1 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
3 * src/frontends/gnome/Makefile.am:
4 * src/frontends/kde/Makefile.am: FormCommand.C
5 disappeared from xforms
7 * src/frontends/kde/FormCitation.C:
8 * src/frontends/kde/FormIndex.C: read-only
11 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
16 * src/bufferlist.C: add using directive.
18 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
20 * src/support/lyxfunctional.h: version of class_fun for void
21 returns added, const versions of back_inseter_fun and compare_fun
24 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
26 * src/frontends/xforms/FormInset.C (showInset): fix typo.
28 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
32 * lib/CREDITS: update to add all the contributors we've forgotten.
33 I have obviously missed some, so tell me whether there were
36 2000-10-13 Marko Vendelin <markov@ioc.ee>
38 * src/frontends/gnome/FormCitation.C
39 * src/frontends/gnome/FormCitation.h
40 * src/frontends/gnome/FormError.C
41 * src/frontends/gnome/FormIndex.C
42 * src/frontends/gnome/FormRef.C
43 * src/frontends/gnome/FormRef.h
44 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
46 * src/frontends/gnome/FormCitation.C
47 * src/frontends/gnome/FormCopyright.C
48 * src/frontends/gnome/FormError.C
49 * src/frontends/gnome/FormIndex.C
50 * src/frontends/gnome/FormRef.C
51 * src/frontends/gnome/FormToc.C
52 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
55 * src/frontends/gnome/Menubar_pimpl.C
56 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
59 2000-10-11 Baruch Even <baruch.even@writeme.com>
62 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
63 to convey its real action.
65 * src/minibuffer.C (peek_event): Added action when mouse clicks to
66 clear the minibuffer and prepare to enter a command.
68 * src/mathed/formula.C (LocalDispatch): Changed to conform with
69 the rename from ExecCommand to PrepareForCommand.
70 * src/lyxfunc.C (Dispatch): ditto.
72 2000-10-11 Baruch Even <baruch.even@writeme.com>
74 * src/buffer.C (writeFile): Added test for errors on writing, this
75 catches all errors and not only file system full errors as intended.
77 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
79 * src/lyx_gui.C (create_forms): better fix for crash with
82 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
84 * src/frontends/kde/Makefile.am:
85 * src/frontends/kde/FormCopyright.C:
86 * src/frontends/kde/formcopyrightdialog.C:
87 * src/frontends/kde/formcopyrightdialog.h:
88 * src/frontends/kde/formcopyrightdialogdata.C:
89 * src/frontends/kde/formcopyrightdialogdata.h:
90 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
91 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
92 copyright to use qtarch
94 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
96 * src/encoding.C (read): Fixed bug that caused an error message at
99 * po/Makefile.in.in: Fixed rule for ext_l10n.h
101 * lib/lyxrc.example: Fixed hebrew example.
103 2000-10-13 Allan Rae <rae@lyx.org>
105 * src/frontends/xforms/FormPreferences.C (input): reworking the
107 (build, update, apply): New inputs in various tabfolders
109 * src/frontends/xforms/FormToc.C: use new button policy.
110 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
111 dialogs that either can't use any existing policy or where it just
114 * src/frontends/xforms/FormTabular.h: removed copyright notice that
117 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
118 added a bool parameter which is ignored.
120 * src/buffer.C (setReadonly):
121 * src/BufferView_pimpl.C (buffer):
122 * src/frontends/kde/FormCopyright.h (update):
123 * src/frontends/kde/FormCitation.[Ch] (update):
124 * src/frontends/kde/FormIndex.[Ch] (update):
125 * src/frontends/kde/FormPrint.[Ch] (update):
126 * src/frontends/kde/FormRef.[Ch] (update):
127 * src/frontends/kde/FormToc.[Ch] (update):
128 * src/frontends/kde/FormUrl.[Ch] (update):
129 * src/frontends/gnome/FormCopyright.h (update):
130 * src/frontends/gnome/FormCitation.[Ch] (update):
131 * src/frontends/gnome/FormError.[Ch] (update):
132 * src/frontends/gnome/FormIndex.[Ch] (update):
133 * src/frontends/gnome/FormPrint.[Ch] (update):
134 * src/frontends/gnome/FormRef.h (update):
135 * src/frontends/gnome/FormToc.[Ch] (update):
136 * src/frontends/gnome/FormUrl.[Ch] (update):
137 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
138 to updateBufferDependent and DialogBase
140 * src/frontends/xforms/FormCitation.[hC]:
141 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
142 * src/frontends/xforms/FormError.[Ch]:
143 * src/frontends/xforms/FormGraphics.[Ch]:
144 * src/frontends/xforms/FormIndex.[Ch]:
145 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
146 and fixed readOnly handling.
147 * src/frontends/xforms/FormPrint.[Ch]:
148 * src/frontends/xforms/FormRef.[Ch]:
149 * src/frontends/xforms/FormTabular.[Ch]:
150 * src/frontends/xforms/FormToc.[Ch]:
151 * src/frontends/xforms/FormUrl.[Ch]:
152 * src/frontends/xforms/FormInset.[Ch]:
153 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
154 form of updateBufferDependent.
156 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
157 if form()->visible just in case someone does stuff to the form in a
160 * src/frontends/DialogBase.h (enum): removed enum since we can now use
161 the buttoncontroller for everything the enum used to be used for.
162 (update) It would seem we need to force all dialogs to use a bool
163 parameter or have two update functions. I chose to go with one.
164 I did try removing update() from here and FormBase and defining the
165 appropriate update signatures in FormBaseB[DI] but then ran into the
166 problem of the update() call in FormBase::show(). Whatever I did
167 to get around that would require another function and that just
168 got more confusing. Hence the decision to make everyone have an
169 update(bool). An alternative might have been to override show() in
170 FormBaseB[DI] and that would allow the different and appropriate
173 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
174 true == buffer change occurred. I decided against using a default
175 template parameter since not all compilers support that at present.
177 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
179 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
180 army knife" by removing functionality.
181 (clearStore): removed. All such housekeeping on hide()ing the dialog
182 is to be carried out by overloaded disconnect() methods.
183 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
184 superceded by Baruch's neat test (FormGraphics) to update an existing
185 dialog if a new signal is recieved rather than block all new signals
187 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
188 only to Inset dialogs.
