3560 - some DocBook fixes
3561 - example files update
3562 - other cool stuff, create a diff and look for yourself.
3564 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3566 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3567 -1 this is a non-line-breaking textinset.
3569 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3570 if there is no width set.
3572 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3574 * Lots of files: Merged the dialogbase branch.
3576 2000-06-09 Allan Rae <rae@lyx.org>
3578 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3579 and the Dispatch methods that used it.
3581 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3582 access to functions formerly kept in Dispatch.
3584 2000-05-19 Allan Rae <rae@lyx.org>
3586 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3587 made to_page and count_copies integers again. from_page remains a
3588 string however because I want to allow entry of a print range like
3589 "1,4,22-25" using this field.
3591 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3592 and printer-params-get. These aren't useful from the minibuffer but
3593 could be used by a script/LyXServer app provided it passes a suitable
3594 auto_mem_buffer. I guess I should take a look at how the LyXServer
3595 works and make it support xtl buffers.
3597 * sigc++/: updated to libsigc++-1.0.1
3599 * src/xtl/: updated to xtl-1.3.pl.11
3601 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3602 those changes done to the files in src/ are actually recreated when
3603 they get regenerated. Please don't ever accept a patch that changes a
3604 dialog unless that patch includes the changes to the corresponding *.fd
3607 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3608 stringOnlyContains, renamed it and generalised it.
3610 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3611 branch. Removed the remaining old form_print code.
3613 2000-04-26 Allan Rae <rae@lyx.org>
3615 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3616 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3618 2000-04-25 Allan Rae <rae@lyx.org>
3620 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3621 against a base of xtl-1.3.pl.4
3623 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3624 filter the Id: entries so they still show the xtl version number
3627 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3628 into the src/xtl code. Patch still pending with José (XTL)
3630 2000-04-24 Allan Rae <rae@lyx.org>
3632 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3633 both more generic and much safer. Use the new template functions.
3634 * src/buffer.[Ch] (Dispatch): ditto.
3636 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3637 and mem buffer more intelligently. Also a little general cleanup.
3640 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3641 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3642 * src/xtl/Makefile.am: ditto.
3643 * src/xtl/.cvsignore: ditto.
3644 * src/Makefile.am: ditto.
3646 * src/PrinterParams.h: Removed the macros member functions. Added a
3647 testInvariant member function. A bit of tidying up and commenting.
3648 Included Angus's idea for fixing operation with egcs-1.1.2.
3650 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3651 cool expansion of XTL's mem_buffer to support automatic memory
3652 management within the buffer itself. Removed the various macros and
3653 replaced them with template functions that use either auto_mem_buffer
3654 or mem_buffer depending on a #define. The mem_buffer support will
3655 disappear as soon as the auto_mem_buffer is confirmed to be good on
3656 other platforms/compilers. That is, it's there so you've got something
3659 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3660 effectively forked XTL. However I expect José will include my code
3661 into the next major release. Also fixed a memory leak.
3662 * src/xtl/text.h: ditto.
3663 * src/xtl/xdr.h: ditto.
3664 * src/xtl/giop.h: ditto.
3666 2000-04-16 Allan Rae <rae@lyx.org>
3668 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3669 by autogen.sh and removed by maintainer-clean anyway.
3670 * .cvsignore, sigc++/.cvsignore: Support the above.
3672 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3674 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3676 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3677 macros, renamed static callback-target member functions to suit new
3678 scheme and made them public.
3679 * src/frontends/xforms/forms/form_print.fd: ditto.
3680 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3682 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3685 * src/xtl/: New directory containing a minimal distribution of XTL.
3686 This is XTL-1.3.pl.4.
3688 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3690 2000-04-15 Allan Rae <rae@lyx.org>
3692 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3694 * sigc++/: Updated to libsigc++-1.0.0
3696 2000-04-14 Allan Rae <rae@lyx.org>
3698 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3699 use the generic ones in future. I'll modify my conversion script.
3701 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3703 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3704 (CloseAllBufferRelatedDialogs): Renamed.
3705 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3707 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3708 of the generic ones. These are the same ones my conversion script
3711 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3712 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3713 * src/buffer.C (Dispatch): ditto
3715 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3716 functions for updating and hiding buffer dependent dialogs.
3717 * src/BufferView.C (buffer): ditto
3718 * src/buffer.C (setReadonly): ditto
3719 * src/lyxfunc.C (CloseBuffer): ditto
3721 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3722 Dialogs.h, and hence all the SigC stuff, into every file that includes
3723 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3725 * src/BufferView2.C: reduce the number of headers included by buffer.h
3727 2000-04-11 Allan Rae <rae@lyx.org>
3729 * src/frontends/xforms/xform_macros.h: A small collection of macros
3730 for building C callbacks.
3732 * src/frontends/xforms/Makefile.am: Added above file.
3734 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3735 scheme again. This time it should work for JMarc. If this is
3736 successful I'll revise my conversion script to automate some of this.
3737 The static member functions in the class also have to be public for
3738 this scheme will work. If the scheme works (it's almost identical to
3739 the way BufferView::cursorToggleCB is handled so it should work) then
3740 FormCopyright and FormPrint will be ready for inclusion into the main
3741 trunk immediately after 1.1.5 is released -- provided we're prepared
3742 for complaints about lame compilers not handling XTL.
3744 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3746 2000-04-07 Allan Rae <rae@lyx.org>
3748 * config/lyxinclude.m4: A bit more tidying up (Angus)
3750 * src/LString.h: JMarc's <string> header fix
3752 * src/PrinterParams.h: Used string for most data to remove some
3753 ugly code in the Print dialog and avoid even uglier code when
3754 appending the ints to a string for output.
3756 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3757 and moved "default:" back to the end of switch statement. Cleaned
3758 up the printing so it uses the right function calls and so the
3759 "print to file" option actually puts the file in the right directory.
3761 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3763 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3764 and Ok+Apply button control into a separate method: input (Angus).
3765 (input) Cleaned it up and improved it to be very thorough now.
3766 (All CB) static_cast used instead of C style cast (Angus). This will
3767 probably change again once we've worked out how to keep gcc-2.8.1 happy
3768 with real C callbacks.
3769 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3770 ignore some of the bool settings and has random numbers instead. Needs
3771 some more investigation. Added other input length checks and checking
3772 of file and printer names.
3774 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3775 would link (Angus). Seems the old code doesn't compile with the pragma
3776 statement either. Separated callback entries from internal methods.
3778 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3780 2000-03-17 Allan Rae <rae@lyx.org>
3782 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3783 need it? Maybe it could go in Dialogs instead? I could make it a
3784 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3785 values to get the bool return value.
3786 (Dispatch): New overloaded method for xtl support.
3788 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3789 extern "C" callback instead of static member functions. Hopefully,
3790 JMarc will be able to compile this. I haven't changed
3791 forms/form_copyright.fd yet. Breaking one of my own rules already.
3793 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3794 because they aren't useful from the minibuffer. Maybe a LyXServer
3795 might want a help message though?
3797 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3799 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3800 xtl which needs both rtti and exceptions.
3802 * src/support/Makefile.am:
3803 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3805 * src/frontends/xforms/input_validators.[ch]: input filters and
3806 validators. These conrol what keys are valid in input boxes.
3807 Use them and write some more. Much better idea than waiting till
3808 after the user has pressed Ok to say that the input fields don't make
3811 * src/frontends/xforms/Makefile.am:
3812 * src/frontends/xforms/forms/form_print.fd:
3813 * src/frontends/xforms/forms/makefile:
3814 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3815 new scheme. Still have to make sure I haven't missed anything from
3816 the current implementation.
3818 * src/Makefile.am, src/PrinterParams.h: New data store.
3820 * other files: Added a couple of copyright notices.
3822 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3824 * src/insets/insetbib.h: move Holder struct in public space.
3826 * src/frontends/include/DialogBase.h: use SigC:: only when
3827 SIGC_CXX_NAMESPACES is defined.
3828 * src/frontends/include/Dialogs.h: ditto.
3830 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3832 * src/frontends/xforms/FormCopyright.[Ch]: do not
3833 mention SigC:: explicitely.
3835 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3837 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3838 deals with testing KDE in main configure.in
3839 * configure.in: ditto.
3841 2000-02-22 Allan Rae <rae@lyx.org>
3843 * Lots of files: Merged from HEAD
3845 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3846 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3848 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3850 * sigc++/: new minidist.
3852 2000-02-14 Allan Rae <rae@lyx.org>
3854 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3856 2000-02-08 Juergen Vigna <jug@sad.it>
3858 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3859 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3861 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3862 for this port and so it is much easier for other people to port
3863 dialogs in a common development environment.
3865 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3866 the QT/KDE implementation.
3868 * src/frontends/kde/Dialogs.C:
3869 * src/frontends/kde/FormCopyright.C:
3870 * src/frontends/kde/FormCopyright.h:
3871 * src/frontends/kde/Makefile.am:
3872 * src/frontends/kde/formcopyrightdialog.C:
3873 * src/frontends/kde/formcopyrightdialog.h:
3874 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3875 for the kde support of the Copyright-Dialog.
3877 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3878 subdir-substitution instead of hardcoded 'xforms' as we now have also
3881 * src/frontends/include/DialogBase.h (Object): just commented the
3882 label after #endif (nasty warning and I don't like warnings ;)
3884 * src/main.C (main): added KApplication initialization if using
3887 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3888 For now only the KDE event-loop is added if frontend==kde.
3890 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3892 * configure.in: added support for the --with-frontend[=value] option
3894 * autogen.sh: added kde.m4 file to list of config-files
3896 * acconfig.h: added define for KDEGUI-support
3898 * config/kde.m4: added configuration functions for KDE-port
3900 * config/lyxinclude.m4: added --with-frontend[=value] option with
3901 support for xforms and KDE.
3903 2000-02-08 Allan Rae <rae@lyx.org>
3905 * all Makefile.am: Fixed up so the make targets dist, distclean,
3906 install and uninstall all work even if builddir != srcdir. Still
3907 have a new sigc++ minidist update to come.
3909 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3911 2000-02-01 Allan Rae <rae@lyx.org>
3913 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3914 Many mods to get builddir != srcdir working.
3916 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3917 for building on NT and so we can do the builddir != srcdir stuff.
3919 2000-01-30 Allan Rae <rae@lyx.org>
3921 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3922 This will stay in "rae" branch. We probably don't really need it in
3923 the main trunk as anyone who wants to help programming it should get
3924 a full library installed also. So they can check both included and
3925 system supplied library compilation.
3927 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3928 Added a 'mini' distribution of libsigc++. If you feel the urge to
3929 change something in these directories - Resist it. If you can't
3930 resist the urge then you should modify the following script and rebuild
3931 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3932 all happen. Still uses a hacked version of libsigc++'s configure.in.
3933 I'm quite happy with the results. I'm not sure the extra work to turn
3934 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3935 worth the trouble and would probably lead to extra maintenance
3937 I haven't tested the following important make targets: install, dist.
3938 Not ready for prime time but very close. Maybe 1.1.5.
3940 * development/tools/makeLyXsigc.sh: A shell script to automatically
3941 generate our mini-dist of libsigc++. It can only be used with a CVS
3942 checkout of libsigc++ not a tarball distribution. It's well commented.
3943 This will end up as part of the libsigc++ distribution so other apps
3944 can easily have an included mini-dist. If someone makes mods to the
3945 sigc++ subpackage without modifying this script to generate those
3946 changes I'll be very upset!
3948 * src/frontends/: Started the gui/system indep structure.
3950 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3951 to access the gui-indep dialogs are in this class. Much improved
3952 design compared to previous revision. Lars, please refrain from
3953 moving this header into src/ like you did with Popups.h last time.
3955 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3957 * src/frontends/xforms/: Started the gui-indep system with a single
3958 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3961 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3962 Here you'll find a very useful makefile and automated fdfix.sh that
3963 makes updating dailogs a no-brainer -- provided you follow the rules
3964 set out in the README. I'm thinking about adding another script to
3965 automatically generate skeleton code for a new dialog given just the
3968 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3969 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3970 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3972 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3974 * src/support/LSubstring.C (operator): simplify
3976 * src/lyxtext.h: removed bparams, use buffer_->params instead
3978 * src/lyxrow.h: make Row a real class, move all variables to
3979 private and use accessors.
3981 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3983 (isRightToLeftPar): ditto
3984 (ChangeLanguage): ditto
3985 (isMultiLingual): ditto
3988 (SimpleTeXOnePar): ditto
3989 (TeXEnvironment): ditto
3990 (GetEndLabel): ditto
3992 (SetOnlyLayout): ditto
3993 (BreakParagraph): ditto
3994 (BreakParagraphConservative): ditto
3995 (GetFontSettings): ditto
3997 (CopyIntoMinibuffer): ditto
3998 (CutIntoMinibuffer): ditto
3999 (PasteParagraph): ditto
4000 (SetPExtraType): ditto
4001 (UnsetPExtraType): ditto
4002 (DocBookContTableRows): ditto
4003 (SimpleDocBookOneTablePar): ditto
4005 (TeXFootnote): ditto
4006 (SimpleTeXOneTablePar): ditto
4007 (TeXContTableRows): ditto
4008 (SimpleTeXSpecialChars): ditto
4011 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4012 to private and use accessors.
4014 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4015 this, we did not use it anymore and has not been for ages. Just a
4016 waste of cpu cycles.
4018 * src/language.h: make Language a real class, move all variables
4019 to private and use accessors.
4021 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4022 (create_view): remove
4023 (update): some changes for new timer
4024 (cursorToggle): use new timer
4025 (beforeChange): change for new timer
4027 * src/BufferView.h (cursorToggleCB): removed last paramter because
4030 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4031 (cursorToggleCB): change because of new timer code
4033 * lib/CREDITS: updated own mailaddress
4035 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4037 * src/support/filetools.C (PutEnv): fix the code in case neither
4038 putenv() nor setenv() have been found.
4040 * INSTALL: mention the install-strip Makefile target.
4042 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4043 read-only documents.
4045 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4047 * lib/reLyX/configure.in (VERSION): avoid using a previously
4048 generated reLyX wrapper to find out $prefix.
4050 * lib/examples/eu_adibide_lyx-atua.lyx:
4051 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4052 translation of the Tutorial (Dooteo)
4054 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4056 * forms/cite.fd: new citation dialog
4058 * src/insetcite.[Ch]: the new citation dialog is moved into
4061 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4064 * src/insets/insetcommand.h: data members made private.
4066 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4068 * LyX 1.1.5 released
4070 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4072 * src/version.h (LYX_RELEASE): to 1.1.5
4074 * src/spellchecker.C (RunSpellChecker): return false if the
4075 spellchecker dies upon creation.
4077 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4079 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4080 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4084 * lib/CREDITS: update entry for Martin Vermeer.
4086 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4088 * src/text.C (draw): Draw foreign language bars at the bottom of
4089 the row instead of at the baseline.
4091 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4093 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4095 * lib/bind/de_menus.bind: updated
4097 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4099 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4101 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4103 * src/menus.C (Limit_string_length): New function
4104 (ShowTocMenu): Limit the number of items/length of items in the
4107 * src/paragraph.C (String): Correct result for a paragraph inside
4110 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4112 * src/bufferlist.C (close): test of buf->getuser() == NULL
4114 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4116 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4117 Do not call to SetCursor when the paragraph is a closed footnote!
4119 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4121 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4124 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4126 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4129 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4130 reference popup, that activates the reference-back action
4132 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4134 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4135 the menus. Also fixed a bug.
4137 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4138 the math panels when switching buffers (unless new buffer is readonly).
4140 * src/BufferView.C (NoSavedPositions)
4141 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4143 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4145 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4146 less of dvi dirty or not.
4148 * src/trans_mgr.[Ch] (insert): change first parameter to string
4151 * src/chset.[Ch] (encodeString): add const to first parameter
4153 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4155 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4159 * src/LaTeX.C (deplog): better searching for dependency files in
4160 the latex log. Uses now regexps.
4162 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4163 instead of the box hack or \hfill.
4165 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4167 * src/lyxfunc.C (doImportHelper): do not create the file before
4168 doing the actual import.
4169 (doImportASCIIasLines): create a new file before doing the insert.
4170 (doImportASCIIasParagraphs): ditto.
4172 * lib/lyxrc.example: remove mention of non-existing commands
4174 * lyx.man: remove mention of color-related switches.
4176 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4178 * src/lyx_gui.C: remove all the color-related ressources, which
4179 are not used anymore.
4181 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4184 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4186 * src/lyxrc.C (read): Add a missing break in the switch
4188 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4190 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4192 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4195 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4197 * src/text.C (draw): draw bars under foreign language words.
4199 * src/LColor.[Ch]: add LColor::language
4201 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4203 * src/lyxcursor.h (boundary): New member variable
4205 * src/text.C (IsBoundary): New methods
4207 * src/text.C: Use the above for currect cursor movement when there
4208 is both RTL & LTR text.
4210 * src/text2.C: ditto
4212 * src/bufferview_funcs.C (ToggleAndShow): ditto
4214 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4216 * src/text.C (DeleteLineForward): set selection to true to avoid
4217 that DeleteEmptyParagraphMechanism does some magic. This is how it
4218 is done in all other functions, and seems reasonable.
4219 (DeleteWordForward): do not jump over non-word stuff, since
4220 CursorRightOneWord() already does it.
4222 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4223 DeleteWordBackward, since they seem safe to me (since selection is
4224 set to "true") DeleteEmptyParagraphMechanism does nothing.
4226 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4228 * src/lyx_main.C (easyParse): simplify the code by factoring the
4229 part that removes parameters from the command line.
4230 (LyX): check wether wrong command line options have been given.
4232 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4234 * src/lyx_main.C : add support for specifying user LyX
4235 directory via command line option -userdir.
4237 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4239 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4240 the number of items per popup.
4241 (Add_to_refs_menu): Ditto.
4243 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4245 * src/lyxparagraph.h: renamed ClearParagraph() to
4246 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4247 textclass as parameter, and do nothing if free_spacing is
4248 true. This fixes part of the line-delete-forward problems.
4250 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4251 (pasteSelection): ditto.
4252 (SwitchLayoutsBetweenClasses): more translatable strings.
4254 * src/text2.C (CutSelection): use StripLeadingSpaces.
4255 (PasteSelection): ditto.
4256 (DeleteEmptyParagraphMechanism): ditto.
4258 2000-05-26 Juergen Vigna <jug@sad.it>
4260 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4261 is not needed in tabular insets.
4263 * src/insets/insettabular.C (TabularFeatures): added missing features.
