1 2001-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/tabular.C (Write): write lowercase identifiers
4 (Read): read lowercase identifiers
6 2001-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8 * src/support/lyxstring.C (rfind): better fix (from Dekel).
10 * src/tabular.h: add a couple std:: qualifiers.
12 2001-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
14 * src/support/lyxstring.C (rfind): also test the first char in the
15 string and be sure that t >= 0.
17 2001-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
19 * src/tabular.C (ReadNew): new method
20 (Read): changed to call ReadNew or ReadOld depending on the
21 tabular version found.
23 * src/tabular-old.C: new file with the support functions and the
27 * src/frontends/xforms/FormDocument.C (CheckChoiceClass): make tc
28 unsigned to remove a signed/usigned warning.
30 * src/tabular.C (tostr): new spesializations, replaces type2string
31 (Write): use the new spesializations
33 2001-01-09 Juergen Vigna <jug@sad.it>
35 * src/tabular.C (OldFormatRead): convert the footer/header information
37 (getTokenValue): chaned this functions again.
38 (string2type): added a bunch of this functions per type.
39 (Write): use type2string and write columns first.
40 (type2string): added a bunch of this functions per type.
42 (TeXTopHLine): check row parameter.
44 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
46 * src/tabular.C (getTokenValue): Fix crash with malformed files.
47 (Read): Read the rotate attribute.
49 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
51 * src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix
52 class switching; do not do anything if class has not been changed.
54 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
56 * lib/build-listerrors: Exit if literate-article doesn't appear in
59 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
61 * src/combox.h (getline): small fix for sun CC 6.0
62 * src/combox.C (input_cb): ditto.
63 * src/spellchecker.C (sigchldhandler): ditto.
65 * src/lyx_main.C (init): do not query for creation of user
66 directory when running without a GUI.
68 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
70 * src/mathed/formula.C (LocalDispatch): Toggle font properties.
72 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
74 * BufferView2.C (open_new_inset): Added 2nd argument.
75 (getParentText, getParentLanguage): New methods.
77 * src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and
78 LFUN_INSET_TABULAR for RTL text.
80 * src/tabular.C (Latex): Put \R{} around RTL cells.
82 * src/text2.C (InsertInset): Change cursor position for highly
85 * src/frontends/xforms/FormTabularCreate.C (apply): Create the
86 tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...)
88 * src/insets/insettabular.C (LocalDispatch): When dispatching
89 LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
90 locked, then the insettext of the new cell will be locked.
91 (moveLeft, moveRight): Fixed for RTL tabulars.
92 (moveNextCell, movePrevCell): Ditto.
93 (isRightToLeft): New method.
95 * src/insets/insettext.C (LocalDispatch): Fixed handling of
96 non-dispatched function in the locking inset.
97 (Edit): If the inset is empty set the language of the current font
98 to the language to the surronding text (this code was moved from
99 LocalDispatch to allow the user to change the languaeg before
101 (moveRight, moveLeft): Fixed for RTL text.
102 (checkAndActivateInset): Fixed.
104 * src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
106 2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
108 * src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate
112 * src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL
113 around some ispell code.
115 * src/lyxcursor.[Ch]: add proper constructor, to avoid tons of
116 Unitialized Memory Read in purify.
118 * lib/examples/nl_splash.lyx: update from Tino Meinen.
120 2001-01-04 Dekel Tsur <dekelts@tau.ac.il>
122 * src/frontends/xforms/FormDocument.C (FormDocument::build):
123 Disable class_->choice_doc_class and language_->choice_language to
124 allow using the class/language combox with keyboard.
126 2001-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
128 * src/support/snprintf.c (va_copy): only define va_copy if undefined
130 2001-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
132 * src/lyxvc.C (showLog): give the tempfile a mask
134 * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
137 * src/support/filetools.C (IsDirWriteable): give the tempfile a
138 mask and unlink the tempfile after use.
140 2001-01-04 Juergen Vigna <jug@sad.it>
142 * src/insets/insettabular.C (resetPos): an extra scroll, but we
143 really should redo all this scrolling code!
144 (TabularFeatures): unlock the_locking_inset before add/del rows/colums.
146 * src/text.C (GetVisibleRow): check that y/h values are good otherwise
149 * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
150 (pasteSelection): pay attention to multicolumn cells.
151 (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
153 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
155 * src/mathed/math_panel.C (deco_cb): check the decoration index is
158 * src/frontends/xforms/FormPreferences.C (feedback): apply
159 formatting to the translated string, not to the original one.
160 (printWarning): ditto.
162 * src/gettext.C (_): translate empty string with empty string.
164 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
169 * UPGRADING: mention that tabular format has been changed.
171 2001-01-03 Juergen Vigna <jug@sad.it>
173 * src/insets/insettabular.C (InsetButtonPress): look for button==2
174 and do Clipboard Paste!
176 * src/insets/insettext.C (SetText): added function.
178 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
179 new LFUN_PASTESELECTION.
181 * src/insets/insettext.C (draw): don't clear if top_x changes.
183 * src/insets/insettabular.C (draw): clear only if the inset didn't
184 change in the draw routine.
186 * src/insets/insettext.C (width): make the width dependant on the
189 * src/text.C (draw): comment out the UpdateInset call.
191 * src/screen.C (DrawOneRow):
192 (DrawFromTo): check for bv->text->status not text->status.
194 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
195 dimensions of ascent-descent for the whole row.
197 * src/insets/insettext.C (draw): check also for need_update == INIT.
199 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
201 * Makefile.am (EXTRA_DIST): add autogen.sh
203 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
205 * development/OS2/quick_fix.patch:
206 * lib/configure.cmd: update OS/2 support files.
208 2001-01-02 Juergen Vigna <jug@sad.it>
210 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
212 * src/tabular.C (TeXTopHLine):
213 (TeXBottomHLine): fixed Lars new code.
215 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
217 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
218 from this function and added a BufferView * parameter.
220 * src/mathed/math_symbols.C (math_insert_symbol): ditto
222 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
224 * src/version.h: set to pre3
226 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
228 * src/Makefile.am (lyx_SOURCES): added Floating.C
230 * src/Floating.h: moved all the inlines to Floating.C
232 * src/Floating.C: new file
234 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
236 * src/frontends/xforms/FormPreferences.C (feedback): fix
237 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
239 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
241 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
244 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
246 * src/mathed/math_inset.h: move LString.h to be included first
248 * src/insets/insetfloat.C: adjust for change in private variable names
250 * src/frontends/xforms/xform_helpers.h : don't include config.h
252 * src/frontends/xforms/xform_helpers.C: adjust the order of
253 includes, some whitespace changes.
255 * src/trans.C (Load): constify filename and res
257 * src/text2.C (SetCounter): call Floating::name()
259 * src/screen.C: change to not use owner from WorkArea, but from
262 * src/lyxfunc.C: adjust because of changes in Intl.
264 * src/intl.h: make trans a object instead of pointer, inlucd
265 trans_mgr.h in this file.
266 (getTrans): return a reference to TransManager
268 * src/intl.C: don't include trans_mgr.h here
269 modify calls to trans to work on object instead of on pointer
271 * src/WorkArea.h: add using for Signal1
272 comment out forward decl of BufferView.
274 remove class variable owner_ and getter method for this.
276 * src/WorkArea.C: don't include BufferView.h
277 (WorkArea): change to not take a BufferView.h, use signals
279 (scroll_cb): emit signal
281 * src/LaTeXFeatures.C: include Floatlist.h
282 (getPackages): only load float.sty when needed
283 (getMacros): prepare for outputting the correct code to preamble.
285 * src/Floating.h: make all variables private + rename to var_.
286 (Floating): default ctor
287 (Floating): complex ctor to set a complete Floating
293 * src/FloatList.C (FloatList): use Floating's constructor
296 (newFloat): call type()
297 (defaultPlacement): call placement()
298 (operator): new operator
300 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
301 (scrollUp): call pimpl's scrollCB
303 (pasteClipboard): constify clip
305 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
306 (insertErrors): constify desctext, errortext, msgtxt and errorrow
307 (open_new_inset): delete some commented code.
309 * src/BufferView.[Ch] (enterView): comment out
312 (workAreaMotionNotify): ditto
313 (workAreaButtonPress): ditto
316 (workAreaButtonRelease): ditto
317 (workAreaExpose): ditto
319 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
320 to compile with cvs gcc (2.97).
322 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
324 * lib/ui/default.ui: menu structure cleanup.
326 * lib/languages: add description of entries.
328 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
330 * src/insets/ExternalTemplate.C (readTemplates): change debug
332 (readTemplate): use lyxlex.printError to report read errors.
335 * src/insets/insetexternal.C (Read): suppress debug message when
338 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
340 * src/insets/insetinclude.C (Ascii): New method. Currently
341 supports only verbatim input.
343 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
345 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
347 2000-12-22 Juergen Vigna <jug@sad.it>
349 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
350 have a selection and button == 3.
351 (UpdateLocal): if what == INIT clear selection if existent!
352 (InsetButtonPress): don't activate the cell inset on button==3
354 (LocalDispatch): move curor up/down if exiting an inset which this
357 2000-12-20 Juergen Vigna <jug@sad.it>
359 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
360 calling for the math-panel (do not unlock the math-inset if locked)!
362 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
363 text-insets (with x-offset).
365 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
366 alignment of multicolumn-cells.
368 2000-12-19 Juergen Vigna <jug@sad.it>
370 * src/lyxfunc.C (Dispatch):
371 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
374 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
376 * src/WorkArea.C (work_area_handler): simplify the key/keysym
377 handling for XForms 0.89, this might have rendered some cases
378 unusable. I have at least deadkeys, accent-xxx and KP_x working.
379 Please report proplems.
381 * src/lyxfunc.C (processKeySym): make the self-insert handling
384 2000-12-18 Baruch Even <baruch.even@writeme.com>
386 * src/LaTeX.C (deplog): fix spelling errors
387 * src/text2.C (CutSelection): ditto
388 * src/lyxfunc.C (Dispatch): ditto
390 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
392 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
394 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
395 and h_align in default init.
396 adjust calls to MathedRowSt
398 * src/mathed/math_iter.C: adjust calls to MathedRowSt
399 * src/mathed/math_iter.h (getAD): ditto
401 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
402 methods setBaseline, ascent, descent
403 (class MathMatrixInset): remove method GetAlign, change h_align
406 * src/lyxfunc.C (processKeySym): discover the correct argument if
407 the action is LFUN_SELFINSERT
409 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
411 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
414 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
416 * src/support/copy.C: don't include filetools.h
418 * lib/images: revert to old banner, drop the cucumber.
420 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
422 * src/converter.C (Formats::View): Change the current directory to
423 the directory of the file.
425 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
427 * src/kbsequence.C (addkey): also clear sequence and modifiers if
430 * src/BufferView2.C (theLockingInset): return 0 if text is 0
432 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
434 * Many files: Fix RTL support for insettext.
436 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
438 * README: add mention of broken ghostscript versions, remove
439 reference to non-existent BUGS file
441 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
443 * src/support/lstrings.C (compare_no_case): small fix. When passed
444 length, should use it in the size comparison.
446 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
448 * src/insets/insetexternal.C (getScreenLabel): Return a default
449 value if the template label is empty.
451 * src/lyxlookup.C: do not condition on FL_REVISION.
454 * src/sp_form.C: fix the font size of some text entries
456 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
457 after TOC when there is no TOC.
459 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
460 bind file if it has not been done yet.
461 (read): remove local bindFile variable. Try to fix the handling of
462 RC_BIND and RC_BINDFILE.
464 * src/lyx_main.C (init): use readBindFileIfNeeded().
466 * lib/languages: Change description of german to "German (new
469 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
471 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
472 "Apply" buttons if arg is non-zero.
474 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
475 launching the popup if sufficient info is passed to
476 LFUN_CITATION_CREATE.
478 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
480 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
481 labels (disabled in 1.1.6).
483 * src/lyxrc.[Ch]: New variable label_init_length
485 * mathed/formula.C (LocalDispatch): Preserve the label when
486 changing from display math to eqnarray (however, the label
487 do not appear at the first line, as one might expects, but at the
489 (LocalDispatch): When inserting a label to a formula which already
490 have a label, the old label is used as default value.
491 Also, if the label is changed, then all references to the label
494 * src/mathed/math_iter.C (setLabel): Allow to set the label
495 even if it is empty. This is needed to allow deletion of a label
498 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
499 refernces only if the old label appears once in the document.
501 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
503 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
504 <gehlert@Rcs1.urz.tu-dresden.de>
506 * src/frontends/xforms/FormBase.C: comment out debug.h
508 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
509 code in xform_helpers instead.
510 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
512 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
513 Use N_(), rather than _() when creating strings to pass to browseFile()
514 because browseFile calls gettext() itself now.
516 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
517 display the filename correctly.
519 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
521 * src/converter.C (Move): New method. Used to move file or files
522 from temp dir to the output dir. (this fixes the bug that
523 exporting linuxdoc/docbook document to html would not move all
524 html file from temp directory).
526 * src/support/filetools.C (DirList): Fixed.
528 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
530 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
532 * src/converter.C (Add): Remove $$i when setting latex_command.
534 * src/text.C (IsBoundary): Return false when pos = 0.
536 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
538 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
540 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
542 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
543 need to empty the fields to turn off use of the geometry package!
545 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
547 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
548 (Buffer const &), not a (BufferParams const &) and so fix a crash
549 caused by using current_view before it had been initialised. Not
550 the best way to do this, but much easier than changing
551 Inset::Clone(Buffer const &) to Inset::Clone().
554 * src/tabular.C: changed call to CopyIntoMinibuffer().
556 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
558 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
560 * src/lyxfunc.C (getStatus): disable insertion of floats in a
563 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
565 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
566 changed filter for screen fonts input filter from int to float
568 * src/frontends/xforms/input_validators.c: removed.
569 * src/frontends/xforms/input_validators.C: new file. Can now call C++
570 functions from within the filter functions.
572 * src/frontends/xforms/input_validators.[Ch]
573 (fl_unsigned_float_filter): new filter function.
575 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
576 confused now! And if you think I'm going to do this in
577 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
579 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
581 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
583 * src/WorkArea.C (work_area_handler): don't handle button requests
584 if xbutton.button == 0
586 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
588 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
589 It creates a lot of interesting problems.
591 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
593 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
594 the menu exists in the current menubar before opening it.
596 * src/MenuBackend.C (hasSubmenu): new method.
598 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
599 action value by offsetting actions by a large constant (so that
600 bogs choice result will be less than this constant).
602 * lib/bind/fi_menus.bind: more cleanup to menus.
603 * lib/bind/sciword.bind: ditto.
604 * lib/bind/xemacs.bind: ditto.
605 * lib/bind/emacs.bind: ditto.
606 * lib/bind/pt_menus.bind: ditto.
607 * lib/bind/hu_menus.bind: ditto.
609 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
611 * INSTALL: update PROBLEMS section.
613 * src/lyxlookup.h: remove condition on xforms version, since we
614 should not include it if not appropriate.
616 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
618 * src/LColor.C: "latex text" -> "latex inset" (from
621 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
623 * src/frontends/kde/FormTabularCreate.C:
624 * src/frontends/kde/citationdlg.C:
625 * src/frontends/kde/copyrightdlg.C:
626 * src/frontends/kde/paradlg.C:
627 * src/frontends/kde/paraextradlg.C:
628 * src/frontends/kde/parageneraldlg.C:
629 * src/frontends/kde/printdlg.C:
630 * src/frontends/kde/refdlg.C:
631 * src/frontends/kde/tabcreatedlg.C:
632 * src/frontends/kde/tocdlg.C:
633 * src/frontends/kde/urldlg.C: add necessary headers
636 * src/frontends/kde/dlg/emptytable.C:
637 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
638 default parameters (from Angus Leeming)
640 * src/frontends/kde/dlg/moc/.cvsignore:
641 * src/frontends/kde/dlg/.cvsignore:
642 * src/frontends/kde/moc/.cvsignore: fix the library name
645 * src/frontends/kde/paradlg.C:
646 * src/frontends/kde/parageneraldlg.C:
647 * src/frontends/kde/dlg/para.dlg:
648 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
650 * src/frontends/kde/dlg/README: clarified qtarch version
652 * src/frontends/kde/dlg/Makefile.am: removed the
653 dlg rules as they created spontaneous rebuilds
654 (not a good idea as it requires qtarch)
656 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
658 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
659 fixlevel along with xforms version.
661 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
662 xforms version is strictly less than 0.89.5.
663 * src/lyx_gui.C (LyXGUI): ditto.
664 * src/LyXView.C (show): ditto.
666 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
668 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
669 movement in inset in RTL text.
670 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
671 (workAreaButtonRelease): Do not open a float when there is a selection.
673 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
675 * src/spellchecker.C (RunSpellChecker): Open all floats before
678 * src/text.C (InsertChar): Consider "," as a part of a number
679 (for LTR numbers in RTL text code).
680 (IsBoundary): Fixed (and simplified).
681 (InsertChar): Recalculate cursor boundary.
684 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
686 * src/spellchecker.C: fix figures with pspell enabled
688 * src/insets/figinset.C: workaround for gs hang xforms bug
690 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
692 * lib/bind/??_menus.bind: comment out the entries corresponding to
693 real menus. They should be eventually removed, but I'll let the
694 language maintainers do that.
696 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
698 * src/frontends/kde/parageneraldlg.C:
699 * src/frontends/kde/parageneraldlg.h: don't use
700 a derived class for SpaceAbove/Below
702 * src/frontends/kde/dlg/README: add some info
704 * src/frontends/kde/dlg/*: update data files, update
707 * src/frontends/kde/dlg/moc/Makefile.am: add
710 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
712 * configure.in: add new KDE Makefiles
713 * src/vspace.h: return GlueLength not a normal one
714 * src/support/lstrings.h:
715 * src/support/lstrings.C: add isStrUnsignedInt(),
718 * src/frontends/kde/*: big reorganisation, update
719 FormParagraph, add FormTabCreate
721 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
723 * lib/ui/default.ui: small grammatical change.
725 * src/frontends/xforms/xform_macros.h: removed.
727 * src/frontends/xforms/FormBase.C:
728 * src/frontends/xforms/FormPreferences.C:
729 * src/frontends/xforms/Makefile.am: changes associated with removing
730 xform_macros.h. Should make Lars' debugging a little easier.
732 * src/frontends/xforms/FormPreferences.C:
733 * src/frontends/xforms/FormPreferences.h:
734 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
735 longer use X11 color name database. HSV and RGB dials/sliders.
736 Please let this be the end of this!
738 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
740 * Several files: Allow compilation when the compiler doesn't
743 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
746 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
747 command line options.
749 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
751 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
752 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
755 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
757 * src/frontends/xforms/FormRef.C (updateBrowser):
758 * src/frontends/xforms/forms/form_ref.fd: try clicking on
759 different insets with the sort key active. Now apply this patch!
761 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
763 * src/frontends/xforms/FormPrint.C: set to valid()
764 when we update from the passed parameters.
766 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
768 * src/LColor.C (getFromGUIName): internationalise the comparison.
770 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
771 FormPreferences choice.
773 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
776 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
778 * src/lyxrc.C: more detail for the printer program config
781 * src/LColor.C: ert->latex text. LColor needs a big revamp
782 but will have to wait till after 1.1.6
784 * src/buffer.C: bring up a dialog if we load a document
785 with an un-installed text class, rather than just complain
788 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
790 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
791 the browser form for a combox in a tabbed folder. Bug fix courtesy of
792 Steve Lamont <spl@ncmir.ucsd.edu>.
794 * src/frontends/xforms/FormDocument.C (build):
795 * src/frontends/xforms/FormPreferences.C (Language::build):
796 pass tabfolders to Combox::add() in order to use this work around.
798 * src/frontends/xforms/FormCitation.C (connect): remove max size
800 (update): sort list of bibliography keys.
802 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
804 No max size limitation. Same popup for new and existing insets. Fixes
805 bugs reported by Rob Lahaye.
807 * src/frontends/xforms/FormCitation.C (c-tor):
808 * src/frontends/xforms/FormCopyright.C (c-tor):
809 * src/frontends/xforms/FormError.C (c-tor):
810 * src/frontends/xforms/FormGraphics.C (c-tor):
811 * src/frontends/xforms/FormIndex.C (c-tor):
812 * src/frontends/xforms/FormRef.C (c-tor):
813 * src/frontends/xforms/FormToc.C (c-tor):
814 * src/frontends/xforms/FormUrl.C (c-tor):
815 use correct policy for ButtonController.
817 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
819 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
822 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
824 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
825 Some resizing changes.
827 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
829 * configure.in: fix typo
831 * lib/languages: add ukraninian and change no to no_NO
833 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
835 * src/bufferview_funcs.C (FontSize): use setLyXSize
837 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
839 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
840 to check for systems where mkstemp() is available but not declared
841 in headers. The new autoconf macro lyx_CHECK_DECL can be used
842 to check for declarations in headers.
844 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
846 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
848 * forms/makefile: added bibforms.fd, include_form.fd.
849 Removed lyx_sendfax.fd.
851 * src/LaTeXLog.C (ShowLatexLog):
852 * src/LyXAction.C (init):
853 * src/bufferparams.C (readLanguage): altered messages as suggested by
856 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
859 * src/credits.C: made fd_form_credits non-static, so that it can be
860 redrawn should the xforms colors be re-mapped.
861 * src/spellchecker.C ditto fd_form_spell_options.
863 * src/filedlg.[Ch] (redraw):
864 * src/intl.[Ch] (redraw):
865 * src/lyxfr0.[Ch] (redraw):
866 * src/insets/figinset.[Ch] (redraw):
867 * src/insets/insetexternal.[Ch] (redraw):
868 new methods, connected to Dialogs::redrawGUI.
870 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
871 to be connected to Dialogs::redrawGUI.
873 * src/frontends/xforms/FormCitation.C (build):
874 * src/frontends/xforms/FormCopyright.C (build):
875 * src/frontends/xforms/FormError.C (build):
876 * src/frontends/xforms/FormGraphics.C (build):
877 * src/frontends/xforms/FormIndex.C (build):
878 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
879 * src/frontends/xforms/FormToc.C (build):
880 * src/frontends/xforms/FormUrl.C (build):
881 use the ButtonController correctly.
883 * src/frontends/xforms/FormCopyright.C (build):
884 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
885 the .fd file and into build().
887 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
889 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
891 * src/frontends/xforms/forms/form_citation.fd:
892 * src/frontends/xforms/forms/form_copyright.fd:
893 * src/frontends/xforms/forms/form_error.fd:
894 * src/frontends/xforms/forms/form_graphics.fd:
895 * src/frontends/xforms/forms/form_index.fd:
896 * src/frontends/xforms/forms/form_toc.fd:
897 * src/frontends/xforms/forms/form_url.fd:
898 renamed some of the objects. Named others explicitly for the first time.
899 Added Restore and Apply buttons where appropriate.
901 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
904 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
906 * src/version.h: try the pre2 again
908 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
910 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
912 * src/frontends/kde/FormParagraph.C: added using directive.
914 * src/frontends/kde/paradlg.C: added config.h and using directive.
916 * src/frontends/kde/paradlg.h: added std::qualifier.
918 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
920 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
922 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
924 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
926 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
928 * src/version.h: set back to 1.1.6cvs
930 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
932 * src/version.h: set to 1.1.6pre2
934 2000-11-20 Marko Vendelin <markov@ioc.ee>
936 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
938 * src/frontends/gnome/Makefile.am: updated list of XForms object files
940 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
942 * src/LColor.C (init):
943 * src/lyxrc.C (getDescription): changed some comments as suggested by
946 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
947 disconnect the redrawGUI signal in best-practice fashion.
949 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
950 long_opts_tab to reflect the change in name of this tabfolder, as
951 suggested by John Levon.
952 (connect, disconnect): new methods. Don't do much at present other than
953 ensuring that we can't resize the dialog. This just makes xforms go
955 (lots of methods in Colors): made void rather than bool. The idea is
956 to have an isOk() function that keeps track of whether any input is
957 genuinely invalid and should therefore block Save, Apply.
958 Easier to manipulate the counters rapidly.
959 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
960 compiler will like this code. Much cleaner way of doing things.
962 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
964 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
965 rather than simple counters, following suggestion by John Levon.
967 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
968 than engraved frame + text.
970 * src/frontends/xforms/forms/makefile: removed spurious command.
972 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
974 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
976 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
979 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
981 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
982 see what Lars has changed and what is just white space!
983 Now used X directly to ascertain the RGB color associated with the
985 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
987 Added some sort capability.
988 The X11 color name database input is only displayed if the database
989 isn't found in the standard place.
990 Got rid of struct compare_converter; it wasn't used.
991 Probably some other stuff that I've forgotten.
993 * src/frontends/xforms/FormPreferences.h: changed the names of some
994 methods in the Colors struct. Added a couple of structs to help sort
995 colors by name and by RGBColor.
997 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
998 functions into a new class RWInfo.
1000 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
1001 The dialog is now almost navigable using the keyboard. Unfortunately,
1002 the cursor has to be inside a browser for it to be activated. There is
1003 no visual feedback for the key shortcuts to the arrow keys (use
1004 Alt-appropriate arrow key, Alt-x).
1006 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
1009 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
1010 xform_helpers.[Ch]. See above.
1012 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1014 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
1016 * src/screen.C (setCursorColor): new method. Sets the color of the
1018 (ShowManualCursor): call it.
1019 Constify some local variables.
1021 * src/LColor.[Ch] (LColor): add entry for cursor
1022 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
1025 2000-11-19 Juergen Vigna <jug@sad.it>
1027 * src/insets/insettabular.C (draw): fixed text border redraw problem.
1028 (calculate_dimensions_of_cells): try to boost up when inserting chars.
1030 2000-11-15 Rob Lahaye <lahaye@postech.edu>
1032 * lib/ui/default.ui: OptItem used for Fax entry
1034 2000-11-17 Matej Cepl <cepl@bigfoot.com>
1036 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
1038 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
1040 * src/vspace.C (nextToken): fix so it can handle length phrases like
1041 "10mm+-20mm", "40inplus16mmminus10cm" etc.
1043 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1045 * src/frontends/xforms/FormPreferences.C: constify several variables
1046 (BrowserLyX): rewrite to not need the choice variable
1047 (Modify): rewrite to not need the choide variable
1048 (compare_converter): make operator const
1050 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
1051 correct the writing of \set_color
1052 (getDescription): return a const string
1054 * src/kbsequence.[Ch] (addkey): remove dead code
1056 * src/Painter.C (text): remove some commented code
1058 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1060 * src/ColorHandler.[Ch]: removed some header files from .h file.
1061 Included LColor.h in .C file.
1063 * src/LColor.[Ch]: made class copyable so that I could create a
1064 system_lcolor instance.
1066 * src/Painter.h: removed LColor.h.
1068 * src/lyx_gui.C (create_forms): used AddName.
1070 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
1071 of user preferences/lyxrc file.
1073 * src/lyxrc.C (output): output changes to lcolor.
1075 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
1077 Moved class xformColor to files xform_helpers.[Ch]. These files,
1078 Color.[Ch], could now be moved into src if they would be useful to
1081 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
1082 Also moved FormPreferences::browseFile here as it can be used by any
1083 xform dialog with a "Browse" button. FormGraphics is a perfect example.
1085 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
1086 ReadableFile): changed the FormPreferences methods a little and moved
1087 them here as they'll be useful elsewhere also.
1089 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
1090 Removed some header files and used forward declarations instead.
1092 Removed some methods as they'll be useful elsewhere (see above).
1094 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
1095 Can also now modify the LyX LColors. However, for reasons that I don't
1096 yet understand, it appears that we can use
1097 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
1098 present. The problem appears to lie in ColorHandler, because I can
1099 change the color using LColor.SetColor(). Similarly, when reading in a
1100 preferences file with some set_color instances, I'll get a warning
1101 like: Color sea green is undefined or may not be redefined
1102 Bad lyxrc set_color for sea green
1104 Once the buffer is loaded, however, I can happily change to this color.
1106 Finally, it appears that I have to set the color of "inset frame"
1107 explicitly, or it oscillates from "black" to "indian red" with each
1110 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1112 * ANNOUNCE: corrected a spelling mistake.
1114 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
1117 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1119 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
1121 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
1124 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
1125 match the requirements from the standard better. This is required
1126 to work with gnu libstdc++-v3
1128 * src/frontends/xforms/FormPreferences.C: add explict pair
1129 arguments to browse calls. include support/lyxmanip.h remvoe
1130 extern fmt. whitespace changes. reorder variables in
1131 FormPreferences.h, to match initalizaton order.
1133 * several files: constify more local variables.
1135 * src/buffer.C: remove some commented functions.
1137 * src/DepTable.C (remove_files_with_extension): temporary
1138 work around for gcc 2.97
1139 * src/filedlg.C (find): ditto
1140 * src/Variables.C (set): ditto
1141 * src/LyXAction.C (searchActionArg): ditto
1142 (retrieveActionArg): ditto
1144 * configure.in: check for mktemp too
1146 * UPGRADING: prepare for 1.1.6
1148 * Makefile.am (lgbtags): add backup tags for when etags are
1149 different than usual.
1151 * ANNOUNCE: prepare for 1.1.6
1153 * src/support/tempname.C (make_tempfile): new function, wrapper
1154 around mkstemp and mktemp. Only mkstemp has been tested.
1155 (tempName): call it.
1157 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1159 * default.ui: capitalized some menu items to improve shortcuts.
1161 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1163 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1165 * src/frontends/xforms/Dialogs.C: add "using" directive.
1167 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1169 * src/filedlg.C (Select): highlight suggested file in browser, if
1172 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1173 each tab folder is encapsulated in its own class.
1174 The Language keymaps are now chosen using a text input and a
1175 browser button, rather than a Combox.
1176 All the browser buttons are now functional, although LyXFileDlg
1177 still needs to be modified to make it straighhtforward to return a
1178 directory if that is what is desired.
1180 * src/frontends/xforms/forms/form_preferences.fd: use text input
1181 and browse button to input the Language keymaps. Add a few
1182 callbacks for the browse buttons.
1184 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1186 * src/support/tempname.C (tempName): small changes to make it
1187 safer. remove the '.' before XXXXXX
1189 * src/support/filetools.C (TmpFileName): remove func
1192 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1193 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1194 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1195 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1197 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1198 (FormCommand): ditto
1200 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1203 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1204 for bp (this fixes a reproducible hard crash)
1206 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1209 * src/frontends/xforms/FormBase.h: make bp_ private
1210 (FormBaseBI): remove default for bp
1213 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1216 * src/frontends/xforms/Color.C (RGBColor): made several vars
1217 const, changed initialization of j to allow it to be const
1220 * several files: added const to local variables.
1222 * src/lyx_cb.C: removed several function prototypes and moved them
1226 (UpdateLayoutPreamble):
1228 (MenuInsertLabel): add BufferView as arguemnt
1229 (LayoutsCB): make tmp const
1231 * src/layout_forms.h: regenerated
1233 * src/debug.C: add Debug::FILES
1234 (showLevel) (showTags): translate the desc
1236 * src/debug.h: add FILES as debug target
1238 * src/bufferlist.C: use current_view as an interim measure becuase
1239 of added arguments to MenuWrite and MenuWriteAs
1241 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1243 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1245 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1246 libstdc++ is compiled with.
1248 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1250 * lib/layouts/docbook-book.layout
1251 * lib/layouts/docbook.layout
1252 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1253 those paragraphs are expresse as SGML comments <!-- -->.
1255 * src/LaTeXFeatures.h
1256 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1257 parameter, this allows to express all the include files as relative
1258 paths to the master buffer. The verbatim insert works as the other
1261 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1263 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1265 (MakeDocBookFile): top_element is always written. Some clean up, as
1266 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1268 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1269 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1270 a reference is written instead of the name.
1271 (Validate): use the relative path for the filename.
1273 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1276 * src/support/filetools.h
1277 * src/support/filetools.C (IsSGMLFilename): added.
1280 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1282 * development/OS2/quick_fix.patch:
1283 * lib/configure.cmd:
1284 * README.OS2: quick update to the OS/2 port.
1286 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1288 * src/converter.C: add "using" directive.
1290 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1291 (compare_converter): add "int" as return type.
1293 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1296 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1298 * src/lyx_gui.C (create_forms): map the xform colours, should a
1299 mapping exist. Ie, call XformColor::read().
1301 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1302 and struct HSV as HSVColor.
1303 (XformColor::read, XformColor::write) : new methods that
1304 input/output any changes to the cform GUI colors.
1306 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1309 * src/frontends/xforms/FormPreferences.C Lots of little changes
1310 associated with the changed name of the RGB and HSV structs. Can
1311 now save changes to xforms GUI to file. Commented out
1312 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1313 used currently anyway.
1315 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1317 * src/converter.C: A lot of changes:
1318 - It is no longer possible to choose between two or more ways to
1319 export to some format (the new code uses only the shortest path).
1320 However, it is still possible to choose between pdflatex/ps2pdf
1321 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1322 - Added several methods that makes the FormPreferences code simpler.
1323 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1325 * src/exporter.C (Export): lyxrc.use_pdf is set before
1326 makeLaTeXFile is called. This works but not very nice.
1328 * src/frontends/xforms/FormPreferences.C: The formats/converters
1329 tabs are now fully functional.
1331 * src/buffer.C (getTocList): Add numbers to the captions.
1333 * lib/lyxrc.example: Removed fax section
1335 * src/support/rename.C (rename): Delete the old file if lyx::copy
1338 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1340 * lib/ui/default.ui: minor polishing.
1342 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1344 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1347 * lib/Makefile.am (DOCINST): do not install everything in the
1348 documentation directory.
1350 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1352 * src/bufferlist.C (newFile): set the filename to the constructed
1355 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1356 constructed "newfileXX.lyx" name to the dialog
1358 * src/frontends/DialogBase.h: make update() non-abstract so
1359 KDE doesn't need to implement two update methods for every form
1361 * src/frontends/kde/Makefile.am: add missing xforms objects
1364 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1366 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1368 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1369 structs RGB and HSV. May not be the best place for these files.
1370 Perhaps move them into src ?
1372 * src/frontends/xforms/Makefile.am: added new files.
1374 * src/frontends/xforms/forms/form_preferences.fd:
1375 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1376 replaced all instances of "colour" with "color"!
1378 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1381 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1382 tab. Can now alter the colors of the xform's GUI on the fly. With
1383 the aid of a single static Signal (see below), can "Apply" these
1384 changes to all currently open dialogs. (Well, to all of the NEW
1385 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1386 subsequently opened dialogs will, of course, also have the new
1387 color scheme. Cannot yet save (or load) the choices to file, so
1388 they are lost when exiting LyX.
1390 * src/frontends/Dialogs.h:
1391 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1392 Used to trigger a redraw of any dialogs connected to it because,
1393 for example, the GUI colours have been re-mapped.
1395 * src/frontends/xforms/FormBase.[Ch]:
1396 * src/frontends/xforms/FormDocument.[Ch]:
1397 * src/frontends/xforms/FormParagraph.[Ch]:
1398 * src/frontends/xforms/FormPreferences.[Ch]:
1399 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1400 method, to be connected to Dialogs::redrawGUI. Method must be
1401 virtual, because dialogs with tabbed folders need to redraw the
1402 forms of each tab folder.
1404 * src/LyXView.C (d-tor):
1405 * src/frontends/xforms/FormBase.C (d-tor): connected
1406 Dialogs::redrawGUI signal to redraw().
1408 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1409 removed Assert, because it is identical to that in FormBase.
1411 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1413 * lib/ui/default.ui: minor polishing.
1415 2000-11-10 Juergen Vigna <jug@sad.it>
1417 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1418 (deleteLyXText): ditto
1420 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1421 selection on mouse-button-3.
1423 * src/insets/insettabular.h: new function clearSelection(), use this
1424 functions inside insettabular.C.
1426 * src/insets/insettabular.C (TabularFeatures): clear the selection
1427 on remove_row/column.
1429 * src/insets/inset.C (scroll): fixed some scroll stuff.
1431 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1433 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1435 * lib/CREDITS: add Yves Bastide
1437 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1439 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1440 check whether C library functions are in the global namespace.
1442 * configure.in: calls it.
1444 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1445 #ifndef __GLIBCPP__.
1447 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1449 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1450 iterators to prevent crash.
1452 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1454 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1456 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1457 shortcut for xforms CB to the preemptive or post-handler function.
1459 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1460 removed the HIDDEN_TIMER as it's no longer used.
1461 Various other small changes.
1463 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1464 preemptive handler to obtain feedback, rather than the post-handler.
1465 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1467 Formats tab is now complete. Converters tab is nearly so.
1469 2000-11-09 Juergen Vigna <jug@sad.it>
1471 * src/insets/insettext.C (~InsetText):
1474 (SetParagraphData): set cache.second to 0 after deleting it!
1475 (getLyXText): check if cache.second is not 0 if finding it.
1477 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1479 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1480 lyxlex to parse the rgb.txt file.
1483 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1484 replace the default '#' comment character.
1486 * src/support/tempname.C: add "using" directive
1487 * src/frontends/ButtonPolicies.C: ditto.
1489 * src/support/filetools.C (DirList): add an explicit cast to avoid
1490 a compile error (probably not the right fix)
1492 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1494 * src/support/filetools.C (DirList): implement using system functions
1496 * src/support/tempname.C: new file
1498 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1500 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1502 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1505 * src/frontends/xforms/ButtonController.C: new file
1507 * src/os2_defines.h: remove getcwd define
1509 * src/lyxvc.C: include support/lyxlib.h
1510 (showLog): use lyx::tempName
1512 * src/lyx_cb.C: comment out includes that we don't need
1513 (AutoSave): use lyx::tempName
1515 * src/filedlg.C: include support/lyxlib.h
1516 (Reread): use lyx::getcwd
1518 * src/converter.C: include support/filetools.h
1519 (add_options): change to static inline, make tail const
1520 (Add): make old_viewer const
1521 (GetAllFormats): make it a const method, use const_iterator
1522 (enable): make static inline
1523 (SplitFormat): make using_format const
1525 * src/LaTeX.C (run): use lyx::getcwd
1527 * configure.in: check for mkstemp as well
1529 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1531 * src/converter.[Ch] (GetAllCommands): new method.
1533 * src/support/filetools.[Ch] (DirList): new method.
1535 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1536 functionality to the converters tab.
1537 The formats tab is now nearly complete.
1538 The kbmap choices in Languages tab now display the contents of
1539 system_lyxdir/kbd/*.kmap in readable form.
1541 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1542 Moved some variables into the class.
1544 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1545 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1546 colour of active folder to lighter grey instead. Any takers?
1547 (form_colours): added an "Apply" button.
1548 (form_converters): added a "Flags" input field.
1549 (form_formats): added a "Shortcut" input field. Note that we can't use
1550 names such as "input_shortcut" as this buggers up the sed script stuff.
1552 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1560 * src/lyx_sendfax_main.C:
1563 * src/spellchecker.C:
1564 * src/insets/figinset.C:
1565 * src/insets/insetbib.C:
1566 * src/insets/insetexternal.C:
1567 * src/insets/insetinclude.C:
1568 * src/insets/insetinfo.C:
1569 * src/mathed/math_panel.C:
1570 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1571 all "daughter" dialogs now have identical "feel".
1573 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1575 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1576 used (and was only used in one place prior to this patch. Incorrectly!)
1578 * src/frontends/xforms/FormDocument.C: changed some instances of
1579 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1580 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1581 for options_->input_float_placement. This fixes a bug reported by
1584 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1585 functionality into d-tor.
1587 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1588 input of numerals also.
1590 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1591 fl_set_form_atclose(). Can now close dialog from window manager,
1592 fixing a bug reported by Rob Lahaye.
1594 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1596 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1597 are no longer dark. Haven't yet worked out how to lighten the colour of
1598 the active tabfolder. Any ideas anybody?
1599 Adjusted Colours tab a little.
1600 Added Shortcut field to converters tab. Note that we can't create an
1601 fdesign label like "input_shortcut" as this buggers up the sed-script
1604 * src/frontends/xforms/FormPreferences.[Ch]:
1605 (feedback): fixed crash due to to ob=0.
1606 (LanguagesXXX): the kbmap choices now contain the files
1607 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1608 be replaced by an input with a file browse button, but since the browse
1609 buttons don'y yet work, this'll do for the moment.
1610 (FormatsXXX): think that this is now nearly fully functional.
1611 Some points/questions though:
1612 1. Does "Apply" remove formats if no longer present?
1613 2. I think that the browser should list the GUI names rather than the
1615 3. Must ensure that we can't delete Formats used by an existing
1618 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1619 if this is the best way to do this.
1621 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1623 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1625 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1626 for variable assignment.
1628 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1630 * src/lib/ui/default.ui: added sub/superscripts to menu as
1631 Insert->Special characters and cleaned-up the file a bit
1633 2000-11-07 Allan Rae <rae@lyx.org>
1635 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1636 ob isn't 0 before using it. See comments in function.
1638 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1640 * src/frontends/xforms/form_*.C: regenerated
1642 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1644 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1646 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1647 compiling with gcc-2.96
1649 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1651 * src/support/lyxstring.C: add a couple "using" directives.
1653 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1654 a .c_str() here too for good measure.
1655 * src/Spacing.C (set): ditto.
1656 * src/lyxfunc.C (Dispatch): ditto.
1658 * src/insets/insettabular.C (copySelection): change .str() to
1659 .str().c_str() to fix problems with lyxstring.
1660 * src/support/filetools.C (GetFileContents): ditto.
1661 * src/buffer.C (asciiParagraph): ditto.
1662 * src/paragraph.C (String): ditto.
1664 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1665 * lib/bind/sciword.bind: ditto.
1667 * src/LyXAction.C (init): remove "symbol-insert" function, which
1668 shared LFUN_INSERT_MATH with "math-insert".
1670 * lib/configure.m4: == is not a valid operator for command test.
1672 * src/lyxrc.C: add using directive.
1674 * src/converter.h: add std:: qualifier.
1676 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1678 * src/converter.[Ch] and other files: Change the Format class to a
1679 real class, and create two instances: formats and system_format.
1681 * src/lyxrc.C (output): Output the difference between formats and
1684 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1685 (buildFormats): Insert formats into browser.
1686 (inputFormats): Made the browser and add button functional.