189 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
190 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
192 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
194 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
195 as a base class to all inset dialogs. Used solely to connect/disconnect
196 the Inset::hide signal and to define what action to take on receipt of
197 a UpdateBufferDependent signal.
198 (FormCommand): now derived from FormInset.
200 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
203 * src/frontends/xforms/FormCopyright.[Ch]:
204 * src/frontends/xforms/FormPreferences.[Ch]:
205 now derived from FormBaseBI.
207 * src/frontends/xforms/FormDocument.[Ch]:
208 * src/frontends/xforms/FormParagraph.[Ch]:
209 * src/frontends/xforms/FormPrint.[Ch]:
210 now derived from FormBaseBD.
212 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
214 * src/frontends/xforms/FormCitation.[Ch]:
215 * src/frontends/xforms/FormError.[Ch]:
216 * src/frontends/xforms/FormRef.[Ch]:
217 * src/frontends/xforms/FormToc.[Ch]:
218 (clearStore): reworked as disconnect().
220 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
223 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
225 * src/converter.C (runLaTeX): constify buffer argument
228 * src/frontends/support/Makefile.am (INCLUDES): fix.
230 * src/buffer.h: add std:: qualifier
231 * src/insets/figinset.C (addpidwait): ditto
232 * src/MenuBackend.C: ditto
233 * src/buffer.C: ditto
234 * src/bufferlist.C: ditto
235 * src/layout.C: ditto
236 * src/lyxfunc.C: ditto
238 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
240 * src/lyxtext.h (bidi_level): change return type to
241 LyXParagraph::size_type.
243 * src/lyxparagraph.h: change size_type to
244 TextContainer::difference_type. This should really be
245 TextContainer::size_type, but we need currently to support signed
248 2000-10-11 Marko Vendelin <markov@ioc.ee>
249 * src/frontends/gnome/FormError.h
250 * src/frontends/gnome/FormRef.C
251 * src/frontends/gnome/FormRef.h
252 * src/frontends/gnome/FormError.C
253 * src/frontends/gnome/Makefile.am
254 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
255 to Gnome frontend. Both dialogs use "action" area.
257 2000-10-12 Baruch Even <baruch.even@writeme.com>
259 * src/graphics/GraphicsCacheItem_pimpl.C:
260 * src/graphics/Renderer.C:
261 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
264 2000-10-12 Juergen Vigna <jug@sad.it>
266 * src/insets/insettext.C (draw): fixed drawing bug (specifically
267 visible when selecting).
269 * development/Code_rules/Rules: fixed some typos.
271 2000-10-09 Baruch Even <baruch.even@writeme.com>
273 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
274 compiling on egcs 1.1.2 possible.
276 * src/filedlg.C (comp_direntry::operator() ): ditto.
278 2000-08-31 Baruch Even <baruch.even@writeme.com>
280 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
283 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
284 transient it now only gets freed when the object is destructed.
286 2000-08-24 Baruch Even <baruch.even@writeme.com>
288 * src/frontends/FormGraphics.h:
289 * src/frontends/FormGraphics.C: Changed to use ButtonController and
292 2000-08-20 Baruch Even <baruch.even@writeme.com>
294 * src/insets/insetgraphics.C:
295 (draw): Added messages to the drawn rectangle to report status.
296 (updateInset): Disabled the use of the inline graphics,
299 2000-08-17 Baruch Even <baruch.even@writeme.com>
301 * src/frontends/support: Directory added for the support of GUII LyX.
303 * src/frontends/support/LyXImage.h:
304 * src/frontends/support/LyXImage.C: Base class for GUII holding of
307 * src/frontends/support/LyXImage_X.h:
308 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
309 version of LyXImage, this uses the Xlib Pixmap.
314 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
315 replacement to Pixmap.
317 * src/insets/insetgraphics.h:
318 * src/insets/insetgraphics.C:
319 * src/graphics/GraphicsCacheItem.h:
320 * src/graphics/GraphicsCacheItem.C:
321 * src/graphics/GraphicsCacheItem_pimpl.h:
322 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
325 * src/graphics/GraphicsCacheItem.h:
326 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
327 another copy of the object.
329 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
330 of cacheHandle, this fixed a bug that sent LyX crashing.
332 * src/graphics/XPM_Renderer.h:
333 * src/graphics/XPM_Renderer.C:
334 * src/graphics/EPS_Renderer.h:
335 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
337 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
339 * src/lyxfunc.C (processKeySym): only handle the
340 lockinginset/inset stuff if we have a buffer and text loaded...
342 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
344 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
346 * src/support/lyxfunctional.h: add operator= that takes a reference
348 * src/lyxserver.C (mkfifo): make first arg const
350 * src/layout.h: renamed name(...) to setName(...) to work around
353 * src/buffer.C (setFileName): had to change name of function to
354 work around bugs in egcs. (renamed from fileName)
356 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
358 * src/support/translator.h: move helper template classes to
359 lyxfunctional.h, include "support/lyxfunctional.h"
361 * src/support/lyxmanip.h: add delaration of fmt
363 * src/support/lyxfunctional.h: new file
364 (class_fun_t): new template class
365 (class_fun): helper template function
366 (back_insert_fun_iterator): new template class
367 (back_inserter_fun): helper template function
368 (compare_memfun_t): new template class
369 (compare_memfun): helper template function
370 (equal_1st_in_pair): moved here from translator
371 (equal_2nd_in_pair): moved here from translator
373 * src/support/fmt.C: new file
374 (fmt): new func, can be used for a printf substitute when still
375 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
377 * src/support/StrPool.C: add some comments
379 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
382 * src/insets/figinset.C (addpidwait): use std::copy with
383 ostream_iterator to fill the pidwaitlist
385 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
387 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
390 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
393 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
395 * src/frontends/xforms/FormDocument.C (build): remove c_str()
396 (class_update): ditto
398 (CheckChoiceClass): move initialization of tc and tct
400 * src/tabular.C: remove current_view
401 (OldFormatRead): similar to right below [istream::ignore]
403 * src/lyxlex_pimpl.C (next): add code for faster skipping of
404 chars, unfortunately this is buggy on gcc 2.95.2, so currently
405 unused [istream::ignore]
407 * src/lyxfunc.C: include "support/lyxfunctional.h"
408 (getInsetByCode): use std::find_if and compare_memfun
410 * src/lyxfont.C (stateText): remove c_str()
412 * src/lyx_main.C (setDebuggingLevel): make static
413 (commandLineHelp): make static
415 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
416 Screen* together with fl_get_display() and fl_screen
418 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
419 togheter with fl_get_display() and fl_screen
420 (create_forms): remove c_str()
422 * src/layout.C: include "support/lyxfunctional.h"
423 (hasLayout): use std::find_if and compare_memfun
424 (GetLayout): use std::find_if and comapre_memfun
425 (delete_layout): use std::remove_if and compare_memfun
426 (NumberOfClass): use std:.find_if and compare_memfun
428 * src/gettext.h: change for the new functions
430 * src/gettext.C: new file, make _(char const * str) and _(string
431 const & str) real functions.
