1 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
6 * src/support/snprintf.[ch]: new files
8 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
10 * src/frontends/kde/formprintdialog.C: add
11 file browser for selecting postscript output
13 * src/frontends/kde/formprintdialogdata.C:
14 * src/frontends/kde/formprintdialogdata.h: re-generate
17 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
19 * src/frontends/gnome/Makefile.am:
20 * src/frontends/kde/Makefile.am: FormCommand.C
21 disappeared from xforms
23 * src/frontends/kde/FormCitation.C:
24 * src/frontends/kde/FormIndex.C: read-only
27 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
29 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
32 * src/bufferlist.C: add using directive.
34 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
36 * src/support/lyxfunctional.h: version of class_fun for void
37 returns added, const versions of back_inseter_fun and compare_fun
40 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
42 * src/frontends/xforms/FormInset.C (showInset): fix typo.
44 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
48 * lib/CREDITS: update to add all the contributors we've forgotten.
49 I have obviously missed some, so tell me whether there were
52 2000-10-13 Marko Vendelin <markov@ioc.ee>
54 * src/frontends/gnome/FormCitation.C
55 * src/frontends/gnome/FormCitation.h
56 * src/frontends/gnome/FormError.C
57 * src/frontends/gnome/FormIndex.C
58 * src/frontends/gnome/FormRef.C
59 * src/frontends/gnome/FormRef.h
60 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
62 * src/frontends/gnome/FormCitation.C
63 * src/frontends/gnome/FormCopyright.C
64 * src/frontends/gnome/FormError.C
65 * src/frontends/gnome/FormIndex.C
66 * src/frontends/gnome/FormRef.C
67 * src/frontends/gnome/FormToc.C
68 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
71 * src/frontends/gnome/Menubar_pimpl.C
72 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
75 2000-10-11 Baruch Even <baruch.even@writeme.com>
78 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
79 to convey its real action.
81 * src/minibuffer.C (peek_event): Added action when mouse clicks to
82 clear the minibuffer and prepare to enter a command.
84 * src/mathed/formula.C (LocalDispatch): Changed to conform with
85 the rename from ExecCommand to PrepareForCommand.
86 * src/lyxfunc.C (Dispatch): ditto.
88 2000-10-11 Baruch Even <baruch.even@writeme.com>
90 * src/buffer.C (writeFile): Added test for errors on writing, this
91 catches all errors and not only file system full errors as intended.
93 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
95 * src/lyx_gui.C (create_forms): better fix for crash with
98 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
100 * src/frontends/kde/Makefile.am:
101 * src/frontends/kde/FormCopyright.C:
102 * src/frontends/kde/formcopyrightdialog.C:
103 * src/frontends/kde/formcopyrightdialog.h:
104 * src/frontends/kde/formcopyrightdialogdata.C:
105 * src/frontends/kde/formcopyrightdialogdata.h:
106 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
107 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
108 copyright to use qtarch
110 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
112 * src/encoding.C (read): Fixed bug that caused an error message at
115 * po/Makefile.in.in: Fixed rule for ext_l10n.h
117 * lib/lyxrc.example: Fixed hebrew example.
119 2000-10-13 Allan Rae <rae@lyx.org>
121 * src/frontends/xforms/FormPreferences.C (input): reworking the
123 (build, update, apply): New inputs in various tabfolders
125 * src/frontends/xforms/FormToc.C: use new button policy.
126 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
127 dialogs that either can't use any existing policy or where it just
130 * src/frontends/xforms/FormTabular.h: removed copyright notice that
133 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
134 added a bool parameter which is ignored.
136 * src/buffer.C (setReadonly):
137 * src/BufferView_pimpl.C (buffer):
138 * src/frontends/kde/FormCopyright.h (update):
139 * src/frontends/kde/FormCitation.[Ch] (update):
140 * src/frontends/kde/FormIndex.[Ch] (update):
141 * src/frontends/kde/FormPrint.[Ch] (update):
142 * src/frontends/kde/FormRef.[Ch] (update):
143 * src/frontends/kde/FormToc.[Ch] (update):
144 * src/frontends/kde/FormUrl.[Ch] (update):
145 * src/frontends/gnome/FormCopyright.h (update):
146 * src/frontends/gnome/FormCitation.[Ch] (update):
147 * src/frontends/gnome/FormError.[Ch] (update):
148 * src/frontends/gnome/FormIndex.[Ch] (update):
149 * src/frontends/gnome/FormPrint.[Ch] (update):
150 * src/frontends/gnome/FormRef.h (update):
151 * src/frontends/gnome/FormToc.[Ch] (update):
152 * src/frontends/gnome/FormUrl.[Ch] (update):
153 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
154 to updateBufferDependent and DialogBase
156 * src/frontends/xforms/FormCitation.[hC]:
157 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
158 * src/frontends/xforms/FormError.[Ch]:
159 * src/frontends/xforms/FormGraphics.[Ch]:
160 * src/frontends/xforms/FormIndex.[Ch]:
161 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
162 and fixed readOnly handling.
163 * src/frontends/xforms/FormPrint.[Ch]:
164 * src/frontends/xforms/FormRef.[Ch]:
165 * src/frontends/xforms/FormTabular.[Ch]:
166 * src/frontends/xforms/FormToc.[Ch]:
167 * src/frontends/xforms/FormUrl.[Ch]:
168 * src/frontends/xforms/FormInset.[Ch]:
169 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
170 form of updateBufferDependent.
172 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
173 if form()->visible just in case someone does stuff to the form in a
176 * src/frontends/DialogBase.h (enum): removed enum since we can now use
177 the buttoncontroller for everything the enum used to be used for.
178 (update) It would seem we need to force all dialogs to use a bool
179 parameter or have two update functions. I chose to go with one.
180 I did try removing update() from here and FormBase and defining the
181 appropriate update signatures in FormBaseB[DI] but then ran into the
182 problem of the update() call in FormBase::show(). Whatever I did
183 to get around that would require another function and that just
184 got more confusing. Hence the decision to make everyone have an
185 update(bool). An alternative might have been to override show() in
186 FormBaseB[DI] and that would allow the different and appropriate
189 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
190 true == buffer change occurred. I decided against using a default
191 template parameter since not all compilers support that at present.
193 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
195 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
196 army knife" by removing functionality.
197 (clearStore): removed. All such housekeeping on hide()ing the dialog
198 is to be carried out by overloaded disconnect() methods.
199 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
200 superceded by Baruch's neat test (FormGraphics) to update an existing
201 dialog if a new signal is recieved rather than block all new signals
203 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
204 only to Inset dialogs.
205 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
206 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
208 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
210 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
211 as a base class to all inset dialogs. Used solely to connect/disconnect
212 the Inset::hide signal and to define what action to take on receipt of
213 a UpdateBufferDependent signal.
214 (FormCommand): now derived from FormInset.
216 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
219 * src/frontends/xforms/FormCopyright.[Ch]:
220 * src/frontends/xforms/FormPreferences.[Ch]:
221 now derived from FormBaseBI.
223 * src/frontends/xforms/FormDocument.[Ch]:
224 * src/frontends/xforms/FormParagraph.[Ch]:
225 * src/frontends/xforms/FormPrint.[Ch]:
226 now derived from FormBaseBD.
228 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
230 * src/frontends/xforms/FormCitation.[Ch]:
231 * src/frontends/xforms/FormError.[Ch]:
232 * src/frontends/xforms/FormRef.[Ch]:
233 * src/frontends/xforms/FormToc.[Ch]:
234 (clearStore): reworked as disconnect().
236 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
239 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
241 * src/converter.C (runLaTeX): constify buffer argument
244 * src/frontends/support/Makefile.am (INCLUDES): fix.
246 * src/buffer.h: add std:: qualifier
247 * src/insets/figinset.C (addpidwait): ditto
248 * src/MenuBackend.C: ditto
249 * src/buffer.C: ditto
250 * src/bufferlist.C: ditto
251 * src/layout.C: ditto
252 * src/lyxfunc.C: ditto
254 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
256 * src/lyxtext.h (bidi_level): change return type to
257 LyXParagraph::size_type.
259 * src/lyxparagraph.h: change size_type to
260 TextContainer::difference_type. This should really be
261 TextContainer::size_type, but we need currently to support signed
264 2000-10-11 Marko Vendelin <markov@ioc.ee>
265 * src/frontends/gnome/FormError.h
266 * src/frontends/gnome/FormRef.C
267 * src/frontends/gnome/FormRef.h
268 * src/frontends/gnome/FormError.C
269 * src/frontends/gnome/Makefile.am
270 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
271 to Gnome frontend. Both dialogs use "action" area.
273 2000-10-12 Baruch Even <baruch.even@writeme.com>
275 * src/graphics/GraphicsCacheItem_pimpl.C:
276 * src/graphics/Renderer.C:
277 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
280 2000-10-12 Juergen Vigna <jug@sad.it>
282 * src/insets/insettext.C (draw): fixed drawing bug (specifically
283 visible when selecting).
285 * development/Code_rules/Rules: fixed some typos.
287 2000-10-09 Baruch Even <baruch.even@writeme.com>
289 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
290 compiling on egcs 1.1.2 possible.
292 * src/filedlg.C (comp_direntry::operator() ): ditto.
294 2000-08-31 Baruch Even <baruch.even@writeme.com>
296 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
299 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
300 transient it now only gets freed when the object is destructed.
302 2000-08-24 Baruch Even <baruch.even@writeme.com>
304 * src/frontends/FormGraphics.h:
305 * src/frontends/FormGraphics.C: Changed to use ButtonController and
308 2000-08-20 Baruch Even <baruch.even@writeme.com>
310 * src/insets/insetgraphics.C:
311 (draw): Added messages to the drawn rectangle to report status.
312 (updateInset): Disabled the use of the inline graphics,
315 2000-08-17 Baruch Even <baruch.even@writeme.com>
317 * src/frontends/support: Directory added for the support of GUII LyX.
319 * src/frontends/support/LyXImage.h:
320 * src/frontends/support/LyXImage.C: Base class for GUII holding of
323 * src/frontends/support/LyXImage_X.h:
324 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
325 version of LyXImage, this uses the Xlib Pixmap.
330 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
331 replacement to Pixmap.
333 * src/insets/insetgraphics.h:
334 * src/insets/insetgraphics.C:
335 * src/graphics/GraphicsCacheItem.h:
336 * src/graphics/GraphicsCacheItem.C:
337 * src/graphics/GraphicsCacheItem_pimpl.h:
338 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
341 * src/graphics/GraphicsCacheItem.h:
342 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
343 another copy of the object.
345 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
346 of cacheHandle, this fixed a bug that sent LyX crashing.
348 * src/graphics/XPM_Renderer.h:
349 * src/graphics/XPM_Renderer.C:
350 * src/graphics/EPS_Renderer.h:
351 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
353 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
355 * src/lyxfunc.C (processKeySym): only handle the
356 lockinginset/inset stuff if we have a buffer and text loaded...
358 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
360 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
362 * src/support/lyxfunctional.h: add operator= that takes a reference
364 * src/lyxserver.C (mkfifo): make first arg const
366 * src/layout.h: renamed name(...) to setName(...) to work around
369 * src/buffer.C (setFileName): had to change name of function to
370 work around bugs in egcs. (renamed from fileName)
372 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
374 * src/support/translator.h: move helper template classes to
375 lyxfunctional.h, include "support/lyxfunctional.h"
377 * src/support/lyxmanip.h: add delaration of fmt
379 * src/support/lyxfunctional.h: new file
380 (class_fun_t): new template class
381 (class_fun): helper template function
382 (back_insert_fun_iterator): new template class
383 (back_inserter_fun): helper template function
384 (compare_memfun_t): new template class
385 (compare_memfun): helper template function
386 (equal_1st_in_pair): moved here from translator
387 (equal_2nd_in_pair): moved here from translator
389 * src/support/fmt.C: new file
390 (fmt): new func, can be used for a printf substitute when still
391 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
393 * src/support/StrPool.C: add some comments
395 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
398 * src/insets/figinset.C (addpidwait): use std::copy with
399 ostream_iterator to fill the pidwaitlist
401 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
403 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
406 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
409 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
411 * src/frontends/xforms/FormDocument.C (build): remove c_str()
412 (class_update): ditto
414 (CheckChoiceClass): move initialization of tc and tct
416 * src/tabular.C: remove current_view
417 (OldFormatRead): similar to right below [istream::ignore]
419 * src/lyxlex_pimpl.C (next): add code for faster skipping of
420 chars, unfortunately this is buggy on gcc 2.95.2, so currently
421 unused [istream::ignore]
423 * src/lyxfunc.C: include "support/lyxfunctional.h"
424 (getInsetByCode): use std::find_if and compare_memfun
426 * src/lyxfont.C (stateText): remove c_str()
428 * src/lyx_main.C (setDebuggingLevel): make static
429 (commandLineHelp): make static
431 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
432 Screen* together with fl_get_display() and fl_screen
434 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
435 togheter with fl_get_display() and fl_screen
436 (create_forms): remove c_str()
438 * src/layout.C: include "support/lyxfunctional.h"
439 (hasLayout): use std::find_if and compare_memfun
440 (GetLayout): use std::find_if and comapre_memfun
441 (delete_layout): use std::remove_if and compare_memfun
442 (NumberOfClass): use std:.find_if and compare_memfun
444 * src/gettext.h: change for the new functions
446 * src/gettext.C: new file, make _(char const * str) and _(string
447 const & str) real functions.
449 * src/font.C (width): rewrite slightly to avoid one extra variable
451 * src/debug.C: initialize Debug::ANY here
453 * src/commandtags.h: update number comments
455 * src/combox.h (get): make const func
457 (getline): make const
459 * src/combox.C (input_cb): handle case where fl_get_input can
462 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
463 "support/lyxfunctional.h", remove current_view variable.
464 (resize): use std::for_each with std::mem_fun
465 (getFileNames): use std::copy with back_inserter_fun
466 (getBuffer): change arg type to unsigned int
467 (emergencyWriteAll): call emergencyWrite with std::for_each and
469 (emergencyWrite): new method, the for loop in emergencyWriteAll
471 (exists): use std::find_if with compare_memfun
472 (getBuffer): use std::find_if and compare_memfun
474 * src/buffer.h: add typedefs for iterator_category, value_type
475 difference_type, pointer and reference for inset_iterator
476 add postfix ++ for inset_iterator
477 make inset_iterator::getPos() const
479 * src/buffer.C: added support/lyxmanip.h
480 (readFile): use lyxerr << fmt instead of printf
481 (makeLaTeXFile): use std::copy to write out encodings
483 * src/Painter.C (text): rewrite slightly to avoid extra font variable
485 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
486 free and the char * temp.
487 (hasMenu): use std::find_if and compare_memfun
490 * src/Makefile.am (lyx_SOURCES): added gettext.C
492 * src/LyXAction.C (retrieveActionArg): clear the arg, use
493 string::insert small change to avoid temporary
495 * src/LColor.C (getGUIName): remove c_str()
497 * several files: change all occurrences of fl_display to
500 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
501 that -pedantic is not used for gcc 2.97 (cvs gcc)
503 * boost/Makefile.am: begin slowly to prepare for a real boost lib
505 2000-10-11 Allan Rae <rae@lyx.org>
507 * src/frontends/xforms/FormPreferences.C (input): template path must be
508 a readable directory. It doesn't need to be writeable.
509 (build, delete, update, apply): New inputs in the various tabfolders
511 * src/frontends/xforms/forms/form_preferences.fd:
512 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
513 several new entries to existing folders. Shuffled some existing stuff
516 * src/frontends/xforms/forms/form_print.fd:
517 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
518 Should probably rework PrinterParams as well. Note that the switch to
519 collated is effectively the same as !unsorted so changing PrinterParams
520 will require a lot of fiddly changes to reverse the existing logic.
522 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
524 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
526 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
528 2000-10-10 Allan Rae <rae@lyx.org>
531 * src/lyxfunc.C (Dispatch):
533 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
536 * src/lyxrc.C (output): Only write the differences between system lyxrc
537 and the users settings.
540 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
542 I'll rewrite this later, after 1.1.6 probably, to keep a single
543 LyXRC but two instances of a LyXRCStruct.
545 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
547 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
549 * src/tabular.h: add a few std:: qualifiers.
551 * src/encoding.C: add using directive.
552 * src/language.C: ditto.
554 * src/insets/insetquotes.C (Validate): use languages->lang()
555 instead of only language.
557 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
559 * lib/languages: New file.
561 * lib/encodings: New file.
563 * src/language.C (Languages): New class.
564 (read): New method. Reads the languages from the 'languages' file.
566 * src/encoding.C (Encodings): New class.
567 (read): New method. Reads the encodings from the 'encodings' file.
569 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
572 * src/bufferparams.h and a lot of files: Deleted the member language,
573 and renamed language_info to language
575 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
576 * src/lyxfont.C (latexWriteStartChanges): ditto.
577 * src/paragraph.C (validate,TeXOnePar): ditto.
579 * src/lyxfont.C (update): Restored deleted code.
581 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
583 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
585 * src/BufferView_pimpl.C (buffer): cleaned up a little.
587 * src/insets/figinset.[Ch]:
588 * src/insets/insetinclude.[Ch]:
589 * src/insets/insetinclude.[Ch]:
590 * src/insets/insetparent.[Ch]:
591 * src/insets/insetref.[Ch]:
592 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
595 * src/mathed/formula.[Ch]:
596 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
598 * src/buffer.C (parseSingleLyXformat2Token, readInset):
599 * src/lyx_cb.C (FigureApplyCB):
600 * src/lyxfunc.C (getStatus, Dispatch):
601 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
604 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
606 * src/converter.[Ch] (Formats::View):
607 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
609 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
610 *current_view->buffer(). This will change later, but this patch is way
613 2000-10-09 Juergen Vigna <jug@sad.it>
615 * src/text.C (GetRow): small fix.
617 * src/BufferView_pimpl.C (cursorPrevious):
618 (cursorNext): added LyXText parameter to function.
620 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
621 keypress depending on cursor position.
623 2000-10-06 Juergen Vigna <jug@sad.it>
625 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
626 (copySelection): redone this function and also copy ascii representa-
629 * src/tabular.C (Ascii):
633 (print_n_chars): new functions to realize the ascii export of tabulars.
635 2000-10-05 Juergen Vigna <jug@sad.it>
637 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
638 if we don't have a buffer.
640 2000-10-10 Allan Rae <rae@lyx.org>
642 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
643 with closing dialog. It seems that nested tabfolders require hiding
644 of inner tabfolders before hiding the dialog itself. Actually all I
645 did was hide the active outer folder.
647 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
648 unless there really is a buffer. hideBufferDependent is called
651 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
652 POTFILES.in stays in $(srcdir).
654 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
656 * lib/lyxrc.example: Few changes.
658 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
660 * src/BufferView_pimpl.C (buffer): only need one the
661 updateBufferDependent signal to be emitted once! Moved to the end of
662 the method to allow bv_->text to be updated first.
664 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
665 and hSignal_ with Dialogs * and BufferDependency variables.
666 New Buffer * parent_, initialised when the dialog is launched. Used to
667 check whether to update() or hide() dialog in the new, private
668 updateOrHide() method that is connected to the updateBufferDependent
669 signal. Daughter classes dictate what to do using the
670 ChangedBufferAction enum, passed to the c-tor.
672 * src/frontends/xforms/FormCitation.C:
673 * src/frontends/xforms/FormCommand.C:
674 * src/frontends/xforms/FormCopyright.C:
675 * src/frontends/xforms/FormDocument.C:
676 * src/frontends/xforms/FormError.C:
677 * src/frontends/xforms/FormIndex.C:
678 * src/frontends/xforms/FormPreferences.C:
679 * src/frontends/xforms/FormPrint.C:
680 * src/frontends/xforms/FormRef.C:
681 * src/frontends/xforms/FormToc.C:
682 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
685 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
686 ChangedBufferAction enum.
688 * src/frontends/xforms/FormParagraph.[Ch]
689 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
692 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
694 * lib/bind/cua.bind: fix a bit.
695 * lib/bind/emacs.bind: ditto.
697 * lib/bind/menus.bind: remove real menu entries from there.
699 * src/spellchecker.C: make sure we only include strings.h when
702 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
704 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
705 function. It enlarges the maximum number of pup when needed.
706 (add_toc2): Open a new menu if maximum number of items per menu has
709 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
711 * src/frontends/kde/FormPrint.C: fix error reporting
713 * src/frontends/xforms/FormDocument.C: fix compiler
716 * lib/.cvsignore: add Literate.nw
718 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
721 * bufferview_funcs.[Ch]
724 * text2.C: Add support for numbers in RTL text.
726 2000-10-06 Allan Rae <rae@lyx.org>
728 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
729 to be gettext.m4 friendly again. ext_l10n.h is now
730 generated into $top_srcdir instead of $top_builddir
731 so that lyx.pot will be built correctly -- without
732 duplicate parsing of ext_l10n.h.
734 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
736 * src/frontends/kde/FormCitation.C: make the dialog
739 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
741 * config/kde.m4: fix consecutive ./configure runs,
742 look for qtarch, fix library order
744 * src/frontends/kde/Makefile.am: tidy up,
745 add Print dialog, add .dlg dependencies
747 * src/frontends/kde/FormPrint.C:
748 * src/frontends/kde/FormPrint.h:
749 * src/frontends/kde/formprintdialog.C:
750 * src/frontends/kde/formprintdialog.h:
751 * src/frontends/kde/formprintdialogdata.C:
752 * src/frontends/kde/formprintdialogdata.h:
753 * src/frontends/kde/dlg/formprintdialog.dlg: add
756 * src/frontends/kde/dlg/README: Added explanatory readme
758 * src/frontends/kde/dlg/checkinitorder.pl: small perl
759 script to double-check qtarch's output
761 * src/frontends/kde/formindexdialog.C:
762 * src/frontends/kde/formindexdialogdata.C:
763 * src/frontends/kde/formindexdialogdata.h:
764 * src/frontends/kde/dlg/formindexdialog.dlg: update
765 for qtarch, minor fixes
767 2000-10-05 Allan Rae <rae@lyx.org>
769 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
770 dialogs when switching buffers update them instead. It's up to each
771 dialog to decide if it should still be visible or not.
772 update() should return a bool to control visiblity within show().
773 Or perhaps better to set a member variable and use that to control
776 * lib/build-listerrors: create an empty "listerrors" file just to stop
777 make trying to regenerate it all the time if you don't have noweb
780 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
782 * po/Makefile.in.in (ext_l10n.h): added a rule to build
783 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
784 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
785 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
786 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
788 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
790 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
792 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
793 deleting buffer. Closes all buffer-dependent dialogs.
795 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
797 * src/frontends/xforms/FormCitation.[Ch]:
798 * src/frontends/xforms/FormPreferences.[Ch]:
799 * src/frontends/xforms/FormPrint.[Ch]:
800 * src/frontends/xforms/FormRef.[Ch]:
801 * src/frontends/xforms/FormUrl.[Ch]: ditto
803 * src/frontends/xforms/FormDocument.[Ch]:
804 * src/frontends/xforms/forms/form_document.C.patch:
805 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
806 pass through a single input() function.
808 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
810 * lib/build-listerrors: return status as OK
812 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
814 * lib/lyxrc.example: Updated to new export code
816 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
818 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
821 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
824 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
826 * lib/layouts/amsbook.layout: ditto.
828 * boost/Makefile.am: fix typo.
830 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
832 (add_lastfiles): removed.
833 (add_documents): removed.
834 (add_formats): removed.
836 * src/frontends/Menubar.C: remove useless "using" directive.
838 * src/MenuBackend.h: add a new MenuItem constructor.
840 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
843 2000-10-04 Allan Rae <rae@lyx.org>
845 * lib/Makefile.am (listerrors):
846 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
847 I haven't got notangle installed so Kayvan please test. The output
848 should end up in $builddir. This also allows people who don't have
849 noweb installed to complete the make process without error.
851 * src/frontends/xforms/FormCommand.[Ch] (showInset):
852 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
853 by JMarc's picky compiler.
855 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
858 * src/insets/insettabular.C (setPos): change for loop to not use
859 sequencing operator. Please check this Jürgen.
861 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
863 * src/insets/insetcite.C (getScreenLabel): ditto
864 * src/support/filetools.C (QuoteName): ditto
865 (ChangeExtension): ditto
867 * src/BufferView_pimpl.C (scrollCB): make heigt int
869 * src/BufferView2.C (insertInset): comment out unused arg
871 * boost/Makefile.am (EXTRADIST): new variable
873 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
875 * src/exporter.C (IsExportable): Fixed
877 * lib/configure.m4: Small fix
879 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
881 * src/insets/insetbutton.C (width): Changed to work with no GUI.
882 * src/insets/insetbib.C (bibitemWidest): ditto.
883 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
885 2000-10-03 Juergen Vigna <jug@sad.it>
887 * src/BufferView2.C (theLockingInset): removed const because of
888 Agnus's compile problems.
890 * src/insets/insettext.C (LocalDispatch): set the language of the
891 surronding paragraph on inserting the first character.
893 * various files: changed use of BufferView::the_locking_inset.
895 * src/BufferView2.C (theLockingInset):
896 (theLockingInset): new functions.
898 * src/BufferView.h: removed the_locking_inset.
900 * src/lyxtext.h: added the_locking_inset
902 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
904 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
906 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
908 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
909 * src/mathed/math_cursor.C (IsAlpha): ditto.
910 * src/mathed/math_inset.C (strnew): ditto.
911 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
912 (IMetrics): cxp set but never used; removed.
913 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
914 that the variable in question has been removed also!
917 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
918 using the Buffer * passed to Latex(), using the BufferView * passed to
919 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
921 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
922 Linuxdoc() and DocBook() rather than the stored Buffer * master.
924 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
925 * src/buffer.C (readInset): used new InsetBibtex c-tor
926 * (getBibkeyList): used new InsetBibtex::getKeys
928 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
931 * lib/build-listerrors
933 * src/exporter.C: Add literate programming support to the export code
936 * src/lyx_cb.C: Remove old literate code.
938 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
941 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
942 * src/converter.C (View, Convert): Use QuoteName.
944 * src/insets/figinset.C (Preview): Use Formats::View.
946 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
948 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
950 * src/lyxfunc.C (Dispatch): move declaration of text variable at
951 the top of the function, because compaq cxx complains that the
952 "goto exit_with_message" when the function is disabled bypasses
954 (MenuNew): try a better fix for the generation of new file names.
955 This time, I used AddName() instead of AddPath(), hoping Juergen
958 2000-10-03 Allan Rae <rae@lyx.org>
960 * src/frontends/xforms/forms/form_preferences.fd:
961 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
962 nested tabfolders has begun. The old "Miscellaneous" was renamed as
963 "Look and Feel"->"General" but will need to be split up further into
964 general output and general input tabs. Current plan is for four outer
965 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
966 stuff; "Inputs" for input and import configuration; "Outputs" for
967 output and export configuration; and one more whatever is left over
968 called "General". The leftovers at present look like being which
969 viewers to use, spellchecker, language support and might be better
970 named "Support". I've put "Paths" in "Inputs" for the moment as this
971 seems reasonable for now at least.
972 One problem remains: X error kills LyX when you close Preferences.
974 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
976 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
977 qualifier from form()
978 * src/frontends/xforms/FormCitation.[Ch]:
979 * src/frontends/xforms/FormCopyright.[Ch]:
980 * src/frontends/xforms/FormDocument.[Ch]:
981 * src/frontends/xforms/FormError.[Ch]:
982 * src/frontends/xforms/FormIndex.[Ch]:
983 * src/frontends/xforms/FormPreferences.[Ch]:
984 * src/frontends/xforms/FormPrint.[Ch]:
985 * src/frontends/xforms/FormRef.[Ch]:
986 * src/frontends/xforms/FormToc.[Ch]:
987 * src/frontends/xforms/FormUrl.[Ch]: ditto.
989 * src/frontends/xforms/FormCitation.[Ch]:
990 * src/frontends/xforms/FormIndex.[Ch]:
991 * src/frontends/xforms/FormRef.[Ch]:
992 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
993 with Allan's naming policy
995 * src/frontends/xforms/FormCitation.C: some static casts to remove
998 2000-10-02 Juergen Vigna <jug@sad.it>
1000 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1001 now you can type or do stuff inside the table-cell also when in dummy
1002 position, fixed visible cursor.
1004 * src/insets/insettext.C (Edit): fixing cursor-view position.
1006 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1007 be used for equal functions in lyxfunc and insettext.
1009 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1011 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1013 * src/frontends/gnome/FormCitation.h:
1014 * src/frontends/gnome/FormCopyright.h:
1015 * src/frontends/gnome/FormIndex.h:
1016 * src/frontends/gnome/FormPrint.h:
1017 * src/frontends/gnome/FormToc.h:
1018 * src/frontends/gnome/FormUrl.h:
1019 * src/frontends/kde/FormCitation.h:
1020 * src/frontends/kde/FormCopyright.h:
1021 * src/frontends/kde/FormIndex.h:
1022 * src/frontends/kde/FormRef.h:
1023 * src/frontends/kde/FormToc.h:
1024 * src/frontends/kde/FormUrl.h: fix remaining users of
1027 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1029 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1030 from depth argument.
1031 (DocBookHandleCaption): ditto.
1032 (DocBookHandleFootnote): ditto.
1033 (SimpleDocBookOnePar): ditto.
1035 * src/frontends/xforms/FormDocument.h (form): remove extra
1036 FormDocument:: qualifier.
1038 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1040 * sigc++/handle.h: ditto.
1042 * src/lyx_gui_misc.C: add "using" directive.
1044 * src/cheaders/cstddef: new file, needed by the boost library (for
1047 2000-10-02 Juergen Vigna <jug@sad.it>
1049 * src/insets/insettext.C (SetFont): better support.
1051 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1053 * src/screen.C (DrawOneRow): some uint refixes!
1055 2000-10-02 Allan Rae <rae@lyx.org>
1057 * boost/.cvsignore: ignore Makefile as well
1059 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1060 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1062 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1063 Left this one out by accident.
1065 * src/frontends/xforms/FormBase.h (restore): default to calling
1066 update() since that will restore the original/currently-applied values.
1067 Any input() triggered error messages will require the derived classes
1068 to redefine restore().
1070 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1071 avoid a segfault. combo_doc_class is the main concern.
1073 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1075 * Simplify build-listerrors in view of GUI-less export ability!
1077 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1079 * src/lyx_main.C (easyParse): Disable gui when exporting
1081 * src/insets/figinset.C:
1084 * src/lyx_gui_misc.C
1085 * src/tabular.C: Changes to allow no-gui.
1087 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1089 * src/support/utility.hpp: removed file
1090 * src/support/block.h: removed file
1092 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1095 * src/mathed/formula.C: add support/lyxlib.h
1096 * src/mathed/formulamacro.C: ditto
1098 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1099 * src/lyxparagraph.h: ditto
1101 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1102 * src/frontends/Makefile.am (INCLUDES): ditto
1103 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1104 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1105 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1106 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1107 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1108 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1110 * src/BufferView.h: use boost/utility.hpp
1111 * src/LColor.h: ditto
1112 * src/LaTeX.h: ditto
1113 * src/LyXAction.h: ditto
1114 * src/LyXView.h: ditto
1115 * src/bufferlist.h: ditto
1116 * src/lastfiles.h: ditto
1117 * src/layout.h: ditto
1118 * src/lyx_gui.h: ditto
1119 * src/lyx_main.h: ditto
1120 * src/lyxlex.h: ditto
1121 * src/lyxrc.h: ditto
1122 * src/frontends/ButtonPolicies.h: ditto
1123 * src/frontends/Dialogs.h: ditto
1124 * src/frontends/xforms/FormBase.h: ditto
1125 * src/frontends/xforms/FormGraphics.h: ditto
1126 * src/frontends/xforms/FormParagraph.h: ditto
1127 * src/frontends/xforms/FormTabular.h: ditto
1128 * src/graphics/GraphicsCache.h: ditto
1129 * src/graphics/Renderer.h: ditto
1130 * src/insets/ExternalTemplate.h: ditto
1131 * src/insets/insetcommand.h: ditto
1132 * src/support/path.h: ditto
1134 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1135 and introduce clause for 2.97.
1137 * boost/libs/README: new file
1139 * boost/boost/utility.hpp: new file
1141 * boost/boost/config.hpp: new file
1143 * boost/boost/array.hpp: new file
1145 * boost/Makefile.am: new file
1147 * boost/.cvsignore: new file
1149 * configure.in (AC_OUTPUT): add boost/Makefile
1151 * Makefile.am (SUBDIRS): add boost
1153 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1155 * src/support/lstrings.C (suffixIs): Fixed.
1157 2000-10-01 Allan Rae <rae@lyx.org>
1159 * src/PrinterParams.h: moved things around to avoid the "can't
1160 inline call" warning.
1162 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1163 into doc++ documentation.
1165 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1167 * src/frontends/xforms/FormRef.C: make use of button controller
1168 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1169 cleaned up button controller usage.
1170 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1171 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1172 use the button controller
1174 * src/frontends/xforms/forms/*.fd: and associated generated files
1175 updated to reflect changes to FormBase. Some other FormXxxx files
1176 also got minor updates to reflect changes to FormBase.
1178 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1179 (hide): made virtual.
1180 (input): return a bool. true == valid input
1181 (RestoreCB, restore): new
1182 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1183 Changes to allow derived dialogs to use a ButtonController and
1184 make sense when doing so: OK button calls ok() and so on.
1186 * src/frontends/xforms/ButtonController.h (class ButtonController):
1187 Switch from template implementation to taking Policy parameter.
1188 Allows FormBase to provide a ButtonController for any dialog.
1190 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1191 Probably should rename connect and disconnect.
1192 (apply): use the radio button groups
1193 (form): needed by FormBase
1194 (build): setup the radio button groups
1196 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1198 * several files: type changes to reduce the number of warnings and
1199 to unify type hangling a bit. Still much to do.
1201 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1203 * lib/images/*: rename a bunch of icons to match Dekel converter
1206 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1209 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1211 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1213 * sigc++/handle.h: ditto for class Handle.
1215 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1217 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1219 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1221 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1222 removal of the "default" language.
1224 * src/combox.h (getline): Check that sel > 0
1226 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1228 * lib/examples/docbook_example.lyx
1229 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1231 * lib/layouts/docbook-book.layout: new docbook book layout.
