1 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
3 * lib/ui/default.ui: small grammatical change.
5 * src/frontends/xforms/xform_macros.h: removed.
7 * src/frontends/xforms/FormBase.C:
8 * src/frontends/xforms/FormPreferences.C:
9 * src/frontends/xforms/Makefile.am: changes associated with removing
10 xform_macros.h. Should make Lars' debugging a little easier.
12 * src/frontends/xforms/FormPreferences.C:
13 * src/frontends/xforms/FormPreferences.h:
14 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
15 longer use X11 color name database. HSV and RGB dials/sliders.
16 Please let this be the end of this!
18 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
20 * Several files: Allow compilation when the compiler doesn't
23 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
26 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
29 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
31 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
32 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
35 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
37 * src/frontends/xforms/FormRef.C (updateBrowser):
38 * src/frontends/xforms/forms/form_ref.fd: try clicking on
39 different insets with the sort key active. Now apply this patch!
41 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
43 * src/frontends/xforms/FormPrint.C: set to valid()
44 when we update from the passed parameters.
46 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
48 * src/LColor.C (getFromGUIName): internationalise the comparison.
50 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
51 FormPreferences choice.
53 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
56 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
58 * src/lyxrc.C: more detail for the printer program config
61 * src/LColor.C: ert->latex text. LColor needs a big revamp
62 but will have to wait till after 1.1.6
64 * src/buffer.C: bring up a dialog if we load a document
65 with an un-installed text class, rather than just complain
68 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
70 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
71 the browser form for a combox in a tabbed folder. Bug fix courtesy of
72 Steve Lamont <spl@ncmir.ucsd.edu>.
74 * src/frontends/xforms/FormDocument.C (build):
75 * src/frontends/xforms/FormPreferences.C (Language::build):
76 pass tabfolders to Combox::add() in order to use this work around.
78 * src/frontends/xforms/FormCitation.C (connect): remove max size
80 (update): sort list of bibliography keys.
82 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
84 No max size limitation. Same popup for new and existing insets. Fixes
85 bugs reported by Rob Lahaye.
87 * src/frontends/xforms/FormCitation.C (c-tor):
88 * src/frontends/xforms/FormCopyright.C (c-tor):
89 * src/frontends/xforms/FormError.C (c-tor):
90 * src/frontends/xforms/FormGraphics.C (c-tor):
91 * src/frontends/xforms/FormIndex.C (c-tor):
92 * src/frontends/xforms/FormRef.C (c-tor):
93 * src/frontends/xforms/FormToc.C (c-tor):
94 * src/frontends/xforms/FormUrl.C (c-tor):
95 use correct policy for ButtonController.
97 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
99 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
102 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
104 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
105 Some resizing changes.
107 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
109 * configure.in: fix typo
111 * lib/languages: add ukraninian and change no to no_NO
113 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
115 * src/bufferview_funcs.C (FontSize): use setLyXSize
117 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
119 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
120 to check for systems where mkstemp() is available but not declared
121 in headers. The new autoconf macro lyx_CHECK_DECL can be used
122 to check for declarations in headers.
124 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
126 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
128 * forms/makefile: added bibforms.fd, include_form.fd.
129 Removed lyx_sendfax.fd.
131 * src/LaTeXLog.C (ShowLatexLog):
132 * src/LyXAction.C (init):
133 * src/bufferparams.C (readLanguage): altered messages as suggested by
136 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
139 * src/credits.C: made fd_form_credits non-static, so that it can be
140 redrawn should the xforms colors be re-mapped.
141 * src/spellchecker.C ditto fd_form_spell_options.
143 * src/filedlg.[Ch] (redraw):
144 * src/intl.[Ch] (redraw):
145 * src/lyxfr0.[Ch] (redraw):
146 * src/insets/figinset.[Ch] (redraw):
147 * src/insets/insetexternal.[Ch] (redraw):
148 new methods, connected to Dialogs::redrawGUI.
150 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
151 to be connected to Dialogs::redrawGUI.
153 * src/frontends/xforms/FormCitation.C (build):
154 * src/frontends/xforms/FormCopyright.C (build):
155 * src/frontends/xforms/FormError.C (build):
156 * src/frontends/xforms/FormGraphics.C (build):
157 * src/frontends/xforms/FormIndex.C (build):
158 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
159 * src/frontends/xforms/FormToc.C (build):
160 * src/frontends/xforms/FormUrl.C (build):
161 use the ButtonController correctly.
163 * src/frontends/xforms/FormCopyright.C (build):
164 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
165 the .fd file and into build().
167 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
169 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
171 * src/frontends/xforms/forms/form_citation.fd:
172 * src/frontends/xforms/forms/form_copyright.fd:
173 * src/frontends/xforms/forms/form_error.fd:
174 * src/frontends/xforms/forms/form_graphics.fd:
175 * src/frontends/xforms/forms/form_index.fd:
176 * src/frontends/xforms/forms/form_toc.fd:
177 * src/frontends/xforms/forms/form_url.fd:
178 renamed some of the objects. Named others explicitly for the first time.
179 Added Restore and Apply buttons where appropriate.
181 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
184 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
186 * src/version.h: try the pre2 again
188 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
190 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
192 * src/frontends/kde/FormParagraph.C: added using directive.
194 * src/frontends/kde/paradlg.C: added config.h and using directive.
196 * src/frontends/kde/paradlg.h: added std::qualifier.
198 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
200 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
202 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
204 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
206 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
208 * src/version.h: set back to 1.1.6cvs
210 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
212 * src/version.h: set to 1.1.6pre2
214 2000-11-20 Marko Vendelin <markov@ioc.ee>
216 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
218 * src/frontends/gnome/Makefile.am: updated list of XForms object files
220 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
222 * src/LColor.C (init):
223 * src/lyxrc.C (getDescription): changed some comments as suggested by
226 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
227 disconnect the redrawGUI signal in best-practice fashion.
229 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
230 long_opts_tab to reflect the change in name of this tabfolder, as
231 suggested by John Levon.
232 (connect, disconnect): new methods. Don't do much at present other than
233 ensuring that we can't resize the dialog. This just makes xforms go
235 (lots of methods in Colors): made void rather than bool. The idea is
236 to have an isOk() function that keeps track of whether any input is
237 genuinely invalid and should therefore block Save, Apply.
238 Easier to manipulate the counters rapidly.
239 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
240 compiler will like this code. Much cleaner way of doing things.
242 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
244 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
245 rather than simple counters, following suggestion by John Levon.
247 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
248 than engraved frame + text.
250 * src/frontends/xforms/forms/makefile: removed spurious command.
252 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
254 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
256 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
259 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
261 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
262 see what Lars has changed and what is just white space!
263 Now used X directly to ascertain the RGB color associated with the
265 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
267 Added some sort capability.
268 The X11 color name database input is only displayed if the database
269 isn't found in the standard place.
270 Got rid of struct compare_converter; it wasn't used.
271 Probably some other stuff that I've forgotten.
273 * src/frontends/xforms/FormPreferences.h: changed the names of some
274 methods in the Colors struct. Added a couple of structs to help sort
275 colors by name and by RGBColor.
277 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
278 functions into a new class RWInfo.
280 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
281 The dialog is now almost navigable using the keyboard. Unfortunately,
282 the cursor has to be inside a browser for it to be activated. There is
283 no visual feedback for the key shortcuts to the arrow keys (use
284 Alt-appropriate arrow key, Alt-x).
286 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
289 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
290 xform_helpers.[Ch]. See above.
292 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
294 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
296 * src/screen.C (setCursorColor): new method. Sets the color of the
298 (ShowManualCursor): call it.
299 Constify some local variables.
301 * src/LColor.[Ch] (LColor): add entry for cursor
302 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
305 2000-11-19 Juergen Vigna <jug@sad.it>
307 * src/insets/insettabular.C (draw): fixed text border redraw problem.
308 (calculate_dimensions_of_cells): try to boost up when inserting chars.
310 2000-11-15 Rob Lahaye <lahaye@postech.edu>
312 * lib/ui/default.ui: OptItem used for Fax entry
314 2000-11-17 Matej Cepl <cepl@bigfoot.com>
316 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
318 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
320 * src/vspace.C (nextToken): fix so it can handle length phrases like
321 "10mm+-20mm", "40inplus16mmminus10cm" etc.
323 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
325 * src/frontends/xforms/FormPreferences.C: constify several variables
326 (BrowserLyX): rewrite to not need the choice variable
327 (Modify): rewrite to not need the choide variable
328 (compare_converter): make operator const
330 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
331 correct the writing of \set_color
332 (getDescription): return a const string
334 * src/kbsequence.[Ch] (addkey): remove dead code
336 * src/Painter.C (text): remove some commented code
338 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
340 * src/ColorHandler.[Ch]: removed some header files from .h file.
341 Included LColor.h in .C file.
343 * src/LColor.[Ch]: made class copyable so that I could create a
344 system_lcolor instance.
346 * src/Painter.h: removed LColor.h.
348 * src/lyx_gui.C (create_forms): used AddName.
350 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
351 of user preferences/lyxrc file.
353 * src/lyxrc.C (output): output changes to lcolor.
355 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
357 Moved class xformColor to files xform_helpers.[Ch]. These files,
358 Color.[Ch], could now be moved into src if they would be useful to
361 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
362 Also moved FormPreferences::browseFile here as it can be used by any
363 xform dialog with a "Browse" button. FormGraphics is a perfect example.
365 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
366 ReadableFile): changed the FormPreferences methods a little and moved
367 them here as they'll be useful elsewhere also.
369 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
370 Removed some header files and used forward declarations instead.
372 Removed some methods as they'll be useful elsewhere (see above).
374 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
375 Can also now modify the LyX LColors. However, for reasons that I don't
376 yet understand, it appears that we can use
377 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
378 present. The problem appears to lie in ColorHandler, because I can
379 change the color using LColor.SetColor(). Similarly, when reading in a
380 preferences file with some set_color instances, I'll get a warning
381 like: Color sea green is undefined or may not be redefined
382 Bad lyxrc set_color for sea green
384 Once the buffer is loaded, however, I can happily change to this color.
386 Finally, it appears that I have to set the color of "inset frame"
387 explicitly, or it oscillates from "black" to "indian red" with each
390 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
392 * ANNOUNCE: corrected a spelling mistake.
394 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
397 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
399 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
401 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
404 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
405 match the requirements from the standard better. This is required
406 to work with gnu libstdc++-v3
408 * src/frontends/xforms/FormPreferences.C: add explict pair
409 arguments to browse calls. include support/lyxmanip.h remvoe
410 extern fmt. whitespace changes. reorder variables in
411 FormPreferences.h, to match initalizaton order.
413 * several files: constify more local variables.
415 * src/buffer.C: remove some commented functions.
417 * src/DepTable.C (remove_files_with_extension): temporary
418 work around for gcc 2.97
419 * src/filedlg.C (find): ditto
420 * src/Variables.C (set): ditto
421 * src/LyXAction.C (searchActionArg): ditto
422 (retrieveActionArg): ditto
424 * configure.in: check for mktemp too
426 * UPGRADING: prepare for 1.1.6
428 * Makefile.am (lgbtags): add backup tags for when etags are
429 different than usual.
431 * ANNOUNCE: prepare for 1.1.6
433 * src/support/tempname.C (make_tempfile): new function, wrapper
434 around mkstemp and mktemp. Only mkstemp has been tested.
437 2000-11-14 Rob Lahaye <lahaye@postech.edu>
439 * default.ui: capitalized some menu items to improve shortcuts.
441 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
443 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
445 * src/frontends/xforms/Dialogs.C: add "using" directive.
447 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
449 * src/filedlg.C (Select): highlight suggested file in browser, if
452 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
453 each tab folder is encapsulated in its own class.
454 The Language keymaps are now chosen using a text input and a
455 browser button, rather than a Combox.
456 All the browser buttons are now functional, although LyXFileDlg
457 still needs to be modified to make it straighhtforward to return a
458 directory if that is what is desired.
460 * src/frontends/xforms/forms/form_preferences.fd: use text input
461 and browse button to input the Language keymaps. Add a few
462 callbacks for the browse buttons.
464 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
466 * src/support/tempname.C (tempName): small changes to make it
467 safer. remove the '.' before XXXXXX
469 * src/support/filetools.C (TmpFileName): remove func
472 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
473 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
474 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
475 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
477 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
480 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
483 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
484 for bp (this fixes a reproducible hard crash)
486 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
489 * src/frontends/xforms/FormBase.h: make bp_ private
490 (FormBaseBI): remove default for bp
493 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
496 * src/frontends/xforms/Color.C (RGBColor): made several vars
497 const, changed initialization of j to allow it to be const
500 * several files: added const to local variables.
502 * src/lyx_cb.C: removed several function prototypes and moved them
506 (UpdateLayoutPreamble):
508 (MenuInsertLabel): add BufferView as arguemnt
509 (LayoutsCB): make tmp const
511 * src/layout_forms.h: regenerated
513 * src/debug.C: add Debug::FILES
514 (showLevel) (showTags): translate the desc
516 * src/debug.h: add FILES as debug target
518 * src/bufferlist.C: use current_view as an interim measure becuase
519 of added arguments to MenuWrite and MenuWriteAs
521 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
523 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
525 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
526 libstdc++ is compiled with.
528 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
530 * lib/layouts/docbook-book.layout
531 * lib/layouts/docbook.layout
532 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
533 those paragraphs are expresse as SGML comments <!-- -->.
535 * src/LaTeXFeatures.h
536 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
537 parameter, this allows to express all the include files as relative
538 paths to the master buffer. The verbatim insert works as the other
541 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
543 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
545 (MakeDocBookFile): top_element is always written. Some clean up, as
546 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
548 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
549 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
550 a reference is written instead of the name.
551 (Validate): use the relative path for the filename.
553 * src/insets/insetlabel.C (DocBook): write end tag, for XML
556 * src/support/filetools.h
557 * src/support/filetools.C (IsSGMLFilename): added.
560 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
562 * development/OS2/quick_fix.patch:
564 * README.OS2: quick update to the OS/2 port.
566 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
568 * src/converter.C: add "using" directive.
570 * src/frontends/xforms/FormPreferences.C: add "using" directive.
571 (compare_converter): add "int" as return type.
573 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
576 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
578 * src/lyx_gui.C (create_forms): map the xform colours, should a
579 mapping exist. Ie, call XformColor::read().
581 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
582 and struct HSV as HSVColor.
583 (XformColor::read, XformColor::write) : new methods that
584 input/output any changes to the cform GUI colors.
586 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
589 * src/frontends/xforms/FormPreferences.C Lots of little changes
590 associated with the changed name of the RGB and HSV structs. Can
591 now save changes to xforms GUI to file. Commented out
592 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
593 used currently anyway.
595 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
597 * src/converter.C: A lot of changes:
598 - It is no longer possible to choose between two or more ways to
599 export to some format (the new code uses only the shortest path).
600 However, it is still possible to choose between pdflatex/ps2pdf
601 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
602 - Added several methods that makes the FormPreferences code simpler.
603 - Changed the tokens $$FName and $$OutName to $$i and $$o.
605 * src/exporter.C (Export): lyxrc.use_pdf is set before
606 makeLaTeXFile is called. This works but not very nice.
608 * src/frontends/xforms/FormPreferences.C: The formats/converters
609 tabs are now fully functional.
611 * src/buffer.C (getTocList): Add numbers to the captions.
613 * lib/lyxrc.example: Removed fax section
615 * src/support/rename.C (rename): Delete the old file if lyx::copy
618 2000-11-13 Rob Lahaye <lahaye@postech.edu>
620 * lib/ui/default.ui: minor polishing.
622 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
624 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
627 * lib/Makefile.am (DOCINST): do not install everything in the
628 documentation directory.
630 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
632 * src/bufferlist.C (newFile): set the filename to the constructed
635 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
636 constructed "newfileXX.lyx" name to the dialog
638 * src/frontends/DialogBase.h: make update() non-abstract so
639 KDE doesn't need to implement two update methods for every form
641 * src/frontends/kde/Makefile.am: add missing xforms objects
644 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
646 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
648 * src/frontends/xforms/Color.[Ch]: new files, defining the color
649 structs RGB and HSV. May not be the best place for these files.
650 Perhaps move them into src ?
652 * src/frontends/xforms/Makefile.am: added new files.
654 * src/frontends/xforms/forms/form_preferences.fd:
655 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
656 replaced all instances of "colour" with "color"!
658 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
661 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
662 tab. Can now alter the colors of the xform's GUI on the fly. With
663 the aid of a single static Signal (see below), can "Apply" these
664 changes to all currently open dialogs. (Well, to all of the NEW
665 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
666 subsequently opened dialogs will, of course, also have the new
667 color scheme. Cannot yet save (or load) the choices to file, so
668 they are lost when exiting LyX.
670 * src/frontends/Dialogs.h:
671 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
672 Used to trigger a redraw of any dialogs connected to it because,
673 for example, the GUI colours have been re-mapped.
675 * src/frontends/xforms/FormBase.[Ch]:
676 * src/frontends/xforms/FormDocument.[Ch]:
677 * src/frontends/xforms/FormParagraph.[Ch]:
678 * src/frontends/xforms/FormPreferences.[Ch]:
679 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
680 method, to be connected to Dialogs::redrawGUI. Method must be
681 virtual, because dialogs with tabbed folders need to redraw the
682 forms of each tab folder.
684 * src/LyXView.C (d-tor):
685 * src/frontends/xforms/FormBase.C (d-tor): connected
686 Dialogs::redrawGUI signal to redraw().
688 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
689 removed Assert, because it is identical to that in FormBase.
691 2000-11-10 Rob Lahaye <lahaye@postech.edu>
693 * lib/ui/default.ui: minor polishing.
695 2000-11-10 Juergen Vigna <jug@sad.it>
697 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
698 (deleteLyXText): ditto
700 * src/insets/insettabular.C (InsetButtonPress): don't clear the
701 selection on mouse-button-3.
703 * src/insets/insettabular.h: new function clearSelection(), use this
704 functions inside insettabular.C.
706 * src/insets/insettabular.C (TabularFeatures): clear the selection
707 on remove_row/column.
709 * src/insets/inset.C (scroll): fixed some scroll stuff.
711 * src/insets/insettabular.C (draw): fixed another minor draw problem.
713 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
715 * lib/CREDITS: add Yves Bastide
717 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
719 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
720 check whether C library functions are in the global namespace.
722 * configure.in: calls it.
724 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
727 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
729 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
730 iterators to prevent crash.
732 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
734 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
736 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
737 shortcut for xforms CB to the preemptive or post-handler function.
739 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
740 removed the HIDDEN_TIMER as it's no longer used.
741 Various other small changes.
743 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
744 preemptive handler to obtain feedback, rather than the post-handler.
745 (ColoursLoadBrowser): find "black" and "white" based on RGB values
747 Formats tab is now complete. Converters tab is nearly so.
749 2000-11-09 Juergen Vigna <jug@sad.it>
751 * src/insets/insettext.C (~InsetText):
754 (SetParagraphData): set cache.second to 0 after deleting it!
755 (getLyXText): check if cache.second is not 0 if finding it.
757 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
759 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
760 lyxlex to parse the rgb.txt file.
763 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
764 replace the default '#' comment character.
766 * src/support/tempname.C: add "using" directive
767 * src/frontends/ButtonPolicies.C: ditto.
769 * src/support/filetools.C (DirList): add an explicit cast to avoid
770 a compile error (probably not the right fix)
772 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
774 * src/support/filetools.C (DirList): implement using system functions
776 * src/support/tempname.C: new file
778 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
780 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
782 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
785 * src/frontends/xforms/ButtonController.C: new file
787 * src/os2_defines.h: remove getcwd define
789 * src/lyxvc.C: include support/lyxlib.h
790 (showLog): use lyx::tempName
792 * src/lyx_cb.C: comment out includes that we don't need
793 (AutoSave): use lyx::tempName
795 * src/filedlg.C: include support/lyxlib.h
796 (Reread): use lyx::getcwd
798 * src/converter.C: include support/filetools.h
799 (add_options): change to static inline, make tail const
800 (Add): make old_viewer const
801 (GetAllFormats): make it a const method, use const_iterator
802 (enable): make static inline
803 (SplitFormat): make using_format const
805 * src/LaTeX.C (run): use lyx::getcwd
807 * configure.in: check for mkstemp as well
809 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
811 * src/converter.[Ch] (GetAllCommands): new method.
813 * src/support/filetools.[Ch] (DirList): new method.
815 * src/frontends/xforms/FormPreferences.C: started (just!) adding
816 functionality to the converters tab.
817 The formats tab is now nearly complete.
818 The kbmap choices in Languages tab now display the contents of
819 system_lyxdir/kbd/*.kmap in readable form.
821 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
822 Moved some variables into the class.
824 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
825 inactive tab folder to FL_COL1. Haven't yet worked out how to change
826 colour of active folder to lighter grey instead. Any takers?
827 (form_colours): added an "Apply" button.
828 (form_converters): added a "Flags" input field.
829 (form_formats): added a "Shortcut" input field. Note that we can't use
830 names such as "input_shortcut" as this buggers up the sed script stuff.
832 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
840 * src/lyx_sendfax_main.C:
843 * src/spellchecker.C:
844 * src/insets/figinset.C:
845 * src/insets/insetbib.C:
846 * src/insets/insetexternal.C:
847 * src/insets/insetinclude.C:
848 * src/insets/insetinfo.C:
849 * src/mathed/math_panel.C:
850 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
851 all "daughter" dialogs now have identical "feel".
853 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
855 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
856 used (and was only used in one place prior to this patch. Incorrectly!)
858 * src/frontends/xforms/FormDocument.C: changed some instances of
859 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
860 sense. Also added fl_set_input_return() for class_->input_doc_extra and
861 for options_->input_float_placement. This fixes a bug reported by
864 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
865 functionality into d-tor.
867 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
868 input of numerals also.
870 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
871 fl_set_form_atclose(). Can now close dialog from window manager,
872 fixing a bug reported by Rob Lahaye.
874 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
876 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
877 are no longer dark. Haven't yet worked out how to lighten the colour of
878 the active tabfolder. Any ideas anybody?
879 Adjusted Colours tab a little.
880 Added Shortcut field to converters tab. Note that we can't create an
881 fdesign label like "input_shortcut" as this buggers up the sed-script
884 * src/frontends/xforms/FormPreferences.[Ch]:
885 (feedback): fixed crash due to to ob=0.
886 (LanguagesXXX): the kbmap choices now contain the files
887 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
888 be replaced by an input with a file browse button, but since the browse
889 buttons don'y yet work, this'll do for the moment.
890 (FormatsXXX): think that this is now nearly fully functional.
891 Some points/questions though:
892 1. Does "Apply" remove formats if no longer present?
893 2. I think that the browser should list the GUI names rather than the
895 3. Must ensure that we can't delete Formats used by an existing
898 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
899 if this is the best way to do this.
901 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
903 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
905 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
906 for variable assignment.
908 2000-11-07 Rob Lahaye <lahaye@postech.edu>
910 * src/lib/ui/default.ui: added sub/superscripts to menu as
911 Insert->Special characters and cleaned-up the file a bit
913 2000-11-07 Allan Rae <rae@lyx.org>
915 * src/frontends/xforms/FormPreferences.C (feedback): make sure
916 ob isn't 0 before using it. See comments in function.
918 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
920 * src/frontends/xforms/form_*.C: regenerated
922 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
924 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
926 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
927 compiling with gcc-2.96
929 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
931 * src/support/lyxstring.C: add a couple "using" directives.
933 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
934 a .c_str() here too for good measure.
935 * src/Spacing.C (set): ditto.
936 * src/lyxfunc.C (Dispatch): ditto.
938 * src/insets/insettabular.C (copySelection): change .str() to
939 .str().c_str() to fix problems with lyxstring.
940 * src/support/filetools.C (GetFileContents): ditto.
941 * src/buffer.C (asciiParagraph): ditto.
942 * src/paragraph.C (String): ditto.
944 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
945 * lib/bind/sciword.bind: ditto.
947 * src/LyXAction.C (init): remove "symbol-insert" function, which
948 shared LFUN_INSERT_MATH with "math-insert".
950 * lib/configure.m4: == is not a valid operator for command test.
952 * src/lyxrc.C: add using directive.
954 * src/converter.h: add std:: qualifier.
956 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
958 * src/converter.[Ch] and other files: Change the Format class to a
959 real class, and create two instances: formats and system_format.
961 * src/lyxrc.C (output): Output the difference between formats and
964 * src/frontends/xforms/FormPreferences.C (input): Simplify.
965 (buildFormats): Insert formats into browser.
966 (inputFormats): Made the browser and add button functional.
967 (applyFormats): Update formats from format_vec.
969 * src/converter.C: Changed all (*it). to it->
970 (Format::dummy): New method.
971 (Format::importer): New format flag.
972 (Formats::GetAllFormats): New method.
973 (Formats::Add): Delete format from the map if prettyname is empty.
974 (Converter::Convert): Print an error message if moving the file fails.
975 (Converter::GetReachableTo): New method
977 * src/MenuBackend.[Ch]: Add support for importformats tag.
979 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
981 * lib/configure.m4: Add word->tex and ps->fax converters.
983 * lib/ui/default.ui: Use ImportFormats on file->import menu.
984 Return fax to file menu.
988 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
990 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
993 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
996 * src/lyxfunc.C (processKeyEvent): removed
998 * src/bufferlist.C (emergencyWrite): removed the out commented
999 emergency write code.
1001 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1003 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1005 * many files: change formatting to be a bit more uniform for
1006 if,while,for,switch statements, remove some parantesis not needed.
1009 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1011 * config/kde.m4: make config more robust when KDEDIR is set
1013 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1015 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1016 not returned a pixmap for "math-insert".
1018 * src/LyXAction.C (init): sort the entries a bit.
1020 2000-11-03 Juergen Vigna <jug@sad.it>
1022 * src/insets/insettabular.h: added fixed number to update codes so
1023 that update is only in one direction.
1025 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1028 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1029 before call to edit because of redraw.
1031 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1033 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1035 * lib/ui/default.ui: Populate "edit_float" menu
1037 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1039 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1040 "floats-operate". The name is ugly (and the func also), but this
1041 is just a band-aid until we switch to new insets.
1043 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1045 * lib/ui/default.ui: update again the menu layout (fix some
1048 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1050 * src/MenuBackend.h (fulllabel): new method.
1052 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1053 the menu shortcuts of a menu are unique and whether they
1054 correspond to a letter of the label.
1055 (expand): call checkShortcuts when debugging.
1057 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1059 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1061 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1063 * lib/examples/*.lyx : '\language default' => '\language english'
1065 * lib/examples/it_splash.lyx : except where it should be italian
1067 * lib/templates/*.lyx : the same
1069 * doc/*.lyx* : the same
1071 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1073 * lib/bind/menus.bind: remove the Layout menu entries, which I
1074 somehow forgot earlier.
1076 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1078 * lib/ui/old-default.ui: keep the old one here for reference (to
1081 * lib/ui/default.ui: update the menu layout
1083 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1085 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1086 Can now Apply to different insets without closing the dialog.
1088 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1089 Can't actually DO anything with them yet, but I'd like a little
1092 * src/frontends/xforms/input_validators.[ch]
1093 (fl_lowercase_filter): new.
1095 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1097 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1098 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1100 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1102 2000-11-02 Juergen Vigna <jug@sad.it>
1104 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1105 on char insertion as it has already be updated by bv->updateInset().
1107 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1108 if an inset inside was updated.
1110 * lib/configure.cmd: commented out fax-search code
1112 2000-11-01 Yves Bastide <stid@acm.org>
1114 * src/tabular.C (OldFormatRead): set tabular language to the
1117 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1119 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1120 class names with non-letter characters (from Yves Bastide).
1122 * lib/ui/default.ui: change Item to OptItem in import menu.
1123 Comment out fax stuff.
1125 * lib/configure.m4: comment out fax-related stuff.
1127 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1129 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1130 useful xforms helper functions. At present contains only formatted().
1131 Input a string and it returns it with line breaks so that in fits
1134 * src/frontends/xforms/Makefile.am: add new files.
1136 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1137 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1140 * src/frontends/xforms/FormPreferences.[Ch]:
1141 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1142 but lots of little clean ups. Removed enum State. Make use of
1143 formatted(). Constify lots of methods. Perhaps best of all: removed
1144 requirement for that horrible reinterpret_cast from pointer to long in
1147 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1149 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1150 conditionalize build on xforms < 0.89
1152 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1154 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1156 * src/LyXAction.C (init): comment out fax
1158 * src/lyxrc.h: comment out the fax enums
1159 comment out the fax variables
1161 * src/commandtags.h: comment out LFUN_FAX
1163 * src/lyxrc.C: disable fax variables.
1164 (read): disable parsing of fax variables
1165 (output): disable writing of fax variables
1166 (getFeedback): now description for fax variables
1168 * src/lyxfunc.C: comment out MenuFax
1169 (Dispatch): disable LFUN_FAX
1171 * src/lyx_cb.C (MenuFax): comment out
1173 * src/WorkArea.C: add <cctype>
1174 (work_area_handler): better key handling, should be ok now.
1175 for accented chars + etc
1177 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1178 lyx_sendfax.h and lyx_sendfax_man.C
1180 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1181 (show): don't call InitLyXLookup when using xforms 0.89
1183 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1185 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1187 * src/support/filetools.C (GetFileContents): close to dummy change
1189 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1191 * src/trans.C (AddDeadkey): workaround stupid compilers.
1193 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1195 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1196 of two-sided document.
1198 2000-10-31 Juergen Vigna <jug@sad.it>
1200 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1202 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1203 xposition to the Edit call.
1205 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1207 * src/trans.C (AddDeadkey): cast explicitly to char.
1209 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1211 * src/tabular.C (AsciiBottomHLine): simplify?
1212 (AsciiTopHLine): simplify?
1213 (print_n_chars): simplify
1214 (DocBook): remove most of the << endl; we should flush the stream
1215 as seldom as possible.
1217 (TeXBottomHLine): ditto
1218 (TeXTopHLine): ditto
1220 (write_attribute): try a templified version.
1221 (set_row_column_number_info): lesson scope of variables
1223 * src/support/lstrings.h (tostr): new specialization of tostr
1225 * src/trans.C (AddDeadkey): slightly cleaner fix.
1227 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1229 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1230 '%%' in Toc menu labels.
1233 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1234 font_norm is iso10646-1.
1236 * src/font.C (ascent): Fixed for 16bit fonts
1237 (descent,lbearing,rbearing): ditto
1239 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1241 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1242 (getFeedback): new static method.
1244 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1245 Now use combox rather than choice to display languages.
1246 Feedback is now output using a new timer callback mechanism, identical
1247 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1249 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1251 * src/minibuffer.C: fix for older compilers
1253 2000-10-30 Juergen Vigna <jug@sad.it>
1255 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1256 has to be Left of the inset otherwise LyXText won't find it!
1258 * src/BufferView2.C (open_new_inset): delete the inset if it can
1261 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1263 * lyx.man: fix typo.
1265 2000-10-29 Marko Vendelin <markov@ioc.ee>
1266 * src/frontends/gnome/FormCitation.C
1267 * src/frontends/gnome/FormCitation.h
1268 * src/frontends/gnome/FormCopyright.C
1269 * src/frontends/gnome/FormCopyright.h
1270 * src/frontends/gnome/FormError.C
1271 * src/frontends/gnome/FormError.h
1272 * src/frontends/gnome/FormIndex.C
1273 * src/frontends/gnome/FormIndex.h
1274 * src/frontends/gnome/FormPrint.C
1275 * src/frontends/gnome/FormPrint.h
1276 * src/frontends/gnome/FormRef.C
1277 * src/frontends/gnome/FormRef.h
1278 * src/frontends/gnome/FormToc.C
1279 * src/frontends/gnome/FormToc.h
1280 * src/frontends/gnome/FormUrl.C
1281 * src/frontends/gnome/FormUrl.h
1282 * src/frontends/gnome/Menubar_pimpl.C
1283 * src/frontends/gnome/mainapp.C
1284 * src/frontends/gnome/mainapp.h
1285 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1286 changing update() to updateSlot() where appropriate
1288 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1290 * src/frontends/xforms/FormPreferences.[Ch]:
1291 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1294 2000-10-28 Juergen Vigna <jug@sad.it>
1296 * src/insets/insettabular.C (draw): fixed drawing bug.
1298 * src/insets/insettext.C (clear):
1300 (SetParagraphData): clearing the TEXT buffers when deleting the
1301 paragraphs used by it.
1303 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1305 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1307 2000-10-27 Juergen Vigna <jug@sad.it>
1309 * src/tabular.C (~LyXTabular): removed not needed anymore.
1311 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1314 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1316 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1319 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1322 * src/frontends/xforms/FormPreferences.[Ch]:
1323 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1324 Reorganised as modules based on tabs. Much easier to follow the
1325 flow and to add new tabs. Added warning and feedback messages.
1328 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1330 * src/tabular.h (DocBook): add std:: qualifier.
1332 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1334 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1335 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1338 * insettabular.C (DocBook): uses the tabular methods to export
1341 * src/insets/insettext.h
1342 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1344 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1346 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1349 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1350 moved misplaced AllowInput two lines up.
1352 * src/buffer.C (readFile): compare float with float, not with int
1354 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1356 * src/minibuffer.C: add "using SigC::slot" statement.
1358 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1360 * src/frontends/xforms/forms/README: updated section about make.
1362 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1363 Tidied some forms up, made two of form_tabular's tabs more
1364 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1365 fixed translation problem with "Column".
1367 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1369 * src/minibuffer.h: use Timeout instead of the xforms timer
1371 (setTimer) rewrite for the Timeout, change to unsigned arg
1372 (set): change to unsigned timer arg
1375 * src/minibuffer.C (TimerCB): removed func
1376 (C_MiniBuffer_TimerCB): removed func
1377 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1378 (peek_event): use a switch statement
1379 (add): don't use fl_add_timer.
1380 (Set): rewrite to use the Timeout
1383 * src/Timeout.[Ch] (setType): return a Timeout &
1384 (setTimeout): ditto, change to unsigned arg for timeout
1386 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1388 * src/mathed/formula.C (mathed_string_width): Use string instead
1389 of a constant size char array.
1391 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1393 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1394 the two recently added operator<< for SMInput and State.
1396 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1398 (OkCancelPolicy): ditto
1399 (OkCancelReadOnlyPolicy): ditto
1400 (NoRepeatedApplyReadOnlyPolicy): ditto
1401 (OkApplyCancelReadOnlyPolicy): ditto
1402 (OkApplyCancelPolicy): ditto
1403 (NoRepeatedApplyPolicy): ditto
1405 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1407 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1408 add the usual std:: qualifiers.
1410 2000-10-25 Juergen Vigna <jug@sad.it>
1412 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1414 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1416 * src/support/filetools.C (MakeRelPath): change some types to
1419 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1420 ButtonPolicy::SMInput and ButtonPolicy::State.
1422 * src/FontLoader.C (reset): small cleanup
1423 (unload): small cleanup
1425 * src/FontInfo.C (getFontname): initialize error to 10000.0
1427 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1429 * src/frontends/xforms/FormPreferences.[Ch]:
1430 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1431 TeX encoding and default paper size sections.
1433 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1435 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1438 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1439 make the message_ empty.
1440 (FormError): don't initialize message_ in initializer list.
1442 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1444 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1446 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1448 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1450 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1452 * src/frontends/kde/*data.[Ch]: _("") is not
1455 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1457 * src/buffer.C: removed redundant using directive.
1459 * src/frontends/DialogBase.h: revert to original definition of
1462 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1463 stuff into two classes, one for each dialog, requires a new
1464 element in the dialogs vector, FormTabularCreate.
1466 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1469 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1470 method. Continues Allan's idea, but means that derived classes
1471 don't need to worry about "update or hide?".
1473 * src/frontends/xforms/FormError.C (showInset): add connection
1476 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1477 one for each dialog. FormTabular now contains main tabular dialog
1480 * src/frontends/xforms/FormTabularCreate.[Ch]:
1481 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1484 * src/frontends/xforms/FormGraphics.[Ch]:
1485 * src/frontends/xforms/forms/form_graphics.fd
1486 * src/frontends/xforms/FormTabular.[Ch]:
1487 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1488 classes of FormInset.
1490 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1491 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1493 * src/frontends/xforms/Makefile.am:
1494 * src/frontends/xforms/forms/makefile: added new files.
1496 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1497 variable. added Signal0 hide signal, in keeping with other GUI-I
1500 * src/support/lstrings.h: removed redundant std:: qualifier as
1501 it's already declared in Lsstream.h.
1503 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1505 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1509 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1511 * src/tabular.C (Ascii): minimize scope of cell.
1513 * src/BufferView2.C (nextWord): return string() instead of 0;
1515 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1517 * src/converter.h: add a std:: qualifier
1519 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1521 * src/importer.[Ch]: New files. Used for importing files into LyX.
1523 * src/lyxfunc.C (doImport): Use the new Importer class.
1525 * src/converter.h: Add shortcut member to the Format class.
1526 Used for holding the menu shortcut.
1528 * src/converter.C and other files: Made a distinction between
1529 format name and format extension. New formats can be defined using
1530 the \format lyxrc tag.
1531 Added two new converter flags: latex and disable.
1533 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1535 * src/support/lyxlib.h: unify namespace/struct implementation.
1536 Remove extra declarations.
1538 * src/support/chdir.C (chdir): remove version taking char const *
1540 * src/support/rename.C: ditto.
1541 * src/support/lyxsum.C: ditto.
1543 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1545 * src/frontends/xforms/FormBase.[Ch]:
1546 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1547 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1548 work only for the next call to fl_show_form(). The correct place to set
1549 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1550 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1551 from FormBase have the minimum size set; no more stupid crashes with
1554 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1556 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1558 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1560 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1562 * src/support/lyxlib.h: changed second argument of mkdir to
1563 unsigned long int (unsigned int would probably have been enough,
1564 but...). Removed <sys/types.h> header.
1565 * src/support/mkdir.C (mkdir): ditto.
1569 2000-10-19 Juergen Vigna <jug@sad.it>
1571 * src/lyxfunc.C (MenuNew): small fix (form John)
1573 * src/screen.C (Update): removed unneeded code.
1575 * src/tabular.C (Ascii): refixed int != uint bug!
1577 * src/support/lyxlib.h: added sys/types.h include for now permits
1578 compiling, but I don't like this!
1580 2000-10-18 Juergen Vigna <jug@sad.it>
1582 * src/text2.C (ClearSelection): if we clear the selection we need
1583 more refresh so set the status apropriately
1585 * src/insets/insettext.C (draw): hopefully finally fixed draw
1588 2000-10-12 Juergen Vigna <jug@sad.it>
1590 * src/insets/insettext.C (draw): another small fix and make a block
1591 so that variables are localized.
1593 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1595 * src/support/lstrings.C (lowercase, uppercase):
1596 use explicit casts to remove compiler warnings.
1598 * src/support/LRegex.C (Impl):
1599 * src/support/StrPool.C (add):
1600 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1601 (AddPath, MakeDisplayPath):
1602 * src/support/lstrings.C (prefixIs, subst):
1603 use correct type to remove compiler warnings.
1605 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1607 * src/support/lyxlib.h:
1608 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1609 portability and to remove compiler warning with DEC cxx.
1611 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1613 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1615 * src/minibuffer.C (peek_event): retun 1 when there has been a
1616 mouseclick in the minibuffer.
1620 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1622 * src/frontends/xforms/FormParagraph.C: more space above/below
1625 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1627 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1628 a char only if real_current_font was changed.