433 * src/font.C (width): rewrite slightly to avoid one extra variable
435 * src/debug.C: initialize Debug::ANY here
437 * src/commandtags.h: update number comments
439 * src/combox.h (get): make const func
441 (getline): make const
443 * src/combox.C (input_cb): handle case where fl_get_input can
446 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
447 "support/lyxfunctional.h", remove current_view variable.
448 (resize): use std::for_each with std::mem_fun
449 (getFileNames): use std::copy with back_inserter_fun
450 (getBuffer): change arg type to unsigned int
451 (emergencyWriteAll): call emergencyWrite with std::for_each and
453 (emergencyWrite): new method, the for loop in emergencyWriteAll
455 (exists): use std::find_if with compare_memfun
456 (getBuffer): use std::find_if and compare_memfun
458 * src/buffer.h: add typedefs for iterator_category, value_type
459 difference_type, pointer and reference for inset_iterator
460 add postfix ++ for inset_iterator
461 make inset_iterator::getPos() const
463 * src/buffer.C: added support/lyxmanip.h
464 (readFile): use lyxerr << fmt instead of printf
465 (makeLaTeXFile): use std::copy to write out encodings
467 * src/Painter.C (text): rewrite slightly to avoid extra font variable
469 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
470 free and the char * temp.
471 (hasMenu): use std::find_if and compare_memfun
474 * src/Makefile.am (lyx_SOURCES): added gettext.C
476 * src/LyXAction.C (retrieveActionArg): clear the arg, use
477 string::insert small change to avoid temporary
479 * src/LColor.C (getGUIName): remove c_str()
481 * several files: change all occurrences of fl_display to
484 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
485 that -pedantic is not used for gcc 2.97 (cvs gcc)
487 * boost/Makefile.am: begin slowly to prepare for a real boost lib
489 2000-10-11 Allan Rae <rae@lyx.org>
491 * src/frontends/xforms/FormPreferences.C (input): template path must be
492 a readable directory. It doesn't need to be writeable.
493 (build, delete, update, apply): New inputs in the various tabfolders
495 * src/frontends/xforms/forms/form_preferences.fd:
496 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
497 several new entries to existing folders. Shuffled some existing stuff
500 * src/frontends/xforms/forms/form_print.fd:
501 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
502 Should probably rework PrinterParams as well. Note that the switch to
503 collated is effectively the same as !unsorted so changing PrinterParams
504 will require a lot of fiddly changes to reverse the existing logic.
506 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
508 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
510 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
512 2000-10-10 Allan Rae <rae@lyx.org>
515 * src/lyxfunc.C (Dispatch):
517 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
520 * src/lyxrc.C (output): Only write the differences between system lyxrc
521 and the users settings.
524 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
526 I'll rewrite this later, after 1.1.6 probably, to keep a single
527 LyXRC but two instances of a LyXRCStruct.
529 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
531 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
533 * src/tabular.h: add a few std:: qualifiers.
535 * src/encoding.C: add using directive.
536 * src/language.C: ditto.
538 * src/insets/insetquotes.C (Validate): use languages->lang()
539 instead of only language.
541 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
543 * lib/languages: New file.
545 * lib/encodings: New file.
547 * src/language.C (Languages): New class.
548 (read): New method. Reads the languages from the 'languages' file.
550 * src/encoding.C (Encodings): New class.
551 (read): New method. Reads the encodings from the 'encodings' file.
553 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
556 * src/bufferparams.h and a lot of files: Deleted the member language,
557 and renamed language_info to language
559 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
560 * src/lyxfont.C (latexWriteStartChanges): ditto.
561 * src/paragraph.C (validate,TeXOnePar): ditto.
563 * src/lyxfont.C (update): Restored deleted code.
565 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
567 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
569 * src/BufferView_pimpl.C (buffer): cleaned up a little.
571 * src/insets/figinset.[Ch]:
572 * src/insets/insetinclude.[Ch]:
573 * src/insets/insetinclude.[Ch]:
574 * src/insets/insetparent.[Ch]:
575 * src/insets/insetref.[Ch]:
576 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
579 * src/mathed/formula.[Ch]:
580 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
582 * src/buffer.C (parseSingleLyXformat2Token, readInset):
583 * src/lyx_cb.C (FigureApplyCB):
584 * src/lyxfunc.C (getStatus, Dispatch):
585 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
588 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
590 * src/converter.[Ch] (Formats::View):
591 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
593 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
594 *current_view->buffer(). This will change later, but this patch is way
597 2000-10-09 Juergen Vigna <jug@sad.it>
599 * src/text.C (GetRow): small fix.
601 * src/BufferView_pimpl.C (cursorPrevious):
602 (cursorNext): added LyXText parameter to function.
604 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
605 keypress depending on cursor position.
607 2000-10-06 Juergen Vigna <jug@sad.it>
609 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
610 (copySelection): redone this function and also copy ascii representa-
613 * src/tabular.C (Ascii):
617 (print_n_chars): new functions to realize the ascii export of tabulars.
619 2000-10-05 Juergen Vigna <jug@sad.it>
621 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
622 if we don't have a buffer.
624 2000-10-10 Allan Rae <rae@lyx.org>
626 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
627 with closing dialog. It seems that nested tabfolders require hiding
628 of inner tabfolders before hiding the dialog itself. Actually all I
629 did was hide the active outer folder.
