1 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/Makefile.am (lyx_SOURCES): added Floating.C
5 * src/Floating.h: moved all the inlines to Floating.C
7 * src/Floating.C: new file
9 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11 * src/frontends/xforms/FormPreferences.C (feedback): fix
12 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
14 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
16 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
19 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
21 * src/mathed/math_inset.h: move LString.h to be included first
23 * src/insets/insetfloat.C: adjust for change in private variable names
25 * src/frontends/xforms/xform_helpers.h : don't include config.h
27 * src/frontends/xforms/xform_helpers.C: adjust the order of
28 includes, some whitespace changes.
30 * src/trans.C (Load): constify filename and res
32 * src/text2.C (SetCounter): call Floating::name()
34 * src/screen.C: change to not use owner from WorkArea, but from
37 * src/lyxfunc.C: adjust because of changes in Intl.
39 * src/intl.h: make trans a object instead of pointer, inlucd
40 trans_mgr.h in this file.
41 (getTrans): return a reference to TransManager
43 * src/intl.C: don't include trans_mgr.h here
44 modify calls to trans to work on object instead of on pointer
46 * src/WorkArea.h: add using for Signal1
47 comment out forward decl of BufferView.
49 remove class variable owner_ and getter method for this.
51 * src/WorkArea.C: don't include BufferView.h
52 (WorkArea): change to not take a BufferView.h, use signals
54 (scroll_cb): emit signal
56 * src/LaTeXFeatures.C: include Floatlist.h
57 (getPackages): only load float.sty when needed
58 (getMacros): prepare for outputting the correct code to preamble.
60 * src/Floating.h: make all variables private + rename to var_.
61 (Floating): default ctor
62 (Floating): complex ctor to set a complete Floating
68 * src/FloatList.C (FloatList): use Floating's constructor
71 (newFloat): call type()
72 (defaultPlacement): call placement()
73 (operator): new operator
75 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
76 (scrollUp): call pimpl's scrollCB
78 (pasteClipboard): constify clip
80 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
81 (insertErrors): constify desctext, errortext, msgtxt and errorrow
82 (open_new_inset): delete some commented code.
84 * src/BufferView.[Ch] (enterView): comment out
87 (workAreaMotionNotify): ditto
88 (workAreaButtonPress): ditto
91 (workAreaButtonRelease): ditto
92 (workAreaExpose): ditto
94 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
95 to compile with cvs gcc (2.97).
97 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
99 * lib/ui/default.ui: menu structure cleanup.
101 * lib/languages: add description of entries.
103 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
105 * src/insets/ExternalTemplate.C (readTemplates): change debug
107 (readTemplate): use lyxlex.printError to report read errors.
110 * src/insets/insetexternal.C (Read): suppress debug message when
113 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
115 * src/insets/insetinclude.C (Ascii): New method. Currently
116 supports only verbatim input.
118 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
120 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
122 2000-12-22 Juergen Vigna <jug@sad.it>
124 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
125 have a selection and button == 3.
126 (UpdateLocal): if what == INIT clear selection if existent!
127 (InsetButtonPress): don't activate the cell inset on button==3
129 (LocalDispatch): move curor up/down if exiting an inset which this
132 2000-12-20 Juergen Vigna <jug@sad.it>
134 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
135 calling for the math-panel (do not unlock the math-inset if locked)!
137 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
138 text-insets (with x-offset).
140 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
141 alignment of multicolumn-cells.
143 2000-12-19 Juergen Vigna <jug@sad.it>
145 * src/lyxfunc.C (Dispatch):
146 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
149 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
151 * src/WorkArea.C (work_area_handler): simplify the key/keysym
152 handling for XForms 0.89, this might have rendered some cases
153 unusable. I have at least deadkeys, accent-xxx and KP_x working.
154 Please report proplems.
156 * src/lyxfunc.C (processKeySym): make the self-insert handling
159 2000-12-18 Baruch Even <baruch.even@writeme.com>
161 * src/LaTeX.C (deplog): fix spelling errors
162 * src/text2.C (CutSelection): ditto
163 * src/lyxfunc.C (Dispatch): ditto
165 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
167 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
169 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
170 and h_align in default init.
171 adjust calls to MathedRowSt
173 * src/mathed/math_iter.C: adjust calls to MathedRowSt
174 * src/mathed/math_iter.h (getAD): ditto
176 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
177 methods setBaseline, ascent, descent
178 (class MathMatrixInset): remove method GetAlign, change h_align
181 * src/lyxfunc.C (processKeySym): discover the correct argument if
182 the action is LFUN_SELFINSERT
184 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
186 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
189 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
191 * src/support/copy.C: don't include filetools.h
193 * lib/images: revert to old banner, drop the cucumber.
195 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
197 * src/converter.C (Formats::View): Change the current directory to
198 the directory of the file.
200 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
202 * src/kbsequence.C (addkey): also clear sequence and modifiers if
205 * src/BufferView2.C (theLockingInset): return 0 if text is 0
207 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
209 * Many files: Fix RTL support for insettext.
211 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
213 * README: add mention of broken ghostscript versions, remove
214 reference to non-existent BUGS file
216 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
218 * src/support/lstrings.C (compare_no_case): small fix. When passed
219 length, should use it in the size comparison.
221 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
223 * src/insets/insetexternal.C (getScreenLabel): Return a default
224 value if the template label is empty.
226 * src/lyxlookup.C: do not condition on FL_REVISION.
229 * src/sp_form.C: fix the font size of some text entries
231 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
232 after TOC when there is no TOC.
234 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
235 bind file if it has not been done yet.
236 (read): remove local bindFile variable. Try to fix the handling of
237 RC_BIND and RC_BINDFILE.
239 * src/lyx_main.C (init): use readBindFileIfNeeded().
241 * lib/languages: Change description of german to "German (new
244 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
246 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
247 "Apply" buttons if arg is non-zero.
249 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
250 launching the popup if sufficient info is passed to
251 LFUN_CITATION_CREATE.
253 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
255 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
256 labels (disabled in 1.1.6).
258 * src/lyxrc.[Ch]: New variable label_init_length
260 * mathed/formula.C (LocalDispatch): Preserve the label when
261 changing from display math to eqnarray (however, the label
262 do not appear at the first line, as one might expects, but at the
264 (LocalDispatch): When inserting a label to a formula which already
265 have a label, the old label is used as default value.
266 Also, if the label is changed, then all references to the label
269 * src/mathed/math_iter.C (setLabel): Allow to set the label
270 even if it is empty. This is needed to allow deletion of a label
273 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
274 refernces only if the old label appears once in the document.
276 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
278 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
279 <gehlert@Rcs1.urz.tu-dresden.de>
281 * src/frontends/xforms/FormBase.C: comment out debug.h
283 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
284 code in xform_helpers instead.
285 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
287 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
288 Use N_(), rather than _() when creating strings to pass to browseFile()
289 because browseFile calls gettext() itself now.
291 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
292 display the filename correctly.
294 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
296 * src/converter.C (Move): New method. Used to move file or files
297 from temp dir to the output dir. (this fixes the bug that
298 exporting linuxdoc/docbook document to html would not move all
299 html file from temp directory).
301 * src/support/filetools.C (DirList): Fixed.
303 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
305 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
307 * src/converter.C (Add): Remove $$i when setting latex_command.
309 * src/text.C (IsBoundary): Return false when pos = 0.
311 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
313 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
315 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
317 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
318 need to empty the fields to turn off use of the geometry package!
320 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
322 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
323 (Buffer const &), not a (BufferParams const &) and so fix a crash
324 caused by using current_view before it had been initialised. Not
325 the best way to do this, but much easier than changing
326 Inset::Clone(Buffer const &) to Inset::Clone().
329 * src/tabular.C: changed call to CopyIntoMinibuffer().
331 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
333 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
335 * src/lyxfunc.C (getStatus): disable insertion of floats in a
338 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
340 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
341 changed filter for screen fonts input filter from int to float
343 * src/frontends/xforms/input_validators.c: removed.
344 * src/frontends/xforms/input_validators.C: new file. Can now call C++
345 functions from within the filter functions.
347 * src/frontends/xforms/input_validators.[Ch]
348 (fl_unsigned_float_filter): new filter function.
350 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
351 confused now! And if you think I'm going to do this in
352 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
354 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
356 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
358 * src/WorkArea.C (work_area_handler): don't handle button requests
359 if xbutton.button == 0
361 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
363 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
364 It creates a lot of interesting problems.
366 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
368 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
369 the menu exists in the current menubar before opening it.
371 * src/MenuBackend.C (hasSubmenu): new method.
373 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
374 action value by offsetting actions by a large constant (so that
375 bogs choice result will be less than this constant).
377 * lib/bind/fi_menus.bind: more cleanup to menus.
378 * lib/bind/sciword.bind: ditto.
379 * lib/bind/xemacs.bind: ditto.
380 * lib/bind/emacs.bind: ditto.
381 * lib/bind/pt_menus.bind: ditto.
382 * lib/bind/hu_menus.bind: ditto.
384 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
386 * INSTALL: update PROBLEMS section.
388 * src/lyxlookup.h: remove condition on xforms version, since we
389 should not include it if not appropriate.
391 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
393 * src/LColor.C: "latex text" -> "latex inset" (from
396 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
398 * src/frontends/kde/FormTabularCreate.C:
399 * src/frontends/kde/citationdlg.C:
400 * src/frontends/kde/copyrightdlg.C:
401 * src/frontends/kde/paradlg.C:
402 * src/frontends/kde/paraextradlg.C:
403 * src/frontends/kde/parageneraldlg.C:
404 * src/frontends/kde/printdlg.C:
405 * src/frontends/kde/refdlg.C:
406 * src/frontends/kde/tabcreatedlg.C:
407 * src/frontends/kde/tocdlg.C:
408 * src/frontends/kde/urldlg.C: add necessary headers
411 * src/frontends/kde/dlg/emptytable.C:
412 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
413 default parameters (from Angus Leeming)
415 * src/frontends/kde/dlg/moc/.cvsignore:
416 * src/frontends/kde/dlg/.cvsignore:
417 * src/frontends/kde/moc/.cvsignore: fix the library name
420 * src/frontends/kde/paradlg.C:
421 * src/frontends/kde/parageneraldlg.C:
422 * src/frontends/kde/dlg/para.dlg:
423 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
425 * src/frontends/kde/dlg/README: clarified qtarch version
427 * src/frontends/kde/dlg/Makefile.am: removed the
428 dlg rules as they created spontaneous rebuilds
429 (not a good idea as it requires qtarch)
431 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
433 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
434 fixlevel along with xforms version.
436 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
437 xforms version is strictly less than 0.89.5.
438 * src/lyx_gui.C (LyXGUI): ditto.
439 * src/LyXView.C (show): ditto.
441 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
443 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
444 movement in inset in RTL text.
445 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
446 (workAreaButtonRelease): Do not open a float when there is a selection.
448 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
450 * src/spellchecker.C (RunSpellChecker): Open all floats before
453 * src/text.C (InsertChar): Consider "," as a part of a number
454 (for LTR numbers in RTL text code).
455 (IsBoundary): Fixed (and simplified).
456 (InsertChar): Recalculate cursor boundary.
459 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
461 * src/spellchecker.C: fix figures with pspell enabled
463 * src/insets/figinset.C: workaround for gs hang xforms bug
465 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
467 * lib/bind/??_menus.bind: comment out the entries corresponding to
468 real menus. They should be eventually removed, but I'll let the
469 language maintainers do that.
471 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
473 * src/frontends/kde/parageneraldlg.C:
474 * src/frontends/kde/parageneraldlg.h: don't use
475 a derived class for SpaceAbove/Below
477 * src/frontends/kde/dlg/README: add some info
479 * src/frontends/kde/dlg/*: update data files, update
482 * src/frontends/kde/dlg/moc/Makefile.am: add
485 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
487 * configure.in: add new KDE Makefiles
488 * src/vspace.h: return GlueLength not a normal one
489 * src/support/lstrings.h:
490 * src/support/lstrings.C: add isStrUnsignedInt(),
493 * src/frontends/kde/*: big reorganisation, update
494 FormParagraph, add FormTabCreate
496 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
498 * lib/ui/default.ui: small grammatical change.
500 * src/frontends/xforms/xform_macros.h: removed.
502 * src/frontends/xforms/FormBase.C:
503 * src/frontends/xforms/FormPreferences.C:
504 * src/frontends/xforms/Makefile.am: changes associated with removing
505 xform_macros.h. Should make Lars' debugging a little easier.
507 * src/frontends/xforms/FormPreferences.C:
508 * src/frontends/xforms/FormPreferences.h:
509 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
510 longer use X11 color name database. HSV and RGB dials/sliders.
511 Please let this be the end of this!
513 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
515 * Several files: Allow compilation when the compiler doesn't
518 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
521 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
522 command line options.
524 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
526 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
527 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
530 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
532 * src/frontends/xforms/FormRef.C (updateBrowser):
533 * src/frontends/xforms/forms/form_ref.fd: try clicking on
534 different insets with the sort key active. Now apply this patch!
536 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
538 * src/frontends/xforms/FormPrint.C: set to valid()
539 when we update from the passed parameters.
541 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
543 * src/LColor.C (getFromGUIName): internationalise the comparison.
545 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
546 FormPreferences choice.
548 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
551 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
553 * src/lyxrc.C: more detail for the printer program config
556 * src/LColor.C: ert->latex text. LColor needs a big revamp
557 but will have to wait till after 1.1.6
559 * src/buffer.C: bring up a dialog if we load a document
560 with an un-installed text class, rather than just complain
563 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
565 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
566 the browser form for a combox in a tabbed folder. Bug fix courtesy of
567 Steve Lamont <spl@ncmir.ucsd.edu>.
569 * src/frontends/xforms/FormDocument.C (build):
570 * src/frontends/xforms/FormPreferences.C (Language::build):
571 pass tabfolders to Combox::add() in order to use this work around.
573 * src/frontends/xforms/FormCitation.C (connect): remove max size
575 (update): sort list of bibliography keys.
577 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
579 No max size limitation. Same popup for new and existing insets. Fixes
580 bugs reported by Rob Lahaye.
582 * src/frontends/xforms/FormCitation.C (c-tor):
583 * src/frontends/xforms/FormCopyright.C (c-tor):
584 * src/frontends/xforms/FormError.C (c-tor):
585 * src/frontends/xforms/FormGraphics.C (c-tor):
586 * src/frontends/xforms/FormIndex.C (c-tor):
587 * src/frontends/xforms/FormRef.C (c-tor):
588 * src/frontends/xforms/FormToc.C (c-tor):
589 * src/frontends/xforms/FormUrl.C (c-tor):
590 use correct policy for ButtonController.
592 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
594 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
597 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
599 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
600 Some resizing changes.
602 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
604 * configure.in: fix typo
606 * lib/languages: add ukraninian and change no to no_NO
608 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
610 * src/bufferview_funcs.C (FontSize): use setLyXSize
612 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
614 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
615 to check for systems where mkstemp() is available but not declared
616 in headers. The new autoconf macro lyx_CHECK_DECL can be used
617 to check for declarations in headers.
619 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
621 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
623 * forms/makefile: added bibforms.fd, include_form.fd.
624 Removed lyx_sendfax.fd.
626 * src/LaTeXLog.C (ShowLatexLog):
627 * src/LyXAction.C (init):
628 * src/bufferparams.C (readLanguage): altered messages as suggested by
631 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
634 * src/credits.C: made fd_form_credits non-static, so that it can be
635 redrawn should the xforms colors be re-mapped.
636 * src/spellchecker.C ditto fd_form_spell_options.
638 * src/filedlg.[Ch] (redraw):
639 * src/intl.[Ch] (redraw):
640 * src/lyxfr0.[Ch] (redraw):
641 * src/insets/figinset.[Ch] (redraw):
642 * src/insets/insetexternal.[Ch] (redraw):
643 new methods, connected to Dialogs::redrawGUI.
645 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
646 to be connected to Dialogs::redrawGUI.
648 * src/frontends/xforms/FormCitation.C (build):
649 * src/frontends/xforms/FormCopyright.C (build):
650 * src/frontends/xforms/FormError.C (build):
651 * src/frontends/xforms/FormGraphics.C (build):
652 * src/frontends/xforms/FormIndex.C (build):
653 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
654 * src/frontends/xforms/FormToc.C (build):
655 * src/frontends/xforms/FormUrl.C (build):
656 use the ButtonController correctly.
658 * src/frontends/xforms/FormCopyright.C (build):
659 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
660 the .fd file and into build().
662 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
664 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
666 * src/frontends/xforms/forms/form_citation.fd:
667 * src/frontends/xforms/forms/form_copyright.fd:
668 * src/frontends/xforms/forms/form_error.fd:
669 * src/frontends/xforms/forms/form_graphics.fd:
670 * src/frontends/xforms/forms/form_index.fd:
671 * src/frontends/xforms/forms/form_toc.fd:
672 * src/frontends/xforms/forms/form_url.fd:
673 renamed some of the objects. Named others explicitly for the first time.
674 Added Restore and Apply buttons where appropriate.
676 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
679 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
681 * src/version.h: try the pre2 again
683 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
685 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
687 * src/frontends/kde/FormParagraph.C: added using directive.
689 * src/frontends/kde/paradlg.C: added config.h and using directive.
691 * src/frontends/kde/paradlg.h: added std::qualifier.
693 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
695 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
697 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
699 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
701 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
703 * src/version.h: set back to 1.1.6cvs
705 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
707 * src/version.h: set to 1.1.6pre2
709 2000-11-20 Marko Vendelin <markov@ioc.ee>
711 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
713 * src/frontends/gnome/Makefile.am: updated list of XForms object files
715 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
717 * src/LColor.C (init):
718 * src/lyxrc.C (getDescription): changed some comments as suggested by
721 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
722 disconnect the redrawGUI signal in best-practice fashion.
724 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
725 long_opts_tab to reflect the change in name of this tabfolder, as
726 suggested by John Levon.
727 (connect, disconnect): new methods. Don't do much at present other than
728 ensuring that we can't resize the dialog. This just makes xforms go
730 (lots of methods in Colors): made void rather than bool. The idea is
731 to have an isOk() function that keeps track of whether any input is
732 genuinely invalid and should therefore block Save, Apply.
733 Easier to manipulate the counters rapidly.
734 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
735 compiler will like this code. Much cleaner way of doing things.
737 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
739 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
740 rather than simple counters, following suggestion by John Levon.
742 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
743 than engraved frame + text.
745 * src/frontends/xforms/forms/makefile: removed spurious command.
747 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
749 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
751 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
754 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
756 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
757 see what Lars has changed and what is just white space!
758 Now used X directly to ascertain the RGB color associated with the
760 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
762 Added some sort capability.
763 The X11 color name database input is only displayed if the database
764 isn't found in the standard place.
765 Got rid of struct compare_converter; it wasn't used.
766 Probably some other stuff that I've forgotten.
768 * src/frontends/xforms/FormPreferences.h: changed the names of some
769 methods in the Colors struct. Added a couple of structs to help sort
770 colors by name and by RGBColor.
772 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
773 functions into a new class RWInfo.
775 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
776 The dialog is now almost navigable using the keyboard. Unfortunately,
777 the cursor has to be inside a browser for it to be activated. There is
778 no visual feedback for the key shortcuts to the arrow keys (use
779 Alt-appropriate arrow key, Alt-x).
781 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
784 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
785 xform_helpers.[Ch]. See above.
787 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
789 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
791 * src/screen.C (setCursorColor): new method. Sets the color of the
793 (ShowManualCursor): call it.
794 Constify some local variables.
796 * src/LColor.[Ch] (LColor): add entry for cursor
797 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
800 2000-11-19 Juergen Vigna <jug@sad.it>
802 * src/insets/insettabular.C (draw): fixed text border redraw problem.
803 (calculate_dimensions_of_cells): try to boost up when inserting chars.
805 2000-11-15 Rob Lahaye <lahaye@postech.edu>
807 * lib/ui/default.ui: OptItem used for Fax entry
809 2000-11-17 Matej Cepl <cepl@bigfoot.com>
811 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
813 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
815 * src/vspace.C (nextToken): fix so it can handle length phrases like
816 "10mm+-20mm", "40inplus16mmminus10cm" etc.
818 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
820 * src/frontends/xforms/FormPreferences.C: constify several variables
821 (BrowserLyX): rewrite to not need the choice variable
822 (Modify): rewrite to not need the choide variable
823 (compare_converter): make operator const
825 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
826 correct the writing of \set_color
827 (getDescription): return a const string
829 * src/kbsequence.[Ch] (addkey): remove dead code
831 * src/Painter.C (text): remove some commented code
833 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
835 * src/ColorHandler.[Ch]: removed some header files from .h file.
836 Included LColor.h in .C file.
838 * src/LColor.[Ch]: made class copyable so that I could create a
839 system_lcolor instance.
841 * src/Painter.h: removed LColor.h.
843 * src/lyx_gui.C (create_forms): used AddName.
845 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
846 of user preferences/lyxrc file.
848 * src/lyxrc.C (output): output changes to lcolor.
850 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
852 Moved class xformColor to files xform_helpers.[Ch]. These files,
853 Color.[Ch], could now be moved into src if they would be useful to
856 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
857 Also moved FormPreferences::browseFile here as it can be used by any
858 xform dialog with a "Browse" button. FormGraphics is a perfect example.
860 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
861 ReadableFile): changed the FormPreferences methods a little and moved
862 them here as they'll be useful elsewhere also.
864 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
865 Removed some header files and used forward declarations instead.
867 Removed some methods as they'll be useful elsewhere (see above).
869 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
870 Can also now modify the LyX LColors. However, for reasons that I don't
871 yet understand, it appears that we can use
872 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
873 present. The problem appears to lie in ColorHandler, because I can
874 change the color using LColor.SetColor(). Similarly, when reading in a
875 preferences file with some set_color instances, I'll get a warning
876 like: Color sea green is undefined or may not be redefined
877 Bad lyxrc set_color for sea green
879 Once the buffer is loaded, however, I can happily change to this color.
881 Finally, it appears that I have to set the color of "inset frame"
882 explicitly, or it oscillates from "black" to "indian red" with each
885 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
887 * ANNOUNCE: corrected a spelling mistake.
889 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
892 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
894 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
896 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
899 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
900 match the requirements from the standard better. This is required
901 to work with gnu libstdc++-v3
903 * src/frontends/xforms/FormPreferences.C: add explict pair
904 arguments to browse calls. include support/lyxmanip.h remvoe
905 extern fmt. whitespace changes. reorder variables in
906 FormPreferences.h, to match initalizaton order.
908 * several files: constify more local variables.
910 * src/buffer.C: remove some commented functions.
912 * src/DepTable.C (remove_files_with_extension): temporary
913 work around for gcc 2.97
914 * src/filedlg.C (find): ditto
915 * src/Variables.C (set): ditto
916 * src/LyXAction.C (searchActionArg): ditto
917 (retrieveActionArg): ditto
919 * configure.in: check for mktemp too
921 * UPGRADING: prepare for 1.1.6
923 * Makefile.am (lgbtags): add backup tags for when etags are
924 different than usual.
926 * ANNOUNCE: prepare for 1.1.6
928 * src/support/tempname.C (make_tempfile): new function, wrapper
929 around mkstemp and mktemp. Only mkstemp has been tested.
932 2000-11-14 Rob Lahaye <lahaye@postech.edu>
934 * default.ui: capitalized some menu items to improve shortcuts.
936 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
938 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
940 * src/frontends/xforms/Dialogs.C: add "using" directive.
942 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
944 * src/filedlg.C (Select): highlight suggested file in browser, if
947 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
948 each tab folder is encapsulated in its own class.
949 The Language keymaps are now chosen using a text input and a
950 browser button, rather than a Combox.
951 All the browser buttons are now functional, although LyXFileDlg
952 still needs to be modified to make it straighhtforward to return a
953 directory if that is what is desired.
955 * src/frontends/xforms/forms/form_preferences.fd: use text input
956 and browse button to input the Language keymaps. Add a few
957 callbacks for the browse buttons.
959 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
961 * src/support/tempname.C (tempName): small changes to make it
962 safer. remove the '.' before XXXXXX
964 * src/support/filetools.C (TmpFileName): remove func
967 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
968 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
969 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
970 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
972 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
975 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
978 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
979 for bp (this fixes a reproducible hard crash)
981 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
984 * src/frontends/xforms/FormBase.h: make bp_ private
985 (FormBaseBI): remove default for bp
988 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
991 * src/frontends/xforms/Color.C (RGBColor): made several vars
992 const, changed initialization of j to allow it to be const
995 * several files: added const to local variables.
997 * src/lyx_cb.C: removed several function prototypes and moved them
1001 (UpdateLayoutPreamble):
1003 (MenuInsertLabel): add BufferView as arguemnt
1004 (LayoutsCB): make tmp const
1006 * src/layout_forms.h: regenerated
1008 * src/debug.C: add Debug::FILES
1009 (showLevel) (showTags): translate the desc
1011 * src/debug.h: add FILES as debug target
1013 * src/bufferlist.C: use current_view as an interim measure becuase
1014 of added arguments to MenuWrite and MenuWriteAs
1016 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1018 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1020 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1021 libstdc++ is compiled with.
1023 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1025 * lib/layouts/docbook-book.layout
1026 * lib/layouts/docbook.layout
1027 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1028 those paragraphs are expresse as SGML comments <!-- -->.
1030 * src/LaTeXFeatures.h
1031 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1032 parameter, this allows to express all the include files as relative
1033 paths to the master buffer. The verbatim insert works as the other
1036 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1038 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1040 (MakeDocBookFile): top_element is always written. Some clean up, as
1041 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1043 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1044 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1045 a reference is written instead of the name.
1046 (Validate): use the relative path for the filename.
1048 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1051 * src/support/filetools.h
1052 * src/support/filetools.C (IsSGMLFilename): added.
1055 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1057 * development/OS2/quick_fix.patch:
1058 * lib/configure.cmd:
1059 * README.OS2: quick update to the OS/2 port.
1061 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1063 * src/converter.C: add "using" directive.
1065 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1066 (compare_converter): add "int" as return type.
1068 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1071 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1073 * src/lyx_gui.C (create_forms): map the xform colours, should a
1074 mapping exist. Ie, call XformColor::read().
1076 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1077 and struct HSV as HSVColor.
1078 (XformColor::read, XformColor::write) : new methods that
1079 input/output any changes to the cform GUI colors.
1081 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1084 * src/frontends/xforms/FormPreferences.C Lots of little changes
1085 associated with the changed name of the RGB and HSV structs. Can
1086 now save changes to xforms GUI to file. Commented out
1087 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1088 used currently anyway.
1090 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1092 * src/converter.C: A lot of changes:
1093 - It is no longer possible to choose between two or more ways to
1094 export to some format (the new code uses only the shortest path).
1095 However, it is still possible to choose between pdflatex/ps2pdf
1096 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1097 - Added several methods that makes the FormPreferences code simpler.
1098 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1100 * src/exporter.C (Export): lyxrc.use_pdf is set before
1101 makeLaTeXFile is called. This works but not very nice.
1103 * src/frontends/xforms/FormPreferences.C: The formats/converters
1104 tabs are now fully functional.
1106 * src/buffer.C (getTocList): Add numbers to the captions.
1108 * lib/lyxrc.example: Removed fax section
1110 * src/support/rename.C (rename): Delete the old file if lyx::copy
1113 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1115 * lib/ui/default.ui: minor polishing.
1117 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1119 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1122 * lib/Makefile.am (DOCINST): do not install everything in the
1123 documentation directory.
1125 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1127 * src/bufferlist.C (newFile): set the filename to the constructed
1130 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1131 constructed "newfileXX.lyx" name to the dialog
1133 * src/frontends/DialogBase.h: make update() non-abstract so
1134 KDE doesn't need to implement two update methods for every form
1136 * src/frontends/kde/Makefile.am: add missing xforms objects
1139 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1141 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1143 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1144 structs RGB and HSV. May not be the best place for these files.
1145 Perhaps move them into src ?
1147 * src/frontends/xforms/Makefile.am: added new files.
1149 * src/frontends/xforms/forms/form_preferences.fd:
1150 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1151 replaced all instances of "colour" with "color"!
1153 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1156 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1157 tab. Can now alter the colors of the xform's GUI on the fly. With
1158 the aid of a single static Signal (see below), can "Apply" these
1159 changes to all currently open dialogs. (Well, to all of the NEW
1160 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1161 subsequently opened dialogs will, of course, also have the new
1162 color scheme. Cannot yet save (or load) the choices to file, so
1163 they are lost when exiting LyX.
1165 * src/frontends/Dialogs.h:
1166 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1167 Used to trigger a redraw of any dialogs connected to it because,
1168 for example, the GUI colours have been re-mapped.
1170 * src/frontends/xforms/FormBase.[Ch]:
1171 * src/frontends/xforms/FormDocument.[Ch]:
1172 * src/frontends/xforms/FormParagraph.[Ch]:
1173 * src/frontends/xforms/FormPreferences.[Ch]:
1174 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1175 method, to be connected to Dialogs::redrawGUI. Method must be
1176 virtual, because dialogs with tabbed folders need to redraw the
1177 forms of each tab folder.
1179 * src/LyXView.C (d-tor):
1180 * src/frontends/xforms/FormBase.C (d-tor): connected
1181 Dialogs::redrawGUI signal to redraw().
1183 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1184 removed Assert, because it is identical to that in FormBase.
1186 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1188 * lib/ui/default.ui: minor polishing.
1190 2000-11-10 Juergen Vigna <jug@sad.it>
1192 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1193 (deleteLyXText): ditto
1195 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1196 selection on mouse-button-3.
1198 * src/insets/insettabular.h: new function clearSelection(), use this
1199 functions inside insettabular.C.
1201 * src/insets/insettabular.C (TabularFeatures): clear the selection
1202 on remove_row/column.
1204 * src/insets/inset.C (scroll): fixed some scroll stuff.
1206 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1208 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1210 * lib/CREDITS: add Yves Bastide
1212 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1214 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1215 check whether C library functions are in the global namespace.
1217 * configure.in: calls it.
1219 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1220 #ifndef __GLIBCPP__.
1222 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1224 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1225 iterators to prevent crash.
1227 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1229 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1231 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1232 shortcut for xforms CB to the preemptive or post-handler function.
1234 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1235 removed the HIDDEN_TIMER as it's no longer used.
1236 Various other small changes.
1238 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1239 preemptive handler to obtain feedback, rather than the post-handler.
1240 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1242 Formats tab is now complete. Converters tab is nearly so.
1244 2000-11-09 Juergen Vigna <jug@sad.it>
1246 * src/insets/insettext.C (~InsetText):
1249 (SetParagraphData): set cache.second to 0 after deleting it!
1250 (getLyXText): check if cache.second is not 0 if finding it.
1252 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1254 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1255 lyxlex to parse the rgb.txt file.
1258 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1259 replace the default '#' comment character.
1261 * src/support/tempname.C: add "using" directive
1262 * src/frontends/ButtonPolicies.C: ditto.
1264 * src/support/filetools.C (DirList): add an explicit cast to avoid
1265 a compile error (probably not the right fix)
1267 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1269 * src/support/filetools.C (DirList): implement using system functions
1271 * src/support/tempname.C: new file
1273 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1275 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1277 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1280 * src/frontends/xforms/ButtonController.C: new file
1282 * src/os2_defines.h: remove getcwd define
1284 * src/lyxvc.C: include support/lyxlib.h
1285 (showLog): use lyx::tempName
1287 * src/lyx_cb.C: comment out includes that we don't need
1288 (AutoSave): use lyx::tempName
1290 * src/filedlg.C: include support/lyxlib.h
1291 (Reread): use lyx::getcwd
1293 * src/converter.C: include support/filetools.h
1294 (add_options): change to static inline, make tail const
1295 (Add): make old_viewer const
1296 (GetAllFormats): make it a const method, use const_iterator
1297 (enable): make static inline
1298 (SplitFormat): make using_format const
1300 * src/LaTeX.C (run): use lyx::getcwd
1302 * configure.in: check for mkstemp as well
1304 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1306 * src/converter.[Ch] (GetAllCommands): new method.
1308 * src/support/filetools.[Ch] (DirList): new method.
1310 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1311 functionality to the converters tab.
1312 The formats tab is now nearly complete.
1313 The kbmap choices in Languages tab now display the contents of
1314 system_lyxdir/kbd/*.kmap in readable form.
1316 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1317 Moved some variables into the class.
1319 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1320 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1321 colour of active folder to lighter grey instead. Any takers?
1322 (form_colours): added an "Apply" button.
1323 (form_converters): added a "Flags" input field.
1324 (form_formats): added a "Shortcut" input field. Note that we can't use
1325 names such as "input_shortcut" as this buggers up the sed script stuff.
1327 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1335 * src/lyx_sendfax_main.C:
1338 * src/spellchecker.C:
1339 * src/insets/figinset.C:
1340 * src/insets/insetbib.C:
1341 * src/insets/insetexternal.C:
1342 * src/insets/insetinclude.C:
1343 * src/insets/insetinfo.C:
1344 * src/mathed/math_panel.C:
1345 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1346 all "daughter" dialogs now have identical "feel".
1348 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1350 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1351 used (and was only used in one place prior to this patch. Incorrectly!)
1353 * src/frontends/xforms/FormDocument.C: changed some instances of
1354 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1355 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1356 for options_->input_float_placement. This fixes a bug reported by
1359 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1360 functionality into d-tor.
1362 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1363 input of numerals also.
1365 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1366 fl_set_form_atclose(). Can now close dialog from window manager,
1367 fixing a bug reported by Rob Lahaye.
1369 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1371 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1372 are no longer dark. Haven't yet worked out how to lighten the colour of
1373 the active tabfolder. Any ideas anybody?
1374 Adjusted Colours tab a little.
1375 Added Shortcut field to converters tab. Note that we can't create an
1376 fdesign label like "input_shortcut" as this buggers up the sed-script
1379 * src/frontends/xforms/FormPreferences.[Ch]:
1380 (feedback): fixed crash due to to ob=0.
1381 (LanguagesXXX): the kbmap choices now contain the files
1382 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1383 be replaced by an input with a file browse button, but since the browse
1384 buttons don'y yet work, this'll do for the moment.
1385 (FormatsXXX): think that this is now nearly fully functional.
1386 Some points/questions though:
1387 1. Does "Apply" remove formats if no longer present?
1388 2. I think that the browser should list the GUI names rather than the
1390 3. Must ensure that we can't delete Formats used by an existing
1393 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1394 if this is the best way to do this.
1396 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1398 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1400 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1401 for variable assignment.
1403 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1405 * src/lib/ui/default.ui: added sub/superscripts to menu as
1406 Insert->Special characters and cleaned-up the file a bit
1408 2000-11-07 Allan Rae <rae@lyx.org>
1410 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1411 ob isn't 0 before using it. See comments in function.
1413 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1415 * src/frontends/xforms/form_*.C: regenerated
1417 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1419 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1421 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1422 compiling with gcc-2.96
1424 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1426 * src/support/lyxstring.C: add a couple "using" directives.
1428 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1429 a .c_str() here too for good measure.
1430 * src/Spacing.C (set): ditto.
1431 * src/lyxfunc.C (Dispatch): ditto.
1433 * src/insets/insettabular.C (copySelection): change .str() to
1434 .str().c_str() to fix problems with lyxstring.
1435 * src/support/filetools.C (GetFileContents): ditto.
1436 * src/buffer.C (asciiParagraph): ditto.
1437 * src/paragraph.C (String): ditto.
1439 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1440 * lib/bind/sciword.bind: ditto.
1442 * src/LyXAction.C (init): remove "symbol-insert" function, which
1443 shared LFUN_INSERT_MATH with "math-insert".
1445 * lib/configure.m4: == is not a valid operator for command test.
1447 * src/lyxrc.C: add using directive.
1449 * src/converter.h: add std:: qualifier.
1451 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1453 * src/converter.[Ch] and other files: Change the Format class to a
1454 real class, and create two instances: formats and system_format.
1456 * src/lyxrc.C (output): Output the difference between formats and
1459 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1460 (buildFormats): Insert formats into browser.
1461 (inputFormats): Made the browser and add button functional.
1462 (applyFormats): Update formats from format_vec.
1464 * src/converter.C: Changed all (*it). to it->
1465 (Format::dummy): New method.
1466 (Format::importer): New format flag.
1467 (Formats::GetAllFormats): New method.
1468 (Formats::Add): Delete format from the map if prettyname is empty.
1469 (Converter::Convert): Print an error message if moving the file fails.
1470 (Converter::GetReachableTo): New method
1472 * src/MenuBackend.[Ch]: Add support for importformats tag.
1474 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1476 * lib/configure.m4: Add word->tex and ps->fax converters.
1478 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1479 Return fax to file menu.
1483 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1485 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1488 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1491 * src/lyxfunc.C (processKeyEvent): removed
1493 * src/bufferlist.C (emergencyWrite): removed the out commented
1494 emergency write code.
1496 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1498 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1500 * many files: change formatting to be a bit more uniform for
1501 if,while,for,switch statements, remove some parantesis not needed.
1504 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1506 * config/kde.m4: make config more robust when KDEDIR is set
1508 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1510 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1511 not returned a pixmap for "math-insert".
1513 * src/LyXAction.C (init): sort the entries a bit.
1515 2000-11-03 Juergen Vigna <jug@sad.it>
1517 * src/insets/insettabular.h: added fixed number to update codes so
1518 that update is only in one direction.
1520 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1523 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1524 before call to edit because of redraw.
1526 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1528 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1530 * lib/ui/default.ui: Populate "edit_float" menu
1532 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1534 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1535 "floats-operate". The name is ugly (and the func also), but this
1536 is just a band-aid until we switch to new insets.
1538 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1540 * lib/ui/default.ui: update again the menu layout (fix some
1543 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1545 * src/MenuBackend.h (fulllabel): new method.
1547 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1548 the menu shortcuts of a menu are unique and whether they
1549 correspond to a letter of the label.
1550 (expand): call checkShortcuts when debugging.
1552 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1554 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1556 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1558 * lib/examples/*.lyx : '\language default' => '\language english'
1560 * lib/examples/it_splash.lyx : except where it should be italian
1562 * lib/templates/*.lyx : the same
1564 * doc/*.lyx* : the same
1566 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1568 * lib/bind/menus.bind: remove the Layout menu entries, which I
1569 somehow forgot earlier.
1571 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1573 * lib/ui/old-default.ui: keep the old one here for reference (to
1576 * lib/ui/default.ui: update the menu layout
1578 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1580 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1581 Can now Apply to different insets without closing the dialog.
1583 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1584 Can't actually DO anything with them yet, but I'd like a little
1587 * src/frontends/xforms/input_validators.[ch]
1588 (fl_lowercase_filter): new.
1590 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1592 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1593 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1595 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1597 2000-11-02 Juergen Vigna <jug@sad.it>
1599 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1600 on char insertion as it has already be updated by bv->updateInset().
1602 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1603 if an inset inside was updated.
1605 * lib/configure.cmd: commented out fax-search code
1607 2000-11-01 Yves Bastide <stid@acm.org>
1609 * src/tabular.C (OldFormatRead): set tabular language to the
1612 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1614 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1615 class names with non-letter characters (from Yves Bastide).
1617 * lib/ui/default.ui: change Item to OptItem in import menu.
1618 Comment out fax stuff.
1620 * lib/configure.m4: comment out fax-related stuff.
1622 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1624 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1625 useful xforms helper functions. At present contains only formatted().
1626 Input a string and it returns it with line breaks so that in fits
1629 * src/frontends/xforms/Makefile.am: add new files.
1631 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1632 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1635 * src/frontends/xforms/FormPreferences.[Ch]:
1636 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1637 but lots of little clean ups. Removed enum State. Make use of
1638 formatted(). Constify lots of methods. Perhaps best of all: removed
1639 requirement for that horrible reinterpret_cast from pointer to long in
1642 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1644 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1645 conditionalize build on xforms < 0.89
1647 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1649 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1651 * src/LyXAction.C (init): comment out fax
1653 * src/lyxrc.h: comment out the fax enums
1654 comment out the fax variables
1656 * src/commandtags.h: comment out LFUN_FAX
1658 * src/lyxrc.C: disable fax variables.
1659 (read): disable parsing of fax variables
1660 (output): disable writing of fax variables
1661 (getFeedback): now description for fax variables
1663 * src/lyxfunc.C: comment out MenuFax
1664 (Dispatch): disable LFUN_FAX
1666 * src/lyx_cb.C (MenuFax): comment out
1668 * src/WorkArea.C: add <cctype>
1669 (work_area_handler): better key handling, should be ok now.
1670 for accented chars + etc
1672 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1673 lyx_sendfax.h and lyx_sendfax_man.C
1675 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1676 (show): don't call InitLyXLookup when using xforms 0.89
1678 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1680 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1682 * src/support/filetools.C (GetFileContents): close to dummy change
1684 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1686 * src/trans.C (AddDeadkey): workaround stupid compilers.
1688 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1690 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1691 of two-sided document.