1630 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1632 * NEWS: update somewhat for 1.1.6
1634 * lib/ui/default.ui: clean up.
1636 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1638 * lib/CREDITS: clean up
1640 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1642 * src/combox.[Ch] (select): changed argument back to int
1643 * src/combox.C (peek_event): removed num_bytes as it is declared but
1646 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1647 modified calls to Combox::select() to remove warnings about type
1650 * src/insets/insetbutton.C (width): explicit cast to remove warning
1651 about type conversion.
1653 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1656 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1657 sel_pos_end, refering to cursor position are changed to
1658 LyXParagraph::size_type.
1660 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1661 consistent with LyXCursor::pos().
1662 (inset_pos): changed to LyXParagraph::size_type for same reason.
1664 * src/insets/insettext.C (resizeLyXText): changed some temporary
1665 variables refing to cursor position to LyXParagraph::size_type.
1667 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1669 * src/frontends/kde/<various>: The Great Renaming,
1672 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1674 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1676 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1678 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1679 0 when there are no arguments.
1681 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1683 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1684 to segfaults when pressing Ok in InsetBibtex dialog.
1686 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1688 * forms/layout_forms.fd:
1689 * src/layout_forms.C (create_form_form_character): small change to use
1690 labelframe rather than engraved frame + text
1692 * src/lyx_gui.C (create_forms): initialise choice_language with some
1693 arbitrary value to prevent segfault when dialog is shown.
1695 2000-10-16 Baruch Even <baruch.even@writeme.com>
1697 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1698 is no resulting file. This pertains only to LaTeX output.
1700 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1702 * src/text.C (Backspace): Make sure that the row of the cursor is
1705 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1708 * src/lyx_gui.C (init): Prevent a crash when only one font from
1709 menu/popup fonts is not found.
1711 * lib/lyxrc.example: Add an example for binding a key for language
1714 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1716 * src/converter.C (GetReachable): Changed the returned type to
1718 (IsReachable): New method
1720 * src/MenuBackend.C (expand): Handle formats that appear more
1723 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1725 * src/frontends/support/Makefile.am
1726 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1729 * lib/CREDITS: add Garst Reese.
1731 * src/support/snprintf.h: add extern "C" {} around the definitions.
1733 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1735 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1738 * src/frontends/xforms/FormDocument.C:
1739 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1740 compile without "conversion to integral type of smaller size"
1743 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1745 * src/text.C (GetColumnNearX): Fixed disabled code.
1747 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1749 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1752 * src/support/snprintf.[ch]: new files
1754 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1756 * src/frontends/kde/formprintdialog.C: add
1757 file browser for selecting postscript output
1759 * src/frontends/kde/formprintdialogdata.C:
1760 * src/frontends/kde/formprintdialogdata.h: re-generate
1763 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1765 * src/frontends/gnome/Makefile.am:
1766 * src/frontends/kde/Makefile.am: FormCommand.C
1767 disappeared from xforms
1769 * src/frontends/kde/FormCitation.C:
1770 * src/frontends/kde/FormIndex.C: read-only
1773 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1775 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1778 * src/bufferlist.C: add using directive.
1780 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1782 * src/support/lyxfunctional.h: version of class_fun for void
1783 returns added, const versions of back_inseter_fun and compare_fun
1786 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1788 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1790 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1792 * ChangeLog: cleanup.
1794 * lib/CREDITS: update to add all the contributors we've forgotten.
1795 I have obviously missed some, so tell me whether there were
1798 2000-10-13 Marko Vendelin <markov@ioc.ee>
1800 * src/frontends/gnome/FormCitation.C
1801 * src/frontends/gnome/FormCitation.h
1802 * src/frontends/gnome/FormError.C
1803 * src/frontends/gnome/FormIndex.C
1804 * src/frontends/gnome/FormRef.C
1805 * src/frontends/gnome/FormRef.h
1806 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1808 * src/frontends/gnome/FormCitation.C
1809 * src/frontends/gnome/FormCopyright.C
1810 * src/frontends/gnome/FormError.C
1811 * src/frontends/gnome/FormIndex.C
1812 * src/frontends/gnome/FormRef.C
1813 * src/frontends/gnome/FormToc.C
1814 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1817 * src/frontends/gnome/Menubar_pimpl.C
1818 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1821 2000-10-11 Baruch Even <baruch.even@writeme.com>
1824 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1825 to convey its real action.
1827 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1828 clear the minibuffer and prepare to enter a command.
1830 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1831 the rename from ExecCommand to PrepareForCommand.
1832 * src/lyxfunc.C (Dispatch): ditto.
1834 2000-10-11 Baruch Even <baruch.even@writeme.com>
1836 * src/buffer.C (writeFile): Added test for errors on writing, this
1837 catches all errors and not only file system full errors as intended.
1839 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1841 * src/lyx_gui.C (create_forms): better fix for crash with
1842 translated interface.
1844 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1846 * src/frontends/kde/Makefile.am:
1847 * src/frontends/kde/FormCopyright.C:
1848 * src/frontends/kde/formcopyrightdialog.C:
1849 * src/frontends/kde/formcopyrightdialog.h:
1850 * src/frontends/kde/formcopyrightdialogdata.C:
1851 * src/frontends/kde/formcopyrightdialogdata.h:
1852 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1853 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1854 copyright to use qtarch
1856 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1858 * src/encoding.C (read): Fixed bug that caused an error message at
1859 the end of the file.
1861 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1863 * lib/lyxrc.example: Fixed hebrew example.
1865 2000-10-13 Allan Rae <rae@lyx.org>
1867 * src/frontends/xforms/FormPreferences.C (input): reworking the
1869 (build, update, apply): New inputs in various tabfolders
1871 * src/frontends/xforms/FormToc.C: use new button policy.
1872 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1873 dialogs that either can't use any existing policy or where it just
1876 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1879 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1880 added a bool parameter which is ignored.
1882 * src/buffer.C (setReadonly):
1883 * src/BufferView_pimpl.C (buffer):
1884 * src/frontends/kde/FormCopyright.h (update):
1885 * src/frontends/kde/FormCitation.[Ch] (update):
1886 * src/frontends/kde/FormIndex.[Ch] (update):
1887 * src/frontends/kde/FormPrint.[Ch] (update):
1888 * src/frontends/kde/FormRef.[Ch] (update):
1889 * src/frontends/kde/FormToc.[Ch] (update):
1890 * src/frontends/kde/FormUrl.[Ch] (update):
1891 * src/frontends/gnome/FormCopyright.h (update):
1892 * src/frontends/gnome/FormCitation.[Ch] (update):
1893 * src/frontends/gnome/FormError.[Ch] (update):
1894 * src/frontends/gnome/FormIndex.[Ch] (update):
1895 * src/frontends/gnome/FormPrint.[Ch] (update):
1896 * src/frontends/gnome/FormRef.h (update):
1897 * src/frontends/gnome/FormToc.[Ch] (update):
1898 * src/frontends/gnome/FormUrl.[Ch] (update):
1899 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1900 to updateBufferDependent and DialogBase
1902 * src/frontends/xforms/FormCitation.[hC]:
1903 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1904 * src/frontends/xforms/FormError.[Ch]:
1905 * src/frontends/xforms/FormGraphics.[Ch]:
1906 * src/frontends/xforms/FormIndex.[Ch]:
1907 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1908 and fixed readOnly handling.
1909 * src/frontends/xforms/FormPrint.[Ch]:
1910 * src/frontends/xforms/FormRef.[Ch]:
1911 * src/frontends/xforms/FormTabular.[Ch]:
1912 * src/frontends/xforms/FormToc.[Ch]:
1913 * src/frontends/xforms/FormUrl.[Ch]:
1914 * src/frontends/xforms/FormInset.[Ch]:
1915 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1916 form of updateBufferDependent.
1918 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1919 if form()->visible just in case someone does stuff to the form in a
1922 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1923 the buttoncontroller for everything the enum used to be used for.
1924 (update) It would seem we need to force all dialogs to use a bool
1925 parameter or have two update functions. I chose to go with one.
1926 I did try removing update() from here and FormBase and defining the
1927 appropriate update signatures in FormBaseB[DI] but then ran into the
1928 problem of the update() call in FormBase::show(). Whatever I did
1929 to get around that would require another function and that just
1930 got more confusing. Hence the decision to make everyone have an
1931 update(bool). An alternative might have been to override show() in
1932 FormBaseB[DI] and that would allow the different and appropriate
1935 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1936 true == buffer change occurred. I decided against using a default
1937 template parameter since not all compilers support that at present.
1939 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1941 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1942 army knife" by removing functionality.
1943 (clearStore): removed. All such housekeeping on hide()ing the dialog
1944 is to be carried out by overloaded disconnect() methods.
1945 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1946 superceded by Baruch's neat test (FormGraphics) to update an existing
1947 dialog if a new signal is recieved rather than block all new signals
1949 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1950 only to Inset dialogs.
1951 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1952 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1954 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1956 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1957 as a base class to all inset dialogs. Used solely to connect/disconnect
1958 the Inset::hide signal and to define what action to take on receipt of
1959 a UpdateBufferDependent signal.
1960 (FormCommand): now derived from FormInset.
1962 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1965 * src/frontends/xforms/FormCopyright.[Ch]:
1966 * src/frontends/xforms/FormPreferences.[Ch]:
1967 now derived from FormBaseBI.
1969 * src/frontends/xforms/FormDocument.[Ch]:
1970 * src/frontends/xforms/FormParagraph.[Ch]:
1971 * src/frontends/xforms/FormPrint.[Ch]:
1972 now derived from FormBaseBD.
1974 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1976 * src/frontends/xforms/FormCitation.[Ch]:
1977 * src/frontends/xforms/FormError.[Ch]:
1978 * src/frontends/xforms/FormRef.[Ch]:
1979 * src/frontends/xforms/FormToc.[Ch]:
1980 (clearStore): reworked as disconnect().
1982 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1985 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1987 * src/converter.C (runLaTeX): constify buffer argument
1990 * src/frontends/support/Makefile.am (INCLUDES): fix.
1992 * src/buffer.h: add std:: qualifier
1993 * src/insets/figinset.C (addpidwait): ditto
1994 * src/MenuBackend.C: ditto
1995 * src/buffer.C: ditto
1996 * src/bufferlist.C: ditto
1997 * src/layout.C: ditto
1998 * src/lyxfunc.C: ditto
2000 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2002 * src/lyxtext.h (bidi_level): change return type to
2003 LyXParagraph::size_type.
2005 * src/lyxparagraph.h: change size_type to
2006 TextContainer::difference_type. This should really be
2007 TextContainer::size_type, but we need currently to support signed
2010 2000-10-11 Marko Vendelin <markov@ioc.ee>
2011 * src/frontends/gnome/FormError.h
2012 * src/frontends/gnome/FormRef.C
2013 * src/frontends/gnome/FormRef.h
2014 * src/frontends/gnome/FormError.C
2015 * src/frontends/gnome/Makefile.am
2016 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2017 to Gnome frontend. Both dialogs use "action" area.
2019 2000-10-12 Baruch Even <baruch.even@writeme.com>
2021 * src/graphics/GraphicsCacheItem_pimpl.C:
2022 * src/graphics/Renderer.C:
2023 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2026 2000-10-12 Juergen Vigna <jug@sad.it>
2028 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2029 visible when selecting).
2031 * development/Code_rules/Rules: fixed some typos.
2033 2000-10-09 Baruch Even <baruch.even@writeme.com>
2035 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2036 compiling on egcs 1.1.2 possible.
2038 * src/filedlg.C (comp_direntry::operator() ): ditto.
2040 2000-08-31 Baruch Even <baruch.even@writeme.com>
2042 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2045 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2046 transient it now only gets freed when the object is destructed.
2048 2000-08-24 Baruch Even <baruch.even@writeme.com>
2050 * src/frontends/FormGraphics.h:
2051 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2054 2000-08-20 Baruch Even <baruch.even@writeme.com>
2056 * src/insets/insetgraphics.C:
2057 (draw): Added messages to the drawn rectangle to report status.
2058 (updateInset): Disabled the use of the inline graphics,
2061 2000-08-17 Baruch Even <baruch.even@writeme.com>
2063 * src/frontends/support: Directory added for the support of GUII LyX.
2065 * src/frontends/support/LyXImage.h:
2066 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2069 * src/frontends/support/LyXImage_X.h:
2070 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2071 version of LyXImage, this uses the Xlib Pixmap.
2073 * src/PainterBase.h:
2074 * src/PainterBase.C:
2076 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2077 replacement to Pixmap.
2079 * src/insets/insetgraphics.h:
2080 * src/insets/insetgraphics.C:
2081 * src/graphics/GraphicsCacheItem.h:
2082 * src/graphics/GraphicsCacheItem.C:
2083 * src/graphics/GraphicsCacheItem_pimpl.h:
2084 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2087 * src/graphics/GraphicsCacheItem.h:
2088 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2089 another copy of the object.
2091 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2092 of cacheHandle, this fixed a bug that sent LyX crashing.
2094 * src/graphics/XPM_Renderer.h:
2095 * src/graphics/XPM_Renderer.C:
2096 * src/graphics/EPS_Renderer.h:
2097 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2099 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2101 * src/lyxfunc.C (processKeySym): only handle the
2102 lockinginset/inset stuff if we have a buffer and text loaded...
2104 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2106 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2108 * src/support/lyxfunctional.h: add operator= that takes a reference
2110 * src/lyxserver.C (mkfifo): make first arg const
2112 * src/layout.h: renamed name(...) to setName(...) to work around
2115 * src/buffer.C (setFileName): had to change name of function to
2116 work around bugs in egcs. (renamed from fileName)
2118 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2120 * src/support/translator.h: move helper template classes to
2121 lyxfunctional.h, include "support/lyxfunctional.h"
2123 * src/support/lyxmanip.h: add delaration of fmt
2125 * src/support/lyxfunctional.h: new file
2126 (class_fun_t): new template class
2127 (class_fun): helper template function
2128 (back_insert_fun_iterator): new template class
2129 (back_inserter_fun): helper template function
2130 (compare_memfun_t): new template class
2131 (compare_memfun): helper template function
2132 (equal_1st_in_pair): moved here from translator
2133 (equal_2nd_in_pair): moved here from translator
2135 * src/support/fmt.C: new file
2136 (fmt): new func, can be used for a printf substitute when still
2137 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2139 * src/support/StrPool.C: add some comments
2141 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2144 * src/insets/figinset.C (addpidwait): use std::copy with
2145 ostream_iterator to fill the pidwaitlist
2147 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2149 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2152 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2155 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2157 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2158 (class_update): ditto
2159 (BulletPanel): ditto
2160 (CheckChoiceClass): move initialization of tc and tct
2162 * src/tabular.C: remove current_view
2163 (OldFormatRead): similar to right below [istream::ignore]
2165 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2166 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2167 unused [istream::ignore]
2169 * src/lyxfunc.C: include "support/lyxfunctional.h"
2170 (getInsetByCode): use std::find_if and compare_memfun
2172 * src/lyxfont.C (stateText): remove c_str()
2174 * src/lyx_main.C (setDebuggingLevel): make static
2175 (commandLineHelp): make static
2177 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2178 Screen* together with fl_get_display() and fl_screen
2180 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2181 togheter with fl_get_display() and fl_screen
2182 (create_forms): remove c_str()
2184 * src/layout.C: include "support/lyxfunctional.h"
2185 (hasLayout): use std::find_if and compare_memfun
2186 (GetLayout): use std::find_if and comapre_memfun
2187 (delete_layout): use std::remove_if and compare_memfun
2188 (NumberOfClass): use std:.find_if and compare_memfun
2190 * src/gettext.h: change for the new functions
2192 * src/gettext.C: new file, make _(char const * str) and _(string
2193 const & str) real functions.
2195 * src/font.C (width): rewrite slightly to avoid one extra variable
2197 * src/debug.C: initialize Debug::ANY here
2199 * src/commandtags.h: update number comments
2201 * src/combox.h (get): make const func
2203 (getline): make const
2205 * src/combox.C (input_cb): handle case where fl_get_input can
2208 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2209 "support/lyxfunctional.h", remove current_view variable.
2210 (resize): use std::for_each with std::mem_fun
2211 (getFileNames): use std::copy with back_inserter_fun
2212 (getBuffer): change arg type to unsigned int
2213 (emergencyWriteAll): call emergencyWrite with std::for_each and
2215 (emergencyWrite): new method, the for loop in emergencyWriteAll
2217 (exists): use std::find_if with compare_memfun
2218 (getBuffer): use std::find_if and compare_memfun
2220 * src/buffer.h: add typedefs for iterator_category, value_type
2221 difference_type, pointer and reference for inset_iterator
2222 add postfix ++ for inset_iterator
2223 make inset_iterator::getPos() const
2225 * src/buffer.C: added support/lyxmanip.h
2226 (readFile): use lyxerr << fmt instead of printf
2227 (makeLaTeXFile): use std::copy to write out encodings
2229 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2231 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2232 free and the char * temp.
2233 (hasMenu): use std::find_if and compare_memfun
2236 * src/Makefile.am (lyx_SOURCES): added gettext.C
2238 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2239 string::insert small change to avoid temporary
2241 * src/LColor.C (getGUIName): remove c_str()
2243 * several files: change all occurrences of fl_display to
2246 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2247 that -pedantic is not used for gcc 2.97 (cvs gcc)
2249 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2251 2000-10-11 Allan Rae <rae@lyx.org>
2253 * src/frontends/xforms/FormPreferences.C (input): template path must be
2254 a readable directory. It doesn't need to be writeable.
2255 (build, delete, update, apply): New inputs in the various tabfolders
2257 * src/frontends/xforms/forms/form_preferences.fd:
2258 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2259 several new entries to existing folders. Shuffled some existing stuff
2262 * src/frontends/xforms/forms/form_print.fd:
2263 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2264 Should probably rework PrinterParams as well. Note that the switch to
2265 collated is effectively the same as !unsorted so changing PrinterParams
2266 will require a lot of fiddly changes to reverse the existing logic.
2268 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2270 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2272 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2274 2000-10-10 Allan Rae <rae@lyx.org>
2277 * src/lyxfunc.C (Dispatch):
2279 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2282 * src/lyxrc.C (output): Only write the differences between system lyxrc
2283 and the users settings.
2286 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2288 I'll rewrite this later, after 1.1.6 probably, to keep a single
2289 LyXRC but two instances of a LyXRCStruct.
2291 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2293 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2295 * src/tabular.h: add a few std:: qualifiers.
2297 * src/encoding.C: add using directive.
2298 * src/language.C: ditto.
2300 * src/insets/insetquotes.C (Validate): use languages->lang()
2301 instead of only language.
2303 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2305 * lib/languages: New file.
2307 * lib/encodings: New file.
2309 * src/language.C (Languages): New class.
2310 (read): New method. Reads the languages from the 'languages' file.
2312 * src/encoding.C (Encodings): New class.
2313 (read): New method. Reads the encodings from the 'encodings' file.
2315 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2318 * src/bufferparams.h and a lot of files: Deleted the member language,
2319 and renamed language_info to language
2321 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2322 * src/lyxfont.C (latexWriteStartChanges): ditto.
2323 * src/paragraph.C (validate,TeXOnePar): ditto.
2325 * src/lyxfont.C (update): Restored deleted code.
2327 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2329 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2331 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2333 * src/insets/figinset.[Ch]:
2334 * src/insets/insetinclude.[Ch]:
2335 * src/insets/insetinclude.[Ch]:
2336 * src/insets/insetparent.[Ch]:
2337 * src/insets/insetref.[Ch]:
2338 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2340 * src/insets/*.[Ch]:
2341 * src/mathed/formula.[Ch]:
2342 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2344 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2345 * src/lyx_cb.C (FigureApplyCB):
2346 * src/lyxfunc.C (getStatus, Dispatch):
2347 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2350 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2352 * src/converter.[Ch] (Formats::View):
2353 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2355 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2356 *current_view->buffer(). This will change later, but this patch is way
2359 2000-10-09 Juergen Vigna <jug@sad.it>
2361 * src/text.C (GetRow): small fix.
2363 * src/BufferView_pimpl.C (cursorPrevious):
2364 (cursorNext): added LyXText parameter to function.
2366 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2367 keypress depending on cursor position.
2369 2000-10-06 Juergen Vigna <jug@sad.it>
2371 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2372 (copySelection): redone this function and also copy ascii representa-
2375 * src/tabular.C (Ascii):
2379 (print_n_chars): new functions to realize the ascii export of tabulars.
2381 2000-10-05 Juergen Vigna <jug@sad.it>
2383 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2384 if we don't have a buffer.
2386 2000-10-10 Allan Rae <rae@lyx.org>
2388 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2389 with closing dialog. It seems that nested tabfolders require hiding
2390 of inner tabfolders before hiding the dialog itself. Actually all I
2391 did was hide the active outer folder.
2393 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2394 unless there really is a buffer. hideBufferDependent is called
2397 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2398 POTFILES.in stays in $(srcdir).
2400 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2402 * lib/lyxrc.example: Few changes.
2404 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2406 * src/BufferView_pimpl.C (buffer): only need one the
2407 updateBufferDependent signal to be emitted once! Moved to the end of
2408 the method to allow bv_->text to be updated first.
2410 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2411 and hSignal_ with Dialogs * and BufferDependency variables.
2412 New Buffer * parent_, initialised when the dialog is launched. Used to
2413 check whether to update() or hide() dialog in the new, private
2414 updateOrHide() method that is connected to the updateBufferDependent
2415 signal. Daughter classes dictate what to do using the
2416 ChangedBufferAction enum, passed to the c-tor.
2418 * src/frontends/xforms/FormCitation.C:
2419 * src/frontends/xforms/FormCommand.C:
2420 * src/frontends/xforms/FormCopyright.C:
2421 * src/frontends/xforms/FormDocument.C:
2422 * src/frontends/xforms/FormError.C:
2423 * src/frontends/xforms/FormIndex.C:
2424 * src/frontends/xforms/FormPreferences.C:
2425 * src/frontends/xforms/FormPrint.C:
2426 * src/frontends/xforms/FormRef.C:
2427 * src/frontends/xforms/FormToc.C:
2428 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2431 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2432 ChangedBufferAction enum.
2434 * src/frontends/xforms/FormParagraph.[Ch]
2435 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2438 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2440 * lib/bind/cua.bind: fix a bit.
2441 * lib/bind/emacs.bind: ditto.
2443 * lib/bind/menus.bind: remove real menu entries from there.
2445 * src/spellchecker.C: make sure we only include strings.h when
2448 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2450 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2451 function. It enlarges the maximum number of pup when needed.
2452 (add_toc2): Open a new menu if maximum number of items per menu has
2455 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2457 * src/frontends/kde/FormPrint.C: fix error reporting
2459 * src/frontends/xforms/FormDocument.C: fix compiler
2462 * lib/.cvsignore: add Literate.nw
2464 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2467 * bufferview_funcs.[Ch]
2470 * text2.C: Add support for numbers in RTL text.
2472 2000-10-06 Allan Rae <rae@lyx.org>
2474 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2475 to be gettext.m4 friendly again. ext_l10n.h is now
2476 generated into $top_srcdir instead of $top_builddir
2477 so that lyx.pot will be built correctly -- without
2478 duplicate parsing of ext_l10n.h.
2480 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2482 * src/frontends/kde/FormCitation.C: make the dialog
2483 behave more sensibly
2485 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2487 * config/kde.m4: fix consecutive ./configure runs,
2488 look for qtarch, fix library order
2490 * src/frontends/kde/Makefile.am: tidy up,
2491 add Print dialog, add .dlg dependencies
2493 * src/frontends/kde/FormPrint.C:
2494 * src/frontends/kde/FormPrint.h:
2495 * src/frontends/kde/formprintdialog.C:
2496 * src/frontends/kde/formprintdialog.h:
2497 * src/frontends/kde/formprintdialogdata.C:
2498 * src/frontends/kde/formprintdialogdata.h:
2499 * src/frontends/kde/dlg/formprintdialog.dlg: add
2502 * src/frontends/kde/dlg/README: Added explanatory readme
2504 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2505 script to double-check qtarch's output
2507 * src/frontends/kde/formindexdialog.C:
2508 * src/frontends/kde/formindexdialogdata.C:
2509 * src/frontends/kde/formindexdialogdata.h:
2510 * src/frontends/kde/dlg/formindexdialog.dlg: update
2511 for qtarch, minor fixes
2513 2000-10-05 Allan Rae <rae@lyx.org>
2515 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2516 dialogs when switching buffers update them instead. It's up to each
2517 dialog to decide if it should still be visible or not.
2518 update() should return a bool to control visiblity within show().
2519 Or perhaps better to set a member variable and use that to control
2522 * lib/build-listerrors: create an empty "listerrors" file just to stop
2523 make trying to regenerate it all the time if you don't have noweb
2526 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2528 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2529 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2530 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2531 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2532 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2534 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2536 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2538 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2539 deleting buffer. Closes all buffer-dependent dialogs.
2541 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2543 * src/frontends/xforms/FormCitation.[Ch]:
2544 * src/frontends/xforms/FormPreferences.[Ch]:
2545 * src/frontends/xforms/FormPrint.[Ch]:
2546 * src/frontends/xforms/FormRef.[Ch]:
2547 * src/frontends/xforms/FormUrl.[Ch]: ditto
2549 * src/frontends/xforms/FormDocument.[Ch]:
2550 * src/frontends/xforms/forms/form_document.C.patch:
2551 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2552 pass through a single input() function.
2554 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2556 * lib/build-listerrors: return status as OK
2558 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2560 * lib/lyxrc.example: Updated to new export code
2562 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2564 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2567 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2570 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2571 LyX-Code is defined.
2572 * lib/layouts/amsbook.layout: ditto.
2574 * boost/Makefile.am: fix typo.
2576 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2578 (add_lastfiles): removed.
2579 (add_documents): removed.
2580 (add_formats): removed.
2582 * src/frontends/Menubar.C: remove useless "using" directive.
2584 * src/MenuBackend.h: add a new MenuItem constructor.
2586 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2589 2000-10-04 Allan Rae <rae@lyx.org>
2591 * lib/Makefile.am (listerrors):
2592 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2593 I haven't got notangle installed so Kayvan please test. The output
2594 should end up in $builddir. This also allows people who don't have
2595 noweb installed to complete the make process without error.
2597 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2598 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2599 by JMarc's picky compiler.
2601 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2604 * src/insets/insettabular.C (setPos): change for loop to not use
2605 sequencing operator. Please check this Jürgen.
2607 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2609 * src/insets/insetcite.C (getScreenLabel): ditto
2610 * src/support/filetools.C (QuoteName): ditto
2611 (ChangeExtension): ditto
2613 * src/BufferView_pimpl.C (scrollCB): make heigt int
2615 * src/BufferView2.C (insertInset): comment out unused arg
2617 * boost/Makefile.am (EXTRADIST): new variable
2619 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2621 * src/exporter.C (IsExportable): Fixed
2623 * lib/configure.m4: Small fix
2625 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2627 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2628 * src/insets/insetbib.C (bibitemWidest): ditto.
2629 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2631 2000-10-03 Juergen Vigna <jug@sad.it>
2633 * src/BufferView2.C (theLockingInset): removed const because of
2634 Agnus's compile problems.
2636 * src/insets/insettext.C (LocalDispatch): set the language of the
2637 surronding paragraph on inserting the first character.
2639 * various files: changed use of BufferView::the_locking_inset.
2641 * src/BufferView2.C (theLockingInset):
2642 (theLockingInset): new functions.
2644 * src/BufferView.h: removed the_locking_inset.
2646 * src/lyxtext.h: added the_locking_inset
2648 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2650 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2652 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2654 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2655 * src/mathed/math_cursor.C (IsAlpha): ditto.
2656 * src/mathed/math_inset.C (strnew): ditto.
2657 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2658 (IMetrics): cxp set but never used; removed.
2659 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2660 that the variable in question has been removed also!
2663 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2664 using the Buffer * passed to Latex(), using the BufferView * passed to
2665 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2667 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2668 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2670 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2671 * src/buffer.C (readInset): used new InsetBibtex c-tor
2672 * (getBibkeyList): used new InsetBibtex::getKeys
2674 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2677 * lib/build-listerrors
2679 * src/exporter.C: Add literate programming support to the export code
2682 * src/lyx_cb.C: Remove old literate code.
2684 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2687 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2688 * src/converter.C (View, Convert): Use QuoteName.
2690 * src/insets/figinset.C (Preview): Use Formats::View.
2692 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2694 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2696 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2697 the top of the function, because compaq cxx complains that the
2698 "goto exit_with_message" when the function is disabled bypasses
2700 (MenuNew): try a better fix for the generation of new file names.
2701 This time, I used AddName() instead of AddPath(), hoping Juergen
2704 2000-10-03 Allan Rae <rae@lyx.org>
2706 * src/frontends/xforms/forms/form_preferences.fd:
2707 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2708 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2709 "Look and Feel"->"General" but will need to be split up further into
2710 general output and general input tabs. Current plan is for four outer
2711 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2712 stuff; "Inputs" for input and import configuration; "Outputs" for
2713 output and export configuration; and one more whatever is left over
2714 called "General". The leftovers at present look like being which
2715 viewers to use, spellchecker, language support and might be better
2716 named "Support". I've put "Paths" in "Inputs" for the moment as this
2717 seems reasonable for now at least.
2718 One problem remains: X error kills LyX when you close Preferences.
2720 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2722 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2723 qualifier from form()
2724 * src/frontends/xforms/FormCitation.[Ch]:
2725 * src/frontends/xforms/FormCopyright.[Ch]:
2726 * src/frontends/xforms/FormDocument.[Ch]:
2727 * src/frontends/xforms/FormError.[Ch]:
2728 * src/frontends/xforms/FormIndex.[Ch]:
2729 * src/frontends/xforms/FormPreferences.[Ch]:
2730 * src/frontends/xforms/FormPrint.[Ch]:
2731 * src/frontends/xforms/FormRef.[Ch]:
2732 * src/frontends/xforms/FormToc.[Ch]:
2733 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2735 * src/frontends/xforms/FormCitation.[Ch]:
2736 * src/frontends/xforms/FormIndex.[Ch]:
2737 * src/frontends/xforms/FormRef.[Ch]:
2738 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2739 with Allan's naming policy
2741 * src/frontends/xforms/FormCitation.C: some static casts to remove
2744 2000-10-02 Juergen Vigna <jug@sad.it>
2746 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2747 now you can type or do stuff inside the table-cell also when in dummy
2748 position, fixed visible cursor.
2750 * src/insets/insettext.C (Edit): fixing cursor-view position.
2752 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2753 be used for equal functions in lyxfunc and insettext.
2755 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2757 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2759 * src/frontends/gnome/FormCitation.h:
2760 * src/frontends/gnome/FormCopyright.h:
2761 * src/frontends/gnome/FormIndex.h:
2762 * src/frontends/gnome/FormPrint.h:
2763 * src/frontends/gnome/FormToc.h:
2764 * src/frontends/gnome/FormUrl.h:
2765 * src/frontends/kde/FormCitation.h:
2766 * src/frontends/kde/FormCopyright.h:
2767 * src/frontends/kde/FormIndex.h:
2768 * src/frontends/kde/FormRef.h:
2769 * src/frontends/kde/FormToc.h:
2770 * src/frontends/kde/FormUrl.h: fix remaining users of
2773 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2775 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2776 from depth argument.
2777 (DocBookHandleCaption): ditto.
2778 (DocBookHandleFootnote): ditto.
2779 (SimpleDocBookOnePar): ditto.
2781 * src/frontends/xforms/FormDocument.h (form): remove extra
2782 FormDocument:: qualifier.
2784 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2786 * sigc++/handle.h: ditto.
2788 * src/lyx_gui_misc.C: add "using" directive.
2790 * src/cheaders/cstddef: new file, needed by the boost library (for
2793 2000-10-02 Juergen Vigna <jug@sad.it>
2795 * src/insets/insettext.C (SetFont): better support.
2797 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2799 * src/screen.C (DrawOneRow): some uint refixes!
2801 2000-10-02 Allan Rae <rae@lyx.org>
2803 * boost/.cvsignore: ignore Makefile as well
2805 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2806 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2808 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2809 Left this one out by accident.
2811 * src/frontends/xforms/FormBase.h (restore): default to calling
2812 update() since that will restore the original/currently-applied values.
2813 Any input() triggered error messages will require the derived classes
2814 to redefine restore().
2816 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2817 avoid a segfault. combo_doc_class is the main concern.
2819 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2821 * Simplify build-listerrors in view of GUI-less export ability!
2823 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2825 * src/lyx_main.C (easyParse): Disable gui when exporting
2827 * src/insets/figinset.C:
2830 * src/lyx_gui_misc.C
2831 * src/tabular.C: Changes to allow no-gui.
2833 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2835 * src/support/utility.hpp: removed file
2836 * src/support/block.h: removed file
2838 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2841 * src/mathed/formula.C: add support/lyxlib.h
2842 * src/mathed/formulamacro.C: ditto
2844 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2845 * src/lyxparagraph.h: ditto
2847 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2848 * src/frontends/Makefile.am (INCLUDES): ditto
2849 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2850 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2851 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2852 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2853 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2854 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2856 * src/BufferView.h: use boost/utility.hpp
2857 * src/LColor.h: ditto
2858 * src/LaTeX.h: ditto
2859 * src/LyXAction.h: ditto
2860 * src/LyXView.h: ditto
2861 * src/bufferlist.h: ditto
2862 * src/lastfiles.h: ditto
2863 * src/layout.h: ditto
2864 * src/lyx_gui.h: ditto
2865 * src/lyx_main.h: ditto
2866 * src/lyxlex.h: ditto
2867 * src/lyxrc.h: ditto
2868 * src/frontends/ButtonPolicies.h: ditto
2869 * src/frontends/Dialogs.h: ditto
2870 * src/frontends/xforms/FormBase.h: ditto
2871 * src/frontends/xforms/FormGraphics.h: ditto
2872 * src/frontends/xforms/FormParagraph.h: ditto
2873 * src/frontends/xforms/FormTabular.h: ditto
2874 * src/graphics/GraphicsCache.h: ditto
2875 * src/graphics/Renderer.h: ditto
2876 * src/insets/ExternalTemplate.h: ditto
2877 * src/insets/insetcommand.h: ditto
2878 * src/support/path.h: ditto
2880 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2881 and introduce clause for 2.97.
2883 * boost/libs/README: new file
2885 * boost/boost/utility.hpp: new file
2887 * boost/boost/config.hpp: new file
2889 * boost/boost/array.hpp: new file
2891 * boost/Makefile.am: new file
2893 * boost/.cvsignore: new file
2895 * configure.in (AC_OUTPUT): add boost/Makefile
2897 * Makefile.am (SUBDIRS): add boost
2899 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2901 * src/support/lstrings.C (suffixIs): Fixed.
2903 2000-10-01 Allan Rae <rae@lyx.org>
2905 * src/PrinterParams.h: moved things around to avoid the "can't
2906 inline call" warning.
2908 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2909 into doc++ documentation.
2911 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2913 * src/frontends/xforms/FormRef.C: make use of button controller
2914 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2915 cleaned up button controller usage.
2916 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2917 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2918 use the button controller
2920 * src/frontends/xforms/forms/*.fd: and associated generated files
2921 updated to reflect changes to FormBase. Some other FormXxxx files
2922 also got minor updates to reflect changes to FormBase.
2924 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2925 (hide): made virtual.
2926 (input): return a bool. true == valid input
2927 (RestoreCB, restore): new
2928 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2929 Changes to allow derived dialogs to use a ButtonController and
2930 make sense when doing so: OK button calls ok() and so on.
2932 * src/frontends/xforms/ButtonController.h (class ButtonController):
2933 Switch from template implementation to taking Policy parameter.
2934 Allows FormBase to provide a ButtonController for any dialog.
2936 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2937 Probably should rename connect and disconnect.
2938 (apply): use the radio button groups
2939 (form): needed by FormBase
2940 (build): setup the radio button groups
2942 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2944 * several files: type changes to reduce the number of warnings and
2945 to unify type hangling a bit. Still much to do.
2947 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2949 * lib/images/*: rename a bunch of icons to match Dekel converter
2952 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2955 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2957 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2959 * sigc++/handle.h: ditto for class Handle.
2961 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2963 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2965 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2967 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2968 removal of the "default" language.
2970 * src/combox.h (getline): Check that sel > 0
2972 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2974 * lib/examples/docbook_example.lyx
2975 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2977 * lib/layouts/docbook-book.layout: new docbook book layout.
2979 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2981 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2983 * src/insets/figinset.C (DocBook):fixed small typo.
2985 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2987 * src/insets/insetinclude.h: string include_label doesn't need to be
2990 2000-09-29 Allan Rae <rae@lyx.org>
2992 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2993 Allow derived type to control connection and disconnection from signals
2994 of its choice if desired.
2996 2000-09-28 Juergen Vigna <jug@sad.it>
2998 * src/insets/insettabular.C (update): fixed cursor setting when
2999 the_locking_inset changed.
3000 (draw): made this a bit cleaner.
3001 (InsetButtonPress): fixed!
3003 * various files: added LyXText Parameter to fitCursor call.
3005 * src/BufferView.C (fitCursor): added LyXText parameter.
3007 * src/insets/insettabular.C (draw): small draw fix.
3009 * src/tabular.C: right setting of left/right celllines.
3011 * src/tabular.[Ch]: fixed various types in funcions and structures.
3012 * src/insets/insettabular.C: ditto
3013 * src/frontends/xforms/FormTabular.C: ditto
3015 2000-09-28 Allan Rae <rae@lyx.org>
3017 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3018 that the #ifdef's had been applied to part of what should have been
3019 a complete condition. It's possible there are other tests that
3020 were specific to tables that are also wrong now that InsetTabular is
3021 being used. Now we need to fix the output of '\n' after a table in a
3022 float for the same reason as the original condition:
3023 "don't insert this if we would be adding it before or after a table
3024 in a float. This little trick is needed in order to allow use of
3025 tables in \subfigures or \subtables."
3026 Juergen can you check this?
3028 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3030 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3031 output to the ostream.
3033 * several files: fixed types based on warnings from cxx
3035 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3037 * src/frontends/kde/Makefile.am: fix rule for
3038 formindexdialogdata_moc.C
3040 * src/.cvsignore: add ext_l10n.h to ignore
3042 * acconfig.h: stop messing with __STRICT_ANSI__
3043 * config/gnome.m4: remove option to set -ansi
3044 * config/kde.m4: remove option to set -ansi
3045 * config/lyxinclude.m4: don't set -ansi
3047 2000-09-27 Juergen Vigna <jug@sad.it>
3049 * various files: remove "default" language check.
3051 * src/insets/insetquotes.C: removed use of current_view.
3053 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3054 the one should have red ears by now!
3056 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3057 in more then one paragraph. Fixed cursor-movement/selection.
3059 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3060 paragraphs inside a text inset.
3062 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3063 text-inset if this owner is an inset.
3065 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3067 * src/Bullet.h: changed type of font, character and size to int
3069 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3071 * src/insets/inseturl.[Ch]:
3072 * src/insets/insetref.[Ch]:
3073 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3075 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3077 * src/buffer.C (readFile): block-if statement rearranged to minimise
3078 bloat. Patch does not reverse Jean-Marc's change ;-)
3080 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3081 Class rewritten to store pointers to hide/update signals directly,
3082 rather than Dialogs *. Also defined an enum to ease use. All xforms
3083 forms can now be derived from this class.