1233 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1235 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1237 * src/insets/figinset.C (DocBook):fixed small typo.
1239 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1241 * src/insets/insetinclude.h: string include_label doesn't need to be
1244 2000-09-29 Allan Rae <rae@lyx.org>
1246 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1247 Allow derived type to control connection and disconnection from signals
1248 of its choice if desired.
1250 2000-09-28 Juergen Vigna <jug@sad.it>
1252 * src/insets/insettabular.C (update): fixed cursor setting when
1253 the_locking_inset changed.
1254 (draw): made this a bit cleaner.
1255 (InsetButtonPress): fixed!
1257 * various files: added LyXText Parameter to fitCursor call.
1259 * src/BufferView.C (fitCursor): added LyXText parameter.
1261 * src/insets/insettabular.C (draw): small draw fix.
1263 * src/tabular.C: right setting of left/right celllines.
1265 * src/tabular.[Ch]: fixed various types in funcions and structures.
1266 * src/insets/insettabular.C: ditto
1267 * src/frontends/xforms/FormTabular.C: ditto
1269 2000-09-28 Allan Rae <rae@lyx.org>
1271 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1272 that the #ifdef's had been applied to part of what should have been
1273 a complete condition. It's possible there are other tests that
1274 were specific to tables that are also wrong now that InsetTabular is
1275 being used. Now we need to fix the output of '\n' after a table in a
1276 float for the same reason as the original condition:
1277 "don't insert this if we would be adding it before or after a table
1278 in a float. This little trick is needed in order to allow use of
1279 tables in \subfigures or \subtables."
1280 Juergen can you check this?
1282 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1284 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1285 outputed to the ostream.
1287 * several files: fixed types based on warnings from cxx
1289 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1291 * src/frontends/kde/Makefile.am: fix rule for
1292 formindexdialogdata_moc.C
1294 * src/.cvsignore: add ext_l10n.h to ignore
1296 * acconfig.h: stop messing with __STRICT_ANSI__
1297 * config/gnome.m4: remove option to set -ansi
1298 * config/kde.m4: remove option to set -ansi
1299 * config/lyxinclude.m4: don't set -ansi
1301 2000-09-27 Juergen Vigna <jug@sad.it>
1303 * various files: remove "default" language check.
1305 * src/insets/insetquotes.C: removed use of current_view.
1307 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1308 the one should have red ears by now!
1310 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1311 in more then one paragraph. Fixed cursor-movement/selection.
1313 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1314 paragraphs inside a text inset.
1316 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1317 text-inset if this owner is an inset.
1319 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1321 * src/Bullet.h: changed type of font, character and size to int
1323 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1325 * src/insets/inseturl.[Ch]:
1326 * src/insets/insetref.[Ch]:
1327 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1329 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1331 * src/buffer.C (readFile): block-if statement rearranged to minimise
1332 bloat. Patch does not reverse Jean-Marc's change ;-)
1334 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1335 Class rewritten to store pointers to hide/update signals directly,
1336 rather than Dialogs *. Also defined an enum to ease use. All xforms
1337 forms can now be derived from this class.
1339 * src/frontends/xforms/FormCommand.[Ch]
1340 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1342 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1345 * src/frontends/xforms/forms/form_citation.fd
1346 * src/frontends/xforms/forms/form_copyright.fd
1347 * src/frontends/xforms/forms/form_error.fd
1348 * src/frontends/xforms/forms/form_index.fd
1349 * src/frontends/xforms/forms/form_ref.fd
1350 * src/frontends/xforms/forms/form_toc.fd
1351 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1353 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1355 * src/insets/insetfoot.C: removed redundent using directive.
1357 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1359 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1360 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1362 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1363 created in the constructors in different groups. Then set() just
1364 have to show the groups as needed. This fixes the redraw problems
1365 (and is how the old menu code worked).
1367 * src/support/lyxlib.h: declare the methods as static when we do
1368 not have namespaces.
1370 2000-09-26 Juergen Vigna <jug@sad.it>
1372 * src/buffer.C (asciiParagraph): new function.
1373 (writeFileAscii): new function with parameter ostream.
1374 (writeFileAscii): use now asciiParagraph.
1376 * various inset files: added the linelen parameter to the Ascii-func.
1378 * src/tabular.C (Write): fixed error in writing file introduced by
1379 the last changes from Lars.
1381 * lib/bind/menus.bind: removed not supported functions.
1383 * src/insets/insettext.C (Ascii): implemented this function.
1385 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1387 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1388 (Write): use of the write_attribute functions.
1390 * src/bufferlist.C (close): fixed reasking question!
1392 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1394 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1395 new files use the everwhere possible.
1398 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1399 src/log_form.C src/lyx.C:
1402 * src/buffer.C (runLaTeX): remove func
1404 * src/PaperLayout.C: removed file
1405 * src/ParagraphExtra.C: likewise
1406 * src/bullet_forms.C: likewise
1407 * src/bullet_forms.h: likewise
1408 * src/bullet_forms_cb.C: likewise
1410 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1411 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1414 * several files: remove all traces of the old fd_form_paragraph,
1415 and functions belonging to that.
1417 * several files: remove all traces of the old fd_form_document,
1418 and functions belonging to that.
1420 * several files: constify local variables were possible.
1422 * several files: remove all code that was dead when NEW_EXPORT was
1425 * several files: removed string::c_str in as many places as
1428 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1429 (e): be a bit more outspoken when patching
1430 (updatesrc): only move files if changed.
1432 * forms/layout_forms.h.patch: regenerated
1434 * forms/layout_forms.fd: remove form_document and form_paragraph
1435 and form_quotes and form_paper and form_table_options and
1436 form_paragraph_extra
1438 * forms/form1.fd: remove form_table
1440 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1441 the fdui->... rewrite. Update some comments to xforms 0.88
1443 * forms/bullet_forms.C.patch: removed file
1444 * forms/bullet_forms.fd: likewise
1445 * forms/bullet_forms.h.patch: likewise
1447 * development/Code_rules/Rules: added a section on switch
1448 statements. Updated some comment to xforms 0.88.
1450 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1452 * src/buffer.C (readFile): make sure that the whole version number
1453 is read after \lyxformat (even when it contains a comma)
1455 * lib/ui/default.ui: change shortcut of math menu to M-a.
1457 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1459 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1462 * src/LyXView.C (updateWindowTitle): show the full files name in
1463 window title, limited to 30 characters.
1465 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1466 When a number of characters has been given, we should not assume
1467 that the string is 0-terminated.
1469 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1470 calls (fixes some memory leaks)
1472 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1473 trans member on exit.
1475 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1477 * src/converter.C (GetReachable): fix typo.
1479 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1480 understand ',' instead of '.'.
1481 (GetInteger): rewrite to use strToInt().
1483 2000-09-26 Juergen Vigna <jug@sad.it>
1485 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1486 better visibility and error-message on wrong VSpace input.
1488 * src/language.C (initL): added english again.
1490 2000-09-25 Juergen Vigna <jug@sad.it>
1492 * src/frontends/kde/Dialogs.C (Dialogs):
1493 * src/frontends/gnome/Dialogs.C (Dialogs):
1494 * src/frontends/kde/Makefile.am:
1495 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1497 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1499 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1501 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1503 * src/frontends/xforms/FormParagraph.C:
1504 * src/frontends/xforms/FormParagraph.h:
1505 * src/frontends/xforms/form_paragraph.C:
1506 * src/frontends/xforms/form_paragraph.h:
1507 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1510 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1512 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1513 Paragraph-Data after use.
1515 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1516 non breakable paragraphs.
1518 2000-09-25 Garst R. Reese <reese@isn.net>
1520 * src/language.C (initL): added missing language_country codes.
1522 2000-09-25 Juergen Vigna <jug@sad.it>
1524 * src/insets/insettext.C (InsetText):
1525 (deleteLyXText): remove the not released LyXText structure!
1527 2000-09-24 Marko Vendelin <markov@ioc.ee>
1529 * src/frontends/gnome/mainapp.C
1530 * src/frontends/gnome/mainapp.h: added support for keyboard
1533 * src/frontends/gnome/FormCitation.C
1534 * src/frontends/gnome/FormCitation.h
1535 * src/frontends/gnome/Makefile.am
1536 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1537 FormCitation to use "action area" in mainapp window
1539 * src/frontends/gnome/Menubar_pimpl.C
1540 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1543 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1545 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1546 width/descent/ascent values if name is empty.
1547 (mathed_string_height): Use std::max.
1549 2000-09-25 Allan Rae <rae@lyx.org>
1551 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1552 segfault. This will be completely redesigned soon.
1554 * sigc++: updated libsigc++. Fixes struct timespec bug.
1556 * development/tools/makeLyXsigc.sh: .cvsignore addition
1558 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1560 * several files: removed almost all traces of the old table
1563 * src/TableLayout.C: removed file
1565 2000-09-22 Juergen Vigna <jug@sad.it>
1567 * src/frontends/kde/Dialogs.C: added credits forms.
1569 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1571 * src/frontends/gnome/Dialogs.C: added some forms.
1573 * src/spellchecker.C (init_spell_checker): set language in pspell code
1574 (RunSpellChecker): some modifications for setting language string.
1576 * src/language.[Ch]: added language_country code.
1578 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1580 * src/frontends/Dialogs.h: added new signal showError.
1581 Rearranged existing signals in some sort of alphabetical order.
1583 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1584 FormError.[Ch], form_error.[Ch]
1585 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1586 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1588 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1589 dialogs. I think that this can be used as the base to all these
1592 * src/frontends/xforms/FormError.[Ch]
1593 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1594 implementation of InsetError dialog.
1596 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1598 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1599 * src/frontends/kde/Makefile.am: ditto
1601 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1603 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1604 macrobf. This fixes a bug of invisible text.
1606 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1608 * lib/doc/LaTeXConfig.lyx.in: updated.
1610 * src/language.C (initL): remove language "francais" and change a
1611 bit the names of the two other french variations.
1613 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1614 string that may not be 0-terminated.
1616 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1618 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1620 2000-09-20 Marko Vendelin <markov@ioc.ee>
1622 * src/frontends/gnome/FormCitation.C
1623 * src/frontends/gnome/FormIndex.C
1624 * src/frontends/gnome/FormToc.C
1625 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1626 the variable initialization to shut up the warnings
1628 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1630 * src/table.[Ch]: deleted files
1632 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1635 2000-09-18 Juergen Vigna <jug@sad.it>
1637 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1638 problems with selection. Inserted new LFUN_PASTESELECTION.
1639 (InsetButtonPress): inserted handling of middle mouse-button paste.
1641 * src/spellchecker.C: changed word to word.c_str().
1643 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1645 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1646 included in the ``make dist'' tarball.
1648 2000-09-15 Juergen Vigna <jug@sad.it>
1650 * src/CutAndPaste.C (cutSelection): small fix return the right
1651 end position after cut inside one paragraph only.
1653 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1654 we are locked as otherwise we don't have a valid cursor position!
1656 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1658 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1660 * src/frontends/kde/FormRef.C: added using directive.
1661 * src/frontends/kde/FormToc.C: ditto
1663 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1665 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1667 2000-09-19 Marko Vendelin <markov@ioc.ee>
1669 * src/frontends/gnome/Menubar_pimpl.C
1670 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1671 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1673 * src/frontends/gnome/mainapp.C
1674 * src/frontends/gnome/mainapp.h: support for menu update used
1677 * src/frontends/gnome/mainapp.C
1678 * src/frontends/gnome/mainapp.h: support for "action" area in the
1679 main window. This area is used by small simple dialogs, such as
1682 * src/frontends/gnome/FormIndex.C
1683 * src/frontends/gnome/FormIndex.h
1684 * src/frontends/gnome/FormUrl.C
1685 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1688 * src/frontends/gnome/FormCitation.C
1689 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1690 action area. Only "Insert new citation" is implemented.
1692 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1694 * src/buffer.C (Dispatch): fix call to Dispatch
1695 * src/insets/insetref.C (Edit): likewise
1696 * src/insets/insetparent.C (Edit): likewise
1697 * src/insets/insetinclude.C (include_cb): likewise
1698 * src/frontends/xforms/FormUrl.C (apply): likewise
1699 * src/frontends/xforms/FormToc.C (apply): likewise
1700 * src/frontends/xforms/FormRef.C (apply): likewise
1701 * src/frontends/xforms/FormIndex.C (apply): likewise
1702 * src/frontends/xforms/FormCitation.C (apply): likewise
1703 * src/lyxserver.C (callback): likewise
1704 * src/lyxfunc.C (processKeySym): likewise
1705 (Dispatch): likewise
1706 (Dispatch): likewise
1707 * src/lyx_cb.C (LayoutsCB): likewise
1709 * Makefile.am (sourcedoc): small change
1711 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1713 * src/main.C (main): Don't make an empty GUIRunTime object. all
1714 methods are static. constify a bit remove unneded using + headers.
1716 * src/tabular.C: some more const to local vars move some loop vars
1718 * src/spellchecker.C: added some c_str after some word for pspell
1720 * src/frontends/GUIRunTime.h: add new static method setDefaults
1721 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1722 * src/frontends/kde/GUIRunTime.C (setDefaults):
1723 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1725 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1726 with strnew in arg, use correct emptystring when calling SetName.
1728 * several files: remove all commented code with relation to
1729 HAVE_SSTREAM beeing false. We now only support stringstream and
1732 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1734 * src/lyxfunc.C: construct correctly the automatic new file
1737 * src/text2.C (IsStringInText): change type of variable i to shut
1740 * src/support/sstream.h: do not use namespaces if the compiler
1741 does not support them.
1743 2000-09-15 Marko Vendelin <markov@ioc.ee>
1744 * src/frontends/gnome/FormCitation.C
1745 * src/frontends/gnome/FormCitation.h
1746 * src/frontends/gnome/diainsertcitation_interface.c
1747 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1748 regexp support to FormCitation [Gnome].
1750 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1753 * configure.in: remove unused KDE/GTKGUI define
1755 * src/frontends/kde/FormRef.C
1756 * src/frontends/kde/FormRef.h
1757 * src/frontends/kde/formrefdialog.C
1758 * src/frontends/kde/formrefdialog.h: double click will
1759 go to reference, now it is possible to change a cross-ref
1762 * src/frontends/kde/FormToc.C
1763 * src/frontends/kde/FormToc.h
1764 * src/frontends/kde/formtocdialog.C
1765 * src/frontends/kde/formtocdialog.h: add a depth
1768 * src/frontends/kde/Makefile.am: add QtLyXView.h
1771 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1773 * src/frontends/kde/FormCitation.h: added some using directives.
1775 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1777 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1780 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1783 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1785 * src/buffer.C (pop_tag): revert for the second time a change by
1786 Lars, who seems to really hate having non-local loop variables :)
1788 * src/Lsstream.h: add "using" statements.
1790 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1791 * src/buffer.C (writeFile): ditto
1793 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1795 * src/buffer.C (writeFile): try to fix the locale modified format
1796 number to always be as we want it.
1798 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1799 in XForms 0.89. C-space is now working again.
1801 * src/Lsstream.h src/support/sstream.h: new files.
1803 * also commented out all cases where strstream were used.
1805 * src/Bullet.h (c_str): remove method.
1807 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1809 * a lot of files: get rid of "char const *" and "char *" is as
1810 many places as possible. We only want to use them in interaction
1811 with system of other libraries, not inside lyx.
1813 * a lot of files: return const object is not of pod type. This
1814 helps ensure that temporary objects is not modified. And fits well
1815 with "programming by contract".
1817 * configure.in: check for the locale header too
1819 * Makefile.am (sourcedoc): new tag for generation of doc++
1822 2000-09-14 Juergen Vigna <jug@sad.it>
1824 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1825 callback to check which combo called it and do the right action.
1827 * src/combox.C (combo_cb): added combo * to the callbacks.
1828 (Hide): moved call of callback after Ungrab of the pointer.
1830 * src/intl.h: removed LCombo2 function.
1832 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1833 function as this can now be handled in one function.
1835 * src/combox.h: added Combox * to callback prototype.
1837 * src/frontends/xforms/Toolbar_pimpl.C:
1838 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1840 2000-09-14 Garst Reese <reese@isn.net>
1842 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1843 moved usepackage{xxx}'s to beginning of file. Changed left margin
1844 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1845 underlining from title. Thanks to John Culleton for useful suggestions.
1847 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1849 * src/lyxlex_pimpl.C (setFile): change error message to debug
1852 2000-09-13 Juergen Vigna <jug@sad.it>
1854 * src/frontends/xforms/FormDocument.C: implemented choice_class
1855 as combox and give callback to combo_language so OK/Apply is activated
1858 * src/bufferlist.C (newFile): small fix so already named files
1859 (via an open call) are not requested to be named again on the
1862 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1864 * src/frontends/kde/Makefile.am
1865 * src/frontends/kde/FormRef.C
1866 * src/frontends/kde/FormRef.h
1867 * src/frontends/kde/formrefdialog.C
1868 * src/frontends/kde/formrefdialog.h: implement
1871 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1873 * src/frontends/kde/formtocdialog.C
1874 * src/frontends/kde/formtocdialog.h
1875 * src/frontends/kde/FormToc.C
1876 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1878 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1880 * src/frontends/kde/FormCitation.C: fix thinko
1881 where we didn't always display the reference text
1884 * src/frontends/kde/formurldialog.C
1885 * src/frontends/kde/formurldialog.h
1886 * src/frontends/kde/FormUrl.C
1887 * src/frontends/kde/FormUrl.h: minor cleanups
1889 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1891 * src/frontends/kde/Makefile.am
1892 * src/frontends/kde/FormToc.C
1893 * src/frontends/kde/FormToc.h
1894 * src/frontends/kde/FormCitation.C
1895 * src/frontends/kde/FormCitation.h
1896 * src/frontends/kde/FormIndex.C
1897 * src/frontends/kde/FormIndex.h
1898 * src/frontends/kde/formtocdialog.C
1899 * src/frontends/kde/formtocdialog.h
1900 * src/frontends/kde/formcitationdialog.C
1901 * src/frontends/kde/formcitationdialog.h
1902 * src/frontends/kde/formindexdialog.C
1903 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1905 2000-09-12 Juergen Vigna <jug@sad.it>
1907 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1910 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1912 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1915 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1917 * src/converter.C (Add, Convert): Added support for converter flags:
1918 needaux, resultdir, resultfile.
1919 (Convert): Added new parameter view_file.
1920 (dvips_options): Fixed letter paper option.
1922 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1923 (Export, GetExportableFormats, GetViewableFormats): Added support
1926 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1928 (easyParse): Fixed to work with new export code.
1930 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1933 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1935 * lib/bind/*.bind: Replaced
1936 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1937 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1939 2000-09-11 Juergen Vigna <jug@sad.it>
1941 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1943 * src/main.C (main): now GUII defines global guiruntime!
1945 * src/frontends/gnome/GUIRunTime.C (initApplication):
1946 * src/frontends/kde/GUIRunTime.C (initApplication):
1947 * src/frontends/xforms/GUIRunTime.C (initApplication):
1948 * src/frontends/GUIRunTime.h: added new function initApplication.
1950 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1952 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1954 2000-09-08 Juergen Vigna <jug@sad.it>
1956 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1957 we have already "Reset".
1959 * src/language.C (initL): inserted "default" language and made this
1960 THE default language (and not american!)
1962 * src/paragraph.C: inserted handling of "default" language!
1964 * src/lyxfont.C: ditto
1968 * src/paragraph.C: output the \\par only if we have a following
1969 paragraph otherwise it's not needed.
1971 2000-09-05 Juergen Vigna <jug@sad.it>
1973 * config/pspell.m4: added entry to lyx-flags
1975 * src/spellchecker.C: modified version from Kevin for using pspell
1977 2000-09-01 Marko Vendelin <markov@ioc.ee>
1978 * src/frontends/gnome/Makefile.am
1979 * src/frontends/gnome/FormCitation.C
1980 * src/frontends/gnome/FormCitation.h
1981 * src/frontends/gnome/diainsertcitation_callbacks.c
1982 * src/frontends/gnome/diainsertcitation_callbacks.h
1983 * src/frontends/gnome/diainsertcitation_interface.c
1984 * src/frontends/gnome/diainsertcitation_interface.h
1985 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1986 dialog for Gnome frontend
1988 * src/main.C: Gnome libraries require keeping application name
1989 and its version as strings
1991 * src/frontends/gnome/mainapp.C: Change the name of the main window
1992 from GnomeLyX to PACKAGE
1994 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1996 * src/frontends/Liason.C: add "using: declaration.
1998 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2000 * src/mathed/math_macro.C (Metrics): Set the size of the template
2002 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2004 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2006 * src/converter.C (add_options): New function.
2007 (SetViewer): Change $$FName into '$$FName'.
2008 (View): Add options when running xdvi
2009 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2010 (Convert): The 3rd parameter is now the desired filename. Converts
2011 calls to lyx::rename if necessary.
2012 Add options when running dvips.
2013 (dvi_papersize,dvips_options): New methods.
2015 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2017 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2018 using a call to Converter::dvips_options.
2019 Fixed to work with nex export code.
2021 * src/support/copy.C
2022 * src/support/rename.C: New files
2024 * src/support/syscall.h
2025 * src/support/syscall.C: Added Starttype SystemDontWait.
2027 * lib/ui/default.ui: Changed to work with new export code
2029 * lib/configure.m4: Changed to work with new export code
2031 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2033 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2035 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2036 so that code compiles with DEC cxx.
2038 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2039 to work correctly! Also now supports the additional elements
2042 2000-09-01 Allan Rae <rae@lyx.org>
2044 * src/frontends/ButtonPolicies.C: renamed all the references to
2045 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2047 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2048 since it's a const not a type.
2050 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2052 2000-08-31 Juergen Vigna <jug@sad.it>
2054 * src/insets/figinset.C: Various changes to look if the filename has
2055 an extension and if not add it for inline previewing.
2057 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2059 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2060 make buttonStatus and isReadOnly be const methods. (also reflect
2061 this in derived classes.)
2063 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2064 (nextState): change to be static inline, pass the StateMachine as
2066 (PreferencesPolicy): remove casts
2067 (OkCancelPolicy): remvoe casts
2068 (OkCancelReadOnlyPolicy): remove casts
2069 (NoRepeatedApplyReadOnlyPolicy): remove casts
2070 (OkApplyCancelReadOnlyPolicy): remove casts
2071 (OkApplyCancelPolicy): remove casts
2072 (NoRepeatedApplyPolicy): remove casts
2074 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2076 * src/converter.C: added some using directives
2078 * src/frontends/ButtonPolicies.C: changes to overcome
2079 "need lvalue" error with DEC c++
2081 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2082 to WMHideCB for DEC c++
2084 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2086 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2087 to BulletBMTableCB for DEC c++
2089 2000-08-31 Allan Rae <rae@lyx.org>
2091 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2092 character dialog separately from old document dialogs combo_language.
2095 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2097 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2098 Removed LFUN_REF_CREATE.
2100 * src/MenuBackend.C: Added new tags: toc and references
2102 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2103 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2105 (add_toc, add_references): New methods.
2106 (create_submenu): Handle correctly the case when there is a
2107 seperator after optional menu items.
2109 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2110 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2111 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2113 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2115 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2117 * src/converter.[Ch]: New file for converting between different
2120 * src/export.[Ch]: New file for exporting a LyX file to different
2123 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2124 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2125 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2126 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2127 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2128 RunDocBook, MenuExport.
2130 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2131 Exporter::Preview methods if NEW_EXPORT is defined.
2133 * src/buffer.C (Dispatch): Use Exporter::Export.
2135 * src/lyxrc.C: Added new tags: \converter and \viewer.
2138 * src/LyXAction.C: Define new lyx-function: buffer-update.
2139 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2140 when NEW_EXPORT is defined.
2142 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2144 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2146 * lib/ui/default.ui: Added submenus "view" and "update" to the
2149 * src/filetools.C (GetExtension): New function.
2151 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2153 2000-08-29 Allan Rae <rae@lyx.org>
2155 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2157 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2158 (EnableDocumentLayout): removed
2159 (DisableDocumentLayout): removed
2160 (build): make use of ButtonController's read-only handling to
2161 de/activate various objects. Replaces both of the above functions.
2163 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2164 (readOnly): was read_only
2165 (refresh): fixed dumb mistakes with read_only_ handling
2167 * src/frontends/xforms/forms/form_document.fd:
2168 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2169 tabbed dialogs so the tabs look more like tabs and so its easier to
2170 work out which is the current tab.
2172 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2173 segfault with form_table
2175 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2177 2000-08-28 Juergen Vigna <jug@sad.it>
2179 * acconfig.h: added USE_PSPELL.
2181 * src/config.h.in: added USE_PSPELL.
2183 * autogen.sh: added pspell.m4
2185 * config/pspell.m4: new file.
2187 * src/spellchecker.C: implemented support for pspell libary.
2189 2000-08-25 Juergen Vigna <jug@sad.it>
2191 * src/LyXAction.C (init): renamed LFUN_TABLE to
2192 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2194 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2196 * src/lyxscreen.h: add force_clear variable and fuction to force
2197 a clear area when redrawing in LyXText.
2199 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2201 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2203 * some whitespace and comment changes.
2205 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2207 * src/buffer.C: up te LYX_FORMAT to 2.17
2209 2000-08-23 Juergen Vigna <jug@sad.it>
2211 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2214 * src/insets/insettabular.C (pasteSelection): delete the insets
2215 LyXText as it is not valid anymore.
2216 (copySelection): new function.
2217 (pasteSelection): new function.
2218 (cutSelection): new function.
2219 (LocalDispatch): implemented cut/copy/paste of cell selections.
2221 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2222 don't have a LyXText.
2224 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2226 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2229 2000-08-22 Juergen Vigna <jug@sad.it>
2231 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2232 ifdef form_table out if NEW_TABULAR.
2234 2000-08-21 Juergen Vigna <jug@sad.it>
2236 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2237 (draw): fixed draw position so that the cursor is positioned in the
2239 (InsetMotionNotify): hide/show cursor so the position is updated.
2240 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2241 using cellstart() function where it should be used.
2243 * src/insets/insettext.C (draw): ditto.
2245 * src/tabular.C: fixed initialization of some missing variables and
2246 made BoxType into an enum.
2248 2000-08-22 Marko Vendelin <markov@ioc.ee>
2249 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2250 stock menu item using action numerical value, not its string
2254 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2256 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2257 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2259 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2261 * src/frontends/xforms/GUIRunTime.C: new file
2263 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2264 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2266 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2268 * src/frontends/kde/GUIRunTime.C: new file
2270 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2271 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2273 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2275 * src/frontends/gnome/GUIRunTime.C: new file
2277 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2280 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2281 small change to documetentation.
2283 * src/frontends/GUIRunTime.C: removed file
2285 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2287 * src/lyxparagraph.h: enable NEW_TABULAR as default
2289 * src/lyxfunc.C (processKeySym): remove some commented code
2291 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2292 NEW_TABULAR around the fd_form_table_options.
2294 * src/lyx_gui.C (runTime): call the static member function as
2295 GUIRunTime::runTime().
2297 2000-08-21 Allan Rae <rae@lyx.org>
2299 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2302 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2304 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2306 2000-08-21 Allan Rae <rae@lyx.org>
2308 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2309 keep Garst happy ;-)
2310 * src/frontends/xforms/FormPreferences.C (build): use setOK
2311 * src/frontends/xforms/FormDocument.C (build): use setOK
2312 (FormDocument): use the appropriate policy.
2314 2000-08-21 Allan Rae <rae@lyx.org>
2316 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2317 automatic [de]activation of arbitrary objects when in a read-only state.
2319 * src/frontends/ButtonPolicies.h: More documentation
2320 (isReadOnly): added to support the above.
2322 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2324 2000-08-18 Juergen Vigna <jug@sad.it>
2326 * src/insets/insettabular.C (getStatus): changed to return func_status.
2328 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2329 display toggle menu entries if they are.
2331 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2332 new document layout now.
2334 * src/lyxfunc.C: ditto
2336 * src/lyx_gui_misc.C: ditto
2338 * src/lyx_gui.C: ditto
2340 * lib/ui/default.ui: removed paper and quotes layout as they are now
2341 all in the document layout tabbed folder.
2343 * src/frontends/xforms/forms/form_document.fd: added Restore
2344 button and callbacks for all inputs for Allan's ButtonPolicy.
2346 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2347 (CheckChoiceClass): added missing params setting on class change.
2348 (UpdateLayoutDocument): added for updating the layout on params.
2349 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2350 (FormDocument): Implemented Allan's ButtonPolicy with the
2353 2000-08-17 Allan Rae <rae@lyx.org>
2355 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2356 so we can at least see the credits again.
2358 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2359 controller calls for the appropriate callbacks. Note that since Ok
2360 calls apply followed by cancel, and apply isn't a valid input for the
2361 APPLIED state, the bc_ calls have to be made in the static callback not
2362 within each of the real callbacks.
2364 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2365 (setOk): renamed from setOkay()
2367 2000-08-17 Juergen Vigna <jug@sad.it>
2369 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2370 in the implementation part.
2371 (composeUIInfo): don't show optional menu-items.
2373 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2375 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2377 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2378 text-state when in a text-inset.
2380 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2382 2000-08-17 Marko Vendelin <markov@ioc.ee>
2383 * src/frontends/gnome/FormIndex.C
2384 * src/frontends/gnome/FormIndex.h
2385 * src/frontends/gnome/FormToc.C
2386 * src/frontends/gnome/FormToc.h
2387 * src/frontends/gnome/dialogs
2388 * src/frontends/gnome/diatoc_callbacks.c
2389 * src/frontends/gnome/diatoc_callbacks.h
2390 * src/frontends/gnome/diainsertindex_callbacks.h
2391 * src/frontends/gnome/diainsertindex_callbacks.c
2392 * src/frontends/gnome/diainsertindex_interface.c
2393 * src/frontends/gnome/diainsertindex_interface.h
2394 * src/frontends/gnome/diatoc_interface.h
2395 * src/frontends/gnome/diatoc_interface.c
2396 * src/frontends/gnome/Makefile.am: Table of Contents and
2397 Insert Index dialogs implementation for Gnome frontend
2399 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2401 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2403 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2406 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2408 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2409 destructor. Don't definde if you don't need it
2410 (processEvents): made static, non-blocking events processing for
2412 (runTime): static method. event loop for xforms
2413 * similar as above for kde and gnome.
2415 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2416 new Pimpl is correct
2417 (runTime): new method calss the real frontends runtime func.
2419 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2421 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2423 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2425 2000-08-16 Juergen Vigna <jug@sad.it>
2427 * src/lyx_gui.C (runTime): added GUII RunTime support.
2429 * src/frontends/Makefile.am:
2430 * src/frontends/GUIRunTime.[Ch]:
2431 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2432 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2433 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2435 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2437 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2438 as this is already set in ${FRONTEND_INCLUDE} if needed.
2440 * configure.in (CPPFLAGS): setting the include dir for the frontend
2441 directory and don't set FRONTEND=xforms for now as this is executed
2444 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2446 * src/frontends/kde/Makefile.am:
2447 * src/frontends/kde/FormUrl.C:
2448 * src/frontends/kde/FormUrl.h:
2449 * src/frontends/kde/formurldialog.h:
2450 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2452 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2454 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2456 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2458 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2461 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2463 * src/WorkArea.C (work_area_handler): more work to get te
2464 FL_KEYBOARD to work with xforms 0.88 too, please test.
2466 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2468 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2470 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2473 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2475 * src/Timeout.h: remove Qt::emit hack.
2477 * several files: changes to allo doc++ compilation
2479 * src/lyxfunc.C (processKeySym): new method
2480 (processKeyEvent): comment out if FL_REVISION < 89
2482 * src/WorkArea.C: change some debugging levels.
2483 (WorkArea): set wantkey to FL_KEY_ALL
2484 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2485 clearer code and the use of compose with XForms 0.89. Change to
2486 use signals instead of calling methods in bufferview directly.
2488 * src/Painter.C: change some debugging levels.
2490 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2493 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2494 (workAreaKeyPress): new method
2496 2000-08-14 Juergen Vigna <jug@sad.it>
2498 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2500 * config/kde.m4: addes some features
2502 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2503 include missing xforms dialogs.
2505 * src/Timeout.h: a hack to be able to compile with qt/kde.
2507 * sigc++/.cvsignore: added acinclude.m4
2509 * lib/.cvsignore: added listerros
2511 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2512 xforms tree as objects are needed for other frontends.
2514 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2515 linking with not yet implemented xforms objects.
2517 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2519 2000-08-14 Baruch Even <baruch.even@writeme.com>
2521 * src/frontends/xforms/FormGraphics.h:
2522 * src/frontends/xforms/FormGraphics.C:
2523 * src/frontends/xforms/RadioButtonGroup.h:
2524 * src/frontends/xforms/RadioButtonGroup.C:
2525 * src/insets/insetgraphics.h:
2526 * src/insets/insetgraphics.C:
2527 * src/insets/insetgraphicsParams.h:
2528 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2529 instead of spaces, and various other indentation issues to make the
2530 sources more consistent.
2532 2000-08-14 Marko Vendelin <markov@ioc.ee>
2534 * src/frontends/gnome/dialogs/diaprint.glade
2535 * src/frontends/gnome/FormPrint.C
2536 * src/frontends/gnome/FormPrint.h
2537 * src/frontends/gnome/diaprint_callbacks.c
2538 * src/frontends/gnome/diaprint_callbacks.h
2539 * src/frontends/gnome/diaprint_interface.c
2540 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2543 * src/frontends/gnome/dialogs/diainserturl.glade
2544 * src/frontends/gnome/FormUrl.C
2545 * src/frontends/gnome/FormUrl.h
2546 * src/frontends/gnome/diainserturl_callbacks.c
2547 * src/frontends/gnome/diainserturl_callbacks.h
2548 * src/frontends/gnome/diainserturl_interface.c
2549 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2550 Gnome implementation
2552 * src/frontends/gnome/Dialogs.C
2553 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2554 all other dialogs. Copy all unimplemented dialogs from Xforms
2557 * src/frontends/gnome/support.c
2558 * src/frontends/gnome/support.h: support files generated by Glade
2562 * config/gnome.m4: Gnome configuration scripts
2564 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2565 configure --help message
2567 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2568 only if there are no events pendling in Gnome/Gtk. This enhances
2569 the performance of menus.