4265 * src/tabular.C (DeleteColumn):
4267 (AppendRow): implemented this functions
4268 (cellsturct::operator=): clone the inset too;
4270 2000-05-23 Juergen Vigna <jug@sad.it>
4272 * src/insets/insettabular.C (LocalDispatch): better selection support
4273 when having multicolumn-cells.
4275 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4277 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4279 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4281 * src/ColorHandler.C (getGCForeground): put more test into _()
4283 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4286 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4289 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4291 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4292 there are no labels, or when buffer is readonly.
4294 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4295 there are no labels, buffer is SGML, or when buffer is readonly.
4297 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4299 * src/LColor.C (LColor): change a couple of grey40 to grey60
4300 (LColor): rewore initalization to make compiles go some magnitude
4302 (getGUIName): don't use gettext until we need the string.
4304 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4306 * src/Bullet.[Ch]: Fixed a small bug.
4308 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4310 * src/paragraph.C (String): Several fixes/improvements
4312 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4314 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4316 * src/paragraph.C (String): give more correct output.
4318 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4320 * src/lyxfont.C (stateText) Do not output the language if it is
4321 eqaul to the language of the document.
4323 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4324 between two paragraphs with the same language.
4326 * src/paragraph.C (getParLanguage) Return a correct answer for an
4327 empty dummy paragraph.
4329 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4332 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4335 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4336 the menus/popup, if requested fonts are unavailable.
4338 2000-05-22 Juergen Vigna <jug@sad.it>
4340 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4341 movement support (Up/Down/Tab/Shift-Tab).
4342 (LocalDispatch): added also preliminari cursor-selection.
4344 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4346 * src/paragraph.C (PasteParagraph): Hopefully now right!
4348 2000-05-22 Garst R. Reese <reese@isn.net>
4350 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4351 of list, change all references to Environment to Command
4352 * tex/hollywood.cls : rewrite environments as commands, add
4353 \uppercase to interiorshot and exteriorshot to force uppecase.
4354 * tex/broadway.cls : rewrite environments as commands. Tweak
4357 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4359 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4360 size of items: use a constant intead of the hardcoded 40, and more
4361 importantly do not remove the %m and %x tags added at the end.
4362 (Add_to_refs_menu): use vector::size_type instead of
4363 unsigned int as basic types for the variables. _Please_ do not
4364 assume that size_t is equal to unsigned int. On an alpha, this is
4365 unsigned long, which is _not_ the same.
4367 * src/language.C (initL): remove language "hungarian", since it
4368 seems that "magyar" is better.
4370 2000-05-22 Juergen Vigna <jug@sad.it>
4372 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4374 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4377 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4378 next was deleted but not set to 0.
4380 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4382 * src/language.C (initL): change the initialization of languages
4383 so that compiles goes _fast_.
4385 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4388 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4390 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4394 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4396 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4398 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4402 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4405 * src/insets/insetlo*.[Ch]: Made editable
4407 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4409 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4410 the current selection.
4412 * src/BufferView_pimpl.C (stuffClipboard): new method
4414 * src/BufferView.C (stuffClipboard): new method
4416 * src/paragraph.C (String): new method
4418 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4419 LColor::ignore when lyxname is not found.
4421 * src/BufferView.C (pasteSelection): new method
4423 * src/BufferView_pimpl.C (pasteSelection): new method
4425 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4427 * src/WorkArea.C (request_clipboard_cb): new static function
4428 (getClipboard): new method
4429 (putClipboard): new method
4431 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4433 * LyX 1.1.5pre2 released
4435 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4437 * src/vspace.C (operator=): removed
4438 (operator=): removed
4440 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4442 * src/layout.C (NumberOfClass): manually set the type in make_pair
4443 (NumberOfLayout): ditto
4445 * src/language.C: use the Language constructor for ignore_lang
4447 * src/language.h: add constructors to struct Language
4449 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4451 * src/text2.C (SetCursorIntern): comment out #warning
4453 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4455 * src/mathed/math_iter.h: initialize sx and sw to 0
4457 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4459 * forms/lyx.fd: Redesign of form_ref
4461 * src/LaTeXFeatures.[Ch]
4465 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4468 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4469 and Buffer::inset_iterator.
4471 * src/menus.C: Added new menus: TOC and Refs.
4473 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4475 * src/buffer.C (getTocList): New method.
4477 * src/BufferView2.C (ChangeRefs): New method.
4479 * src/buffer.C (getLabelList): New method. It replaces the old
4480 getReferenceList. The return type is vector<string> instead of
4483 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4484 the old getLabel() and GetNumberOfLabels() methods.
4485 * src/insets/insetlabel.C (getLabelList): ditto
4486 * src/mathed/formula.C (getLabelList): ditto
4488 * src/paragraph.C (String): New method.
4490 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4491 Uses the new getTocList() method.
4492 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4493 which automatically updates the contents of the browser.
4494 (RefUpdateCB): Use the new getLabelList method.
4496 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4498 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4500 * src/spellchecker.C: Added using std::reverse;
4502 2000-05-19 Juergen Vigna <jug@sad.it>
4504 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4506 * src/insets/insettext.C (computeTextRows): small fix for display of
4507 1 character after a newline.
4509 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4512 2000-05-18 Juergen Vigna <jug@sad.it>
4514 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4515 when changing width of column.
4517 * src/tabular.C (set_row_column_number_info): setting of
4518 autobreak rows if necessary.
4520 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4522 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4524 * src/vc-backend.*: renamed stat() to status() and vcstat to
4525 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4526 compilation broke. The new name seems more relevant, anyway.
4528 2000-05-17 Juergen Vigna <jug@sad.it>
4530 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4531 which was wrong if the removing caused removing of rows!
4533 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4534 (pushToken): new function.
4536 * src/text2.C (CutSelection): fix problem discovered with purify
4538 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4540 * src/debug.C (showTags): enlarge the first column, now that we
4541 have 6-digits debug codes.
4543 * lib/layouts/hollywood.layout:
4544 * lib/tex/hollywood.cls:
4545 * lib/tex/brodway.cls:
4546 * lib/layouts/brodway.layout: more commands and fewer
4547 environments. Preambles moved in the .cls files. Broadway now has
4548 more options on scene numbering and less whitespace (from Garst)
4550 * src/insets/insetbib.C (getKeys): make sure that we are in the
4551 document directory, in case the bib file is there.
4553 * src/insets/insetbib.C (Latex): revert bogus change.
4555 2000-05-16 Juergen Vigna <jug@sad.it>
4557 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4558 the TabularLayout on cursor move.
4560 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4562 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4565 (draw): fixed cursor position and drawing so that the cursor is
4566 visible when before the tabular-inset.
4568 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4569 when creating from old insettext.
4571 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4573 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4575 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4576 * lib/tex/brodway.cls: ditto
4578 * lib/layouts/brodway.layout: change alignment of parenthical
4581 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4583 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4584 versions 0.88 and 0.89 are supported.
4586 2000-05-15 Juergen Vigna <jug@sad.it>
4588 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4591 * src/insets/insettext.C (computeTextRows): redone completely this
4592 function in a much cleaner way, because of problems when having a
4594 (draw): added a frame border when the inset is locked.
4595 (SetDrawLockedFrame): this sets if we draw the border or not.
4596 (SetFrameColor): this sets the frame color (default=insetframe).
4598 * src/insets/lyxinset.h: added x() and y() functions which return
4599 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4600 function which is needed to see if we have a locking inset of some
4601 type in this inset (needed for now in insettabular).
4603 * src/vspace.C (inPixels): the same function also without a BufferView
4604 parameter as so it is easier to use it in some ocasions.
4606 * src/lyxfunc.C: changed all places where insertInset was used so
4607 that now if it couldn't be inserted it is deleted!
4609 * src/TabularLayout.C:
4610 * src/TableLayout.C: added support for new tabular-inset!
4612 * src/BufferView2.C (insertInset): this now returns a bool if the
4613 inset was really inserted!!!
4615 * src/tabular.C (GetLastCellInRow):
4616 (GetFirstCellInRow): new helper functions.
4617 (Latex): implemented for new tabular class.
4621 (TeXTopHLine): new Latex() helper functions.
4623 2000-05-12 Juergen Vigna <jug@sad.it>
4625 * src/mathed/formulamacro.C (Read):
4626 * src/mathed/formula.C (Read): read also the \end_inset here!
4628 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4630 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4631 crush when saving formulae with unbalanced parenthesis.
4633 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4635 * src/layout.C: Add new keyword "endlabelstring" to layout file
4637 * src/text.C (GetVisibleRow): Draw endlabel string.
4639 * lib/layouts/broadway.layout
4640 * lib/layouts/hollywood.layout: Added endlabel for the
4641 Parenthetical layout.
4643 * lib/layouts/heb-article.layout: Do not use slanted font shape
4644 for Theorem like environments.
4646 * src/buffer.C (makeLaTeXFile): Always add "american" to
4647 the UsedLanguages list if document language is RTL.
4649 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4651 * add addendum to README.OS2 and small patch (from SMiyata)
4653 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4655 * many files: correct the calls to ChangeExtension().
4657 * src/support/filetools.C (ChangeExtension): remove the no_path
4658 argument, which does not belong there. Use OnlyFileName() instead.
4660 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4661 files when LaTeXing a non-nice latex file.
4663 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4664 a chain of "if". Return false when deadkeys are not handled.
4666 * src/lyx_main.C (LyX): adapted the code for default bindings.
4668 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4669 bindings for basic functionality (except deadkeys).
4670 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4672 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4673 several methods: handle override_x_deadkeys.
4675 * src/lyxrc.h: remove the "bindings" map, which did not make much
4676 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4678 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4680 * src/lyxfont.C (stateText): use a saner method to determine
4681 whether the font is "default". Seems to fix the crash with DEC
4684 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4686 2000-05-08 Juergen Vigna <jug@sad.it>
4688 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4689 TabularLayoutMenu with mouse-button-3
4690 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4692 * src/TabularLayout.C: added this file for having a Layout for
4695 2000-05-05 Juergen Vigna <jug@sad.it>
4697 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4698 recalculating inset-widths.
4699 (TabularFeatures): activated this function so that I can change
4700 tabular-features via menu.
4702 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4703 that I can test some functions with the Table menu.
4705 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4707 * src/lyxfont.C (stateText): guard against stupid c++libs.
4709 * src/tabular.C: add using std::vector
4710 some whitespace changes, + removed som autogenerated code.
4712 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4714 2000-05-05 Juergen Vigna <jug@sad.it>
4716 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4717 row, columns and cellstructures.
4719 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4721 * lib/lyxrc.example: remove obsolete entries.
4723 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4724 reading of protected_separator for free_spacing.
4726 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4728 * src/text.C (draw): do not display an exclamation mark in the
4729 margin for margin notes. This is confusing, ugly and
4732 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4733 AMS math' is checked.
4735 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4736 name to see whether including the amsmath package is needed.
4738 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4740 * src/paragraph.C (validate): Compute UsedLanguages correctly
4741 (don't insert the american language if it doesn't appear in the
4744 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4745 The argument of \thanks{} command is considered moving argument
4747 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4750 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4752 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4753 for appendix/minipage/depth. The lines can be now both in the footnote
4754 frame, and outside the frame.
4756 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4759 2000-05-05 Juergen Vigna <jug@sad.it>
4761 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4762 neede only in tabular.[Ch].
4764 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4766 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4768 (Write): write '~' for PROTECTED_SEPARATOR
4770 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4772 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4775 * src/mathed/formula.C (drawStr): rename size to siz.
4777 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4778 possibly fix a bug by not changing the pflags = flags to piflags =
4781 2000-05-05 Juergen Vigna <jug@sad.it>
4783 * src/insets/insetbib.C: moved using directive
4785 * src/ImportNoweb.C: small fix for being able to compile (missing
4788 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4790 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4791 to use clear, since we don't depend on this in the code. Add test
4794 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4796 * (various *.C files): add using std::foo directives to please dec
4799 * replace calls to string::clear() to string::erase() (Angus)
4801 * src/cheaders/cmath: modified to provide std::abs.
4803 2000-05-04 Juergen Vigna <jug@sad.it>
4805 * src/insets/insettext.C: Prepared all for inserting of multiple
4806 paragraphs. Still display stuff to do (alignment and other things),
4807 but I would like to use LyXText to do this when we cleaned out the
4808 table-support stuff.
4810 * src/insets/insettabular.C: Changed lot of stuff and added lots
4811 of functionality still a lot to do.
4813 * src/tabular.C: Various functions changed name and moved to be
4814 const functions. Added new Read and Write functions and changed
4815 lots of things so it works good with tabular-insets (also removed
4816 some stuff which is not needed anymore * hacks *).
4818 * src/lyxcursor.h: added operators == and != which just look if
4819 par and pos are (not) equal.
4821 * src/buffer.C (latexParagraphs): inserted this function to latex
4822 all paragraphs form par to endpar as then I can use this too for
4825 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4826 so that I can call this to from text insets with their own cursor.
4828 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4829 output off all paragraphs (because of the fix below)!
4831 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4832 the very last paragraph (this could be also the last paragraph of an
4835 * src/texrow.h: added rows() call which returns the count-variable.
4837 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4839 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4841 * lib/configure.m4: better autodetection of DocBook tools.
4843 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4845 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4847 * src/lyx_cb.C: add using std::reverse;
4849 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4852 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4853 selected files. Should fix repeated errors from generated files.
4855 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4857 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4859 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4860 the spellchecker popup.
4862 * lib/lyxrc.example: Removed the \number_inset section
4864 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4866 * src/insets/figinset.C (various): Use IsFileReadable() to make
4867 sure that the file actually exist. Relying on ghostscripts errors
4868 is a bad idea since they can lead to X server crashes.
4870 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4872 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4875 * lib/lyxrc.example: smallish typo in description of
4876 \view_dvi_paper_option
4878 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4881 * src/lyxfunc.C: doImportHelper to factor out common code of the
4882 various import methods. New functions doImportASCIIasLines,
4883 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4884 doImportLinuxDoc for the format specific parts.
4887 * buffer.C: Dispatch returns now a bool to indicate success
4890 * lyx_gui.C: Add getLyXView() for member access
4892 * lyx_main.C: Change logic for batch commands: First try
4893 Buffer::Dispatch (possibly without GUI), if that fails, use
4896 * lyx_main.C: Add support for --import command line switch.
4897 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4898 Available Formats: Everything accepted by 'buffer-import <format>'
4900 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4902 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4905 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4906 documents will be reformatted upon reentry.
4908 2000-04-27 Juergen Vigna <jug@sad.it>
4910 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4911 correctly only last pos this was a bug.
4913 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4915 * release of lyx-1.1.5pre1
4917 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4919 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4921 * src/menus.C: revert the change of naming (Figure->Graphic...)
4922 from 2000-04-11. It was incomplete and bad.
4924 * src/LColor.[Ch]: add LColor::depthbar.
4925 * src/text.C (GetVisibleRow): use it.
4927 * README: update the languages list.
4929 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4931 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4934 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4936 * README: remove sections that were just wrong.
4938 * src/text2.C (GetRowNearY): remove currentrow code
4940 * src/text.C (GetRow): remove currentrow code
4942 * src/screen.C (Update): rewritten a bit.
4943 (SmallUpdate): removed func
4945 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4947 (FullRebreak): return bool
4948 (currentrow): remove var
4949 (currentrow_y): ditto
4951 * src/lyxscreen.h (Draw): change arg to unsigned long
4952 (FitCursor): return bool
4953 (FitManualCursor): ditto
4954 (Smallpdate): remove func
4955 (first): change to unsigned long
4956 (DrawOneRow): change second arg to long (from long &)
4957 (screen_refresh_y): remove var
4958 (scree_refresh_row): ditto
4960 * src/lyxrow.h: change baseline to usigned int from unsigned
4961 short, this brings some implicit/unsigned issues out in the open.
4963 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4965 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4966 instead of smallUpdate.
4968 * src/lyxcursor.h: change y to unsigned long
4970 * src/buffer.h: don't call updateScrollbar after fitcursor
4972 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4973 where they are used. Removed "\\direction", this was not present
4974 in 1.1.4 and is already obsolete. Commented out some code that I
4975 believe to never be called.
4976 (runLiterate): don't call updateScrollbar after fitCursor
4978 (buildProgram): ditto
4981 * src/WorkArea.h (workWidth): change return val to unsigned
4984 (redraw): remove the button redraws
4985 (setScrollbarValue): change for scrollbar
4986 (getScrollbarValue): change for scrollbar
4987 (getScrollbarBounds): change for scrollbar
4989 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4990 (C_WorkArea_down_cb): removed func
4991 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4992 (resize): change for scrollbar
4993 (setScrollbar): ditto
4994 (setScrollbarBounds): ditto
4995 (setScrollbarIncrements): ditto
4996 (up_cb): removed func
4997 (down_cb): removed func
4998 (scroll_cb): change for scrollbar
4999 (work_area_handler): ditto
5001 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5002 when FitCursor did something.
5003 (updateScrollbar): some unsigned changes
5004 (downCB): removed func
5005 (scrollUpOnePage): removed func
5006 (scrollDownOnePage): remvoed func
5007 (workAreaMotionNotify): don't call screen->FitCursor but use
5008 fitCursor instead. and bool return val
5009 (workAreaButtonPress): ditto
5010 (workAreaButtonRelease): some unsigned changes
5011 (checkInsetHit): ditto
5012 (workAreaExpose): ditto
5013 (update): parts rewritten, comments about the signed char arg added
5014 (smallUpdate): removed func
5015 (cursorPrevious): call needed updateScrollbar
5018 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5021 * src/BufferView.[Ch] (upCB): removed func
5022 (downCB): removed func
5023 (smallUpdate): removed func
5025 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5027 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5028 currentrow, currentrow_y optimization. This did not help a lot and
5029 if we want to do this kind of optimization we should rather use
5030 cursor.row instead of the currentrow.
5032 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5033 buffer spacing and klyx spacing support.
5035 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5037 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5040 2000-04-26 Juergen Vigna <jug@sad.it>
5042 * src/insets/figinset.C: fixes to Lars sstream changes!
5044 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5046 * A lot of files: Added Ascii(ostream &) methods to all inset
5047 classes. Used when exporting to ASCII.
5049 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5050 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5053 * src/text2.C (ToggleFree): Disabled implicit word selection when
5054 there is a change in the language
5056 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5057 no output was generated for end-of-sentence inset.