1693 2000-10-31 Juergen Vigna <jug@sad.it>
1695 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1697 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1698 xposition to the Edit call.
1700 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1702 * src/trans.C (AddDeadkey): cast explicitly to char.
1704 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1706 * src/tabular.C (AsciiBottomHLine): simplify?
1707 (AsciiTopHLine): simplify?
1708 (print_n_chars): simplify
1709 (DocBook): remove most of the << endl; we should flush the stream
1710 as seldom as possible.
1712 (TeXBottomHLine): ditto
1713 (TeXTopHLine): ditto
1715 (write_attribute): try a templified version.
1716 (set_row_column_number_info): lesson scope of variables
1718 * src/support/lstrings.h (tostr): new specialization of tostr
1720 * src/trans.C (AddDeadkey): slightly cleaner fix.
1722 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1724 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1725 '%%' in Toc menu labels.
1728 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1729 font_norm is iso10646-1.
1731 * src/font.C (ascent): Fixed for 16bit fonts
1732 (descent,lbearing,rbearing): ditto
1734 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1736 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1737 (getFeedback): new static method.
1739 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1740 Now use combox rather than choice to display languages.
1741 Feedback is now output using a new timer callback mechanism, identical
1742 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1744 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1746 * src/minibuffer.C: fix for older compilers
1748 2000-10-30 Juergen Vigna <jug@sad.it>
1750 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1751 has to be Left of the inset otherwise LyXText won't find it!
1753 * src/BufferView2.C (open_new_inset): delete the inset if it can
1756 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1758 * lyx.man: fix typo.
1760 2000-10-29 Marko Vendelin <markov@ioc.ee>
1761 * src/frontends/gnome/FormCitation.C
1762 * src/frontends/gnome/FormCitation.h
1763 * src/frontends/gnome/FormCopyright.C
1764 * src/frontends/gnome/FormCopyright.h
1765 * src/frontends/gnome/FormError.C
1766 * src/frontends/gnome/FormError.h
1767 * src/frontends/gnome/FormIndex.C
1768 * src/frontends/gnome/FormIndex.h
1769 * src/frontends/gnome/FormPrint.C
1770 * src/frontends/gnome/FormPrint.h
1771 * src/frontends/gnome/FormRef.C
1772 * src/frontends/gnome/FormRef.h
1773 * src/frontends/gnome/FormToc.C
1774 * src/frontends/gnome/FormToc.h
1775 * src/frontends/gnome/FormUrl.C
1776 * src/frontends/gnome/FormUrl.h
1777 * src/frontends/gnome/Menubar_pimpl.C
1778 * src/frontends/gnome/mainapp.C
1779 * src/frontends/gnome/mainapp.h
1780 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1781 changing update() to updateSlot() where appropriate
1783 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1785 * src/frontends/xforms/FormPreferences.[Ch]:
1786 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1789 2000-10-28 Juergen Vigna <jug@sad.it>
1791 * src/insets/insettabular.C (draw): fixed drawing bug.
1793 * src/insets/insettext.C (clear):
1795 (SetParagraphData): clearing the TEXT buffers when deleting the
1796 paragraphs used by it.
1798 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1800 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1802 2000-10-27 Juergen Vigna <jug@sad.it>
1804 * src/tabular.C (~LyXTabular): removed not needed anymore.
1806 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1809 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1811 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1814 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1817 * src/frontends/xforms/FormPreferences.[Ch]:
1818 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1819 Reorganised as modules based on tabs. Much easier to follow the
1820 flow and to add new tabs. Added warning and feedback messages.
1823 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1825 * src/tabular.h (DocBook): add std:: qualifier.
1827 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1829 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1830 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1833 * insettabular.C (DocBook): uses the tabular methods to export
1836 * src/insets/insettext.h
1837 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1839 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1841 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1844 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1845 moved misplaced AllowInput two lines up.
1847 * src/buffer.C (readFile): compare float with float, not with int
1849 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1851 * src/minibuffer.C: add "using SigC::slot" statement.
1853 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1855 * src/frontends/xforms/forms/README: updated section about make.
1857 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1858 Tidied some forms up, made two of form_tabular's tabs more
1859 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1860 fixed translation problem with "Column".
1862 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1864 * src/minibuffer.h: use Timeout instead of the xforms timer
1866 (setTimer) rewrite for the Timeout, change to unsigned arg
1867 (set): change to unsigned timer arg
1870 * src/minibuffer.C (TimerCB): removed func
1871 (C_MiniBuffer_TimerCB): removed func
1872 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1873 (peek_event): use a switch statement
1874 (add): don't use fl_add_timer.
1875 (Set): rewrite to use the Timeout
1878 * src/Timeout.[Ch] (setType): return a Timeout &
1879 (setTimeout): ditto, change to unsigned arg for timeout
1881 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1883 * src/mathed/formula.C (mathed_string_width): Use string instead
1884 of a constant size char array.
1886 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1888 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1889 the two recently added operator<< for SMInput and State.
1891 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1893 (OkCancelPolicy): ditto
1894 (OkCancelReadOnlyPolicy): ditto
1895 (NoRepeatedApplyReadOnlyPolicy): ditto
1896 (OkApplyCancelReadOnlyPolicy): ditto
1897 (OkApplyCancelPolicy): ditto
1898 (NoRepeatedApplyPolicy): ditto
1900 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1902 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1903 add the usual std:: qualifiers.
1905 2000-10-25 Juergen Vigna <jug@sad.it>
1907 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1909 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1911 * src/support/filetools.C (MakeRelPath): change some types to
1914 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1915 ButtonPolicy::SMInput and ButtonPolicy::State.
1917 * src/FontLoader.C (reset): small cleanup
1918 (unload): small cleanup
1920 * src/FontInfo.C (getFontname): initialize error to 10000.0
1922 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1924 * src/frontends/xforms/FormPreferences.[Ch]:
1925 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1926 TeX encoding and default paper size sections.
1928 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1930 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1933 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1934 make the message_ empty.
1935 (FormError): don't initialize message_ in initializer list.
1937 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1939 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1941 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1943 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1945 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1947 * src/frontends/kde/*data.[Ch]: _("") is not
1950 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1952 * src/buffer.C: removed redundant using directive.
1954 * src/frontends/DialogBase.h: revert to original definition of
1957 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1958 stuff into two classes, one for each dialog, requires a new
1959 element in the dialogs vector, FormTabularCreate.
1961 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1964 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1965 method. Continues Allan's idea, but means that derived classes
1966 don't need to worry about "update or hide?".
1968 * src/frontends/xforms/FormError.C (showInset): add connection
1971 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1972 one for each dialog. FormTabular now contains main tabular dialog
1975 * src/frontends/xforms/FormTabularCreate.[Ch]:
1976 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1979 * src/frontends/xforms/FormGraphics.[Ch]:
1980 * src/frontends/xforms/forms/form_graphics.fd
1981 * src/frontends/xforms/FormTabular.[Ch]:
1982 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1983 classes of FormInset.
1985 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1986 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1988 * src/frontends/xforms/Makefile.am:
1989 * src/frontends/xforms/forms/makefile: added new files.
1991 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1992 variable. added Signal0 hide signal, in keeping with other GUI-I
1995 * src/support/lstrings.h: removed redundant std:: qualifier as
1996 it's already declared in Lsstream.h.
1998 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2000 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2004 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2006 * src/tabular.C (Ascii): minimize scope of cell.
2008 * src/BufferView2.C (nextWord): return string() instead of 0;
2010 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2012 * src/converter.h: add a std:: qualifier
2014 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2016 * src/importer.[Ch]: New files. Used for importing files into LyX.
2018 * src/lyxfunc.C (doImport): Use the new Importer class.
2020 * src/converter.h: Add shortcut member to the Format class.
2021 Used for holding the menu shortcut.
2023 * src/converter.C and other files: Made a distinction between
2024 format name and format extension. New formats can be defined using
2025 the \format lyxrc tag.
2026 Added two new converter flags: latex and disable.
2028 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2030 * src/support/lyxlib.h: unify namespace/struct implementation.
2031 Remove extra declarations.
2033 * src/support/chdir.C (chdir): remove version taking char const *
2035 * src/support/rename.C: ditto.
2036 * src/support/lyxsum.C: ditto.
2038 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2040 * src/frontends/xforms/FormBase.[Ch]:
2041 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2042 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2043 work only for the next call to fl_show_form(). The correct place to set
2044 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2045 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2046 from FormBase have the minimum size set; no more stupid crashes with
2049 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2051 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2053 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2055 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2057 * src/support/lyxlib.h: changed second argument of mkdir to
2058 unsigned long int (unsigned int would probably have been enough,
2059 but...). Removed <sys/types.h> header.
2060 * src/support/mkdir.C (mkdir): ditto.
2064 2000-10-19 Juergen Vigna <jug@sad.it>
2066 * src/lyxfunc.C (MenuNew): small fix (form John)
2068 * src/screen.C (Update): removed unneeded code.
2070 * src/tabular.C (Ascii): refixed int != uint bug!
2072 * src/support/lyxlib.h: added sys/types.h include for now permits
2073 compiling, but I don't like this!
2075 2000-10-18 Juergen Vigna <jug@sad.it>
2077 * src/text2.C (ClearSelection): if we clear the selection we need
2078 more refresh so set the status apropriately
2080 * src/insets/insettext.C (draw): hopefully finally fixed draw
2083 2000-10-12 Juergen Vigna <jug@sad.it>
2085 * src/insets/insettext.C (draw): another small fix and make a block
2086 so that variables are localized.
2088 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2090 * src/support/lstrings.C (lowercase, uppercase):
2091 use explicit casts to remove compiler warnings.
2093 * src/support/LRegex.C (Impl):
2094 * src/support/StrPool.C (add):
2095 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2096 (AddPath, MakeDisplayPath):
2097 * src/support/lstrings.C (prefixIs, subst):
2098 use correct type to remove compiler warnings.
2100 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2102 * src/support/lyxlib.h:
2103 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2104 portability and to remove compiler warning with DEC cxx.
2106 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2108 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2110 * src/minibuffer.C (peek_event): retun 1 when there has been a
2111 mouseclick in the minibuffer.
2115 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2117 * src/frontends/xforms/FormParagraph.C: more space above/below
2120 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2122 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2123 a char only if real_current_font was changed.
2125 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2127 * NEWS: update somewhat for 1.1.6
2129 * lib/ui/default.ui: clean up.
2131 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2133 * lib/CREDITS: clean up
2135 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2137 * src/combox.[Ch] (select): changed argument back to int
2138 * src/combox.C (peek_event): removed num_bytes as it is declared but
2141 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2142 modified calls to Combox::select() to remove warnings about type
2145 * src/insets/insetbutton.C (width): explicit cast to remove warning
2146 about type conversion.
2148 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2151 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2152 sel_pos_end, refering to cursor position are changed to
2153 LyXParagraph::size_type.
2155 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2156 consistent with LyXCursor::pos().
2157 (inset_pos): changed to LyXParagraph::size_type for same reason.
2159 * src/insets/insettext.C (resizeLyXText): changed some temporary
2160 variables refing to cursor position to LyXParagraph::size_type.
2162 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2164 * src/frontends/kde/<various>: The Great Renaming,
2167 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2169 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2171 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2173 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2174 0 when there are no arguments.
2176 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2178 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2179 to segfaults when pressing Ok in InsetBibtex dialog.
2181 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2183 * forms/layout_forms.fd:
2184 * src/layout_forms.C (create_form_form_character): small change to use
2185 labelframe rather than engraved frame + text
2187 * src/lyx_gui.C (create_forms): initialise choice_language with some
2188 arbitrary value to prevent segfault when dialog is shown.
2190 2000-10-16 Baruch Even <baruch.even@writeme.com>
2192 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2193 is no resulting file. This pertains only to LaTeX output.
2195 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2197 * src/text.C (Backspace): Make sure that the row of the cursor is
2200 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2203 * src/lyx_gui.C (init): Prevent a crash when only one font from
2204 menu/popup fonts is not found.
2206 * lib/lyxrc.example: Add an example for binding a key for language
2209 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2211 * src/converter.C (GetReachable): Changed the returned type to
2213 (IsReachable): New method
2215 * src/MenuBackend.C (expand): Handle formats that appear more
2218 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2220 * src/frontends/support/Makefile.am
2221 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2224 * lib/CREDITS: add Garst Reese.
2226 * src/support/snprintf.h: add extern "C" {} around the definitions.
2228 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2230 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2233 * src/frontends/xforms/FormDocument.C:
2234 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2235 compile without "conversion to integral type of smaller size"
2238 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2240 * src/text.C (GetColumnNearX): Fixed disabled code.
2242 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2244 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2247 * src/support/snprintf.[ch]: new files
2249 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2251 * src/frontends/kde/formprintdialog.C: add
2252 file browser for selecting postscript output
2254 * src/frontends/kde/formprintdialogdata.C:
2255 * src/frontends/kde/formprintdialogdata.h: re-generate
2258 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2260 * src/frontends/gnome/Makefile.am:
2261 * src/frontends/kde/Makefile.am: FormCommand.C
2262 disappeared from xforms
2264 * src/frontends/kde/FormCitation.C:
2265 * src/frontends/kde/FormIndex.C: read-only
2268 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2270 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2273 * src/bufferlist.C: add using directive.
2275 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2277 * src/support/lyxfunctional.h: version of class_fun for void
2278 returns added, const versions of back_inseter_fun and compare_fun
2281 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2283 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2285 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2287 * ChangeLog: cleanup.
2289 * lib/CREDITS: update to add all the contributors we've forgotten.
2290 I have obviously missed some, so tell me whether there were
2293 2000-10-13 Marko Vendelin <markov@ioc.ee>
2295 * src/frontends/gnome/FormCitation.C
2296 * src/frontends/gnome/FormCitation.h
2297 * src/frontends/gnome/FormError.C
2298 * src/frontends/gnome/FormIndex.C
2299 * src/frontends/gnome/FormRef.C
2300 * src/frontends/gnome/FormRef.h
2301 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2303 * src/frontends/gnome/FormCitation.C
2304 * src/frontends/gnome/FormCopyright.C
2305 * src/frontends/gnome/FormError.C
2306 * src/frontends/gnome/FormIndex.C
2307 * src/frontends/gnome/FormRef.C
2308 * src/frontends/gnome/FormToc.C
2309 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2312 * src/frontends/gnome/Menubar_pimpl.C
2313 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2316 2000-10-11 Baruch Even <baruch.even@writeme.com>
2319 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2320 to convey its real action.
2322 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2323 clear the minibuffer and prepare to enter a command.
2325 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2326 the rename from ExecCommand to PrepareForCommand.
2327 * src/lyxfunc.C (Dispatch): ditto.
2329 2000-10-11 Baruch Even <baruch.even@writeme.com>
2331 * src/buffer.C (writeFile): Added test for errors on writing, this
2332 catches all errors and not only file system full errors as intended.
2334 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2336 * src/lyx_gui.C (create_forms): better fix for crash with
2337 translated interface.
2339 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2341 * src/frontends/kde/Makefile.am:
2342 * src/frontends/kde/FormCopyright.C:
2343 * src/frontends/kde/formcopyrightdialog.C:
2344 * src/frontends/kde/formcopyrightdialog.h:
2345 * src/frontends/kde/formcopyrightdialogdata.C:
2346 * src/frontends/kde/formcopyrightdialogdata.h:
2347 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2348 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2349 copyright to use qtarch
2351 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2353 * src/encoding.C (read): Fixed bug that caused an error message at
2354 the end of the file.
2356 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2358 * lib/lyxrc.example: Fixed hebrew example.
2360 2000-10-13 Allan Rae <rae@lyx.org>
2362 * src/frontends/xforms/FormPreferences.C (input): reworking the
2364 (build, update, apply): New inputs in various tabfolders
2366 * src/frontends/xforms/FormToc.C: use new button policy.
2367 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2368 dialogs that either can't use any existing policy or where it just
2371 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2374 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2375 added a bool parameter which is ignored.
2377 * src/buffer.C (setReadonly):
2378 * src/BufferView_pimpl.C (buffer):
2379 * src/frontends/kde/FormCopyright.h (update):
2380 * src/frontends/kde/FormCitation.[Ch] (update):
2381 * src/frontends/kde/FormIndex.[Ch] (update):
2382 * src/frontends/kde/FormPrint.[Ch] (update):
2383 * src/frontends/kde/FormRef.[Ch] (update):
2384 * src/frontends/kde/FormToc.[Ch] (update):
2385 * src/frontends/kde/FormUrl.[Ch] (update):
2386 * src/frontends/gnome/FormCopyright.h (update):
2387 * src/frontends/gnome/FormCitation.[Ch] (update):
2388 * src/frontends/gnome/FormError.[Ch] (update):
2389 * src/frontends/gnome/FormIndex.[Ch] (update):
2390 * src/frontends/gnome/FormPrint.[Ch] (update):
2391 * src/frontends/gnome/FormRef.h (update):
2392 * src/frontends/gnome/FormToc.[Ch] (update):
2393 * src/frontends/gnome/FormUrl.[Ch] (update):
2394 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2395 to updateBufferDependent and DialogBase
2397 * src/frontends/xforms/FormCitation.[hC]:
2398 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2399 * src/frontends/xforms/FormError.[Ch]:
2400 * src/frontends/xforms/FormGraphics.[Ch]:
2401 * src/frontends/xforms/FormIndex.[Ch]:
2402 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2403 and fixed readOnly handling.
2404 * src/frontends/xforms/FormPrint.[Ch]:
2405 * src/frontends/xforms/FormRef.[Ch]:
2406 * src/frontends/xforms/FormTabular.[Ch]:
2407 * src/frontends/xforms/FormToc.[Ch]:
2408 * src/frontends/xforms/FormUrl.[Ch]:
2409 * src/frontends/xforms/FormInset.[Ch]:
2410 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2411 form of updateBufferDependent.
2413 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2414 if form()->visible just in case someone does stuff to the form in a
2417 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2418 the buttoncontroller for everything the enum used to be used for.
2419 (update) It would seem we need to force all dialogs to use a bool
2420 parameter or have two update functions. I chose to go with one.
2421 I did try removing update() from here and FormBase and defining the
2422 appropriate update signatures in FormBaseB[DI] but then ran into the
2423 problem of the update() call in FormBase::show(). Whatever I did
2424 to get around that would require another function and that just
2425 got more confusing. Hence the decision to make everyone have an
2426 update(bool). An alternative might have been to override show() in
2427 FormBaseB[DI] and that would allow the different and appropriate
2430 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2431 true == buffer change occurred. I decided against using a default
2432 template parameter since not all compilers support that at present.
2434 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2436 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2437 army knife" by removing functionality.
2438 (clearStore): removed. All such housekeeping on hide()ing the dialog
2439 is to be carried out by overloaded disconnect() methods.
2440 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2441 superceded by Baruch's neat test (FormGraphics) to update an existing
2442 dialog if a new signal is recieved rather than block all new signals
2444 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2445 only to Inset dialogs.
2446 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2447 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2449 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2451 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2452 as a base class to all inset dialogs. Used solely to connect/disconnect
2453 the Inset::hide signal and to define what action to take on receipt of
2454 a UpdateBufferDependent signal.
2455 (FormCommand): now derived from FormInset.
2457 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2460 * src/frontends/xforms/FormCopyright.[Ch]:
2461 * src/frontends/xforms/FormPreferences.[Ch]:
2462 now derived from FormBaseBI.
2464 * src/frontends/xforms/FormDocument.[Ch]:
2465 * src/frontends/xforms/FormParagraph.[Ch]:
2466 * src/frontends/xforms/FormPrint.[Ch]:
2467 now derived from FormBaseBD.
2469 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2471 * src/frontends/xforms/FormCitation.[Ch]:
2472 * src/frontends/xforms/FormError.[Ch]:
2473 * src/frontends/xforms/FormRef.[Ch]:
2474 * src/frontends/xforms/FormToc.[Ch]:
2475 (clearStore): reworked as disconnect().
2477 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2480 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2482 * src/converter.C (runLaTeX): constify buffer argument
2485 * src/frontends/support/Makefile.am (INCLUDES): fix.
2487 * src/buffer.h: add std:: qualifier
2488 * src/insets/figinset.C (addpidwait): ditto
2489 * src/MenuBackend.C: ditto
2490 * src/buffer.C: ditto
2491 * src/bufferlist.C: ditto
2492 * src/layout.C: ditto
2493 * src/lyxfunc.C: ditto
2495 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2497 * src/lyxtext.h (bidi_level): change return type to
2498 LyXParagraph::size_type.
2500 * src/lyxparagraph.h: change size_type to
2501 TextContainer::difference_type. This should really be
2502 TextContainer::size_type, but we need currently to support signed
2505 2000-10-11 Marko Vendelin <markov@ioc.ee>
2506 * src/frontends/gnome/FormError.h
2507 * src/frontends/gnome/FormRef.C
2508 * src/frontends/gnome/FormRef.h
2509 * src/frontends/gnome/FormError.C
2510 * src/frontends/gnome/Makefile.am
2511 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2512 to Gnome frontend. Both dialogs use "action" area.
2514 2000-10-12 Baruch Even <baruch.even@writeme.com>
2516 * src/graphics/GraphicsCacheItem_pimpl.C:
2517 * src/graphics/Renderer.C:
2518 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2521 2000-10-12 Juergen Vigna <jug@sad.it>
2523 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2524 visible when selecting).
2526 * development/Code_rules/Rules: fixed some typos.
2528 2000-10-09 Baruch Even <baruch.even@writeme.com>
2530 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2531 compiling on egcs 1.1.2 possible.
2533 * src/filedlg.C (comp_direntry::operator() ): ditto.
2535 2000-08-31 Baruch Even <baruch.even@writeme.com>
2537 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2540 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2541 transient it now only gets freed when the object is destructed.
2543 2000-08-24 Baruch Even <baruch.even@writeme.com>
2545 * src/frontends/FormGraphics.h:
2546 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2549 2000-08-20 Baruch Even <baruch.even@writeme.com>
2551 * src/insets/insetgraphics.C:
2552 (draw): Added messages to the drawn rectangle to report status.
2553 (updateInset): Disabled the use of the inline graphics,
2556 2000-08-17 Baruch Even <baruch.even@writeme.com>
2558 * src/frontends/support: Directory added for the support of GUII LyX.
2560 * src/frontends/support/LyXImage.h:
2561 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2564 * src/frontends/support/LyXImage_X.h:
2565 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2566 version of LyXImage, this uses the Xlib Pixmap.
2568 * src/PainterBase.h:
2569 * src/PainterBase.C:
2571 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2572 replacement to Pixmap.
2574 * src/insets/insetgraphics.h:
2575 * src/insets/insetgraphics.C:
2576 * src/graphics/GraphicsCacheItem.h:
2577 * src/graphics/GraphicsCacheItem.C:
2578 * src/graphics/GraphicsCacheItem_pimpl.h:
2579 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2582 * src/graphics/GraphicsCacheItem.h:
2583 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2584 another copy of the object.
2586 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2587 of cacheHandle, this fixed a bug that sent LyX crashing.
2589 * src/graphics/XPM_Renderer.h:
2590 * src/graphics/XPM_Renderer.C:
2591 * src/graphics/EPS_Renderer.h:
2592 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2594 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2596 * src/lyxfunc.C (processKeySym): only handle the
2597 lockinginset/inset stuff if we have a buffer and text loaded...
2599 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2601 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2603 * src/support/lyxfunctional.h: add operator= that takes a reference
2605 * src/lyxserver.C (mkfifo): make first arg const
2607 * src/layout.h: renamed name(...) to setName(...) to work around
2610 * src/buffer.C (setFileName): had to change name of function to
2611 work around bugs in egcs. (renamed from fileName)
2613 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2615 * src/support/translator.h: move helper template classes to
2616 lyxfunctional.h, include "support/lyxfunctional.h"
2618 * src/support/lyxmanip.h: add delaration of fmt
2620 * src/support/lyxfunctional.h: new file
2621 (class_fun_t): new template class
2622 (class_fun): helper template function
2623 (back_insert_fun_iterator): new template class
2624 (back_inserter_fun): helper template function
2625 (compare_memfun_t): new template class
2626 (compare_memfun): helper template function
2627 (equal_1st_in_pair): moved here from translator
2628 (equal_2nd_in_pair): moved here from translator
2630 * src/support/fmt.C: new file
2631 (fmt): new func, can be used for a printf substitute when still
2632 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2634 * src/support/StrPool.C: add some comments
2636 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2639 * src/insets/figinset.C (addpidwait): use std::copy with
2640 ostream_iterator to fill the pidwaitlist
2642 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2644 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2647 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2650 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2652 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2653 (class_update): ditto
2654 (BulletPanel): ditto
2655 (CheckChoiceClass): move initialization of tc and tct
2657 * src/tabular.C: remove current_view
2658 (OldFormatRead): similar to right below [istream::ignore]
2660 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2661 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2662 unused [istream::ignore]
2664 * src/lyxfunc.C: include "support/lyxfunctional.h"
2665 (getInsetByCode): use std::find_if and compare_memfun
2667 * src/lyxfont.C (stateText): remove c_str()
2669 * src/lyx_main.C (setDebuggingLevel): make static
2670 (commandLineHelp): make static
2672 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2673 Screen* together with fl_get_display() and fl_screen
2675 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2676 togheter with fl_get_display() and fl_screen
2677 (create_forms): remove c_str()
2679 * src/layout.C: include "support/lyxfunctional.h"
2680 (hasLayout): use std::find_if and compare_memfun
2681 (GetLayout): use std::find_if and comapre_memfun
2682 (delete_layout): use std::remove_if and compare_memfun
2683 (NumberOfClass): use std:.find_if and compare_memfun
2685 * src/gettext.h: change for the new functions
2687 * src/gettext.C: new file, make _(char const * str) and _(string
2688 const & str) real functions.
2690 * src/font.C (width): rewrite slightly to avoid one extra variable
2692 * src/debug.C: initialize Debug::ANY here
2694 * src/commandtags.h: update number comments
2696 * src/combox.h (get): make const func
2698 (getline): make const
2700 * src/combox.C (input_cb): handle case where fl_get_input can
2703 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2704 "support/lyxfunctional.h", remove current_view variable.
2705 (resize): use std::for_each with std::mem_fun
2706 (getFileNames): use std::copy with back_inserter_fun
2707 (getBuffer): change arg type to unsigned int
2708 (emergencyWriteAll): call emergencyWrite with std::for_each and
2710 (emergencyWrite): new method, the for loop in emergencyWriteAll
2712 (exists): use std::find_if with compare_memfun
2713 (getBuffer): use std::find_if and compare_memfun
2715 * src/buffer.h: add typedefs for iterator_category, value_type
2716 difference_type, pointer and reference for inset_iterator
2717 add postfix ++ for inset_iterator
2718 make inset_iterator::getPos() const
2720 * src/buffer.C: added support/lyxmanip.h
2721 (readFile): use lyxerr << fmt instead of printf
2722 (makeLaTeXFile): use std::copy to write out encodings
2724 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2726 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2727 free and the char * temp.
2728 (hasMenu): use std::find_if and compare_memfun
2731 * src/Makefile.am (lyx_SOURCES): added gettext.C
2733 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2734 string::insert small change to avoid temporary
2736 * src/LColor.C (getGUIName): remove c_str()
2738 * several files: change all occurrences of fl_display to
2741 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2742 that -pedantic is not used for gcc 2.97 (cvs gcc)
2744 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2746 2000-10-11 Allan Rae <rae@lyx.org>
2748 * src/frontends/xforms/FormPreferences.C (input): template path must be
2749 a readable directory. It doesn't need to be writeable.
2750 (build, delete, update, apply): New inputs in the various tabfolders
2752 * src/frontends/xforms/forms/form_preferences.fd:
2753 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2754 several new entries to existing folders. Shuffled some existing stuff
2757 * src/frontends/xforms/forms/form_print.fd:
2758 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2759 Should probably rework PrinterParams as well. Note that the switch to
2760 collated is effectively the same as !unsorted so changing PrinterParams
2761 will require a lot of fiddly changes to reverse the existing logic.
2763 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2765 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2767 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2769 2000-10-10 Allan Rae <rae@lyx.org>
2772 * src/lyxfunc.C (Dispatch):
2774 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2777 * src/lyxrc.C (output): Only write the differences between system lyxrc
2778 and the users settings.
2781 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2783 I'll rewrite this later, after 1.1.6 probably, to keep a single
2784 LyXRC but two instances of a LyXRCStruct.
2786 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2788 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2790 * src/tabular.h: add a few std:: qualifiers.
2792 * src/encoding.C: add using directive.
2793 * src/language.C: ditto.
2795 * src/insets/insetquotes.C (Validate): use languages->lang()
2796 instead of only language.
2798 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2800 * lib/languages: New file.
2802 * lib/encodings: New file.
2804 * src/language.C (Languages): New class.
2805 (read): New method. Reads the languages from the 'languages' file.
2807 * src/encoding.C (Encodings): New class.
2808 (read): New method. Reads the encodings from the 'encodings' file.
2810 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2813 * src/bufferparams.h and a lot of files: Deleted the member language,
2814 and renamed language_info to language
2816 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2817 * src/lyxfont.C (latexWriteStartChanges): ditto.
2818 * src/paragraph.C (validate,TeXOnePar): ditto.
2820 * src/lyxfont.C (update): Restored deleted code.
2822 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2824 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2826 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2828 * src/insets/figinset.[Ch]:
2829 * src/insets/insetinclude.[Ch]:
2830 * src/insets/insetinclude.[Ch]:
2831 * src/insets/insetparent.[Ch]:
2832 * src/insets/insetref.[Ch]:
2833 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2835 * src/insets/*.[Ch]:
2836 * src/mathed/formula.[Ch]:
2837 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2839 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2840 * src/lyx_cb.C (FigureApplyCB):
2841 * src/lyxfunc.C (getStatus, Dispatch):
2842 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2845 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2847 * src/converter.[Ch] (Formats::View):
2848 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2850 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2851 *current_view->buffer(). This will change later, but this patch is way
2854 2000-10-09 Juergen Vigna <jug@sad.it>
2856 * src/text.C (GetRow): small fix.
2858 * src/BufferView_pimpl.C (cursorPrevious):
2859 (cursorNext): added LyXText parameter to function.
2861 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2862 keypress depending on cursor position.
2864 2000-10-06 Juergen Vigna <jug@sad.it>
2866 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2867 (copySelection): redone this function and also copy ascii representa-
2870 * src/tabular.C (Ascii):
2874 (print_n_chars): new functions to realize the ascii export of tabulars.
2876 2000-10-05 Juergen Vigna <jug@sad.it>
2878 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2879 if we don't have a buffer.
2881 2000-10-10 Allan Rae <rae@lyx.org>
2883 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2884 with closing dialog. It seems that nested tabfolders require hiding
2885 of inner tabfolders before hiding the dialog itself. Actually all I
2886 did was hide the active outer folder.
2888 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2889 unless there really is a buffer. hideBufferDependent is called
2892 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2893 POTFILES.in stays in $(srcdir).
2895 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2897 * lib/lyxrc.example: Few changes.
2899 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2901 * src/BufferView_pimpl.C (buffer): only need one the
2902 updateBufferDependent signal to be emitted once! Moved to the end of
2903 the method to allow bv_->text to be updated first.
2905 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2906 and hSignal_ with Dialogs * and BufferDependency variables.
2907 New Buffer * parent_, initialised when the dialog is launched. Used to
2908 check whether to update() or hide() dialog in the new, private
2909 updateOrHide() method that is connected to the updateBufferDependent
2910 signal. Daughter classes dictate what to do using the
2911 ChangedBufferAction enum, passed to the c-tor.
2913 * src/frontends/xforms/FormCitation.C:
2914 * src/frontends/xforms/FormCommand.C:
2915 * src/frontends/xforms/FormCopyright.C:
2916 * src/frontends/xforms/FormDocument.C:
2917 * src/frontends/xforms/FormError.C:
2918 * src/frontends/xforms/FormIndex.C:
2919 * src/frontends/xforms/FormPreferences.C:
2920 * src/frontends/xforms/FormPrint.C:
2921 * src/frontends/xforms/FormRef.C:
2922 * src/frontends/xforms/FormToc.C:
2923 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2926 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2927 ChangedBufferAction enum.
2929 * src/frontends/xforms/FormParagraph.[Ch]
2930 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2933 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2935 * lib/bind/cua.bind: fix a bit.
2936 * lib/bind/emacs.bind: ditto.
2938 * lib/bind/menus.bind: remove real menu entries from there.
2940 * src/spellchecker.C: make sure we only include strings.h when
2943 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2945 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2946 function. It enlarges the maximum number of pup when needed.
2947 (add_toc2): Open a new menu if maximum number of items per menu has
2950 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2952 * src/frontends/kde/FormPrint.C: fix error reporting
2954 * src/frontends/xforms/FormDocument.C: fix compiler
2957 * lib/.cvsignore: add Literate.nw
2959 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2962 * bufferview_funcs.[Ch]
2965 * text2.C: Add support for numbers in RTL text.
2967 2000-10-06 Allan Rae <rae@lyx.org>
2969 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2970 to be gettext.m4 friendly again. ext_l10n.h is now
2971 generated into $top_srcdir instead of $top_builddir
2972 so that lyx.pot will be built correctly -- without
2973 duplicate parsing of ext_l10n.h.
2975 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2977 * src/frontends/kde/FormCitation.C: make the dialog
2978 behave more sensibly
2980 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2982 * config/kde.m4: fix consecutive ./configure runs,
2983 look for qtarch, fix library order
2985 * src/frontends/kde/Makefile.am: tidy up,
2986 add Print dialog, add .dlg dependencies
2988 * src/frontends/kde/FormPrint.C:
2989 * src/frontends/kde/FormPrint.h:
2990 * src/frontends/kde/formprintdialog.C:
2991 * src/frontends/kde/formprintdialog.h:
2992 * src/frontends/kde/formprintdialogdata.C:
2993 * src/frontends/kde/formprintdialogdata.h:
2994 * src/frontends/kde/dlg/formprintdialog.dlg: add
2997 * src/frontends/kde/dlg/README: Added explanatory readme
2999 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3000 script to double-check qtarch's output
3002 * src/frontends/kde/formindexdialog.C:
3003 * src/frontends/kde/formindexdialogdata.C:
3004 * src/frontends/kde/formindexdialogdata.h:
3005 * src/frontends/kde/dlg/formindexdialog.dlg: update
3006 for qtarch, minor fixes
3008 2000-10-05 Allan Rae <rae@lyx.org>
3010 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3011 dialogs when switching buffers update them instead. It's up to each
3012 dialog to decide if it should still be visible or not.
3013 update() should return a bool to control visiblity within show().
3014 Or perhaps better to set a member variable and use that to control
3017 * lib/build-listerrors: create an empty "listerrors" file just to stop
3018 make trying to regenerate it all the time if you don't have noweb
3021 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3023 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3024 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3025 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3026 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3027 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3029 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3031 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3033 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3034 deleting buffer. Closes all buffer-dependent dialogs.
3036 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3038 * src/frontends/xforms/FormCitation.[Ch]:
3039 * src/frontends/xforms/FormPreferences.[Ch]:
3040 * src/frontends/xforms/FormPrint.[Ch]:
3041 * src/frontends/xforms/FormRef.[Ch]:
3042 * src/frontends/xforms/FormUrl.[Ch]: ditto
3044 * src/frontends/xforms/FormDocument.[Ch]:
3045 * src/frontends/xforms/forms/form_document.C.patch:
3046 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3047 pass through a single input() function.
3049 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3051 * lib/build-listerrors: return status as OK
3053 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3055 * lib/lyxrc.example: Updated to new export code
3057 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3059 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3062 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3065 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3066 LyX-Code is defined.
3067 * lib/layouts/amsbook.layout: ditto.
3069 * boost/Makefile.am: fix typo.
3071 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3073 (add_lastfiles): removed.
3074 (add_documents): removed.
3075 (add_formats): removed.
3077 * src/frontends/Menubar.C: remove useless "using" directive.
3079 * src/MenuBackend.h: add a new MenuItem constructor.
3081 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3084 2000-10-04 Allan Rae <rae@lyx.org>
3086 * lib/Makefile.am (listerrors):
3087 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3088 I haven't got notangle installed so Kayvan please test. The output
3089 should end up in $builddir. This also allows people who don't have
3090 noweb installed to complete the make process without error.
3092 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3093 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3094 by JMarc's picky compiler.
3096 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3099 * src/insets/insettabular.C (setPos): change for loop to not use
3100 sequencing operator. Please check this Jürgen.
3102 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3104 * src/insets/insetcite.C (getScreenLabel): ditto
3105 * src/support/filetools.C (QuoteName): ditto
3106 (ChangeExtension): ditto
3108 * src/BufferView_pimpl.C (scrollCB): make heigt int
3110 * src/BufferView2.C (insertInset): comment out unused arg
3112 * boost/Makefile.am (EXTRADIST): new variable
3114 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3116 * src/exporter.C (IsExportable): Fixed
3118 * lib/configure.m4: Small fix
3120 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3122 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3123 * src/insets/insetbib.C (bibitemWidest): ditto.
3124 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3126 2000-10-03 Juergen Vigna <jug@sad.it>
3128 * src/BufferView2.C (theLockingInset): removed const because of
3129 Agnus's compile problems.
3131 * src/insets/insettext.C (LocalDispatch): set the language of the
3132 surronding paragraph on inserting the first character.
3134 * various files: changed use of BufferView::the_locking_inset.
3136 * src/BufferView2.C (theLockingInset):
3137 (theLockingInset): new functions.
3139 * src/BufferView.h: removed the_locking_inset.
3141 * src/lyxtext.h: added the_locking_inset
3143 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3145 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3147 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3149 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3150 * src/mathed/math_cursor.C (IsAlpha): ditto.
3151 * src/mathed/math_inset.C (strnew): ditto.
3152 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3153 (IMetrics): cxp set but never used; removed.
3154 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3155 that the variable in question has been removed also!
3158 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3159 using the Buffer * passed to Latex(), using the BufferView * passed to
3160 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3162 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3163 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3165 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3166 * src/buffer.C (readInset): used new InsetBibtex c-tor
3167 * (getBibkeyList): used new InsetBibtex::getKeys
3169 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3172 * lib/build-listerrors
3174 * src/exporter.C: Add literate programming support to the export code
3177 * src/lyx_cb.C: Remove old literate code.
3179 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3182 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3183 * src/converter.C (View, Convert): Use QuoteName.
3185 * src/insets/figinset.C (Preview): Use Formats::View.
3187 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3189 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3191 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3192 the top of the function, because compaq cxx complains that the
3193 "goto exit_with_message" when the function is disabled bypasses
3195 (MenuNew): try a better fix for the generation of new file names.
3196 This time, I used AddName() instead of AddPath(), hoping Juergen
3199 2000-10-03 Allan Rae <rae@lyx.org>
3201 * src/frontends/xforms/forms/form_preferences.fd:
3202 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3203 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3204 "Look and Feel"->"General" but will need to be split up further into
3205 general output and general input tabs. Current plan is for four outer
3206 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3207 stuff; "Inputs" for input and import configuration; "Outputs" for
3208 output and export configuration; and one more whatever is left over
3209 called "General". The leftovers at present look like being which
3210 viewers to use, spellchecker, language support and might be better
3211 named "Support". I've put "Paths" in "Inputs" for the moment as this
3212 seems reasonable for now at least.
3213 One problem remains: X error kills LyX when you close Preferences.
3215 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3217 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3218 qualifier from form()
3219 * src/frontends/xforms/FormCitation.[Ch]:
3220 * src/frontends/xforms/FormCopyright.[Ch]:
3221 * src/frontends/xforms/FormDocument.[Ch]:
3222 * src/frontends/xforms/FormError.[Ch]:
3223 * src/frontends/xforms/FormIndex.[Ch]:
3224 * src/frontends/xforms/FormPreferences.[Ch]:
3225 * src/frontends/xforms/FormPrint.[Ch]:
3226 * src/frontends/xforms/FormRef.[Ch]:
3227 * src/frontends/xforms/FormToc.[Ch]:
3228 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3230 * src/frontends/xforms/FormCitation.[Ch]:
3231 * src/frontends/xforms/FormIndex.[Ch]:
3232 * src/frontends/xforms/FormRef.[Ch]:
3233 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3234 with Allan's naming policy
3236 * src/frontends/xforms/FormCitation.C: some static casts to remove
3239 2000-10-02 Juergen Vigna <jug@sad.it>
3241 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3242 now you can type or do stuff inside the table-cell also when in dummy
3243 position, fixed visible cursor.
3245 * src/insets/insettext.C (Edit): fixing cursor-view position.
3247 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3248 be used for equal functions in lyxfunc and insettext.