631 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
632 unless there really is a buffer. hideBufferDependent is called
635 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
636 POTFILES.in stays in $(srcdir).
638 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
640 * lib/lyxrc.example: Few changes.
642 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
644 * src/BufferView_pimpl.C (buffer): only need one the
645 updateBufferDependent signal to be emitted once! Moved to the end of
646 the method to allow bv_->text to be updated first.
648 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
649 and hSignal_ with Dialogs * and BufferDependency variables.
650 New Buffer * parent_, initialised when the dialog is launched. Used to
651 check whether to update() or hide() dialog in the new, private
652 updateOrHide() method that is connected to the updateBufferDependent
653 signal. Daughter classes dictate what to do using the
654 ChangedBufferAction enum, passed to the c-tor.
656 * src/frontends/xforms/FormCitation.C:
657 * src/frontends/xforms/FormCommand.C:
658 * src/frontends/xforms/FormCopyright.C:
659 * src/frontends/xforms/FormDocument.C:
660 * src/frontends/xforms/FormError.C:
661 * src/frontends/xforms/FormIndex.C:
662 * src/frontends/xforms/FormPreferences.C:
663 * src/frontends/xforms/FormPrint.C:
664 * src/frontends/xforms/FormRef.C:
665 * src/frontends/xforms/FormToc.C:
666 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
669 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
670 ChangedBufferAction enum.
672 * src/frontends/xforms/FormParagraph.[Ch]
673 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
676 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
678 * lib/bind/cua.bind: fix a bit.
679 * lib/bind/emacs.bind: ditto.
681 * lib/bind/menus.bind: remove real menu entries from there.
683 * src/spellchecker.C: make sure we only include strings.h when
686 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
688 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
689 function. It enlarges the maximum number of pup when needed.
690 (add_toc2): Open a new menu if maximum number of items per menu has
693 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
695 * src/frontends/kde/FormPrint.C: fix error reporting
697 * src/frontends/xforms/FormDocument.C: fix compiler
700 * lib/.cvsignore: add Literate.nw
702 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
705 * bufferview_funcs.[Ch]
708 * text2.C: Add support for numbers in RTL text.
710 2000-10-06 Allan Rae <rae@lyx.org>
712 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
713 to be gettext.m4 friendly again. ext_l10n.h is now
714 generated into $top_srcdir instead of $top_builddir
715 so that lyx.pot will be built correctly -- without
716 duplicate parsing of ext_l10n.h.
718 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
720 * src/frontends/kde/FormCitation.C: make the dialog
723 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
725 * config/kde.m4: fix consecutive ./configure runs,
726 look for qtarch, fix library order
728 * src/frontends/kde/Makefile.am: tidy up,
729 add Print dialog, add .dlg dependencies
731 * src/frontends/kde/FormPrint.C:
732 * src/frontends/kde/FormPrint.h:
733 * src/frontends/kde/formprintdialog.C:
734 * src/frontends/kde/formprintdialog.h:
735 * src/frontends/kde/formprintdialogdata.C:
736 * src/frontends/kde/formprintdialogdata.h:
737 * src/frontends/kde/dlg/formprintdialog.dlg: add
740 * src/frontends/kde/dlg/README: Added explanatory readme
742 * src/frontends/kde/dlg/checkinitorder.pl: small perl
743 script to double-check qtarch's output
745 * src/frontends/kde/formindexdialog.C:
746 * src/frontends/kde/formindexdialogdata.C:
747 * src/frontends/kde/formindexdialogdata.h:
748 * src/frontends/kde/dlg/formindexdialog.dlg: update
749 for qtarch, minor fixes
751 2000-10-05 Allan Rae <rae@lyx.org>
753 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
754 dialogs when switching buffers update them instead. It's up to each
755 dialog to decide if it should still be visible or not.
756 update() should return a bool to control visiblity within show().
757 Or perhaps better to set a member variable and use that to control
760 * lib/build-listerrors: create an empty "listerrors" file just to stop
761 make trying to regenerate it all the time if you don't have noweb
764 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
766 * po/Makefile.in.in (ext_l10n.h): added a rule to build
767 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
768 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
769 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
770 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
772 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
774 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
776 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
777 deleting buffer. Closes all buffer-dependent dialogs.
779 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
781 * src/frontends/xforms/FormCitation.[Ch]:
782 * src/frontends/xforms/FormPreferences.[Ch]:
783 * src/frontends/xforms/FormPrint.[Ch]:
784 * src/frontends/xforms/FormRef.[Ch]:
785 * src/frontends/xforms/FormUrl.[Ch]: ditto
787 * src/frontends/xforms/FormDocument.[Ch]:
788 * src/frontends/xforms/forms/form_document.C.patch:
789 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
790 pass through a single input() function.
792 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
794 * lib/build-listerrors: return status as OK
796 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
798 * lib/lyxrc.example: Updated to new export code
800 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
802 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
805 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
808 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
810 * lib/layouts/amsbook.layout: ditto.
812 * boost/Makefile.am: fix typo.
814 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
816 (add_lastfiles): removed.
817 (add_documents): removed.
818 (add_formats): removed.
820 * src/frontends/Menubar.C: remove useless "using" directive.
822 * src/MenuBackend.h: add a new MenuItem constructor.
824 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
827 2000-10-04 Allan Rae <rae@lyx.org>
829 * lib/Makefile.am (listerrors):
830 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
831 I haven't got notangle installed so Kayvan please test. The output
832 should end up in $builddir. This also allows people who don't have
833 noweb installed to complete the make process without error.
835 * src/frontends/xforms/FormCommand.[Ch] (showInset):
836 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
837 by JMarc's picky compiler.
839 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
842 * src/insets/insettabular.C (setPos): change for loop to not use
843 sequencing operator. Please check this Jürgen.
845 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
847 * src/insets/insetcite.C (getScreenLabel): ditto
848 * src/support/filetools.C (QuoteName): ditto
849 (ChangeExtension): ditto
851 * src/BufferView_pimpl.C (scrollCB): make heigt int
853 * src/BufferView2.C (insertInset): comment out unused arg
855 * boost/Makefile.am (EXTRADIST): new variable
857 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
859 * src/exporter.C (IsExportable): Fixed
861 * lib/configure.m4: Small fix
863 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
865 * src/insets/insetbutton.C (width): Changed to work with no GUI.