5059 * src/insets/lyxinset.h
5062 * src/paragraph.C: Removed the insetnumber code
5064 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5066 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5068 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5069 no_babel and no_epsfig completely from the file.
5070 (parseSingleLyXformat2Token): add handling for per-paragraph
5071 spacing as written by klyx.
5073 * src/insets/figinset.C: applied patch by Andre. Made it work with
5076 2000-04-20 Juergen Vigna <jug@sad.it>
5078 * src/insets/insettext.C (cutSelection):
5079 (copySelection): Fixed with selection from right to left.
5080 (draw): now the rows are not recalculated at every draw.
5081 (computeTextRows): for now reset the inset-owner here (this is
5082 important for an undo or copy where the inset-owner is not set
5085 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5086 motion to the_locking_inset screen->first was forgotten, this was
5087 not important till we got multiline insets.
5089 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5091 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5092 code seems to be alright (it is code changed by Dekel, and the
5093 intent is indeed that all macros should be defined \protect'ed)
5095 * NEWS: a bit of reorganisation of the new user-visible features.
5097 2000-04-19 Juergen Vigna <jug@sad.it>
5099 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5100 position. Set the inset_owner of the used paragraph so that it knows
5101 that it is inside an inset. Fixed cursor handling with mouse and
5102 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5103 and cleanups to make TextInsets work better.
5105 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5106 Changed parameters of various functions and added LockInsetInInset().
5108 * src/insets/insettext.C:
5110 * src/insets/insetcollapsable.h:
5111 * src/insets/insetcollapsable.C:
5112 * src/insets/insetfoot.h:
5113 * src/insets/insetfoot.C:
5114 * src/insets/insetert.h:
5115 * src/insets/insetert.C: cleaned up the code so that it works now
5116 correctly with insettext.
5118 * src/insets/inset.C:
5119 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5120 that insets in insets are supported right.
5123 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5125 * src/paragraph.C: some small fixes
5127 * src/debug.h: inserted INSETS debug info
5129 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5130 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5132 * src/commandtags.h:
5133 * src/LyXAction.C: insert code for InsetTabular.
5135 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5136 not Button1MotionMask.
5137 (workAreaButtonRelease): send always a InsetButtonRelease event to
5139 (checkInsetHit): some setCursor fixes (always with insets).
5141 * src/BufferView2.C (lockInset): returns a bool now and extended for
5142 locking insets inside insets.
5143 (showLockedInsetCursor): it is important to have the cursor always
5144 before the locked inset.
5145 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5147 * src/BufferView.h: made lockInset return a bool.
5149 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5151 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5152 that is used also internally but can be called as public to have back
5153 a cursor pos which is not set internally.
5154 (SetCursorIntern): Changed to use above function.
5156 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5158 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5163 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5164 patches for things that should be in or should be changed.
5166 * src/* [insetfiles]: change "usigned char fragile" to bool
5167 fragile. There was only one point that could that be questioned
5168 and that is commented in formulamacro.C. Grep for "CHECK".
5170 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5171 (DeleteBuffer): take it out of CutAndPaste and make it static.
5173 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5175 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5176 output the spacing envir commands. Also the new commands used in
5177 the LaTeX output makes the result better.
5179 * src/Spacing.C (writeEnvirBegin): new method
5180 (writeEnvirEnd): new method
5182 2000-04-18 Juergen Vigna <jug@sad.it>
5184 * src/CutAndPaste.C: made textclass a static member of the class
5185 as otherwise it is not accesed right!!!
5187 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5189 * forms/layout_forms.fd
5190 * src/layout_forms.h
5191 * src/layout_forms.C (create_form_form_character)
5192 * src/lyx_cb.C (UserFreeFont)
5193 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5194 documents (in the layout->character popup).
5196 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5198 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5199 \spell_command was in fact not honored (from Kevin Atkinson).
5201 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5204 * src/lyx_gui.h: make lyxViews private (Angus)
5206 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5208 * src/mathed/math_write.C
5209 (MathMatrixInset::Write) Put \protect before \begin{array} and
5210 \end{array} if fragile
5211 (MathParInset::Write): Put \protect before \\ if fragile
5213 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5215 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5216 initialization if the LyXColorHandler must be done after the
5217 connections to the XServer has been established.
5219 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5220 get the background pixel from the lyxColorhandler so that the
5221 figures are rendered with the correct background color.
5222 (NextToken): removed functions.
5223 (GetPSSizes): use ifs >> string instead of NextToken.
5225 * src/Painter.[Ch]: the color cache moved out of this file.
5227 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5230 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5232 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5233 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5235 * src/BufferView.C (enterView): new func
5236 (leaveView): new func
5238 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5240 (leaveView): new func, undefines xterm cursor when approp.
5242 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5243 (AllowInput): delete the Workarea cursor handling from this func.
5245 * src/Painter.C (underline): draw a slimer underline in most cases.
5247 * src/lyx_main.C (error_handler): use extern "C"
5249 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5251 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5252 sent directly to me.
5254 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5255 to the list by Dekel.
5257 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5260 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5261 methods from lyx_cb.here.
5263 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5266 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5268 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5269 instead of using current_view directly.
5271 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5273 * src/LyXAction.C (init): add the paragraph-spacing command.
5275 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5277 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5279 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5280 different from the documents.
5282 * src/text.C (SetHeightOfRow): take paragraph spacing into
5283 account, paragraph spacing takes precedence over buffer spacing
5284 (GetVisibleRow): ditto
5286 * src/paragraph.C (writeFile): output the spacing parameter too.
5287 (validate): set the correct features if spacing is used in the
5289 (Clear): set spacing to default
5290 (MakeSameLayout): spacing too
5291 (HasSameLayout): spacing too
5292 (SetLayout): spacing too
5293 (TeXOnePar): output the spacing commands
5295 * src/lyxparagraph.h: added a spacing variable for use with
5296 per-paragraph spacing.
5298 * src/Spacing.h: add a Default spacing and a method to check if
5299 the current spacing is default. also added an operator==
5301 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5304 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5306 * src/lyxserver.C (callback): fix dispatch of functions
5308 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5309 printf() into lyxerr call.
5311 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5314 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5315 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5316 the "Float" from each of the subitems.
5317 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5319 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5320 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5321 documented the change so that the workaround can be nuked later.
5323 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5326 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5328 * src/buffer.C (getLatexName): ditto
5329 (setReadonly): ditto
5331 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5333 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5334 avoid some uses of current_view. Added also a bufferParams()
5335 method to get at this.
5337 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5339 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5341 * src/lyxparagraph.[Ch]: removed
5342 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5343 with operators used by lower_bound and
5344 upper_bound in InsetTable's
5345 Make struct InsetTable private again. Used matchpos.
5347 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5349 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5350 document, the language of existing text is changed (unless the
5351 document is multi-lingual)
5353 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5355 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5357 * A lot of files: A rewrite of the Right-to-Left support.
5359 2000-04-10 Juergen Vigna <jug@sad.it>
5361 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5362 misplaced cursor when inset in inset is locked.
5364 * src/insets/insettext.C (LocalDispatch): small fix so that a
5365 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5367 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5368 footnote font should be decreased in size twice when displaying.
5370 * src/insets/insettext.C (GetDrawFont): inserted this function as
5371 the drawing-font may differ from the real paragraph font.
5373 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5374 insets (inset in inset!).
5376 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5377 function here because we don't want footnotes inside footnotes.
5379 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5381 (init): now set the inset_owner in paragraph.C
5382 (LocalDispatch): added some resetPos() in the right position
5385 (pasteSelection): changed to use the new CutAndPaste-Class.
5387 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5388 which tells if it is allowed to insert another inset inside this one.
5390 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5391 SwitchLayoutsBetweenClasses.
5393 * src/text2.C (InsertInset): checking of the new paragraph-function
5395 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5396 is not needed anymore here!
5399 (PasteSelection): redone (also with #ifdef) so that now this uses
5400 the CutAndPaste-Class.
5401 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5404 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5405 from/to text/insets.
5407 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5408 so that the paragraph knows if it is inside an (text)-inset.
5409 (InsertFromMinibuffer): changed return-value to bool as now it
5410 may happen that an inset is not inserted in the paragraph.
5411 (InsertInsetAllowed): this checks if it is allowed to insert an
5412 inset in this paragraph.
5414 (BreakParagraphConservative):
5415 (BreakParagraph) : small change for the above change of the return
5416 value of InsertFromMinibuffer.
5418 * src/lyxparagraph.h: added inset_owner and the functions to handle
5419 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5421 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5423 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5424 functions from BufferView to BufferView::Pimpl to ease maintence.
5426 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5427 correctly. Also use SetCursorIntern instead of SetCursor.
5429 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5432 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5434 * src/WorkArea.C (belowMouse): manually implement below mouse.
5436 * src/*: Add "explicit" on several constructors, I added probably
5437 some unneeded ones. A couple of changes to code because of this.
5439 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5440 implementation and private parts from the users of BufferView. Not
5443 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5444 implementation and private parts from the users of LyXLex. Not
5447 * src/BufferView_pimpl.[Ch]: new files
5449 * src/lyxlex_pimpl.[Ch]: new files
5451 * src/LyXView.[Ch]: some inline functions move out-of-line
5453 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5455 * src/lyxparagraph.h: make struct InsetTable public.
5457 * src/support/lyxstring.h: change lyxstring::difference_type to be
5458 ptrdiff_t. Add std:: modifiers to streams.
5460 * src/font.C: include the <cctype> header, for islower() and
5463 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5465 * src/font.[Ch]: new files. Contains the metric functions for
5466 fonts, takes a LyXFont as parameter. Better separation of concepts.
5468 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5469 changes because of this.
5471 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5473 * src/*: compile with -Winline and move functions that don't
5476 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5479 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5481 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5482 (various files changed because of this)
5484 * src/Painter.C (text): fixed the drawing of smallcaps.
5486 * src/lyxfont.[Ch] (drawText): removed unused member func.
5489 * src/*.C: added needed "using" statements and "std::" qualifiers.
5491 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5493 * src/*.h: removed all use of "using" from header files use
5494 qualifier std:: instead.
5496 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5498 * src/text.C (Backspace): some additional cleanups (we already
5499 know whether cursor.pos is 0 or not).
5501 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5502 automake does not provide one).
5504 * src/bmtable.h: replace C++ comments with C comments.
5506 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5508 * src/screen.C (ShowCursor): Change the shape of the cursor if
5509 the current language is not equal to the language of the document.
5510 (If the cursor change its shape unexpectedly, then you've found a bug)
5512 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5515 * src/insets/insetnumber.[Ch]: New files.
5517 * src/LyXAction.C (init)
5518 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5521 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5523 * src/lyxparagraph.h
5524 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5525 (the vector is kept sorted).
5527 * src/text.C (GetVisibleRow): Draw selection correctly when there
5528 is both LTR and RTL text.
5530 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5531 which is much faster.
5533 * src/text.C (GetVisibleRow and other): Do not draw the last space
5534 in a row if the direction of the last letter is not equal to the
5535 direction of the paragraph.
5537 * src/lyxfont.C (latexWriteStartChanges):
5538 Check that font language is not equal to basefont language.
5539 (latexWriteEndChanges): ditto
5541 * src/lyx_cb.C (StyleReset): Don't change the language while using
5542 the font-default command.
5544 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5545 empty paragraph before a footnote.
5547 * src/insets/insetcommand.C (draw): Increase x correctly.
5549 * src/screen.C (ShowCursor): Change cursor shape if
5550 current language != document language.
5552 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5554 2000-03-31 Juergen Vigna <jug@sad.it>
5556 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5557 (Clone): changed mode how the paragraph-data is copied to the
5558 new clone-paragraph.
5560 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5561 GetInset(pos) with no inset anymore there (in inset UNDO)
5563 * src/insets/insetcommand.C (draw): small fix as here x is
5564 incremented not as much as width() returns (2 before, 2 behind = 4)
5566 2000-03-30 Juergen Vigna <jug@sad.it>
5568 * src/insets/insettext.C (InsetText): small fix in initialize
5569 widthOffset (should not be done in the init() function)
5571 2000-03-29 Amir Karger <karger@lyx.org>
5573 * lib/examples/it_ItemizeBullets.lyx: translation by
5576 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5578 2000-03-29 Juergen Vigna <jug@sad.it>
5580 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5582 * src/insets/insetfoot.C (Clone): small change as for the below
5583 new init function in the text-inset
5585 * src/insets/insettext.C (init): new function as I've seen that
5586 clone did not copy the Paragraph-Data!
5587 (LocalDispatch): Added code so that now we have some sort of Undo
5588 functionality (well actually we HAVE Undo ;)
5590 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5592 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5594 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5597 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5599 * src/main.C: added a runtime check that verifies that the xforms
5600 header used when building LyX and the library used when running
5601 LyX match. Exit with a message if they don't match. This is a
5602 version number check only.
5604 * src/buffer.C (save): Don't allocate memory on the heap for
5605 struct utimbuf times.
5607 * *: some using changes, use iosfwd instead of the real headers.
5609 * src/lyxfont.C use char const * instead of string for the static
5610 strings. Rewrite some functions to use sstream.
5612 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5614 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5617 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5619 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5620 of Geodesy (from Martin Vermeer)
5622 * lib/layouts/svjour.inc: include file for the Springer svjour
5623 class. It can be used to support journals other than JoG.
5625 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5626 Miskiewicz <misiek@pld.org.pl>)
5627 * lib/reLyX/Makefile.am: ditto.
5629 2000-03-27 Juergen Vigna <jug@sad.it>
5631 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5632 also some modifications with operations on selected text.
5634 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5635 problems with clicking on insets (last famous words ;)
5637 * src/insets/insetcommand.C (draw):
5638 (width): Changed to have a bit of space before and after the inset so
5639 that the blinking cursor can be seen (otherwise it was hidden)
5641 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5643 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5644 would not be added to the link list when an installed gettext (not
5645 part of libc) is found.
5647 2000-03-24 Juergen Vigna <jug@sad.it>
5649 * src/insets/insetcollapsable.C (Edit):
5650 * src/mathed/formula.C (InsetButtonRelease):
5651 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5654 * src/BufferView.C (workAreaButtonPress):
5655 (workAreaButtonRelease):
5656 (checkInsetHit): Finally fixed the clicking on insets be handled
5659 * src/insets/insetert.C (Edit): inserted this call so that ERT
5660 insets work always with LaTeX-font
5662 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5664 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5665 caused lyx to startup with no GUI in place, causing in a crash
5666 upon startup when called with arguments.
5668 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5670 * src/FontLoader.C: better initialization of dummyXFontStruct.
5672 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5674 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5675 for linuxdoc and docbook import and export format options.
5677 * lib/lyxrc.example Example of default values for the previous flags.
5679 * src/lyx_cb.C Use those flags instead of the hardwired values for
5680 linuxdoc and docbook export.
5682 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5685 * src/menus.C Added menus entries for the new import/exports formats.
5687 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5689 * src/lyxrc.*: Added support for running without Gui
5692 * src/FontLoader.C: sensible defaults if no fonts are needed
5694 * src/lyx_cb.C: New function ShowMessage (writes either to the
5695 minibuffer or cout in case of no gui
5696 New function AskOverwrite for common stuff
5697 Consequently various changes to call these functions
5699 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5700 wild guess at sensible screen resolution when having no gui
5702 * src/lyxfont.C: no gui, no fonts... set some defaults
5704 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5706 * src/LColor.C: made the command inset background a bit lighter.
5708 2000-03-20 Hartmut Goebel <goebel@noris.net>
5710 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5711 stdstruct.inc. Koma-Script added some title elements which
5712 otherwise have been listed below "bibliography". This split allows
5713 adding title elements to where they belong.
5715 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5716 define the additional tilte elements and then include
5719 * many other layout files: changed to include stdtitle.inc just
5720 before stdstruct.inc.
5722 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5724 * src/buffer.C: (save) Added the option to store all backup files
5725 in a single directory
5727 * src/lyxrc.[Ch]: Added variable \backupdir_path
5729 * lib/lyxrc.example: Added descriptions of recently added variables
5731 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5732 bibtex inset, not closing the bibtex popup when deleting the inset)
5734 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5736 * src/lyx_cb.C: add a couple using directives.
5738 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5739 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5740 import based on the filename.
5742 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5743 file would be imported at start, if the filename where of a sgml file.
5745 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5747 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5749 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5750 * src/lyxfont.h Replaced the member variable bits.direction by the
5751 member variable lang. Made many changes in other files.
5752 This allows having a multi-lingual document
5754 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5755 that change the current language to <l>.
5756 Removed the command "font-rtl"
5758 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5759 format for Hebrew documents)
5761 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5762 When auto_mathmode is "true", pressing a digit key in normal mode
5763 will cause entering into mathmode.
5764 If auto_mathmode is "rtl" then this behavior will be active only
5765 when writing right-to-left text.
5767 * src/text2.C (InsertStringA) The string is inserted using the
5770 * src/paragraph.C (GetEndLabel) Gives a correct result for
5771 footnote paragraphs.
5773 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5775 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5777 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5778 front of PasteParagraph. Never insert a ' '. This should at least
5779 fix some cause for the segfaults that we have been experiencing,
5780 it also fixes backspace behaviour slightly. (Phu!)
5782 * src/support/lstrings.C (compare_no_case): some change to make it
5783 compile with gcc 2.95.2 and stdlibc++-v3
5785 * src/text2.C (MeltFootnoteEnvironment): change type o
5786 first_footnote_par_is_not_empty to bool.
5788 * src/lyxparagraph.h: make text private. Changes in other files
5790 (fitToSize): new function
5791 (setContentsFromPar): new function
5792 (clearContents): new function
5793 (SetChar): new function
5795 * src/paragraph.C (readSimpleWholeFile): deleted.
5797 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5798 the file, just use a simple string instead. Also read the file in
5799 a more maintainable manner.
5801 * src/text2.C (InsertStringA): deleted.
5802 (InsertStringB): deleted.
5804 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5806 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5807 RedoParagraphs from the doublespace handling part, just set status
5808 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5809 done, but perhaps not like this.)
5811 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5813 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5814 character when inserting an inset.
5816 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5818 * src/bufferparams.C (readLanguage): now takes "default" into
5821 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5822 also initialize the toplevel_keymap with the default bindings from
5825 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5827 * all files using lyxrc: have lyxrc as a real variable and not a
5828 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5831 * src/lyxrc.C: remove double call to defaultKeyBindings
5833 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5834 toolbar defauls using lyxlex. Remove enums, structs, functions
5837 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5838 toolbar defaults. Also store default keybindings in a map.