3250 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3252 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3254 * src/frontends/gnome/FormCitation.h:
3255 * src/frontends/gnome/FormCopyright.h:
3256 * src/frontends/gnome/FormIndex.h:
3257 * src/frontends/gnome/FormPrint.h:
3258 * src/frontends/gnome/FormToc.h:
3259 * src/frontends/gnome/FormUrl.h:
3260 * src/frontends/kde/FormCitation.h:
3261 * src/frontends/kde/FormCopyright.h:
3262 * src/frontends/kde/FormIndex.h:
3263 * src/frontends/kde/FormRef.h:
3264 * src/frontends/kde/FormToc.h:
3265 * src/frontends/kde/FormUrl.h: fix remaining users of
3268 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3270 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3271 from depth argument.
3272 (DocBookHandleCaption): ditto.
3273 (DocBookHandleFootnote): ditto.
3274 (SimpleDocBookOnePar): ditto.
3276 * src/frontends/xforms/FormDocument.h (form): remove extra
3277 FormDocument:: qualifier.
3279 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3281 * sigc++/handle.h: ditto.
3283 * src/lyx_gui_misc.C: add "using" directive.
3285 * src/cheaders/cstddef: new file, needed by the boost library (for
3288 2000-10-02 Juergen Vigna <jug@sad.it>
3290 * src/insets/insettext.C (SetFont): better support.
3292 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3294 * src/screen.C (DrawOneRow): some uint refixes!
3296 2000-10-02 Allan Rae <rae@lyx.org>
3298 * boost/.cvsignore: ignore Makefile as well
3300 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3301 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3303 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3304 Left this one out by accident.
3306 * src/frontends/xforms/FormBase.h (restore): default to calling
3307 update() since that will restore the original/currently-applied values.
3308 Any input() triggered error messages will require the derived classes
3309 to redefine restore().
3311 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3312 avoid a segfault. combo_doc_class is the main concern.
3314 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3316 * Simplify build-listerrors in view of GUI-less export ability!
3318 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3320 * src/lyx_main.C (easyParse): Disable gui when exporting
3322 * src/insets/figinset.C:
3325 * src/lyx_gui_misc.C
3326 * src/tabular.C: Changes to allow no-gui.
3328 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3330 * src/support/utility.hpp: removed file
3331 * src/support/block.h: removed file
3333 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3336 * src/mathed/formula.C: add support/lyxlib.h
3337 * src/mathed/formulamacro.C: ditto
3339 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3340 * src/lyxparagraph.h: ditto
3342 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3343 * src/frontends/Makefile.am (INCLUDES): ditto
3344 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3345 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3346 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3347 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3348 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3349 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3351 * src/BufferView.h: use boost/utility.hpp
3352 * src/LColor.h: ditto
3353 * src/LaTeX.h: ditto
3354 * src/LyXAction.h: ditto
3355 * src/LyXView.h: ditto
3356 * src/bufferlist.h: ditto
3357 * src/lastfiles.h: ditto
3358 * src/layout.h: ditto
3359 * src/lyx_gui.h: ditto
3360 * src/lyx_main.h: ditto
3361 * src/lyxlex.h: ditto
3362 * src/lyxrc.h: ditto
3363 * src/frontends/ButtonPolicies.h: ditto
3364 * src/frontends/Dialogs.h: ditto
3365 * src/frontends/xforms/FormBase.h: ditto
3366 * src/frontends/xforms/FormGraphics.h: ditto
3367 * src/frontends/xforms/FormParagraph.h: ditto
3368 * src/frontends/xforms/FormTabular.h: ditto
3369 * src/graphics/GraphicsCache.h: ditto
3370 * src/graphics/Renderer.h: ditto
3371 * src/insets/ExternalTemplate.h: ditto
3372 * src/insets/insetcommand.h: ditto
3373 * src/support/path.h: ditto
3375 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3376 and introduce clause for 2.97.
3378 * boost/libs/README: new file
3380 * boost/boost/utility.hpp: new file
3382 * boost/boost/config.hpp: new file
3384 * boost/boost/array.hpp: new file
3386 * boost/Makefile.am: new file
3388 * boost/.cvsignore: new file
3390 * configure.in (AC_OUTPUT): add boost/Makefile
3392 * Makefile.am (SUBDIRS): add boost
3394 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3396 * src/support/lstrings.C (suffixIs): Fixed.
3398 2000-10-01 Allan Rae <rae@lyx.org>
3400 * src/PrinterParams.h: moved things around to avoid the "can't
3401 inline call" warning.
3403 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3404 into doc++ documentation.
3406 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3408 * src/frontends/xforms/FormRef.C: make use of button controller
3409 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3410 cleaned up button controller usage.
3411 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3412 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3413 use the button controller
3415 * src/frontends/xforms/forms/*.fd: and associated generated files
3416 updated to reflect changes to FormBase. Some other FormXxxx files
3417 also got minor updates to reflect changes to FormBase.
3419 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3420 (hide): made virtual.
3421 (input): return a bool. true == valid input
3422 (RestoreCB, restore): new
3423 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3424 Changes to allow derived dialogs to use a ButtonController and
3425 make sense when doing so: OK button calls ok() and so on.
3427 * src/frontends/xforms/ButtonController.h (class ButtonController):
3428 Switch from template implementation to taking Policy parameter.
3429 Allows FormBase to provide a ButtonController for any dialog.
3431 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3432 Probably should rename connect and disconnect.
3433 (apply): use the radio button groups
3434 (form): needed by FormBase
3435 (build): setup the radio button groups
3437 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3439 * several files: type changes to reduce the number of warnings and
3440 to unify type hangling a bit. Still much to do.
3442 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3444 * lib/images/*: rename a bunch of icons to match Dekel converter
3447 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3450 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3452 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3454 * sigc++/handle.h: ditto for class Handle.
3456 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3458 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3460 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3462 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3463 removal of the "default" language.
3465 * src/combox.h (getline): Check that sel > 0
3467 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3469 * lib/examples/docbook_example.lyx
3470 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3472 * lib/layouts/docbook-book.layout: new docbook book layout.
3474 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3476 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3478 * src/insets/figinset.C (DocBook):fixed small typo.
3480 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3482 * src/insets/insetinclude.h: string include_label doesn't need to be
3485 2000-09-29 Allan Rae <rae@lyx.org>
3487 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3488 Allow derived type to control connection and disconnection from signals
3489 of its choice if desired.
3491 2000-09-28 Juergen Vigna <jug@sad.it>
3493 * src/insets/insettabular.C (update): fixed cursor setting when
3494 the_locking_inset changed.
3495 (draw): made this a bit cleaner.
3496 (InsetButtonPress): fixed!
3498 * various files: added LyXText Parameter to fitCursor call.
3500 * src/BufferView.C (fitCursor): added LyXText parameter.
3502 * src/insets/insettabular.C (draw): small draw fix.
3504 * src/tabular.C: right setting of left/right celllines.
3506 * src/tabular.[Ch]: fixed various types in funcions and structures.
3507 * src/insets/insettabular.C: ditto
3508 * src/frontends/xforms/FormTabular.C: ditto
3510 2000-09-28 Allan Rae <rae@lyx.org>
3512 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3513 that the #ifdef's had been applied to part of what should have been
3514 a complete condition. It's possible there are other tests that
3515 were specific to tables that are also wrong now that InsetTabular is
3516 being used. Now we need to fix the output of '\n' after a table in a
3517 float for the same reason as the original condition:
3518 "don't insert this if we would be adding it before or after a table
3519 in a float. This little trick is needed in order to allow use of
3520 tables in \subfigures or \subtables."
3521 Juergen can you check this?
3523 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3525 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3526 output to the ostream.
3528 * several files: fixed types based on warnings from cxx
3530 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3532 * src/frontends/kde/Makefile.am: fix rule for
3533 formindexdialogdata_moc.C
3535 * src/.cvsignore: add ext_l10n.h to ignore
3537 * acconfig.h: stop messing with __STRICT_ANSI__
3538 * config/gnome.m4: remove option to set -ansi
3539 * config/kde.m4: remove option to set -ansi
3540 * config/lyxinclude.m4: don't set -ansi
3542 2000-09-27 Juergen Vigna <jug@sad.it>
3544 * various files: remove "default" language check.
3546 * src/insets/insetquotes.C: removed use of current_view.
3548 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3549 the one should have red ears by now!
3551 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3552 in more then one paragraph. Fixed cursor-movement/selection.
3554 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3555 paragraphs inside a text inset.
3557 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3558 text-inset if this owner is an inset.
3560 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3562 * src/Bullet.h: changed type of font, character and size to int
3564 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3566 * src/insets/inseturl.[Ch]:
3567 * src/insets/insetref.[Ch]:
3568 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3570 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3572 * src/buffer.C (readFile): block-if statement rearranged to minimise
3573 bloat. Patch does not reverse Jean-Marc's change ;-)
3575 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3576 Class rewritten to store pointers to hide/update signals directly,
3577 rather than Dialogs *. Also defined an enum to ease use. All xforms
3578 forms can now be derived from this class.
3580 * src/frontends/xforms/FormCommand.[Ch]
3581 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3583 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3586 * src/frontends/xforms/forms/form_citation.fd
3587 * src/frontends/xforms/forms/form_copyright.fd
3588 * src/frontends/xforms/forms/form_error.fd
3589 * src/frontends/xforms/forms/form_index.fd
3590 * src/frontends/xforms/forms/form_ref.fd
3591 * src/frontends/xforms/forms/form_toc.fd
3592 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3594 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3596 * src/insets/insetfoot.C: removed redundent using directive.
3598 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3600 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3601 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3603 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3604 created in the constructors in different groups. Then set() just
3605 have to show the groups as needed. This fixes the redraw problems
3606 (and is how the old menu code worked).
3608 * src/support/lyxlib.h: declare the methods as static when we do
3609 not have namespaces.
3611 2000-09-26 Juergen Vigna <jug@sad.it>
3613 * src/buffer.C (asciiParagraph): new function.
3614 (writeFileAscii): new function with parameter ostream.
3615 (writeFileAscii): use now asciiParagraph.
3617 * various inset files: added the linelen parameter to the Ascii-func.
3619 * src/tabular.C (Write): fixed error in writing file introduced by
3620 the last changes from Lars.
3622 * lib/bind/menus.bind: removed not supported functions.
3624 * src/insets/insettext.C (Ascii): implemented this function.
3626 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3628 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3629 (Write): use of the write_attribute functions.
3631 * src/bufferlist.C (close): fixed reasking question!
3633 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3635 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3636 new files use the everwhere possible.
3639 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3640 src/log_form.C src/lyx.C:
3643 * src/buffer.C (runLaTeX): remove func
3645 * src/PaperLayout.C: removed file
3646 * src/ParagraphExtra.C: likewise
3647 * src/bullet_forms.C: likewise
3648 * src/bullet_forms.h: likewise
3649 * src/bullet_forms_cb.C: likewise
3651 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3652 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3655 * several files: remove all traces of the old fd_form_paragraph,
3656 and functions belonging to that.
3658 * several files: remove all traces of the old fd_form_document,
3659 and functions belonging to that.
3661 * several files: constify local variables were possible.
3663 * several files: remove all code that was dead when NEW_EXPORT was
3666 * several files: removed string::c_str in as many places as
3669 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3670 (e): be a bit more outspoken when patching
3671 (updatesrc): only move files if changed.
3673 * forms/layout_forms.h.patch: regenerated
3675 * forms/layout_forms.fd: remove form_document and form_paragraph
3676 and form_quotes and form_paper and form_table_options and
3677 form_paragraph_extra
3679 * forms/form1.fd: remove form_table
3681 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3682 the fdui->... rewrite. Update some comments to xforms 0.88
3684 * forms/bullet_forms.C.patch: removed file
3685 * forms/bullet_forms.fd: likewise
3686 * forms/bullet_forms.h.patch: likewise
3688 * development/Code_rules/Rules: added a section on switch
3689 statements. Updated some comment to xforms 0.88.
3691 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3693 * src/buffer.C (readFile): make sure that the whole version number
3694 is read after \lyxformat (even when it contains a comma)
3696 * lib/ui/default.ui: change shortcut of math menu to M-a.
3698 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3700 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3703 * src/LyXView.C (updateWindowTitle): show the full files name in
3704 window title, limited to 30 characters.
3706 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3707 When a number of characters has been given, we should not assume
3708 that the string is 0-terminated.
3710 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3711 calls (fixes some memory leaks)
3713 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3714 trans member on exit.
3716 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3718 * src/converter.C (GetReachable): fix typo.
3720 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3721 understand ',' instead of '.'.
3722 (GetInteger): rewrite to use strToInt().
3724 2000-09-26 Juergen Vigna <jug@sad.it>
3726 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3727 better visibility and error-message on wrong VSpace input.
3729 * src/language.C (initL): added english again.
3731 2000-09-25 Juergen Vigna <jug@sad.it>
3733 * src/frontends/kde/Dialogs.C (Dialogs):
3734 * src/frontends/gnome/Dialogs.C (Dialogs):
3735 * src/frontends/kde/Makefile.am:
3736 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3738 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3740 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3742 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3744 * src/frontends/xforms/FormParagraph.C:
3745 * src/frontends/xforms/FormParagraph.h:
3746 * src/frontends/xforms/form_paragraph.C:
3747 * src/frontends/xforms/form_paragraph.h:
3748 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3751 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3753 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3754 Paragraph-Data after use.
3756 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3757 non breakable paragraphs.
3759 2000-09-25 Garst R. Reese <reese@isn.net>
3761 * src/language.C (initL): added missing language_country codes.
3763 2000-09-25 Juergen Vigna <jug@sad.it>
3765 * src/insets/insettext.C (InsetText):
3766 (deleteLyXText): remove the not released LyXText structure!
3768 2000-09-24 Marko Vendelin <markov@ioc.ee>
3770 * src/frontends/gnome/mainapp.C
3771 * src/frontends/gnome/mainapp.h: added support for keyboard
3774 * src/frontends/gnome/FormCitation.C
3775 * src/frontends/gnome/FormCitation.h
3776 * src/frontends/gnome/Makefile.am
3777 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3778 FormCitation to use "action area" in mainapp window
3780 * src/frontends/gnome/Menubar_pimpl.C
3781 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3784 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3786 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3787 width/descent/ascent values if name is empty.
3788 (mathed_string_height): Use std::max.
3790 2000-09-25 Allan Rae <rae@lyx.org>
3792 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3793 segfault. This will be completely redesigned soon.
3795 * sigc++: updated libsigc++. Fixes struct timespec bug.
3797 * development/tools/makeLyXsigc.sh: .cvsignore addition
3799 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3801 * several files: removed almost all traces of the old table
3804 * src/TableLayout.C: removed file
3806 2000-09-22 Juergen Vigna <jug@sad.it>
3808 * src/frontends/kde/Dialogs.C: added credits forms.
3810 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3812 * src/frontends/gnome/Dialogs.C: added some forms.
3814 * src/spellchecker.C (init_spell_checker): set language in pspell code
3815 (RunSpellChecker): some modifications for setting language string.
3817 * src/language.[Ch]: added language_country code.
3819 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3821 * src/frontends/Dialogs.h: added new signal showError.
3822 Rearranged existing signals in some sort of alphabetical order.
3824 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3825 FormError.[Ch], form_error.[Ch]
3826 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3827 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3829 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3830 dialogs. I think that this can be used as the base to all these
3833 * src/frontends/xforms/FormError.[Ch]
3834 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3835 implementation of InsetError dialog.
3837 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3839 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3840 * src/frontends/kde/Makefile.am: ditto
3842 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3844 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3845 macrobf. This fixes a bug of invisible text.
3847 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3849 * lib/doc/LaTeXConfig.lyx.in: updated.
3851 * src/language.C (initL): remove language "francais" and change a
3852 bit the names of the two other french variations.
3854 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3855 string that may not be 0-terminated.
3857 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3859 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3861 2000-09-20 Marko Vendelin <markov@ioc.ee>
3863 * src/frontends/gnome/FormCitation.C
3864 * src/frontends/gnome/FormIndex.C
3865 * src/frontends/gnome/FormToc.C
3866 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3867 the variable initialization to shut up the warnings
3869 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3871 * src/table.[Ch]: deleted files
3873 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3876 2000-09-18 Juergen Vigna <jug@sad.it>
3878 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3879 problems with selection. Inserted new LFUN_PASTESELECTION.
3880 (InsetButtonPress): inserted handling of middle mouse-button paste.
3882 * src/spellchecker.C: changed word to word.c_str().
3884 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3886 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3887 included in the ``make dist'' tarball.
3889 2000-09-15 Juergen Vigna <jug@sad.it>
3891 * src/CutAndPaste.C (cutSelection): small fix return the right
3892 end position after cut inside one paragraph only.
3894 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3895 we are locked as otherwise we don't have a valid cursor position!
3897 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3899 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3901 * src/frontends/kde/FormRef.C: added using directive.
3902 * src/frontends/kde/FormToc.C: ditto
3904 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3906 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3908 2000-09-19 Marko Vendelin <markov@ioc.ee>
3910 * src/frontends/gnome/Menubar_pimpl.C
3911 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3912 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3914 * src/frontends/gnome/mainapp.C
3915 * src/frontends/gnome/mainapp.h: support for menu update used
3918 * src/frontends/gnome/mainapp.C
3919 * src/frontends/gnome/mainapp.h: support for "action" area in the
3920 main window. This area is used by small simple dialogs, such as
3923 * src/frontends/gnome/FormIndex.C
3924 * src/frontends/gnome/FormIndex.h
3925 * src/frontends/gnome/FormUrl.C
3926 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3929 * src/frontends/gnome/FormCitation.C
3930 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3931 action area. Only "Insert new citation" is implemented.
3933 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3935 * src/buffer.C (Dispatch): fix call to Dispatch
3936 * src/insets/insetref.C (Edit): likewise
3937 * src/insets/insetparent.C (Edit): likewise
3938 * src/insets/insetinclude.C (include_cb): likewise
3939 * src/frontends/xforms/FormUrl.C (apply): likewise
3940 * src/frontends/xforms/FormToc.C (apply): likewise
3941 * src/frontends/xforms/FormRef.C (apply): likewise
3942 * src/frontends/xforms/FormIndex.C (apply): likewise
3943 * src/frontends/xforms/FormCitation.C (apply): likewise
3944 * src/lyxserver.C (callback): likewise
3945 * src/lyxfunc.C (processKeySym): likewise
3946 (Dispatch): likewise
3947 (Dispatch): likewise
3948 * src/lyx_cb.C (LayoutsCB): likewise
3950 * Makefile.am (sourcedoc): small change
3952 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3954 * src/main.C (main): Don't make an empty GUIRunTime object. all
3955 methods are static. constify a bit remove unneded using + headers.
3957 * src/tabular.C: some more const to local vars move some loop vars
3959 * src/spellchecker.C: added some c_str after some word for pspell
3961 * src/frontends/GUIRunTime.h: add new static method setDefaults
3962 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3963 * src/frontends/kde/GUIRunTime.C (setDefaults):
3964 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3966 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3967 with strnew in arg, use correct emptystring when calling SetName.
3969 * several files: remove all commented code with relation to
3970 HAVE_SSTREAM beeing false. We now only support stringstream and
3973 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3975 * src/lyxfunc.C: construct correctly the automatic new file
3978 * src/text2.C (IsStringInText): change type of variable i to shut
3981 * src/support/sstream.h: do not use namespaces if the compiler
3982 does not support them.
3984 2000-09-15 Marko Vendelin <markov@ioc.ee>
3985 * src/frontends/gnome/FormCitation.C
3986 * src/frontends/gnome/FormCitation.h
3987 * src/frontends/gnome/diainsertcitation_interface.c
3988 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3989 regexp support to FormCitation [Gnome].
3991 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3994 * configure.in: remove unused KDE/GTKGUI define
3996 * src/frontends/kde/FormRef.C
3997 * src/frontends/kde/FormRef.h
3998 * src/frontends/kde/formrefdialog.C
3999 * src/frontends/kde/formrefdialog.h: double click will
4000 go to reference, now it is possible to change a cross-ref
4003 * src/frontends/kde/FormToc.C
4004 * src/frontends/kde/FormToc.h
4005 * src/frontends/kde/formtocdialog.C
4006 * src/frontends/kde/formtocdialog.h: add a depth
4009 * src/frontends/kde/Makefile.am: add QtLyXView.h
4012 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4014 * src/frontends/kde/FormCitation.h: added some using directives.
4016 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4018 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4021 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4024 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4026 * src/buffer.C (pop_tag): revert for the second time a change by
4027 Lars, who seems to really hate having non-local loop variables :)
4029 * src/Lsstream.h: add "using" statements.
4031 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4032 * src/buffer.C (writeFile): ditto
4034 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4036 * src/buffer.C (writeFile): try to fix the locale modified format
4037 number to always be as we want it.
4039 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4040 in XForms 0.89. C-space is now working again.
4042 * src/Lsstream.h src/support/sstream.h: new files.
4044 * also commented out all cases where strstream were used.
4046 * src/Bullet.h (c_str): remove method.
4048 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4050 * a lot of files: get rid of "char const *" and "char *" is as
4051 many places as possible. We only want to use them in interaction
4052 with system of other libraries, not inside lyx.
4054 * a lot of files: return const object is not of pod type. This
4055 helps ensure that temporary objects is not modified. And fits well
4056 with "programming by contract".
4058 * configure.in: check for the locale header too
4060 * Makefile.am (sourcedoc): new tag for generation of doc++
4063 2000-09-14 Juergen Vigna <jug@sad.it>
4065 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4066 callback to check which combo called it and do the right action.
4068 * src/combox.C (combo_cb): added combo * to the callbacks.
4069 (Hide): moved call of callback after Ungrab of the pointer.
4071 * src/intl.h: removed LCombo2 function.
4073 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4074 function as this can now be handled in one function.
4076 * src/combox.h: added Combox * to callback prototype.
4078 * src/frontends/xforms/Toolbar_pimpl.C:
4079 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4081 2000-09-14 Garst Reese <reese@isn.net>
4083 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4084 moved usepackage{xxx}'s to beginning of file. Changed left margin
4085 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4086 underlining from title. Thanks to John Culleton for useful suggestions.
4088 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4090 * src/lyxlex_pimpl.C (setFile): change error message to debug
4093 2000-09-13 Juergen Vigna <jug@sad.it>
4095 * src/frontends/xforms/FormDocument.C: implemented choice_class
4096 as combox and give callback to combo_language so OK/Apply is activated
4099 * src/bufferlist.C (newFile): small fix so already named files
4100 (via an open call) are not requested to be named again on the
4103 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4105 * src/frontends/kde/Makefile.am
4106 * src/frontends/kde/FormRef.C
4107 * src/frontends/kde/FormRef.h
4108 * src/frontends/kde/formrefdialog.C
4109 * src/frontends/kde/formrefdialog.h: implement
4112 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4114 * src/frontends/kde/formtocdialog.C
4115 * src/frontends/kde/formtocdialog.h
4116 * src/frontends/kde/FormToc.C
4117 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4119 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4121 * src/frontends/kde/FormCitation.C: fix thinko
4122 where we didn't always display the reference text
4125 * src/frontends/kde/formurldialog.C
4126 * src/frontends/kde/formurldialog.h
4127 * src/frontends/kde/FormUrl.C
4128 * src/frontends/kde/FormUrl.h: minor cleanups
4130 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4132 * src/frontends/kde/Makefile.am
4133 * src/frontends/kde/FormToc.C
4134 * src/frontends/kde/FormToc.h
4135 * src/frontends/kde/FormCitation.C
4136 * src/frontends/kde/FormCitation.h
4137 * src/frontends/kde/FormIndex.C
4138 * src/frontends/kde/FormIndex.h
4139 * src/frontends/kde/formtocdialog.C
4140 * src/frontends/kde/formtocdialog.h
4141 * src/frontends/kde/formcitationdialog.C
4142 * src/frontends/kde/formcitationdialog.h
4143 * src/frontends/kde/formindexdialog.C
4144 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4146 2000-09-12 Juergen Vigna <jug@sad.it>
4148 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4151 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4153 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4156 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4158 * src/converter.C (Add, Convert): Added support for converter flags:
4159 needaux, resultdir, resultfile.
4160 (Convert): Added new parameter view_file.
4161 (dvips_options): Fixed letter paper option.
4163 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4164 (Export, GetExportableFormats, GetViewableFormats): Added support
4167 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4169 (easyParse): Fixed to work with new export code.
4171 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4174 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4176 * lib/bind/*.bind: Replaced
4177 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4178 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4180 2000-09-11 Juergen Vigna <jug@sad.it>
4182 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4184 * src/main.C (main): now GUII defines global guiruntime!
4186 * src/frontends/gnome/GUIRunTime.C (initApplication):
4187 * src/frontends/kde/GUIRunTime.C (initApplication):
4188 * src/frontends/xforms/GUIRunTime.C (initApplication):
4189 * src/frontends/GUIRunTime.h: added new function initApplication.
4191 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4193 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4195 2000-09-08 Juergen Vigna <jug@sad.it>
4197 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4198 we have already "Reset".
4200 * src/language.C (initL): inserted "default" language and made this
4201 THE default language (and not american!)
4203 * src/paragraph.C: inserted handling of "default" language!
4205 * src/lyxfont.C: ditto
4209 * src/paragraph.C: output the \\par only if we have a following
4210 paragraph otherwise it's not needed.
4212 2000-09-05 Juergen Vigna <jug@sad.it>
4214 * config/pspell.m4: added entry to lyx-flags
4216 * src/spellchecker.C: modified version from Kevin for using pspell
4218 2000-09-01 Marko Vendelin <markov@ioc.ee>
4219 * src/frontends/gnome/Makefile.am
4220 * src/frontends/gnome/FormCitation.C
4221 * src/frontends/gnome/FormCitation.h
4222 * src/frontends/gnome/diainsertcitation_callbacks.c
4223 * src/frontends/gnome/diainsertcitation_callbacks.h
4224 * src/frontends/gnome/diainsertcitation_interface.c
4225 * src/frontends/gnome/diainsertcitation_interface.h
4226 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4227 dialog for Gnome frontend
4229 * src/main.C: Gnome libraries require keeping application name
4230 and its version as strings
4232 * src/frontends/gnome/mainapp.C: Change the name of the main window
4233 from GnomeLyX to PACKAGE
4235 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4237 * src/frontends/Liason.C: add "using: declaration.
4239 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4241 * src/mathed/math_macro.C (Metrics): Set the size of the template
4243 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4245 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4247 * src/converter.C (add_options): New function.
4248 (SetViewer): Change $$FName into '$$FName'.
4249 (View): Add options when running xdvi
4250 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4251 (Convert): The 3rd parameter is now the desired filename. Converts
4252 calls to lyx::rename if necessary.
4253 Add options when running dvips.
4254 (dvi_papersize,dvips_options): New methods.
4256 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4258 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4259 using a call to Converter::dvips_options.
4260 Fixed to work with nex export code.
4262 * src/support/copy.C
4263 * src/support/rename.C: New files
4265 * src/support/syscall.h
4266 * src/support/syscall.C: Added Starttype SystemDontWait.
4268 * lib/ui/default.ui: Changed to work with new export code
4270 * lib/configure.m4: Changed to work with new export code
4272 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4274 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4276 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4277 so that code compiles with DEC cxx.
4279 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4280 to work correctly! Also now supports the additional elements
4283 2000-09-01 Allan Rae <rae@lyx.org>
4285 * src/frontends/ButtonPolicies.C: renamed all the references to
4286 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4288 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4289 since it's a const not a type.
4291 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4293 2000-08-31 Juergen Vigna <jug@sad.it>
4295 * src/insets/figinset.C: Various changes to look if the filename has
4296 an extension and if not add it for inline previewing.
4298 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4300 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4301 make buttonStatus and isReadOnly be const methods. (also reflect
4302 this in derived classes.)
4304 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4305 (nextState): change to be static inline, pass the StateMachine as
4307 (PreferencesPolicy): remove casts
4308 (OkCancelPolicy): remvoe casts
4309 (OkCancelReadOnlyPolicy): remove casts
4310 (NoRepeatedApplyReadOnlyPolicy): remove casts
4311 (OkApplyCancelReadOnlyPolicy): remove casts
4312 (OkApplyCancelPolicy): remove casts
4313 (NoRepeatedApplyPolicy): remove casts
4315 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4317 * src/converter.C: added some using directives
4319 * src/frontends/ButtonPolicies.C: changes to overcome
4320 "need lvalue" error with DEC c++
4322 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4323 to WMHideCB for DEC c++
4325 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4327 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4328 to BulletBMTableCB for DEC c++
4330 2000-08-31 Allan Rae <rae@lyx.org>
4332 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4333 character dialog separately from old document dialogs combo_language.
4336 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4338 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4339 Removed LFUN_REF_CREATE.
4341 * src/MenuBackend.C: Added new tags: toc and references
4343 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4344 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4346 (add_toc, add_references): New methods.
4347 (create_submenu): Handle correctly the case when there is a
4348 seperator after optional menu items.
4350 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4351 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4352 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4354 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4356 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4358 * src/converter.[Ch]: New file for converting between different
4361 * src/export.[Ch]: New file for exporting a LyX file to different
4364 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4365 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4366 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4367 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4368 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4369 RunDocBook, MenuExport.
4371 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4372 Exporter::Preview methods if NEW_EXPORT is defined.
4374 * src/buffer.C (Dispatch): Use Exporter::Export.
4376 * src/lyxrc.C: Added new tags: \converter and \viewer.
4379 * src/LyXAction.C: Define new lyx-function: buffer-update.
4380 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4381 when NEW_EXPORT is defined.
4383 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4385 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4387 * lib/ui/default.ui: Added submenus "view" and "update" to the
4390 * src/filetools.C (GetExtension): New function.
4392 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4394 2000-08-29 Allan Rae <rae@lyx.org>
4396 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4398 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4399 (EnableDocumentLayout): removed
4400 (DisableDocumentLayout): removed
4401 (build): make use of ButtonController's read-only handling to
4402 de/activate various objects. Replaces both of the above functions.
4404 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4405 (readOnly): was read_only
4406 (refresh): fixed dumb mistakes with read_only_ handling
4408 * src/frontends/xforms/forms/form_document.fd:
4409 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4410 tabbed dialogs so the tabs look more like tabs and so its easier to
4411 work out which is the current tab.
4413 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4414 segfault with form_table
4416 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4418 2000-08-28 Juergen Vigna <jug@sad.it>
4420 * acconfig.h: added USE_PSPELL.
4422 * src/config.h.in: added USE_PSPELL.
4424 * autogen.sh: added pspell.m4
4426 * config/pspell.m4: new file.
4428 * src/spellchecker.C: implemented support for pspell libary.
4430 2000-08-25 Juergen Vigna <jug@sad.it>
4432 * src/LyXAction.C (init): renamed LFUN_TABLE to
4433 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4435 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4437 * src/lyxscreen.h: add force_clear variable and fuction to force
4438 a clear area when redrawing in LyXText.
4440 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4442 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4444 * some whitespace and comment changes.
4446 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4448 * src/buffer.C: up te LYX_FORMAT to 2.17
4450 2000-08-23 Juergen Vigna <jug@sad.it>
4452 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4455 * src/insets/insettabular.C (pasteSelection): delete the insets
4456 LyXText as it is not valid anymore.
4457 (copySelection): new function.
4458 (pasteSelection): new function.
4459 (cutSelection): new function.
4460 (LocalDispatch): implemented cut/copy/paste of cell selections.
4462 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4463 don't have a LyXText.
4465 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4467 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4470 2000-08-22 Juergen Vigna <jug@sad.it>
4472 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4473 ifdef form_table out if NEW_TABULAR.
4475 2000-08-21 Juergen Vigna <jug@sad.it>
4477 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4478 (draw): fixed draw position so that the cursor is positioned in the
4480 (InsetMotionNotify): hide/show cursor so the position is updated.
4481 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4482 using cellstart() function where it should be used.
4484 * src/insets/insettext.C (draw): ditto.
4486 * src/tabular.C: fixed initialization of some missing variables and
4487 made BoxType into an enum.
4489 2000-08-22 Marko Vendelin <markov@ioc.ee>
4490 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4491 stock menu item using action numerical value, not its string
4495 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4497 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4498 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4500 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4502 * src/frontends/xforms/GUIRunTime.C: new file
4504 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4505 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4507 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4509 * src/frontends/kde/GUIRunTime.C: new file
4511 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4512 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4514 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4516 * src/frontends/gnome/GUIRunTime.C: new file
4518 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4521 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4522 small change to documetentation.
4524 * src/frontends/GUIRunTime.C: removed file
4526 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4528 * src/lyxparagraph.h: enable NEW_TABULAR as default
4530 * src/lyxfunc.C (processKeySym): remove some commented code
4532 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4533 NEW_TABULAR around the fd_form_table_options.
4535 * src/lyx_gui.C (runTime): call the static member function as
4536 GUIRunTime::runTime().
4538 2000-08-21 Allan Rae <rae@lyx.org>
4540 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4543 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4545 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4547 2000-08-21 Allan Rae <rae@lyx.org>
4549 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4550 keep Garst happy ;-)
4551 * src/frontends/xforms/FormPreferences.C (build): use setOK
4552 * src/frontends/xforms/FormDocument.C (build): use setOK
4553 (FormDocument): use the appropriate policy.
4555 2000-08-21 Allan Rae <rae@lyx.org>
4557 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4558 automatic [de]activation of arbitrary objects when in a read-only state.
4560 * src/frontends/ButtonPolicies.h: More documentation
4561 (isReadOnly): added to support the above.
4563 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4565 2000-08-18 Juergen Vigna <jug@sad.it>
4567 * src/insets/insettabular.C (getStatus): changed to return func_status.
4569 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4570 display toggle menu entries if they are.
4572 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4573 new document layout now.
4575 * src/lyxfunc.C: ditto
4577 * src/lyx_gui_misc.C: ditto
4579 * src/lyx_gui.C: ditto
4581 * lib/ui/default.ui: removed paper and quotes layout as they are now
4582 all in the document layout tabbed folder.
4584 * src/frontends/xforms/forms/form_document.fd: added Restore
4585 button and callbacks for all inputs for Allan's ButtonPolicy.
4587 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4588 (CheckChoiceClass): added missing params setting on class change.
4589 (UpdateLayoutDocument): added for updating the layout on params.
4590 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4591 (FormDocument): Implemented Allan's ButtonPolicy with the
4594 2000-08-17 Allan Rae <rae@lyx.org>
4596 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4597 so we can at least see the credits again.
4599 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4600 controller calls for the appropriate callbacks. Note that since Ok
4601 calls apply followed by cancel, and apply isn't a valid input for the
4602 APPLIED state, the bc_ calls have to be made in the static callback not
4603 within each of the real callbacks.
4605 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4606 (setOk): renamed from setOkay()
4608 2000-08-17 Juergen Vigna <jug@sad.it>
4610 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4611 in the implementation part.
4612 (composeUIInfo): don't show optional menu-items.
4614 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4616 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4618 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4619 text-state when in a text-inset.
4621 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4623 2000-08-17 Marko Vendelin <markov@ioc.ee>
4624 * src/frontends/gnome/FormIndex.C
4625 * src/frontends/gnome/FormIndex.h
4626 * src/frontends/gnome/FormToc.C
4627 * src/frontends/gnome/FormToc.h
4628 * src/frontends/gnome/dialogs
4629 * src/frontends/gnome/diatoc_callbacks.c
4630 * src/frontends/gnome/diatoc_callbacks.h
4631 * src/frontends/gnome/diainsertindex_callbacks.h
4632 * src/frontends/gnome/diainsertindex_callbacks.c
4633 * src/frontends/gnome/diainsertindex_interface.c
4634 * src/frontends/gnome/diainsertindex_interface.h
4635 * src/frontends/gnome/diatoc_interface.h
4636 * src/frontends/gnome/diatoc_interface.c
4637 * src/frontends/gnome/Makefile.am: Table of Contents and
4638 Insert Index dialogs implementation for Gnome frontend
4640 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4642 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4644 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4647 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4649 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4650 destructor. Don't definde if you don't need it
4651 (processEvents): made static, non-blocking events processing for
4653 (runTime): static method. event loop for xforms
4654 * similar as above for kde and gnome.
4656 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4657 new Pimpl is correct
4658 (runTime): new method calss the real frontends runtime func.
4660 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4662 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4664 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4666 2000-08-16 Juergen Vigna <jug@sad.it>
4668 * src/lyx_gui.C (runTime): added GUII RunTime support.
4670 * src/frontends/Makefile.am:
4671 * src/frontends/GUIRunTime.[Ch]:
4672 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4673 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4674 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4676 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4678 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4679 as this is already set in ${FRONTEND_INCLUDE} if needed.
4681 * configure.in (CPPFLAGS): setting the include dir for the frontend
4682 directory and don't set FRONTEND=xforms for now as this is executed
4685 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4687 * src/frontends/kde/Makefile.am:
4688 * src/frontends/kde/FormUrl.C:
4689 * src/frontends/kde/FormUrl.h:
4690 * src/frontends/kde/formurldialog.h:
4691 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4693 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4695 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4697 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4699 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4702 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4704 * src/WorkArea.C (work_area_handler): more work to get te
4705 FL_KEYBOARD to work with xforms 0.88 too, please test.
4707 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4709 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4711 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4714 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4716 * src/Timeout.h: remove Qt::emit hack.
4718 * several files: changes to allo doc++ compilation
4720 * src/lyxfunc.C (processKeySym): new method
4721 (processKeyEvent): comment out if FL_REVISION < 89
4723 * src/WorkArea.C: change some debugging levels.
4724 (WorkArea): set wantkey to FL_KEY_ALL
4725 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4726 clearer code and the use of compose with XForms 0.89. Change to
4727 use signals instead of calling methods in bufferview directly.
4729 * src/Painter.C: change some debugging levels.
4731 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4734 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4735 (workAreaKeyPress): new method
4737 2000-08-14 Juergen Vigna <jug@sad.it>
4739 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4741 * config/kde.m4: addes some features
4743 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4744 include missing xforms dialogs.
4746 * src/Timeout.h: a hack to be able to compile with qt/kde.
4748 * sigc++/.cvsignore: added acinclude.m4
4750 * lib/.cvsignore: added listerros
4752 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4753 xforms tree as objects are needed for other frontends.
4755 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4756 linking with not yet implemented xforms objects.
4758 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4760 2000-08-14 Baruch Even <baruch.even@writeme.com>
4762 * src/frontends/xforms/FormGraphics.h:
4763 * src/frontends/xforms/FormGraphics.C:
4764 * src/frontends/xforms/RadioButtonGroup.h:
4765 * src/frontends/xforms/RadioButtonGroup.C:
4766 * src/insets/insetgraphics.h:
4767 * src/insets/insetgraphics.C:
4768 * src/insets/insetgraphicsParams.h:
4769 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4770 instead of spaces, and various other indentation issues to make the
4771 sources more consistent.
4773 2000-08-14 Marko Vendelin <markov@ioc.ee>
4775 * src/frontends/gnome/dialogs/diaprint.glade
4776 * src/frontends/gnome/FormPrint.C
4777 * src/frontends/gnome/FormPrint.h
4778 * src/frontends/gnome/diaprint_callbacks.c
4779 * src/frontends/gnome/diaprint_callbacks.h
4780 * src/frontends/gnome/diaprint_interface.c
4781 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4784 * src/frontends/gnome/dialogs/diainserturl.glade
4785 * src/frontends/gnome/FormUrl.C
4786 * src/frontends/gnome/FormUrl.h
4787 * src/frontends/gnome/diainserturl_callbacks.c
4788 * src/frontends/gnome/diainserturl_callbacks.h
4789 * src/frontends/gnome/diainserturl_interface.c
4790 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4791 Gnome implementation
4793 * src/frontends/gnome/Dialogs.C
4794 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4795 all other dialogs. Copy all unimplemented dialogs from Xforms
4798 * src/frontends/gnome/support.c
4799 * src/frontends/gnome/support.h: support files generated by Glade
4803 * config/gnome.m4: Gnome configuration scripts
4805 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4806 configure --help message
4808 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4809 only if there are no events pendling in Gnome/Gtk. This enhances
4810 the performance of menus.
4813 2000-08-14 Allan Rae <rae@lyx.org>
4815 * lib/Makefile.am: listerrors cleaning
4817 * lib/listerrors: removed -- generated file
4818 * acinclude.m4: ditto
4819 * sigc++/acinclude.m4: ditto
4821 * src/frontends/xforms/forms/form_citation.fd:
4822 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4825 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4826 `updatesrc` and now we have a `test` target that does what `updatesrc`
4827 used to do. I didn't like having an install target that wasn't related
4830 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4831 on all except FormGraphics. This may yet happen. Followed by a major
4832 cleanup including using FL_TRANSIENT for most of the dialogs. More
4833 changes to come when the ButtonController below is introduced.
4835 * src/frontends/xforms/ButtonController.h: New file for managing up to
4836 four buttons on a dialog according to an externally defined policy.
4837 * src/frontends/xforms/Makefile.am: added above
4839 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4840 Apply and Cancel/Close buttons and everything in between and beyond.
4841 * src/frontends/Makefile.am: added above.
4843 * src/frontends/xforms/forms/form_preferences.fd:
4844 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4845 and removed variable 'status' as a result. Fixed the set_minsize thing.