866 * src/insets/insetbib.C (bibitemWidest): ditto.
867 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
869 2000-10-03 Juergen Vigna <jug@sad.it>
871 * src/BufferView2.C (theLockingInset): removed const because of
872 Agnus's compile problems.
874 * src/insets/insettext.C (LocalDispatch): set the language of the
875 surronding paragraph on inserting the first character.
877 * various files: changed use of BufferView::the_locking_inset.
879 * src/BufferView2.C (theLockingInset):
880 (theLockingInset): new functions.
882 * src/BufferView.h: removed the_locking_inset.
884 * src/lyxtext.h: added the_locking_inset
886 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
888 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
890 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
892 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
893 * src/mathed/math_cursor.C (IsAlpha): ditto.
894 * src/mathed/math_inset.C (strnew): ditto.
895 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
896 (IMetrics): cxp set but never used; removed.
897 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
898 that the variable in question has been removed also!
901 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
902 using the Buffer * passed to Latex(), using the BufferView * passed to
903 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
905 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
906 Linuxdoc() and DocBook() rather than the stored Buffer * master.
908 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
909 * src/buffer.C (readInset): used new InsetBibtex c-tor
910 * (getBibkeyList): used new InsetBibtex::getKeys
912 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
915 * lib/build-listerrors
917 * src/exporter.C: Add literate programming support to the export code
920 * src/lyx_cb.C: Remove old literate code.
922 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
925 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
926 * src/converter.C (View, Convert): Use QuoteName.
928 * src/insets/figinset.C (Preview): Use Formats::View.
930 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
932 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
934 * src/lyxfunc.C (Dispatch): move declaration of text variable at
935 the top of the function, because compaq cxx complains that the
936 "goto exit_with_message" when the function is disabled bypasses
938 (MenuNew): try a better fix for the generation of new file names.
939 This time, I used AddName() instead of AddPath(), hoping Juergen
942 2000-10-03 Allan Rae <rae@lyx.org>
944 * src/frontends/xforms/forms/form_preferences.fd:
945 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
946 nested tabfolders has begun. The old "Miscellaneous" was renamed as
947 "Look and Feel"->"General" but will need to be split up further into
948 general output and general input tabs. Current plan is for four outer
949 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
950 stuff; "Inputs" for input and import configuration; "Outputs" for
951 output and export configuration; and one more whatever is left over
952 called "General". The leftovers at present look like being which
953 viewers to use, spellchecker, language support and might be better
954 named "Support". I've put "Paths" in "Inputs" for the moment as this
955 seems reasonable for now at least.
956 One problem remains: X error kills LyX when you close Preferences.
958 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
960 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
961 qualifier from form()
962 * src/frontends/xforms/FormCitation.[Ch]:
963 * src/frontends/xforms/FormCopyright.[Ch]:
964 * src/frontends/xforms/FormDocument.[Ch]:
965 * src/frontends/xforms/FormError.[Ch]:
966 * src/frontends/xforms/FormIndex.[Ch]:
967 * src/frontends/xforms/FormPreferences.[Ch]:
968 * src/frontends/xforms/FormPrint.[Ch]:
969 * src/frontends/xforms/FormRef.[Ch]:
970 * src/frontends/xforms/FormToc.[Ch]:
971 * src/frontends/xforms/FormUrl.[Ch]: ditto.
973 * src/frontends/xforms/FormCitation.[Ch]:
974 * src/frontends/xforms/FormIndex.[Ch]:
975 * src/frontends/xforms/FormRef.[Ch]:
976 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
977 with Allan's naming policy
979 * src/frontends/xforms/FormCitation.C: some static casts to remove
982 2000-10-02 Juergen Vigna <jug@sad.it>
984 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
985 now you can type or do stuff inside the table-cell also when in dummy
986 position, fixed visible cursor.
988 * src/insets/insettext.C (Edit): fixing cursor-view position.
990 * src/lyxfunc.C (Dispatch): use * text variable so that it can
991 be used for equal functions in lyxfunc and insettext.
993 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
995 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
997 * src/frontends/gnome/FormCitation.h:
998 * src/frontends/gnome/FormCopyright.h:
999 * src/frontends/gnome/FormIndex.h:
1000 * src/frontends/gnome/FormPrint.h:
1001 * src/frontends/gnome/FormToc.h:
1002 * src/frontends/gnome/FormUrl.h:
1003 * src/frontends/kde/FormCitation.h:
1004 * src/frontends/kde/FormCopyright.h:
1005 * src/frontends/kde/FormIndex.h:
1006 * src/frontends/kde/FormRef.h:
1007 * src/frontends/kde/FormToc.h:
1008 * src/frontends/kde/FormUrl.h: fix remaining users of
1011 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1013 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1014 from depth argument.
1015 (DocBookHandleCaption): ditto.
1016 (DocBookHandleFootnote): ditto.
1017 (SimpleDocBookOnePar): ditto.
1019 * src/frontends/xforms/FormDocument.h (form): remove extra
1020 FormDocument:: qualifier.
1022 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1024 * sigc++/handle.h: ditto.
1026 * src/lyx_gui_misc.C: add "using" directive.
1028 * src/cheaders/cstddef: new file, needed by the boost library (for
1031 2000-10-02 Juergen Vigna <jug@sad.it>
1033 * src/insets/insettext.C (SetFont): better support.
1035 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1037 * src/screen.C (DrawOneRow): some uint refixes!
1039 2000-10-02 Allan Rae <rae@lyx.org>
1041 * boost/.cvsignore: ignore Makefile as well
1043 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1044 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1046 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1047 Left this one out by accident.
1049 * src/frontends/xforms/FormBase.h (restore): default to calling
1050 update() since that will restore the original/currently-applied values.
1051 Any input() triggered error messages will require the derived classes
1052 to redefine restore().
1054 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1055 avoid a segfault. combo_doc_class is the main concern.
1057 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1059 * Simplify build-listerrors in view of GUI-less export ability!
1061 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1063 * src/lyx_main.C (easyParse): Disable gui when exporting
1065 * src/insets/figinset.C:
1068 * src/lyx_gui_misc.C
1069 * src/tabular.C: Changes to allow no-gui.