3085 * src/frontends/xforms/FormCommand.[Ch]
3086 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3088 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3091 * src/frontends/xforms/forms/form_citation.fd
3092 * src/frontends/xforms/forms/form_copyright.fd
3093 * src/frontends/xforms/forms/form_error.fd
3094 * src/frontends/xforms/forms/form_index.fd
3095 * src/frontends/xforms/forms/form_ref.fd
3096 * src/frontends/xforms/forms/form_toc.fd
3097 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3099 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3101 * src/insets/insetfoot.C: removed redundent using directive.
3103 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3105 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3106 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3108 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3109 created in the constructors in different groups. Then set() just
3110 have to show the groups as needed. This fixes the redraw problems
3111 (and is how the old menu code worked).
3113 * src/support/lyxlib.h: declare the methods as static when we do
3114 not have namespaces.
3116 2000-09-26 Juergen Vigna <jug@sad.it>
3118 * src/buffer.C (asciiParagraph): new function.
3119 (writeFileAscii): new function with parameter ostream.
3120 (writeFileAscii): use now asciiParagraph.
3122 * various inset files: added the linelen parameter to the Ascii-func.
3124 * src/tabular.C (Write): fixed error in writing file introduced by
3125 the last changes from Lars.
3127 * lib/bind/menus.bind: removed not supported functions.
3129 * src/insets/insettext.C (Ascii): implemented this function.
3131 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3133 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3134 (Write): use of the write_attribute functions.
3136 * src/bufferlist.C (close): fixed reasking question!
3138 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3140 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3141 new files use the everwhere possible.
3144 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3145 src/log_form.C src/lyx.C:
3148 * src/buffer.C (runLaTeX): remove func
3150 * src/PaperLayout.C: removed file
3151 * src/ParagraphExtra.C: likewise
3152 * src/bullet_forms.C: likewise
3153 * src/bullet_forms.h: likewise
3154 * src/bullet_forms_cb.C: likewise
3156 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3157 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3160 * several files: remove all traces of the old fd_form_paragraph,
3161 and functions belonging to that.
3163 * several files: remove all traces of the old fd_form_document,
3164 and functions belonging to that.
3166 * several files: constify local variables were possible.
3168 * several files: remove all code that was dead when NEW_EXPORT was
3171 * several files: removed string::c_str in as many places as
3174 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3175 (e): be a bit more outspoken when patching
3176 (updatesrc): only move files if changed.
3178 * forms/layout_forms.h.patch: regenerated
3180 * forms/layout_forms.fd: remove form_document and form_paragraph
3181 and form_quotes and form_paper and form_table_options and
3182 form_paragraph_extra
3184 * forms/form1.fd: remove form_table
3186 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3187 the fdui->... rewrite. Update some comments to xforms 0.88
3189 * forms/bullet_forms.C.patch: removed file
3190 * forms/bullet_forms.fd: likewise
3191 * forms/bullet_forms.h.patch: likewise
3193 * development/Code_rules/Rules: added a section on switch
3194 statements. Updated some comment to xforms 0.88.
3196 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3198 * src/buffer.C (readFile): make sure that the whole version number
3199 is read after \lyxformat (even when it contains a comma)
3201 * lib/ui/default.ui: change shortcut of math menu to M-a.
3203 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3205 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3208 * src/LyXView.C (updateWindowTitle): show the full files name in
3209 window title, limited to 30 characters.
3211 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3212 When a number of characters has been given, we should not assume
3213 that the string is 0-terminated.
3215 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3216 calls (fixes some memory leaks)
3218 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3219 trans member on exit.
3221 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3223 * src/converter.C (GetReachable): fix typo.
3225 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3226 understand ',' instead of '.'.
3227 (GetInteger): rewrite to use strToInt().
3229 2000-09-26 Juergen Vigna <jug@sad.it>
3231 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3232 better visibility and error-message on wrong VSpace input.
3234 * src/language.C (initL): added english again.
3236 2000-09-25 Juergen Vigna <jug@sad.it>
3238 * src/frontends/kde/Dialogs.C (Dialogs):
3239 * src/frontends/gnome/Dialogs.C (Dialogs):
3240 * src/frontends/kde/Makefile.am:
3241 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3243 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3245 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3247 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3249 * src/frontends/xforms/FormParagraph.C:
3250 * src/frontends/xforms/FormParagraph.h:
3251 * src/frontends/xforms/form_paragraph.C:
3252 * src/frontends/xforms/form_paragraph.h:
3253 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3256 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3258 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3259 Paragraph-Data after use.
3261 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3262 non breakable paragraphs.
3264 2000-09-25 Garst R. Reese <reese@isn.net>
3266 * src/language.C (initL): added missing language_country codes.
3268 2000-09-25 Juergen Vigna <jug@sad.it>
3270 * src/insets/insettext.C (InsetText):
3271 (deleteLyXText): remove the not released LyXText structure!
3273 2000-09-24 Marko Vendelin <markov@ioc.ee>
3275 * src/frontends/gnome/mainapp.C
3276 * src/frontends/gnome/mainapp.h: added support for keyboard
3279 * src/frontends/gnome/FormCitation.C
3280 * src/frontends/gnome/FormCitation.h
3281 * src/frontends/gnome/Makefile.am
3282 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3283 FormCitation to use "action area" in mainapp window
3285 * src/frontends/gnome/Menubar_pimpl.C
3286 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3289 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3291 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3292 width/descent/ascent values if name is empty.
3293 (mathed_string_height): Use std::max.
3295 2000-09-25 Allan Rae <rae@lyx.org>
3297 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3298 segfault. This will be completely redesigned soon.
3300 * sigc++: updated libsigc++. Fixes struct timespec bug.
3302 * development/tools/makeLyXsigc.sh: .cvsignore addition
3304 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3306 * several files: removed almost all traces of the old table
3309 * src/TableLayout.C: removed file
3311 2000-09-22 Juergen Vigna <jug@sad.it>
3313 * src/frontends/kde/Dialogs.C: added credits forms.
3315 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3317 * src/frontends/gnome/Dialogs.C: added some forms.
3319 * src/spellchecker.C (init_spell_checker): set language in pspell code
3320 (RunSpellChecker): some modifications for setting language string.
3322 * src/language.[Ch]: added language_country code.
3324 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3326 * src/frontends/Dialogs.h: added new signal showError.
3327 Rearranged existing signals in some sort of alphabetical order.
3329 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3330 FormError.[Ch], form_error.[Ch]
3331 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3332 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3334 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3335 dialogs. I think that this can be used as the base to all these
3338 * src/frontends/xforms/FormError.[Ch]
3339 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3340 implementation of InsetError dialog.
3342 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3344 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3345 * src/frontends/kde/Makefile.am: ditto
3347 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3349 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3350 macrobf. This fixes a bug of invisible text.
3352 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3354 * lib/doc/LaTeXConfig.lyx.in: updated.
3356 * src/language.C (initL): remove language "francais" and change a
3357 bit the names of the two other french variations.
3359 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3360 string that may not be 0-terminated.
3362 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3364 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3366 2000-09-20 Marko Vendelin <markov@ioc.ee>
3368 * src/frontends/gnome/FormCitation.C
3369 * src/frontends/gnome/FormIndex.C
3370 * src/frontends/gnome/FormToc.C
3371 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3372 the variable initialization to shut up the warnings
3374 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3376 * src/table.[Ch]: deleted files
3378 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3381 2000-09-18 Juergen Vigna <jug@sad.it>
3383 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3384 problems with selection. Inserted new LFUN_PASTESELECTION.
3385 (InsetButtonPress): inserted handling of middle mouse-button paste.
3387 * src/spellchecker.C: changed word to word.c_str().
3389 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3391 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3392 included in the ``make dist'' tarball.
3394 2000-09-15 Juergen Vigna <jug@sad.it>
3396 * src/CutAndPaste.C (cutSelection): small fix return the right
3397 end position after cut inside one paragraph only.
3399 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3400 we are locked as otherwise we don't have a valid cursor position!
3402 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3404 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3406 * src/frontends/kde/FormRef.C: added using directive.
3407 * src/frontends/kde/FormToc.C: ditto
3409 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3411 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3413 2000-09-19 Marko Vendelin <markov@ioc.ee>
3415 * src/frontends/gnome/Menubar_pimpl.C
3416 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3417 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3419 * src/frontends/gnome/mainapp.C
3420 * src/frontends/gnome/mainapp.h: support for menu update used
3423 * src/frontends/gnome/mainapp.C
3424 * src/frontends/gnome/mainapp.h: support for "action" area in the
3425 main window. This area is used by small simple dialogs, such as
3428 * src/frontends/gnome/FormIndex.C
3429 * src/frontends/gnome/FormIndex.h
3430 * src/frontends/gnome/FormUrl.C
3431 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3434 * src/frontends/gnome/FormCitation.C
3435 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3436 action area. Only "Insert new citation" is implemented.
3438 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3440 * src/buffer.C (Dispatch): fix call to Dispatch
3441 * src/insets/insetref.C (Edit): likewise
3442 * src/insets/insetparent.C (Edit): likewise
3443 * src/insets/insetinclude.C (include_cb): likewise
3444 * src/frontends/xforms/FormUrl.C (apply): likewise
3445 * src/frontends/xforms/FormToc.C (apply): likewise
3446 * src/frontends/xforms/FormRef.C (apply): likewise
3447 * src/frontends/xforms/FormIndex.C (apply): likewise
3448 * src/frontends/xforms/FormCitation.C (apply): likewise
3449 * src/lyxserver.C (callback): likewise
3450 * src/lyxfunc.C (processKeySym): likewise
3451 (Dispatch): likewise
3452 (Dispatch): likewise
3453 * src/lyx_cb.C (LayoutsCB): likewise
3455 * Makefile.am (sourcedoc): small change
3457 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3459 * src/main.C (main): Don't make an empty GUIRunTime object. all
3460 methods are static. constify a bit remove unneded using + headers.
3462 * src/tabular.C: some more const to local vars move some loop vars
3464 * src/spellchecker.C: added some c_str after some word for pspell
3466 * src/frontends/GUIRunTime.h: add new static method setDefaults
3467 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3468 * src/frontends/kde/GUIRunTime.C (setDefaults):
3469 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3471 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3472 with strnew in arg, use correct emptystring when calling SetName.
3474 * several files: remove all commented code with relation to
3475 HAVE_SSTREAM beeing false. We now only support stringstream and
3478 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3480 * src/lyxfunc.C: construct correctly the automatic new file
3483 * src/text2.C (IsStringInText): change type of variable i to shut
3486 * src/support/sstream.h: do not use namespaces if the compiler
3487 does not support them.
3489 2000-09-15 Marko Vendelin <markov@ioc.ee>
3490 * src/frontends/gnome/FormCitation.C
3491 * src/frontends/gnome/FormCitation.h
3492 * src/frontends/gnome/diainsertcitation_interface.c
3493 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3494 regexp support to FormCitation [Gnome].
3496 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3499 * configure.in: remove unused KDE/GTKGUI define
3501 * src/frontends/kde/FormRef.C
3502 * src/frontends/kde/FormRef.h
3503 * src/frontends/kde/formrefdialog.C
3504 * src/frontends/kde/formrefdialog.h: double click will
3505 go to reference, now it is possible to change a cross-ref
3508 * src/frontends/kde/FormToc.C
3509 * src/frontends/kde/FormToc.h
3510 * src/frontends/kde/formtocdialog.C
3511 * src/frontends/kde/formtocdialog.h: add a depth
3514 * src/frontends/kde/Makefile.am: add QtLyXView.h
3517 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3519 * src/frontends/kde/FormCitation.h: added some using directives.
3521 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3523 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3526 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3529 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3531 * src/buffer.C (pop_tag): revert for the second time a change by
3532 Lars, who seems to really hate having non-local loop variables :)
3534 * src/Lsstream.h: add "using" statements.
3536 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3537 * src/buffer.C (writeFile): ditto
3539 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3541 * src/buffer.C (writeFile): try to fix the locale modified format
3542 number to always be as we want it.
3544 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3545 in XForms 0.89. C-space is now working again.
3547 * src/Lsstream.h src/support/sstream.h: new files.
3549 * also commented out all cases where strstream were used.
3551 * src/Bullet.h (c_str): remove method.
3553 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3555 * a lot of files: get rid of "char const *" and "char *" is as
3556 many places as possible. We only want to use them in interaction
3557 with system of other libraries, not inside lyx.
3559 * a lot of files: return const object is not of pod type. This
3560 helps ensure that temporary objects is not modified. And fits well
3561 with "programming by contract".
3563 * configure.in: check for the locale header too
3565 * Makefile.am (sourcedoc): new tag for generation of doc++
3568 2000-09-14 Juergen Vigna <jug@sad.it>
3570 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3571 callback to check which combo called it and do the right action.
3573 * src/combox.C (combo_cb): added combo * to the callbacks.
3574 (Hide): moved call of callback after Ungrab of the pointer.
3576 * src/intl.h: removed LCombo2 function.
3578 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3579 function as this can now be handled in one function.
3581 * src/combox.h: added Combox * to callback prototype.
3583 * src/frontends/xforms/Toolbar_pimpl.C:
3584 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3586 2000-09-14 Garst Reese <reese@isn.net>
3588 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3589 moved usepackage{xxx}'s to beginning of file. Changed left margin
3590 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3591 underlining from title. Thanks to John Culleton for useful suggestions.
3593 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3595 * src/lyxlex_pimpl.C (setFile): change error message to debug
3598 2000-09-13 Juergen Vigna <jug@sad.it>
3600 * src/frontends/xforms/FormDocument.C: implemented choice_class
3601 as combox and give callback to combo_language so OK/Apply is activated
3604 * src/bufferlist.C (newFile): small fix so already named files
3605 (via an open call) are not requested to be named again on the
3608 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3610 * src/frontends/kde/Makefile.am
3611 * src/frontends/kde/FormRef.C
3612 * src/frontends/kde/FormRef.h
3613 * src/frontends/kde/formrefdialog.C
3614 * src/frontends/kde/formrefdialog.h: implement
3617 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3619 * src/frontends/kde/formtocdialog.C
3620 * src/frontends/kde/formtocdialog.h
3621 * src/frontends/kde/FormToc.C
3622 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3624 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3626 * src/frontends/kde/FormCitation.C: fix thinko
3627 where we didn't always display the reference text
3630 * src/frontends/kde/formurldialog.C
3631 * src/frontends/kde/formurldialog.h
3632 * src/frontends/kde/FormUrl.C
3633 * src/frontends/kde/FormUrl.h: minor cleanups
3635 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3637 * src/frontends/kde/Makefile.am
3638 * src/frontends/kde/FormToc.C
3639 * src/frontends/kde/FormToc.h
3640 * src/frontends/kde/FormCitation.C
3641 * src/frontends/kde/FormCitation.h
3642 * src/frontends/kde/FormIndex.C
3643 * src/frontends/kde/FormIndex.h
3644 * src/frontends/kde/formtocdialog.C
3645 * src/frontends/kde/formtocdialog.h
3646 * src/frontends/kde/formcitationdialog.C
3647 * src/frontends/kde/formcitationdialog.h
3648 * src/frontends/kde/formindexdialog.C
3649 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3651 2000-09-12 Juergen Vigna <jug@sad.it>
3653 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3656 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3658 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3661 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3663 * src/converter.C (Add, Convert): Added support for converter flags:
3664 needaux, resultdir, resultfile.
3665 (Convert): Added new parameter view_file.
3666 (dvips_options): Fixed letter paper option.
3668 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3669 (Export, GetExportableFormats, GetViewableFormats): Added support
3672 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3674 (easyParse): Fixed to work with new export code.
3676 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3679 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3681 * lib/bind/*.bind: Replaced
3682 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3683 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3685 2000-09-11 Juergen Vigna <jug@sad.it>
3687 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3689 * src/main.C (main): now GUII defines global guiruntime!
3691 * src/frontends/gnome/GUIRunTime.C (initApplication):
3692 * src/frontends/kde/GUIRunTime.C (initApplication):
3693 * src/frontends/xforms/GUIRunTime.C (initApplication):
3694 * src/frontends/GUIRunTime.h: added new function initApplication.
3696 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3698 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3700 2000-09-08 Juergen Vigna <jug@sad.it>
3702 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3703 we have already "Reset".
3705 * src/language.C (initL): inserted "default" language and made this
3706 THE default language (and not american!)
3708 * src/paragraph.C: inserted handling of "default" language!
3710 * src/lyxfont.C: ditto
3714 * src/paragraph.C: output the \\par only if we have a following
3715 paragraph otherwise it's not needed.
3717 2000-09-05 Juergen Vigna <jug@sad.it>
3719 * config/pspell.m4: added entry to lyx-flags
3721 * src/spellchecker.C: modified version from Kevin for using pspell
3723 2000-09-01 Marko Vendelin <markov@ioc.ee>
3724 * src/frontends/gnome/Makefile.am
3725 * src/frontends/gnome/FormCitation.C
3726 * src/frontends/gnome/FormCitation.h
3727 * src/frontends/gnome/diainsertcitation_callbacks.c
3728 * src/frontends/gnome/diainsertcitation_callbacks.h
3729 * src/frontends/gnome/diainsertcitation_interface.c
3730 * src/frontends/gnome/diainsertcitation_interface.h
3731 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3732 dialog for Gnome frontend
3734 * src/main.C: Gnome libraries require keeping application name
3735 and its version as strings
3737 * src/frontends/gnome/mainapp.C: Change the name of the main window
3738 from GnomeLyX to PACKAGE
3740 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3742 * src/frontends/Liason.C: add "using: declaration.
3744 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3746 * src/mathed/math_macro.C (Metrics): Set the size of the template
3748 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3750 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3752 * src/converter.C (add_options): New function.
3753 (SetViewer): Change $$FName into '$$FName'.
3754 (View): Add options when running xdvi
3755 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3756 (Convert): The 3rd parameter is now the desired filename. Converts
3757 calls to lyx::rename if necessary.
3758 Add options when running dvips.
3759 (dvi_papersize,dvips_options): New methods.
3761 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3763 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3764 using a call to Converter::dvips_options.
3765 Fixed to work with nex export code.
3767 * src/support/copy.C
3768 * src/support/rename.C: New files
3770 * src/support/syscall.h
3771 * src/support/syscall.C: Added Starttype SystemDontWait.
3773 * lib/ui/default.ui: Changed to work with new export code
3775 * lib/configure.m4: Changed to work with new export code
3777 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3779 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3781 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3782 so that code compiles with DEC cxx.
3784 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3785 to work correctly! Also now supports the additional elements
3788 2000-09-01 Allan Rae <rae@lyx.org>
3790 * src/frontends/ButtonPolicies.C: renamed all the references to
3791 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3793 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3794 since it's a const not a type.
3796 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3798 2000-08-31 Juergen Vigna <jug@sad.it>
3800 * src/insets/figinset.C: Various changes to look if the filename has
3801 an extension and if not add it for inline previewing.
3803 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3805 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3806 make buttonStatus and isReadOnly be const methods. (also reflect
3807 this in derived classes.)
3809 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3810 (nextState): change to be static inline, pass the StateMachine as
3812 (PreferencesPolicy): remove casts
3813 (OkCancelPolicy): remvoe casts
3814 (OkCancelReadOnlyPolicy): remove casts
3815 (NoRepeatedApplyReadOnlyPolicy): remove casts
3816 (OkApplyCancelReadOnlyPolicy): remove casts
3817 (OkApplyCancelPolicy): remove casts
3818 (NoRepeatedApplyPolicy): remove casts
3820 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3822 * src/converter.C: added some using directives
3824 * src/frontends/ButtonPolicies.C: changes to overcome
3825 "need lvalue" error with DEC c++
3827 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3828 to WMHideCB for DEC c++
3830 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3832 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3833 to BulletBMTableCB for DEC c++
3835 2000-08-31 Allan Rae <rae@lyx.org>
3837 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3838 character dialog separately from old document dialogs combo_language.
3841 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3843 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3844 Removed LFUN_REF_CREATE.
3846 * src/MenuBackend.C: Added new tags: toc and references
3848 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3849 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3851 (add_toc, add_references): New methods.
3852 (create_submenu): Handle correctly the case when there is a
3853 seperator after optional menu items.
3855 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3856 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3857 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3859 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3861 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3863 * src/converter.[Ch]: New file for converting between different
3866 * src/export.[Ch]: New file for exporting a LyX file to different
3869 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3870 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3871 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3872 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3873 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3874 RunDocBook, MenuExport.
3876 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3877 Exporter::Preview methods if NEW_EXPORT is defined.
3879 * src/buffer.C (Dispatch): Use Exporter::Export.
3881 * src/lyxrc.C: Added new tags: \converter and \viewer.
3884 * src/LyXAction.C: Define new lyx-function: buffer-update.
3885 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3886 when NEW_EXPORT is defined.
3888 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3890 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3892 * lib/ui/default.ui: Added submenus "view" and "update" to the
3895 * src/filetools.C (GetExtension): New function.
3897 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3899 2000-08-29 Allan Rae <rae@lyx.org>
3901 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3903 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3904 (EnableDocumentLayout): removed
3905 (DisableDocumentLayout): removed
3906 (build): make use of ButtonController's read-only handling to
3907 de/activate various objects. Replaces both of the above functions.
3909 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3910 (readOnly): was read_only
3911 (refresh): fixed dumb mistakes with read_only_ handling
3913 * src/frontends/xforms/forms/form_document.fd:
3914 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3915 tabbed dialogs so the tabs look more like tabs and so its easier to
3916 work out which is the current tab.
3918 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3919 segfault with form_table
3921 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3923 2000-08-28 Juergen Vigna <jug@sad.it>
3925 * acconfig.h: added USE_PSPELL.
3927 * src/config.h.in: added USE_PSPELL.
3929 * autogen.sh: added pspell.m4
3931 * config/pspell.m4: new file.
3933 * src/spellchecker.C: implemented support for pspell libary.
3935 2000-08-25 Juergen Vigna <jug@sad.it>
3937 * src/LyXAction.C (init): renamed LFUN_TABLE to
3938 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3940 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3942 * src/lyxscreen.h: add force_clear variable and fuction to force
3943 a clear area when redrawing in LyXText.
3945 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3947 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3949 * some whitespace and comment changes.
3951 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3953 * src/buffer.C: up te LYX_FORMAT to 2.17
3955 2000-08-23 Juergen Vigna <jug@sad.it>
3957 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3960 * src/insets/insettabular.C (pasteSelection): delete the insets
3961 LyXText as it is not valid anymore.
3962 (copySelection): new function.
3963 (pasteSelection): new function.
3964 (cutSelection): new function.
3965 (LocalDispatch): implemented cut/copy/paste of cell selections.
3967 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3968 don't have a LyXText.
3970 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3972 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3975 2000-08-22 Juergen Vigna <jug@sad.it>
3977 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3978 ifdef form_table out if NEW_TABULAR.
3980 2000-08-21 Juergen Vigna <jug@sad.it>
3982 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3983 (draw): fixed draw position so that the cursor is positioned in the
3985 (InsetMotionNotify): hide/show cursor so the position is updated.
3986 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3987 using cellstart() function where it should be used.
3989 * src/insets/insettext.C (draw): ditto.
3991 * src/tabular.C: fixed initialization of some missing variables and
3992 made BoxType into an enum.
3994 2000-08-22 Marko Vendelin <markov@ioc.ee>
3995 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3996 stock menu item using action numerical value, not its string
4000 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4002 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4003 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4005 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4007 * src/frontends/xforms/GUIRunTime.C: new file
4009 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4010 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4012 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4014 * src/frontends/kde/GUIRunTime.C: new file
4016 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4017 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4019 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4021 * src/frontends/gnome/GUIRunTime.C: new file
4023 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4026 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4027 small change to documetentation.
4029 * src/frontends/GUIRunTime.C: removed file
4031 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4033 * src/lyxparagraph.h: enable NEW_TABULAR as default
4035 * src/lyxfunc.C (processKeySym): remove some commented code
4037 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4038 NEW_TABULAR around the fd_form_table_options.
4040 * src/lyx_gui.C (runTime): call the static member function as
4041 GUIRunTime::runTime().
4043 2000-08-21 Allan Rae <rae@lyx.org>
4045 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4048 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4050 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4052 2000-08-21 Allan Rae <rae@lyx.org>
4054 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4055 keep Garst happy ;-)
4056 * src/frontends/xforms/FormPreferences.C (build): use setOK
4057 * src/frontends/xforms/FormDocument.C (build): use setOK
4058 (FormDocument): use the appropriate policy.
4060 2000-08-21 Allan Rae <rae@lyx.org>
4062 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4063 automatic [de]activation of arbitrary objects when in a read-only state.
4065 * src/frontends/ButtonPolicies.h: More documentation
4066 (isReadOnly): added to support the above.
4068 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4070 2000-08-18 Juergen Vigna <jug@sad.it>
4072 * src/insets/insettabular.C (getStatus): changed to return func_status.
4074 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4075 display toggle menu entries if they are.
4077 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4078 new document layout now.
4080 * src/lyxfunc.C: ditto
4082 * src/lyx_gui_misc.C: ditto
4084 * src/lyx_gui.C: ditto
4086 * lib/ui/default.ui: removed paper and quotes layout as they are now
4087 all in the document layout tabbed folder.
4089 * src/frontends/xforms/forms/form_document.fd: added Restore
4090 button and callbacks for all inputs for Allan's ButtonPolicy.
4092 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4093 (CheckChoiceClass): added missing params setting on class change.
4094 (UpdateLayoutDocument): added for updating the layout on params.
4095 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4096 (FormDocument): Implemented Allan's ButtonPolicy with the
4099 2000-08-17 Allan Rae <rae@lyx.org>
4101 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4102 so we can at least see the credits again.
4104 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4105 controller calls for the appropriate callbacks. Note that since Ok
4106 calls apply followed by cancel, and apply isn't a valid input for the
4107 APPLIED state, the bc_ calls have to be made in the static callback not
4108 within each of the real callbacks.
4110 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4111 (setOk): renamed from setOkay()
4113 2000-08-17 Juergen Vigna <jug@sad.it>
4115 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4116 in the implementation part.
4117 (composeUIInfo): don't show optional menu-items.
4119 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4121 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4123 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4124 text-state when in a text-inset.
4126 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4128 2000-08-17 Marko Vendelin <markov@ioc.ee>
4129 * src/frontends/gnome/FormIndex.C
4130 * src/frontends/gnome/FormIndex.h
4131 * src/frontends/gnome/FormToc.C
4132 * src/frontends/gnome/FormToc.h
4133 * src/frontends/gnome/dialogs
4134 * src/frontends/gnome/diatoc_callbacks.c
4135 * src/frontends/gnome/diatoc_callbacks.h
4136 * src/frontends/gnome/diainsertindex_callbacks.h
4137 * src/frontends/gnome/diainsertindex_callbacks.c
4138 * src/frontends/gnome/diainsertindex_interface.c
4139 * src/frontends/gnome/diainsertindex_interface.h
4140 * src/frontends/gnome/diatoc_interface.h
4141 * src/frontends/gnome/diatoc_interface.c
4142 * src/frontends/gnome/Makefile.am: Table of Contents and
4143 Insert Index dialogs implementation for Gnome frontend
4145 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4147 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4149 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4152 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4154 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4155 destructor. Don't definde if you don't need it
4156 (processEvents): made static, non-blocking events processing for
4158 (runTime): static method. event loop for xforms
4159 * similar as above for kde and gnome.
4161 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4162 new Pimpl is correct
4163 (runTime): new method calss the real frontends runtime func.
4165 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4167 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4169 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4171 2000-08-16 Juergen Vigna <jug@sad.it>
4173 * src/lyx_gui.C (runTime): added GUII RunTime support.
4175 * src/frontends/Makefile.am:
4176 * src/frontends/GUIRunTime.[Ch]:
4177 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4178 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4179 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4181 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4183 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4184 as this is already set in ${FRONTEND_INCLUDE} if needed.
4186 * configure.in (CPPFLAGS): setting the include dir for the frontend
4187 directory and don't set FRONTEND=xforms for now as this is executed
4190 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4192 * src/frontends/kde/Makefile.am:
4193 * src/frontends/kde/FormUrl.C:
4194 * src/frontends/kde/FormUrl.h:
4195 * src/frontends/kde/formurldialog.h:
4196 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4198 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4200 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4202 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4204 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4207 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4209 * src/WorkArea.C (work_area_handler): more work to get te
4210 FL_KEYBOARD to work with xforms 0.88 too, please test.
4212 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4214 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4216 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4219 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4221 * src/Timeout.h: remove Qt::emit hack.
4223 * several files: changes to allo doc++ compilation
4225 * src/lyxfunc.C (processKeySym): new method
4226 (processKeyEvent): comment out if FL_REVISION < 89
4228 * src/WorkArea.C: change some debugging levels.
4229 (WorkArea): set wantkey to FL_KEY_ALL
4230 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4231 clearer code and the use of compose with XForms 0.89. Change to
4232 use signals instead of calling methods in bufferview directly.
4234 * src/Painter.C: change some debugging levels.
4236 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4239 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4240 (workAreaKeyPress): new method
4242 2000-08-14 Juergen Vigna <jug@sad.it>
4244 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4246 * config/kde.m4: addes some features
4248 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4249 include missing xforms dialogs.
4251 * src/Timeout.h: a hack to be able to compile with qt/kde.
4253 * sigc++/.cvsignore: added acinclude.m4
4255 * lib/.cvsignore: added listerros
4257 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4258 xforms tree as objects are needed for other frontends.
4260 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4261 linking with not yet implemented xforms objects.
4263 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4265 2000-08-14 Baruch Even <baruch.even@writeme.com>
4267 * src/frontends/xforms/FormGraphics.h:
4268 * src/frontends/xforms/FormGraphics.C:
4269 * src/frontends/xforms/RadioButtonGroup.h:
4270 * src/frontends/xforms/RadioButtonGroup.C:
4271 * src/insets/insetgraphics.h:
4272 * src/insets/insetgraphics.C:
4273 * src/insets/insetgraphicsParams.h:
4274 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4275 instead of spaces, and various other indentation issues to make the
4276 sources more consistent.
4278 2000-08-14 Marko Vendelin <markov@ioc.ee>
4280 * src/frontends/gnome/dialogs/diaprint.glade
4281 * src/frontends/gnome/FormPrint.C
4282 * src/frontends/gnome/FormPrint.h
4283 * src/frontends/gnome/diaprint_callbacks.c
4284 * src/frontends/gnome/diaprint_callbacks.h
4285 * src/frontends/gnome/diaprint_interface.c
4286 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4289 * src/frontends/gnome/dialogs/diainserturl.glade
4290 * src/frontends/gnome/FormUrl.C
4291 * src/frontends/gnome/FormUrl.h
4292 * src/frontends/gnome/diainserturl_callbacks.c
4293 * src/frontends/gnome/diainserturl_callbacks.h
4294 * src/frontends/gnome/diainserturl_interface.c
4295 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4296 Gnome implementation
4298 * src/frontends/gnome/Dialogs.C
4299 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4300 all other dialogs. Copy all unimplemented dialogs from Xforms
4303 * src/frontends/gnome/support.c
4304 * src/frontends/gnome/support.h: support files generated by Glade
4308 * config/gnome.m4: Gnome configuration scripts
4310 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4311 configure --help message
4313 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4314 only if there are no events pendling in Gnome/Gtk. This enhances
4315 the performance of menus.
4318 2000-08-14 Allan Rae <rae@lyx.org>
4320 * lib/Makefile.am: listerrors cleaning
4322 * lib/listerrors: removed -- generated file
4323 * acinclude.m4: ditto
4324 * sigc++/acinclude.m4: ditto
4326 * src/frontends/xforms/forms/form_citation.fd:
4327 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4330 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4331 `updatesrc` and now we have a `test` target that does what `updatesrc`
4332 used to do. I didn't like having an install target that wasn't related
4335 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4336 on all except FormGraphics. This may yet happen. Followed by a major
4337 cleanup including using FL_TRANSIENT for most of the dialogs. More
4338 changes to come when the ButtonController below is introduced.
4340 * src/frontends/xforms/ButtonController.h: New file for managing up to
4341 four buttons on a dialog according to an externally defined policy.
4342 * src/frontends/xforms/Makefile.am: added above
4344 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4345 Apply and Cancel/Close buttons and everything in between and beyond.
4346 * src/frontends/Makefile.am: added above.
4348 * src/frontends/xforms/forms/form_preferences.fd:
4349 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4350 and removed variable 'status' as a result. Fixed the set_minsize thing.
4351 Use the new screen-font-update after checking screen fonts were changed
4352 Added a "Restore" button to restore the original lyxrc values while
4353 editing. This restores everything not just the last input changed.
4354 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4356 * src/LyXAction.C: screen-font-update added for updating buffers after
4357 screen font settings have been changed.
4358 * src/commandtags.h: ditto
4359 * src/lyxfunc.C: ditto
4361 * forms/lyx.fd: removed screen fonts dialog.
4362 * src/lyx_gui.C: ditto
4363 * src/menus.[Ch]: ditto
4364 * src/lyx.[Ch]: ditto
4365 * src/lyx_cb.C: ditto + code from here moved to make
4366 screen-font-update. And people wonder why progress on GUII is
4367 slow. Look at how scattered this stuff was! It takes forever
4370 * forms/fdfix.sh: Fixup the spacing after commas.
4371 * forms/makefile: Remove date from generated files. Fewer clashes now.
4372 * forms/bullet_forms.C.patch: included someones handwritten changes
4374 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4375 once I've discovered why LyXRC was made noncopyable.
4376 * src/lyx_main.C: ditto
4378 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4380 * src/frontends/xforms/forms/fdfix.sh:
4381 * src/frontends/xforms/forms/fdfixh.sed:
4382 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4383 * src/frontends/xforms/Form*.[hC]:
4384 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4385 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4386 provide a destructor for the struct FD_form_xxxx. Another version of
4387 the set_[max|min]size workaround and a few other cleanups. Actually,
4388 Angus' patch from 20000809.
4390 2000-08-13 Baruch Even <baruch.even@writeme.com>
4392 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4395 2000-08-11 Juergen Vigna <jug@sad.it>
4397 * src/insets/insetgraphics.C (InsetGraphics): changing init
4398 order because of warnings.
4400 * src/frontends/xforms/forms/makefile: adding patching .C with
4403 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4404 from .C.patch to .c.patch
4406 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4407 order because of warning.
4409 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4411 * src/frontends/Liason.C (setMinibuffer): new helper function
4413 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4415 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4417 * lib/ui/default.ui: commented out PaperLayout entry
4419 * src/frontends/xforms/form_document.[Ch]: new added files
4421 * src/frontends/xforms/FormDocument.[Ch]: ditto
4423 * src/frontends/xforms/forms/form_document.fd: ditto
4425 * src/frontends/xforms/forms/form_document.C.patch: ditto
4427 2000-08-10 Juergen Vigna <jug@sad.it>
4429 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4430 (InsetGraphics): initialized cacheHandle to 0.
4431 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4433 2000-08-10 Baruch Even <baruch.even@writeme.com>
4435 * src/graphics/GraphicsCache.h:
4436 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4437 correctly as a cache.
4439 * src/graphics/GraphicsCacheItem.h:
4440 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4443 * src/graphics/GraphicsCacheItem_pimpl.h:
4444 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4447 * src/insets/insetgraphics.h:
4448 * src/insets/insetgraphics.C: Changed from using a signal notification
4449 to polling when image is not loaded.
4451 2000-08-10 Allan Rae <rae@lyx.org>
4453 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4454 that there are two functions that have to been taken out of line by
4455 hand and aren't taken care of in the script. (Just a reminder note)
4457 * sigc++/macros/*.h.m4: Updated as above.
4459 2000-08-09 Juergen Vigna <jug@sad.it>
4461 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4463 * src/insets/insettabular.C: make drawing of single cell smarter.
4465 2000-08-09 Marko Vendelin <markov@ioc.ee>
4466 * src/frontends/gnome/Menubar_pimpl.C
4467 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4468 implementation: new files
4470 * src/frontends/gnome/mainapp.C
4471 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4474 * src/main.C: create Gnome main window
4476 * src/frontends/xforms/Menubar_pimpl.h
4477 * src/frontends/Menubar.C
4478 * src/frontends/Menubar.h: added method Menubar::update that calls
4479 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4481 * src/LyXView.C: calls Menubar::update to update the state
4484 * src/frontends/gnome/Makefile.am: added new files
4486 * src/frontends/Makefile.am: added frontend compiler options
4488 2000-08-08 Juergen Vigna <jug@sad.it>
4490 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4492 * src/bufferlist.C (close):
4493 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4494 documents if exiting without saving.
4496 * src/buffer.C (save): use removeAutosaveFile()
4498 * src/support/filetools.C (removeAutosaveFile): new function.
4500 * src/lyx_cb.C (MenuWrite): returns a bool now.
4501 (MenuWriteAs): check if file could really be saved and revert to the
4503 (MenuWriteAs): removing old autosavefile if existant.
4505 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4506 before Goto toggle declaration, because of compiler warning.
4508 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4510 * src/lyxfunc.C (MenuNew): small fix.
4512 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4514 * src/bufferlist.C (newFile):
4515 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4517 * src/lyxrc.C: added new_ask_filename tag
4519 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4521 * src/lyx.fd: removed code pertaining to form_ref
4522 * src/lyx.[Ch]: ditto
4523 * src/lyx_cb.C: ditto
4524 * src/lyx_gui.C: ditto
4525 * src/lyx_gui_misc.C: ditto
4527 * src/BufferView_pimpl.C (restorePosition): update buffer only
4530 * src/commandtags.h (LFUN_REFTOGGLE): removed
4531 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4532 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4533 (LFUN_REFBACK): renamed LFUN_REF_BACK
4535 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4536 * src/menus.C: ditto
4537 * src/lyxfunc.C (Dispatch): ditto.
4538 InsertRef dialog is now GUI-independent.
4540 * src/texrow.C: added using std::endl;
4542 * src/insets/insetref.[Ch]: strip out large amounts of code.
4543 The inset is now a container and this functionality is now
4544 managed by a new FormRef dialog
4546 * src/frontends/Dialogs.h (showRef, createRef): new signals
4548 * src/frontends/xforms/FormIndex.[Ch],
4549 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4550 when setting dialog's min/max size
4551 * src/frontends/xforms/FormIndex.[Ch]: ditto
4553 * src/frontends/xforms/FormRef.[Ch],
4554 src/frontends/xforms/forms/form_ref.fd: new xforms
4555 implementation of an InsetRef dialog
4557 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4560 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4561 ios::nocreate is not part of the standard. Removed.
4563 2000-08-07 Baruch Even <baruch.even@writeme.com>
4565 * src/graphics/Renderer.h:
4566 * src/graphics/Renderer.C: Added base class for rendering of different
4567 image formats into Pixmaps.
4569 * src/graphics/XPM_Renderer.h:
4570 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4571 in a different class.
4573 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4574 easily add support for other formats.
4576 * src/insets/figinset.C: plugged a leak of an X resource.
4578 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4580 * src/CutAndPaste.[Ch]: make all metods static.
4582 * development/Code_rules/Rules: more work, added section on
4583 Exceptions, and a References section.
4585 * a lot of header files: work to make doc++ able to generate the
4586 source documentation, some workarounds of doc++ problems. Doc++ is
4587 now able to generate the documentation.
4589 2000-08-07 Juergen Vigna <jug@sad.it>
4591 * src/insets/insettabular.C (recomputeTextInsets): removed function
4593 * src/tabular.C (SetWidthOfMulticolCell):
4595 (calculate_width_of_column_NMC): fixed return value so that it really
4596 only returns true if the column-width has changed (there where
4597 problems with muliticolumn-cells in this column).