5840 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5841 storing the toolbar defaults without any xforms dependencies.
5843 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5844 applied. Changed to use iterators.
5846 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5848 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5849 systems that don't have LINGUAS set to begin with.
5851 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5853 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5854 the list by Dekel Tsur.
5856 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5858 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5859 * src/insets/form_graphics.C: ditto.
5861 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5863 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5865 * src/bufferparams.C (readLanguage): use the new language map
5867 * src/intl.C (InitKeyMapper): use the new language map
5869 * src/lyx_gui.C (create_forms): use the new language map
5871 * src/language.[Ch]: New files. Used for holding the information
5872 about each language. Now! Use this new language map enhance it and
5873 make it really usable for our needs.
5875 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5877 * screen.C (ShowCursor): Removed duplicate code.
5878 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5879 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5881 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5884 * src/text.C Added TransformChar method. Used for rendering Arabic
5885 text correctly (change the glyphs of the letter according to the
5886 position in the word)
5891 * src/lyxrc.C Added lyxrc command {language_command_begin,
5892 language_command_end,language_command_ltr,language_command_rtl,
5893 language_package} which allows the use of either arabtex or Omega
5896 * src/lyx_gui.C (init)
5898 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5899 to use encoding for menu fonts which is different than the encoding
5902 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5903 do not load the babel package.
5904 To write an English document with Hebrew/Arabic, change the document
5905 language to "english".
5907 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5908 (alphaCounter): changed to return char
5909 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5911 * lib/lyxrc.example Added examples for Hebrew/Arabic
5914 * src/layout.C Added layout command endlabeltype
5916 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5918 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5920 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5922 * src/mathed/math_delim.C (search_deco): return a
5923 math_deco_struct* instead of index.
5925 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5927 * All files with a USE_OSTREAM_ONLY within: removed all code that
5928 was unused when USE_OSTREAM_ONLY is defined.
5930 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5931 of any less. Removed header and using.
5933 * src/text.C (GetVisibleRow): draw the string "Page Break
5934 (top/bottom)" on screen when drawing a pagebreak line.
5936 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5938 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5940 * src/mathed/math_macro.C (draw): do some cast magic.
5943 * src/mathed/math_defs.h: change byte* argument to byte const*.
5945 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5947 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5948 know it is right to return InsetFoot* too, but cxx does not like
5951 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5953 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5955 * src/mathed/math_delim.C: change == to proper assignment.
5957 2000-03-09 Juergen Vigna <jug@sad.it>
5959 * src/insets/insettext.C (setPos): fixed various cursor positioning
5960 problems (via mouse and cursor-keys)
5961 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5962 inset (still a small display problem but it works ;)
5964 * src/insets/insetcollapsable.C (draw): added button_top_y and
5965 button_bottom_y to have correct values for clicking on the inset.
5967 * src/support/lyxalgo.h: commented out 'using std::less'
5969 2000-03-08 Juergen Vigna <jug@sad.it>
5971 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5972 Button-Release event closes as it is alos the Release-Event
5975 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5977 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5979 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5980 can add multiple spaces in Scrap (literate programming) styles...
5981 which, by the way, is how I got hooked on LyX to begin with.
5983 * src/mathed/formula.C (Write): Added dummy variable to an
5984 inset::Latex() call.
5985 (Latex): Add free_spacing boolean to inset::Latex()
5987 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5989 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5990 virtual function to include the free_spacing boolean from
5991 the containing paragraph's style.
5993 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5994 Added free_spacing boolean arg to match inset.h
5996 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5997 Added free_spacing boolean arg to match inset.h
5999 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6000 Added free_spacing boolean and made sure that if in a free_spacing
6001 paragraph, that we output normal space if there is a protected space.
6003 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6004 Added free_spacing boolean arg to match inset.h
6006 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6007 Added free_spacing boolean arg to match inset.h
6009 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6010 Added free_spacing boolean arg to match inset.h
6012 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6013 Added free_spacing boolean arg to match inset.h
6015 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6016 Added free_spacing boolean arg to match inset.h
6018 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6019 free_spacing boolean arg to match inset.h
6021 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6022 Added free_spacing boolean arg to match inset.h
6024 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6025 Added free_spacing boolean arg to match inset.h
6027 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6028 Added free_spacing boolean arg to match inset.h
6030 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6031 Added free_spacing boolean arg to match inset.h
6033 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6034 Added free_spacing boolean arg to match inset.h
6036 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6037 free_spacing boolean arg to match inset.h
6039 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6040 free_spacing boolean arg to match inset.h
6042 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6043 ignore free_spacing paragraphs. The user's spaces are left
6046 * src/text.C (InsertChar): Fixed the free_spacing layout
6047 attribute behavior. Now, if free_spacing is set, you can
6048 add multiple spaces in a paragraph with impunity (and they
6049 get output verbatim).
6050 (SelectSelectedWord): Added dummy argument to inset::Latex()
6053 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6056 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6057 paragraph layouts now only input a simple space instead.
6058 Special character insets don't make any sense in free-spacing
6061 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6062 hard-spaces in the *input* file to simple spaces if the layout
6063 is free-spacing. This converts old files which had to have
6064 hard-spaces in free-spacing layouts where a simple space was
6066 (writeFileAscii): Added free_spacing check to pass to the newly
6067 reworked inset::Latex(...) methods. The inset::Latex() code
6068 ensures that hard-spaces in free-spacing paragraphs get output
6069 as spaces (rather than "~").
6071 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6073 * src/mathed/math_delim.C (draw): draw the empty placeholder
6074 delims with a onoffdash line.
6075 (struct math_deco_compare): struct that holds the "functors" used
6076 for the sort and the binary search in math_deco_table.
6077 (class init_deco_table): class used for initial sort of the
6079 (search_deco): use lower_bound to do a binary search in the
6082 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6084 * src/lyxrc.C: a small secret thingie...
6086 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6087 and to not flush the stream as often as it used to.
6089 * src/support/lyxalgo.h: new file
6090 (sorted): template function used for checking if a sequence is
6091 sorted or not. Two versions with and without user supplied
6092 compare. Uses same compare as std::sort.
6094 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6095 it and give warning on lyxerr.
6097 (struct compare_tags): struct with function operators used for
6098 checking if sorted, sorting and lower_bound.
6099 (search_kw): use lower_bound instead of manually implemented
6102 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6104 * src/insets/insetcollapsable.h: fix Clone() declaration.
6105 * src/insets/insetfoot.h: ditto.
6107 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6109 2000-03-08 Juergen Vigna <jug@sad.it>
6111 * src/insets/lyxinset.h: added owner call which tells us if
6112 this inset is inside another inset. Changed also the return-type
6113 of Editable to an enum so it tells clearer what the return-value is.
6115 * src/insets/insettext.C (computeTextRows): fixed computing of
6116 textinsets which split automatically on more rows.
6118 * src/insets/insetert.[Ch]: changed this to be of BaseType
6121 * src/insets/insetfoot.[Ch]: added footnote inset
6123 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6124 collapsable insets (like footnote, ert, ...)
6126 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6128 * src/lyxdraw.h: remvoe file
6130 * src/lyxdraw.C: remove file
6132 * src/insets/insettext.C: added <algorithm>.
6134 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6136 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6137 (matrix_cb): case MM_OK use string stream
6139 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6142 * src/mathed/math_macro.C (draw): use string stream
6143 (Metrics): use string stream
6145 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6146 directly to the ostream.
6148 * src/vspace.C (asString): use string stream.
6149 (asString): use string stream
6150 (asLatexString): use string stream
6152 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6153 setting Spacing::Other.
6155 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6156 sprintf when creating the stretch vale.
6158 * src/text2.C (alphaCounter): changed to return a string and to
6159 not use a static variable internally. Also fixed a one-off bug.
6160 (SetCounter): changed the drawing of the labels to use string
6161 streams instead of sprintf.
6163 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6164 manipulator to use a scheme that does not require library support.
6165 This is also the way it is done in the new GNU libstdc++. Should
6166 work with DEC cxx now.
6168 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6170 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6171 end. This fixes a bug.
6173 * src/mathed (all files concerned with file writing): apply the
6174 USE_OSTREAM_ONLY changes to mathed too.
6176 * src/support/DebugStream.h: make the constructor explicit.
6178 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6179 count and ostream squashed.
6181 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6183 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6185 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6186 ostringstream uses STL strings, and we might not.
6188 * src/insets/insetspecialchar.C: add using directive.
6189 * src/insets/insettext.C: ditto.
6191 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6193 * lib/layouts/seminar.layout: feeble attempt at a layout for
6194 seminar.cls, far from completet and could really use some looking
6195 at from people used to write layout files.
6197 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6198 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6199 a lot nicer and works nicely with ostreams.
6201 * src/mathed/formula.C (draw): a slightly different solution that
6202 the one posted to the list, but I think this one works too. (font
6203 size wrong in headers.)
6205 * src/insets/insettext.C (computeTextRows): some fiddling on
6206 Jürgens turf, added some comments that he should read.
6208 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6209 used and it gave compiler warnings.
6210 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6213 * src/lyx_gui.C (create_forms): do the right thing when
6214 show_banner is true/false.
6216 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6217 show_banner is false.
6219 * most file writing files: Now use iostreams to do almost all of
6220 the writing. Also instead of passing string &, we now use
6221 stringstreams. mathed output is still not adapted to iostreams.
6222 This change can be turned off by commenting out all the occurences
6223 of the "#define USE_OSTREAM_ONLY 1" lines.
6225 * src/WorkArea.C (createPixmap): don't output debug messages.
6226 (WorkArea): don't output debug messages.
6228 * lib/lyxrc.example: added a comment about the new variable
6231 * development/Code_rules/Rules: Added some more commente about how
6232 to build class interfaces and on how better encapsulation can be
6235 2000-03-03 Juergen Vigna <jug@sad.it>
6237 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6238 automatically with the width of the LyX-Window
6240 * src/insets/insettext.C (computeTextRows): fixed update bug in
6241 displaying text-insets (scrollvalues where not initialized!)
6243 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6245 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6246 id in the check of the result from lower_bound is not enough since
6247 lower_bound can return last too, and then res->id will not be a
6250 * all insets and some code that use them: I have conditionalized
6251 removed the Latex(string & out, ...) this means that only the
6252 Latex(ostream &, ...) will be used. This is a work in progress to
6253 move towards using streams for all output of files.
6255 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6258 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6260 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6261 routine (this fixes bug where greek letters were surrounded by too
6264 * src/support/filetools.C (findtexfile): change a bit the search
6265 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6266 no longer passed to kpsewhich, we may have to change that later.
6268 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6269 warning options to avoid problems with X header files (from Angus
6271 * acinclude.m4: regenerated.
6273 2000-03-02 Juergen Vigna <jug@sad.it>
6275 * src/insets/insettext.C (WriteParagraphData): Using the
6276 par->writeFile() function for writing paragraph-data.
6277 (Read): Using buffer->parseSingleLyXformat2Token()-function
6278 for parsing paragraph data!
6280 * src/buffer.C (readLyXformat2): removed all parse data and using
6281 the new parseSingleLyXformat2Token()-function.
6282 (parseSingleLyXformat2Token): added this function to parse (read)
6283 lyx-file-format (this is called also from text-insets now!)
6285 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6287 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6290 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6291 directly instead of going through a func. One very bad thing: a
6292 static LyXFindReplace, but I don't know where to place it.
6294 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6295 string instead of char[]. Also changed to static.
6296 (GetSelectionOrWordAtCursor): changed to static inline
6297 (SetSelectionOverLenChars): ditto.
6299 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6300 current_view and global variables. both classes has changed names
6301 and LyXFindReplace is not inherited from SearchForm.
6303 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6304 fl_form_search form.
6306 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6308 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6310 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6311 bound (from Kayvan).
6313 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6315 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6317 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6319 * some things that I should comment but the local pub says head to
6322 * comment out all code that belongs to the Roff code for Ascii
6323 export of tables. (this is unused)
6325 * src/LyXView.C: use correct type for global variable
6326 current_layout. (LyXTextClass::size_type)
6328 * some code to get the new insetgraphics closer to working I'd be
6329 grateful for any help.
6331 * src/BufferView2.C (insertInset): use the return type of
6332 NumberOfLayout properly. (also changes in other files)
6334 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6335 this as a test. I want to know what breaks because of this.
6337 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6339 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6341 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6342 to use a \makebox in the label, this allows proper justification
6343 with out using protected spaces or multiple hfills. Now it is
6344 "label" for left justified, "\hfill label\hfill" for center, and
6345 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6346 should be changed accordingly.
6348 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6350 * src/lyxtext.h: change SetLayout() to take a
6351 LyXTextClass::size_type instead of a char (when there is more than
6352 127 layouts in a class); also change type of copylayouttype.
6353 * src/text2.C (SetLayout): ditto.
6354 * src/LyXView.C (updateLayoutChoice): ditto.
6356 * src/LaTeX.C (scanLogFile): errors where the line number was not
6357 given just after the '!'-line were ignored (from Dekel Tsur).
6359 * lib/lyxrc.example: fix description of \date_insert_format
6361 * lib/layouts/llncs.layout: new layout, contributed by Martin
6364 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6366 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6367 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6368 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6369 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6370 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6371 paragraph.C, text.C, text2.C)
6373 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6375 * src/insets/insettext.C (LocalDispatch): remove extra break
6378 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6379 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6381 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6382 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6384 * src/insets/insetbib.h: move InsetBibkey::Holder and
6385 InsetCitation::Holder in public space.
6387 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6389 * src/insets/insettext.h: small change to get the new files from
6390 Juergen to compile (use "string", not "class string").
6392 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6393 const & as parameter to LocalDispatch, use LyXFont const & as
6394 paramter to some other func. This also had impacto on lyxinsets.h
6395 and the two mathed insets.
6397 2000-02-24 Juergen Vigna <jug@sad.it>
6400 * src/commandtags.h:
6402 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6406 * src/BufferView2.C: added/updated code for various inset-functions
6408 * src/insets/insetert.[Ch]: added implementation of InsetERT
6410 * src/insets/insettext.[Ch]: added implementation of InsetText
6412 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6413 (draw): added preliminary code for inset scrolling not finshed yet
6415 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6416 as it is in lyxfunc.C now
6418 * src/insets/lyxinset.h: Added functions for text-insets
6420 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6422 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6423 BufferView and reimplement the list as a queue put inside its own
6426 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6428 * several files: use the new interface to the "updateinsetlist"
6430 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6432 (work_area_handler): call BufferView::trippleClick on trippleclick.
6434 * src/BufferView.C (doubleClick): new function, selects word on
6436 (trippleClick): new function, selects line on trippleclick.
6438 2000-02-22 Allan Rae <rae@lyx.org>
6440 * lib/bind/xemacs.bind: buffer-previous not supported
6442 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6444 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6447 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6449 * src/bufferlist.C: get rid of current_view from this file
6451 * src/spellchecker.C: get rid of current_view from this file
6453 * src/vspace.C: get rid of current_view from this file
6454 (inPixels): added BufferView parameter for this func
6455 (asLatexCommand): added a BufferParams for this func
6457 * src/text.C src/text2.C: get rid of current_view from these
6460 * src/lyxfont.C (getFontDirection): move this function here from
6463 * src/bufferparams.C (getDocumentDirection): move this function
6466 * src/paragraph.C (getParDirection): move this function here from
6468 (getLetterDirection): ditto
6470 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6472 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6473 resize due to wrong pixmap beeing used. Also took the opurtunity
6474 to make the LyXScreen stateless on regard to WorkArea and some
6475 general cleanup in the same files.
6477 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6479 * src/Makefile.am: add missing direction.h
6481 * src/PainterBase.h: made the width functions const.
6483 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6486 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6488 * src/insets/insetlatexaccent.C (draw): make the accents draw
6489 better, at present this will only work well with iso8859-1.
6491 * several files: remove the old drawing code, now we use the new
6494 * several files: remove support for mono_video, reverse_video and
6497 2000-02-17 Juergen Vigna <jug@sad.it>
6499 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6500 int ** as we have to return the pointer, otherwise we have only
6501 NULL pointers in the returning function.
6503 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6505 * src/LaTeX.C (operator()): quote file name when running latex.
6507 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6509 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6510 (bubble tip), this removes our special handling of this.
6512 * Remove all code that is unused now that we have the new
6513 workarea. (Code that are not active when NEW_WA is defined.)
6515 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6517 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6519 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6520 nonexisting layout; correctly redirect obsoleted layouts.
6522 * lib/lyxrc.example: document \view_dvi_paper_option
6524 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6527 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6528 (PreviewDVI): handle the view_dvi_paper_option variable.
6529 [Both from Roland Krause]
6531 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6533 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6534 char const *, int, LyXFont)
6535 (text(int, int, string, LyXFont)): ditto
6537 * src/text.C (InsertCharInTable): attempt to fix the double-space
6538 feature in tables too.
6539 (BackspaceInTable): ditto.
6540 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6542 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6544 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6546 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6547 newly found text in textcache to this.
6548 (buffer): set the owner of the text put into the textcache to 0
6550 * src/insets/figinset.C (draw): fixed the drawing of figures with
6553 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6554 drawing of mathframe, hfills, protected space, table lines. I have
6555 now no outstanding drawing problems with the new Painter code.
6557 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6559 * src/PainterBase.C (ellipse, circle): do not specify the default
6562 * src/LColor.h: add using directive.
6564 * src/Painter.[Ch]: change return type of methods from Painter& to
6565 PainterBase&. Add a using directive.
6567 * src/WorkArea.C: wrap xforms callbacks in C functions
6570 * lib/layouts/foils.layout: font fix and simplifications from Carl
6573 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6575 * a lot of files: The Painter, LColor and WorkArea from the old
6576 devel branch has been ported to lyx-devel. Some new files and a
6577 lot of #ifdeffed code. The new workarea is enabled by default, but
6578 if you want to test the new Painter and LColor you have to compile
6579 with USE_PAINTER defined (do this in config.h f.ex.) There are
6580 still some rought edges, and I'd like some help to clear those
6581 out. It looks stable (loads and displays the Userguide very well).
6584 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6586 * src/buffer.C (pop_tag): revert to the previous implementation
6587 (use a global variable for both loops).
6589 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6591 * src/lyxrc.C (LyXRC): change slightly default date format.
6593 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6594 there is an English text with a footnote that starts with a Hebrew
6595 paragraph, or vice versa.
6596 (TeXFootnote): ditto.