1687 (applyFormats): Update formats from format_vec.
1689 * src/converter.C: Changed all (*it). to it->
1690 (Format::dummy): New method.
1691 (Format::importer): New format flag.
1692 (Formats::GetAllFormats): New method.
1693 (Formats::Add): Delete format from the map if prettyname is empty.
1694 (Converter::Convert): Print an error message if moving the file fails.
1695 (Converter::GetReachableTo): New method
1697 * src/MenuBackend.[Ch]: Add support for importformats tag.
1699 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1701 * lib/configure.m4: Add word->tex and ps->fax converters.
1703 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1704 Return fax to file menu.
1708 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1710 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1713 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1716 * src/lyxfunc.C (processKeyEvent): removed
1718 * src/bufferlist.C (emergencyWrite): removed the out commented
1719 emergency write code.
1721 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1723 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1725 * many files: change formatting to be a bit more uniform for
1726 if,while,for,switch statements, remove some parantesis not needed.
1729 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1731 * config/kde.m4: make config more robust when KDEDIR is set
1733 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1735 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1736 not returned a pixmap for "math-insert".
1738 * src/LyXAction.C (init): sort the entries a bit.
1740 2000-11-03 Juergen Vigna <jug@sad.it>
1742 * src/insets/insettabular.h: added fixed number to update codes so
1743 that update is only in one direction.
1745 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1748 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1749 before call to edit because of redraw.
1751 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1753 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1755 * lib/ui/default.ui: Populate "edit_float" menu
1757 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1759 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1760 "floats-operate". The name is ugly (and the func also), but this
1761 is just a band-aid until we switch to new insets.
1763 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1765 * lib/ui/default.ui: update again the menu layout (fix some
1768 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1770 * src/MenuBackend.h (fulllabel): new method.
1772 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1773 the menu shortcuts of a menu are unique and whether they
1774 correspond to a letter of the label.
1775 (expand): call checkShortcuts when debugging.
1777 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1779 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1781 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1783 * lib/examples/*.lyx : '\language default' => '\language english'
1785 * lib/examples/it_splash.lyx : except where it should be italian
1787 * lib/templates/*.lyx : the same
1789 * doc/*.lyx* : the same
1791 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1793 * lib/bind/menus.bind: remove the Layout menu entries, which I
1794 somehow forgot earlier.
1796 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1798 * lib/ui/old-default.ui: keep the old one here for reference (to
1801 * lib/ui/default.ui: update the menu layout
1803 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1805 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1806 Can now Apply to different insets without closing the dialog.
1808 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1809 Can't actually DO anything with them yet, but I'd like a little
1812 * src/frontends/xforms/input_validators.[ch]
1813 (fl_lowercase_filter): new.
1815 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1817 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1818 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1820 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1822 2000-11-02 Juergen Vigna <jug@sad.it>
1824 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1825 on char insertion as it has already be updated by bv->updateInset().
1827 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1828 if an inset inside was updated.
1830 * lib/configure.cmd: commented out fax-search code
1832 2000-11-01 Yves Bastide <stid@acm.org>
1834 * src/tabular.C (OldFormatRead): set tabular language to the
1837 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1839 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1840 class names with non-letter characters (from Yves Bastide).
1842 * lib/ui/default.ui: change Item to OptItem in import menu.
1843 Comment out fax stuff.
1845 * lib/configure.m4: comment out fax-related stuff.
1847 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1849 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1850 useful xforms helper functions. At present contains only formatted().
1851 Input a string and it returns it with line breaks so that in fits
1854 * src/frontends/xforms/Makefile.am: add new files.
1856 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1857 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1860 * src/frontends/xforms/FormPreferences.[Ch]:
1861 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1862 but lots of little clean ups. Removed enum State. Make use of
1863 formatted(). Constify lots of methods. Perhaps best of all: removed
1864 requirement for that horrible reinterpret_cast from pointer to long in
1867 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1869 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1870 conditionalize build on xforms < 0.89
1872 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1874 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1876 * src/LyXAction.C (init): comment out fax
1878 * src/lyxrc.h: comment out the fax enums
1879 comment out the fax variables
1881 * src/commandtags.h: comment out LFUN_FAX
1883 * src/lyxrc.C: disable fax variables.
1884 (read): disable parsing of fax variables
1885 (output): disable writing of fax variables
1886 (getFeedback): now description for fax variables
1888 * src/lyxfunc.C: comment out MenuFax
1889 (Dispatch): disable LFUN_FAX
1891 * src/lyx_cb.C (MenuFax): comment out
1893 * src/WorkArea.C: add <cctype>
1894 (work_area_handler): better key handling, should be ok now.
1895 for accented chars + etc
1897 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1898 lyx_sendfax.h and lyx_sendfax_man.C
1900 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1901 (show): don't call InitLyXLookup when using xforms 0.89
1903 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1905 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1907 * src/support/filetools.C (GetFileContents): close to dummy change
1909 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1911 * src/trans.C (AddDeadkey): workaround stupid compilers.
1913 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1915 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1916 of two-sided document.
1918 2000-10-31 Juergen Vigna <jug@sad.it>
1920 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1922 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1923 xposition to the Edit call.
1925 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1927 * src/trans.C (AddDeadkey): cast explicitly to char.
1929 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1931 * src/tabular.C (AsciiBottomHLine): simplify?
1932 (AsciiTopHLine): simplify?
1933 (print_n_chars): simplify
1934 (DocBook): remove most of the << endl; we should flush the stream
1935 as seldom as possible.
1937 (TeXBottomHLine): ditto
1938 (TeXTopHLine): ditto
1940 (write_attribute): try a templified version.
1941 (set_row_column_number_info): lesson scope of variables
1943 * src/support/lstrings.h (tostr): new specialization of tostr
1945 * src/trans.C (AddDeadkey): slightly cleaner fix.
1947 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1949 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1950 '%%' in Toc menu labels.
1953 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1954 font_norm is iso10646-1.
1956 * src/font.C (ascent): Fixed for 16bit fonts
1957 (descent,lbearing,rbearing): ditto
1959 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1961 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1962 (getFeedback): new static method.
1964 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1965 Now use combox rather than choice to display languages.
1966 Feedback is now output using a new timer callback mechanism, identical
1967 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1969 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1971 * src/minibuffer.C: fix for older compilers
1973 2000-10-30 Juergen Vigna <jug@sad.it>
1975 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1976 has to be Left of the inset otherwise LyXText won't find it!
1978 * src/BufferView2.C (open_new_inset): delete the inset if it can
1981 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1983 * lyx.man: fix typo.
1985 2000-10-29 Marko Vendelin <markov@ioc.ee>
1986 * src/frontends/gnome/FormCitation.C
1987 * src/frontends/gnome/FormCitation.h
1988 * src/frontends/gnome/FormCopyright.C
1989 * src/frontends/gnome/FormCopyright.h
1990 * src/frontends/gnome/FormError.C
1991 * src/frontends/gnome/FormError.h
1992 * src/frontends/gnome/FormIndex.C
1993 * src/frontends/gnome/FormIndex.h
1994 * src/frontends/gnome/FormPrint.C
1995 * src/frontends/gnome/FormPrint.h
1996 * src/frontends/gnome/FormRef.C
1997 * src/frontends/gnome/FormRef.h
1998 * src/frontends/gnome/FormToc.C
1999 * src/frontends/gnome/FormToc.h
2000 * src/frontends/gnome/FormUrl.C
2001 * src/frontends/gnome/FormUrl.h
2002 * src/frontends/gnome/Menubar_pimpl.C
2003 * src/frontends/gnome/mainapp.C
2004 * src/frontends/gnome/mainapp.h
2005 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
2006 changing update() to updateSlot() where appropriate
2008 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
2010 * src/frontends/xforms/FormPreferences.[Ch]:
2011 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
2014 2000-10-28 Juergen Vigna <jug@sad.it>
2016 * src/insets/insettabular.C (draw): fixed drawing bug.
2018 * src/insets/insettext.C (clear):
2020 (SetParagraphData): clearing the TEXT buffers when deleting the
2021 paragraphs used by it.
2023 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
2025 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
2027 2000-10-27 Juergen Vigna <jug@sad.it>
2029 * src/tabular.C (~LyXTabular): removed not needed anymore.
2031 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
2034 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
2036 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
2039 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
2042 * src/frontends/xforms/FormPreferences.[Ch]:
2043 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
2044 Reorganised as modules based on tabs. Much easier to follow the
2045 flow and to add new tabs. Added warning and feedback messages.
2048 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2050 * src/tabular.h (DocBook): add std:: qualifier.
2052 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
2054 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
2055 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
2058 * insettabular.C (DocBook): uses the tabular methods to export
2061 * src/insets/insettext.h
2062 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
2064 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2066 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
2069 * src/lyxfunc.C (MenuNew): lessen the scope of fname
2070 moved misplaced AllowInput two lines up.
2072 * src/buffer.C (readFile): compare float with float, not with int
2074 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2076 * src/minibuffer.C: add "using SigC::slot" statement.
2078 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
2080 * src/frontends/xforms/forms/README: updated section about make.
2082 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
2083 Tidied some forms up, made two of form_tabular's tabs more
2084 self-consistent, fixed Jean-Marc's size problem in form_preferences,
2085 fixed translation problem with "Column".
2087 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2089 * src/minibuffer.h: use Timeout instead of the xforms timer
2091 (setTimer) rewrite for the Timeout, change to unsigned arg
2092 (set): change to unsigned timer arg
2095 * src/minibuffer.C (TimerCB): removed func
2096 (C_MiniBuffer_TimerCB): removed func
2097 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
2098 (peek_event): use a switch statement
2099 (add): don't use fl_add_timer.
2100 (Set): rewrite to use the Timeout
2103 * src/Timeout.[Ch] (setType): return a Timeout &
2104 (setTimeout): ditto, change to unsigned arg for timeout
2106 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
2108 * src/mathed/formula.C (mathed_string_width): Use string instead
2109 of a constant size char array.
2111 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2113 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
2114 the two recently added operator<< for SMInput and State.
2116 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
2118 (OkCancelPolicy): ditto
2119 (OkCancelReadOnlyPolicy): ditto
2120 (NoRepeatedApplyReadOnlyPolicy): ditto
2121 (OkApplyCancelReadOnlyPolicy): ditto
2122 (OkApplyCancelPolicy): ditto
2123 (NoRepeatedApplyPolicy): ditto
2125 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2127 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
2128 add the usual std:: qualifiers.
2130 2000-10-25 Juergen Vigna <jug@sad.it>
2132 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
2134 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2136 * src/support/filetools.C (MakeRelPath): change some types to
2139 * src/frontends/ButtonPolicies.h (operator<<): new operator for
2140 ButtonPolicy::SMInput and ButtonPolicy::State.
2142 * src/FontLoader.C (reset): small cleanup
2143 (unload): small cleanup
2145 * src/FontInfo.C (getFontname): initialize error to 10000.0
2147 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2149 * src/frontends/xforms/FormPreferences.[Ch]:
2150 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
2151 TeX encoding and default paper size sections.
2153 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2155 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2158 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2159 make the message_ empty.
2160 (FormError): don't initialize message_ in initializer list.
2162 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2164 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2166 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2168 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2170 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2172 * src/frontends/kde/*data.[Ch]: _("") is not
2175 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2177 * src/buffer.C: removed redundant using directive.
2179 * src/frontends/DialogBase.h: revert to original definition of
2182 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2183 stuff into two classes, one for each dialog, requires a new
2184 element in the dialogs vector, FormTabularCreate.
2186 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2189 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2190 method. Continues Allan's idea, but means that derived classes
2191 don't need to worry about "update or hide?".
2193 * src/frontends/xforms/FormError.C (showInset): add connection
2196 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2197 one for each dialog. FormTabular now contains main tabular dialog
2200 * src/frontends/xforms/FormTabularCreate.[Ch]:
2201 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2204 * src/frontends/xforms/FormGraphics.[Ch]:
2205 * src/frontends/xforms/forms/form_graphics.fd
2206 * src/frontends/xforms/FormTabular.[Ch]:
2207 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2208 classes of FormInset.
2210 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2211 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2213 * src/frontends/xforms/Makefile.am:
2214 * src/frontends/xforms/forms/makefile: added new files.
2216 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2217 variable. added Signal0 hide signal, in keeping with other GUI-I
2220 * src/support/lstrings.h: removed redundant std:: qualifier as
2221 it's already declared in Lsstream.h.
2223 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2225 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2229 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2231 * src/tabular.C (Ascii): minimize scope of cell.
2233 * src/BufferView2.C (nextWord): return string() instead of 0;
2235 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2237 * src/converter.h: add a std:: qualifier
2239 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2241 * src/importer.[Ch]: New files. Used for importing files into LyX.
2243 * src/lyxfunc.C (doImport): Use the new Importer class.
2245 * src/converter.h: Add shortcut member to the Format class.
2246 Used for holding the menu shortcut.
2248 * src/converter.C and other files: Made a distinction between
2249 format name and format extension. New formats can be defined using
2250 the \format lyxrc tag.
2251 Added two new converter flags: latex and disable.
2253 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2255 * src/support/lyxlib.h: unify namespace/struct implementation.
2256 Remove extra declarations.
2258 * src/support/chdir.C (chdir): remove version taking char const *
2260 * src/support/rename.C: ditto.
2261 * src/support/lyxsum.C: ditto.
2263 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2265 * src/frontends/xforms/FormBase.[Ch]:
2266 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2267 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2268 work only for the next call to fl_show_form(). The correct place to set
2269 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2270 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2271 from FormBase have the minimum size set; no more stupid crashes with
2274 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2276 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2278 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2280 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2282 * src/support/lyxlib.h: changed second argument of mkdir to
2283 unsigned long int (unsigned int would probably have been enough,
2284 but...). Removed <sys/types.h> header.
2285 * src/support/mkdir.C (mkdir): ditto.
2289 2000-10-19 Juergen Vigna <jug@sad.it>
2291 * src/lyxfunc.C (MenuNew): small fix (form John)
2293 * src/screen.C (Update): removed unneeded code.
2295 * src/tabular.C (Ascii): refixed int != uint bug!
2297 * src/support/lyxlib.h: added sys/types.h include for now permits
2298 compiling, but I don't like this!
2300 2000-10-18 Juergen Vigna <jug@sad.it>
2302 * src/text2.C (ClearSelection): if we clear the selection we need
2303 more refresh so set the status apropriately
2305 * src/insets/insettext.C (draw): hopefully finally fixed draw
2308 2000-10-12 Juergen Vigna <jug@sad.it>
2310 * src/insets/insettext.C (draw): another small fix and make a block
2311 so that variables are localized.
2313 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2315 * src/support/lstrings.C (lowercase, uppercase):
2316 use explicit casts to remove compiler warnings.
2318 * src/support/LRegex.C (Impl):
2319 * src/support/StrPool.C (add):
2320 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2321 (AddPath, MakeDisplayPath):
2322 * src/support/lstrings.C (prefixIs, subst):
2323 use correct type to remove compiler warnings.
2325 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2327 * src/support/lyxlib.h:
2328 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2329 portability and to remove compiler warning with DEC cxx.
2331 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2333 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2335 * src/minibuffer.C (peek_event): retun 1 when there has been a
2336 mouseclick in the minibuffer.
2340 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2342 * src/frontends/xforms/FormParagraph.C: more space above/below
2345 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2347 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2348 a char only if real_current_font was changed.
2350 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2352 * NEWS: update somewhat for 1.1.6
2354 * lib/ui/default.ui: clean up.
2356 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2358 * lib/CREDITS: clean up
2360 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2362 * src/combox.[Ch] (select): changed argument back to int
2363 * src/combox.C (peek_event): removed num_bytes as it is declared but
2366 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2367 modified calls to Combox::select() to remove warnings about type
2370 * src/insets/insetbutton.C (width): explicit cast to remove warning
2371 about type conversion.
2373 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2376 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2377 sel_pos_end, refering to cursor position are changed to
2378 LyXParagraph::size_type.
2380 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2381 consistent with LyXCursor::pos().
2382 (inset_pos): changed to LyXParagraph::size_type for same reason.
2384 * src/insets/insettext.C (resizeLyXText): changed some temporary
2385 variables refing to cursor position to LyXParagraph::size_type.
2387 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2389 * src/frontends/kde/<various>: The Great Renaming,
2392 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2394 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2396 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2398 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2399 0 when there are no arguments.
2401 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2403 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2404 to segfaults when pressing Ok in InsetBibtex dialog.
2406 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2408 * forms/layout_forms.fd:
2409 * src/layout_forms.C (create_form_form_character): small change to use
2410 labelframe rather than engraved frame + text
2412 * src/lyx_gui.C (create_forms): initialise choice_language with some
2413 arbitrary value to prevent segfault when dialog is shown.
2415 2000-10-16 Baruch Even <baruch.even@writeme.com>
2417 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2418 is no resulting file. This pertains only to LaTeX output.
2420 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2422 * src/text.C (Backspace): Make sure that the row of the cursor is
2425 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2428 * src/lyx_gui.C (init): Prevent a crash when only one font from
2429 menu/popup fonts is not found.
2431 * lib/lyxrc.example: Add an example for binding a key for language
2434 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2436 * src/converter.C (GetReachable): Changed the returned type to
2438 (IsReachable): New method
2440 * src/MenuBackend.C (expand): Handle formats that appear more
2443 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2445 * src/frontends/support/Makefile.am
2446 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2449 * lib/CREDITS: add Garst Reese.
2451 * src/support/snprintf.h: add extern "C" {} around the definitions.
2453 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2455 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2458 * src/frontends/xforms/FormDocument.C:
2459 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2460 compile without "conversion to integral type of smaller size"
2463 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2465 * src/text.C (GetColumnNearX): Fixed disabled code.
2467 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2469 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2472 * src/support/snprintf.[ch]: new files
2474 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2476 * src/frontends/kde/formprintdialog.C: add
2477 file browser for selecting postscript output
2479 * src/frontends/kde/formprintdialogdata.C:
2480 * src/frontends/kde/formprintdialogdata.h: re-generate
2483 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2485 * src/frontends/gnome/Makefile.am:
2486 * src/frontends/kde/Makefile.am: FormCommand.C
2487 disappeared from xforms
2489 * src/frontends/kde/FormCitation.C:
2490 * src/frontends/kde/FormIndex.C: read-only
2493 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2495 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2498 * src/bufferlist.C: add using directive.
2500 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2502 * src/support/lyxfunctional.h: version of class_fun for void
2503 returns added, const versions of back_inseter_fun and compare_fun
2506 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2508 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2510 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2512 * ChangeLog: cleanup.
2514 * lib/CREDITS: update to add all the contributors we've forgotten.
2515 I have obviously missed some, so tell me whether there were
2518 2000-10-13 Marko Vendelin <markov@ioc.ee>
2520 * src/frontends/gnome/FormCitation.C
2521 * src/frontends/gnome/FormCitation.h
2522 * src/frontends/gnome/FormError.C
2523 * src/frontends/gnome/FormIndex.C
2524 * src/frontends/gnome/FormRef.C
2525 * src/frontends/gnome/FormRef.h
2526 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2528 * src/frontends/gnome/FormCitation.C
2529 * src/frontends/gnome/FormCopyright.C
2530 * src/frontends/gnome/FormError.C
2531 * src/frontends/gnome/FormIndex.C
2532 * src/frontends/gnome/FormRef.C
2533 * src/frontends/gnome/FormToc.C
2534 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2537 * src/frontends/gnome/Menubar_pimpl.C
2538 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2541 2000-10-11 Baruch Even <baruch.even@writeme.com>
2544 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2545 to convey its real action.
2547 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2548 clear the minibuffer and prepare to enter a command.
2550 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2551 the rename from ExecCommand to PrepareForCommand.
2552 * src/lyxfunc.C (Dispatch): ditto.
2554 2000-10-11 Baruch Even <baruch.even@writeme.com>
2556 * src/buffer.C (writeFile): Added test for errors on writing, this
2557 catches all errors and not only file system full errors as intended.
2559 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2561 * src/lyx_gui.C (create_forms): better fix for crash with
2562 translated interface.
2564 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2566 * src/frontends/kde/Makefile.am:
2567 * src/frontends/kde/FormCopyright.C:
2568 * src/frontends/kde/formcopyrightdialog.C:
2569 * src/frontends/kde/formcopyrightdialog.h:
2570 * src/frontends/kde/formcopyrightdialogdata.C:
2571 * src/frontends/kde/formcopyrightdialogdata.h:
2572 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2573 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2574 copyright to use qtarch
2576 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2578 * src/encoding.C (read): Fixed bug that caused an error message at
2579 the end of the file.
2581 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2583 * lib/lyxrc.example: Fixed hebrew example.
2585 2000-10-13 Allan Rae <rae@lyx.org>
2587 * src/frontends/xforms/FormPreferences.C (input): reworking the
2589 (build, update, apply): New inputs in various tabfolders
2591 * src/frontends/xforms/FormToc.C: use new button policy.
2592 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2593 dialogs that either can't use any existing policy or where it just
2596 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2599 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2600 added a bool parameter which is ignored.
2602 * src/buffer.C (setReadonly):
2603 * src/BufferView_pimpl.C (buffer):
2604 * src/frontends/kde/FormCopyright.h (update):
2605 * src/frontends/kde/FormCitation.[Ch] (update):
2606 * src/frontends/kde/FormIndex.[Ch] (update):
2607 * src/frontends/kde/FormPrint.[Ch] (update):
2608 * src/frontends/kde/FormRef.[Ch] (update):
2609 * src/frontends/kde/FormToc.[Ch] (update):
2610 * src/frontends/kde/FormUrl.[Ch] (update):
2611 * src/frontends/gnome/FormCopyright.h (update):
2612 * src/frontends/gnome/FormCitation.[Ch] (update):
2613 * src/frontends/gnome/FormError.[Ch] (update):
2614 * src/frontends/gnome/FormIndex.[Ch] (update):
2615 * src/frontends/gnome/FormPrint.[Ch] (update):
2616 * src/frontends/gnome/FormRef.h (update):
2617 * src/frontends/gnome/FormToc.[Ch] (update):
2618 * src/frontends/gnome/FormUrl.[Ch] (update):
2619 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2620 to updateBufferDependent and DialogBase
2622 * src/frontends/xforms/FormCitation.[hC]:
2623 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2624 * src/frontends/xforms/FormError.[Ch]:
2625 * src/frontends/xforms/FormGraphics.[Ch]:
2626 * src/frontends/xforms/FormIndex.[Ch]:
2627 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2628 and fixed readOnly handling.
2629 * src/frontends/xforms/FormPrint.[Ch]:
2630 * src/frontends/xforms/FormRef.[Ch]:
2631 * src/frontends/xforms/FormTabular.[Ch]:
2632 * src/frontends/xforms/FormToc.[Ch]:
2633 * src/frontends/xforms/FormUrl.[Ch]:
2634 * src/frontends/xforms/FormInset.[Ch]:
2635 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2636 form of updateBufferDependent.
2638 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2639 if form()->visible just in case someone does stuff to the form in a
2642 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2643 the buttoncontroller for everything the enum used to be used for.
2644 (update) It would seem we need to force all dialogs to use a bool
2645 parameter or have two update functions. I chose to go with one.
2646 I did try removing update() from here and FormBase and defining the
2647 appropriate update signatures in FormBaseB[DI] but then ran into the
2648 problem of the update() call in FormBase::show(). Whatever I did
2649 to get around that would require another function and that just
2650 got more confusing. Hence the decision to make everyone have an
2651 update(bool). An alternative might have been to override show() in
2652 FormBaseB[DI] and that would allow the different and appropriate
2655 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2656 true == buffer change occurred. I decided against using a default
2657 template parameter since not all compilers support that at present.
2659 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2661 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2662 army knife" by removing functionality.
2663 (clearStore): removed. All such housekeeping on hide()ing the dialog
2664 is to be carried out by overloaded disconnect() methods.
2665 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2666 superceded by Baruch's neat test (FormGraphics) to update an existing
2667 dialog if a new signal is recieved rather than block all new signals
2669 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2670 only to Inset dialogs.
2671 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2672 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2674 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2676 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2677 as a base class to all inset dialogs. Used solely to connect/disconnect
2678 the Inset::hide signal and to define what action to take on receipt of
2679 a UpdateBufferDependent signal.
2680 (FormCommand): now derived from FormInset.
2682 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2685 * src/frontends/xforms/FormCopyright.[Ch]:
2686 * src/frontends/xforms/FormPreferences.[Ch]:
2687 now derived from FormBaseBI.
2689 * src/frontends/xforms/FormDocument.[Ch]:
2690 * src/frontends/xforms/FormParagraph.[Ch]:
2691 * src/frontends/xforms/FormPrint.[Ch]:
2692 now derived from FormBaseBD.
2694 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2696 * src/frontends/xforms/FormCitation.[Ch]:
2697 * src/frontends/xforms/FormError.[Ch]:
2698 * src/frontends/xforms/FormRef.[Ch]:
2699 * src/frontends/xforms/FormToc.[Ch]:
2700 (clearStore): reworked as disconnect().
2702 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2705 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2707 * src/converter.C (runLaTeX): constify buffer argument
2710 * src/frontends/support/Makefile.am (INCLUDES): fix.
2712 * src/buffer.h: add std:: qualifier
2713 * src/insets/figinset.C (addpidwait): ditto
2714 * src/MenuBackend.C: ditto
2715 * src/buffer.C: ditto
2716 * src/bufferlist.C: ditto
2717 * src/layout.C: ditto
2718 * src/lyxfunc.C: ditto
2720 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2722 * src/lyxtext.h (bidi_level): change return type to
2723 LyXParagraph::size_type.
2725 * src/lyxparagraph.h: change size_type to
2726 TextContainer::difference_type. This should really be
2727 TextContainer::size_type, but we need currently to support signed
2730 2000-10-11 Marko Vendelin <markov@ioc.ee>
2731 * src/frontends/gnome/FormError.h
2732 * src/frontends/gnome/FormRef.C
2733 * src/frontends/gnome/FormRef.h
2734 * src/frontends/gnome/FormError.C
2735 * src/frontends/gnome/Makefile.am
2736 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2737 to Gnome frontend. Both dialogs use "action" area.
2739 2000-10-12 Baruch Even <baruch.even@writeme.com>
2741 * src/graphics/GraphicsCacheItem_pimpl.C:
2742 * src/graphics/Renderer.C:
2743 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2746 2000-10-12 Juergen Vigna <jug@sad.it>
2748 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2749 visible when selecting).
2751 * development/Code_rules/Rules: fixed some typos.
2753 2000-10-09 Baruch Even <baruch.even@writeme.com>
2755 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2756 compiling on egcs 1.1.2 possible.
2758 * src/filedlg.C (comp_direntry::operator() ): ditto.
2760 2000-08-31 Baruch Even <baruch.even@writeme.com>
2762 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2765 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2766 transient it now only gets freed when the object is destructed.
2768 2000-08-24 Baruch Even <baruch.even@writeme.com>
2770 * src/frontends/FormGraphics.h:
2771 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2774 2000-08-20 Baruch Even <baruch.even@writeme.com>
2776 * src/insets/insetgraphics.C:
2777 (draw): Added messages to the drawn rectangle to report status.
2778 (updateInset): Disabled the use of the inline graphics,
2781 2000-08-17 Baruch Even <baruch.even@writeme.com>
2783 * src/frontends/support: Directory added for the support of GUII LyX.
2785 * src/frontends/support/LyXImage.h:
2786 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2789 * src/frontends/support/LyXImage_X.h:
2790 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2791 version of LyXImage, this uses the Xlib Pixmap.
2793 * src/PainterBase.h:
2794 * src/PainterBase.C:
2796 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2797 replacement to Pixmap.
2799 * src/insets/insetgraphics.h:
2800 * src/insets/insetgraphics.C:
2801 * src/graphics/GraphicsCacheItem.h:
2802 * src/graphics/GraphicsCacheItem.C:
2803 * src/graphics/GraphicsCacheItem_pimpl.h:
2804 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2807 * src/graphics/GraphicsCacheItem.h:
2808 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2809 another copy of the object.
2811 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2812 of cacheHandle, this fixed a bug that sent LyX crashing.
2814 * src/graphics/XPM_Renderer.h:
2815 * src/graphics/XPM_Renderer.C:
2816 * src/graphics/EPS_Renderer.h:
2817 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2819 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2821 * src/lyxfunc.C (processKeySym): only handle the
2822 lockinginset/inset stuff if we have a buffer and text loaded...
2824 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2826 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2828 * src/support/lyxfunctional.h: add operator= that takes a reference
2830 * src/lyxserver.C (mkfifo): make first arg const
2832 * src/layout.h: renamed name(...) to setName(...) to work around
2835 * src/buffer.C (setFileName): had to change name of function to
2836 work around bugs in egcs. (renamed from fileName)
2838 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2840 * src/support/translator.h: move helper template classes to
2841 lyxfunctional.h, include "support/lyxfunctional.h"
2843 * src/support/lyxmanip.h: add delaration of fmt
2845 * src/support/lyxfunctional.h: new file
2846 (class_fun_t): new template class
2847 (class_fun): helper template function
2848 (back_insert_fun_iterator): new template class
2849 (back_inserter_fun): helper template function
2850 (compare_memfun_t): new template class
2851 (compare_memfun): helper template function
2852 (equal_1st_in_pair): moved here from translator
2853 (equal_2nd_in_pair): moved here from translator
2855 * src/support/fmt.C: new file
2856 (fmt): new func, can be used for a printf substitute when still
2857 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2859 * src/support/StrPool.C: add some comments
2861 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2864 * src/insets/figinset.C (addpidwait): use std::copy with
2865 ostream_iterator to fill the pidwaitlist
2867 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2869 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2872 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2875 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2877 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2878 (class_update): ditto
2879 (BulletPanel): ditto
2880 (CheckChoiceClass): move initialization of tc and tct
2882 * src/tabular.C: remove current_view
2883 (OldFormatRead): similar to right below [istream::ignore]
2885 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2886 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2887 unused [istream::ignore]
2889 * src/lyxfunc.C: include "support/lyxfunctional.h"
2890 (getInsetByCode): use std::find_if and compare_memfun
2892 * src/lyxfont.C (stateText): remove c_str()
2894 * src/lyx_main.C (setDebuggingLevel): make static
2895 (commandLineHelp): make static
2897 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2898 Screen* together with fl_get_display() and fl_screen
2900 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2901 togheter with fl_get_display() and fl_screen
2902 (create_forms): remove c_str()
2904 * src/layout.C: include "support/lyxfunctional.h"
2905 (hasLayout): use std::find_if and compare_memfun
2906 (GetLayout): use std::find_if and comapre_memfun
2907 (delete_layout): use std::remove_if and compare_memfun
2908 (NumberOfClass): use std:.find_if and compare_memfun
2910 * src/gettext.h: change for the new functions
2912 * src/gettext.C: new file, make _(char const * str) and _(string
2913 const & str) real functions.
2915 * src/font.C (width): rewrite slightly to avoid one extra variable
2917 * src/debug.C: initialize Debug::ANY here
2919 * src/commandtags.h: update number comments
2921 * src/combox.h (get): make const func
2923 (getline): make const
2925 * src/combox.C (input_cb): handle case where fl_get_input can
2928 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2929 "support/lyxfunctional.h", remove current_view variable.
2930 (resize): use std::for_each with std::mem_fun
2931 (getFileNames): use std::copy with back_inserter_fun
2932 (getBuffer): change arg type to unsigned int
2933 (emergencyWriteAll): call emergencyWrite with std::for_each and
2935 (emergencyWrite): new method, the for loop in emergencyWriteAll
2937 (exists): use std::find_if with compare_memfun
2938 (getBuffer): use std::find_if and compare_memfun
2940 * src/buffer.h: add typedefs for iterator_category, value_type
2941 difference_type, pointer and reference for inset_iterator
2942 add postfix ++ for inset_iterator
2943 make inset_iterator::getPos() const
2945 * src/buffer.C: added support/lyxmanip.h
2946 (readFile): use lyxerr << fmt instead of printf
2947 (makeLaTeXFile): use std::copy to write out encodings
2949 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2951 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2952 free and the char * temp.
2953 (hasMenu): use std::find_if and compare_memfun
2956 * src/Makefile.am (lyx_SOURCES): added gettext.C
2958 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2959 string::insert small change to avoid temporary
2961 * src/LColor.C (getGUIName): remove c_str()
2963 * several files: change all occurrences of fl_display to
2966 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2967 that -pedantic is not used for gcc 2.97 (cvs gcc)
2969 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2971 2000-10-11 Allan Rae <rae@lyx.org>
2973 * src/frontends/xforms/FormPreferences.C (input): template path must be
2974 a readable directory. It doesn't need to be writeable.
2975 (build, delete, update, apply): New inputs in the various tabfolders
2977 * src/frontends/xforms/forms/form_preferences.fd:
2978 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2979 several new entries to existing folders. Shuffled some existing stuff
2982 * src/frontends/xforms/forms/form_print.fd:
2983 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2984 Should probably rework PrinterParams as well. Note that the switch to
2985 collated is effectively the same as !unsorted so changing PrinterParams
2986 will require a lot of fiddly changes to reverse the existing logic.
2988 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2990 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2992 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2994 2000-10-10 Allan Rae <rae@lyx.org>
2997 * src/lyxfunc.C (Dispatch):
2999 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
3002 * src/lyxrc.C (output): Only write the differences between system lyxrc
3003 and the users settings.
3006 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
3008 I'll rewrite this later, after 1.1.6 probably, to keep a single
3009 LyXRC but two instances of a LyXRCStruct.
3011 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3013 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
3015 * src/tabular.h: add a few std:: qualifiers.
3017 * src/encoding.C: add using directive.
3018 * src/language.C: ditto.
3020 * src/insets/insetquotes.C (Validate): use languages->lang()
3021 instead of only language.
3023 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
3025 * lib/languages: New file.
3027 * lib/encodings: New file.
3029 * src/language.C (Languages): New class.
3030 (read): New method. Reads the languages from the 'languages' file.
3032 * src/encoding.C (Encodings): New class.
3033 (read): New method. Reads the encodings from the 'encodings' file.
3035 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
3038 * src/bufferparams.h and a lot of files: Deleted the member language,
3039 and renamed language_info to language
3041 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
3042 * src/lyxfont.C (latexWriteStartChanges): ditto.
3043 * src/paragraph.C (validate,TeXOnePar): ditto.
3045 * src/lyxfont.C (update): Restored deleted code.
3047 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
3049 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
3051 * src/BufferView_pimpl.C (buffer): cleaned up a little.
3053 * src/insets/figinset.[Ch]:
3054 * src/insets/insetinclude.[Ch]:
3055 * src/insets/insetinclude.[Ch]:
3056 * src/insets/insetparent.[Ch]:
3057 * src/insets/insetref.[Ch]:
3058 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
3060 * src/insets/*.[Ch]:
3061 * src/mathed/formula.[Ch]:
3062 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
3064 * src/buffer.C (parseSingleLyXformat2Token, readInset):
3065 * src/lyx_cb.C (FigureApplyCB):
3066 * src/lyxfunc.C (getStatus, Dispatch):
3067 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
3070 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
3072 * src/converter.[Ch] (Formats::View):
3073 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
3075 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
3076 *current_view->buffer(). This will change later, but this patch is way
3079 2000-10-09 Juergen Vigna <jug@sad.it>
3081 * src/text.C (GetRow): small fix.
3083 * src/BufferView_pimpl.C (cursorPrevious):
3084 (cursorNext): added LyXText parameter to function.
3086 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
3087 keypress depending on cursor position.
3089 2000-10-06 Juergen Vigna <jug@sad.it>
3091 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
3092 (copySelection): redone this function and also copy ascii representa-
3095 * src/tabular.C (Ascii):
3099 (print_n_chars): new functions to realize the ascii export of tabulars.
3101 2000-10-05 Juergen Vigna <jug@sad.it>
3103 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
3104 if we don't have a buffer.
3106 2000-10-10 Allan Rae <rae@lyx.org>
3108 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
3109 with closing dialog. It seems that nested tabfolders require hiding
3110 of inner tabfolders before hiding the dialog itself. Actually all I
3111 did was hide the active outer folder.
3113 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
3114 unless there really is a buffer. hideBufferDependent is called
3117 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
3118 POTFILES.in stays in $(srcdir).
3120 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
3122 * lib/lyxrc.example: Few changes.
3124 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
3126 * src/BufferView_pimpl.C (buffer): only need one the
3127 updateBufferDependent signal to be emitted once! Moved to the end of
3128 the method to allow bv_->text to be updated first.
3130 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
3131 and hSignal_ with Dialogs * and BufferDependency variables.
3132 New Buffer * parent_, initialised when the dialog is launched. Used to
3133 check whether to update() or hide() dialog in the new, private
3134 updateOrHide() method that is connected to the updateBufferDependent
3135 signal. Daughter classes dictate what to do using the
3136 ChangedBufferAction enum, passed to the c-tor.
3138 * src/frontends/xforms/FormCitation.C:
3139 * src/frontends/xforms/FormCommand.C:
3140 * src/frontends/xforms/FormCopyright.C:
3141 * src/frontends/xforms/FormDocument.C:
3142 * src/frontends/xforms/FormError.C:
3143 * src/frontends/xforms/FormIndex.C:
3144 * src/frontends/xforms/FormPreferences.C:
3145 * src/frontends/xforms/FormPrint.C:
3146 * src/frontends/xforms/FormRef.C:
3147 * src/frontends/xforms/FormToc.C:
3148 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
3151 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3152 ChangedBufferAction enum.
3154 * src/frontends/xforms/FormParagraph.[Ch]
3155 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3158 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3160 * lib/bind/cua.bind: fix a bit.
3161 * lib/bind/emacs.bind: ditto.
3163 * lib/bind/menus.bind: remove real menu entries from there.
3165 * src/spellchecker.C: make sure we only include strings.h when
3168 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3170 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3171 function. It enlarges the maximum number of pup when needed.
3172 (add_toc2): Open a new menu if maximum number of items per menu has
3175 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3177 * src/frontends/kde/FormPrint.C: fix error reporting
3179 * src/frontends/xforms/FormDocument.C: fix compiler
3182 * lib/.cvsignore: add Literate.nw
3184 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3187 * bufferview_funcs.[Ch]
3190 * text2.C: Add support for numbers in RTL text.
3192 2000-10-06 Allan Rae <rae@lyx.org>
3194 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3195 to be gettext.m4 friendly again. ext_l10n.h is now
3196 generated into $top_srcdir instead of $top_builddir
3197 so that lyx.pot will be built correctly -- without
3198 duplicate parsing of ext_l10n.h.
3200 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3202 * src/frontends/kde/FormCitation.C: make the dialog
3203 behave more sensibly
3205 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3207 * config/kde.m4: fix consecutive ./configure runs,
3208 look for qtarch, fix library order
3210 * src/frontends/kde/Makefile.am: tidy up,
3211 add Print dialog, add .dlg dependencies
3213 * src/frontends/kde/FormPrint.C:
3214 * src/frontends/kde/FormPrint.h:
3215 * src/frontends/kde/formprintdialog.C:
3216 * src/frontends/kde/formprintdialog.h:
3217 * src/frontends/kde/formprintdialogdata.C:
3218 * src/frontends/kde/formprintdialogdata.h:
3219 * src/frontends/kde/dlg/formprintdialog.dlg: add
3222 * src/frontends/kde/dlg/README: Added explanatory readme
3224 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3225 script to double-check qtarch's output
3227 * src/frontends/kde/formindexdialog.C:
3228 * src/frontends/kde/formindexdialogdata.C:
3229 * src/frontends/kde/formindexdialogdata.h:
3230 * src/frontends/kde/dlg/formindexdialog.dlg: update
3231 for qtarch, minor fixes
3233 2000-10-05 Allan Rae <rae@lyx.org>
3235 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3236 dialogs when switching buffers update them instead. It's up to each
3237 dialog to decide if it should still be visible or not.
3238 update() should return a bool to control visiblity within show().
3239 Or perhaps better to set a member variable and use that to control
3242 * lib/build-listerrors: create an empty "listerrors" file just to stop
3243 make trying to regenerate it all the time if you don't have noweb
3246 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3248 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3249 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3250 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3251 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3252 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3254 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3256 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3258 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3259 deleting buffer. Closes all buffer-dependent dialogs.
3261 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3263 * src/frontends/xforms/FormCitation.[Ch]:
3264 * src/frontends/xforms/FormPreferences.[Ch]:
3265 * src/frontends/xforms/FormPrint.[Ch]:
3266 * src/frontends/xforms/FormRef.[Ch]:
3267 * src/frontends/xforms/FormUrl.[Ch]: ditto
3269 * src/frontends/xforms/FormDocument.[Ch]:
3270 * src/frontends/xforms/forms/form_document.C.patch:
3271 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3272 pass through a single input() function.
3274 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3276 * lib/build-listerrors: return status as OK
3278 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3280 * lib/lyxrc.example: Updated to new export code
3282 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3284 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3287 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3290 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3291 LyX-Code is defined.
3292 * lib/layouts/amsbook.layout: ditto.
3294 * boost/Makefile.am: fix typo.
3296 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3298 (add_lastfiles): removed.
3299 (add_documents): removed.
3300 (add_formats): removed.
3302 * src/frontends/Menubar.C: remove useless "using" directive.
3304 * src/MenuBackend.h: add a new MenuItem constructor.
3306 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3309 2000-10-04 Allan Rae <rae@lyx.org>
3311 * lib/Makefile.am (listerrors):
3312 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3313 I haven't got notangle installed so Kayvan please test. The output
3314 should end up in $builddir. This also allows people who don't have
3315 noweb installed to complete the make process without error.
3317 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3318 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3319 by JMarc's picky compiler.
3321 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3324 * src/insets/insettabular.C (setPos): change for loop to not use
3325 sequencing operator. Please check this Jürgen.
3327 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3329 * src/insets/insetcite.C (getScreenLabel): ditto
3330 * src/support/filetools.C (QuoteName): ditto
3331 (ChangeExtension): ditto
3333 * src/BufferView_pimpl.C (scrollCB): make heigt int
3335 * src/BufferView2.C (insertInset): comment out unused arg
3337 * boost/Makefile.am (EXTRADIST): new variable
3339 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3341 * src/exporter.C (IsExportable): Fixed
3343 * lib/configure.m4: Small fix
3345 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3347 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3348 * src/insets/insetbib.C (bibitemWidest): ditto.