2572 2000-08-14 Allan Rae <rae@lyx.org>
2574 * lib/Makefile.am: listerrors cleaning
2576 * lib/listerrors: removed -- generated file
2577 * acinclude.m4: ditto
2578 * sigc++/acinclude.m4: ditto
2580 * src/frontends/xforms/forms/form_citation.fd:
2581 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2584 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2585 `updatesrc` and now we have a `test` target that does what `updatesrc`
2586 used to do. I didn't like having an install target that wasn't related
2589 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2590 on all except FormGraphics. This may yet happen. Followed by a major
2591 cleanup including using FL_TRANSIENT for most of the dialogs. More
2592 changes to come when the ButtonController below is introduced.
2594 * src/frontends/xforms/ButtonController.h: New file for managing up to
2595 four buttons on a dialog according to an externally defined policy.
2596 * src/frontends/xforms/Makefile.am: added above
2598 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2599 Apply and Cancel/Close buttons and everything in between and beyond.
2600 * src/frontends/Makefile.am: added above.
2602 * src/frontends/xforms/forms/form_preferences.fd:
2603 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2604 and removed variable 'status' as a result. Fixed the set_minsize thing.
2605 Use the new screen-font-update after checking screen fonts were changed
2606 Added a "Restore" button to restore the original lyxrc values while
2607 editing. This restores everything not just the last input changed.
2608 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2610 * src/LyXAction.C: screen-font-update added for updating buffers after
2611 screen font settings have been changed.
2612 * src/commandtags.h: ditto
2613 * src/lyxfunc.C: ditto
2615 * forms/lyx.fd: removed screen fonts dialog.
2616 * src/lyx_gui.C: ditto
2617 * src/menus.[Ch]: ditto
2618 * src/lyx.[Ch]: ditto
2619 * src/lyx_cb.C: ditto + code from here moved to make
2620 screen-font-update. And people wonder why progress on GUII is
2621 slow. Look at how scattered this stuff was! It takes forever
2624 * forms/fdfix.sh: Fixup the spacing after commas.
2625 * forms/makefile: Remove date from generated files. Fewer clashes now.
2626 * forms/bullet_forms.C.patch: included someones handwritten changes
2628 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2629 once I've discovered why LyXRC was made noncopyable.
2630 * src/lyx_main.C: ditto
2632 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2634 * src/frontends/xforms/forms/fdfix.sh:
2635 * src/frontends/xforms/forms/fdfixh.sed:
2636 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2637 * src/frontends/xforms/Form*.[hC]:
2638 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2639 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2640 provide a destructor for the struct FD_form_xxxx. Another version of
2641 the set_[max|min]size workaround and a few other cleanups. Actually,
2642 Angus' patch from 20000809.
2644 2000-08-13 Baruch Even <baruch.even@writeme.com>
2646 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2649 2000-08-11 Juergen Vigna <jug@sad.it>
2651 * src/insets/insetgraphics.C (InsetGraphics): changing init
2652 order because of warnings.
2654 * src/frontends/xforms/forms/makefile: adding patching .C with
2657 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2658 from .C.patch to .c.patch
2660 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2661 order because of warning.
2663 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2665 * src/frontends/Liason.C (setMinibuffer): new helper function
2667 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2669 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2671 * lib/ui/default.ui: commented out PaperLayout entry
2673 * src/frontends/xforms/form_document.[Ch]: new added files
2675 * src/frontends/xforms/FormDocument.[Ch]: ditto
2677 * src/frontends/xforms/forms/form_document.fd: ditto
2679 * src/frontends/xforms/forms/form_document.C.patch: ditto
2681 2000-08-10 Juergen Vigna <jug@sad.it>
2683 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2684 (InsetGraphics): initialized cacheHandle to 0.
2685 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2687 2000-08-10 Baruch Even <baruch.even@writeme.com>
2689 * src/graphics/GraphicsCache.h:
2690 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2691 correctly as a cache.
2693 * src/graphics/GraphicsCacheItem.h:
2694 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2697 * src/graphics/GraphicsCacheItem_pimpl.h:
2698 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2701 * src/insets/insetgraphics.h:
2702 * src/insets/insetgraphics.C: Changed from using a signal notification
2703 to polling when image is not loaded.
2705 2000-08-10 Allan Rae <rae@lyx.org>
2707 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2708 that there are two functions that have to been taken out of line by
2709 hand and aren't taken care of in the script. (Just a reminder note)
2711 * sigc++/macros/*.h.m4: Updated as above.
2713 2000-08-09 Juergen Vigna <jug@sad.it>
2715 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2717 * src/insets/insettabular.C: make drawing of single cell smarter.
2719 2000-08-09 Marko Vendelin <markov@ioc.ee>
2720 * src/frontends/gnome/Menubar_pimpl.C
2721 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2722 implementation: new files
2724 * src/frontends/gnome/mainapp.C
2725 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2728 * src/main.C: create Gnome main window
2730 * src/frontends/xforms/Menubar_pimpl.h
2731 * src/frontends/Menubar.C
2732 * src/frontends/Menubar.h: added method Menubar::update that calls
2733 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2735 * src/LyXView.C: calls Menubar::update to update the state
2738 * src/frontends/gnome/Makefile.am: added new files
2740 * src/frontends/Makefile.am: added frontend compiler options
2742 2000-08-08 Juergen Vigna <jug@sad.it>
2744 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2746 * src/bufferlist.C (close):
2747 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2748 documents if exiting without saving.
2750 * src/buffer.C (save): use removeAutosaveFile()
2752 * src/support/filetools.C (removeAutosaveFile): new function.
2754 * src/lyx_cb.C (MenuWrite): returns a bool now.
2755 (MenuWriteAs): check if file could really be saved and revert to the
2757 (MenuWriteAs): removing old autosavefile if existant.
2759 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2760 before Goto toggle declaration, because of compiler warning.
2762 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2764 * src/lyxfunc.C (MenuNew): small fix.
2766 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2768 * src/bufferlist.C (newFile):
2769 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2771 * src/lyxrc.C: added new_ask_filename tag
2773 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2775 * src/lyx.fd: removed code pertaining to form_ref
2776 * src/lyx.[Ch]: ditto
2777 * src/lyx_cb.C: ditto
2778 * src/lyx_gui.C: ditto
2779 * src/lyx_gui_misc.C: ditto
2781 * src/BufferView_pimpl.C (restorePosition): update buffer only
2784 * src/commandtags.h (LFUN_REFTOGGLE): removed
2785 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2786 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2787 (LFUN_REFBACK): renamed LFUN_REF_BACK
2789 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2790 * src/menus.C: ditto
2791 * src/lyxfunc.C (Dispatch): ditto.
2792 InsertRef dialog is now GUI-independent.
2794 * src/texrow.C: added using std::endl;
2796 * src/insets/insetref.[Ch]: strip out large amounts of code.
2797 The inset is now a container and this functionality is now
2798 managed by a new FormRef dialog
2800 * src/frontends/Dialogs.h (showRef, createRef): new signals
2802 * src/frontends/xforms/FormIndex.[Ch],
2803 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2804 when setting dialog's min/max size
2805 * src/frontends/xforms/FormIndex.[Ch]: ditto
2807 * src/frontends/xforms/FormRef.[Ch],
2808 src/frontends/xforms/forms/form_ref.fd: new xforms
2809 implementation of an InsetRef dialog
2811 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2814 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2815 ios::nocreate is not part of the standard. Removed.
2817 2000-08-07 Baruch Even <baruch.even@writeme.com>
2819 * src/graphics/Renderer.h:
2820 * src/graphics/Renderer.C: Added base class for rendering of different
2821 image formats into Pixmaps.
2823 * src/graphics/XPM_Renderer.h:
2824 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2825 in a different class.
2827 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2828 easily add support for other formats.
2830 * src/insets/figinset.C: plugged a leak of an X resource.
2832 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2834 * src/CutAndPaste.[Ch]: make all metods static.
2836 * development/Code_rules/Rules: more work, added section on
2837 Exceptions, and a References section.
2839 * a lot of header files: work to make doc++ able to generate the
2840 source documentation, some workarounds of doc++ problems. Doc++ is
2841 now able to generate the documentation.
2843 2000-08-07 Juergen Vigna <jug@sad.it>
2845 * src/insets/insettabular.C (recomputeTextInsets): removed function
2847 * src/tabular.C (SetWidthOfMulticolCell):
2849 (calculate_width_of_column_NMC): fixed return value so that it really
2850 only returns true if the column-width has changed (there where
2851 problems with muliticolumn-cells in this column).
2853 2000-08-04 Juergen Vigna <jug@sad.it>
2855 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2856 also on the scrollstatus of the inset.
2857 (workAreaMotionNotify): ditto.
2859 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2861 2000-08-01 Juergen Vigna <jug@sad.it>
2863 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2865 * src/commandtags.h:
2866 * src/LyXAction.C (init):
2867 * src/insets/inset.C (LocalDispatch): added support for
2870 * src/insets/inset.C (scroll): new functions.
2872 * src/insets/insettext.C (removeNewlines): new function.
2873 (SetAutoBreakRows): removes forced newlines in the text of the
2874 paragraph if autoBreakRows is set to false.
2876 * src/tabular.C (Latex): generates a parbox around the cell contents
2879 * src/frontends/xforms/FormTabular.C (local_update): removed
2880 the radio_useparbox button.
2882 * src/tabular.C (UseParbox): new function
2884 2000-08-06 Baruch Even <baruch.even@writeme.com>
2886 * src/graphics/GraphicsCache.h:
2887 * src/graphics/GraphicsCache.C:
2888 * src/graphics/GraphicsCacheItem.h:
2889 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2892 * src/insets/insetgraphics.h:
2893 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
2894 and the drawing of the inline image.
2896 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
2897 loaded into the wrong position.
2899 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2902 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2904 * src/support/translator.h: move all typedefs to public section
2906 * src/support/filetools.C (MakeLatexName): return string const
2908 (TmpFileName): ditto
2909 (FileOpenSearch): ditto
2911 (LibFileSearch): ditto
2912 (i18nLibFileSearch): ditto
2915 (CreateTmpDir): ditto
2916 (CreateBufferTmpDir): ditto
2917 (CreateLyXTmpDir): ditto
2920 (MakeAbsPath): ditto
2922 (OnlyFilename): ditto
2924 (NormalizePath): ditto
2925 (CleanupPath): ditto
2926 (GetFileContents): ditto
2927 (ReplaceEnvironmentPath): ditto
2928 (MakeRelPath): ditto
2930 (ChangeExtension): ditto
2931 (MakeDisplayPath): ditto
2932 (do_popen): return cmdret const
2933 (findtexfile): return string const
2935 * src/support/DebugStream.h: add some /// to please doc++
2937 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2939 * src/texrow.C (same_rownumber): functor to use with find_if
2940 (getIdFromRow): rewritten to use find_if and to not update the
2941 positions. return true if row is found
2942 (increasePos): new method, use to update positions
2944 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2946 * src/lyxlex_pimpl.C (verifyTable): new method
2949 (GetString): return string const
2950 (pushTable): rewrite to use std::stack
2952 (setFile): better check
2955 * src/lyxlex.h: make LyXLex noncopyable
2957 * src/lyxlex.C (text): return char const * const
2958 (GetString): return string const
2959 (getLongString): return string const
2961 * src/lyx_gui_misc.C (askForText): return pair<...> const
2963 * src/lastfiles.[Ch] (operator): return string const
2965 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2966 istringstream not char const *.
2967 move token.end() out of loop.
2968 (readFile): move initializaton of token
2970 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2971 getIdFromRow is successful.
2973 * lib/bind/emacs.bind: don't include menus bind
2975 * development/Code_rules/Rules: the beginnings of making this
2976 better and covering more of the unwritten rules that we have.
2978 * development/Code_rules/Recommendations: a couple of wording
2981 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2983 * src/support/strerror.c: remove C++ comment.
2985 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2987 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2988 LFUN_INDEX_INSERT_LAST
2990 * src/texrow.C (getIdFromRow): changed from const_iterator to
2991 iterator, allowing code to compile with DEC cxx
2993 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2994 stores part of the class, as suggested by Allan. Will allow
2996 (apply): test to apply uses InsetCommandParams operator!=
2998 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2999 (apply): test to apply uses InsetCommandParams operator!=
3001 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3002 stores part of the class.
3003 (update): removed limits on min/max size.
3005 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3006 (apply): test to apply uses InsetCommandParams operator!=
3008 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3009 (Read, Write, scanCommand, getCommand): moved functionality
3010 into InsetCommandParams.
3012 (getScreenLabel): made pure virtual
3013 new InsetCommandParams operators== and !=
3015 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3016 c-tors based on InsetCommandParams. Removed others.
3017 * src/insets/insetinclude.[Ch]: ditto
3018 * src/insets/insetlabel.[Ch]: ditto
3019 * src/insets/insetparent.[Ch]: ditto
3020 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3022 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3023 insets derived from InsetCommand created using similar c-tors
3024 based on InsetCommandParams
3025 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3026 * src/menus.C (ShowRefsMenu): ditto
3027 * src/paragraph.C (Clone): ditto
3028 * src/text2.C (SetCounter): ditto
3029 * src/lyxfunc.C (Dispatch) ditto
3030 Also recreated old InsetIndex behaviour exactly. Can now
3031 index-insert at the start of a paragraph and index-insert-last
3032 without launching the pop-up.
3034 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3036 * lib/lyxrc.example: mark te pdf options as non functional.
3038 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3039 (isStrDbl): move tmpstr.end() out of loop.
3040 (strToDbl): move intialization of tmpstr
3041 (lowercase): return string const and move tmp.end() out of loop.
3042 (uppercase): return string const and move tmp.edn() out of loop.
3043 (prefixIs): add assertion
3048 (containsOnly): ditto
3049 (containsOnly): ditto
3050 (containsOnly): ditto
3051 (countChar): make last arg char not char const
3052 (token): return string const
3053 (subst): return string const, move tmp.end() out of loop.
3054 (subst): return string const, add assertion
3055 (strip): return string const
3056 (frontStrip): return string const, add assertion
3057 (frontStrip): return string const
3062 * src/support/lstrings.C: add inclde "LAssert.h"
3063 (isStrInt): move tmpstr.end() out of loop.
3065 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3066 toollist.end() out of loop.
3067 (deactivate): move toollist.end() out of loop.
3068 (update): move toollist.end() out of loop.
3069 (updateLayoutList): move tc.end() out of loop.
3070 (add): move toollist.end() out of loop.
3072 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3073 md.end() out of loop.
3075 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3077 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3080 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3081 (Erase): move insetlist.end() out of loop.
3083 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3084 ref to const string as first arg. Move initialization of some
3085 variables, whitespace changes.
3087 * src/kbmap.C (defkey): move table.end() out of loop.
3088 (kb_keymap): move table.end() out of loop.
3089 (findbinding): move table.end() out of loop.
3091 * src/MenuBackend.C (hasMenu): move end() out of loop.
3092 (getMenu): move end() out of loop.
3093 (getMenu): move menulist_.end() out of loop.
3095 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3097 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3100 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3101 (getFromLyXName): move infotab.end() out of loop.
3103 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3104 -fvtable-thunks -ffunction-sections -fdata-sections
3106 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3108 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3111 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3113 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3115 * src/frontends/xforms/FormCitation.[Ch],
3116 src/frontends/xforms/FormIndex.[Ch],
3117 src/frontends/xforms/FormToc.[Ch],
3118 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3120 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3122 * src/commandtags.h: renamed, created some flags for citation
3125 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3127 * src/lyxfunc.C (dispatch): use signals to insert index entry
3129 * src/frontends/Dialogs.h: new signal createIndex
3131 * src/frontends/xforms/FormCommand.[Ch],
3132 src/frontends/xforms/FormCitation.[Ch],
3133 src/frontends/xforms/FormToc.[Ch],
3134 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3136 * src/insets/insetindex.[Ch]: GUI-independent
3138 * src/frontends/xforms/FormIndex.[Ch],
3139 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3142 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3144 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3145 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3147 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3149 * src/insets/insetref.C (Latex): rewrite so that there is now
3150 question that a initialization is requested.
3152 * src/insets/insetcommand.h: reenable the hide signal
3154 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3156 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3157 fix handling of shortcuts (many bugs :)
3158 (add_lastfiles): ditto.
3160 * lib/ui/default.ui: fix a few shortcuts.
3162 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3164 * Makefile.am: Fix ``rpmdist'' target to return the exit
3165 status of the ``rpm'' command, instead of the last command in
3166 the chain (the ``rm lyx.xpm'' command, which always returns
3169 2000-08-02 Allan Rae <rae@lyx.org>
3171 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3172 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3173 * src/frontends/xforms/FormToc.C (FormToc): ditto
3175 * src/frontends/xforms/Makefile.am: A few forgotten files
3177 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3178 Signals-not-copyable-problem Lars' started commenting out.
3180 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3182 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3184 * src/insets/insetcommand.h: Signals is not copyable so anoter
3185 scheme for automatic hiding of forms must be used.
3187 * src/frontends/xforms/FormCitation.h: don't inerit from
3188 noncopyable, FormCommand already does that.
3189 * src/frontends/xforms/FormToc.h: ditto
3190 * src/frontends/xforms/FormUrl.h: ditto
3192 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3194 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3196 * src/insets/insetcommand.h (hide): new SigC::Signal0
3197 (d-tor) new virtual destructor emits hide signal
3199 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3200 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3202 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3203 LOF and LOT. Inset is now GUI-independent
3205 * src/insets/insetloa.[Ch]: redundant
3206 * src/insets/insetlof.[Ch]: ditto
3207 * src/insets/insetlot.[Ch]: ditto
3209 * src/frontends/xforms/forms/form_url.fd: tweaked!
3210 * src/frontends/xforms/forms/form_citation.fd: ditto
3212 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3213 dialogs dealing with InsetCommand insets
3215 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3216 FormCommand base class
3217 * src/frontends/xforms/FormUrl.[Ch]: ditto
3219 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3221 * src/frontends/xforms/FormToc.[Ch]: ditto
3223 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3224 passed a generic InsetCommand pointer
3225 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3227 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3228 and modified InsetTOC class
3229 * src/buffer.C: ditto
3231 * forms/lyx.fd: strip out old FD_form_toc code
3232 * src/lyx_gui_misc.C: ditto
3233 * src/lyx_gui.C: ditto
3234 * src/lyx_cb.C: ditto
3235 * src/lyx.[Ch]: ditto
3237 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3239 * src/support/utility.hpp: tr -d '\r'
3241 2000-08-01 Juergen Vigna <jug@sad.it>
3243 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3245 * src/commandtags.h:
3246 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3247 LFUN_TABULAR_FEATURES.
3249 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3250 LFUN_LAYOUT_TABULAR.
3252 * src/insets/insettabular.C (getStatus): implemented helper function.
3254 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3256 2000-07-31 Juergen Vigna <jug@sad.it>
3258 * src/text.C (draw): fixed screen update problem for text-insets.
3260 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3261 something changed probably this has to be added in various other
3264 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3266 2000-07-31 Baruch Even <baruch.even@writeme.com>
3268 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3269 templates to satisfy compaq cxx.
3272 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3274 * src/support/translator.h (equal_1st_in_pair::operator()): take
3275 const ref pair_type as arg.
3276 (equal_2nd_in_pair::operator()): ditto
3277 (Translator::~Translator): remove empty d-tor.
3279 * src/graphics/GraphicsCache.C: move include config.h to top, also
3280 put initialization of GraphicsCache::singleton here.
3281 (~GraphicsCache): move here
3282 (addFile): take const ref as arg
3285 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3287 * src/BufferView2.C (insertLyXFile): change te with/without header
3290 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3292 * src/frontends/xforms/FormGraphics.C (apply): add some
3293 static_cast. Not very nice, but required by compaq cxx.
3295 * src/frontends/xforms/RadioButtonGroup.h: include header
3296 <utility> instead of <pair.h>
3298 * src/insets/insetgraphicsParams.C: add using directive.
3299 (readResize): change return type to void.
3300 (readOrigin): ditto.
3302 * src/lyxfunc.C (getStatus): add missing break for build-program
3303 function; add test for Literate for export functions.
3305 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3306 entries in Options menu.
3308 2000-07-31 Baruch Even <baruch.even@writeme.com>
3310 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3311 protect against auto-allocation; release icon when needed.
3313 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3315 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3316 on usual typewriter.
3318 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3319 earlier czech.kmap), useful only for programming.
3321 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3323 * src/frontends/xforms/FormCitation.h: fix conditioning around
3326 2000-07-31 Juergen Vigna <jug@sad.it>
3328 * src/frontends/xforms/FormTabular.C (local_update): changed
3329 radio_linebreaks to radio_useparbox and added radio_useminipage.
3331 * src/tabular.C: made support for using minipages/parboxes.
3333 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3335 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3337 (descent): so the cursor is in the middle.
3338 (width): bit smaller box.
3340 * src/insets/insetgraphics.h: added display() function.
3342 2000-07-31 Baruch Even <baruch.even@writeme.com>
3344 * src/frontends/Dialogs.h: Added showGraphics signals.
3346 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3347 xforms form definition of the graphics dialog.
3349 * src/frontends/xforms/FormGraphics.h:
3350 * src/frontends/xforms/FormGraphics.C: Added files, the
3351 GUIndependent code of InsetGraphics
3353 * src/insets/insetgraphics.h:
3354 * src/insets/insetgraphics.C: Major writing to make it work.
3356 * src/insets/insetgraphicsParams.h:
3357 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3358 struct between InsetGraphics and GUI.
3360 * src/LaTeXFeatures.h:
3361 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3362 support for graphicx package.
3364 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3365 for the graphics inset.
3367 * src/support/translator.h: Added file, used in
3368 InsetGraphicsParams. this is a template to translate between two
3371 * src/frontends/xforms/RadioButtonGroup.h:
3372 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3373 way to easily control a radio button group.
3375 2000-07-28 Juergen Vigna <jug@sad.it>
3377 * src/insets/insettabular.C (LocalDispatch):
3378 (TabularFeatures): added support for lyx-functions of tabular features.
3379 (cellstart): refixed this function after someone wrongly changed it.
3381 * src/commandtags.h:
3382 * src/LyXAction.C (init): added support for tabular-features
3384 2000-07-28 Allan Rae <rae@lyx.org>
3386 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3387 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3388 triggers the callback for input checking. As a result we sometimes get
3389 "LyX: This shouldn't happen..." printed to cerr.
3390 (input): Started using status variable since I only free() on
3391 destruction. Some input checking for paths and font sizes.
3393 * src/frontends/xforms/FormPreferences.h: Use status to control
3394 activation of Ok and Apply
3396 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3397 callback. Also resized to stop segfaults with 0.88. The problem is
3398 that xforms-0.88 requires the folder to be wide enough to fit all the
3399 tabs. If it isn't it causes all sorts of problems.
3401 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3403 * src/frontends/xforms/forms/README: Reflect reality.
3405 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3406 * src/frontends/xforms/forms/makefile: ditto.
3408 * src/commandtags.h: Get access to new Preferences dialog
3409 * src/LyXAction.C: ditto
3410 * src/lyxfunc.C: ditto
3411 * lib/ui/default.ui: ditto
3413 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3415 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3417 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3420 * src/frontends/xforms/form_url.[Ch]: added.
3422 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3424 * src/insets/insetbib.h: fixed bug in previous commit
3426 * src/frontends/xforms/FormUrl.h: ditto
3428 * src/frontends/xforms/FormPrint.h: ditto
3430 * src/frontends/xforms/FormPreferences.h: ditto
3432 * src/frontends/xforms/FormCopyright.h: ditto
3434 * src/frontends/xforms/FormCitation.C: ditto
3436 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3437 private copyconstructor and private default contructor
3439 * src/support/Makefile.am: add utility.hpp
3441 * src/support/utility.hpp: new file from boost
3443 * src/insets/insetbib.h: set owner in clone
3445 * src/frontends/xforms/FormCitation.C: added missing include
3448 * src/insets/form_url.[Ch]: removed
3450 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3452 * development/lyx.spec.in
3453 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3454 file/directory re-organization.
3456 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3458 * src/insets/insetcommand.[Ch]: moved the string data and
3459 associated manipulation methods into a new stand-alone class
3460 InsetCommandParams. This class has two additional methods
3461 getAsString() and setFromString() allowing the contents to be
3462 moved around as a single string.
3463 (addContents) method removed.
3464 (setContents) method no longer virtual.
3466 * src/buffer.C (readInset): made use of new InsetCitation,
3467 InsetUrl constructors based on InsetCommandParams.
3469 * src/commandtags.h: add LFUN_INSERT_URL
3471 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3472 independent InsetUrl and use InsetCommandParams to extract
3473 string info and create new Insets.
3475 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3477 * src/frontends/xforms/FormCitation.C (apply): uses
3480 * src/frontends/xforms/form_url.C
3481 * src/frontends/xforms/form_url.h
3482 * src/frontends/xforms/FormUrl.h
3483 * src/frontends/xforms/FormUrl.C
3484 * src/frontends/xforms/forms/form_url.fd: new files
3486 * src/insets/insetcite.[Ch]: removed unused constructors.
3488 * src/insets/insetinclude.[Ch]: no longer store filename
3490 * src/insets/inseturl.[Ch]: GUI-independent.
3492 2000-07-26 Juergen Vigna <jug@sad.it>
3493 * renamed frontend from gtk to gnome as it is that what is realized
3494 and did the necessary changes in the files.
3496 2000-07-26 Marko Vendelin <markov@ioc.ee>
3498 * configure.in: cleaning up gnome configuration scripts
3500 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3502 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3503 shortcuts syndrom by redrawing them explicitely (a better solution
3504 would be appreciated).
3506 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3508 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3511 * src/lyx_cb.C (MenuExport): change html export to do the right
3512 thing depending of the document type (instead of having
3513 html-linuxdoc and html-docbook).
3514 * src/lyxfunc.C (getStatus): update for html
3515 * lib/ui/default.ui: simplify due to the above change.
3516 * src/menus.C (ShowFileMenu): update too (in case we need it).
3518 * src/MenuBackend.C (read): if a menu is defined twice, add the
3519 new entries to the exiting one.
3521 2000-07-26 Juergen Vigna <jug@sad.it>
3523 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3525 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3526 and return a bool if it did actual save the file.
3527 (AutoSave): don't autosave a unnamed doc.
3529 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3530 check if this is an UNNAMED new file and react to it.
3531 (newFile): set buffer to unnamed and change to not mark a new
3532 buffer dirty if I didn't do anything with it.
3534 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3536 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3538 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3539 friend as per Angus's patch posted to lyx-devel.
3541 * src/ext_l10n.h: updated
3543 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3544 gettext on the style string right before inserting them into the
3547 * autogen.sh: add code to extract style strings form layout files,
3548 not good enough yet.
3550 * src/frontends/gtk/.cvsignore: add MAKEFILE
3552 * src/MenuBackend.C (read): run the label strings through gettext
3553 before storing them in the containers.
3555 * src/ext_l10n.h: new file
3557 * autogen.sh : generate the ext_l10n.h file here
3559 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3561 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3564 * lib/ui/default.ui: fix a couple of typos.
3566 * config/gnome/gtk.m4: added (and added to the list of files in
3569 * src/insets/insetinclude.C (unique_id): fix when we are using
3570 lyxstring instead of basic_string<>.
3571 * src/insets/insettext.C (LocalDispatch): ditto.
3572 * src/support/filetools.C: ditto.
3574 * lib/configure.m4: create the ui/ directory if necessary.
3576 * src/LyXView.[Ch] (updateToolbar): new method.
3578 * src/BufferView_pimpl.C (buffer): update the toolbar when
3579 opening/closing buffer.
3581 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3583 * src/LyXAction.C (getActionName): enhance to return also the name
3584 and options of pseudo-actions.
3585 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3587 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3588 as an example of what is possible). Used in File->Build too (more
3589 useful) and in the import/export menus (to mimick the complicated
3590 handling of linuxdoc and friends). Try to update all the entries.
3592 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3595 * src/MenuBackend.C (read): Parse the new OptItem tag.
3597 * src/MenuBackend.h: Add a new optional_ data member (used if the
3598 entry should be omitted when the lyxfunc is disabled).
3600 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3601 function, used as a shortcut.
3602 (create_submenu): align correctly the shortcuts on the widest
3605 * src/MenuBackend.h: MenuItem.label() only returns the label of
3606 the menu without shortcut; new method shortcut().
3608 2000-07-14 Marko Vendelin <markov@ioc.ee>
3610 * src/frontends/gtk/Dialogs.C:
3611 * src/frontends/gtk/FormCopyright.C:
3612 * src/frontends/gtk/FormCopyright.h:
3613 * src/frontends/gtk/Makefile.am: added these source-files for the
3614 Gtk/Gnome support of the Copyright-Dialog.
3616 * src/main.C: added Gnome::Main initialization if using
3617 Gtk/Gnome frontend-GUI.
3619 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3621 * config/gnome/aclocal-include.m4
3622 * config/gnome/compiler-flags.m4
3623 * config/gnome/curses.m4
3624 * config/gnome/gnome--.m4
3625 * config/gnome/gnome-bonobo-check.m4
3626 * config/gnome/gnome-common.m4
3627 * config/gnome/gnome-fileutils.m4
3628 * config/gnome/gnome-ghttp-check.m4
3629 * config/gnome/gnome-gnorba-check.m4
3630 * config/gnome/gnome-guile-checks.m4
3631 * config/gnome/gnome-libgtop-check.m4
3632 * config/gnome/gnome-objc-checks.m4
3633 * config/gnome/gnome-orbit-check.m4
3634 * config/gnome/gnome-print-check.m4
3635 * config/gnome/gnome-pthread-check.m4
3636 * config/gnome/gnome-support.m4
3637 * config/gnome/gnome-undelfs.m4
3638 * config/gnome/gnome-vfs.m4
3639 * config/gnome/gnome-x-checks.m4
3640 * config/gnome/gnome-xml-check.m4
3641 * config/gnome/gnome.m4
3642 * config/gnome/gperf-check.m4
3643 * config/gnome/gtk--.m4
3644 * config/gnome/linger.m4
3645 * config/gnome/need-declaration.m4: added configuration scripts
3646 for Gtk/Gnome frontend-GUI
3648 * configure.in: added support for the --with-frontend=gtk option
3650 * autogen.sh: added config/gnome/* to list of config-files
3652 * acconfig.h: added define for GTKGUI-support
3654 * config/lyxinclude.m4: added --with-frontend[=value] option value
3655 for Gtk/Gnome frontend-GUI support.
3657 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3659 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3663 * src/paragraph.C (GetChar): remove non-const version
3665 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3666 (search_kw): use it.
3668 * src/lyx_main.C (init): if "preferences" exist, read that instead
3670 (ReadRcFile): return bool if the file could be read ok.
3671 (ReadUIFile): add a check to see if lex file is set ok.
3673 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3674 bastring can be used instead of lyxstring (still uses the old code
3675 if std::string is good enough or if lyxstring is used.)
3677 * src/encoding.C: make the arrays static, move ininle functions
3679 * src/encoding.h: from here.
3681 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3682 (parseSingleLyXformat2Token): move inset parsing to separate method
3683 (readInset): new private method
3685 * src/Variables.h: remove virtual from get().
3687 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3688 access to NEW_INSETS and NEW_TABULAR
3690 * src/MenuBackend.h: remove superfluous forward declaration of
3691 MenuItem. Add documentations tags "///", remove empty MenuItem
3692 destructor, remove private default contructor.
3694 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3696 (read): more string mlabel and mname to where they are used
3697 (read): remove unused variables mlabel and mname
3698 (defaults): unconditional clear, make menusetup take advantage of
3699 add returning Menu &.
3701 * src/LyXView.h: define NEW_MENUBAR as default
3703 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3704 to NEW_INSETS and NEW_TABULAR.
3705 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3706 defined. Change some of the "xxxx-inset-insert" functions names to
3709 * several files: more enahncements to NEW_INSETS and the resulting
3712 * lib/lyxrc.example (\date_insert_format): move to misc section
3714 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3715 bastring and use AC_CACHE_CHECK.
3716 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3717 the system have the newest methods. uses AC_CACHE_CHECK
3718 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3719 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3720 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3722 * configure.in: add LYX_CXX_GOOD_STD_STRING
3724 * acinclude.m4: recreated
3726 2000-07-24 Amir Karger <karger@lyx.org>
3728 * README: add Hebrew, Arabic kmaps
3731 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3733 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3736 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3738 * Lot of files: add pragma interface/implementation.
3740 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3742 * lib/ui/default.ui: new file (ans new directory). Contains the
3743 default menu and toolbar.
3745 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3746 global space. Toolbars are now read (as menus) in ui files.
3748 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3750 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3751 is disabled because the document is read-only. We want to have the
3752 toggle state of the function anyway.
3753 (getStatus): add code for LFUN_VC* functions (mimicking what is
3754 done in old-style menus)
3756 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3757 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3759 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3760 * src/BufferView_pimpl.C: ditto.
3761 * src/lyxfunc.C: ditto.
3763 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3764 default). This replaces old-style menus by new ones.
3766 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3767 MenuItem. Contain the data structure of a menu.
3769 * src/insets/insettext.C: use LyXView::setLayout instead of
3770 accessing directly the toolbar combox.
3771 * src/lyxfunc.C (Dispatch): ditto.
3773 * src/LyXView.C (setLayout): new method, which just calls
3774 Toolbar::setLayout().
3775 (updateLayoutChoice): move part of this method in Toolbar.
3777 * src/toolbar.[Ch]: removed.
3779 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3780 implementation the toolbar.
3782 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3783 the toolbar. It might make sense to merge it with ToolbarDefaults
3785 (setLayout): new function.
3786 (updateLayoutList): ditto.
3787 (openLayoutList): ditto.
3789 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3790 xforms implementation of the toolbar.
3791 (get_toolbar_func): comment out, since I do not
3792 know what it is good for.
3794 * src/ToolbarDefaults.h: Add the ItemType enum.
3796 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3797 for a list of allocated C strings. Used in Menubar xforms
3798 implementation to avoid memory leaks.
3800 * src/support/lstrings.[Ch] (uppercase): new version taking and
3804 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3805 * lib/bind/emacs.bind: ditto.
3807 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3809 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3810 forward decl of LyXView.