6598 * src/text.C (LeftMargin): allow for negative values for
6599 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6602 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6603 for input encoding (cyrillic)
6605 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6607 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6610 * src/toolbar.C (set): ditto
6611 * src/insets/insetbib.C (create_form_citation_form): ditto
6613 * lib/CREDITS: added Dekel Tsur.
6615 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6616 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6617 hebrew supports files from Dekel Tsur.
6619 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6620 <tzafrir@technion.ac.il>
6622 * src/lyxrc.C: put \date_insert_format at the right place.
6624 * src/buffer.C (makeLaTeXFile): fix the handling of
6625 BufferParams::sides when writing out latex files.
6627 * src/BufferView2.C: add a "using" directive.
6629 * src/support/lyxsum.C (sum): when we use lyxstring,
6630 ostringstream::str needs an additional .c_str().
6632 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6634 * src/support/filetools.C (ChangeExtension): patch from Etienne
6637 * src/TextCache.C (show): remove const_cast and make second
6638 parameter non-const LyXText *.
6640 * src/TextCache.h: use non const LyXText in show.
6642 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6645 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6647 * src/support/lyxsum.C: rework to be more flexible.
6649 * several places: don't check if a pointer is 0 if you are going
6652 * src/text.C: remove some dead code.
6654 * src/insets/figinset.C: remove some dead code
6656 * src/buffer.C: move the BufferView funcs to BufferView2.C
6657 remove all support for insetlatexdel
6658 remove support for oldpapersize stuff
6659 made some member funcs const
6661 * src/kbmap.C: use a std::list to store the bindings in.
6663 * src/BufferView2.C: new file
6665 * src/kbsequence.[Ch]: new files
6667 * src/LyXAction.C + others: remove all trace of buffer-previous
6669 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6670 only have one copy in the binary of this table.
6672 * hebrew patch: moved some functions from LyXText to more
6673 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6675 * several files: remove support for XForms older than 0.88
6677 remove some #if 0 #endif code
6679 * src/TextCache.[Ch]: new file. Holds the textcache.
6681 * src/BufferView.C: changes to use the new TextCache interface.
6682 (waitForX): remove the now unused code.
6684 * src/BackStack.h: remove some commented code
6686 * lib/bind/emacs.bind: remove binding for buffer-previous
6688 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6690 * applied the hebrew patch.
6692 * src/lyxrow.h: make sure that all Row variables are initialized.
6694 * src/text2.C (TextHandleUndo): comment out a delete, this might
6695 introduce a memory leak, but should also help us to not try to
6696 read freed memory. We need to look at this one.
6698 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6699 (LyXParagraph): initalize footnotekind.
6701 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6702 forgot this when applying the patch. Please heed the warnings.
6704 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6705 (aka. reformat problem)
6707 * src/bufferlist.C (exists): made const, and use const_iterator
6708 (isLoaded): new func.
6709 (release): use std::find to find the correct buffer.
6711 * src/bufferlist.h: made getState a const func.
6712 made empty a const func.
6713 made exists a const func.
6716 2000-02-01 Juergen Vigna <jug@sad.it>
6718 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6720 * po/it.po: updated a bit the italian po file and also changed the
6721 'file nuovo' for newfile to 'filenuovo' without a space, this did
6724 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6725 for the new insert_date command.
6727 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6728 from jdblair, to insert a date into the current text conforming to
6729 a strftime format (for now only considering the locale-set and not
6730 the document-language).
6732 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6734 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6735 Bounds Read error seen by purify. The problem was that islower is
6736 a macros which takes an unsigned char and uses it as an index for
6737 in array of characters properties (and is thus subject to the
6741 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6742 correctly the paper sides radio buttons.
6743 (UpdateDocumentButtons): ditto.
6745 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6747 * src/kbmap.C (getsym + others): change to return unsigned int,
6748 returning a long can give problems on 64 bit systems. (I assume
6749 that int is 32bit on 64bit systems)
6751 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6753 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6754 LyXLookupString to be zero-terminated. Really fixes problems seen
6757 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6759 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6760 write a (char*)0 to the lyxerr stream.
6762 * src/lastfiles.C: move algorithm before the using statemets.
6764 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6766 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6767 complains otherwise).
6768 * src/table.C: ditto
6770 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6773 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6774 that I removed earlier... It is really needed.
6776 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6778 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6780 * INSTALL: update xforms home page URL.
6782 * lib/configure.m4: fix a bug with unreadable layout files.
6784 * src/table.C (calculate_width_of_column): add "using std::max"
6787 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6789 * several files: marked several lines with "DEL LINE", this is
6790 lines that can be deleted without changing anything.
6791 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6792 checks this anyway */
6795 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6797 * src/DepTable.C (update): add a "+" at the end when the checksum
6798 is different. (debugging string only)
6800 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6801 the next inset to not be displayed. This should also fix the list
6802 of labels in the "Insert Crossreference" dialog.
6804 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6806 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6807 when regex was not found.
6809 * src/support/lstrings.C (lowercase): use handcoded transform always.
6812 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6813 old_cursor.par->prev could be 0.
6815 * several files: changed post inc/dec to pre inc/dec
6817 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6818 write the lastfiles to file.
6820 * src/BufferView.C (buffer): only show TextCache info when debugging
6822 (resizeCurrentBuffer): ditto
6823 (workAreaExpose): ditto
6825 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6827 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6829 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6830 a bit better by removing the special case for \i and \j.
6832 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6834 * src/lyx_main.C (easyParse): remove test for bad comand line
6835 options, since this broke all xforms-related parsing.
6837 * src/kbmap.C (getsym): set return type to unsigned long, as
6838 declared in header. On an alpha, long is _not_ the same as int.
6840 * src/support/LOstream.h: add a "using std::flush;"
6842 * src/insets/figinset.C: ditto.
6844 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6846 * src/bufferlist.C (write): use blinding fast file copy instead of
6847 "a char at a time", now we are doing it the C++ way.
6849 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6850 std::list<int> instead.
6851 (addpidwait): reflect move to std::list<int>
6852 (sigchldchecker): ditto
6854 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6857 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6858 that obviously was wrong...
6860 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6861 c, this avoids warnings with purify and islower.
6863 * src/insets/figinset.C: rename struct queue to struct
6864 queue_element and rewrite to use a std::queue. gsqueue is now a
6865 std::queue<queue_element>
6866 (runqueue): reflect move to std::queue
6869 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6870 we would get "1" "0" instead of "true" "false. Also make the tostr
6873 2000-01-21 Juergen Vigna <jug@sad.it>
6875 * src/buffer.C (writeFileAscii): Disabled code for special groff
6876 handling of tabulars till I fix this in table.C
6878 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6880 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6882 * src/support/lyxlib.h: ditto.
6884 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6886 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6887 and 'j' look better. This might fix the "macron" bug that has been
6890 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6891 functions as one template function. Delete the old versions.
6893 * src/support/lyxsum.C: move using std::ifstream inside
6896 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6899 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6901 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6903 * src/insets/figinset.C (InitFigures): use new instead of malloc
6904 to allocate memory for figures and bitmaps.
6905 (DoneFigures): use delete[] instead of free to deallocate memory
6906 for figures and bitmaps.
6907 (runqueue): use new to allocate
6908 (getfigdata): use new/delete[] instead of malloc/free
6909 (RegisterFigure): ditto
6911 * some files: moved some declarations closer to first use, small
6912 whitespace changes use preincrement instead of postincrement where
6913 it does not make a difference.
6915 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6916 step on the way to use stl::containers for key maps.
6918 * src/bufferlist.h: add a typedef for const_iterator and const
6919 versions of begin and end.
6921 * src/bufferlist.[Ch]: change name of member variable _state to
6922 state_. (avoid reserved names)
6924 (getFileNames): returns the filenames of the buffers in a vector.
6926 * configure.in (ALL_LINGUAS): added ro
6928 * src/support/putenv.C: new file
6930 * src/support/mkdir.C: new file
6932 2000-01-20 Allan Rae <rae@lyx.org>
6934 * lib/layouts/IEEEtran.layout: Added several theorem environments
6936 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6937 couple of minor additions.
6939 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6940 (except for those in footnotes of course)
6942 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6944 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6946 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6947 std::sort and std::lower_bound instead of qsort and handwritten
6949 (struct compara): struct that holds the functors used by std::sort
6950 and std::lower_bound in MathedLookupBOP.
6952 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6954 * src/support/LAssert.h: do not do partial specialization. We do
6957 * src/support/lyxlib.h: note that lyx::getUserName() and
6958 lyx::date() are not in use right now. Should these be suppressed?
6960 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6961 (makeLinuxDocFile): do not put date and user name in linuxdoc
6964 * src/support/lyxlib.h (kill): change first argument to long int,
6965 since that's what solaris uses.
6967 * src/support/kill.C (kill): fix declaration to match prototype.
6969 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6970 actually check whether namespaces are supported. This is not what
6973 * src/support/lyxsum.C: add a using directive.
6975 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6977 * src/support/kill.C: if we have namespace support we don't have
6978 to include lyxlib.h.
6980 * src/support/lyxlib.h: use namespace lyx if supported.
6982 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6984 * src/support/date.C: new file
6986 * src/support/chdir.C: new file
6988 * src/support/getUserName.C: new file
6990 * src/support/getcwd.C: new file
6992 * src/support/abort.C: new file
6994 * src/support/kill.C: new file
6996 * src/support/lyxlib.h: moved all the functions in this file
6997 insede struct lyx. Added also kill and abort to this struct. This
6998 is a way to avoid the "kill is not defined in <csignal>", we make
6999 C++ wrappers for functions that are not ANSI C or ANSI C++.
7001 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7002 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7003 lyx it has been renamed to sum.
7005 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7007 * src/text.C: add using directives for std::min and std::max.
7009 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7011 * src/texrow.C (getIdFromRow): actually return something useful in
7012 id and pos. Hopefully fixes the bug with positionning of errorbox
7015 * src/lyx_main.C (easyParse): output an error and exit if an
7016 incorrect command line option has been given.
7018 * src/spellchecker.C (ispell_check_word): document a memory leak.
7020 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7021 where a "struct utimbuf" is allocated with "new" and deleted with
7024 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7026 * src/text2.C (CutSelection): don't delete double spaces.
7027 (PasteSelection): ditto
7028 (CopySelection): ditto
7030 * src/text.C (Backspace): don't delete double spaces.
7032 * src/lyxlex.C (next): fix a bug that were only present with
7033 conformant std::istream::get to read comment lines, use
7034 std::istream::getline instead. This seems to fix the problem.
7036 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7038 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7039 allowed to insert space before space" editing problem. Please read
7040 commends at the beginning of the function. Comments about usage
7043 * src/text.C (InsertChar): fix for the "not allowed to insert
7044 space before space" editing problem.
7046 * src/text2.C (DeleteEmptyParagraphMechanism): when
7047 IsEmptyTableRow can only return false this last "else if" will
7048 always be a no-op. Commented out.
7050 * src/text.C (RedoParagraph): As far as I can understand tmp
7051 cursor is not really needed.
7053 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7054 present it could only return false anyway.
7055 (several functions): Did something not so smart...added a const
7056 specifier on a lot of methods.
7058 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7059 and add a tmp->text.resize. The LyXParagraph constructor does the
7061 (BreakParagraphConservative): ditto
7063 * src/support/path.h (Path): add a define so that the wrong usage
7064 "Path("/tmp") will be flagged as a compilation error:
7065 "`unnamed_Path' undeclared (first use this function)"
7067 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7069 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7070 which was bogus for several reasons.
7072 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7076 * autogen.sh: do not use "type -path" (what's that anyway?).
7078 * src/support/filetools.C (findtexfile): remove extraneous space
7079 which caused a kpsewhich warning (at least with kpathsea version
7082 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7084 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7086 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7088 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7090 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7092 * src/paragraph.C (BreakParagraph): do not reserve space on text
7093 if we don't need to (otherwise, if pos_end < pos, we end up
7094 reserving huge amounts of memory due to bad unsigned karma).
7095 (BreakParagraphConservative): ditto, although I have not seen
7096 evidence the bug can happen here.
7098 * src/lyxparagraph.h: add a using std::list.
7100 2000-01-11 Juergen Vigna <jug@sad.it>
7102 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7105 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7107 * src/vc-backend.C (doVCCommand): change to be static and take one
7108 more parameter: the path to chdir too be fore executing the command.
7109 (retrive): new function equiv to "co -r"
7111 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7112 file_not_found_hook is true.
7114 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7116 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7117 if a file is readwrite,readonly...anything else.
7119 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7121 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7122 (CreatePostscript): name change from MenuRunDVIPS (or something)
7123 (PreviewPostscript): name change from MenuPreviewPS
7124 (PreviewDVI): name change from MenuPreviewDVI
7126 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7127 \view_pdf_command., \pdf_to_ps_command
7129 * lib/configure.m4: added search for PDF viewer, and search for
7130 PDF to PS converter.
7131 (lyxrc.defaults output): add \pdflatex_command,
7132 \view_pdf_command and \pdf_to_ps_command.
7134 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7136 * src/bufferlist.C (write): we don't use blocksize for anything so
7139 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7141 * src/support/block.h: disable operator T* (), since it causes
7142 problems with both compilers I tried. See comments in the file.
7144 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7147 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7148 variable LYX_DIR_10x to LYX_DIR_11x.
7150 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7152 * INSTALL: document --with-lyxname.
7155 * configure.in: new configure flag --with-lyxname which allows to
7156 choose the name under which lyx is installed. Default is "lyx", of
7157 course. It used to be possible to do this with --program-suffix,
7158 but the later has in fact a different meaning for autoconf.
7160 * src/support/lstrings.h (lstrchr): reformat a bit.
7162 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7163 * src/mathed/math_defs.h: ditto.
7165 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7167 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7168 true, decides if we create a backup file or not when saving. New
7169 tag and variable \pdf_mode, defaults to false. New tag and
7170 variable \pdflatex_command, defaults to pdflatex. New tag and
7171 variable \view_pdf_command, defaults to xpdf. New tag and variable
7172 \pdf_to_ps_command, defaults to pdf2ps.
7174 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7176 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7177 does not have a BufferView.
7178 (unlockInset): ditto + don't access the_locking_inset if the
7179 buffer does not have a BufferView.
7181 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7182 certain circumstances so that we don't continue a keyboard
7183 operation long after the key was released. Try f.ex. to load a
7184 large document, press PageDown for some seconds and then release
7185 it. Before this change the document would contine to scroll for
7186 some time, with this change it stops imidiatly.
7188 * src/support/block.h: don't allocate more space than needed. As
7189 long as we don't try to write to the arr[x] in a array_type arr[x]
7190 it is perfectly ok. (if you write to it you might segfault).
7191 added operator value_type*() so that is possible to pass the array
7192 to functions expecting a C-pointer.
7194 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7197 * intl/*: updated to gettext 0.10.35, tried to add our own
7198 required modifications. Please verify.
7200 * po/*: updated to gettext 0.10.35, tried to add our own required
7201 modifications. Please verify.
7203 * src/support/lstrings.C (tostr): go at fixing the problem with
7204 cxx and stringstream. When stringstream is used return
7205 oss.str().c_str() so that problems with lyxstring and basic_string
7206 are avoided. Note that the best solution would be for cxx to use
7207 basic_string all the way, but it is not conformant yet. (it seems)
7209 * src/lyx_cb.C + other files: moved several global functions to
7210 class BufferView, some have been moved to BufferView.[Ch] others
7211 are still located in lyx_cb.C. Code changes because of this. (part
7212 of "get rid of current_view project".)
7214 * src/buffer.C + other files: moved several Buffer functions to
7215 class BufferView, the functions are still present in buffer.C.
7216 Code changes because of this.
7218 * config/lcmessage.m4: updated to most recent. used when creating
7221 * config/progtest.m4: updated to most recent. used when creating
7224 * config/gettext.m4: updated to most recent. applied patch for
7227 * config/gettext.m4.patch: new file that shows what changes we
7228 have done to the local copy of gettext.m4.
7230 * config/libtool.m4: new file, used in creation of acinclude.m4
7232 * config/lyxinclude.m4: new file, this is the lyx created m4
7233 macros, used in making acinclude.m4.
7235 * autogen.sh: GNU m4 discovered as a separate task not as part of
7236 the lib/configure creation.
7237 Generate acinlucde from files in config. Actually cat
7238 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7239 easier to upgrade .m4 files that really are external.
7241 * src/Spacing.h: moved using std::istringstream to right after
7242 <sstream>. This should fix the problem seen with some compilers.
7244 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7246 * src/lyx_cb.C: began some work to remove the dependency a lot of
7247 functions have on BufferView::text, even if not really needed.
7248 (GetCurrentTextClass): removed this func, it only hid the
7251 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7252 forgot this in last commit.
7254 * src/Bullet.C (bulletEntry): use static char const *[] for the
7255 tables, becuase of this the return arg had to change to string.
7257 (~Bullet): removed unneeded destructor
7259 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7260 (insetSleep): moved from Buffer
7261 (insetWakeup): moved from Buffer
7262 (insetUnlock): moved from Buffer
7264 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7265 from Buffer to BufferView.
7267 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7269 * config/ltmain.sh: updated to version 1.3.4 of libtool
7271 * config/ltconfig: updated to version 1.3.4 of libtool
7273 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7276 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7277 Did I get that right?
7279 * src/lyxlex.h: add a "using" directive or two.
7280 * src/Spacing.h: ditto.
7281 * src/insets/figinset.C: ditto.
7282 * src/support/filetools.C: ditto.
7283 * src/support/lstrings.C: ditto.
7284 * src/BufferView.C: ditto.
7285 * src/bufferlist.C: ditto.
7286 * src/lyx_cb.C: ditto.
7287 * src/lyxlex.C: ditto.
7289 * NEWS: add some changes for 1.1.4.
7291 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7293 * src/BufferView.C: first go at a TextCache to speed up switching
7296 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7298 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7299 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7300 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7301 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7304 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7305 members of the struct are correctly initialized to 0 (detected by
7307 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7308 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7310 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7311 pidwait, since it was allocated with "new". This was potentially
7312 very bad. Thanks to Michael Schmitt for running purify for us.
7315 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7317 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7319 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7321 1999-12-30 Allan Rae <rae@lyx.org>
7323 * lib/templates/IEEEtran.lyx: minor change
7325 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7326 src/mathed/formula.C (LocalDispatch): askForText changes
7328 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7329 know when a user has cancelled input. Fixes annoying problems with
7330 inserting labels and version control.