4599 2000-08-04 Juergen Vigna <jug@sad.it>
4601 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4602 also on the scrollstatus of the inset.
4603 (workAreaMotionNotify): ditto.
4605 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4607 2000-08-01 Juergen Vigna <jug@sad.it>
4609 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4611 * src/commandtags.h:
4612 * src/LyXAction.C (init):
4613 * src/insets/inset.C (LocalDispatch): added support for
4616 * src/insets/inset.C (scroll): new functions.
4618 * src/insets/insettext.C (removeNewlines): new function.
4619 (SetAutoBreakRows): removes forced newlines in the text of the
4620 paragraph if autoBreakRows is set to false.
4622 * src/tabular.C (Latex): generates a parbox around the cell contents
4625 * src/frontends/xforms/FormTabular.C (local_update): removed
4626 the radio_useparbox button.
4628 * src/tabular.C (UseParbox): new function
4630 2000-08-06 Baruch Even <baruch.even@writeme.com>
4632 * src/graphics/GraphicsCache.h:
4633 * src/graphics/GraphicsCache.C:
4634 * src/graphics/GraphicsCacheItem.h:
4635 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4638 * src/insets/insetgraphics.h:
4639 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4640 and the drawing of the inline image.
4642 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4643 loaded into the wrong position.
4645 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4648 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4650 * src/support/translator.h: move all typedefs to public section
4652 * src/support/filetools.C (MakeLatexName): return string const
4654 (TmpFileName): ditto
4655 (FileOpenSearch): ditto
4657 (LibFileSearch): ditto
4658 (i18nLibFileSearch): ditto
4661 (CreateTmpDir): ditto
4662 (CreateBufferTmpDir): ditto
4663 (CreateLyXTmpDir): ditto
4666 (MakeAbsPath): ditto
4668 (OnlyFilename): ditto
4670 (NormalizePath): ditto
4671 (CleanupPath): ditto
4672 (GetFileContents): ditto
4673 (ReplaceEnvironmentPath): ditto
4674 (MakeRelPath): ditto
4676 (ChangeExtension): ditto
4677 (MakeDisplayPath): ditto
4678 (do_popen): return cmdret const
4679 (findtexfile): return string const
4681 * src/support/DebugStream.h: add some /// to please doc++
4683 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4685 * src/texrow.C (same_rownumber): functor to use with find_if
4686 (getIdFromRow): rewritten to use find_if and to not update the
4687 positions. return true if row is found
4688 (increasePos): new method, use to update positions
4690 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4692 * src/lyxlex_pimpl.C (verifyTable): new method
4695 (GetString): return string const
4696 (pushTable): rewrite to use std::stack
4698 (setFile): better check
4701 * src/lyxlex.h: make LyXLex noncopyable
4703 * src/lyxlex.C (text): return char const * const
4704 (GetString): return string const
4705 (getLongString): return string const
4707 * src/lyx_gui_misc.C (askForText): return pair<...> const
4709 * src/lastfiles.[Ch] (operator): return string const
4711 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4712 istringstream not char const *.
4713 move token.end() out of loop.
4714 (readFile): move initializaton of token
4716 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4717 getIdFromRow is successful.
4719 * lib/bind/emacs.bind: don't include menus bind
4721 * development/Code_rules/Rules: the beginnings of making this
4722 better and covering more of the unwritten rules that we have.
4724 * development/Code_rules/Recommendations: a couple of wording
4727 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4729 * src/support/strerror.c: remove C++ comment.
4731 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4733 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4734 LFUN_INDEX_INSERT_LAST
4736 * src/texrow.C (getIdFromRow): changed from const_iterator to
4737 iterator, allowing code to compile with DEC cxx
4739 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4740 stores part of the class, as suggested by Allan. Will allow
4742 (apply): test to apply uses InsetCommandParams operator!=
4744 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4745 (apply): test to apply uses InsetCommandParams operator!=
4747 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4748 stores part of the class.
4749 (update): removed limits on min/max size.
4751 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4752 (apply): test to apply uses InsetCommandParams operator!=
4754 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4755 (Read, Write, scanCommand, getCommand): moved functionality
4756 into InsetCommandParams.
4758 (getScreenLabel): made pure virtual
4759 new InsetCommandParams operators== and !=
4761 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4762 c-tors based on InsetCommandParams. Removed others.
4763 * src/insets/insetinclude.[Ch]: ditto
4764 * src/insets/insetlabel.[Ch]: ditto
4765 * src/insets/insetparent.[Ch]: ditto
4766 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4768 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4769 insets derived from InsetCommand created using similar c-tors
4770 based on InsetCommandParams
4771 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4772 * src/menus.C (ShowRefsMenu): ditto
4773 * src/paragraph.C (Clone): ditto
4774 * src/text2.C (SetCounter): ditto
4775 * src/lyxfunc.C (Dispatch) ditto
4776 Also recreated old InsetIndex behaviour exactly. Can now
4777 index-insert at the start of a paragraph and index-insert-last
4778 without launching the pop-up.
4780 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4782 * lib/lyxrc.example: mark te pdf options as non functional.
4784 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4785 (isStrDbl): move tmpstr.end() out of loop.
4786 (strToDbl): move intialization of tmpstr
4787 (lowercase): return string const and move tmp.end() out of loop.
4788 (uppercase): return string const and move tmp.edn() out of loop.
4789 (prefixIs): add assertion
4794 (containsOnly): ditto
4795 (containsOnly): ditto
4796 (containsOnly): ditto
4797 (countChar): make last arg char not char const
4798 (token): return string const
4799 (subst): return string const, move tmp.end() out of loop.
4800 (subst): return string const, add assertion
4801 (strip): return string const
4802 (frontStrip): return string const, add assertion
4803 (frontStrip): return string const
4808 * src/support/lstrings.C: add inclde "LAssert.h"
4809 (isStrInt): move tmpstr.end() out of loop.
4811 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4812 toollist.end() out of loop.
4813 (deactivate): move toollist.end() out of loop.
4814 (update): move toollist.end() out of loop.
4815 (updateLayoutList): move tc.end() out of loop.
4816 (add): move toollist.end() out of loop.
4818 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4819 md.end() out of loop.
4821 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4823 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4826 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4827 (Erase): move insetlist.end() out of loop.
4829 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4830 ref to const string as first arg. Move initialization of some
4831 variables, whitespace changes.
4833 * src/kbmap.C (defkey): move table.end() out of loop.
4834 (kb_keymap): move table.end() out of loop.
4835 (findbinding): move table.end() out of loop.
4837 * src/MenuBackend.C (hasMenu): move end() out of loop.
4838 (getMenu): move end() out of loop.
4839 (getMenu): move menulist_.end() out of loop.
4841 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4843 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4846 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4847 (getFromLyXName): move infotab.end() out of loop.
4849 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4850 -fvtable-thunks -ffunction-sections -fdata-sections
4852 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4854 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4857 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4859 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4861 * src/frontends/xforms/FormCitation.[Ch],
4862 src/frontends/xforms/FormIndex.[Ch],
4863 src/frontends/xforms/FormToc.[Ch],
4864 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4866 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4868 * src/commandtags.h: renamed, created some flags for citation
4871 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4873 * src/lyxfunc.C (dispatch): use signals to insert index entry
4875 * src/frontends/Dialogs.h: new signal createIndex
4877 * src/frontends/xforms/FormCommand.[Ch],
4878 src/frontends/xforms/FormCitation.[Ch],
4879 src/frontends/xforms/FormToc.[Ch],
4880 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4882 * src/insets/insetindex.[Ch]: GUI-independent
4884 * src/frontends/xforms/FormIndex.[Ch],
4885 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4888 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4890 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4891 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4893 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4895 * src/insets/insetref.C (Latex): rewrite so that there is now
4896 question that a initialization is requested.
4898 * src/insets/insetcommand.h: reenable the hide signal
4900 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4902 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4903 fix handling of shortcuts (many bugs :)
4904 (add_lastfiles): ditto.
4906 * lib/ui/default.ui: fix a few shortcuts.
4908 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4910 * Makefile.am: Fix ``rpmdist'' target to return the exit
4911 status of the ``rpm'' command, instead of the last command in
4912 the chain (the ``rm lyx.xpm'' command, which always returns
4915 2000-08-02 Allan Rae <rae@lyx.org>
4917 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4918 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4919 * src/frontends/xforms/FormToc.C (FormToc): ditto
4921 * src/frontends/xforms/Makefile.am: A few forgotten files
4923 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4924 Signals-not-copyable-problem Lars' started commenting out.
4926 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4928 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4930 * src/insets/insetcommand.h: Signals is not copyable so anoter
4931 scheme for automatic hiding of forms must be used.
4933 * src/frontends/xforms/FormCitation.h: don't inerit from
4934 noncopyable, FormCommand already does that.
4935 * src/frontends/xforms/FormToc.h: ditto
4936 * src/frontends/xforms/FormUrl.h: ditto
4938 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4940 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4942 * src/insets/insetcommand.h (hide): new SigC::Signal0
4943 (d-tor) new virtual destructor emits hide signal
4945 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4946 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4948 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4949 LOF and LOT. Inset is now GUI-independent
4951 * src/insets/insetloa.[Ch]: redundant
4952 * src/insets/insetlof.[Ch]: ditto
4953 * src/insets/insetlot.[Ch]: ditto
4955 * src/frontends/xforms/forms/form_url.fd: tweaked!
4956 * src/frontends/xforms/forms/form_citation.fd: ditto
4958 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4959 dialogs dealing with InsetCommand insets
4961 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4962 FormCommand base class
4963 * src/frontends/xforms/FormUrl.[Ch]: ditto
4965 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4967 * src/frontends/xforms/FormToc.[Ch]: ditto
4969 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4970 passed a generic InsetCommand pointer
4971 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4973 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4974 and modified InsetTOC class
4975 * src/buffer.C: ditto
4977 * forms/lyx.fd: strip out old FD_form_toc code
4978 * src/lyx_gui_misc.C: ditto
4979 * src/lyx_gui.C: ditto
4980 * src/lyx_cb.C: ditto
4981 * src/lyx.[Ch]: ditto
4983 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4985 * src/support/utility.hpp: tr -d '\r'
4987 2000-08-01 Juergen Vigna <jug@sad.it>
4989 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4991 * src/commandtags.h:
4992 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4993 LFUN_TABULAR_FEATURES.
4995 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4996 LFUN_LAYOUT_TABULAR.
4998 * src/insets/insettabular.C (getStatus): implemented helper function.
5000 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5002 2000-07-31 Juergen Vigna <jug@sad.it>
5004 * src/text.C (draw): fixed screen update problem for text-insets.
5006 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5007 something changed probably this has to be added in various other
5010 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5012 2000-07-31 Baruch Even <baruch.even@writeme.com>
5014 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5015 templates to satisfy compaq cxx.
5018 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5020 * src/support/translator.h (equal_1st_in_pair::operator()): take
5021 const ref pair_type as arg.
5022 (equal_2nd_in_pair::operator()): ditto
5023 (Translator::~Translator): remove empty d-tor.
5025 * src/graphics/GraphicsCache.C: move include config.h to top, also
5026 put initialization of GraphicsCache::singleton here.
5027 (~GraphicsCache): move here
5028 (addFile): take const ref as arg
5031 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5033 * src/BufferView2.C (insertLyXFile): change te with/without header
5036 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5038 * src/frontends/xforms/FormGraphics.C (apply): add some
5039 static_cast. Not very nice, but required by compaq cxx.
5041 * src/frontends/xforms/RadioButtonGroup.h: include header
5042 <utility> instead of <pair.h>
5044 * src/insets/insetgraphicsParams.C: add using directive.
5045 (readResize): change return type to void.
5046 (readOrigin): ditto.
5048 * src/lyxfunc.C (getStatus): add missing break for build-program
5049 function; add test for Literate for export functions.
5051 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5052 entries in Options menu.
5054 2000-07-31 Baruch Even <baruch.even@writeme.com>
5056 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5057 protect against auto-allocation; release icon when needed.
5059 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5061 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5062 on usual typewriter.
5064 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5065 earlier czech.kmap), useful only for programming.
5067 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5069 * src/frontends/xforms/FormCitation.h: fix conditioning around
5072 2000-07-31 Juergen Vigna <jug@sad.it>
5074 * src/frontends/xforms/FormTabular.C (local_update): changed
5075 radio_linebreaks to radio_useparbox and added radio_useminipage.
5077 * src/tabular.C: made support for using minipages/parboxes.
5079 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5081 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5083 (descent): so the cursor is in the middle.
5084 (width): bit smaller box.
5086 * src/insets/insetgraphics.h: added display() function.
5088 2000-07-31 Baruch Even <baruch.even@writeme.com>
5090 * src/frontends/Dialogs.h: Added showGraphics signals.
5092 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5093 xforms form definition of the graphics dialog.
5095 * src/frontends/xforms/FormGraphics.h:
5096 * src/frontends/xforms/FormGraphics.C: Added files, the
5097 GUIndependent code of InsetGraphics
5099 * src/insets/insetgraphics.h:
5100 * src/insets/insetgraphics.C: Major writing to make it work.
5102 * src/insets/insetgraphicsParams.h:
5103 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5104 struct between InsetGraphics and GUI.
5106 * src/LaTeXFeatures.h:
5107 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5108 support for graphicx package.
5110 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5111 for the graphics inset.
5113 * src/support/translator.h: Added file, used in
5114 InsetGraphicsParams. this is a template to translate between two
5117 * src/frontends/xforms/RadioButtonGroup.h:
5118 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5119 way to easily control a radio button group.
5121 2000-07-28 Juergen Vigna <jug@sad.it>
5123 * src/insets/insettabular.C (LocalDispatch):
5124 (TabularFeatures): added support for lyx-functions of tabular features.
5125 (cellstart): refixed this function after someone wrongly changed it.
5127 * src/commandtags.h:
5128 * src/LyXAction.C (init): added support for tabular-features
5130 2000-07-28 Allan Rae <rae@lyx.org>
5132 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5133 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5134 triggers the callback for input checking. As a result we sometimes get
5135 "LyX: This shouldn't happen..." printed to cerr.
5136 (input): Started using status variable since I only free() on
5137 destruction. Some input checking for paths and font sizes.
5139 * src/frontends/xforms/FormPreferences.h: Use status to control
5140 activation of Ok and Apply
5142 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5143 callback. Also resized to stop segfaults with 0.88. The problem is
5144 that xforms-0.88 requires the folder to be wide enough to fit all the
5145 tabs. If it isn't it causes all sorts of problems.
5147 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5149 * src/frontends/xforms/forms/README: Reflect reality.
5151 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5152 * src/frontends/xforms/forms/makefile: ditto.
5154 * src/commandtags.h: Get access to new Preferences dialog
5155 * src/LyXAction.C: ditto
5156 * src/lyxfunc.C: ditto
5157 * lib/ui/default.ui: ditto
5159 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5161 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5163 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5166 * src/frontends/xforms/form_url.[Ch]: added.
5168 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5170 * src/insets/insetbib.h: fixed bug in previous commit
5172 * src/frontends/xforms/FormUrl.h: ditto
5174 * src/frontends/xforms/FormPrint.h: ditto
5176 * src/frontends/xforms/FormPreferences.h: ditto
5178 * src/frontends/xforms/FormCopyright.h: ditto
5180 * src/frontends/xforms/FormCitation.C: ditto
5182 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5183 private copyconstructor and private default contructor
5185 * src/support/Makefile.am: add utility.hpp
5187 * src/support/utility.hpp: new file from boost
5189 * src/insets/insetbib.h: set owner in clone
5191 * src/frontends/xforms/FormCitation.C: added missing include
5194 * src/insets/form_url.[Ch]: removed
5196 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5198 * development/lyx.spec.in
5199 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5200 file/directory re-organization.
5202 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5204 * src/insets/insetcommand.[Ch]: moved the string data and
5205 associated manipulation methods into a new stand-alone class
5206 InsetCommandParams. This class has two additional methods
5207 getAsString() and setFromString() allowing the contents to be
5208 moved around as a single string.
5209 (addContents) method removed.
5210 (setContents) method no longer virtual.
5212 * src/buffer.C (readInset): made use of new InsetCitation,
5213 InsetUrl constructors based on InsetCommandParams.
5215 * src/commandtags.h: add LFUN_INSERT_URL
5217 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5218 independent InsetUrl and use InsetCommandParams to extract
5219 string info and create new Insets.
5221 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5223 * src/frontends/xforms/FormCitation.C (apply): uses
5226 * src/frontends/xforms/form_url.C
5227 * src/frontends/xforms/form_url.h
5228 * src/frontends/xforms/FormUrl.h
5229 * src/frontends/xforms/FormUrl.C
5230 * src/frontends/xforms/forms/form_url.fd: new files
5232 * src/insets/insetcite.[Ch]: removed unused constructors.
5234 * src/insets/insetinclude.[Ch]: no longer store filename
5236 * src/insets/inseturl.[Ch]: GUI-independent.
5238 2000-07-26 Juergen Vigna <jug@sad.it>
5239 * renamed frontend from gtk to gnome as it is that what is realized
5240 and did the necessary changes in the files.
5242 2000-07-26 Marko Vendelin <markov@ioc.ee>
5244 * configure.in: cleaning up gnome configuration scripts
5246 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5248 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5249 shortcuts syndrom by redrawing them explicitely (a better solution
5250 would be appreciated).
5252 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5254 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5257 * src/lyx_cb.C (MenuExport): change html export to do the right
5258 thing depending of the document type (instead of having
5259 html-linuxdoc and html-docbook).
5260 * src/lyxfunc.C (getStatus): update for html
5261 * lib/ui/default.ui: simplify due to the above change.
5262 * src/menus.C (ShowFileMenu): update too (in case we need it).
5264 * src/MenuBackend.C (read): if a menu is defined twice, add the
5265 new entries to the exiting one.
5267 2000-07-26 Juergen Vigna <jug@sad.it>
5269 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5271 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5272 and return a bool if it did actual save the file.
5273 (AutoSave): don't autosave a unnamed doc.
5275 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5276 check if this is an UNNAMED new file and react to it.
5277 (newFile): set buffer to unnamed and change to not mark a new
5278 buffer dirty if I didn't do anything with it.
5280 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5282 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5284 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5285 friend as per Angus's patch posted to lyx-devel.
5287 * src/ext_l10n.h: updated
5289 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5290 gettext on the style string right before inserting them into the
5293 * autogen.sh: add code to extract style strings form layout files,
5294 not good enough yet.
5296 * src/frontends/gtk/.cvsignore: add MAKEFILE
5298 * src/MenuBackend.C (read): run the label strings through gettext
5299 before storing them in the containers.
5301 * src/ext_l10n.h: new file
5303 * autogen.sh : generate the ext_l10n.h file here
5305 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5307 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5310 * lib/ui/default.ui: fix a couple of typos.
5312 * config/gnome/gtk.m4: added (and added to the list of files in
5315 * src/insets/insetinclude.C (unique_id): fix when we are using
5316 lyxstring instead of basic_string<>.
5317 * src/insets/insettext.C (LocalDispatch): ditto.
5318 * src/support/filetools.C: ditto.
5320 * lib/configure.m4: create the ui/ directory if necessary.
5322 * src/LyXView.[Ch] (updateToolbar): new method.
5324 * src/BufferView_pimpl.C (buffer): update the toolbar when
5325 opening/closing buffer.
5327 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5329 * src/LyXAction.C (getActionName): enhance to return also the name
5330 and options of pseudo-actions.
5331 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5333 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5334 as an example of what is possible). Used in File->Build too (more
5335 useful) and in the import/export menus (to mimick the complicated
5336 handling of linuxdoc and friends). Try to update all the entries.
5338 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5341 * src/MenuBackend.C (read): Parse the new OptItem tag.
5343 * src/MenuBackend.h: Add a new optional_ data member (used if the
5344 entry should be omitted when the lyxfunc is disabled).
5346 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5347 function, used as a shortcut.
5348 (create_submenu): align correctly the shortcuts on the widest
5351 * src/MenuBackend.h: MenuItem.label() only returns the label of
5352 the menu without shortcut; new method shortcut().
5354 2000-07-14 Marko Vendelin <markov@ioc.ee>
5356 * src/frontends/gtk/Dialogs.C:
5357 * src/frontends/gtk/FormCopyright.C:
5358 * src/frontends/gtk/FormCopyright.h:
5359 * src/frontends/gtk/Makefile.am: added these source-files for the
5360 Gtk/Gnome support of the Copyright-Dialog.
5362 * src/main.C: added Gnome::Main initialization if using
5363 Gtk/Gnome frontend-GUI.
5365 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5367 * config/gnome/aclocal-include.m4
5368 * config/gnome/compiler-flags.m4
5369 * config/gnome/curses.m4
5370 * config/gnome/gnome--.m4
5371 * config/gnome/gnome-bonobo-check.m4
5372 * config/gnome/gnome-common.m4
5373 * config/gnome/gnome-fileutils.m4
5374 * config/gnome/gnome-ghttp-check.m4
5375 * config/gnome/gnome-gnorba-check.m4
5376 * config/gnome/gnome-guile-checks.m4
5377 * config/gnome/gnome-libgtop-check.m4
5378 * config/gnome/gnome-objc-checks.m4
5379 * config/gnome/gnome-orbit-check.m4
5380 * config/gnome/gnome-print-check.m4
5381 * config/gnome/gnome-pthread-check.m4
5382 * config/gnome/gnome-support.m4
5383 * config/gnome/gnome-undelfs.m4
5384 * config/gnome/gnome-vfs.m4
5385 * config/gnome/gnome-x-checks.m4
5386 * config/gnome/gnome-xml-check.m4
5387 * config/gnome/gnome.m4
5388 * config/gnome/gperf-check.m4
5389 * config/gnome/gtk--.m4
5390 * config/gnome/linger.m4
5391 * config/gnome/need-declaration.m4: added configuration scripts
5392 for Gtk/Gnome frontend-GUI
5394 * configure.in: added support for the --with-frontend=gtk option
5396 * autogen.sh: added config/gnome/* to list of config-files
5398 * acconfig.h: added define for GTKGUI-support
5400 * config/lyxinclude.m4: added --with-frontend[=value] option value
5401 for Gtk/Gnome frontend-GUI support.
5403 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5405 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5409 * src/paragraph.C (GetChar): remove non-const version
5411 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5412 (search_kw): use it.
5414 * src/lyx_main.C (init): if "preferences" exist, read that instead
5416 (ReadRcFile): return bool if the file could be read ok.
5417 (ReadUIFile): add a check to see if lex file is set ok.
5419 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5420 bastring can be used instead of lyxstring (still uses the old code
5421 if std::string is good enough or if lyxstring is used.)
5423 * src/encoding.C: make the arrays static, move ininle functions
5425 * src/encoding.h: from here.
5427 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5428 (parseSingleLyXformat2Token): move inset parsing to separate method
5429 (readInset): new private method
5431 * src/Variables.h: remove virtual from get().
5433 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5434 access to NEW_INSETS and NEW_TABULAR
5436 * src/MenuBackend.h: remove superfluous forward declaration of
5437 MenuItem. Add documentations tags "///", remove empty MenuItem
5438 destructor, remove private default contructor.
5440 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5442 (read): more string mlabel and mname to where they are used
5443 (read): remove unused variables mlabel and mname
5444 (defaults): unconditional clear, make menusetup take advantage of
5445 add returning Menu &.
5447 * src/LyXView.h: define NEW_MENUBAR as default
5449 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5450 to NEW_INSETS and NEW_TABULAR.
5451 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5452 defined. Change some of the "xxxx-inset-insert" functions names to
5455 * several files: more enahncements to NEW_INSETS and the resulting
5458 * lib/lyxrc.example (\date_insert_format): move to misc section
5460 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5461 bastring and use AC_CACHE_CHECK.
5462 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5463 the system have the newest methods. uses AC_CACHE_CHECK
5464 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5465 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5466 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5468 * configure.in: add LYX_CXX_GOOD_STD_STRING
5470 * acinclude.m4: recreated
5472 2000-07-24 Amir Karger <karger@lyx.org>
5474 * README: add Hebrew, Arabic kmaps
5477 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5479 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5482 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5484 * Lot of files: add pragma interface/implementation.
5486 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5488 * lib/ui/default.ui: new file (ans new directory). Contains the
5489 default menu and toolbar.
5491 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5492 global space. Toolbars are now read (as menus) in ui files.
5494 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5496 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5497 is disabled because the document is read-only. We want to have the
5498 toggle state of the function anyway.
5499 (getStatus): add code for LFUN_VC* functions (mimicking what is
5500 done in old-style menus)
5502 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5503 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5505 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5506 * src/BufferView_pimpl.C: ditto.
5507 * src/lyxfunc.C: ditto.
5509 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5510 default). This replaces old-style menus by new ones.
5512 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5513 MenuItem. Contain the data structure of a menu.
5515 * src/insets/insettext.C: use LyXView::setLayout instead of
5516 accessing directly the toolbar combox.
5517 * src/lyxfunc.C (Dispatch): ditto.
5519 * src/LyXView.C (setLayout): new method, which just calls
5520 Toolbar::setLayout().
5521 (updateLayoutChoice): move part of this method in Toolbar.
5523 * src/toolbar.[Ch]: removed.
5525 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5526 implementation the toolbar.
5528 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5529 the toolbar. It might make sense to merge it with ToolbarDefaults
5531 (setLayout): new function.
5532 (updateLayoutList): ditto.
5533 (openLayoutList): ditto.
5535 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5536 xforms implementation of the toolbar.
5537 (get_toolbar_func): comment out, since I do not
5538 know what it is good for.
5540 * src/ToolbarDefaults.h: Add the ItemType enum.
5542 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5543 for a list of allocated C strings. Used in Menubar xforms
5544 implementation to avoid memory leaks.
5546 * src/support/lstrings.[Ch] (uppercase): new version taking and
5550 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5551 * lib/bind/emacs.bind: ditto.
5553 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5555 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5556 forward decl of LyXView.
5558 * src/toolbar.C (toolbarItem): moved from toolbar.h
5559 (toolbarItem::clean): ditto
5560 (toolbarItem::~toolbarItem): ditto
5561 (toolbarItem::operator): ditto
5563 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5565 * src/paragraph.h: control the NEW_TABULAR define from here
5567 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5568 USE_TABULAR_INSETS to NEW_TABULAR
5570 * src/ToolbarDefaults.C: add include "lyxlex.h"
5572 * files using the old table/tabular: use NEW_TABULAR to control
5573 compilation of old tabular stuff.
5575 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5578 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5579 planemet in reading of old style floats, fix the \end_deeper
5580 problem when reading old style floats.
5582 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5584 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5586 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5588 * lib/bind/sciword.bind: updated.
5590 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5592 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5593 layout write problem
5595 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5597 * src/Makefile.am (INCLUDES): remove image directory from include
5600 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5601 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5603 * src/LyXView.C (create_form_form_main): read the application icon
5606 * lib/images/*.xpm: change the icons to use transparent color for
5609 * src/toolbar.C (update): change the color of the button when it
5612 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5614 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5615 setting explicitely the minibuffer.
5616 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5618 * src/LyXView.C (showState): new function. Shows font information
5619 in minibuffer and update toolbar state.
5620 (LyXView): call Toolbar::update after creating the
5623 * src/toolbar.C: change toollist to be a vector instead of a
5625 (BubbleTimerCB): get help string directly from the callback
5626 argument of the corresponding icon (which is the action)
5627 (set): remove unnecessary ugliness.
5628 (update): new function. update the icons (depressed, disabled)
5629 depending of the status of the corresponding action.
5631 * src/toolbar.h: remove help in toolbarItem
5633 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5635 * src/Painter.C (text): Added code for using symbol glyphs from
5636 iso10646 fonts. Currently diabled.
5638 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5641 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5642 magyar,turkish and usorbian.
5644 * src/paragraph.C (isMultiLingual): Made more efficient.
5646 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5649 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5650 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5651 Also changed the prototype to "bool math_insert_greek(char)".
5653 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5655 * lots of files: apply the NEW_INSETS on all code that will not be
5656 needed when we move to use the new insets. Enable the define in
5657 lyxparagrah.h to try it.
5659 * src/insets/insettabular.C (cellstart): change to be a static
5661 (InsetTabular): initialize buffer in the initializer list.
5663 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5665 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5666 form_print.h out of the header file. Replaced with forward
5667 declarations of the relevant struct.
5669 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5672 * src/commandtags.h: do not include "debug.h" which does not
5673 belong there. #include it in some other places because of this
5676 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5678 * src/insets/insetcaption.C: add a couple "using" directives.
5680 * src/toolbar.C (add): get the help text directly from lyxaction.
5682 (setPixmap): new function. Loads from disk and sets a pixmap on a
5683 botton; the name of the pixmap file is derived from the command
5686 * src/toolbar.h: remove members isBitmap and pixmap from
5689 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5690 * lib/images/: move many files from images/banner.xpm.
5692 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5694 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5695 * src/toolbar.C: ditto.
5696 * configure.in: ditto.
5697 * INSTALL: document.
5699 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5700 the spellchecker popup is closed from the WM.
5702 2000-07-19 Juergen Vigna <jug@sad.it>
5704 * src/insets/insetfloat.C (Write): small fix because we use the
5705 insetname for the type now!
5707 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5709 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5712 * src/frontends/Dialogs.h: removed hideCitation signal
5714 * src/insets/insetcite.h: added hide signal
5716 * src/insets/insetcite.C (~InsetCitation): emits new signal
5717 (getScreenLabel): "intelligent" label should now fit on the screen!
5719 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5721 * src/frontends/xforms/FormCitation.C (showInset): connects
5722 hide() to the inset's hide signal
5723 (show): modified to use fl_set_object_position rather than
5724 fl_set_object_geometry wherever possible
5726 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5728 * src/insets/lyxinset.h: add caption code
5730 * src/insets/insetfloat.C (type): new method
5732 * src/insets/insetcaption.C (Write): new method
5734 (LyxCode): new method
5736 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5737 to get it right together with using the FloatList.
5739 * src/commandtags.h: add LFUN_INSET_CAPTION
5740 * src/lyxfunc.C (Dispatch): handle it
5742 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5745 * src/Variables.[Ch]: make expand take a const reference, remove
5746 the destructor, some whitespace changes.
5748 * src/LyXAction.C (init): add caption-inset-insert
5750 * src/FloatList.C (FloatList): update the default floats a bit.
5752 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5754 * src/Variables.[Ch]: new files. Intended to be used for language
5755 specific strings (like \chaptername) and filename substitution in
5758 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5760 * lib/kbd/american.kmap: update
5762 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5764 * src/bufferparams.[Ch]: remove member allowAccents.
5766 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5768 * src/LaTeXLog.C: use the log_form.h header.
5769 * src/lyx_gui.C: ditto.
5770 * src/lyx_gui_misc.C: ditto.
5771 * src/lyxvc.h: ditto.
5773 * forms/log_form.fd: new file, created from latexoptions.fd. I
5774 kept the log popup and nuked the options form.
5776 * src/{la,}texoptions.[Ch]: removed.
5777 * src/lyx_cb.C (LaTeXOptions): ditto
5779 * src/lyx_gui.C (create_forms): do not handle the
5780 fd_latex_options form.
5782 2000-07-18 Juergen Vigna <jug@sad.it>
5784 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5785 name of the inset so that it can be requested outside (text2.C).
5787 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5790 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/mathed/formula.h (ConvertFont): constify
5794 * src/mathed/formula.C (Read): add warning if \end_inset is not
5795 found on expected place.
5797 * src/insets/lyxinset.h (ConvertFont): consify
5799 * src/insets/insetquotes.C (ConvertFont): constify
5800 * src/insets/insetquotes.h: ditto
5802 * src/insets/insetinfo.h: add labelfont
5804 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5805 (ascent): use labelfont
5809 (Write): make .lyx file a bit nicer
5811 * src/insets/insetfloat.C (Write): simplify somewhat...
5812 (Read): add warning if arg is not found
5814 * src/insets/insetcollapsable.C: add using std::max
5815 (Read): move string token and add warning in arg is not found
5816 (draw): use std::max to get the right ty
5817 (getMaxWidth): simplify by using std::max
5819 * src/insets/insetsection.h: new file
5820 * src/insets/insetsection.C: new file
5821 * src/insets/insetcaption.h: new file
5822 * src/insets/insetcaption.C: new file
5824 * src/insets/inset.C (ConvertFont): constify signature
5826 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5827 insetcaption.[Ch] and insetsection.[Ch]
5829 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5830 uses to use LABEL_COUNTER_CHAPTER instead.
5831 * src/text2.C (SetCounter): here
5833 * src/counters.h: new file
5834 * src/counters.C: new file
5835 * src/Sectioning.h: new file
5836 * src/Sectioning.C: new file
5838 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5840 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5842 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5845 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5848 2000-07-17 Juergen Vigna <jug@sad.it>
5850 * src/tabular.C (Validate): check if array-package is needed.
5851 (SetVAlignment): added support for vertical alignment.
5852 (SetLTFoot): better support for longtable header/footers
5853 (Latex): modified to support added features.
5855 * src/LaTeXFeatures.[Ch]: added array-package.
5857 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5859 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5862 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5864 * configure.in: do not forget to put a space after -isystem.
5866 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5868 * lib/kbd/arabic.kmap: a few fixes.
5870 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5872 * some whitespace chagnes to a number of files.
5874 * src/support/DebugStream.h: change to make it easier for
5875 doc++ to parse correctly.
5876 * src/support/lyxstring.h: ditto
5878 * src/mathed/math_utils.C (compara): change to have only one
5880 (MathedLookupBOP): change because of the above.
5882 * src/mathed/math_delim.C (math_deco_compare): change to have only
5884 (search_deco): change becasue of the above.
5886 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5887 instead of manually coded one.
5889 * src/insets/insetquotes.C (Read): read the \end_inset too
5891 * src/insets/insetlatex.h: remove file
5892 * src/insets/insetlatex.C: remove file
5894 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5896 (InsetPrintIndex): remove destructor
5898 * src/insets/insetinclude.h: remove default constructor
5900 * src/insets/insetfloat.C: work to make it work better
5902 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5904 * src/insets/insetcite.h (InsetCitation): remove default constructor
5906 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5908 * src/text.C (GetColumnNearX): comment out some currently unused code.
5910 * src/paragraph.C (writeFile): move some initializations closer to
5912 (CutIntoMinibuffer): small change to use new matchIT operator
5916 (InsertInset): ditto
5919 (InsetIterator): ditto
5920 (Erase): small change to use new matchFT operator
5922 (GetFontSettings): ditto
5923 (HighestFontInRange): ditto
5926 * src/lyxparagraph.h: some chars changed to value_type
5927 (matchIT): because of some stronger checking (perhaps too strong)
5928 in SGI STL, the two operator() unified to one.
5931 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5933 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5934 the last inset read added
5935 (parseSingleLyXformat2Token): some more (future) compability code added
5936 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5937 (parseSingleLyXformat2Token): set last_inset_read
5938 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5939 (parseSingleLyXformat2Token): don't double intializw string next_token
5941 * src/TextCache.C (text_fits::operator()): add const's to the signature
5942 (has_buffer::operator()): ditto
5944 * src/Floating.h: add some comments on the class
5946 * src/FloatList.[Ch] (typeExist): new method
5949 * src/BackStack.h: added default constructor, wanted by Gcc.
5951 2000-07-14 Juergen Vigna <jug@sad.it>
5953 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5955 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5957 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5958 do a redraw when the window is resized!
5959 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5961 * src/insets/insettext.C (resizeLyXText): added function to correctly
5962 being able to resize the LyXWindow.
5964 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5966 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5968 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5969 crashes when closing dialog to a deleted inset.
5971 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5972 method! Now similar to other insets.
5974 2000-07-13 Juergen Vigna <jug@sad.it>
5976 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5978 * lib/examples/Literate.lyx: small patch!
5980 * src/insets/insetbib.C (Read): added this function because of wrong
5981 Write (without [begin|end]_inset).
5983 2000-07-11 Juergen Vigna <jug@sad.it>
5985 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5986 as the insertInset could not be good!
5988 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5989 the bool param should not be last.
5991 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5993 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5994 did submit that to Karl).
5996 * configure.in: use -isystem instead of -I for X headers. This
5997 fixes a problem on solaris with a recent gcc;
5998 put the front-end code after the X detection code;
5999 configure in sigc++ before lib/
6001 * src/lyx_main.C (commandLineHelp): remove -display from command
6004 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6006 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6007 Also put in Makefile rules for building the ``listerrors''
6008 program for parsing errors from literate programs written in LyX.
6010 * lib/build-listerrors: Added small shell script as part of compile
6011 process. This builds a working ``listerrors'' binary if noweb is
6012 installed and either 1) the VNC X server is installed on the machine,
6013 or 2) the user is compiling from within a GUI. The existence of a GUI
6014 is necessary to use the ``lyx --export'' feature for now. This
6015 hack can be removed once ``lyx --export'' no longer requires a GUI to
6018 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6020 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6021 now passed back correctly from gcc and placed "under" error
6022 buttons in a Literate LyX source.
6024 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6026 * src/text.C (GetColumnNearX): Better behavior when a RTL
6027 paragraph is ended by LTR text.
6029 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6032 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6034 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6035 true when clipboard is empty.
6037 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6039 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6040 row of the paragraph.
6041 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6042 to prevent calculation of bidi tables
6044 2000-07-07 Juergen Vigna <jug@sad.it>
6046 * src/screen.C (ToggleSelection): added y_offset and x_offset
6049 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6052 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6054 * src/insets/insettext.C: fixed Layout-Display!
6056 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6058 * configure.in: add check for strings.h header.
6060 * src/spellchecker.C: include <strings.h> in order to have a
6061 definition for bzero().
6063 2000-07-07 Juergen Vigna <jug@sad.it>
6065 * src/insets/insettext.C (draw): set the status of the bv->text to
6066 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6068 * src/screen.C (DrawOneRow):
6069 (DrawFromTo): redraw the actual row if something has changed in it
6072 * src/text.C (draw): call an update of the toplevel-inset if something
6073 has changed inside while drawing.
6075 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6077 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6079 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6080 processing inside class.
6082 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6083 processing inside class.
6085 * src/insets/insetindex.h new struct Holder, consistent with other
6088 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6089 citation dialog from main code and placed it in src/frontends/xforms.
6090 Dialog launched through signals instead of callbacks
6092 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6094 * lyx.man: update the options description.
6096 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6098 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6099 handle neg values, set min width to 590, add doc about -display
6101 2000-07-05 Juergen Vigna <jug@sad.it>
6103 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6104 calls to BufferView *.
6106 * src/insets/insettext.C (checkAndActivateInset): small fix non
6107 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6109 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6110 their \end_inset token!
6112 2000-07-04 edscott <edscott@imp.mx>
6114 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6115 lib/lyxrc.example: added option \wheel_jump
6117 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6119 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6120 remove support for -width,-height,-xpos and -ypos.
6122 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6124 * src/encoding.[Ch]: New files.
6126 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6127 (text): Call to the underline() method only when needed.
6129 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6131 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6132 encoding(s) for the document.
6134 * src/bufferparams.C (BufferParams): Changed default value of
6137 * src/language.C (newLang): Removed.
6138 (items[]): Added encoding information for all defined languages.
6140 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6141 encoding choice button.
6143 * src/lyxrc.h (font_norm_type): New member variable.
6144 (set_font_norm_type): New method.
6146 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6147 paragraphs with different encodings.
6149 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6150 (TransformChar): Changed to work correctly with Arabic points.