3812 * src/toolbar.C (toolbarItem): moved from toolbar.h
3813 (toolbarItem::clean): ditto
3814 (toolbarItem::~toolbarItem): ditto
3815 (toolbarItem::operator): ditto
3817 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3819 * src/paragraph.h: control the NEW_TABULAR define from here
3821 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3822 USE_TABULAR_INSETS to NEW_TABULAR
3824 * src/ToolbarDefaults.C: add include "lyxlex.h"
3826 * files using the old table/tabular: use NEW_TABULAR to control
3827 compilation of old tabular stuff.
3829 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3832 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3833 planemet in reading of old style floats, fix the \end_deeper
3834 problem when reading old style floats.
3836 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3838 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3840 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3842 * lib/bind/sciword.bind: updated.
3844 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3846 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3847 layout write problem
3849 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3851 * src/Makefile.am (INCLUDES): remove image directory from include
3854 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3855 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3857 * src/LyXView.C (create_form_form_main): read the application icon
3860 * lib/images/*.xpm: change the icons to use transparent color for
3863 * src/toolbar.C (update): change the color of the button when it
3866 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3868 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3869 setting explicitely the minibuffer.
3870 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3872 * src/LyXView.C (showState): new function. Shows font information
3873 in minibuffer and update toolbar state.
3874 (LyXView): call Toolbar::update after creating the
3877 * src/toolbar.C: change toollist to be a vector instead of a
3879 (BubbleTimerCB): get help string directly from the callback
3880 argument of the corresponding icon (which is the action)
3881 (set): remove unnecessary ugliness.
3882 (update): new function. update the icons (depressed, disabled)
3883 depending of the status of the corresponding action.
3885 * src/toolbar.h: remove help in toolbarItem
3887 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3889 * src/Painter.C (text): Added code for using symbol glyphs from
3890 iso10646 fonts. Currently diabled.
3892 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3895 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3896 magyar,turkish and usorbian.
3898 * src/paragraph.C (isMultiLingual): Made more efficient.
3900 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3903 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3904 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3905 Also changed the prototype to "bool math_insert_greek(char)".
3907 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3909 * lots of files: apply the NEW_INSETS on all code that will not be
3910 needed when we move to use the new insets. Enable the define in
3911 lyxparagrah.h to try it.
3913 * src/insets/insettabular.C (cellstart): change to be a static
3915 (InsetTabular): initialize buffer in the initializer list.
3917 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3919 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3920 form_print.h out of the header file. Replaced with forward
3921 declarations of the relevant struct.
3923 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3926 * src/commandtags.h: do not include "debug.h" which does not
3927 belong there. #include it in some other places because of this
3930 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3932 * src/insets/insetcaption.C: add a couple "using" directives.
3934 * src/toolbar.C (add): get the help text directly from lyxaction.
3936 (setPixmap): new function. Loads from disk and sets a pixmap on a
3937 botton; the name of the pixmap file is derived from the command
3940 * src/toolbar.h: remove members isBitmap and pixmap from
3943 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3944 * lib/images/: move many files from images/banner.xpm.
3946 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3948 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3949 * src/toolbar.C: ditto.
3950 * configure.in: ditto.
3951 * INSTALL: document.
3953 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3954 the spellchecker popup is closed from the WM.
3956 2000-07-19 Juergen Vigna <jug@sad.it>
3958 * src/insets/insetfloat.C (Write): small fix because we use the
3959 insetname for the type now!
3961 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3963 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3966 * src/frontends/Dialogs.h: removed hideCitation signal
3968 * src/insets/insetcite.h: added hide signal
3970 * src/insets/insetcite.C (~InsetCitation): emits new signal
3971 (getScreenLabel): "intelligent" label should now fit on the screen!
3973 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3975 * src/frontends/xforms/FormCitation.C (showInset): connects
3976 hide() to the inset's hide signal
3977 (show): modified to use fl_set_object_position rather than
3978 fl_set_object_geometry wherever possible
3980 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3982 * src/insets/lyxinset.h: add caption code
3984 * src/insets/insetfloat.C (type): new method
3986 * src/insets/insetcaption.C (Write): new method
3988 (LyxCode): new method
3990 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3991 to get it right together with using the FloatList.
3993 * src/commandtags.h: add LFUN_INSET_CAPTION
3994 * src/lyxfunc.C (Dispatch): handle it
3996 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3999 * src/Variables.[Ch]: make expand take a const reference, remove
4000 the destructor, some whitespace changes.
4002 * src/LyXAction.C (init): add caption-inset-insert
4004 * src/FloatList.C (FloatList): update the default floats a bit.
4006 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4008 * src/Variables.[Ch]: new files. Intended to be used for language
4009 specific strings (like \chaptername) and filename substitution in
4012 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4014 * lib/kbd/american.kmap: update
4016 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4018 * src/bufferparams.[Ch]: remove member allowAccents.
4020 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4022 * src/LaTeXLog.C: use the log_form.h header.
4023 * src/lyx_gui.C: ditto.
4024 * src/lyx_gui_misc.C: ditto.
4025 * src/lyxvc.h: ditto.
4027 * forms/log_form.fd: new file, created from latexoptions.fd. I
4028 kept the log popup and nuked the options form.
4030 * src/{la,}texoptions.[Ch]: removed.
4031 * src/lyx_cb.C (LaTeXOptions): ditto
4033 * src/lyx_gui.C (create_forms): do not handle the
4034 fd_latex_options form.
4036 2000-07-18 Juergen Vigna <jug@sad.it>
4038 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4039 name of the inset so that it can be requested outside (text2.C).
4041 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4044 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4046 * src/mathed/formula.h (ConvertFont): constify
4048 * src/mathed/formula.C (Read): add warning if \end_inset is not
4049 found on expected place.
4051 * src/insets/lyxinset.h (ConvertFont): consify
4053 * src/insets/insetquotes.C (ConvertFont): constify
4054 * src/insets/insetquotes.h: ditto
4056 * src/insets/insetinfo.h: add labelfont
4058 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4059 (ascent): use labelfont
4063 (Write): make .lyx file a bit nicer
4065 * src/insets/insetfloat.C (Write): simplify somewhat...
4066 (Read): add warning if arg is not found
4068 * src/insets/insetcollapsable.C: add using std::max
4069 (Read): move string token and add warning in arg is not found
4070 (draw): use std::max to get the right ty
4071 (getMaxWidth): simplify by using std::max
4073 * src/insets/insetsection.h: new file
4074 * src/insets/insetsection.C: new file
4075 * src/insets/insetcaption.h: new file
4076 * src/insets/insetcaption.C: new file
4078 * src/insets/inset.C (ConvertFont): constify signature
4080 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4081 insetcaption.[Ch] and insetsection.[Ch]
4083 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4084 uses to use LABEL_COUNTER_CHAPTER instead.
4085 * src/text2.C (SetCounter): here
4087 * src/counters.h: new file
4088 * src/counters.C: new file
4089 * src/Sectioning.h: new file
4090 * src/Sectioning.C: new file
4092 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4094 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4096 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4099 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4102 2000-07-17 Juergen Vigna <jug@sad.it>
4104 * src/tabular.C (Validate): check if array-package is needed.
4105 (SetVAlignment): added support for vertical alignment.
4106 (SetLTFoot): better support for longtable header/footers
4107 (Latex): modified to support added features.
4109 * src/LaTeXFeatures.[Ch]: added array-package.
4111 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4113 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4116 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4118 * configure.in: do not forget to put a space after -isystem.
4120 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4122 * lib/kbd/arabic.kmap: a few fixes.
4124 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4126 * some whitespace chagnes to a number of files.
4128 * src/support/DebugStream.h: change to make it easier for
4129 doc++ to parse correctly.
4130 * src/support/lyxstring.h: ditto
4132 * src/mathed/math_utils.C (compara): change to have only one
4134 (MathedLookupBOP): change because of the above.
4136 * src/mathed/math_delim.C (math_deco_compare): change to have only
4138 (search_deco): change becasue of the above.
4140 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4141 instead of manually coded one.
4143 * src/insets/insetquotes.C (Read): read the \end_inset too
4145 * src/insets/insetlatex.h: remove file
4146 * src/insets/insetlatex.C: remove file
4148 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4150 (InsetPrintIndex): remove destructor
4152 * src/insets/insetinclude.h: remove default constructor
4154 * src/insets/insetfloat.C: work to make it work better
4156 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4158 * src/insets/insetcite.h (InsetCitation): remove default constructor
4160 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4162 * src/text.C (GetColumnNearX): comment out some currently unused code.
4164 * src/paragraph.C (writeFile): move some initializations closer to
4166 (CutIntoMinibuffer): small change to use new matchIT operator
4170 (InsertInset): ditto
4173 (InsetIterator): ditto
4174 (Erase): small change to use new matchFT operator
4176 (GetFontSettings): ditto
4177 (HighestFontInRange): ditto
4180 * src/lyxparagraph.h: some chars changed to value_type
4181 (matchIT): because of some stronger checking (perhaps too strong)
4182 in SGI STL, the two operator() unified to one.
4185 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4187 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4188 the last inset read added
4189 (parseSingleLyXformat2Token): some more (future) compability code added
4190 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4191 (parseSingleLyXformat2Token): set last_inset_read
4192 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4193 (parseSingleLyXformat2Token): don't double intializw string next_token
4195 * src/TextCache.C (text_fits::operator()): add const's to the signature
4196 (has_buffer::operator()): ditto
4198 * src/Floating.h: add some comments on the class
4200 * src/FloatList.[Ch] (typeExist): new method
4203 * src/BackStack.h: added default constructor, wanted by Gcc.
4205 2000-07-14 Juergen Vigna <jug@sad.it>
4207 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4209 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4211 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4212 do a redraw when the window is resized!
4213 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4215 * src/insets/insettext.C (resizeLyXText): added function to correctly
4216 being able to resize the LyXWindow.
4218 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4220 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4222 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4223 crashes when closing dialog to a deleted inset.
4225 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4226 method! Now similar to other insets.
4228 2000-07-13 Juergen Vigna <jug@sad.it>
4230 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4232 * lib/examples/Literate.lyx: small patch!
4234 * src/insets/insetbib.C (Read): added this function because of wrong
4235 Write (without [begin|end]_inset).
4237 2000-07-11 Juergen Vigna <jug@sad.it>
4239 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4240 as the insertInset could not be good!
4242 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4243 the bool param should not be last.
4245 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4247 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4248 did submit that to Karl).
4250 * configure.in: use -isystem instead of -I for X headers. This
4251 fixes a problem on solaris with a recent gcc;
4252 put the front-end code after the X detection code;
4253 configure in sigc++ before lib/
4255 * src/lyx_main.C (commandLineHelp): remove -display from command
4258 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4260 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4261 Also put in Makefile rules for building the ``listerrors''
4262 program for parsing errors from literate programs written in LyX.
4264 * lib/build-listerrors: Added small shell script as part of compile
4265 process. This builds a working ``listerrors'' binary if noweb is
4266 installed and either 1) the VNC X server is installed on the machine,
4267 or 2) the user is compiling from within a GUI. The existence of a GUI
4268 is necessary to use the ``lyx --export'' feature for now. This
4269 hack can be removed once ``lyx --export'' no longer requires a GUI to
4272 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4274 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4275 now passed back correctly from gcc and placed "under" error
4276 buttons in a Literate LyX source.
4278 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4280 * src/text.C (GetColumnNearX): Better behavior when a RTL
4281 paragraph is ended by LTR text.
4283 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4286 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4288 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4289 true when clipboard is empty.
4291 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4293 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4294 row of the paragraph.
4295 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4296 to prevent calculation of bidi tables
4298 2000-07-07 Juergen Vigna <jug@sad.it>
4300 * src/screen.C (ToggleSelection): added y_offset and x_offset
4303 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4306 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4308 * src/insets/insettext.C: fixed Layout-Display!
4310 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4312 * configure.in: add check for strings.h header.
4314 * src/spellchecker.C: include <strings.h> in order to have a
4315 definition for bzero().
4317 2000-07-07 Juergen Vigna <jug@sad.it>
4319 * src/insets/insettext.C (draw): set the status of the bv->text to
4320 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4322 * src/screen.C (DrawOneRow):
4323 (DrawFromTo): redraw the actual row if something has changed in it
4326 * src/text.C (draw): call an update of the toplevel-inset if something
4327 has changed inside while drawing.
4329 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4331 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4333 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4334 processing inside class.
4336 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4337 processing inside class.
4339 * src/insets/insetindex.h new struct Holder, consistent with other
4342 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4343 citation dialog from main code and placed it in src/frontends/xforms.
4344 Dialog launched through signals instead of callbacks
4346 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4348 * lyx.man: update the options description.
4350 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4352 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4353 handle neg values, set min width to 590, add doc about -display
4355 2000-07-05 Juergen Vigna <jug@sad.it>
4357 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4358 calls to BufferView *.
4360 * src/insets/insettext.C (checkAndActivateInset): small fix non
4361 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4363 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4364 their \end_inset token!
4366 2000-07-04 edscott <edscott@imp.mx>
4368 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4369 lib/lyxrc.example: added option \wheel_jump
4371 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4373 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4374 remove support for -width,-height,-xpos and -ypos.
4376 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4378 * src/encoding.[Ch]: New files.
4380 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4381 (text): Call to the underline() method only when needed.
4383 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4385 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4386 encoding(s) for the document.
4388 * src/bufferparams.C (BufferParams): Changed default value of
4391 * src/language.C (newLang): Removed.
4392 (items[]): Added encoding information for all defined languages.
4394 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4395 encoding choice button.
4397 * src/lyxrc.h (font_norm_type): New member variable.
4398 (set_font_norm_type): New method.
4400 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4401 paragraphs with different encodings.
4403 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4404 (TransformChar): Changed to work correctly with Arabic points.
4405 (draw): Added support for drawing Arabic points.
4406 (draw): Removed code for drawing underbars (this is done by
4409 * src/support/textutils.h (IsPrintableNonspace): New function.
4411 * src/BufferView_pimpl.h: Added "using SigC::Object".
4412 * src/LyXView.h: ditto.
4414 * src/insets/insetinclude.h (include_label): Changed to mutable.
4416 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4418 * src/mathed/math_iter.h: remove empty destructor
4420 * src/mathed/math_cursor.h: remove empty destructor
4422 * src/insets/lyxinset.h: add THEOREM_CODE
4424 * src/insets/insettheorem.[Ch]: new files
4426 * src/insets/insetminipage.C: (InsertInset): remove
4428 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4430 (InsertInset): remove
4432 * src/insets/insetlist.C: (InsertList): remove
4434 * src/insets/insetfootlike.[Ch]: new files
4436 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4439 (InsertInset): ditto
4441 * src/insets/insetert.C: remove include Painter.h, reindent
4442 (InsertInset): move to header
4444 * src/insets/insetcollapsable.h: remove explicit from default
4445 contructor, remove empty destructor, add InsertInset
4447 * src/insets/insetcollapsable.C (InsertInset): new func
4449 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4451 * src/vspace.h: add explicit to constructor
4453 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4454 \textcompwordmark, please test this.
4456 * src/lyxrc.C: set ascii_linelen to 65 by default
4458 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4460 * src/commandtags.h: add LFUN_INSET_THEOREM
4462 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4463 (makeLinuxDocFile): remove _some_ of the nice logic
4464 (makeDocBookFile): ditto
4466 * src/Painter.[Ch]: (~Painter): removed
4468 * src/LyXAction.C (init): entry for insettheorem added
4470 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4472 (deplog): code to detect files generated by LaTeX, needs testing
4475 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4477 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4479 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4481 * src/LaTeX.C (deplog): Add a check for files that are going to be
4482 created by the first latex run, part of the project to remove the
4485 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4486 contents to the extension list.
4488 2000-07-04 Juergen Vigna <jug@sad.it>
4490 * src/text.C (NextBreakPoint): added support for needFullRow()
4492 * src/insets/lyxinset.h: added needFullRow()
4494 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4497 * src/insets/insettext.C: lots of changes for update!
4499 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4501 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4503 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4505 * src/insets/insetinclude.C (InsetInclude): fixed
4506 initialization of include_label.
4507 (unique_id): now returns a string.
4509 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4511 * src/LaTeXFeatures.h: new member IncludedFiles, for
4512 a map of key, included file name.
4514 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4515 with the included files for inclusion in SGML preamble,
4516 i. e., linuxdoc and docbook.
4519 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4520 nice (is the generated linuxdoc code to be exported?), that
4521 allows to remove column, and only_body that will be true for
4522 slave documents. Insets are allowed inside SGML font type.
4523 New handling of the SGML preamble for included files.
4524 (makeDocBookFile): the same for docbook.
4526 * src/insets/insetinclude.h:
4527 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4529 (DocBook): new export methods.
4531 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4532 and makeDocBookFile.
4534 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4535 formats to export with command line argument -x.
4537 2000-06-29 Juergen Vigna <jug@sad.it>
4539 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4540 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4542 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4543 region could already been cleared by an inset!
4545 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4547 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4550 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4552 (cursorToggle): remove special handling of lyx focus.
4554 2000-06-28 Juergen Vigna <jug@sad.it>
4556 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4559 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4561 * src/insets/insetindex.C (Edit): add a callback when popup is
4564 * src/insets/insettext.C (LocalDispatch):
4565 * src/insets/insetmarginal.h:
4566 * src/insets/insetlist.h:
4567 * src/insets/insetfoot.h:
4568 * src/insets/insetfloat.h:
4569 * src/insets/insetert.h: add a missing std:: qualifier.
4571 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4573 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4576 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4578 * src/insets/insettext.C (Read): remove tmptok unused variable
4579 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4580 (InsertInset): change for new InsetInset code
4582 * src/insets/insettext.h: add TEXT inline method
4584 * src/insets/insettext.C: remove TEXT macro
4586 * src/insets/insetmarginal.C (Write): new method
4587 (Latex): change output slightly
4589 * src/insets/insetfoot.C (Write): new method
4590 (Latex): change output slightly (don't use endl when no need)
4592 * src/insets/insetert.C (Write): new method
4594 * src/insets/insetcollapsable.h: make button_length, button_top_y
4595 and button_bottm_y protected.
4597 * src/insets/insetcollapsable.C (Write): simplify code by using
4598 tostr. Also do not output the float name, the children class
4599 should to that to get control over own arguments
4601 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4602 src/insets/insetminipage.[Ch]:
4605 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4607 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4609 * src/Makefile.am (lyx_SOURCES): add the new files
4611 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4612 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4613 * src/commandtags.h: ditto
4615 * src/LaTeXFeatures.h: add a std::set of used floattypes
4617 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4619 * src/FloatList.[Ch] src/Floating.h: new files
4621 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4623 * src/lyx_cb.C (TableApplyCB): ditto
4625 * src/text2.C: ditto
4626 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4627 (parseSingleLyXformat2Token): ditto + add code for
4628 backwards compability for old float styles + add code for new insets
4630 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4632 (InsertInset(size_type, Inset *, LyXFont)): new method
4633 (InsetChar(size_type, char)): changed to use the other InsetChar
4634 with a LyXFont(ALL_INHERIT).
4635 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4636 insert the META_INSET.
4638 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4640 * sigc++/thread.h (Threads): from here
4642 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4643 definition out of line
4644 * sigc++/scope.h: from here
4646 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4648 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4649 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4651 * Makefile.am (bindist): new target.
4653 * INSTALL: add instructions for doing a binary distribution.
4655 * development/tools/README.bin.example: update a bit.
4657 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4660 * lib/lyxrc.example: new lyxrc tag \set_color.
4662 * src/lyxfunc.C (Dispatch):
4663 * src/commandtags.h:
4664 * src/LyXAction.C: new lyxfunc "set-color".
4666 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4667 and an x11name given as strings.
4669 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4670 cache when a color is changed.
4672 2000-06-26 Juergen Vigna <jug@sad.it>
4674 * src/lyxrow.C (width): added this functions and variable.
4676 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4679 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4681 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4683 * images/undo_bw.xpm: new icon.
4684 * images/redo_bw.xpm: ditto.
4686 * configure.in (INSTALL_SCRIPT): change value to
4687 ${INSTALL} to avoid failures of install-script target.
4688 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4690 * src/BufferView.h: add a magic "friend" declaration to please
4693 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4695 * forms/cite.fd: modified to allow resizing without messing
4698 * src/insetcite.C: Uses code from cite.fd almost without
4700 User can now resize dialog in the x-direction.
4701 Resizing the dialog in the y-direction is prevented, as the
4702 code does this intelligently already.
4704 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4706 * INSTALL: remove obsolete entry in "problems" section.
4708 * lib/examples/sl_*.lyx: update of the slovenian examples.
4710 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4712 2000-06-23 Juergen Vigna <jug@sad.it>
4714 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4716 * src/buffer.C (resize): delete the LyXText of textinsets.
4718 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4720 * src/insets/lyxinset.h: added another parameter 'cleared' to
4721 the draw() function.
4723 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4724 unlocking inset in inset.
4726 2000-06-22 Juergen Vigna <jug@sad.it>
4728 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4729 of insets and moved first to LyXText.
4731 * src/mathed/formulamacro.[Ch]:
4732 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4734 2000-06-21 Juergen Vigna <jug@sad.it>
4736 * src/text.C (GetVisibleRow): look if I should clear the area or not
4737 using Inset::doClearArea() function.
4739 * src/insets/lyxinset.h: added doClearArea() function and
4740 modified draw(Painter &, ...) to draw(BufferView *, ...)
4742 * src/text2.C (UpdateInset): return bool insted of int
4744 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4746 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4747 combox in the character popup
4749 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4750 BufferParams const & params
4752 2000-06-20 Juergen Vigna <jug@sad.it>
4754 * src/insets/insettext.C (SetParagraphData): set insetowner on
4757 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4759 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4760 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4762 (form_main_): remove
4764 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4765 (create_form_form_main): remove FD_form_main stuff, connect to
4766 autosave_timeout signal
4768 * src/LyXView.[Ch] (getMainForm): remove
4769 (UpdateTimerCB): remove
4770 * src/BufferView_pimpl.h: inherit from SigC::Object
4772 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4773 signal instead of callback
4775 * src/BufferView.[Ch] (cursorToggleCB): remove
4777 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4779 * src/BufferView_pimpl.C: changes because of the one below
4781 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4782 instead of storing a pointer to a LyXText.
4784 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4786 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4788 * src/lyxparagraph.h
4790 * src/paragraph.C: Changed fontlist to a sorted vector.
4792 2000-06-19 Juergen Vigna <jug@sad.it>
4794 * src/BufferView.h: added screen() function.
4796 * src/insets/insettext.C (LocalDispatch): some selection code
4799 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4801 * src/insets/insettext.C (SetParagraphData):
4803 (InsetText): fixes for multiple paragraphs.
4805 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4807 * development/lyx.spec.in: Call configure with ``--without-warnings''
4808 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4809 This should be fine, however, since we generally don't want to be
4810 verbose when making an RPM.
4812 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4814 * lib/scripts/fig2pstex.py: New file
4816 2000-06-16 Juergen Vigna <jug@sad.it>
4818 * src/insets/insettabular.C (UpdateLocal):
4819 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4820 (LocalDispatch): Changed all functions to use LyXText.
4822 2000-06-15 Juergen Vigna <jug@sad.it>
4824 * src/text.C (SetHeightOfRow): call inset::update before requesting
4827 * src/insets/insettext.C (update):
4828 * src/insets/insettabular.C (update): added implementation
4830 * src/insets/lyxinset.h: added update function
4832 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4834 * src/text.C (SelectNextWord): protect against null pointers with
4835 old-style string streams. (fix from Paul Theo Gonciari
4838 * src/cite.[Ch]: remove erroneous files.
4840 * lib/configure.m4: update the list of created directories.
4842 * src/lyxrow.C: include <config.h>
4843 * src/lyxcursor.C: ditto.
4845 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4847 * lib/examples/decimal.lyx: new example file from Mike.
4849 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4850 to find template definitions (from Dekel)
4852 * src/frontends/.cvsignore: add a few things.
4854 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4856 * src/Timeout.C (TimeOut): remove default argument.
4858 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4861 * src/insets/ExternalTemplate.C: add a "using" directive.
4863 * src/lyx_main.h: remove the act_ struct, which seems unused
4866 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4868 * LyX Developers Meeting: All files changed, due to random C++ (by
4869 coincidence) code generator script.
4871 - external inset (cool!)
4872 - initial online editing of preferences
4873 - insettabular breaks insettext(s contents)
4875 - some DocBook fixes
4876 - example files update
4877 - other cool stuff, create a diff and look for yourself.
4879 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4881 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4882 -1 this is a non-line-breaking textinset.
4884 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4885 if there is no width set.
4887 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4889 * Lots of files: Merged the dialogbase branch.
4891 2000-06-09 Allan Rae <rae@lyx.org>
4893 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4894 and the Dispatch methods that used it.
4896 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4897 access to functions formerly kept in Dispatch.
4899 2000-05-19 Allan Rae <rae@lyx.org>
4901 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4902 made to_page and count_copies integers again. from_page remains a
4903 string however because I want to allow entry of a print range like
4904 "1,4,22-25" using this field.
4906 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4907 and printer-params-get. These aren't useful from the minibuffer but
4908 could be used by a script/LyXServer app provided it passes a suitable
4909 auto_mem_buffer. I guess I should take a look at how the LyXServer
4910 works and make it support xtl buffers.
4912 * sigc++/: updated to libsigc++-1.0.1
4914 * src/xtl/: updated to xtl-1.3.pl.11
4916 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4917 those changes done to the files in src/ are actually recreated when
4918 they get regenerated. Please don't ever accept a patch that changes a
4919 dialog unless that patch includes the changes to the corresponding *.fd
4922 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4923 stringOnlyContains, renamed it and generalised it.
4925 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4926 branch. Removed the remaining old form_print code.
4928 2000-04-26 Allan Rae <rae@lyx.org>
4930 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4931 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4933 2000-04-25 Allan Rae <rae@lyx.org>
4935 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4936 against a base of xtl-1.3.pl.4
4938 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4939 filter the Id: entries so they still show the xtl version number
4942 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4943 into the src/xtl code. Patch still pending with José (XTL)
4945 2000-04-24 Allan Rae <rae@lyx.org>
4947 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4948 both more generic and much safer. Use the new template functions.
4949 * src/buffer.[Ch] (Dispatch): ditto.
4951 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4952 and mem buffer more intelligently. Also a little general cleanup.
4955 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4956 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4957 * src/xtl/Makefile.am: ditto.
4958 * src/xtl/.cvsignore: ditto.
4959 * src/Makefile.am: ditto.
4961 * src/PrinterParams.h: Removed the macros member functions. Added a
4962 testInvariant member function. A bit of tidying up and commenting.
4963 Included Angus's idea for fixing operation with egcs-1.1.2.
4965 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4966 cool expansion of XTL's mem_buffer to support automatic memory
4967 management within the buffer itself. Removed the various macros and
4968 replaced them with template functions that use either auto_mem_buffer
4969 or mem_buffer depending on a #define. The mem_buffer support will
4970 disappear as soon as the auto_mem_buffer is confirmed to be good on
4971 other platforms/compilers. That is, it's there so you've got something
4974 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4975 effectively forked XTL. However I expect José will include my code
4976 into the next major release. Also fixed a memory leak.
4977 * src/xtl/text.h: ditto.
4978 * src/xtl/xdr.h: ditto.
4979 * src/xtl/giop.h: ditto.
4981 2000-04-16 Allan Rae <rae@lyx.org>
4983 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4984 by autogen.sh and removed by maintainer-clean anyway.
4985 * .cvsignore, sigc++/.cvsignore: Support the above.
4987 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4989 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4991 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4992 macros, renamed static callback-target member functions to suit new
4993 scheme and made them public.
4994 * src/frontends/xforms/forms/form_print.fd: ditto.
4995 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4997 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5000 * src/xtl/: New directory containing a minimal distribution of XTL.
5001 This is XTL-1.3.pl.4.
5003 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5005 2000-04-15 Allan Rae <rae@lyx.org>
5007 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5009 * sigc++/: Updated to libsigc++-1.0.0
5011 2000-04-14 Allan Rae <rae@lyx.org>
5013 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5014 use the generic ones in future. I'll modify my conversion script.
5016 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5018 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5019 (CloseAllBufferRelatedDialogs): Renamed.
5020 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5022 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5023 of the generic ones. These are the same ones my conversion script
5026 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5027 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5028 * src/buffer.C (Dispatch): ditto
5030 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5031 functions for updating and hiding buffer dependent dialogs.
5032 * src/BufferView.C (buffer): ditto
5033 * src/buffer.C (setReadonly): ditto
5034 * src/lyxfunc.C (CloseBuffer): ditto
5036 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5037 Dialogs.h, and hence all the SigC stuff, into every file that includes
5038 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5040 * src/BufferView2.C: reduce the number of headers included by buffer.h
5042 2000-04-11 Allan Rae <rae@lyx.org>
5044 * src/frontends/xforms/xform_macros.h: A small collection of macros
5045 for building C callbacks.
5047 * src/frontends/xforms/Makefile.am: Added above file.
5049 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5050 scheme again. This time it should work for JMarc. If this is
5051 successful I'll revise my conversion script to automate some of this.
5052 The static member functions in the class also have to be public for
5053 this scheme will work. If the scheme works (it's almost identical to
5054 the way BufferView::cursorToggleCB is handled so it should work) then
5055 FormCopyright and FormPrint will be ready for inclusion into the main
5056 trunk immediately after 1.1.5 is released -- provided we're prepared
5057 for complaints about lame compilers not handling XTL.
5059 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5061 2000-04-07 Allan Rae <rae@lyx.org>
5063 * config/lyxinclude.m4: A bit more tidying up (Angus)
5065 * src/LString.h: JMarc's <string> header fix
5067 * src/PrinterParams.h: Used string for most data to remove some
5068 ugly code in the Print dialog and avoid even uglier code when
5069 appending the ints to a string for output.
5071 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5072 and moved "default:" back to the end of switch statement. Cleaned
5073 up the printing so it uses the right function calls and so the
5074 "print to file" option actually puts the file in the right directory.
5076 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5078 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5079 and Ok+Apply button control into a separate method: input (Angus).
5080 (input) Cleaned it up and improved it to be very thorough now.
5081 (All CB) static_cast used instead of C style cast (Angus). This will
5082 probably change again once we've worked out how to keep gcc-2.8.1 happy
5083 with real C callbacks.
5084 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5085 ignore some of the bool settings and has random numbers instead. Needs
5086 some more investigation. Added other input length checks and checking
5087 of file and printer names.
5089 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5090 would link (Angus). Seems the old code doesn't compile with the pragma
5091 statement either. Separated callback entries from internal methods.
5093 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5095 2000-03-17 Allan Rae <rae@lyx.org>
5097 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5098 need it? Maybe it could go in Dialogs instead? I could make it a
5099 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5100 values to get the bool return value.
5101 (Dispatch): New overloaded method for xtl support.
5103 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5104 extern "C" callback instead of static member functions. Hopefully,
5105 JMarc will be able to compile this. I haven't changed
5106 forms/form_copyright.fd yet. Breaking one of my own rules already.
5108 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5109 because they aren't useful from the minibuffer. Maybe a LyXServer
5110 might want a help message though?
5112 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5114 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5115 xtl which needs both rtti and exceptions.
5117 * src/support/Makefile.am:
5118 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5120 * src/frontends/xforms/input_validators.[ch]: input filters and
5121 validators. These conrol what keys are valid in input boxes.
5122 Use them and write some more. Much better idea than waiting till
5123 after the user has pressed Ok to say that the input fields don't make
5126 * src/frontends/xforms/Makefile.am:
5127 * src/frontends/xforms/forms/form_print.fd:
5128 * src/frontends/xforms/forms/makefile:
5129 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5130 new scheme. Still have to make sure I haven't missed anything from
5131 the current implementation.
5133 * src/Makefile.am, src/PrinterParams.h: New data store.
5135 * other files: Added a couple of copyright notices.
5137 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5139 * src/insets/insetbib.h: move Holder struct in public space.
5141 * src/frontends/include/DialogBase.h: use SigC:: only when
5142 SIGC_CXX_NAMESPACES is defined.
5143 * src/frontends/include/Dialogs.h: ditto.
5145 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5147 * src/frontends/xforms/FormCopyright.[Ch]: do not
5148 mention SigC:: explicitely.
5150 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5152 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5153 deals with testing KDE in main configure.in
5154 * configure.in: ditto.
5156 2000-02-22 Allan Rae <rae@lyx.org>
5158 * Lots of files: Merged from HEAD
5160 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5161 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5163 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5165 * sigc++/: new minidist.
5167 2000-02-14 Allan Rae <rae@lyx.org>
5169 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5171 2000-02-08 Juergen Vigna <jug@sad.it>
5173 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5174 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5176 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5177 for this port and so it is much easier for other people to port
5178 dialogs in a common development environment.
5180 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5181 the QT/KDE implementation.
5183 * src/frontends/kde/Dialogs.C:
5184 * src/frontends/kde/FormCopyright.C:
5185 * src/frontends/kde/FormCopyright.h:
5186 * src/frontends/kde/Makefile.am:
5187 * src/frontends/kde/formcopyrightdialog.C:
5188 * src/frontends/kde/formcopyrightdialog.h:
5189 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5190 for the kde support of the Copyright-Dialog.
5192 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5193 subdir-substitution instead of hardcoded 'xforms' as we now have also
5196 * src/frontends/include/DialogBase.h (Object): just commented the
5197 label after #endif (nasty warning and I don't like warnings ;)
5199 * src/main.C (main): added KApplication initialization if using
5202 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5203 For now only the KDE event-loop is added if frontend==kde.
5205 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5207 * configure.in: added support for the --with-frontend[=value] option
5209 * autogen.sh: added kde.m4 file to list of config-files
5211 * acconfig.h: added define for KDEGUI-support
5213 * config/kde.m4: added configuration functions for KDE-port
5215 * config/lyxinclude.m4: added --with-frontend[=value] option with
5216 support for xforms and KDE.
5218 2000-02-08 Allan Rae <rae@lyx.org>
5220 * all Makefile.am: Fixed up so the make targets dist, distclean,
5221 install and uninstall all work even if builddir != srcdir. Still
5222 have a new sigc++ minidist update to come.
5224 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5226 2000-02-01 Allan Rae <rae@lyx.org>
5228 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5229 Many mods to get builddir != srcdir working.