7332 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7334 * src/support/lstrings.C (tostr): rewritten to use strstream and
7337 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7339 * src/support/filetools.C (IsFileWriteable): use fstream to check
7340 (IsDirWriteable): use fileinfo to check
7342 * src/support/filetools.h (FilePtr): whole class deleted
7344 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7346 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7348 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7350 * src/bufferlist.C (write): use ifstream and ofstream instead of
7353 * src/Spacing.h: use istrstream instead of sscanf
7355 * src/mathed/math_defs.h: change first arg to istream from FILE*
7357 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7359 * src/mathed/math_parser.C: have yyis to be an istream
7360 (LexGetArg): use istream (yyis)
7362 (mathed_parse): ditto
7363 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7365 * src/mathed/formula.C (Read): rewritten to use istream
7367 * src/mathed/formulamacro.C (Read): rewritten to use istream
7369 * src/lyxlex.h (~LyXLex): deleted desturctor
7370 (getStream): new function, returns an istream
7371 (getFile): deleted funtion
7372 (IsOK): return is.good();
7374 * src/lyxlex.C (LyXLex): delete file and owns_file
7375 (setFile): open an filebuf and assign that to a istream instead of
7377 (setStream): new function, takes an istream as arg.
7378 (setFile): deleted function
7379 (EatLine): rewritten us use istream instead of FILE*
7383 * src/table.C (LyXTable): use istream instead of FILE*
7384 (Read): rewritten to take an istream instead of FILE*
7386 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7388 * src/buffer.C (Dispatch): remove an extraneous break statement.
7390 * src/support/filetools.C (QuoteName): change to do simple
7391 'quoting'. More work is necessary. Also changed to do nothing
7392 under emx (needs fix too).
7393 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7395 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7396 config.h.in to the AC_DEFINE_UNQUOTED() call.
7397 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7398 needs char * as argument (because Solaris 7 declares it like
7401 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7402 remove definition of BZERO.
7404 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7406 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7407 defined, "lyxregex.h" if not.
7409 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7411 (REGEX): new variable that is set to regex.c lyxregex.h when
7412 AM_CONDITIONAL USE_REGEX is set.
7413 (libsupport_la_SOURCES): add $(REGEX)
7415 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7418 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7421 * configure.in: add call to LYX_REGEX
7423 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7424 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7426 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7428 * lib/bind/fi_menus.bind: new file, from
7429 pauli.virtanen@saunalahti.fi.
7431 * src/buffer.C (getBibkeyList): pass the parameter delim to
7432 InsetInclude::getKeys and InsetBibtex::getKeys.
7434 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7435 is passed to Buffer::getBibkeyList
7437 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7438 instead of the hardcoded comma.
7440 * src/insets/insetbib.C (getKeys): make sure that there are not
7441 leading blanks in bibtex keys. Normal latex does not care, but
7442 harvard.sty seems to dislike blanks at the beginning of citation
7443 keys. In particular, the retturn value of the function is
7445 * INSTALL: make it clear that libstdc++ is needed and that gcc
7446 2.7.x probably does not work.
7448 * src/support/filetools.C (findtexfile): make debug message go to
7450 * src/insets/insetbib.C (getKeys): ditto
7452 * src/debug.C (showTags): make sure that the output is correctly
7455 * configure.in: add a comment for TWO_COLOR_ICON define.
7457 * acconfig.h: remove all the entries that already defined in
7458 configure.in or acinclude.m4.
7460 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7461 to avoid user name, date and copyright.
7463 1999-12-21 Juergen Vigna <jug@sad.it>
7465 * src/table.C (Read): Now read bogus row format informations
7466 if the format is < 5 so that afterwards the table can
7467 be read by lyx but without any format-info. Fixed the
7468 crash we experienced when not doing this.
7470 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7472 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7473 (RedoDrawingOfParagraph): ditto
7474 (RedoParagraphs): ditto
7475 (RemoveTableRow): ditto
7477 * src/text.C (Fill): rename arg paperwidth -> paper_width
7479 * src/buffer.C (insertLyXFile): rename var filename -> fname
7480 (writeFile): rename arg filename -> fname
7481 (writeFileAscii): ditto
7482 (makeLaTeXFile): ditto
7483 (makeLinuxDocFile): ditto
7484 (makeDocBookFile): ditto
7486 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7489 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7491 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7494 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7495 compiled by a C compiler not C++.
7497 * src/layout.h (LyXTextClass): added typedef for const_iterator
7498 (LyXTextClassList): added typedef for const_iterator + member
7499 functions begin and end.
7501 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7502 iterators to fill the choice_class.
7503 (updateLayoutChoice): rewritten to use iterators to fill the
7504 layoutlist in the toolbar.
7506 * src/BufferView.h (BufferView::work_area_width): removed unused
7509 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7511 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7512 (sgmlCloseTag): ditto
7514 * src/support/lstrings.h: return type of countChar changed to
7517 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7518 what version of this func to use. Also made to return unsigned int.
7520 * configure.in: call LYX_STD_COUNT
7522 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7523 conforming std::count.
7525 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7527 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7528 and a subscript would give bad display (patch from Dekel Tsur
7529 <dekel@math.tau.ac.il>).
7531 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7533 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7536 * src/chset.h: add a few 'using' directives
7538 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7539 triggered when no buffer is active
7541 * src/layout.C: removed `break' after `return' in switch(), since
7544 * src/lyx_main.C (init): make sure LyX can be ran in place even
7545 when libtool has done its magic with shared libraries. Fix the
7546 test for the case when the system directory has not been found.
7548 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7549 name for the latex file.
7550 (MenuMakeHTML): ditto
7552 * src/buffer.h: add an optional boolean argument, which is passed
7555 1999-12-20 Allan Rae <rae@lyx.org>
7557 * lib/templates/IEEEtran.lyx: small correction and update.
7559 * configure.in: Attempted to use LYX_PATH_HEADER
7561 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7563 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7564 input from JMarc. Now use preprocessor to find the header.
7565 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7566 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7567 LYX_STL_STRING_FWD. See comments in file.
7569 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7571 * The global MiniBuffer * minibuffer variable is dead.
7573 * The global FD_form_main * fd_form_main variable is dead.
7575 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7577 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7579 * src/table.h: add the LOstream.h header
7580 * src/debug.h: ditto
7582 * src/LyXAction.h: change the explaination of the ReadOnly
7583 attribute: is indicates that the function _can_ be used.
7585 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7588 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7590 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7596 * src/paragraph.C (GetWord): assert on pos>=0
7599 * src/support/lyxstring.C: condition the use of an invariant on
7601 * src/support/lyxstring.h: ditto
7603 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7604 Use LAssert.h instead of plain assert().
7606 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7608 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7609 * src/support/filetools.C: ditto
7611 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7614 * INSTALL: document the new configure flags
7616 * configure.in: suppress --with-debug; add --enable-assertions
7618 * acinclude.m4: various changes in alignment of help strings.
7620 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7622 * src/kbmap.C: commented out the use of the hash map in kb_map,
7623 beginning of movement to a stl::container.
7625 * several files: removed code that was not in effect when
7626 MOVE_TEXT was defined.
7628 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7629 for escaping should not be used. We can discuss if the string
7630 should be enclosed in f.ex. [] instead of "".
7632 * src/trans_mgr.C (insert): use the new returned value from
7633 encodeString to get deadkeys and keymaps done correctly.
7635 * src/chset.C (encodeString): changed to return a pair, to tell
7636 what to use if we know the string.
7638 * src/lyxscreen.h (fillArc): new function.
7640 * src/FontInfo.C (resize): rewritten to use more std::string like
7641 structore, especially string::replace.
7643 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7646 * configure.in (chmod +x some scripts): remove config/gcc-hack
7648 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7650 * src/buffer.C (writeFile): change once again the top comment in a
7651 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7652 instead of an hardcoded version number.
7653 (makeDocBookFile): ditto
7655 * src/version.h: add new define LYX_DOCVERSION
7657 * po/de.po: update from Pit Sütterlin
7658 * lib/bind/de_menus.bind: ditto.
7660 * src/lyxfunc.C (Dispatch): call MenuExport()
7661 * src/buffer.C (Dispatch): ditto
7663 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7664 LyXFunc::Dispatch().
7665 (MenuExport): new function, moved from
7666 LyXFunc::Dispatch().
7668 * src/trans_mgr.C (insert): small cleanup
7669 * src/chset.C (loadFile): ditto
7671 * lib/kbd/iso8859-1.cdef: add missing backslashes
7673 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7675 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7676 help with placing the manually drawn accents better.
7678 (Draw): x2 and hg changed to float to minimize rounding errors and
7679 help place the accents better.
7681 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7682 unsigned short to char is just wrong...cast the char to unsigned
7683 char instead so that the two values can compare sanely. This
7684 should also make the display of insetlatexaccents better and
7685 perhaps also some other insets.
7687 (lbearing): new function
7690 1999-12-15 Allan Rae <rae@lyx.org>
7692 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7693 header that provides a wrapper around the very annoying SGI STL header
7696 * src/support/lyxstring.C, src/LString.h:
7697 removed old SGI-STL-compatability attempts.
7699 * configure.in: Use LYX_STL_STRING_FWD.
7701 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7702 stl_string_fwd.h is around and try to determine it's location.
7703 Major improvement over previous SGI STL 3.2 compatability.
7704 Three small problems remain with this function due to my zero
7705 knowledge of autoconf. JMarc and lgb see the comments in the code.
7707 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7709 * src/broken_const.h, config/hack-gcc, config/README: removed
7711 * configure.in: remove --with-gcc-hack option; do not call
7714 * INSTALL: remove documentation of --with-broken-const and
7717 * acconfig.h: remove all trace of BROKEN_CONST define
7719 * src/buffer.C (makeDocBookFile): update version number in output
7721 (SimpleDocBookOnePar): fix an assert when trying to a character
7722 access beyond string length
7725 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7727 * po/de.po: fix the Export menu
7729 * lyx.man: update the description of -dbg
7731 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7732 (commandLineHelp): updated
7733 (easyParse): show list of available debug levels if -dbg is passed
7736 * src/Makefile.am: add debug.C
7738 * src/debug.h: moved some code to debug.C
7740 * src/debug.C: new file. Contains code to set and show debug
7743 * src/layout.C: remove 'break' after 'continue' in switch
7744 statements, since these cannot be reached.
7746 1999-12-13 Allan Rae <rae@lyx.org>
7748 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7749 (in_word_set): hash() -> math_hash()
7751 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7753 * acconfig.h: Added a test for whether we are using exceptions in the
7754 current compilation run. If so USING_EXCEPTIONS is defined.
7756 * config.in: Check for existance of stl_string_fwd.h
7757 * src/LString.h: If compiling --with-included-string and SGI's
7758 STL version 3.2 is present (see above test) we need to block their
7759 forward declaration of string and supply a __get_c_string().
7760 However, it turns out this is only necessary if compiling with
7761 exceptions enabled so I've a bit more to add yet.
7763 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7764 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7765 src/support/LRegex.h, src/undo.h:
7766 Shuffle the order of the included files a little to ensure that
7767 LString.h gets included before anything that includes stl_string_fwd.h
7769 * src/support/lyxstring.C: We need to #include LString.h instead of
7770 lyxstring.h to get the necessary definition of __get_c_string.
7771 (__get_c_string): New function. This is defined static just like SGI's
7772 although why they need to do this I'm not sure. Perhaps it should be
7773 in lstrings.C instead.
7775 * lib/templates/IEEEtran.lyx: New template file.
7777 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7779 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7780 * intl/Makefile.in (MKINSTALLDIRS): ditto
7782 * src/LyXAction.C (init): changed to hold the LFUN data in a
7783 automatic array in stead of in callso to newFunc, this speeds up
7784 compilation a lot. Also all the memory used by the array is
7785 returned when the init is completed.
7787 * a lot of files: compiled with -Wold-style-cast, changed most of
7788 the reported offenders to C++ style casts. Did not change the
7789 offenders in C files.
7791 * src/trans.h (Match): change argument type to unsigned int.
7793 * src/support/DebugStream.C: fix some types on the streambufs so
7794 that it works on a conforming implementation.
7796 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7798 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7800 * src/support/lyxstring.C: remove the inline added earlier since
7801 they cause a bunch of unsatisfied symbols when linking with dec
7802 cxx. Cxx likes to have the body of inlines at the place where they
7805 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7806 accessing negative bounds in array. This fixes the crash when
7807 inserting accented characters.
7808 * src/trans.h (Match): ditto
7810 * src/buffer.C (Dispatch): since this is a void, it should not try
7811 to return anything...
7813 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7815 * src/buffer.h: removed the two friends from Buffer. Some changes
7816 because of this. Buffer::getFileName and Buffer::setFileName
7817 renamed to Buffer::fileName() and Buffer::fileName(...).
7819 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7821 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7822 and Buffer::update(short) to BufferView. This move is currently
7823 controlled by a define MOVE_TEXT, this will be removed when all
7824 shows to be ok. This move paves the way for better separation
7825 between buffer contents and buffer view. One side effect is that
7826 the BufferView needs a rebreak when swiching buffers, if we want
7827 to avoid this we can add a cache that holds pointers to LyXText's
7828 that is not currently in use.
7830 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7833 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7835 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7837 * lyx_main.C: new command line option -x (or --execute) and
7838 -e (or --export). Now direct conversion from .lyx to .tex
7839 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7840 Unfortunately, X is still needed and the GUI pops up during the
7843 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7845 * src/Spacing.C: add a using directive to bring stream stuff into
7847 * src/paragraph.C: ditto
7848 * src/buffer.C: ditto
7850 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7851 from Lars' announcement).
7853 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7854 example files from Tino Meinen.
7856 1999-12-06 Allan Rae <rae@lyx.org>
7858 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7860 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7862 * src/support/lyxstring.C: added a lot of inline for no good
7865 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7866 latexWriteEndChanges, they were not used.
7868 * src/layout.h (operator<<): output operator for PageSides
7870 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7872 * some example files: loaded in LyX 1.0.4 and saved again to update
7873 certain constructs (table format)
7875 * a lot of files: did the change to use fstream/iostream for all
7876 writing of files. Done with a close look at Andre Poenitz's patch.
7878 * some files: whitespace changes.
7880 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7882 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7883 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7884 architecture, we provide our own. It is used unconditionnally, but
7885 I do not think this is a performance problem. Thanks to Angus
7886 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7887 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7889 (GetInset): use my_memcpy.
7893 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7894 it is easier to understand, but it uses less TeX-only constructs now.
7896 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7897 elements contain spaces
7899 * lib/configure: regenerated
7901 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7902 elements contain spaces; display the list of programs that are
7905 * autogen.sh: make sure lib/configure is executable
7907 * lib/examples/*: rename the tutorial examples to begin with the
7908 two-letters language code.
7910 * src/lyxfunc.C (getStatus): do not query current font if no
7913 * src/lyx_cb.C (RunScript): use QuoteName
7914 (MenuRunDvips): ditto
7915 (PrintApplyCB): ditto
7917 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7918 around argument, so that it works well with the current shell.
7919 Does not work properly with OS/2 shells currently.
7921 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7922 * src/LyXSendto.C (SendtoApplyCB): ditto
7923 * src/lyxfunc.C (Dispatch): ditto
7924 * src/buffer.C (runLaTeX): ditto
7925 (runLiterate): ditto
7926 (buildProgram): ditto
7928 * src/lyx_cb.C (RunScript): ditto
7929 (MenuMakeLaTeX): ditto
7931 * src/buffer.h (getLatexName): new method
7933 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7935 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7937 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7938 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7939 (create_math_panel): ditto
7941 * src/lyxfunc.C (getStatus): re-activate the code which gets
7942 current font and cursor; add test for export to html.
7944 * src/lyxrc.C (read): remove unreachable break statements; add a
7947 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7949 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7951 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7952 introduced by faulty regex.
7953 * src/buffer.C: ditto
7954 * src/lastfiles.C: ditto
7955 * src/paragraph.C: ditto
7956 * src/table.C: ditto
7957 * src/vspace.C: ditto
7958 * src/insets/figinset.C: ditto
7959 Note: most of these is absolutely harmless, except the one in
7960 src/mathed formula.C.
7962 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7964 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7965 operation, yielding correct results for the reLyX command.
7967 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7969 * src/support/filetools.C (ExpandPath): removed an over eager
7971 (ReplaceEnvironmentPath): ditto
7973 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7974 shows that we are doing something fishy in our code...
7978 * src/lyxrc.C (read): use a double switch trick to get more help
7979 from the compiler. (the same trick is used in layout.C)
7980 (write): new function. opens a ofstream and pass that to output
7981 (output): new function, takes a ostream and writes the lyxrc
7982 elemts to it. uses a dummy switch to make sure no elements are
7985 * src/lyxlex.h: added a struct pushpophelper for use in functions
7986 with more than one exit point.
7988 * src/lyxlex.[Ch] (GetInteger): made it const
7992 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7994 * src/layout.[hC] : LayoutTags splitted into several enums, new
7995 methods created, better error handling cleaner use of lyxlex. Read
7998 * src/bmtable.[Ch]: change some member prototypes because of the
7999 image const changes.
8001 * commandtags.h, src/LyXAction.C (init): new function:
8002 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8003 This file is not read automatically but you can add \input
8004 preferences to your lyxrc if you want to. We need to discuss how
8007 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8008 in .aux, also remove .bib and .bst files from dependencies when
8011 * src/BufferView.C, src/LyXView.C: add const_cast several places
8012 because of changes to images.
8014 * lib/images/*: same change as for images/*
8016 * lib/lyxrc.example: Default for accept_compound is false not no.
8018 * images/*: changed to be const, however I have som misgivings
8019 about this change so it might be changed back.
8021 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8023 * lib/configure, po/POTFILES.in: regenerated
8025 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8027 * config/lib_configure.m4: removed
8029 * lib/configure.m4: new file (was config/lib_configure.m4)
8031 * configure.in: do not test for rtti, since we do not use it.
8033 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8035 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8036 doubling of allocated space scheme. This makes it faster for large
8037 strings end to use less memory for small strings. xtra rememoved.
8039 * src/insets/figinset.C (waitalarm): commented out.
8040 (GhostscriptMsg): use static_cast
8041 (GhostscriptMsg): use new instead of malloc to allocate memory for
8042 cmap. also delete the memory after use.
8044 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8046 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8047 for changes in bibtex database or style.
8048 (runBibTeX): remove all .bib and .bst files from dep before we
8050 (run): use scanAuc in when dep file already exist.
8052 * src/DepTable.C (remove_files_with_extension): new method
8055 * src/DepTable.[Ch]: made many of the methods const.