1071 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1073 * src/support/utility.hpp: removed file
1074 * src/support/block.h: removed file
1076 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1079 * src/mathed/formula.C: add support/lyxlib.h
1080 * src/mathed/formulamacro.C: ditto
1082 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1083 * src/lyxparagraph.h: ditto
1085 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1086 * src/frontends/Makefile.am (INCLUDES): ditto
1087 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1088 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1089 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1090 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1091 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1092 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1094 * src/BufferView.h: use boost/utility.hpp
1095 * src/LColor.h: ditto
1096 * src/LaTeX.h: ditto
1097 * src/LyXAction.h: ditto
1098 * src/LyXView.h: ditto
1099 * src/bufferlist.h: ditto
1100 * src/lastfiles.h: ditto
1101 * src/layout.h: ditto
1102 * src/lyx_gui.h: ditto
1103 * src/lyx_main.h: ditto
1104 * src/lyxlex.h: ditto
1105 * src/lyxrc.h: ditto
1106 * src/frontends/ButtonPolicies.h: ditto
1107 * src/frontends/Dialogs.h: ditto
1108 * src/frontends/xforms/FormBase.h: ditto
1109 * src/frontends/xforms/FormGraphics.h: ditto
1110 * src/frontends/xforms/FormParagraph.h: ditto
1111 * src/frontends/xforms/FormTabular.h: ditto
1112 * src/graphics/GraphicsCache.h: ditto
1113 * src/graphics/Renderer.h: ditto
1114 * src/insets/ExternalTemplate.h: ditto
1115 * src/insets/insetcommand.h: ditto
1116 * src/support/path.h: ditto
1118 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1119 and introduce clause for 2.97.
1121 * boost/libs/README: new file
1123 * boost/boost/utility.hpp: new file
1125 * boost/boost/config.hpp: new file
1127 * boost/boost/array.hpp: new file
1129 * boost/Makefile.am: new file
1131 * boost/.cvsignore: new file
1133 * configure.in (AC_OUTPUT): add boost/Makefile
1135 * Makefile.am (SUBDIRS): add boost
1137 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1139 * src/support/lstrings.C (suffixIs): Fixed.
1141 2000-10-01 Allan Rae <rae@lyx.org>
1143 * src/PrinterParams.h: moved things around to avoid the "can't
1144 inline call" warning.
1146 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1147 into doc++ documentation.
1149 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1151 * src/frontends/xforms/FormRef.C: make use of button controller
1152 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1153 cleaned up button controller usage.
1154 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1155 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1156 use the button controller
1158 * src/frontends/xforms/forms/*.fd: and associated generated files
1159 updated to reflect changes to FormBase. Some other FormXxxx files
1160 also got minor updates to reflect changes to FormBase.
1162 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1163 (hide): made virtual.
1164 (input): return a bool. true == valid input
1165 (RestoreCB, restore): new
1166 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1167 Changes to allow derived dialogs to use a ButtonController and
1168 make sense when doing so: OK button calls ok() and so on.
1170 * src/frontends/xforms/ButtonController.h (class ButtonController):
1171 Switch from template implementation to taking Policy parameter.
1172 Allows FormBase to provide a ButtonController for any dialog.
1174 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1175 Probably should rename connect and disconnect.
1176 (apply): use the radio button groups
1177 (form): needed by FormBase
1178 (build): setup the radio button groups
1180 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1182 * several files: type changes to reduce the number of warnings and
1183 to unify type hangling a bit. Still much to do.
1185 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1187 * lib/images/*: rename a bunch of icons to match Dekel converter
1190 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1193 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1195 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1197 * sigc++/handle.h: ditto for class Handle.
1199 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1201 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1203 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1205 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1206 removal of the "default" language.
1208 * src/combox.h (getline): Check that sel > 0
1210 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1212 * lib/examples/docbook_example.lyx
1213 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1215 * lib/layouts/docbook-book.layout: new docbook book layout.
1217 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1219 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1221 * src/insets/figinset.C (DocBook):fixed small typo.
1223 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1225 * src/insets/insetinclude.h: string include_label doesn't need to be
1228 2000-09-29 Allan Rae <rae@lyx.org>
1230 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1231 Allow derived type to control connection and disconnection from signals
1232 of its choice if desired.
1234 2000-09-28 Juergen Vigna <jug@sad.it>
1236 * src/insets/insettabular.C (update): fixed cursor setting when
1237 the_locking_inset changed.
1238 (draw): made this a bit cleaner.
1239 (InsetButtonPress): fixed!
1241 * various files: added LyXText Parameter to fitCursor call.
1243 * src/BufferView.C (fitCursor): added LyXText parameter.
1245 * src/insets/insettabular.C (draw): small draw fix.
1247 * src/tabular.C: right setting of left/right celllines.
1249 * src/tabular.[Ch]: fixed various types in funcions and structures.
1250 * src/insets/insettabular.C: ditto
1251 * src/frontends/xforms/FormTabular.C: ditto
1253 2000-09-28 Allan Rae <rae@lyx.org>
1255 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1256 that the #ifdef's had been applied to part of what should have been
1257 a complete condition. It's possible there are other tests that
1258 were specific to tables that are also wrong now that InsetTabular is
1259 being used. Now we need to fix the output of '\n' after a table in a
1260 float for the same reason as the original condition:
1261 "don't insert this if we would be adding it before or after a table
1262 in a float. This little trick is needed in order to allow use of
1263 tables in \subfigures or \subtables."
1264 Juergen can you check this?
1266 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1268 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1269 outputed to the ostream.
1271 * several files: fixed types based on warnings from cxx
1273 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1275 * src/frontends/kde/Makefile.am: fix rule for
1276 formindexdialogdata_moc.C
1278 * src/.cvsignore: add ext_l10n.h to ignore
1280 * acconfig.h: stop messing with __STRICT_ANSI__
1281 * config/gnome.m4: remove option to set -ansi
1282 * config/kde.m4: remove option to set -ansi
1283 * config/lyxinclude.m4: don't set -ansi
1285 2000-09-27 Juergen Vigna <jug@sad.it>
1287 * various files: remove "default" language check.