5231 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5232 for building on NT and so we can do the builddir != srcdir stuff.
5234 2000-01-30 Allan Rae <rae@lyx.org>
5236 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5237 This will stay in "rae" branch. We probably don't really need it in
5238 the main trunk as anyone who wants to help programming it should get
5239 a full library installed also. So they can check both included and
5240 system supplied library compilation.
5242 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5243 Added a 'mini' distribution of libsigc++. If you feel the urge to
5244 change something in these directories - Resist it. If you can't
5245 resist the urge then you should modify the following script and rebuild
5246 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5247 all happen. Still uses a hacked version of libsigc++'s configure.in.
5248 I'm quite happy with the results. I'm not sure the extra work to turn
5249 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5250 worth the trouble and would probably lead to extra maintenance
5252 I haven't tested the following important make targets: install, dist.
5253 Not ready for prime time but very close. Maybe 1.1.5.
5255 * development/tools/makeLyXsigc.sh: A shell script to automatically
5256 generate our mini-dist of libsigc++. It can only be used with a CVS
5257 checkout of libsigc++ not a tarball distribution. It's well commented.
5258 This will end up as part of the libsigc++ distribution so other apps
5259 can easily have an included mini-dist. If someone makes mods to the
5260 sigc++ subpackage without modifying this script to generate those
5261 changes I'll be very upset!
5263 * src/frontends/: Started the gui/system indep structure.
5265 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5266 to access the gui-indep dialogs are in this class. Much improved
5267 design compared to previous revision. Lars, please refrain from
5268 moving this header into src/ like you did with Popups.h last time.
5270 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5272 * src/frontends/xforms/: Started the gui-indep system with a single
5273 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5276 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5277 Here you'll find a very useful makefile and automated fdfix.sh that
5278 makes updating dailogs a no-brainer -- provided you follow the rules
5279 set out in the README. I'm thinking about adding another script to
5280 automatically generate skeleton code for a new dialog given just the
5283 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5284 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5285 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5287 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5289 * src/support/LSubstring.C (operator): simplify
5291 * src/lyxtext.h: removed bparams, use buffer_->params instead
5293 * src/lyxrow.h: make Row a real class, move all variables to
5294 private and use accessors.
5296 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5298 (isRightToLeftPar): ditto
5299 (ChangeLanguage): ditto
5300 (isMultiLingual): ditto
5303 (SimpleTeXOnePar): ditto
5304 (TeXEnvironment): ditto
5305 (GetEndLabel): ditto
5307 (SetOnlyLayout): ditto
5308 (BreakParagraph): ditto
5309 (BreakParagraphConservative): ditto
5310 (GetFontSettings): ditto
5312 (CopyIntoMinibuffer): ditto
5313 (CutIntoMinibuffer): ditto
5314 (PasteParagraph): ditto
5315 (SetPExtraType): ditto
5316 (UnsetPExtraType): ditto
5317 (DocBookContTableRows): ditto
5318 (SimpleDocBookOneTablePar): ditto
5320 (TeXFootnote): ditto
5321 (SimpleTeXOneTablePar): ditto
5322 (TeXContTableRows): ditto
5323 (SimpleTeXSpecialChars): ditto
5326 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5327 to private and use accessors.
5329 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5330 this, we did not use it anymore and has not been for ages. Just a
5331 waste of cpu cycles.
5333 * src/language.h: make Language a real class, move all variables
5334 to private and use accessors.
5336 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5337 (create_view): remove
5338 (update): some changes for new timer
5339 (cursorToggle): use new timer
5340 (beforeChange): change for new timer
5342 * src/BufferView.h (cursorToggleCB): removed last paramter because
5345 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5346 (cursorToggleCB): change because of new timer code
5348 * lib/CREDITS: updated own mailaddress
5350 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5352 * src/support/filetools.C (PutEnv): fix the code in case neither
5353 putenv() nor setenv() have been found.
5355 * INSTALL: mention the install-strip Makefile target.
5357 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5358 read-only documents.
5360 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5362 * lib/reLyX/configure.in (VERSION): avoid using a previously
5363 generated reLyX wrapper to find out $prefix.
5365 * lib/examples/eu_adibide_lyx-atua.lyx:
5366 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5367 translation of the Tutorial (Dooteo)
5369 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5371 * forms/cite.fd: new citation dialog
5373 * src/insetcite.[Ch]: the new citation dialog is moved into
5376 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5379 * src/insets/insetcommand.h: data members made private.
5381 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5383 * LyX 1.1.5 released
5385 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5387 * src/version.h (LYX_RELEASE): to 1.1.5
5389 * src/spellchecker.C (RunSpellChecker): return false if the
5390 spellchecker dies upon creation.
5392 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5394 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5395 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5399 * lib/CREDITS: update entry for Martin Vermeer.
5401 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5403 * src/text.C (draw): Draw foreign language bars at the bottom of
5404 the row instead of at the baseline.
5406 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5408 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5410 * lib/bind/de_menus.bind: updated
5412 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5414 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5416 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5418 * src/menus.C (Limit_string_length): New function
5419 (ShowTocMenu): Limit the number of items/length of items in the
5422 * src/paragraph.C (String): Correct result for a paragraph inside
5425 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5427 * src/bufferlist.C (close): test of buf->getuser() == NULL
5429 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5431 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5432 Do not call to SetCursor when the paragraph is a closed footnote!
5434 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5436 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5439 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5441 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5444 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5445 reference popup, that activates the reference-back action
5447 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5449 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5450 the menus. Also fixed a bug.
5452 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5453 the math panels when switching buffers (unless new buffer is readonly).
5455 * src/BufferView.C (NoSavedPositions)
5456 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5458 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5460 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5461 less of dvi dirty or not.
5463 * src/trans_mgr.[Ch] (insert): change first parameter to string
5466 * src/chset.[Ch] (encodeString): add const to first parameter
5468 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5470 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5474 * src/LaTeX.C (deplog): better searching for dependency files in
5475 the latex log. Uses now regexps.
5477 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5478 instead of the box hack or \hfill.
5480 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5482 * src/lyxfunc.C (doImportHelper): do not create the file before
5483 doing the actual import.
5484 (doImportASCIIasLines): create a new file before doing the insert.
5485 (doImportASCIIasParagraphs): ditto.
5487 * lib/lyxrc.example: remove mention of non-existing commands
5489 * lyx.man: remove mention of color-related switches.
5491 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5493 * src/lyx_gui.C: remove all the color-related ressources, which
5494 are not used anymore.
5496 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5499 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5501 * src/lyxrc.C (read): Add a missing break in the switch
5503 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5505 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5507 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5510 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5512 * src/text.C (draw): draw bars under foreign language words.
5514 * src/LColor.[Ch]: add LColor::language
5516 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5518 * src/lyxcursor.h (boundary): New member variable
5520 * src/text.C (IsBoundary): New methods
5522 * src/text.C: Use the above for currect cursor movement when there
5523 is both RTL & LTR text.
5525 * src/text2.C: ditto
5527 * src/bufferview_funcs.C (ToggleAndShow): ditto
5529 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5531 * src/text.C (DeleteLineForward): set selection to true to avoid
5532 that DeleteEmptyParagraphMechanism does some magic. This is how it
5533 is done in all other functions, and seems reasonable.
5534 (DeleteWordForward): do not jump over non-word stuff, since
5535 CursorRightOneWord() already does it.
5537 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5538 DeleteWordBackward, since they seem safe to me (since selection is
5539 set to "true") DeleteEmptyParagraphMechanism does nothing.
5541 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5543 * src/lyx_main.C (easyParse): simplify the code by factoring the
5544 part that removes parameters from the command line.
5545 (LyX): check wether wrong command line options have been given.
5547 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5549 * src/lyx_main.C : add support for specifying user LyX
5550 directory via command line option -userdir.
5552 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5554 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5555 the number of items per popup.
5556 (Add_to_refs_menu): Ditto.
5558 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5560 * src/lyxparagraph.h: renamed ClearParagraph() to
5561 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5562 textclass as parameter, and do nothing if free_spacing is
5563 true. This fixes part of the line-delete-forward problems.
5565 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5566 (pasteSelection): ditto.
5567 (SwitchLayoutsBetweenClasses): more translatable strings.
5569 * src/text2.C (CutSelection): use StripLeadingSpaces.
5570 (PasteSelection): ditto.
5571 (DeleteEmptyParagraphMechanism): ditto.
5573 2000-05-26 Juergen Vigna <jug@sad.it>
5575 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5576 is not needed in tabular insets.
5578 * src/insets/insettabular.C (TabularFeatures): added missing features.
5580 * src/tabular.C (DeleteColumn):
5582 (AppendRow): implemented this functions
5583 (cellsturct::operator=): clone the inset too;
5585 2000-05-23 Juergen Vigna <jug@sad.it>
5587 * src/insets/insettabular.C (LocalDispatch): better selection support
5588 when having multicolumn-cells.
5590 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5592 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5594 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5596 * src/ColorHandler.C (getGCForeground): put more test into _()
5598 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5601 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5604 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5606 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5607 there are no labels, or when buffer is readonly.
5609 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5610 there are no labels, buffer is SGML, or when buffer is readonly.
5612 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5614 * src/LColor.C (LColor): change a couple of grey40 to grey60
5615 (LColor): rewore initalization to make compiles go some magnitude
5617 (getGUIName): don't use gettext until we need the string.
5619 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5621 * src/Bullet.[Ch]: Fixed a small bug.
5623 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5625 * src/paragraph.C (String): Several fixes/improvements
5627 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5629 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5631 * src/paragraph.C (String): give more correct output.
5633 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5635 * src/lyxfont.C (stateText) Do not output the language if it is
5636 eqaul to the language of the document.
5638 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5639 between two paragraphs with the same language.
5641 * src/paragraph.C (getParLanguage) Return a correct answer for an
5642 empty dummy paragraph.
5644 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5647 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5650 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5651 the menus/popup, if requested fonts are unavailable.
5653 2000-05-22 Juergen Vigna <jug@sad.it>
5655 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5656 movement support (Up/Down/Tab/Shift-Tab).
5657 (LocalDispatch): added also preliminari cursor-selection.
5659 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5661 * src/paragraph.C (PasteParagraph): Hopefully now right!
5663 2000-05-22 Garst R. Reese <reese@isn.net>
5665 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5666 of list, change all references to Environment to Command
5667 * tex/hollywood.cls : rewrite environments as commands, add
5668 \uppercase to interiorshot and exteriorshot to force uppecase.
5669 * tex/broadway.cls : rewrite environments as commands. Tweak
5672 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5674 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5675 size of items: use a constant intead of the hardcoded 40, and more
5676 importantly do not remove the %m and %x tags added at the end.
5677 (Add_to_refs_menu): use vector::size_type instead of
5678 unsigned int as basic types for the variables. _Please_ do not
5679 assume that size_t is equal to unsigned int. On an alpha, this is
5680 unsigned long, which is _not_ the same.
5682 * src/language.C (initL): remove language "hungarian", since it
5683 seems that "magyar" is better.
5685 2000-05-22 Juergen Vigna <jug@sad.it>
5687 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5689 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5692 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5693 next was deleted but not set to 0.
5695 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5697 * src/language.C (initL): change the initialization of languages
5698 so that compiles goes _fast_.
5700 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5703 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5705 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5709 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5711 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5713 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5717 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5720 * src/insets/insetlo*.[Ch]: Made editable
5722 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5724 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5725 the current selection.
5727 * src/BufferView_pimpl.C (stuffClipboard): new method
5729 * src/BufferView.C (stuffClipboard): new method
5731 * src/paragraph.C (String): new method
5733 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5734 LColor::ignore when lyxname is not found.
5736 * src/BufferView.C (pasteSelection): new method
5738 * src/BufferView_pimpl.C (pasteSelection): new method
5740 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5742 * src/WorkArea.C (request_clipboard_cb): new static function
5743 (getClipboard): new method
5744 (putClipboard): new method
5746 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5748 * LyX 1.1.5pre2 released
5750 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5752 * src/vspace.C (operator=): removed
5753 (operator=): removed
5755 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5757 * src/layout.C (NumberOfClass): manually set the type in make_pair
5758 (NumberOfLayout): ditto
5760 * src/language.C: use the Language constructor for ignore_lang
5762 * src/language.h: add constructors to struct Language
5764 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5766 * src/text2.C (SetCursorIntern): comment out #warning
5768 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5770 * src/mathed/math_iter.h: initialize sx and sw to 0
5772 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5774 * forms/lyx.fd: Redesign of form_ref
5776 * src/LaTeXFeatures.[Ch]
5780 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5783 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5784 and Buffer::inset_iterator.
5786 * src/menus.C: Added new menus: TOC and Refs.
5788 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5790 * src/buffer.C (getTocList): New method.
5792 * src/BufferView2.C (ChangeRefs): New method.
5794 * src/buffer.C (getLabelList): New method. It replaces the old
5795 getReferenceList. The return type is vector<string> instead of
5798 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5799 the old getLabel() and GetNumberOfLabels() methods.
5800 * src/insets/insetlabel.C (getLabelList): ditto
5801 * src/mathed/formula.C (getLabelList): ditto
5803 * src/paragraph.C (String): New method.
5805 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5806 Uses the new getTocList() method.
5807 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5808 which automatically updates the contents of the browser.
5809 (RefUpdateCB): Use the new getLabelList method.
5811 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5813 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5815 * src/spellchecker.C: Added using std::reverse;
5817 2000-05-19 Juergen Vigna <jug@sad.it>
5819 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5821 * src/insets/insettext.C (computeTextRows): small fix for display of
5822 1 character after a newline.
5824 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5827 2000-05-18 Juergen Vigna <jug@sad.it>
5829 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5830 when changing width of column.
5832 * src/tabular.C (set_row_column_number_info): setting of
5833 autobreak rows if necessary.
5835 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5837 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5839 * src/vc-backend.*: renamed stat() to status() and vcstat to
5840 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5841 compilation broke. The new name seems more relevant, anyway.
5843 2000-05-17 Juergen Vigna <jug@sad.it>
5845 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5846 which was wrong if the removing caused removing of rows!
5848 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5849 (pushToken): new function.
5851 * src/text2.C (CutSelection): fix problem discovered with purify
5853 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5855 * src/debug.C (showTags): enlarge the first column, now that we
5856 have 6-digits debug codes.
5858 * lib/layouts/hollywood.layout:
5859 * lib/tex/hollywood.cls:
5860 * lib/tex/brodway.cls:
5861 * lib/layouts/brodway.layout: more commands and fewer
5862 environments. Preambles moved in the .cls files. Broadway now has
5863 more options on scene numbering and less whitespace (from Garst)
5865 * src/insets/insetbib.C (getKeys): make sure that we are in the
5866 document directory, in case the bib file is there.
5868 * src/insets/insetbib.C (Latex): revert bogus change.
5870 2000-05-16 Juergen Vigna <jug@sad.it>
5872 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5873 the TabularLayout on cursor move.
5875 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5877 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5880 (draw): fixed cursor position and drawing so that the cursor is
5881 visible when before the tabular-inset.
5883 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5884 when creating from old insettext.
5886 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5888 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5890 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5891 * lib/tex/brodway.cls: ditto
5893 * lib/layouts/brodway.layout: change alignment of parenthical
5896 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5898 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5899 versions 0.88 and 0.89 are supported.
5901 2000-05-15 Juergen Vigna <jug@sad.it>
5903 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5906 * src/insets/insettext.C (computeTextRows): redone completely this
5907 function in a much cleaner way, because of problems when having a
5909 (draw): added a frame border when the inset is locked.
5910 (SetDrawLockedFrame): this sets if we draw the border or not.
5911 (SetFrameColor): this sets the frame color (default=insetframe).
5913 * src/insets/lyxinset.h: added x() and y() functions which return
5914 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5915 function which is needed to see if we have a locking inset of some
5916 type in this inset (needed for now in insettabular).
5918 * src/vspace.C (inPixels): the same function also without a BufferView
5919 parameter as so it is easier to use it in some ocasions.
5921 * src/lyxfunc.C: changed all places where insertInset was used so
5922 that now if it couldn't be inserted it is deleted!
5924 * src/TabularLayout.C:
5925 * src/TableLayout.C: added support for new tabular-inset!
5927 * src/BufferView2.C (insertInset): this now returns a bool if the
5928 inset was really inserted!!!
5930 * src/tabular.C (GetLastCellInRow):
5931 (GetFirstCellInRow): new helper functions.
5932 (Latex): implemented for new tabular class.
5936 (TeXTopHLine): new Latex() helper functions.
5938 2000-05-12 Juergen Vigna <jug@sad.it>
5940 * src/mathed/formulamacro.C (Read):
5941 * src/mathed/formula.C (Read): read also the \end_inset here!
5943 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5945 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5946 crush when saving formulae with unbalanced parenthesis.
5948 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5950 * src/layout.C: Add new keyword "endlabelstring" to layout file
5952 * src/text.C (GetVisibleRow): Draw endlabel string.
5954 * lib/layouts/broadway.layout
5955 * lib/layouts/hollywood.layout: Added endlabel for the
5956 Parenthetical layout.
5958 * lib/layouts/heb-article.layout: Do not use slanted font shape
5959 for Theorem like environments.
5961 * src/buffer.C (makeLaTeXFile): Always add "american" to
5962 the UsedLanguages list if document language is RTL.
5964 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5966 * add addendum to README.OS2 and small patch (from SMiyata)
5968 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5970 * many files: correct the calls to ChangeExtension().
5972 * src/support/filetools.C (ChangeExtension): remove the no_path
5973 argument, which does not belong there. Use OnlyFileName() instead.
5975 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5976 files when LaTeXing a non-nice latex file.
5978 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5979 a chain of "if". Return false when deadkeys are not handled.
5981 * src/lyx_main.C (LyX): adapted the code for default bindings.
5983 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5984 bindings for basic functionality (except deadkeys).
5985 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5987 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5988 several methods: handle override_x_deadkeys.
5990 * src/lyxrc.h: remove the "bindings" map, which did not make much
5991 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5993 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5995 * src/lyxfont.C (stateText): use a saner method to determine
5996 whether the font is "default". Seems to fix the crash with DEC
5999 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6001 2000-05-08 Juergen Vigna <jug@sad.it>
6003 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6004 TabularLayoutMenu with mouse-button-3
6005 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6007 * src/TabularLayout.C: added this file for having a Layout for
6010 2000-05-05 Juergen Vigna <jug@sad.it>
6012 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6013 recalculating inset-widths.
6014 (TabularFeatures): activated this function so that I can change
6015 tabular-features via menu.
6017 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6018 that I can test some functions with the Table menu.
6020 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6022 * src/lyxfont.C (stateText): guard against stupid c++libs.
6024 * src/tabular.C: add using std::vector
6025 some whitespace changes, + removed som autogenerated code.
6027 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6029 2000-05-05 Juergen Vigna <jug@sad.it>
6031 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6032 row, columns and cellstructures.
6034 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6036 * lib/lyxrc.example: remove obsolete entries.
6038 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6039 reading of protected_separator for free_spacing.
6041 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6043 * src/text.C (draw): do not display an exclamation mark in the
6044 margin for margin notes. This is confusing, ugly and
6047 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6048 AMS math' is checked.
6050 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6051 name to see whether including the amsmath package is needed.
6053 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6055 * src/paragraph.C (validate): Compute UsedLanguages correctly
6056 (don't insert the american language if it doesn't appear in the
6059 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6060 The argument of \thanks{} command is considered moving argument
6062 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6065 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6067 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6068 for appendix/minipage/depth. The lines can be now both in the footnote
6069 frame, and outside the frame.
6071 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6074 2000-05-05 Juergen Vigna <jug@sad.it>
6076 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6077 neede only in tabular.[Ch].
6079 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6081 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6083 (Write): write '~' for PROTECTED_SEPARATOR
6085 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6087 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6090 * src/mathed/formula.C (drawStr): rename size to siz.
6092 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6093 possibly fix a bug by not changing the pflags = flags to piflags =
6096 2000-05-05 Juergen Vigna <jug@sad.it>
6098 * src/insets/insetbib.C: moved using directive
6100 * src/ImportNoweb.C: small fix for being able to compile (missing
6103 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6105 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6106 to use clear, since we don't depend on this in the code. Add test
6109 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6111 * (various *.C files): add using std::foo directives to please dec
6114 * replace calls to string::clear() to string::erase() (Angus)
6116 * src/cheaders/cmath: modified to provide std::abs.
6118 2000-05-04 Juergen Vigna <jug@sad.it>
6120 * src/insets/insettext.C: Prepared all for inserting of multiple
6121 paragraphs. Still display stuff to do (alignment and other things),
6122 but I would like to use LyXText to do this when we cleaned out the
6123 table-support stuff.
6125 * src/insets/insettabular.C: Changed lot of stuff and added lots
6126 of functionality still a lot to do.
6128 * src/tabular.C: Various functions changed name and moved to be
6129 const functions. Added new Read and Write functions and changed
6130 lots of things so it works good with tabular-insets (also removed
6131 some stuff which is not needed anymore * hacks *).
6133 * src/lyxcursor.h: added operators == and != which just look if
6134 par and pos are (not) equal.
6136 * src/buffer.C (latexParagraphs): inserted this function to latex
6137 all paragraphs form par to endpar as then I can use this too for
6140 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6141 so that I can call this to from text insets with their own cursor.
6143 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6144 output off all paragraphs (because of the fix below)!
6146 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6147 the very last paragraph (this could be also the last paragraph of an
6150 * src/texrow.h: added rows() call which returns the count-variable.
6152 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6154 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6156 * lib/configure.m4: better autodetection of DocBook tools.
6158 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6160 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6162 * src/lyx_cb.C: add using std::reverse;
6164 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6167 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6168 selected files. Should fix repeated errors from generated files.
6170 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6172 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6174 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6175 the spellchecker popup.
6177 * lib/lyxrc.example: Removed the \number_inset section
6179 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6181 * src/insets/figinset.C (various): Use IsFileReadable() to make
6182 sure that the file actually exist. Relying on ghostscripts errors
6183 is a bad idea since they can lead to X server crashes.
6185 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6187 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6190 * lib/lyxrc.example: smallish typo in description of
6191 \view_dvi_paper_option
6193 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6196 * src/lyxfunc.C: doImportHelper to factor out common code of the
6197 various import methods. New functions doImportASCIIasLines,
6198 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6199 doImportLinuxDoc for the format specific parts.
6202 * buffer.C: Dispatch returns now a bool to indicate success
6205 * lyx_gui.C: Add getLyXView() for member access
6207 * lyx_main.C: Change logic for batch commands: First try
6208 Buffer::Dispatch (possibly without GUI), if that fails, use
6211 * lyx_main.C: Add support for --import command line switch.
6212 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6213 Available Formats: Everything accepted by 'buffer-import <format>'
6215 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6217 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6220 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6221 documents will be reformatted upon reentry.
6223 2000-04-27 Juergen Vigna <jug@sad.it>
6225 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6226 correctly only last pos this was a bug.
6228 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6230 * release of lyx-1.1.5pre1
6232 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6234 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6236 * src/menus.C: revert the change of naming (Figure->Graphic...)
6237 from 2000-04-11. It was incomplete and bad.
6239 * src/LColor.[Ch]: add LColor::depthbar.
6240 * src/text.C (GetVisibleRow): use it.
6242 * README: update the languages list.
6244 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6246 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6249 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6251 * README: remove sections that were just wrong.
6253 * src/text2.C (GetRowNearY): remove currentrow code
6255 * src/text.C (GetRow): remove currentrow code
6257 * src/screen.C (Update): rewritten a bit.
6258 (SmallUpdate): removed func
6260 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6262 (FullRebreak): return bool
6263 (currentrow): remove var
6264 (currentrow_y): ditto
6266 * src/lyxscreen.h (Draw): change arg to unsigned long
6267 (FitCursor): return bool
6268 (FitManualCursor): ditto
6269 (Smallpdate): remove func
6270 (first): change to unsigned long
6271 (DrawOneRow): change second arg to long (from long &)
6272 (screen_refresh_y): remove var
6273 (scree_refresh_row): ditto
6275 * src/lyxrow.h: change baseline to usigned int from unsigned
6276 short, this brings some implicit/unsigned issues out in the open.
6278 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6280 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6281 instead of smallUpdate.
6283 * src/lyxcursor.h: change y to unsigned long
6285 * src/buffer.h: don't call updateScrollbar after fitcursor
6287 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6288 where they are used. Removed "\\direction", this was not present
6289 in 1.1.4 and is already obsolete. Commented out some code that I
6290 believe to never be called.
6291 (runLiterate): don't call updateScrollbar after fitCursor
6293 (buildProgram): ditto
6296 * src/WorkArea.h (workWidth): change return val to unsigned
6299 (redraw): remove the button redraws
6300 (setScrollbarValue): change for scrollbar
6301 (getScrollbarValue): change for scrollbar
6302 (getScrollbarBounds): change for scrollbar
6304 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6305 (C_WorkArea_down_cb): removed func
6306 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6307 (resize): change for scrollbar
6308 (setScrollbar): ditto
6309 (setScrollbarBounds): ditto
6310 (setScrollbarIncrements): ditto
6311 (up_cb): removed func
6312 (down_cb): removed func
6313 (scroll_cb): change for scrollbar
6314 (work_area_handler): ditto
6316 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6317 when FitCursor did something.
6318 (updateScrollbar): some unsigned changes
6319 (downCB): removed func
6320 (scrollUpOnePage): removed func
6321 (scrollDownOnePage): remvoed func
6322 (workAreaMotionNotify): don't call screen->FitCursor but use
6323 fitCursor instead. and bool return val
6324 (workAreaButtonPress): ditto
6325 (workAreaButtonRelease): some unsigned changes
6326 (checkInsetHit): ditto
6327 (workAreaExpose): ditto
6328 (update): parts rewritten, comments about the signed char arg added
6329 (smallUpdate): removed func
6330 (cursorPrevious): call needed updateScrollbar
6333 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6336 * src/BufferView.[Ch] (upCB): removed func
6337 (downCB): removed func
6338 (smallUpdate): removed func
6340 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6342 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6343 currentrow, currentrow_y optimization. This did not help a lot and
6344 if we want to do this kind of optimization we should rather use
6345 cursor.row instead of the currentrow.
6347 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6348 buffer spacing and klyx spacing support.
6350 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6352 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6355 2000-04-26 Juergen Vigna <jug@sad.it>
6357 * src/insets/figinset.C: fixes to Lars sstream changes!
6359 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6361 * A lot of files: Added Ascii(ostream &) methods to all inset
6362 classes. Used when exporting to ASCII.
6364 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6365 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6368 * src/text2.C (ToggleFree): Disabled implicit word selection when
6369 there is a change in the language
6371 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6372 no output was generated for end-of-sentence inset.
6374 * src/insets/lyxinset.h
6377 * src/paragraph.C: Removed the insetnumber code
6379 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6381 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6383 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6384 no_babel and no_epsfig completely from the file.
6385 (parseSingleLyXformat2Token): add handling for per-paragraph
6386 spacing as written by klyx.
6388 * src/insets/figinset.C: applied patch by Andre. Made it work with
6391 2000-04-20 Juergen Vigna <jug@sad.it>
6393 * src/insets/insettext.C (cutSelection):
6394 (copySelection): Fixed with selection from right to left.
6395 (draw): now the rows are not recalculated at every draw.
6396 (computeTextRows): for now reset the inset-owner here (this is
6397 important for an undo or copy where the inset-owner is not set
6400 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6401 motion to the_locking_inset screen->first was forgotten, this was
6402 not important till we got multiline insets.
6404 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6406 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6407 code seems to be alright (it is code changed by Dekel, and the
6408 intent is indeed that all macros should be defined \protect'ed)
6410 * NEWS: a bit of reorganisation of the new user-visible features.
6412 2000-04-19 Juergen Vigna <jug@sad.it>
6414 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6415 position. Set the inset_owner of the used paragraph so that it knows
6416 that it is inside an inset. Fixed cursor handling with mouse and
6417 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6418 and cleanups to make TextInsets work better.
6420 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6421 Changed parameters of various functions and added LockInsetInInset().
6423 * src/insets/insettext.C:
6425 * src/insets/insetcollapsable.h:
6426 * src/insets/insetcollapsable.C:
6427 * src/insets/insetfoot.h:
6428 * src/insets/insetfoot.C:
6429 * src/insets/insetert.h:
6430 * src/insets/insetert.C: cleaned up the code so that it works now
6431 correctly with insettext.
6433 * src/insets/inset.C:
6434 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6435 that insets in insets are supported right.
6438 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6440 * src/paragraph.C: some small fixes
6442 * src/debug.h: inserted INSETS debug info
6444 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6445 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6447 * src/commandtags.h:
6448 * src/LyXAction.C: insert code for InsetTabular.
6450 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6451 not Button1MotionMask.
6452 (workAreaButtonRelease): send always a InsetButtonRelease event to
6454 (checkInsetHit): some setCursor fixes (always with insets).
6456 * src/BufferView2.C (lockInset): returns a bool now and extended for
6457 locking insets inside insets.
6458 (showLockedInsetCursor): it is important to have the cursor always
6459 before the locked inset.
6460 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6462 * src/BufferView.h: made lockInset return a bool.
6464 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6466 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6467 that is used also internally but can be called as public to have back
6468 a cursor pos which is not set internally.
6469 (SetCursorIntern): Changed to use above function.
6471 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6473 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6478 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6479 patches for things that should be in or should be changed.
6481 * src/* [insetfiles]: change "usigned char fragile" to bool
6482 fragile. There was only one point that could that be questioned
6483 and that is commented in formulamacro.C. Grep for "CHECK".
6485 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6486 (DeleteBuffer): take it out of CutAndPaste and make it static.
6488 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6490 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6491 output the spacing envir commands. Also the new commands used in
6492 the LaTeX output makes the result better.
6494 * src/Spacing.C (writeEnvirBegin): new method
6495 (writeEnvirEnd): new method
6497 2000-04-18 Juergen Vigna <jug@sad.it>
6499 * src/CutAndPaste.C: made textclass a static member of the class
6500 as otherwise it is not accesed right!!!
6502 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6504 * forms/layout_forms.fd
6505 * src/layout_forms.h
6506 * src/layout_forms.C (create_form_form_character)
6507 * src/lyx_cb.C (UserFreeFont)
6508 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6509 documents (in the layout->character popup).
6511 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6513 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6514 \spell_command was in fact not honored (from Kevin Atkinson).
6516 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6519 * src/lyx_gui.h: make lyxViews private (Angus)
6521 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6523 * src/mathed/math_write.C
6524 (MathMatrixInset::Write) Put \protect before \begin{array} and
6525 \end{array} if fragile
6526 (MathParInset::Write): Put \protect before \\ if fragile
6528 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6530 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6531 initialization if the LyXColorHandler must be done after the
6532 connections to the XServer has been established.
6534 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6535 get the background pixel from the lyxColorhandler so that the
6536 figures are rendered with the correct background color.
6537 (NextToken): removed functions.
6538 (GetPSSizes): use ifs >> string instead of NextToken.
6540 * src/Painter.[Ch]: the color cache moved out of this file.
6542 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6545 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6547 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6548 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6550 * src/BufferView.C (enterView): new func
6551 (leaveView): new func
6553 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6555 (leaveView): new func, undefines xterm cursor when approp.
6557 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6558 (AllowInput): delete the Workarea cursor handling from this func.
6560 * src/Painter.C (underline): draw a slimer underline in most cases.
6562 * src/lyx_main.C (error_handler): use extern "C"
6564 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6566 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6567 sent directly to me.
6569 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6570 to the list by Dekel.
6572 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6575 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6576 methods from lyx_cb.here.
6578 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6581 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6583 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6584 instead of using current_view directly.
6586 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6588 * src/LyXAction.C (init): add the paragraph-spacing command.
6590 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6592 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6594 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6595 different from the documents.
6597 * src/text.C (SetHeightOfRow): take paragraph spacing into
6598 account, paragraph spacing takes precedence over buffer spacing
6599 (GetVisibleRow): ditto
6601 * src/paragraph.C (writeFile): output the spacing parameter too.
6602 (validate): set the correct features if spacing is used in the
6604 (Clear): set spacing to default
6605 (MakeSameLayout): spacing too
6606 (HasSameLayout): spacing too
6607 (SetLayout): spacing too
6608 (TeXOnePar): output the spacing commands
6610 * src/lyxparagraph.h: added a spacing variable for use with
6611 per-paragraph spacing.
6613 * src/Spacing.h: add a Default spacing and a method to check if
6614 the current spacing is default. also added an operator==
6616 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6619 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6621 * src/lyxserver.C (callback): fix dispatch of functions
6623 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6624 printf() into lyxerr call.
6626 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6629 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6630 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6631 the "Float" from each of the subitems.
6632 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6634 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6635 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6636 documented the change so that the workaround can be nuked later.
6638 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6641 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6643 * src/buffer.C (getLatexName): ditto
6644 (setReadonly): ditto
6646 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6648 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6649 avoid some uses of current_view. Added also a bufferParams()
6650 method to get at this.
6652 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6654 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6656 * src/lyxparagraph.[Ch]: removed
6657 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6658 with operators used by lower_bound and
6659 upper_bound in InsetTable's
6660 Make struct InsetTable private again. Used matchpos.
6662 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6664 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6665 document, the language of existing text is changed (unless the
6666 document is multi-lingual)
6668 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6670 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6672 * A lot of files: A rewrite of the Right-to-Left support.
6674 2000-04-10 Juergen Vigna <jug@sad.it>
6676 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6677 misplaced cursor when inset in inset is locked.
6679 * src/insets/insettext.C (LocalDispatch): small fix so that a
6680 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6682 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6683 footnote font should be decreased in size twice when displaying.
6685 * src/insets/insettext.C (GetDrawFont): inserted this function as
6686 the drawing-font may differ from the real paragraph font.
6688 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6689 insets (inset in inset!).
6691 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6692 function here because we don't want footnotes inside footnotes.
6694 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6696 (init): now set the inset_owner in paragraph.C
6697 (LocalDispatch): added some resetPos() in the right position
6700 (pasteSelection): changed to use the new CutAndPaste-Class.
6702 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6703 which tells if it is allowed to insert another inset inside this one.
6705 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6706 SwitchLayoutsBetweenClasses.
6708 * src/text2.C (InsertInset): checking of the new paragraph-function
6710 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6711 is not needed anymore here!