6151 (draw): Added support for drawing Arabic points.
6152 (draw): Removed code for drawing underbars (this is done by
6155 * src/support/textutils.h (IsPrintableNonspace): New function.
6157 * src/BufferView_pimpl.h: Added "using SigC::Object".
6158 * src/LyXView.h: ditto.
6160 * src/insets/insetinclude.h (include_label): Changed to mutable.
6162 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6164 * src/mathed/math_iter.h: remove empty destructor
6166 * src/mathed/math_cursor.h: remove empty destructor
6168 * src/insets/lyxinset.h: add THEOREM_CODE
6170 * src/insets/insettheorem.[Ch]: new files
6172 * src/insets/insetminipage.C: (InsertInset): remove
6174 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6176 (InsertInset): remove
6178 * src/insets/insetlist.C: (InsertList): remove
6180 * src/insets/insetfootlike.[Ch]: new files
6182 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6185 (InsertInset): ditto
6187 * src/insets/insetert.C: remove include Painter.h, reindent
6188 (InsertInset): move to header
6190 * src/insets/insetcollapsable.h: remove explicit from default
6191 contructor, remove empty destructor, add InsertInset
6193 * src/insets/insetcollapsable.C (InsertInset): new func
6195 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6197 * src/vspace.h: add explicit to constructor
6199 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6200 \textcompwordmark, please test this.
6202 * src/lyxrc.C: set ascii_linelen to 65 by default
6204 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6206 * src/commandtags.h: add LFUN_INSET_THEOREM
6208 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6209 (makeLinuxDocFile): remove _some_ of the nice logic
6210 (makeDocBookFile): ditto
6212 * src/Painter.[Ch]: (~Painter): removed
6214 * src/LyXAction.C (init): entry for insettheorem added
6216 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6218 (deplog): code to detect files generated by LaTeX, needs testing
6221 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6223 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6225 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6227 * src/LaTeX.C (deplog): Add a check for files that are going to be
6228 created by the first latex run, part of the project to remove the
6231 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6232 contents to the extension list.
6234 2000-07-04 Juergen Vigna <jug@sad.it>
6236 * src/text.C (NextBreakPoint): added support for needFullRow()
6238 * src/insets/lyxinset.h: added needFullRow()
6240 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6243 * src/insets/insettext.C: lots of changes for update!
6245 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6247 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6249 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6251 * src/insets/insetinclude.C (InsetInclude): fixed
6252 initialization of include_label.
6253 (unique_id): now returns a string.
6255 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6257 * src/LaTeXFeatures.h: new member IncludedFiles, for
6258 a map of key, included file name.
6260 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6261 with the included files for inclusion in SGML preamble,
6262 i. e., linuxdoc and docbook.
6265 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6266 nice (is the generated linuxdoc code to be exported?), that
6267 allows to remove column, and only_body that will be true for
6268 slave documents. Insets are allowed inside SGML font type.
6269 New handling of the SGML preamble for included files.
6270 (makeDocBookFile): the same for docbook.
6272 * src/insets/insetinclude.h:
6273 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6275 (DocBook): new export methods.
6277 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6278 and makeDocBookFile.
6280 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6281 formats to export with command line argument -x.
6283 2000-06-29 Juergen Vigna <jug@sad.it>
6285 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6286 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6288 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6289 region could already been cleared by an inset!
6291 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6293 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6296 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6298 (cursorToggle): remove special handling of lyx focus.
6300 2000-06-28 Juergen Vigna <jug@sad.it>
6302 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6305 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6307 * src/insets/insetindex.C (Edit): add a callback when popup is
6310 * src/insets/insettext.C (LocalDispatch):
6311 * src/insets/insetmarginal.h:
6312 * src/insets/insetlist.h:
6313 * src/insets/insetfoot.h:
6314 * src/insets/insetfloat.h:
6315 * src/insets/insetert.h: add a missing std:: qualifier.
6317 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6319 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6322 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6324 * src/insets/insettext.C (Read): remove tmptok unused variable
6325 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6326 (InsertInset): change for new InsetInset code
6328 * src/insets/insettext.h: add TEXT inline method
6330 * src/insets/insettext.C: remove TEXT macro
6332 * src/insets/insetmarginal.C (Write): new method
6333 (Latex): change output slightly
6335 * src/insets/insetfoot.C (Write): new method
6336 (Latex): change output slightly (don't use endl when no need)
6338 * src/insets/insetert.C (Write): new method
6340 * src/insets/insetcollapsable.h: make button_length, button_top_y
6341 and button_bottm_y protected.
6343 * src/insets/insetcollapsable.C (Write): simplify code by using
6344 tostr. Also do not output the float name, the children class
6345 should to that to get control over own arguments
6347 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6348 src/insets/insetminipage.[Ch]:
6351 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6353 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6355 * src/Makefile.am (lyx_SOURCES): add the new files
6357 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6358 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6359 * src/commandtags.h: ditto
6361 * src/LaTeXFeatures.h: add a std::set of used floattypes
6363 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6365 * src/FloatList.[Ch] src/Floating.h: new files
6367 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6369 * src/lyx_cb.C (TableApplyCB): ditto
6371 * src/text2.C: ditto
6372 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6373 (parseSingleLyXformat2Token): ditto + add code for
6374 backwards compability for old float styles + add code for new insets
6376 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6378 (InsertInset(size_type, Inset *, LyXFont)): new method
6379 (InsetChar(size_type, char)): changed to use the other InsetChar
6380 with a LyXFont(ALL_INHERIT).
6381 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6382 insert the META_INSET.
6384 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6386 * sigc++/thread.h (Threads): from here
6388 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6389 definition out of line
6390 * sigc++/scope.h: from here
6392 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6394 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6395 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6397 * Makefile.am (bindist): new target.
6399 * INSTALL: add instructions for doing a binary distribution.
6401 * development/tools/README.bin.example: update a bit.
6403 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6406 * lib/lyxrc.example: new lyxrc tag \set_color.
6408 * src/lyxfunc.C (Dispatch):
6409 * src/commandtags.h:
6410 * src/LyXAction.C: new lyxfunc "set-color".
6412 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6413 and an x11name given as strings.
6415 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6416 cache when a color is changed.
6418 2000-06-26 Juergen Vigna <jug@sad.it>
6420 * src/lyxrow.C (width): added this functions and variable.
6422 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6425 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6427 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6429 * images/undo_bw.xpm: new icon.
6430 * images/redo_bw.xpm: ditto.
6432 * configure.in (INSTALL_SCRIPT): change value to
6433 ${INSTALL} to avoid failures of install-script target.
6434 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6436 * src/BufferView.h: add a magic "friend" declaration to please
6439 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6441 * forms/cite.fd: modified to allow resizing without messing
6444 * src/insetcite.C: Uses code from cite.fd almost without
6446 User can now resize dialog in the x-direction.
6447 Resizing the dialog in the y-direction is prevented, as the
6448 code does this intelligently already.
6450 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6452 * INSTALL: remove obsolete entry in "problems" section.
6454 * lib/examples/sl_*.lyx: update of the slovenian examples.
6456 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6458 2000-06-23 Juergen Vigna <jug@sad.it>
6460 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6462 * src/buffer.C (resize): delete the LyXText of textinsets.
6464 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6466 * src/insets/lyxinset.h: added another parameter 'cleared' to
6467 the draw() function.
6469 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6470 unlocking inset in inset.
6472 2000-06-22 Juergen Vigna <jug@sad.it>
6474 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6475 of insets and moved first to LyXText.
6477 * src/mathed/formulamacro.[Ch]:
6478 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6480 2000-06-21 Juergen Vigna <jug@sad.it>
6482 * src/text.C (GetVisibleRow): look if I should clear the area or not
6483 using Inset::doClearArea() function.
6485 * src/insets/lyxinset.h: added doClearArea() function and
6486 modified draw(Painter &, ...) to draw(BufferView *, ...)
6488 * src/text2.C (UpdateInset): return bool insted of int
6490 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6492 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6493 combox in the character popup
6495 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6496 BufferParams const & params
6498 2000-06-20 Juergen Vigna <jug@sad.it>
6500 * src/insets/insettext.C (SetParagraphData): set insetowner on
6503 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6505 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6506 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6508 (form_main_): remove
6510 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6511 (create_form_form_main): remove FD_form_main stuff, connect to
6512 autosave_timeout signal
6514 * src/LyXView.[Ch] (getMainForm): remove
6515 (UpdateTimerCB): remove
6516 * src/BufferView_pimpl.h: inherit from SigC::Object
6518 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6519 signal instead of callback
6521 * src/BufferView.[Ch] (cursorToggleCB): remove
6523 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6525 * src/BufferView_pimpl.C: changes because of the one below
6527 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6528 instead of storing a pointer to a LyXText.
6530 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6532 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6534 * src/lyxparagraph.h
6536 * src/paragraph.C: Changed fontlist to a sorted vector.
6538 2000-06-19 Juergen Vigna <jug@sad.it>
6540 * src/BufferView.h: added screen() function.
6542 * src/insets/insettext.C (LocalDispatch): some selection code
6545 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6547 * src/insets/insettext.C (SetParagraphData):
6549 (InsetText): fixes for multiple paragraphs.
6551 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6553 * development/lyx.spec.in: Call configure with ``--without-warnings''
6554 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6555 This should be fine, however, since we generally don't want to be
6556 verbose when making an RPM.
6558 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6560 * lib/scripts/fig2pstex.py: New file
6562 2000-06-16 Juergen Vigna <jug@sad.it>
6564 * src/insets/insettabular.C (UpdateLocal):
6565 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6566 (LocalDispatch): Changed all functions to use LyXText.
6568 2000-06-15 Juergen Vigna <jug@sad.it>
6570 * src/text.C (SetHeightOfRow): call inset::update before requesting
6573 * src/insets/insettext.C (update):
6574 * src/insets/insettabular.C (update): added implementation
6576 * src/insets/lyxinset.h: added update function
6578 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6580 * src/text.C (SelectNextWord): protect against null pointers with
6581 old-style string streams. (fix from Paul Theo Gonciari
6584 * src/cite.[Ch]: remove erroneous files.
6586 * lib/configure.m4: update the list of created directories.
6588 * src/lyxrow.C: include <config.h>
6589 * src/lyxcursor.C: ditto.
6591 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6593 * lib/examples/decimal.lyx: new example file from Mike.
6595 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6596 to find template definitions (from Dekel)
6598 * src/frontends/.cvsignore: add a few things.
6600 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6602 * src/Timeout.C (TimeOut): remove default argument.
6604 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6607 * src/insets/ExternalTemplate.C: add a "using" directive.
6609 * src/lyx_main.h: remove the act_ struct, which seems unused
6612 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6614 * LyX Developers Meeting: All files changed, due to random C++ (by
6615 coincidence) code generator script.
6617 - external inset (cool!)
6618 - initial online editing of preferences
6619 - insettabular breaks insettext(s contents)
6621 - some DocBook fixes
6622 - example files update
6623 - other cool stuff, create a diff and look for yourself.
6625 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6627 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6628 -1 this is a non-line-breaking textinset.
6630 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6631 if there is no width set.
6633 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6635 * Lots of files: Merged the dialogbase branch.
6637 2000-06-09 Allan Rae <rae@lyx.org>
6639 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6640 and the Dispatch methods that used it.
6642 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6643 access to functions formerly kept in Dispatch.
6645 2000-05-19 Allan Rae <rae@lyx.org>
6647 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6648 made to_page and count_copies integers again. from_page remains a
6649 string however because I want to allow entry of a print range like
6650 "1,4,22-25" using this field.
6652 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6653 and printer-params-get. These aren't useful from the minibuffer but
6654 could be used by a script/LyXServer app provided it passes a suitable
6655 auto_mem_buffer. I guess I should take a look at how the LyXServer
6656 works and make it support xtl buffers.
6658 * sigc++/: updated to libsigc++-1.0.1
6660 * src/xtl/: updated to xtl-1.3.pl.11
6662 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6663 those changes done to the files in src/ are actually recreated when
6664 they get regenerated. Please don't ever accept a patch that changes a
6665 dialog unless that patch includes the changes to the corresponding *.fd
6668 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6669 stringOnlyContains, renamed it and generalised it.
6671 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6672 branch. Removed the remaining old form_print code.
6674 2000-04-26 Allan Rae <rae@lyx.org>
6676 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6677 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6679 2000-04-25 Allan Rae <rae@lyx.org>
6681 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6682 against a base of xtl-1.3.pl.4
6684 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6685 filter the Id: entries so they still show the xtl version number
6688 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6689 into the src/xtl code. Patch still pending with José (XTL)
6691 2000-04-24 Allan Rae <rae@lyx.org>
6693 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6694 both more generic and much safer. Use the new template functions.
6695 * src/buffer.[Ch] (Dispatch): ditto.
6697 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6698 and mem buffer more intelligently. Also a little general cleanup.
6701 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6702 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6703 * src/xtl/Makefile.am: ditto.
6704 * src/xtl/.cvsignore: ditto.
6705 * src/Makefile.am: ditto.
6707 * src/PrinterParams.h: Removed the macros member functions. Added a
6708 testInvariant member function. A bit of tidying up and commenting.
6709 Included Angus's idea for fixing operation with egcs-1.1.2.
6711 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6712 cool expansion of XTL's mem_buffer to support automatic memory
6713 management within the buffer itself. Removed the various macros and
6714 replaced them with template functions that use either auto_mem_buffer
6715 or mem_buffer depending on a #define. The mem_buffer support will
6716 disappear as soon as the auto_mem_buffer is confirmed to be good on
6717 other platforms/compilers. That is, it's there so you've got something
6720 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6721 effectively forked XTL. However I expect José will include my code
6722 into the next major release. Also fixed a memory leak.
6723 * src/xtl/text.h: ditto.
6724 * src/xtl/xdr.h: ditto.
6725 * src/xtl/giop.h: ditto.
6727 2000-04-16 Allan Rae <rae@lyx.org>
6729 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6730 by autogen.sh and removed by maintainer-clean anyway.
6731 * .cvsignore, sigc++/.cvsignore: Support the above.
6733 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6735 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6737 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6738 macros, renamed static callback-target member functions to suit new
6739 scheme and made them public.
6740 * src/frontends/xforms/forms/form_print.fd: ditto.
6741 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6743 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6746 * src/xtl/: New directory containing a minimal distribution of XTL.
6747 This is XTL-1.3.pl.4.
6749 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6751 2000-04-15 Allan Rae <rae@lyx.org>
6753 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6755 * sigc++/: Updated to libsigc++-1.0.0
6757 2000-04-14 Allan Rae <rae@lyx.org>
6759 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6760 use the generic ones in future. I'll modify my conversion script.
6762 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6764 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6765 (CloseAllBufferRelatedDialogs): Renamed.
6766 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6768 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6769 of the generic ones. These are the same ones my conversion script
6772 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6773 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6774 * src/buffer.C (Dispatch): ditto
6776 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6777 functions for updating and hiding buffer dependent dialogs.
6778 * src/BufferView.C (buffer): ditto
6779 * src/buffer.C (setReadonly): ditto
6780 * src/lyxfunc.C (CloseBuffer): ditto
6782 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6783 Dialogs.h, and hence all the SigC stuff, into every file that includes
6784 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6786 * src/BufferView2.C: reduce the number of headers included by buffer.h
6788 2000-04-11 Allan Rae <rae@lyx.org>
6790 * src/frontends/xforms/xform_macros.h: A small collection of macros
6791 for building C callbacks.
6793 * src/frontends/xforms/Makefile.am: Added above file.
6795 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6796 scheme again. This time it should work for JMarc. If this is
6797 successful I'll revise my conversion script to automate some of this.
6798 The static member functions in the class also have to be public for
6799 this scheme will work. If the scheme works (it's almost identical to
6800 the way BufferView::cursorToggleCB is handled so it should work) then
6801 FormCopyright and FormPrint will be ready for inclusion into the main
6802 trunk immediately after 1.1.5 is released -- provided we're prepared
6803 for complaints about lame compilers not handling XTL.
6805 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6807 2000-04-07 Allan Rae <rae@lyx.org>
6809 * config/lyxinclude.m4: A bit more tidying up (Angus)
6811 * src/LString.h: JMarc's <string> header fix
6813 * src/PrinterParams.h: Used string for most data to remove some
6814 ugly code in the Print dialog and avoid even uglier code when
6815 appending the ints to a string for output.
6817 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6818 and moved "default:" back to the end of switch statement. Cleaned
6819 up the printing so it uses the right function calls and so the
6820 "print to file" option actually puts the file in the right directory.
6822 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6824 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6825 and Ok+Apply button control into a separate method: input (Angus).
6826 (input) Cleaned it up and improved it to be very thorough now.
6827 (All CB) static_cast used instead of C style cast (Angus). This will
6828 probably change again once we've worked out how to keep gcc-2.8.1 happy
6829 with real C callbacks.
6830 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6831 ignore some of the bool settings and has random numbers instead. Needs
6832 some more investigation. Added other input length checks and checking
6833 of file and printer names.
6835 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6836 would link (Angus). Seems the old code doesn't compile with the pragma
6837 statement either. Separated callback entries from internal methods.
6839 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6841 2000-03-17 Allan Rae <rae@lyx.org>
6843 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6844 need it? Maybe it could go in Dialogs instead? I could make it a
6845 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6846 values to get the bool return value.
6847 (Dispatch): New overloaded method for xtl support.
6849 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6850 extern "C" callback instead of static member functions. Hopefully,
6851 JMarc will be able to compile this. I haven't changed
6852 forms/form_copyright.fd yet. Breaking one of my own rules already.
6854 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6855 because they aren't useful from the minibuffer. Maybe a LyXServer
6856 might want a help message though?
6858 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6860 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6861 xtl which needs both rtti and exceptions.
6863 * src/support/Makefile.am:
6864 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6866 * src/frontends/xforms/input_validators.[ch]: input filters and
6867 validators. These conrol what keys are valid in input boxes.
6868 Use them and write some more. Much better idea than waiting till
6869 after the user has pressed Ok to say that the input fields don't make
6872 * src/frontends/xforms/Makefile.am:
6873 * src/frontends/xforms/forms/form_print.fd:
6874 * src/frontends/xforms/forms/makefile:
6875 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6876 new scheme. Still have to make sure I haven't missed anything from
6877 the current implementation.
6879 * src/Makefile.am, src/PrinterParams.h: New data store.
6881 * other files: Added a couple of copyright notices.
6883 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6885 * src/insets/insetbib.h: move Holder struct in public space.
6887 * src/frontends/include/DialogBase.h: use SigC:: only when
6888 SIGC_CXX_NAMESPACES is defined.
6889 * src/frontends/include/Dialogs.h: ditto.
6891 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6893 * src/frontends/xforms/FormCopyright.[Ch]: do not
6894 mention SigC:: explicitely.
6896 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6898 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6899 deals with testing KDE in main configure.in
6900 * configure.in: ditto.
6902 2000-02-22 Allan Rae <rae@lyx.org>
6904 * Lots of files: Merged from HEAD
6906 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6907 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6909 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6911 * sigc++/: new minidist.
6913 2000-02-14 Allan Rae <rae@lyx.org>
6915 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6917 2000-02-08 Juergen Vigna <jug@sad.it>
6919 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6920 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6922 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6923 for this port and so it is much easier for other people to port
6924 dialogs in a common development environment.
6926 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6927 the QT/KDE implementation.
6929 * src/frontends/kde/Dialogs.C:
6930 * src/frontends/kde/FormCopyright.C:
6931 * src/frontends/kde/FormCopyright.h:
6932 * src/frontends/kde/Makefile.am:
6933 * src/frontends/kde/formcopyrightdialog.C:
6934 * src/frontends/kde/formcopyrightdialog.h:
6935 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6936 for the kde support of the Copyright-Dialog.
6938 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6939 subdir-substitution instead of hardcoded 'xforms' as we now have also
6942 * src/frontends/include/DialogBase.h (Object): just commented the
6943 label after #endif (nasty warning and I don't like warnings ;)
6945 * src/main.C (main): added KApplication initialization if using
6948 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6949 For now only the KDE event-loop is added if frontend==kde.
6951 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6953 * configure.in: added support for the --with-frontend[=value] option
6955 * autogen.sh: added kde.m4 file to list of config-files
6957 * acconfig.h: added define for KDEGUI-support
6959 * config/kde.m4: added configuration functions for KDE-port
6961 * config/lyxinclude.m4: added --with-frontend[=value] option with
6962 support for xforms and KDE.
6964 2000-02-08 Allan Rae <rae@lyx.org>
6966 * all Makefile.am: Fixed up so the make targets dist, distclean,
6967 install and uninstall all work even if builddir != srcdir. Still
6968 have a new sigc++ minidist update to come.
6970 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6972 2000-02-01 Allan Rae <rae@lyx.org>
6974 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6975 Many mods to get builddir != srcdir working.
6977 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6978 for building on NT and so we can do the builddir != srcdir stuff.
6980 2000-01-30 Allan Rae <rae@lyx.org>
6982 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6983 This will stay in "rae" branch. We probably don't really need it in
6984 the main trunk as anyone who wants to help programming it should get
6985 a full library installed also. So they can check both included and
6986 system supplied library compilation.
6988 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6989 Added a 'mini' distribution of libsigc++. If you feel the urge to
6990 change something in these directories - Resist it. If you can't
6991 resist the urge then you should modify the following script and rebuild
6992 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6993 all happen. Still uses a hacked version of libsigc++'s configure.in.
6994 I'm quite happy with the results. I'm not sure the extra work to turn
6995 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6996 worth the trouble and would probably lead to extra maintenance
6998 I haven't tested the following important make targets: install, dist.
6999 Not ready for prime time but very close. Maybe 1.1.5.
7001 * development/tools/makeLyXsigc.sh: A shell script to automatically
7002 generate our mini-dist of libsigc++. It can only be used with a CVS
7003 checkout of libsigc++ not a tarball distribution. It's well commented.
7004 This will end up as part of the libsigc++ distribution so other apps
7005 can easily have an included mini-dist. If someone makes mods to the
7006 sigc++ subpackage without modifying this script to generate those
7007 changes I'll be very upset!
7009 * src/frontends/: Started the gui/system indep structure.
7011 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7012 to access the gui-indep dialogs are in this class. Much improved
7013 design compared to previous revision. Lars, please refrain from
7014 moving this header into src/ like you did with Popups.h last time.
7016 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7018 * src/frontends/xforms/: Started the gui-indep system with a single
7019 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7022 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7023 Here you'll find a very useful makefile and automated fdfix.sh that
7024 makes updating dailogs a no-brainer -- provided you follow the rules
7025 set out in the README. I'm thinking about adding another script to
7026 automatically generate skeleton code for a new dialog given just the
7029 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7030 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7031 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7033 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7035 * src/support/LSubstring.C (operator): simplify
7037 * src/lyxtext.h: removed bparams, use buffer_->params instead
7039 * src/lyxrow.h: make Row a real class, move all variables to
7040 private and use accessors.
7042 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7044 (isRightToLeftPar): ditto
7045 (ChangeLanguage): ditto
7046 (isMultiLingual): ditto
7049 (SimpleTeXOnePar): ditto
7050 (TeXEnvironment): ditto
7051 (GetEndLabel): ditto
7053 (SetOnlyLayout): ditto
7054 (BreakParagraph): ditto
7055 (BreakParagraphConservative): ditto
7056 (GetFontSettings): ditto
7058 (CopyIntoMinibuffer): ditto
7059 (CutIntoMinibuffer): ditto
7060 (PasteParagraph): ditto
7061 (SetPExtraType): ditto
7062 (UnsetPExtraType): ditto
7063 (DocBookContTableRows): ditto
7064 (SimpleDocBookOneTablePar): ditto
7066 (TeXFootnote): ditto
7067 (SimpleTeXOneTablePar): ditto
7068 (TeXContTableRows): ditto
7069 (SimpleTeXSpecialChars): ditto
7072 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7073 to private and use accessors.
7075 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7076 this, we did not use it anymore and has not been for ages. Just a
7077 waste of cpu cycles.
7079 * src/language.h: make Language a real class, move all variables
7080 to private and use accessors.
7082 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7083 (create_view): remove
7084 (update): some changes for new timer
7085 (cursorToggle): use new timer
7086 (beforeChange): change for new timer
7088 * src/BufferView.h (cursorToggleCB): removed last paramter because
7091 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7092 (cursorToggleCB): change because of new timer code
7094 * lib/CREDITS: updated own mailaddress
7096 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7098 * src/support/filetools.C (PutEnv): fix the code in case neither
7099 putenv() nor setenv() have been found.
7101 * INSTALL: mention the install-strip Makefile target.
7103 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7104 read-only documents.
7106 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7108 * lib/reLyX/configure.in (VERSION): avoid using a previously
7109 generated reLyX wrapper to find out $prefix.
7111 * lib/examples/eu_adibide_lyx-atua.lyx:
7112 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7113 translation of the Tutorial (Dooteo)
7115 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7117 * forms/cite.fd: new citation dialog
7119 * src/insetcite.[Ch]: the new citation dialog is moved into
7122 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7125 * src/insets/insetcommand.h: data members made private.
7127 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7129 * LyX 1.1.5 released
7131 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7133 * src/version.h (LYX_RELEASE): to 1.1.5
7135 * src/spellchecker.C (RunSpellChecker): return false if the
7136 spellchecker dies upon creation.
7138 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7140 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7141 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7145 * lib/CREDITS: update entry for Martin Vermeer.
7147 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7149 * src/text.C (draw): Draw foreign language bars at the bottom of
7150 the row instead of at the baseline.
7152 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7154 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7156 * lib/bind/de_menus.bind: updated
7158 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7160 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7162 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7164 * src/menus.C (Limit_string_length): New function
7165 (ShowTocMenu): Limit the number of items/length of items in the
7168 * src/paragraph.C (String): Correct result for a paragraph inside
7171 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7173 * src/bufferlist.C (close): test of buf->getuser() == NULL
7175 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7177 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7178 Do not call to SetCursor when the paragraph is a closed footnote!
7180 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7182 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7185 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7187 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7190 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7191 reference popup, that activates the reference-back action
7193 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7195 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7196 the menus. Also fixed a bug.
7198 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7199 the math panels when switching buffers (unless new buffer is readonly).
7201 * src/BufferView.C (NoSavedPositions)
7202 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7204 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7206 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7207 less of dvi dirty or not.
7209 * src/trans_mgr.[Ch] (insert): change first parameter to string
7212 * src/chset.[Ch] (encodeString): add const to first parameter
7214 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7216 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7220 * src/LaTeX.C (deplog): better searching for dependency files in
7221 the latex log. Uses now regexps.
7223 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7224 instead of the box hack or \hfill.
7226 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7228 * src/lyxfunc.C (doImportHelper): do not create the file before
7229 doing the actual import.
7230 (doImportASCIIasLines): create a new file before doing the insert.
7231 (doImportASCIIasParagraphs): ditto.
7233 * lib/lyxrc.example: remove mention of non-existing commands
7235 * lyx.man: remove mention of color-related switches.
7237 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7239 * src/lyx_gui.C: remove all the color-related ressources, which
7240 are not used anymore.
7242 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7245 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7247 * src/lyxrc.C (read): Add a missing break in the switch
7249 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7251 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7253 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7256 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7258 * src/text.C (draw): draw bars under foreign language words.
7260 * src/LColor.[Ch]: add LColor::language
7262 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7264 * src/lyxcursor.h (boundary): New member variable
7266 * src/text.C (IsBoundary): New methods
7268 * src/text.C: Use the above for currect cursor movement when there
7269 is both RTL & LTR text.
7271 * src/text2.C: ditto
7273 * src/bufferview_funcs.C (ToggleAndShow): ditto
7275 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7277 * src/text.C (DeleteLineForward): set selection to true to avoid
7278 that DeleteEmptyParagraphMechanism does some magic. This is how it
7279 is done in all other functions, and seems reasonable.
7280 (DeleteWordForward): do not jump over non-word stuff, since
7281 CursorRightOneWord() already does it.
7283 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7284 DeleteWordBackward, since they seem safe to me (since selection is
7285 set to "true") DeleteEmptyParagraphMechanism does nothing.
7287 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7289 * src/lyx_main.C (easyParse): simplify the code by factoring the
7290 part that removes parameters from the command line.
7291 (LyX): check wether wrong command line options have been given.
7293 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7295 * src/lyx_main.C : add support for specifying user LyX
7296 directory via command line option -userdir.
7298 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7300 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7301 the number of items per popup.
7302 (Add_to_refs_menu): Ditto.
7304 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7306 * src/lyxparagraph.h: renamed ClearParagraph() to
7307 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7308 textclass as parameter, and do nothing if free_spacing is
7309 true. This fixes part of the line-delete-forward problems.
7311 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7312 (pasteSelection): ditto.
7313 (SwitchLayoutsBetweenClasses): more translatable strings.
7315 * src/text2.C (CutSelection): use StripLeadingSpaces.
7316 (PasteSelection): ditto.
7317 (DeleteEmptyParagraphMechanism): ditto.
7319 2000-05-26 Juergen Vigna <jug@sad.it>
7321 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7322 is not needed in tabular insets.
7324 * src/insets/insettabular.C (TabularFeatures): added missing features.
7326 * src/tabular.C (DeleteColumn):
7328 (AppendRow): implemented this functions
7329 (cellsturct::operator=): clone the inset too;
7331 2000-05-23 Juergen Vigna <jug@sad.it>
7333 * src/insets/insettabular.C (LocalDispatch): better selection support
7334 when having multicolumn-cells.
7336 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7338 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7340 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7342 * src/ColorHandler.C (getGCForeground): put more test into _()
7344 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7347 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7350 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7352 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7353 there are no labels, or when buffer is readonly.
7355 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7356 there are no labels, buffer is SGML, or when buffer is readonly.
7358 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7360 * src/LColor.C (LColor): change a couple of grey40 to grey60
7361 (LColor): rewore initalization to make compiles go some magnitude
7363 (getGUIName): don't use gettext until we need the string.
7365 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7367 * src/Bullet.[Ch]: Fixed a small bug.
7369 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7371 * src/paragraph.C (String): Several fixes/improvements
7373 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7375 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7377 * src/paragraph.C (String): give more correct output.
7379 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7381 * src/lyxfont.C (stateText) Do not output the language if it is
7382 eqaul to the language of the document.
7384 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7385 between two paragraphs with the same language.
7387 * src/paragraph.C (getParLanguage) Return a correct answer for an
7388 empty dummy paragraph.
7390 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7393 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7396 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7397 the menus/popup, if requested fonts are unavailable.
7399 2000-05-22 Juergen Vigna <jug@sad.it>
7401 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7402 movement support (Up/Down/Tab/Shift-Tab).
7403 (LocalDispatch): added also preliminari cursor-selection.
7405 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7407 * src/paragraph.C (PasteParagraph): Hopefully now right!
7409 2000-05-22 Garst R. Reese <reese@isn.net>
7411 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7412 of list, change all references to Environment to Command
7413 * tex/hollywood.cls : rewrite environments as commands, add
7414 \uppercase to interiorshot and exteriorshot to force uppecase.
7415 * tex/broadway.cls : rewrite environments as commands. Tweak
7418 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7420 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7421 size of items: use a constant intead of the hardcoded 40, and more
7422 importantly do not remove the %m and %x tags added at the end.
7423 (Add_to_refs_menu): use vector::size_type instead of
7424 unsigned int as basic types for the variables. _Please_ do not
7425 assume that size_t is equal to unsigned int. On an alpha, this is
7426 unsigned long, which is _not_ the same.
7428 * src/language.C (initL): remove language "hungarian", since it
7429 seems that "magyar" is better.
7431 2000-05-22 Juergen Vigna <jug@sad.it>
7433 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7435 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7438 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7439 next was deleted but not set to 0.
7441 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7443 * src/language.C (initL): change the initialization of languages
7444 so that compiles goes _fast_.
7446 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7449 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7451 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7455 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7457 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7459 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7463 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7466 * src/insets/insetlo*.[Ch]: Made editable
7468 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7470 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7471 the current selection.
7473 * src/BufferView_pimpl.C (stuffClipboard): new method
7475 * src/BufferView.C (stuffClipboard): new method
7477 * src/paragraph.C (String): new method
7479 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7480 LColor::ignore when lyxname is not found.
7482 * src/BufferView.C (pasteSelection): new method
7484 * src/BufferView_pimpl.C (pasteSelection): new method
7486 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7488 * src/WorkArea.C (request_clipboard_cb): new static function
7489 (getClipboard): new method
7490 (putClipboard): new method
7492 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7494 * LyX 1.1.5pre2 released
7496 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7498 * src/vspace.C (operator=): removed
7499 (operator=): removed
7501 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7503 * src/layout.C (NumberOfClass): manually set the type in make_pair
7504 (NumberOfLayout): ditto
7506 * src/language.C: use the Language constructor for ignore_lang
7508 * src/language.h: add constructors to struct Language
7510 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7512 * src/text2.C (SetCursorIntern): comment out #warning
7514 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7516 * src/mathed/math_iter.h: initialize sx and sw to 0
7518 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7520 * forms/lyx.fd: Redesign of form_ref
7522 * src/LaTeXFeatures.[Ch]
7526 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7529 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7530 and Buffer::inset_iterator.
7532 * src/menus.C: Added new menus: TOC and Refs.
7534 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7536 * src/buffer.C (getTocList): New method.
7538 * src/BufferView2.C (ChangeRefs): New method.
7540 * src/buffer.C (getLabelList): New method. It replaces the old
7541 getReferenceList. The return type is vector<string> instead of
7544 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7545 the old getLabel() and GetNumberOfLabels() methods.
7546 * src/insets/insetlabel.C (getLabelList): ditto
7547 * src/mathed/formula.C (getLabelList): ditto
7549 * src/paragraph.C (String): New method.
7551 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7552 Uses the new getTocList() method.
7553 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7554 which automatically updates the contents of the browser.
7555 (RefUpdateCB): Use the new getLabelList method.
7557 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7559 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7561 * src/spellchecker.C: Added using std::reverse;
7563 2000-05-19 Juergen Vigna <jug@sad.it>
7565 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7567 * src/insets/insettext.C (computeTextRows): small fix for display of
7568 1 character after a newline.
7570 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7573 2000-05-18 Juergen Vigna <jug@sad.it>
7575 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7576 when changing width of column.
7578 * src/tabular.C (set_row_column_number_info): setting of
7579 autobreak rows if necessary.
7581 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7583 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7585 * src/vc-backend.*: renamed stat() to status() and vcstat to
7586 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7587 compilation broke. The new name seems more relevant, anyway.
7589 2000-05-17 Juergen Vigna <jug@sad.it>
7591 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7592 which was wrong if the removing caused removing of rows!
7594 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7595 (pushToken): new function.
7597 * src/text2.C (CutSelection): fix problem discovered with purify
7599 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7601 * src/debug.C (showTags): enlarge the first column, now that we
7602 have 6-digits debug codes.
7604 * lib/layouts/hollywood.layout:
7605 * lib/tex/hollywood.cls:
7606 * lib/tex/brodway.cls:
7607 * lib/layouts/brodway.layout: more commands and fewer
7608 environments. Preambles moved in the .cls files. Broadway now has
7609 more options on scene numbering and less whitespace (from Garst)
7611 * src/insets/insetbib.C (getKeys): make sure that we are in the
7612 document directory, in case the bib file is there.
7614 * src/insets/insetbib.C (Latex): revert bogus change.
7616 2000-05-16 Juergen Vigna <jug@sad.it>
7618 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7619 the TabularLayout on cursor move.
7621 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7623 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7626 (draw): fixed cursor position and drawing so that the cursor is
7627 visible when before the tabular-inset.
7629 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7630 when creating from old insettext.
7632 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7634 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7636 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7637 * lib/tex/brodway.cls: ditto
7639 * lib/layouts/brodway.layout: change alignment of parenthical
7642 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7644 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7645 versions 0.88 and 0.89 are supported.
7647 2000-05-15 Juergen Vigna <jug@sad.it>
7649 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7652 * src/insets/insettext.C (computeTextRows): redone completely this
7653 function in a much cleaner way, because of problems when having a
7655 (draw): added a frame border when the inset is locked.
7656 (SetDrawLockedFrame): this sets if we draw the border or not.
7657 (SetFrameColor): this sets the frame color (default=insetframe).
7659 * src/insets/lyxinset.h: added x() and y() functions which return
7660 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7661 function which is needed to see if we have a locking inset of some
7662 type in this inset (needed for now in insettabular).
7664 * src/vspace.C (inPixels): the same function also without a BufferView
7665 parameter as so it is easier to use it in some ocasions.
7667 * src/lyxfunc.C: changed all places where insertInset was used so
7668 that now if it couldn't be inserted it is deleted!
7670 * src/TabularLayout.C:
7671 * src/TableLayout.C: added support for new tabular-inset!
7673 * src/BufferView2.C (insertInset): this now returns a bool if the
7674 inset was really inserted!!!
7676 * src/tabular.C (GetLastCellInRow):
7677 (GetFirstCellInRow): new helper functions.
7678 (Latex): implemented for new tabular class.
7682 (TeXTopHLine): new Latex() helper functions.
7684 2000-05-12 Juergen Vigna <jug@sad.it>
7686 * src/mathed/formulamacro.C (Read):
7687 * src/mathed/formula.C (Read): read also the \end_inset here!
7689 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7691 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7692 crush when saving formulae with unbalanced parenthesis.
7694 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7696 * src/layout.C: Add new keyword "endlabelstring" to layout file
7698 * src/text.C (GetVisibleRow): Draw endlabel string.
7700 * lib/layouts/broadway.layout
7701 * lib/layouts/hollywood.layout: Added endlabel for the
7702 Parenthetical layout.
7704 * lib/layouts/heb-article.layout: Do not use slanted font shape
7705 for Theorem like environments.
7707 * src/buffer.C (makeLaTeXFile): Always add "american" to
7708 the UsedLanguages list if document language is RTL.
7710 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7712 * add addendum to README.OS2 and small patch (from SMiyata)
7714 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7716 * many files: correct the calls to ChangeExtension().
7718 * src/support/filetools.C (ChangeExtension): remove the no_path
7719 argument, which does not belong there. Use OnlyFileName() instead.
7721 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7722 files when LaTeXing a non-nice latex file.
7724 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7725 a chain of "if". Return false when deadkeys are not handled.
7727 * src/lyx_main.C (LyX): adapted the code for default bindings.
7729 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7730 bindings for basic functionality (except deadkeys).
7731 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7733 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7734 several methods: handle override_x_deadkeys.
7736 * src/lyxrc.h: remove the "bindings" map, which did not make much
7737 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7739 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7741 * src/lyxfont.C (stateText): use a saner method to determine
7742 whether the font is "default". Seems to fix the crash with DEC
7745 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7747 2000-05-08 Juergen Vigna <jug@sad.it>
7749 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7750 TabularLayoutMenu with mouse-button-3
7751 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7753 * src/TabularLayout.C: added this file for having a Layout for
7756 2000-05-05 Juergen Vigna <jug@sad.it>
7758 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7759 recalculating inset-widths.
7760 (TabularFeatures): activated this function so that I can change
7761 tabular-features via menu.
7763 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7764 that I can test some functions with the Table menu.
7766 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7768 * src/lyxfont.C (stateText): guard against stupid c++libs.
7770 * src/tabular.C: add using std::vector
7771 some whitespace changes, + removed som autogenerated code.
7773 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7775 2000-05-05 Juergen Vigna <jug@sad.it>
7777 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7778 row, columns and cellstructures.
7780 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7782 * lib/lyxrc.example: remove obsolete entries.