1289 * src/insets/insetquotes.C: removed use of current_view.
1291 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1292 the one should have red ears by now!
1294 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1295 in more then one paragraph. Fixed cursor-movement/selection.
1297 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1298 paragraphs inside a text inset.
1300 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1301 text-inset if this owner is an inset.
1303 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1305 * src/Bullet.h: changed type of font, character and size to int
1307 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1309 * src/insets/inseturl.[Ch]:
1310 * src/insets/insetref.[Ch]:
1311 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1313 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1315 * src/buffer.C (readFile): block-if statement rearranged to minimise
1316 bloat. Patch does not reverse Jean-Marc's change ;-)
1318 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1319 Class rewritten to store pointers to hide/update signals directly,
1320 rather than Dialogs *. Also defined an enum to ease use. All xforms
1321 forms can now be derived from this class.
1323 * src/frontends/xforms/FormCommand.[Ch]
1324 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1326 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1329 * src/frontends/xforms/forms/form_citation.fd
1330 * src/frontends/xforms/forms/form_copyright.fd
1331 * src/frontends/xforms/forms/form_error.fd
1332 * src/frontends/xforms/forms/form_index.fd
1333 * src/frontends/xforms/forms/form_ref.fd
1334 * src/frontends/xforms/forms/form_toc.fd
1335 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1337 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1339 * src/insets/insetfoot.C: removed redundent using directive.
1341 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1343 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1344 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1346 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1347 created in the constructors in different groups. Then set() just
1348 have to show the groups as needed. This fixes the redraw problems
1349 (and is how the old menu code worked).
1351 * src/support/lyxlib.h: declare the methods as static when we do
1352 not have namespaces.
1354 2000-09-26 Juergen Vigna <jug@sad.it>
1356 * src/buffer.C (asciiParagraph): new function.
1357 (writeFileAscii): new function with parameter ostream.
1358 (writeFileAscii): use now asciiParagraph.
1360 * various inset files: added the linelen parameter to the Ascii-func.
1362 * src/tabular.C (Write): fixed error in writing file introduced by
1363 the last changes from Lars.
1365 * lib/bind/menus.bind: removed not supported functions.
1367 * src/insets/insettext.C (Ascii): implemented this function.
1369 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1371 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1372 (Write): use of the write_attribute functions.
1374 * src/bufferlist.C (close): fixed reasking question!
1376 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1378 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1379 new files use the everwhere possible.
1382 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1383 src/log_form.C src/lyx.C:
1386 * src/buffer.C (runLaTeX): remove func
1388 * src/PaperLayout.C: removed file
1389 * src/ParagraphExtra.C: likewise
1390 * src/bullet_forms.C: likewise
1391 * src/bullet_forms.h: likewise
1392 * src/bullet_forms_cb.C: likewise
1394 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1395 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1398 * several files: remove all traces of the old fd_form_paragraph,
1399 and functions belonging to that.
1401 * several files: remove all traces of the old fd_form_document,
1402 and functions belonging to that.
1404 * several files: constify local variables were possible.
1406 * several files: remove all code that was dead when NEW_EXPORT was
1409 * several files: removed string::c_str in as many places as
1412 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1413 (e): be a bit more outspoken when patching
1414 (updatesrc): only move files if changed.
1416 * forms/layout_forms.h.patch: regenerated
1418 * forms/layout_forms.fd: remove form_document and form_paragraph
1419 and form_quotes and form_paper and form_table_options and
1420 form_paragraph_extra
1422 * forms/form1.fd: remove form_table
1424 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1425 the fdui->... rewrite. Update some comments to xforms 0.88
1427 * forms/bullet_forms.C.patch: removed file
1428 * forms/bullet_forms.fd: likewise
1429 * forms/bullet_forms.h.patch: likewise
1431 * development/Code_rules/Rules: added a section on switch
1432 statements. Updated some comment to xforms 0.88.
1434 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1436 * src/buffer.C (readFile): make sure that the whole version number
1437 is read after \lyxformat (even when it contains a comma)
1439 * lib/ui/default.ui: change shortcut of math menu to M-a.
1441 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1443 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1446 * src/LyXView.C (updateWindowTitle): show the full files name in
1447 window title, limited to 30 characters.
1449 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1450 When a number of characters has been given, we should not assume
1451 that the string is 0-terminated.
1453 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1454 calls (fixes some memory leaks)
1456 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1457 trans member on exit.
1459 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1461 * src/converter.C (GetReachable): fix typo.
1463 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1464 understand ',' instead of '.'.
1465 (GetInteger): rewrite to use strToInt().
1467 2000-09-26 Juergen Vigna <jug@sad.it>
1469 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1470 better visibility and error-message on wrong VSpace input.
1472 * src/language.C (initL): added english again.
1474 2000-09-25 Juergen Vigna <jug@sad.it>
1476 * src/frontends/kde/Dialogs.C (Dialogs):
1477 * src/frontends/gnome/Dialogs.C (Dialogs):
1478 * src/frontends/kde/Makefile.am:
1479 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1481 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1483 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1485 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1487 * src/frontends/xforms/FormParagraph.C:
1488 * src/frontends/xforms/FormParagraph.h:
1489 * src/frontends/xforms/form_paragraph.C:
1490 * src/frontends/xforms/form_paragraph.h:
1491 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1494 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1496 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1497 Paragraph-Data after use.
1499 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1500 non breakable paragraphs.
1502 2000-09-25 Garst R. Reese <reese@isn.net>
1504 * src/language.C (initL): added missing language_country codes.
1506 2000-09-25 Juergen Vigna <jug@sad.it>
1508 * src/insets/insettext.C (InsetText):
1509 (deleteLyXText): remove the not released LyXText structure!
1511 2000-09-24 Marko Vendelin <markov@ioc.ee>
1513 * src/frontends/gnome/mainapp.C
1514 * src/frontends/gnome/mainapp.h: added support for keyboard
1517 * src/frontends/gnome/FormCitation.C
1518 * src/frontends/gnome/FormCitation.h
1519 * src/frontends/gnome/Makefile.am
1520 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1521 FormCitation to use "action area" in mainapp window
1523 * src/frontends/gnome/Menubar_pimpl.C
1524 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1527 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1529 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1530 width/descent/ascent values if name is empty.