4846 Use the new screen-font-update after checking screen fonts were changed
4847 Added a "Restore" button to restore the original lyxrc values while
4848 editing. This restores everything not just the last input changed.
4849 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4851 * src/LyXAction.C: screen-font-update added for updating buffers after
4852 screen font settings have been changed.
4853 * src/commandtags.h: ditto
4854 * src/lyxfunc.C: ditto
4856 * forms/lyx.fd: removed screen fonts dialog.
4857 * src/lyx_gui.C: ditto
4858 * src/menus.[Ch]: ditto
4859 * src/lyx.[Ch]: ditto
4860 * src/lyx_cb.C: ditto + code from here moved to make
4861 screen-font-update. And people wonder why progress on GUII is
4862 slow. Look at how scattered this stuff was! It takes forever
4865 * forms/fdfix.sh: Fixup the spacing after commas.
4866 * forms/makefile: Remove date from generated files. Fewer clashes now.
4867 * forms/bullet_forms.C.patch: included someones handwritten changes
4869 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4870 once I've discovered why LyXRC was made noncopyable.
4871 * src/lyx_main.C: ditto
4873 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4875 * src/frontends/xforms/forms/fdfix.sh:
4876 * src/frontends/xforms/forms/fdfixh.sed:
4877 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4878 * src/frontends/xforms/Form*.[hC]:
4879 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4880 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4881 provide a destructor for the struct FD_form_xxxx. Another version of
4882 the set_[max|min]size workaround and a few other cleanups. Actually,
4883 Angus' patch from 20000809.
4885 2000-08-13 Baruch Even <baruch.even@writeme.com>
4887 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4890 2000-08-11 Juergen Vigna <jug@sad.it>
4892 * src/insets/insetgraphics.C (InsetGraphics): changing init
4893 order because of warnings.
4895 * src/frontends/xforms/forms/makefile: adding patching .C with
4898 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4899 from .C.patch to .c.patch
4901 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4902 order because of warning.
4904 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4906 * src/frontends/Liason.C (setMinibuffer): new helper function
4908 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4910 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4912 * lib/ui/default.ui: commented out PaperLayout entry
4914 * src/frontends/xforms/form_document.[Ch]: new added files
4916 * src/frontends/xforms/FormDocument.[Ch]: ditto
4918 * src/frontends/xforms/forms/form_document.fd: ditto
4920 * src/frontends/xforms/forms/form_document.C.patch: ditto
4922 2000-08-10 Juergen Vigna <jug@sad.it>
4924 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4925 (InsetGraphics): initialized cacheHandle to 0.
4926 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4928 2000-08-10 Baruch Even <baruch.even@writeme.com>
4930 * src/graphics/GraphicsCache.h:
4931 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4932 correctly as a cache.
4934 * src/graphics/GraphicsCacheItem.h:
4935 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4938 * src/graphics/GraphicsCacheItem_pimpl.h:
4939 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4942 * src/insets/insetgraphics.h:
4943 * src/insets/insetgraphics.C: Changed from using a signal notification
4944 to polling when image is not loaded.
4946 2000-08-10 Allan Rae <rae@lyx.org>
4948 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4949 that there are two functions that have to been taken out of line by
4950 hand and aren't taken care of in the script. (Just a reminder note)
4952 * sigc++/macros/*.h.m4: Updated as above.
4954 2000-08-09 Juergen Vigna <jug@sad.it>
4956 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4958 * src/insets/insettabular.C: make drawing of single cell smarter.
4960 2000-08-09 Marko Vendelin <markov@ioc.ee>
4961 * src/frontends/gnome/Menubar_pimpl.C
4962 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4963 implementation: new files
4965 * src/frontends/gnome/mainapp.C
4966 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4969 * src/main.C: create Gnome main window
4971 * src/frontends/xforms/Menubar_pimpl.h
4972 * src/frontends/Menubar.C
4973 * src/frontends/Menubar.h: added method Menubar::update that calls
4974 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4976 * src/LyXView.C: calls Menubar::update to update the state
4979 * src/frontends/gnome/Makefile.am: added new files
4981 * src/frontends/Makefile.am: added frontend compiler options
4983 2000-08-08 Juergen Vigna <jug@sad.it>
4985 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4987 * src/bufferlist.C (close):
4988 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4989 documents if exiting without saving.
4991 * src/buffer.C (save): use removeAutosaveFile()
4993 * src/support/filetools.C (removeAutosaveFile): new function.
4995 * src/lyx_cb.C (MenuWrite): returns a bool now.
4996 (MenuWriteAs): check if file could really be saved and revert to the
4998 (MenuWriteAs): removing old autosavefile if existant.
5000 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5001 before Goto toggle declaration, because of compiler warning.
5003 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5005 * src/lyxfunc.C (MenuNew): small fix.
5007 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5009 * src/bufferlist.C (newFile):
5010 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5012 * src/lyxrc.C: added new_ask_filename tag
5014 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5016 * src/lyx.fd: removed code pertaining to form_ref
5017 * src/lyx.[Ch]: ditto
5018 * src/lyx_cb.C: ditto
5019 * src/lyx_gui.C: ditto
5020 * src/lyx_gui_misc.C: ditto
5022 * src/BufferView_pimpl.C (restorePosition): update buffer only
5025 * src/commandtags.h (LFUN_REFTOGGLE): removed
5026 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5027 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5028 (LFUN_REFBACK): renamed LFUN_REF_BACK
5030 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5031 * src/menus.C: ditto
5032 * src/lyxfunc.C (Dispatch): ditto.
5033 InsertRef dialog is now GUI-independent.
5035 * src/texrow.C: added using std::endl;
5037 * src/insets/insetref.[Ch]: strip out large amounts of code.
5038 The inset is now a container and this functionality is now
5039 managed by a new FormRef dialog
5041 * src/frontends/Dialogs.h (showRef, createRef): new signals
5043 * src/frontends/xforms/FormIndex.[Ch],
5044 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5045 when setting dialog's min/max size
5046 * src/frontends/xforms/FormIndex.[Ch]: ditto
5048 * src/frontends/xforms/FormRef.[Ch],
5049 src/frontends/xforms/forms/form_ref.fd: new xforms
5050 implementation of an InsetRef dialog
5052 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5055 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5056 ios::nocreate is not part of the standard. Removed.
5058 2000-08-07 Baruch Even <baruch.even@writeme.com>
5060 * src/graphics/Renderer.h:
5061 * src/graphics/Renderer.C: Added base class for rendering of different
5062 image formats into Pixmaps.
5064 * src/graphics/XPM_Renderer.h:
5065 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5066 in a different class.
5068 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5069 easily add support for other formats.
5071 * src/insets/figinset.C: plugged a leak of an X resource.
5073 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5075 * src/CutAndPaste.[Ch]: make all metods static.
5077 * development/Code_rules/Rules: more work, added section on
5078 Exceptions, and a References section.
5080 * a lot of header files: work to make doc++ able to generate the
5081 source documentation, some workarounds of doc++ problems. Doc++ is
5082 now able to generate the documentation.
5084 2000-08-07 Juergen Vigna <jug@sad.it>
5086 * src/insets/insettabular.C (recomputeTextInsets): removed function
5088 * src/tabular.C (SetWidthOfMulticolCell):
5090 (calculate_width_of_column_NMC): fixed return value so that it really
5091 only returns true if the column-width has changed (there where
5092 problems with muliticolumn-cells in this column).
5094 2000-08-04 Juergen Vigna <jug@sad.it>
5096 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5097 also on the scrollstatus of the inset.
5098 (workAreaMotionNotify): ditto.
5100 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5102 2000-08-01 Juergen Vigna <jug@sad.it>
5104 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5106 * src/commandtags.h:
5107 * src/LyXAction.C (init):
5108 * src/insets/inset.C (LocalDispatch): added support for
5111 * src/insets/inset.C (scroll): new functions.
5113 * src/insets/insettext.C (removeNewlines): new function.
5114 (SetAutoBreakRows): removes forced newlines in the text of the
5115 paragraph if autoBreakRows is set to false.
5117 * src/tabular.C (Latex): generates a parbox around the cell contents
5120 * src/frontends/xforms/FormTabular.C (local_update): removed
5121 the radio_useparbox button.
5123 * src/tabular.C (UseParbox): new function
5125 2000-08-06 Baruch Even <baruch.even@writeme.com>
5127 * src/graphics/GraphicsCache.h:
5128 * src/graphics/GraphicsCache.C:
5129 * src/graphics/GraphicsCacheItem.h:
5130 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5133 * src/insets/insetgraphics.h:
5134 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5135 and the drawing of the inline image.
5137 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5138 loaded into the wrong position.
5140 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5143 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5145 * src/support/translator.h: move all typedefs to public section
5147 * src/support/filetools.C (MakeLatexName): return string const
5149 (TmpFileName): ditto
5150 (FileOpenSearch): ditto
5152 (LibFileSearch): ditto
5153 (i18nLibFileSearch): ditto
5156 (CreateTmpDir): ditto
5157 (CreateBufferTmpDir): ditto
5158 (CreateLyXTmpDir): ditto
5161 (MakeAbsPath): ditto
5163 (OnlyFilename): ditto
5165 (NormalizePath): ditto
5166 (CleanupPath): ditto
5167 (GetFileContents): ditto
5168 (ReplaceEnvironmentPath): ditto
5169 (MakeRelPath): ditto
5171 (ChangeExtension): ditto
5172 (MakeDisplayPath): ditto
5173 (do_popen): return cmdret const
5174 (findtexfile): return string const
5176 * src/support/DebugStream.h: add some /// to please doc++
5178 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5180 * src/texrow.C (same_rownumber): functor to use with find_if
5181 (getIdFromRow): rewritten to use find_if and to not update the
5182 positions. return true if row is found
5183 (increasePos): new method, use to update positions
5185 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5187 * src/lyxlex_pimpl.C (verifyTable): new method
5190 (GetString): return string const
5191 (pushTable): rewrite to use std::stack
5193 (setFile): better check
5196 * src/lyxlex.h: make LyXLex noncopyable
5198 * src/lyxlex.C (text): return char const * const
5199 (GetString): return string const
5200 (getLongString): return string const
5202 * src/lyx_gui_misc.C (askForText): return pair<...> const
5204 * src/lastfiles.[Ch] (operator): return string const
5206 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5207 istringstream not char const *.
5208 move token.end() out of loop.
5209 (readFile): move initializaton of token
5211 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5212 getIdFromRow is successful.
5214 * lib/bind/emacs.bind: don't include menus bind
5216 * development/Code_rules/Rules: the beginnings of making this
5217 better and covering more of the unwritten rules that we have.
5219 * development/Code_rules/Recommendations: a couple of wording
5222 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5224 * src/support/strerror.c: remove C++ comment.
5226 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5228 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5229 LFUN_INDEX_INSERT_LAST
5231 * src/texrow.C (getIdFromRow): changed from const_iterator to
5232 iterator, allowing code to compile with DEC cxx
5234 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5235 stores part of the class, as suggested by Allan. Will allow
5237 (apply): test to apply uses InsetCommandParams operator!=
5239 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5240 (apply): test to apply uses InsetCommandParams operator!=
5242 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5243 stores part of the class.
5244 (update): removed limits on min/max size.
5246 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5247 (apply): test to apply uses InsetCommandParams operator!=
5249 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5250 (Read, Write, scanCommand, getCommand): moved functionality
5251 into InsetCommandParams.
5253 (getScreenLabel): made pure virtual
5254 new InsetCommandParams operators== and !=
5256 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5257 c-tors based on InsetCommandParams. Removed others.
5258 * src/insets/insetinclude.[Ch]: ditto
5259 * src/insets/insetlabel.[Ch]: ditto
5260 * src/insets/insetparent.[Ch]: ditto
5261 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5263 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5264 insets derived from InsetCommand created using similar c-tors
5265 based on InsetCommandParams
5266 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5267 * src/menus.C (ShowRefsMenu): ditto
5268 * src/paragraph.C (Clone): ditto
5269 * src/text2.C (SetCounter): ditto
5270 * src/lyxfunc.C (Dispatch) ditto
5271 Also recreated old InsetIndex behaviour exactly. Can now
5272 index-insert at the start of a paragraph and index-insert-last
5273 without launching the pop-up.
5275 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5277 * lib/lyxrc.example: mark te pdf options as non functional.
5279 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5280 (isStrDbl): move tmpstr.end() out of loop.
5281 (strToDbl): move intialization of tmpstr
5282 (lowercase): return string const and move tmp.end() out of loop.
5283 (uppercase): return string const and move tmp.edn() out of loop.
5284 (prefixIs): add assertion
5289 (containsOnly): ditto
5290 (containsOnly): ditto
5291 (containsOnly): ditto
5292 (countChar): make last arg char not char const
5293 (token): return string const
5294 (subst): return string const, move tmp.end() out of loop.
5295 (subst): return string const, add assertion
5296 (strip): return string const
5297 (frontStrip): return string const, add assertion
5298 (frontStrip): return string const
5303 * src/support/lstrings.C: add inclde "LAssert.h"
5304 (isStrInt): move tmpstr.end() out of loop.
5306 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5307 toollist.end() out of loop.
5308 (deactivate): move toollist.end() out of loop.
5309 (update): move toollist.end() out of loop.
5310 (updateLayoutList): move tc.end() out of loop.
5311 (add): move toollist.end() out of loop.
5313 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5314 md.end() out of loop.
5316 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5318 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5321 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5322 (Erase): move insetlist.end() out of loop.
5324 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5325 ref to const string as first arg. Move initialization of some
5326 variables, whitespace changes.
5328 * src/kbmap.C (defkey): move table.end() out of loop.
5329 (kb_keymap): move table.end() out of loop.
5330 (findbinding): move table.end() out of loop.
5332 * src/MenuBackend.C (hasMenu): move end() out of loop.
5333 (getMenu): move end() out of loop.
5334 (getMenu): move menulist_.end() out of loop.
5336 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5338 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5341 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5342 (getFromLyXName): move infotab.end() out of loop.
5344 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5345 -fvtable-thunks -ffunction-sections -fdata-sections
5347 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5349 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5352 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5354 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5356 * src/frontends/xforms/FormCitation.[Ch],
5357 src/frontends/xforms/FormIndex.[Ch],
5358 src/frontends/xforms/FormToc.[Ch],
5359 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5361 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5363 * src/commandtags.h: renamed, created some flags for citation
5366 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5368 * src/lyxfunc.C (dispatch): use signals to insert index entry
5370 * src/frontends/Dialogs.h: new signal createIndex
5372 * src/frontends/xforms/FormCommand.[Ch],
5373 src/frontends/xforms/FormCitation.[Ch],
5374 src/frontends/xforms/FormToc.[Ch],
5375 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5377 * src/insets/insetindex.[Ch]: GUI-independent
5379 * src/frontends/xforms/FormIndex.[Ch],
5380 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5383 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5385 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5386 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5388 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5390 * src/insets/insetref.C (Latex): rewrite so that there is now
5391 question that a initialization is requested.
5393 * src/insets/insetcommand.h: reenable the hide signal
5395 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5397 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5398 fix handling of shortcuts (many bugs :)
5399 (add_lastfiles): ditto.
5401 * lib/ui/default.ui: fix a few shortcuts.
5403 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5405 * Makefile.am: Fix ``rpmdist'' target to return the exit
5406 status of the ``rpm'' command, instead of the last command in
5407 the chain (the ``rm lyx.xpm'' command, which always returns
5410 2000-08-02 Allan Rae <rae@lyx.org>
5412 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5413 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5414 * src/frontends/xforms/FormToc.C (FormToc): ditto
5416 * src/frontends/xforms/Makefile.am: A few forgotten files
5418 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5419 Signals-not-copyable-problem Lars' started commenting out.
5421 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5423 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5425 * src/insets/insetcommand.h: Signals is not copyable so anoter
5426 scheme for automatic hiding of forms must be used.
5428 * src/frontends/xforms/FormCitation.h: don't inerit from
5429 noncopyable, FormCommand already does that.
5430 * src/frontends/xforms/FormToc.h: ditto
5431 * src/frontends/xforms/FormUrl.h: ditto
5433 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5435 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5437 * src/insets/insetcommand.h (hide): new SigC::Signal0
5438 (d-tor) new virtual destructor emits hide signal
5440 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5441 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5443 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5444 LOF and LOT. Inset is now GUI-independent
5446 * src/insets/insetloa.[Ch]: redundant
5447 * src/insets/insetlof.[Ch]: ditto
5448 * src/insets/insetlot.[Ch]: ditto
5450 * src/frontends/xforms/forms/form_url.fd: tweaked!
5451 * src/frontends/xforms/forms/form_citation.fd: ditto
5453 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5454 dialogs dealing with InsetCommand insets
5456 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5457 FormCommand base class
5458 * src/frontends/xforms/FormUrl.[Ch]: ditto
5460 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5462 * src/frontends/xforms/FormToc.[Ch]: ditto
5464 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5465 passed a generic InsetCommand pointer
5466 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5468 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5469 and modified InsetTOC class
5470 * src/buffer.C: ditto
5472 * forms/lyx.fd: strip out old FD_form_toc code
5473 * src/lyx_gui_misc.C: ditto
5474 * src/lyx_gui.C: ditto
5475 * src/lyx_cb.C: ditto
5476 * src/lyx.[Ch]: ditto
5478 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5480 * src/support/utility.hpp: tr -d '\r'
5482 2000-08-01 Juergen Vigna <jug@sad.it>
5484 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5486 * src/commandtags.h:
5487 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5488 LFUN_TABULAR_FEATURES.
5490 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5491 LFUN_LAYOUT_TABULAR.
5493 * src/insets/insettabular.C (getStatus): implemented helper function.
5495 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5497 2000-07-31 Juergen Vigna <jug@sad.it>
5499 * src/text.C (draw): fixed screen update problem for text-insets.
5501 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5502 something changed probably this has to be added in various other
5505 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5507 2000-07-31 Baruch Even <baruch.even@writeme.com>
5509 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5510 templates to satisfy compaq cxx.
5513 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5515 * src/support/translator.h (equal_1st_in_pair::operator()): take
5516 const ref pair_type as arg.
5517 (equal_2nd_in_pair::operator()): ditto
5518 (Translator::~Translator): remove empty d-tor.
5520 * src/graphics/GraphicsCache.C: move include config.h to top, also
5521 put initialization of GraphicsCache::singleton here.
5522 (~GraphicsCache): move here
5523 (addFile): take const ref as arg
5526 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5528 * src/BufferView2.C (insertLyXFile): change te with/without header
5531 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5533 * src/frontends/xforms/FormGraphics.C (apply): add some
5534 static_cast. Not very nice, but required by compaq cxx.
5536 * src/frontends/xforms/RadioButtonGroup.h: include header
5537 <utility> instead of <pair.h>
5539 * src/insets/insetgraphicsParams.C: add using directive.
5540 (readResize): change return type to void.
5541 (readOrigin): ditto.
5543 * src/lyxfunc.C (getStatus): add missing break for build-program
5544 function; add test for Literate for export functions.
5546 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5547 entries in Options menu.
5549 2000-07-31 Baruch Even <baruch.even@writeme.com>
5551 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5552 protect against auto-allocation; release icon when needed.
5554 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5556 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5557 on usual typewriter.
5559 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5560 earlier czech.kmap), useful only for programming.
5562 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5564 * src/frontends/xforms/FormCitation.h: fix conditioning around
5567 2000-07-31 Juergen Vigna <jug@sad.it>
5569 * src/frontends/xforms/FormTabular.C (local_update): changed
5570 radio_linebreaks to radio_useparbox and added radio_useminipage.
5572 * src/tabular.C: made support for using minipages/parboxes.
5574 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5576 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5578 (descent): so the cursor is in the middle.
5579 (width): bit smaller box.
5581 * src/insets/insetgraphics.h: added display() function.
5583 2000-07-31 Baruch Even <baruch.even@writeme.com>
5585 * src/frontends/Dialogs.h: Added showGraphics signals.
5587 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5588 xforms form definition of the graphics dialog.
5590 * src/frontends/xforms/FormGraphics.h:
5591 * src/frontends/xforms/FormGraphics.C: Added files, the
5592 GUIndependent code of InsetGraphics
5594 * src/insets/insetgraphics.h:
5595 * src/insets/insetgraphics.C: Major writing to make it work.
5597 * src/insets/insetgraphicsParams.h:
5598 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5599 struct between InsetGraphics and GUI.
5601 * src/LaTeXFeatures.h:
5602 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5603 support for graphicx package.
5605 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5606 for the graphics inset.
5608 * src/support/translator.h: Added file, used in
5609 InsetGraphicsParams. this is a template to translate between two
5612 * src/frontends/xforms/RadioButtonGroup.h:
5613 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5614 way to easily control a radio button group.
5616 2000-07-28 Juergen Vigna <jug@sad.it>
5618 * src/insets/insettabular.C (LocalDispatch):
5619 (TabularFeatures): added support for lyx-functions of tabular features.
5620 (cellstart): refixed this function after someone wrongly changed it.
5622 * src/commandtags.h:
5623 * src/LyXAction.C (init): added support for tabular-features
5625 2000-07-28 Allan Rae <rae@lyx.org>
5627 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5628 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5629 triggers the callback for input checking. As a result we sometimes get
5630 "LyX: This shouldn't happen..." printed to cerr.
5631 (input): Started using status variable since I only free() on
5632 destruction. Some input checking for paths and font sizes.
5634 * src/frontends/xforms/FormPreferences.h: Use status to control
5635 activation of Ok and Apply
5637 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5638 callback. Also resized to stop segfaults with 0.88. The problem is
5639 that xforms-0.88 requires the folder to be wide enough to fit all the
5640 tabs. If it isn't it causes all sorts of problems.
5642 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5644 * src/frontends/xforms/forms/README: Reflect reality.
5646 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5647 * src/frontends/xforms/forms/makefile: ditto.
5649 * src/commandtags.h: Get access to new Preferences dialog
5650 * src/LyXAction.C: ditto
5651 * src/lyxfunc.C: ditto
5652 * lib/ui/default.ui: ditto
5654 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5656 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5658 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5661 * src/frontends/xforms/form_url.[Ch]: added.
5663 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5665 * src/insets/insetbib.h: fixed bug in previous commit
5667 * src/frontends/xforms/FormUrl.h: ditto
5669 * src/frontends/xforms/FormPrint.h: ditto
5671 * src/frontends/xforms/FormPreferences.h: ditto
5673 * src/frontends/xforms/FormCopyright.h: ditto
5675 * src/frontends/xforms/FormCitation.C: ditto
5677 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5678 private copyconstructor and private default contructor
5680 * src/support/Makefile.am: add utility.hpp
5682 * src/support/utility.hpp: new file from boost
5684 * src/insets/insetbib.h: set owner in clone
5686 * src/frontends/xforms/FormCitation.C: added missing include
5689 * src/insets/form_url.[Ch]: removed
5691 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5693 * development/lyx.spec.in
5694 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5695 file/directory re-organization.
5697 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5699 * src/insets/insetcommand.[Ch]: moved the string data and
5700 associated manipulation methods into a new stand-alone class
5701 InsetCommandParams. This class has two additional methods
5702 getAsString() and setFromString() allowing the contents to be
5703 moved around as a single string.
5704 (addContents) method removed.
5705 (setContents) method no longer virtual.
5707 * src/buffer.C (readInset): made use of new InsetCitation,
5708 InsetUrl constructors based on InsetCommandParams.
5710 * src/commandtags.h: add LFUN_INSERT_URL
5712 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5713 independent InsetUrl and use InsetCommandParams to extract
5714 string info and create new Insets.
5716 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5718 * src/frontends/xforms/FormCitation.C (apply): uses
5721 * src/frontends/xforms/form_url.C
5722 * src/frontends/xforms/form_url.h
5723 * src/frontends/xforms/FormUrl.h
5724 * src/frontends/xforms/FormUrl.C
5725 * src/frontends/xforms/forms/form_url.fd: new files
5727 * src/insets/insetcite.[Ch]: removed unused constructors.
5729 * src/insets/insetinclude.[Ch]: no longer store filename
5731 * src/insets/inseturl.[Ch]: GUI-independent.
5733 2000-07-26 Juergen Vigna <jug@sad.it>
5734 * renamed frontend from gtk to gnome as it is that what is realized
5735 and did the necessary changes in the files.
5737 2000-07-26 Marko Vendelin <markov@ioc.ee>
5739 * configure.in: cleaning up gnome configuration scripts
5741 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5743 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5744 shortcuts syndrom by redrawing them explicitely (a better solution
5745 would be appreciated).
5747 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5749 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5752 * src/lyx_cb.C (MenuExport): change html export to do the right
5753 thing depending of the document type (instead of having
5754 html-linuxdoc and html-docbook).
5755 * src/lyxfunc.C (getStatus): update for html
5756 * lib/ui/default.ui: simplify due to the above change.
5757 * src/menus.C (ShowFileMenu): update too (in case we need it).
5759 * src/MenuBackend.C (read): if a menu is defined twice, add the
5760 new entries to the exiting one.
5762 2000-07-26 Juergen Vigna <jug@sad.it>
5764 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5766 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5767 and return a bool if it did actual save the file.
5768 (AutoSave): don't autosave a unnamed doc.
5770 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5771 check if this is an UNNAMED new file and react to it.
5772 (newFile): set buffer to unnamed and change to not mark a new
5773 buffer dirty if I didn't do anything with it.
5775 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5777 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5779 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5780 friend as per Angus's patch posted to lyx-devel.
5782 * src/ext_l10n.h: updated
5784 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5785 gettext on the style string right before inserting them into the
5788 * autogen.sh: add code to extract style strings form layout files,
5789 not good enough yet.
5791 * src/frontends/gtk/.cvsignore: add MAKEFILE
5793 * src/MenuBackend.C (read): run the label strings through gettext
5794 before storing them in the containers.
5796 * src/ext_l10n.h: new file
5798 * autogen.sh : generate the ext_l10n.h file here
5800 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5802 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5805 * lib/ui/default.ui: fix a couple of typos.
5807 * config/gnome/gtk.m4: added (and added to the list of files in
5810 * src/insets/insetinclude.C (unique_id): fix when we are using
5811 lyxstring instead of basic_string<>.
5812 * src/insets/insettext.C (LocalDispatch): ditto.
5813 * src/support/filetools.C: ditto.
5815 * lib/configure.m4: create the ui/ directory if necessary.
5817 * src/LyXView.[Ch] (updateToolbar): new method.
5819 * src/BufferView_pimpl.C (buffer): update the toolbar when
5820 opening/closing buffer.
5822 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5824 * src/LyXAction.C (getActionName): enhance to return also the name
5825 and options of pseudo-actions.
5826 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5828 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5829 as an example of what is possible). Used in File->Build too (more
5830 useful) and in the import/export menus (to mimick the complicated
5831 handling of linuxdoc and friends). Try to update all the entries.
5833 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5836 * src/MenuBackend.C (read): Parse the new OptItem tag.
5838 * src/MenuBackend.h: Add a new optional_ data member (used if the
5839 entry should be omitted when the lyxfunc is disabled).
5841 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5842 function, used as a shortcut.
5843 (create_submenu): align correctly the shortcuts on the widest
5846 * src/MenuBackend.h: MenuItem.label() only returns the label of
5847 the menu without shortcut; new method shortcut().
5849 2000-07-14 Marko Vendelin <markov@ioc.ee>
5851 * src/frontends/gtk/Dialogs.C:
5852 * src/frontends/gtk/FormCopyright.C:
5853 * src/frontends/gtk/FormCopyright.h:
5854 * src/frontends/gtk/Makefile.am: added these source-files for the
5855 Gtk/Gnome support of the Copyright-Dialog.
5857 * src/main.C: added Gnome::Main initialization if using
5858 Gtk/Gnome frontend-GUI.
5860 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5862 * config/gnome/aclocal-include.m4
5863 * config/gnome/compiler-flags.m4
5864 * config/gnome/curses.m4
5865 * config/gnome/gnome--.m4
5866 * config/gnome/gnome-bonobo-check.m4
5867 * config/gnome/gnome-common.m4
5868 * config/gnome/gnome-fileutils.m4
5869 * config/gnome/gnome-ghttp-check.m4
5870 * config/gnome/gnome-gnorba-check.m4
5871 * config/gnome/gnome-guile-checks.m4
5872 * config/gnome/gnome-libgtop-check.m4
5873 * config/gnome/gnome-objc-checks.m4
5874 * config/gnome/gnome-orbit-check.m4
5875 * config/gnome/gnome-print-check.m4
5876 * config/gnome/gnome-pthread-check.m4
5877 * config/gnome/gnome-support.m4
5878 * config/gnome/gnome-undelfs.m4
5879 * config/gnome/gnome-vfs.m4
5880 * config/gnome/gnome-x-checks.m4
5881 * config/gnome/gnome-xml-check.m4
5882 * config/gnome/gnome.m4
5883 * config/gnome/gperf-check.m4
5884 * config/gnome/gtk--.m4
5885 * config/gnome/linger.m4
5886 * config/gnome/need-declaration.m4: added configuration scripts
5887 for Gtk/Gnome frontend-GUI
5889 * configure.in: added support for the --with-frontend=gtk option
5891 * autogen.sh: added config/gnome/* to list of config-files
5893 * acconfig.h: added define for GTKGUI-support
5895 * config/lyxinclude.m4: added --with-frontend[=value] option value
5896 for Gtk/Gnome frontend-GUI support.
5898 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5900 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5904 * src/paragraph.C (GetChar): remove non-const version
5906 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5907 (search_kw): use it.
5909 * src/lyx_main.C (init): if "preferences" exist, read that instead
5911 (ReadRcFile): return bool if the file could be read ok.
5912 (ReadUIFile): add a check to see if lex file is set ok.
5914 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5915 bastring can be used instead of lyxstring (still uses the old code
5916 if std::string is good enough or if lyxstring is used.)
5918 * src/encoding.C: make the arrays static, move ininle functions
5920 * src/encoding.h: from here.
5922 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5923 (parseSingleLyXformat2Token): move inset parsing to separate method
5924 (readInset): new private method
5926 * src/Variables.h: remove virtual from get().
5928 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5929 access to NEW_INSETS and NEW_TABULAR
5931 * src/MenuBackend.h: remove superfluous forward declaration of
5932 MenuItem. Add documentations tags "///", remove empty MenuItem
5933 destructor, remove private default contructor.
5935 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5937 (read): more string mlabel and mname to where they are used
5938 (read): remove unused variables mlabel and mname
5939 (defaults): unconditional clear, make menusetup take advantage of
5940 add returning Menu &.
5942 * src/LyXView.h: define NEW_MENUBAR as default
5944 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5945 to NEW_INSETS and NEW_TABULAR.
5946 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5947 defined. Change some of the "xxxx-inset-insert" functions names to
5950 * several files: more enahncements to NEW_INSETS and the resulting
5953 * lib/lyxrc.example (\date_insert_format): move to misc section
5955 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5956 bastring and use AC_CACHE_CHECK.
5957 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5958 the system have the newest methods. uses AC_CACHE_CHECK
5959 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5960 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5961 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5963 * configure.in: add LYX_CXX_GOOD_STD_STRING
5965 * acinclude.m4: recreated
5967 2000-07-24 Amir Karger <karger@lyx.org>
5969 * README: add Hebrew, Arabic kmaps
5972 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5974 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5977 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5979 * Lot of files: add pragma interface/implementation.
5981 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5983 * lib/ui/default.ui: new file (ans new directory). Contains the
5984 default menu and toolbar.
5986 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5987 global space. Toolbars are now read (as menus) in ui files.
5989 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5991 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5992 is disabled because the document is read-only. We want to have the
5993 toggle state of the function anyway.
5994 (getStatus): add code for LFUN_VC* functions (mimicking what is
5995 done in old-style menus)
5997 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5998 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6000 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6001 * src/BufferView_pimpl.C: ditto.
6002 * src/lyxfunc.C: ditto.
6004 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6005 default). This replaces old-style menus by new ones.
6007 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6008 MenuItem. Contain the data structure of a menu.
6010 * src/insets/insettext.C: use LyXView::setLayout instead of
6011 accessing directly the toolbar combox.
6012 * src/lyxfunc.C (Dispatch): ditto.
6014 * src/LyXView.C (setLayout): new method, which just calls
6015 Toolbar::setLayout().
6016 (updateLayoutChoice): move part of this method in Toolbar.
6018 * src/toolbar.[Ch]: removed.
6020 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6021 implementation the toolbar.
6023 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6024 the toolbar. It might make sense to merge it with ToolbarDefaults
6026 (setLayout): new function.
6027 (updateLayoutList): ditto.
6028 (openLayoutList): ditto.
6030 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6031 xforms implementation of the toolbar.
6032 (get_toolbar_func): comment out, since I do not
6033 know what it is good for.
6035 * src/ToolbarDefaults.h: Add the ItemType enum.
6037 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6038 for a list of allocated C strings. Used in Menubar xforms
6039 implementation to avoid memory leaks.
6041 * src/support/lstrings.[Ch] (uppercase): new version taking and
6045 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6046 * lib/bind/emacs.bind: ditto.
6048 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6050 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6051 forward decl of LyXView.
6053 * src/toolbar.C (toolbarItem): moved from toolbar.h
6054 (toolbarItem::clean): ditto
6055 (toolbarItem::~toolbarItem): ditto
6056 (toolbarItem::operator): ditto
6058 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6060 * src/paragraph.h: control the NEW_TABULAR define from here
6062 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6063 USE_TABULAR_INSETS to NEW_TABULAR
6065 * src/ToolbarDefaults.C: add include "lyxlex.h"
6067 * files using the old table/tabular: use NEW_TABULAR to control
6068 compilation of old tabular stuff.
6070 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6073 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6074 planemet in reading of old style floats, fix the \end_deeper
6075 problem when reading old style floats.
6077 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6079 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6081 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6083 * lib/bind/sciword.bind: updated.
6085 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6087 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6088 layout write problem
6090 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6092 * src/Makefile.am (INCLUDES): remove image directory from include
6095 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6096 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6098 * src/LyXView.C (create_form_form_main): read the application icon
6101 * lib/images/*.xpm: change the icons to use transparent color for
6104 * src/toolbar.C (update): change the color of the button when it
6107 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6109 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6110 setting explicitely the minibuffer.
6111 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6113 * src/LyXView.C (showState): new function. Shows font information
6114 in minibuffer and update toolbar state.
6115 (LyXView): call Toolbar::update after creating the
6118 * src/toolbar.C: change toollist to be a vector instead of a
6120 (BubbleTimerCB): get help string directly from the callback
6121 argument of the corresponding icon (which is the action)
6122 (set): remove unnecessary ugliness.
6123 (update): new function. update the icons (depressed, disabled)
6124 depending of the status of the corresponding action.
6126 * src/toolbar.h: remove help in toolbarItem
6128 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6130 * src/Painter.C (text): Added code for using symbol glyphs from
6131 iso10646 fonts. Currently diabled.
6133 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6136 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6137 magyar,turkish and usorbian.
6139 * src/paragraph.C (isMultiLingual): Made more efficient.
6141 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6144 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6145 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6146 Also changed the prototype to "bool math_insert_greek(char)".
6148 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6150 * lots of files: apply the NEW_INSETS on all code that will not be
6151 needed when we move to use the new insets. Enable the define in
6152 lyxparagrah.h to try it.
6154 * src/insets/insettabular.C (cellstart): change to be a static
6156 (InsetTabular): initialize buffer in the initializer list.
6158 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6160 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6161 form_print.h out of the header file. Replaced with forward
6162 declarations of the relevant struct.
6164 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6167 * src/commandtags.h: do not include "debug.h" which does not
6168 belong there. #include it in some other places because of this
6171 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6173 * src/insets/insetcaption.C: add a couple "using" directives.
6175 * src/toolbar.C (add): get the help text directly from lyxaction.
6177 (setPixmap): new function. Loads from disk and sets a pixmap on a
6178 botton; the name of the pixmap file is derived from the command
6181 * src/toolbar.h: remove members isBitmap and pixmap from
6184 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6185 * lib/images/: move many files from images/banner.xpm.
6187 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6189 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6190 * src/toolbar.C: ditto.
6191 * configure.in: ditto.
6192 * INSTALL: document.
6194 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6195 the spellchecker popup is closed from the WM.
6197 2000-07-19 Juergen Vigna <jug@sad.it>
6199 * src/insets/insetfloat.C (Write): small fix because we use the
6200 insetname for the type now!
6202 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6204 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6207 * src/frontends/Dialogs.h: removed hideCitation signal
6209 * src/insets/insetcite.h: added hide signal
6211 * src/insets/insetcite.C (~InsetCitation): emits new signal
6212 (getScreenLabel): "intelligent" label should now fit on the screen!
6214 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6216 * src/frontends/xforms/FormCitation.C (showInset): connects
6217 hide() to the inset's hide signal
6218 (show): modified to use fl_set_object_position rather than
6219 fl_set_object_geometry wherever possible
6221 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6223 * src/insets/lyxinset.h: add caption code
6225 * src/insets/insetfloat.C (type): new method
6227 * src/insets/insetcaption.C (Write): new method
6229 (LyxCode): new method
6231 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6232 to get it right together with using the FloatList.
6234 * src/commandtags.h: add LFUN_INSET_CAPTION
6235 * src/lyxfunc.C (Dispatch): handle it
6237 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6240 * src/Variables.[Ch]: make expand take a const reference, remove
6241 the destructor, some whitespace changes.
6243 * src/LyXAction.C (init): add caption-inset-insert
6245 * src/FloatList.C (FloatList): update the default floats a bit.
6247 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6249 * src/Variables.[Ch]: new files. Intended to be used for language
6250 specific strings (like \chaptername) and filename substitution in
6253 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6255 * lib/kbd/american.kmap: update
6257 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6259 * src/bufferparams.[Ch]: remove member allowAccents.
6261 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6263 * src/LaTeXLog.C: use the log_form.h header.
6264 * src/lyx_gui.C: ditto.
6265 * src/lyx_gui_misc.C: ditto.
6266 * src/lyxvc.h: ditto.
6268 * forms/log_form.fd: new file, created from latexoptions.fd. I
6269 kept the log popup and nuked the options form.
6271 * src/{la,}texoptions.[Ch]: removed.
6272 * src/lyx_cb.C (LaTeXOptions): ditto
6274 * src/lyx_gui.C (create_forms): do not handle the
6275 fd_latex_options form.
6277 2000-07-18 Juergen Vigna <jug@sad.it>
6279 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6280 name of the inset so that it can be requested outside (text2.C).
6282 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6285 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6287 * src/mathed/formula.h (ConvertFont): constify
6289 * src/mathed/formula.C (Read): add warning if \end_inset is not
6290 found on expected place.
6292 * src/insets/lyxinset.h (ConvertFont): consify
6294 * src/insets/insetquotes.C (ConvertFont): constify
6295 * src/insets/insetquotes.h: ditto
6297 * src/insets/insetinfo.h: add labelfont
6299 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6300 (ascent): use labelfont
6304 (Write): make .lyx file a bit nicer
6306 * src/insets/insetfloat.C (Write): simplify somewhat...
6307 (Read): add warning if arg is not found
6309 * src/insets/insetcollapsable.C: add using std::max
6310 (Read): move string token and add warning in arg is not found
6311 (draw): use std::max to get the right ty
6312 (getMaxWidth): simplify by using std::max
6314 * src/insets/insetsection.h: new file
6315 * src/insets/insetsection.C: new file
6316 * src/insets/insetcaption.h: new file
6317 * src/insets/insetcaption.C: new file
6319 * src/insets/inset.C (ConvertFont): constify signature
6321 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6322 insetcaption.[Ch] and insetsection.[Ch]
6324 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6325 uses to use LABEL_COUNTER_CHAPTER instead.
6326 * src/text2.C (SetCounter): here
6328 * src/counters.h: new file
6329 * src/counters.C: new file
6330 * src/Sectioning.h: new file
6331 * src/Sectioning.C: new file
6333 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6335 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6337 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6340 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6343 2000-07-17 Juergen Vigna <jug@sad.it>
6345 * src/tabular.C (Validate): check if array-package is needed.
6346 (SetVAlignment): added support for vertical alignment.
6347 (SetLTFoot): better support for longtable header/footers
6348 (Latex): modified to support added features.
6350 * src/LaTeXFeatures.[Ch]: added array-package.
6352 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6354 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6357 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6359 * configure.in: do not forget to put a space after -isystem.
6361 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6363 * lib/kbd/arabic.kmap: a few fixes.
6365 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6367 * some whitespace chagnes to a number of files.
6369 * src/support/DebugStream.h: change to make it easier for
6370 doc++ to parse correctly.
6371 * src/support/lyxstring.h: ditto
6373 * src/mathed/math_utils.C (compara): change to have only one
6375 (MathedLookupBOP): change because of the above.
6377 * src/mathed/math_delim.C (math_deco_compare): change to have only
6379 (search_deco): change becasue of the above.
6381 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6382 instead of manually coded one.