6714 (PasteSelection): redone (also with #ifdef) so that now this uses
6715 the CutAndPaste-Class.
6716 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6719 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6720 from/to text/insets.
6722 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6723 so that the paragraph knows if it is inside an (text)-inset.
6724 (InsertFromMinibuffer): changed return-value to bool as now it
6725 may happen that an inset is not inserted in the paragraph.
6726 (InsertInsetAllowed): this checks if it is allowed to insert an
6727 inset in this paragraph.
6729 (BreakParagraphConservative):
6730 (BreakParagraph) : small change for the above change of the return
6731 value of InsertFromMinibuffer.
6733 * src/lyxparagraph.h: added inset_owner and the functions to handle
6734 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6736 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6738 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6739 functions from BufferView to BufferView::Pimpl to ease maintence.
6741 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6742 correctly. Also use SetCursorIntern instead of SetCursor.
6744 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6747 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6749 * src/WorkArea.C (belowMouse): manually implement below mouse.
6751 * src/*: Add "explicit" on several constructors, I added probably
6752 some unneeded ones. A couple of changes to code because of this.
6754 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6755 implementation and private parts from the users of BufferView. Not
6758 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6759 implementation and private parts from the users of LyXLex. Not
6762 * src/BufferView_pimpl.[Ch]: new files
6764 * src/lyxlex_pimpl.[Ch]: new files
6766 * src/LyXView.[Ch]: some inline functions move out-of-line
6768 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6770 * src/lyxparagraph.h: make struct InsetTable public.
6772 * src/support/lyxstring.h: change lyxstring::difference_type to be
6773 ptrdiff_t. Add std:: modifiers to streams.
6775 * src/font.C: include the <cctype> header, for islower() and
6778 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6780 * src/font.[Ch]: new files. Contains the metric functions for
6781 fonts, takes a LyXFont as parameter. Better separation of concepts.
6783 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6784 changes because of this.
6786 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6788 * src/*: compile with -Winline and move functions that don't
6791 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6794 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6796 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6797 (various files changed because of this)
6799 * src/Painter.C (text): fixed the drawing of smallcaps.
6801 * src/lyxfont.[Ch] (drawText): removed unused member func.
6804 * src/*.C: added needed "using" statements and "std::" qualifiers.
6806 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6808 * src/*.h: removed all use of "using" from header files use
6809 qualifier std:: instead.
6811 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6813 * src/text.C (Backspace): some additional cleanups (we already
6814 know whether cursor.pos is 0 or not).
6816 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6817 automake does not provide one).
6819 * src/bmtable.h: replace C++ comments with C comments.
6821 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6823 * src/screen.C (ShowCursor): Change the shape of the cursor if
6824 the current language is not equal to the language of the document.
6825 (If the cursor change its shape unexpectedly, then you've found a bug)
6827 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6830 * src/insets/insetnumber.[Ch]: New files.
6832 * src/LyXAction.C (init)
6833 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6836 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6838 * src/lyxparagraph.h
6839 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6840 (the vector is kept sorted).
6842 * src/text.C (GetVisibleRow): Draw selection correctly when there
6843 is both LTR and RTL text.
6845 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6846 which is much faster.
6848 * src/text.C (GetVisibleRow and other): Do not draw the last space
6849 in a row if the direction of the last letter is not equal to the
6850 direction of the paragraph.
6852 * src/lyxfont.C (latexWriteStartChanges):
6853 Check that font language is not equal to basefont language.
6854 (latexWriteEndChanges): ditto
6856 * src/lyx_cb.C (StyleReset): Don't change the language while using
6857 the font-default command.
6859 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6860 empty paragraph before a footnote.
6862 * src/insets/insetcommand.C (draw): Increase x correctly.
6864 * src/screen.C (ShowCursor): Change cursor shape if
6865 current language != document language.
6867 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6869 2000-03-31 Juergen Vigna <jug@sad.it>
6871 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6872 (Clone): changed mode how the paragraph-data is copied to the
6873 new clone-paragraph.
6875 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6876 GetInset(pos) with no inset anymore there (in inset UNDO)
6878 * src/insets/insetcommand.C (draw): small fix as here x is
6879 incremented not as much as width() returns (2 before, 2 behind = 4)
6881 2000-03-30 Juergen Vigna <jug@sad.it>
6883 * src/insets/insettext.C (InsetText): small fix in initialize
6884 widthOffset (should not be done in the init() function)
6886 2000-03-29 Amir Karger <karger@lyx.org>
6888 * lib/examples/it_ItemizeBullets.lyx: translation by
6891 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6893 2000-03-29 Juergen Vigna <jug@sad.it>
6895 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6897 * src/insets/insetfoot.C (Clone): small change as for the below
6898 new init function in the text-inset
6900 * src/insets/insettext.C (init): new function as I've seen that
6901 clone did not copy the Paragraph-Data!
6902 (LocalDispatch): Added code so that now we have some sort of Undo
6903 functionality (well actually we HAVE Undo ;)
6905 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6907 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6909 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6912 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6914 * src/main.C: added a runtime check that verifies that the xforms
6915 header used when building LyX and the library used when running
6916 LyX match. Exit with a message if they don't match. This is a
6917 version number check only.
6919 * src/buffer.C (save): Don't allocate memory on the heap for
6920 struct utimbuf times.
6922 * *: some using changes, use iosfwd instead of the real headers.
6924 * src/lyxfont.C use char const * instead of string for the static
6925 strings. Rewrite some functions to use sstream.
6927 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6929 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6932 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6934 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6935 of Geodesy (from Martin Vermeer)
6937 * lib/layouts/svjour.inc: include file for the Springer svjour
6938 class. It can be used to support journals other than JoG.
6940 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6941 Miskiewicz <misiek@pld.org.pl>)
6942 * lib/reLyX/Makefile.am: ditto.
6944 2000-03-27 Juergen Vigna <jug@sad.it>
6946 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6947 also some modifications with operations on selected text.
6949 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6950 problems with clicking on insets (last famous words ;)
6952 * src/insets/insetcommand.C (draw):
6953 (width): Changed to have a bit of space before and after the inset so
6954 that the blinking cursor can be seen (otherwise it was hidden)
6956 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6958 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6959 would not be added to the link list when an installed gettext (not
6960 part of libc) is found.
6962 2000-03-24 Juergen Vigna <jug@sad.it>
6964 * src/insets/insetcollapsable.C (Edit):
6965 * src/mathed/formula.C (InsetButtonRelease):
6966 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6969 * src/BufferView.C (workAreaButtonPress):
6970 (workAreaButtonRelease):
6971 (checkInsetHit): Finally fixed the clicking on insets be handled
6974 * src/insets/insetert.C (Edit): inserted this call so that ERT
6975 insets work always with LaTeX-font
6977 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6979 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6980 caused lyx to startup with no GUI in place, causing in a crash
6981 upon startup when called with arguments.
6983 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6985 * src/FontLoader.C: better initialization of dummyXFontStruct.
6987 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6989 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6990 for linuxdoc and docbook import and export format options.
6992 * lib/lyxrc.example Example of default values for the previous flags.
6994 * src/lyx_cb.C Use those flags instead of the hardwired values for
6995 linuxdoc and docbook export.
6997 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7000 * src/menus.C Added menus entries for the new import/exports formats.
7002 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7004 * src/lyxrc.*: Added support for running without Gui
7007 * src/FontLoader.C: sensible defaults if no fonts are needed
7009 * src/lyx_cb.C: New function ShowMessage (writes either to the
7010 minibuffer or cout in case of no gui
7011 New function AskOverwrite for common stuff
7012 Consequently various changes to call these functions
7014 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7015 wild guess at sensible screen resolution when having no gui
7017 * src/lyxfont.C: no gui, no fonts... set some defaults
7019 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7021 * src/LColor.C: made the command inset background a bit lighter.
7023 2000-03-20 Hartmut Goebel <goebel@noris.net>
7025 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7026 stdstruct.inc. Koma-Script added some title elements which
7027 otherwise have been listed below "bibliography". This split allows
7028 adding title elements to where they belong.
7030 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7031 define the additional title elements and then include
7034 * many other layout files: changed to include stdtitle.inc just
7035 before stdstruct.inc.
7037 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7039 * src/buffer.C: (save) Added the option to store all backup files
7040 in a single directory
7042 * src/lyxrc.[Ch]: Added variable \backupdir_path
7044 * lib/lyxrc.example: Added descriptions of recently added variables
7046 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7047 bibtex inset, not closing the bibtex popup when deleting the inset)
7049 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7051 * src/lyx_cb.C: add a couple using directives.
7053 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7054 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7055 import based on the filename.
7057 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7058 file would be imported at start, if the filename where of a sgml file.
7060 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7062 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7064 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7065 * src/lyxfont.h Replaced the member variable bits.direction by the
7066 member variable lang. Made many changes in other files.
7067 This allows having a multi-lingual document
7069 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7070 that change the current language to <l>.
7071 Removed the command "font-rtl"
7073 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7074 format for Hebrew documents)
7076 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7077 When auto_mathmode is "true", pressing a digit key in normal mode
7078 will cause entering into mathmode.
7079 If auto_mathmode is "rtl" then this behavior will be active only
7080 when writing right-to-left text.
7082 * src/text2.C (InsertStringA) The string is inserted using the
7085 * src/paragraph.C (GetEndLabel) Gives a correct result for
7086 footnote paragraphs.
7088 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7090 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7092 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7093 front of PasteParagraph. Never insert a ' '. This should at least
7094 fix some cause for the segfaults that we have been experiencing,
7095 it also fixes backspace behaviour slightly. (Phu!)
7097 * src/support/lstrings.C (compare_no_case): some change to make it
7098 compile with gcc 2.95.2 and stdlibc++-v3
7100 * src/text2.C (MeltFootnoteEnvironment): change type o
7101 first_footnote_par_is_not_empty to bool.
7103 * src/lyxparagraph.h: make text private. Changes in other files
7105 (fitToSize): new function
7106 (setContentsFromPar): new function
7107 (clearContents): new function
7108 (SetChar): new function
7110 * src/paragraph.C (readSimpleWholeFile): deleted.
7112 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7113 the file, just use a simple string instead. Also read the file in
7114 a more maintainable manner.
7116 * src/text2.C (InsertStringA): deleted.
7117 (InsertStringB): deleted.
7119 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7121 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7122 RedoParagraphs from the doublespace handling part, just set status
7123 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7124 done, but perhaps not like this.)
7126 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7128 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7129 character when inserting an inset.
7131 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7133 * src/bufferparams.C (readLanguage): now takes "default" into
7136 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7137 also initialize the toplevel_keymap with the default bindings from
7140 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7142 * all files using lyxrc: have lyxrc as a real variable and not a
7143 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7146 * src/lyxrc.C: remove double call to defaultKeyBindings
7148 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7149 toolbar defauls using lyxlex. Remove enums, structs, functions
7152 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7153 toolbar defaults. Also store default keybindings in a map.
7155 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7156 storing the toolbar defaults without any xforms dependencies.
7158 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7159 applied. Changed to use iterators.
7161 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7163 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7164 systems that don't have LINGUAS set to begin with.
7166 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7168 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7169 the list by Dekel Tsur.
7171 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7173 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7174 * src/insets/form_graphics.C: ditto.
7176 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7178 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7180 * src/bufferparams.C (readLanguage): use the new language map
7182 * src/intl.C (InitKeyMapper): use the new language map
7184 * src/lyx_gui.C (create_forms): use the new language map
7186 * src/language.[Ch]: New files. Used for holding the information
7187 about each language. Now! Use this new language map enhance it and
7188 make it really usable for our needs.
7190 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7192 * screen.C (ShowCursor): Removed duplicate code.
7193 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7194 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7196 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7199 * src/text.C Added TransformChar method. Used for rendering Arabic
7200 text correctly (change the glyphs of the letter according to the
7201 position in the word)
7206 * src/lyxrc.C Added lyxrc command {language_command_begin,
7207 language_command_end,language_command_ltr,language_command_rtl,
7208 language_package} which allows the use of either arabtex or Omega
7211 * src/lyx_gui.C (init)
7213 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7214 to use encoding for menu fonts which is different than the encoding
7217 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7218 do not load the babel package.
7219 To write an English document with Hebrew/Arabic, change the document
7220 language to "english".
7222 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7223 (alphaCounter): changed to return char
7224 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7226 * lib/lyxrc.example Added examples for Hebrew/Arabic
7229 * src/layout.C Added layout command endlabeltype
7231 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7233 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7235 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7237 * src/mathed/math_delim.C (search_deco): return a
7238 math_deco_struct* instead of index.
7240 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7242 * All files with a USE_OSTREAM_ONLY within: removed all code that
7243 was unused when USE_OSTREAM_ONLY is defined.
7245 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7246 of any less. Removed header and using.
7248 * src/text.C (GetVisibleRow): draw the string "Page Break
7249 (top/bottom)" on screen when drawing a pagebreak line.
7251 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7253 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7255 * src/mathed/math_macro.C (draw): do some cast magic.
7258 * src/mathed/math_defs.h: change byte* argument to byte const*.
7260 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7262 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7263 know it is right to return InsetFoot* too, but cxx does not like
7266 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7268 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7270 * src/mathed/math_delim.C: change == to proper assignment.
7272 2000-03-09 Juergen Vigna <jug@sad.it>
7274 * src/insets/insettext.C (setPos): fixed various cursor positioning
7275 problems (via mouse and cursor-keys)
7276 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7277 inset (still a small display problem but it works ;)
7279 * src/insets/insetcollapsable.C (draw): added button_top_y and
7280 button_bottom_y to have correct values for clicking on the inset.
7282 * src/support/lyxalgo.h: commented out 'using std::less'
7284 2000-03-08 Juergen Vigna <jug@sad.it>
7286 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7287 Button-Release event closes as it is alos the Release-Event
7290 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7292 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7294 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7295 can add multiple spaces in Scrap (literate programming) styles...
7296 which, by the way, is how I got hooked on LyX to begin with.
7298 * src/mathed/formula.C (Write): Added dummy variable to an
7299 inset::Latex() call.
7300 (Latex): Add free_spacing boolean to inset::Latex()
7302 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7304 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7305 virtual function to include the free_spacing boolean from
7306 the containing paragraph's style.
7308 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7309 Added free_spacing boolean arg to match inset.h
7311 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7312 Added free_spacing boolean arg to match inset.h
7314 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7315 Added free_spacing boolean and made sure that if in a free_spacing
7316 paragraph, that we output normal space if there is a protected space.
7318 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7319 Added free_spacing boolean arg to match inset.h
7321 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7322 Added free_spacing boolean arg to match inset.h
7324 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7325 Added free_spacing boolean arg to match inset.h
7327 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7328 Added free_spacing boolean arg to match inset.h
7330 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7331 Added free_spacing boolean arg to match inset.h
7333 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7334 free_spacing boolean arg to match inset.h
7336 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7337 Added free_spacing boolean arg to match inset.h
7339 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7340 Added free_spacing boolean arg to match inset.h
7342 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7343 Added free_spacing boolean arg to match inset.h
7345 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7346 Added free_spacing boolean arg to match inset.h
7348 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7349 Added free_spacing boolean arg to match inset.h
7351 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7352 free_spacing boolean arg to match inset.h
7354 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7355 free_spacing boolean arg to match inset.h
7357 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7358 ignore free_spacing paragraphs. The user's spaces are left
7361 * src/text.C (InsertChar): Fixed the free_spacing layout
7362 attribute behavior. Now, if free_spacing is set, you can
7363 add multiple spaces in a paragraph with impunity (and they
7364 get output verbatim).
7365 (SelectSelectedWord): Added dummy argument to inset::Latex()
7368 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7371 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7372 paragraph layouts now only input a simple space instead.
7373 Special character insets don't make any sense in free-spacing
7376 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7377 hard-spaces in the *input* file to simple spaces if the layout
7378 is free-spacing. This converts old files which had to have
7379 hard-spaces in free-spacing layouts where a simple space was
7381 (writeFileAscii): Added free_spacing check to pass to the newly
7382 reworked inset::Latex(...) methods. The inset::Latex() code
7383 ensures that hard-spaces in free-spacing paragraphs get output
7384 as spaces (rather than "~").
7386 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7388 * src/mathed/math_delim.C (draw): draw the empty placeholder
7389 delims with a onoffdash line.
7390 (struct math_deco_compare): struct that holds the "functors" used
7391 for the sort and the binary search in math_deco_table.
7392 (class init_deco_table): class used for initial sort of the
7394 (search_deco): use lower_bound to do a binary search in the
7397 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7399 * src/lyxrc.C: a small secret thingie...
7401 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7402 and to not flush the stream as often as it used to.
7404 * src/support/lyxalgo.h: new file
7405 (sorted): template function used for checking if a sequence is
7406 sorted or not. Two versions with and without user supplied
7407 compare. Uses same compare as std::sort.
7409 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7410 it and give warning on lyxerr.
7412 (struct compare_tags): struct with function operators used for
7413 checking if sorted, sorting and lower_bound.
7414 (search_kw): use lower_bound instead of manually implemented
7417 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7419 * src/insets/insetcollapsable.h: fix Clone() declaration.
7420 * src/insets/insetfoot.h: ditto.
7422 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7424 2000-03-08 Juergen Vigna <jug@sad.it>
7426 * src/insets/lyxinset.h: added owner call which tells us if
7427 this inset is inside another inset. Changed also the return-type
7428 of Editable to an enum so it tells clearer what the return-value is.
7430 * src/insets/insettext.C (computeTextRows): fixed computing of
7431 textinsets which split automatically on more rows.
7433 * src/insets/insetert.[Ch]: changed this to be of BaseType
7436 * src/insets/insetfoot.[Ch]: added footnote inset
7438 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7439 collapsable insets (like footnote, ert, ...)
7441 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7443 * src/lyxdraw.h: remvoe file
7445 * src/lyxdraw.C: remove file
7447 * src/insets/insettext.C: added <algorithm>.
7449 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7451 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7452 (matrix_cb): case MM_OK use string stream
7454 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7457 * src/mathed/math_macro.C (draw): use string stream
7458 (Metrics): use string stream
7460 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7461 directly to the ostream.
7463 * src/vspace.C (asString): use string stream.
7464 (asString): use string stream
7465 (asLatexString): use string stream
7467 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7468 setting Spacing::Other.
7470 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7471 sprintf when creating the stretch vale.
7473 * src/text2.C (alphaCounter): changed to return a string and to
7474 not use a static variable internally. Also fixed a one-off bug.
7475 (SetCounter): changed the drawing of the labels to use string
7476 streams instead of sprintf.
7478 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7479 manipulator to use a scheme that does not require library support.
7480 This is also the way it is done in the new GNU libstdc++. Should
7481 work with DEC cxx now.
7483 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7485 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7486 end. This fixes a bug.
7488 * src/mathed (all files concerned with file writing): apply the
7489 USE_OSTREAM_ONLY changes to mathed too.
7491 * src/support/DebugStream.h: make the constructor explicit.
7493 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7494 count and ostream squashed.
7496 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7498 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7500 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7501 ostringstream uses STL strings, and we might not.
7503 * src/insets/insetspecialchar.C: add using directive.
7504 * src/insets/insettext.C: ditto.
7506 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7508 * lib/layouts/seminar.layout: feeble attempt at a layout for
7509 seminar.cls, far from completet and could really use some looking
7510 at from people used to write layout files.
7512 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7513 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7514 a lot nicer and works nicely with ostreams.
7516 * src/mathed/formula.C (draw): a slightly different solution that
7517 the one posted to the list, but I think this one works too. (font
7518 size wrong in headers.)
7520 * src/insets/insettext.C (computeTextRows): some fiddling on
7521 Jürgens turf, added some comments that he should read.
7523 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7524 used and it gave compiler warnings.
7525 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7528 * src/lyx_gui.C (create_forms): do the right thing when
7529 show_banner is true/false.
7531 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7532 show_banner is false.
7534 * most file writing files: Now use iostreams to do almost all of
7535 the writing. Also instead of passing string &, we now use
7536 stringstreams. mathed output is still not adapted to iostreams.
7537 This change can be turned off by commenting out all the occurences
7538 of the "#define USE_OSTREAM_ONLY 1" lines.
7540 * src/WorkArea.C (createPixmap): don't output debug messages.
7541 (WorkArea): don't output debug messages.
7543 * lib/lyxrc.example: added a comment about the new variable
7546 * development/Code_rules/Rules: Added some more commente about how
7547 to build class interfaces and on how better encapsulation can be
7550 2000-03-03 Juergen Vigna <jug@sad.it>
7552 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7553 automatically with the width of the LyX-Window
7555 * src/insets/insettext.C (computeTextRows): fixed update bug in
7556 displaying text-insets (scrollvalues where not initialized!)
7558 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7560 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7561 id in the check of the result from lower_bound is not enough since
7562 lower_bound can return last too, and then res->id will not be a
7565 * all insets and some code that use them: I have conditionalized
7566 removed the Latex(string & out, ...) this means that only the
7567 Latex(ostream &, ...) will be used. This is a work in progress to
7568 move towards using streams for all output of files.
7570 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7573 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7575 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7576 routine (this fixes bug where greek letters were surrounded by too
7579 * src/support/filetools.C (findtexfile): change a bit the search
7580 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7581 no longer passed to kpsewhich, we may have to change that later.
7583 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7584 warning options to avoid problems with X header files (from Angus
7586 * acinclude.m4: regenerated.
7588 2000-03-02 Juergen Vigna <jug@sad.it>
7590 * src/insets/insettext.C (WriteParagraphData): Using the
7591 par->writeFile() function for writing paragraph-data.
7592 (Read): Using buffer->parseSingleLyXformat2Token()-function
7593 for parsing paragraph data!
7595 * src/buffer.C (readLyXformat2): removed all parse data and using
7596 the new parseSingleLyXformat2Token()-function.
7597 (parseSingleLyXformat2Token): added this function to parse (read)
7598 lyx-file-format (this is called also from text-insets now!)
7600 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7602 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7605 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7606 directly instead of going through a func. One very bad thing: a
7607 static LyXFindReplace, but I don't know where to place it.
7609 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7610 string instead of char[]. Also changed to static.
7611 (GetSelectionOrWordAtCursor): changed to static inline
7612 (SetSelectionOverLenChars): ditto.
7614 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7615 current_view and global variables. both classes has changed names
7616 and LyXFindReplace is not inherited from SearchForm.
7618 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7619 fl_form_search form.
7621 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7623 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7625 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7626 bound (from Kayvan).
7628 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7630 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7632 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7634 * some things that I should comment but the local pub says head to
7637 * comment out all code that belongs to the Roff code for Ascii
7638 export of tables. (this is unused)
7640 * src/LyXView.C: use correct type for global variable
7641 current_layout. (LyXTextClass::size_type)
7643 * some code to get the new insetgraphics closer to working I'd be
7644 grateful for any help.
7646 * src/BufferView2.C (insertInset): use the return type of
7647 NumberOfLayout properly. (also changes in other files)
7649 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7650 this as a test. I want to know what breaks because of this.
7652 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7654 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7656 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7657 to use a \makebox in the label, this allows proper justification
7658 with out using protected spaces or multiple hfills. Now it is
7659 "label" for left justified, "\hfill label\hfill" for center, and
7660 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7661 should be changed accordingly.
7663 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7665 * src/lyxtext.h: change SetLayout() to take a
7666 LyXTextClass::size_type instead of a char (when there is more than
7667 127 layouts in a class); also change type of copylayouttype.
7668 * src/text2.C (SetLayout): ditto.
7669 * src/LyXView.C (updateLayoutChoice): ditto.
7671 * src/LaTeX.C (scanLogFile): errors where the line number was not
7672 given just after the '!'-line were ignored (from Dekel Tsur).
7674 * lib/lyxrc.example: fix description of \date_insert_format
7676 * lib/layouts/llncs.layout: new layout, contributed by Martin
7679 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7681 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7682 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7683 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7684 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7685 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7686 paragraph.C, text.C, text2.C)
7688 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7690 * src/insets/insettext.C (LocalDispatch): remove extra break
7693 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7694 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7696 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7697 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7699 * src/insets/insetbib.h: move InsetBibkey::Holder and
7700 InsetCitation::Holder in public space.
7702 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7704 * src/insets/insettext.h: small change to get the new files from
7705 Juergen to compile (use "string", not "class string").
7707 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7708 const & as parameter to LocalDispatch, use LyXFont const & as
7709 paramter to some other func. This also had impacto on lyxinsets.h
7710 and the two mathed insets.
7712 2000-02-24 Juergen Vigna <jug@sad.it>
7715 * src/commandtags.h:
7717 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7721 * src/BufferView2.C: added/updated code for various inset-functions
7723 * src/insets/insetert.[Ch]: added implementation of InsetERT
7725 * src/insets/insettext.[Ch]: added implementation of InsetText
7727 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7728 (draw): added preliminary code for inset scrolling not finshed yet
7730 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7731 as it is in lyxfunc.C now
7733 * src/insets/lyxinset.h: Added functions for text-insets
7735 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7737 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7738 BufferView and reimplement the list as a queue put inside its own
7741 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7743 * several files: use the new interface to the "updateinsetlist"
7745 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7747 (work_area_handler): call BufferView::trippleClick on trippleclick.
7749 * src/BufferView.C (doubleClick): new function, selects word on
7751 (trippleClick): new function, selects line on trippleclick.
7753 2000-02-22 Allan Rae <rae@lyx.org>
7755 * lib/bind/xemacs.bind: buffer-previous not supported
7757 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7759 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7762 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7764 * src/bufferlist.C: get rid of current_view from this file
7766 * src/spellchecker.C: get rid of current_view from this file
7768 * src/vspace.C: get rid of current_view from this file
7769 (inPixels): added BufferView parameter for this func
7770 (asLatexCommand): added a BufferParams for this func
7772 * src/text.C src/text2.C: get rid of current_view from these
7775 * src/lyxfont.C (getFontDirection): move this function here from
7778 * src/bufferparams.C (getDocumentDirection): move this function
7781 * src/paragraph.C (getParDirection): move this function here from
7783 (getLetterDirection): ditto
7785 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7787 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7788 resize due to wrong pixmap beeing used. Also took the opurtunity
7789 to make the LyXScreen stateless on regard to WorkArea and some
7790 general cleanup in the same files.
7792 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7794 * src/Makefile.am: add missing direction.h
7796 * src/PainterBase.h: made the width functions const.
7798 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7801 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7803 * src/insets/insetlatexaccent.C (draw): make the accents draw
7804 better, at present this will only work well with iso8859-1.
7806 * several files: remove the old drawing code, now we use the new
7809 * several files: remove support for mono_video, reverse_video and
7812 2000-02-17 Juergen Vigna <jug@sad.it>
7814 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7815 int ** as we have to return the pointer, otherwise we have only
7816 NULL pointers in the returning function.
7818 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7820 * src/LaTeX.C (operator()): quote file name when running latex.
7822 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7824 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7825 (bubble tip), this removes our special handling of this.
7827 * Remove all code that is unused now that we have the new
7828 workarea. (Code that are not active when NEW_WA is defined.)
7830 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7832 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7834 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7835 nonexisting layout; correctly redirect obsoleted layouts.
7837 * lib/lyxrc.example: document \view_dvi_paper_option
7839 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7842 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7843 (PreviewDVI): handle the view_dvi_paper_option variable.
7844 [Both from Roland Krause]
7846 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7848 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7849 char const *, int, LyXFont)
7850 (text(int, int, string, LyXFont)): ditto
7852 * src/text.C (InsertCharInTable): attempt to fix the double-space
7853 feature in tables too.
7854 (BackspaceInTable): ditto.
7855 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7857 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7859 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7861 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7862 newly found text in textcache to this.
7863 (buffer): set the owner of the text put into the textcache to 0
7865 * src/insets/figinset.C (draw): fixed the drawing of figures with
7868 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7869 drawing of mathframe, hfills, protected space, table lines. I have
7870 now no outstanding drawing problems with the new Painter code.
7872 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7874 * src/PainterBase.C (ellipse, circle): do not specify the default
7877 * src/LColor.h: add using directive.
7879 * src/Painter.[Ch]: change return type of methods from Painter& to
7880 PainterBase&. Add a using directive.
7882 * src/WorkArea.C: wrap xforms callbacks in C functions
7885 * lib/layouts/foils.layout: font fix and simplifications from Carl
7888 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7890 * a lot of files: The Painter, LColor and WorkArea from the old
7891 devel branch has been ported to lyx-devel. Some new files and a
7892 lot of #ifdeffed code. The new workarea is enabled by default, but
7893 if you want to test the new Painter and LColor you have to compile
7894 with USE_PAINTER defined (do this in config.h f.ex.) There are
7895 still some rought edges, and I'd like some help to clear those
7896 out. It looks stable (loads and displays the Userguide very well).
7899 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7901 * src/buffer.C (pop_tag): revert to the previous implementation
7902 (use a global variable for both loops).
7904 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7906 * src/lyxrc.C (LyXRC): change slightly default date format.
7908 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7909 there is an English text with a footnote that starts with a Hebrew
7910 paragraph, or vice versa.
7911 (TeXFootnote): ditto.
7913 * src/text.C (LeftMargin): allow for negative values for
7914 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7917 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7918 for input encoding (cyrillic)
7920 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7922 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7925 * src/toolbar.C (set): ditto
7926 * src/insets/insetbib.C (create_form_citation_form): ditto
7928 * lib/CREDITS: added Dekel Tsur.
7930 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7931 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7932 hebrew supports files from Dekel Tsur.
7934 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7935 <tzafrir@technion.ac.il>
7937 * src/lyxrc.C: put \date_insert_format at the right place.
7939 * src/buffer.C (makeLaTeXFile): fix the handling of
7940 BufferParams::sides when writing out latex files.
7942 * src/BufferView2.C: add a "using" directive.
7944 * src/support/lyxsum.C (sum): when we use lyxstring,
7945 ostringstream::str needs an additional .c_str().
7947 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7949 * src/support/filetools.C (ChangeExtension): patch from Etienne
7952 * src/TextCache.C (show): remove const_cast and make second
7953 parameter non-const LyXText *.
7955 * src/TextCache.h: use non const LyXText in show.
7957 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7960 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7962 * src/support/lyxsum.C: rework to be more flexible.
7964 * several places: don't check if a pointer is 0 if you are going
7967 * src/text.C: remove some dead code.
7969 * src/insets/figinset.C: remove some dead code
7971 * src/buffer.C: move the BufferView funcs to BufferView2.C
7972 remove all support for insetlatexdel
7973 remove support for oldpapersize stuff
7974 made some member funcs const
7976 * src/kbmap.C: use a std::list to store the bindings in.
7978 * src/BufferView2.C: new file
7980 * src/kbsequence.[Ch]: new files
7982 * src/LyXAction.C + others: remove all trace of buffer-previous
7984 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7985 only have one copy in the binary of this table.
7987 * hebrew patch: moved some functions from LyXText to more
7988 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7990 * several files: remove support for XForms older than 0.88
7992 remove some #if 0 #endif code
7994 * src/TextCache.[Ch]: new file. Holds the textcache.
7996 * src/BufferView.C: changes to use the new TextCache interface.
7997 (waitForX): remove the now unused code.
7999 * src/BackStack.h: remove some commented code
8001 * lib/bind/emacs.bind: remove binding for buffer-previous
8003 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8005 * applied the hebrew patch.
8007 * src/lyxrow.h: make sure that all Row variables are initialized.
8009 * src/text2.C (TextHandleUndo): comment out a delete, this might
8010 introduce a memory leak, but should also help us to not try to
8011 read freed memory. We need to look at this one.
8013 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8014 (LyXParagraph): initalize footnotekind.
8016 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8017 forgot this when applying the patch. Please heed the warnings.
8019 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8020 (aka. reformat problem)
8022 * src/bufferlist.C (exists): made const, and use const_iterator
8023 (isLoaded): new func.
8024 (release): use std::find to find the correct buffer.
8026 * src/bufferlist.h: made getState a const func.
8027 made empty a const func.
8028 made exists a const func.
8031 2000-02-01 Juergen Vigna <jug@sad.it>
8033 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8035 * po/it.po: updated a bit the italian po file and also changed the
8036 'file nuovo' for newfile to 'filenuovo' without a space, this did
8039 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8040 for the new insert_date command.
8042 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8043 from jdblair, to insert a date into the current text conforming to
8044 a strftime format (for now only considering the locale-set and not
8045 the document-language).
8047 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8049 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8050 Bounds Read error seen by purify. The problem was that islower is
8051 a macros which takes an unsigned char and uses it as an index for
8052 in array of characters properties (and is thus subject to the
8056 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8057 correctly the paper sides radio buttons.
8058 (UpdateDocumentButtons): ditto.
8060 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8062 * src/kbmap.C (getsym + others): change to return unsigned int,
8063 returning a long can give problems on 64 bit systems. (I assume
8064 that int is 32bit on 64bit systems)
8066 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8068 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8069 LyXLookupString to be zero-terminated. Really fixes problems seen
8072 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8074 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8075 write a (char*)0 to the lyxerr stream.
8077 * src/lastfiles.C: move algorithm before the using statemets.
8079 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8081 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8082 complains otherwise).
8083 * src/table.C: ditto
8085 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8088 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8089 that I removed earlier... It is really needed.
8091 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8093 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8095 * INSTALL: update xforms home page URL.
8097 * lib/configure.m4: fix a bug with unreadable layout files.
8099 * src/table.C (calculate_width_of_column): add "using std::max"
8102 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8104 * several files: marked several lines with "DEL LINE", this is
8105 lines that can be deleted without changing anything.
8106 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8107 checks this anyway */
8110 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8112 * src/DepTable.C (update): add a "+" at the end when the checksum
8113 is different. (debugging string only)
8115 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8116 the next inset to not be displayed. This should also fix the list
8117 of labels in the "Insert Crossreference" dialog.
8119 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8121 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8122 when regex was not found.
8124 * src/support/lstrings.C (lowercase): use handcoded transform always.
8127 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8128 old_cursor.par->prev could be 0.
8130 * several files: changed post inc/dec to pre inc/dec
8132 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8133 write the lastfiles to file.
8135 * src/BufferView.C (buffer): only show TextCache info when debugging
8137 (resizeCurrentBuffer): ditto
8138 (workAreaExpose): ditto
8140 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8142 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8144 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8145 a bit better by removing the special case for \i and \j.