8057 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8059 * src/bufferparams.C: make sure that the default textclass is
8060 "article". It used to be the first one by description order, but
8061 now the first one is "docbook".
8063 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8064 string; call Debug::value.
8065 (easyParse): pass complete argument to setDebuggingLevel().
8067 * src/debug.h (value): fix the code that parses debug levels.
8069 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8072 * src/LyXAction.C: use Debug::ACTION as debug channel.
8074 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8076 * NEWS: updated for the future 1.1.3 release.
8078 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8079 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8080 it should. This is of course a controversial change (since many
8081 people will find that their lyx workscreen is suddenly full of
8082 red), but done for the sake of correctness.
8084 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8085 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8087 * src/insets/inseterror.h, src/insets/inseturl.h,
8088 src/insets/insetinfo.h, src/insets/figinset.h,
8089 src/mathed/formulamacro.h, src/mathed/math_macro.h
8090 (EditMessage): add a missing const and add _() to make sure that
8093 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8094 src/insets/insetbib.C, src/support/filetools.C: add `using'
8097 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8098 doing 'Insert index of last word' at the beginning of a paragraph.
8100 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8102 * several files: white-space changes.
8104 * src/mathed/formula.C: removed IsAlpha and IsDigit
8106 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8107 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8110 * src/insets/figinset.C (GetPSSizes): don't break when
8111 "EndComments" is seen. But break when a boundingbox is read.
8113 * all classes inherited from Inset: return value of Clone
8114 changed back to Inset *.
8116 * all classes inherited form MathInset: return value of Clone
8117 changed back to MathedInset *.
8119 * src/insets/figinset.C (runqueue): use a ofstream to output the
8120 gs/ps file. Might need some setpresicion or setw. However I can
8121 see no problem with the current code.
8122 (runqueue): use sleep instead of the alarm/signal code. I just
8123 can't see the difference.
8125 * src/paragraph.C (LyXParagraph): reserve space in the new
8126 paragraph and resize the inserted paragraph to just fit.
8128 * src/lyxfunc.h (operator|=): added operator for func_status.
8130 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8131 check for readable file.
8133 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8134 check for readable file.
8135 (MenuMakeLinuxDoc): ditto
8136 (MenuMakeDocBook): ditto
8137 (MenuMakeAscii): ditto
8138 (InsertAsciiFile): split the test for openable and readable
8140 * src/bmtable.C (draw_bitmaptable): use
8141 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8143 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8144 findtexfile from LaTeX to filetools.
8146 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8147 instead of FilePtr. Needs to be verified by a literate user.
8149 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8151 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8152 (EditMessage): likewise.
8154 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8155 respectively as \textasciitilde and \textasciicircum.
8157 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8159 * src/support/lyxstring.h: made the methods that take iterators
8162 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8163 (regexMatch): made is use the real regex class.
8165 * src/support/Makefile.am: changed to use libtool
8167 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8169 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8171 (MathIsInset ++): changed several macros to be inline functions
8174 * src/mathed/Makefile.am: changed to use libtool
8176 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8178 * src/insets/inset* : Clone changed to const and return type is
8179 the true insettype not just Inset*.
8181 * src/insets/Makefile.am: changed to use libtool
8183 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8185 * src/undo.[Ch] : added empty() and changed some of the method
8188 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8190 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8191 setID use block<> for the bullets array, added const several places.
8193 * src/lyxfunc.C (getStatus): new function
8195 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8196 LyXAction, added const to several funtions.
8198 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8199 a std::map, and to store the dir items in a vector.
8201 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8204 * src/LyXView.[Ch] + other files : changed currentView to view.
8206 * src/LyXAction.[Ch] : ported from the old devel branch.
8208 * src/.cvsignore: added .libs and a.out
8210 * configure.in : changes to use libtool.
8212 * acinclude.m4 : inserted libtool.m4
8214 * .cvsignore: added libtool
8216 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8218 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8219 file name in insets and mathed directories (otherwise the
8220 dependency is not taken in account under cygwin).
8222 * src/text2.C (InsertString[AB]): make sure that we do not try to
8223 read characters past the string length.
8225 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8227 * lib/doc/LaTeXConfig.lyx.in,
8228 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8230 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8231 file saying who created them and when this heppened; this is
8232 useless and annoys tools like cvs.
8234 * lib/layouts/g-brief-{en,de}.layout,
8235 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8236 from Thomas Hartkens <thomas@hartkens.de>.
8238 * src/{insets,mathed}/Makefile.am: do not declare an empty
8239 LDFLAGS, so that it can be set at configure time (useful on Irix
8242 * lib/reLyX/configure.in: make sure that the prefix is set
8243 correctly in LYX_DIR.
8245 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8247 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8248 be used by 'command-sequence' this allows to bind a key to a
8249 sequence of LyX-commands
8250 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8252 * src/LyXAction.C: add "command-sequence"
8254 * src/LyXFunction.C: handling of "command-sequence"
8256 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8257 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8259 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8261 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8263 * src/buffer.C (writeFile): Do not output a comment giving user
8264 and date at the beginning of a .lyx file. This is useless and
8265 annoys cvs anyway; update version number to 1.1.
8267 * src/Makefile.am (LYX_DIR): add this definition, so that a
8268 default path is hardcoded in LyX.
8270 * configure.in: Use LYX_GNU_GETTEXT.
8272 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8273 AM_GNU_GETTEXT with a bug fixed.
8275 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8277 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8279 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8280 which is used to point to LyX data is now LYX_DIR_11x.
8282 * lyx.man: convert to a unix text file; small updates.
8284 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8286 * src/support/LSubstring.[Ch]: made the second arg of most of the
8287 constructors be a const reference.
8289 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8292 * src/support/lyxstring.[Ch] (swap): added missing member function
8293 and specialization of swap(str, str);
8295 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8297 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8298 trace of the old one.
8300 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8301 put the member definitions in undo.C.
8303 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8304 NEW_TEXT and have now only code that was included when this was
8307 * src/intl.C (LCombo): use static_cast
8309 (DispatchCallback): ditto
8311 * src/definitions.h: removed whole file
8313 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8315 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8316 parsing and stores in a std:map. a regex defines the file format.
8317 removed unneeded members.
8319 * src/bufferparams.h: added several enums from definitions.h here.
8320 Removed unsused destructor. Changed some types to use proper enum
8321 types. use block to have the temp_bullets and user_defined_bullets
8322 and to make the whole class assignable.
8324 * src/bufferparams.C (Copy): removed this functions, use a default
8327 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8330 * src/buffer.C (readLyXformat2): commend out all that have with
8331 oldpapersize to do. also comment out all that hve to do with
8332 insetlatex and insetlatexdel.
8333 (setOldPaperStuff): commented out
8335 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8337 * src/LyXAction.C: remove use of inset-latex-insert
8339 * src/mathed/math_panel.C (button_cb): use static_cast
8341 * src/insets/Makefile.am (insets_o_SOURCES): removed
8344 * src/support/lyxstring.C (helper): use the unsigned long
8345 specifier, UL, instead of a static_cast.
8347 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8349 * src/support/block.h: new file. to be used as a c-style array in
8350 classes, so that the class can be assignable.
8352 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8354 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8355 NULL, make sure to return an empty string (it is not possible to
8356 set a string to NULL).
8358 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8360 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8362 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8364 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8365 link line, so that Irix users (for example) can set it explicitely to
8368 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8369 it can be overidden at make time (static or dynamic link, for
8372 * src/vc-backend.C, src/LaTeXFeatures.h,
8373 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8374 statements to bring templates to global namespace.
8376 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8378 * src/support/lyxstring.C (operator[] const): make it standard
8381 * src/minibuffer.C (Init): changed to reflect that more
8382 information is given from the lyxvc and need not be provided here.
8384 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8386 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8388 * src/LyXView.C (UpdateTimerCB): use static_cast
8389 (KeyPressMask_raw_callback): ditto
8391 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8392 buffer_, a lot of changes because of this. currentBuffer() ->
8393 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8394 also changes to other files because of this.
8396 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8398 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8399 have no support for RCS and partial support for CVS, will be
8402 * src/insets/ several files: changes because of function name
8403 changes in Bufferview and LyXView.
8405 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8407 * src/support/LSubstring.[Ch]: new files. These implement a
8408 Substring that can be very convenient to use. i.e. is this
8410 string a = "Mary had a little sheep";
8411 Substring(a, "sheep") = "lamb";
8412 a is now "Mary has a little lamb".
8414 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8415 out patterns and subpatterns of strings. It is used by LSubstring
8416 and also by vc-backend.C
8418 * src/support/lyxstring.C: went over all the assertions used and
8419 tried to correct the wrong ones and flag which of them is required
8420 by the standard. some bugs found because of this. Also removed a
8421 couple of assertions.
8423 * src/support/Makefile.am (libsupport_a_SOURCES): added
8424 LSubstring.[Ch] and LRegex.[Ch]
8426 * src/support/FileInfo.h: have struct stat buf as an object and
8427 not a pointer to one, some changes because of this.
8429 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8430 information in layout when adding the layouts preamble to the
8433 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8436 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8437 because of bug in OS/2.
8439 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8441 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8442 \verbatim@font instead of \ttfamily, so that it can be redefined.
8444 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8445 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8446 src/layout.h, src/text2.C: add 'using' directive to bring the
8447 STL templates we need from the std:: namespace to the global one.
8448 Needed by DEC cxx in strict ansi mode.
8450 * src/support/LIstream.h,src/support/LOstream.h,
8451 src/support/lyxstring.h,src/table.h,
8452 src/lyxlookup.h: do not include <config.h> in header
8453 files. This should be done in the .C files only.
8455 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8459 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8461 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8462 from Kayvan to fix the tth invokation.
8464 * development/lyx.spec.in: updates from Kayvan to reflect the
8465 changes of file names.
8467 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8469 * src/text2.C (InsertStringB): use std::copy
8470 (InsertStringA): use std::copy
8472 * src/bufferlist.C: use a vector to store the buffers in. This is
8473 an internal change and should not affect any other thing.
8475 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8478 * src/text.C (Fill): fix potential bug, one off bug.
8480 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8482 * src/Makefile.am (lyx_main.o): add more files it depends on.
8484 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8486 * src/support/lyxstring.C: use size_t for the reference count,
8487 size, reserved memory and xtra.
8488 (internal_compare): new private member function. Now the compare
8489 functions should work for std::strings that have embedded '\0'
8491 (compare): all compare functions rewritten to use
8494 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8496 * src/support/lyxstring.C (compare): pass c_str()
8497 (compare): pass c_str
8498 (compare): pass c_str
8500 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8502 * src/support/DebugStream.C: <config.h> was not included correctly.
8504 * lib/configure: forgot to re-generate it :( I'll make this file
8505 auto generated soon.
8507 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8509 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8512 * src/support/lyxstring.C: some changes from length() to rep->sz.
8513 avoids a function call.
8515 * src/support/filetools.C (SpaceLess): yet another version of the
8516 algorithm...now per Jean-Marc's suggestions.
8518 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8520 * src/layout.C (less_textclass_desc): functor for use in sorting
8522 (LyXTextClass::Read): sort the textclasses after reading.
8524 * src/support/filetools.C (SpaceLess): new version of the
8525 SpaceLess functions. What problems does this one give? Please
8528 * images/banner_bw.xbm: made the arrays unsigned char *
8530 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8532 * src/support/lyxstring.C (find): remove bogus assertion in the
8533 two versions of find where this has not been done yet.
8535 * src/support/lyxlib.h: add missing int return type to
8538 * src/menus.C (ShowFileMenu): disable exporting to html if no
8539 html export command is present.
8541 * config/lib_configure.m4: add a test for an HTML converter. The
8542 programs checked for are, in this order: tth, latex2html and
8545 * lib/configure: generated from config/lib_configure.m4.
8547 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8548 html converter. The parameters are now passed through $$FName and
8549 $$OutName, instead of standard input/output.
8551 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8553 * lib/lyxrc.example: update description of \html_command.
8554 add "quotes" around \screen_font_xxx font setting examples to help
8555 people who use fonts with spaces in their names.
8557 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8559 * Distribution files: updates for v1.1.2
8561 * src/support/lyxstring.C (find): remove bogus assert and return
8562 npos for the same condition.
8564 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8566 * added patch for OS/2 from SMiyata.
8568 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8570 * src/text2.C (CutSelection): make space_wrapped a bool
8571 (CutSelection): dont declare int i until we have to.
8572 (alphaCounter): return a char const *.
8574 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8576 * src/support/syscall.C (Systemcalls::kill):
8577 src/support/filetools.C (PutEnv, PutEnvPath):
8578 src/lyx_cb.C (addNewlineAndDepth):
8579 src/FontInfo.C (FontInfo::resize): condition some #warning
8580 directives with WITH_WARNINGS.
8583 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8585 * src/layout.[Ch] + several files: access to class variables
8586 limited and made accessor functions instead a lot of code changed
8587 becuase of this. Also instead of returning pointers often a const
8588 reference is returned instead.
8590 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8592 * src/Makefile.am (dist-hook): added used to remove the CVS from
8593 cheaders upon creating a dist
8594 (EXTRA_DIST): added cheaders
8596 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8597 a character not as a small integer.
8599 * src/support/lyxstring.C (find): removed Assert and added i >=
8600 rep->sz to the first if.
8602 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8604 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8605 src/LyXView.C src/buffer.C src/bufferparams.C
8606 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8607 src/text2.C src/insets/insetinclude.C:
8608 lyxlayout renamed to textclasslist.
8610 * src/layout.C: some lyxerr changes.
8612 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8613 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8614 (LyXLayoutList): removed all traces of this class.
8615 (LyXTextClass::Read): rewrote LT_STYLE
8616 (LyXTextClass::hasLayout): new function
8617 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8618 both const and nonconst version.
8619 (LyXTextClass::delete_layout): new function.
8620 (LyXTextClassList::Style): bug fix. do the right thing if layout
8622 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8623 (LyXTextClassList::NameOfLayout): ditto
8624 (LyXTextClassList::Load): ditto
8626 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8628 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8630 * src/LyXAction.C (LookupFunc): added a workaround for sun
8631 compiler, on the other hand...we don't know if the current code
8632 compiles on sun at all...
8634 * src/support/filetools.C (CleanupPath): subst fix
8636 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8639 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8640 complained about this one?
8642 * src/insets/insetinclude.C (Latex): subst fix
8644 * src/insets/insetbib.C (getKeys): subst fix
8646 * src/LyXSendto.C (SendtoApplyCB): subst fix
8648 * src/lyx_main.C (init): subst fix
8650 * src/layout.C (Read): subst fix
8652 * src/lyx_sendfax_main.C (button_send): subst fix
8654 * src/buffer.C (RoffAsciiTable): subst fix
8656 * src/lyx_cb.C (MenuFax): subst fix
8657 (PrintApplyCB): subst fix
8659 1999-10-26 Juergen Vigna <jug@sad.it>
8661 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8663 (Read): Cleaned up this code so now we read only format vestion >= 5
8665 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8667 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8668 come nobody has complained about this one?
8670 * src/insets/insetinclude.C (Latex): subst fix
8672 * src/insets/insetbib.C (getKeys): subst fix
8674 * src/lyx_main.C (init): subst fix
8676 * src/layout.C (Read): subst fix
8678 * src/buffer.C (RoffAsciiTable): subst fix
8680 * src/lyx_cb.C (MenuFax): subst fix.
8682 * src/layout.[hC] + some other files: rewrote to use
8683 std::container to store textclasses and layouts in.
8684 Simplified, removed a lot of code. Make all classes
8685 assignable. Further simplifications and review of type
8686 use still to be one.
8688 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8689 lastfiles to create the lastfiles partr of the menu.
8691 * src/lastfiles.[Ch]: rewritten to use deque to store the
8692 lastfiles in. Uses fstream for reading and writing. Simplifies
8695 * src/support/syscall.C: remove explicit cast.
8697 * src/BufferView.C (CursorToggleCB): removed code snippets that
8699 use explicat C++ style casts instead of C style casts. also use
8700 u_vdata instea of passing pointers in longs.
8702 * src/PaperLayout.C: removed code snippets that were commented out.
8704 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8706 * src/lyx_main.C: removed code snippets that wer commented out.
8708 * src/paragraph.C: removed code snippets that were commented out.
8710 * src/lyxvc.C (logClose): use static_cast
8712 (viewLog): remove explicit cast to void*
8713 (showLog): removed old commented code
8715 * src/menus.C: use static_cast instead of C style casts. use
8716 u_vdata instead of u_ldata. remove explicit cast to (long) for
8717 pointers. Removed old code that was commented out.
8719 * src/insets/inset.C: removed old commented func
8721 * src/insets/insetref.C (InsetRef): removed old code that had been
8722 commented out for a long time.
8724 (escape): removed C style cast
8726 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8728 * src/insets/insetlatex.C (Draw): removed old commented code
8729 (Read): rewritten to use string
8731 * src/insets/insetlabel.C (escape): removed C style cast
8733 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8735 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8738 * src/insets/insetinclude.h: removed a couple of stupid bools
8740 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8741 (Clone): remove C style cast
8742 (getKeys): changed list to lst because of std::list
8744 * src/insets/inseterror.C (Draw): removed som old commented code.
8746 * src/insets/insetcommand.C (Draw): removed some old commented code.
8748 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8749 commented out forever.
8750 (bibitem_cb): use static_cast instead of C style cast
8751 use of vdata changed to u_vdata.
8753 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8755 (CloseUrlCB): use static_cast instead of C style cast.
8756 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8758 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8759 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8760 (CloseInfoCB): static_cast from ob->u_vdata instead.
8761 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8764 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8765 (C_InsetError_CloseErrorCB): forward the ob parameter
8766 (CloseErrorCB): static_cast from ob->u_vdata instead.
8768 * src/vspace.h: include LString.h since we use string in this class.
8770 * src/vspace.C (lyx_advance): changed name from advance because of
8771 nameclash with stl. And since we cannot use namespaces yet...I
8772 used a lyx_ prefix instead. Expect this to change when we begin
8775 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8777 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8778 and removed now defunct constructor and deconstructor.
8780 * src/BufferView.h: have backstack as a object not as a pointer.
8781 removed initialization from constructor. added include for BackStack
8783 * development/lyx.spec.in (%build): add CFLAGS also.
8785 * src/screen.C (drawFrame): removed another warning.