7784 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7785 reading of protected_separator for free_spacing.
7787 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7789 * src/text.C (draw): do not display an exclamation mark in the
7790 margin for margin notes. This is confusing, ugly and
7793 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7794 AMS math' is checked.
7796 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7797 name to see whether including the amsmath package is needed.
7799 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7801 * src/paragraph.C (validate): Compute UsedLanguages correctly
7802 (don't insert the american language if it doesn't appear in the
7805 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7806 The argument of \thanks{} command is considered moving argument
7808 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7811 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7813 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7814 for appendix/minipage/depth. The lines can be now both in the footnote
7815 frame, and outside the frame.
7817 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7820 2000-05-05 Juergen Vigna <jug@sad.it>
7822 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7823 neede only in tabular.[Ch].
7825 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7827 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7829 (Write): write '~' for PROTECTED_SEPARATOR
7831 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7833 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7836 * src/mathed/formula.C (drawStr): rename size to siz.
7838 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7839 possibly fix a bug by not changing the pflags = flags to piflags =
7842 2000-05-05 Juergen Vigna <jug@sad.it>
7844 * src/insets/insetbib.C: moved using directive
7846 * src/ImportNoweb.C: small fix for being able to compile (missing
7849 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7851 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7852 to use clear, since we don't depend on this in the code. Add test
7855 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7857 * (various *.C files): add using std::foo directives to please dec
7860 * replace calls to string::clear() to string::erase() (Angus)
7862 * src/cheaders/cmath: modified to provide std::abs.
7864 2000-05-04 Juergen Vigna <jug@sad.it>
7866 * src/insets/insettext.C: Prepared all for inserting of multiple
7867 paragraphs. Still display stuff to do (alignment and other things),
7868 but I would like to use LyXText to do this when we cleaned out the
7869 table-support stuff.
7871 * src/insets/insettabular.C: Changed lot of stuff and added lots
7872 of functionality still a lot to do.
7874 * src/tabular.C: Various functions changed name and moved to be
7875 const functions. Added new Read and Write functions and changed
7876 lots of things so it works good with tabular-insets (also removed
7877 some stuff which is not needed anymore * hacks *).
7879 * src/lyxcursor.h: added operators == and != which just look if
7880 par and pos are (not) equal.
7882 * src/buffer.C (latexParagraphs): inserted this function to latex
7883 all paragraphs form par to endpar as then I can use this too for
7886 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7887 so that I can call this to from text insets with their own cursor.
7889 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7890 output off all paragraphs (because of the fix below)!
7892 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7893 the very last paragraph (this could be also the last paragraph of an
7896 * src/texrow.h: added rows() call which returns the count-variable.
7898 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7900 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7902 * lib/configure.m4: better autodetection of DocBook tools.
7904 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7906 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7908 * src/lyx_cb.C: add using std::reverse;
7910 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7913 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7914 selected files. Should fix repeated errors from generated files.
7916 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7918 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7920 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7921 the spellchecker popup.
7923 * lib/lyxrc.example: Removed the \number_inset section
7925 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7927 * src/insets/figinset.C (various): Use IsFileReadable() to make
7928 sure that the file actually exist. Relying on ghostscripts errors
7929 is a bad idea since they can lead to X server crashes.
7931 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7933 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7936 * lib/lyxrc.example: smallish typo in description of
7937 \view_dvi_paper_option
7939 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7942 * src/lyxfunc.C: doImportHelper to factor out common code of the
7943 various import methods. New functions doImportASCIIasLines,
7944 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7945 doImportLinuxDoc for the format specific parts.
7948 * buffer.C: Dispatch returns now a bool to indicate success
7951 * lyx_gui.C: Add getLyXView() for member access
7953 * lyx_main.C: Change logic for batch commands: First try
7954 Buffer::Dispatch (possibly without GUI), if that fails, use
7957 * lyx_main.C: Add support for --import command line switch.
7958 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7959 Available Formats: Everything accepted by 'buffer-import <format>'
7961 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7963 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7966 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7967 documents will be reformatted upon reentry.
7969 2000-04-27 Juergen Vigna <jug@sad.it>
7971 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7972 correctly only last pos this was a bug.
7974 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7976 * release of lyx-1.1.5pre1
7978 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7980 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7982 * src/menus.C: revert the change of naming (Figure->Graphic...)
7983 from 2000-04-11. It was incomplete and bad.
7985 * src/LColor.[Ch]: add LColor::depthbar.
7986 * src/text.C (GetVisibleRow): use it.
7988 * README: update the languages list.
7990 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7992 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7995 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7997 * README: remove sections that were just wrong.
7999 * src/text2.C (GetRowNearY): remove currentrow code
8001 * src/text.C (GetRow): remove currentrow code
8003 * src/screen.C (Update): rewritten a bit.
8004 (SmallUpdate): removed func
8006 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8008 (FullRebreak): return bool
8009 (currentrow): remove var
8010 (currentrow_y): ditto
8012 * src/lyxscreen.h (Draw): change arg to unsigned long
8013 (FitCursor): return bool
8014 (FitManualCursor): ditto
8015 (Smallpdate): remove func
8016 (first): change to unsigned long
8017 (DrawOneRow): change second arg to long (from long &)
8018 (screen_refresh_y): remove var
8019 (scree_refresh_row): ditto
8021 * src/lyxrow.h: change baseline to usigned int from unsigned
8022 short, this brings some implicit/unsigned issues out in the open.
8024 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8026 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8027 instead of smallUpdate.
8029 * src/lyxcursor.h: change y to unsigned long
8031 * src/buffer.h: don't call updateScrollbar after fitcursor
8033 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8034 where they are used. Removed "\\direction", this was not present
8035 in 1.1.4 and is already obsolete. Commented out some code that I
8036 believe to never be called.
8037 (runLiterate): don't call updateScrollbar after fitCursor
8039 (buildProgram): ditto
8042 * src/WorkArea.h (workWidth): change return val to unsigned
8045 (redraw): remove the button redraws
8046 (setScrollbarValue): change for scrollbar
8047 (getScrollbarValue): change for scrollbar
8048 (getScrollbarBounds): change for scrollbar
8050 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8051 (C_WorkArea_down_cb): removed func
8052 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8053 (resize): change for scrollbar
8054 (setScrollbar): ditto
8055 (setScrollbarBounds): ditto
8056 (setScrollbarIncrements): ditto
8057 (up_cb): removed func
8058 (down_cb): removed func
8059 (scroll_cb): change for scrollbar
8060 (work_area_handler): ditto
8062 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8063 when FitCursor did something.
8064 (updateScrollbar): some unsigned changes
8065 (downCB): removed func
8066 (scrollUpOnePage): removed func
8067 (scrollDownOnePage): remvoed func
8068 (workAreaMotionNotify): don't call screen->FitCursor but use
8069 fitCursor instead. and bool return val
8070 (workAreaButtonPress): ditto
8071 (workAreaButtonRelease): some unsigned changes
8072 (checkInsetHit): ditto
8073 (workAreaExpose): ditto
8074 (update): parts rewritten, comments about the signed char arg added
8075 (smallUpdate): removed func
8076 (cursorPrevious): call needed updateScrollbar
8079 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8082 * src/BufferView.[Ch] (upCB): removed func
8083 (downCB): removed func
8084 (smallUpdate): removed func
8086 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8088 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8089 currentrow, currentrow_y optimization. This did not help a lot and
8090 if we want to do this kind of optimization we should rather use
8091 cursor.row instead of the currentrow.
8093 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8094 buffer spacing and klyx spacing support.
8096 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8098 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8101 2000-04-26 Juergen Vigna <jug@sad.it>
8103 * src/insets/figinset.C: fixes to Lars sstream changes!
8105 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8107 * A lot of files: Added Ascii(ostream &) methods to all inset
8108 classes. Used when exporting to ASCII.
8110 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8111 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8114 * src/text2.C (ToggleFree): Disabled implicit word selection when
8115 there is a change in the language
8117 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8118 no output was generated for end-of-sentence inset.
8120 * src/insets/lyxinset.h
8123 * src/paragraph.C: Removed the insetnumber code
8125 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8127 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8129 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8130 no_babel and no_epsfig completely from the file.
8131 (parseSingleLyXformat2Token): add handling for per-paragraph
8132 spacing as written by klyx.
8134 * src/insets/figinset.C: applied patch by Andre. Made it work with
8137 2000-04-20 Juergen Vigna <jug@sad.it>
8139 * src/insets/insettext.C (cutSelection):
8140 (copySelection): Fixed with selection from right to left.
8141 (draw): now the rows are not recalculated at every draw.
8142 (computeTextRows): for now reset the inset-owner here (this is
8143 important for an undo or copy where the inset-owner is not set
8146 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8147 motion to the_locking_inset screen->first was forgotten, this was
8148 not important till we got multiline insets.
8150 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8152 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8153 code seems to be alright (it is code changed by Dekel, and the
8154 intent is indeed that all macros should be defined \protect'ed)
8156 * NEWS: a bit of reorganisation of the new user-visible features.
8158 2000-04-19 Juergen Vigna <jug@sad.it>
8160 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8161 position. Set the inset_owner of the used paragraph so that it knows
8162 that it is inside an inset. Fixed cursor handling with mouse and
8163 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8164 and cleanups to make TextInsets work better.
8166 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8167 Changed parameters of various functions and added LockInsetInInset().
8169 * src/insets/insettext.C:
8171 * src/insets/insetcollapsable.h:
8172 * src/insets/insetcollapsable.C:
8173 * src/insets/insetfoot.h:
8174 * src/insets/insetfoot.C:
8175 * src/insets/insetert.h:
8176 * src/insets/insetert.C: cleaned up the code so that it works now
8177 correctly with insettext.
8179 * src/insets/inset.C:
8180 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8181 that insets in insets are supported right.
8184 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8186 * src/paragraph.C: some small fixes
8188 * src/debug.h: inserted INSETS debug info
8190 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8191 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8193 * src/commandtags.h:
8194 * src/LyXAction.C: insert code for InsetTabular.
8196 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8197 not Button1MotionMask.
8198 (workAreaButtonRelease): send always a InsetButtonRelease event to
8200 (checkInsetHit): some setCursor fixes (always with insets).
8202 * src/BufferView2.C (lockInset): returns a bool now and extended for
8203 locking insets inside insets.
8204 (showLockedInsetCursor): it is important to have the cursor always
8205 before the locked inset.
8206 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8208 * src/BufferView.h: made lockInset return a bool.
8210 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8212 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8213 that is used also internally but can be called as public to have back
8214 a cursor pos which is not set internally.
8215 (SetCursorIntern): Changed to use above function.
8217 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8219 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8224 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8225 patches for things that should be in or should be changed.
8227 * src/* [insetfiles]: change "usigned char fragile" to bool
8228 fragile. There was only one point that could that be questioned
8229 and that is commented in formulamacro.C. Grep for "CHECK".
8231 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8232 (DeleteBuffer): take it out of CutAndPaste and make it static.
8234 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8236 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8237 output the spacing envir commands. Also the new commands used in
8238 the LaTeX output makes the result better.
8240 * src/Spacing.C (writeEnvirBegin): new method
8241 (writeEnvirEnd): new method
8243 2000-04-18 Juergen Vigna <jug@sad.it>
8245 * src/CutAndPaste.C: made textclass a static member of the class
8246 as otherwise it is not accesed right!!!
8248 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8250 * forms/layout_forms.fd
8251 * src/layout_forms.h
8252 * src/layout_forms.C (create_form_form_character)
8253 * src/lyx_cb.C (UserFreeFont)
8254 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8255 documents (in the layout->character popup).
8257 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8259 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8260 \spell_command was in fact not honored (from Kevin Atkinson).
8262 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8265 * src/lyx_gui.h: make lyxViews private (Angus)
8267 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8269 * src/mathed/math_write.C
8270 (MathMatrixInset::Write) Put \protect before \begin{array} and
8271 \end{array} if fragile
8272 (MathParInset::Write): Put \protect before \\ if fragile
8274 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8276 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8277 initialization if the LyXColorHandler must be done after the
8278 connections to the XServer has been established.
8280 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8281 get the background pixel from the lyxColorhandler so that the
8282 figures are rendered with the correct background color.
8283 (NextToken): removed functions.
8284 (GetPSSizes): use ifs >> string instead of NextToken.
8286 * src/Painter.[Ch]: the color cache moved out of this file.
8288 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8291 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8293 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8294 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8296 * src/BufferView.C (enterView): new func
8297 (leaveView): new func
8299 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8301 (leaveView): new func, undefines xterm cursor when approp.
8303 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8304 (AllowInput): delete the Workarea cursor handling from this func.
8306 * src/Painter.C (underline): draw a slimer underline in most cases.
8308 * src/lyx_main.C (error_handler): use extern "C"
8310 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8312 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8313 sent directly to me.
8315 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8316 to the list by Dekel.
8318 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8321 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8322 methods from lyx_cb.here.
8324 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8327 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8329 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8330 instead of using current_view directly.
8332 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8334 * src/LyXAction.C (init): add the paragraph-spacing command.
8336 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8338 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8340 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8341 different from the documents.
8343 * src/text.C (SetHeightOfRow): take paragraph spacing into
8344 account, paragraph spacing takes precedence over buffer spacing
8345 (GetVisibleRow): ditto
8347 * src/paragraph.C (writeFile): output the spacing parameter too.
8348 (validate): set the correct features if spacing is used in the
8350 (Clear): set spacing to default
8351 (MakeSameLayout): spacing too
8352 (HasSameLayout): spacing too
8353 (SetLayout): spacing too
8354 (TeXOnePar): output the spacing commands
8356 * src/lyxparagraph.h: added a spacing variable for use with
8357 per-paragraph spacing.
8359 * src/Spacing.h: add a Default spacing and a method to check if
8360 the current spacing is default. also added an operator==
8362 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8365 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8367 * src/lyxserver.C (callback): fix dispatch of functions
8369 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8370 printf() into lyxerr call.
8372 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8375 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8376 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8377 the "Float" from each of the subitems.
8378 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8380 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8381 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8382 documented the change so that the workaround can be nuked later.
8384 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8387 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8389 * src/buffer.C (getLatexName): ditto
8390 (setReadonly): ditto
8392 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8394 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8395 avoid some uses of current_view. Added also a bufferParams()
8396 method to get at this.
8398 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8400 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8402 * src/lyxparagraph.[Ch]: removed
8403 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8404 with operators used by lower_bound and
8405 upper_bound in InsetTable's
8406 Make struct InsetTable private again. Used matchpos.
8408 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8410 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8411 document, the language of existing text is changed (unless the
8412 document is multi-lingual)
8414 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8416 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8418 * A lot of files: A rewrite of the Right-to-Left support.
8420 2000-04-10 Juergen Vigna <jug@sad.it>
8422 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8423 misplaced cursor when inset in inset is locked.
8425 * src/insets/insettext.C (LocalDispatch): small fix so that a
8426 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8428 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8429 footnote font should be decreased in size twice when displaying.
8431 * src/insets/insettext.C (GetDrawFont): inserted this function as
8432 the drawing-font may differ from the real paragraph font.
8434 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8435 insets (inset in inset!).
8437 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8438 function here because we don't want footnotes inside footnotes.
8440 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8442 (init): now set the inset_owner in paragraph.C
8443 (LocalDispatch): added some resetPos() in the right position
8446 (pasteSelection): changed to use the new CutAndPaste-Class.
8448 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8449 which tells if it is allowed to insert another inset inside this one.
8451 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8452 SwitchLayoutsBetweenClasses.
8454 * src/text2.C (InsertInset): checking of the new paragraph-function
8456 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8457 is not needed anymore here!
8460 (PasteSelection): redone (also with #ifdef) so that now this uses
8461 the CutAndPaste-Class.
8462 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8465 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8466 from/to text/insets.
8468 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8469 so that the paragraph knows if it is inside an (text)-inset.
8470 (InsertFromMinibuffer): changed return-value to bool as now it
8471 may happen that an inset is not inserted in the paragraph.
8472 (InsertInsetAllowed): this checks if it is allowed to insert an
8473 inset in this paragraph.
8475 (BreakParagraphConservative):
8476 (BreakParagraph) : small change for the above change of the return
8477 value of InsertFromMinibuffer.
8479 * src/lyxparagraph.h: added inset_owner and the functions to handle
8480 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8482 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8484 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8485 functions from BufferView to BufferView::Pimpl to ease maintence.
8487 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8488 correctly. Also use SetCursorIntern instead of SetCursor.
8490 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8493 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8495 * src/WorkArea.C (belowMouse): manually implement below mouse.
8497 * src/*: Add "explicit" on several constructors, I added probably
8498 some unneeded ones. A couple of changes to code because of this.
8500 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8501 implementation and private parts from the users of BufferView. Not
8504 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8505 implementation and private parts from the users of LyXLex. Not
8508 * src/BufferView_pimpl.[Ch]: new files
8510 * src/lyxlex_pimpl.[Ch]: new files
8512 * src/LyXView.[Ch]: some inline functions move out-of-line
8514 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8516 * src/lyxparagraph.h: make struct InsetTable public.
8518 * src/support/lyxstring.h: change lyxstring::difference_type to be
8519 ptrdiff_t. Add std:: modifiers to streams.
8521 * src/font.C: include the <cctype> header, for islower() and
8524 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8526 * src/font.[Ch]: new files. Contains the metric functions for
8527 fonts, takes a LyXFont as parameter. Better separation of concepts.
8529 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8530 changes because of this.
8532 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8534 * src/*: compile with -Winline and move functions that don't
8537 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8540 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8542 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8543 (various files changed because of this)
8545 * src/Painter.C (text): fixed the drawing of smallcaps.
8547 * src/lyxfont.[Ch] (drawText): removed unused member func.
8550 * src/*.C: added needed "using" statements and "std::" qualifiers.
8552 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * src/*.h: removed all use of "using" from header files use
8555 qualifier std:: instead.
8557 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8559 * src/text.C (Backspace): some additional cleanups (we already
8560 know whether cursor.pos is 0 or not).
8562 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8563 automake does not provide one).
8565 * src/bmtable.h: replace C++ comments with C comments.
8567 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8569 * src/screen.C (ShowCursor): Change the shape of the cursor if
8570 the current language is not equal to the language of the document.
8571 (If the cursor change its shape unexpectedly, then you've found a bug)
8573 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8576 * src/insets/insetnumber.[Ch]: New files.
8578 * src/LyXAction.C (init)
8579 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8582 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8584 * src/lyxparagraph.h
8585 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8586 (the vector is kept sorted).
8588 * src/text.C (GetVisibleRow): Draw selection correctly when there
8589 is both LTR and RTL text.
8591 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8592 which is much faster.
8594 * src/text.C (GetVisibleRow and other): Do not draw the last space
8595 in a row if the direction of the last letter is not equal to the
8596 direction of the paragraph.
8598 * src/lyxfont.C (latexWriteStartChanges):
8599 Check that font language is not equal to basefont language.
8600 (latexWriteEndChanges): ditto
8602 * src/lyx_cb.C (StyleReset): Don't change the language while using
8603 the font-default command.
8605 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8606 empty paragraph before a footnote.
8608 * src/insets/insetcommand.C (draw): Increase x correctly.
8610 * src/screen.C (ShowCursor): Change cursor shape if
8611 current language != document language.
8613 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8615 2000-03-31 Juergen Vigna <jug@sad.it>
8617 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8618 (Clone): changed mode how the paragraph-data is copied to the
8619 new clone-paragraph.
8621 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8622 GetInset(pos) with no inset anymore there (in inset UNDO)
8624 * src/insets/insetcommand.C (draw): small fix as here x is
8625 incremented not as much as width() returns (2 before, 2 behind = 4)
8627 2000-03-30 Juergen Vigna <jug@sad.it>
8629 * src/insets/insettext.C (InsetText): small fix in initialize
8630 widthOffset (should not be done in the init() function)
8632 2000-03-29 Amir Karger <karger@lyx.org>
8634 * lib/examples/it_ItemizeBullets.lyx: translation by
8637 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8639 2000-03-29 Juergen Vigna <jug@sad.it>
8641 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8643 * src/insets/insetfoot.C (Clone): small change as for the below
8644 new init function in the text-inset
8646 * src/insets/insettext.C (init): new function as I've seen that
8647 clone did not copy the Paragraph-Data!
8648 (LocalDispatch): Added code so that now we have some sort of Undo
8649 functionality (well actually we HAVE Undo ;)
8651 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8653 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8655 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8658 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8660 * src/main.C: added a runtime check that verifies that the xforms
8661 header used when building LyX and the library used when running
8662 LyX match. Exit with a message if they don't match. This is a
8663 version number check only.
8665 * src/buffer.C (save): Don't allocate memory on the heap for
8666 struct utimbuf times.
8668 * *: some using changes, use iosfwd instead of the real headers.
8670 * src/lyxfont.C use char const * instead of string for the static
8671 strings. Rewrite some functions to use sstream.
8673 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8675 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8678 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8680 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8681 of Geodesy (from Martin Vermeer)
8683 * lib/layouts/svjour.inc: include file for the Springer svjour
8684 class. It can be used to support journals other than JoG.
8686 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8687 Miskiewicz <misiek@pld.org.pl>)
8688 * lib/reLyX/Makefile.am: ditto.
8690 2000-03-27 Juergen Vigna <jug@sad.it>
8692 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8693 also some modifications with operations on selected text.
8695 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8696 problems with clicking on insets (last famous words ;)
8698 * src/insets/insetcommand.C (draw):
8699 (width): Changed to have a bit of space before and after the inset so
8700 that the blinking cursor can be seen (otherwise it was hidden)
8702 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8704 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8705 would not be added to the link list when an installed gettext (not
8706 part of libc) is found.
8708 2000-03-24 Juergen Vigna <jug@sad.it>
8710 * src/insets/insetcollapsable.C (Edit):
8711 * src/mathed/formula.C (InsetButtonRelease):
8712 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8715 * src/BufferView.C (workAreaButtonPress):
8716 (workAreaButtonRelease):
8717 (checkInsetHit): Finally fixed the clicking on insets be handled
8720 * src/insets/insetert.C (Edit): inserted this call so that ERT
8721 insets work always with LaTeX-font
8723 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8725 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8726 caused lyx to startup with no GUI in place, causing in a crash
8727 upon startup when called with arguments.
8729 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8731 * src/FontLoader.C: better initialization of dummyXFontStruct.
8733 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8735 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8736 for linuxdoc and docbook import and export format options.
8738 * lib/lyxrc.example Example of default values for the previous flags.
8740 * src/lyx_cb.C Use those flags instead of the hardwired values for
8741 linuxdoc and docbook export.
8743 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8746 * src/menus.C Added menus entries for the new import/exports formats.
8748 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8750 * src/lyxrc.*: Added support for running without Gui
8753 * src/FontLoader.C: sensible defaults if no fonts are needed
8755 * src/lyx_cb.C: New function ShowMessage (writes either to the
8756 minibuffer or cout in case of no gui
8757 New function AskOverwrite for common stuff
8758 Consequently various changes to call these functions
8760 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8761 wild guess at sensible screen resolution when having no gui
8763 * src/lyxfont.C: no gui, no fonts... set some defaults
8765 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8767 * src/LColor.C: made the command inset background a bit lighter.
8769 2000-03-20 Hartmut Goebel <goebel@noris.net>
8771 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8772 stdstruct.inc. Koma-Script added some title elements which
8773 otherwise have been listed below "bibliography". This split allows
8774 adding title elements to where they belong.
8776 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8777 define the additional title elements and then include
8780 * many other layout files: changed to include stdtitle.inc just
8781 before stdstruct.inc.
8783 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8785 * src/buffer.C: (save) Added the option to store all backup files
8786 in a single directory
8788 * src/lyxrc.[Ch]: Added variable \backupdir_path
8790 * lib/lyxrc.example: Added descriptions of recently added variables
8792 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8793 bibtex inset, not closing the bibtex popup when deleting the inset)
8795 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8797 * src/lyx_cb.C: add a couple using directives.
8799 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8800 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8801 import based on the filename.
8803 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8804 file would be imported at start, if the filename where of a sgml file.
8806 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8808 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8810 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8811 * src/lyxfont.h Replaced the member variable bits.direction by the
8812 member variable lang. Made many changes in other files.
8813 This allows having a multi-lingual document
8815 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8816 that change the current language to <l>.
8817 Removed the command "font-rtl"
8819 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8820 format for Hebrew documents)
8822 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8823 When auto_mathmode is "true", pressing a digit key in normal mode
8824 will cause entering into mathmode.
8825 If auto_mathmode is "rtl" then this behavior will be active only
8826 when writing right-to-left text.
8828 * src/text2.C (InsertStringA) The string is inserted using the
8831 * src/paragraph.C (GetEndLabel) Gives a correct result for
8832 footnote paragraphs.
8834 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8836 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8838 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8839 front of PasteParagraph. Never insert a ' '. This should at least
8840 fix some cause for the segfaults that we have been experiencing,
8841 it also fixes backspace behaviour slightly. (Phu!)
8843 * src/support/lstrings.C (compare_no_case): some change to make it
8844 compile with gcc 2.95.2 and stdlibc++-v3
8846 * src/text2.C (MeltFootnoteEnvironment): change type o
8847 first_footnote_par_is_not_empty to bool.
8849 * src/lyxparagraph.h: make text private. Changes in other files
8851 (fitToSize): new function
8852 (setContentsFromPar): new function
8853 (clearContents): new function
8854 (SetChar): new function
8856 * src/paragraph.C (readSimpleWholeFile): deleted.
8858 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8859 the file, just use a simple string instead. Also read the file in
8860 a more maintainable manner.
8862 * src/text2.C (InsertStringA): deleted.
8863 (InsertStringB): deleted.
8865 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8867 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8868 RedoParagraphs from the doublespace handling part, just set status
8869 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8870 done, but perhaps not like this.)
8872 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8874 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8875 character when inserting an inset.
8877 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8879 * src/bufferparams.C (readLanguage): now takes "default" into
8882 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8883 also initialize the toplevel_keymap with the default bindings from
8886 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8888 * all files using lyxrc: have lyxrc as a real variable and not a
8889 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8892 * src/lyxrc.C: remove double call to defaultKeyBindings
8894 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8895 toolbar defauls using lyxlex. Remove enums, structs, functions
8898 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8899 toolbar defaults. Also store default keybindings in a map.
8901 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8902 storing the toolbar defaults without any xforms dependencies.
8904 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8905 applied. Changed to use iterators.
8907 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8909 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8910 systems that don't have LINGUAS set to begin with.
8912 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8914 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8915 the list by Dekel Tsur.
8917 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8919 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8920 * src/insets/form_graphics.C: ditto.
8922 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8924 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8926 * src/bufferparams.C (readLanguage): use the new language map
8928 * src/intl.C (InitKeyMapper): use the new language map
8930 * src/lyx_gui.C (create_forms): use the new language map
8932 * src/language.[Ch]: New files. Used for holding the information
8933 about each language. Now! Use this new language map enhance it and
8934 make it really usable for our needs.
8936 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8938 * screen.C (ShowCursor): Removed duplicate code.
8939 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8940 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8942 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8945 * src/text.C Added TransformChar method. Used for rendering Arabic
8946 text correctly (change the glyphs of the letter according to the
8947 position in the word)
8952 * src/lyxrc.C Added lyxrc command {language_command_begin,
8953 language_command_end,language_command_ltr,language_command_rtl,
8954 language_package} which allows the use of either arabtex or Omega
8957 * src/lyx_gui.C (init)
8959 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8960 to use encoding for menu fonts which is different than the encoding
8963 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8964 do not load the babel package.
8965 To write an English document with Hebrew/Arabic, change the document
8966 language to "english".
8968 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8969 (alphaCounter): changed to return char
8970 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8972 * lib/lyxrc.example Added examples for Hebrew/Arabic
8975 * src/layout.C Added layout command endlabeltype
8977 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8979 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8981 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8983 * src/mathed/math_delim.C (search_deco): return a
8984 math_deco_struct* instead of index.
8986 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8988 * All files with a USE_OSTREAM_ONLY within: removed all code that
8989 was unused when USE_OSTREAM_ONLY is defined.
8991 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8992 of any less. Removed header and using.
8994 * src/text.C (GetVisibleRow): draw the string "Page Break
8995 (top/bottom)" on screen when drawing a pagebreak line.
8997 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8999 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9001 * src/mathed/math_macro.C (draw): do some cast magic.
9004 * src/mathed/math_defs.h: change byte* argument to byte const*.
9006 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9008 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9009 know it is right to return InsetFoot* too, but cxx does not like
9012 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9014 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9016 * src/mathed/math_delim.C: change == to proper assignment.
9018 2000-03-09 Juergen Vigna <jug@sad.it>
9020 * src/insets/insettext.C (setPos): fixed various cursor positioning
9021 problems (via mouse and cursor-keys)
9022 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9023 inset (still a small display problem but it works ;)
9025 * src/insets/insetcollapsable.C (draw): added button_top_y and
9026 button_bottom_y to have correct values for clicking on the inset.
9028 * src/support/lyxalgo.h: commented out 'using std::less'
9030 2000-03-08 Juergen Vigna <jug@sad.it>
9032 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9033 Button-Release event closes as it is alos the Release-Event
9036 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9038 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9040 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9041 can add multiple spaces in Scrap (literate programming) styles...
9042 which, by the way, is how I got hooked on LyX to begin with.
9044 * src/mathed/formula.C (Write): Added dummy variable to an
9045 inset::Latex() call.
9046 (Latex): Add free_spacing boolean to inset::Latex()
9048 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9050 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9051 virtual function to include the free_spacing boolean from
9052 the containing paragraph's style.
9054 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9055 Added free_spacing boolean arg to match inset.h
9057 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9058 Added free_spacing boolean arg to match inset.h
9060 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9061 Added free_spacing boolean and made sure that if in a free_spacing
9062 paragraph, that we output normal space if there is a protected space.
9064 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9065 Added free_spacing boolean arg to match inset.h
9067 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9068 Added free_spacing boolean arg to match inset.h
9070 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9071 Added free_spacing boolean arg to match inset.h
9073 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9074 Added free_spacing boolean arg to match inset.h
9076 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9077 Added free_spacing boolean arg to match inset.h
9079 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9080 free_spacing boolean arg to match inset.h
9082 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9083 Added free_spacing boolean arg to match inset.h
9085 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9086 Added free_spacing boolean arg to match inset.h
9088 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9089 Added free_spacing boolean arg to match inset.h
9091 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9092 Added free_spacing boolean arg to match inset.h
9094 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9095 Added free_spacing boolean arg to match inset.h
9097 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9098 free_spacing boolean arg to match inset.h
9100 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9101 free_spacing boolean arg to match inset.h
9103 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9104 ignore free_spacing paragraphs. The user's spaces are left
9107 * src/text.C (InsertChar): Fixed the free_spacing layout
9108 attribute behavior. Now, if free_spacing is set, you can
9109 add multiple spaces in a paragraph with impunity (and they
9110 get output verbatim).
9111 (SelectSelectedWord): Added dummy argument to inset::Latex()
9114 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9117 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9118 paragraph layouts now only input a simple space instead.
9119 Special character insets don't make any sense in free-spacing
9122 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9123 hard-spaces in the *input* file to simple spaces if the layout
9124 is free-spacing. This converts old files which had to have
9125 hard-spaces in free-spacing layouts where a simple space was
9127 (writeFileAscii): Added free_spacing check to pass to the newly
9128 reworked inset::Latex(...) methods. The inset::Latex() code
9129 ensures that hard-spaces in free-spacing paragraphs get output
9130 as spaces (rather than "~").
9132 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9134 * src/mathed/math_delim.C (draw): draw the empty placeholder
9135 delims with a onoffdash line.
9136 (struct math_deco_compare): struct that holds the "functors" used
9137 for the sort and the binary search in math_deco_table.
9138 (class init_deco_table): class used for initial sort of the
9140 (search_deco): use lower_bound to do a binary search in the
9143 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9145 * src/lyxrc.C: a small secret thingie...
9147 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9148 and to not flush the stream as often as it used to.
9150 * src/support/lyxalgo.h: new file
9151 (sorted): template function used for checking if a sequence is
9152 sorted or not. Two versions with and without user supplied
9153 compare. Uses same compare as std::sort.
9155 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9156 it and give warning on lyxerr.
9158 (struct compare_tags): struct with function operators used for
9159 checking if sorted, sorting and lower_bound.
9160 (search_kw): use lower_bound instead of manually implemented
9163 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9165 * src/insets/insetcollapsable.h: fix Clone() declaration.
9166 * src/insets/insetfoot.h: ditto.
9168 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9170 2000-03-08 Juergen Vigna <jug@sad.it>
9172 * src/insets/lyxinset.h: added owner call which tells us if
9173 this inset is inside another inset. Changed also the return-type
9174 of Editable to an enum so it tells clearer what the return-value is.
9176 * src/insets/insettext.C (computeTextRows): fixed computing of
9177 textinsets which split automatically on more rows.
9179 * src/insets/insetert.[Ch]: changed this to be of BaseType
9182 * src/insets/insetfoot.[Ch]: added footnote inset
9184 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9185 collapsable insets (like footnote, ert, ...)
9187 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9189 * src/lyxdraw.h: remvoe file
9191 * src/lyxdraw.C: remove file
9193 * src/insets/insettext.C: added <algorithm>.
9195 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9197 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9198 (matrix_cb): case MM_OK use string stream
9200 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9203 * src/mathed/math_macro.C (draw): use string stream
9204 (Metrics): use string stream
9206 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9207 directly to the ostream.
9209 * src/vspace.C (asString): use string stream.
9210 (asString): use string stream
9211 (asLatexString): use string stream
9213 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9214 setting Spacing::Other.
9216 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9217 sprintf when creating the stretch vale.
9219 * src/text2.C (alphaCounter): changed to return a string and to
9220 not use a static variable internally. Also fixed a one-off bug.
9221 (SetCounter): changed the drawing of the labels to use string
9222 streams instead of sprintf.
9224 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9225 manipulator to use a scheme that does not require library support.
9226 This is also the way it is done in the new GNU libstdc++. Should
9227 work with DEC cxx now.
9229 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9231 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9232 end. This fixes a bug.
9234 * src/mathed (all files concerned with file writing): apply the
9235 USE_OSTREAM_ONLY changes to mathed too.
9237 * src/support/DebugStream.h: make the constructor explicit.
9239 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9240 count and ostream squashed.
9242 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9244 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9246 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9247 ostringstream uses STL strings, and we might not.
9249 * src/insets/insetspecialchar.C: add using directive.
9250 * src/insets/insettext.C: ditto.
9252 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9254 * lib/layouts/seminar.layout: feeble attempt at a layout for
9255 seminar.cls, far from completet and could really use some looking
9256 at from people used to write layout files.
9258 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9259 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9260 a lot nicer and works nicely with ostreams.
9262 * src/mathed/formula.C (draw): a slightly different solution that
9263 the one posted to the list, but I think this one works too. (font
9264 size wrong in headers.)
9266 * src/insets/insettext.C (computeTextRows): some fiddling on
9267 Jürgens turf, added some comments that he should read.
9269 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9270 used and it gave compiler warnings.
9271 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9274 * src/lyx_gui.C (create_forms): do the right thing when
9275 show_banner is true/false.
9277 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9278 show_banner is false.
9280 * most file writing files: Now use iostreams to do almost all of
9281 the writing. Also instead of passing string &, we now use
9282 stringstreams. mathed output is still not adapted to iostreams.
9283 This change can be turned off by commenting out all the occurences
9284 of the "#define USE_OSTREAM_ONLY 1" lines.
9286 * src/WorkArea.C (createPixmap): don't output debug messages.
9287 (WorkArea): don't output debug messages.
9289 * lib/lyxrc.example: added a comment about the new variable
9292 * development/Code_rules/Rules: Added some more commente about how
9293 to build class interfaces and on how better encapsulation can be
9296 2000-03-03 Juergen Vigna <jug@sad.it>
9298 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9299 automatically with the width of the LyX-Window
9301 * src/insets/insettext.C (computeTextRows): fixed update bug in
9302 displaying text-insets (scrollvalues where not initialized!)
9304 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9306 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9307 id in the check of the result from lower_bound is not enough since
9308 lower_bound can return last too, and then res->id will not be a
9311 * all insets and some code that use them: I have conditionalized
9312 removed the Latex(string & out, ...) this means that only the
9313 Latex(ostream &, ...) will be used. This is a work in progress to
9314 move towards using streams for all output of files.
9316 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9319 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9321 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9322 routine (this fixes bug where greek letters were surrounded by too
9325 * src/support/filetools.C (findtexfile): change a bit the search
9326 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9327 no longer passed to kpsewhich, we may have to change that later.
9329 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9330 warning options to avoid problems with X header files (from Angus
9332 * acinclude.m4: regenerated.
9334 2000-03-02 Juergen Vigna <jug@sad.it>
9336 * src/insets/insettext.C (WriteParagraphData): Using the
9337 par->writeFile() function for writing paragraph-data.
9338 (Read): Using buffer->parseSingleLyXformat2Token()-function
9339 for parsing paragraph data!
9341 * src/buffer.C (readLyXformat2): removed all parse data and using
9342 the new parseSingleLyXformat2Token()-function.
9343 (parseSingleLyXformat2Token): added this function to parse (read)
9344 lyx-file-format (this is called also from text-insets now!)
9346 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9348 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9351 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9352 directly instead of going through a func. One very bad thing: a
9353 static LyXFindReplace, but I don't know where to place it.
9355 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9356 string instead of char[]. Also changed to static.
9357 (GetSelectionOrWordAtCursor): changed to static inline
9358 (SetSelectionOverLenChars): ditto.
9360 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9361 current_view and global variables. both classes has changed names
9362 and LyXFindReplace is not inherited from SearchForm.
9364 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9365 fl_form_search form.
9367 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9369 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9371 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9372 bound (from Kayvan).
9374 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9376 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9378 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9380 * some things that I should comment but the local pub says head to
9383 * comment out all code that belongs to the Roff code for Ascii
9384 export of tables. (this is unused)
9386 * src/LyXView.C: use correct type for global variable
9387 current_layout. (LyXTextClass::size_type)
9389 * some code to get the new insetgraphics closer to working I'd be
9390 grateful for any help.
9392 * src/BufferView2.C (insertInset): use the return type of
9393 NumberOfLayout properly. (also changes in other files)
9395 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9396 this as a test. I want to know what breaks because of this.
9398 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9400 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9402 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9403 to use a \makebox in the label, this allows proper justification
9404 with out using protected spaces or multiple hfills. Now it is
9405 "label" for left justified, "\hfill label\hfill" for center, and
9406 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9407 should be changed accordingly.
9409 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9411 * src/lyxtext.h: change SetLayout() to take a
9412 LyXTextClass::size_type instead of a char (when there is more than
9413 127 layouts in a class); also change type of copylayouttype.
9414 * src/text2.C (SetLayout): ditto.
9415 * src/LyXView.C (updateLayoutChoice): ditto.
9417 * src/LaTeX.C (scanLogFile): errors where the line number was not
9418 given just after the '!'-line were ignored (from Dekel Tsur).
9420 * lib/lyxrc.example: fix description of \date_insert_format
9422 * lib/layouts/llncs.layout: new layout, contributed by Martin
9425 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9427 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9428 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9429 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9430 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9431 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9432 paragraph.C, text.C, text2.C)
9434 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9436 * src/insets/insettext.C (LocalDispatch): remove extra break
9439 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9440 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9442 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9443 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9445 * src/insets/insetbib.h: move InsetBibkey::Holder and
9446 InsetCitation::Holder in public space.
9448 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9450 * src/insets/insettext.h: small change to get the new files from
9451 Juergen to compile (use "string", not "class string").
9453 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9454 const & as parameter to LocalDispatch, use LyXFont const & as
9455 paramter to some other func. This also had impacto on lyxinsets.h
9456 and the two mathed insets.