6384 * src/insets/insetquotes.C (Read): read the \end_inset too
6386 * src/insets/insetlatex.h: remove file
6387 * src/insets/insetlatex.C: remove file
6389 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6391 (InsetPrintIndex): remove destructor
6393 * src/insets/insetinclude.h: remove default constructor
6395 * src/insets/insetfloat.C: work to make it work better
6397 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6399 * src/insets/insetcite.h (InsetCitation): remove default constructor
6401 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6403 * src/text.C (GetColumnNearX): comment out some currently unused code.
6405 * src/paragraph.C (writeFile): move some initializations closer to
6407 (CutIntoMinibuffer): small change to use new matchIT operator
6411 (InsertInset): ditto
6414 (InsetIterator): ditto
6415 (Erase): small change to use new matchFT operator
6417 (GetFontSettings): ditto
6418 (HighestFontInRange): ditto
6421 * src/lyxparagraph.h: some chars changed to value_type
6422 (matchIT): because of some stronger checking (perhaps too strong)
6423 in SGI STL, the two operator() unified to one.
6426 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6428 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6429 the last inset read added
6430 (parseSingleLyXformat2Token): some more (future) compability code added
6431 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6432 (parseSingleLyXformat2Token): set last_inset_read
6433 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6434 (parseSingleLyXformat2Token): don't double intializw string next_token
6436 * src/TextCache.C (text_fits::operator()): add const's to the signature
6437 (has_buffer::operator()): ditto
6439 * src/Floating.h: add some comments on the class
6441 * src/FloatList.[Ch] (typeExist): new method
6444 * src/BackStack.h: added default constructor, wanted by Gcc.
6446 2000-07-14 Juergen Vigna <jug@sad.it>
6448 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6450 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6452 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6453 do a redraw when the window is resized!
6454 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6456 * src/insets/insettext.C (resizeLyXText): added function to correctly
6457 being able to resize the LyXWindow.
6459 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6461 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6463 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6464 crashes when closing dialog to a deleted inset.
6466 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6467 method! Now similar to other insets.
6469 2000-07-13 Juergen Vigna <jug@sad.it>
6471 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6473 * lib/examples/Literate.lyx: small patch!
6475 * src/insets/insetbib.C (Read): added this function because of wrong
6476 Write (without [begin|end]_inset).
6478 2000-07-11 Juergen Vigna <jug@sad.it>
6480 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6481 as the insertInset could not be good!
6483 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6484 the bool param should not be last.
6486 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6488 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6489 did submit that to Karl).
6491 * configure.in: use -isystem instead of -I for X headers. This
6492 fixes a problem on solaris with a recent gcc;
6493 put the front-end code after the X detection code;
6494 configure in sigc++ before lib/
6496 * src/lyx_main.C (commandLineHelp): remove -display from command
6499 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6501 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6502 Also put in Makefile rules for building the ``listerrors''
6503 program for parsing errors from literate programs written in LyX.
6505 * lib/build-listerrors: Added small shell script as part of compile
6506 process. This builds a working ``listerrors'' binary if noweb is
6507 installed and either 1) the VNC X server is installed on the machine,
6508 or 2) the user is compiling from within a GUI. The existence of a GUI
6509 is necessary to use the ``lyx --export'' feature for now. This
6510 hack can be removed once ``lyx --export'' no longer requires a GUI to
6513 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6515 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6516 now passed back correctly from gcc and placed "under" error
6517 buttons in a Literate LyX source.
6519 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6521 * src/text.C (GetColumnNearX): Better behavior when a RTL
6522 paragraph is ended by LTR text.
6524 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6527 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6529 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6530 true when clipboard is empty.
6532 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6534 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6535 row of the paragraph.
6536 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6537 to prevent calculation of bidi tables
6539 2000-07-07 Juergen Vigna <jug@sad.it>
6541 * src/screen.C (ToggleSelection): added y_offset and x_offset
6544 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6547 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6549 * src/insets/insettext.C: fixed Layout-Display!
6551 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6553 * configure.in: add check for strings.h header.
6555 * src/spellchecker.C: include <strings.h> in order to have a
6556 definition for bzero().
6558 2000-07-07 Juergen Vigna <jug@sad.it>
6560 * src/insets/insettext.C (draw): set the status of the bv->text to
6561 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6563 * src/screen.C (DrawOneRow):
6564 (DrawFromTo): redraw the actual row if something has changed in it
6567 * src/text.C (draw): call an update of the toplevel-inset if something
6568 has changed inside while drawing.
6570 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6572 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6574 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6575 processing inside class.
6577 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6578 processing inside class.
6580 * src/insets/insetindex.h new struct Holder, consistent with other
6583 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6584 citation dialog from main code and placed it in src/frontends/xforms.
6585 Dialog launched through signals instead of callbacks
6587 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6589 * lyx.man: update the options description.
6591 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6593 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6594 handle neg values, set min width to 590, add doc about -display
6596 2000-07-05 Juergen Vigna <jug@sad.it>
6598 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6599 calls to BufferView *.
6601 * src/insets/insettext.C (checkAndActivateInset): small fix non
6602 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6604 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6605 their \end_inset token!
6607 2000-07-04 edscott <edscott@imp.mx>
6609 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6610 lib/lyxrc.example: added option \wheel_jump
6612 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6614 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6615 remove support for -width,-height,-xpos and -ypos.
6617 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6619 * src/encoding.[Ch]: New files.
6621 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6622 (text): Call to the underline() method only when needed.
6624 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6626 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6627 encoding(s) for the document.
6629 * src/bufferparams.C (BufferParams): Changed default value of
6632 * src/language.C (newLang): Removed.
6633 (items[]): Added encoding information for all defined languages.
6635 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6636 encoding choice button.
6638 * src/lyxrc.h (font_norm_type): New member variable.
6639 (set_font_norm_type): New method.
6641 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6642 paragraphs with different encodings.
6644 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6645 (TransformChar): Changed to work correctly with Arabic points.
6646 (draw): Added support for drawing Arabic points.
6647 (draw): Removed code for drawing underbars (this is done by
6650 * src/support/textutils.h (IsPrintableNonspace): New function.
6652 * src/BufferView_pimpl.h: Added "using SigC::Object".
6653 * src/LyXView.h: ditto.
6655 * src/insets/insetinclude.h (include_label): Changed to mutable.
6657 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6659 * src/mathed/math_iter.h: remove empty destructor
6661 * src/mathed/math_cursor.h: remove empty destructor
6663 * src/insets/lyxinset.h: add THEOREM_CODE
6665 * src/insets/insettheorem.[Ch]: new files
6667 * src/insets/insetminipage.C: (InsertInset): remove
6669 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6671 (InsertInset): remove
6673 * src/insets/insetlist.C: (InsertList): remove
6675 * src/insets/insetfootlike.[Ch]: new files
6677 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6680 (InsertInset): ditto
6682 * src/insets/insetert.C: remove include Painter.h, reindent
6683 (InsertInset): move to header
6685 * src/insets/insetcollapsable.h: remove explicit from default
6686 contructor, remove empty destructor, add InsertInset
6688 * src/insets/insetcollapsable.C (InsertInset): new func
6690 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6692 * src/vspace.h: add explicit to constructor
6694 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6695 \textcompwordmark, please test this.
6697 * src/lyxrc.C: set ascii_linelen to 65 by default
6699 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6701 * src/commandtags.h: add LFUN_INSET_THEOREM
6703 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6704 (makeLinuxDocFile): remove _some_ of the nice logic
6705 (makeDocBookFile): ditto
6707 * src/Painter.[Ch]: (~Painter): removed
6709 * src/LyXAction.C (init): entry for insettheorem added
6711 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6713 (deplog): code to detect files generated by LaTeX, needs testing
6716 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6718 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6720 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6722 * src/LaTeX.C (deplog): Add a check for files that are going to be
6723 created by the first latex run, part of the project to remove the
6726 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6727 contents to the extension list.
6729 2000-07-04 Juergen Vigna <jug@sad.it>
6731 * src/text.C (NextBreakPoint): added support for needFullRow()
6733 * src/insets/lyxinset.h: added needFullRow()
6735 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6738 * src/insets/insettext.C: lots of changes for update!
6740 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6742 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6744 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6746 * src/insets/insetinclude.C (InsetInclude): fixed
6747 initialization of include_label.
6748 (unique_id): now returns a string.
6750 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6752 * src/LaTeXFeatures.h: new member IncludedFiles, for
6753 a map of key, included file name.
6755 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6756 with the included files for inclusion in SGML preamble,
6757 i. e., linuxdoc and docbook.
6760 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6761 nice (is the generated linuxdoc code to be exported?), that
6762 allows to remove column, and only_body that will be true for
6763 slave documents. Insets are allowed inside SGML font type.
6764 New handling of the SGML preamble for included files.
6765 (makeDocBookFile): the same for docbook.
6767 * src/insets/insetinclude.h:
6768 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6770 (DocBook): new export methods.
6772 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6773 and makeDocBookFile.
6775 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6776 formats to export with command line argument -x.
6778 2000-06-29 Juergen Vigna <jug@sad.it>
6780 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6781 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6783 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6784 region could already been cleared by an inset!
6786 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6788 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6791 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6793 (cursorToggle): remove special handling of lyx focus.
6795 2000-06-28 Juergen Vigna <jug@sad.it>
6797 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6800 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6802 * src/insets/insetindex.C (Edit): add a callback when popup is
6805 * src/insets/insettext.C (LocalDispatch):
6806 * src/insets/insetmarginal.h:
6807 * src/insets/insetlist.h:
6808 * src/insets/insetfoot.h:
6809 * src/insets/insetfloat.h:
6810 * src/insets/insetert.h: add a missing std:: qualifier.
6812 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6814 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6817 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6819 * src/insets/insettext.C (Read): remove tmptok unused variable
6820 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6821 (InsertInset): change for new InsetInset code
6823 * src/insets/insettext.h: add TEXT inline method
6825 * src/insets/insettext.C: remove TEXT macro
6827 * src/insets/insetmarginal.C (Write): new method
6828 (Latex): change output slightly
6830 * src/insets/insetfoot.C (Write): new method
6831 (Latex): change output slightly (don't use endl when no need)
6833 * src/insets/insetert.C (Write): new method
6835 * src/insets/insetcollapsable.h: make button_length, button_top_y
6836 and button_bottm_y protected.
6838 * src/insets/insetcollapsable.C (Write): simplify code by using
6839 tostr. Also do not output the float name, the children class
6840 should to that to get control over own arguments
6842 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6843 src/insets/insetminipage.[Ch]:
6846 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6848 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6850 * src/Makefile.am (lyx_SOURCES): add the new files
6852 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6853 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6854 * src/commandtags.h: ditto
6856 * src/LaTeXFeatures.h: add a std::set of used floattypes
6858 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6860 * src/FloatList.[Ch] src/Floating.h: new files
6862 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6864 * src/lyx_cb.C (TableApplyCB): ditto
6866 * src/text2.C: ditto
6867 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6868 (parseSingleLyXformat2Token): ditto + add code for
6869 backwards compability for old float styles + add code for new insets
6871 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6873 (InsertInset(size_type, Inset *, LyXFont)): new method
6874 (InsetChar(size_type, char)): changed to use the other InsetChar
6875 with a LyXFont(ALL_INHERIT).
6876 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6877 insert the META_INSET.
6879 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6881 * sigc++/thread.h (Threads): from here
6883 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6884 definition out of line
6885 * sigc++/scope.h: from here
6887 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6889 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6890 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6892 * Makefile.am (bindist): new target.
6894 * INSTALL: add instructions for doing a binary distribution.
6896 * development/tools/README.bin.example: update a bit.
6898 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6901 * lib/lyxrc.example: new lyxrc tag \set_color.
6903 * src/lyxfunc.C (Dispatch):
6904 * src/commandtags.h:
6905 * src/LyXAction.C: new lyxfunc "set-color".
6907 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6908 and an x11name given as strings.
6910 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6911 cache when a color is changed.
6913 2000-06-26 Juergen Vigna <jug@sad.it>
6915 * src/lyxrow.C (width): added this functions and variable.
6917 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6920 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6922 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6924 * images/undo_bw.xpm: new icon.
6925 * images/redo_bw.xpm: ditto.
6927 * configure.in (INSTALL_SCRIPT): change value to
6928 ${INSTALL} to avoid failures of install-script target.
6929 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6931 * src/BufferView.h: add a magic "friend" declaration to please
6934 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6936 * forms/cite.fd: modified to allow resizing without messing
6939 * src/insetcite.C: Uses code from cite.fd almost without
6941 User can now resize dialog in the x-direction.
6942 Resizing the dialog in the y-direction is prevented, as the
6943 code does this intelligently already.
6945 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6947 * INSTALL: remove obsolete entry in "problems" section.
6949 * lib/examples/sl_*.lyx: update of the slovenian examples.
6951 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6953 2000-06-23 Juergen Vigna <jug@sad.it>
6955 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6957 * src/buffer.C (resize): delete the LyXText of textinsets.
6959 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6961 * src/insets/lyxinset.h: added another parameter 'cleared' to
6962 the draw() function.
6964 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6965 unlocking inset in inset.
6967 2000-06-22 Juergen Vigna <jug@sad.it>
6969 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6970 of insets and moved first to LyXText.
6972 * src/mathed/formulamacro.[Ch]:
6973 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6975 2000-06-21 Juergen Vigna <jug@sad.it>
6977 * src/text.C (GetVisibleRow): look if I should clear the area or not
6978 using Inset::doClearArea() function.
6980 * src/insets/lyxinset.h: added doClearArea() function and
6981 modified draw(Painter &, ...) to draw(BufferView *, ...)
6983 * src/text2.C (UpdateInset): return bool insted of int
6985 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6987 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6988 combox in the character popup
6990 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6991 BufferParams const & params
6993 2000-06-20 Juergen Vigna <jug@sad.it>
6995 * src/insets/insettext.C (SetParagraphData): set insetowner on
6998 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7000 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7001 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7003 (form_main_): remove
7005 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7006 (create_form_form_main): remove FD_form_main stuff, connect to
7007 autosave_timeout signal
7009 * src/LyXView.[Ch] (getMainForm): remove
7010 (UpdateTimerCB): remove
7011 * src/BufferView_pimpl.h: inherit from SigC::Object
7013 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7014 signal instead of callback
7016 * src/BufferView.[Ch] (cursorToggleCB): remove
7018 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7020 * src/BufferView_pimpl.C: changes because of the one below
7022 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7023 instead of storing a pointer to a LyXText.
7025 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7027 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7029 * src/lyxparagraph.h
7031 * src/paragraph.C: Changed fontlist to a sorted vector.
7033 2000-06-19 Juergen Vigna <jug@sad.it>
7035 * src/BufferView.h: added screen() function.
7037 * src/insets/insettext.C (LocalDispatch): some selection code
7040 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7042 * src/insets/insettext.C (SetParagraphData):
7044 (InsetText): fixes for multiple paragraphs.
7046 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7048 * development/lyx.spec.in: Call configure with ``--without-warnings''
7049 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7050 This should be fine, however, since we generally don't want to be
7051 verbose when making an RPM.
7053 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7055 * lib/scripts/fig2pstex.py: New file
7057 2000-06-16 Juergen Vigna <jug@sad.it>
7059 * src/insets/insettabular.C (UpdateLocal):
7060 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7061 (LocalDispatch): Changed all functions to use LyXText.
7063 2000-06-15 Juergen Vigna <jug@sad.it>
7065 * src/text.C (SetHeightOfRow): call inset::update before requesting
7068 * src/insets/insettext.C (update):
7069 * src/insets/insettabular.C (update): added implementation
7071 * src/insets/lyxinset.h: added update function
7073 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7075 * src/text.C (SelectNextWord): protect against null pointers with
7076 old-style string streams. (fix from Paul Theo Gonciari
7079 * src/cite.[Ch]: remove erroneous files.
7081 * lib/configure.m4: update the list of created directories.
7083 * src/lyxrow.C: include <config.h>
7084 * src/lyxcursor.C: ditto.
7086 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7088 * lib/examples/decimal.lyx: new example file from Mike.
7090 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7091 to find template definitions (from Dekel)
7093 * src/frontends/.cvsignore: add a few things.
7095 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7097 * src/Timeout.C (TimeOut): remove default argument.
7099 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7102 * src/insets/ExternalTemplate.C: add a "using" directive.
7104 * src/lyx_main.h: remove the act_ struct, which seems unused
7107 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7109 * LyX Developers Meeting: All files changed, due to random C++ (by
7110 coincidence) code generator script.
7112 - external inset (cool!)
7113 - initial online editing of preferences
7114 - insettabular breaks insettext(s contents)
7116 - some DocBook fixes
7117 - example files update
7118 - other cool stuff, create a diff and look for yourself.
7120 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7122 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7123 -1 this is a non-line-breaking textinset.
7125 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7126 if there is no width set.
7128 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7130 * Lots of files: Merged the dialogbase branch.
7132 2000-06-09 Allan Rae <rae@lyx.org>
7134 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7135 and the Dispatch methods that used it.
7137 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7138 access to functions formerly kept in Dispatch.
7140 2000-05-19 Allan Rae <rae@lyx.org>
7142 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7143 made to_page and count_copies integers again. from_page remains a
7144 string however because I want to allow entry of a print range like
7145 "1,4,22-25" using this field.
7147 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7148 and printer-params-get. These aren't useful from the minibuffer but
7149 could be used by a script/LyXServer app provided it passes a suitable
7150 auto_mem_buffer. I guess I should take a look at how the LyXServer
7151 works and make it support xtl buffers.
7153 * sigc++/: updated to libsigc++-1.0.1
7155 * src/xtl/: updated to xtl-1.3.pl.11
7157 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7158 those changes done to the files in src/ are actually recreated when
7159 they get regenerated. Please don't ever accept a patch that changes a
7160 dialog unless that patch includes the changes to the corresponding *.fd
7163 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7164 stringOnlyContains, renamed it and generalised it.
7166 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7167 branch. Removed the remaining old form_print code.
7169 2000-04-26 Allan Rae <rae@lyx.org>
7171 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7172 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7174 2000-04-25 Allan Rae <rae@lyx.org>
7176 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7177 against a base of xtl-1.3.pl.4
7179 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7180 filter the Id: entries so they still show the xtl version number
7183 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7184 into the src/xtl code. Patch still pending with José (XTL)
7186 2000-04-24 Allan Rae <rae@lyx.org>
7188 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7189 both more generic and much safer. Use the new template functions.
7190 * src/buffer.[Ch] (Dispatch): ditto.
7192 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7193 and mem buffer more intelligently. Also a little general cleanup.
7196 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7197 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7198 * src/xtl/Makefile.am: ditto.
7199 * src/xtl/.cvsignore: ditto.
7200 * src/Makefile.am: ditto.
7202 * src/PrinterParams.h: Removed the macros member functions. Added a
7203 testInvariant member function. A bit of tidying up and commenting.
7204 Included Angus's idea for fixing operation with egcs-1.1.2.
7206 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7207 cool expansion of XTL's mem_buffer to support automatic memory
7208 management within the buffer itself. Removed the various macros and
7209 replaced them with template functions that use either auto_mem_buffer
7210 or mem_buffer depending on a #define. The mem_buffer support will
7211 disappear as soon as the auto_mem_buffer is confirmed to be good on
7212 other platforms/compilers. That is, it's there so you've got something
7215 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7216 effectively forked XTL. However I expect José will include my code
7217 into the next major release. Also fixed a memory leak.
7218 * src/xtl/text.h: ditto.
7219 * src/xtl/xdr.h: ditto.
7220 * src/xtl/giop.h: ditto.
7222 2000-04-16 Allan Rae <rae@lyx.org>
7224 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7225 by autogen.sh and removed by maintainer-clean anyway.
7226 * .cvsignore, sigc++/.cvsignore: Support the above.
7228 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7230 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7232 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7233 macros, renamed static callback-target member functions to suit new
7234 scheme and made them public.
7235 * src/frontends/xforms/forms/form_print.fd: ditto.
7236 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7238 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7241 * src/xtl/: New directory containing a minimal distribution of XTL.
7242 This is XTL-1.3.pl.4.
7244 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7246 2000-04-15 Allan Rae <rae@lyx.org>
7248 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7250 * sigc++/: Updated to libsigc++-1.0.0
7252 2000-04-14 Allan Rae <rae@lyx.org>
7254 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7255 use the generic ones in future. I'll modify my conversion script.
7257 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7259 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7260 (CloseAllBufferRelatedDialogs): Renamed.
7261 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7263 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7264 of the generic ones. These are the same ones my conversion script
7267 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7268 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7269 * src/buffer.C (Dispatch): ditto
7271 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7272 functions for updating and hiding buffer dependent dialogs.
7273 * src/BufferView.C (buffer): ditto
7274 * src/buffer.C (setReadonly): ditto
7275 * src/lyxfunc.C (CloseBuffer): ditto
7277 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7278 Dialogs.h, and hence all the SigC stuff, into every file that includes
7279 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7281 * src/BufferView2.C: reduce the number of headers included by buffer.h
7283 2000-04-11 Allan Rae <rae@lyx.org>
7285 * src/frontends/xforms/xform_macros.h: A small collection of macros
7286 for building C callbacks.
7288 * src/frontends/xforms/Makefile.am: Added above file.
7290 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7291 scheme again. This time it should work for JMarc. If this is
7292 successful I'll revise my conversion script to automate some of this.
7293 The static member functions in the class also have to be public for
7294 this scheme will work. If the scheme works (it's almost identical to
7295 the way BufferView::cursorToggleCB is handled so it should work) then
7296 FormCopyright and FormPrint will be ready for inclusion into the main
7297 trunk immediately after 1.1.5 is released -- provided we're prepared
7298 for complaints about lame compilers not handling XTL.
7300 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7302 2000-04-07 Allan Rae <rae@lyx.org>
7304 * config/lyxinclude.m4: A bit more tidying up (Angus)
7306 * src/LString.h: JMarc's <string> header fix
7308 * src/PrinterParams.h: Used string for most data to remove some
7309 ugly code in the Print dialog and avoid even uglier code when
7310 appending the ints to a string for output.
7312 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7313 and moved "default:" back to the end of switch statement. Cleaned
7314 up the printing so it uses the right function calls and so the
7315 "print to file" option actually puts the file in the right directory.
7317 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7319 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7320 and Ok+Apply button control into a separate method: input (Angus).
7321 (input) Cleaned it up and improved it to be very thorough now.
7322 (All CB) static_cast used instead of C style cast (Angus). This will
7323 probably change again once we've worked out how to keep gcc-2.8.1 happy
7324 with real C callbacks.
7325 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7326 ignore some of the bool settings and has random numbers instead. Needs
7327 some more investigation. Added other input length checks and checking
7328 of file and printer names.
7330 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7331 would link (Angus). Seems the old code doesn't compile with the pragma
7332 statement either. Separated callback entries from internal methods.
7334 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7336 2000-03-17 Allan Rae <rae@lyx.org>
7338 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7339 need it? Maybe it could go in Dialogs instead? I could make it a
7340 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7341 values to get the bool return value.
7342 (Dispatch): New overloaded method for xtl support.
7344 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7345 extern "C" callback instead of static member functions. Hopefully,
7346 JMarc will be able to compile this. I haven't changed
7347 forms/form_copyright.fd yet. Breaking one of my own rules already.
7349 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7350 because they aren't useful from the minibuffer. Maybe a LyXServer
7351 might want a help message though?
7353 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7355 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7356 xtl which needs both rtti and exceptions.
7358 * src/support/Makefile.am:
7359 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7361 * src/frontends/xforms/input_validators.[ch]: input filters and
7362 validators. These conrol what keys are valid in input boxes.
7363 Use them and write some more. Much better idea than waiting till
7364 after the user has pressed Ok to say that the input fields don't make
7367 * src/frontends/xforms/Makefile.am:
7368 * src/frontends/xforms/forms/form_print.fd:
7369 * src/frontends/xforms/forms/makefile:
7370 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7371 new scheme. Still have to make sure I haven't missed anything from
7372 the current implementation.
7374 * src/Makefile.am, src/PrinterParams.h: New data store.
7376 * other files: Added a couple of copyright notices.
7378 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7380 * src/insets/insetbib.h: move Holder struct in public space.
7382 * src/frontends/include/DialogBase.h: use SigC:: only when
7383 SIGC_CXX_NAMESPACES is defined.
7384 * src/frontends/include/Dialogs.h: ditto.
7386 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7388 * src/frontends/xforms/FormCopyright.[Ch]: do not
7389 mention SigC:: explicitely.
7391 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7393 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7394 deals with testing KDE in main configure.in
7395 * configure.in: ditto.
7397 2000-02-22 Allan Rae <rae@lyx.org>
7399 * Lots of files: Merged from HEAD
7401 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7402 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7404 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7406 * sigc++/: new minidist.
7408 2000-02-14 Allan Rae <rae@lyx.org>
7410 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7412 2000-02-08 Juergen Vigna <jug@sad.it>
7414 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7415 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7417 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7418 for this port and so it is much easier for other people to port
7419 dialogs in a common development environment.
7421 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7422 the QT/KDE implementation.
7424 * src/frontends/kde/Dialogs.C:
7425 * src/frontends/kde/FormCopyright.C:
7426 * src/frontends/kde/FormCopyright.h:
7427 * src/frontends/kde/Makefile.am:
7428 * src/frontends/kde/formcopyrightdialog.C:
7429 * src/frontends/kde/formcopyrightdialog.h:
7430 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7431 for the kde support of the Copyright-Dialog.
7433 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7434 subdir-substitution instead of hardcoded 'xforms' as we now have also
7437 * src/frontends/include/DialogBase.h (Object): just commented the
7438 label after #endif (nasty warning and I don't like warnings ;)
7440 * src/main.C (main): added KApplication initialization if using
7443 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7444 For now only the KDE event-loop is added if frontend==kde.
7446 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7448 * configure.in: added support for the --with-frontend[=value] option
7450 * autogen.sh: added kde.m4 file to list of config-files
7452 * acconfig.h: added define for KDEGUI-support
7454 * config/kde.m4: added configuration functions for KDE-port
7456 * config/lyxinclude.m4: added --with-frontend[=value] option with
7457 support for xforms and KDE.
7459 2000-02-08 Allan Rae <rae@lyx.org>
7461 * all Makefile.am: Fixed up so the make targets dist, distclean,
7462 install and uninstall all work even if builddir != srcdir. Still
7463 have a new sigc++ minidist update to come.
7465 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7467 2000-02-01 Allan Rae <rae@lyx.org>
7469 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7470 Many mods to get builddir != srcdir working.
7472 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7473 for building on NT and so we can do the builddir != srcdir stuff.
7475 2000-01-30 Allan Rae <rae@lyx.org>
7477 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7478 This will stay in "rae" branch. We probably don't really need it in
7479 the main trunk as anyone who wants to help programming it should get
7480 a full library installed also. So they can check both included and
7481 system supplied library compilation.
7483 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7484 Added a 'mini' distribution of libsigc++. If you feel the urge to
7485 change something in these directories - Resist it. If you can't
7486 resist the urge then you should modify the following script and rebuild
7487 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7488 all happen. Still uses a hacked version of libsigc++'s configure.in.
7489 I'm quite happy with the results. I'm not sure the extra work to turn
7490 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7491 worth the trouble and would probably lead to extra maintenance
7493 I haven't tested the following important make targets: install, dist.
7494 Not ready for prime time but very close. Maybe 1.1.5.
7496 * development/tools/makeLyXsigc.sh: A shell script to automatically
7497 generate our mini-dist of libsigc++. It can only be used with a CVS
7498 checkout of libsigc++ not a tarball distribution. It's well commented.
7499 This will end up as part of the libsigc++ distribution so other apps
7500 can easily have an included mini-dist. If someone makes mods to the
7501 sigc++ subpackage without modifying this script to generate those
7502 changes I'll be very upset!
7504 * src/frontends/: Started the gui/system indep structure.
7506 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7507 to access the gui-indep dialogs are in this class. Much improved
7508 design compared to previous revision. Lars, please refrain from
7509 moving this header into src/ like you did with Popups.h last time.
7511 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7513 * src/frontends/xforms/: Started the gui-indep system with a single
7514 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7517 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7518 Here you'll find a very useful makefile and automated fdfix.sh that
7519 makes updating dailogs a no-brainer -- provided you follow the rules
7520 set out in the README. I'm thinking about adding another script to
7521 automatically generate skeleton code for a new dialog given just the
7524 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7525 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7526 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7528 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7530 * src/support/LSubstring.C (operator): simplify
7532 * src/lyxtext.h: removed bparams, use buffer_->params instead
7534 * src/lyxrow.h: make Row a real class, move all variables to
7535 private and use accessors.
7537 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7539 (isRightToLeftPar): ditto
7540 (ChangeLanguage): ditto
7541 (isMultiLingual): ditto
7544 (SimpleTeXOnePar): ditto
7545 (TeXEnvironment): ditto
7546 (GetEndLabel): ditto
7548 (SetOnlyLayout): ditto
7549 (BreakParagraph): ditto
7550 (BreakParagraphConservative): ditto
7551 (GetFontSettings): ditto
7553 (CopyIntoMinibuffer): ditto
7554 (CutIntoMinibuffer): ditto
7555 (PasteParagraph): ditto
7556 (SetPExtraType): ditto
7557 (UnsetPExtraType): ditto
7558 (DocBookContTableRows): ditto
7559 (SimpleDocBookOneTablePar): ditto
7561 (TeXFootnote): ditto
7562 (SimpleTeXOneTablePar): ditto
7563 (TeXContTableRows): ditto
7564 (SimpleTeXSpecialChars): ditto
7567 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7568 to private and use accessors.
7570 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7571 this, we did not use it anymore and has not been for ages. Just a
7572 waste of cpu cycles.
7574 * src/language.h: make Language a real class, move all variables
7575 to private and use accessors.
7577 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7578 (create_view): remove
7579 (update): some changes for new timer
7580 (cursorToggle): use new timer
7581 (beforeChange): change for new timer
7583 * src/BufferView.h (cursorToggleCB): removed last paramter because
7586 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7587 (cursorToggleCB): change because of new timer code
7589 * lib/CREDITS: updated own mailaddress
7591 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7593 * src/support/filetools.C (PutEnv): fix the code in case neither
7594 putenv() nor setenv() have been found.
7596 * INSTALL: mention the install-strip Makefile target.
7598 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7599 read-only documents.
7601 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7603 * lib/reLyX/configure.in (VERSION): avoid using a previously
7604 generated reLyX wrapper to find out $prefix.
7606 * lib/examples/eu_adibide_lyx-atua.lyx:
7607 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7608 translation of the Tutorial (Dooteo)
7610 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7612 * forms/cite.fd: new citation dialog
7614 * src/insetcite.[Ch]: the new citation dialog is moved into
7617 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7620 * src/insets/insetcommand.h: data members made private.
7622 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7624 * LyX 1.1.5 released
7626 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7628 * src/version.h (LYX_RELEASE): to 1.1.5
7630 * src/spellchecker.C (RunSpellChecker): return false if the
7631 spellchecker dies upon creation.
7633 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7635 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7636 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7640 * lib/CREDITS: update entry for Martin Vermeer.
7642 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7644 * src/text.C (draw): Draw foreign language bars at the bottom of
7645 the row instead of at the baseline.
7647 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7649 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7651 * lib/bind/de_menus.bind: updated
7653 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7655 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7657 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7659 * src/menus.C (Limit_string_length): New function
7660 (ShowTocMenu): Limit the number of items/length of items in the
7663 * src/paragraph.C (String): Correct result for a paragraph inside
7666 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7668 * src/bufferlist.C (close): test of buf->getuser() == NULL
7670 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7672 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7673 Do not call to SetCursor when the paragraph is a closed footnote!
7675 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7677 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7680 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7682 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7685 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7686 reference popup, that activates the reference-back action
7688 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7690 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7691 the menus. Also fixed a bug.
7693 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7694 the math panels when switching buffers (unless new buffer is readonly).
7696 * src/BufferView.C (NoSavedPositions)
7697 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7699 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7701 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7702 less of dvi dirty or not.
7704 * src/trans_mgr.[Ch] (insert): change first parameter to string
7707 * src/chset.[Ch] (encodeString): add const to first parameter
7709 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7711 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7715 * src/LaTeX.C (deplog): better searching for dependency files in
7716 the latex log. Uses now regexps.
7718 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7719 instead of the box hack or \hfill.
7721 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7723 * src/lyxfunc.C (doImportHelper): do not create the file before
7724 doing the actual import.
7725 (doImportASCIIasLines): create a new file before doing the insert.
7726 (doImportASCIIasParagraphs): ditto.
7728 * lib/lyxrc.example: remove mention of non-existing commands
7730 * lyx.man: remove mention of color-related switches.
7732 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7734 * src/lyx_gui.C: remove all the color-related ressources, which
7735 are not used anymore.
7737 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7740 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7742 * src/lyxrc.C (read): Add a missing break in the switch
7744 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7746 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7748 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7751 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7753 * src/text.C (draw): draw bars under foreign language words.
7755 * src/LColor.[Ch]: add LColor::language
7757 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7759 * src/lyxcursor.h (boundary): New member variable
7761 * src/text.C (IsBoundary): New methods
7763 * src/text.C: Use the above for currect cursor movement when there
7764 is both RTL & LTR text.
7766 * src/text2.C: ditto
7768 * src/bufferview_funcs.C (ToggleAndShow): ditto
7770 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7772 * src/text.C (DeleteLineForward): set selection to true to avoid
7773 that DeleteEmptyParagraphMechanism does some magic. This is how it
7774 is done in all other functions, and seems reasonable.
7775 (DeleteWordForward): do not jump over non-word stuff, since
7776 CursorRightOneWord() already does it.
7778 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7779 DeleteWordBackward, since they seem safe to me (since selection is
7780 set to "true") DeleteEmptyParagraphMechanism does nothing.
7782 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7784 * src/lyx_main.C (easyParse): simplify the code by factoring the
7785 part that removes parameters from the command line.
7786 (LyX): check wether wrong command line options have been given.
7788 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7790 * src/lyx_main.C : add support for specifying user LyX
7791 directory via command line option -userdir.
7793 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7795 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7796 the number of items per popup.
7797 (Add_to_refs_menu): Ditto.
7799 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7801 * src/lyxparagraph.h: renamed ClearParagraph() to
7802 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7803 textclass as parameter, and do nothing if free_spacing is
7804 true. This fixes part of the line-delete-forward problems.
7806 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7807 (pasteSelection): ditto.
7808 (SwitchLayoutsBetweenClasses): more translatable strings.
7810 * src/text2.C (CutSelection): use StripLeadingSpaces.
7811 (PasteSelection): ditto.
7812 (DeleteEmptyParagraphMechanism): ditto.
7814 2000-05-26 Juergen Vigna <jug@sad.it>
7816 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7817 is not needed in tabular insets.
7819 * src/insets/insettabular.C (TabularFeatures): added missing features.
7821 * src/tabular.C (DeleteColumn):
7823 (AppendRow): implemented this functions
7824 (cellsturct::operator=): clone the inset too;
7826 2000-05-23 Juergen Vigna <jug@sad.it>
7828 * src/insets/insettabular.C (LocalDispatch): better selection support
7829 when having multicolumn-cells.
7831 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7833 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7835 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7837 * src/ColorHandler.C (getGCForeground): put more test into _()
7839 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7842 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7845 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7847 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7848 there are no labels, or when buffer is readonly.
7850 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7851 there are no labels, buffer is SGML, or when buffer is readonly.
7853 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7855 * src/LColor.C (LColor): change a couple of grey40 to grey60
7856 (LColor): rewore initalization to make compiles go some magnitude
7858 (getGUIName): don't use gettext until we need the string.
7860 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7862 * src/Bullet.[Ch]: Fixed a small bug.
7864 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7866 * src/paragraph.C (String): Several fixes/improvements
7868 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7870 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7872 * src/paragraph.C (String): give more correct output.
7874 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7876 * src/lyxfont.C (stateText) Do not output the language if it is
7877 eqaul to the language of the document.
7879 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7880 between two paragraphs with the same language.
7882 * src/paragraph.C (getParLanguage) Return a correct answer for an
7883 empty dummy paragraph.
7885 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7888 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7891 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7892 the menus/popup, if requested fonts are unavailable.
7894 2000-05-22 Juergen Vigna <jug@sad.it>
7896 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7897 movement support (Up/Down/Tab/Shift-Tab).
7898 (LocalDispatch): added also preliminari cursor-selection.
7900 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7902 * src/paragraph.C (PasteParagraph): Hopefully now right!
7904 2000-05-22 Garst R. Reese <reese@isn.net>
7906 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7907 of list, change all references to Environment to Command
7908 * tex/hollywood.cls : rewrite environments as commands, add
7909 \uppercase to interiorshot and exteriorshot to force uppecase.
7910 * tex/broadway.cls : rewrite environments as commands. Tweak
7913 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7915 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7916 size of items: use a constant intead of the hardcoded 40, and more
7917 importantly do not remove the %m and %x tags added at the end.
7918 (Add_to_refs_menu): use vector::size_type instead of
7919 unsigned int as basic types for the variables. _Please_ do not
7920 assume that size_t is equal to unsigned int. On an alpha, this is
7921 unsigned long, which is _not_ the same.
7923 * src/language.C (initL): remove language "hungarian", since it
7924 seems that "magyar" is better.
7926 2000-05-22 Juergen Vigna <jug@sad.it>
7928 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7930 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7933 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7934 next was deleted but not set to 0.
7936 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7938 * src/language.C (initL): change the initialization of languages
7939 so that compiles goes _fast_.
7941 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7944 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7946 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7950 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7952 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7954 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7958 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7961 * src/insets/insetlo*.[Ch]: Made editable
7963 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7965 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7966 the current selection.
7968 * src/BufferView_pimpl.C (stuffClipboard): new method
7970 * src/BufferView.C (stuffClipboard): new method
7972 * src/paragraph.C (String): new method
7974 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7975 LColor::ignore when lyxname is not found.
7977 * src/BufferView.C (pasteSelection): new method
7979 * src/BufferView_pimpl.C (pasteSelection): new method
7981 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7983 * src/WorkArea.C (request_clipboard_cb): new static function
7984 (getClipboard): new method
7985 (putClipboard): new method
7987 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7989 * LyX 1.1.5pre2 released
7991 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7993 * src/vspace.C (operator=): removed
7994 (operator=): removed
7996 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7998 * src/layout.C (NumberOfClass): manually set the type in make_pair
7999 (NumberOfLayout): ditto
8001 * src/language.C: use the Language constructor for ignore_lang
8003 * src/language.h: add constructors to struct Language
8005 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8007 * src/text2.C (SetCursorIntern): comment out #warning
8009 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8011 * src/mathed/math_iter.h: initialize sx and sw to 0
8013 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8015 * forms/lyx.fd: Redesign of form_ref
8017 * src/LaTeXFeatures.[Ch]
8021 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8024 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8025 and Buffer::inset_iterator.
8027 * src/menus.C: Added new menus: TOC and Refs.
8029 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8031 * src/buffer.C (getTocList): New method.
8033 * src/BufferView2.C (ChangeRefs): New method.
8035 * src/buffer.C (getLabelList): New method. It replaces the old
8036 getReferenceList. The return type is vector<string> instead of
8039 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8040 the old getLabel() and GetNumberOfLabels() methods.
8041 * src/insets/insetlabel.C (getLabelList): ditto
8042 * src/mathed/formula.C (getLabelList): ditto
8044 * src/paragraph.C (String): New method.
8046 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8047 Uses the new getTocList() method.
8048 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8049 which automatically updates the contents of the browser.
8050 (RefUpdateCB): Use the new getLabelList method.
8052 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8054 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8056 * src/spellchecker.C: Added using std::reverse;
8058 2000-05-19 Juergen Vigna <jug@sad.it>
8060 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8062 * src/insets/insettext.C (computeTextRows): small fix for display of
8063 1 character after a newline.
8065 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8068 2000-05-18 Juergen Vigna <jug@sad.it>
8070 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8071 when changing width of column.
8073 * src/tabular.C (set_row_column_number_info): setting of
8074 autobreak rows if necessary.
8076 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8078 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8080 * src/vc-backend.*: renamed stat() to status() and vcstat to
8081 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8082 compilation broke. The new name seems more relevant, anyway.
8084 2000-05-17 Juergen Vigna <jug@sad.it>
8086 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8087 which was wrong if the removing caused removing of rows!
8089 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8090 (pushToken): new function.
8092 * src/text2.C (CutSelection): fix problem discovered with purify
8094 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8096 * src/debug.C (showTags): enlarge the first column, now that we
8097 have 6-digits debug codes.
8099 * lib/layouts/hollywood.layout:
8100 * lib/tex/hollywood.cls:
8101 * lib/tex/brodway.cls:
8102 * lib/layouts/brodway.layout: more commands and fewer
8103 environments. Preambles moved in the .cls files. Broadway now has
8104 more options on scene numbering and less whitespace (from Garst)
8106 * src/insets/insetbib.C (getKeys): make sure that we are in the
8107 document directory, in case the bib file is there.