8787 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8789 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8790 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8791 README and ANNOUNCE a bit for the next release. More work is
8794 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8795 unbreakable if we are in freespacing mode (LyX-Code), but not in
8798 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8800 * src/BackStack.h: fixed initialization order in constructor
8802 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8804 * acinclude.m4 (VERSION): new rules for when a version is
8805 development, added also a variable for prerelease.
8806 (warnings): we set with_warnings=yes for prereleases
8807 (lyx_opt): prereleases compile with same optimization as development
8808 (CXXFLAGS): only use pedantic if we are a development version
8810 * src/BufferView.C (restorePosition): don't do anything if the
8813 * src/BackStack.h: added member empty, use this to test if there
8814 is anything to pop...
8816 1999-10-25 Juergen Vigna <jug@sad.it>
8819 * forms/layout_forms.fd +
8820 * forms/latexoptions.fd +
8821 * lyx.fd: changed for various form resize issues
8823 * src/mathed/math_panel.C +
8824 * src/insets/inseterror.C +
8825 * src/insets/insetinfo.C +
8826 * src/insets/inseturl.C +
8827 * src/insets/inseturl.h +
8830 * src/PaperLayout.C +
8831 * src/ParagraphExtra.C +
8832 * src/TableLayout.C +
8834 * src/layout_forms.C +
8841 * src/menus.C: fixed various resize issues. So now forms can be
8842 resized savely or not be resized at all.
8844 * forms/form_url.fd +
8845 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8848 * src/insets/Makefile.am: added files form_url.[Ch]
8850 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8852 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8853 (and presumably 6.2).
8855 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8856 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8857 remaining static member callbacks.
8859 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8862 * src/support/lyxstring.h: declare struct Srep as friend of
8863 lyxstring, since DEC cxx complains otherwise.
8865 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8867 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8869 * src/LaTeX.C (run): made run_bibtex also depend on files with
8871 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8872 are put into the dependency file.
8874 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8875 the code has shown itself to work
8876 (create_ispell_pipe): removed another warning, added a comment
8879 * src/minibuffer.C (ExecutingCB): removed code that has been
8880 commented out a long time
8882 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8883 out code + a warning.
8885 * src/support/lyxstring.h: comment out the three private
8886 operators, when compiling with string ansi conforming compilers
8889 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8891 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8892 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8895 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8898 * src/mathed/math_panel.C (create_math_panel): remove explicit
8901 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8904 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8905 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8906 to XCreatePixmapFromBitmapData
8907 (fl_set_bmtable_data): change the last argument to be unsigned
8909 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8910 and bh to be unsigned int, remove explicit casts in call to
8911 XReadBitmapFileData.
8913 * images/arrows.xbm: made the arrays unsigned char *
8914 * images/varsz.xbm: ditto
8915 * images/misc.xbm: ditto
8916 * images/greek.xbm: ditto
8917 * images/dots.xbm: ditto
8918 * images/brel.xbm: ditto
8919 * images/bop.xbm: ditto
8921 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8923 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8924 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8925 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8927 (LYX_CXX_CHEADERS): added <clocale> to the test.
8929 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8931 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8933 * src/support/lyxstring.C (append): fixed something that must be a
8934 bug, rep->assign was used instead of rep->append.
8936 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8939 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8940 lyx insert double chars. Fix spotted by Kayvan.
8942 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8944 * Fixed the tth support. I messed up with the Emacs patch apply feature
8945 and omitted the changes in lyxrc.C.
8947 1999-10-22 Juergen Vigna <jug@sad.it>
8949 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8951 * src/lyx_cb.C (MenuInsertRef) +
8952 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8953 the form cannot be resized under it limits (fixes a segfault)
8955 * src/lyx.C (create_form_form_ref) +
8956 * forms/lyx.fd: Changed Gravity on name input field so that it is
8959 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8961 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8962 <ostream> and <istream>.
8964 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8965 whether <fstream> provides the latest standard features, or if we
8966 have an oldstyle library (like in egcs).
8967 (LYX_CXX_STL_STRING): fix the test.
8969 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8970 code on MODERN_STL_STREAM.
8972 * src/support/lyxstring.h: use L{I,O}stream.h.
8974 * src/support/L{I,O}stream.h: new files, designed to setup
8975 correctly streams for our use
8976 - includes the right header depending on STL capabilities
8977 - puts std::ostream and std::endl (for LOStream.h) or
8978 std::istream (LIStream.h) in toplevel namespace.
8980 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8982 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8983 was a bib file that had been changed we ensure that bibtex is run.
8984 (runBibTeX): enhanced to extract the names of the bib files and
8985 getting their absolute path and enter them into the dep file.
8986 (findtexfile): static func that is used to look for tex-files,
8987 checks for absolute patchs and tries also with kpsewhich.
8988 Alternative ways of finding the correct files are wanted. Will
8990 (do_popen): function that runs a command using popen and returns
8991 the whole output of that command in a string. Should be moved to
8994 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8995 file with extension ext has changed.
8997 * src/insets/figinset.C: added ifdef guards around the fl_free
8998 code that jug commented out. Now it is commented out when
8999 compiling with XForms == 0.89.
9001 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9002 to lyxstring.C, and only keep a forward declaration in
9003 lyxstring.h. Simplifies the header file a bit and should help a
9004 bit on compile time too. Also changes to Srep will not mandate a
9005 recompile of code just using string.
9006 (~lyxstring): definition moved here since it uses srep.
9007 (size): definition moved here since it uses srep.
9009 * src/support/lyxstring.h: removed a couple of "inline" that should
9012 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9014 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9017 1999-10-21 Juergen Vigna <jug@sad.it>
9019 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9020 set to left if I just remove the width entry (or it is empty).
9022 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9023 paragraph when having dummy paragraphs.
9025 1999-10-20 Juergen Vigna <jug@sad.it>
9027 * src/insets/figinset.C: just commented some fl_free_form calls
9028 and added warnings so that this calls should be activated later
9029 again. This avoids for now a segfault, but we have a memory leak!
9031 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9032 'const char * argument' to 'string argument', this should
9033 fix some Asserts() in lyxstring.C.
9035 * src/lyxfunc.h: Removed the function argAsString(const char *)
9036 as it is not used anymore.
9038 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9040 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9043 * src/Literate.h: some funcs moved from public to private to make
9044 interface clearer. Unneeded args removed.
9046 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9048 (scanBuildLogFile): ditto
9050 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9051 normal TeX Error. Still room for improvement.
9053 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9055 * src/buffer.C (insertErrors): changes to make the error
9056 desctription show properly.
9058 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9061 * src/support/lyxstring.C (helper): changed to use
9062 sizeof(object->rep->ref).
9063 (operator>>): changed to use a pointer instead.
9065 * src/support/lyxstring.h: changed const reference & to value_type
9066 const & lets see if that helps.
9068 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9070 * Makefile.am (rpmdist): fixed to have non static package and
9073 * src/support/lyxstring.C: removed the compilation guards
9075 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9078 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9079 conditional compile of lyxstring.Ch
9081 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9082 stupid check, but it is a lot better than the bastring hack.
9083 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9085 * several files: changed string::erase into string::clear. Not
9088 * src/chset.C (encodeString): use a char temporary instead
9090 * src/table.C (TexEndOfCell): added tostr around
9091 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9092 (TexEndOfCell): ditto
9093 (TexEndOfCell): ditto
9094 (TexEndOfCell): ditto
9095 (DocBookEndOfCell): ditto
9096 (DocBookEndOfCell): ditto
9097 (DocBookEndOfCell): ditto
9098 (DocBookEndOfCell): ditto
9100 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9102 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9104 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9105 (MenuBuildProg): added tostr around ret
9106 (MenuRunChktex): added tostr around ret
9107 (DocumentApplyCB): added tostr around ret
9109 * src/chset.C (encodeString): added tostr around t->ic
9111 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9112 (makeLaTeXFile): added tostr around tocdepth
9113 (makeLaTeXFile): added tostr around ftcound - 1
9115 * src/insets/insetbib.C (setCounter): added tostr around counter.
9117 * src/support/lyxstring.h: added an operator+=(int) to catch more
9120 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9121 (lyxstring): We DON'T allow NULL pointers.
9123 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9125 * src/mathed/math_macro.C (MathMacroArgument::Write,
9126 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9127 when writing them out.
9129 * src/LString.C: remove, since it is not used anymore.
9131 * src/support/lyxstring.C: condition the content to
9132 USE_INCLUDED_STRING macro.
9134 * src/mathed/math_symbols.C, src/support/lstrings.C,
9135 src/support/lyxstring.C: add `using' directive to specify what
9136 we need in <algorithm>. I do not think that we need to
9137 conditionalize this, but any thought is appreciated.
9139 * many files: change all callback functions to "C" linkage
9140 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9141 strict_ansi. Those who were static are now global.
9142 The case of callbacks which are static class members is
9143 trickier, since we have to make C wrappers around them (see
9144 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9145 did not finish this yet, since it defeats the purpose of
9146 encapsulation, and I am not sure what the best route is.
9148 1999-10-19 Juergen Vigna <jug@sad.it>
9150 * src/support/lyxstring.C (lyxstring): we permit to have a null
9151 pointer as assignment value and just don't assign it.
9153 * src/vspace.C (nextToken): corrected this function substituting
9154 find_first(_not)_of with find_last_of.
9156 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9157 (TableOptCloseCB) (TableSpeCloseCB):
9158 inserted fl_set_focus call for problem with fl_hide_form() in
9161 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9163 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9166 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9168 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9169 LyXLex::next() and not eatline() to get its argument.
9171 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9173 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9174 instead, use fstreams for io of the depfile, removed unneeded
9175 functions and variables.
9177 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9178 vector instead, removed all functions and variables that is not in
9181 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9183 * src/buffer.C (insertErrors): use new interface to TeXError
9185 * Makefile.am (rpmdist): added a rpmdist target
9187 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9188 per Kayvan's instructions.
9190 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9192 * src/Makefile.am: add a definition for localedir, so that locales
9193 are found after installation (Kayvan)
9195 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9197 * development/.cvsignore: new file.
9199 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9201 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9202 C++ compiler provides wrappers for C headers and use our alternate
9205 * configure.in: use LYX_CXX_CHEADERS.
9207 * src/cheader/: new directory, populated with cname headers from
9208 libstdc++-2.8.1. They are a bit old, but probably good enough for
9209 what we want (support compilers who lack them).
9211 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9212 from includes. It turns out is was stupid.
9214 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9216 * lib/Makefile.am (install-data-local): forgot a ';'
9217 (install-data-local): forgot a '\'
9218 (libinstalldirs): needed after all. reintroduced.
9220 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9222 * configure.in (AC_OUTPUT): added lyx.spec
9224 * development/lyx.spec: removed file
9226 * development/lyx.spec.in: new file
9228 * po/*.po: merged with lyx.pot becuase of make distcheck
9230 * lib/Makefile.am (dist-hook): added dist-hook so that
9231 documentation files will be included when doing a make
9232 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9233 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9235 more: tried to make install do the right thing, exclude CVS dirs
9238 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9239 Path would fit in more nicely.
9241 * all files that used to use pathstack: uses now Path instead.
9242 This change was a lot easier than expected.
9244 * src/support/path.h: new file
9246 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9248 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9250 * src/support/lyxstring.C (getline): Default arg was given for
9253 * Configure.cmd: removed file
9255 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9257 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9258 streams classes and types, add the proper 'using' statements when
9259 MODERN_STL is defined.
9261 * src/debug.h: move the << operator definition after the inclusion
9264 * src/support/filetools.C: include "LAssert.h", which is needed
9267 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9270 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9271 include "debug.h" to define a proper ostream.
9273 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9275 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9276 method to the SystemCall class which can kill a process, but it's
9277 not fully implemented yet.
9279 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9281 * src/support/FileInfo.h: Better documentation
9283 * src/lyxfunc.C: Added support for buffer-export html
9285 * src/menus.C: Added Export->As HTML...
9287 * lib/bind/*.bind: Added short-cut for buffer-export html
9289 * src/lyxrc.*: Added support for new \tth_command
9291 * lib/lyxrc.example: Added stuff for new \tth_command
9293 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9295 * lib/Makefile.am (IMAGES): removed images/README
9296 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9297 installes in correct place. Check permisions is installed
9300 * src/LaTeX.C: some no-op changes moved declaration of some
9303 * src/LaTeX.h (LATEX_H): changed include guard name
9305 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9307 * lib/reLyX/Makefile.am: install noweb2lyx.
9309 * lib/Makefile.am: install configure.
9311 * lib/reLyX/configure.in: declare a config aux dir; set package
9312 name to lyx (not sure what the best solution is); generate noweb2lyx.
9314 * lib/layouts/egs.layout: fix the bibliography layout.
9316 1999-10-08 Jürgen Vigna <jug@sad.it>
9318 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9319 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9320 it returned without continuing to search the path.
9322 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9324 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9325 also fixes a bug. It is not allowed to do tricks with std::strings
9326 like: string a("hei"); &a[e]; this will not give what you
9327 think... Any reason for the complexity in this func?
9329 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9331 * Updated README and INSTALL a bit, mostly to check that my
9332 CVS rights are correctly set up.
9334 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9336 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9337 does not allow '\0' chars but lyxstring and std::string does.
9339 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9341 * autogen.sh (AUTOCONF): let the autogen script create the
9342 POTFILES.in file too. POTFILES.in should perhaps now not be
9343 included in the cvs module.
9345 * some more files changed to use C++ includes instead of C ones.
9347 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9349 (Reread): added tostr to nlink. buggy output otherwise.
9350 (Reread): added a string() around szMode when assigning to Buffer,
9351 without this I got a log of garbled info strings.
9353 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9356 * I have added several ostream & operator<<(ostream &, some_type)
9357 functions. This has been done to avoid casting and warnings when
9358 outputting enums to lyxerr. This as thus eliminated a lot of
9359 explicit casts and has made the code clearer. Among the enums
9360 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9361 mathed enums, some font enum the Debug::type enum.
9363 * src/support/lyxstring.h (clear): missing method. equivalent of
9366 * all files that contained "stderr": rewrote constructs that used
9367 stderr to use lyxerr instead. (except bmtable)
9369 * src/support/DebugStream.h (level): and the passed t with
9370 Debug::ANY to avoid spurious bits set.
9372 * src/debug.h (Debug::type value): made it accept strings of the
9375 * configure.in (Check for programs): Added a check for kpsewhich,
9376 the latex generation will use this later to better the dicovery of
9379 * src/BufferView.C (create_view): we don't need to cast this to
9380 (void*) that is done automatically.
9381 (WorkAreaButtonPress): removed some dead code.
9383 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9385 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9386 is not overwritten when translated (David Sua'rez de Lis).
9388 * lib/CREDITS: Added David Sua'rez de Lis
9390 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9392 * src/bufferparams.C (BufferParams): default input encoding is now
9395 * acinclude.m4 (cross_compiling): comment out macro
9396 LYX_GXX_STRENGTH_REDUCE.
9398 * acconfig.h: make sure that const is not defined (to empty) when
9399 we are compiling C++. Remove commented out code using SIZEOF_xx
9402 * configure.in : move the test for const and inline as late as
9403 possible so that these C tests do not interefere with C++ ones.
9404 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9405 has not been proven.
9407 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9409 * src/table.C (getDocBookAlign): remove bad default value for
9412 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9414 (ShowFileMenu2): ditto.
9416 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9419 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9421 * Most files: finished the change from the old error code to use
9422 DebugStream for all lyxerr debugging. Only minor changes remain
9423 (e.g. the setting of debug levels using strings instead of number)
9425 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9427 * src/layout.C (Add): Changed to use compare_no_case instead of
9430 * src/FontInfo.C: changed loop variable type too string::size_type.
9432 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9434 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9435 set ETAGS_ARGS to --c++
9437 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9439 * src/table.C (DocBookEndOfCell): commented out two unused variables
9441 * src/paragraph.C: commented out four unused variables.
9443 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9444 insed a if clause with type string::size_type.
9446 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9449 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9451 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9452 variable, also changed loop to go from 0 to lenght + 1, instead of
9453 -1 to length. This should be correct.
9455 * src/LaTeX.C (scanError): use string::size_type as loop variable
9458 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9459 (l.896) since y_tmp and row was not used anyway.
9461 * src/insets/insetref.C (escape): use string::size_type as loop
9464 * src/insets/insetquotes.C (Width): use string::size_type as loop
9466 (Draw): use string::size_type as loop variable type.
9468 * src/insets/insetlatexaccent.C (checkContents): use
9469 string::size_type as loop variable type.
9471 * src/insets/insetlabel.C (escape): use string::size_type as loop
9474 * src/insets/insetinfo.C: added an extern for current_view.
9476 * src/insets/insetcommand.C (scanCommand): use string::size_type
9477 as loop variable type.
9479 * most files: removed the RCS tags. With them we had to recompile
9480 a lot of files after a simple cvs commit. Also we have never used
9481 them for anything meaningful.
9483 * most files: tags-query-replace NULL 0. As adviced several plases
9484 we now use "0" instead of "NULL" in our code.
9486 * src/support/filetools.C (SpaceLess): use string::size_type as
9489 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9491 * src/paragraph.C: fixed up some more string stuff.
9493 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9495 * src/support/filetools.h: make modestr a std::string.
9497 * src/filetools.C (GetEnv): made ch really const.
9499 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9500 made code that used these use max/min from <algorithm> instead.
9502 * changed several c library include files to their equivalent c++
9503 library include files. All is not changed yet.
9505 * created a support subdir in src, put lyxstring and lstrings
9506 there + the extra files atexit, fileblock, strerror. Created
9507 Makefile.am. edited configure.in and src/Makefile.am to use this
9508 new subdir. More files moved to support.
9510 * imported som of the functions from repository lyx, filetools
9512 * ran tags-query-replace on LString -> string, corrected the bogus
9513 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9514 is still some errors in there. This is errors where too much or
9515 too litle get deleted from strings (string::erase, string::substr,
9516 string::replace), there can also be some off by one errors, or
9517 just plain wrong use of functions from lstrings. Viewing of quotes
9520 * LyX is now running fairly well with string, but there are
9521 certainly some bugs yet (see above) also string is quite different
9522 from LString among others in that it does not allow null pointers
9523 passed in and will abort if it gets any.
9525 * Added the revtex4 files I forgot when setting up the repository.
9527 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9529 * All over: Tried to clean everything up so that only the files
9530 that we really need are included in the cvs repository.
9531 * Switched to use automake.
9532 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9533 * Install has not been checked.
9535 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9537 * po/pt.po: Three errors:
9538 l.533 and l.538 format specification error
9539 l. 402 duplicate entry, I just deleted it.