3349 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3351 2000-10-03 Juergen Vigna <jug@sad.it>
3353 * src/BufferView2.C (theLockingInset): removed const because of
3354 Agnus's compile problems.
3356 * src/insets/insettext.C (LocalDispatch): set the language of the
3357 surronding paragraph on inserting the first character.
3359 * various files: changed use of BufferView::the_locking_inset.
3361 * src/BufferView2.C (theLockingInset):
3362 (theLockingInset): new functions.
3364 * src/BufferView.h: removed the_locking_inset.
3366 * src/lyxtext.h: added the_locking_inset
3368 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3370 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3372 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3374 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3375 * src/mathed/math_cursor.C (IsAlpha): ditto.
3376 * src/mathed/math_inset.C (strnew): ditto.
3377 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3378 (IMetrics): cxp set but never used; removed.
3379 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3380 that the variable in question has been removed also!
3383 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3384 using the Buffer * passed to Latex(), using the BufferView * passed to
3385 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3387 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3388 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3390 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3391 * src/buffer.C (readInset): used new InsetBibtex c-tor
3392 * (getBibkeyList): used new InsetBibtex::getKeys
3394 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3397 * lib/build-listerrors
3399 * src/exporter.C: Add literate programming support to the export code
3402 * src/lyx_cb.C: Remove old literate code.
3404 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3407 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3408 * src/converter.C (View, Convert): Use QuoteName.
3410 * src/insets/figinset.C (Preview): Use Formats::View.
3412 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3414 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3416 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3417 the top of the function, because compaq cxx complains that the
3418 "goto exit_with_message" when the function is disabled bypasses
3420 (MenuNew): try a better fix for the generation of new file names.
3421 This time, I used AddName() instead of AddPath(), hoping Juergen
3424 2000-10-03 Allan Rae <rae@lyx.org>
3426 * src/frontends/xforms/forms/form_preferences.fd:
3427 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3428 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3429 "Look and Feel"->"General" but will need to be split up further into
3430 general output and general input tabs. Current plan is for four outer
3431 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3432 stuff; "Inputs" for input and import configuration; "Outputs" for
3433 output and export configuration; and one more whatever is left over
3434 called "General". The leftovers at present look like being which
3435 viewers to use, spellchecker, language support and might be better
3436 named "Support". I've put "Paths" in "Inputs" for the moment as this
3437 seems reasonable for now at least.
3438 One problem remains: X error kills LyX when you close Preferences.
3440 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3442 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3443 qualifier from form()
3444 * src/frontends/xforms/FormCitation.[Ch]:
3445 * src/frontends/xforms/FormCopyright.[Ch]:
3446 * src/frontends/xforms/FormDocument.[Ch]:
3447 * src/frontends/xforms/FormError.[Ch]:
3448 * src/frontends/xforms/FormIndex.[Ch]:
3449 * src/frontends/xforms/FormPreferences.[Ch]:
3450 * src/frontends/xforms/FormPrint.[Ch]:
3451 * src/frontends/xforms/FormRef.[Ch]:
3452 * src/frontends/xforms/FormToc.[Ch]:
3453 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3455 * src/frontends/xforms/FormCitation.[Ch]:
3456 * src/frontends/xforms/FormIndex.[Ch]:
3457 * src/frontends/xforms/FormRef.[Ch]:
3458 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3459 with Allan's naming policy
3461 * src/frontends/xforms/FormCitation.C: some static casts to remove
3464 2000-10-02 Juergen Vigna <jug@sad.it>
3466 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3467 now you can type or do stuff inside the table-cell also when in dummy
3468 position, fixed visible cursor.
3470 * src/insets/insettext.C (Edit): fixing cursor-view position.
3472 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3473 be used for equal functions in lyxfunc and insettext.
3475 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3477 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3479 * src/frontends/gnome/FormCitation.h:
3480 * src/frontends/gnome/FormCopyright.h:
3481 * src/frontends/gnome/FormIndex.h:
3482 * src/frontends/gnome/FormPrint.h:
3483 * src/frontends/gnome/FormToc.h:
3484 * src/frontends/gnome/FormUrl.h:
3485 * src/frontends/kde/FormCitation.h:
3486 * src/frontends/kde/FormCopyright.h:
3487 * src/frontends/kde/FormIndex.h:
3488 * src/frontends/kde/FormRef.h:
3489 * src/frontends/kde/FormToc.h:
3490 * src/frontends/kde/FormUrl.h: fix remaining users of
3493 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3495 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3496 from depth argument.
3497 (DocBookHandleCaption): ditto.
3498 (DocBookHandleFootnote): ditto.
3499 (SimpleDocBookOnePar): ditto.
3501 * src/frontends/xforms/FormDocument.h (form): remove extra
3502 FormDocument:: qualifier.
3504 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3506 * sigc++/handle.h: ditto.
3508 * src/lyx_gui_misc.C: add "using" directive.
3510 * src/cheaders/cstddef: new file, needed by the boost library (for
3513 2000-10-02 Juergen Vigna <jug@sad.it>
3515 * src/insets/insettext.C (SetFont): better support.
3517 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3519 * src/screen.C (DrawOneRow): some uint refixes!
3521 2000-10-02 Allan Rae <rae@lyx.org>
3523 * boost/.cvsignore: ignore Makefile as well
3525 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3526 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3528 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3529 Left this one out by accident.
3531 * src/frontends/xforms/FormBase.h (restore): default to calling
3532 update() since that will restore the original/currently-applied values.
3533 Any input() triggered error messages will require the derived classes
3534 to redefine restore().
3536 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3537 avoid a segfault. combo_doc_class is the main concern.
3539 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3541 * Simplify build-listerrors in view of GUI-less export ability!
3543 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3545 * src/lyx_main.C (easyParse): Disable gui when exporting
3547 * src/insets/figinset.C:
3550 * src/lyx_gui_misc.C
3551 * src/tabular.C: Changes to allow no-gui.
3553 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3555 * src/support/utility.hpp: removed file
3556 * src/support/block.h: removed file
3558 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3561 * src/mathed/formula.C: add support/lyxlib.h
3562 * src/mathed/formulamacro.C: ditto
3564 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3565 * src/lyxparagraph.h: ditto
3567 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3568 * src/frontends/Makefile.am (INCLUDES): ditto
3569 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3570 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3571 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3572 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3573 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3574 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3576 * src/BufferView.h: use boost/utility.hpp
3577 * src/LColor.h: ditto
3578 * src/LaTeX.h: ditto
3579 * src/LyXAction.h: ditto
3580 * src/LyXView.h: ditto
3581 * src/bufferlist.h: ditto
3582 * src/lastfiles.h: ditto
3583 * src/layout.h: ditto
3584 * src/lyx_gui.h: ditto
3585 * src/lyx_main.h: ditto
3586 * src/lyxlex.h: ditto
3587 * src/lyxrc.h: ditto
3588 * src/frontends/ButtonPolicies.h: ditto
3589 * src/frontends/Dialogs.h: ditto
3590 * src/frontends/xforms/FormBase.h: ditto
3591 * src/frontends/xforms/FormGraphics.h: ditto
3592 * src/frontends/xforms/FormParagraph.h: ditto
3593 * src/frontends/xforms/FormTabular.h: ditto
3594 * src/graphics/GraphicsCache.h: ditto
3595 * src/graphics/Renderer.h: ditto
3596 * src/insets/ExternalTemplate.h: ditto
3597 * src/insets/insetcommand.h: ditto
3598 * src/support/path.h: ditto
3600 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3601 and introduce clause for 2.97.
3603 * boost/libs/README: new file
3605 * boost/boost/utility.hpp: new file
3607 * boost/boost/config.hpp: new file
3609 * boost/boost/array.hpp: new file
3611 * boost/Makefile.am: new file
3613 * boost/.cvsignore: new file
3615 * configure.in (AC_OUTPUT): add boost/Makefile
3617 * Makefile.am (SUBDIRS): add boost
3619 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3621 * src/support/lstrings.C (suffixIs): Fixed.
3623 2000-10-01 Allan Rae <rae@lyx.org>
3625 * src/PrinterParams.h: moved things around to avoid the "can't
3626 inline call" warning.
3628 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3629 into doc++ documentation.
3631 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3633 * src/frontends/xforms/FormRef.C: make use of button controller
3634 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3635 cleaned up button controller usage.
3636 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3637 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3638 use the button controller
3640 * src/frontends/xforms/forms/*.fd: and associated generated files
3641 updated to reflect changes to FormBase. Some other FormXxxx files
3642 also got minor updates to reflect changes to FormBase.
3644 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3645 (hide): made virtual.
3646 (input): return a bool. true == valid input
3647 (RestoreCB, restore): new
3648 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3649 Changes to allow derived dialogs to use a ButtonController and
3650 make sense when doing so: OK button calls ok() and so on.
3652 * src/frontends/xforms/ButtonController.h (class ButtonController):
3653 Switch from template implementation to taking Policy parameter.
3654 Allows FormBase to provide a ButtonController for any dialog.
3656 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3657 Probably should rename connect and disconnect.
3658 (apply): use the radio button groups
3659 (form): needed by FormBase
3660 (build): setup the radio button groups
3662 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3664 * several files: type changes to reduce the number of warnings and
3665 to unify type hangling a bit. Still much to do.
3667 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3669 * lib/images/*: rename a bunch of icons to match Dekel converter
3672 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3675 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3677 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3679 * sigc++/handle.h: ditto for class Handle.
3681 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3683 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3685 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3687 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3688 removal of the "default" language.
3690 * src/combox.h (getline): Check that sel > 0
3692 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3694 * lib/examples/docbook_example.lyx
3695 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3697 * lib/layouts/docbook-book.layout: new docbook book layout.
3699 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3701 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3703 * src/insets/figinset.C (DocBook):fixed small typo.
3705 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3707 * src/insets/insetinclude.h: string include_label doesn't need to be
3710 2000-09-29 Allan Rae <rae@lyx.org>
3712 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3713 Allow derived type to control connection and disconnection from signals
3714 of its choice if desired.
3716 2000-09-28 Juergen Vigna <jug@sad.it>
3718 * src/insets/insettabular.C (update): fixed cursor setting when
3719 the_locking_inset changed.
3720 (draw): made this a bit cleaner.
3721 (InsetButtonPress): fixed!
3723 * various files: added LyXText Parameter to fitCursor call.
3725 * src/BufferView.C (fitCursor): added LyXText parameter.
3727 * src/insets/insettabular.C (draw): small draw fix.
3729 * src/tabular.C: right setting of left/right celllines.
3731 * src/tabular.[Ch]: fixed various types in funcions and structures.
3732 * src/insets/insettabular.C: ditto
3733 * src/frontends/xforms/FormTabular.C: ditto
3735 2000-09-28 Allan Rae <rae@lyx.org>
3737 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3738 that the #ifdef's had been applied to part of what should have been
3739 a complete condition. It's possible there are other tests that
3740 were specific to tables that are also wrong now that InsetTabular is
3741 being used. Now we need to fix the output of '\n' after a table in a
3742 float for the same reason as the original condition:
3743 "don't insert this if we would be adding it before or after a table
3744 in a float. This little trick is needed in order to allow use of
3745 tables in \subfigures or \subtables."
3746 Juergen can you check this?
3748 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3750 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3751 output to the ostream.
3753 * several files: fixed types based on warnings from cxx
3755 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3757 * src/frontends/kde/Makefile.am: fix rule for
3758 formindexdialogdata_moc.C
3760 * src/.cvsignore: add ext_l10n.h to ignore
3762 * acconfig.h: stop messing with __STRICT_ANSI__
3763 * config/gnome.m4: remove option to set -ansi
3764 * config/kde.m4: remove option to set -ansi
3765 * config/lyxinclude.m4: don't set -ansi
3767 2000-09-27 Juergen Vigna <jug@sad.it>
3769 * various files: remove "default" language check.
3771 * src/insets/insetquotes.C: removed use of current_view.
3773 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3774 the one should have red ears by now!
3776 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3777 in more then one paragraph. Fixed cursor-movement/selection.
3779 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3780 paragraphs inside a text inset.
3782 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3783 text-inset if this owner is an inset.
3785 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3787 * src/Bullet.h: changed type of font, character and size to int
3789 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3791 * src/insets/inseturl.[Ch]:
3792 * src/insets/insetref.[Ch]:
3793 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3795 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3797 * src/buffer.C (readFile): block-if statement rearranged to minimise
3798 bloat. Patch does not reverse Jean-Marc's change ;-)
3800 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3801 Class rewritten to store pointers to hide/update signals directly,
3802 rather than Dialogs *. Also defined an enum to ease use. All xforms
3803 forms can now be derived from this class.
3805 * src/frontends/xforms/FormCommand.[Ch]
3806 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3808 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3811 * src/frontends/xforms/forms/form_citation.fd
3812 * src/frontends/xforms/forms/form_copyright.fd
3813 * src/frontends/xforms/forms/form_error.fd
3814 * src/frontends/xforms/forms/form_index.fd
3815 * src/frontends/xforms/forms/form_ref.fd
3816 * src/frontends/xforms/forms/form_toc.fd
3817 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3819 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3821 * src/insets/insetfoot.C: removed redundent using directive.
3823 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3825 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3826 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3828 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3829 created in the constructors in different groups. Then set() just
3830 have to show the groups as needed. This fixes the redraw problems
3831 (and is how the old menu code worked).
3833 * src/support/lyxlib.h: declare the methods as static when we do
3834 not have namespaces.
3836 2000-09-26 Juergen Vigna <jug@sad.it>
3838 * src/buffer.C (asciiParagraph): new function.
3839 (writeFileAscii): new function with parameter ostream.
3840 (writeFileAscii): use now asciiParagraph.
3842 * various inset files: added the linelen parameter to the Ascii-func.
3844 * src/tabular.C (Write): fixed error in writing file introduced by
3845 the last changes from Lars.
3847 * lib/bind/menus.bind: removed not supported functions.
3849 * src/insets/insettext.C (Ascii): implemented this function.
3851 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3853 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3854 (Write): use of the write_attribute functions.
3856 * src/bufferlist.C (close): fixed reasking question!
3858 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3860 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3861 new files use the everwhere possible.
3864 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3865 src/log_form.C src/lyx.C:
3868 * src/buffer.C (runLaTeX): remove func
3870 * src/PaperLayout.C: removed file
3871 * src/ParagraphExtra.C: likewise
3872 * src/bullet_forms.C: likewise
3873 * src/bullet_forms.h: likewise
3874 * src/bullet_forms_cb.C: likewise
3876 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3877 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3880 * several files: remove all traces of the old fd_form_paragraph,
3881 and functions belonging to that.
3883 * several files: remove all traces of the old fd_form_document,
3884 and functions belonging to that.
3886 * several files: constify local variables were possible.
3888 * several files: remove all code that was dead when NEW_EXPORT was
3891 * several files: removed string::c_str in as many places as
3894 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3895 (e): be a bit more outspoken when patching
3896 (updatesrc): only move files if changed.
3898 * forms/layout_forms.h.patch: regenerated
3900 * forms/layout_forms.fd: remove form_document and form_paragraph
3901 and form_quotes and form_paper and form_table_options and
3902 form_paragraph_extra
3904 * forms/form1.fd: remove form_table
3906 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3907 the fdui->... rewrite. Update some comments to xforms 0.88
3909 * forms/bullet_forms.C.patch: removed file
3910 * forms/bullet_forms.fd: likewise
3911 * forms/bullet_forms.h.patch: likewise
3913 * development/Code_rules/Rules: added a section on switch
3914 statements. Updated some comment to xforms 0.88.
3916 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3918 * src/buffer.C (readFile): make sure that the whole version number
3919 is read after \lyxformat (even when it contains a comma)
3921 * lib/ui/default.ui: change shortcut of math menu to M-a.
3923 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3925 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3928 * src/LyXView.C (updateWindowTitle): show the full files name in
3929 window title, limited to 30 characters.
3931 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3932 When a number of characters has been given, we should not assume
3933 that the string is 0-terminated.
3935 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3936 calls (fixes some memory leaks)
3938 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3939 trans member on exit.
3941 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3943 * src/converter.C (GetReachable): fix typo.
3945 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3946 understand ',' instead of '.'.
3947 (GetInteger): rewrite to use strToInt().
3949 2000-09-26 Juergen Vigna <jug@sad.it>
3951 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3952 better visibility and error-message on wrong VSpace input.
3954 * src/language.C (initL): added english again.
3956 2000-09-25 Juergen Vigna <jug@sad.it>
3958 * src/frontends/kde/Dialogs.C (Dialogs):
3959 * src/frontends/gnome/Dialogs.C (Dialogs):
3960 * src/frontends/kde/Makefile.am:
3961 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3963 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3965 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3967 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3969 * src/frontends/xforms/FormParagraph.C:
3970 * src/frontends/xforms/FormParagraph.h:
3971 * src/frontends/xforms/form_paragraph.C:
3972 * src/frontends/xforms/form_paragraph.h:
3973 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3976 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3978 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3979 Paragraph-Data after use.
3981 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3982 non breakable paragraphs.
3984 2000-09-25 Garst R. Reese <reese@isn.net>
3986 * src/language.C (initL): added missing language_country codes.
3988 2000-09-25 Juergen Vigna <jug@sad.it>
3990 * src/insets/insettext.C (InsetText):
3991 (deleteLyXText): remove the not released LyXText structure!
3993 2000-09-24 Marko Vendelin <markov@ioc.ee>
3995 * src/frontends/gnome/mainapp.C
3996 * src/frontends/gnome/mainapp.h: added support for keyboard
3999 * src/frontends/gnome/FormCitation.C
4000 * src/frontends/gnome/FormCitation.h
4001 * src/frontends/gnome/Makefile.am
4002 * src/frontends/gnome/pixbutton.h: completed the rewrite of
4003 FormCitation to use "action area" in mainapp window
4005 * src/frontends/gnome/Menubar_pimpl.C
4006 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
4009 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
4011 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
4012 width/descent/ascent values if name is empty.
4013 (mathed_string_height): Use std::max.
4015 2000-09-25 Allan Rae <rae@lyx.org>
4017 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
4018 segfault. This will be completely redesigned soon.
4020 * sigc++: updated libsigc++. Fixes struct timespec bug.
4022 * development/tools/makeLyXsigc.sh: .cvsignore addition
4024 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
4026 * several files: removed almost all traces of the old table
4029 * src/TableLayout.C: removed file
4031 2000-09-22 Juergen Vigna <jug@sad.it>
4033 * src/frontends/kde/Dialogs.C: added credits forms.
4035 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
4037 * src/frontends/gnome/Dialogs.C: added some forms.
4039 * src/spellchecker.C (init_spell_checker): set language in pspell code
4040 (RunSpellChecker): some modifications for setting language string.
4042 * src/language.[Ch]: added language_country code.
4044 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
4046 * src/frontends/Dialogs.h: added new signal showError.
4047 Rearranged existing signals in some sort of alphabetical order.
4049 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
4050 FormError.[Ch], form_error.[Ch]
4051 * src/frontends/xforms/forms/makefile: added new file form_error.fd
4052 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
4054 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
4055 dialogs. I think that this can be used as the base to all these
4058 * src/frontends/xforms/FormError.[Ch]
4059 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
4060 implementation of InsetError dialog.
4062 * src/insets/inseterror.[Ch]: rendered GUI-independent.
4064 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
4065 * src/frontends/kde/Makefile.am: ditto
4067 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
4069 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
4070 macrobf. This fixes a bug of invisible text.
4072 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4074 * lib/doc/LaTeXConfig.lyx.in: updated.
4076 * src/language.C (initL): remove language "francais" and change a
4077 bit the names of the two other french variations.
4079 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
4080 string that may not be 0-terminated.
4082 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4084 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
4086 2000-09-20 Marko Vendelin <markov@ioc.ee>
4088 * src/frontends/gnome/FormCitation.C
4089 * src/frontends/gnome/FormIndex.C
4090 * src/frontends/gnome/FormToc.C
4091 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
4092 the variable initialization to shut up the warnings
4094 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4096 * src/table.[Ch]: deleted files
4098 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
4101 2000-09-18 Juergen Vigna <jug@sad.it>
4103 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
4104 problems with selection. Inserted new LFUN_PASTESELECTION.
4105 (InsetButtonPress): inserted handling of middle mouse-button paste.
4107 * src/spellchecker.C: changed word to word.c_str().
4109 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
4111 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
4112 included in the ``make dist'' tarball.
4114 2000-09-15 Juergen Vigna <jug@sad.it>
4116 * src/CutAndPaste.C (cutSelection): small fix return the right
4117 end position after cut inside one paragraph only.
4119 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
4120 we are locked as otherwise we don't have a valid cursor position!
4122 * src/insets/figinset.C (draw): small bugfix but why is this needed???
4124 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
4126 * src/frontends/kde/FormRef.C: added using directive.
4127 * src/frontends/kde/FormToc.C: ditto
4129 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
4131 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
4133 2000-09-19 Marko Vendelin <markov@ioc.ee>
4135 * src/frontends/gnome/Menubar_pimpl.C
4136 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
4137 Toc, ViewFormats, UpdateFormats, and ExportFormats.
4139 * src/frontends/gnome/mainapp.C
4140 * src/frontends/gnome/mainapp.h: support for menu update used
4143 * src/frontends/gnome/mainapp.C
4144 * src/frontends/gnome/mainapp.h: support for "action" area in the
4145 main window. This area is used by small simple dialogs, such as
4148 * src/frontends/gnome/FormIndex.C
4149 * src/frontends/gnome/FormIndex.h
4150 * src/frontends/gnome/FormUrl.C
4151 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4154 * src/frontends/gnome/FormCitation.C
4155 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4156 action area. Only "Insert new citation" is implemented.
4158 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4160 * src/buffer.C (Dispatch): fix call to Dispatch
4161 * src/insets/insetref.C (Edit): likewise
4162 * src/insets/insetparent.C (Edit): likewise
4163 * src/insets/insetinclude.C (include_cb): likewise
4164 * src/frontends/xforms/FormUrl.C (apply): likewise
4165 * src/frontends/xforms/FormToc.C (apply): likewise
4166 * src/frontends/xforms/FormRef.C (apply): likewise
4167 * src/frontends/xforms/FormIndex.C (apply): likewise
4168 * src/frontends/xforms/FormCitation.C (apply): likewise
4169 * src/lyxserver.C (callback): likewise
4170 * src/lyxfunc.C (processKeySym): likewise
4171 (Dispatch): likewise
4172 (Dispatch): likewise
4173 * src/lyx_cb.C (LayoutsCB): likewise
4175 * Makefile.am (sourcedoc): small change
4177 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4179 * src/main.C (main): Don't make an empty GUIRunTime object. all
4180 methods are static. constify a bit remove unneded using + headers.
4182 * src/tabular.C: some more const to local vars move some loop vars
4184 * src/spellchecker.C: added some c_str after some word for pspell
4186 * src/frontends/GUIRunTime.h: add new static method setDefaults
4187 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4188 * src/frontends/kde/GUIRunTime.C (setDefaults):
4189 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4191 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4192 with strnew in arg, use correct emptystring when calling SetName.
4194 * several files: remove all commented code with relation to
4195 HAVE_SSTREAM beeing false. We now only support stringstream and
4198 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4200 * src/lyxfunc.C: construct correctly the automatic new file
4203 * src/text2.C (IsStringInText): change type of variable i to shut
4206 * src/support/sstream.h: do not use namespaces if the compiler
4207 does not support them.
4209 2000-09-15 Marko Vendelin <markov@ioc.ee>
4210 * src/frontends/gnome/FormCitation.C
4211 * src/frontends/gnome/FormCitation.h
4212 * src/frontends/gnome/diainsertcitation_interface.c
4213 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4214 regexp support to FormCitation [Gnome].
4216 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4219 * configure.in: remove unused KDE/GTKGUI define
4221 * src/frontends/kde/FormRef.C
4222 * src/frontends/kde/FormRef.h
4223 * src/frontends/kde/formrefdialog.C
4224 * src/frontends/kde/formrefdialog.h: double click will
4225 go to reference, now it is possible to change a cross-ref
4228 * src/frontends/kde/FormToc.C
4229 * src/frontends/kde/FormToc.h
4230 * src/frontends/kde/formtocdialog.C
4231 * src/frontends/kde/formtocdialog.h: add a depth
4234 * src/frontends/kde/Makefile.am: add QtLyXView.h
4237 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4239 * src/frontends/kde/FormCitation.h: added some using directives.
4241 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4243 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4246 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4249 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4251 * src/buffer.C (pop_tag): revert for the second time a change by
4252 Lars, who seems to really hate having non-local loop variables :)
4254 * src/Lsstream.h: add "using" statements.
4256 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4257 * src/buffer.C (writeFile): ditto
4259 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4261 * src/buffer.C (writeFile): try to fix the locale modified format
4262 number to always be as we want it.
4264 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4265 in XForms 0.89. C-space is now working again.
4267 * src/Lsstream.h src/support/sstream.h: new files.
4269 * also commented out all cases where strstream were used.
4271 * src/Bullet.h (c_str): remove method.
4273 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4275 * a lot of files: get rid of "char const *" and "char *" is as
4276 many places as possible. We only want to use them in interaction
4277 with system of other libraries, not inside lyx.
4279 * a lot of files: return const object is not of pod type. This
4280 helps ensure that temporary objects is not modified. And fits well
4281 with "programming by contract".
4283 * configure.in: check for the locale header too
4285 * Makefile.am (sourcedoc): new tag for generation of doc++
4288 2000-09-14 Juergen Vigna <jug@sad.it>
4290 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4291 callback to check which combo called it and do the right action.
4293 * src/combox.C (combo_cb): added combo * to the callbacks.
4294 (Hide): moved call of callback after Ungrab of the pointer.
4296 * src/intl.h: removed LCombo2 function.
4298 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4299 function as this can now be handled in one function.
4301 * src/combox.h: added Combox * to callback prototype.
4303 * src/frontends/xforms/Toolbar_pimpl.C:
4304 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4306 2000-09-14 Garst Reese <reese@isn.net>
4308 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4309 moved usepackage{xxx}'s to beginning of file. Changed left margin
4310 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4311 underlining from title. Thanks to John Culleton for useful suggestions.
4313 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4315 * src/lyxlex_pimpl.C (setFile): change error message to debug
4318 2000-09-13 Juergen Vigna <jug@sad.it>
4320 * src/frontends/xforms/FormDocument.C: implemented choice_class
4321 as combox and give callback to combo_language so OK/Apply is activated
4324 * src/bufferlist.C (newFile): small fix so already named files
4325 (via an open call) are not requested to be named again on the
4328 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4330 * src/frontends/kde/Makefile.am
4331 * src/frontends/kde/FormRef.C
4332 * src/frontends/kde/FormRef.h
4333 * src/frontends/kde/formrefdialog.C
4334 * src/frontends/kde/formrefdialog.h: implement
4337 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4339 * src/frontends/kde/formtocdialog.C
4340 * src/frontends/kde/formtocdialog.h
4341 * src/frontends/kde/FormToc.C
4342 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4344 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4346 * src/frontends/kde/FormCitation.C: fix thinko
4347 where we didn't always display the reference text
4350 * src/frontends/kde/formurldialog.C
4351 * src/frontends/kde/formurldialog.h
4352 * src/frontends/kde/FormUrl.C
4353 * src/frontends/kde/FormUrl.h: minor cleanups
4355 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4357 * src/frontends/kde/Makefile.am
4358 * src/frontends/kde/FormToc.C
4359 * src/frontends/kde/FormToc.h
4360 * src/frontends/kde/FormCitation.C
4361 * src/frontends/kde/FormCitation.h
4362 * src/frontends/kde/FormIndex.C
4363 * src/frontends/kde/FormIndex.h
4364 * src/frontends/kde/formtocdialog.C
4365 * src/frontends/kde/formtocdialog.h
4366 * src/frontends/kde/formcitationdialog.C
4367 * src/frontends/kde/formcitationdialog.h
4368 * src/frontends/kde/formindexdialog.C
4369 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4371 2000-09-12 Juergen Vigna <jug@sad.it>
4373 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4376 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4378 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4381 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4383 * src/converter.C (Add, Convert): Added support for converter flags:
4384 needaux, resultdir, resultfile.
4385 (Convert): Added new parameter view_file.
4386 (dvips_options): Fixed letter paper option.
4388 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4389 (Export, GetExportableFormats, GetViewableFormats): Added support
4392 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4394 (easyParse): Fixed to work with new export code.
4396 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4399 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4401 * lib/bind/*.bind: Replaced
4402 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4403 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4405 2000-09-11 Juergen Vigna <jug@sad.it>
4407 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4409 * src/main.C (main): now GUII defines global guiruntime!
4411 * src/frontends/gnome/GUIRunTime.C (initApplication):
4412 * src/frontends/kde/GUIRunTime.C (initApplication):
4413 * src/frontends/xforms/GUIRunTime.C (initApplication):
4414 * src/frontends/GUIRunTime.h: added new function initApplication.
4416 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4418 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4420 2000-09-08 Juergen Vigna <jug@sad.it>
4422 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4423 we have already "Reset".
4425 * src/language.C (initL): inserted "default" language and made this
4426 THE default language (and not american!)
4428 * src/paragraph.C: inserted handling of "default" language!
4430 * src/lyxfont.C: ditto
4434 * src/paragraph.C: output the \\par only if we have a following
4435 paragraph otherwise it's not needed.
4437 2000-09-05 Juergen Vigna <jug@sad.it>
4439 * config/pspell.m4: added entry to lyx-flags
4441 * src/spellchecker.C: modified version from Kevin for using pspell
4443 2000-09-01 Marko Vendelin <markov@ioc.ee>
4444 * src/frontends/gnome/Makefile.am
4445 * src/frontends/gnome/FormCitation.C
4446 * src/frontends/gnome/FormCitation.h
4447 * src/frontends/gnome/diainsertcitation_callbacks.c
4448 * src/frontends/gnome/diainsertcitation_callbacks.h
4449 * src/frontends/gnome/diainsertcitation_interface.c
4450 * src/frontends/gnome/diainsertcitation_interface.h
4451 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4452 dialog for Gnome frontend
4454 * src/main.C: Gnome libraries require keeping application name
4455 and its version as strings
4457 * src/frontends/gnome/mainapp.C: Change the name of the main window
4458 from GnomeLyX to PACKAGE
4460 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4462 * src/frontends/Liason.C: add "using: declaration.
4464 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4466 * src/mathed/math_macro.C (Metrics): Set the size of the template
4468 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4470 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4472 * src/converter.C (add_options): New function.
4473 (SetViewer): Change $$FName into '$$FName'.
4474 (View): Add options when running xdvi
4475 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4476 (Convert): The 3rd parameter is now the desired filename. Converts
4477 calls to lyx::rename if necessary.
4478 Add options when running dvips.
4479 (dvi_papersize,dvips_options): New methods.
4481 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4483 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4484 using a call to Converter::dvips_options.
4485 Fixed to work with nex export code.
4487 * src/support/copy.C
4488 * src/support/rename.C: New files
4490 * src/support/syscall.h
4491 * src/support/syscall.C: Added Starttype SystemDontWait.
4493 * lib/ui/default.ui: Changed to work with new export code
4495 * lib/configure.m4: Changed to work with new export code
4497 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4499 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4501 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4502 so that code compiles with DEC cxx.
4504 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4505 to work correctly! Also now supports the additional elements
4508 2000-09-01 Allan Rae <rae@lyx.org>
4510 * src/frontends/ButtonPolicies.C: renamed all the references to
4511 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4513 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4514 since it's a const not a type.
4516 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4518 2000-08-31 Juergen Vigna <jug@sad.it>
4520 * src/insets/figinset.C: Various changes to look if the filename has
4521 an extension and if not add it for inline previewing.
4523 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4525 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4526 make buttonStatus and isReadOnly be const methods. (also reflect
4527 this in derived classes.)
4529 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4530 (nextState): change to be static inline, pass the StateMachine as
4532 (PreferencesPolicy): remove casts
4533 (OkCancelPolicy): remvoe casts
4534 (OkCancelReadOnlyPolicy): remove casts
4535 (NoRepeatedApplyReadOnlyPolicy): remove casts
4536 (OkApplyCancelReadOnlyPolicy): remove casts
4537 (OkApplyCancelPolicy): remove casts
4538 (NoRepeatedApplyPolicy): remove casts
4540 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4542 * src/converter.C: added some using directives
4544 * src/frontends/ButtonPolicies.C: changes to overcome
4545 "need lvalue" error with DEC c++
4547 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4548 to WMHideCB for DEC c++
4550 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4552 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4553 to BulletBMTableCB for DEC c++
4555 2000-08-31 Allan Rae <rae@lyx.org>
4557 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4558 character dialog separately from old document dialogs combo_language.
4561 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4563 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4564 Removed LFUN_REF_CREATE.
4566 * src/MenuBackend.C: Added new tags: toc and references
4568 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4569 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4571 (add_toc, add_references): New methods.
4572 (create_submenu): Handle correctly the case when there is a
4573 seperator after optional menu items.
4575 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4576 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4577 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4579 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4581 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4583 * src/converter.[Ch]: New file for converting between different
4586 * src/export.[Ch]: New file for exporting a LyX file to different
4589 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4590 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4591 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4592 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4593 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4594 RunDocBook, MenuExport.
4596 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4597 Exporter::Preview methods if NEW_EXPORT is defined.
4599 * src/buffer.C (Dispatch): Use Exporter::Export.
4601 * src/lyxrc.C: Added new tags: \converter and \viewer.
4604 * src/LyXAction.C: Define new lyx-function: buffer-update.
4605 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4606 when NEW_EXPORT is defined.
4608 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4610 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4612 * lib/ui/default.ui: Added submenus "view" and "update" to the
4615 * src/filetools.C (GetExtension): New function.
4617 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4619 2000-08-29 Allan Rae <rae@lyx.org>
4621 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4623 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4624 (EnableDocumentLayout): removed
4625 (DisableDocumentLayout): removed
4626 (build): make use of ButtonController's read-only handling to
4627 de/activate various objects. Replaces both of the above functions.
4629 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4630 (readOnly): was read_only
4631 (refresh): fixed dumb mistakes with read_only_ handling
4633 * src/frontends/xforms/forms/form_document.fd:
4634 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4635 tabbed dialogs so the tabs look more like tabs and so its easier to
4636 work out which is the current tab.
4638 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4639 segfault with form_table
4641 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4643 2000-08-28 Juergen Vigna <jug@sad.it>
4645 * acconfig.h: added USE_PSPELL.
4647 * src/config.h.in: added USE_PSPELL.
4649 * autogen.sh: added pspell.m4
4651 * config/pspell.m4: new file.
4653 * src/spellchecker.C: implemented support for pspell libary.
4655 2000-08-25 Juergen Vigna <jug@sad.it>
4657 * src/LyXAction.C (init): renamed LFUN_TABLE to
4658 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4660 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4662 * src/lyxscreen.h: add force_clear variable and fuction to force
4663 a clear area when redrawing in LyXText.
4665 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4667 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4669 * some whitespace and comment changes.
4671 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4673 * src/buffer.C: up te LYX_FORMAT to 2.17
4675 2000-08-23 Juergen Vigna <jug@sad.it>
4677 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4680 * src/insets/insettabular.C (pasteSelection): delete the insets
4681 LyXText as it is not valid anymore.
4682 (copySelection): new function.
4683 (pasteSelection): new function.
4684 (cutSelection): new function.
4685 (LocalDispatch): implemented cut/copy/paste of cell selections.
4687 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4688 don't have a LyXText.
4690 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4692 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4695 2000-08-22 Juergen Vigna <jug@sad.it>
4697 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4698 ifdef form_table out if NEW_TABULAR.
4700 2000-08-21 Juergen Vigna <jug@sad.it>
4702 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4703 (draw): fixed draw position so that the cursor is positioned in the
4705 (InsetMotionNotify): hide/show cursor so the position is updated.
4706 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4707 using cellstart() function where it should be used.
4709 * src/insets/insettext.C (draw): ditto.
4711 * src/tabular.C: fixed initialization of some missing variables and
4712 made BoxType into an enum.
4714 2000-08-22 Marko Vendelin <markov@ioc.ee>
4715 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4716 stock menu item using action numerical value, not its string
4720 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4722 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4723 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4725 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4727 * src/frontends/xforms/GUIRunTime.C: new file
4729 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4730 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4732 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4734 * src/frontends/kde/GUIRunTime.C: new file
4736 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4737 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4739 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4741 * src/frontends/gnome/GUIRunTime.C: new file
4743 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4746 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4747 small change to documetentation.
4749 * src/frontends/GUIRunTime.C: removed file
4751 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4753 * src/lyxparagraph.h: enable NEW_TABULAR as default
4755 * src/lyxfunc.C (processKeySym): remove some commented code
4757 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4758 NEW_TABULAR around the fd_form_table_options.
4760 * src/lyx_gui.C (runTime): call the static member function as
4761 GUIRunTime::runTime().
4763 2000-08-21 Allan Rae <rae@lyx.org>
4765 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4768 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4770 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4772 2000-08-21 Allan Rae <rae@lyx.org>
4774 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4775 keep Garst happy ;-)
4776 * src/frontends/xforms/FormPreferences.C (build): use setOK
4777 * src/frontends/xforms/FormDocument.C (build): use setOK
4778 (FormDocument): use the appropriate policy.
4780 2000-08-21 Allan Rae <rae@lyx.org>
4782 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4783 automatic [de]activation of arbitrary objects when in a read-only state.
4785 * src/frontends/ButtonPolicies.h: More documentation
4786 (isReadOnly): added to support the above.
4788 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4790 2000-08-18 Juergen Vigna <jug@sad.it>
4792 * src/insets/insettabular.C (getStatus): changed to return func_status.
4794 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4795 display toggle menu entries if they are.
4797 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4798 new document layout now.
4800 * src/lyxfunc.C: ditto
4802 * src/lyx_gui_misc.C: ditto
4804 * src/lyx_gui.C: ditto
4806 * lib/ui/default.ui: removed paper and quotes layout as they are now
4807 all in the document layout tabbed folder.
4809 * src/frontends/xforms/forms/form_document.fd: added Restore
4810 button and callbacks for all inputs for Allan's ButtonPolicy.
4812 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4813 (CheckChoiceClass): added missing params setting on class change.
4814 (UpdateLayoutDocument): added for updating the layout on params.
4815 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4816 (FormDocument): Implemented Allan's ButtonPolicy with the
4819 2000-08-17 Allan Rae <rae@lyx.org>
4821 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4822 so we can at least see the credits again.
4824 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4825 controller calls for the appropriate callbacks. Note that since Ok
4826 calls apply followed by cancel, and apply isn't a valid input for the
4827 APPLIED state, the bc_ calls have to be made in the static callback not
4828 within each of the real callbacks.
4830 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4831 (setOk): renamed from setOkay()
4833 2000-08-17 Juergen Vigna <jug@sad.it>
4835 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4836 in the implementation part.
4837 (composeUIInfo): don't show optional menu-items.
4839 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4841 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4843 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4844 text-state when in a text-inset.
4846 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4848 2000-08-17 Marko Vendelin <markov@ioc.ee>
4849 * src/frontends/gnome/FormIndex.C
4850 * src/frontends/gnome/FormIndex.h
4851 * src/frontends/gnome/FormToc.C
4852 * src/frontends/gnome/FormToc.h
4853 * src/frontends/gnome/dialogs
4854 * src/frontends/gnome/diatoc_callbacks.c
4855 * src/frontends/gnome/diatoc_callbacks.h
4856 * src/frontends/gnome/diainsertindex_callbacks.h
4857 * src/frontends/gnome/diainsertindex_callbacks.c
4858 * src/frontends/gnome/diainsertindex_interface.c
4859 * src/frontends/gnome/diainsertindex_interface.h
4860 * src/frontends/gnome/diatoc_interface.h
4861 * src/frontends/gnome/diatoc_interface.c
4862 * src/frontends/gnome/Makefile.am: Table of Contents and
4863 Insert Index dialogs implementation for Gnome frontend
4865 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4867 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4869 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4872 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4874 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4875 destructor. Don't definde if you don't need it
4876 (processEvents): made static, non-blocking events processing for
4878 (runTime): static method. event loop for xforms
4879 * similar as above for kde and gnome.
4881 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4882 new Pimpl is correct
4883 (runTime): new method calss the real frontends runtime func.
4885 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4887 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4889 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4891 2000-08-16 Juergen Vigna <jug@sad.it>
4893 * src/lyx_gui.C (runTime): added GUII RunTime support.
4895 * src/frontends/Makefile.am:
4896 * src/frontends/GUIRunTime.[Ch]:
4897 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4898 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4899 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4901 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4903 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4904 as this is already set in ${FRONTEND_INCLUDE} if needed.
4906 * configure.in (CPPFLAGS): setting the include dir for the frontend
4907 directory and don't set FRONTEND=xforms for now as this is executed
4910 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4912 * src/frontends/kde/Makefile.am:
4913 * src/frontends/kde/FormUrl.C:
4914 * src/frontends/kde/FormUrl.h:
4915 * src/frontends/kde/formurldialog.h:
4916 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4918 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4920 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4922 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4924 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4927 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4929 * src/WorkArea.C (work_area_handler): more work to get te
4930 FL_KEYBOARD to work with xforms 0.88 too, please test.
4932 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4934 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4936 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4939 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4941 * src/Timeout.h: remove Qt::emit hack.
4943 * several files: changes to allo doc++ compilation
4945 * src/lyxfunc.C (processKeySym): new method
4946 (processKeyEvent): comment out if FL_REVISION < 89
4948 * src/WorkArea.C: change some debugging levels.
4949 (WorkArea): set wantkey to FL_KEY_ALL
4950 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4951 clearer code and the use of compose with XForms 0.89. Change to
4952 use signals instead of calling methods in bufferview directly.
4954 * src/Painter.C: change some debugging levels.
4956 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4959 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4960 (workAreaKeyPress): new method
4962 2000-08-14 Juergen Vigna <jug@sad.it>
4964 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4966 * config/kde.m4: addes some features
4968 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4969 include missing xforms dialogs.
4971 * src/Timeout.h: a hack to be able to compile with qt/kde.