8109 * src/insets/insetbib.C (Latex): revert bogus change.
8111 2000-05-16 Juergen Vigna <jug@sad.it>
8113 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8114 the TabularLayout on cursor move.
8116 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8118 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8121 (draw): fixed cursor position and drawing so that the cursor is
8122 visible when before the tabular-inset.
8124 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8125 when creating from old insettext.
8127 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8129 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8131 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8132 * lib/tex/brodway.cls: ditto
8134 * lib/layouts/brodway.layout: change alignment of parenthical
8137 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8139 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8140 versions 0.88 and 0.89 are supported.
8142 2000-05-15 Juergen Vigna <jug@sad.it>
8144 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8147 * src/insets/insettext.C (computeTextRows): redone completely this
8148 function in a much cleaner way, because of problems when having a
8150 (draw): added a frame border when the inset is locked.
8151 (SetDrawLockedFrame): this sets if we draw the border or not.
8152 (SetFrameColor): this sets the frame color (default=insetframe).
8154 * src/insets/lyxinset.h: added x() and y() functions which return
8155 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8156 function which is needed to see if we have a locking inset of some
8157 type in this inset (needed for now in insettabular).
8159 * src/vspace.C (inPixels): the same function also without a BufferView
8160 parameter as so it is easier to use it in some ocasions.
8162 * src/lyxfunc.C: changed all places where insertInset was used so
8163 that now if it couldn't be inserted it is deleted!
8165 * src/TabularLayout.C:
8166 * src/TableLayout.C: added support for new tabular-inset!
8168 * src/BufferView2.C (insertInset): this now returns a bool if the
8169 inset was really inserted!!!
8171 * src/tabular.C (GetLastCellInRow):
8172 (GetFirstCellInRow): new helper functions.
8173 (Latex): implemented for new tabular class.
8177 (TeXTopHLine): new Latex() helper functions.
8179 2000-05-12 Juergen Vigna <jug@sad.it>
8181 * src/mathed/formulamacro.C (Read):
8182 * src/mathed/formula.C (Read): read also the \end_inset here!
8184 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8186 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8187 crush when saving formulae with unbalanced parenthesis.
8189 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8191 * src/layout.C: Add new keyword "endlabelstring" to layout file
8193 * src/text.C (GetVisibleRow): Draw endlabel string.
8195 * lib/layouts/broadway.layout
8196 * lib/layouts/hollywood.layout: Added endlabel for the
8197 Parenthetical layout.
8199 * lib/layouts/heb-article.layout: Do not use slanted font shape
8200 for Theorem like environments.
8202 * src/buffer.C (makeLaTeXFile): Always add "american" to
8203 the UsedLanguages list if document language is RTL.
8205 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8207 * add addendum to README.OS2 and small patch (from SMiyata)
8209 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8211 * many files: correct the calls to ChangeExtension().
8213 * src/support/filetools.C (ChangeExtension): remove the no_path
8214 argument, which does not belong there. Use OnlyFileName() instead.
8216 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8217 files when LaTeXing a non-nice latex file.
8219 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8220 a chain of "if". Return false when deadkeys are not handled.
8222 * src/lyx_main.C (LyX): adapted the code for default bindings.
8224 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8225 bindings for basic functionality (except deadkeys).
8226 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8228 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8229 several methods: handle override_x_deadkeys.
8231 * src/lyxrc.h: remove the "bindings" map, which did not make much
8232 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8234 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8236 * src/lyxfont.C (stateText): use a saner method to determine
8237 whether the font is "default". Seems to fix the crash with DEC
8240 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8242 2000-05-08 Juergen Vigna <jug@sad.it>
8244 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8245 TabularLayoutMenu with mouse-button-3
8246 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8248 * src/TabularLayout.C: added this file for having a Layout for
8251 2000-05-05 Juergen Vigna <jug@sad.it>
8253 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8254 recalculating inset-widths.
8255 (TabularFeatures): activated this function so that I can change
8256 tabular-features via menu.
8258 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8259 that I can test some functions with the Table menu.
8261 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8263 * src/lyxfont.C (stateText): guard against stupid c++libs.
8265 * src/tabular.C: add using std::vector
8266 some whitespace changes, + removed som autogenerated code.
8268 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8270 2000-05-05 Juergen Vigna <jug@sad.it>
8272 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8273 row, columns and cellstructures.
8275 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8277 * lib/lyxrc.example: remove obsolete entries.
8279 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8280 reading of protected_separator for free_spacing.
8282 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8284 * src/text.C (draw): do not display an exclamation mark in the
8285 margin for margin notes. This is confusing, ugly and
8288 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8289 AMS math' is checked.
8291 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8292 name to see whether including the amsmath package is needed.
8294 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8296 * src/paragraph.C (validate): Compute UsedLanguages correctly
8297 (don't insert the american language if it doesn't appear in the
8300 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8301 The argument of \thanks{} command is considered moving argument
8303 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8306 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8308 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8309 for appendix/minipage/depth. The lines can be now both in the footnote
8310 frame, and outside the frame.
8312 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8315 2000-05-05 Juergen Vigna <jug@sad.it>
8317 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8318 neede only in tabular.[Ch].
8320 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8322 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8324 (Write): write '~' for PROTECTED_SEPARATOR
8326 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8328 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8331 * src/mathed/formula.C (drawStr): rename size to siz.
8333 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8334 possibly fix a bug by not changing the pflags = flags to piflags =
8337 2000-05-05 Juergen Vigna <jug@sad.it>
8339 * src/insets/insetbib.C: moved using directive
8341 * src/ImportNoweb.C: small fix for being able to compile (missing
8344 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8346 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8347 to use clear, since we don't depend on this in the code. Add test
8350 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8352 * (various *.C files): add using std::foo directives to please dec
8355 * replace calls to string::clear() to string::erase() (Angus)
8357 * src/cheaders/cmath: modified to provide std::abs.
8359 2000-05-04 Juergen Vigna <jug@sad.it>
8361 * src/insets/insettext.C: Prepared all for inserting of multiple
8362 paragraphs. Still display stuff to do (alignment and other things),
8363 but I would like to use LyXText to do this when we cleaned out the
8364 table-support stuff.
8366 * src/insets/insettabular.C: Changed lot of stuff and added lots
8367 of functionality still a lot to do.
8369 * src/tabular.C: Various functions changed name and moved to be
8370 const functions. Added new Read and Write functions and changed
8371 lots of things so it works good with tabular-insets (also removed
8372 some stuff which is not needed anymore * hacks *).
8374 * src/lyxcursor.h: added operators == and != which just look if
8375 par and pos are (not) equal.
8377 * src/buffer.C (latexParagraphs): inserted this function to latex
8378 all paragraphs form par to endpar as then I can use this too for
8381 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8382 so that I can call this to from text insets with their own cursor.
8384 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8385 output off all paragraphs (because of the fix below)!
8387 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8388 the very last paragraph (this could be also the last paragraph of an
8391 * src/texrow.h: added rows() call which returns the count-variable.
8393 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8395 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8397 * lib/configure.m4: better autodetection of DocBook tools.
8399 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8401 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8403 * src/lyx_cb.C: add using std::reverse;
8405 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8408 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8409 selected files. Should fix repeated errors from generated files.
8411 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8413 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8415 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8416 the spellchecker popup.
8418 * lib/lyxrc.example: Removed the \number_inset section
8420 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8422 * src/insets/figinset.C (various): Use IsFileReadable() to make
8423 sure that the file actually exist. Relying on ghostscripts errors
8424 is a bad idea since they can lead to X server crashes.
8426 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8428 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8431 * lib/lyxrc.example: smallish typo in description of
8432 \view_dvi_paper_option
8434 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8437 * src/lyxfunc.C: doImportHelper to factor out common code of the
8438 various import methods. New functions doImportASCIIasLines,
8439 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8440 doImportLinuxDoc for the format specific parts.
8443 * buffer.C: Dispatch returns now a bool to indicate success
8446 * lyx_gui.C: Add getLyXView() for member access
8448 * lyx_main.C: Change logic for batch commands: First try
8449 Buffer::Dispatch (possibly without GUI), if that fails, use
8452 * lyx_main.C: Add support for --import command line switch.
8453 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8454 Available Formats: Everything accepted by 'buffer-import <format>'
8456 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8461 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8462 documents will be reformatted upon reentry.
8464 2000-04-27 Juergen Vigna <jug@sad.it>
8466 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8467 correctly only last pos this was a bug.
8469 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8471 * release of lyx-1.1.5pre1
8473 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8475 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8477 * src/menus.C: revert the change of naming (Figure->Graphic...)
8478 from 2000-04-11. It was incomplete and bad.
8480 * src/LColor.[Ch]: add LColor::depthbar.
8481 * src/text.C (GetVisibleRow): use it.
8483 * README: update the languages list.
8485 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8487 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8490 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8492 * README: remove sections that were just wrong.
8494 * src/text2.C (GetRowNearY): remove currentrow code
8496 * src/text.C (GetRow): remove currentrow code
8498 * src/screen.C (Update): rewritten a bit.
8499 (SmallUpdate): removed func
8501 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8503 (FullRebreak): return bool
8504 (currentrow): remove var
8505 (currentrow_y): ditto
8507 * src/lyxscreen.h (Draw): change arg to unsigned long
8508 (FitCursor): return bool
8509 (FitManualCursor): ditto
8510 (Smallpdate): remove func
8511 (first): change to unsigned long
8512 (DrawOneRow): change second arg to long (from long &)
8513 (screen_refresh_y): remove var
8514 (scree_refresh_row): ditto
8516 * src/lyxrow.h: change baseline to usigned int from unsigned
8517 short, this brings some implicit/unsigned issues out in the open.
8519 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8521 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8522 instead of smallUpdate.
8524 * src/lyxcursor.h: change y to unsigned long
8526 * src/buffer.h: don't call updateScrollbar after fitcursor
8528 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8529 where they are used. Removed "\\direction", this was not present
8530 in 1.1.4 and is already obsolete. Commented out some code that I
8531 believe to never be called.
8532 (runLiterate): don't call updateScrollbar after fitCursor
8534 (buildProgram): ditto
8537 * src/WorkArea.h (workWidth): change return val to unsigned
8540 (redraw): remove the button redraws
8541 (setScrollbarValue): change for scrollbar
8542 (getScrollbarValue): change for scrollbar
8543 (getScrollbarBounds): change for scrollbar
8545 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8546 (C_WorkArea_down_cb): removed func
8547 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8548 (resize): change for scrollbar
8549 (setScrollbar): ditto
8550 (setScrollbarBounds): ditto
8551 (setScrollbarIncrements): ditto
8552 (up_cb): removed func
8553 (down_cb): removed func
8554 (scroll_cb): change for scrollbar
8555 (work_area_handler): ditto
8557 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8558 when FitCursor did something.
8559 (updateScrollbar): some unsigned changes
8560 (downCB): removed func
8561 (scrollUpOnePage): removed func
8562 (scrollDownOnePage): remvoed func
8563 (workAreaMotionNotify): don't call screen->FitCursor but use
8564 fitCursor instead. and bool return val
8565 (workAreaButtonPress): ditto
8566 (workAreaButtonRelease): some unsigned changes
8567 (checkInsetHit): ditto
8568 (workAreaExpose): ditto
8569 (update): parts rewritten, comments about the signed char arg added
8570 (smallUpdate): removed func
8571 (cursorPrevious): call needed updateScrollbar
8574 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8577 * src/BufferView.[Ch] (upCB): removed func
8578 (downCB): removed func
8579 (smallUpdate): removed func
8581 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8583 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8584 currentrow, currentrow_y optimization. This did not help a lot and
8585 if we want to do this kind of optimization we should rather use
8586 cursor.row instead of the currentrow.
8588 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8589 buffer spacing and klyx spacing support.
8591 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8593 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8596 2000-04-26 Juergen Vigna <jug@sad.it>
8598 * src/insets/figinset.C: fixes to Lars sstream changes!
8600 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8602 * A lot of files: Added Ascii(ostream &) methods to all inset
8603 classes. Used when exporting to ASCII.
8605 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8606 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8609 * src/text2.C (ToggleFree): Disabled implicit word selection when
8610 there is a change in the language
8612 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8613 no output was generated for end-of-sentence inset.
8615 * src/insets/lyxinset.h
8618 * src/paragraph.C: Removed the insetnumber code
8620 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8622 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8624 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8625 no_babel and no_epsfig completely from the file.
8626 (parseSingleLyXformat2Token): add handling for per-paragraph
8627 spacing as written by klyx.
8629 * src/insets/figinset.C: applied patch by Andre. Made it work with
8632 2000-04-20 Juergen Vigna <jug@sad.it>
8634 * src/insets/insettext.C (cutSelection):
8635 (copySelection): Fixed with selection from right to left.
8636 (draw): now the rows are not recalculated at every draw.
8637 (computeTextRows): for now reset the inset-owner here (this is
8638 important for an undo or copy where the inset-owner is not set
8641 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8642 motion to the_locking_inset screen->first was forgotten, this was
8643 not important till we got multiline insets.
8645 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8647 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8648 code seems to be alright (it is code changed by Dekel, and the
8649 intent is indeed that all macros should be defined \protect'ed)
8651 * NEWS: a bit of reorganisation of the new user-visible features.
8653 2000-04-19 Juergen Vigna <jug@sad.it>
8655 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8656 position. Set the inset_owner of the used paragraph so that it knows
8657 that it is inside an inset. Fixed cursor handling with mouse and
8658 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8659 and cleanups to make TextInsets work better.
8661 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8662 Changed parameters of various functions and added LockInsetInInset().
8664 * src/insets/insettext.C:
8666 * src/insets/insetcollapsable.h:
8667 * src/insets/insetcollapsable.C:
8668 * src/insets/insetfoot.h:
8669 * src/insets/insetfoot.C:
8670 * src/insets/insetert.h:
8671 * src/insets/insetert.C: cleaned up the code so that it works now
8672 correctly with insettext.
8674 * src/insets/inset.C:
8675 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8676 that insets in insets are supported right.
8679 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8681 * src/paragraph.C: some small fixes
8683 * src/debug.h: inserted INSETS debug info
8685 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8686 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8688 * src/commandtags.h:
8689 * src/LyXAction.C: insert code for InsetTabular.
8691 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8692 not Button1MotionMask.
8693 (workAreaButtonRelease): send always a InsetButtonRelease event to
8695 (checkInsetHit): some setCursor fixes (always with insets).
8697 * src/BufferView2.C (lockInset): returns a bool now and extended for
8698 locking insets inside insets.
8699 (showLockedInsetCursor): it is important to have the cursor always
8700 before the locked inset.
8701 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8703 * src/BufferView.h: made lockInset return a bool.
8705 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8707 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8708 that is used also internally but can be called as public to have back
8709 a cursor pos which is not set internally.
8710 (SetCursorIntern): Changed to use above function.
8712 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8714 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8719 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8720 patches for things that should be in or should be changed.
8722 * src/* [insetfiles]: change "usigned char fragile" to bool
8723 fragile. There was only one point that could that be questioned
8724 and that is commented in formulamacro.C. Grep for "CHECK".
8726 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8727 (DeleteBuffer): take it out of CutAndPaste and make it static.
8729 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8731 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8732 output the spacing envir commands. Also the new commands used in
8733 the LaTeX output makes the result better.
8735 * src/Spacing.C (writeEnvirBegin): new method
8736 (writeEnvirEnd): new method
8738 2000-04-18 Juergen Vigna <jug@sad.it>
8740 * src/CutAndPaste.C: made textclass a static member of the class
8741 as otherwise it is not accesed right!!!
8743 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8745 * forms/layout_forms.fd
8746 * src/layout_forms.h
8747 * src/layout_forms.C (create_form_form_character)
8748 * src/lyx_cb.C (UserFreeFont)
8749 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8750 documents (in the layout->character popup).
8752 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8754 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8755 \spell_command was in fact not honored (from Kevin Atkinson).
8757 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8760 * src/lyx_gui.h: make lyxViews private (Angus)
8762 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8764 * src/mathed/math_write.C
8765 (MathMatrixInset::Write) Put \protect before \begin{array} and
8766 \end{array} if fragile
8767 (MathParInset::Write): Put \protect before \\ if fragile
8769 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8771 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8772 initialization if the LyXColorHandler must be done after the
8773 connections to the XServer has been established.
8775 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8776 get the background pixel from the lyxColorhandler so that the
8777 figures are rendered with the correct background color.
8778 (NextToken): removed functions.
8779 (GetPSSizes): use ifs >> string instead of NextToken.
8781 * src/Painter.[Ch]: the color cache moved out of this file.
8783 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8786 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8788 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8789 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8791 * src/BufferView.C (enterView): new func
8792 (leaveView): new func
8794 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8796 (leaveView): new func, undefines xterm cursor when approp.
8798 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8799 (AllowInput): delete the Workarea cursor handling from this func.
8801 * src/Painter.C (underline): draw a slimer underline in most cases.
8803 * src/lyx_main.C (error_handler): use extern "C"
8805 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8807 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8808 sent directly to me.
8810 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8811 to the list by Dekel.
8813 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8816 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8817 methods from lyx_cb.here.
8819 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8822 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8824 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8825 instead of using current_view directly.
8827 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8829 * src/LyXAction.C (init): add the paragraph-spacing command.
8831 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8833 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8835 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8836 different from the documents.
8838 * src/text.C (SetHeightOfRow): take paragraph spacing into
8839 account, paragraph spacing takes precedence over buffer spacing
8840 (GetVisibleRow): ditto
8842 * src/paragraph.C (writeFile): output the spacing parameter too.
8843 (validate): set the correct features if spacing is used in the
8845 (Clear): set spacing to default
8846 (MakeSameLayout): spacing too
8847 (HasSameLayout): spacing too
8848 (SetLayout): spacing too
8849 (TeXOnePar): output the spacing commands
8851 * src/lyxparagraph.h: added a spacing variable for use with
8852 per-paragraph spacing.
8854 * src/Spacing.h: add a Default spacing and a method to check if
8855 the current spacing is default. also added an operator==
8857 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8860 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8862 * src/lyxserver.C (callback): fix dispatch of functions
8864 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8865 printf() into lyxerr call.
8867 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8870 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8871 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8872 the "Float" from each of the subitems.
8873 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8875 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8876 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8877 documented the change so that the workaround can be nuked later.
8879 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8882 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8884 * src/buffer.C (getLatexName): ditto
8885 (setReadonly): ditto
8887 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8889 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8890 avoid some uses of current_view. Added also a bufferParams()
8891 method to get at this.
8893 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8895 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8897 * src/lyxparagraph.[Ch]: removed
8898 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8899 with operators used by lower_bound and
8900 upper_bound in InsetTable's
8901 Make struct InsetTable private again. Used matchpos.
8903 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8905 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8906 document, the language of existing text is changed (unless the
8907 document is multi-lingual)
8909 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8911 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8913 * A lot of files: A rewrite of the Right-to-Left support.
8915 2000-04-10 Juergen Vigna <jug@sad.it>
8917 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8918 misplaced cursor when inset in inset is locked.
8920 * src/insets/insettext.C (LocalDispatch): small fix so that a
8921 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8923 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8924 footnote font should be decreased in size twice when displaying.
8926 * src/insets/insettext.C (GetDrawFont): inserted this function as
8927 the drawing-font may differ from the real paragraph font.
8929 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8930 insets (inset in inset!).
8932 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8933 function here because we don't want footnotes inside footnotes.
8935 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8937 (init): now set the inset_owner in paragraph.C
8938 (LocalDispatch): added some resetPos() in the right position
8941 (pasteSelection): changed to use the new CutAndPaste-Class.
8943 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8944 which tells if it is allowed to insert another inset inside this one.
8946 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8947 SwitchLayoutsBetweenClasses.
8949 * src/text2.C (InsertInset): checking of the new paragraph-function
8951 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8952 is not needed anymore here!
8955 (PasteSelection): redone (also with #ifdef) so that now this uses
8956 the CutAndPaste-Class.
8957 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8960 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8961 from/to text/insets.
8963 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8964 so that the paragraph knows if it is inside an (text)-inset.
8965 (InsertFromMinibuffer): changed return-value to bool as now it
8966 may happen that an inset is not inserted in the paragraph.
8967 (InsertInsetAllowed): this checks if it is allowed to insert an
8968 inset in this paragraph.
8970 (BreakParagraphConservative):
8971 (BreakParagraph) : small change for the above change of the return
8972 value of InsertFromMinibuffer.
8974 * src/lyxparagraph.h: added inset_owner and the functions to handle
8975 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8977 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8979 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8980 functions from BufferView to BufferView::Pimpl to ease maintence.
8982 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8983 correctly. Also use SetCursorIntern instead of SetCursor.
8985 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8988 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8990 * src/WorkArea.C (belowMouse): manually implement below mouse.
8992 * src/*: Add "explicit" on several constructors, I added probably
8993 some unneeded ones. A couple of changes to code because of this.
8995 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8996 implementation and private parts from the users of BufferView. Not
8999 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9000 implementation and private parts from the users of LyXLex. Not
9003 * src/BufferView_pimpl.[Ch]: new files
9005 * src/lyxlex_pimpl.[Ch]: new files
9007 * src/LyXView.[Ch]: some inline functions move out-of-line
9009 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9011 * src/lyxparagraph.h: make struct InsetTable public.
9013 * src/support/lyxstring.h: change lyxstring::difference_type to be
9014 ptrdiff_t. Add std:: modifiers to streams.
9016 * src/font.C: include the <cctype> header, for islower() and
9019 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9021 * src/font.[Ch]: new files. Contains the metric functions for
9022 fonts, takes a LyXFont as parameter. Better separation of concepts.
9024 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9025 changes because of this.
9027 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9029 * src/*: compile with -Winline and move functions that don't
9032 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9035 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9037 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9038 (various files changed because of this)
9040 * src/Painter.C (text): fixed the drawing of smallcaps.
9042 * src/lyxfont.[Ch] (drawText): removed unused member func.
9045 * src/*.C: added needed "using" statements and "std::" qualifiers.
9047 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9049 * src/*.h: removed all use of "using" from header files use
9050 qualifier std:: instead.
9052 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9054 * src/text.C (Backspace): some additional cleanups (we already
9055 know whether cursor.pos is 0 or not).
9057 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9058 automake does not provide one).
9060 * src/bmtable.h: replace C++ comments with C comments.
9062 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9064 * src/screen.C (ShowCursor): Change the shape of the cursor if
9065 the current language is not equal to the language of the document.
9066 (If the cursor change its shape unexpectedly, then you've found a bug)
9068 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9071 * src/insets/insetnumber.[Ch]: New files.
9073 * src/LyXAction.C (init)
9074 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9077 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9079 * src/lyxparagraph.h
9080 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9081 (the vector is kept sorted).
9083 * src/text.C (GetVisibleRow): Draw selection correctly when there
9084 is both LTR and RTL text.
9086 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9087 which is much faster.
9089 * src/text.C (GetVisibleRow and other): Do not draw the last space
9090 in a row if the direction of the last letter is not equal to the
9091 direction of the paragraph.
9093 * src/lyxfont.C (latexWriteStartChanges):
9094 Check that font language is not equal to basefont language.
9095 (latexWriteEndChanges): ditto
9097 * src/lyx_cb.C (StyleReset): Don't change the language while using
9098 the font-default command.
9100 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9101 empty paragraph before a footnote.
9103 * src/insets/insetcommand.C (draw): Increase x correctly.
9105 * src/screen.C (ShowCursor): Change cursor shape if
9106 current language != document language.
9108 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9110 2000-03-31 Juergen Vigna <jug@sad.it>
9112 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9113 (Clone): changed mode how the paragraph-data is copied to the
9114 new clone-paragraph.
9116 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9117 GetInset(pos) with no inset anymore there (in inset UNDO)
9119 * src/insets/insetcommand.C (draw): small fix as here x is
9120 incremented not as much as width() returns (2 before, 2 behind = 4)
9122 2000-03-30 Juergen Vigna <jug@sad.it>
9124 * src/insets/insettext.C (InsetText): small fix in initialize
9125 widthOffset (should not be done in the init() function)
9127 2000-03-29 Amir Karger <karger@lyx.org>
9129 * lib/examples/it_ItemizeBullets.lyx: translation by
9132 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9134 2000-03-29 Juergen Vigna <jug@sad.it>
9136 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9138 * src/insets/insetfoot.C (Clone): small change as for the below
9139 new init function in the text-inset
9141 * src/insets/insettext.C (init): new function as I've seen that
9142 clone did not copy the Paragraph-Data!
9143 (LocalDispatch): Added code so that now we have some sort of Undo
9144 functionality (well actually we HAVE Undo ;)
9146 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9148 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9150 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9153 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9155 * src/main.C: added a runtime check that verifies that the xforms
9156 header used when building LyX and the library used when running
9157 LyX match. Exit with a message if they don't match. This is a
9158 version number check only.
9160 * src/buffer.C (save): Don't allocate memory on the heap for
9161 struct utimbuf times.
9163 * *: some using changes, use iosfwd instead of the real headers.
9165 * src/lyxfont.C use char const * instead of string for the static
9166 strings. Rewrite some functions to use sstream.
9168 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9170 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9173 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9175 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9176 of Geodesy (from Martin Vermeer)
9178 * lib/layouts/svjour.inc: include file for the Springer svjour
9179 class. It can be used to support journals other than JoG.
9181 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9182 Miskiewicz <misiek@pld.org.pl>)
9183 * lib/reLyX/Makefile.am: ditto.
9185 2000-03-27 Juergen Vigna <jug@sad.it>
9187 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9188 also some modifications with operations on selected text.
9190 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9191 problems with clicking on insets (last famous words ;)
9193 * src/insets/insetcommand.C (draw):
9194 (width): Changed to have a bit of space before and after the inset so
9195 that the blinking cursor can be seen (otherwise it was hidden)
9197 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9199 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9200 would not be added to the link list when an installed gettext (not
9201 part of libc) is found.
9203 2000-03-24 Juergen Vigna <jug@sad.it>
9205 * src/insets/insetcollapsable.C (Edit):
9206 * src/mathed/formula.C (InsetButtonRelease):
9207 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9210 * src/BufferView.C (workAreaButtonPress):
9211 (workAreaButtonRelease):
9212 (checkInsetHit): Finally fixed the clicking on insets be handled
9215 * src/insets/insetert.C (Edit): inserted this call so that ERT
9216 insets work always with LaTeX-font
9218 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9220 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9221 caused lyx to startup with no GUI in place, causing in a crash
9222 upon startup when called with arguments.
9224 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9226 * src/FontLoader.C: better initialization of dummyXFontStruct.
9228 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9230 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9231 for linuxdoc and docbook import and export format options.
9233 * lib/lyxrc.example Example of default values for the previous flags.
9235 * src/lyx_cb.C Use those flags instead of the hardwired values for
9236 linuxdoc and docbook export.
9238 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9241 * src/menus.C Added menus entries for the new import/exports formats.
9243 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9245 * src/lyxrc.*: Added support for running without Gui
9248 * src/FontLoader.C: sensible defaults if no fonts are needed
9250 * src/lyx_cb.C: New function ShowMessage (writes either to the
9251 minibuffer or cout in case of no gui
9252 New function AskOverwrite for common stuff
9253 Consequently various changes to call these functions
9255 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9256 wild guess at sensible screen resolution when having no gui
9258 * src/lyxfont.C: no gui, no fonts... set some defaults
9260 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9262 * src/LColor.C: made the command inset background a bit lighter.
9264 2000-03-20 Hartmut Goebel <goebel@noris.net>
9266 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9267 stdstruct.inc. Koma-Script added some title elements which
9268 otherwise have been listed below "bibliography". This split allows
9269 adding title elements to where they belong.
9271 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9272 define the additional title elements and then include
9275 * many other layout files: changed to include stdtitle.inc just
9276 before stdstruct.inc.
9278 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9280 * src/buffer.C: (save) Added the option to store all backup files
9281 in a single directory
9283 * src/lyxrc.[Ch]: Added variable \backupdir_path
9285 * lib/lyxrc.example: Added descriptions of recently added variables
9287 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9288 bibtex inset, not closing the bibtex popup when deleting the inset)
9290 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9292 * src/lyx_cb.C: add a couple using directives.
9294 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9295 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9296 import based on the filename.
9298 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9299 file would be imported at start, if the filename where of a sgml file.
9301 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9303 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9305 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9306 * src/lyxfont.h Replaced the member variable bits.direction by the
9307 member variable lang. Made many changes in other files.
9308 This allows having a multi-lingual document
9310 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9311 that change the current language to <l>.
9312 Removed the command "font-rtl"
9314 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9315 format for Hebrew documents)
9317 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9318 When auto_mathmode is "true", pressing a digit key in normal mode
9319 will cause entering into mathmode.
9320 If auto_mathmode is "rtl" then this behavior will be active only
9321 when writing right-to-left text.
9323 * src/text2.C (InsertStringA) The string is inserted using the
9326 * src/paragraph.C (GetEndLabel) Gives a correct result for
9327 footnote paragraphs.
9329 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9331 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9333 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9334 front of PasteParagraph. Never insert a ' '. This should at least
9335 fix some cause for the segfaults that we have been experiencing,
9336 it also fixes backspace behaviour slightly. (Phu!)
9338 * src/support/lstrings.C (compare_no_case): some change to make it
9339 compile with gcc 2.95.2 and stdlibc++-v3
9341 * src/text2.C (MeltFootnoteEnvironment): change type o
9342 first_footnote_par_is_not_empty to bool.
9344 * src/lyxparagraph.h: make text private. Changes in other files
9346 (fitToSize): new function
9347 (setContentsFromPar): new function
9348 (clearContents): new function
9349 (SetChar): new function
9351 * src/paragraph.C (readSimpleWholeFile): deleted.
9353 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9354 the file, just use a simple string instead. Also read the file in
9355 a more maintainable manner.
9357 * src/text2.C (InsertStringA): deleted.
9358 (InsertStringB): deleted.
9360 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9362 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9363 RedoParagraphs from the doublespace handling part, just set status
9364 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9365 done, but perhaps not like this.)
9367 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9369 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9370 character when inserting an inset.
9372 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9374 * src/bufferparams.C (readLanguage): now takes "default" into
9377 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9378 also initialize the toplevel_keymap with the default bindings from
9381 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9383 * all files using lyxrc: have lyxrc as a real variable and not a
9384 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9387 * src/lyxrc.C: remove double call to defaultKeyBindings
9389 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9390 toolbar defauls using lyxlex. Remove enums, structs, functions
9393 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9394 toolbar defaults. Also store default keybindings in a map.
9396 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9397 storing the toolbar defaults without any xforms dependencies.
9399 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9400 applied. Changed to use iterators.
9402 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9404 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9405 systems that don't have LINGUAS set to begin with.
9407 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9409 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9410 the list by Dekel Tsur.
9412 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9414 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9415 * src/insets/form_graphics.C: ditto.
9417 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9419 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9421 * src/bufferparams.C (readLanguage): use the new language map
9423 * src/intl.C (InitKeyMapper): use the new language map
9425 * src/lyx_gui.C (create_forms): use the new language map
9427 * src/language.[Ch]: New files. Used for holding the information
9428 about each language. Now! Use this new language map enhance it and
9429 make it really usable for our needs.
9431 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9433 * screen.C (ShowCursor): Removed duplicate code.
9434 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9435 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9437 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9440 * src/text.C Added TransformChar method. Used for rendering Arabic
9441 text correctly (change the glyphs of the letter according to the
9442 position in the word)
9447 * src/lyxrc.C Added lyxrc command {language_command_begin,
9448 language_command_end,language_command_ltr,language_command_rtl,
9449 language_package} which allows the use of either arabtex or Omega
9452 * src/lyx_gui.C (init)
9454 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9455 to use encoding for menu fonts which is different than the encoding
9458 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9459 do not load the babel package.
9460 To write an English document with Hebrew/Arabic, change the document
9461 language to "english".
9463 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9464 (alphaCounter): changed to return char
9465 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9467 * lib/lyxrc.example Added examples for Hebrew/Arabic
9470 * src/layout.C Added layout command endlabeltype
9472 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9474 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9476 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9478 * src/mathed/math_delim.C (search_deco): return a
9479 math_deco_struct* instead of index.
9481 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9483 * All files with a USE_OSTREAM_ONLY within: removed all code that
9484 was unused when USE_OSTREAM_ONLY is defined.
9486 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9487 of any less. Removed header and using.
9489 * src/text.C (GetVisibleRow): draw the string "Page Break
9490 (top/bottom)" on screen when drawing a pagebreak line.
9492 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9494 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9496 * src/mathed/math_macro.C (draw): do some cast magic.
9499 * src/mathed/math_defs.h: change byte* argument to byte const*.
9501 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9503 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9504 know it is right to return InsetFoot* too, but cxx does not like
9507 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9509 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9511 * src/mathed/math_delim.C: change == to proper assignment.
9513 2000-03-09 Juergen Vigna <jug@sad.it>
9515 * src/insets/insettext.C (setPos): fixed various cursor positioning
9516 problems (via mouse and cursor-keys)
9517 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9518 inset (still a small display problem but it works ;)
9520 * src/insets/insetcollapsable.C (draw): added button_top_y and
9521 button_bottom_y to have correct values for clicking on the inset.
9523 * src/support/lyxalgo.h: commented out 'using std::less'
9525 2000-03-08 Juergen Vigna <jug@sad.it>
9527 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9528 Button-Release event closes as it is alos the Release-Event
9531 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9533 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9535 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9536 can add multiple spaces in Scrap (literate programming) styles...
9537 which, by the way, is how I got hooked on LyX to begin with.
9539 * src/mathed/formula.C (Write): Added dummy variable to an
9540 inset::Latex() call.
9541 (Latex): Add free_spacing boolean to inset::Latex()
9543 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9545 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9546 virtual function to include the free_spacing boolean from
9547 the containing paragraph's style.
9549 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9550 Added free_spacing boolean arg to match inset.h
9552 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9553 Added free_spacing boolean arg to match inset.h
9555 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9556 Added free_spacing boolean and made sure that if in a free_spacing
9557 paragraph, that we output normal space if there is a protected space.
9559 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9560 Added free_spacing boolean arg to match inset.h
9562 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9563 Added free_spacing boolean arg to match inset.h
9565 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9566 Added free_spacing boolean arg to match inset.h
9568 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9569 Added free_spacing boolean arg to match inset.h
9571 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9572 Added free_spacing boolean arg to match inset.h
9574 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9575 free_spacing boolean arg to match inset.h
9577 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9578 Added free_spacing boolean arg to match inset.h
9580 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9581 Added free_spacing boolean arg to match inset.h
9583 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9584 Added free_spacing boolean arg to match inset.h
9586 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9587 Added free_spacing boolean arg to match inset.h
9589 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9590 Added free_spacing boolean arg to match inset.h
9592 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9593 free_spacing boolean arg to match inset.h
9595 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9596 free_spacing boolean arg to match inset.h
9598 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9599 ignore free_spacing paragraphs. The user's spaces are left
9602 * src/text.C (InsertChar): Fixed the free_spacing layout
9603 attribute behavior. Now, if free_spacing is set, you can
9604 add multiple spaces in a paragraph with impunity (and they
9605 get output verbatim).
9606 (SelectSelectedWord): Added dummy argument to inset::Latex()
9609 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9612 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9613 paragraph layouts now only input a simple space instead.
9614 Special character insets don't make any sense in free-spacing
9617 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9618 hard-spaces in the *input* file to simple spaces if the layout
9619 is free-spacing. This converts old files which had to have
9620 hard-spaces in free-spacing layouts where a simple space was
9622 (writeFileAscii): Added free_spacing check to pass to the newly
9623 reworked inset::Latex(...) methods. The inset::Latex() code
9624 ensures that hard-spaces in free-spacing paragraphs get output
9625 as spaces (rather than "~").
9627 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9629 * src/mathed/math_delim.C (draw): draw the empty placeholder
9630 delims with a onoffdash line.
9631 (struct math_deco_compare): struct that holds the "functors" used
9632 for the sort and the binary search in math_deco_table.
9633 (class init_deco_table): class used for initial sort of the
9635 (search_deco): use lower_bound to do a binary search in the
9638 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9640 * src/lyxrc.C: a small secret thingie...
9642 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9643 and to not flush the stream as often as it used to.
9645 * src/support/lyxalgo.h: new file
9646 (sorted): template function used for checking if a sequence is
9647 sorted or not. Two versions with and without user supplied
9648 compare. Uses same compare as std::sort.
9650 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9651 it and give warning on lyxerr.
9653 (struct compare_tags): struct with function operators used for
9654 checking if sorted, sorting and lower_bound.
9655 (search_kw): use lower_bound instead of manually implemented
9658 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9660 * src/insets/insetcollapsable.h: fix Clone() declaration.
9661 * src/insets/insetfoot.h: ditto.
9663 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9665 2000-03-08 Juergen Vigna <jug@sad.it>
9667 * src/insets/lyxinset.h: added owner call which tells us if
9668 this inset is inside another inset. Changed also the return-type
9669 of Editable to an enum so it tells clearer what the return-value is.
9671 * src/insets/insettext.C (computeTextRows): fixed computing of
9672 textinsets which split automatically on more rows.
9674 * src/insets/insetert.[Ch]: changed this to be of BaseType
9677 * src/insets/insetfoot.[Ch]: added footnote inset
9679 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9680 collapsable insets (like footnote, ert, ...)
9682 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9684 * src/lyxdraw.h: remvoe file
9686 * src/lyxdraw.C: remove file
9688 * src/insets/insettext.C: added <algorithm>.
9690 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9692 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9693 (matrix_cb): case MM_OK use string stream
9695 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9698 * src/mathed/math_macro.C (draw): use string stream
9699 (Metrics): use string stream
9701 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9702 directly to the ostream.
9704 * src/vspace.C (asString): use string stream.
9705 (asString): use string stream
9706 (asLatexString): use string stream
9708 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9709 setting Spacing::Other.
9711 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9712 sprintf when creating the stretch vale.
9714 * src/text2.C (alphaCounter): changed to return a string and to
9715 not use a static variable internally. Also fixed a one-off bug.
9716 (SetCounter): changed the drawing of the labels to use string
9717 streams instead of sprintf.
9719 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9720 manipulator to use a scheme that does not require library support.
9721 This is also the way it is done in the new GNU libstdc++. Should
9722 work with DEC cxx now.
9724 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9726 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9727 end. This fixes a bug.
9729 * src/mathed (all files concerned with file writing): apply the
9730 USE_OSTREAM_ONLY changes to mathed too.
9732 * src/support/DebugStream.h: make the constructor explicit.
9734 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9735 count and ostream squashed.
9737 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9739 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9741 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9742 ostringstream uses STL strings, and we might not.
9744 * src/insets/insetspecialchar.C: add using directive.
9745 * src/insets/insettext.C: ditto.
9747 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9749 * lib/layouts/seminar.layout: feeble attempt at a layout for
9750 seminar.cls, far from completet and could really use some looking
9751 at from people used to write layout files.
9753 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9754 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9755 a lot nicer and works nicely with ostreams.
9757 * src/mathed/formula.C (draw): a slightly different solution that
9758 the one posted to the list, but I think this one works too. (font
9759 size wrong in headers.)
9761 * src/insets/insettext.C (computeTextRows): some fiddling on
9762 Jürgens turf, added some comments that he should read.
9764 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9765 used and it gave compiler warnings.
9766 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9769 * src/lyx_gui.C (create_forms): do the right thing when
9770 show_banner is true/false.
9772 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9773 show_banner is false.
9775 * most file writing files: Now use iostreams to do almost all of
9776 the writing. Also instead of passing string &, we now use
9777 stringstreams. mathed output is still not adapted to iostreams.
9778 This change can be turned off by commenting out all the occurences
9779 of the "#define USE_OSTREAM_ONLY 1" lines.
9781 * src/WorkArea.C (createPixmap): don't output debug messages.
9782 (WorkArea): don't output debug messages.
9784 * lib/lyxrc.example: added a comment about the new variable
9787 * development/Code_rules/Rules: Added some more commente about how
9788 to build class interfaces and on how better encapsulation can be
9791 2000-03-03 Juergen Vigna <jug@sad.it>
9793 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9794 automatically with the width of the LyX-Window
9796 * src/insets/insettext.C (computeTextRows): fixed update bug in
9797 displaying text-insets (scrollvalues where not initialized!)
9799 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9801 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9802 id in the check of the result from lower_bound is not enough since
9803 lower_bound can return last too, and then res->id will not be a
9806 * all insets and some code that use them: I have conditionalized
9807 removed the Latex(string & out, ...) this means that only the
9808 Latex(ostream &, ...) will be used. This is a work in progress to
9809 move towards using streams for all output of files.
9811 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9814 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9816 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9817 routine (this fixes bug where greek letters were surrounded by too
9820 * src/support/filetools.C (findtexfile): change a bit the search
9821 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9822 no longer passed to kpsewhich, we may have to change that later.