9458 2000-02-24 Juergen Vigna <jug@sad.it>
9461 * src/commandtags.h:
9463 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9467 * src/BufferView2.C: added/updated code for various inset-functions
9469 * src/insets/insetert.[Ch]: added implementation of InsetERT
9471 * src/insets/insettext.[Ch]: added implementation of InsetText
9473 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9474 (draw): added preliminary code for inset scrolling not finshed yet
9476 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9477 as it is in lyxfunc.C now
9479 * src/insets/lyxinset.h: Added functions for text-insets
9481 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9483 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9484 BufferView and reimplement the list as a queue put inside its own
9487 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9489 * several files: use the new interface to the "updateinsetlist"
9491 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9493 (work_area_handler): call BufferView::trippleClick on trippleclick.
9495 * src/BufferView.C (doubleClick): new function, selects word on
9497 (trippleClick): new function, selects line on trippleclick.
9499 2000-02-22 Allan Rae <rae@lyx.org>
9501 * lib/bind/xemacs.bind: buffer-previous not supported
9503 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9505 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9508 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9510 * src/bufferlist.C: get rid of current_view from this file
9512 * src/spellchecker.C: get rid of current_view from this file
9514 * src/vspace.C: get rid of current_view from this file
9515 (inPixels): added BufferView parameter for this func
9516 (asLatexCommand): added a BufferParams for this func
9518 * src/text.C src/text2.C: get rid of current_view from these
9521 * src/lyxfont.C (getFontDirection): move this function here from
9524 * src/bufferparams.C (getDocumentDirection): move this function
9527 * src/paragraph.C (getParDirection): move this function here from
9529 (getLetterDirection): ditto
9531 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9533 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9534 resize due to wrong pixmap beeing used. Also took the opurtunity
9535 to make the LyXScreen stateless on regard to WorkArea and some
9536 general cleanup in the same files.
9538 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9540 * src/Makefile.am: add missing direction.h
9542 * src/PainterBase.h: made the width functions const.
9544 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9547 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9549 * src/insets/insetlatexaccent.C (draw): make the accents draw
9550 better, at present this will only work well with iso8859-1.
9552 * several files: remove the old drawing code, now we use the new
9555 * several files: remove support for mono_video, reverse_video and
9558 2000-02-17 Juergen Vigna <jug@sad.it>
9560 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9561 int ** as we have to return the pointer, otherwise we have only
9562 NULL pointers in the returning function.
9564 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9566 * src/LaTeX.C (operator()): quote file name when running latex.
9568 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9570 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9571 (bubble tip), this removes our special handling of this.
9573 * Remove all code that is unused now that we have the new
9574 workarea. (Code that are not active when NEW_WA is defined.)
9576 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9578 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9580 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9581 nonexisting layout; correctly redirect obsoleted layouts.
9583 * lib/lyxrc.example: document \view_dvi_paper_option
9585 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9588 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9589 (PreviewDVI): handle the view_dvi_paper_option variable.
9590 [Both from Roland Krause]
9592 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9594 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9595 char const *, int, LyXFont)
9596 (text(int, int, string, LyXFont)): ditto
9598 * src/text.C (InsertCharInTable): attempt to fix the double-space
9599 feature in tables too.
9600 (BackspaceInTable): ditto.
9601 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9603 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9605 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9607 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9608 newly found text in textcache to this.
9609 (buffer): set the owner of the text put into the textcache to 0
9611 * src/insets/figinset.C (draw): fixed the drawing of figures with
9614 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9615 drawing of mathframe, hfills, protected space, table lines. I have
9616 now no outstanding drawing problems with the new Painter code.
9618 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9620 * src/PainterBase.C (ellipse, circle): do not specify the default
9623 * src/LColor.h: add using directive.
9625 * src/Painter.[Ch]: change return type of methods from Painter& to
9626 PainterBase&. Add a using directive.
9628 * src/WorkArea.C: wrap xforms callbacks in C functions
9631 * lib/layouts/foils.layout: font fix and simplifications from Carl
9634 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9636 * a lot of files: The Painter, LColor and WorkArea from the old
9637 devel branch has been ported to lyx-devel. Some new files and a
9638 lot of #ifdeffed code. The new workarea is enabled by default, but
9639 if you want to test the new Painter and LColor you have to compile
9640 with USE_PAINTER defined (do this in config.h f.ex.) There are
9641 still some rought edges, and I'd like some help to clear those
9642 out. It looks stable (loads and displays the Userguide very well).
9645 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9647 * src/buffer.C (pop_tag): revert to the previous implementation
9648 (use a global variable for both loops).
9650 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9652 * src/lyxrc.C (LyXRC): change slightly default date format.
9654 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9655 there is an English text with a footnote that starts with a Hebrew
9656 paragraph, or vice versa.
9657 (TeXFootnote): ditto.
9659 * src/text.C (LeftMargin): allow for negative values for
9660 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9663 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9664 for input encoding (cyrillic)
9666 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9668 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9671 * src/toolbar.C (set): ditto
9672 * src/insets/insetbib.C (create_form_citation_form): ditto
9674 * lib/CREDITS: added Dekel Tsur.
9676 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9677 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9678 hebrew supports files from Dekel Tsur.
9680 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9681 <tzafrir@technion.ac.il>
9683 * src/lyxrc.C: put \date_insert_format at the right place.
9685 * src/buffer.C (makeLaTeXFile): fix the handling of
9686 BufferParams::sides when writing out latex files.
9688 * src/BufferView2.C: add a "using" directive.
9690 * src/support/lyxsum.C (sum): when we use lyxstring,
9691 ostringstream::str needs an additional .c_str().
9693 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9695 * src/support/filetools.C (ChangeExtension): patch from Etienne
9698 * src/TextCache.C (show): remove const_cast and make second
9699 parameter non-const LyXText *.
9701 * src/TextCache.h: use non const LyXText in show.
9703 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9706 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9708 * src/support/lyxsum.C: rework to be more flexible.
9710 * several places: don't check if a pointer is 0 if you are going
9713 * src/text.C: remove some dead code.
9715 * src/insets/figinset.C: remove some dead code
9717 * src/buffer.C: move the BufferView funcs to BufferView2.C
9718 remove all support for insetlatexdel
9719 remove support for oldpapersize stuff
9720 made some member funcs const
9722 * src/kbmap.C: use a std::list to store the bindings in.
9724 * src/BufferView2.C: new file
9726 * src/kbsequence.[Ch]: new files
9728 * src/LyXAction.C + others: remove all trace of buffer-previous
9730 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9731 only have one copy in the binary of this table.
9733 * hebrew patch: moved some functions from LyXText to more
9734 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9736 * several files: remove support for XForms older than 0.88
9738 remove some #if 0 #endif code
9740 * src/TextCache.[Ch]: new file. Holds the textcache.
9742 * src/BufferView.C: changes to use the new TextCache interface.
9743 (waitForX): remove the now unused code.
9745 * src/BackStack.h: remove some commented code
9747 * lib/bind/emacs.bind: remove binding for buffer-previous
9749 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9751 * applied the hebrew patch.
9753 * src/lyxrow.h: make sure that all Row variables are initialized.
9755 * src/text2.C (TextHandleUndo): comment out a delete, this might
9756 introduce a memory leak, but should also help us to not try to
9757 read freed memory. We need to look at this one.
9759 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9760 (LyXParagraph): initalize footnotekind.
9762 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9763 forgot this when applying the patch. Please heed the warnings.
9765 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9766 (aka. reformat problem)
9768 * src/bufferlist.C (exists): made const, and use const_iterator
9769 (isLoaded): new func.
9770 (release): use std::find to find the correct buffer.
9772 * src/bufferlist.h: made getState a const func.
9773 made empty a const func.
9774 made exists a const func.
9777 2000-02-01 Juergen Vigna <jug@sad.it>
9779 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9781 * po/it.po: updated a bit the italian po file and also changed the
9782 'file nuovo' for newfile to 'filenuovo' without a space, this did
9785 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9786 for the new insert_date command.
9788 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9789 from jdblair, to insert a date into the current text conforming to
9790 a strftime format (for now only considering the locale-set and not
9791 the document-language).
9793 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9795 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9796 Bounds Read error seen by purify. The problem was that islower is
9797 a macros which takes an unsigned char and uses it as an index for
9798 in array of characters properties (and is thus subject to the
9802 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9803 correctly the paper sides radio buttons.
9804 (UpdateDocumentButtons): ditto.
9806 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9808 * src/kbmap.C (getsym + others): change to return unsigned int,
9809 returning a long can give problems on 64 bit systems. (I assume
9810 that int is 32bit on 64bit systems)
9812 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9814 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9815 LyXLookupString to be zero-terminated. Really fixes problems seen
9818 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9820 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9821 write a (char*)0 to the lyxerr stream.
9823 * src/lastfiles.C: move algorithm before the using statemets.
9825 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9827 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9828 complains otherwise).
9829 * src/table.C: ditto
9831 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9834 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9835 that I removed earlier... It is really needed.
9837 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9839 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9841 * INSTALL: update xforms home page URL.
9843 * lib/configure.m4: fix a bug with unreadable layout files.
9845 * src/table.C (calculate_width_of_column): add "using std::max"
9848 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9850 * several files: marked several lines with "DEL LINE", this is
9851 lines that can be deleted without changing anything.
9852 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9853 checks this anyway */
9856 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9858 * src/DepTable.C (update): add a "+" at the end when the checksum
9859 is different. (debugging string only)
9861 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9862 the next inset to not be displayed. This should also fix the list
9863 of labels in the "Insert Crossreference" dialog.
9865 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9867 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9868 when regex was not found.
9870 * src/support/lstrings.C (lowercase): use handcoded transform always.
9873 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9874 old_cursor.par->prev could be 0.
9876 * several files: changed post inc/dec to pre inc/dec
9878 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9879 write the lastfiles to file.
9881 * src/BufferView.C (buffer): only show TextCache info when debugging
9883 (resizeCurrentBuffer): ditto
9884 (workAreaExpose): ditto
9886 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9888 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9890 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9891 a bit better by removing the special case for \i and \j.
9893 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9895 * src/lyx_main.C (easyParse): remove test for bad comand line
9896 options, since this broke all xforms-related parsing.
9898 * src/kbmap.C (getsym): set return type to unsigned long, as
9899 declared in header. On an alpha, long is _not_ the same as int.
9901 * src/support/LOstream.h: add a "using std::flush;"
9903 * src/insets/figinset.C: ditto.
9905 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9907 * src/bufferlist.C (write): use blinding fast file copy instead of
9908 "a char at a time", now we are doing it the C++ way.
9910 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9911 std::list<int> instead.
9912 (addpidwait): reflect move to std::list<int>
9913 (sigchldchecker): ditto
9915 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9918 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9919 that obviously was wrong...
9921 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9922 c, this avoids warnings with purify and islower.
9924 * src/insets/figinset.C: rename struct queue to struct
9925 queue_element and rewrite to use a std::queue. gsqueue is now a
9926 std::queue<queue_element>
9927 (runqueue): reflect move to std::queue
9930 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9931 we would get "1" "0" instead of "true" "false. Also make the tostr
9934 2000-01-21 Juergen Vigna <jug@sad.it>
9936 * src/buffer.C (writeFileAscii): Disabled code for special groff
9937 handling of tabulars till I fix this in table.C
9939 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9941 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9943 * src/support/lyxlib.h: ditto.
9945 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9947 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9948 and 'j' look better. This might fix the "macron" bug that has been
9951 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9952 functions as one template function. Delete the old versions.
9954 * src/support/lyxsum.C: move using std::ifstream inside
9957 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9960 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9962 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9964 * src/insets/figinset.C (InitFigures): use new instead of malloc
9965 to allocate memory for figures and bitmaps.
9966 (DoneFigures): use delete[] instead of free to deallocate memory
9967 for figures and bitmaps.
9968 (runqueue): use new to allocate
9969 (getfigdata): use new/delete[] instead of malloc/free
9970 (RegisterFigure): ditto
9972 * some files: moved some declarations closer to first use, small
9973 whitespace changes use preincrement instead of postincrement where
9974 it does not make a difference.
9976 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9977 step on the way to use stl::containers for key maps.
9979 * src/bufferlist.h: add a typedef for const_iterator and const
9980 versions of begin and end.
9982 * src/bufferlist.[Ch]: change name of member variable _state to
9983 state_. (avoid reserved names)
9985 (getFileNames): returns the filenames of the buffers in a vector.
9987 * configure.in (ALL_LINGUAS): added ro
9989 * src/support/putenv.C: new file
9991 * src/support/mkdir.C: new file
9993 2000-01-20 Allan Rae <rae@lyx.org>
9995 * lib/layouts/IEEEtran.layout: Added several theorem environments
9997 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9998 couple of minor additions.
10000 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10001 (except for those in footnotes of course)
10003 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10005 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10007 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10008 std::sort and std::lower_bound instead of qsort and handwritten
10010 (struct compara): struct that holds the functors used by std::sort
10011 and std::lower_bound in MathedLookupBOP.
10013 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10015 * src/support/LAssert.h: do not do partial specialization. We do
10016 not really need it.
10018 * src/support/lyxlib.h: note that lyx::getUserName() and
10019 lyx::date() are not in use right now. Should these be suppressed?
10021 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10022 (makeLinuxDocFile): do not put date and user name in linuxdoc
10025 * src/support/lyxlib.h (kill): change first argument to long int,
10026 since that's what solaris uses.
10028 * src/support/kill.C (kill): fix declaration to match prototype.
10030 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10031 actually check whether namespaces are supported. This is not what
10034 * src/support/lyxsum.C: add a using directive.
10036 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10038 * src/support/kill.C: if we have namespace support we don't have
10039 to include lyxlib.h.
10041 * src/support/lyxlib.h: use namespace lyx if supported.
10043 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10045 * src/support/date.C: new file
10047 * src/support/chdir.C: new file
10049 * src/support/getUserName.C: new file
10051 * src/support/getcwd.C: new file
10053 * src/support/abort.C: new file
10055 * src/support/kill.C: new file
10057 * src/support/lyxlib.h: moved all the functions in this file
10058 insede struct lyx. Added also kill and abort to this struct. This
10059 is a way to avoid the "kill is not defined in <csignal>", we make
10060 C++ wrappers for functions that are not ANSI C or ANSI C++.
10062 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10063 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10064 lyx it has been renamed to sum.
10066 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10068 * src/text.C: add using directives for std::min and std::max.
10070 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10072 * src/texrow.C (getIdFromRow): actually return something useful in
10073 id and pos. Hopefully fixes the bug with positionning of errorbox
10076 * src/lyx_main.C (easyParse): output an error and exit if an
10077 incorrect command line option has been given.
10079 * src/spellchecker.C (ispell_check_word): document a memory leak.
10081 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10082 where a "struct utimbuf" is allocated with "new" and deleted with
10085 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10087 * src/text2.C (CutSelection): don't delete double spaces.
10088 (PasteSelection): ditto
10089 (CopySelection): ditto
10091 * src/text.C (Backspace): don't delete double spaces.
10093 * src/lyxlex.C (next): fix a bug that were only present with
10094 conformant std::istream::get to read comment lines, use
10095 std::istream::getline instead. This seems to fix the problem.
10097 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10099 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10100 allowed to insert space before space" editing problem. Please read
10101 commends at the beginning of the function. Comments about usage
10104 * src/text.C (InsertChar): fix for the "not allowed to insert
10105 space before space" editing problem.
10107 * src/text2.C (DeleteEmptyParagraphMechanism): when
10108 IsEmptyTableRow can only return false this last "else if" will
10109 always be a no-op. Commented out.
10111 * src/text.C (RedoParagraph): As far as I can understand tmp
10112 cursor is not really needed.
10114 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10115 present it could only return false anyway.
10116 (several functions): Did something not so smart...added a const
10117 specifier on a lot of methods.
10119 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10120 and add a tmp->text.resize. The LyXParagraph constructor does the
10122 (BreakParagraphConservative): ditto
10124 * src/support/path.h (Path): add a define so that the wrong usage
10125 "Path("/tmp") will be flagged as a compilation error:
10126 "`unnamed_Path' undeclared (first use this function)"
10128 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10130 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10131 which was bogus for several reasons.
10133 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10135 (runBibTeX): ditto.
10137 * autogen.sh: do not use "type -path" (what's that anyway?).
10139 * src/support/filetools.C (findtexfile): remove extraneous space
10140 which caused a kpsewhich warning (at least with kpathsea version
10143 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10145 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10147 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10149 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10151 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10153 * src/paragraph.C (BreakParagraph): do not reserve space on text
10154 if we don't need to (otherwise, if pos_end < pos, we end up
10155 reserving huge amounts of memory due to bad unsigned karma).
10156 (BreakParagraphConservative): ditto, although I have not seen
10157 evidence the bug can happen here.
10159 * src/lyxparagraph.h: add a using std::list.
10161 2000-01-11 Juergen Vigna <jug@sad.it>
10163 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10164 could not be found.
10166 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10168 * src/vc-backend.C (doVCCommand): change to be static and take one
10169 more parameter: the path to chdir too be fore executing the command.
10170 (retrive): new function equiv to "co -r"
10172 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10173 file_not_found_hook is true.
10175 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10177 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10178 if a file is readwrite,readonly...anything else.
10180 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10182 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10183 (CreatePostscript): name change from MenuRunDVIPS (or something)
10184 (PreviewPostscript): name change from MenuPreviewPS
10185 (PreviewDVI): name change from MenuPreviewDVI
10187 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10188 \view_pdf_command., \pdf_to_ps_command
10190 * lib/configure.m4: added search for PDF viewer, and search for
10191 PDF to PS converter.
10192 (lyxrc.defaults output): add \pdflatex_command,
10193 \view_pdf_command and \pdf_to_ps_command.
10195 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10197 * src/bufferlist.C (write): we don't use blocksize for anything so
10200 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10202 * src/support/block.h: disable operator T* (), since it causes
10203 problems with both compilers I tried. See comments in the file.
10205 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10208 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10209 variable LYX_DIR_10x to LYX_DIR_11x.
10211 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10213 * INSTALL: document --with-lyxname.
10216 * configure.in: new configure flag --with-lyxname which allows to
10217 choose the name under which lyx is installed. Default is "lyx", of
10218 course. It used to be possible to do this with --program-suffix,
10219 but the later has in fact a different meaning for autoconf.
10221 * src/support/lstrings.h (lstrchr): reformat a bit.
10223 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10224 * src/mathed/math_defs.h: ditto.
10226 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10228 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10229 true, decides if we create a backup file or not when saving. New
10230 tag and variable \pdf_mode, defaults to false. New tag and
10231 variable \pdflatex_command, defaults to pdflatex. New tag and
10232 variable \view_pdf_command, defaults to xpdf. New tag and variable
10233 \pdf_to_ps_command, defaults to pdf2ps.
10235 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10237 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10238 does not have a BufferView.
10239 (unlockInset): ditto + don't access the_locking_inset if the
10240 buffer does not have a BufferView.
10242 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10243 certain circumstances so that we don't continue a keyboard
10244 operation long after the key was released. Try f.ex. to load a
10245 large document, press PageDown for some seconds and then release
10246 it. Before this change the document would contine to scroll for
10247 some time, with this change it stops imidiatly.
10249 * src/support/block.h: don't allocate more space than needed. As
10250 long as we don't try to write to the arr[x] in a array_type arr[x]
10251 it is perfectly ok. (if you write to it you might segfault).
10252 added operator value_type*() so that is possible to pass the array
10253 to functions expecting a C-pointer.
10255 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10258 * intl/*: updated to gettext 0.10.35, tried to add our own
10259 required modifications. Please verify.
10261 * po/*: updated to gettext 0.10.35, tried to add our own required
10262 modifications. Please verify.
10264 * src/support/lstrings.C (tostr): go at fixing the problem with
10265 cxx and stringstream. When stringstream is used return
10266 oss.str().c_str() so that problems with lyxstring and basic_string
10267 are avoided. Note that the best solution would be for cxx to use
10268 basic_string all the way, but it is not conformant yet. (it seems)
10270 * src/lyx_cb.C + other files: moved several global functions to
10271 class BufferView, some have been moved to BufferView.[Ch] others
10272 are still located in lyx_cb.C. Code changes because of this. (part
10273 of "get rid of current_view project".)
10275 * src/buffer.C + other files: moved several Buffer functions to
10276 class BufferView, the functions are still present in buffer.C.
10277 Code changes because of this.
10279 * config/lcmessage.m4: updated to most recent. used when creating
10282 * config/progtest.m4: updated to most recent. used when creating
10285 * config/gettext.m4: updated to most recent. applied patch for
10288 * config/gettext.m4.patch: new file that shows what changes we
10289 have done to the local copy of gettext.m4.
10291 * config/libtool.m4: new file, used in creation of acinclude.m4
10293 * config/lyxinclude.m4: new file, this is the lyx created m4
10294 macros, used in making acinclude.m4.
10296 * autogen.sh: GNU m4 discovered as a separate task not as part of
10297 the lib/configure creation.
10298 Generate acinlucde from files in config. Actually cat
10299 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10300 easier to upgrade .m4 files that really are external.
10302 * src/Spacing.h: moved using std::istringstream to right after
10303 <sstream>. This should fix the problem seen with some compilers.
10305 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10307 * src/lyx_cb.C: began some work to remove the dependency a lot of
10308 functions have on BufferView::text, even if not really needed.
10309 (GetCurrentTextClass): removed this func, it only hid the
10312 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10313 forgot this in last commit.
10315 * src/Bullet.C (bulletEntry): use static char const *[] for the
10316 tables, becuase of this the return arg had to change to string.
10317 (bulletSize): ditto
10318 (~Bullet): removed unneeded destructor
10320 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10321 (insetSleep): moved from Buffer
10322 (insetWakeup): moved from Buffer
10323 (insetUnlock): moved from Buffer
10325 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10326 from Buffer to BufferView.
10328 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10330 * config/ltmain.sh: updated to version 1.3.4 of libtool
10332 * config/ltconfig: updated to version 1.3.4 of libtool
10334 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10337 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10338 Did I get that right?
10340 * src/lyxlex.h: add a "using" directive or two.
10341 * src/Spacing.h: ditto.
10342 * src/insets/figinset.C: ditto.
10343 * src/support/filetools.C: ditto.
10344 * src/support/lstrings.C: ditto.
10345 * src/BufferView.C: ditto.
10346 * src/bufferlist.C: ditto.
10347 * src/lyx_cb.C: ditto.
10348 * src/lyxlex.C: ditto.
10350 * NEWS: add some changes for 1.1.4.
10352 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10354 * src/BufferView.C: first go at a TextCache to speed up switching
10357 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10359 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10360 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10361 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10362 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10365 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10366 members of the struct are correctly initialized to 0 (detected by
10368 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10369 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10371 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10372 pidwait, since it was allocated with "new". This was potentially
10373 very bad. Thanks to Michael Schmitt for running purify for us.
10376 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10378 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10380 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10382 1999-12-30 Allan Rae <rae@lyx.org>
10384 * lib/templates/IEEEtran.lyx: minor change
10386 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10387 src/mathed/formula.C (LocalDispatch): askForText changes
10389 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10390 know when a user has cancelled input. Fixes annoying problems with
10391 inserting labels and version control.
10393 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10395 * src/support/lstrings.C (tostr): rewritten to use strstream and
10398 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10400 * src/support/filetools.C (IsFileWriteable): use fstream to check
10401 (IsDirWriteable): use fileinfo to check
10403 * src/support/filetools.h (FilePtr): whole class deleted
10405 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10407 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10409 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10411 * src/bufferlist.C (write): use ifstream and ofstream instead of
10414 * src/Spacing.h: use istrstream instead of sscanf
10416 * src/mathed/math_defs.h: change first arg to istream from FILE*
10418 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10420 * src/mathed/math_parser.C: have yyis to be an istream
10421 (LexGetArg): use istream (yyis)
10423 (mathed_parse): ditto
10424 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10426 * src/mathed/formula.C (Read): rewritten to use istream
10428 * src/mathed/formulamacro.C (Read): rewritten to use istream
10430 * src/lyxlex.h (~LyXLex): deleted desturctor
10431 (getStream): new function, returns an istream
10432 (getFile): deleted funtion
10433 (IsOK): return is.good();
10435 * src/lyxlex.C (LyXLex): delete file and owns_file
10436 (setFile): open an filebuf and assign that to a istream instead of
10438 (setStream): new function, takes an istream as arg.
10439 (setFile): deleted function
10440 (EatLine): rewritten us use istream instead of FILE*
10444 * src/table.C (LyXTable): use istream instead of FILE*
10445 (Read): rewritten to take an istream instead of FILE*
10447 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10449 * src/buffer.C (Dispatch): remove an extraneous break statement.
10451 * src/support/filetools.C (QuoteName): change to do simple
10452 'quoting'. More work is necessary. Also changed to do nothing
10453 under emx (needs fix too).
10454 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10456 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10457 config.h.in to the AC_DEFINE_UNQUOTED() call.
10458 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10459 needs char * as argument (because Solaris 7 declares it like
10462 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10463 remove definition of BZERO.
10465 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10467 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10468 defined, "lyxregex.h" if not.
10470 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10472 (REGEX): new variable that is set to regex.c lyxregex.h when
10473 AM_CONDITIONAL USE_REGEX is set.
10474 (libsupport_la_SOURCES): add $(REGEX)
10476 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10479 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10482 * configure.in: add call to LYX_REGEX
10484 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10485 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10487 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10489 * lib/bind/fi_menus.bind: new file, from
10490 pauli.virtanen@saunalahti.fi.
10492 * src/buffer.C (getBibkeyList): pass the parameter delim to
10493 InsetInclude::getKeys and InsetBibtex::getKeys.
10495 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10496 is passed to Buffer::getBibkeyList
10498 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10499 instead of the hardcoded comma.
10501 * src/insets/insetbib.C (getKeys): make sure that there are not
10502 leading blanks in bibtex keys. Normal latex does not care, but
10503 harvard.sty seems to dislike blanks at the beginning of citation
10504 keys. In particular, the retturn value of the function is
10506 * INSTALL: make it clear that libstdc++ is needed and that gcc
10507 2.7.x probably does not work.
10509 * src/support/filetools.C (findtexfile): make debug message go to
10511 * src/insets/insetbib.C (getKeys): ditto
10513 * src/debug.C (showTags): make sure that the output is correctly
10516 * configure.in: add a comment for TWO_COLOR_ICON define.
10518 * acconfig.h: remove all the entries that already defined in
10519 configure.in or acinclude.m4.
10521 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10522 to avoid user name, date and copyright.
10524 1999-12-21 Juergen Vigna <jug@sad.it>
10526 * src/table.C (Read): Now read bogus row format informations
10527 if the format is < 5 so that afterwards the table can
10528 be read by lyx but without any format-info. Fixed the
10529 crash we experienced when not doing this.
10531 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10533 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10534 (RedoDrawingOfParagraph): ditto
10535 (RedoParagraphs): ditto
10536 (RemoveTableRow): ditto
10538 * src/text.C (Fill): rename arg paperwidth -> paper_width
10540 * src/buffer.C (insertLyXFile): rename var filename -> fname
10541 (writeFile): rename arg filename -> fname
10542 (writeFileAscii): ditto
10543 (makeLaTeXFile): ditto
10544 (makeLinuxDocFile): ditto
10545 (makeDocBookFile): ditto
10547 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10550 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10552 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10555 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10556 compiled by a C compiler not C++.
10558 * src/layout.h (LyXTextClass): added typedef for const_iterator
10559 (LyXTextClassList): added typedef for const_iterator + member
10560 functions begin and end.
10562 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10563 iterators to fill the choice_class.
10564 (updateLayoutChoice): rewritten to use iterators to fill the
10565 layoutlist in the toolbar.
10567 * src/BufferView.h (BufferView::work_area_width): removed unused
10570 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10572 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10573 (sgmlCloseTag): ditto
10575 * src/support/lstrings.h: return type of countChar changed to
10578 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10579 what version of this func to use. Also made to return unsigned int.
10581 * configure.in: call LYX_STD_COUNT
10583 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10584 conforming std::count.
10586 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10588 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10589 and a subscript would give bad display (patch from Dekel Tsur
10590 <dekel@math.tau.ac.il>).
10592 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10594 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10597 * src/chset.h: add a few 'using' directives
10599 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10600 triggered when no buffer is active
10602 * src/layout.C: removed `break' after `return' in switch(), since
10605 * src/lyx_main.C (init): make sure LyX can be ran in place even
10606 when libtool has done its magic with shared libraries. Fix the
10607 test for the case when the system directory has not been found.
10609 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10610 name for the latex file.
10611 (MenuMakeHTML): ditto
10613 * src/buffer.h: add an optional boolean argument, which is passed
10614 to ChangeExtension.
10616 1999-12-20 Allan Rae <rae@lyx.org>
10618 * lib/templates/IEEEtran.lyx: small correction and update.
10620 * configure.in: Attempted to use LYX_PATH_HEADER
10622 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10624 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10625 input from JMarc. Now use preprocessor to find the header.
10626 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10627 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10628 LYX_STL_STRING_FWD. See comments in file.
10630 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10632 * The global MiniBuffer * minibuffer variable is dead.
10634 * The global FD_form_main * fd_form_main variable is dead.
10636 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10638 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10640 * src/table.h: add the LOstream.h header
10641 * src/debug.h: ditto
10643 * src/LyXAction.h: change the explaination of the ReadOnly
10644 attribute: is indicates that the function _can_ be used.
10646 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10649 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10651 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10657 * src/paragraph.C (GetWord): assert on pos>=0
10660 * src/support/lyxstring.C: condition the use of an invariant on
10662 * src/support/lyxstring.h: ditto
10664 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10665 Use LAssert.h instead of plain assert().
10667 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10669 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10670 * src/support/filetools.C: ditto
10672 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10675 * INSTALL: document the new configure flags
10677 * configure.in: suppress --with-debug; add --enable-assertions
10679 * acinclude.m4: various changes in alignment of help strings.
10681 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10683 * src/kbmap.C: commented out the use of the hash map in kb_map,
10684 beginning of movement to a stl::container.
10686 * several files: removed code that was not in effect when
10687 MOVE_TEXT was defined.
10689 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10690 for escaping should not be used. We can discuss if the string
10691 should be enclosed in f.ex. [] instead of "".
10693 * src/trans_mgr.C (insert): use the new returned value from
10694 encodeString to get deadkeys and keymaps done correctly.
10696 * src/chset.C (encodeString): changed to return a pair, to tell
10697 what to use if we know the string.
10699 * src/lyxscreen.h (fillArc): new function.
10701 * src/FontInfo.C (resize): rewritten to use more std::string like
10702 structore, especially string::replace.
10704 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10707 * configure.in (chmod +x some scripts): remove config/gcc-hack
10709 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10711 * src/buffer.C (writeFile): change once again the top comment in a
10712 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10713 instead of an hardcoded version number.
10714 (makeDocBookFile): ditto
10716 * src/version.h: add new define LYX_DOCVERSION
10718 * po/de.po: update from Pit Sütterlin
10719 * lib/bind/de_menus.bind: ditto.
10721 * src/lyxfunc.C (Dispatch): call MenuExport()
10722 * src/buffer.C (Dispatch): ditto
10724 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10725 LyXFunc::Dispatch().
10726 (MenuExport): new function, moved from
10727 LyXFunc::Dispatch().
10729 * src/trans_mgr.C (insert): small cleanup
10730 * src/chset.C (loadFile): ditto
10732 * lib/kbd/iso8859-1.cdef: add missing backslashes
10734 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10736 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10737 help with placing the manually drawn accents better.
10739 (Draw): x2 and hg changed to float to minimize rounding errors and
10740 help place the accents better.
10742 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10743 unsigned short to char is just wrong...cast the char to unsigned
10744 char instead so that the two values can compare sanely. This
10745 should also make the display of insetlatexaccents better and
10746 perhaps also some other insets.
10748 (lbearing): new function
10751 1999-12-15 Allan Rae <rae@lyx.org>
10753 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10754 header that provides a wrapper around the very annoying SGI STL header
10757 * src/support/lyxstring.C, src/LString.h:
10758 removed old SGI-STL-compatability attempts.
10760 * configure.in: Use LYX_STL_STRING_FWD.
10762 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10763 stl_string_fwd.h is around and try to determine it's location.
10764 Major improvement over previous SGI STL 3.2 compatability.
10765 Three small problems remain with this function due to my zero
10766 knowledge of autoconf. JMarc and lgb see the comments in the code.
10768 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10770 * src/broken_const.h, config/hack-gcc, config/README: removed
10772 * configure.in: remove --with-gcc-hack option; do not call
10775 * INSTALL: remove documentation of --with-broken-const and
10778 * acconfig.h: remove all trace of BROKEN_CONST define
10780 * src/buffer.C (makeDocBookFile): update version number in output
10782 (SimpleDocBookOnePar): fix an assert when trying to a character
10783 access beyond string length
10786 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10788 * po/de.po: fix the Export menu
10790 * lyx.man: update the description of -dbg
10792 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10793 (commandLineHelp): updated
10794 (easyParse): show list of available debug levels if -dbg is passed
10797 * src/Makefile.am: add debug.C
10799 * src/debug.h: moved some code to debug.C
10801 * src/debug.C: new file. Contains code to set and show debug
10804 * src/layout.C: remove 'break' after 'continue' in switch
10805 statements, since these cannot be reached.
10807 1999-12-13 Allan Rae <rae@lyx.org>
10809 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10810 (in_word_set): hash() -> math_hash()
10812 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10814 * acconfig.h: Added a test for whether we are using exceptions in the
10815 current compilation run. If so USING_EXCEPTIONS is defined.
10817 * config.in: Check for existance of stl_string_fwd.h
10818 * src/LString.h: If compiling --with-included-string and SGI's
10819 STL version 3.2 is present (see above test) we need to block their
10820 forward declaration of string and supply a __get_c_string().
10821 However, it turns out this is only necessary if compiling with
10822 exceptions enabled so I've a bit more to add yet.
10824 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10825 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10826 src/support/LRegex.h, src/undo.h:
10827 Shuffle the order of the included files a little to ensure that
10828 LString.h gets included before anything that includes stl_string_fwd.h
10830 * src/support/lyxstring.C: We need to #include LString.h instead of
10831 lyxstring.h to get the necessary definition of __get_c_string.
10832 (__get_c_string): New function. This is defined static just like SGI's
10833 although why they need to do this I'm not sure. Perhaps it should be
10834 in lstrings.C instead.
10836 * lib/templates/IEEEtran.lyx: New template file.
10838 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10840 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10841 * intl/Makefile.in (MKINSTALLDIRS): ditto
10843 * src/LyXAction.C (init): changed to hold the LFUN data in a
10844 automatic array in stead of in callso to newFunc, this speeds up
10845 compilation a lot. Also all the memory used by the array is
10846 returned when the init is completed.
10848 * a lot of files: compiled with -Wold-style-cast, changed most of
10849 the reported offenders to C++ style casts. Did not change the
10850 offenders in C files.
10852 * src/trans.h (Match): change argument type to unsigned int.
10854 * src/support/DebugStream.C: fix some types on the streambufs so
10855 that it works on a conforming implementation.
10857 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10859 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10861 * src/support/lyxstring.C: remove the inline added earlier since
10862 they cause a bunch of unsatisfied symbols when linking with dec
10863 cxx. Cxx likes to have the body of inlines at the place where they
10866 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10867 accessing negative bounds in array. This fixes the crash when
10868 inserting accented characters.
10869 * src/trans.h (Match): ditto
10871 * src/buffer.C (Dispatch): since this is a void, it should not try
10872 to return anything...
10874 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10876 * src/buffer.h: removed the two friends from Buffer. Some changes
10877 because of this. Buffer::getFileName and Buffer::setFileName
10878 renamed to Buffer::fileName() and Buffer::fileName(...).
10880 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10882 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10883 and Buffer::update(short) to BufferView. This move is currently
10884 controlled by a define MOVE_TEXT, this will be removed when all
10885 shows to be ok. This move paves the way for better separation
10886 between buffer contents and buffer view. One side effect is that
10887 the BufferView needs a rebreak when swiching buffers, if we want
10888 to avoid this we can add a cache that holds pointers to LyXText's
10889 that is not currently in use.
10891 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10894 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10896 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10898 * lyx_main.C: new command line option -x (or --execute) and
10899 -e (or --export). Now direct conversion from .lyx to .tex
10900 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10901 Unfortunately, X is still needed and the GUI pops up during the
10904 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10906 * src/Spacing.C: add a using directive to bring stream stuff into
10908 * src/paragraph.C: ditto
10909 * src/buffer.C: ditto
10911 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10912 from Lars' announcement).
10914 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10915 example files from Tino Meinen.
10917 1999-12-06 Allan Rae <rae@lyx.org>
10919 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10921 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10923 * src/support/lyxstring.C: added a lot of inline for no good
10926 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10927 latexWriteEndChanges, they were not used.
10929 * src/layout.h (operator<<): output operator for PageSides
10931 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10933 * some example files: loaded in LyX 1.0.4 and saved again to update
10934 certain constructs (table format)
10936 * a lot of files: did the change to use fstream/iostream for all
10937 writing of files. Done with a close look at Andre Poenitz's patch.
10939 * some files: whitespace changes.
10941 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10943 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10944 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10945 architecture, we provide our own. It is used unconditionnally, but
10946 I do not think this is a performance problem. Thanks to Angus
10947 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10948 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10950 (GetInset): use my_memcpy.
10954 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10955 it is easier to understand, but it uses less TeX-only constructs now.
10957 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10958 elements contain spaces
10960 * lib/configure: regenerated
10962 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10963 elements contain spaces; display the list of programs that are
10966 * autogen.sh: make sure lib/configure is executable
10968 * lib/examples/*: rename the tutorial examples to begin with the
10969 two-letters language code.
10971 * src/lyxfunc.C (getStatus): do not query current font if no
10974 * src/lyx_cb.C (RunScript): use QuoteName
10975 (MenuRunDvips): ditto
10976 (PrintApplyCB): ditto
10978 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10979 around argument, so that it works well with the current shell.
10980 Does not work properly with OS/2 shells currently.
10982 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10983 * src/LyXSendto.C (SendtoApplyCB): ditto
10984 * src/lyxfunc.C (Dispatch): ditto
10985 * src/buffer.C (runLaTeX): ditto
10986 (runLiterate): ditto
10987 (buildProgram): ditto
10989 * src/lyx_cb.C (RunScript): ditto
10990 (MenuMakeLaTeX): ditto
10992 * src/buffer.h (getLatexName): new method
10994 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10996 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10998 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10999 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11000 (create_math_panel): ditto
11002 * src/lyxfunc.C (getStatus): re-activate the code which gets
11003 current font and cursor; add test for export to html.
11005 * src/lyxrc.C (read): remove unreachable break statements; add a
11008 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11010 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11012 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11013 introduced by faulty regex.
11014 * src/buffer.C: ditto
11015 * src/lastfiles.C: ditto
11016 * src/paragraph.C: ditto
11017 * src/table.C: ditto
11018 * src/vspace.C: ditto
11019 * src/insets/figinset.C: ditto
11020 Note: most of these is absolutely harmless, except the one in
11021 src/mathed formula.C.
11023 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11025 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11026 operation, yielding correct results for the reLyX command.