4973 * sigc++/.cvsignore: added acinclude.m4
4975 * lib/.cvsignore: added listerros
4977 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4978 xforms tree as objects are needed for other frontends.
4980 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4981 linking with not yet implemented xforms objects.
4983 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4985 2000-08-14 Baruch Even <baruch.even@writeme.com>
4987 * src/frontends/xforms/FormGraphics.h:
4988 * src/frontends/xforms/FormGraphics.C:
4989 * src/frontends/xforms/RadioButtonGroup.h:
4990 * src/frontends/xforms/RadioButtonGroup.C:
4991 * src/insets/insetgraphics.h:
4992 * src/insets/insetgraphics.C:
4993 * src/insets/insetgraphicsParams.h:
4994 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4995 instead of spaces, and various other indentation issues to make the
4996 sources more consistent.
4998 2000-08-14 Marko Vendelin <markov@ioc.ee>
5000 * src/frontends/gnome/dialogs/diaprint.glade
5001 * src/frontends/gnome/FormPrint.C
5002 * src/frontends/gnome/FormPrint.h
5003 * src/frontends/gnome/diaprint_callbacks.c
5004 * src/frontends/gnome/diaprint_callbacks.h
5005 * src/frontends/gnome/diaprint_interface.c
5006 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
5009 * src/frontends/gnome/dialogs/diainserturl.glade
5010 * src/frontends/gnome/FormUrl.C
5011 * src/frontends/gnome/FormUrl.h
5012 * src/frontends/gnome/diainserturl_callbacks.c
5013 * src/frontends/gnome/diainserturl_callbacks.h
5014 * src/frontends/gnome/diainserturl_interface.c
5015 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
5016 Gnome implementation
5018 * src/frontends/gnome/Dialogs.C
5019 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
5020 all other dialogs. Copy all unimplemented dialogs from Xforms
5023 * src/frontends/gnome/support.c
5024 * src/frontends/gnome/support.h: support files generated by Glade
5028 * config/gnome.m4: Gnome configuration scripts
5030 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
5031 configure --help message
5033 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
5034 only if there are no events pendling in Gnome/Gtk. This enhances
5035 the performance of menus.
5038 2000-08-14 Allan Rae <rae@lyx.org>
5040 * lib/Makefile.am: listerrors cleaning
5042 * lib/listerrors: removed -- generated file
5043 * acinclude.m4: ditto
5044 * sigc++/acinclude.m4: ditto
5046 * src/frontends/xforms/forms/form_citation.fd:
5047 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
5050 * src/frontends/xforms/forms/makefile: I renamed the `install` target
5051 `updatesrc` and now we have a `test` target that does what `updatesrc`
5052 used to do. I didn't like having an install target that wasn't related
5055 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
5056 on all except FormGraphics. This may yet happen. Followed by a major
5057 cleanup including using FL_TRANSIENT for most of the dialogs. More
5058 changes to come when the ButtonController below is introduced.
5060 * src/frontends/xforms/ButtonController.h: New file for managing up to
5061 four buttons on a dialog according to an externally defined policy.
5062 * src/frontends/xforms/Makefile.am: added above
5064 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
5065 Apply and Cancel/Close buttons and everything in between and beyond.
5066 * src/frontends/Makefile.am: added above.
5068 * src/frontends/xforms/forms/form_preferences.fd:
5069 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
5070 and removed variable 'status' as a result. Fixed the set_minsize thing.
5071 Use the new screen-font-update after checking screen fonts were changed
5072 Added a "Restore" button to restore the original lyxrc values while
5073 editing. This restores everything not just the last input changed.
5074 That's still a tricky one. As is the "LyX: this shouldn't happen..."
5076 * src/LyXAction.C: screen-font-update added for updating buffers after
5077 screen font settings have been changed.
5078 * src/commandtags.h: ditto
5079 * src/lyxfunc.C: ditto
5081 * forms/lyx.fd: removed screen fonts dialog.
5082 * src/lyx_gui.C: ditto
5083 * src/menus.[Ch]: ditto
5084 * src/lyx.[Ch]: ditto
5085 * src/lyx_cb.C: ditto + code from here moved to make
5086 screen-font-update. And people wonder why progress on GUII is
5087 slow. Look at how scattered this stuff was! It takes forever
5090 * forms/fdfix.sh: Fixup the spacing after commas.
5091 * forms/makefile: Remove date from generated files. Fewer clashes now.
5092 * forms/bullet_forms.C.patch: included someones handwritten changes
5094 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
5095 once I've discovered why LyXRC was made noncopyable.
5096 * src/lyx_main.C: ditto
5098 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
5100 * src/frontends/xforms/forms/fdfix.sh:
5101 * src/frontends/xforms/forms/fdfixh.sed:
5102 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
5103 * src/frontends/xforms/Form*.[hC]:
5104 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
5105 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
5106 provide a destructor for the struct FD_form_xxxx. Another version of
5107 the set_[max|min]size workaround and a few other cleanups. Actually,
5108 Angus' patch from 20000809.
5110 2000-08-13 Baruch Even <baruch.even@writeme.com>
5112 * src/insets/insetgraphics.C (Clone): Added several fields that needed
5115 2000-08-11 Juergen Vigna <jug@sad.it>
5117 * src/insets/insetgraphics.C (InsetGraphics): changing init
5118 order because of warnings.
5120 * src/frontends/xforms/forms/makefile: adding patching .C with
5123 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
5124 from .C.patch to .c.patch
5126 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
5127 order because of warning.
5129 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
5131 * src/frontends/Liason.C (setMinibuffer): new helper function
5133 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
5135 * src/lyxfunc.C (Dispatch): calling new Document-Layout
5137 * lib/ui/default.ui: commented out PaperLayout entry
5139 * src/frontends/xforms/form_document.[Ch]: new added files
5141 * src/frontends/xforms/FormDocument.[Ch]: ditto
5143 * src/frontends/xforms/forms/form_document.fd: ditto
5145 * src/frontends/xforms/forms/form_document.C.patch: ditto
5147 2000-08-10 Juergen Vigna <jug@sad.it>
5149 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
5150 (InsetGraphics): initialized cacheHandle to 0.
5151 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5153 2000-08-10 Baruch Even <baruch.even@writeme.com>
5155 * src/graphics/GraphicsCache.h:
5156 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5157 correctly as a cache.
5159 * src/graphics/GraphicsCacheItem.h:
5160 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5163 * src/graphics/GraphicsCacheItem_pimpl.h:
5164 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5167 * src/insets/insetgraphics.h:
5168 * src/insets/insetgraphics.C: Changed from using a signal notification
5169 to polling when image is not loaded.
5171 2000-08-10 Allan Rae <rae@lyx.org>
5173 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5174 that there are two functions that have to been taken out of line by
5175 hand and aren't taken care of in the script. (Just a reminder note)
5177 * sigc++/macros/*.h.m4: Updated as above.
5179 2000-08-09 Juergen Vigna <jug@sad.it>
5181 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5183 * src/insets/insettabular.C: make drawing of single cell smarter.
5185 2000-08-09 Marko Vendelin <markov@ioc.ee>
5186 * src/frontends/gnome/Menubar_pimpl.C
5187 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5188 implementation: new files
5190 * src/frontends/gnome/mainapp.C
5191 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5194 * src/main.C: create Gnome main window
5196 * src/frontends/xforms/Menubar_pimpl.h
5197 * src/frontends/Menubar.C
5198 * src/frontends/Menubar.h: added method Menubar::update that calls
5199 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5201 * src/LyXView.C: calls Menubar::update to update the state
5204 * src/frontends/gnome/Makefile.am: added new files
5206 * src/frontends/Makefile.am: added frontend compiler options
5208 2000-08-08 Juergen Vigna <jug@sad.it>
5210 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5212 * src/bufferlist.C (close):
5213 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5214 documents if exiting without saving.
5216 * src/buffer.C (save): use removeAutosaveFile()
5218 * src/support/filetools.C (removeAutosaveFile): new function.
5220 * src/lyx_cb.C (MenuWrite): returns a bool now.
5221 (MenuWriteAs): check if file could really be saved and revert to the
5223 (MenuWriteAs): removing old autosavefile if existant.
5225 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5226 before Goto toggle declaration, because of compiler warning.
5228 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5230 * src/lyxfunc.C (MenuNew): small fix.
5232 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5234 * src/bufferlist.C (newFile):
5235 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5237 * src/lyxrc.C: added new_ask_filename tag
5239 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5241 * src/lyx.fd: removed code pertaining to form_ref
5242 * src/lyx.[Ch]: ditto
5243 * src/lyx_cb.C: ditto
5244 * src/lyx_gui.C: ditto
5245 * src/lyx_gui_misc.C: ditto
5247 * src/BufferView_pimpl.C (restorePosition): update buffer only
5250 * src/commandtags.h (LFUN_REFTOGGLE): removed
5251 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5252 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5253 (LFUN_REFBACK): renamed LFUN_REF_BACK
5255 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5256 * src/menus.C: ditto
5257 * src/lyxfunc.C (Dispatch): ditto.
5258 InsertRef dialog is now GUI-independent.
5260 * src/texrow.C: added using std::endl;
5262 * src/insets/insetref.[Ch]: strip out large amounts of code.
5263 The inset is now a container and this functionality is now
5264 managed by a new FormRef dialog
5266 * src/frontends/Dialogs.h (showRef, createRef): new signals
5268 * src/frontends/xforms/FormIndex.[Ch],
5269 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5270 when setting dialog's min/max size
5271 * src/frontends/xforms/FormIndex.[Ch]: ditto
5273 * src/frontends/xforms/FormRef.[Ch],
5274 src/frontends/xforms/forms/form_ref.fd: new xforms
5275 implementation of an InsetRef dialog
5277 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5280 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5281 ios::nocreate is not part of the standard. Removed.
5283 2000-08-07 Baruch Even <baruch.even@writeme.com>
5285 * src/graphics/Renderer.h:
5286 * src/graphics/Renderer.C: Added base class for rendering of different
5287 image formats into Pixmaps.
5289 * src/graphics/XPM_Renderer.h:
5290 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5291 in a different class.
5293 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5294 easily add support for other formats.
5296 * src/insets/figinset.C: plugged a leak of an X resource.
5298 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5300 * src/CutAndPaste.[Ch]: make all metods static.
5302 * development/Code_rules/Rules: more work, added section on
5303 Exceptions, and a References section.
5305 * a lot of header files: work to make doc++ able to generate the
5306 source documentation, some workarounds of doc++ problems. Doc++ is
5307 now able to generate the documentation.
5309 2000-08-07 Juergen Vigna <jug@sad.it>
5311 * src/insets/insettabular.C (recomputeTextInsets): removed function
5313 * src/tabular.C (SetWidthOfMulticolCell):
5315 (calculate_width_of_column_NMC): fixed return value so that it really
5316 only returns true if the column-width has changed (there where
5317 problems with muliticolumn-cells in this column).
5319 2000-08-04 Juergen Vigna <jug@sad.it>
5321 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5322 also on the scrollstatus of the inset.
5323 (workAreaMotionNotify): ditto.
5325 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5327 2000-08-01 Juergen Vigna <jug@sad.it>
5329 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5331 * src/commandtags.h:
5332 * src/LyXAction.C (init):
5333 * src/insets/inset.C (LocalDispatch): added support for
5336 * src/insets/inset.C (scroll): new functions.
5338 * src/insets/insettext.C (removeNewlines): new function.
5339 (SetAutoBreakRows): removes forced newlines in the text of the
5340 paragraph if autoBreakRows is set to false.
5342 * src/tabular.C (Latex): generates a parbox around the cell contents
5345 * src/frontends/xforms/FormTabular.C (local_update): removed
5346 the radio_useparbox button.
5348 * src/tabular.C (UseParbox): new function
5350 2000-08-06 Baruch Even <baruch.even@writeme.com>
5352 * src/graphics/GraphicsCache.h:
5353 * src/graphics/GraphicsCache.C:
5354 * src/graphics/GraphicsCacheItem.h:
5355 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5358 * src/insets/insetgraphics.h:
5359 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5360 and the drawing of the inline image.
5362 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5363 loaded into the wrong position.
5365 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5368 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5370 * src/support/translator.h: move all typedefs to public section
5372 * src/support/filetools.C (MakeLatexName): return string const
5374 (TmpFileName): ditto
5375 (FileOpenSearch): ditto
5377 (LibFileSearch): ditto
5378 (i18nLibFileSearch): ditto
5381 (CreateTmpDir): ditto
5382 (CreateBufferTmpDir): ditto
5383 (CreateLyXTmpDir): ditto
5386 (MakeAbsPath): ditto
5388 (OnlyFilename): ditto
5390 (NormalizePath): ditto
5391 (CleanupPath): ditto
5392 (GetFileContents): ditto
5393 (ReplaceEnvironmentPath): ditto
5394 (MakeRelPath): ditto
5396 (ChangeExtension): ditto
5397 (MakeDisplayPath): ditto
5398 (do_popen): return cmdret const
5399 (findtexfile): return string const
5401 * src/support/DebugStream.h: add some /// to please doc++
5403 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5405 * src/texrow.C (same_rownumber): functor to use with find_if
5406 (getIdFromRow): rewritten to use find_if and to not update the
5407 positions. return true if row is found
5408 (increasePos): new method, use to update positions
5410 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5412 * src/lyxlex_pimpl.C (verifyTable): new method
5415 (GetString): return string const
5416 (pushTable): rewrite to use std::stack
5418 (setFile): better check
5421 * src/lyxlex.h: make LyXLex noncopyable
5423 * src/lyxlex.C (text): return char const * const
5424 (GetString): return string const
5425 (getLongString): return string const
5427 * src/lyx_gui_misc.C (askForText): return pair<...> const
5429 * src/lastfiles.[Ch] (operator): return string const
5431 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5432 istringstream not char const *.
5433 move token.end() out of loop.
5434 (readFile): move initializaton of token
5436 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5437 getIdFromRow is successful.
5439 * lib/bind/emacs.bind: don't include menus bind
5441 * development/Code_rules/Rules: the beginnings of making this
5442 better and covering more of the unwritten rules that we have.
5444 * development/Code_rules/Recommendations: a couple of wording
5447 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5449 * src/support/strerror.c: remove C++ comment.
5451 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5453 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5454 LFUN_INDEX_INSERT_LAST
5456 * src/texrow.C (getIdFromRow): changed from const_iterator to
5457 iterator, allowing code to compile with DEC cxx
5459 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5460 stores part of the class, as suggested by Allan. Will allow
5462 (apply): test to apply uses InsetCommandParams operator!=
5464 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5465 (apply): test to apply uses InsetCommandParams operator!=
5467 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5468 stores part of the class.
5469 (update): removed limits on min/max size.
5471 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5472 (apply): test to apply uses InsetCommandParams operator!=
5474 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5475 (Read, Write, scanCommand, getCommand): moved functionality
5476 into InsetCommandParams.
5478 (getScreenLabel): made pure virtual
5479 new InsetCommandParams operators== and !=
5481 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5482 c-tors based on InsetCommandParams. Removed others.
5483 * src/insets/insetinclude.[Ch]: ditto
5484 * src/insets/insetlabel.[Ch]: ditto
5485 * src/insets/insetparent.[Ch]: ditto
5486 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5488 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5489 insets derived from InsetCommand created using similar c-tors
5490 based on InsetCommandParams
5491 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5492 * src/menus.C (ShowRefsMenu): ditto
5493 * src/paragraph.C (Clone): ditto
5494 * src/text2.C (SetCounter): ditto
5495 * src/lyxfunc.C (Dispatch) ditto
5496 Also recreated old InsetIndex behaviour exactly. Can now
5497 index-insert at the start of a paragraph and index-insert-last
5498 without launching the pop-up.
5500 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5502 * lib/lyxrc.example: mark te pdf options as non functional.
5504 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5505 (isStrDbl): move tmpstr.end() out of loop.
5506 (strToDbl): move intialization of tmpstr
5507 (lowercase): return string const and move tmp.end() out of loop.
5508 (uppercase): return string const and move tmp.edn() out of loop.
5509 (prefixIs): add assertion
5514 (containsOnly): ditto
5515 (containsOnly): ditto
5516 (containsOnly): ditto
5517 (countChar): make last arg char not char const
5518 (token): return string const
5519 (subst): return string const, move tmp.end() out of loop.
5520 (subst): return string const, add assertion
5521 (strip): return string const
5522 (frontStrip): return string const, add assertion
5523 (frontStrip): return string const
5528 * src/support/lstrings.C: add inclde "LAssert.h"
5529 (isStrInt): move tmpstr.end() out of loop.
5531 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5532 toollist.end() out of loop.
5533 (deactivate): move toollist.end() out of loop.
5534 (update): move toollist.end() out of loop.
5535 (updateLayoutList): move tc.end() out of loop.
5536 (add): move toollist.end() out of loop.
5538 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5539 md.end() out of loop.
5541 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5543 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5546 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5547 (Erase): move insetlist.end() out of loop.
5549 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5550 ref to const string as first arg. Move initialization of some
5551 variables, whitespace changes.
5553 * src/kbmap.C (defkey): move table.end() out of loop.
5554 (kb_keymap): move table.end() out of loop.
5555 (findbinding): move table.end() out of loop.
5557 * src/MenuBackend.C (hasMenu): move end() out of loop.
5558 (getMenu): move end() out of loop.
5559 (getMenu): move menulist_.end() out of loop.
5561 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5563 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5566 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5567 (getFromLyXName): move infotab.end() out of loop.
5569 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5570 -fvtable-thunks -ffunction-sections -fdata-sections
5572 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5574 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5577 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5579 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5581 * src/frontends/xforms/FormCitation.[Ch],
5582 src/frontends/xforms/FormIndex.[Ch],
5583 src/frontends/xforms/FormToc.[Ch],
5584 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5586 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5588 * src/commandtags.h: renamed, created some flags for citation
5591 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5593 * src/lyxfunc.C (dispatch): use signals to insert index entry
5595 * src/frontends/Dialogs.h: new signal createIndex
5597 * src/frontends/xforms/FormCommand.[Ch],
5598 src/frontends/xforms/FormCitation.[Ch],
5599 src/frontends/xforms/FormToc.[Ch],
5600 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5602 * src/insets/insetindex.[Ch]: GUI-independent
5604 * src/frontends/xforms/FormIndex.[Ch],
5605 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5608 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5610 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5611 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5613 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5615 * src/insets/insetref.C (Latex): rewrite so that there is now
5616 question that a initialization is requested.
5618 * src/insets/insetcommand.h: reenable the hide signal
5620 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5622 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5623 fix handling of shortcuts (many bugs :)
5624 (add_lastfiles): ditto.
5626 * lib/ui/default.ui: fix a few shortcuts.
5628 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5630 * Makefile.am: Fix ``rpmdist'' target to return the exit
5631 status of the ``rpm'' command, instead of the last command in
5632 the chain (the ``rm lyx.xpm'' command, which always returns
5635 2000-08-02 Allan Rae <rae@lyx.org>
5637 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5638 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5639 * src/frontends/xforms/FormToc.C (FormToc): ditto
5641 * src/frontends/xforms/Makefile.am: A few forgotten files
5643 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5644 Signals-not-copyable-problem Lars' started commenting out.
5646 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5648 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5650 * src/insets/insetcommand.h: Signals is not copyable so anoter
5651 scheme for automatic hiding of forms must be used.
5653 * src/frontends/xforms/FormCitation.h: don't inerit from
5654 noncopyable, FormCommand already does that.
5655 * src/frontends/xforms/FormToc.h: ditto
5656 * src/frontends/xforms/FormUrl.h: ditto
5658 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5660 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5662 * src/insets/insetcommand.h (hide): new SigC::Signal0
5663 (d-tor) new virtual destructor emits hide signal
5665 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5666 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5668 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5669 LOF and LOT. Inset is now GUI-independent
5671 * src/insets/insetloa.[Ch]: redundant
5672 * src/insets/insetlof.[Ch]: ditto
5673 * src/insets/insetlot.[Ch]: ditto
5675 * src/frontends/xforms/forms/form_url.fd: tweaked!
5676 * src/frontends/xforms/forms/form_citation.fd: ditto
5678 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5679 dialogs dealing with InsetCommand insets
5681 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5682 FormCommand base class
5683 * src/frontends/xforms/FormUrl.[Ch]: ditto
5685 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5687 * src/frontends/xforms/FormToc.[Ch]: ditto
5689 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5690 passed a generic InsetCommand pointer
5691 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5693 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5694 and modified InsetTOC class
5695 * src/buffer.C: ditto
5697 * forms/lyx.fd: strip out old FD_form_toc code
5698 * src/lyx_gui_misc.C: ditto
5699 * src/lyx_gui.C: ditto
5700 * src/lyx_cb.C: ditto
5701 * src/lyx.[Ch]: ditto
5703 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5705 * src/support/utility.hpp: tr -d '\r'
5707 2000-08-01 Juergen Vigna <jug@sad.it>
5709 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5711 * src/commandtags.h:
5712 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5713 LFUN_TABULAR_FEATURES.
5715 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5716 LFUN_LAYOUT_TABULAR.
5718 * src/insets/insettabular.C (getStatus): implemented helper function.
5720 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5722 2000-07-31 Juergen Vigna <jug@sad.it>
5724 * src/text.C (draw): fixed screen update problem for text-insets.
5726 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5727 something changed probably this has to be added in various other
5730 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5732 2000-07-31 Baruch Even <baruch.even@writeme.com>
5734 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5735 templates to satisfy compaq cxx.
5738 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5740 * src/support/translator.h (equal_1st_in_pair::operator()): take
5741 const ref pair_type as arg.
5742 (equal_2nd_in_pair::operator()): ditto
5743 (Translator::~Translator): remove empty d-tor.
5745 * src/graphics/GraphicsCache.C: move include config.h to top, also
5746 put initialization of GraphicsCache::singleton here.
5747 (~GraphicsCache): move here
5748 (addFile): take const ref as arg
5751 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5753 * src/BufferView2.C (insertLyXFile): change te with/without header
5756 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5758 * src/frontends/xforms/FormGraphics.C (apply): add some
5759 static_cast. Not very nice, but required by compaq cxx.
5761 * src/frontends/xforms/RadioButtonGroup.h: include header
5762 <utility> instead of <pair.h>
5764 * src/insets/insetgraphicsParams.C: add using directive.
5765 (readResize): change return type to void.
5766 (readOrigin): ditto.
5768 * src/lyxfunc.C (getStatus): add missing break for build-program
5769 function; add test for Literate for export functions.
5771 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5772 entries in Options menu.
5774 2000-07-31 Baruch Even <baruch.even@writeme.com>
5776 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5777 protect against auto-allocation; release icon when needed.
5779 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5781 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5782 on usual typewriter.
5784 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5785 earlier czech.kmap), useful only for programming.
5787 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5789 * src/frontends/xforms/FormCitation.h: fix conditioning around
5792 2000-07-31 Juergen Vigna <jug@sad.it>
5794 * src/frontends/xforms/FormTabular.C (local_update): changed
5795 radio_linebreaks to radio_useparbox and added radio_useminipage.
5797 * src/tabular.C: made support for using minipages/parboxes.
5799 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5801 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5803 (descent): so the cursor is in the middle.
5804 (width): bit smaller box.
5806 * src/insets/insetgraphics.h: added display() function.
5808 2000-07-31 Baruch Even <baruch.even@writeme.com>
5810 * src/frontends/Dialogs.h: Added showGraphics signals.
5812 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5813 xforms form definition of the graphics dialog.
5815 * src/frontends/xforms/FormGraphics.h:
5816 * src/frontends/xforms/FormGraphics.C: Added files, the
5817 GUIndependent code of InsetGraphics
5819 * src/insets/insetgraphics.h:
5820 * src/insets/insetgraphics.C: Major writing to make it work.
5822 * src/insets/insetgraphicsParams.h:
5823 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5824 struct between InsetGraphics and GUI.
5826 * src/LaTeXFeatures.h:
5827 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5828 support for graphicx package.
5830 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5831 for the graphics inset.
5833 * src/support/translator.h: Added file, used in
5834 InsetGraphicsParams. this is a template to translate between two
5837 * src/frontends/xforms/RadioButtonGroup.h:
5838 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5839 way to easily control a radio button group.
5841 2000-07-28 Juergen Vigna <jug@sad.it>
5843 * src/insets/insettabular.C (LocalDispatch):
5844 (TabularFeatures): added support for lyx-functions of tabular features.
5845 (cellstart): refixed this function after someone wrongly changed it.
5847 * src/commandtags.h:
5848 * src/LyXAction.C (init): added support for tabular-features
5850 2000-07-28 Allan Rae <rae@lyx.org>
5852 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5853 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5854 triggers the callback for input checking. As a result we sometimes get
5855 "LyX: This shouldn't happen..." printed to cerr.
5856 (input): Started using status variable since I only free() on
5857 destruction. Some input checking for paths and font sizes.
5859 * src/frontends/xforms/FormPreferences.h: Use status to control
5860 activation of Ok and Apply
5862 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5863 callback. Also resized to stop segfaults with 0.88. The problem is
5864 that xforms-0.88 requires the folder to be wide enough to fit all the
5865 tabs. If it isn't it causes all sorts of problems.
5867 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5869 * src/frontends/xforms/forms/README: Reflect reality.
5871 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5872 * src/frontends/xforms/forms/makefile: ditto.
5874 * src/commandtags.h: Get access to new Preferences dialog
5875 * src/LyXAction.C: ditto
5876 * src/lyxfunc.C: ditto
5877 * lib/ui/default.ui: ditto
5879 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5881 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5883 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5886 * src/frontends/xforms/form_url.[Ch]: added.
5888 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5890 * src/insets/insetbib.h: fixed bug in previous commit
5892 * src/frontends/xforms/FormUrl.h: ditto
5894 * src/frontends/xforms/FormPrint.h: ditto
5896 * src/frontends/xforms/FormPreferences.h: ditto
5898 * src/frontends/xforms/FormCopyright.h: ditto
5900 * src/frontends/xforms/FormCitation.C: ditto
5902 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5903 private copyconstructor and private default contructor
5905 * src/support/Makefile.am: add utility.hpp
5907 * src/support/utility.hpp: new file from boost
5909 * src/insets/insetbib.h: set owner in clone
5911 * src/frontends/xforms/FormCitation.C: added missing include
5914 * src/insets/form_url.[Ch]: removed
5916 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5918 * development/lyx.spec.in
5919 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5920 file/directory re-organization.
5922 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5924 * src/insets/insetcommand.[Ch]: moved the string data and
5925 associated manipulation methods into a new stand-alone class
5926 InsetCommandParams. This class has two additional methods
5927 getAsString() and setFromString() allowing the contents to be
5928 moved around as a single string.
5929 (addContents) method removed.
5930 (setContents) method no longer virtual.
5932 * src/buffer.C (readInset): made use of new InsetCitation,
5933 InsetUrl constructors based on InsetCommandParams.
5935 * src/commandtags.h: add LFUN_INSERT_URL
5937 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5938 independent InsetUrl and use InsetCommandParams to extract
5939 string info and create new Insets.
5941 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5943 * src/frontends/xforms/FormCitation.C (apply): uses
5946 * src/frontends/xforms/form_url.C
5947 * src/frontends/xforms/form_url.h
5948 * src/frontends/xforms/FormUrl.h
5949 * src/frontends/xforms/FormUrl.C
5950 * src/frontends/xforms/forms/form_url.fd: new files
5952 * src/insets/insetcite.[Ch]: removed unused constructors.
5954 * src/insets/insetinclude.[Ch]: no longer store filename
5956 * src/insets/inseturl.[Ch]: GUI-independent.
5958 2000-07-26 Juergen Vigna <jug@sad.it>
5959 * renamed frontend from gtk to gnome as it is that what is realized
5960 and did the necessary changes in the files.
5962 2000-07-26 Marko Vendelin <markov@ioc.ee>
5964 * configure.in: cleaning up gnome configuration scripts
5966 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5968 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5969 shortcuts syndrom by redrawing them explicitely (a better solution
5970 would be appreciated).
5972 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5974 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5977 * src/lyx_cb.C (MenuExport): change html export to do the right
5978 thing depending of the document type (instead of having
5979 html-linuxdoc and html-docbook).
5980 * src/lyxfunc.C (getStatus): update for html
5981 * lib/ui/default.ui: simplify due to the above change.
5982 * src/menus.C (ShowFileMenu): update too (in case we need it).
5984 * src/MenuBackend.C (read): if a menu is defined twice, add the
5985 new entries to the exiting one.
5987 2000-07-26 Juergen Vigna <jug@sad.it>
5989 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5991 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5992 and return a bool if it did actual save the file.
5993 (AutoSave): don't autosave a unnamed doc.
5995 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5996 check if this is an UNNAMED new file and react to it.
5997 (newFile): set buffer to unnamed and change to not mark a new
5998 buffer dirty if I didn't do anything with it.
6000 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
6002 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6004 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
6005 friend as per Angus's patch posted to lyx-devel.
6007 * src/ext_l10n.h: updated
6009 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
6010 gettext on the style string right before inserting them into the
6013 * autogen.sh: add code to extract style strings form layout files,
6014 not good enough yet.
6016 * src/frontends/gtk/.cvsignore: add MAKEFILE
6018 * src/MenuBackend.C (read): run the label strings through gettext
6019 before storing them in the containers.
6021 * src/ext_l10n.h: new file
6023 * autogen.sh : generate the ext_l10n.h file here
6025 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6027 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
6030 * lib/ui/default.ui: fix a couple of typos.
6032 * config/gnome/gtk.m4: added (and added to the list of files in
6035 * src/insets/insetinclude.C (unique_id): fix when we are using
6036 lyxstring instead of basic_string<>.
6037 * src/insets/insettext.C (LocalDispatch): ditto.
6038 * src/support/filetools.C: ditto.
6040 * lib/configure.m4: create the ui/ directory if necessary.
6042 * src/LyXView.[Ch] (updateToolbar): new method.
6044 * src/BufferView_pimpl.C (buffer): update the toolbar when
6045 opening/closing buffer.
6047 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6049 * src/LyXAction.C (getActionName): enhance to return also the name
6050 and options of pseudo-actions.
6051 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
6053 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
6054 as an example of what is possible). Used in File->Build too (more
6055 useful) and in the import/export menus (to mimick the complicated
6056 handling of linuxdoc and friends). Try to update all the entries.
6058 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
6061 * src/MenuBackend.C (read): Parse the new OptItem tag.
6063 * src/MenuBackend.h: Add a new optional_ data member (used if the
6064 entry should be omitted when the lyxfunc is disabled).
6066 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
6067 function, used as a shortcut.
6068 (create_submenu): align correctly the shortcuts on the widest
6071 * src/MenuBackend.h: MenuItem.label() only returns the label of
6072 the menu without shortcut; new method shortcut().
6074 2000-07-14 Marko Vendelin <markov@ioc.ee>
6076 * src/frontends/gtk/Dialogs.C:
6077 * src/frontends/gtk/FormCopyright.C:
6078 * src/frontends/gtk/FormCopyright.h:
6079 * src/frontends/gtk/Makefile.am: added these source-files for the
6080 Gtk/Gnome support of the Copyright-Dialog.
6082 * src/main.C: added Gnome::Main initialization if using
6083 Gtk/Gnome frontend-GUI.
6085 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
6087 * config/gnome/aclocal-include.m4
6088 * config/gnome/compiler-flags.m4
6089 * config/gnome/curses.m4
6090 * config/gnome/gnome--.m4
6091 * config/gnome/gnome-bonobo-check.m4
6092 * config/gnome/gnome-common.m4
6093 * config/gnome/gnome-fileutils.m4
6094 * config/gnome/gnome-ghttp-check.m4
6095 * config/gnome/gnome-gnorba-check.m4
6096 * config/gnome/gnome-guile-checks.m4
6097 * config/gnome/gnome-libgtop-check.m4
6098 * config/gnome/gnome-objc-checks.m4
6099 * config/gnome/gnome-orbit-check.m4
6100 * config/gnome/gnome-print-check.m4
6101 * config/gnome/gnome-pthread-check.m4
6102 * config/gnome/gnome-support.m4
6103 * config/gnome/gnome-undelfs.m4
6104 * config/gnome/gnome-vfs.m4
6105 * config/gnome/gnome-x-checks.m4
6106 * config/gnome/gnome-xml-check.m4
6107 * config/gnome/gnome.m4
6108 * config/gnome/gperf-check.m4
6109 * config/gnome/gtk--.m4
6110 * config/gnome/linger.m4
6111 * config/gnome/need-declaration.m4: added configuration scripts
6112 for Gtk/Gnome frontend-GUI
6114 * configure.in: added support for the --with-frontend=gtk option
6116 * autogen.sh: added config/gnome/* to list of config-files
6118 * acconfig.h: added define for GTKGUI-support
6120 * config/lyxinclude.m4: added --with-frontend[=value] option value
6121 for Gtk/Gnome frontend-GUI support.
6123 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6125 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
6129 * src/paragraph.C (GetChar): remove non-const version
6131 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
6132 (search_kw): use it.
6134 * src/lyx_main.C (init): if "preferences" exist, read that instead
6136 (ReadRcFile): return bool if the file could be read ok.
6137 (ReadUIFile): add a check to see if lex file is set ok.
6139 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
6140 bastring can be used instead of lyxstring (still uses the old code
6141 if std::string is good enough or if lyxstring is used.)
6143 * src/encoding.C: make the arrays static, move ininle functions
6145 * src/encoding.h: from here.
6147 * src/buffer.C: have last_isnet_read as a file scope variable for now.
6148 (parseSingleLyXformat2Token): move inset parsing to separate method
6149 (readInset): new private method
6151 * src/Variables.h: remove virtual from get().
6153 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6154 access to NEW_INSETS and NEW_TABULAR
6156 * src/MenuBackend.h: remove superfluous forward declaration of
6157 MenuItem. Add documentations tags "///", remove empty MenuItem
6158 destructor, remove private default contructor.
6160 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6162 (read): more string mlabel and mname to where they are used
6163 (read): remove unused variables mlabel and mname
6164 (defaults): unconditional clear, make menusetup take advantage of
6165 add returning Menu &.
6167 * src/LyXView.h: define NEW_MENUBAR as default
6169 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6170 to NEW_INSETS and NEW_TABULAR.
6171 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6172 defined. Change some of the "xxxx-inset-insert" functions names to
6175 * several files: more enahncements to NEW_INSETS and the resulting
6178 * lib/lyxrc.example (\date_insert_format): move to misc section
6180 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6181 bastring and use AC_CACHE_CHECK.
6182 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6183 the system have the newest methods. uses AC_CACHE_CHECK
6184 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6185 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6186 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6188 * configure.in: add LYX_CXX_GOOD_STD_STRING
6190 * acinclude.m4: recreated
6192 2000-07-24 Amir Karger <karger@lyx.org>
6194 * README: add Hebrew, Arabic kmaps
6197 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6199 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6202 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6204 * Lot of files: add pragma interface/implementation.
6206 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6208 * lib/ui/default.ui: new file (ans new directory). Contains the
6209 default menu and toolbar.
6211 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6212 global space. Toolbars are now read (as menus) in ui files.
6214 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6216 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6217 is disabled because the document is read-only. We want to have the
6218 toggle state of the function anyway.
6219 (getStatus): add code for LFUN_VC* functions (mimicking what is
6220 done in old-style menus)
6222 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6223 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6225 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6226 * src/BufferView_pimpl.C: ditto.
6227 * src/lyxfunc.C: ditto.
6229 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6230 default). This replaces old-style menus by new ones.
6232 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6233 MenuItem. Contain the data structure of a menu.
6235 * src/insets/insettext.C: use LyXView::setLayout instead of
6236 accessing directly the toolbar combox.
6237 * src/lyxfunc.C (Dispatch): ditto.
6239 * src/LyXView.C (setLayout): new method, which just calls
6240 Toolbar::setLayout().
6241 (updateLayoutChoice): move part of this method in Toolbar.
6243 * src/toolbar.[Ch]: removed.
6245 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6246 implementation the toolbar.
6248 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6249 the toolbar. It might make sense to merge it with ToolbarDefaults
6251 (setLayout): new function.
6252 (updateLayoutList): ditto.
6253 (openLayoutList): ditto.
6255 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6256 xforms implementation of the toolbar.
6257 (get_toolbar_func): comment out, since I do not
6258 know what it is good for.
6260 * src/ToolbarDefaults.h: Add the ItemType enum.
6262 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6263 for a list of allocated C strings. Used in Menubar xforms
6264 implementation to avoid memory leaks.
6266 * src/support/lstrings.[Ch] (uppercase): new version taking and
6270 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6271 * lib/bind/emacs.bind: ditto.
6273 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6275 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6276 forward decl of LyXView.
6278 * src/toolbar.C (toolbarItem): moved from toolbar.h
6279 (toolbarItem::clean): ditto
6280 (toolbarItem::~toolbarItem): ditto
6281 (toolbarItem::operator): ditto
6283 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6285 * src/paragraph.h: control the NEW_TABULAR define from here
6287 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6288 USE_TABULAR_INSETS to NEW_TABULAR
6290 * src/ToolbarDefaults.C: add include "lyxlex.h"
6292 * files using the old table/tabular: use NEW_TABULAR to control
6293 compilation of old tabular stuff.
6295 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6298 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6299 planemet in reading of old style floats, fix the \end_deeper
6300 problem when reading old style floats.
6302 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6304 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6306 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6308 * lib/bind/sciword.bind: updated.
6310 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6312 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6313 layout write problem
6315 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6317 * src/Makefile.am (INCLUDES): remove image directory from include
6320 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6321 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6323 * src/LyXView.C (create_form_form_main): read the application icon
6326 * lib/images/*.xpm: change the icons to use transparent color for
6329 * src/toolbar.C (update): change the color of the button when it
6332 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6334 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6335 setting explicitely the minibuffer.
6336 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6338 * src/LyXView.C (showState): new function. Shows font information
6339 in minibuffer and update toolbar state.
6340 (LyXView): call Toolbar::update after creating the
6343 * src/toolbar.C: change toollist to be a vector instead of a
6345 (BubbleTimerCB): get help string directly from the callback
6346 argument of the corresponding icon (which is the action)
6347 (set): remove unnecessary ugliness.
6348 (update): new function. update the icons (depressed, disabled)
6349 depending of the status of the corresponding action.
6351 * src/toolbar.h: remove help in toolbarItem
6353 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6355 * src/Painter.C (text): Added code for using symbol glyphs from
6356 iso10646 fonts. Currently diabled.
6358 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6361 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6362 magyar,turkish and usorbian.
6364 * src/paragraph.C (isMultiLingual): Made more efficient.
6366 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6369 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6370 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6371 Also changed the prototype to "bool math_insert_greek(char)".
6373 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6375 * lots of files: apply the NEW_INSETS on all code that will not be
6376 needed when we move to use the new insets. Enable the define in
6377 lyxparagrah.h to try it.
6379 * src/insets/insettabular.C (cellstart): change to be a static
6381 (InsetTabular): initialize buffer in the initializer list.
6383 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6385 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6386 form_print.h out of the header file. Replaced with forward
6387 declarations of the relevant struct.
6389 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6392 * src/commandtags.h: do not include "debug.h" which does not
6393 belong there. #include it in some other places because of this
6396 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6398 * src/insets/insetcaption.C: add a couple "using" directives.
6400 * src/toolbar.C (add): get the help text directly from lyxaction.
6402 (setPixmap): new function. Loads from disk and sets a pixmap on a
6403 botton; the name of the pixmap file is derived from the command
6406 * src/toolbar.h: remove members isBitmap and pixmap from
6409 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6410 * lib/images/: move many files from images/banner.xpm.
6412 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6414 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6415 * src/toolbar.C: ditto.
6416 * configure.in: ditto.
6417 * INSTALL: document.
6419 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6420 the spellchecker popup is closed from the WM.
6422 2000-07-19 Juergen Vigna <jug@sad.it>
6424 * src/insets/insetfloat.C (Write): small fix because we use the
6425 insetname for the type now!
6427 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6429 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6432 * src/frontends/Dialogs.h: removed hideCitation signal
6434 * src/insets/insetcite.h: added hide signal
6436 * src/insets/insetcite.C (~InsetCitation): emits new signal
6437 (getScreenLabel): "intelligent" label should now fit on the screen!
6439 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6441 * src/frontends/xforms/FormCitation.C (showInset): connects
6442 hide() to the inset's hide signal
6443 (show): modified to use fl_set_object_position rather than
6444 fl_set_object_geometry wherever possible
6446 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6448 * src/insets/lyxinset.h: add caption code
6450 * src/insets/insetfloat.C (type): new method
6452 * src/insets/insetcaption.C (Write): new method
6454 (LyxCode): new method
6456 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6457 to get it right together with using the FloatList.
6459 * src/commandtags.h: add LFUN_INSET_CAPTION
6460 * src/lyxfunc.C (Dispatch): handle it
6462 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6465 * src/Variables.[Ch]: make expand take a const reference, remove
6466 the destructor, some whitespace changes.
6468 * src/LyXAction.C (init): add caption-inset-insert
6470 * src/FloatList.C (FloatList): update the default floats a bit.
6472 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6474 * src/Variables.[Ch]: new files. Intended to be used for language
6475 specific strings (like \chaptername) and filename substitution in
6478 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6480 * lib/kbd/american.kmap: update
6482 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6484 * src/bufferparams.[Ch]: remove member allowAccents.
6486 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6488 * src/LaTeXLog.C: use the log_form.h header.
6489 * src/lyx_gui.C: ditto.
6490 * src/lyx_gui_misc.C: ditto.
6491 * src/lyxvc.h: ditto.
6493 * forms/log_form.fd: new file, created from latexoptions.fd. I
6494 kept the log popup and nuked the options form.
6496 * src/{la,}texoptions.[Ch]: removed.
6497 * src/lyx_cb.C (LaTeXOptions): ditto
6499 * src/lyx_gui.C (create_forms): do not handle the
6500 fd_latex_options form.
6502 2000-07-18 Juergen Vigna <jug@sad.it>
6504 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6505 name of the inset so that it can be requested outside (text2.C).
6507 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6510 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6512 * src/mathed/formula.h (ConvertFont): constify
6514 * src/mathed/formula.C (Read): add warning if \end_inset is not
6515 found on expected place.