9824 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9825 warning options to avoid problems with X header files (from Angus
9827 * acinclude.m4: regenerated.
9829 2000-03-02 Juergen Vigna <jug@sad.it>
9831 * src/insets/insettext.C (WriteParagraphData): Using the
9832 par->writeFile() function for writing paragraph-data.
9833 (Read): Using buffer->parseSingleLyXformat2Token()-function
9834 for parsing paragraph data!
9836 * src/buffer.C (readLyXformat2): removed all parse data and using
9837 the new parseSingleLyXformat2Token()-function.
9838 (parseSingleLyXformat2Token): added this function to parse (read)
9839 lyx-file-format (this is called also from text-insets now!)
9841 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9843 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9846 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9847 directly instead of going through a func. One very bad thing: a
9848 static LyXFindReplace, but I don't know where to place it.
9850 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9851 string instead of char[]. Also changed to static.
9852 (GetSelectionOrWordAtCursor): changed to static inline
9853 (SetSelectionOverLenChars): ditto.
9855 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9856 current_view and global variables. both classes has changed names
9857 and LyXFindReplace is not inherited from SearchForm.
9859 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9860 fl_form_search form.
9862 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9864 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9866 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9867 bound (from Kayvan).
9869 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9871 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9873 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9875 * some things that I should comment but the local pub says head to
9878 * comment out all code that belongs to the Roff code for Ascii
9879 export of tables. (this is unused)
9881 * src/LyXView.C: use correct type for global variable
9882 current_layout. (LyXTextClass::size_type)
9884 * some code to get the new insetgraphics closer to working I'd be
9885 grateful for any help.
9887 * src/BufferView2.C (insertInset): use the return type of
9888 NumberOfLayout properly. (also changes in other files)
9890 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9891 this as a test. I want to know what breaks because of this.
9893 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9895 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9897 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9898 to use a \makebox in the label, this allows proper justification
9899 with out using protected spaces or multiple hfills. Now it is
9900 "label" for left justified, "\hfill label\hfill" for center, and
9901 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9902 should be changed accordingly.
9904 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9906 * src/lyxtext.h: change SetLayout() to take a
9907 LyXTextClass::size_type instead of a char (when there is more than
9908 127 layouts in a class); also change type of copylayouttype.
9909 * src/text2.C (SetLayout): ditto.
9910 * src/LyXView.C (updateLayoutChoice): ditto.
9912 * src/LaTeX.C (scanLogFile): errors where the line number was not
9913 given just after the '!'-line were ignored (from Dekel Tsur).
9915 * lib/lyxrc.example: fix description of \date_insert_format
9917 * lib/layouts/llncs.layout: new layout, contributed by Martin
9920 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9922 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9923 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9924 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9925 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9926 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9927 paragraph.C, text.C, text2.C)
9929 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9931 * src/insets/insettext.C (LocalDispatch): remove extra break
9934 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9935 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9937 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9938 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9940 * src/insets/insetbib.h: move InsetBibkey::Holder and
9941 InsetCitation::Holder in public space.
9943 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9945 * src/insets/insettext.h: small change to get the new files from
9946 Juergen to compile (use "string", not "class string").
9948 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9949 const & as parameter to LocalDispatch, use LyXFont const & as
9950 paramter to some other func. This also had impacto on lyxinsets.h
9951 and the two mathed insets.
9953 2000-02-24 Juergen Vigna <jug@sad.it>
9956 * src/commandtags.h:
9958 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9962 * src/BufferView2.C: added/updated code for various inset-functions
9964 * src/insets/insetert.[Ch]: added implementation of InsetERT
9966 * src/insets/insettext.[Ch]: added implementation of InsetText
9968 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9969 (draw): added preliminary code for inset scrolling not finshed yet
9971 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9972 as it is in lyxfunc.C now
9974 * src/insets/lyxinset.h: Added functions for text-insets
9976 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9978 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9979 BufferView and reimplement the list as a queue put inside its own
9982 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9984 * several files: use the new interface to the "updateinsetlist"
9986 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9988 (work_area_handler): call BufferView::trippleClick on trippleclick.
9990 * src/BufferView.C (doubleClick): new function, selects word on
9992 (trippleClick): new function, selects line on trippleclick.
9994 2000-02-22 Allan Rae <rae@lyx.org>
9996 * lib/bind/xemacs.bind: buffer-previous not supported
9998 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10000 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10003 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10005 * src/bufferlist.C: get rid of current_view from this file
10007 * src/spellchecker.C: get rid of current_view from this file
10009 * src/vspace.C: get rid of current_view from this file
10010 (inPixels): added BufferView parameter for this func
10011 (asLatexCommand): added a BufferParams for this func
10013 * src/text.C src/text2.C: get rid of current_view from these
10016 * src/lyxfont.C (getFontDirection): move this function here from
10019 * src/bufferparams.C (getDocumentDirection): move this function
10022 * src/paragraph.C (getParDirection): move this function here from
10024 (getLetterDirection): ditto
10026 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10028 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10029 resize due to wrong pixmap beeing used. Also took the opurtunity
10030 to make the LyXScreen stateless on regard to WorkArea and some
10031 general cleanup in the same files.
10033 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10035 * src/Makefile.am: add missing direction.h
10037 * src/PainterBase.h: made the width functions const.
10039 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10042 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10044 * src/insets/insetlatexaccent.C (draw): make the accents draw
10045 better, at present this will only work well with iso8859-1.
10047 * several files: remove the old drawing code, now we use the new
10050 * several files: remove support for mono_video, reverse_video and
10053 2000-02-17 Juergen Vigna <jug@sad.it>
10055 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10056 int ** as we have to return the pointer, otherwise we have only
10057 NULL pointers in the returning function.
10059 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10061 * src/LaTeX.C (operator()): quote file name when running latex.
10063 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10065 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10066 (bubble tip), this removes our special handling of this.
10068 * Remove all code that is unused now that we have the new
10069 workarea. (Code that are not active when NEW_WA is defined.)
10071 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10073 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10075 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10076 nonexisting layout; correctly redirect obsoleted layouts.
10078 * lib/lyxrc.example: document \view_dvi_paper_option
10080 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10083 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10084 (PreviewDVI): handle the view_dvi_paper_option variable.
10085 [Both from Roland Krause]
10087 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10089 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10090 char const *, int, LyXFont)
10091 (text(int, int, string, LyXFont)): ditto
10093 * src/text.C (InsertCharInTable): attempt to fix the double-space
10094 feature in tables too.
10095 (BackspaceInTable): ditto.
10096 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10098 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10100 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10102 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10103 newly found text in textcache to this.
10104 (buffer): set the owner of the text put into the textcache to 0
10106 * src/insets/figinset.C (draw): fixed the drawing of figures with
10109 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10110 drawing of mathframe, hfills, protected space, table lines. I have
10111 now no outstanding drawing problems with the new Painter code.
10113 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10115 * src/PainterBase.C (ellipse, circle): do not specify the default
10118 * src/LColor.h: add using directive.
10120 * src/Painter.[Ch]: change return type of methods from Painter& to
10121 PainterBase&. Add a using directive.
10123 * src/WorkArea.C: wrap xforms callbacks in C functions
10126 * lib/layouts/foils.layout: font fix and simplifications from Carl
10129 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10131 * a lot of files: The Painter, LColor and WorkArea from the old
10132 devel branch has been ported to lyx-devel. Some new files and a
10133 lot of #ifdeffed code. The new workarea is enabled by default, but
10134 if you want to test the new Painter and LColor you have to compile
10135 with USE_PAINTER defined (do this in config.h f.ex.) There are
10136 still some rought edges, and I'd like some help to clear those
10137 out. It looks stable (loads and displays the Userguide very well).
10140 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10142 * src/buffer.C (pop_tag): revert to the previous implementation
10143 (use a global variable for both loops).
10145 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10147 * src/lyxrc.C (LyXRC): change slightly default date format.
10149 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10150 there is an English text with a footnote that starts with a Hebrew
10151 paragraph, or vice versa.
10152 (TeXFootnote): ditto.
10154 * src/text.C (LeftMargin): allow for negative values for
10155 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10158 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10159 for input encoding (cyrillic)
10161 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10163 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10166 * src/toolbar.C (set): ditto
10167 * src/insets/insetbib.C (create_form_citation_form): ditto
10169 * lib/CREDITS: added Dekel Tsur.
10171 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10172 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10173 hebrew supports files from Dekel Tsur.
10175 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10176 <tzafrir@technion.ac.il>
10178 * src/lyxrc.C: put \date_insert_format at the right place.
10180 * src/buffer.C (makeLaTeXFile): fix the handling of
10181 BufferParams::sides when writing out latex files.
10183 * src/BufferView2.C: add a "using" directive.
10185 * src/support/lyxsum.C (sum): when we use lyxstring,
10186 ostringstream::str needs an additional .c_str().
10188 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10190 * src/support/filetools.C (ChangeExtension): patch from Etienne
10193 * src/TextCache.C (show): remove const_cast and make second
10194 parameter non-const LyXText *.
10196 * src/TextCache.h: use non const LyXText in show.
10198 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10201 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10203 * src/support/lyxsum.C: rework to be more flexible.
10205 * several places: don't check if a pointer is 0 if you are going
10208 * src/text.C: remove some dead code.
10210 * src/insets/figinset.C: remove some dead code
10212 * src/buffer.C: move the BufferView funcs to BufferView2.C
10213 remove all support for insetlatexdel
10214 remove support for oldpapersize stuff
10215 made some member funcs const
10217 * src/kbmap.C: use a std::list to store the bindings in.
10219 * src/BufferView2.C: new file
10221 * src/kbsequence.[Ch]: new files
10223 * src/LyXAction.C + others: remove all trace of buffer-previous
10225 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10226 only have one copy in the binary of this table.
10228 * hebrew patch: moved some functions from LyXText to more
10229 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10231 * several files: remove support for XForms older than 0.88
10232 whitespace changes.
10233 remove some #if 0 #endif code
10235 * src/TextCache.[Ch]: new file. Holds the textcache.
10237 * src/BufferView.C: changes to use the new TextCache interface.
10238 (waitForX): remove the now unused code.
10240 * src/BackStack.h: remove some commented code
10242 * lib/bind/emacs.bind: remove binding for buffer-previous
10244 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10246 * applied the hebrew patch.
10248 * src/lyxrow.h: make sure that all Row variables are initialized.
10250 * src/text2.C (TextHandleUndo): comment out a delete, this might
10251 introduce a memory leak, but should also help us to not try to
10252 read freed memory. We need to look at this one.
10254 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10255 (LyXParagraph): initalize footnotekind.
10257 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10258 forgot this when applying the patch. Please heed the warnings.
10260 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10261 (aka. reformat problem)
10263 * src/bufferlist.C (exists): made const, and use const_iterator
10264 (isLoaded): new func.
10265 (release): use std::find to find the correct buffer.
10267 * src/bufferlist.h: made getState a const func.
10268 made empty a const func.
10269 made exists a const func.
10272 2000-02-01 Juergen Vigna <jug@sad.it>
10274 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10276 * po/it.po: updated a bit the italian po file and also changed the
10277 'file nuovo' for newfile to 'filenuovo' without a space, this did
10280 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10281 for the new insert_date command.
10283 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10284 from jdblair, to insert a date into the current text conforming to
10285 a strftime format (for now only considering the locale-set and not
10286 the document-language).
10288 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10290 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10291 Bounds Read error seen by purify. The problem was that islower is
10292 a macros which takes an unsigned char and uses it as an index for
10293 in array of characters properties (and is thus subject to the
10297 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10298 correctly the paper sides radio buttons.
10299 (UpdateDocumentButtons): ditto.
10301 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10303 * src/kbmap.C (getsym + others): change to return unsigned int,
10304 returning a long can give problems on 64 bit systems. (I assume
10305 that int is 32bit on 64bit systems)
10307 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10309 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10310 LyXLookupString to be zero-terminated. Really fixes problems seen
10311 by purify, I think.
10313 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10315 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10316 write a (char*)0 to the lyxerr stream.
10318 * src/lastfiles.C: move algorithm before the using statemets.
10320 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10322 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10323 complains otherwise).
10324 * src/table.C: ditto
10326 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10329 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10330 that I removed earlier... It is really needed.
10332 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10334 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10336 * INSTALL: update xforms home page URL.
10338 * lib/configure.m4: fix a bug with unreadable layout files.
10340 * src/table.C (calculate_width_of_column): add "using std::max"
10343 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10345 * several files: marked several lines with "DEL LINE", this is
10346 lines that can be deleted without changing anything.
10347 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10348 checks this anyway */
10351 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10353 * src/DepTable.C (update): add a "+" at the end when the checksum
10354 is different. (debugging string only)
10356 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10357 the next inset to not be displayed. This should also fix the list
10358 of labels in the "Insert Crossreference" dialog.
10360 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10362 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10363 when regex was not found.
10365 * src/support/lstrings.C (lowercase): use handcoded transform always.
10368 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10369 old_cursor.par->prev could be 0.
10371 * several files: changed post inc/dec to pre inc/dec
10373 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10374 write the lastfiles to file.
10376 * src/BufferView.C (buffer): only show TextCache info when debugging
10378 (resizeCurrentBuffer): ditto
10379 (workAreaExpose): ditto
10381 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10383 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10385 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10386 a bit better by removing the special case for \i and \j.
10388 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10390 * src/lyx_main.C (easyParse): remove test for bad comand line
10391 options, since this broke all xforms-related parsing.
10393 * src/kbmap.C (getsym): set return type to unsigned long, as
10394 declared in header. On an alpha, long is _not_ the same as int.
10396 * src/support/LOstream.h: add a "using std::flush;"
10398 * src/insets/figinset.C: ditto.
10400 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10402 * src/bufferlist.C (write): use blinding fast file copy instead of
10403 "a char at a time", now we are doing it the C++ way.
10405 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10406 std::list<int> instead.
10407 (addpidwait): reflect move to std::list<int>
10408 (sigchldchecker): ditto
10410 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10413 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10414 that obviously was wrong...
10416 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10417 c, this avoids warnings with purify and islower.
10419 * src/insets/figinset.C: rename struct queue to struct
10420 queue_element and rewrite to use a std::queue. gsqueue is now a
10421 std::queue<queue_element>
10422 (runqueue): reflect move to std::queue
10425 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10426 we would get "1" "0" instead of "true" "false. Also make the tostr
10429 2000-01-21 Juergen Vigna <jug@sad.it>
10431 * src/buffer.C (writeFileAscii): Disabled code for special groff
10432 handling of tabulars till I fix this in table.C
10434 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10436 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10438 * src/support/lyxlib.h: ditto.
10440 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10442 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10443 and 'j' look better. This might fix the "macron" bug that has been
10446 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10447 functions as one template function. Delete the old versions.
10449 * src/support/lyxsum.C: move using std::ifstream inside
10452 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10455 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10457 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10459 * src/insets/figinset.C (InitFigures): use new instead of malloc
10460 to allocate memory for figures and bitmaps.
10461 (DoneFigures): use delete[] instead of free to deallocate memory
10462 for figures and bitmaps.
10463 (runqueue): use new to allocate
10464 (getfigdata): use new/delete[] instead of malloc/free
10465 (RegisterFigure): ditto
10467 * some files: moved some declarations closer to first use, small
10468 whitespace changes use preincrement instead of postincrement where
10469 it does not make a difference.
10471 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10472 step on the way to use stl::containers for key maps.
10474 * src/bufferlist.h: add a typedef for const_iterator and const
10475 versions of begin and end.
10477 * src/bufferlist.[Ch]: change name of member variable _state to
10478 state_. (avoid reserved names)
10480 (getFileNames): returns the filenames of the buffers in a vector.
10482 * configure.in (ALL_LINGUAS): added ro
10484 * src/support/putenv.C: new file
10486 * src/support/mkdir.C: new file
10488 2000-01-20 Allan Rae <rae@lyx.org>
10490 * lib/layouts/IEEEtran.layout: Added several theorem environments
10492 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10493 couple of minor additions.
10495 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10496 (except for those in footnotes of course)
10498 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10500 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10502 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10503 std::sort and std::lower_bound instead of qsort and handwritten
10505 (struct compara): struct that holds the functors used by std::sort
10506 and std::lower_bound in MathedLookupBOP.
10508 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10510 * src/support/LAssert.h: do not do partial specialization. We do
10511 not really need it.
10513 * src/support/lyxlib.h: note that lyx::getUserName() and
10514 lyx::date() are not in use right now. Should these be suppressed?
10516 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10517 (makeLinuxDocFile): do not put date and user name in linuxdoc
10520 * src/support/lyxlib.h (kill): change first argument to long int,
10521 since that's what solaris uses.
10523 * src/support/kill.C (kill): fix declaration to match prototype.
10525 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10526 actually check whether namespaces are supported. This is not what
10529 * src/support/lyxsum.C: add a using directive.
10531 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10533 * src/support/kill.C: if we have namespace support we don't have
10534 to include lyxlib.h.
10536 * src/support/lyxlib.h: use namespace lyx if supported.
10538 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10540 * src/support/date.C: new file
10542 * src/support/chdir.C: new file
10544 * src/support/getUserName.C: new file
10546 * src/support/getcwd.C: new file
10548 * src/support/abort.C: new file
10550 * src/support/kill.C: new file
10552 * src/support/lyxlib.h: moved all the functions in this file
10553 insede struct lyx. Added also kill and abort to this struct. This
10554 is a way to avoid the "kill is not defined in <csignal>", we make
10555 C++ wrappers for functions that are not ANSI C or ANSI C++.
10557 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10558 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10559 lyx it has been renamed to sum.
10561 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10563 * src/text.C: add using directives for std::min and std::max.
10565 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10567 * src/texrow.C (getIdFromRow): actually return something useful in
10568 id and pos. Hopefully fixes the bug with positionning of errorbox
10571 * src/lyx_main.C (easyParse): output an error and exit if an
10572 incorrect command line option has been given.
10574 * src/spellchecker.C (ispell_check_word): document a memory leak.
10576 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10577 where a "struct utimbuf" is allocated with "new" and deleted with
10580 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10582 * src/text2.C (CutSelection): don't delete double spaces.
10583 (PasteSelection): ditto
10584 (CopySelection): ditto
10586 * src/text.C (Backspace): don't delete double spaces.
10588 * src/lyxlex.C (next): fix a bug that were only present with
10589 conformant std::istream::get to read comment lines, use
10590 std::istream::getline instead. This seems to fix the problem.
10592 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10594 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10595 allowed to insert space before space" editing problem. Please read
10596 commends at the beginning of the function. Comments about usage
10599 * src/text.C (InsertChar): fix for the "not allowed to insert
10600 space before space" editing problem.
10602 * src/text2.C (DeleteEmptyParagraphMechanism): when
10603 IsEmptyTableRow can only return false this last "else if" will
10604 always be a no-op. Commented out.
10606 * src/text.C (RedoParagraph): As far as I can understand tmp
10607 cursor is not really needed.
10609 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10610 present it could only return false anyway.
10611 (several functions): Did something not so smart...added a const
10612 specifier on a lot of methods.
10614 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10615 and add a tmp->text.resize. The LyXParagraph constructor does the
10617 (BreakParagraphConservative): ditto
10619 * src/support/path.h (Path): add a define so that the wrong usage
10620 "Path("/tmp") will be flagged as a compilation error:
10621 "`unnamed_Path' undeclared (first use this function)"
10623 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10625 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10626 which was bogus for several reasons.
10628 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10630 (runBibTeX): ditto.
10632 * autogen.sh: do not use "type -path" (what's that anyway?).
10634 * src/support/filetools.C (findtexfile): remove extraneous space
10635 which caused a kpsewhich warning (at least with kpathsea version
10638 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10640 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10642 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10644 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10646 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10648 * src/paragraph.C (BreakParagraph): do not reserve space on text
10649 if we don't need to (otherwise, if pos_end < pos, we end up
10650 reserving huge amounts of memory due to bad unsigned karma).
10651 (BreakParagraphConservative): ditto, although I have not seen
10652 evidence the bug can happen here.
10654 * src/lyxparagraph.h: add a using std::list.
10656 2000-01-11 Juergen Vigna <jug@sad.it>
10658 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10659 could not be found.
10661 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10663 * src/vc-backend.C (doVCCommand): change to be static and take one
10664 more parameter: the path to chdir too be fore executing the command.
10665 (retrive): new function equiv to "co -r"
10667 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10668 file_not_found_hook is true.
10670 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10672 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10673 if a file is readwrite,readonly...anything else.
10675 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10677 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10678 (CreatePostscript): name change from MenuRunDVIPS (or something)
10679 (PreviewPostscript): name change from MenuPreviewPS
10680 (PreviewDVI): name change from MenuPreviewDVI
10682 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10683 \view_pdf_command., \pdf_to_ps_command
10685 * lib/configure.m4: added search for PDF viewer, and search for
10686 PDF to PS converter.
10687 (lyxrc.defaults output): add \pdflatex_command,
10688 \view_pdf_command and \pdf_to_ps_command.
10690 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10692 * src/bufferlist.C (write): we don't use blocksize for anything so
10695 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10697 * src/support/block.h: disable operator T* (), since it causes
10698 problems with both compilers I tried. See comments in the file.
10700 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10703 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10704 variable LYX_DIR_10x to LYX_DIR_11x.
10706 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10708 * INSTALL: document --with-lyxname.
10711 * configure.in: new configure flag --with-lyxname which allows to
10712 choose the name under which lyx is installed. Default is "lyx", of
10713 course. It used to be possible to do this with --program-suffix,
10714 but the later has in fact a different meaning for autoconf.
10716 * src/support/lstrings.h (lstrchr): reformat a bit.
10718 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10719 * src/mathed/math_defs.h: ditto.
10721 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10723 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10724 true, decides if we create a backup file or not when saving. New
10725 tag and variable \pdf_mode, defaults to false. New tag and
10726 variable \pdflatex_command, defaults to pdflatex. New tag and
10727 variable \view_pdf_command, defaults to xpdf. New tag and variable
10728 \pdf_to_ps_command, defaults to pdf2ps.
10730 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10732 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10733 does not have a BufferView.
10734 (unlockInset): ditto + don't access the_locking_inset if the
10735 buffer does not have a BufferView.
10737 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10738 certain circumstances so that we don't continue a keyboard
10739 operation long after the key was released. Try f.ex. to load a
10740 large document, press PageDown for some seconds and then release
10741 it. Before this change the document would contine to scroll for
10742 some time, with this change it stops imidiatly.
10744 * src/support/block.h: don't allocate more space than needed. As
10745 long as we don't try to write to the arr[x] in a array_type arr[x]
10746 it is perfectly ok. (if you write to it you might segfault).
10747 added operator value_type*() so that is possible to pass the array
10748 to functions expecting a C-pointer.
10750 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10753 * intl/*: updated to gettext 0.10.35, tried to add our own
10754 required modifications. Please verify.
10756 * po/*: updated to gettext 0.10.35, tried to add our own required
10757 modifications. Please verify.
10759 * src/support/lstrings.C (tostr): go at fixing the problem with
10760 cxx and stringstream. When stringstream is used return
10761 oss.str().c_str() so that problems with lyxstring and basic_string
10762 are avoided. Note that the best solution would be for cxx to use
10763 basic_string all the way, but it is not conformant yet. (it seems)
10765 * src/lyx_cb.C + other files: moved several global functions to
10766 class BufferView, some have been moved to BufferView.[Ch] others
10767 are still located in lyx_cb.C. Code changes because of this. (part
10768 of "get rid of current_view project".)
10770 * src/buffer.C + other files: moved several Buffer functions to
10771 class BufferView, the functions are still present in buffer.C.
10772 Code changes because of this.
10774 * config/lcmessage.m4: updated to most recent. used when creating
10777 * config/progtest.m4: updated to most recent. used when creating
10780 * config/gettext.m4: updated to most recent. applied patch for
10783 * config/gettext.m4.patch: new file that shows what changes we
10784 have done to the local copy of gettext.m4.
10786 * config/libtool.m4: new file, used in creation of acinclude.m4
10788 * config/lyxinclude.m4: new file, this is the lyx created m4
10789 macros, used in making acinclude.m4.
10791 * autogen.sh: GNU m4 discovered as a separate task not as part of
10792 the lib/configure creation.
10793 Generate acinlucde from files in config. Actually cat
10794 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10795 easier to upgrade .m4 files that really are external.
10797 * src/Spacing.h: moved using std::istringstream to right after
10798 <sstream>. This should fix the problem seen with some compilers.
10800 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10802 * src/lyx_cb.C: began some work to remove the dependency a lot of
10803 functions have on BufferView::text, even if not really needed.
10804 (GetCurrentTextClass): removed this func, it only hid the
10807 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10808 forgot this in last commit.
10810 * src/Bullet.C (bulletEntry): use static char const *[] for the
10811 tables, becuase of this the return arg had to change to string.
10812 (bulletSize): ditto
10813 (~Bullet): removed unneeded destructor
10815 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10816 (insetSleep): moved from Buffer
10817 (insetWakeup): moved from Buffer
10818 (insetUnlock): moved from Buffer
10820 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10821 from Buffer to BufferView.
10823 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10825 * config/ltmain.sh: updated to version 1.3.4 of libtool
10827 * config/ltconfig: updated to version 1.3.4 of libtool
10829 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10832 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10833 Did I get that right?
10835 * src/lyxlex.h: add a "using" directive or two.
10836 * src/Spacing.h: ditto.
10837 * src/insets/figinset.C: ditto.
10838 * src/support/filetools.C: ditto.
10839 * src/support/lstrings.C: ditto.
10840 * src/BufferView.C: ditto.
10841 * src/bufferlist.C: ditto.
10842 * src/lyx_cb.C: ditto.
10843 * src/lyxlex.C: ditto.
10845 * NEWS: add some changes for 1.1.4.
10847 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10849 * src/BufferView.C: first go at a TextCache to speed up switching
10852 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10854 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10855 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10856 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10857 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10860 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10861 members of the struct are correctly initialized to 0 (detected by
10863 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10864 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10866 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10867 pidwait, since it was allocated with "new". This was potentially
10868 very bad. Thanks to Michael Schmitt for running purify for us.
10871 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10873 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10875 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10877 1999-12-30 Allan Rae <rae@lyx.org>
10879 * lib/templates/IEEEtran.lyx: minor change
10881 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10882 src/mathed/formula.C (LocalDispatch): askForText changes
10884 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10885 know when a user has cancelled input. Fixes annoying problems with
10886 inserting labels and version control.
10888 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10890 * src/support/lstrings.C (tostr): rewritten to use strstream and
10893 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10895 * src/support/filetools.C (IsFileWriteable): use fstream to check
10896 (IsDirWriteable): use fileinfo to check
10898 * src/support/filetools.h (FilePtr): whole class deleted
10900 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10902 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10904 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10906 * src/bufferlist.C (write): use ifstream and ofstream instead of
10909 * src/Spacing.h: use istrstream instead of sscanf
10911 * src/mathed/math_defs.h: change first arg to istream from FILE*
10913 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10915 * src/mathed/math_parser.C: have yyis to be an istream
10916 (LexGetArg): use istream (yyis)
10918 (mathed_parse): ditto
10919 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10921 * src/mathed/formula.C (Read): rewritten to use istream
10923 * src/mathed/formulamacro.C (Read): rewritten to use istream
10925 * src/lyxlex.h (~LyXLex): deleted desturctor
10926 (getStream): new function, returns an istream
10927 (getFile): deleted funtion
10928 (IsOK): return is.good();
10930 * src/lyxlex.C (LyXLex): delete file and owns_file
10931 (setFile): open an filebuf and assign that to a istream instead of
10933 (setStream): new function, takes an istream as arg.
10934 (setFile): deleted function
10935 (EatLine): rewritten us use istream instead of FILE*
10939 * src/table.C (LyXTable): use istream instead of FILE*
10940 (Read): rewritten to take an istream instead of FILE*
10942 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10944 * src/buffer.C (Dispatch): remove an extraneous break statement.
10946 * src/support/filetools.C (QuoteName): change to do simple
10947 'quoting'. More work is necessary. Also changed to do nothing
10948 under emx (needs fix too).
10949 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10951 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10952 config.h.in to the AC_DEFINE_UNQUOTED() call.
10953 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10954 needs char * as argument (because Solaris 7 declares it like
10957 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10958 remove definition of BZERO.
10960 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10962 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10963 defined, "lyxregex.h" if not.
10965 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10967 (REGEX): new variable that is set to regex.c lyxregex.h when
10968 AM_CONDITIONAL USE_REGEX is set.
10969 (libsupport_la_SOURCES): add $(REGEX)
10971 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10974 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10977 * configure.in: add call to LYX_REGEX
10979 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10980 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10982 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10984 * lib/bind/fi_menus.bind: new file, from
10985 pauli.virtanen@saunalahti.fi.
10987 * src/buffer.C (getBibkeyList): pass the parameter delim to
10988 InsetInclude::getKeys and InsetBibtex::getKeys.
10990 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10991 is passed to Buffer::getBibkeyList
10993 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10994 instead of the hardcoded comma.
10996 * src/insets/insetbib.C (getKeys): make sure that there are not
10997 leading blanks in bibtex keys. Normal latex does not care, but
10998 harvard.sty seems to dislike blanks at the beginning of citation
10999 keys. In particular, the retturn value of the function is
11001 * INSTALL: make it clear that libstdc++ is needed and that gcc
11002 2.7.x probably does not work.
11004 * src/support/filetools.C (findtexfile): make debug message go to
11006 * src/insets/insetbib.C (getKeys): ditto
11008 * src/debug.C (showTags): make sure that the output is correctly
11011 * configure.in: add a comment for TWO_COLOR_ICON define.
11013 * acconfig.h: remove all the entries that already defined in
11014 configure.in or acinclude.m4.
11016 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11017 to avoid user name, date and copyright.
11019 1999-12-21 Juergen Vigna <jug@sad.it>
11021 * src/table.C (Read): Now read bogus row format informations
11022 if the format is < 5 so that afterwards the table can
11023 be read by lyx but without any format-info. Fixed the
11024 crash we experienced when not doing this.
11026 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11028 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11029 (RedoDrawingOfParagraph): ditto
11030 (RedoParagraphs): ditto
11031 (RemoveTableRow): ditto
11033 * src/text.C (Fill): rename arg paperwidth -> paper_width
11035 * src/buffer.C (insertLyXFile): rename var filename -> fname
11036 (writeFile): rename arg filename -> fname
11037 (writeFileAscii): ditto
11038 (makeLaTeXFile): ditto
11039 (makeLinuxDocFile): ditto
11040 (makeDocBookFile): ditto
11042 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11045 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11047 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11050 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11051 compiled by a C compiler not C++.
11053 * src/layout.h (LyXTextClass): added typedef for const_iterator
11054 (LyXTextClassList): added typedef for const_iterator + member
11055 functions begin and end.
11057 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11058 iterators to fill the choice_class.
11059 (updateLayoutChoice): rewritten to use iterators to fill the
11060 layoutlist in the toolbar.
11062 * src/BufferView.h (BufferView::work_area_width): removed unused
11065 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11067 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11068 (sgmlCloseTag): ditto
11070 * src/support/lstrings.h: return type of countChar changed to
11073 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11074 what version of this func to use. Also made to return unsigned int.
11076 * configure.in: call LYX_STD_COUNT
11078 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11079 conforming std::count.
11081 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11083 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11084 and a subscript would give bad display (patch from Dekel Tsur
11085 <dekel@math.tau.ac.il>).
11087 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11089 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11092 * src/chset.h: add a few 'using' directives
11094 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11095 triggered when no buffer is active
11097 * src/layout.C: removed `break' after `return' in switch(), since
11100 * src/lyx_main.C (init): make sure LyX can be ran in place even
11101 when libtool has done its magic with shared libraries. Fix the
11102 test for the case when the system directory has not been found.
11104 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11105 name for the latex file.
11106 (MenuMakeHTML): ditto
11108 * src/buffer.h: add an optional boolean argument, which is passed
11109 to ChangeExtension.
11111 1999-12-20 Allan Rae <rae@lyx.org>
11113 * lib/templates/IEEEtran.lyx: small correction and update.
11115 * configure.in: Attempted to use LYX_PATH_HEADER
11117 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11119 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11120 input from JMarc. Now use preprocessor to find the header.
11121 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11122 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11123 LYX_STL_STRING_FWD. See comments in file.
11125 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11127 * The global MiniBuffer * minibuffer variable is dead.
11129 * The global FD_form_main * fd_form_main variable is dead.
11131 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11133 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11135 * src/table.h: add the LOstream.h header
11136 * src/debug.h: ditto
11138 * src/LyXAction.h: change the explaination of the ReadOnly
11139 attribute: is indicates that the function _can_ be used.
11141 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11144 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11146 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11152 * src/paragraph.C (GetWord): assert on pos>=0
11155 * src/support/lyxstring.C: condition the use of an invariant on
11157 * src/support/lyxstring.h: ditto
11159 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11160 Use LAssert.h instead of plain assert().
11162 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11164 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11165 * src/support/filetools.C: ditto
11167 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11170 * INSTALL: document the new configure flags
11172 * configure.in: suppress --with-debug; add --enable-assertions
11174 * acinclude.m4: various changes in alignment of help strings.
11176 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11178 * src/kbmap.C: commented out the use of the hash map in kb_map,
11179 beginning of movement to a stl::container.
11181 * several files: removed code that was not in effect when
11182 MOVE_TEXT was defined.
11184 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11185 for escaping should not be used. We can discuss if the string
11186 should be enclosed in f.ex. [] instead of "".
11188 * src/trans_mgr.C (insert): use the new returned value from
11189 encodeString to get deadkeys and keymaps done correctly.
11191 * src/chset.C (encodeString): changed to return a pair, to tell
11192 what to use if we know the string.
11194 * src/lyxscreen.h (fillArc): new function.
11196 * src/FontInfo.C (resize): rewritten to use more std::string like
11197 structore, especially string::replace.
11199 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11202 * configure.in (chmod +x some scripts): remove config/gcc-hack
11204 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11206 * src/buffer.C (writeFile): change once again the top comment in a
11207 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11208 instead of an hardcoded version number.
11209 (makeDocBookFile): ditto
11211 * src/version.h: add new define LYX_DOCVERSION
11213 * po/de.po: update from Pit Sütterlin
11214 * lib/bind/de_menus.bind: ditto.
11216 * src/lyxfunc.C (Dispatch): call MenuExport()
11217 * src/buffer.C (Dispatch): ditto
11219 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11220 LyXFunc::Dispatch().
11221 (MenuExport): new function, moved from
11222 LyXFunc::Dispatch().
11224 * src/trans_mgr.C (insert): small cleanup
11225 * src/chset.C (loadFile): ditto
11227 * lib/kbd/iso8859-1.cdef: add missing backslashes
11229 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11231 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11232 help with placing the manually drawn accents better.
11234 (Draw): x2 and hg changed to float to minimize rounding errors and
11235 help place the accents better.
11237 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11238 unsigned short to char is just wrong...cast the char to unsigned
11239 char instead so that the two values can compare sanely. This
11240 should also make the display of insetlatexaccents better and
11241 perhaps also some other insets.
11243 (lbearing): new function
11246 1999-12-15 Allan Rae <rae@lyx.org>
11248 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11249 header that provides a wrapper around the very annoying SGI STL header
11252 * src/support/lyxstring.C, src/LString.h:
11253 removed old SGI-STL-compatability attempts.
11255 * configure.in: Use LYX_STL_STRING_FWD.
11257 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11258 stl_string_fwd.h is around and try to determine it's location.
11259 Major improvement over previous SGI STL 3.2 compatability.
11260 Three small problems remain with this function due to my zero
11261 knowledge of autoconf. JMarc and lgb see the comments in the code.
11263 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11265 * src/broken_const.h, config/hack-gcc, config/README: removed
11267 * configure.in: remove --with-gcc-hack option; do not call
11270 * INSTALL: remove documentation of --with-broken-const and
11273 * acconfig.h: remove all trace of BROKEN_CONST define
11275 * src/buffer.C (makeDocBookFile): update version number in output
11277 (SimpleDocBookOnePar): fix an assert when trying to a character
11278 access beyond string length
11281 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11283 * po/de.po: fix the Export menu
11285 * lyx.man: update the description of -dbg
11287 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11288 (commandLineHelp): updated
11289 (easyParse): show list of available debug levels if -dbg is passed
11292 * src/Makefile.am: add debug.C
11294 * src/debug.h: moved some code to debug.C
11296 * src/debug.C: new file. Contains code to set and show debug
11299 * src/layout.C: remove 'break' after 'continue' in switch
11300 statements, since these cannot be reached.
11302 1999-12-13 Allan Rae <rae@lyx.org>
11304 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11305 (in_word_set): hash() -> math_hash()
11307 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11309 * acconfig.h: Added a test for whether we are using exceptions in the
11310 current compilation run. If so USING_EXCEPTIONS is defined.
11312 * config.in: Check for existance of stl_string_fwd.h
11313 * src/LString.h: If compiling --with-included-string and SGI's
11314 STL version 3.2 is present (see above test) we need to block their
11315 forward declaration of string and supply a __get_c_string().
11316 However, it turns out this is only necessary if compiling with
11317 exceptions enabled so I've a bit more to add yet.
11319 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11320 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11321 src/support/LRegex.h, src/undo.h:
11322 Shuffle the order of the included files a little to ensure that
11323 LString.h gets included before anything that includes stl_string_fwd.h
11325 * src/support/lyxstring.C: We need to #include LString.h instead of
11326 lyxstring.h to get the necessary definition of __get_c_string.
11327 (__get_c_string): New function. This is defined static just like SGI's
11328 although why they need to do this I'm not sure. Perhaps it should be
11329 in lstrings.C instead.
11331 * lib/templates/IEEEtran.lyx: New template file.
11333 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11335 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11336 * intl/Makefile.in (MKINSTALLDIRS): ditto
11338 * src/LyXAction.C (init): changed to hold the LFUN data in a
11339 automatic array in stead of in callso to newFunc, this speeds up
11340 compilation a lot. Also all the memory used by the array is
11341 returned when the init is completed.
11343 * a lot of files: compiled with -Wold-style-cast, changed most of
11344 the reported offenders to C++ style casts. Did not change the
11345 offenders in C files.
11347 * src/trans.h (Match): change argument type to unsigned int.
11349 * src/support/DebugStream.C: fix some types on the streambufs so
11350 that it works on a conforming implementation.
11352 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11354 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11356 * src/support/lyxstring.C: remove the inline added earlier since
11357 they cause a bunch of unsatisfied symbols when linking with dec
11358 cxx. Cxx likes to have the body of inlines at the place where they
11361 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11362 accessing negative bounds in array. This fixes the crash when
11363 inserting accented characters.
11364 * src/trans.h (Match): ditto
11366 * src/buffer.C (Dispatch): since this is a void, it should not try
11367 to return anything...
11369 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11371 * src/buffer.h: removed the two friends from Buffer. Some changes
11372 because of this. Buffer::getFileName and Buffer::setFileName
11373 renamed to Buffer::fileName() and Buffer::fileName(...).
11375 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11377 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11378 and Buffer::update(short) to BufferView. This move is currently
11379 controlled by a define MOVE_TEXT, this will be removed when all
11380 shows to be ok. This move paves the way for better separation
11381 between buffer contents and buffer view. One side effect is that
11382 the BufferView needs a rebreak when swiching buffers, if we want
11383 to avoid this we can add a cache that holds pointers to LyXText's
11384 that is not currently in use.
11386 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11389 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11391 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11393 * lyx_main.C: new command line option -x (or --execute) and
11394 -e (or --export). Now direct conversion from .lyx to .tex
11395 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11396 Unfortunately, X is still needed and the GUI pops up during the
11399 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11401 * src/Spacing.C: add a using directive to bring stream stuff into
11403 * src/paragraph.C: ditto
11404 * src/buffer.C: ditto
11406 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11407 from Lars' announcement).
11409 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11410 example files from Tino Meinen.
11412 1999-12-06 Allan Rae <rae@lyx.org>
11414 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11416 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11418 * src/support/lyxstring.C: added a lot of inline for no good
11421 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11422 latexWriteEndChanges, they were not used.
11424 * src/layout.h (operator<<): output operator for PageSides
11426 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11428 * some example files: loaded in LyX 1.0.4 and saved again to update
11429 certain constructs (table format)
11431 * a lot of files: did the change to use fstream/iostream for all
11432 writing of files. Done with a close look at Andre Poenitz's patch.
11434 * some files: whitespace changes.
11436 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11438 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11439 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11440 architecture, we provide our own. It is used unconditionnally, but
11441 I do not think this is a performance problem. Thanks to Angus
11442 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11443 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11445 (GetInset): use my_memcpy.
11449 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11450 it is easier to understand, but it uses less TeX-only constructs now.
11452 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11453 elements contain spaces
11455 * lib/configure: regenerated
11457 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11458 elements contain spaces; display the list of programs that are
11461 * autogen.sh: make sure lib/configure is executable
11463 * lib/examples/*: rename the tutorial examples to begin with the
11464 two-letters language code.