11028 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11030 * src/support/filetools.C (ExpandPath): removed an over eager
11032 (ReplaceEnvironmentPath): ditto
11034 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11035 shows that we are doing something fishy in our code...
11036 (BubblePost): ditto
11039 * src/lyxrc.C (read): use a double switch trick to get more help
11040 from the compiler. (the same trick is used in layout.C)
11041 (write): new function. opens a ofstream and pass that to output
11042 (output): new function, takes a ostream and writes the lyxrc
11043 elemts to it. uses a dummy switch to make sure no elements are
11046 * src/lyxlex.h: added a struct pushpophelper for use in functions
11047 with more than one exit point.
11049 * src/lyxlex.[Ch] (GetInteger): made it const
11053 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11055 * src/layout.[hC] : LayoutTags splitted into several enums, new
11056 methods created, better error handling cleaner use of lyxlex. Read
11059 * src/bmtable.[Ch]: change some member prototypes because of the
11060 image const changes.
11062 * commandtags.h, src/LyXAction.C (init): new function:
11063 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11064 This file is not read automatically but you can add \input
11065 preferences to your lyxrc if you want to. We need to discuss how
11068 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11069 in .aux, also remove .bib and .bst files from dependencies when
11072 * src/BufferView.C, src/LyXView.C: add const_cast several places
11073 because of changes to images.
11075 * lib/images/*: same change as for images/*
11077 * lib/lyxrc.example: Default for accept_compound is false not no.
11079 * images/*: changed to be const, however I have som misgivings
11080 about this change so it might be changed back.
11082 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11084 * lib/configure, po/POTFILES.in: regenerated
11086 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11088 * config/lib_configure.m4: removed
11090 * lib/configure.m4: new file (was config/lib_configure.m4)
11092 * configure.in: do not test for rtti, since we do not use it.
11094 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11096 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11097 doubling of allocated space scheme. This makes it faster for large
11098 strings end to use less memory for small strings. xtra rememoved.
11100 * src/insets/figinset.C (waitalarm): commented out.
11101 (GhostscriptMsg): use static_cast
11102 (GhostscriptMsg): use new instead of malloc to allocate memory for
11103 cmap. also delete the memory after use.
11105 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11107 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11108 for changes in bibtex database or style.
11109 (runBibTeX): remove all .bib and .bst files from dep before we
11111 (run): use scanAuc in when dep file already exist.
11113 * src/DepTable.C (remove_files_with_extension): new method
11114 (exist): new method
11116 * src/DepTable.[Ch]: made many of the methods const.
11118 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11120 * src/bufferparams.C: make sure that the default textclass is
11121 "article". It used to be the first one by description order, but
11122 now the first one is "docbook".
11124 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11125 string; call Debug::value.
11126 (easyParse): pass complete argument to setDebuggingLevel().
11128 * src/debug.h (value): fix the code that parses debug levels.
11130 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11133 * src/LyXAction.C: use Debug::ACTION as debug channel.
11135 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11137 * NEWS: updated for the future 1.1.3 release.
11139 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11140 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11141 it should. This is of course a controversial change (since many
11142 people will find that their lyx workscreen is suddenly full of
11143 red), but done for the sake of correctness.
11145 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11146 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11148 * src/insets/inseterror.h, src/insets/inseturl.h,
11149 src/insets/insetinfo.h, src/insets/figinset.h,
11150 src/mathed/formulamacro.h, src/mathed/math_macro.h
11151 (EditMessage): add a missing const and add _() to make sure that
11152 translation happens
11154 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11155 src/insets/insetbib.C, src/support/filetools.C: add `using'
11156 directives for cxx.
11158 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11159 doing 'Insert index of last word' at the beginning of a paragraph.
11161 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11163 * several files: white-space changes.
11165 * src/mathed/formula.C: removed IsAlpha and IsDigit
11167 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11168 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11171 * src/insets/figinset.C (GetPSSizes): don't break when
11172 "EndComments" is seen. But break when a boundingbox is read.
11174 * all classes inherited from Inset: return value of Clone
11175 changed back to Inset *.
11177 * all classes inherited form MathInset: return value of Clone
11178 changed back to MathedInset *.
11180 * src/insets/figinset.C (runqueue): use a ofstream to output the
11181 gs/ps file. Might need some setpresicion or setw. However I can
11182 see no problem with the current code.
11183 (runqueue): use sleep instead of the alarm/signal code. I just
11184 can't see the difference.
11186 * src/paragraph.C (LyXParagraph): reserve space in the new
11187 paragraph and resize the inserted paragraph to just fit.
11189 * src/lyxfunc.h (operator|=): added operator for func_status.
11191 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11192 check for readable file.
11194 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11195 check for readable file.
11196 (MenuMakeLinuxDoc): ditto
11197 (MenuMakeDocBook): ditto
11198 (MenuMakeAscii): ditto
11199 (InsertAsciiFile): split the test for openable and readable
11201 * src/bmtable.C (draw_bitmaptable): use
11202 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11204 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11205 findtexfile from LaTeX to filetools.
11207 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11208 instead of FilePtr. Needs to be verified by a literate user.
11210 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11212 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11213 (EditMessage): likewise.
11215 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11216 respectively as \textasciitilde and \textasciicircum.
11218 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11220 * src/support/lyxstring.h: made the methods that take iterators
11221 use const_iterator.
11223 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11224 (regexMatch): made is use the real regex class.
11226 * src/support/Makefile.am: changed to use libtool
11228 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11230 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11232 (MathIsInset ++): changed several macros to be inline functions
11235 * src/mathed/Makefile.am: changed to use libtool
11237 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11239 * src/insets/inset* : Clone changed to const and return type is
11240 the true insettype not just Inset*.
11242 * src/insets/Makefile.am: changed to use libtool
11244 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11246 * src/undo.[Ch] : added empty() and changed some of the method
11249 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11251 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11252 setID use block<> for the bullets array, added const several places.
11254 * src/lyxfunc.C (getStatus): new function
11256 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11257 LyXAction, added const to several funtions.
11259 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11260 a std::map, and to store the dir items in a vector.
11262 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11265 * src/LyXView.[Ch] + other files : changed currentView to view.
11267 * src/LyXAction.[Ch] : ported from the old devel branch.
11269 * src/.cvsignore: added .libs and a.out
11271 * configure.in : changes to use libtool.
11273 * acinclude.m4 : inserted libtool.m4
11275 * .cvsignore: added libtool
11277 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11279 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11280 file name in insets and mathed directories (otherwise the
11281 dependency is not taken in account under cygwin).
11283 * src/text2.C (InsertString[AB]): make sure that we do not try to
11284 read characters past the string length.
11286 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11288 * lib/doc/LaTeXConfig.lyx.in,
11289 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11291 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11292 file saying who created them and when this heppened; this is
11293 useless and annoys tools like cvs.
11295 * lib/layouts/g-brief-{en,de}.layout,
11296 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11297 from Thomas Hartkens <thomas@hartkens.de>.
11299 * src/{insets,mathed}/Makefile.am: do not declare an empty
11300 LDFLAGS, so that it can be set at configure time (useful on Irix
11303 * lib/reLyX/configure.in: make sure that the prefix is set
11304 correctly in LYX_DIR.
11306 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11308 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11309 be used by 'command-sequence' this allows to bind a key to a
11310 sequence of LyX-commands
11311 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11313 * src/LyXAction.C: add "command-sequence"
11315 * src/LyXFunction.C: handling of "command-sequence"
11317 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11318 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11320 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11322 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11324 * src/buffer.C (writeFile): Do not output a comment giving user
11325 and date at the beginning of a .lyx file. This is useless and
11326 annoys cvs anyway; update version number to 1.1.
11328 * src/Makefile.am (LYX_DIR): add this definition, so that a
11329 default path is hardcoded in LyX.
11331 * configure.in: Use LYX_GNU_GETTEXT.
11333 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11334 AM_GNU_GETTEXT with a bug fixed.
11336 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11338 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11340 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11341 which is used to point to LyX data is now LYX_DIR_11x.
11343 * lyx.man: convert to a unix text file; small updates.
11345 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11347 * src/support/LSubstring.[Ch]: made the second arg of most of the
11348 constructors be a const reference.
11350 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11353 * src/support/lyxstring.[Ch] (swap): added missing member function
11354 and specialization of swap(str, str);
11356 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11358 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11359 trace of the old one.
11361 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11362 put the member definitions in undo.C.
11364 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11365 NEW_TEXT and have now only code that was included when this was
11368 * src/intl.C (LCombo): use static_cast
11370 (DispatchCallback): ditto
11372 * src/definitions.h: removed whole file
11374 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11376 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11377 parsing and stores in a std:map. a regex defines the file format.
11378 removed unneeded members.
11380 * src/bufferparams.h: added several enums from definitions.h here.
11381 Removed unsused destructor. Changed some types to use proper enum
11382 types. use block to have the temp_bullets and user_defined_bullets
11383 and to make the whole class assignable.
11385 * src/bufferparams.C (Copy): removed this functions, use a default
11386 assignment instead.
11388 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11391 * src/buffer.C (readLyXformat2): commend out all that have with
11392 oldpapersize to do. also comment out all that hve to do with
11393 insetlatex and insetlatexdel.
11394 (setOldPaperStuff): commented out
11396 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11398 * src/LyXAction.C: remove use of inset-latex-insert
11400 * src/mathed/math_panel.C (button_cb): use static_cast
11402 * src/insets/Makefile.am (insets_o_SOURCES): removed
11405 * src/support/lyxstring.C (helper): use the unsigned long
11406 specifier, UL, instead of a static_cast.
11408 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11410 * src/support/block.h: new file. to be used as a c-style array in
11411 classes, so that the class can be assignable.
11413 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11415 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11416 NULL, make sure to return an empty string (it is not possible to
11417 set a string to NULL).
11419 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11421 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11423 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11425 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11426 link line, so that Irix users (for example) can set it explicitely to
11429 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11430 it can be overidden at make time (static or dynamic link, for
11433 * src/vc-backend.C, src/LaTeXFeatures.h,
11434 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11435 statements to bring templates to global namespace.
11437 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11439 * src/support/lyxstring.C (operator[] const): make it standard
11442 * src/minibuffer.C (Init): changed to reflect that more
11443 information is given from the lyxvc and need not be provided here.
11445 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11447 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11449 * src/LyXView.C (UpdateTimerCB): use static_cast
11450 (KeyPressMask_raw_callback): ditto
11452 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11453 buffer_, a lot of changes because of this. currentBuffer() ->
11454 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11455 also changes to other files because of this.
11457 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11459 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11460 have no support for RCS and partial support for CVS, will be
11463 * src/insets/ several files: changes because of function name
11464 changes in Bufferview and LyXView.
11466 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11468 * src/support/LSubstring.[Ch]: new files. These implement a
11469 Substring that can be very convenient to use. i.e. is this
11471 string a = "Mary had a little sheep";
11472 Substring(a, "sheep") = "lamb";
11473 a is now "Mary has a little lamb".
11475 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11476 out patterns and subpatterns of strings. It is used by LSubstring
11477 and also by vc-backend.C
11479 * src/support/lyxstring.C: went over all the assertions used and
11480 tried to correct the wrong ones and flag which of them is required
11481 by the standard. some bugs found because of this. Also removed a
11482 couple of assertions.
11484 * src/support/Makefile.am (libsupport_a_SOURCES): added
11485 LSubstring.[Ch] and LRegex.[Ch]
11487 * src/support/FileInfo.h: have struct stat buf as an object and
11488 not a pointer to one, some changes because of this.
11490 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11491 information in layout when adding the layouts preamble to the
11492 textclass preamble.
11494 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11497 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11498 because of bug in OS/2.
11500 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11502 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11503 \verbatim@font instead of \ttfamily, so that it can be redefined.
11505 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11506 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11507 src/layout.h, src/text2.C: add 'using' directive to bring the
11508 STL templates we need from the std:: namespace to the global one.
11509 Needed by DEC cxx in strict ansi mode.
11511 * src/support/LIstream.h,src/support/LOstream.h,
11512 src/support/lyxstring.h,src/table.h,
11513 src/lyxlookup.h: do not include <config.h> in header
11514 files. This should be done in the .C files only.
11516 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11520 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11522 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11523 from Kayvan to fix the tth invokation.
11525 * development/lyx.spec.in: updates from Kayvan to reflect the
11526 changes of file names.
11528 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11530 * src/text2.C (InsertStringB): use std::copy
11531 (InsertStringA): use std::copy
11533 * src/bufferlist.C: use a vector to store the buffers in. This is
11534 an internal change and should not affect any other thing.
11536 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11539 * src/text.C (Fill): fix potential bug, one off bug.
11541 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11543 * src/Makefile.am (lyx_main.o): add more files it depends on.
11545 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11547 * src/support/lyxstring.C: use size_t for the reference count,
11548 size, reserved memory and xtra.
11549 (internal_compare): new private member function. Now the compare
11550 functions should work for std::strings that have embedded '\0'
11552 (compare): all compare functions rewritten to use
11555 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11557 * src/support/lyxstring.C (compare): pass c_str()
11558 (compare): pass c_str
11559 (compare): pass c_str
11561 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11563 * src/support/DebugStream.C: <config.h> was not included correctly.
11565 * lib/configure: forgot to re-generate it :( I'll make this file
11566 auto generated soon.
11568 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11570 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11573 * src/support/lyxstring.C: some changes from length() to rep->sz.
11574 avoids a function call.
11576 * src/support/filetools.C (SpaceLess): yet another version of the
11577 algorithm...now per Jean-Marc's suggestions.
11579 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11581 * src/layout.C (less_textclass_desc): functor for use in sorting
11583 (LyXTextClass::Read): sort the textclasses after reading.
11585 * src/support/filetools.C (SpaceLess): new version of the
11586 SpaceLess functions. What problems does this one give? Please
11589 * images/banner_bw.xbm: made the arrays unsigned char *
11591 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11593 * src/support/lyxstring.C (find): remove bogus assertion in the
11594 two versions of find where this has not been done yet.
11596 * src/support/lyxlib.h: add missing int return type to
11599 * src/menus.C (ShowFileMenu): disable exporting to html if no
11600 html export command is present.
11602 * config/lib_configure.m4: add a test for an HTML converter. The
11603 programs checked for are, in this order: tth, latex2html and
11606 * lib/configure: generated from config/lib_configure.m4.
11608 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11609 html converter. The parameters are now passed through $$FName and
11610 $$OutName, instead of standard input/output.
11612 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11614 * lib/lyxrc.example: update description of \html_command.
11615 add "quotes" around \screen_font_xxx font setting examples to help
11616 people who use fonts with spaces in their names.
11618 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11620 * Distribution files: updates for v1.1.2
11622 * src/support/lyxstring.C (find): remove bogus assert and return
11623 npos for the same condition.
11625 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11627 * added patch for OS/2 from SMiyata.
11629 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11631 * src/text2.C (CutSelection): make space_wrapped a bool
11632 (CutSelection): dont declare int i until we have to.
11633 (alphaCounter): return a char const *.
11635 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11637 * src/support/syscall.C (Systemcalls::kill):
11638 src/support/filetools.C (PutEnv, PutEnvPath):
11639 src/lyx_cb.C (addNewlineAndDepth):
11640 src/FontInfo.C (FontInfo::resize): condition some #warning
11641 directives with WITH_WARNINGS.
11644 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11646 * src/layout.[Ch] + several files: access to class variables
11647 limited and made accessor functions instead a lot of code changed
11648 becuase of this. Also instead of returning pointers often a const
11649 reference is returned instead.
11651 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11653 * src/Makefile.am (dist-hook): added used to remove the CVS from
11654 cheaders upon creating a dist
11655 (EXTRA_DIST): added cheaders
11657 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11658 a character not as a small integer.
11660 * src/support/lyxstring.C (find): removed Assert and added i >=
11661 rep->sz to the first if.
11663 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11665 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11666 src/LyXView.C src/buffer.C src/bufferparams.C
11667 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11668 src/text2.C src/insets/insetinclude.C:
11669 lyxlayout renamed to textclasslist.
11671 * src/layout.C: some lyxerr changes.
11673 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11674 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11675 (LyXLayoutList): removed all traces of this class.
11676 (LyXTextClass::Read): rewrote LT_STYLE
11677 (LyXTextClass::hasLayout): new function
11678 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11679 both const and nonconst version.
11680 (LyXTextClass::delete_layout): new function.
11681 (LyXTextClassList::Style): bug fix. do the right thing if layout
11683 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11684 (LyXTextClassList::NameOfLayout): ditto
11685 (LyXTextClassList::Load): ditto
11687 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11689 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11691 * src/LyXAction.C (LookupFunc): added a workaround for sun
11692 compiler, on the other hand...we don't know if the current code
11693 compiles on sun at all...
11695 * src/support/filetools.C (CleanupPath): subst fix
11697 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11700 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11701 complained about this one?
11703 * src/insets/insetinclude.C (Latex): subst fix
11705 * src/insets/insetbib.C (getKeys): subst fix
11707 * src/LyXSendto.C (SendtoApplyCB): subst fix
11709 * src/lyx_main.C (init): subst fix
11711 * src/layout.C (Read): subst fix
11713 * src/lyx_sendfax_main.C (button_send): subst fix
11715 * src/buffer.C (RoffAsciiTable): subst fix
11717 * src/lyx_cb.C (MenuFax): subst fix
11718 (PrintApplyCB): subst fix
11720 1999-10-26 Juergen Vigna <jug@sad.it>
11722 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11724 (Read): Cleaned up this code so now we read only format vestion >= 5
11726 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11728 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11729 come nobody has complained about this one?
11731 * src/insets/insetinclude.C (Latex): subst fix
11733 * src/insets/insetbib.C (getKeys): subst fix
11735 * src/lyx_main.C (init): subst fix
11737 * src/layout.C (Read): subst fix
11739 * src/buffer.C (RoffAsciiTable): subst fix
11741 * src/lyx_cb.C (MenuFax): subst fix.
11743 * src/layout.[hC] + some other files: rewrote to use
11744 std::container to store textclasses and layouts in.
11745 Simplified, removed a lot of code. Make all classes
11746 assignable. Further simplifications and review of type
11747 use still to be one.
11749 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11750 lastfiles to create the lastfiles partr of the menu.
11752 * src/lastfiles.[Ch]: rewritten to use deque to store the
11753 lastfiles in. Uses fstream for reading and writing. Simplifies
11756 * src/support/syscall.C: remove explicit cast.
11758 * src/BufferView.C (CursorToggleCB): removed code snippets that
11759 were commented out.
11760 use explicat C++ style casts instead of C style casts. also use
11761 u_vdata instea of passing pointers in longs.
11763 * src/PaperLayout.C: removed code snippets that were commented out.
11765 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11767 * src/lyx_main.C: removed code snippets that wer commented out.
11769 * src/paragraph.C: removed code snippets that were commented out.
11771 * src/lyxvc.C (logClose): use static_cast
11773 (viewLog): remove explicit cast to void*
11774 (showLog): removed old commented code
11776 * src/menus.C: use static_cast instead of C style casts. use
11777 u_vdata instead of u_ldata. remove explicit cast to (long) for
11778 pointers. Removed old code that was commented out.
11780 * src/insets/inset.C: removed old commented func
11782 * src/insets/insetref.C (InsetRef): removed old code that had been
11783 commented out for a long time.
11785 (escape): removed C style cast
11787 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11789 * src/insets/insetlatex.C (Draw): removed old commented code
11790 (Read): rewritten to use string
11792 * src/insets/insetlabel.C (escape): removed C style cast
11794 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11796 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11797 old commented code.
11799 * src/insets/insetinclude.h: removed a couple of stupid bools
11801 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11802 (Clone): remove C style cast
11803 (getKeys): changed list to lst because of std::list
11805 * src/insets/inseterror.C (Draw): removed som old commented code.
11807 * src/insets/insetcommand.C (Draw): removed some old commented code.
11809 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11810 commented out forever.
11811 (bibitem_cb): use static_cast instead of C style cast
11812 use of vdata changed to u_vdata.
11814 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11816 (CloseUrlCB): use static_cast instead of C style cast.
11817 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11819 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11820 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11821 (CloseInfoCB): static_cast from ob->u_vdata instead.
11822 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11825 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11826 (C_InsetError_CloseErrorCB): forward the ob parameter
11827 (CloseErrorCB): static_cast from ob->u_vdata instead.
11829 * src/vspace.h: include LString.h since we use string in this class.
11831 * src/vspace.C (lyx_advance): changed name from advance because of
11832 nameclash with stl. And since we cannot use namespaces yet...I
11833 used a lyx_ prefix instead. Expect this to change when we begin
11836 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11838 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11839 and removed now defunct constructor and deconstructor.
11841 * src/BufferView.h: have backstack as a object not as a pointer.
11842 removed initialization from constructor. added include for BackStack
11844 * development/lyx.spec.in (%build): add CFLAGS also.
11846 * src/screen.C (drawFrame): removed another warning.
11848 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11850 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11851 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11852 README and ANNOUNCE a bit for the next release. More work is
11855 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11856 unbreakable if we are in freespacing mode (LyX-Code), but not in
11859 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11861 * src/BackStack.h: fixed initialization order in constructor
11863 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11865 * acinclude.m4 (VERSION): new rules for when a version is
11866 development, added also a variable for prerelease.
11867 (warnings): we set with_warnings=yes for prereleases
11868 (lyx_opt): prereleases compile with same optimization as development
11869 (CXXFLAGS): only use pedantic if we are a development version
11871 * src/BufferView.C (restorePosition): don't do anything if the
11872 backstack is empty.
11874 * src/BackStack.h: added member empty, use this to test if there
11875 is anything to pop...
11877 1999-10-25 Juergen Vigna <jug@sad.it>
11880 * forms/layout_forms.fd +
11881 * forms/latexoptions.fd +
11882 * lyx.fd: changed for various form resize issues
11884 * src/mathed/math_panel.C +
11885 * src/insets/inseterror.C +
11886 * src/insets/insetinfo.C +
11887 * src/insets/inseturl.C +
11888 * src/insets/inseturl.h +
11890 * src/LyXSendto.C +
11891 * src/PaperLayout.C +
11892 * src/ParagraphExtra.C +
11893 * src/TableLayout.C +
11895 * src/layout_forms.C +
11902 * src/menus.C: fixed various resize issues. So now forms can be
11903 resized savely or not be resized at all.
11905 * forms/form_url.fd +
11906 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11909 * src/insets/Makefile.am: added files form_url.[Ch]
11911 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11913 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11914 (and presumably 6.2).
11916 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11917 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11918 remaining static member callbacks.
11920 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11923 * src/support/lyxstring.h: declare struct Srep as friend of
11924 lyxstring, since DEC cxx complains otherwise.
11926 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11928 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11930 * src/LaTeX.C (run): made run_bibtex also depend on files with
11932 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11933 are put into the dependency file.
11935 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11936 the code has shown itself to work
11937 (create_ispell_pipe): removed another warning, added a comment
11940 * src/minibuffer.C (ExecutingCB): removed code that has been
11941 commented out a long time
11943 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11944 out code + a warning.
11946 * src/support/lyxstring.h: comment out the three private
11947 operators, when compiling with string ansi conforming compilers
11948 they make problems.
11950 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11952 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11953 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11956 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11959 * src/mathed/math_panel.C (create_math_panel): remove explicit
11962 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11965 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11966 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11967 to XCreatePixmapFromBitmapData
11968 (fl_set_bmtable_data): change the last argument to be unsigned
11970 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11971 and bh to be unsigned int, remove explicit casts in call to
11972 XReadBitmapFileData.
11974 * images/arrows.xbm: made the arrays unsigned char *
11975 * images/varsz.xbm: ditto
11976 * images/misc.xbm: ditto
11977 * images/greek.xbm: ditto
11978 * images/dots.xbm: ditto
11979 * images/brel.xbm: ditto
11980 * images/bop.xbm: ditto
11982 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11984 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11985 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11986 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11988 (LYX_CXX_CHEADERS): added <clocale> to the test.
11990 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11992 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11994 * src/support/lyxstring.C (append): fixed something that must be a
11995 bug, rep->assign was used instead of rep->append.
11997 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12000 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12001 lyx insert double chars. Fix spotted by Kayvan.
12003 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12005 * Fixed the tth support. I messed up with the Emacs patch apply feature
12006 and omitted the changes in lyxrc.C.
12008 1999-10-22 Juergen Vigna <jug@sad.it>
12010 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12012 * src/lyx_cb.C (MenuInsertRef) +
12013 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12014 the form cannot be resized under it limits (fixes a segfault)
12016 * src/lyx.C (create_form_form_ref) +
12017 * forms/lyx.fd: Changed Gravity on name input field so that it is
12020 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12022 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12023 <ostream> and <istream>.
12025 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12026 whether <fstream> provides the latest standard features, or if we
12027 have an oldstyle library (like in egcs).
12028 (LYX_CXX_STL_STRING): fix the test.
12030 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12031 code on MODERN_STL_STREAM.
12033 * src/support/lyxstring.h: use L{I,O}stream.h.
12035 * src/support/L{I,O}stream.h: new files, designed to setup
12036 correctly streams for our use
12037 - includes the right header depending on STL capabilities
12038 - puts std::ostream and std::endl (for LOStream.h) or
12039 std::istream (LIStream.h) in toplevel namespace.
12041 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12043 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12044 was a bib file that had been changed we ensure that bibtex is run.
12045 (runBibTeX): enhanced to extract the names of the bib files and
12046 getting their absolute path and enter them into the dep file.
12047 (findtexfile): static func that is used to look for tex-files,
12048 checks for absolute patchs and tries also with kpsewhich.
12049 Alternative ways of finding the correct files are wanted. Will
12051 (do_popen): function that runs a command using popen and returns
12052 the whole output of that command in a string. Should be moved to
12055 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12056 file with extension ext has changed.
12058 * src/insets/figinset.C: added ifdef guards around the fl_free
12059 code that jug commented out. Now it is commented out when
12060 compiling with XForms == 0.89.
12062 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12063 to lyxstring.C, and only keep a forward declaration in
12064 lyxstring.h. Simplifies the header file a bit and should help a
12065 bit on compile time too. Also changes to Srep will not mandate a
12066 recompile of code just using string.
12067 (~lyxstring): definition moved here since it uses srep.
12068 (size): definition moved here since it uses srep.
12070 * src/support/lyxstring.h: removed a couple of "inline" that should
12073 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12075 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12078 1999-10-21 Juergen Vigna <jug@sad.it>
12080 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12081 set to left if I just remove the width entry (or it is empty).
12083 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12084 paragraph when having dummy paragraphs.
12086 1999-10-20 Juergen Vigna <jug@sad.it>
12088 * src/insets/figinset.C: just commented some fl_free_form calls
12089 and added warnings so that this calls should be activated later
12090 again. This avoids for now a segfault, but we have a memory leak!
12092 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12093 'const char * argument' to 'string argument', this should
12094 fix some Asserts() in lyxstring.C.
12096 * src/lyxfunc.h: Removed the function argAsString(const char *)
12097 as it is not used anymore.
12099 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12101 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12104 * src/Literate.h: some funcs moved from public to private to make
12105 interface clearer. Unneeded args removed.
12107 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12109 (scanBuildLogFile): ditto
12111 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12112 normal TeX Error. Still room for improvement.
12114 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12116 * src/buffer.C (insertErrors): changes to make the error
12117 desctription show properly.
12119 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12122 * src/support/lyxstring.C (helper): changed to use
12123 sizeof(object->rep->ref).
12124 (operator>>): changed to use a pointer instead.
12126 * src/support/lyxstring.h: changed const reference & to value_type
12127 const & lets see if that helps.
12129 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12131 * Makefile.am (rpmdist): fixed to have non static package and
12134 * src/support/lyxstring.C: removed the compilation guards
12136 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12139 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12140 conditional compile of lyxstring.Ch
12142 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12143 stupid check, but it is a lot better than the bastring hack.
12144 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12146 * several files: changed string::erase into string::clear. Not
12149 * src/chset.C (encodeString): use a char temporary instead
12151 * src/table.C (TexEndOfCell): added tostr around
12152 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12153 (TexEndOfCell): ditto
12154 (TexEndOfCell): ditto
12155 (TexEndOfCell): ditto
12156 (DocBookEndOfCell): ditto
12157 (DocBookEndOfCell): ditto
12158 (DocBookEndOfCell): ditto
12159 (DocBookEndOfCell): ditto
12161 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12163 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12165 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12166 (MenuBuildProg): added tostr around ret
12167 (MenuRunChktex): added tostr around ret
12168 (DocumentApplyCB): added tostr around ret
12170 * src/chset.C (encodeString): added tostr around t->ic
12172 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12173 (makeLaTeXFile): added tostr around tocdepth
12174 (makeLaTeXFile): added tostr around ftcound - 1
12176 * src/insets/insetbib.C (setCounter): added tostr around counter.
12178 * src/support/lyxstring.h: added an operator+=(int) to catch more
12181 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12182 (lyxstring): We DON'T allow NULL pointers.
12184 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12186 * src/mathed/math_macro.C (MathMacroArgument::Write,
12187 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12188 when writing them out.
12190 * src/LString.C: remove, since it is not used anymore.
12192 * src/support/lyxstring.C: condition the content to
12193 USE_INCLUDED_STRING macro.
12195 * src/mathed/math_symbols.C, src/support/lstrings.C,
12196 src/support/lyxstring.C: add `using' directive to specify what
12197 we need in <algorithm>. I do not think that we need to
12198 conditionalize this, but any thought is appreciated.
12200 * many files: change all callback functions to "C" linkage
12201 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12202 strict_ansi. Those who were static are now global.
12203 The case of callbacks which are static class members is
12204 trickier, since we have to make C wrappers around them (see
12205 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12206 did not finish this yet, since it defeats the purpose of
12207 encapsulation, and I am not sure what the best route is.
12209 1999-10-19 Juergen Vigna <jug@sad.it>
12211 * src/support/lyxstring.C (lyxstring): we permit to have a null
12212 pointer as assignment value and just don't assign it.
12214 * src/vspace.C (nextToken): corrected this function substituting
12215 find_first(_not)_of with find_last_of.
12217 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12218 (TableOptCloseCB) (TableSpeCloseCB):
12219 inserted fl_set_focus call for problem with fl_hide_form() in
12222 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12224 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12227 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12229 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12230 LyXLex::next() and not eatline() to get its argument.
12232 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12234 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12235 instead, use fstreams for io of the depfile, removed unneeded
12236 functions and variables.
12238 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12239 vector instead, removed all functions and variables that is not in
12242 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12244 * src/buffer.C (insertErrors): use new interface to TeXError
12246 * Makefile.am (rpmdist): added a rpmdist target
12248 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12249 per Kayvan's instructions.
12251 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12253 * src/Makefile.am: add a definition for localedir, so that locales
12254 are found after installation (Kayvan)
12256 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12258 * development/.cvsignore: new file.
12260 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12262 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12263 C++ compiler provides wrappers for C headers and use our alternate
12266 * configure.in: use LYX_CXX_CHEADERS.
12268 * src/cheader/: new directory, populated with cname headers from
12269 libstdc++-2.8.1. They are a bit old, but probably good enough for
12270 what we want (support compilers who lack them).
12272 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12273 from includes. It turns out is was stupid.
12275 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12277 * lib/Makefile.am (install-data-local): forgot a ';'
12278 (install-data-local): forgot a '\'
12279 (libinstalldirs): needed after all. reintroduced.
12281 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12283 * configure.in (AC_OUTPUT): added lyx.spec
12285 * development/lyx.spec: removed file
12287 * development/lyx.spec.in: new file
12289 * po/*.po: merged with lyx.pot becuase of make distcheck
12291 * lib/Makefile.am (dist-hook): added dist-hook so that
12292 documentation files will be included when doing a make
12293 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12294 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12296 more: tried to make install do the right thing, exclude CVS dirs
12299 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12300 Path would fit in more nicely.
12302 * all files that used to use pathstack: uses now Path instead.
12303 This change was a lot easier than expected.
12305 * src/support/path.h: new file
12307 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12309 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12311 * src/support/lyxstring.C (getline): Default arg was given for
12314 * Configure.cmd: removed file
12316 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12318 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12319 streams classes and types, add the proper 'using' statements when
12320 MODERN_STL is defined.
12322 * src/debug.h: move the << operator definition after the inclusion
12325 * src/support/filetools.C: include "LAssert.h", which is needed
12328 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12331 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12332 include "debug.h" to define a proper ostream.
12334 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12336 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12337 method to the SystemCall class which can kill a process, but it's
12338 not fully implemented yet.
12340 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12342 * src/support/FileInfo.h: Better documentation
12344 * src/lyxfunc.C: Added support for buffer-export html
12346 * src/menus.C: Added Export->As HTML...
12348 * lib/bind/*.bind: Added short-cut for buffer-export html
12350 * src/lyxrc.*: Added support for new \tth_command
12352 * lib/lyxrc.example: Added stuff for new \tth_command
12354 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12356 * lib/Makefile.am (IMAGES): removed images/README
12357 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12358 installes in correct place. Check permisions is installed
12361 * src/LaTeX.C: some no-op changes moved declaration of some
12364 * src/LaTeX.h (LATEX_H): changed include guard name
12366 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12368 * lib/reLyX/Makefile.am: install noweb2lyx.
12370 * lib/Makefile.am: install configure.
12372 * lib/reLyX/configure.in: declare a config aux dir; set package
12373 name to lyx (not sure what the best solution is); generate noweb2lyx.
12375 * lib/layouts/egs.layout: fix the bibliography layout.
12377 1999-10-08 Jürgen Vigna <jug@sad.it>
12379 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12380 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12381 it returned without continuing to search the path.
12383 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12385 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12386 also fixes a bug. It is not allowed to do tricks with std::strings
12387 like: string a("hei"); &a[e]; this will not give what you
12388 think... Any reason for the complexity in this func?
12390 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12392 * Updated README and INSTALL a bit, mostly to check that my
12393 CVS rights are correctly set up.
12395 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12397 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12398 does not allow '\0' chars but lyxstring and std::string does.
12400 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12402 * autogen.sh (AUTOCONF): let the autogen script create the
12403 POTFILES.in file too. POTFILES.in should perhaps now not be
12404 included in the cvs module.
12406 * some more files changed to use C++ includes instead of C ones.
12408 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12410 (Reread): added tostr to nlink. buggy output otherwise.
12411 (Reread): added a string() around szMode when assigning to Buffer,
12412 without this I got a log of garbled info strings.
12414 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12417 * I have added several ostream & operator<<(ostream &, some_type)
12418 functions. This has been done to avoid casting and warnings when
12419 outputting enums to lyxerr. This as thus eliminated a lot of
12420 explicit casts and has made the code clearer. Among the enums
12421 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12422 mathed enums, some font enum the Debug::type enum.
12424 * src/support/lyxstring.h (clear): missing method. equivalent of
12427 * all files that contained "stderr": rewrote constructs that used
12428 stderr to use lyxerr instead. (except bmtable)
12430 * src/support/DebugStream.h (level): and the passed t with
12431 Debug::ANY to avoid spurious bits set.
12433 * src/debug.h (Debug::type value): made it accept strings of the
12434 type INFO,INIT,KEY.
12436 * configure.in (Check for programs): Added a check for kpsewhich,
12437 the latex generation will use this later to better the dicovery of
12440 * src/BufferView.C (create_view): we don't need to cast this to
12441 (void*) that is done automatically.
12442 (WorkAreaButtonPress): removed some dead code.
12444 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12446 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12447 is not overwritten when translated (David Sua'rez de Lis).
12449 * lib/CREDITS: Added David Sua'rez de Lis
12451 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12453 * src/bufferparams.C (BufferParams): default input encoding is now
12456 * acinclude.m4 (cross_compiling): comment out macro
12457 LYX_GXX_STRENGTH_REDUCE.
12459 * acconfig.h: make sure that const is not defined (to empty) when
12460 we are compiling C++. Remove commented out code using SIZEOF_xx
12463 * configure.in : move the test for const and inline as late as
12464 possible so that these C tests do not interefere with C++ ones.
12465 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12466 has not been proven.
12468 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12470 * src/table.C (getDocBookAlign): remove bad default value for
12471 isColumn parameter.
12473 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12475 (ShowFileMenu2): ditto.
12477 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12478 of files to ignore.
12480 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12482 * Most files: finished the change from the old error code to use
12483 DebugStream for all lyxerr debugging. Only minor changes remain
12484 (e.g. the setting of debug levels using strings instead of number)
12486 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12488 * src/layout.C (Add): Changed to use compare_no_case instead of
12491 * src/FontInfo.C: changed loop variable type too string::size_type.
12493 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12495 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12496 set ETAGS_ARGS to --c++
12498 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12500 * src/table.C (DocBookEndOfCell): commented out two unused variables
12502 * src/paragraph.C: commented out four unused variables.
12504 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12505 insed a if clause with type string::size_type.
12507 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12510 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12512 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12513 variable, also changed loop to go from 0 to lenght + 1, instead of
12514 -1 to length. This should be correct.
12516 * src/LaTeX.C (scanError): use string::size_type as loop variable
12519 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12520 (l.896) since y_tmp and row was not used anyway.
12522 * src/insets/insetref.C (escape): use string::size_type as loop
12525 * src/insets/insetquotes.C (Width): use string::size_type as loop
12527 (Draw): use string::size_type as loop variable type.
12529 * src/insets/insetlatexaccent.C (checkContents): use
12530 string::size_type as loop variable type.
12532 * src/insets/insetlabel.C (escape): use string::size_type as loop
12535 * src/insets/insetinfo.C: added an extern for current_view.
12537 * src/insets/insetcommand.C (scanCommand): use string::size_type
12538 as loop variable type.
12540 * most files: removed the RCS tags. With them we had to recompile
12541 a lot of files after a simple cvs commit. Also we have never used
12542 them for anything meaningful.
12544 * most files: tags-query-replace NULL 0. As adviced several plases
12545 we now use "0" instead of "NULL" in our code.
12547 * src/support/filetools.C (SpaceLess): use string::size_type as
12548 loop variable type.
12550 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12552 * src/paragraph.C: fixed up some more string stuff.
12554 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12556 * src/support/filetools.h: make modestr a std::string.
12558 * src/filetools.C (GetEnv): made ch really const.
12560 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12561 made code that used these use max/min from <algorithm> instead.
12563 * changed several c library include files to their equivalent c++
12564 library include files. All is not changed yet.
12566 * created a support subdir in src, put lyxstring and lstrings
12567 there + the extra files atexit, fileblock, strerror. Created
12568 Makefile.am. edited configure.in and src/Makefile.am to use this
12569 new subdir. More files moved to support.
12571 * imported som of the functions from repository lyx, filetools
12573 * ran tags-query-replace on LString -> string, corrected the bogus
12574 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12575 is still some errors in there. This is errors where too much or
12576 too litle get deleted from strings (string::erase, string::substr,
12577 string::replace), there can also be some off by one errors, or
12578 just plain wrong use of functions from lstrings. Viewing of quotes
12581 * LyX is now running fairly well with string, but there are
12582 certainly some bugs yet (see above) also string is quite different
12583 from LString among others in that it does not allow null pointers
12584 passed in and will abort if it gets any.
12586 * Added the revtex4 files I forgot when setting up the repository.
12588 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12590 * All over: Tried to clean everything up so that only the files
12591 that we really need are included in the cvs repository.
12592 * Switched to use automake.
12593 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12594 * Install has not been checked.
12596 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12598 * po/pt.po: Three errors:
12599 l.533 and l.538 format specification error
12600 l. 402 duplicate entry, I just deleted it.