6517 * src/insets/lyxinset.h (ConvertFont): consify
6519 * src/insets/insetquotes.C (ConvertFont): constify
6520 * src/insets/insetquotes.h: ditto
6522 * src/insets/insetinfo.h: add labelfont
6524 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6525 (ascent): use labelfont
6529 (Write): make .lyx file a bit nicer
6531 * src/insets/insetfloat.C (Write): simplify somewhat...
6532 (Read): add warning if arg is not found
6534 * src/insets/insetcollapsable.C: add using std::max
6535 (Read): move string token and add warning in arg is not found
6536 (draw): use std::max to get the right ty
6537 (getMaxWidth): simplify by using std::max
6539 * src/insets/insetsection.h: new file
6540 * src/insets/insetsection.C: new file
6541 * src/insets/insetcaption.h: new file
6542 * src/insets/insetcaption.C: new file
6544 * src/insets/inset.C (ConvertFont): constify signature
6546 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6547 insetcaption.[Ch] and insetsection.[Ch]
6549 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6550 uses to use LABEL_COUNTER_CHAPTER instead.
6551 * src/text2.C (SetCounter): here
6553 * src/counters.h: new file
6554 * src/counters.C: new file
6555 * src/Sectioning.h: new file
6556 * src/Sectioning.C: new file
6558 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6560 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6562 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6565 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6568 2000-07-17 Juergen Vigna <jug@sad.it>
6570 * src/tabular.C (Validate): check if array-package is needed.
6571 (SetVAlignment): added support for vertical alignment.
6572 (SetLTFoot): better support for longtable header/footers
6573 (Latex): modified to support added features.
6575 * src/LaTeXFeatures.[Ch]: added array-package.
6577 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6579 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6582 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6584 * configure.in: do not forget to put a space after -isystem.
6586 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6588 * lib/kbd/arabic.kmap: a few fixes.
6590 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6592 * some whitespace chagnes to a number of files.
6594 * src/support/DebugStream.h: change to make it easier for
6595 doc++ to parse correctly.
6596 * src/support/lyxstring.h: ditto
6598 * src/mathed/math_utils.C (compara): change to have only one
6600 (MathedLookupBOP): change because of the above.
6602 * src/mathed/math_delim.C (math_deco_compare): change to have only
6604 (search_deco): change becasue of the above.
6606 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6607 instead of manually coded one.
6609 * src/insets/insetquotes.C (Read): read the \end_inset too
6611 * src/insets/insetlatex.h: remove file
6612 * src/insets/insetlatex.C: remove file
6614 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6616 (InsetPrintIndex): remove destructor
6618 * src/insets/insetinclude.h: remove default constructor
6620 * src/insets/insetfloat.C: work to make it work better
6622 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6624 * src/insets/insetcite.h (InsetCitation): remove default constructor
6626 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6628 * src/text.C (GetColumnNearX): comment out some currently unused code.
6630 * src/paragraph.C (writeFile): move some initializations closer to
6632 (CutIntoMinibuffer): small change to use new matchIT operator
6636 (InsertInset): ditto
6639 (InsetIterator): ditto
6640 (Erase): small change to use new matchFT operator
6642 (GetFontSettings): ditto
6643 (HighestFontInRange): ditto
6646 * src/lyxparagraph.h: some chars changed to value_type
6647 (matchIT): because of some stronger checking (perhaps too strong)
6648 in SGI STL, the two operator() unified to one.
6651 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6653 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6654 the last inset read added
6655 (parseSingleLyXformat2Token): some more (future) compability code added
6656 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6657 (parseSingleLyXformat2Token): set last_inset_read
6658 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6659 (parseSingleLyXformat2Token): don't double intializw string next_token
6661 * src/TextCache.C (text_fits::operator()): add const's to the signature
6662 (has_buffer::operator()): ditto
6664 * src/Floating.h: add some comments on the class
6666 * src/FloatList.[Ch] (typeExist): new method
6669 * src/BackStack.h: added default constructor, wanted by Gcc.
6671 2000-07-14 Juergen Vigna <jug@sad.it>
6673 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6675 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6677 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6678 do a redraw when the window is resized!
6679 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6681 * src/insets/insettext.C (resizeLyXText): added function to correctly
6682 being able to resize the LyXWindow.
6684 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6686 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6688 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6689 crashes when closing dialog to a deleted inset.
6691 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6692 method! Now similar to other insets.
6694 2000-07-13 Juergen Vigna <jug@sad.it>
6696 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6698 * lib/examples/Literate.lyx: small patch!
6700 * src/insets/insetbib.C (Read): added this function because of wrong
6701 Write (without [begin|end]_inset).
6703 2000-07-11 Juergen Vigna <jug@sad.it>
6705 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6706 as the insertInset could not be good!
6708 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6709 the bool param should not be last.
6711 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6713 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6714 did submit that to Karl).
6716 * configure.in: use -isystem instead of -I for X headers. This
6717 fixes a problem on solaris with a recent gcc;
6718 put the front-end code after the X detection code;
6719 configure in sigc++ before lib/
6721 * src/lyx_main.C (commandLineHelp): remove -display from command
6724 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6726 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6727 Also put in Makefile rules for building the ``listerrors''
6728 program for parsing errors from literate programs written in LyX.
6730 * lib/build-listerrors: Added small shell script as part of compile
6731 process. This builds a working ``listerrors'' binary if noweb is
6732 installed and either 1) the VNC X server is installed on the machine,
6733 or 2) the user is compiling from within a GUI. The existence of a GUI
6734 is necessary to use the ``lyx --export'' feature for now. This
6735 hack can be removed once ``lyx --export'' no longer requires a GUI to
6738 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6740 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6741 now passed back correctly from gcc and placed "under" error
6742 buttons in a Literate LyX source.
6744 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6746 * src/text.C (GetColumnNearX): Better behavior when a RTL
6747 paragraph is ended by LTR text.
6749 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6752 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6754 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6755 true when clipboard is empty.
6757 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6759 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6760 row of the paragraph.
6761 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6762 to prevent calculation of bidi tables
6764 2000-07-07 Juergen Vigna <jug@sad.it>
6766 * src/screen.C (ToggleSelection): added y_offset and x_offset
6769 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6772 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6774 * src/insets/insettext.C: fixed Layout-Display!
6776 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6778 * configure.in: add check for strings.h header.
6780 * src/spellchecker.C: include <strings.h> in order to have a
6781 definition for bzero().
6783 2000-07-07 Juergen Vigna <jug@sad.it>
6785 * src/insets/insettext.C (draw): set the status of the bv->text to
6786 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6788 * src/screen.C (DrawOneRow):
6789 (DrawFromTo): redraw the actual row if something has changed in it
6792 * src/text.C (draw): call an update of the toplevel-inset if something
6793 has changed inside while drawing.
6795 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6797 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6799 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6800 processing inside class.
6802 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6803 processing inside class.
6805 * src/insets/insetindex.h new struct Holder, consistent with other
6808 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6809 citation dialog from main code and placed it in src/frontends/xforms.
6810 Dialog launched through signals instead of callbacks
6812 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6814 * lyx.man: update the options description.
6816 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6818 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6819 handle neg values, set min width to 590, add doc about -display
6821 2000-07-05 Juergen Vigna <jug@sad.it>
6823 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6824 calls to BufferView *.
6826 * src/insets/insettext.C (checkAndActivateInset): small fix non
6827 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6829 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6830 their \end_inset token!
6832 2000-07-04 edscott <edscott@imp.mx>
6834 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6835 lib/lyxrc.example: added option \wheel_jump
6837 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6839 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6840 remove support for -width,-height,-xpos and -ypos.
6842 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6844 * src/encoding.[Ch]: New files.
6846 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6847 (text): Call to the underline() method only when needed.
6849 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6851 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6852 encoding(s) for the document.
6854 * src/bufferparams.C (BufferParams): Changed default value of
6857 * src/language.C (newLang): Removed.
6858 (items[]): Added encoding information for all defined languages.
6860 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6861 encoding choice button.
6863 * src/lyxrc.h (font_norm_type): New member variable.
6864 (set_font_norm_type): New method.
6866 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6867 paragraphs with different encodings.
6869 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6870 (TransformChar): Changed to work correctly with Arabic points.
6871 (draw): Added support for drawing Arabic points.
6872 (draw): Removed code for drawing underbars (this is done by
6875 * src/support/textutils.h (IsPrintableNonspace): New function.
6877 * src/BufferView_pimpl.h: Added "using SigC::Object".
6878 * src/LyXView.h: ditto.
6880 * src/insets/insetinclude.h (include_label): Changed to mutable.
6882 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6884 * src/mathed/math_iter.h: remove empty destructor
6886 * src/mathed/math_cursor.h: remove empty destructor
6888 * src/insets/lyxinset.h: add THEOREM_CODE
6890 * src/insets/insettheorem.[Ch]: new files
6892 * src/insets/insetminipage.C: (InsertInset): remove
6894 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6896 (InsertInset): remove
6898 * src/insets/insetlist.C: (InsertList): remove
6900 * src/insets/insetfootlike.[Ch]: new files
6902 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6905 (InsertInset): ditto
6907 * src/insets/insetert.C: remove include Painter.h, reindent
6908 (InsertInset): move to header
6910 * src/insets/insetcollapsable.h: remove explicit from default
6911 contructor, remove empty destructor, add InsertInset
6913 * src/insets/insetcollapsable.C (InsertInset): new func
6915 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6917 * src/vspace.h: add explicit to constructor
6919 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6920 \textcompwordmark, please test this.
6922 * src/lyxrc.C: set ascii_linelen to 65 by default
6924 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6926 * src/commandtags.h: add LFUN_INSET_THEOREM
6928 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6929 (makeLinuxDocFile): remove _some_ of the nice logic
6930 (makeDocBookFile): ditto
6932 * src/Painter.[Ch]: (~Painter): removed
6934 * src/LyXAction.C (init): entry for insettheorem added
6936 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6938 (deplog): code to detect files generated by LaTeX, needs testing
6941 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6945 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6947 * src/LaTeX.C (deplog): Add a check for files that are going to be
6948 created by the first latex run, part of the project to remove the
6951 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6952 contents to the extension list.
6954 2000-07-04 Juergen Vigna <jug@sad.it>
6956 * src/text.C (NextBreakPoint): added support for needFullRow()
6958 * src/insets/lyxinset.h: added needFullRow()
6960 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6963 * src/insets/insettext.C: lots of changes for update!
6965 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6967 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6969 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6971 * src/insets/insetinclude.C (InsetInclude): fixed
6972 initialization of include_label.
6973 (unique_id): now returns a string.
6975 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6977 * src/LaTeXFeatures.h: new member IncludedFiles, for
6978 a map of key, included file name.
6980 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6981 with the included files for inclusion in SGML preamble,
6982 i. e., linuxdoc and docbook.
6985 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6986 nice (is the generated linuxdoc code to be exported?), that
6987 allows to remove column, and only_body that will be true for
6988 slave documents. Insets are allowed inside SGML font type.
6989 New handling of the SGML preamble for included files.
6990 (makeDocBookFile): the same for docbook.
6992 * src/insets/insetinclude.h:
6993 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6995 (DocBook): new export methods.
6997 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6998 and makeDocBookFile.
7000 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
7001 formats to export with command line argument -x.
7003 2000-06-29 Juergen Vigna <jug@sad.it>
7005 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
7006 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
7008 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
7009 region could already been cleared by an inset!
7011 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7013 * src/BufferView_pimpl.h: remove member variables lyx_focus and
7016 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
7018 (cursorToggle): remove special handling of lyx focus.
7020 2000-06-28 Juergen Vigna <jug@sad.it>
7022 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
7025 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7027 * src/insets/insetindex.C (Edit): add a callback when popup is
7030 * src/insets/insettext.C (LocalDispatch):
7031 * src/insets/insetmarginal.h:
7032 * src/insets/insetlist.h:
7033 * src/insets/insetfoot.h:
7034 * src/insets/insetfloat.h:
7035 * src/insets/insetert.h: add a missing std:: qualifier.
7037 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7039 * src/support/lyxsum.C (sum): '\0' teminate file read when using
7042 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
7044 * src/insets/insettext.C (Read): remove tmptok unused variable
7045 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
7046 (InsertInset): change for new InsetInset code
7048 * src/insets/insettext.h: add TEXT inline method
7050 * src/insets/insettext.C: remove TEXT macro
7052 * src/insets/insetmarginal.C (Write): new method
7053 (Latex): change output slightly
7055 * src/insets/insetfoot.C (Write): new method
7056 (Latex): change output slightly (don't use endl when no need)
7058 * src/insets/insetert.C (Write): new method
7060 * src/insets/insetcollapsable.h: make button_length, button_top_y
7061 and button_bottm_y protected.
7063 * src/insets/insetcollapsable.C (Write): simplify code by using
7064 tostr. Also do not output the float name, the children class
7065 should to that to get control over own arguments
7067 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
7068 src/insets/insetminipage.[Ch]:
7071 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
7073 * src/lyxfunc.C (Dispatch): cases for new insets/commands
7075 * src/Makefile.am (lyx_SOURCES): add the new files
7077 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
7078 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
7079 * src/commandtags.h: ditto
7081 * src/LaTeXFeatures.h: add a std::set of used floattypes
7083 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
7085 * src/FloatList.[Ch] src/Floating.h: new files
7087 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
7089 * src/lyx_cb.C (TableApplyCB): ditto
7091 * src/text2.C: ditto
7092 * src/buffer.C (SimpleLinuxDocOnePar): ditto
7093 (parseSingleLyXformat2Token): ditto + add code for
7094 backwards compability for old float styles + add code for new insets
7096 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
7098 (InsertInset(size_type, Inset *, LyXFont)): new method
7099 (InsetChar(size_type, char)): changed to use the other InsetChar
7100 with a LyXFont(ALL_INHERIT).
7101 (InsetInset(size_type, Inset*)): changed to use InsetChar to
7102 insert the META_INSET.
7104 * sigc++/thread.cc (Privete<int>::operator int&): move definition
7106 * sigc++/thread.h (Threads): from here
7108 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
7109 definition out of line
7110 * sigc++/scope.h: from here
7112 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7114 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
7115 is specified (adapted from a patch from edscott <edscott@imp.mx>).
7117 * Makefile.am (bindist): new target.
7119 * INSTALL: add instructions for doing a binary distribution.
7121 * development/tools/README.bin.example: update a bit.
7123 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
7126 * lib/lyxrc.example: new lyxrc tag \set_color.
7128 * src/lyxfunc.C (Dispatch):
7129 * src/commandtags.h:
7130 * src/LyXAction.C: new lyxfunc "set-color".
7132 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
7133 and an x11name given as strings.
7135 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
7136 cache when a color is changed.
7138 2000-06-26 Juergen Vigna <jug@sad.it>
7140 * src/lyxrow.C (width): added this functions and variable.
7142 * src/insets/insetcite.C (create_form_citation_form): some Gravity
7145 * src/text.C (SetHeightOfRow): fixed calcualting of width.
7147 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7149 * images/undo_bw.xpm: new icon.
7150 * images/redo_bw.xpm: ditto.
7152 * configure.in (INSTALL_SCRIPT): change value to
7153 ${INSTALL} to avoid failures of install-script target.
7154 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7156 * src/BufferView.h: add a magic "friend" declaration to please
7159 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7161 * forms/cite.fd: modified to allow resizing without messing
7164 * src/insetcite.C: Uses code from cite.fd almost without
7166 User can now resize dialog in the x-direction.
7167 Resizing the dialog in the y-direction is prevented, as the
7168 code does this intelligently already.
7170 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7172 * INSTALL: remove obsolete entry in "problems" section.
7174 * lib/examples/sl_*.lyx: update of the slovenian examples.
7176 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7178 2000-06-23 Juergen Vigna <jug@sad.it>
7180 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7182 * src/buffer.C (resize): delete the LyXText of textinsets.
7184 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7186 * src/insets/lyxinset.h: added another parameter 'cleared' to
7187 the draw() function.
7189 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7190 unlocking inset in inset.
7192 2000-06-22 Juergen Vigna <jug@sad.it>
7194 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7195 of insets and moved first to LyXText.
7197 * src/mathed/formulamacro.[Ch]:
7198 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7200 2000-06-21 Juergen Vigna <jug@sad.it>
7202 * src/text.C (GetVisibleRow): look if I should clear the area or not
7203 using Inset::doClearArea() function.
7205 * src/insets/lyxinset.h: added doClearArea() function and
7206 modified draw(Painter &, ...) to draw(BufferView *, ...)
7208 * src/text2.C (UpdateInset): return bool insted of int
7210 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7212 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7213 combox in the character popup
7215 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7216 BufferParams const & params
7218 2000-06-20 Juergen Vigna <jug@sad.it>
7220 * src/insets/insettext.C (SetParagraphData): set insetowner on
7223 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7225 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7226 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7228 (form_main_): remove
7230 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7231 (create_form_form_main): remove FD_form_main stuff, connect to
7232 autosave_timeout signal
7234 * src/LyXView.[Ch] (getMainForm): remove
7235 (UpdateTimerCB): remove
7236 * src/BufferView_pimpl.h: inherit from SigC::Object
7238 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7239 signal instead of callback
7241 * src/BufferView.[Ch] (cursorToggleCB): remove
7243 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7245 * src/BufferView_pimpl.C: changes because of the one below
7247 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7248 instead of storing a pointer to a LyXText.
7250 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7252 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7254 * src/lyxparagraph.h
7256 * src/paragraph.C: Changed fontlist to a sorted vector.
7258 2000-06-19 Juergen Vigna <jug@sad.it>
7260 * src/BufferView.h: added screen() function.
7262 * src/insets/insettext.C (LocalDispatch): some selection code
7265 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7267 * src/insets/insettext.C (SetParagraphData):
7269 (InsetText): fixes for multiple paragraphs.
7271 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7273 * development/lyx.spec.in: Call configure with ``--without-warnings''
7274 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7275 This should be fine, however, since we generally don't want to be
7276 verbose when making an RPM.
7278 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7280 * lib/scripts/fig2pstex.py: New file
7282 2000-06-16 Juergen Vigna <jug@sad.it>
7284 * src/insets/insettabular.C (UpdateLocal):
7285 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7286 (LocalDispatch): Changed all functions to use LyXText.
7288 2000-06-15 Juergen Vigna <jug@sad.it>
7290 * src/text.C (SetHeightOfRow): call inset::update before requesting
7293 * src/insets/insettext.C (update):
7294 * src/insets/insettabular.C (update): added implementation
7296 * src/insets/lyxinset.h: added update function
7298 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7300 * src/text.C (SelectNextWord): protect against null pointers with
7301 old-style string streams. (fix from Paul Theo Gonciari
7304 * src/cite.[Ch]: remove erroneous files.
7306 * lib/configure.m4: update the list of created directories.
7308 * src/lyxrow.C: include <config.h>
7309 * src/lyxcursor.C: ditto.
7311 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7313 * lib/examples/decimal.lyx: new example file from Mike.
7315 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7316 to find template definitions (from Dekel)
7318 * src/frontends/.cvsignore: add a few things.
7320 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7322 * src/Timeout.C (TimeOut): remove default argument.
7324 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7327 * src/insets/ExternalTemplate.C: add a "using" directive.
7329 * src/lyx_main.h: remove the act_ struct, which seems unused
7332 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7334 * LyX Developers Meeting: All files changed, due to random C++ (by
7335 coincidence) code generator script.
7337 - external inset (cool!)
7338 - initial online editing of preferences
7339 - insettabular breaks insettext(s contents)
7341 - some DocBook fixes
7342 - example files update
7343 - other cool stuff, create a diff and look for yourself.
7345 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7347 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7348 -1 this is a non-line-breaking textinset.
7350 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7351 if there is no width set.
7353 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7355 * Lots of files: Merged the dialogbase branch.
7357 2000-06-09 Allan Rae <rae@lyx.org>
7359 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7360 and the Dispatch methods that used it.
7362 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7363 access to functions formerly kept in Dispatch.
7365 2000-05-19 Allan Rae <rae@lyx.org>
7367 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7368 made to_page and count_copies integers again. from_page remains a
7369 string however because I want to allow entry of a print range like
7370 "1,4,22-25" using this field.
7372 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7373 and printer-params-get. These aren't useful from the minibuffer but
7374 could be used by a script/LyXServer app provided it passes a suitable
7375 auto_mem_buffer. I guess I should take a look at how the LyXServer
7376 works and make it support xtl buffers.
7378 * sigc++/: updated to libsigc++-1.0.1
7380 * src/xtl/: updated to xtl-1.3.pl.11
7382 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7383 those changes done to the files in src/ are actually recreated when
7384 they get regenerated. Please don't ever accept a patch that changes a
7385 dialog unless that patch includes the changes to the corresponding *.fd
7388 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7389 stringOnlyContains, renamed it and generalised it.
7391 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7392 branch. Removed the remaining old form_print code.
7394 2000-04-26 Allan Rae <rae@lyx.org>
7396 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7397 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7399 2000-04-25 Allan Rae <rae@lyx.org>
7401 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7402 against a base of xtl-1.3.pl.4
7404 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7405 filter the Id: entries so they still show the xtl version number
7408 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7409 into the src/xtl code. Patch still pending with José (XTL)
7411 2000-04-24 Allan Rae <rae@lyx.org>
7413 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7414 both more generic and much safer. Use the new template functions.
7415 * src/buffer.[Ch] (Dispatch): ditto.
7417 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7418 and mem buffer more intelligently. Also a little general cleanup.
7421 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7422 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7423 * src/xtl/Makefile.am: ditto.
7424 * src/xtl/.cvsignore: ditto.
7425 * src/Makefile.am: ditto.
7427 * src/PrinterParams.h: Removed the macros member functions. Added a
7428 testInvariant member function. A bit of tidying up and commenting.
7429 Included Angus's idea for fixing operation with egcs-1.1.2.
7431 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7432 cool expansion of XTL's mem_buffer to support automatic memory
7433 management within the buffer itself. Removed the various macros and
7434 replaced them with template functions that use either auto_mem_buffer
7435 or mem_buffer depending on a #define. The mem_buffer support will
7436 disappear as soon as the auto_mem_buffer is confirmed to be good on
7437 other platforms/compilers. That is, it's there so you've got something
7440 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7441 effectively forked XTL. However I expect José will include my code
7442 into the next major release. Also fixed a memory leak.
7443 * src/xtl/text.h: ditto.
7444 * src/xtl/xdr.h: ditto.
7445 * src/xtl/giop.h: ditto.
7447 2000-04-16 Allan Rae <rae@lyx.org>
7449 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7450 by autogen.sh and removed by maintainer-clean anyway.
7451 * .cvsignore, sigc++/.cvsignore: Support the above.
7453 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7455 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7457 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7458 macros, renamed static callback-target member functions to suit new
7459 scheme and made them public.
7460 * src/frontends/xforms/forms/form_print.fd: ditto.
7461 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7463 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7466 * src/xtl/: New directory containing a minimal distribution of XTL.
7467 This is XTL-1.3.pl.4.
7469 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7471 2000-04-15 Allan Rae <rae@lyx.org>
7473 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7475 * sigc++/: Updated to libsigc++-1.0.0
7477 2000-04-14 Allan Rae <rae@lyx.org>
7479 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7480 use the generic ones in future. I'll modify my conversion script.
7482 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7484 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7485 (CloseAllBufferRelatedDialogs): Renamed.
7486 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7488 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7489 of the generic ones. These are the same ones my conversion script
7492 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7493 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7494 * src/buffer.C (Dispatch): ditto
7496 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7497 functions for updating and hiding buffer dependent dialogs.
7498 * src/BufferView.C (buffer): ditto
7499 * src/buffer.C (setReadonly): ditto
7500 * src/lyxfunc.C (CloseBuffer): ditto
7502 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7503 Dialogs.h, and hence all the SigC stuff, into every file that includes
7504 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7506 * src/BufferView2.C: reduce the number of headers included by buffer.h
7508 2000-04-11 Allan Rae <rae@lyx.org>
7510 * src/frontends/xforms/xform_macros.h: A small collection of macros
7511 for building C callbacks.
7513 * src/frontends/xforms/Makefile.am: Added above file.
7515 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7516 scheme again. This time it should work for JMarc. If this is
7517 successful I'll revise my conversion script to automate some of this.
7518 The static member functions in the class also have to be public for
7519 this scheme will work. If the scheme works (it's almost identical to
7520 the way BufferView::cursorToggleCB is handled so it should work) then
7521 FormCopyright and FormPrint will be ready for inclusion into the main
7522 trunk immediately after 1.1.5 is released -- provided we're prepared
7523 for complaints about lame compilers not handling XTL.
7525 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7527 2000-04-07 Allan Rae <rae@lyx.org>
7529 * config/lyxinclude.m4: A bit more tidying up (Angus)
7531 * src/LString.h: JMarc's <string> header fix
7533 * src/PrinterParams.h: Used string for most data to remove some
7534 ugly code in the Print dialog and avoid even uglier code when
7535 appending the ints to a string for output.
7537 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7538 and moved "default:" back to the end of switch statement. Cleaned
7539 up the printing so it uses the right function calls and so the
7540 "print to file" option actually puts the file in the right directory.
7542 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7544 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7545 and Ok+Apply button control into a separate method: input (Angus).
7546 (input) Cleaned it up and improved it to be very thorough now.
7547 (All CB) static_cast used instead of C style cast (Angus). This will
7548 probably change again once we've worked out how to keep gcc-2.8.1 happy
7549 with real C callbacks.
7550 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7551 ignore some of the bool settings and has random numbers instead. Needs
7552 some more investigation. Added other input length checks and checking
7553 of file and printer names.
7555 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7556 would link (Angus). Seems the old code doesn't compile with the pragma
7557 statement either. Separated callback entries from internal methods.
7559 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7561 2000-03-17 Allan Rae <rae@lyx.org>
7563 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7564 need it? Maybe it could go in Dialogs instead? I could make it a
7565 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7566 values to get the bool return value.
7567 (Dispatch): New overloaded method for xtl support.
7569 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7570 extern "C" callback instead of static member functions. Hopefully,
7571 JMarc will be able to compile this. I haven't changed
7572 forms/form_copyright.fd yet. Breaking one of my own rules already.
7574 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7575 because they aren't useful from the minibuffer. Maybe a LyXServer
7576 might want a help message though?
7578 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7580 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7581 xtl which needs both rtti and exceptions.
7583 * src/support/Makefile.am:
7584 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7586 * src/frontends/xforms/input_validators.[ch]: input filters and
7587 validators. These conrol what keys are valid in input boxes.
7588 Use them and write some more. Much better idea than waiting till
7589 after the user has pressed Ok to say that the input fields don't make
7592 * src/frontends/xforms/Makefile.am:
7593 * src/frontends/xforms/forms/form_print.fd:
7594 * src/frontends/xforms/forms/makefile:
7595 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7596 new scheme. Still have to make sure I haven't missed anything from
7597 the current implementation.
7599 * src/Makefile.am, src/PrinterParams.h: New data store.
7601 * other files: Added a couple of copyright notices.
7603 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7605 * src/insets/insetbib.h: move Holder struct in public space.
7607 * src/frontends/include/DialogBase.h: use SigC:: only when
7608 SIGC_CXX_NAMESPACES is defined.
7609 * src/frontends/include/Dialogs.h: ditto.
7611 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7613 * src/frontends/xforms/FormCopyright.[Ch]: do not
7614 mention SigC:: explicitely.
7616 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7618 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7619 deals with testing KDE in main configure.in
7620 * configure.in: ditto.
7622 2000-02-22 Allan Rae <rae@lyx.org>
7624 * Lots of files: Merged from HEAD
7626 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7627 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7629 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7631 * sigc++/: new minidist.
7633 2000-02-14 Allan Rae <rae@lyx.org>
7635 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7637 2000-02-08 Juergen Vigna <jug@sad.it>
7639 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7640 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7642 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7643 for this port and so it is much easier for other people to port
7644 dialogs in a common development environment.
7646 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7647 the QT/KDE implementation.
7649 * src/frontends/kde/Dialogs.C:
7650 * src/frontends/kde/FormCopyright.C:
7651 * src/frontends/kde/FormCopyright.h:
7652 * src/frontends/kde/Makefile.am:
7653 * src/frontends/kde/formcopyrightdialog.C:
7654 * src/frontends/kde/formcopyrightdialog.h:
7655 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7656 for the kde support of the Copyright-Dialog.
7658 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7659 subdir-substitution instead of hardcoded 'xforms' as we now have also
7662 * src/frontends/include/DialogBase.h (Object): just commented the
7663 label after #endif (nasty warning and I don't like warnings ;)
7665 * src/main.C (main): added KApplication initialization if using
7668 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7669 For now only the KDE event-loop is added if frontend==kde.
7671 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7673 * configure.in: added support for the --with-frontend[=value] option
7675 * autogen.sh: added kde.m4 file to list of config-files
7677 * acconfig.h: added define for KDEGUI-support
7679 * config/kde.m4: added configuration functions for KDE-port
7681 * config/lyxinclude.m4: added --with-frontend[=value] option with
7682 support for xforms and KDE.
7684 2000-02-08 Allan Rae <rae@lyx.org>
7686 * all Makefile.am: Fixed up so the make targets dist, distclean,
7687 install and uninstall all work even if builddir != srcdir. Still
7688 have a new sigc++ minidist update to come.
7690 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7692 2000-02-01 Allan Rae <rae@lyx.org>
7694 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7695 Many mods to get builddir != srcdir working.
7697 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7698 for building on NT and so we can do the builddir != srcdir stuff.
7700 2000-01-30 Allan Rae <rae@lyx.org>
7702 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7703 This will stay in "rae" branch. We probably don't really need it in
7704 the main trunk as anyone who wants to help programming it should get
7705 a full library installed also. So they can check both included and
7706 system supplied library compilation.
7708 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7709 Added a 'mini' distribution of libsigc++. If you feel the urge to
7710 change something in these directories - Resist it. If you can't
7711 resist the urge then you should modify the following script and rebuild
7712 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7713 all happen. Still uses a hacked version of libsigc++'s configure.in.
7714 I'm quite happy with the results. I'm not sure the extra work to turn
7715 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7716 worth the trouble and would probably lead to extra maintenance
7718 I haven't tested the following important make targets: install, dist.
7719 Not ready for prime time but very close. Maybe 1.1.5.
7721 * development/tools/makeLyXsigc.sh: A shell script to automatically
7722 generate our mini-dist of libsigc++. It can only be used with a CVS
7723 checkout of libsigc++ not a tarball distribution. It's well commented.
7724 This will end up as part of the libsigc++ distribution so other apps
7725 can easily have an included mini-dist. If someone makes mods to the
7726 sigc++ subpackage without modifying this script to generate those
7727 changes I'll be very upset!
7729 * src/frontends/: Started the gui/system indep structure.
7731 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7732 to access the gui-indep dialogs are in this class. Much improved
7733 design compared to previous revision. Lars, please refrain from
7734 moving this header into src/ like you did with Popups.h last time.
7736 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7738 * src/frontends/xforms/: Started the gui-indep system with a single
7739 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7742 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7743 Here you'll find a very useful makefile and automated fdfix.sh that
7744 makes updating dailogs a no-brainer -- provided you follow the rules
7745 set out in the README. I'm thinking about adding another script to
7746 automatically generate skeleton code for a new dialog given just the
7749 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7750 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7751 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7753 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7755 * src/support/LSubstring.C (operator): simplify
7757 * src/lyxtext.h: removed bparams, use buffer_->params instead
7759 * src/lyxrow.h: make Row a real class, move all variables to
7760 private and use accessors.
7762 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7764 (isRightToLeftPar): ditto
7765 (ChangeLanguage): ditto
7766 (isMultiLingual): ditto
7769 (SimpleTeXOnePar): ditto
7770 (TeXEnvironment): ditto
7771 (GetEndLabel): ditto
7773 (SetOnlyLayout): ditto
7774 (BreakParagraph): ditto
7775 (BreakParagraphConservative): ditto
7776 (GetFontSettings): ditto
7778 (CopyIntoMinibuffer): ditto
7779 (CutIntoMinibuffer): ditto
7780 (PasteParagraph): ditto
7781 (SetPExtraType): ditto
7782 (UnsetPExtraType): ditto
7783 (DocBookContTableRows): ditto
7784 (SimpleDocBookOneTablePar): ditto
7786 (TeXFootnote): ditto
7787 (SimpleTeXOneTablePar): ditto
7788 (TeXContTableRows): ditto
7789 (SimpleTeXSpecialChars): ditto
7792 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7793 to private and use accessors.
7795 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7796 this, we did not use it anymore and has not been for ages. Just a
7797 waste of cpu cycles.
7799 * src/language.h: make Language a real class, move all variables
7800 to private and use accessors.
7802 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7803 (create_view): remove
7804 (update): some changes for new timer
7805 (cursorToggle): use new timer
7806 (beforeChange): change for new timer
7808 * src/BufferView.h (cursorToggleCB): removed last paramter because
7811 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7812 (cursorToggleCB): change because of new timer code
7814 * lib/CREDITS: updated own mailaddress
7816 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7818 * src/support/filetools.C (PutEnv): fix the code in case neither
7819 putenv() nor setenv() have been found.
7821 * INSTALL: mention the install-strip Makefile target.
7823 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7824 read-only documents.
7826 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7828 * lib/reLyX/configure.in (VERSION): avoid using a previously
7829 generated reLyX wrapper to find out $prefix.
7831 * lib/examples/eu_adibide_lyx-atua.lyx:
7832 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7833 translation of the Tutorial (Dooteo)
7835 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7837 * forms/cite.fd: new citation dialog
7839 * src/insetcite.[Ch]: the new citation dialog is moved into
7842 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7845 * src/insets/insetcommand.h: data members made private.
7847 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7849 * LyX 1.1.5 released
7851 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7853 * src/version.h (LYX_RELEASE): to 1.1.5
7855 * src/spellchecker.C (RunSpellChecker): return false if the
7856 spellchecker dies upon creation.
7858 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7860 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7861 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7865 * lib/CREDITS: update entry for Martin Vermeer.
7867 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7869 * src/text.C (draw): Draw foreign language bars at the bottom of
7870 the row instead of at the baseline.
7872 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7874 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7876 * lib/bind/de_menus.bind: updated
7878 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7880 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7882 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7884 * src/menus.C (Limit_string_length): New function
7885 (ShowTocMenu): Limit the number of items/length of items in the
7888 * src/paragraph.C (String): Correct result for a paragraph inside
7891 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7893 * src/bufferlist.C (close): test of buf->getuser() == NULL
7895 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7897 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7898 Do not call to SetCursor when the paragraph is a closed footnote!
7900 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7902 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7905 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7907 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7910 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7911 reference popup, that activates the reference-back action
7913 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7915 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7916 the menus. Also fixed a bug.
7918 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7919 the math panels when switching buffers (unless new buffer is readonly).
7921 * src/BufferView.C (NoSavedPositions)
7922 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7924 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7926 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7927 less of dvi dirty or not.
7929 * src/trans_mgr.[Ch] (insert): change first parameter to string
7932 * src/chset.[Ch] (encodeString): add const to first parameter
7934 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7936 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7940 * src/LaTeX.C (deplog): better searching for dependency files in
7941 the latex log. Uses now regexps.
7943 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7944 instead of the box hack or \hfill.
7946 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7948 * src/lyxfunc.C (doImportHelper): do not create the file before
7949 doing the actual import.
7950 (doImportASCIIasLines): create a new file before doing the insert.
7951 (doImportASCIIasParagraphs): ditto.
7953 * lib/lyxrc.example: remove mention of non-existing commands
7955 * lyx.man: remove mention of color-related switches.
7957 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7959 * src/lyx_gui.C: remove all the color-related ressources, which
7960 are not used anymore.
7962 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7965 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7967 * src/lyxrc.C (read): Add a missing break in the switch
7969 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7971 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7973 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7976 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7978 * src/text.C (draw): draw bars under foreign language words.
7980 * src/LColor.[Ch]: add LColor::language
7982 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7984 * src/lyxcursor.h (boundary): New member variable
7986 * src/text.C (IsBoundary): New methods
7988 * src/text.C: Use the above for currect cursor movement when there
7989 is both RTL & LTR text.
7991 * src/text2.C: ditto
7993 * src/bufferview_funcs.C (ToggleAndShow): ditto
7995 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7997 * src/text.C (DeleteLineForward): set selection to true to avoid
7998 that DeleteEmptyParagraphMechanism does some magic. This is how it
7999 is done in all other functions, and seems reasonable.
8000 (DeleteWordForward): do not jump over non-word stuff, since
8001 CursorRightOneWord() already does it.
8003 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
8004 DeleteWordBackward, since they seem safe to me (since selection is
8005 set to "true") DeleteEmptyParagraphMechanism does nothing.
8007 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8009 * src/lyx_main.C (easyParse): simplify the code by factoring the
8010 part that removes parameters from the command line.
8011 (LyX): check wether wrong command line options have been given.
8013 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
8015 * src/lyx_main.C : add support for specifying user LyX
8016 directory via command line option -userdir.
8018 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
8020 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
8021 the number of items per popup.
8022 (Add_to_refs_menu): Ditto.
8024 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8026 * src/lyxparagraph.h: renamed ClearParagraph() to
8027 StripLeadingSpaces() and moved it to paragraph.C. We pass the
8028 textclass as parameter, and do nothing if free_spacing is
8029 true. This fixes part of the line-delete-forward problems.
8031 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
8032 (pasteSelection): ditto.
8033 (SwitchLayoutsBetweenClasses): more translatable strings.
8035 * src/text2.C (CutSelection): use StripLeadingSpaces.
8036 (PasteSelection): ditto.
8037 (DeleteEmptyParagraphMechanism): ditto.
8039 2000-05-26 Juergen Vigna <jug@sad.it>
8041 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
8042 is not needed in tabular insets.
8044 * src/insets/insettabular.C (TabularFeatures): added missing features.
8046 * src/tabular.C (DeleteColumn):
8048 (AppendRow): implemented this functions
8049 (cellsturct::operator=): clone the inset too;
8051 2000-05-23 Juergen Vigna <jug@sad.it>
8053 * src/insets/insettabular.C (LocalDispatch): better selection support
8054 when having multicolumn-cells.
8056 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8058 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
8060 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8062 * src/ColorHandler.C (getGCForeground): put more test into _()
8064 * lib/examples/eu_splash.lyx: new file (Basque translation) from
8067 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
8070 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
8072 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
8073 there are no labels, or when buffer is readonly.
8075 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
8076 there are no labels, buffer is SGML, or when buffer is readonly.
8078 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8080 * src/LColor.C (LColor): change a couple of grey40 to grey60
8081 (LColor): rewore initalization to make compiles go some magnitude
8083 (getGUIName): don't use gettext until we need the string.
8085 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
8087 * src/Bullet.[Ch]: Fixed a small bug.
8089 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
8091 * src/paragraph.C (String): Several fixes/improvements
8093 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
8095 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8097 * src/paragraph.C (String): give more correct output.
8099 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
8101 * src/lyxfont.C (stateText) Do not output the language if it is
8102 eqaul to the language of the document.
8104 * src/paragraph.C (TeXOnePar): Do not put language switch commands
8105 between two paragraphs with the same language.
8107 * src/paragraph.C (getParLanguage) Return a correct answer for an
8108 empty dummy paragraph.
8110 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
8113 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
8116 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
8117 the menus/popup, if requested fonts are unavailable.
8119 2000-05-22 Juergen Vigna <jug@sad.it>
8121 * src/insets/insettabular.C (LocalDispatch): added some more cursor
8122 movement support (Up/Down/Tab/Shift-Tab).
8123 (LocalDispatch): added also preliminari cursor-selection.
8125 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
8127 * src/paragraph.C (PasteParagraph): Hopefully now right!
8129 2000-05-22 Garst R. Reese <reese@isn.net>
8131 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
8132 of list, change all references to Environment to Command
8133 * tex/hollywood.cls : rewrite environments as commands, add
8134 \uppercase to interiorshot and exteriorshot to force uppecase.
8135 * tex/broadway.cls : rewrite environments as commands. Tweak
8138 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8140 * src/menus.C (Add_to_toc_menu): fix the code which limits the
8141 size of items: use a constant intead of the hardcoded 40, and more
8142 importantly do not remove the %m and %x tags added at the end.
8143 (Add_to_refs_menu): use vector::size_type instead of
8144 unsigned int as basic types for the variables. _Please_ do not
8145 assume that size_t is equal to unsigned int. On an alpha, this is
8146 unsigned long, which is _not_ the same.
8148 * src/language.C (initL): remove language "hungarian", since it
8149 seems that "magyar" is better.
8151 2000-05-22 Juergen Vigna <jug@sad.it>
8153 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8155 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8158 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8159 next was deleted but not set to 0.
8161 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8163 * src/language.C (initL): change the initialization of languages
8164 so that compiles goes _fast_.
8166 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8169 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8171 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8175 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8177 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8179 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8183 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8186 * src/insets/insetlo*.[Ch]: Made editable
8188 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8190 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8191 the current selection.
8193 * src/BufferView_pimpl.C (stuffClipboard): new method
8195 * src/BufferView.C (stuffClipboard): new method
8197 * src/paragraph.C (String): new method
8199 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8200 LColor::ignore when lyxname is not found.
8202 * src/BufferView.C (pasteSelection): new method
8204 * src/BufferView_pimpl.C (pasteSelection): new method
8206 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8208 * src/WorkArea.C (request_clipboard_cb): new static function
8209 (getClipboard): new method
8210 (putClipboard): new method
8212 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8214 * LyX 1.1.5pre2 released
8216 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8218 * src/vspace.C (operator=): removed
8219 (operator=): removed
8221 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8223 * src/layout.C (NumberOfClass): manually set the type in make_pair
8224 (NumberOfLayout): ditto
8226 * src/language.C: use the Language constructor for ignore_lang
8228 * src/language.h: add constructors to struct Language
8230 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8232 * src/text2.C (SetCursorIntern): comment out #warning
8234 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8236 * src/mathed/math_iter.h: initialize sx and sw to 0
8238 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8240 * forms/lyx.fd: Redesign of form_ref
8242 * src/LaTeXFeatures.[Ch]
8246 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8249 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8250 and Buffer::inset_iterator.
8252 * src/menus.C: Added new menus: TOC and Refs.
8254 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8256 * src/buffer.C (getTocList): New method.