8147 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8149 * src/lyx_main.C (easyParse): remove test for bad comand line
8150 options, since this broke all xforms-related parsing.
8152 * src/kbmap.C (getsym): set return type to unsigned long, as
8153 declared in header. On an alpha, long is _not_ the same as int.
8155 * src/support/LOstream.h: add a "using std::flush;"
8157 * src/insets/figinset.C: ditto.
8159 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8161 * src/bufferlist.C (write): use blinding fast file copy instead of
8162 "a char at a time", now we are doing it the C++ way.
8164 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8165 std::list<int> instead.
8166 (addpidwait): reflect move to std::list<int>
8167 (sigchldchecker): ditto
8169 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8172 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8173 that obviously was wrong...
8175 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8176 c, this avoids warnings with purify and islower.
8178 * src/insets/figinset.C: rename struct queue to struct
8179 queue_element and rewrite to use a std::queue. gsqueue is now a
8180 std::queue<queue_element>
8181 (runqueue): reflect move to std::queue
8184 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8185 we would get "1" "0" instead of "true" "false. Also make the tostr
8188 2000-01-21 Juergen Vigna <jug@sad.it>
8190 * src/buffer.C (writeFileAscii): Disabled code for special groff
8191 handling of tabulars till I fix this in table.C
8193 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8195 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8197 * src/support/lyxlib.h: ditto.
8199 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8201 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8202 and 'j' look better. This might fix the "macron" bug that has been
8205 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8206 functions as one template function. Delete the old versions.
8208 * src/support/lyxsum.C: move using std::ifstream inside
8211 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8214 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8216 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8218 * src/insets/figinset.C (InitFigures): use new instead of malloc
8219 to allocate memory for figures and bitmaps.
8220 (DoneFigures): use delete[] instead of free to deallocate memory
8221 for figures and bitmaps.
8222 (runqueue): use new to allocate
8223 (getfigdata): use new/delete[] instead of malloc/free
8224 (RegisterFigure): ditto
8226 * some files: moved some declarations closer to first use, small
8227 whitespace changes use preincrement instead of postincrement where
8228 it does not make a difference.
8230 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8231 step on the way to use stl::containers for key maps.
8233 * src/bufferlist.h: add a typedef for const_iterator and const
8234 versions of begin and end.
8236 * src/bufferlist.[Ch]: change name of member variable _state to
8237 state_. (avoid reserved names)
8239 (getFileNames): returns the filenames of the buffers in a vector.
8241 * configure.in (ALL_LINGUAS): added ro
8243 * src/support/putenv.C: new file
8245 * src/support/mkdir.C: new file
8247 2000-01-20 Allan Rae <rae@lyx.org>
8249 * lib/layouts/IEEEtran.layout: Added several theorem environments
8251 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8252 couple of minor additions.
8254 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8255 (except for those in footnotes of course)
8257 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8259 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8261 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8262 std::sort and std::lower_bound instead of qsort and handwritten
8264 (struct compara): struct that holds the functors used by std::sort
8265 and std::lower_bound in MathedLookupBOP.
8267 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8269 * src/support/LAssert.h: do not do partial specialization. We do
8272 * src/support/lyxlib.h: note that lyx::getUserName() and
8273 lyx::date() are not in use right now. Should these be suppressed?
8275 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8276 (makeLinuxDocFile): do not put date and user name in linuxdoc
8279 * src/support/lyxlib.h (kill): change first argument to long int,
8280 since that's what solaris uses.
8282 * src/support/kill.C (kill): fix declaration to match prototype.
8284 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8285 actually check whether namespaces are supported. This is not what
8288 * src/support/lyxsum.C: add a using directive.
8290 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8292 * src/support/kill.C: if we have namespace support we don't have
8293 to include lyxlib.h.
8295 * src/support/lyxlib.h: use namespace lyx if supported.
8297 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8299 * src/support/date.C: new file
8301 * src/support/chdir.C: new file
8303 * src/support/getUserName.C: new file
8305 * src/support/getcwd.C: new file
8307 * src/support/abort.C: new file
8309 * src/support/kill.C: new file
8311 * src/support/lyxlib.h: moved all the functions in this file
8312 insede struct lyx. Added also kill and abort to this struct. This
8313 is a way to avoid the "kill is not defined in <csignal>", we make
8314 C++ wrappers for functions that are not ANSI C or ANSI C++.
8316 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8317 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8318 lyx it has been renamed to sum.
8320 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8322 * src/text.C: add using directives for std::min and std::max.
8324 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8326 * src/texrow.C (getIdFromRow): actually return something useful in
8327 id and pos. Hopefully fixes the bug with positionning of errorbox
8330 * src/lyx_main.C (easyParse): output an error and exit if an
8331 incorrect command line option has been given.
8333 * src/spellchecker.C (ispell_check_word): document a memory leak.
8335 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8336 where a "struct utimbuf" is allocated with "new" and deleted with
8339 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8341 * src/text2.C (CutSelection): don't delete double spaces.
8342 (PasteSelection): ditto
8343 (CopySelection): ditto
8345 * src/text.C (Backspace): don't delete double spaces.
8347 * src/lyxlex.C (next): fix a bug that were only present with
8348 conformant std::istream::get to read comment lines, use
8349 std::istream::getline instead. This seems to fix the problem.
8351 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8353 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8354 allowed to insert space before space" editing problem. Please read
8355 commends at the beginning of the function. Comments about usage
8358 * src/text.C (InsertChar): fix for the "not allowed to insert
8359 space before space" editing problem.
8361 * src/text2.C (DeleteEmptyParagraphMechanism): when
8362 IsEmptyTableRow can only return false this last "else if" will
8363 always be a no-op. Commented out.
8365 * src/text.C (RedoParagraph): As far as I can understand tmp
8366 cursor is not really needed.
8368 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8369 present it could only return false anyway.
8370 (several functions): Did something not so smart...added a const
8371 specifier on a lot of methods.
8373 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8374 and add a tmp->text.resize. The LyXParagraph constructor does the
8376 (BreakParagraphConservative): ditto
8378 * src/support/path.h (Path): add a define so that the wrong usage
8379 "Path("/tmp") will be flagged as a compilation error:
8380 "`unnamed_Path' undeclared (first use this function)"
8382 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8384 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8385 which was bogus for several reasons.
8387 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8391 * autogen.sh: do not use "type -path" (what's that anyway?).
8393 * src/support/filetools.C (findtexfile): remove extraneous space
8394 which caused a kpsewhich warning (at least with kpathsea version
8397 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8399 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8401 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8403 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8405 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8407 * src/paragraph.C (BreakParagraph): do not reserve space on text
8408 if we don't need to (otherwise, if pos_end < pos, we end up
8409 reserving huge amounts of memory due to bad unsigned karma).
8410 (BreakParagraphConservative): ditto, although I have not seen
8411 evidence the bug can happen here.
8413 * src/lyxparagraph.h: add a using std::list.
8415 2000-01-11 Juergen Vigna <jug@sad.it>
8417 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8420 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8422 * src/vc-backend.C (doVCCommand): change to be static and take one
8423 more parameter: the path to chdir too be fore executing the command.
8424 (retrive): new function equiv to "co -r"
8426 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8427 file_not_found_hook is true.
8429 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8431 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8432 if a file is readwrite,readonly...anything else.
8434 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8436 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8437 (CreatePostscript): name change from MenuRunDVIPS (or something)
8438 (PreviewPostscript): name change from MenuPreviewPS
8439 (PreviewDVI): name change from MenuPreviewDVI
8441 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8442 \view_pdf_command., \pdf_to_ps_command
8444 * lib/configure.m4: added search for PDF viewer, and search for
8445 PDF to PS converter.
8446 (lyxrc.defaults output): add \pdflatex_command,
8447 \view_pdf_command and \pdf_to_ps_command.
8449 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8451 * src/bufferlist.C (write): we don't use blocksize for anything so
8454 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8456 * src/support/block.h: disable operator T* (), since it causes
8457 problems with both compilers I tried. See comments in the file.
8459 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8462 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8463 variable LYX_DIR_10x to LYX_DIR_11x.
8465 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8467 * INSTALL: document --with-lyxname.
8470 * configure.in: new configure flag --with-lyxname which allows to
8471 choose the name under which lyx is installed. Default is "lyx", of
8472 course. It used to be possible to do this with --program-suffix,
8473 but the later has in fact a different meaning for autoconf.
8475 * src/support/lstrings.h (lstrchr): reformat a bit.
8477 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8478 * src/mathed/math_defs.h: ditto.
8480 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8482 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8483 true, decides if we create a backup file or not when saving. New
8484 tag and variable \pdf_mode, defaults to false. New tag and
8485 variable \pdflatex_command, defaults to pdflatex. New tag and
8486 variable \view_pdf_command, defaults to xpdf. New tag and variable
8487 \pdf_to_ps_command, defaults to pdf2ps.
8489 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8491 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8492 does not have a BufferView.
8493 (unlockInset): ditto + don't access the_locking_inset if the
8494 buffer does not have a BufferView.
8496 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8497 certain circumstances so that we don't continue a keyboard
8498 operation long after the key was released. Try f.ex. to load a
8499 large document, press PageDown for some seconds and then release
8500 it. Before this change the document would contine to scroll for
8501 some time, with this change it stops imidiatly.
8503 * src/support/block.h: don't allocate more space than needed. As
8504 long as we don't try to write to the arr[x] in a array_type arr[x]
8505 it is perfectly ok. (if you write to it you might segfault).
8506 added operator value_type*() so that is possible to pass the array
8507 to functions expecting a C-pointer.
8509 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8512 * intl/*: updated to gettext 0.10.35, tried to add our own
8513 required modifications. Please verify.
8515 * po/*: updated to gettext 0.10.35, tried to add our own required
8516 modifications. Please verify.
8518 * src/support/lstrings.C (tostr): go at fixing the problem with
8519 cxx and stringstream. When stringstream is used return
8520 oss.str().c_str() so that problems with lyxstring and basic_string
8521 are avoided. Note that the best solution would be for cxx to use
8522 basic_string all the way, but it is not conformant yet. (it seems)
8524 * src/lyx_cb.C + other files: moved several global functions to
8525 class BufferView, some have been moved to BufferView.[Ch] others
8526 are still located in lyx_cb.C. Code changes because of this. (part
8527 of "get rid of current_view project".)
8529 * src/buffer.C + other files: moved several Buffer functions to
8530 class BufferView, the functions are still present in buffer.C.
8531 Code changes because of this.
8533 * config/lcmessage.m4: updated to most recent. used when creating
8536 * config/progtest.m4: updated to most recent. used when creating
8539 * config/gettext.m4: updated to most recent. applied patch for
8542 * config/gettext.m4.patch: new file that shows what changes we
8543 have done to the local copy of gettext.m4.
8545 * config/libtool.m4: new file, used in creation of acinclude.m4
8547 * config/lyxinclude.m4: new file, this is the lyx created m4
8548 macros, used in making acinclude.m4.
8550 * autogen.sh: GNU m4 discovered as a separate task not as part of
8551 the lib/configure creation.
8552 Generate acinlucde from files in config. Actually cat
8553 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8554 easier to upgrade .m4 files that really are external.
8556 * src/Spacing.h: moved using std::istringstream to right after
8557 <sstream>. This should fix the problem seen with some compilers.
8559 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8561 * src/lyx_cb.C: began some work to remove the dependency a lot of
8562 functions have on BufferView::text, even if not really needed.
8563 (GetCurrentTextClass): removed this func, it only hid the
8566 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8567 forgot this in last commit.
8569 * src/Bullet.C (bulletEntry): use static char const *[] for the
8570 tables, becuase of this the return arg had to change to string.
8572 (~Bullet): removed unneeded destructor
8574 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8575 (insetSleep): moved from Buffer
8576 (insetWakeup): moved from Buffer
8577 (insetUnlock): moved from Buffer
8579 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8580 from Buffer to BufferView.
8582 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8584 * config/ltmain.sh: updated to version 1.3.4 of libtool
8586 * config/ltconfig: updated to version 1.3.4 of libtool
8588 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8591 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8592 Did I get that right?
8594 * src/lyxlex.h: add a "using" directive or two.
8595 * src/Spacing.h: ditto.
8596 * src/insets/figinset.C: ditto.
8597 * src/support/filetools.C: ditto.
8598 * src/support/lstrings.C: ditto.
8599 * src/BufferView.C: ditto.
8600 * src/bufferlist.C: ditto.
8601 * src/lyx_cb.C: ditto.
8602 * src/lyxlex.C: ditto.
8604 * NEWS: add some changes for 1.1.4.
8606 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8608 * src/BufferView.C: first go at a TextCache to speed up switching
8611 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8613 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8614 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8615 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8616 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8619 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8620 members of the struct are correctly initialized to 0 (detected by
8622 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8623 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8625 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8626 pidwait, since it was allocated with "new". This was potentially
8627 very bad. Thanks to Michael Schmitt for running purify for us.
8630 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8632 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8634 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8636 1999-12-30 Allan Rae <rae@lyx.org>
8638 * lib/templates/IEEEtran.lyx: minor change
8640 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8641 src/mathed/formula.C (LocalDispatch): askForText changes
8643 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8644 know when a user has cancelled input. Fixes annoying problems with
8645 inserting labels and version control.
8647 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8649 * src/support/lstrings.C (tostr): rewritten to use strstream and
8652 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8654 * src/support/filetools.C (IsFileWriteable): use fstream to check
8655 (IsDirWriteable): use fileinfo to check
8657 * src/support/filetools.h (FilePtr): whole class deleted
8659 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8661 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8663 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8665 * src/bufferlist.C (write): use ifstream and ofstream instead of
8668 * src/Spacing.h: use istrstream instead of sscanf
8670 * src/mathed/math_defs.h: change first arg to istream from FILE*
8672 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8674 * src/mathed/math_parser.C: have yyis to be an istream
8675 (LexGetArg): use istream (yyis)
8677 (mathed_parse): ditto
8678 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8680 * src/mathed/formula.C (Read): rewritten to use istream
8682 * src/mathed/formulamacro.C (Read): rewritten to use istream
8684 * src/lyxlex.h (~LyXLex): deleted desturctor
8685 (getStream): new function, returns an istream
8686 (getFile): deleted funtion
8687 (IsOK): return is.good();
8689 * src/lyxlex.C (LyXLex): delete file and owns_file
8690 (setFile): open an filebuf and assign that to a istream instead of
8692 (setStream): new function, takes an istream as arg.
8693 (setFile): deleted function
8694 (EatLine): rewritten us use istream instead of FILE*
8698 * src/table.C (LyXTable): use istream instead of FILE*
8699 (Read): rewritten to take an istream instead of FILE*
8701 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8703 * src/buffer.C (Dispatch): remove an extraneous break statement.
8705 * src/support/filetools.C (QuoteName): change to do simple
8706 'quoting'. More work is necessary. Also changed to do nothing
8707 under emx (needs fix too).
8708 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8710 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8711 config.h.in to the AC_DEFINE_UNQUOTED() call.
8712 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8713 needs char * as argument (because Solaris 7 declares it like
8716 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8717 remove definition of BZERO.
8719 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8721 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8722 defined, "lyxregex.h" if not.
8724 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8726 (REGEX): new variable that is set to regex.c lyxregex.h when
8727 AM_CONDITIONAL USE_REGEX is set.
8728 (libsupport_la_SOURCES): add $(REGEX)
8730 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8733 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8736 * configure.in: add call to LYX_REGEX
8738 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8739 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8741 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8743 * lib/bind/fi_menus.bind: new file, from
8744 pauli.virtanen@saunalahti.fi.
8746 * src/buffer.C (getBibkeyList): pass the parameter delim to
8747 InsetInclude::getKeys and InsetBibtex::getKeys.
8749 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8750 is passed to Buffer::getBibkeyList
8752 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8753 instead of the hardcoded comma.
8755 * src/insets/insetbib.C (getKeys): make sure that there are not
8756 leading blanks in bibtex keys. Normal latex does not care, but
8757 harvard.sty seems to dislike blanks at the beginning of citation
8758 keys. In particular, the retturn value of the function is
8760 * INSTALL: make it clear that libstdc++ is needed and that gcc
8761 2.7.x probably does not work.
8763 * src/support/filetools.C (findtexfile): make debug message go to
8765 * src/insets/insetbib.C (getKeys): ditto
8767 * src/debug.C (showTags): make sure that the output is correctly
8770 * configure.in: add a comment for TWO_COLOR_ICON define.
8772 * acconfig.h: remove all the entries that already defined in
8773 configure.in or acinclude.m4.
8775 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8776 to avoid user name, date and copyright.
8778 1999-12-21 Juergen Vigna <jug@sad.it>
8780 * src/table.C (Read): Now read bogus row format informations
8781 if the format is < 5 so that afterwards the table can
8782 be read by lyx but without any format-info. Fixed the
8783 crash we experienced when not doing this.
8785 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8787 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8788 (RedoDrawingOfParagraph): ditto
8789 (RedoParagraphs): ditto
8790 (RemoveTableRow): ditto
8792 * src/text.C (Fill): rename arg paperwidth -> paper_width
8794 * src/buffer.C (insertLyXFile): rename var filename -> fname
8795 (writeFile): rename arg filename -> fname
8796 (writeFileAscii): ditto
8797 (makeLaTeXFile): ditto
8798 (makeLinuxDocFile): ditto
8799 (makeDocBookFile): ditto
8801 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8804 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8806 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8809 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8810 compiled by a C compiler not C++.
8812 * src/layout.h (LyXTextClass): added typedef for const_iterator
8813 (LyXTextClassList): added typedef for const_iterator + member
8814 functions begin and end.
8816 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8817 iterators to fill the choice_class.
8818 (updateLayoutChoice): rewritten to use iterators to fill the
8819 layoutlist in the toolbar.
8821 * src/BufferView.h (BufferView::work_area_width): removed unused
8824 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8826 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8827 (sgmlCloseTag): ditto
8829 * src/support/lstrings.h: return type of countChar changed to
8832 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8833 what version of this func to use. Also made to return unsigned int.
8835 * configure.in: call LYX_STD_COUNT
8837 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8838 conforming std::count.
8840 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8842 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8843 and a subscript would give bad display (patch from Dekel Tsur
8844 <dekel@math.tau.ac.il>).
8846 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8848 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8851 * src/chset.h: add a few 'using' directives
8853 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8854 triggered when no buffer is active
8856 * src/layout.C: removed `break' after `return' in switch(), since
8859 * src/lyx_main.C (init): make sure LyX can be ran in place even
8860 when libtool has done its magic with shared libraries. Fix the
8861 test for the case when the system directory has not been found.
8863 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8864 name for the latex file.
8865 (MenuMakeHTML): ditto
8867 * src/buffer.h: add an optional boolean argument, which is passed
8870 1999-12-20 Allan Rae <rae@lyx.org>
8872 * lib/templates/IEEEtran.lyx: small correction and update.
8874 * configure.in: Attempted to use LYX_PATH_HEADER
8876 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8878 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8879 input from JMarc. Now use preprocessor to find the header.
8880 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8881 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8882 LYX_STL_STRING_FWD. See comments in file.
8884 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8886 * The global MiniBuffer * minibuffer variable is dead.
8888 * The global FD_form_main * fd_form_main variable is dead.
8890 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8892 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8894 * src/table.h: add the LOstream.h header
8895 * src/debug.h: ditto
8897 * src/LyXAction.h: change the explaination of the ReadOnly
8898 attribute: is indicates that the function _can_ be used.
8900 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8903 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8905 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8911 * src/paragraph.C (GetWord): assert on pos>=0
8914 * src/support/lyxstring.C: condition the use of an invariant on
8916 * src/support/lyxstring.h: ditto
8918 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8919 Use LAssert.h instead of plain assert().
8921 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8923 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8924 * src/support/filetools.C: ditto
8926 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8929 * INSTALL: document the new configure flags
8931 * configure.in: suppress --with-debug; add --enable-assertions
8933 * acinclude.m4: various changes in alignment of help strings.
8935 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8937 * src/kbmap.C: commented out the use of the hash map in kb_map,
8938 beginning of movement to a stl::container.
8940 * several files: removed code that was not in effect when
8941 MOVE_TEXT was defined.
8943 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8944 for escaping should not be used. We can discuss if the string
8945 should be enclosed in f.ex. [] instead of "".
8947 * src/trans_mgr.C (insert): use the new returned value from
8948 encodeString to get deadkeys and keymaps done correctly.
8950 * src/chset.C (encodeString): changed to return a pair, to tell
8951 what to use if we know the string.
8953 * src/lyxscreen.h (fillArc): new function.
8955 * src/FontInfo.C (resize): rewritten to use more std::string like
8956 structore, especially string::replace.
8958 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8961 * configure.in (chmod +x some scripts): remove config/gcc-hack
8963 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8965 * src/buffer.C (writeFile): change once again the top comment in a
8966 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8967 instead of an hardcoded version number.
8968 (makeDocBookFile): ditto
8970 * src/version.h: add new define LYX_DOCVERSION
8972 * po/de.po: update from Pit Sütterlin
8973 * lib/bind/de_menus.bind: ditto.
8975 * src/lyxfunc.C (Dispatch): call MenuExport()
8976 * src/buffer.C (Dispatch): ditto
8978 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8979 LyXFunc::Dispatch().
8980 (MenuExport): new function, moved from
8981 LyXFunc::Dispatch().
8983 * src/trans_mgr.C (insert): small cleanup
8984 * src/chset.C (loadFile): ditto
8986 * lib/kbd/iso8859-1.cdef: add missing backslashes
8988 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8990 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8991 help with placing the manually drawn accents better.
8993 (Draw): x2 and hg changed to float to minimize rounding errors and
8994 help place the accents better.
8996 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8997 unsigned short to char is just wrong...cast the char to unsigned
8998 char instead so that the two values can compare sanely. This
8999 should also make the display of insetlatexaccents better and
9000 perhaps also some other insets.
9002 (lbearing): new function
9005 1999-12-15 Allan Rae <rae@lyx.org>
9007 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9008 header that provides a wrapper around the very annoying SGI STL header
9011 * src/support/lyxstring.C, src/LString.h:
9012 removed old SGI-STL-compatability attempts.
9014 * configure.in: Use LYX_STL_STRING_FWD.
9016 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9017 stl_string_fwd.h is around and try to determine it's location.
9018 Major improvement over previous SGI STL 3.2 compatability.
9019 Three small problems remain with this function due to my zero
9020 knowledge of autoconf. JMarc and lgb see the comments in the code.
9022 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9024 * src/broken_const.h, config/hack-gcc, config/README: removed
9026 * configure.in: remove --with-gcc-hack option; do not call
9029 * INSTALL: remove documentation of --with-broken-const and
9032 * acconfig.h: remove all trace of BROKEN_CONST define
9034 * src/buffer.C (makeDocBookFile): update version number in output
9036 (SimpleDocBookOnePar): fix an assert when trying to a character
9037 access beyond string length
9040 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9042 * po/de.po: fix the Export menu
9044 * lyx.man: update the description of -dbg
9046 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9047 (commandLineHelp): updated
9048 (easyParse): show list of available debug levels if -dbg is passed
9051 * src/Makefile.am: add debug.C
9053 * src/debug.h: moved some code to debug.C
9055 * src/debug.C: new file. Contains code to set and show debug
9058 * src/layout.C: remove 'break' after 'continue' in switch
9059 statements, since these cannot be reached.
9061 1999-12-13 Allan Rae <rae@lyx.org>
9063 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9064 (in_word_set): hash() -> math_hash()
9066 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9068 * acconfig.h: Added a test for whether we are using exceptions in the
9069 current compilation run. If so USING_EXCEPTIONS is defined.
9071 * config.in: Check for existance of stl_string_fwd.h
9072 * src/LString.h: If compiling --with-included-string and SGI's
9073 STL version 3.2 is present (see above test) we need to block their
9074 forward declaration of string and supply a __get_c_string().
9075 However, it turns out this is only necessary if compiling with
9076 exceptions enabled so I've a bit more to add yet.
9078 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9079 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9080 src/support/LRegex.h, src/undo.h:
9081 Shuffle the order of the included files a little to ensure that
9082 LString.h gets included before anything that includes stl_string_fwd.h
9084 * src/support/lyxstring.C: We need to #include LString.h instead of
9085 lyxstring.h to get the necessary definition of __get_c_string.
9086 (__get_c_string): New function. This is defined static just like SGI's
9087 although why they need to do this I'm not sure. Perhaps it should be
9088 in lstrings.C instead.
9090 * lib/templates/IEEEtran.lyx: New template file.
9092 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9094 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9095 * intl/Makefile.in (MKINSTALLDIRS): ditto
9097 * src/LyXAction.C (init): changed to hold the LFUN data in a
9098 automatic array in stead of in callso to newFunc, this speeds up
9099 compilation a lot. Also all the memory used by the array is
9100 returned when the init is completed.
9102 * a lot of files: compiled with -Wold-style-cast, changed most of
9103 the reported offenders to C++ style casts. Did not change the
9104 offenders in C files.
9106 * src/trans.h (Match): change argument type to unsigned int.
9108 * src/support/DebugStream.C: fix some types on the streambufs so
9109 that it works on a conforming implementation.
9111 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9113 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9115 * src/support/lyxstring.C: remove the inline added earlier since
9116 they cause a bunch of unsatisfied symbols when linking with dec
9117 cxx. Cxx likes to have the body of inlines at the place where they
9120 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9121 accessing negative bounds in array. This fixes the crash when
9122 inserting accented characters.
9123 * src/trans.h (Match): ditto
9125 * src/buffer.C (Dispatch): since this is a void, it should not try
9126 to return anything...
9128 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9130 * src/buffer.h: removed the two friends from Buffer. Some changes
9131 because of this. Buffer::getFileName and Buffer::setFileName
9132 renamed to Buffer::fileName() and Buffer::fileName(...).
9134 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9136 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9137 and Buffer::update(short) to BufferView. This move is currently
9138 controlled by a define MOVE_TEXT, this will be removed when all
9139 shows to be ok. This move paves the way for better separation
9140 between buffer contents and buffer view. One side effect is that
9141 the BufferView needs a rebreak when swiching buffers, if we want
9142 to avoid this we can add a cache that holds pointers to LyXText's
9143 that is not currently in use.
9145 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9148 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9150 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9152 * lyx_main.C: new command line option -x (or --execute) and
9153 -e (or --export). Now direct conversion from .lyx to .tex
9154 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9155 Unfortunately, X is still needed and the GUI pops up during the
9158 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9160 * src/Spacing.C: add a using directive to bring stream stuff into
9162 * src/paragraph.C: ditto
9163 * src/buffer.C: ditto
9165 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9166 from Lars' announcement).
9168 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9169 example files from Tino Meinen.
9171 1999-12-06 Allan Rae <rae@lyx.org>
9173 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9175 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9177 * src/support/lyxstring.C: added a lot of inline for no good
9180 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9181 latexWriteEndChanges, they were not used.
9183 * src/layout.h (operator<<): output operator for PageSides
9185 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9187 * some example files: loaded in LyX 1.0.4 and saved again to update
9188 certain constructs (table format)
9190 * a lot of files: did the change to use fstream/iostream for all
9191 writing of files. Done with a close look at Andre Poenitz's patch.
9193 * some files: whitespace changes.
9195 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9197 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9198 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9199 architecture, we provide our own. It is used unconditionnally, but
9200 I do not think this is a performance problem. Thanks to Angus
9201 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9202 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9204 (GetInset): use my_memcpy.
9208 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9209 it is easier to understand, but it uses less TeX-only constructs now.
9211 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9212 elements contain spaces
9214 * lib/configure: regenerated
9216 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9217 elements contain spaces; display the list of programs that are
9220 * autogen.sh: make sure lib/configure is executable
9222 * lib/examples/*: rename the tutorial examples to begin with the
9223 two-letters language code.
9225 * src/lyxfunc.C (getStatus): do not query current font if no
9228 * src/lyx_cb.C (RunScript): use QuoteName
9229 (MenuRunDvips): ditto
9230 (PrintApplyCB): ditto
9232 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9233 around argument, so that it works well with the current shell.
9234 Does not work properly with OS/2 shells currently.
9236 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9237 * src/LyXSendto.C (SendtoApplyCB): ditto
9238 * src/lyxfunc.C (Dispatch): ditto
9239 * src/buffer.C (runLaTeX): ditto
9240 (runLiterate): ditto
9241 (buildProgram): ditto
9243 * src/lyx_cb.C (RunScript): ditto
9244 (MenuMakeLaTeX): ditto
9246 * src/buffer.h (getLatexName): new method
9248 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9250 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9252 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9253 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9254 (create_math_panel): ditto
9256 * src/lyxfunc.C (getStatus): re-activate the code which gets
9257 current font and cursor; add test for export to html.
9259 * src/lyxrc.C (read): remove unreachable break statements; add a
9262 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9264 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9266 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9267 introduced by faulty regex.
9268 * src/buffer.C: ditto
9269 * src/lastfiles.C: ditto
9270 * src/paragraph.C: ditto
9271 * src/table.C: ditto
9272 * src/vspace.C: ditto
9273 * src/insets/figinset.C: ditto
9274 Note: most of these is absolutely harmless, except the one in
9275 src/mathed formula.C.
9277 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9279 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9280 operation, yielding correct results for the reLyX command.
9282 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9284 * src/support/filetools.C (ExpandPath): removed an over eager
9286 (ReplaceEnvironmentPath): ditto
9288 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9289 shows that we are doing something fishy in our code...
9293 * src/lyxrc.C (read): use a double switch trick to get more help
9294 from the compiler. (the same trick is used in layout.C)
9295 (write): new function. opens a ofstream and pass that to output
9296 (output): new function, takes a ostream and writes the lyxrc
9297 elemts to it. uses a dummy switch to make sure no elements are
9300 * src/lyxlex.h: added a struct pushpophelper for use in functions
9301 with more than one exit point.
9303 * src/lyxlex.[Ch] (GetInteger): made it const
9307 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9309 * src/layout.[hC] : LayoutTags splitted into several enums, new
9310 methods created, better error handling cleaner use of lyxlex. Read
9313 * src/bmtable.[Ch]: change some member prototypes because of the
9314 image const changes.
9316 * commandtags.h, src/LyXAction.C (init): new function:
9317 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9318 This file is not read automatically but you can add \input
9319 preferences to your lyxrc if you want to. We need to discuss how
9322 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9323 in .aux, also remove .bib and .bst files from dependencies when
9326 * src/BufferView.C, src/LyXView.C: add const_cast several places
9327 because of changes to images.
9329 * lib/images/*: same change as for images/*
9331 * lib/lyxrc.example: Default for accept_compound is false not no.
9333 * images/*: changed to be const, however I have som misgivings
9334 about this change so it might be changed back.
9336 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9338 * lib/configure, po/POTFILES.in: regenerated
9340 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9342 * config/lib_configure.m4: removed
9344 * lib/configure.m4: new file (was config/lib_configure.m4)
9346 * configure.in: do not test for rtti, since we do not use it.
9348 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9350 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9351 doubling of allocated space scheme. This makes it faster for large
9352 strings end to use less memory for small strings. xtra rememoved.
9354 * src/insets/figinset.C (waitalarm): commented out.
9355 (GhostscriptMsg): use static_cast
9356 (GhostscriptMsg): use new instead of malloc to allocate memory for
9357 cmap. also delete the memory after use.
9359 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9361 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9362 for changes in bibtex database or style.
9363 (runBibTeX): remove all .bib and .bst files from dep before we
9365 (run): use scanAuc in when dep file already exist.
9367 * src/DepTable.C (remove_files_with_extension): new method
9370 * src/DepTable.[Ch]: made many of the methods const.
9372 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9374 * src/bufferparams.C: make sure that the default textclass is
9375 "article". It used to be the first one by description order, but
9376 now the first one is "docbook".
9378 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9379 string; call Debug::value.
9380 (easyParse): pass complete argument to setDebuggingLevel().
9382 * src/debug.h (value): fix the code that parses debug levels.
9384 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9387 * src/LyXAction.C: use Debug::ACTION as debug channel.
9389 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9391 * NEWS: updated for the future 1.1.3 release.
9393 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9394 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9395 it should. This is of course a controversial change (since many
9396 people will find that their lyx workscreen is suddenly full of
9397 red), but done for the sake of correctness.
9399 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9400 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9402 * src/insets/inseterror.h, src/insets/inseturl.h,
9403 src/insets/insetinfo.h, src/insets/figinset.h,
9404 src/mathed/formulamacro.h, src/mathed/math_macro.h
9405 (EditMessage): add a missing const and add _() to make sure that
9408 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9409 src/insets/insetbib.C, src/support/filetools.C: add `using'
9412 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9413 doing 'Insert index of last word' at the beginning of a paragraph.
9415 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9417 * several files: white-space changes.
9419 * src/mathed/formula.C: removed IsAlpha and IsDigit
9421 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9422 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9425 * src/insets/figinset.C (GetPSSizes): don't break when
9426 "EndComments" is seen. But break when a boundingbox is read.
9428 * all classes inherited from Inset: return value of Clone
9429 changed back to Inset *.
9431 * all classes inherited form MathInset: return value of Clone
9432 changed back to MathedInset *.
9434 * src/insets/figinset.C (runqueue): use a ofstream to output the
9435 gs/ps file. Might need some setpresicion or setw. However I can
9436 see no problem with the current code.
9437 (runqueue): use sleep instead of the alarm/signal code. I just
9438 can't see the difference.
9440 * src/paragraph.C (LyXParagraph): reserve space in the new
9441 paragraph and resize the inserted paragraph to just fit.
9443 * src/lyxfunc.h (operator|=): added operator for func_status.
9445 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9446 check for readable file.
9448 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9449 check for readable file.
9450 (MenuMakeLinuxDoc): ditto
9451 (MenuMakeDocBook): ditto
9452 (MenuMakeAscii): ditto
9453 (InsertAsciiFile): split the test for openable and readable
9455 * src/bmtable.C (draw_bitmaptable): use
9456 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9458 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9459 findtexfile from LaTeX to filetools.
9461 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9462 instead of FilePtr. Needs to be verified by a literate user.
9464 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9466 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9467 (EditMessage): likewise.
9469 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9470 respectively as \textasciitilde and \textasciicircum.
9472 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9474 * src/support/lyxstring.h: made the methods that take iterators
9477 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9478 (regexMatch): made is use the real regex class.