11466 * src/lyxfunc.C (getStatus): do not query current font if no
11469 * src/lyx_cb.C (RunScript): use QuoteName
11470 (MenuRunDvips): ditto
11471 (PrintApplyCB): ditto
11473 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11474 around argument, so that it works well with the current shell.
11475 Does not work properly with OS/2 shells currently.
11477 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11478 * src/LyXSendto.C (SendtoApplyCB): ditto
11479 * src/lyxfunc.C (Dispatch): ditto
11480 * src/buffer.C (runLaTeX): ditto
11481 (runLiterate): ditto
11482 (buildProgram): ditto
11484 * src/lyx_cb.C (RunScript): ditto
11485 (MenuMakeLaTeX): ditto
11487 * src/buffer.h (getLatexName): new method
11489 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11491 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11493 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11494 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11495 (create_math_panel): ditto
11497 * src/lyxfunc.C (getStatus): re-activate the code which gets
11498 current font and cursor; add test for export to html.
11500 * src/lyxrc.C (read): remove unreachable break statements; add a
11503 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11505 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11507 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11508 introduced by faulty regex.
11509 * src/buffer.C: ditto
11510 * src/lastfiles.C: ditto
11511 * src/paragraph.C: ditto
11512 * src/table.C: ditto
11513 * src/vspace.C: ditto
11514 * src/insets/figinset.C: ditto
11515 Note: most of these is absolutely harmless, except the one in
11516 src/mathed formula.C.
11518 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11520 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11521 operation, yielding correct results for the reLyX command.
11523 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11525 * src/support/filetools.C (ExpandPath): removed an over eager
11527 (ReplaceEnvironmentPath): ditto
11529 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11530 shows that we are doing something fishy in our code...
11531 (BubblePost): ditto
11534 * src/lyxrc.C (read): use a double switch trick to get more help
11535 from the compiler. (the same trick is used in layout.C)
11536 (write): new function. opens a ofstream and pass that to output
11537 (output): new function, takes a ostream and writes the lyxrc
11538 elemts to it. uses a dummy switch to make sure no elements are
11541 * src/lyxlex.h: added a struct pushpophelper for use in functions
11542 with more than one exit point.
11544 * src/lyxlex.[Ch] (GetInteger): made it const
11548 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11550 * src/layout.[hC] : LayoutTags splitted into several enums, new
11551 methods created, better error handling cleaner use of lyxlex. Read
11554 * src/bmtable.[Ch]: change some member prototypes because of the
11555 image const changes.
11557 * commandtags.h, src/LyXAction.C (init): new function:
11558 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11559 This file is not read automatically but you can add \input
11560 preferences to your lyxrc if you want to. We need to discuss how
11563 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11564 in .aux, also remove .bib and .bst files from dependencies when
11567 * src/BufferView.C, src/LyXView.C: add const_cast several places
11568 because of changes to images.
11570 * lib/images/*: same change as for images/*
11572 * lib/lyxrc.example: Default for accept_compound is false not no.
11574 * images/*: changed to be const, however I have som misgivings
11575 about this change so it might be changed back.
11577 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11579 * lib/configure, po/POTFILES.in: regenerated
11581 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11583 * config/lib_configure.m4: removed
11585 * lib/configure.m4: new file (was config/lib_configure.m4)
11587 * configure.in: do not test for rtti, since we do not use it.
11589 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11591 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11592 doubling of allocated space scheme. This makes it faster for large
11593 strings end to use less memory for small strings. xtra rememoved.
11595 * src/insets/figinset.C (waitalarm): commented out.
11596 (GhostscriptMsg): use static_cast
11597 (GhostscriptMsg): use new instead of malloc to allocate memory for
11598 cmap. also delete the memory after use.
11600 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11602 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11603 for changes in bibtex database or style.
11604 (runBibTeX): remove all .bib and .bst files from dep before we
11606 (run): use scanAuc in when dep file already exist.
11608 * src/DepTable.C (remove_files_with_extension): new method
11609 (exist): new method
11611 * src/DepTable.[Ch]: made many of the methods const.
11613 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11615 * src/bufferparams.C: make sure that the default textclass is
11616 "article". It used to be the first one by description order, but
11617 now the first one is "docbook".
11619 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11620 string; call Debug::value.
11621 (easyParse): pass complete argument to setDebuggingLevel().
11623 * src/debug.h (value): fix the code that parses debug levels.
11625 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11628 * src/LyXAction.C: use Debug::ACTION as debug channel.
11630 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11632 * NEWS: updated for the future 1.1.3 release.
11634 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11635 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11636 it should. This is of course a controversial change (since many
11637 people will find that their lyx workscreen is suddenly full of
11638 red), but done for the sake of correctness.
11640 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11641 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11643 * src/insets/inseterror.h, src/insets/inseturl.h,
11644 src/insets/insetinfo.h, src/insets/figinset.h,
11645 src/mathed/formulamacro.h, src/mathed/math_macro.h
11646 (EditMessage): add a missing const and add _() to make sure that
11647 translation happens
11649 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11650 src/insets/insetbib.C, src/support/filetools.C: add `using'
11651 directives for cxx.
11653 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11654 doing 'Insert index of last word' at the beginning of a paragraph.
11656 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11658 * several files: white-space changes.
11660 * src/mathed/formula.C: removed IsAlpha and IsDigit
11662 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11663 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11666 * src/insets/figinset.C (GetPSSizes): don't break when
11667 "EndComments" is seen. But break when a boundingbox is read.
11669 * all classes inherited from Inset: return value of Clone
11670 changed back to Inset *.
11672 * all classes inherited form MathInset: return value of Clone
11673 changed back to MathedInset *.
11675 * src/insets/figinset.C (runqueue): use a ofstream to output the
11676 gs/ps file. Might need some setpresicion or setw. However I can
11677 see no problem with the current code.
11678 (runqueue): use sleep instead of the alarm/signal code. I just
11679 can't see the difference.
11681 * src/paragraph.C (LyXParagraph): reserve space in the new
11682 paragraph and resize the inserted paragraph to just fit.
11684 * src/lyxfunc.h (operator|=): added operator for func_status.
11686 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11687 check for readable file.
11689 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11690 check for readable file.
11691 (MenuMakeLinuxDoc): ditto
11692 (MenuMakeDocBook): ditto
11693 (MenuMakeAscii): ditto
11694 (InsertAsciiFile): split the test for openable and readable
11696 * src/bmtable.C (draw_bitmaptable): use
11697 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11699 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11700 findtexfile from LaTeX to filetools.
11702 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11703 instead of FilePtr. Needs to be verified by a literate user.
11705 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11707 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11708 (EditMessage): likewise.
11710 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11711 respectively as \textasciitilde and \textasciicircum.
11713 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11715 * src/support/lyxstring.h: made the methods that take iterators
11716 use const_iterator.
11718 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11719 (regexMatch): made is use the real regex class.
11721 * src/support/Makefile.am: changed to use libtool
11723 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11725 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11727 (MathIsInset ++): changed several macros to be inline functions
11730 * src/mathed/Makefile.am: changed to use libtool
11732 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11734 * src/insets/inset* : Clone changed to const and return type is
11735 the true insettype not just Inset*.
11737 * src/insets/Makefile.am: changed to use libtool
11739 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11741 * src/undo.[Ch] : added empty() and changed some of the method
11744 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11746 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11747 setID use block<> for the bullets array, added const several places.
11749 * src/lyxfunc.C (getStatus): new function
11751 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11752 LyXAction, added const to several funtions.
11754 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11755 a std::map, and to store the dir items in a vector.
11757 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11760 * src/LyXView.[Ch] + other files : changed currentView to view.
11762 * src/LyXAction.[Ch] : ported from the old devel branch.
11764 * src/.cvsignore: added .libs and a.out
11766 * configure.in : changes to use libtool.
11768 * acinclude.m4 : inserted libtool.m4
11770 * .cvsignore: added libtool
11772 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11774 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11775 file name in insets and mathed directories (otherwise the
11776 dependency is not taken in account under cygwin).
11778 * src/text2.C (InsertString[AB]): make sure that we do not try to
11779 read characters past the string length.
11781 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11783 * lib/doc/LaTeXConfig.lyx.in,
11784 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11786 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11787 file saying who created them and when this heppened; this is
11788 useless and annoys tools like cvs.
11790 * lib/layouts/g-brief-{en,de}.layout,
11791 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11792 from Thomas Hartkens <thomas@hartkens.de>.
11794 * src/{insets,mathed}/Makefile.am: do not declare an empty
11795 LDFLAGS, so that it can be set at configure time (useful on Irix
11798 * lib/reLyX/configure.in: make sure that the prefix is set
11799 correctly in LYX_DIR.
11801 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11803 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11804 be used by 'command-sequence' this allows to bind a key to a
11805 sequence of LyX-commands
11806 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11808 * src/LyXAction.C: add "command-sequence"
11810 * src/LyXFunction.C: handling of "command-sequence"
11812 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11813 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11815 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11817 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11819 * src/buffer.C (writeFile): Do not output a comment giving user
11820 and date at the beginning of a .lyx file. This is useless and
11821 annoys cvs anyway; update version number to 1.1.
11823 * src/Makefile.am (LYX_DIR): add this definition, so that a
11824 default path is hardcoded in LyX.
11826 * configure.in: Use LYX_GNU_GETTEXT.
11828 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11829 AM_GNU_GETTEXT with a bug fixed.
11831 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11833 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11835 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11836 which is used to point to LyX data is now LYX_DIR_11x.
11838 * lyx.man: convert to a unix text file; small updates.
11840 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11842 * src/support/LSubstring.[Ch]: made the second arg of most of the
11843 constructors be a const reference.
11845 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11848 * src/support/lyxstring.[Ch] (swap): added missing member function
11849 and specialization of swap(str, str);
11851 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11853 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11854 trace of the old one.
11856 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11857 put the member definitions in undo.C.
11859 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11860 NEW_TEXT and have now only code that was included when this was
11863 * src/intl.C (LCombo): use static_cast
11865 (DispatchCallback): ditto
11867 * src/definitions.h: removed whole file
11869 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11871 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11872 parsing and stores in a std:map. a regex defines the file format.
11873 removed unneeded members.
11875 * src/bufferparams.h: added several enums from definitions.h here.
11876 Removed unsused destructor. Changed some types to use proper enum
11877 types. use block to have the temp_bullets and user_defined_bullets
11878 and to make the whole class assignable.
11880 * src/bufferparams.C (Copy): removed this functions, use a default
11881 assignment instead.
11883 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11886 * src/buffer.C (readLyXformat2): commend out all that have with
11887 oldpapersize to do. also comment out all that hve to do with
11888 insetlatex and insetlatexdel.
11889 (setOldPaperStuff): commented out
11891 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11893 * src/LyXAction.C: remove use of inset-latex-insert
11895 * src/mathed/math_panel.C (button_cb): use static_cast
11897 * src/insets/Makefile.am (insets_o_SOURCES): removed
11900 * src/support/lyxstring.C (helper): use the unsigned long
11901 specifier, UL, instead of a static_cast.
11903 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11905 * src/support/block.h: new file. to be used as a c-style array in
11906 classes, so that the class can be assignable.
11908 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11910 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11911 NULL, make sure to return an empty string (it is not possible to
11912 set a string to NULL).
11914 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11916 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11918 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11920 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11921 link line, so that Irix users (for example) can set it explicitely to
11924 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11925 it can be overidden at make time (static or dynamic link, for
11928 * src/vc-backend.C, src/LaTeXFeatures.h,
11929 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11930 statements to bring templates to global namespace.
11932 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11934 * src/support/lyxstring.C (operator[] const): make it standard
11937 * src/minibuffer.C (Init): changed to reflect that more
11938 information is given from the lyxvc and need not be provided here.
11940 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11942 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11944 * src/LyXView.C (UpdateTimerCB): use static_cast
11945 (KeyPressMask_raw_callback): ditto
11947 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11948 buffer_, a lot of changes because of this. currentBuffer() ->
11949 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11950 also changes to other files because of this.
11952 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11954 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11955 have no support for RCS and partial support for CVS, will be
11958 * src/insets/ several files: changes because of function name
11959 changes in Bufferview and LyXView.
11961 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11963 * src/support/LSubstring.[Ch]: new files. These implement a
11964 Substring that can be very convenient to use. i.e. is this
11966 string a = "Mary had a little sheep";
11967 Substring(a, "sheep") = "lamb";
11968 a is now "Mary has a little lamb".
11970 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11971 out patterns and subpatterns of strings. It is used by LSubstring
11972 and also by vc-backend.C
11974 * src/support/lyxstring.C: went over all the assertions used and
11975 tried to correct the wrong ones and flag which of them is required
11976 by the standard. some bugs found because of this. Also removed a
11977 couple of assertions.
11979 * src/support/Makefile.am (libsupport_a_SOURCES): added
11980 LSubstring.[Ch] and LRegex.[Ch]
11982 * src/support/FileInfo.h: have struct stat buf as an object and
11983 not a pointer to one, some changes because of this.
11985 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11986 information in layout when adding the layouts preamble to the
11987 textclass preamble.
11989 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11992 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11993 because of bug in OS/2.
11995 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11997 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11998 \verbatim@font instead of \ttfamily, so that it can be redefined.
12000 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12001 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12002 src/layout.h, src/text2.C: add 'using' directive to bring the
12003 STL templates we need from the std:: namespace to the global one.
12004 Needed by DEC cxx in strict ansi mode.
12006 * src/support/LIstream.h,src/support/LOstream.h,
12007 src/support/lyxstring.h,src/table.h,
12008 src/lyxlookup.h: do not include <config.h> in header
12009 files. This should be done in the .C files only.
12011 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12015 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12017 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12018 from Kayvan to fix the tth invokation.
12020 * development/lyx.spec.in: updates from Kayvan to reflect the
12021 changes of file names.
12023 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12025 * src/text2.C (InsertStringB): use std::copy
12026 (InsertStringA): use std::copy
12028 * src/bufferlist.C: use a vector to store the buffers in. This is
12029 an internal change and should not affect any other thing.
12031 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12034 * src/text.C (Fill): fix potential bug, one off bug.
12036 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12038 * src/Makefile.am (lyx_main.o): add more files it depends on.
12040 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12042 * src/support/lyxstring.C: use size_t for the reference count,
12043 size, reserved memory and xtra.
12044 (internal_compare): new private member function. Now the compare
12045 functions should work for std::strings that have embedded '\0'
12047 (compare): all compare functions rewritten to use
12050 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12052 * src/support/lyxstring.C (compare): pass c_str()
12053 (compare): pass c_str
12054 (compare): pass c_str
12056 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12058 * src/support/DebugStream.C: <config.h> was not included correctly.
12060 * lib/configure: forgot to re-generate it :( I'll make this file
12061 auto generated soon.
12063 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12065 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12068 * src/support/lyxstring.C: some changes from length() to rep->sz.
12069 avoids a function call.
12071 * src/support/filetools.C (SpaceLess): yet another version of the
12072 algorithm...now per Jean-Marc's suggestions.
12074 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12076 * src/layout.C (less_textclass_desc): functor for use in sorting
12078 (LyXTextClass::Read): sort the textclasses after reading.
12080 * src/support/filetools.C (SpaceLess): new version of the
12081 SpaceLess functions. What problems does this one give? Please
12084 * images/banner_bw.xbm: made the arrays unsigned char *
12086 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12088 * src/support/lyxstring.C (find): remove bogus assertion in the
12089 two versions of find where this has not been done yet.
12091 * src/support/lyxlib.h: add missing int return type to
12094 * src/menus.C (ShowFileMenu): disable exporting to html if no
12095 html export command is present.
12097 * config/lib_configure.m4: add a test for an HTML converter. The
12098 programs checked for are, in this order: tth, latex2html and
12101 * lib/configure: generated from config/lib_configure.m4.
12103 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12104 html converter. The parameters are now passed through $$FName and
12105 $$OutName, instead of standard input/output.
12107 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12109 * lib/lyxrc.example: update description of \html_command.
12110 add "quotes" around \screen_font_xxx font setting examples to help
12111 people who use fonts with spaces in their names.
12113 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12115 * Distribution files: updates for v1.1.2
12117 * src/support/lyxstring.C (find): remove bogus assert and return
12118 npos for the same condition.
12120 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12122 * added patch for OS/2 from SMiyata.
12124 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12126 * src/text2.C (CutSelection): make space_wrapped a bool
12127 (CutSelection): dont declare int i until we have to.
12128 (alphaCounter): return a char const *.
12130 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12132 * src/support/syscall.C (Systemcalls::kill):
12133 src/support/filetools.C (PutEnv, PutEnvPath):
12134 src/lyx_cb.C (addNewlineAndDepth):
12135 src/FontInfo.C (FontInfo::resize): condition some #warning
12136 directives with WITH_WARNINGS.
12139 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12141 * src/layout.[Ch] + several files: access to class variables
12142 limited and made accessor functions instead a lot of code changed
12143 becuase of this. Also instead of returning pointers often a const
12144 reference is returned instead.
12146 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12148 * src/Makefile.am (dist-hook): added used to remove the CVS from
12149 cheaders upon creating a dist
12150 (EXTRA_DIST): added cheaders
12152 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12153 a character not as a small integer.
12155 * src/support/lyxstring.C (find): removed Assert and added i >=
12156 rep->sz to the first if.
12158 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12160 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12161 src/LyXView.C src/buffer.C src/bufferparams.C
12162 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12163 src/text2.C src/insets/insetinclude.C:
12164 lyxlayout renamed to textclasslist.
12166 * src/layout.C: some lyxerr changes.
12168 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12169 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12170 (LyXLayoutList): removed all traces of this class.
12171 (LyXTextClass::Read): rewrote LT_STYLE
12172 (LyXTextClass::hasLayout): new function
12173 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12174 both const and nonconst version.
12175 (LyXTextClass::delete_layout): new function.
12176 (LyXTextClassList::Style): bug fix. do the right thing if layout
12178 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12179 (LyXTextClassList::NameOfLayout): ditto
12180 (LyXTextClassList::Load): ditto
12182 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12184 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12186 * src/LyXAction.C (LookupFunc): added a workaround for sun
12187 compiler, on the other hand...we don't know if the current code
12188 compiles on sun at all...
12190 * src/support/filetools.C (CleanupPath): subst fix
12192 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12195 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12196 complained about this one?
12198 * src/insets/insetinclude.C (Latex): subst fix
12200 * src/insets/insetbib.C (getKeys): subst fix
12202 * src/LyXSendto.C (SendtoApplyCB): subst fix
12204 * src/lyx_main.C (init): subst fix
12206 * src/layout.C (Read): subst fix
12208 * src/lyx_sendfax_main.C (button_send): subst fix
12210 * src/buffer.C (RoffAsciiTable): subst fix
12212 * src/lyx_cb.C (MenuFax): subst fix
12213 (PrintApplyCB): subst fix
12215 1999-10-26 Juergen Vigna <jug@sad.it>
12217 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12219 (Read): Cleaned up this code so now we read only format vestion >= 5
12221 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12223 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12224 come nobody has complained about this one?
12226 * src/insets/insetinclude.C (Latex): subst fix
12228 * src/insets/insetbib.C (getKeys): subst fix
12230 * src/lyx_main.C (init): subst fix
12232 * src/layout.C (Read): subst fix
12234 * src/buffer.C (RoffAsciiTable): subst fix
12236 * src/lyx_cb.C (MenuFax): subst fix.
12238 * src/layout.[hC] + some other files: rewrote to use
12239 std::container to store textclasses and layouts in.
12240 Simplified, removed a lot of code. Make all classes
12241 assignable. Further simplifications and review of type
12242 use still to be one.
12244 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12245 lastfiles to create the lastfiles partr of the menu.
12247 * src/lastfiles.[Ch]: rewritten to use deque to store the
12248 lastfiles in. Uses fstream for reading and writing. Simplifies
12251 * src/support/syscall.C: remove explicit cast.
12253 * src/BufferView.C (CursorToggleCB): removed code snippets that
12254 were commented out.
12255 use explicat C++ style casts instead of C style casts. also use
12256 u_vdata instea of passing pointers in longs.
12258 * src/PaperLayout.C: removed code snippets that were commented out.
12260 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12262 * src/lyx_main.C: removed code snippets that wer commented out.
12264 * src/paragraph.C: removed code snippets that were commented out.
12266 * src/lyxvc.C (logClose): use static_cast
12268 (viewLog): remove explicit cast to void*
12269 (showLog): removed old commented code
12271 * src/menus.C: use static_cast instead of C style casts. use
12272 u_vdata instead of u_ldata. remove explicit cast to (long) for
12273 pointers. Removed old code that was commented out.
12275 * src/insets/inset.C: removed old commented func
12277 * src/insets/insetref.C (InsetRef): removed old code that had been
12278 commented out for a long time.
12280 (escape): removed C style cast
12282 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12284 * src/insets/insetlatex.C (Draw): removed old commented code
12285 (Read): rewritten to use string
12287 * src/insets/insetlabel.C (escape): removed C style cast
12289 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12291 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12292 old commented code.
12294 * src/insets/insetinclude.h: removed a couple of stupid bools
12296 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12297 (Clone): remove C style cast
12298 (getKeys): changed list to lst because of std::list
12300 * src/insets/inseterror.C (Draw): removed som old commented code.
12302 * src/insets/insetcommand.C (Draw): removed some old commented code.
12304 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12305 commented out forever.
12306 (bibitem_cb): use static_cast instead of C style cast
12307 use of vdata changed to u_vdata.
12309 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12311 (CloseUrlCB): use static_cast instead of C style cast.
12312 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12314 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12315 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12316 (CloseInfoCB): static_cast from ob->u_vdata instead.
12317 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12320 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12321 (C_InsetError_CloseErrorCB): forward the ob parameter
12322 (CloseErrorCB): static_cast from ob->u_vdata instead.
12324 * src/vspace.h: include LString.h since we use string in this class.
12326 * src/vspace.C (lyx_advance): changed name from advance because of
12327 nameclash with stl. And since we cannot use namespaces yet...I
12328 used a lyx_ prefix instead. Expect this to change when we begin
12331 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12333 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12334 and removed now defunct constructor and deconstructor.
12336 * src/BufferView.h: have backstack as a object not as a pointer.
12337 removed initialization from constructor. added include for BackStack
12339 * development/lyx.spec.in (%build): add CFLAGS also.
12341 * src/screen.C (drawFrame): removed another warning.
12343 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12345 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12346 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12347 README and ANNOUNCE a bit for the next release. More work is
12350 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12351 unbreakable if we are in freespacing mode (LyX-Code), but not in
12354 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12356 * src/BackStack.h: fixed initialization order in constructor
12358 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12360 * acinclude.m4 (VERSION): new rules for when a version is
12361 development, added also a variable for prerelease.
12362 (warnings): we set with_warnings=yes for prereleases
12363 (lyx_opt): prereleases compile with same optimization as development
12364 (CXXFLAGS): only use pedantic if we are a development version
12366 * src/BufferView.C (restorePosition): don't do anything if the
12367 backstack is empty.
12369 * src/BackStack.h: added member empty, use this to test if there
12370 is anything to pop...
12372 1999-10-25 Juergen Vigna <jug@sad.it>
12375 * forms/layout_forms.fd +
12376 * forms/latexoptions.fd +
12377 * lyx.fd: changed for various form resize issues
12379 * src/mathed/math_panel.C +
12380 * src/insets/inseterror.C +
12381 * src/insets/insetinfo.C +
12382 * src/insets/inseturl.C +
12383 * src/insets/inseturl.h +
12385 * src/LyXSendto.C +
12386 * src/PaperLayout.C +
12387 * src/ParagraphExtra.C +
12388 * src/TableLayout.C +
12390 * src/layout_forms.C +
12397 * src/menus.C: fixed various resize issues. So now forms can be
12398 resized savely or not be resized at all.
12400 * forms/form_url.fd +
12401 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12404 * src/insets/Makefile.am: added files form_url.[Ch]
12406 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12408 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12409 (and presumably 6.2).
12411 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12412 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12413 remaining static member callbacks.
12415 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12418 * src/support/lyxstring.h: declare struct Srep as friend of
12419 lyxstring, since DEC cxx complains otherwise.
12421 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12423 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12425 * src/LaTeX.C (run): made run_bibtex also depend on files with
12427 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12428 are put into the dependency file.
12430 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12431 the code has shown itself to work
12432 (create_ispell_pipe): removed another warning, added a comment
12435 * src/minibuffer.C (ExecutingCB): removed code that has been
12436 commented out a long time
12438 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12439 out code + a warning.
12441 * src/support/lyxstring.h: comment out the three private
12442 operators, when compiling with string ansi conforming compilers
12443 they make problems.
12445 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12447 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12448 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12451 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12454 * src/mathed/math_panel.C (create_math_panel): remove explicit
12457 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12460 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12461 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12462 to XCreatePixmapFromBitmapData
12463 (fl_set_bmtable_data): change the last argument to be unsigned
12465 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12466 and bh to be unsigned int, remove explicit casts in call to
12467 XReadBitmapFileData.
12469 * images/arrows.xbm: made the arrays unsigned char *
12470 * images/varsz.xbm: ditto
12471 * images/misc.xbm: ditto
12472 * images/greek.xbm: ditto
12473 * images/dots.xbm: ditto
12474 * images/brel.xbm: ditto
12475 * images/bop.xbm: ditto
12477 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12479 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12480 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12481 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12483 (LYX_CXX_CHEADERS): added <clocale> to the test.
12485 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12487 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12489 * src/support/lyxstring.C (append): fixed something that must be a
12490 bug, rep->assign was used instead of rep->append.
12492 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12495 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12496 lyx insert double chars. Fix spotted by Kayvan.
12498 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12500 * Fixed the tth support. I messed up with the Emacs patch apply feature
12501 and omitted the changes in lyxrc.C.
12503 1999-10-22 Juergen Vigna <jug@sad.it>
12505 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12507 * src/lyx_cb.C (MenuInsertRef) +
12508 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12509 the form cannot be resized under it limits (fixes a segfault)
12511 * src/lyx.C (create_form_form_ref) +
12512 * forms/lyx.fd: Changed Gravity on name input field so that it is
12515 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12517 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12518 <ostream> and <istream>.
12520 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12521 whether <fstream> provides the latest standard features, or if we
12522 have an oldstyle library (like in egcs).
12523 (LYX_CXX_STL_STRING): fix the test.
12525 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12526 code on MODERN_STL_STREAM.
12528 * src/support/lyxstring.h: use L{I,O}stream.h.
12530 * src/support/L{I,O}stream.h: new files, designed to setup
12531 correctly streams for our use
12532 - includes the right header depending on STL capabilities
12533 - puts std::ostream and std::endl (for LOStream.h) or
12534 std::istream (LIStream.h) in toplevel namespace.
12536 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12538 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12539 was a bib file that had been changed we ensure that bibtex is run.
12540 (runBibTeX): enhanced to extract the names of the bib files and
12541 getting their absolute path and enter them into the dep file.
12542 (findtexfile): static func that is used to look for tex-files,
12543 checks for absolute patchs and tries also with kpsewhich.
12544 Alternative ways of finding the correct files are wanted. Will
12546 (do_popen): function that runs a command using popen and returns
12547 the whole output of that command in a string. Should be moved to
12550 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12551 file with extension ext has changed.
12553 * src/insets/figinset.C: added ifdef guards around the fl_free
12554 code that jug commented out. Now it is commented out when
12555 compiling with XForms == 0.89.
12557 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12558 to lyxstring.C, and only keep a forward declaration in
12559 lyxstring.h. Simplifies the header file a bit and should help a
12560 bit on compile time too. Also changes to Srep will not mandate a
12561 recompile of code just using string.
12562 (~lyxstring): definition moved here since it uses srep.
12563 (size): definition moved here since it uses srep.
12565 * src/support/lyxstring.h: removed a couple of "inline" that should
12568 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12570 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12573 1999-10-21 Juergen Vigna <jug@sad.it>
12575 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12576 set to left if I just remove the width entry (or it is empty).
12578 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12579 paragraph when having dummy paragraphs.
12581 1999-10-20 Juergen Vigna <jug@sad.it>
12583 * src/insets/figinset.C: just commented some fl_free_form calls
12584 and added warnings so that this calls should be activated later
12585 again. This avoids for now a segfault, but we have a memory leak!
12587 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12588 'const char * argument' to 'string argument', this should
12589 fix some Asserts() in lyxstring.C.
12591 * src/lyxfunc.h: Removed the function argAsString(const char *)
12592 as it is not used anymore.
12594 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12596 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12599 * src/Literate.h: some funcs moved from public to private to make
12600 interface clearer. Unneeded args removed.
12602 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12604 (scanBuildLogFile): ditto
12606 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12607 normal TeX Error. Still room for improvement.
12609 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12611 * src/buffer.C (insertErrors): changes to make the error
12612 desctription show properly.
12614 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12617 * src/support/lyxstring.C (helper): changed to use
12618 sizeof(object->rep->ref).
12619 (operator>>): changed to use a pointer instead.
12621 * src/support/lyxstring.h: changed const reference & to value_type
12622 const & lets see if that helps.
12624 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12626 * Makefile.am (rpmdist): fixed to have non static package and
12629 * src/support/lyxstring.C: removed the compilation guards
12631 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12634 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12635 conditional compile of lyxstring.Ch
12637 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12638 stupid check, but it is a lot better than the bastring hack.
12639 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12641 * several files: changed string::erase into string::clear. Not
12644 * src/chset.C (encodeString): use a char temporary instead
12646 * src/table.C (TexEndOfCell): added tostr around
12647 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12648 (TexEndOfCell): ditto
12649 (TexEndOfCell): ditto
12650 (TexEndOfCell): ditto
12651 (DocBookEndOfCell): ditto
12652 (DocBookEndOfCell): ditto
12653 (DocBookEndOfCell): ditto
12654 (DocBookEndOfCell): ditto
12656 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12658 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12660 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12661 (MenuBuildProg): added tostr around ret
12662 (MenuRunChktex): added tostr around ret
12663 (DocumentApplyCB): added tostr around ret
12665 * src/chset.C (encodeString): added tostr around t->ic
12667 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12668 (makeLaTeXFile): added tostr around tocdepth
12669 (makeLaTeXFile): added tostr around ftcound - 1
12671 * src/insets/insetbib.C (setCounter): added tostr around counter.
12673 * src/support/lyxstring.h: added an operator+=(int) to catch more
12676 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12677 (lyxstring): We DON'T allow NULL pointers.
12679 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12681 * src/mathed/math_macro.C (MathMacroArgument::Write,
12682 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12683 when writing them out.
12685 * src/LString.C: remove, since it is not used anymore.
12687 * src/support/lyxstring.C: condition the content to
12688 USE_INCLUDED_STRING macro.
12690 * src/mathed/math_symbols.C, src/support/lstrings.C,
12691 src/support/lyxstring.C: add `using' directive to specify what
12692 we need in <algorithm>. I do not think that we need to
12693 conditionalize this, but any thought is appreciated.
12695 * many files: change all callback functions to "C" linkage
12696 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12697 strict_ansi. Those who were static are now global.
12698 The case of callbacks which are static class members is
12699 trickier, since we have to make C wrappers around them (see
12700 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12701 did not finish this yet, since it defeats the purpose of
12702 encapsulation, and I am not sure what the best route is.
12704 1999-10-19 Juergen Vigna <jug@sad.it>
12706 * src/support/lyxstring.C (lyxstring): we permit to have a null
12707 pointer as assignment value and just don't assign it.
12709 * src/vspace.C (nextToken): corrected this function substituting
12710 find_first(_not)_of with find_last_of.
12712 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12713 (TableOptCloseCB) (TableSpeCloseCB):
12714 inserted fl_set_focus call for problem with fl_hide_form() in
12717 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12719 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12722 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12724 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12725 LyXLex::next() and not eatline() to get its argument.
12727 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12729 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12730 instead, use fstreams for io of the depfile, removed unneeded
12731 functions and variables.
12733 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12734 vector instead, removed all functions and variables that is not in
12737 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12739 * src/buffer.C (insertErrors): use new interface to TeXError
12741 * Makefile.am (rpmdist): added a rpmdist target
12743 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12744 per Kayvan's instructions.
12746 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12748 * src/Makefile.am: add a definition for localedir, so that locales
12749 are found after installation (Kayvan)
12751 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12753 * development/.cvsignore: new file.
12755 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12757 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12758 C++ compiler provides wrappers for C headers and use our alternate
12761 * configure.in: use LYX_CXX_CHEADERS.
12763 * src/cheader/: new directory, populated with cname headers from
12764 libstdc++-2.8.1. They are a bit old, but probably good enough for
12765 what we want (support compilers who lack them).
12767 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12768 from includes. It turns out is was stupid.
12770 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12772 * lib/Makefile.am (install-data-local): forgot a ';'
12773 (install-data-local): forgot a '\'
12774 (libinstalldirs): needed after all. reintroduced.
12776 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12778 * configure.in (AC_OUTPUT): added lyx.spec
12780 * development/lyx.spec: removed file
12782 * development/lyx.spec.in: new file
12784 * po/*.po: merged with lyx.pot becuase of make distcheck
12786 * lib/Makefile.am (dist-hook): added dist-hook so that
12787 documentation files will be included when doing a make
12788 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12789 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12791 more: tried to make install do the right thing, exclude CVS dirs
12794 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12795 Path would fit in more nicely.
12797 * all files that used to use pathstack: uses now Path instead.
12798 This change was a lot easier than expected.
12800 * src/support/path.h: new file
12802 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12804 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12806 * src/support/lyxstring.C (getline): Default arg was given for
12809 * Configure.cmd: removed file
12811 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12813 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12814 streams classes and types, add the proper 'using' statements when
12815 MODERN_STL is defined.
12817 * src/debug.h: move the << operator definition after the inclusion
12820 * src/support/filetools.C: include "LAssert.h", which is needed
12823 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12826 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12827 include "debug.h" to define a proper ostream.
12829 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12831 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12832 method to the SystemCall class which can kill a process, but it's
12833 not fully implemented yet.
12835 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12837 * src/support/FileInfo.h: Better documentation
12839 * src/lyxfunc.C: Added support for buffer-export html
12841 * src/menus.C: Added Export->As HTML...
12843 * lib/bind/*.bind: Added short-cut for buffer-export html
12845 * src/lyxrc.*: Added support for new \tth_command
12847 * lib/lyxrc.example: Added stuff for new \tth_command
12849 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12851 * lib/Makefile.am (IMAGES): removed images/README
12852 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12853 installes in correct place. Check permisions is installed
12856 * src/LaTeX.C: some no-op changes moved declaration of some
12859 * src/LaTeX.h (LATEX_H): changed include guard name
12861 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12863 * lib/reLyX/Makefile.am: install noweb2lyx.
12865 * lib/Makefile.am: install configure.
12867 * lib/reLyX/configure.in: declare a config aux dir; set package
12868 name to lyx (not sure what the best solution is); generate noweb2lyx.
12870 * lib/layouts/egs.layout: fix the bibliography layout.
12872 1999-10-08 Jürgen Vigna <jug@sad.it>
12874 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12875 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12876 it returned without continuing to search the path.
12878 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12880 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12881 also fixes a bug. It is not allowed to do tricks with std::strings
12882 like: string a("hei"); &a[e]; this will not give what you
12883 think... Any reason for the complexity in this func?
12885 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12887 * Updated README and INSTALL a bit, mostly to check that my
12888 CVS rights are correctly set up.
12890 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12892 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12893 does not allow '\0' chars but lyxstring and std::string does.
12895 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12897 * autogen.sh (AUTOCONF): let the autogen script create the
12898 POTFILES.in file too. POTFILES.in should perhaps now not be
12899 included in the cvs module.
12901 * some more files changed to use C++ includes instead of C ones.
12903 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12905 (Reread): added tostr to nlink. buggy output otherwise.
12906 (Reread): added a string() around szMode when assigning to Buffer,
12907 without this I got a log of garbled info strings.
12909 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12912 * I have added several ostream & operator<<(ostream &, some_type)
12913 functions. This has been done to avoid casting and warnings when
12914 outputting enums to lyxerr. This as thus eliminated a lot of
12915 explicit casts and has made the code clearer. Among the enums
12916 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12917 mathed enums, some font enum the Debug::type enum.
12919 * src/support/lyxstring.h (clear): missing method. equivalent of
12922 * all files that contained "stderr": rewrote constructs that used
12923 stderr to use lyxerr instead. (except bmtable)
12925 * src/support/DebugStream.h (level): and the passed t with
12926 Debug::ANY to avoid spurious bits set.
12928 * src/debug.h (Debug::type value): made it accept strings of the
12929 type INFO,INIT,KEY.
12931 * configure.in (Check for programs): Added a check for kpsewhich,
12932 the latex generation will use this later to better the dicovery of
12935 * src/BufferView.C (create_view): we don't need to cast this to
12936 (void*) that is done automatically.
12937 (WorkAreaButtonPress): removed some dead code.
12939 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12941 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12942 is not overwritten when translated (David Sua'rez de Lis).
12944 * lib/CREDITS: Added David Sua'rez de Lis
12946 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12948 * src/bufferparams.C (BufferParams): default input encoding is now
12951 * acinclude.m4 (cross_compiling): comment out macro
12952 LYX_GXX_STRENGTH_REDUCE.
12954 * acconfig.h: make sure that const is not defined (to empty) when
12955 we are compiling C++. Remove commented out code using SIZEOF_xx
12958 * configure.in : move the test for const and inline as late as
12959 possible so that these C tests do not interefere with C++ ones.
12960 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12961 has not been proven.
12963 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12965 * src/table.C (getDocBookAlign): remove bad default value for
12966 isColumn parameter.
12968 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12970 (ShowFileMenu2): ditto.
12972 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12973 of files to ignore.
12975 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12977 * Most files: finished the change from the old error code to use
12978 DebugStream for all lyxerr debugging. Only minor changes remain
12979 (e.g. the setting of debug levels using strings instead of number)
12981 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12983 * src/layout.C (Add): Changed to use compare_no_case instead of
12986 * src/FontInfo.C: changed loop variable type too string::size_type.
12988 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12990 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12991 set ETAGS_ARGS to --c++
12993 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12995 * src/table.C (DocBookEndOfCell): commented out two unused variables
12997 * src/paragraph.C: commented out four unused variables.
12999 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13000 insed a if clause with type string::size_type.
13002 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13005 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13007 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13008 variable, also changed loop to go from 0 to lenght + 1, instead of
13009 -1 to length. This should be correct.
13011 * src/LaTeX.C (scanError): use string::size_type as loop variable
13014 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13015 (l.896) since y_tmp and row was not used anyway.
13017 * src/insets/insetref.C (escape): use string::size_type as loop
13020 * src/insets/insetquotes.C (Width): use string::size_type as loop
13022 (Draw): use string::size_type as loop variable type.
13024 * src/insets/insetlatexaccent.C (checkContents): use
13025 string::size_type as loop variable type.
13027 * src/insets/insetlabel.C (escape): use string::size_type as loop
13030 * src/insets/insetinfo.C: added an extern for current_view.
13032 * src/insets/insetcommand.C (scanCommand): use string::size_type
13033 as loop variable type.
13035 * most files: removed the RCS tags. With them we had to recompile
13036 a lot of files after a simple cvs commit. Also we have never used
13037 them for anything meaningful.
13039 * most files: tags-query-replace NULL 0. As adviced several plases
13040 we now use "0" instead of "NULL" in our code.
13042 * src/support/filetools.C (SpaceLess): use string::size_type as
13043 loop variable type.
13045 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13047 * src/paragraph.C: fixed up some more string stuff.
13049 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13051 * src/support/filetools.h: make modestr a std::string.
13053 * src/filetools.C (GetEnv): made ch really const.
13055 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13056 made code that used these use max/min from <algorithm> instead.
13058 * changed several c library include files to their equivalent c++
13059 library include files. All is not changed yet.
13061 * created a support subdir in src, put lyxstring and lstrings
13062 there + the extra files atexit, fileblock, strerror. Created
13063 Makefile.am. edited configure.in and src/Makefile.am to use this
13064 new subdir. More files moved to support.
13066 * imported som of the functions from repository lyx, filetools
13068 * ran tags-query-replace on LString -> string, corrected the bogus
13069 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13070 is still some errors in there. This is errors where too much or
13071 too litle get deleted from strings (string::erase, string::substr,
13072 string::replace), there can also be some off by one errors, or
13073 just plain wrong use of functions from lstrings. Viewing of quotes
13076 * LyX is now running fairly well with string, but there are
13077 certainly some bugs yet (see above) also string is quite different
13078 from LString among others in that it does not allow null pointers
13079 passed in and will abort if it gets any.
13081 * Added the revtex4 files I forgot when setting up the repository.
13083 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13085 * All over: Tried to clean everything up so that only the files
13086 that we really need are included in the cvs repository.
13087 * Switched to use automake.
13088 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13089 * Install has not been checked.
13091 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13093 * po/pt.po: Three errors:
13094 l.533 and l.538 format specification error
13095 l. 402 duplicate entry, I just deleted it.