8258 * src/BufferView2.C (ChangeRefs): New method.
8260 * src/buffer.C (getLabelList): New method. It replaces the old
8261 getReferenceList. The return type is vector<string> instead of
8264 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8265 the old getLabel() and GetNumberOfLabels() methods.
8266 * src/insets/insetlabel.C (getLabelList): ditto
8267 * src/mathed/formula.C (getLabelList): ditto
8269 * src/paragraph.C (String): New method.
8271 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8272 Uses the new getTocList() method.
8273 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8274 which automatically updates the contents of the browser.
8275 (RefUpdateCB): Use the new getLabelList method.
8277 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8279 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8281 * src/spellchecker.C: Added using std::reverse;
8283 2000-05-19 Juergen Vigna <jug@sad.it>
8285 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8287 * src/insets/insettext.C (computeTextRows): small fix for display of
8288 1 character after a newline.
8290 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8293 2000-05-18 Juergen Vigna <jug@sad.it>
8295 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8296 when changing width of column.
8298 * src/tabular.C (set_row_column_number_info): setting of
8299 autobreak rows if necessary.
8301 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8303 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8305 * src/vc-backend.*: renamed stat() to status() and vcstat to
8306 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8307 compilation broke. The new name seems more relevant, anyway.
8309 2000-05-17 Juergen Vigna <jug@sad.it>
8311 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8312 which was wrong if the removing caused removing of rows!
8314 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8315 (pushToken): new function.
8317 * src/text2.C (CutSelection): fix problem discovered with purify
8319 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8321 * src/debug.C (showTags): enlarge the first column, now that we
8322 have 6-digits debug codes.
8324 * lib/layouts/hollywood.layout:
8325 * lib/tex/hollywood.cls:
8326 * lib/tex/brodway.cls:
8327 * lib/layouts/brodway.layout: more commands and fewer
8328 environments. Preambles moved in the .cls files. Broadway now has
8329 more options on scene numbering and less whitespace (from Garst)
8331 * src/insets/insetbib.C (getKeys): make sure that we are in the
8332 document directory, in case the bib file is there.
8334 * src/insets/insetbib.C (Latex): revert bogus change.
8336 2000-05-16 Juergen Vigna <jug@sad.it>
8338 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8339 the TabularLayout on cursor move.
8341 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8343 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8346 (draw): fixed cursor position and drawing so that the cursor is
8347 visible when before the tabular-inset.
8349 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8350 when creating from old insettext.
8352 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8354 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8356 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8357 * lib/tex/brodway.cls: ditto
8359 * lib/layouts/brodway.layout: change alignment of parenthical
8362 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8364 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8365 versions 0.88 and 0.89 are supported.
8367 2000-05-15 Juergen Vigna <jug@sad.it>
8369 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8372 * src/insets/insettext.C (computeTextRows): redone completely this
8373 function in a much cleaner way, because of problems when having a
8375 (draw): added a frame border when the inset is locked.
8376 (SetDrawLockedFrame): this sets if we draw the border or not.
8377 (SetFrameColor): this sets the frame color (default=insetframe).
8379 * src/insets/lyxinset.h: added x() and y() functions which return
8380 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8381 function which is needed to see if we have a locking inset of some
8382 type in this inset (needed for now in insettabular).
8384 * src/vspace.C (inPixels): the same function also without a BufferView
8385 parameter as so it is easier to use it in some ocasions.
8387 * src/lyxfunc.C: changed all places where insertInset was used so
8388 that now if it couldn't be inserted it is deleted!
8390 * src/TabularLayout.C:
8391 * src/TableLayout.C: added support for new tabular-inset!
8393 * src/BufferView2.C (insertInset): this now returns a bool if the
8394 inset was really inserted!!!
8396 * src/tabular.C (GetLastCellInRow):
8397 (GetFirstCellInRow): new helper functions.
8398 (Latex): implemented for new tabular class.
8402 (TeXTopHLine): new Latex() helper functions.
8404 2000-05-12 Juergen Vigna <jug@sad.it>
8406 * src/mathed/formulamacro.C (Read):
8407 * src/mathed/formula.C (Read): read also the \end_inset here!
8409 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8411 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8412 crush when saving formulae with unbalanced parenthesis.
8414 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8416 * src/layout.C: Add new keyword "endlabelstring" to layout file
8418 * src/text.C (GetVisibleRow): Draw endlabel string.
8420 * lib/layouts/broadway.layout
8421 * lib/layouts/hollywood.layout: Added endlabel for the
8422 Parenthetical layout.
8424 * lib/layouts/heb-article.layout: Do not use slanted font shape
8425 for Theorem like environments.
8427 * src/buffer.C (makeLaTeXFile): Always add "american" to
8428 the UsedLanguages list if document language is RTL.
8430 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8432 * add addendum to README.OS2 and small patch (from SMiyata)
8434 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8436 * many files: correct the calls to ChangeExtension().
8438 * src/support/filetools.C (ChangeExtension): remove the no_path
8439 argument, which does not belong there. Use OnlyFileName() instead.
8441 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8442 files when LaTeXing a non-nice latex file.
8444 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8445 a chain of "if". Return false when deadkeys are not handled.
8447 * src/lyx_main.C (LyX): adapted the code for default bindings.
8449 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8450 bindings for basic functionality (except deadkeys).
8451 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8453 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8454 several methods: handle override_x_deadkeys.
8456 * src/lyxrc.h: remove the "bindings" map, which did not make much
8457 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8459 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8461 * src/lyxfont.C (stateText): use a saner method to determine
8462 whether the font is "default". Seems to fix the crash with DEC
8465 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8467 2000-05-08 Juergen Vigna <jug@sad.it>
8469 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8470 TabularLayoutMenu with mouse-button-3
8471 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8473 * src/TabularLayout.C: added this file for having a Layout for
8476 2000-05-05 Juergen Vigna <jug@sad.it>
8478 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8479 recalculating inset-widths.
8480 (TabularFeatures): activated this function so that I can change
8481 tabular-features via menu.
8483 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8484 that I can test some functions with the Table menu.
8486 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8488 * src/lyxfont.C (stateText): guard against stupid c++libs.
8490 * src/tabular.C: add using std::vector
8491 some whitespace changes, + removed som autogenerated code.
8493 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8495 2000-05-05 Juergen Vigna <jug@sad.it>
8497 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8498 row, columns and cellstructures.
8500 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8502 * lib/lyxrc.example: remove obsolete entries.
8504 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8505 reading of protected_separator for free_spacing.
8507 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8509 * src/text.C (draw): do not display an exclamation mark in the
8510 margin for margin notes. This is confusing, ugly and
8513 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8514 AMS math' is checked.
8516 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8517 name to see whether including the amsmath package is needed.
8519 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8521 * src/paragraph.C (validate): Compute UsedLanguages correctly
8522 (don't insert the american language if it doesn't appear in the
8525 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8526 The argument of \thanks{} command is considered moving argument
8528 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8531 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8533 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8534 for appendix/minipage/depth. The lines can be now both in the footnote
8535 frame, and outside the frame.
8537 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8540 2000-05-05 Juergen Vigna <jug@sad.it>
8542 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8543 neede only in tabular.[Ch].
8545 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8547 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8549 (Write): write '~' for PROTECTED_SEPARATOR
8551 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8553 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8556 * src/mathed/formula.C (drawStr): rename size to siz.
8558 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8559 possibly fix a bug by not changing the pflags = flags to piflags =
8562 2000-05-05 Juergen Vigna <jug@sad.it>
8564 * src/insets/insetbib.C: moved using directive
8566 * src/ImportNoweb.C: small fix for being able to compile (missing
8569 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8571 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8572 to use clear, since we don't depend on this in the code. Add test
8575 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8577 * (various *.C files): add using std::foo directives to please dec
8580 * replace calls to string::clear() to string::erase() (Angus)
8582 * src/cheaders/cmath: modified to provide std::abs.
8584 2000-05-04 Juergen Vigna <jug@sad.it>
8586 * src/insets/insettext.C: Prepared all for inserting of multiple
8587 paragraphs. Still display stuff to do (alignment and other things),
8588 but I would like to use LyXText to do this when we cleaned out the
8589 table-support stuff.
8591 * src/insets/insettabular.C: Changed lot of stuff and added lots
8592 of functionality still a lot to do.
8594 * src/tabular.C: Various functions changed name and moved to be
8595 const functions. Added new Read and Write functions and changed
8596 lots of things so it works good with tabular-insets (also removed
8597 some stuff which is not needed anymore * hacks *).
8599 * src/lyxcursor.h: added operators == and != which just look if
8600 par and pos are (not) equal.
8602 * src/buffer.C (latexParagraphs): inserted this function to latex
8603 all paragraphs form par to endpar as then I can use this too for
8606 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8607 so that I can call this to from text insets with their own cursor.
8609 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8610 output off all paragraphs (because of the fix below)!
8612 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8613 the very last paragraph (this could be also the last paragraph of an
8616 * src/texrow.h: added rows() call which returns the count-variable.
8618 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8620 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8622 * lib/configure.m4: better autodetection of DocBook tools.
8624 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8626 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8628 * src/lyx_cb.C: add using std::reverse;
8630 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8633 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8634 selected files. Should fix repeated errors from generated files.
8636 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8638 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8640 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8641 the spellchecker popup.
8643 * lib/lyxrc.example: Removed the \number_inset section
8645 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8647 * src/insets/figinset.C (various): Use IsFileReadable() to make
8648 sure that the file actually exist. Relying on ghostscripts errors
8649 is a bad idea since they can lead to X server crashes.
8651 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8653 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8656 * lib/lyxrc.example: smallish typo in description of
8657 \view_dvi_paper_option
8659 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8662 * src/lyxfunc.C: doImportHelper to factor out common code of the
8663 various import methods. New functions doImportASCIIasLines,
8664 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8665 doImportLinuxDoc for the format specific parts.
8668 * buffer.C: Dispatch returns now a bool to indicate success
8671 * lyx_gui.C: Add getLyXView() for member access
8673 * lyx_main.C: Change logic for batch commands: First try
8674 Buffer::Dispatch (possibly without GUI), if that fails, use
8677 * lyx_main.C: Add support for --import command line switch.
8678 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8679 Available Formats: Everything accepted by 'buffer-import <format>'
8681 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8683 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8686 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8687 documents will be reformatted upon reentry.
8689 2000-04-27 Juergen Vigna <jug@sad.it>
8691 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8692 correctly only last pos this was a bug.
8694 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8696 * release of lyx-1.1.5pre1
8698 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8700 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8702 * src/menus.C: revert the change of naming (Figure->Graphic...)
8703 from 2000-04-11. It was incomplete and bad.
8705 * src/LColor.[Ch]: add LColor::depthbar.
8706 * src/text.C (GetVisibleRow): use it.
8708 * README: update the languages list.
8710 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8712 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8715 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8717 * README: remove sections that were just wrong.
8719 * src/text2.C (GetRowNearY): remove currentrow code
8721 * src/text.C (GetRow): remove currentrow code
8723 * src/screen.C (Update): rewritten a bit.
8724 (SmallUpdate): removed func
8726 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8728 (FullRebreak): return bool
8729 (currentrow): remove var
8730 (currentrow_y): ditto
8732 * src/lyxscreen.h (Draw): change arg to unsigned long
8733 (FitCursor): return bool
8734 (FitManualCursor): ditto
8735 (Smallpdate): remove func
8736 (first): change to unsigned long
8737 (DrawOneRow): change second arg to long (from long &)
8738 (screen_refresh_y): remove var
8739 (scree_refresh_row): ditto
8741 * src/lyxrow.h: change baseline to usigned int from unsigned
8742 short, this brings some implicit/unsigned issues out in the open.
8744 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8746 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8747 instead of smallUpdate.
8749 * src/lyxcursor.h: change y to unsigned long
8751 * src/buffer.h: don't call updateScrollbar after fitcursor
8753 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8754 where they are used. Removed "\\direction", this was not present
8755 in 1.1.4 and is already obsolete. Commented out some code that I
8756 believe to never be called.
8757 (runLiterate): don't call updateScrollbar after fitCursor
8759 (buildProgram): ditto
8762 * src/WorkArea.h (workWidth): change return val to unsigned
8765 (redraw): remove the button redraws
8766 (setScrollbarValue): change for scrollbar
8767 (getScrollbarValue): change for scrollbar
8768 (getScrollbarBounds): change for scrollbar
8770 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8771 (C_WorkArea_down_cb): removed func
8772 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8773 (resize): change for scrollbar
8774 (setScrollbar): ditto
8775 (setScrollbarBounds): ditto
8776 (setScrollbarIncrements): ditto
8777 (up_cb): removed func
8778 (down_cb): removed func
8779 (scroll_cb): change for scrollbar
8780 (work_area_handler): ditto
8782 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8783 when FitCursor did something.
8784 (updateScrollbar): some unsigned changes
8785 (downCB): removed func
8786 (scrollUpOnePage): removed func
8787 (scrollDownOnePage): remvoed func
8788 (workAreaMotionNotify): don't call screen->FitCursor but use
8789 fitCursor instead. and bool return val
8790 (workAreaButtonPress): ditto
8791 (workAreaButtonRelease): some unsigned changes
8792 (checkInsetHit): ditto
8793 (workAreaExpose): ditto
8794 (update): parts rewritten, comments about the signed char arg added
8795 (smallUpdate): removed func
8796 (cursorPrevious): call needed updateScrollbar
8799 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8802 * src/BufferView.[Ch] (upCB): removed func
8803 (downCB): removed func
8804 (smallUpdate): removed func
8806 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8808 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8809 currentrow, currentrow_y optimization. This did not help a lot and
8810 if we want to do this kind of optimization we should rather use
8811 cursor.row instead of the currentrow.
8813 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8814 buffer spacing and klyx spacing support.
8816 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8818 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8821 2000-04-26 Juergen Vigna <jug@sad.it>
8823 * src/insets/figinset.C: fixes to Lars sstream changes!
8825 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8827 * A lot of files: Added Ascii(ostream &) methods to all inset
8828 classes. Used when exporting to ASCII.
8830 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8831 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8834 * src/text2.C (ToggleFree): Disabled implicit word selection when
8835 there is a change in the language
8837 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8838 no output was generated for end-of-sentence inset.
8840 * src/insets/lyxinset.h
8843 * src/paragraph.C: Removed the insetnumber code
8845 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8847 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8849 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8850 no_babel and no_epsfig completely from the file.
8851 (parseSingleLyXformat2Token): add handling for per-paragraph
8852 spacing as written by klyx.
8854 * src/insets/figinset.C: applied patch by Andre. Made it work with
8857 2000-04-20 Juergen Vigna <jug@sad.it>
8859 * src/insets/insettext.C (cutSelection):
8860 (copySelection): Fixed with selection from right to left.
8861 (draw): now the rows are not recalculated at every draw.
8862 (computeTextRows): for now reset the inset-owner here (this is
8863 important for an undo or copy where the inset-owner is not set
8866 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8867 motion to the_locking_inset screen->first was forgotten, this was
8868 not important till we got multiline insets.
8870 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8872 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8873 code seems to be alright (it is code changed by Dekel, and the
8874 intent is indeed that all macros should be defined \protect'ed)
8876 * NEWS: a bit of reorganisation of the new user-visible features.
8878 2000-04-19 Juergen Vigna <jug@sad.it>
8880 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8881 position. Set the inset_owner of the used paragraph so that it knows
8882 that it is inside an inset. Fixed cursor handling with mouse and
8883 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8884 and cleanups to make TextInsets work better.
8886 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8887 Changed parameters of various functions and added LockInsetInInset().
8889 * src/insets/insettext.C:
8891 * src/insets/insetcollapsable.h:
8892 * src/insets/insetcollapsable.C:
8893 * src/insets/insetfoot.h:
8894 * src/insets/insetfoot.C:
8895 * src/insets/insetert.h:
8896 * src/insets/insetert.C: cleaned up the code so that it works now
8897 correctly with insettext.
8899 * src/insets/inset.C:
8900 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8901 that insets in insets are supported right.
8904 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8906 * src/paragraph.C: some small fixes
8908 * src/debug.h: inserted INSETS debug info
8910 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8911 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8913 * src/commandtags.h:
8914 * src/LyXAction.C: insert code for InsetTabular.
8916 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8917 not Button1MotionMask.
8918 (workAreaButtonRelease): send always a InsetButtonRelease event to
8920 (checkInsetHit): some setCursor fixes (always with insets).
8922 * src/BufferView2.C (lockInset): returns a bool now and extended for
8923 locking insets inside insets.
8924 (showLockedInsetCursor): it is important to have the cursor always
8925 before the locked inset.
8926 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8928 * src/BufferView.h: made lockInset return a bool.
8930 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8932 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8933 that is used also internally but can be called as public to have back
8934 a cursor pos which is not set internally.
8935 (SetCursorIntern): Changed to use above function.
8937 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8939 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8944 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8945 patches for things that should be in or should be changed.
8947 * src/* [insetfiles]: change "usigned char fragile" to bool
8948 fragile. There was only one point that could that be questioned
8949 and that is commented in formulamacro.C. Grep for "CHECK".
8951 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8952 (DeleteBuffer): take it out of CutAndPaste and make it static.
8954 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8956 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8957 output the spacing envir commands. Also the new commands used in
8958 the LaTeX output makes the result better.
8960 * src/Spacing.C (writeEnvirBegin): new method
8961 (writeEnvirEnd): new method
8963 2000-04-18 Juergen Vigna <jug@sad.it>
8965 * src/CutAndPaste.C: made textclass a static member of the class
8966 as otherwise it is not accesed right!!!
8968 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8970 * forms/layout_forms.fd
8971 * src/layout_forms.h
8972 * src/layout_forms.C (create_form_form_character)
8973 * src/lyx_cb.C (UserFreeFont)
8974 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8975 documents (in the layout->character popup).
8977 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8979 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8980 \spell_command was in fact not honored (from Kevin Atkinson).
8982 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8985 * src/lyx_gui.h: make lyxViews private (Angus)
8987 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8989 * src/mathed/math_write.C
8990 (MathMatrixInset::Write) Put \protect before \begin{array} and
8991 \end{array} if fragile
8992 (MathParInset::Write): Put \protect before \\ if fragile
8994 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8996 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8997 initialization if the LyXColorHandler must be done after the
8998 connections to the XServer has been established.
9000 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
9001 get the background pixel from the lyxColorhandler so that the
9002 figures are rendered with the correct background color.
9003 (NextToken): removed functions.
9004 (GetPSSizes): use ifs >> string instead of NextToken.
9006 * src/Painter.[Ch]: the color cache moved out of this file.
9008 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
9011 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9013 * src/WorkArea.C (work_area_handler): call BufferView::enterView
9014 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
9016 * src/BufferView.C (enterView): new func
9017 (leaveView): new func
9019 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
9021 (leaveView): new func, undefines xterm cursor when approp.
9023 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
9024 (AllowInput): delete the Workarea cursor handling from this func.
9026 * src/Painter.C (underline): draw a slimer underline in most cases.
9028 * src/lyx_main.C (error_handler): use extern "C"
9030 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9032 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
9033 sent directly to me.
9035 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
9036 to the list by Dekel.
9038 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
9041 * src/bufferview_funcs.[Ch]: two new files, moved several of the
9042 methods from lyx_cb.here.
9044 * src/lyx_cb.C: in addition to the above; removed input_prohibited
9047 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9049 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
9050 instead of using current_view directly.
9052 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
9054 * src/LyXAction.C (init): add the paragraph-spacing command.
9056 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
9058 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
9060 * src/lyx_cb.C (CurrentState): output a string when the spacing is
9061 different from the documents.
9063 * src/text.C (SetHeightOfRow): take paragraph spacing into
9064 account, paragraph spacing takes precedence over buffer spacing
9065 (GetVisibleRow): ditto
9067 * src/paragraph.C (writeFile): output the spacing parameter too.
9068 (validate): set the correct features if spacing is used in the
9070 (Clear): set spacing to default
9071 (MakeSameLayout): spacing too
9072 (HasSameLayout): spacing too
9073 (SetLayout): spacing too
9074 (TeXOnePar): output the spacing commands
9076 * src/lyxparagraph.h: added a spacing variable for use with
9077 per-paragraph spacing.
9079 * src/Spacing.h: add a Default spacing and a method to check if
9080 the current spacing is default. also added an operator==
9082 * src/text2.C (DeleteEmptyParagraphMechanism): added a
9085 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9087 * src/lyxserver.C (callback): fix dispatch of functions
9089 * src/insets/insetlatexaccent.C (checkContents): turn bogus
9090 printf() into lyxerr call.
9092 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
9095 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
9096 "Table" to "Table Box", "Float" to "Floating Material"; deletes
9097 the "Float" from each of the subitems.
9098 (ShowHelpMenu): add entry for "FAQ" and "TOC".
9100 * src/support/DebugStream.h: add an #ifdef to work around a gcc
9101 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
9102 documented the change so that the workaround can be nuked later.
9104 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
9107 * src/lyxlex_pimpl.C (next): do not re-declare the default value
9109 * src/buffer.C (getLatexName): ditto
9110 (setReadonly): ditto
9112 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9114 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
9115 avoid some uses of current_view. Added also a bufferParams()
9116 method to get at this.
9118 * src/lyxtext.h: changed params->buffer and paramters->bparams.
9120 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9122 * src/lyxparagraph.[Ch]: removed
9123 operator<(LyXParagraph::InsetTable..., added a struct matchIT
9124 with operators used by lower_bound and
9125 upper_bound in InsetTable's
9126 Make struct InsetTable private again. Used matchpos.
9128 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
9130 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
9131 document, the language of existing text is changed (unless the
9132 document is multi-lingual)
9134 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
9136 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
9138 * A lot of files: A rewrite of the Right-to-Left support.
9140 2000-04-10 Juergen Vigna <jug@sad.it>
9142 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
9143 misplaced cursor when inset in inset is locked.
9145 * src/insets/insettext.C (LocalDispatch): small fix so that a
9146 BREAKLINE is not inserted if we don't permit it with autBreakRows.
9148 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
9149 footnote font should be decreased in size twice when displaying.
9151 * src/insets/insettext.C (GetDrawFont): inserted this function as
9152 the drawing-font may differ from the real paragraph font.
9154 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9155 insets (inset in inset!).
9157 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9158 function here because we don't want footnotes inside footnotes.
9160 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9162 (init): now set the inset_owner in paragraph.C
9163 (LocalDispatch): added some resetPos() in the right position
9166 (pasteSelection): changed to use the new CutAndPaste-Class.
9168 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9169 which tells if it is allowed to insert another inset inside this one.
9171 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9172 SwitchLayoutsBetweenClasses.
9174 * src/text2.C (InsertInset): checking of the new paragraph-function
9176 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9177 is not needed anymore here!
9180 (PasteSelection): redone (also with #ifdef) so that now this uses
9181 the CutAndPaste-Class.
9182 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9185 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9186 from/to text/insets.
9188 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9189 so that the paragraph knows if it is inside an (text)-inset.
9190 (InsertFromMinibuffer): changed return-value to bool as now it
9191 may happen that an inset is not inserted in the paragraph.
9192 (InsertInsetAllowed): this checks if it is allowed to insert an
9193 inset in this paragraph.
9195 (BreakParagraphConservative):
9196 (BreakParagraph) : small change for the above change of the return
9197 value of InsertFromMinibuffer.
9199 * src/lyxparagraph.h: added inset_owner and the functions to handle
9200 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9202 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9204 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9205 functions from BufferView to BufferView::Pimpl to ease maintence.
9207 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9208 correctly. Also use SetCursorIntern instead of SetCursor.
9210 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9213 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9215 * src/WorkArea.C (belowMouse): manually implement below mouse.
9217 * src/*: Add "explicit" on several constructors, I added probably
9218 some unneeded ones. A couple of changes to code because of this.
9220 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9221 implementation and private parts from the users of BufferView. Not
9224 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9225 implementation and private parts from the users of LyXLex. Not
9228 * src/BufferView_pimpl.[Ch]: new files
9230 * src/lyxlex_pimpl.[Ch]: new files
9232 * src/LyXView.[Ch]: some inline functions move out-of-line
9234 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9236 * src/lyxparagraph.h: make struct InsetTable public.
9238 * src/support/lyxstring.h: change lyxstring::difference_type to be
9239 ptrdiff_t. Add std:: modifiers to streams.
9241 * src/font.C: include the <cctype> header, for islower() and
9244 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9246 * src/font.[Ch]: new files. Contains the metric functions for
9247 fonts, takes a LyXFont as parameter. Better separation of concepts.
9249 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9250 changes because of this.
9252 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9254 * src/*: compile with -Winline and move functions that don't
9257 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9260 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9262 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9263 (various files changed because of this)
9265 * src/Painter.C (text): fixed the drawing of smallcaps.
9267 * src/lyxfont.[Ch] (drawText): removed unused member func.
9270 * src/*.C: added needed "using" statements and "std::" qualifiers.
9272 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9274 * src/*.h: removed all use of "using" from header files use
9275 qualifier std:: instead.
9277 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9279 * src/text.C (Backspace): some additional cleanups (we already
9280 know whether cursor.pos is 0 or not).
9282 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9283 automake does not provide one).
9285 * src/bmtable.h: replace C++ comments with C comments.
9287 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9289 * src/screen.C (ShowCursor): Change the shape of the cursor if
9290 the current language is not equal to the language of the document.
9291 (If the cursor change its shape unexpectedly, then you've found a bug)
9293 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9296 * src/insets/insetnumber.[Ch]: New files.
9298 * src/LyXAction.C (init)
9299 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9302 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9304 * src/lyxparagraph.h
9305 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9306 (the vector is kept sorted).
9308 * src/text.C (GetVisibleRow): Draw selection correctly when there
9309 is both LTR and RTL text.
9311 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9312 which is much faster.
9314 * src/text.C (GetVisibleRow and other): Do not draw the last space
9315 in a row if the direction of the last letter is not equal to the
9316 direction of the paragraph.
9318 * src/lyxfont.C (latexWriteStartChanges):
9319 Check that font language is not equal to basefont language.
9320 (latexWriteEndChanges): ditto
9322 * src/lyx_cb.C (StyleReset): Don't change the language while using
9323 the font-default command.
9325 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9326 empty paragraph before a footnote.
9328 * src/insets/insetcommand.C (draw): Increase x correctly.
9330 * src/screen.C (ShowCursor): Change cursor shape if
9331 current language != document language.
9333 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9335 2000-03-31 Juergen Vigna <jug@sad.it>
9337 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9338 (Clone): changed mode how the paragraph-data is copied to the
9339 new clone-paragraph.
9341 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9342 GetInset(pos) with no inset anymore there (in inset UNDO)
9344 * src/insets/insetcommand.C (draw): small fix as here x is
9345 incremented not as much as width() returns (2 before, 2 behind = 4)
9347 2000-03-30 Juergen Vigna <jug@sad.it>
9349 * src/insets/insettext.C (InsetText): small fix in initialize
9350 widthOffset (should not be done in the init() function)
9352 2000-03-29 Amir Karger <karger@lyx.org>
9354 * lib/examples/it_ItemizeBullets.lyx: translation by
9357 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9359 2000-03-29 Juergen Vigna <jug@sad.it>
9361 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9363 * src/insets/insetfoot.C (Clone): small change as for the below
9364 new init function in the text-inset
9366 * src/insets/insettext.C (init): new function as I've seen that
9367 clone did not copy the Paragraph-Data!
9368 (LocalDispatch): Added code so that now we have some sort of Undo
9369 functionality (well actually we HAVE Undo ;)
9371 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9373 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9375 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9378 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9380 * src/main.C: added a runtime check that verifies that the xforms
9381 header used when building LyX and the library used when running
9382 LyX match. Exit with a message if they don't match. This is a
9383 version number check only.
9385 * src/buffer.C (save): Don't allocate memory on the heap for
9386 struct utimbuf times.
9388 * *: some using changes, use iosfwd instead of the real headers.
9390 * src/lyxfont.C use char const * instead of string for the static
9391 strings. Rewrite some functions to use sstream.
9393 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9395 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9398 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9400 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9401 of Geodesy (from Martin Vermeer)
9403 * lib/layouts/svjour.inc: include file for the Springer svjour
9404 class. It can be used to support journals other than JoG.
9406 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9407 Miskiewicz <misiek@pld.org.pl>)
9408 * lib/reLyX/Makefile.am: ditto.
9410 2000-03-27 Juergen Vigna <jug@sad.it>
9412 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9413 also some modifications with operations on selected text.
9415 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9416 problems with clicking on insets (last famous words ;)
9418 * src/insets/insetcommand.C (draw):
9419 (width): Changed to have a bit of space before and after the inset so
9420 that the blinking cursor can be seen (otherwise it was hidden)
9422 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9424 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9425 would not be added to the link list when an installed gettext (not
9426 part of libc) is found.
9428 2000-03-24 Juergen Vigna <jug@sad.it>
9430 * src/insets/insetcollapsable.C (Edit):
9431 * src/mathed/formula.C (InsetButtonRelease):
9432 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9435 * src/BufferView.C (workAreaButtonPress):
9436 (workAreaButtonRelease):
9437 (checkInsetHit): Finally fixed the clicking on insets be handled
9440 * src/insets/insetert.C (Edit): inserted this call so that ERT
9441 insets work always with LaTeX-font
9443 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9445 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9446 caused lyx to startup with no GUI in place, causing in a crash
9447 upon startup when called with arguments.
9449 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9451 * src/FontLoader.C: better initialization of dummyXFontStruct.
9453 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9455 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9456 for linuxdoc and docbook import and export format options.
9458 * lib/lyxrc.example Example of default values for the previous flags.
9460 * src/lyx_cb.C Use those flags instead of the hardwired values for
9461 linuxdoc and docbook export.
9463 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9466 * src/menus.C Added menus entries for the new import/exports formats.
9468 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9470 * src/lyxrc.*: Added support for running without Gui
9473 * src/FontLoader.C: sensible defaults if no fonts are needed
9475 * src/lyx_cb.C: New function ShowMessage (writes either to the
9476 minibuffer or cout in case of no gui
9477 New function AskOverwrite for common stuff
9478 Consequently various changes to call these functions
9480 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9481 wild guess at sensible screen resolution when having no gui
9483 * src/lyxfont.C: no gui, no fonts... set some defaults
9485 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9487 * src/LColor.C: made the command inset background a bit lighter.
9489 2000-03-20 Hartmut Goebel <goebel@noris.net>
9491 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9492 stdstruct.inc. Koma-Script added some title elements which
9493 otherwise have been listed below "bibliography". This split allows
9494 adding title elements to where they belong.
9496 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9497 define the additional title elements and then include
9500 * many other layout files: changed to include stdtitle.inc just
9501 before stdstruct.inc.
9503 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9505 * src/buffer.C: (save) Added the option to store all backup files
9506 in a single directory
9508 * src/lyxrc.[Ch]: Added variable \backupdir_path
9510 * lib/lyxrc.example: Added descriptions of recently added variables
9512 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9513 bibtex inset, not closing the bibtex popup when deleting the inset)
9515 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9517 * src/lyx_cb.C: add a couple using directives.
9519 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9520 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9521 import based on the filename.
9523 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9524 file would be imported at start, if the filename where of a sgml file.
9526 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9528 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9530 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9531 * src/lyxfont.h Replaced the member variable bits.direction by the
9532 member variable lang. Made many changes in other files.
9533 This allows having a multi-lingual document
9535 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9536 that change the current language to <l>.
9537 Removed the command "font-rtl"
9539 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9540 format for Hebrew documents)
9542 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9543 When auto_mathmode is "true", pressing a digit key in normal mode
9544 will cause entering into mathmode.
9545 If auto_mathmode is "rtl" then this behavior will be active only
9546 when writing right-to-left text.
9548 * src/text2.C (InsertStringA) The string is inserted using the
9551 * src/paragraph.C (GetEndLabel) Gives a correct result for
9552 footnote paragraphs.
9554 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9556 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9558 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9559 front of PasteParagraph. Never insert a ' '. This should at least
9560 fix some cause for the segfaults that we have been experiencing,
9561 it also fixes backspace behaviour slightly. (Phu!)
9563 * src/support/lstrings.C (compare_no_case): some change to make it
9564 compile with gcc 2.95.2 and stdlibc++-v3
9566 * src/text2.C (MeltFootnoteEnvironment): change type o
9567 first_footnote_par_is_not_empty to bool.
9569 * src/lyxparagraph.h: make text private. Changes in other files
9571 (fitToSize): new function
9572 (setContentsFromPar): new function
9573 (clearContents): new function
9574 (SetChar): new function
9576 * src/paragraph.C (readSimpleWholeFile): deleted.
9578 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9579 the file, just use a simple string instead. Also read the file in
9580 a more maintainable manner.
9582 * src/text2.C (InsertStringA): deleted.
9583 (InsertStringB): deleted.
9585 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9587 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9588 RedoParagraphs from the doublespace handling part, just set status
9589 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9590 done, but perhaps not like this.)
9592 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9594 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9595 character when inserting an inset.
9597 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9599 * src/bufferparams.C (readLanguage): now takes "default" into
9602 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9603 also initialize the toplevel_keymap with the default bindings from
9606 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9608 * all files using lyxrc: have lyxrc as a real variable and not a
9609 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9612 * src/lyxrc.C: remove double call to defaultKeyBindings
9614 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9615 toolbar defauls using lyxlex. Remove enums, structs, functions
9618 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9619 toolbar defaults. Also store default keybindings in a map.
9621 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9622 storing the toolbar defaults without any xforms dependencies.
9624 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9625 applied. Changed to use iterators.
9627 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9629 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9630 systems that don't have LINGUAS set to begin with.
9632 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9634 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9635 the list by Dekel Tsur.
9637 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9639 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9640 * src/insets/form_graphics.C: ditto.
9642 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9644 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9646 * src/bufferparams.C (readLanguage): use the new language map
9648 * src/intl.C (InitKeyMapper): use the new language map
9650 * src/lyx_gui.C (create_forms): use the new language map
9652 * src/language.[Ch]: New files. Used for holding the information
9653 about each language. Now! Use this new language map enhance it and
9654 make it really usable for our needs.
9656 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9658 * screen.C (ShowCursor): Removed duplicate code.
9659 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9660 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9662 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9665 * src/text.C Added TransformChar method. Used for rendering Arabic
9666 text correctly (change the glyphs of the letter according to the
9667 position in the word)
9672 * src/lyxrc.C Added lyxrc command {language_command_begin,
9673 language_command_end,language_command_ltr,language_command_rtl,
9674 language_package} which allows the use of either arabtex or Omega
9677 * src/lyx_gui.C (init)
9679 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9680 to use encoding for menu fonts which is different than the encoding
9683 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9684 do not load the babel package.
9685 To write an English document with Hebrew/Arabic, change the document
9686 language to "english".
9688 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9689 (alphaCounter): changed to return char
9690 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9692 * lib/lyxrc.example Added examples for Hebrew/Arabic
9695 * src/layout.C Added layout command endlabeltype
9697 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9699 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9701 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9703 * src/mathed/math_delim.C (search_deco): return a
9704 math_deco_struct* instead of index.
9706 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9708 * All files with a USE_OSTREAM_ONLY within: removed all code that
9709 was unused when USE_OSTREAM_ONLY is defined.
9711 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9712 of any less. Removed header and using.
9714 * src/text.C (GetVisibleRow): draw the string "Page Break
9715 (top/bottom)" on screen when drawing a pagebreak line.
9717 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9719 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9721 * src/mathed/math_macro.C (draw): do some cast magic.
9724 * src/mathed/math_defs.h: change byte* argument to byte const*.
9726 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9728 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9729 know it is right to return InsetFoot* too, but cxx does not like
9732 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9734 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9736 * src/mathed/math_delim.C: change == to proper assignment.
9738 2000-03-09 Juergen Vigna <jug@sad.it>
9740 * src/insets/insettext.C (setPos): fixed various cursor positioning
9741 problems (via mouse and cursor-keys)
9742 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9743 inset (still a small display problem but it works ;)
9745 * src/insets/insetcollapsable.C (draw): added button_top_y and
9746 button_bottom_y to have correct values for clicking on the inset.
9748 * src/support/lyxalgo.h: commented out 'using std::less'
9750 2000-03-08 Juergen Vigna <jug@sad.it>
9752 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9753 Button-Release event closes as it is alos the Release-Event
9756 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9758 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9760 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9761 can add multiple spaces in Scrap (literate programming) styles...
9762 which, by the way, is how I got hooked on LyX to begin with.
9764 * src/mathed/formula.C (Write): Added dummy variable to an
9765 inset::Latex() call.
9766 (Latex): Add free_spacing boolean to inset::Latex()
9768 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9770 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9771 virtual function to include the free_spacing boolean from
9772 the containing paragraph's style.
9774 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9775 Added free_spacing boolean arg to match inset.h
9777 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9778 Added free_spacing boolean arg to match inset.h
9780 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9781 Added free_spacing boolean and made sure that if in a free_spacing
9782 paragraph, that we output normal space if there is a protected space.
9784 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9785 Added free_spacing boolean arg to match inset.h
9787 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9788 Added free_spacing boolean arg to match inset.h
9790 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9791 Added free_spacing boolean arg to match inset.h
9793 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9794 Added free_spacing boolean arg to match inset.h
9796 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9797 Added free_spacing boolean arg to match inset.h
9799 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9800 free_spacing boolean arg to match inset.h
9802 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9803 Added free_spacing boolean arg to match inset.h
9805 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9806 Added free_spacing boolean arg to match inset.h
9808 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9809 Added free_spacing boolean arg to match inset.h
9811 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9812 Added free_spacing boolean arg to match inset.h
9814 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9815 Added free_spacing boolean arg to match inset.h
9817 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9818 free_spacing boolean arg to match inset.h
9820 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9821 free_spacing boolean arg to match inset.h
9823 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9824 ignore free_spacing paragraphs. The user's spaces are left
9827 * src/text.C (InsertChar): Fixed the free_spacing layout
9828 attribute behavior. Now, if free_spacing is set, you can
9829 add multiple spaces in a paragraph with impunity (and they
9830 get output verbatim).
9831 (SelectSelectedWord): Added dummy argument to inset::Latex()
9834 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9837 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9838 paragraph layouts now only input a simple space instead.
9839 Special character insets don't make any sense in free-spacing
9842 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9843 hard-spaces in the *input* file to simple spaces if the layout
9844 is free-spacing. This converts old files which had to have
9845 hard-spaces in free-spacing layouts where a simple space was
9847 (writeFileAscii): Added free_spacing check to pass to the newly
9848 reworked inset::Latex(...) methods. The inset::Latex() code
9849 ensures that hard-spaces in free-spacing paragraphs get output
9850 as spaces (rather than "~").
9852 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9854 * src/mathed/math_delim.C (draw): draw the empty placeholder
9855 delims with a onoffdash line.
9856 (struct math_deco_compare): struct that holds the "functors" used
9857 for the sort and the binary search in math_deco_table.
9858 (class init_deco_table): class used for initial sort of the
9860 (search_deco): use lower_bound to do a binary search in the
9863 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9865 * src/lyxrc.C: a small secret thingie...
9867 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9868 and to not flush the stream as often as it used to.
9870 * src/support/lyxalgo.h: new file
9871 (sorted): template function used for checking if a sequence is
9872 sorted or not. Two versions with and without user supplied
9873 compare. Uses same compare as std::sort.
9875 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9876 it and give warning on lyxerr.
9878 (struct compare_tags): struct with function operators used for
9879 checking if sorted, sorting and lower_bound.
9880 (search_kw): use lower_bound instead of manually implemented
9883 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9885 * src/insets/insetcollapsable.h: fix Clone() declaration.
9886 * src/insets/insetfoot.h: ditto.
9888 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9890 2000-03-08 Juergen Vigna <jug@sad.it>
9892 * src/insets/lyxinset.h: added owner call which tells us if
9893 this inset is inside another inset. Changed also the return-type
9894 of Editable to an enum so it tells clearer what the return-value is.
9896 * src/insets/insettext.C (computeTextRows): fixed computing of
9897 textinsets which split automatically on more rows.
9899 * src/insets/insetert.[Ch]: changed this to be of BaseType
9902 * src/insets/insetfoot.[Ch]: added footnote inset
9904 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9905 collapsable insets (like footnote, ert, ...)
9907 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9909 * src/lyxdraw.h: remvoe file
9911 * src/lyxdraw.C: remove file
9913 * src/insets/insettext.C: added <algorithm>.
9915 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9917 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9918 (matrix_cb): case MM_OK use string stream
9920 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9923 * src/mathed/math_macro.C (draw): use string stream
9924 (Metrics): use string stream
9926 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9927 directly to the ostream.
9929 * src/vspace.C (asString): use string stream.
9930 (asString): use string stream
9931 (asLatexString): use string stream
9933 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9934 setting Spacing::Other.
9936 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9937 sprintf when creating the stretch vale.
9939 * src/text2.C (alphaCounter): changed to return a string and to
9940 not use a static variable internally. Also fixed a one-off bug.
9941 (SetCounter): changed the drawing of the labels to use string
9942 streams instead of sprintf.
9944 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9945 manipulator to use a scheme that does not require library support.
9946 This is also the way it is done in the new GNU libstdc++. Should
9947 work with DEC cxx now.
9949 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9951 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9952 end. This fixes a bug.
9954 * src/mathed (all files concerned with file writing): apply the
9955 USE_OSTREAM_ONLY changes to mathed too.
9957 * src/support/DebugStream.h: make the constructor explicit.
9959 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9960 count and ostream squashed.
9962 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9964 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9966 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9967 ostringstream uses STL strings, and we might not.
9969 * src/insets/insetspecialchar.C: add using directive.
9970 * src/insets/insettext.C: ditto.
9972 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9974 * lib/layouts/seminar.layout: feeble attempt at a layout for
9975 seminar.cls, far from completet and could really use some looking
9976 at from people used to write layout files.
9978 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9979 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9980 a lot nicer and works nicely with ostreams.
9982 * src/mathed/formula.C (draw): a slightly different solution that
9983 the one posted to the list, but I think this one works too. (font
9984 size wrong in headers.)
9986 * src/insets/insettext.C (computeTextRows): some fiddling on
9987 Jürgens turf, added some comments that he should read.
9989 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9990 used and it gave compiler warnings.