9480 * src/support/Makefile.am: changed to use libtool
9482 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9484 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9486 (MathIsInset ++): changed several macros to be inline functions
9489 * src/mathed/Makefile.am: changed to use libtool
9491 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9493 * src/insets/inset* : Clone changed to const and return type is
9494 the true insettype not just Inset*.
9496 * src/insets/Makefile.am: changed to use libtool
9498 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9500 * src/undo.[Ch] : added empty() and changed some of the method
9503 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9505 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9506 setID use block<> for the bullets array, added const several places.
9508 * src/lyxfunc.C (getStatus): new function
9510 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9511 LyXAction, added const to several funtions.
9513 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9514 a std::map, and to store the dir items in a vector.
9516 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9519 * src/LyXView.[Ch] + other files : changed currentView to view.
9521 * src/LyXAction.[Ch] : ported from the old devel branch.
9523 * src/.cvsignore: added .libs and a.out
9525 * configure.in : changes to use libtool.
9527 * acinclude.m4 : inserted libtool.m4
9529 * .cvsignore: added libtool
9531 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9533 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9534 file name in insets and mathed directories (otherwise the
9535 dependency is not taken in account under cygwin).
9537 * src/text2.C (InsertString[AB]): make sure that we do not try to
9538 read characters past the string length.
9540 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9542 * lib/doc/LaTeXConfig.lyx.in,
9543 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9545 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9546 file saying who created them and when this heppened; this is
9547 useless and annoys tools like cvs.
9549 * lib/layouts/g-brief-{en,de}.layout,
9550 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9551 from Thomas Hartkens <thomas@hartkens.de>.
9553 * src/{insets,mathed}/Makefile.am: do not declare an empty
9554 LDFLAGS, so that it can be set at configure time (useful on Irix
9557 * lib/reLyX/configure.in: make sure that the prefix is set
9558 correctly in LYX_DIR.
9560 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9562 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9563 be used by 'command-sequence' this allows to bind a key to a
9564 sequence of LyX-commands
9565 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9567 * src/LyXAction.C: add "command-sequence"
9569 * src/LyXFunction.C: handling of "command-sequence"
9571 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9572 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9574 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9576 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9578 * src/buffer.C (writeFile): Do not output a comment giving user
9579 and date at the beginning of a .lyx file. This is useless and
9580 annoys cvs anyway; update version number to 1.1.
9582 * src/Makefile.am (LYX_DIR): add this definition, so that a
9583 default path is hardcoded in LyX.
9585 * configure.in: Use LYX_GNU_GETTEXT.
9587 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9588 AM_GNU_GETTEXT with a bug fixed.
9590 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9592 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9594 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9595 which is used to point to LyX data is now LYX_DIR_11x.
9597 * lyx.man: convert to a unix text file; small updates.
9599 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9601 * src/support/LSubstring.[Ch]: made the second arg of most of the
9602 constructors be a const reference.
9604 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9607 * src/support/lyxstring.[Ch] (swap): added missing member function
9608 and specialization of swap(str, str);
9610 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9612 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9613 trace of the old one.
9615 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9616 put the member definitions in undo.C.
9618 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9619 NEW_TEXT and have now only code that was included when this was
9622 * src/intl.C (LCombo): use static_cast
9624 (DispatchCallback): ditto
9626 * src/definitions.h: removed whole file
9628 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9630 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9631 parsing and stores in a std:map. a regex defines the file format.
9632 removed unneeded members.
9634 * src/bufferparams.h: added several enums from definitions.h here.
9635 Removed unsused destructor. Changed some types to use proper enum
9636 types. use block to have the temp_bullets and user_defined_bullets
9637 and to make the whole class assignable.
9639 * src/bufferparams.C (Copy): removed this functions, use a default
9642 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9645 * src/buffer.C (readLyXformat2): commend out all that have with
9646 oldpapersize to do. also comment out all that hve to do with
9647 insetlatex and insetlatexdel.
9648 (setOldPaperStuff): commented out
9650 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9652 * src/LyXAction.C: remove use of inset-latex-insert
9654 * src/mathed/math_panel.C (button_cb): use static_cast
9656 * src/insets/Makefile.am (insets_o_SOURCES): removed
9659 * src/support/lyxstring.C (helper): use the unsigned long
9660 specifier, UL, instead of a static_cast.
9662 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9664 * src/support/block.h: new file. to be used as a c-style array in
9665 classes, so that the class can be assignable.
9667 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9669 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9670 NULL, make sure to return an empty string (it is not possible to
9671 set a string to NULL).
9673 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9675 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9677 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9679 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9680 link line, so that Irix users (for example) can set it explicitely to
9683 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9684 it can be overidden at make time (static or dynamic link, for
9687 * src/vc-backend.C, src/LaTeXFeatures.h,
9688 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9689 statements to bring templates to global namespace.
9691 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9693 * src/support/lyxstring.C (operator[] const): make it standard
9696 * src/minibuffer.C (Init): changed to reflect that more
9697 information is given from the lyxvc and need not be provided here.
9699 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9701 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9703 * src/LyXView.C (UpdateTimerCB): use static_cast
9704 (KeyPressMask_raw_callback): ditto
9706 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9707 buffer_, a lot of changes because of this. currentBuffer() ->
9708 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9709 also changes to other files because of this.
9711 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9713 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9714 have no support for RCS and partial support for CVS, will be
9717 * src/insets/ several files: changes because of function name
9718 changes in Bufferview and LyXView.
9720 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9722 * src/support/LSubstring.[Ch]: new files. These implement a
9723 Substring that can be very convenient to use. i.e. is this
9725 string a = "Mary had a little sheep";
9726 Substring(a, "sheep") = "lamb";
9727 a is now "Mary has a little lamb".
9729 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9730 out patterns and subpatterns of strings. It is used by LSubstring
9731 and also by vc-backend.C
9733 * src/support/lyxstring.C: went over all the assertions used and
9734 tried to correct the wrong ones and flag which of them is required
9735 by the standard. some bugs found because of this. Also removed a
9736 couple of assertions.
9738 * src/support/Makefile.am (libsupport_a_SOURCES): added
9739 LSubstring.[Ch] and LRegex.[Ch]
9741 * src/support/FileInfo.h: have struct stat buf as an object and
9742 not a pointer to one, some changes because of this.
9744 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9745 information in layout when adding the layouts preamble to the
9748 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9751 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9752 because of bug in OS/2.
9754 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9756 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9757 \verbatim@font instead of \ttfamily, so that it can be redefined.
9759 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9760 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9761 src/layout.h, src/text2.C: add 'using' directive to bring the
9762 STL templates we need from the std:: namespace to the global one.
9763 Needed by DEC cxx in strict ansi mode.
9765 * src/support/LIstream.h,src/support/LOstream.h,
9766 src/support/lyxstring.h,src/table.h,
9767 src/lyxlookup.h: do not include <config.h> in header
9768 files. This should be done in the .C files only.
9770 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9774 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9776 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9777 from Kayvan to fix the tth invokation.
9779 * development/lyx.spec.in: updates from Kayvan to reflect the
9780 changes of file names.
9782 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9784 * src/text2.C (InsertStringB): use std::copy
9785 (InsertStringA): use std::copy
9787 * src/bufferlist.C: use a vector to store the buffers in. This is
9788 an internal change and should not affect any other thing.
9790 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9793 * src/text.C (Fill): fix potential bug, one off bug.
9795 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9797 * src/Makefile.am (lyx_main.o): add more files it depends on.
9799 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9801 * src/support/lyxstring.C: use size_t for the reference count,
9802 size, reserved memory and xtra.
9803 (internal_compare): new private member function. Now the compare
9804 functions should work for std::strings that have embedded '\0'
9806 (compare): all compare functions rewritten to use
9809 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9811 * src/support/lyxstring.C (compare): pass c_str()
9812 (compare): pass c_str
9813 (compare): pass c_str
9815 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9817 * src/support/DebugStream.C: <config.h> was not included correctly.
9819 * lib/configure: forgot to re-generate it :( I'll make this file
9820 auto generated soon.
9822 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9824 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9827 * src/support/lyxstring.C: some changes from length() to rep->sz.
9828 avoids a function call.
9830 * src/support/filetools.C (SpaceLess): yet another version of the
9831 algorithm...now per Jean-Marc's suggestions.
9833 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9835 * src/layout.C (less_textclass_desc): functor for use in sorting
9837 (LyXTextClass::Read): sort the textclasses after reading.
9839 * src/support/filetools.C (SpaceLess): new version of the
9840 SpaceLess functions. What problems does this one give? Please
9843 * images/banner_bw.xbm: made the arrays unsigned char *
9845 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9847 * src/support/lyxstring.C (find): remove bogus assertion in the
9848 two versions of find where this has not been done yet.
9850 * src/support/lyxlib.h: add missing int return type to
9853 * src/menus.C (ShowFileMenu): disable exporting to html if no
9854 html export command is present.
9856 * config/lib_configure.m4: add a test for an HTML converter. The
9857 programs checked for are, in this order: tth, latex2html and
9860 * lib/configure: generated from config/lib_configure.m4.
9862 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9863 html converter. The parameters are now passed through $$FName and
9864 $$OutName, instead of standard input/output.
9866 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9868 * lib/lyxrc.example: update description of \html_command.
9869 add "quotes" around \screen_font_xxx font setting examples to help
9870 people who use fonts with spaces in their names.
9872 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9874 * Distribution files: updates for v1.1.2
9876 * src/support/lyxstring.C (find): remove bogus assert and return
9877 npos for the same condition.
9879 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9881 * added patch for OS/2 from SMiyata.
9883 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9885 * src/text2.C (CutSelection): make space_wrapped a bool
9886 (CutSelection): dont declare int i until we have to.
9887 (alphaCounter): return a char const *.
9889 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9891 * src/support/syscall.C (Systemcalls::kill):
9892 src/support/filetools.C (PutEnv, PutEnvPath):
9893 src/lyx_cb.C (addNewlineAndDepth):
9894 src/FontInfo.C (FontInfo::resize): condition some #warning
9895 directives with WITH_WARNINGS.
9898 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9900 * src/layout.[Ch] + several files: access to class variables
9901 limited and made accessor functions instead a lot of code changed
9902 becuase of this. Also instead of returning pointers often a const
9903 reference is returned instead.
9905 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9907 * src/Makefile.am (dist-hook): added used to remove the CVS from
9908 cheaders upon creating a dist
9909 (EXTRA_DIST): added cheaders
9911 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9912 a character not as a small integer.
9914 * src/support/lyxstring.C (find): removed Assert and added i >=
9915 rep->sz to the first if.
9917 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9919 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9920 src/LyXView.C src/buffer.C src/bufferparams.C
9921 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9922 src/text2.C src/insets/insetinclude.C:
9923 lyxlayout renamed to textclasslist.
9925 * src/layout.C: some lyxerr changes.
9927 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9928 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9929 (LyXLayoutList): removed all traces of this class.
9930 (LyXTextClass::Read): rewrote LT_STYLE
9931 (LyXTextClass::hasLayout): new function
9932 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9933 both const and nonconst version.
9934 (LyXTextClass::delete_layout): new function.
9935 (LyXTextClassList::Style): bug fix. do the right thing if layout
9937 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9938 (LyXTextClassList::NameOfLayout): ditto
9939 (LyXTextClassList::Load): ditto
9941 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9943 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9945 * src/LyXAction.C (LookupFunc): added a workaround for sun
9946 compiler, on the other hand...we don't know if the current code
9947 compiles on sun at all...
9949 * src/support/filetools.C (CleanupPath): subst fix
9951 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9954 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9955 complained about this one?
9957 * src/insets/insetinclude.C (Latex): subst fix
9959 * src/insets/insetbib.C (getKeys): subst fix
9961 * src/LyXSendto.C (SendtoApplyCB): subst fix
9963 * src/lyx_main.C (init): subst fix
9965 * src/layout.C (Read): subst fix
9967 * src/lyx_sendfax_main.C (button_send): subst fix
9969 * src/buffer.C (RoffAsciiTable): subst fix
9971 * src/lyx_cb.C (MenuFax): subst fix
9972 (PrintApplyCB): subst fix
9974 1999-10-26 Juergen Vigna <jug@sad.it>
9976 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9978 (Read): Cleaned up this code so now we read only format vestion >= 5
9980 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9982 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9983 come nobody has complained about this one?
9985 * src/insets/insetinclude.C (Latex): subst fix
9987 * src/insets/insetbib.C (getKeys): subst fix
9989 * src/lyx_main.C (init): subst fix
9991 * src/layout.C (Read): subst fix
9993 * src/buffer.C (RoffAsciiTable): subst fix
9995 * src/lyx_cb.C (MenuFax): subst fix.
9997 * src/layout.[hC] + some other files: rewrote to use
9998 std::container to store textclasses and layouts in.
9999 Simplified, removed a lot of code. Make all classes
10000 assignable. Further simplifications and review of type
10001 use still to be one.
10003 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10004 lastfiles to create the lastfiles partr of the menu.
10006 * src/lastfiles.[Ch]: rewritten to use deque to store the
10007 lastfiles in. Uses fstream for reading and writing. Simplifies
10010 * src/support/syscall.C: remove explicit cast.
10012 * src/BufferView.C (CursorToggleCB): removed code snippets that
10013 were commented out.
10014 use explicat C++ style casts instead of C style casts. also use
10015 u_vdata instea of passing pointers in longs.
10017 * src/PaperLayout.C: removed code snippets that were commented out.
10019 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10021 * src/lyx_main.C: removed code snippets that wer commented out.
10023 * src/paragraph.C: removed code snippets that were commented out.
10025 * src/lyxvc.C (logClose): use static_cast
10027 (viewLog): remove explicit cast to void*
10028 (showLog): removed old commented code
10030 * src/menus.C: use static_cast instead of C style casts. use
10031 u_vdata instead of u_ldata. remove explicit cast to (long) for
10032 pointers. Removed old code that was commented out.
10034 * src/insets/inset.C: removed old commented func
10036 * src/insets/insetref.C (InsetRef): removed old code that had been
10037 commented out for a long time.
10039 (escape): removed C style cast
10041 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10043 * src/insets/insetlatex.C (Draw): removed old commented code
10044 (Read): rewritten to use string
10046 * src/insets/insetlabel.C (escape): removed C style cast
10048 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10050 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10051 old commented code.
10053 * src/insets/insetinclude.h: removed a couple of stupid bools
10055 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10056 (Clone): remove C style cast
10057 (getKeys): changed list to lst because of std::list
10059 * src/insets/inseterror.C (Draw): removed som old commented code.
10061 * src/insets/insetcommand.C (Draw): removed some old commented code.
10063 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10064 commented out forever.
10065 (bibitem_cb): use static_cast instead of C style cast
10066 use of vdata changed to u_vdata.
10068 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10070 (CloseUrlCB): use static_cast instead of C style cast.
10071 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10073 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10074 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10075 (CloseInfoCB): static_cast from ob->u_vdata instead.
10076 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10079 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10080 (C_InsetError_CloseErrorCB): forward the ob parameter
10081 (CloseErrorCB): static_cast from ob->u_vdata instead.
10083 * src/vspace.h: include LString.h since we use string in this class.
10085 * src/vspace.C (lyx_advance): changed name from advance because of
10086 nameclash with stl. And since we cannot use namespaces yet...I
10087 used a lyx_ prefix instead. Expect this to change when we begin
10090 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10092 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10093 and removed now defunct constructor and deconstructor.
10095 * src/BufferView.h: have backstack as a object not as a pointer.
10096 removed initialization from constructor. added include for BackStack
10098 * development/lyx.spec.in (%build): add CFLAGS also.
10100 * src/screen.C (drawFrame): removed another warning.
10102 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10104 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10105 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10106 README and ANNOUNCE a bit for the next release. More work is
10109 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10110 unbreakable if we are in freespacing mode (LyX-Code), but not in
10113 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10115 * src/BackStack.h: fixed initialization order in constructor
10117 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10119 * acinclude.m4 (VERSION): new rules for when a version is
10120 development, added also a variable for prerelease.
10121 (warnings): we set with_warnings=yes for prereleases
10122 (lyx_opt): prereleases compile with same optimization as development
10123 (CXXFLAGS): only use pedantic if we are a development version
10125 * src/BufferView.C (restorePosition): don't do anything if the
10126 backstack is empty.
10128 * src/BackStack.h: added member empty, use this to test if there
10129 is anything to pop...
10131 1999-10-25 Juergen Vigna <jug@sad.it>
10134 * forms/layout_forms.fd +
10135 * forms/latexoptions.fd +
10136 * lyx.fd: changed for various form resize issues
10138 * src/mathed/math_panel.C +
10139 * src/insets/inseterror.C +
10140 * src/insets/insetinfo.C +
10141 * src/insets/inseturl.C +
10142 * src/insets/inseturl.h +
10144 * src/LyXSendto.C +
10145 * src/PaperLayout.C +
10146 * src/ParagraphExtra.C +
10147 * src/TableLayout.C +
10149 * src/layout_forms.C +
10156 * src/menus.C: fixed various resize issues. So now forms can be
10157 resized savely or not be resized at all.
10159 * forms/form_url.fd +
10160 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10163 * src/insets/Makefile.am: added files form_url.[Ch]
10165 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10167 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10168 (and presumably 6.2).
10170 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10171 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10172 remaining static member callbacks.
10174 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10177 * src/support/lyxstring.h: declare struct Srep as friend of
10178 lyxstring, since DEC cxx complains otherwise.
10180 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10182 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10184 * src/LaTeX.C (run): made run_bibtex also depend on files with
10186 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10187 are put into the dependency file.
10189 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10190 the code has shown itself to work
10191 (create_ispell_pipe): removed another warning, added a comment
10194 * src/minibuffer.C (ExecutingCB): removed code that has been
10195 commented out a long time
10197 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10198 out code + a warning.
10200 * src/support/lyxstring.h: comment out the three private
10201 operators, when compiling with string ansi conforming compilers
10202 they make problems.
10204 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10206 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10207 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10210 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10213 * src/mathed/math_panel.C (create_math_panel): remove explicit
10216 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10219 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10220 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10221 to XCreatePixmapFromBitmapData
10222 (fl_set_bmtable_data): change the last argument to be unsigned
10224 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10225 and bh to be unsigned int, remove explicit casts in call to
10226 XReadBitmapFileData.
10228 * images/arrows.xbm: made the arrays unsigned char *
10229 * images/varsz.xbm: ditto
10230 * images/misc.xbm: ditto
10231 * images/greek.xbm: ditto
10232 * images/dots.xbm: ditto
10233 * images/brel.xbm: ditto
10234 * images/bop.xbm: ditto
10236 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10238 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10239 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10240 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10242 (LYX_CXX_CHEADERS): added <clocale> to the test.
10244 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10246 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10248 * src/support/lyxstring.C (append): fixed something that must be a
10249 bug, rep->assign was used instead of rep->append.
10251 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10254 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10255 lyx insert double chars. Fix spotted by Kayvan.
10257 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10259 * Fixed the tth support. I messed up with the Emacs patch apply feature
10260 and omitted the changes in lyxrc.C.
10262 1999-10-22 Juergen Vigna <jug@sad.it>
10264 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10266 * src/lyx_cb.C (MenuInsertRef) +
10267 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10268 the form cannot be resized under it limits (fixes a segfault)
10270 * src/lyx.C (create_form_form_ref) +
10271 * forms/lyx.fd: Changed Gravity on name input field so that it is
10274 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10276 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10277 <ostream> and <istream>.
10279 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10280 whether <fstream> provides the latest standard features, or if we
10281 have an oldstyle library (like in egcs).
10282 (LYX_CXX_STL_STRING): fix the test.
10284 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10285 code on MODERN_STL_STREAM.
10287 * src/support/lyxstring.h: use L{I,O}stream.h.
10289 * src/support/L{I,O}stream.h: new files, designed to setup
10290 correctly streams for our use
10291 - includes the right header depending on STL capabilities
10292 - puts std::ostream and std::endl (for LOStream.h) or
10293 std::istream (LIStream.h) in toplevel namespace.
10295 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10297 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10298 was a bib file that had been changed we ensure that bibtex is run.
10299 (runBibTeX): enhanced to extract the names of the bib files and
10300 getting their absolute path and enter them into the dep file.
10301 (findtexfile): static func that is used to look for tex-files,
10302 checks for absolute patchs and tries also with kpsewhich.
10303 Alternative ways of finding the correct files are wanted. Will
10305 (do_popen): function that runs a command using popen and returns
10306 the whole output of that command in a string. Should be moved to
10309 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10310 file with extension ext has changed.
10312 * src/insets/figinset.C: added ifdef guards around the fl_free
10313 code that jug commented out. Now it is commented out when
10314 compiling with XForms == 0.89.
10316 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10317 to lyxstring.C, and only keep a forward declaration in
10318 lyxstring.h. Simplifies the header file a bit and should help a
10319 bit on compile time too. Also changes to Srep will not mandate a
10320 recompile of code just using string.
10321 (~lyxstring): definition moved here since it uses srep.
10322 (size): definition moved here since it uses srep.
10324 * src/support/lyxstring.h: removed a couple of "inline" that should
10327 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10329 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10332 1999-10-21 Juergen Vigna <jug@sad.it>
10334 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10335 set to left if I just remove the width entry (or it is empty).
10337 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10338 paragraph when having dummy paragraphs.
10340 1999-10-20 Juergen Vigna <jug@sad.it>
10342 * src/insets/figinset.C: just commented some fl_free_form calls
10343 and added warnings so that this calls should be activated later
10344 again. This avoids for now a segfault, but we have a memory leak!
10346 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10347 'const char * argument' to 'string argument', this should
10348 fix some Asserts() in lyxstring.C.
10350 * src/lyxfunc.h: Removed the function argAsString(const char *)
10351 as it is not used anymore.
10353 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10355 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10358 * src/Literate.h: some funcs moved from public to private to make
10359 interface clearer. Unneeded args removed.
10361 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10363 (scanBuildLogFile): ditto
10365 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10366 normal TeX Error. Still room for improvement.
10368 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10370 * src/buffer.C (insertErrors): changes to make the error
10371 desctription show properly.
10373 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10376 * src/support/lyxstring.C (helper): changed to use
10377 sizeof(object->rep->ref).
10378 (operator>>): changed to use a pointer instead.
10380 * src/support/lyxstring.h: changed const reference & to value_type
10381 const & lets see if that helps.
10383 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10385 * Makefile.am (rpmdist): fixed to have non static package and
10388 * src/support/lyxstring.C: removed the compilation guards
10390 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10393 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10394 conditional compile of lyxstring.Ch
10396 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10397 stupid check, but it is a lot better than the bastring hack.
10398 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10400 * several files: changed string::erase into string::clear. Not
10403 * src/chset.C (encodeString): use a char temporary instead
10405 * src/table.C (TexEndOfCell): added tostr around
10406 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10407 (TexEndOfCell): ditto
10408 (TexEndOfCell): ditto
10409 (TexEndOfCell): ditto
10410 (DocBookEndOfCell): ditto
10411 (DocBookEndOfCell): ditto
10412 (DocBookEndOfCell): ditto
10413 (DocBookEndOfCell): ditto
10415 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10417 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10419 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10420 (MenuBuildProg): added tostr around ret
10421 (MenuRunChktex): added tostr around ret
10422 (DocumentApplyCB): added tostr around ret
10424 * src/chset.C (encodeString): added tostr around t->ic
10426 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10427 (makeLaTeXFile): added tostr around tocdepth
10428 (makeLaTeXFile): added tostr around ftcound - 1
10430 * src/insets/insetbib.C (setCounter): added tostr around counter.
10432 * src/support/lyxstring.h: added an operator+=(int) to catch more
10435 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10436 (lyxstring): We DON'T allow NULL pointers.
10438 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10440 * src/mathed/math_macro.C (MathMacroArgument::Write,
10441 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10442 when writing them out.
10444 * src/LString.C: remove, since it is not used anymore.
10446 * src/support/lyxstring.C: condition the content to
10447 USE_INCLUDED_STRING macro.
10449 * src/mathed/math_symbols.C, src/support/lstrings.C,
10450 src/support/lyxstring.C: add `using' directive to specify what
10451 we need in <algorithm>. I do not think that we need to
10452 conditionalize this, but any thought is appreciated.
10454 * many files: change all callback functions to "C" linkage
10455 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10456 strict_ansi. Those who were static are now global.
10457 The case of callbacks which are static class members is
10458 trickier, since we have to make C wrappers around them (see
10459 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10460 did not finish this yet, since it defeats the purpose of
10461 encapsulation, and I am not sure what the best route is.
10463 1999-10-19 Juergen Vigna <jug@sad.it>
10465 * src/support/lyxstring.C (lyxstring): we permit to have a null
10466 pointer as assignment value and just don't assign it.
10468 * src/vspace.C (nextToken): corrected this function substituting
10469 find_first(_not)_of with find_last_of.
10471 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10472 (TableOptCloseCB) (TableSpeCloseCB):
10473 inserted fl_set_focus call for problem with fl_hide_form() in
10476 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10478 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10481 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10483 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10484 LyXLex::next() and not eatline() to get its argument.
10486 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10488 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10489 instead, use fstreams for io of the depfile, removed unneeded
10490 functions and variables.
10492 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10493 vector instead, removed all functions and variables that is not in
10496 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10498 * src/buffer.C (insertErrors): use new interface to TeXError
10500 * Makefile.am (rpmdist): added a rpmdist target
10502 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10503 per Kayvan's instructions.
10505 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10507 * src/Makefile.am: add a definition for localedir, so that locales
10508 are found after installation (Kayvan)
10510 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10512 * development/.cvsignore: new file.
10514 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10516 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10517 C++ compiler provides wrappers for C headers and use our alternate
10520 * configure.in: use LYX_CXX_CHEADERS.
10522 * src/cheader/: new directory, populated with cname headers from
10523 libstdc++-2.8.1. They are a bit old, but probably good enough for
10524 what we want (support compilers who lack them).
10526 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10527 from includes. It turns out is was stupid.
10529 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10531 * lib/Makefile.am (install-data-local): forgot a ';'
10532 (install-data-local): forgot a '\'
10533 (libinstalldirs): needed after all. reintroduced.
10535 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10537 * configure.in (AC_OUTPUT): added lyx.spec
10539 * development/lyx.spec: removed file
10541 * development/lyx.spec.in: new file
10543 * po/*.po: merged with lyx.pot becuase of make distcheck
10545 * lib/Makefile.am (dist-hook): added dist-hook so that
10546 documentation files will be included when doing a make
10547 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10548 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10550 more: tried to make install do the right thing, exclude CVS dirs
10553 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10554 Path would fit in more nicely.
10556 * all files that used to use pathstack: uses now Path instead.
10557 This change was a lot easier than expected.
10559 * src/support/path.h: new file
10561 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10563 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10565 * src/support/lyxstring.C (getline): Default arg was given for
10568 * Configure.cmd: removed file
10570 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10572 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10573 streams classes and types, add the proper 'using' statements when
10574 MODERN_STL is defined.
10576 * src/debug.h: move the << operator definition after the inclusion
10579 * src/support/filetools.C: include "LAssert.h", which is needed
10582 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10585 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10586 include "debug.h" to define a proper ostream.
10588 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10590 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10591 method to the SystemCall class which can kill a process, but it's
10592 not fully implemented yet.
10594 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10596 * src/support/FileInfo.h: Better documentation
10598 * src/lyxfunc.C: Added support for buffer-export html
10600 * src/menus.C: Added Export->As HTML...
10602 * lib/bind/*.bind: Added short-cut for buffer-export html
10604 * src/lyxrc.*: Added support for new \tth_command
10606 * lib/lyxrc.example: Added stuff for new \tth_command
10608 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10610 * lib/Makefile.am (IMAGES): removed images/README
10611 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10612 installes in correct place. Check permisions is installed
10615 * src/LaTeX.C: some no-op changes moved declaration of some
10618 * src/LaTeX.h (LATEX_H): changed include guard name
10620 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10622 * lib/reLyX/Makefile.am: install noweb2lyx.
10624 * lib/Makefile.am: install configure.
10626 * lib/reLyX/configure.in: declare a config aux dir; set package
10627 name to lyx (not sure what the best solution is); generate noweb2lyx.
10629 * lib/layouts/egs.layout: fix the bibliography layout.
10631 1999-10-08 Jürgen Vigna <jug@sad.it>
10633 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10634 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10635 it returned without continuing to search the path.
10637 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10639 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10640 also fixes a bug. It is not allowed to do tricks with std::strings
10641 like: string a("hei"); &a[e]; this will not give what you
10642 think... Any reason for the complexity in this func?
10644 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10646 * Updated README and INSTALL a bit, mostly to check that my
10647 CVS rights are correctly set up.
10649 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10651 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10652 does not allow '\0' chars but lyxstring and std::string does.
10654 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10656 * autogen.sh (AUTOCONF): let the autogen script create the
10657 POTFILES.in file too. POTFILES.in should perhaps now not be
10658 included in the cvs module.
10660 * some more files changed to use C++ includes instead of C ones.
10662 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10664 (Reread): added tostr to nlink. buggy output otherwise.
10665 (Reread): added a string() around szMode when assigning to Buffer,
10666 without this I got a log of garbled info strings.
10668 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10671 * I have added several ostream & operator<<(ostream &, some_type)
10672 functions. This has been done to avoid casting and warnings when
10673 outputting enums to lyxerr. This as thus eliminated a lot of
10674 explicit casts and has made the code clearer. Among the enums
10675 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10676 mathed enums, some font enum the Debug::type enum.
10678 * src/support/lyxstring.h (clear): missing method. equivalent of
10681 * all files that contained "stderr": rewrote constructs that used
10682 stderr to use lyxerr instead. (except bmtable)
10684 * src/support/DebugStream.h (level): and the passed t with
10685 Debug::ANY to avoid spurious bits set.
10687 * src/debug.h (Debug::type value): made it accept strings of the
10688 type INFO,INIT,KEY.
10690 * configure.in (Check for programs): Added a check for kpsewhich,
10691 the latex generation will use this later to better the dicovery of
10694 * src/BufferView.C (create_view): we don't need to cast this to
10695 (void*) that is done automatically.
10696 (WorkAreaButtonPress): removed some dead code.
10698 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10700 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10701 is not overwritten when translated (David Sua'rez de Lis).
10703 * lib/CREDITS: Added David Sua'rez de Lis
10705 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10707 * src/bufferparams.C (BufferParams): default input encoding is now
10710 * acinclude.m4 (cross_compiling): comment out macro
10711 LYX_GXX_STRENGTH_REDUCE.
10713 * acconfig.h: make sure that const is not defined (to empty) when
10714 we are compiling C++. Remove commented out code using SIZEOF_xx
10717 * configure.in : move the test for const and inline as late as
10718 possible so that these C tests do not interefere with C++ ones.
10719 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10720 has not been proven.
10722 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10724 * src/table.C (getDocBookAlign): remove bad default value for
10725 isColumn parameter.
10727 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10729 (ShowFileMenu2): ditto.
10731 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10732 of files to ignore.
10734 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10736 * Most files: finished the change from the old error code to use
10737 DebugStream for all lyxerr debugging. Only minor changes remain
10738 (e.g. the setting of debug levels using strings instead of number)
10740 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10742 * src/layout.C (Add): Changed to use compare_no_case instead of
10745 * src/FontInfo.C: changed loop variable type too string::size_type.
10747 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10749 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10750 set ETAGS_ARGS to --c++
10752 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10754 * src/table.C (DocBookEndOfCell): commented out two unused variables
10756 * src/paragraph.C: commented out four unused variables.
10758 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10759 insed a if clause with type string::size_type.
10761 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10764 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10766 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10767 variable, also changed loop to go from 0 to lenght + 1, instead of
10768 -1 to length. This should be correct.
10770 * src/LaTeX.C (scanError): use string::size_type as loop variable
10773 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10774 (l.896) since y_tmp and row was not used anyway.
10776 * src/insets/insetref.C (escape): use string::size_type as loop
10779 * src/insets/insetquotes.C (Width): use string::size_type as loop
10781 (Draw): use string::size_type as loop variable type.
10783 * src/insets/insetlatexaccent.C (checkContents): use
10784 string::size_type as loop variable type.
10786 * src/insets/insetlabel.C (escape): use string::size_type as loop
10789 * src/insets/insetinfo.C: added an extern for current_view.
10791 * src/insets/insetcommand.C (scanCommand): use string::size_type
10792 as loop variable type.
10794 * most files: removed the RCS tags. With them we had to recompile
10795 a lot of files after a simple cvs commit. Also we have never used
10796 them for anything meaningful.
10798 * most files: tags-query-replace NULL 0. As adviced several plases
10799 we now use "0" instead of "NULL" in our code.
10801 * src/support/filetools.C (SpaceLess): use string::size_type as
10802 loop variable type.
10804 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10806 * src/paragraph.C: fixed up some more string stuff.
10808 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10810 * src/support/filetools.h: make modestr a std::string.
10812 * src/filetools.C (GetEnv): made ch really const.
10814 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10815 made code that used these use max/min from <algorithm> instead.
10817 * changed several c library include files to their equivalent c++
10818 library include files. All is not changed yet.
10820 * created a support subdir in src, put lyxstring and lstrings
10821 there + the extra files atexit, fileblock, strerror. Created
10822 Makefile.am. edited configure.in and src/Makefile.am to use this
10823 new subdir. More files moved to support.
10825 * imported som of the functions from repository lyx, filetools
10827 * ran tags-query-replace on LString -> string, corrected the bogus
10828 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10829 is still some errors in there. This is errors where too much or
10830 too litle get deleted from strings (string::erase, string::substr,
10831 string::replace), there can also be some off by one errors, or
10832 just plain wrong use of functions from lstrings. Viewing of quotes
10835 * LyX is now running fairly well with string, but there are
10836 certainly some bugs yet (see above) also string is quite different
10837 from LString among others in that it does not allow null pointers
10838 passed in and will abort if it gets any.
10840 * Added the revtex4 files I forgot when setting up the repository.
10842 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10844 * All over: Tried to clean everything up so that only the files
10845 that we really need are included in the cvs repository.
10846 * Switched to use automake.
10847 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10848 * Install has not been checked.
10850 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10852 * po/pt.po: Three errors:
10853 l.533 and l.538 format specification error
10854 l. 402 duplicate entry, I just deleted it.