9991 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9994 * src/lyx_gui.C (create_forms): do the right thing when
9995 show_banner is true/false.
9997 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9998 show_banner is false.
10000 * most file writing files: Now use iostreams to do almost all of
10001 the writing. Also instead of passing string &, we now use
10002 stringstreams. mathed output is still not adapted to iostreams.
10003 This change can be turned off by commenting out all the occurences
10004 of the "#define USE_OSTREAM_ONLY 1" lines.
10006 * src/WorkArea.C (createPixmap): don't output debug messages.
10007 (WorkArea): don't output debug messages.
10009 * lib/lyxrc.example: added a comment about the new variable
10012 * development/Code_rules/Rules: Added some more commente about how
10013 to build class interfaces and on how better encapsulation can be
10016 2000-03-03 Juergen Vigna <jug@sad.it>
10018 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
10019 automatically with the width of the LyX-Window
10021 * src/insets/insettext.C (computeTextRows): fixed update bug in
10022 displaying text-insets (scrollvalues where not initialized!)
10024 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10026 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
10027 id in the check of the result from lower_bound is not enough since
10028 lower_bound can return last too, and then res->id will not be a
10031 * all insets and some code that use them: I have conditionalized
10032 removed the Latex(string & out, ...) this means that only the
10033 Latex(ostream &, ...) will be used. This is a work in progress to
10034 move towards using streams for all output of files.
10036 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
10039 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10041 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
10042 routine (this fixes bug where greek letters were surrounded by too
10045 * src/support/filetools.C (findtexfile): change a bit the search
10046 algorithm, to fix bug introduced in 1.1.4. Note that --format is
10047 no longer passed to kpsewhich, we may have to change that later.
10049 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
10050 warning options to avoid problems with X header files (from Angus
10052 * acinclude.m4: regenerated.
10054 2000-03-02 Juergen Vigna <jug@sad.it>
10056 * src/insets/insettext.C (WriteParagraphData): Using the
10057 par->writeFile() function for writing paragraph-data.
10058 (Read): Using buffer->parseSingleLyXformat2Token()-function
10059 for parsing paragraph data!
10061 * src/buffer.C (readLyXformat2): removed all parse data and using
10062 the new parseSingleLyXformat2Token()-function.
10063 (parseSingleLyXformat2Token): added this function to parse (read)
10064 lyx-file-format (this is called also from text-insets now!)
10066 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10068 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
10071 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
10072 directly instead of going through a func. One very bad thing: a
10073 static LyXFindReplace, but I don't know where to place it.
10075 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
10076 string instead of char[]. Also changed to static.
10077 (GetSelectionOrWordAtCursor): changed to static inline
10078 (SetSelectionOverLenChars): ditto.
10080 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
10081 current_view and global variables. both classes has changed names
10082 and LyXFindReplace is not inherited from SearchForm.
10084 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
10085 fl_form_search form.
10087 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
10089 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10091 * lib/bind/*.bind: make sure 'buffer-previous' function is not
10092 bound (from Kayvan).
10094 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
10096 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
10098 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10100 * some things that I should comment but the local pub says head to
10103 * comment out all code that belongs to the Roff code for Ascii
10104 export of tables. (this is unused)
10106 * src/LyXView.C: use correct type for global variable
10107 current_layout. (LyXTextClass::size_type)
10109 * some code to get the new insetgraphics closer to working I'd be
10110 grateful for any help.
10112 * src/BufferView2.C (insertInset): use the return type of
10113 NumberOfLayout properly. (also changes in other files)
10115 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
10116 this as a test. I want to know what breaks because of this.
10118 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
10120 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10122 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
10123 to use a \makebox in the label, this allows proper justification
10124 with out using protected spaces or multiple hfills. Now it is
10125 "label" for left justified, "\hfill label\hfill" for center, and
10126 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
10127 should be changed accordingly.
10129 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10131 * src/lyxtext.h: change SetLayout() to take a
10132 LyXTextClass::size_type instead of a char (when there is more than
10133 127 layouts in a class); also change type of copylayouttype.
10134 * src/text2.C (SetLayout): ditto.
10135 * src/LyXView.C (updateLayoutChoice): ditto.
10137 * src/LaTeX.C (scanLogFile): errors where the line number was not
10138 given just after the '!'-line were ignored (from Dekel Tsur).
10140 * lib/lyxrc.example: fix description of \date_insert_format
10142 * lib/layouts/llncs.layout: new layout, contributed by Martin
10145 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10147 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
10148 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
10149 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
10150 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
10151 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10152 paragraph.C, text.C, text2.C)
10154 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10156 * src/insets/insettext.C (LocalDispatch): remove extra break
10159 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10160 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10162 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10163 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10165 * src/insets/insetbib.h: move InsetBibkey::Holder and
10166 InsetCitation::Holder in public space.
10168 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10170 * src/insets/insettext.h: small change to get the new files from
10171 Juergen to compile (use "string", not "class string").
10173 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10174 const & as parameter to LocalDispatch, use LyXFont const & as
10175 paramter to some other func. This also had impacto on lyxinsets.h
10176 and the two mathed insets.
10178 2000-02-24 Juergen Vigna <jug@sad.it>
10181 * src/commandtags.h:
10183 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10187 * src/BufferView2.C: added/updated code for various inset-functions
10189 * src/insets/insetert.[Ch]: added implementation of InsetERT
10191 * src/insets/insettext.[Ch]: added implementation of InsetText
10193 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10194 (draw): added preliminary code for inset scrolling not finshed yet
10196 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10197 as it is in lyxfunc.C now
10199 * src/insets/lyxinset.h: Added functions for text-insets
10201 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10203 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10204 BufferView and reimplement the list as a queue put inside its own
10207 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10209 * several files: use the new interface to the "updateinsetlist"
10211 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10213 (work_area_handler): call BufferView::trippleClick on trippleclick.
10215 * src/BufferView.C (doubleClick): new function, selects word on
10217 (trippleClick): new function, selects line on trippleclick.
10219 2000-02-22 Allan Rae <rae@lyx.org>
10221 * lib/bind/xemacs.bind: buffer-previous not supported
10223 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10225 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10228 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10230 * src/bufferlist.C: get rid of current_view from this file
10232 * src/spellchecker.C: get rid of current_view from this file
10234 * src/vspace.C: get rid of current_view from this file
10235 (inPixels): added BufferView parameter for this func
10236 (asLatexCommand): added a BufferParams for this func
10238 * src/text.C src/text2.C: get rid of current_view from these
10241 * src/lyxfont.C (getFontDirection): move this function here from
10244 * src/bufferparams.C (getDocumentDirection): move this function
10247 * src/paragraph.C (getParDirection): move this function here from
10249 (getLetterDirection): ditto
10251 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10253 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10254 resize due to wrong pixmap beeing used. Also took the opurtunity
10255 to make the LyXScreen stateless on regard to WorkArea and some
10256 general cleanup in the same files.
10258 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10260 * src/Makefile.am: add missing direction.h
10262 * src/PainterBase.h: made the width functions const.
10264 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10267 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10269 * src/insets/insetlatexaccent.C (draw): make the accents draw
10270 better, at present this will only work well with iso8859-1.
10272 * several files: remove the old drawing code, now we use the new
10275 * several files: remove support for mono_video, reverse_video and
10278 2000-02-17 Juergen Vigna <jug@sad.it>
10280 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10281 int ** as we have to return the pointer, otherwise we have only
10282 NULL pointers in the returning function.
10284 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10286 * src/LaTeX.C (operator()): quote file name when running latex.
10288 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10290 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10291 (bubble tip), this removes our special handling of this.
10293 * Remove all code that is unused now that we have the new
10294 workarea. (Code that are not active when NEW_WA is defined.)
10296 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10298 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10300 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10301 nonexisting layout; correctly redirect obsoleted layouts.
10303 * lib/lyxrc.example: document \view_dvi_paper_option
10305 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10308 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10309 (PreviewDVI): handle the view_dvi_paper_option variable.
10310 [Both from Roland Krause]
10312 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10314 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10315 char const *, int, LyXFont)
10316 (text(int, int, string, LyXFont)): ditto
10318 * src/text.C (InsertCharInTable): attempt to fix the double-space
10319 feature in tables too.
10320 (BackspaceInTable): ditto.
10321 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10323 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10325 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10327 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10328 newly found text in textcache to this.
10329 (buffer): set the owner of the text put into the textcache to 0
10331 * src/insets/figinset.C (draw): fixed the drawing of figures with
10334 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10335 drawing of mathframe, hfills, protected space, table lines. I have
10336 now no outstanding drawing problems with the new Painter code.
10338 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10340 * src/PainterBase.C (ellipse, circle): do not specify the default
10343 * src/LColor.h: add using directive.
10345 * src/Painter.[Ch]: change return type of methods from Painter& to
10346 PainterBase&. Add a using directive.
10348 * src/WorkArea.C: wrap xforms callbacks in C functions
10351 * lib/layouts/foils.layout: font fix and simplifications from Carl
10354 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10356 * a lot of files: The Painter, LColor and WorkArea from the old
10357 devel branch has been ported to lyx-devel. Some new files and a
10358 lot of #ifdeffed code. The new workarea is enabled by default, but
10359 if you want to test the new Painter and LColor you have to compile
10360 with USE_PAINTER defined (do this in config.h f.ex.) There are
10361 still some rought edges, and I'd like some help to clear those
10362 out. It looks stable (loads and displays the Userguide very well).
10365 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10367 * src/buffer.C (pop_tag): revert to the previous implementation
10368 (use a global variable for both loops).
10370 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10372 * src/lyxrc.C (LyXRC): change slightly default date format.
10374 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10375 there is an English text with a footnote that starts with a Hebrew
10376 paragraph, or vice versa.
10377 (TeXFootnote): ditto.
10379 * src/text.C (LeftMargin): allow for negative values for
10380 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10383 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10384 for input encoding (cyrillic)
10386 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10388 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10391 * src/toolbar.C (set): ditto
10392 * src/insets/insetbib.C (create_form_citation_form): ditto
10394 * lib/CREDITS: added Dekel Tsur.
10396 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10397 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10398 hebrew supports files from Dekel Tsur.
10400 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10401 <tzafrir@technion.ac.il>
10403 * src/lyxrc.C: put \date_insert_format at the right place.
10405 * src/buffer.C (makeLaTeXFile): fix the handling of
10406 BufferParams::sides when writing out latex files.
10408 * src/BufferView2.C: add a "using" directive.
10410 * src/support/lyxsum.C (sum): when we use lyxstring,
10411 ostringstream::str needs an additional .c_str().
10413 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10415 * src/support/filetools.C (ChangeExtension): patch from Etienne
10418 * src/TextCache.C (show): remove const_cast and make second
10419 parameter non-const LyXText *.
10421 * src/TextCache.h: use non const LyXText in show.
10423 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10426 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10428 * src/support/lyxsum.C: rework to be more flexible.
10430 * several places: don't check if a pointer is 0 if you are going
10433 * src/text.C: remove some dead code.
10435 * src/insets/figinset.C: remove some dead code
10437 * src/buffer.C: move the BufferView funcs to BufferView2.C
10438 remove all support for insetlatexdel
10439 remove support for oldpapersize stuff
10440 made some member funcs const
10442 * src/kbmap.C: use a std::list to store the bindings in.
10444 * src/BufferView2.C: new file
10446 * src/kbsequence.[Ch]: new files
10448 * src/LyXAction.C + others: remove all trace of buffer-previous
10450 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10451 only have one copy in the binary of this table.
10453 * hebrew patch: moved some functions from LyXText to more
10454 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10456 * several files: remove support for XForms older than 0.88
10457 whitespace changes.
10458 remove some #if 0 #endif code
10460 * src/TextCache.[Ch]: new file. Holds the textcache.
10462 * src/BufferView.C: changes to use the new TextCache interface.
10463 (waitForX): remove the now unused code.
10465 * src/BackStack.h: remove some commented code
10467 * lib/bind/emacs.bind: remove binding for buffer-previous
10469 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10471 * applied the hebrew patch.
10473 * src/lyxrow.h: make sure that all Row variables are initialized.
10475 * src/text2.C (TextHandleUndo): comment out a delete, this might
10476 introduce a memory leak, but should also help us to not try to
10477 read freed memory. We need to look at this one.
10479 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10480 (LyXParagraph): initalize footnotekind.
10482 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10483 forgot this when applying the patch. Please heed the warnings.
10485 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10486 (aka. reformat problem)
10488 * src/bufferlist.C (exists): made const, and use const_iterator
10489 (isLoaded): new func.
10490 (release): use std::find to find the correct buffer.
10492 * src/bufferlist.h: made getState a const func.
10493 made empty a const func.
10494 made exists a const func.
10497 2000-02-01 Juergen Vigna <jug@sad.it>
10499 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10501 * po/it.po: updated a bit the italian po file and also changed the
10502 'file nuovo' for newfile to 'filenuovo' without a space, this did
10505 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10506 for the new insert_date command.
10508 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10509 from jdblair, to insert a date into the current text conforming to
10510 a strftime format (for now only considering the locale-set and not
10511 the document-language).
10513 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10515 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10516 Bounds Read error seen by purify. The problem was that islower is
10517 a macros which takes an unsigned char and uses it as an index for
10518 in array of characters properties (and is thus subject to the
10522 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10523 correctly the paper sides radio buttons.
10524 (UpdateDocumentButtons): ditto.
10526 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10528 * src/kbmap.C (getsym + others): change to return unsigned int,
10529 returning a long can give problems on 64 bit systems. (I assume
10530 that int is 32bit on 64bit systems)
10532 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10534 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10535 LyXLookupString to be zero-terminated. Really fixes problems seen
10536 by purify, I think.
10538 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10540 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10541 write a (char*)0 to the lyxerr stream.
10543 * src/lastfiles.C: move algorithm before the using statemets.
10545 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10547 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10548 complains otherwise).
10549 * src/table.C: ditto
10551 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10554 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10555 that I removed earlier... It is really needed.
10557 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10559 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10561 * INSTALL: update xforms home page URL.
10563 * lib/configure.m4: fix a bug with unreadable layout files.
10565 * src/table.C (calculate_width_of_column): add "using std::max"
10568 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10570 * several files: marked several lines with "DEL LINE", this is
10571 lines that can be deleted without changing anything.
10572 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10573 checks this anyway */
10576 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10578 * src/DepTable.C (update): add a "+" at the end when the checksum
10579 is different. (debugging string only)
10581 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10582 the next inset to not be displayed. This should also fix the list
10583 of labels in the "Insert Crossreference" dialog.
10585 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10587 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10588 when regex was not found.
10590 * src/support/lstrings.C (lowercase): use handcoded transform always.
10593 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10594 old_cursor.par->prev could be 0.
10596 * several files: changed post inc/dec to pre inc/dec
10598 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10599 write the lastfiles to file.
10601 * src/BufferView.C (buffer): only show TextCache info when debugging
10603 (resizeCurrentBuffer): ditto
10604 (workAreaExpose): ditto
10606 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10608 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10610 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10611 a bit better by removing the special case for \i and \j.
10613 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10615 * src/lyx_main.C (easyParse): remove test for bad comand line
10616 options, since this broke all xforms-related parsing.
10618 * src/kbmap.C (getsym): set return type to unsigned long, as
10619 declared in header. On an alpha, long is _not_ the same as int.
10621 * src/support/LOstream.h: add a "using std::flush;"
10623 * src/insets/figinset.C: ditto.
10625 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10627 * src/bufferlist.C (write): use blinding fast file copy instead of
10628 "a char at a time", now we are doing it the C++ way.
10630 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10631 std::list<int> instead.
10632 (addpidwait): reflect move to std::list<int>
10633 (sigchldchecker): ditto
10635 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10638 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10639 that obviously was wrong...
10641 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10642 c, this avoids warnings with purify and islower.
10644 * src/insets/figinset.C: rename struct queue to struct
10645 queue_element and rewrite to use a std::queue. gsqueue is now a
10646 std::queue<queue_element>
10647 (runqueue): reflect move to std::queue
10650 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10651 we would get "1" "0" instead of "true" "false. Also make the tostr
10654 2000-01-21 Juergen Vigna <jug@sad.it>
10656 * src/buffer.C (writeFileAscii): Disabled code for special groff
10657 handling of tabulars till I fix this in table.C
10659 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10661 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10663 * src/support/lyxlib.h: ditto.
10665 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10667 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10668 and 'j' look better. This might fix the "macron" bug that has been
10671 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10672 functions as one template function. Delete the old versions.
10674 * src/support/lyxsum.C: move using std::ifstream inside
10677 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10680 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10682 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10684 * src/insets/figinset.C (InitFigures): use new instead of malloc
10685 to allocate memory for figures and bitmaps.
10686 (DoneFigures): use delete[] instead of free to deallocate memory
10687 for figures and bitmaps.
10688 (runqueue): use new to allocate
10689 (getfigdata): use new/delete[] instead of malloc/free
10690 (RegisterFigure): ditto
10692 * some files: moved some declarations closer to first use, small
10693 whitespace changes use preincrement instead of postincrement where
10694 it does not make a difference.
10696 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10697 step on the way to use stl::containers for key maps.
10699 * src/bufferlist.h: add a typedef for const_iterator and const
10700 versions of begin and end.
10702 * src/bufferlist.[Ch]: change name of member variable _state to
10703 state_. (avoid reserved names)
10705 (getFileNames): returns the filenames of the buffers in a vector.
10707 * configure.in (ALL_LINGUAS): added ro
10709 * src/support/putenv.C: new file
10711 * src/support/mkdir.C: new file
10713 2000-01-20 Allan Rae <rae@lyx.org>
10715 * lib/layouts/IEEEtran.layout: Added several theorem environments
10717 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10718 couple of minor additions.
10720 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10721 (except for those in footnotes of course)
10723 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10725 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10727 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10728 std::sort and std::lower_bound instead of qsort and handwritten
10730 (struct compara): struct that holds the functors used by std::sort
10731 and std::lower_bound in MathedLookupBOP.
10733 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10735 * src/support/LAssert.h: do not do partial specialization. We do
10736 not really need it.
10738 * src/support/lyxlib.h: note that lyx::getUserName() and
10739 lyx::date() are not in use right now. Should these be suppressed?
10741 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10742 (makeLinuxDocFile): do not put date and user name in linuxdoc
10745 * src/support/lyxlib.h (kill): change first argument to long int,
10746 since that's what solaris uses.
10748 * src/support/kill.C (kill): fix declaration to match prototype.
10750 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10751 actually check whether namespaces are supported. This is not what
10754 * src/support/lyxsum.C: add a using directive.
10756 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10758 * src/support/kill.C: if we have namespace support we don't have
10759 to include lyxlib.h.
10761 * src/support/lyxlib.h: use namespace lyx if supported.
10763 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10765 * src/support/date.C: new file
10767 * src/support/chdir.C: new file
10769 * src/support/getUserName.C: new file
10771 * src/support/getcwd.C: new file
10773 * src/support/abort.C: new file
10775 * src/support/kill.C: new file
10777 * src/support/lyxlib.h: moved all the functions in this file
10778 insede struct lyx. Added also kill and abort to this struct. This
10779 is a way to avoid the "kill is not defined in <csignal>", we make
10780 C++ wrappers for functions that are not ANSI C or ANSI C++.
10782 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10783 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10784 lyx it has been renamed to sum.
10786 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10788 * src/text.C: add using directives for std::min and std::max.
10790 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10792 * src/texrow.C (getIdFromRow): actually return something useful in
10793 id and pos. Hopefully fixes the bug with positionning of errorbox
10796 * src/lyx_main.C (easyParse): output an error and exit if an
10797 incorrect command line option has been given.
10799 * src/spellchecker.C (ispell_check_word): document a memory leak.
10801 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10802 where a "struct utimbuf" is allocated with "new" and deleted with
10805 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10807 * src/text2.C (CutSelection): don't delete double spaces.
10808 (PasteSelection): ditto
10809 (CopySelection): ditto
10811 * src/text.C (Backspace): don't delete double spaces.
10813 * src/lyxlex.C (next): fix a bug that were only present with
10814 conformant std::istream::get to read comment lines, use
10815 std::istream::getline instead. This seems to fix the problem.
10817 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10819 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10820 allowed to insert space before space" editing problem. Please read
10821 commends at the beginning of the function. Comments about usage
10824 * src/text.C (InsertChar): fix for the "not allowed to insert
10825 space before space" editing problem.
10827 * src/text2.C (DeleteEmptyParagraphMechanism): when
10828 IsEmptyTableRow can only return false this last "else if" will
10829 always be a no-op. Commented out.
10831 * src/text.C (RedoParagraph): As far as I can understand tmp
10832 cursor is not really needed.
10834 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10835 present it could only return false anyway.
10836 (several functions): Did something not so smart...added a const
10837 specifier on a lot of methods.
10839 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10840 and add a tmp->text.resize. The LyXParagraph constructor does the
10842 (BreakParagraphConservative): ditto
10844 * src/support/path.h (Path): add a define so that the wrong usage
10845 "Path("/tmp") will be flagged as a compilation error:
10846 "`unnamed_Path' undeclared (first use this function)"
10848 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10850 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10851 which was bogus for several reasons.
10853 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10855 (runBibTeX): ditto.
10857 * autogen.sh: do not use "type -path" (what's that anyway?).
10859 * src/support/filetools.C (findtexfile): remove extraneous space
10860 which caused a kpsewhich warning (at least with kpathsea version
10863 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10865 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10867 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10869 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10871 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10873 * src/paragraph.C (BreakParagraph): do not reserve space on text
10874 if we don't need to (otherwise, if pos_end < pos, we end up
10875 reserving huge amounts of memory due to bad unsigned karma).
10876 (BreakParagraphConservative): ditto, although I have not seen
10877 evidence the bug can happen here.
10879 * src/lyxparagraph.h: add a using std::list.
10881 2000-01-11 Juergen Vigna <jug@sad.it>
10883 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10884 could not be found.
10886 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10888 * src/vc-backend.C (doVCCommand): change to be static and take one
10889 more parameter: the path to chdir too be fore executing the command.
10890 (retrive): new function equiv to "co -r"
10892 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10893 file_not_found_hook is true.
10895 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10897 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10898 if a file is readwrite,readonly...anything else.
10900 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10902 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10903 (CreatePostscript): name change from MenuRunDVIPS (or something)
10904 (PreviewPostscript): name change from MenuPreviewPS
10905 (PreviewDVI): name change from MenuPreviewDVI
10907 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10908 \view_pdf_command., \pdf_to_ps_command
10910 * lib/configure.m4: added search for PDF viewer, and search for
10911 PDF to PS converter.
10912 (lyxrc.defaults output): add \pdflatex_command,
10913 \view_pdf_command and \pdf_to_ps_command.
10915 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10917 * src/bufferlist.C (write): we don't use blocksize for anything so
10920 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10922 * src/support/block.h: disable operator T* (), since it causes
10923 problems with both compilers I tried. See comments in the file.
10925 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10928 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10929 variable LYX_DIR_10x to LYX_DIR_11x.
10931 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10933 * INSTALL: document --with-lyxname.
10936 * configure.in: new configure flag --with-lyxname which allows to
10937 choose the name under which lyx is installed. Default is "lyx", of
10938 course. It used to be possible to do this with --program-suffix,
10939 but the later has in fact a different meaning for autoconf.
10941 * src/support/lstrings.h (lstrchr): reformat a bit.
10943 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10944 * src/mathed/math_defs.h: ditto.
10946 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10948 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10949 true, decides if we create a backup file or not when saving. New
10950 tag and variable \pdf_mode, defaults to false. New tag and
10951 variable \pdflatex_command, defaults to pdflatex. New tag and
10952 variable \view_pdf_command, defaults to xpdf. New tag and variable
10953 \pdf_to_ps_command, defaults to pdf2ps.
10955 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10957 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10958 does not have a BufferView.
10959 (unlockInset): ditto + don't access the_locking_inset if the
10960 buffer does not have a BufferView.
10962 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10963 certain circumstances so that we don't continue a keyboard
10964 operation long after the key was released. Try f.ex. to load a
10965 large document, press PageDown for some seconds and then release
10966 it. Before this change the document would contine to scroll for
10967 some time, with this change it stops imidiatly.
10969 * src/support/block.h: don't allocate more space than needed. As
10970 long as we don't try to write to the arr[x] in a array_type arr[x]
10971 it is perfectly ok. (if you write to it you might segfault).
10972 added operator value_type*() so that is possible to pass the array
10973 to functions expecting a C-pointer.
10975 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10978 * intl/*: updated to gettext 0.10.35, tried to add our own
10979 required modifications. Please verify.
10981 * po/*: updated to gettext 0.10.35, tried to add our own required
10982 modifications. Please verify.
10984 * src/support/lstrings.C (tostr): go at fixing the problem with
10985 cxx and stringstream. When stringstream is used return
10986 oss.str().c_str() so that problems with lyxstring and basic_string
10987 are avoided. Note that the best solution would be for cxx to use
10988 basic_string all the way, but it is not conformant yet. (it seems)
10990 * src/lyx_cb.C + other files: moved several global functions to
10991 class BufferView, some have been moved to BufferView.[Ch] others
10992 are still located in lyx_cb.C. Code changes because of this. (part
10993 of "get rid of current_view project".)
10995 * src/buffer.C + other files: moved several Buffer functions to
10996 class BufferView, the functions are still present in buffer.C.
10997 Code changes because of this.
10999 * config/lcmessage.m4: updated to most recent. used when creating
11002 * config/progtest.m4: updated to most recent. used when creating
11005 * config/gettext.m4: updated to most recent. applied patch for
11008 * config/gettext.m4.patch: new file that shows what changes we
11009 have done to the local copy of gettext.m4.
11011 * config/libtool.m4: new file, used in creation of acinclude.m4
11013 * config/lyxinclude.m4: new file, this is the lyx created m4
11014 macros, used in making acinclude.m4.
11016 * autogen.sh: GNU m4 discovered as a separate task not as part of
11017 the lib/configure creation.
11018 Generate acinlucde from files in config. Actually cat
11019 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
11020 easier to upgrade .m4 files that really are external.
11022 * src/Spacing.h: moved using std::istringstream to right after
11023 <sstream>. This should fix the problem seen with some compilers.
11025 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11027 * src/lyx_cb.C: began some work to remove the dependency a lot of
11028 functions have on BufferView::text, even if not really needed.
11029 (GetCurrentTextClass): removed this func, it only hid the
11032 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
11033 forgot this in last commit.
11035 * src/Bullet.C (bulletEntry): use static char const *[] for the
11036 tables, becuase of this the return arg had to change to string.
11037 (bulletSize): ditto
11038 (~Bullet): removed unneeded destructor
11040 * src/BufferView.C (beforeChange): moved from lyx_cb.C
11041 (insetSleep): moved from Buffer
11042 (insetWakeup): moved from Buffer
11043 (insetUnlock): moved from Buffer
11045 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
11046 from Buffer to BufferView.
11048 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
11050 * config/ltmain.sh: updated to version 1.3.4 of libtool
11052 * config/ltconfig: updated to version 1.3.4 of libtool
11054 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11057 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
11058 Did I get that right?
11060 * src/lyxlex.h: add a "using" directive or two.
11061 * src/Spacing.h: ditto.
11062 * src/insets/figinset.C: ditto.
11063 * src/support/filetools.C: ditto.
11064 * src/support/lstrings.C: ditto.
11065 * src/BufferView.C: ditto.
11066 * src/bufferlist.C: ditto.
11067 * src/lyx_cb.C: ditto.
11068 * src/lyxlex.C: ditto.
11070 * NEWS: add some changes for 1.1.4.
11072 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11074 * src/BufferView.C: first go at a TextCache to speed up switching
11077 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11079 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
11080 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
11081 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
11082 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
11085 * src/mathed/math_defs.h (MathedRowSt): make sure that all
11086 members of the struct are correctly initialized to 0 (detected by
11088 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
11089 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
11091 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
11092 pidwait, since it was allocated with "new". This was potentially
11093 very bad. Thanks to Michael Schmitt for running purify for us.
11096 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11098 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
11100 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
11102 1999-12-30 Allan Rae <rae@lyx.org>
11104 * lib/templates/IEEEtran.lyx: minor change
11106 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
11107 src/mathed/formula.C (LocalDispatch): askForText changes
11109 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
11110 know when a user has cancelled input. Fixes annoying problems with
11111 inserting labels and version control.
11113 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11115 * src/support/lstrings.C (tostr): rewritten to use strstream and
11118 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11120 * src/support/filetools.C (IsFileWriteable): use fstream to check
11121 (IsDirWriteable): use fileinfo to check
11123 * src/support/filetools.h (FilePtr): whole class deleted
11125 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
11127 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
11129 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
11131 * src/bufferlist.C (write): use ifstream and ofstream instead of
11134 * src/Spacing.h: use istrstream instead of sscanf
11136 * src/mathed/math_defs.h: change first arg to istream from FILE*
11138 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
11140 * src/mathed/math_parser.C: have yyis to be an istream
11141 (LexGetArg): use istream (yyis)
11143 (mathed_parse): ditto
11144 (mathed_parser_file): first arg istream instead of FILE*, set yyis
11146 * src/mathed/formula.C (Read): rewritten to use istream
11148 * src/mathed/formulamacro.C (Read): rewritten to use istream
11150 * src/lyxlex.h (~LyXLex): deleted desturctor
11151 (getStream): new function, returns an istream
11152 (getFile): deleted funtion
11153 (IsOK): return is.good();
11155 * src/lyxlex.C (LyXLex): delete file and owns_file
11156 (setFile): open an filebuf and assign that to a istream instead of
11158 (setStream): new function, takes an istream as arg.
11159 (setFile): deleted function
11160 (EatLine): rewritten us use istream instead of FILE*
11164 * src/table.C (LyXTable): use istream instead of FILE*
11165 (Read): rewritten to take an istream instead of FILE*
11167 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11169 * src/buffer.C (Dispatch): remove an extraneous break statement.
11171 * src/support/filetools.C (QuoteName): change to do simple
11172 'quoting'. More work is necessary. Also changed to do nothing
11173 under emx (needs fix too).
11174 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11176 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11177 config.h.in to the AC_DEFINE_UNQUOTED() call.
11178 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11179 needs char * as argument (because Solaris 7 declares it like
11182 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11183 remove definition of BZERO.
11185 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11187 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11188 defined, "lyxregex.h" if not.
11190 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11192 (REGEX): new variable that is set to regex.c lyxregex.h when
11193 AM_CONDITIONAL USE_REGEX is set.
11194 (libsupport_la_SOURCES): add $(REGEX)
11196 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11199 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11202 * configure.in: add call to LYX_REGEX
11204 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11205 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11207 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11209 * lib/bind/fi_menus.bind: new file, from
11210 pauli.virtanen@saunalahti.fi.
11212 * src/buffer.C (getBibkeyList): pass the parameter delim to
11213 InsetInclude::getKeys and InsetBibtex::getKeys.
11215 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11216 is passed to Buffer::getBibkeyList
11218 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11219 instead of the hardcoded comma.
11221 * src/insets/insetbib.C (getKeys): make sure that there are not
11222 leading blanks in bibtex keys. Normal latex does not care, but
11223 harvard.sty seems to dislike blanks at the beginning of citation
11224 keys. In particular, the retturn value of the function is
11226 * INSTALL: make it clear that libstdc++ is needed and that gcc
11227 2.7.x probably does not work.
11229 * src/support/filetools.C (findtexfile): make debug message go to
11231 * src/insets/insetbib.C (getKeys): ditto
11233 * src/debug.C (showTags): make sure that the output is correctly
11236 * configure.in: add a comment for TWO_COLOR_ICON define.
11238 * acconfig.h: remove all the entries that already defined in
11239 configure.in or acinclude.m4.
11241 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11242 to avoid user name, date and copyright.
11244 1999-12-21 Juergen Vigna <jug@sad.it>
11246 * src/table.C (Read): Now read bogus row format informations
11247 if the format is < 5 so that afterwards the table can
11248 be read by lyx but without any format-info. Fixed the
11249 crash we experienced when not doing this.
11251 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11253 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11254 (RedoDrawingOfParagraph): ditto
11255 (RedoParagraphs): ditto
11256 (RemoveTableRow): ditto
11258 * src/text.C (Fill): rename arg paperwidth -> paper_width
11260 * src/buffer.C (insertLyXFile): rename var filename -> fname
11261 (writeFile): rename arg filename -> fname
11262 (writeFileAscii): ditto
11263 (makeLaTeXFile): ditto
11264 (makeLinuxDocFile): ditto
11265 (makeDocBookFile): ditto
11267 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11270 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11272 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11275 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11276 compiled by a C compiler not C++.
11278 * src/layout.h (LyXTextClass): added typedef for const_iterator
11279 (LyXTextClassList): added typedef for const_iterator + member
11280 functions begin and end.
11282 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11283 iterators to fill the choice_class.
11284 (updateLayoutChoice): rewritten to use iterators to fill the
11285 layoutlist in the toolbar.
11287 * src/BufferView.h (BufferView::work_area_width): removed unused
11290 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11292 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11293 (sgmlCloseTag): ditto
11295 * src/support/lstrings.h: return type of countChar changed to
11298 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11299 what version of this func to use. Also made to return unsigned int.
11301 * configure.in: call LYX_STD_COUNT
11303 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11304 conforming std::count.
11306 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11308 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11309 and a subscript would give bad display (patch from Dekel Tsur
11310 <dekel@math.tau.ac.il>).
11312 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11314 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11317 * src/chset.h: add a few 'using' directives
11319 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11320 triggered when no buffer is active
11322 * src/layout.C: removed `break' after `return' in switch(), since
11325 * src/lyx_main.C (init): make sure LyX can be ran in place even
11326 when libtool has done its magic with shared libraries. Fix the
11327 test for the case when the system directory has not been found.
11329 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11330 name for the latex file.
11331 (MenuMakeHTML): ditto
11333 * src/buffer.h: add an optional boolean argument, which is passed
11334 to ChangeExtension.
11336 1999-12-20 Allan Rae <rae@lyx.org>
11338 * lib/templates/IEEEtran.lyx: small correction and update.
11340 * configure.in: Attempted to use LYX_PATH_HEADER
11342 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11344 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11345 input from JMarc. Now use preprocessor to find the header.
11346 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11347 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11348 LYX_STL_STRING_FWD. See comments in file.
11350 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11352 * The global MiniBuffer * minibuffer variable is dead.
11354 * The global FD_form_main * fd_form_main variable is dead.
11356 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11358 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11360 * src/table.h: add the LOstream.h header
11361 * src/debug.h: ditto
11363 * src/LyXAction.h: change the explaination of the ReadOnly
11364 attribute: is indicates that the function _can_ be used.
11366 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11369 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11371 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11377 * src/paragraph.C (GetWord): assert on pos>=0
11380 * src/support/lyxstring.C: condition the use of an invariant on
11382 * src/support/lyxstring.h: ditto
11384 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11385 Use LAssert.h instead of plain assert().
11387 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11389 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11390 * src/support/filetools.C: ditto
11392 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11395 * INSTALL: document the new configure flags
11397 * configure.in: suppress --with-debug; add --enable-assertions
11399 * acinclude.m4: various changes in alignment of help strings.
11401 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11403 * src/kbmap.C: commented out the use of the hash map in kb_map,
11404 beginning of movement to a stl::container.
11406 * several files: removed code that was not in effect when
11407 MOVE_TEXT was defined.
11409 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11410 for escaping should not be used. We can discuss if the string
11411 should be enclosed in f.ex. [] instead of "".
11413 * src/trans_mgr.C (insert): use the new returned value from
11414 encodeString to get deadkeys and keymaps done correctly.
11416 * src/chset.C (encodeString): changed to return a pair, to tell
11417 what to use if we know the string.
11419 * src/lyxscreen.h (fillArc): new function.
11421 * src/FontInfo.C (resize): rewritten to use more std::string like
11422 structore, especially string::replace.
11424 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11427 * configure.in (chmod +x some scripts): remove config/gcc-hack
11429 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11431 * src/buffer.C (writeFile): change once again the top comment in a
11432 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11433 instead of an hardcoded version number.
11434 (makeDocBookFile): ditto
11436 * src/version.h: add new define LYX_DOCVERSION
11438 * po/de.po: update from Pit Sütterlin
11439 * lib/bind/de_menus.bind: ditto.
11441 * src/lyxfunc.C (Dispatch): call MenuExport()
11442 * src/buffer.C (Dispatch): ditto
11444 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11445 LyXFunc::Dispatch().
11446 (MenuExport): new function, moved from
11447 LyXFunc::Dispatch().
11449 * src/trans_mgr.C (insert): small cleanup
11450 * src/chset.C (loadFile): ditto
11452 * lib/kbd/iso8859-1.cdef: add missing backslashes
11454 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11456 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11457 help with placing the manually drawn accents better.
11459 (Draw): x2 and hg changed to float to minimize rounding errors and
11460 help place the accents better.
11462 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11463 unsigned short to char is just wrong...cast the char to unsigned
11464 char instead so that the two values can compare sanely. This
11465 should also make the display of insetlatexaccents better and
11466 perhaps also some other insets.
11468 (lbearing): new function
11471 1999-12-15 Allan Rae <rae@lyx.org>
11473 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11474 header that provides a wrapper around the very annoying SGI STL header
11477 * src/support/lyxstring.C, src/LString.h:
11478 removed old SGI-STL-compatability attempts.
11480 * configure.in: Use LYX_STL_STRING_FWD.
11482 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11483 stl_string_fwd.h is around and try to determine it's location.
11484 Major improvement over previous SGI STL 3.2 compatability.
11485 Three small problems remain with this function due to my zero
11486 knowledge of autoconf. JMarc and lgb see the comments in the code.
11488 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11490 * src/broken_const.h, config/hack-gcc, config/README: removed
11492 * configure.in: remove --with-gcc-hack option; do not call
11495 * INSTALL: remove documentation of --with-broken-const and
11498 * acconfig.h: remove all trace of BROKEN_CONST define
11500 * src/buffer.C (makeDocBookFile): update version number in output
11502 (SimpleDocBookOnePar): fix an assert when trying to a character
11503 access beyond string length
11506 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11508 * po/de.po: fix the Export menu
11510 * lyx.man: update the description of -dbg
11512 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11513 (commandLineHelp): updated
11514 (easyParse): show list of available debug levels if -dbg is passed
11517 * src/Makefile.am: add debug.C
11519 * src/debug.h: moved some code to debug.C
11521 * src/debug.C: new file. Contains code to set and show debug
11524 * src/layout.C: remove 'break' after 'continue' in switch
11525 statements, since these cannot be reached.
11527 1999-12-13 Allan Rae <rae@lyx.org>
11529 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11530 (in_word_set): hash() -> math_hash()
11532 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11534 * acconfig.h: Added a test for whether we are using exceptions in the
11535 current compilation run. If so USING_EXCEPTIONS is defined.
11537 * config.in: Check for existance of stl_string_fwd.h
11538 * src/LString.h: If compiling --with-included-string and SGI's
11539 STL version 3.2 is present (see above test) we need to block their
11540 forward declaration of string and supply a __get_c_string().
11541 However, it turns out this is only necessary if compiling with
11542 exceptions enabled so I've a bit more to add yet.
11544 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11545 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11546 src/support/LRegex.h, src/undo.h:
11547 Shuffle the order of the included files a little to ensure that
11548 LString.h gets included before anything that includes stl_string_fwd.h
11550 * src/support/lyxstring.C: We need to #include LString.h instead of
11551 lyxstring.h to get the necessary definition of __get_c_string.
11552 (__get_c_string): New function. This is defined static just like SGI's
11553 although why they need to do this I'm not sure. Perhaps it should be
11554 in lstrings.C instead.
11556 * lib/templates/IEEEtran.lyx: New template file.
11558 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11560 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11561 * intl/Makefile.in (MKINSTALLDIRS): ditto
11563 * src/LyXAction.C (init): changed to hold the LFUN data in a
11564 automatic array in stead of in callso to newFunc, this speeds up
11565 compilation a lot. Also all the memory used by the array is
11566 returned when the init is completed.
11568 * a lot of files: compiled with -Wold-style-cast, changed most of
11569 the reported offenders to C++ style casts. Did not change the
11570 offenders in C files.
11572 * src/trans.h (Match): change argument type to unsigned int.
11574 * src/support/DebugStream.C: fix some types on the streambufs so
11575 that it works on a conforming implementation.
11577 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11579 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11581 * src/support/lyxstring.C: remove the inline added earlier since
11582 they cause a bunch of unsatisfied symbols when linking with dec
11583 cxx. Cxx likes to have the body of inlines at the place where they
11586 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11587 accessing negative bounds in array. This fixes the crash when
11588 inserting accented characters.
11589 * src/trans.h (Match): ditto
11591 * src/buffer.C (Dispatch): since this is a void, it should not try
11592 to return anything...
11594 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11596 * src/buffer.h: removed the two friends from Buffer. Some changes
11597 because of this. Buffer::getFileName and Buffer::setFileName
11598 renamed to Buffer::fileName() and Buffer::fileName(...).
11600 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11602 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11603 and Buffer::update(short) to BufferView. This move is currently
11604 controlled by a define MOVE_TEXT, this will be removed when all
11605 shows to be ok. This move paves the way for better separation
11606 between buffer contents and buffer view. One side effect is that
11607 the BufferView needs a rebreak when swiching buffers, if we want
11608 to avoid this we can add a cache that holds pointers to LyXText's
11609 that is not currently in use.
11611 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11614 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11616 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11618 * lyx_main.C: new command line option -x (or --execute) and
11619 -e (or --export). Now direct conversion from .lyx to .tex
11620 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11621 Unfortunately, X is still needed and the GUI pops up during the
11624 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11626 * src/Spacing.C: add a using directive to bring stream stuff into
11628 * src/paragraph.C: ditto
11629 * src/buffer.C: ditto
11631 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11632 from Lars' announcement).
11634 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11635 example files from Tino Meinen.
11637 1999-12-06 Allan Rae <rae@lyx.org>
11639 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11641 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11643 * src/support/lyxstring.C: added a lot of inline for no good
11646 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11647 latexWriteEndChanges, they were not used.
11649 * src/layout.h (operator<<): output operator for PageSides
11651 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11653 * some example files: loaded in LyX 1.0.4 and saved again to update
11654 certain constructs (table format)
11656 * a lot of files: did the change to use fstream/iostream for all
11657 writing of files. Done with a close look at Andre Poenitz's patch.
11659 * some files: whitespace changes.
11661 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11663 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11664 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11665 architecture, we provide our own. It is used unconditionnally, but
11666 I do not think this is a performance problem. Thanks to Angus
11667 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11668 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11670 (GetInset): use my_memcpy.
11674 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11675 it is easier to understand, but it uses less TeX-only constructs now.
11677 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11678 elements contain spaces
11680 * lib/configure: regenerated
11682 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11683 elements contain spaces; display the list of programs that are
11686 * autogen.sh: make sure lib/configure is executable
11688 * lib/examples/*: rename the tutorial examples to begin with the
11689 two-letters language code.
11691 * src/lyxfunc.C (getStatus): do not query current font if no
11694 * src/lyx_cb.C (RunScript): use QuoteName
11695 (MenuRunDvips): ditto
11696 (PrintApplyCB): ditto
11698 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11699 around argument, so that it works well with the current shell.
11700 Does not work properly with OS/2 shells currently.
11702 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11703 * src/LyXSendto.C (SendtoApplyCB): ditto
11704 * src/lyxfunc.C (Dispatch): ditto
11705 * src/buffer.C (runLaTeX): ditto
11706 (runLiterate): ditto
11707 (buildProgram): ditto
11709 * src/lyx_cb.C (RunScript): ditto
11710 (MenuMakeLaTeX): ditto
11712 * src/buffer.h (getLatexName): new method
11714 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11716 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11718 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11719 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11720 (create_math_panel): ditto
11722 * src/lyxfunc.C (getStatus): re-activate the code which gets
11723 current font and cursor; add test for export to html.
11725 * src/lyxrc.C (read): remove unreachable break statements; add a
11728 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11730 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11732 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11733 introduced by faulty regex.
11734 * src/buffer.C: ditto
11735 * src/lastfiles.C: ditto
11736 * src/paragraph.C: ditto
11737 * src/table.C: ditto
11738 * src/vspace.C: ditto
11739 * src/insets/figinset.C: ditto
11740 Note: most of these is absolutely harmless, except the one in
11741 src/mathed formula.C.
11743 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11745 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11746 operation, yielding correct results for the reLyX command.
11748 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11750 * src/support/filetools.C (ExpandPath): removed an over eager
11752 (ReplaceEnvironmentPath): ditto
11754 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11755 shows that we are doing something fishy in our code...
11756 (BubblePost): ditto
11759 * src/lyxrc.C (read): use a double switch trick to get more help
11760 from the compiler. (the same trick is used in layout.C)
11761 (write): new function. opens a ofstream and pass that to output
11762 (output): new function, takes a ostream and writes the lyxrc
11763 elemts to it. uses a dummy switch to make sure no elements are
11766 * src/lyxlex.h: added a struct pushpophelper for use in functions
11767 with more than one exit point.
11769 * src/lyxlex.[Ch] (GetInteger): made it const
11773 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11775 * src/layout.[hC] : LayoutTags splitted into several enums, new
11776 methods created, better error handling cleaner use of lyxlex. Read
11779 * src/bmtable.[Ch]: change some member prototypes because of the
11780 image const changes.
11782 * commandtags.h, src/LyXAction.C (init): new function:
11783 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11784 This file is not read automatically but you can add \input
11785 preferences to your lyxrc if you want to. We need to discuss how
11788 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11789 in .aux, also remove .bib and .bst files from dependencies when
11792 * src/BufferView.C, src/LyXView.C: add const_cast several places
11793 because of changes to images.
11795 * lib/images/*: same change as for images/*
11797 * lib/lyxrc.example: Default for accept_compound is false not no.
11799 * images/*: changed to be const, however I have som misgivings
11800 about this change so it might be changed back.
11802 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11804 * lib/configure, po/POTFILES.in: regenerated
11806 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11808 * config/lib_configure.m4: removed
11810 * lib/configure.m4: new file (was config/lib_configure.m4)
11812 * configure.in: do not test for rtti, since we do not use it.
11814 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11816 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11817 doubling of allocated space scheme. This makes it faster for large
11818 strings end to use less memory for small strings. xtra rememoved.
11820 * src/insets/figinset.C (waitalarm): commented out.
11821 (GhostscriptMsg): use static_cast
11822 (GhostscriptMsg): use new instead of malloc to allocate memory for
11823 cmap. also delete the memory after use.
11825 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11827 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11828 for changes in bibtex database or style.
11829 (runBibTeX): remove all .bib and .bst files from dep before we
11831 (run): use scanAuc in when dep file already exist.
11833 * src/DepTable.C (remove_files_with_extension): new method
11834 (exist): new method
11836 * src/DepTable.[Ch]: made many of the methods const.
11838 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11840 * src/bufferparams.C: make sure that the default textclass is
11841 "article". It used to be the first one by description order, but
11842 now the first one is "docbook".
11844 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11845 string; call Debug::value.
11846 (easyParse): pass complete argument to setDebuggingLevel().
11848 * src/debug.h (value): fix the code that parses debug levels.
11850 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11853 * src/LyXAction.C: use Debug::ACTION as debug channel.
11855 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11857 * NEWS: updated for the future 1.1.3 release.
11859 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11860 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11861 it should. This is of course a controversial change (since many
11862 people will find that their lyx workscreen is suddenly full of
11863 red), but done for the sake of correctness.
11865 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11866 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11868 * src/insets/inseterror.h, src/insets/inseturl.h,
11869 src/insets/insetinfo.h, src/insets/figinset.h,
11870 src/mathed/formulamacro.h, src/mathed/math_macro.h
11871 (EditMessage): add a missing const and add _() to make sure that
11872 translation happens
11874 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11875 src/insets/insetbib.C, src/support/filetools.C: add `using'
11876 directives for cxx.
11878 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11879 doing 'Insert index of last word' at the beginning of a paragraph.
11881 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11883 * several files: white-space changes.
11885 * src/mathed/formula.C: removed IsAlpha and IsDigit
11887 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11888 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11891 * src/insets/figinset.C (GetPSSizes): don't break when
11892 "EndComments" is seen. But break when a boundingbox is read.
11894 * all classes inherited from Inset: return value of Clone
11895 changed back to Inset *.
11897 * all classes inherited form MathInset: return value of Clone
11898 changed back to MathedInset *.
11900 * src/insets/figinset.C (runqueue): use a ofstream to output the
11901 gs/ps file. Might need some setpresicion or setw. However I can
11902 see no problem with the current code.
11903 (runqueue): use sleep instead of the alarm/signal code. I just
11904 can't see the difference.
11906 * src/paragraph.C (LyXParagraph): reserve space in the new
11907 paragraph and resize the inserted paragraph to just fit.
11909 * src/lyxfunc.h (operator|=): added operator for func_status.
11911 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11912 check for readable file.
11914 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11915 check for readable file.
11916 (MenuMakeLinuxDoc): ditto
11917 (MenuMakeDocBook): ditto
11918 (MenuMakeAscii): ditto
11919 (InsertAsciiFile): split the test for openable and readable
11921 * src/bmtable.C (draw_bitmaptable): use
11922 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11924 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11925 findtexfile from LaTeX to filetools.
11927 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11928 instead of FilePtr. Needs to be verified by a literate user.
11930 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11932 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11933 (EditMessage): likewise.
11935 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11936 respectively as \textasciitilde and \textasciicircum.
11938 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11940 * src/support/lyxstring.h: made the methods that take iterators
11941 use const_iterator.
11943 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11944 (regexMatch): made is use the real regex class.
11946 * src/support/Makefile.am: changed to use libtool
11948 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11950 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11952 (MathIsInset ++): changed several macros to be inline functions
11955 * src/mathed/Makefile.am: changed to use libtool
11957 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11959 * src/insets/inset* : Clone changed to const and return type is
11960 the true insettype not just Inset*.
11962 * src/insets/Makefile.am: changed to use libtool
11964 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11966 * src/undo.[Ch] : added empty() and changed some of the method
11969 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11971 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11972 setID use block<> for the bullets array, added const several places.
11974 * src/lyxfunc.C (getStatus): new function
11976 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11977 LyXAction, added const to several funtions.
11979 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11980 a std::map, and to store the dir items in a vector.
11982 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11985 * src/LyXView.[Ch] + other files : changed currentView to view.
11987 * src/LyXAction.[Ch] : ported from the old devel branch.
11989 * src/.cvsignore: added .libs and a.out
11991 * configure.in : changes to use libtool.
11993 * acinclude.m4 : inserted libtool.m4
11995 * .cvsignore: added libtool
11997 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11999 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
12000 file name in insets and mathed directories (otherwise the
12001 dependency is not taken in account under cygwin).
12003 * src/text2.C (InsertString[AB]): make sure that we do not try to
12004 read characters past the string length.
12006 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12008 * lib/doc/LaTeXConfig.lyx.in,
12009 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
12011 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
12012 file saying who created them and when this heppened; this is
12013 useless and annoys tools like cvs.
12015 * lib/layouts/g-brief-{en,de}.layout,
12016 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
12017 from Thomas Hartkens <thomas@hartkens.de>.
12019 * src/{insets,mathed}/Makefile.am: do not declare an empty
12020 LDFLAGS, so that it can be set at configure time (useful on Irix
12023 * lib/reLyX/configure.in: make sure that the prefix is set
12024 correctly in LYX_DIR.
12026 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
12028 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
12029 be used by 'command-sequence' this allows to bind a key to a
12030 sequence of LyX-commands
12031 (Example: 'command-sequence math-insert alpha; math-insert beta;")
12033 * src/LyXAction.C: add "command-sequence"
12035 * src/LyXFunction.C: handling of "command-sequence"
12037 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
12038 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
12040 * src/lyxserver.C, src/minibuffer.C: Use this new interface
12042 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12044 * src/buffer.C (writeFile): Do not output a comment giving user
12045 and date at the beginning of a .lyx file. This is useless and
12046 annoys cvs anyway; update version number to 1.1.
12048 * src/Makefile.am (LYX_DIR): add this definition, so that a
12049 default path is hardcoded in LyX.
12051 * configure.in: Use LYX_GNU_GETTEXT.
12053 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
12054 AM_GNU_GETTEXT with a bug fixed.
12056 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
12058 * src/chset.C: add "using std::ifstream;" to please dec cxx.
12060 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
12061 which is used to point to LyX data is now LYX_DIR_11x.
12063 * lyx.man: convert to a unix text file; small updates.
12065 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
12067 * src/support/LSubstring.[Ch]: made the second arg of most of the
12068 constructors be a const reference.
12070 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
12073 * src/support/lyxstring.[Ch] (swap): added missing member function
12074 and specialization of swap(str, str);
12076 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
12078 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
12079 trace of the old one.
12081 * src/undo.[Ch]: made the undostack use std::list to store undo's in
12082 put the member definitions in undo.C.
12084 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
12085 NEW_TEXT and have now only code that was included when this was
12088 * src/intl.C (LCombo): use static_cast
12090 (DispatchCallback): ditto
12092 * src/definitions.h: removed whole file
12094 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
12096 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
12097 parsing and stores in a std:map. a regex defines the file format.
12098 removed unneeded members.
12100 * src/bufferparams.h: added several enums from definitions.h here.
12101 Removed unsused destructor. Changed some types to use proper enum
12102 types. use block to have the temp_bullets and user_defined_bullets
12103 and to make the whole class assignable.
12105 * src/bufferparams.C (Copy): removed this functions, use a default
12106 assignment instead.
12108 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
12111 * src/buffer.C (readLyXformat2): commend out all that have with
12112 oldpapersize to do. also comment out all that hve to do with
12113 insetlatex and insetlatexdel.
12114 (setOldPaperStuff): commented out
12116 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
12118 * src/LyXAction.C: remove use of inset-latex-insert
12120 * src/mathed/math_panel.C (button_cb): use static_cast
12122 * src/insets/Makefile.am (insets_o_SOURCES): removed
12125 * src/support/lyxstring.C (helper): use the unsigned long
12126 specifier, UL, instead of a static_cast.
12128 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
12130 * src/support/block.h: new file. to be used as a c-style array in
12131 classes, so that the class can be assignable.
12133 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12135 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
12136 NULL, make sure to return an empty string (it is not possible to
12137 set a string to NULL).
12139 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12141 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
12143 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
12145 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
12146 link line, so that Irix users (for example) can set it explicitely to
12149 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
12150 it can be overidden at make time (static or dynamic link, for
12153 * src/vc-backend.C, src/LaTeXFeatures.h,
12154 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12155 statements to bring templates to global namespace.
12157 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12159 * src/support/lyxstring.C (operator[] const): make it standard
12162 * src/minibuffer.C (Init): changed to reflect that more
12163 information is given from the lyxvc and need not be provided here.
12165 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12167 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12169 * src/LyXView.C (UpdateTimerCB): use static_cast
12170 (KeyPressMask_raw_callback): ditto
12172 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12173 buffer_, a lot of changes because of this. currentBuffer() ->
12174 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12175 also changes to other files because of this.
12177 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12179 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12180 have no support for RCS and partial support for CVS, will be
12183 * src/insets/ several files: changes because of function name
12184 changes in Bufferview and LyXView.
12186 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12188 * src/support/LSubstring.[Ch]: new files. These implement a
12189 Substring that can be very convenient to use. i.e. is this
12191 string a = "Mary had a little sheep";
12192 Substring(a, "sheep") = "lamb";
12193 a is now "Mary has a little lamb".
12195 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12196 out patterns and subpatterns of strings. It is used by LSubstring
12197 and also by vc-backend.C
12199 * src/support/lyxstring.C: went over all the assertions used and
12200 tried to correct the wrong ones and flag which of them is required
12201 by the standard. some bugs found because of this. Also removed a
12202 couple of assertions.
12204 * src/support/Makefile.am (libsupport_a_SOURCES): added
12205 LSubstring.[Ch] and LRegex.[Ch]
12207 * src/support/FileInfo.h: have struct stat buf as an object and
12208 not a pointer to one, some changes because of this.
12210 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12211 information in layout when adding the layouts preamble to the
12212 textclass preamble.
12214 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12217 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12218 because of bug in OS/2.
12220 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12222 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12223 \verbatim@font instead of \ttfamily, so that it can be redefined.
12225 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12226 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12227 src/layout.h, src/text2.C: add 'using' directive to bring the
12228 STL templates we need from the std:: namespace to the global one.
12229 Needed by DEC cxx in strict ansi mode.
12231 * src/support/LIstream.h,src/support/LOstream.h,
12232 src/support/lyxstring.h,src/table.h,
12233 src/lyxlookup.h: do not include <config.h> in header
12234 files. This should be done in the .C files only.
12236 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12240 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12242 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12243 from Kayvan to fix the tth invokation.
12245 * development/lyx.spec.in: updates from Kayvan to reflect the
12246 changes of file names.
12248 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12250 * src/text2.C (InsertStringB): use std::copy
12251 (InsertStringA): use std::copy
12253 * src/bufferlist.C: use a vector to store the buffers in. This is
12254 an internal change and should not affect any other thing.
12256 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12259 * src/text.C (Fill): fix potential bug, one off bug.
12261 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12263 * src/Makefile.am (lyx_main.o): add more files it depends on.
12265 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12267 * src/support/lyxstring.C: use size_t for the reference count,
12268 size, reserved memory and xtra.
12269 (internal_compare): new private member function. Now the compare
12270 functions should work for std::strings that have embedded '\0'
12272 (compare): all compare functions rewritten to use
12275 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12277 * src/support/lyxstring.C (compare): pass c_str()
12278 (compare): pass c_str
12279 (compare): pass c_str
12281 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12283 * src/support/DebugStream.C: <config.h> was not included correctly.
12285 * lib/configure: forgot to re-generate it :( I'll make this file
12286 auto generated soon.
12288 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12290 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12293 * src/support/lyxstring.C: some changes from length() to rep->sz.
12294 avoids a function call.
12296 * src/support/filetools.C (SpaceLess): yet another version of the
12297 algorithm...now per Jean-Marc's suggestions.
12299 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12301 * src/layout.C (less_textclass_desc): functor for use in sorting
12303 (LyXTextClass::Read): sort the textclasses after reading.
12305 * src/support/filetools.C (SpaceLess): new version of the
12306 SpaceLess functions. What problems does this one give? Please
12309 * images/banner_bw.xbm: made the arrays unsigned char *
12311 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12313 * src/support/lyxstring.C (find): remove bogus assertion in the
12314 two versions of find where this has not been done yet.
12316 * src/support/lyxlib.h: add missing int return type to
12319 * src/menus.C (ShowFileMenu): disable exporting to html if no
12320 html export command is present.
12322 * config/lib_configure.m4: add a test for an HTML converter. The
12323 programs checked for are, in this order: tth, latex2html and
12326 * lib/configure: generated from config/lib_configure.m4.
12328 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12329 html converter. The parameters are now passed through $$FName and
12330 $$OutName, instead of standard input/output.
12332 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12334 * lib/lyxrc.example: update description of \html_command.
12335 add "quotes" around \screen_font_xxx font setting examples to help
12336 people who use fonts with spaces in their names.
12338 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12340 * Distribution files: updates for v1.1.2
12342 * src/support/lyxstring.C (find): remove bogus assert and return
12343 npos for the same condition.
12345 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12347 * added patch for OS/2 from SMiyata.
12349 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12351 * src/text2.C (CutSelection): make space_wrapped a bool
12352 (CutSelection): dont declare int i until we have to.
12353 (alphaCounter): return a char const *.
12355 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12357 * src/support/syscall.C (Systemcalls::kill):
12358 src/support/filetools.C (PutEnv, PutEnvPath):
12359 src/lyx_cb.C (addNewlineAndDepth):
12360 src/FontInfo.C (FontInfo::resize): condition some #warning
12361 directives with WITH_WARNINGS.
12364 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12366 * src/layout.[Ch] + several files: access to class variables
12367 limited and made accessor functions instead a lot of code changed
12368 becuase of this. Also instead of returning pointers often a const
12369 reference is returned instead.
12371 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12373 * src/Makefile.am (dist-hook): added used to remove the CVS from
12374 cheaders upon creating a dist
12375 (EXTRA_DIST): added cheaders
12377 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12378 a character not as a small integer.
12380 * src/support/lyxstring.C (find): removed Assert and added i >=
12381 rep->sz to the first if.
12383 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12385 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12386 src/LyXView.C src/buffer.C src/bufferparams.C
12387 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12388 src/text2.C src/insets/insetinclude.C:
12389 lyxlayout renamed to textclasslist.
12391 * src/layout.C: some lyxerr changes.
12393 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12394 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12395 (LyXLayoutList): removed all traces of this class.
12396 (LyXTextClass::Read): rewrote LT_STYLE
12397 (LyXTextClass::hasLayout): new function
12398 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12399 both const and nonconst version.
12400 (LyXTextClass::delete_layout): new function.
12401 (LyXTextClassList::Style): bug fix. do the right thing if layout
12403 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12404 (LyXTextClassList::NameOfLayout): ditto
12405 (LyXTextClassList::Load): ditto
12407 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12409 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12411 * src/LyXAction.C (LookupFunc): added a workaround for sun
12412 compiler, on the other hand...we don't know if the current code
12413 compiles on sun at all...
12415 * src/support/filetools.C (CleanupPath): subst fix
12417 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12420 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12421 complained about this one?
12423 * src/insets/insetinclude.C (Latex): subst fix
12425 * src/insets/insetbib.C (getKeys): subst fix
12427 * src/LyXSendto.C (SendtoApplyCB): subst fix
12429 * src/lyx_main.C (init): subst fix
12431 * src/layout.C (Read): subst fix
12433 * src/lyx_sendfax_main.C (button_send): subst fix
12435 * src/buffer.C (RoffAsciiTable): subst fix
12437 * src/lyx_cb.C (MenuFax): subst fix
12438 (PrintApplyCB): subst fix
12440 1999-10-26 Juergen Vigna <jug@sad.it>
12442 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12444 (Read): Cleaned up this code so now we read only format vestion >= 5
12446 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12448 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12449 come nobody has complained about this one?
12451 * src/insets/insetinclude.C (Latex): subst fix
12453 * src/insets/insetbib.C (getKeys): subst fix
12455 * src/lyx_main.C (init): subst fix
12457 * src/layout.C (Read): subst fix
12459 * src/buffer.C (RoffAsciiTable): subst fix
12461 * src/lyx_cb.C (MenuFax): subst fix.
12463 * src/layout.[hC] + some other files: rewrote to use
12464 std::container to store textclasses and layouts in.
12465 Simplified, removed a lot of code. Make all classes
12466 assignable. Further simplifications and review of type
12467 use still to be one.
12469 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12470 lastfiles to create the lastfiles partr of the menu.
12472 * src/lastfiles.[Ch]: rewritten to use deque to store the
12473 lastfiles in. Uses fstream for reading and writing. Simplifies
12476 * src/support/syscall.C: remove explicit cast.
12478 * src/BufferView.C (CursorToggleCB): removed code snippets that
12479 were commented out.
12480 use explicat C++ style casts instead of C style casts. also use
12481 u_vdata instea of passing pointers in longs.
12483 * src/PaperLayout.C: removed code snippets that were commented out.
12485 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12487 * src/lyx_main.C: removed code snippets that wer commented out.
12489 * src/paragraph.C: removed code snippets that were commented out.
12491 * src/lyxvc.C (logClose): use static_cast
12493 (viewLog): remove explicit cast to void*
12494 (showLog): removed old commented code
12496 * src/menus.C: use static_cast instead of C style casts. use
12497 u_vdata instead of u_ldata. remove explicit cast to (long) for
12498 pointers. Removed old code that was commented out.
12500 * src/insets/inset.C: removed old commented func
12502 * src/insets/insetref.C (InsetRef): removed old code that had been
12503 commented out for a long time.
12505 (escape): removed C style cast
12507 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12509 * src/insets/insetlatex.C (Draw): removed old commented code
12510 (Read): rewritten to use string
12512 * src/insets/insetlabel.C (escape): removed C style cast
12514 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12516 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12517 old commented code.
12519 * src/insets/insetinclude.h: removed a couple of stupid bools
12521 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12522 (Clone): remove C style cast
12523 (getKeys): changed list to lst because of std::list
12525 * src/insets/inseterror.C (Draw): removed som old commented code.
12527 * src/insets/insetcommand.C (Draw): removed some old commented code.
12529 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12530 commented out forever.
12531 (bibitem_cb): use static_cast instead of C style cast
12532 use of vdata changed to u_vdata.
12534 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12536 (CloseUrlCB): use static_cast instead of C style cast.
12537 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12539 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12540 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12541 (CloseInfoCB): static_cast from ob->u_vdata instead.
12542 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12545 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12546 (C_InsetError_CloseErrorCB): forward the ob parameter
12547 (CloseErrorCB): static_cast from ob->u_vdata instead.
12549 * src/vspace.h: include LString.h since we use string in this class.
12551 * src/vspace.C (lyx_advance): changed name from advance because of
12552 nameclash with stl. And since we cannot use namespaces yet...I
12553 used a lyx_ prefix instead. Expect this to change when we begin
12556 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12558 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12559 and removed now defunct constructor and deconstructor.
12561 * src/BufferView.h: have backstack as a object not as a pointer.
12562 removed initialization from constructor. added include for BackStack
12564 * development/lyx.spec.in (%build): add CFLAGS also.
12566 * src/screen.C (drawFrame): removed another warning.
12568 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12570 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12571 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12572 README and ANNOUNCE a bit for the next release. More work is
12575 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12576 unbreakable if we are in freespacing mode (LyX-Code), but not in
12579 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12581 * src/BackStack.h: fixed initialization order in constructor
12583 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12585 * acinclude.m4 (VERSION): new rules for when a version is
12586 development, added also a variable for prerelease.
12587 (warnings): we set with_warnings=yes for prereleases
12588 (lyx_opt): prereleases compile with same optimization as development
12589 (CXXFLAGS): only use pedantic if we are a development version
12591 * src/BufferView.C (restorePosition): don't do anything if the
12592 backstack is empty.
12594 * src/BackStack.h: added member empty, use this to test if there
12595 is anything to pop...
12597 1999-10-25 Juergen Vigna <jug@sad.it>
12600 * forms/layout_forms.fd +
12601 * forms/latexoptions.fd +
12602 * lyx.fd: changed for various form resize issues
12604 * src/mathed/math_panel.C +
12605 * src/insets/inseterror.C +
12606 * src/insets/insetinfo.C +
12607 * src/insets/inseturl.C +
12608 * src/insets/inseturl.h +
12610 * src/LyXSendto.C +
12611 * src/PaperLayout.C +
12612 * src/ParagraphExtra.C +
12613 * src/TableLayout.C +
12615 * src/layout_forms.C +
12622 * src/menus.C: fixed various resize issues. So now forms can be
12623 resized savely or not be resized at all.
12625 * forms/form_url.fd +
12626 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12629 * src/insets/Makefile.am: added files form_url.[Ch]
12631 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12633 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12634 (and presumably 6.2).
12636 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12637 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12638 remaining static member callbacks.
12640 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12643 * src/support/lyxstring.h: declare struct Srep as friend of
12644 lyxstring, since DEC cxx complains otherwise.
12646 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12648 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12650 * src/LaTeX.C (run): made run_bibtex also depend on files with
12652 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12653 are put into the dependency file.
12655 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12656 the code has shown itself to work
12657 (create_ispell_pipe): removed another warning, added a comment
12660 * src/minibuffer.C (ExecutingCB): removed code that has been
12661 commented out a long time
12663 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12664 out code + a warning.
12666 * src/support/lyxstring.h: comment out the three private
12667 operators, when compiling with string ansi conforming compilers
12668 they make problems.
12670 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12672 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12673 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12676 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12679 * src/mathed/math_panel.C (create_math_panel): remove explicit
12682 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12685 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12686 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12687 to XCreatePixmapFromBitmapData
12688 (fl_set_bmtable_data): change the last argument to be unsigned
12690 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12691 and bh to be unsigned int, remove explicit casts in call to
12692 XReadBitmapFileData.
12694 * images/arrows.xbm: made the arrays unsigned char *
12695 * images/varsz.xbm: ditto
12696 * images/misc.xbm: ditto
12697 * images/greek.xbm: ditto
12698 * images/dots.xbm: ditto
12699 * images/brel.xbm: ditto
12700 * images/bop.xbm: ditto
12702 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12704 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12705 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12706 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12708 (LYX_CXX_CHEADERS): added <clocale> to the test.
12710 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12712 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12714 * src/support/lyxstring.C (append): fixed something that must be a
12715 bug, rep->assign was used instead of rep->append.
12717 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12720 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12721 lyx insert double chars. Fix spotted by Kayvan.
12723 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12725 * Fixed the tth support. I messed up with the Emacs patch apply feature
12726 and omitted the changes in lyxrc.C.
12728 1999-10-22 Juergen Vigna <jug@sad.it>
12730 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12732 * src/lyx_cb.C (MenuInsertRef) +
12733 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12734 the form cannot be resized under it limits (fixes a segfault)
12736 * src/lyx.C (create_form_form_ref) +
12737 * forms/lyx.fd: Changed Gravity on name input field so that it is
12740 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12742 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12743 <ostream> and <istream>.
12745 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12746 whether <fstream> provides the latest standard features, or if we
12747 have an oldstyle library (like in egcs).
12748 (LYX_CXX_STL_STRING): fix the test.
12750 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12751 code on MODERN_STL_STREAM.
12753 * src/support/lyxstring.h: use L{I,O}stream.h.
12755 * src/support/L{I,O}stream.h: new files, designed to setup
12756 correctly streams for our use
12757 - includes the right header depending on STL capabilities
12758 - puts std::ostream and std::endl (for LOStream.h) or
12759 std::istream (LIStream.h) in toplevel namespace.
12761 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12763 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12764 was a bib file that had been changed we ensure that bibtex is run.
12765 (runBibTeX): enhanced to extract the names of the bib files and
12766 getting their absolute path and enter them into the dep file.
12767 (findtexfile): static func that is used to look for tex-files,
12768 checks for absolute patchs and tries also with kpsewhich.
12769 Alternative ways of finding the correct files are wanted. Will
12771 (do_popen): function that runs a command using popen and returns
12772 the whole output of that command in a string. Should be moved to
12775 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12776 file with extension ext has changed.
12778 * src/insets/figinset.C: added ifdef guards around the fl_free
12779 code that jug commented out. Now it is commented out when
12780 compiling with XForms == 0.89.
12782 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12783 to lyxstring.C, and only keep a forward declaration in
12784 lyxstring.h. Simplifies the header file a bit and should help a
12785 bit on compile time too. Also changes to Srep will not mandate a
12786 recompile of code just using string.
12787 (~lyxstring): definition moved here since it uses srep.
12788 (size): definition moved here since it uses srep.
12790 * src/support/lyxstring.h: removed a couple of "inline" that should
12793 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12795 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12798 1999-10-21 Juergen Vigna <jug@sad.it>
12800 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12801 set to left if I just remove the width entry (or it is empty).
12803 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12804 paragraph when having dummy paragraphs.
12806 1999-10-20 Juergen Vigna <jug@sad.it>
12808 * src/insets/figinset.C: just commented some fl_free_form calls
12809 and added warnings so that this calls should be activated later
12810 again. This avoids for now a segfault, but we have a memory leak!
12812 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12813 'const char * argument' to 'string argument', this should
12814 fix some Asserts() in lyxstring.C.
12816 * src/lyxfunc.h: Removed the function argAsString(const char *)
12817 as it is not used anymore.
12819 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12821 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12824 * src/Literate.h: some funcs moved from public to private to make
12825 interface clearer. Unneeded args removed.
12827 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12829 (scanBuildLogFile): ditto
12831 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12832 normal TeX Error. Still room for improvement.
12834 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12836 * src/buffer.C (insertErrors): changes to make the error
12837 desctription show properly.
12839 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12842 * src/support/lyxstring.C (helper): changed to use
12843 sizeof(object->rep->ref).
12844 (operator>>): changed to use a pointer instead.
12846 * src/support/lyxstring.h: changed const reference & to value_type
12847 const & lets see if that helps.
12849 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12851 * Makefile.am (rpmdist): fixed to have non static package and
12854 * src/support/lyxstring.C: removed the compilation guards
12856 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12859 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12860 conditional compile of lyxstring.Ch
12862 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12863 stupid check, but it is a lot better than the bastring hack.
12864 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12866 * several files: changed string::erase into string::clear. Not
12869 * src/chset.C (encodeString): use a char temporary instead
12871 * src/table.C (TexEndOfCell): added tostr around
12872 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12873 (TexEndOfCell): ditto
12874 (TexEndOfCell): ditto
12875 (TexEndOfCell): ditto
12876 (DocBookEndOfCell): ditto
12877 (DocBookEndOfCell): ditto
12878 (DocBookEndOfCell): ditto
12879 (DocBookEndOfCell): ditto
12881 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12883 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12885 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12886 (MenuBuildProg): added tostr around ret
12887 (MenuRunChktex): added tostr around ret
12888 (DocumentApplyCB): added tostr around ret
12890 * src/chset.C (encodeString): added tostr around t->ic
12892 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12893 (makeLaTeXFile): added tostr around tocdepth
12894 (makeLaTeXFile): added tostr around ftcound - 1
12896 * src/insets/insetbib.C (setCounter): added tostr around counter.
12898 * src/support/lyxstring.h: added an operator+=(int) to catch more
12901 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12902 (lyxstring): We DON'T allow NULL pointers.
12904 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12906 * src/mathed/math_macro.C (MathMacroArgument::Write,
12907 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12908 when writing them out.
12910 * src/LString.C: remove, since it is not used anymore.
12912 * src/support/lyxstring.C: condition the content to
12913 USE_INCLUDED_STRING macro.
12915 * src/mathed/math_symbols.C, src/support/lstrings.C,
12916 src/support/lyxstring.C: add `using' directive to specify what
12917 we need in <algorithm>. I do not think that we need to
12918 conditionalize this, but any thought is appreciated.
12920 * many files: change all callback functions to "C" linkage
12921 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12922 strict_ansi. Those who were static are now global.
12923 The case of callbacks which are static class members is
12924 trickier, since we have to make C wrappers around them (see
12925 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12926 did not finish this yet, since it defeats the purpose of
12927 encapsulation, and I am not sure what the best route is.
12929 1999-10-19 Juergen Vigna <jug@sad.it>
12931 * src/support/lyxstring.C (lyxstring): we permit to have a null
12932 pointer as assignment value and just don't assign it.
12934 * src/vspace.C (nextToken): corrected this function substituting
12935 find_first(_not)_of with find_last_of.
12937 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12938 (TableOptCloseCB) (TableSpeCloseCB):
12939 inserted fl_set_focus call for problem with fl_hide_form() in
12942 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12944 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12947 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12949 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12950 LyXLex::next() and not eatline() to get its argument.
12952 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12954 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12955 instead, use fstreams for io of the depfile, removed unneeded
12956 functions and variables.
12958 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12959 vector instead, removed all functions and variables that is not in
12962 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12964 * src/buffer.C (insertErrors): use new interface to TeXError
12966 * Makefile.am (rpmdist): added a rpmdist target
12968 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12969 per Kayvan's instructions.
12971 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12973 * src/Makefile.am: add a definition for localedir, so that locales
12974 are found after installation (Kayvan)
12976 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12978 * development/.cvsignore: new file.
12980 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12982 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12983 C++ compiler provides wrappers for C headers and use our alternate
12986 * configure.in: use LYX_CXX_CHEADERS.
12988 * src/cheader/: new directory, populated with cname headers from
12989 libstdc++-2.8.1. They are a bit old, but probably good enough for
12990 what we want (support compilers who lack them).
12992 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12993 from includes. It turns out is was stupid.
12995 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12997 * lib/Makefile.am (install-data-local): forgot a ';'
12998 (install-data-local): forgot a '\'
12999 (libinstalldirs): needed after all. reintroduced.
13001 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
13003 * configure.in (AC_OUTPUT): added lyx.spec
13005 * development/lyx.spec: removed file
13007 * development/lyx.spec.in: new file
13009 * po/*.po: merged with lyx.pot becuase of make distcheck
13011 * lib/Makefile.am (dist-hook): added dist-hook so that
13012 documentation files will be included when doing a make
13013 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
13014 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
13016 more: tried to make install do the right thing, exclude CVS dirs
13019 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
13020 Path would fit in more nicely.
13022 * all files that used to use pathstack: uses now Path instead.
13023 This change was a lot easier than expected.
13025 * src/support/path.h: new file
13027 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
13029 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
13031 * src/support/lyxstring.C (getline): Default arg was given for
13034 * Configure.cmd: removed file
13036 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13038 * src/support/DebugStream.[Ch]: remove the explicit std:: before
13039 streams classes and types, add the proper 'using' statements when
13040 MODERN_STL is defined.
13042 * src/debug.h: move the << operator definition after the inclusion
13045 * src/support/filetools.C: include "LAssert.h", which is needed
13048 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
13051 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
13052 include "debug.h" to define a proper ostream.
13054 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
13056 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
13057 method to the SystemCall class which can kill a process, but it's
13058 not fully implemented yet.
13060 * src/*.C: Changed Systemcalls::Startscript() to startscript()
13062 * src/support/FileInfo.h: Better documentation
13064 * src/lyxfunc.C: Added support for buffer-export html
13066 * src/menus.C: Added Export->As HTML...
13068 * lib/bind/*.bind: Added short-cut for buffer-export html
13070 * src/lyxrc.*: Added support for new \tth_command
13072 * lib/lyxrc.example: Added stuff for new \tth_command
13074 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
13076 * lib/Makefile.am (IMAGES): removed images/README
13077 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
13078 installes in correct place. Check permisions is installed
13081 * src/LaTeX.C: some no-op changes moved declaration of some
13084 * src/LaTeX.h (LATEX_H): changed include guard name
13086 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13088 * lib/reLyX/Makefile.am: install noweb2lyx.
13090 * lib/Makefile.am: install configure.
13092 * lib/reLyX/configure.in: declare a config aux dir; set package
13093 name to lyx (not sure what the best solution is); generate noweb2lyx.
13095 * lib/layouts/egs.layout: fix the bibliography layout.
13097 1999-10-08 Jürgen Vigna <jug@sad.it>
13099 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
13100 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
13101 it returned without continuing to search the path.
13103 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
13105 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
13106 also fixes a bug. It is not allowed to do tricks with std::strings
13107 like: string a("hei"); &a[e]; this will not give what you
13108 think... Any reason for the complexity in this func?
13110 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
13112 * Updated README and INSTALL a bit, mostly to check that my
13113 CVS rights are correctly set up.
13115 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
13117 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
13118 does not allow '\0' chars but lyxstring and std::string does.
13120 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
13122 * autogen.sh (AUTOCONF): let the autogen script create the
13123 POTFILES.in file too. POTFILES.in should perhaps now not be
13124 included in the cvs module.
13126 * some more files changed to use C++ includes instead of C ones.
13128 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
13130 (Reread): added tostr to nlink. buggy output otherwise.
13131 (Reread): added a string() around szMode when assigning to Buffer,
13132 without this I got a log of garbled info strings.
13134 * acconfig.h: commented out the PTR_AS_INT macros. They should not
13137 * I have added several ostream & operator<<(ostream &, some_type)
13138 functions. This has been done to avoid casting and warnings when
13139 outputting enums to lyxerr. This as thus eliminated a lot of
13140 explicit casts and has made the code clearer. Among the enums
13141 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
13142 mathed enums, some font enum the Debug::type enum.
13144 * src/support/lyxstring.h (clear): missing method. equivalent of
13147 * all files that contained "stderr": rewrote constructs that used
13148 stderr to use lyxerr instead. (except bmtable)
13150 * src/support/DebugStream.h (level): and the passed t with
13151 Debug::ANY to avoid spurious bits set.
13153 * src/debug.h (Debug::type value): made it accept strings of the
13154 type INFO,INIT,KEY.
13156 * configure.in (Check for programs): Added a check for kpsewhich,
13157 the latex generation will use this later to better the dicovery of
13160 * src/BufferView.C (create_view): we don't need to cast this to
13161 (void*) that is done automatically.
13162 (WorkAreaButtonPress): removed some dead code.
13164 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13166 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13167 is not overwritten when translated (David Sua'rez de Lis).
13169 * lib/CREDITS: Added David Sua'rez de Lis
13171 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13173 * src/bufferparams.C (BufferParams): default input encoding is now
13176 * acinclude.m4 (cross_compiling): comment out macro
13177 LYX_GXX_STRENGTH_REDUCE.
13179 * acconfig.h: make sure that const is not defined (to empty) when
13180 we are compiling C++. Remove commented out code using SIZEOF_xx
13183 * configure.in : move the test for const and inline as late as
13184 possible so that these C tests do not interefere with C++ ones.
13185 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13186 has not been proven.
13188 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13190 * src/table.C (getDocBookAlign): remove bad default value for
13191 isColumn parameter.
13193 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13195 (ShowFileMenu2): ditto.
13197 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13198 of files to ignore.
13200 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13202 * Most files: finished the change from the old error code to use
13203 DebugStream for all lyxerr debugging. Only minor changes remain
13204 (e.g. the setting of debug levels using strings instead of number)
13206 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13208 * src/layout.C (Add): Changed to use compare_no_case instead of
13211 * src/FontInfo.C: changed loop variable type too string::size_type.
13213 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13215 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13216 set ETAGS_ARGS to --c++
13218 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13220 * src/table.C (DocBookEndOfCell): commented out two unused variables
13222 * src/paragraph.C: commented out four unused variables.
13224 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13225 insed a if clause with type string::size_type.
13227 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13230 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13232 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13233 variable, also changed loop to go from 0 to lenght + 1, instead of
13234 -1 to length. This should be correct.
13236 * src/LaTeX.C (scanError): use string::size_type as loop variable
13239 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13240 (l.896) since y_tmp and row was not used anyway.
13242 * src/insets/insetref.C (escape): use string::size_type as loop
13245 * src/insets/insetquotes.C (Width): use string::size_type as loop
13247 (Draw): use string::size_type as loop variable type.
13249 * src/insets/insetlatexaccent.C (checkContents): use
13250 string::size_type as loop variable type.
13252 * src/insets/insetlabel.C (escape): use string::size_type as loop
13255 * src/insets/insetinfo.C: added an extern for current_view.
13257 * src/insets/insetcommand.C (scanCommand): use string::size_type
13258 as loop variable type.
13260 * most files: removed the RCS tags. With them we had to recompile
13261 a lot of files after a simple cvs commit. Also we have never used
13262 them for anything meaningful.
13264 * most files: tags-query-replace NULL 0. As adviced several plases
13265 we now use "0" instead of "NULL" in our code.
13267 * src/support/filetools.C (SpaceLess): use string::size_type as
13268 loop variable type.
13270 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13272 * src/paragraph.C: fixed up some more string stuff.
13274 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13276 * src/support/filetools.h: make modestr a std::string.
13278 * src/filetools.C (GetEnv): made ch really const.
13280 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13281 made code that used these use max/min from <algorithm> instead.
13283 * changed several c library include files to their equivalent c++
13284 library include files. All is not changed yet.
13286 * created a support subdir in src, put lyxstring and lstrings
13287 there + the extra files atexit, fileblock, strerror. Created
13288 Makefile.am. edited configure.in and src/Makefile.am to use this
13289 new subdir. More files moved to support.
13291 * imported som of the functions from repository lyx, filetools
13293 * ran tags-query-replace on LString -> string, corrected the bogus
13294 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13295 is still some errors in there. This is errors where too much or
13296 too litle get deleted from strings (string::erase, string::substr,
13297 string::replace), there can also be some off by one errors, or
13298 just plain wrong use of functions from lstrings. Viewing of quotes
13301 * LyX is now running fairly well with string, but there are
13302 certainly some bugs yet (see above) also string is quite different
13303 from LString among others in that it does not allow null pointers
13304 passed in and will abort if it gets any.
13306 * Added the revtex4 files I forgot when setting up the repository.
13308 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13310 * All over: Tried to clean everything up so that only the files
13311 that we really need are included in the cvs repository.
13312 * Switched to use automake.
13313 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13314 * Install has not been checked.
13316 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13318 * po/pt.po: Three errors:
13319 l.533 and l.538 format specification error
13320 l. 402 duplicate entry, I just deleted it.