1531 (mathed_string_height): Use std::max.
1533 2000-09-25 Allan Rae <rae@lyx.org>
1535 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1536 segfault. This will be completely redesigned soon.
1538 * sigc++: updated libsigc++. Fixes struct timespec bug.
1540 * development/tools/makeLyXsigc.sh: .cvsignore addition
1542 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1544 * several files: removed almost all traces of the old table
1547 * src/TableLayout.C: removed file
1549 2000-09-22 Juergen Vigna <jug@sad.it>
1551 * src/frontends/kde/Dialogs.C: added credits forms.
1553 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1555 * src/frontends/gnome/Dialogs.C: added some forms.
1557 * src/spellchecker.C (init_spell_checker): set language in pspell code
1558 (RunSpellChecker): some modifications for setting language string.
1560 * src/language.[Ch]: added language_country code.
1562 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1564 * src/frontends/Dialogs.h: added new signal showError.
1565 Rearranged existing signals in some sort of alphabetical order.
1567 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1568 FormError.[Ch], form_error.[Ch]
1569 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1570 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1572 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1573 dialogs. I think that this can be used as the base to all these
1576 * src/frontends/xforms/FormError.[Ch]
1577 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1578 implementation of InsetError dialog.
1580 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1582 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1583 * src/frontends/kde/Makefile.am: ditto
1585 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1587 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1588 macrobf. This fixes a bug of invisible text.
1590 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1592 * lib/doc/LaTeXConfig.lyx.in: updated.
1594 * src/language.C (initL): remove language "francais" and change a
1595 bit the names of the two other french variations.
1597 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1598 string that may not be 0-terminated.
1600 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1602 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1604 2000-09-20 Marko Vendelin <markov@ioc.ee>
1606 * src/frontends/gnome/FormCitation.C
1607 * src/frontends/gnome/FormIndex.C
1608 * src/frontends/gnome/FormToc.C
1609 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1610 the variable initialization to shut up the warnings
1612 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1614 * src/table.[Ch]: deleted files
1616 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1619 2000-09-18 Juergen Vigna <jug@sad.it>
1621 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1622 problems with selection. Inserted new LFUN_PASTESELECTION.
1623 (InsetButtonPress): inserted handling of middle mouse-button paste.
1625 * src/spellchecker.C: changed word to word.c_str().
1627 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1629 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1630 included in the ``make dist'' tarball.
1632 2000-09-15 Juergen Vigna <jug@sad.it>
1634 * src/CutAndPaste.C (cutSelection): small fix return the right
1635 end position after cut inside one paragraph only.
1637 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1638 we are locked as otherwise we don't have a valid cursor position!
1640 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1642 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1644 * src/frontends/kde/FormRef.C: added using directive.
1645 * src/frontends/kde/FormToc.C: ditto
1647 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1649 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1651 2000-09-19 Marko Vendelin <markov@ioc.ee>
1653 * src/frontends/gnome/Menubar_pimpl.C
1654 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1655 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1657 * src/frontends/gnome/mainapp.C
1658 * src/frontends/gnome/mainapp.h: support for menu update used
1661 * src/frontends/gnome/mainapp.C
1662 * src/frontends/gnome/mainapp.h: support for "action" area in the
1663 main window. This area is used by small simple dialogs, such as
1666 * src/frontends/gnome/FormIndex.C
1667 * src/frontends/gnome/FormIndex.h
1668 * src/frontends/gnome/FormUrl.C
1669 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1672 * src/frontends/gnome/FormCitation.C
1673 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1674 action area. Only "Insert new citation" is implemented.
1676 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1678 * src/buffer.C (Dispatch): fix call to Dispatch
1679 * src/insets/insetref.C (Edit): likewise
1680 * src/insets/insetparent.C (Edit): likewise
1681 * src/insets/insetinclude.C (include_cb): likewise
1682 * src/frontends/xforms/FormUrl.C (apply): likewise
1683 * src/frontends/xforms/FormToc.C (apply): likewise
1684 * src/frontends/xforms/FormRef.C (apply): likewise
1685 * src/frontends/xforms/FormIndex.C (apply): likewise
1686 * src/frontends/xforms/FormCitation.C (apply): likewise
1687 * src/lyxserver.C (callback): likewise
1688 * src/lyxfunc.C (processKeySym): likewise
1689 (Dispatch): likewise
1690 (Dispatch): likewise
1691 * src/lyx_cb.C (LayoutsCB): likewise
1693 * Makefile.am (sourcedoc): small change
1695 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1697 * src/main.C (main): Don't make an empty GUIRunTime object. all
1698 methods are static. constify a bit remove unneded using + headers.
1700 * src/tabular.C: some more const to local vars move some loop vars
1702 * src/spellchecker.C: added some c_str after some word for pspell
1704 * src/frontends/GUIRunTime.h: add new static method setDefaults
1705 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1706 * src/frontends/kde/GUIRunTime.C (setDefaults):
1707 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1709 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1710 with strnew in arg, use correct emptystring when calling SetName.
1712 * several files: remove all commented code with relation to
1713 HAVE_SSTREAM beeing false. We now only support stringstream and
1716 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1718 * src/lyxfunc.C: construct correctly the automatic new file
1721 * src/text2.C (IsStringInText): change type of variable i to shut
1724 * src/support/sstream.h: do not use namespaces if the compiler
1725 does not support them.
1727 2000-09-15 Marko Vendelin <markov@ioc.ee>
1728 * src/frontends/gnome/FormCitation.C
1729 * src/frontends/gnome/FormCitation.h
1730 * src/frontends/gnome/diainsertcitation_interface.c
1731 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1732 regexp support to FormCitation [Gnome].
1734 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1737 * configure.in: remove unused KDE/GTKGUI define
1739 * src/frontends/kde/FormRef.C
1740 * src/frontends/kde/FormRef.h
1741 * src/frontends/kde/formrefdialog.C
1742 * src/frontends/kde/formrefdialog.h: double click will
1743 go to reference, now it is possible to change a cross-ref
1746 * src/frontends/kde/FormToc.C
1747 * src/frontends/kde/FormToc.h
1748 * src/frontends/kde/formtocdialog.C
1749 * src/frontends/kde/formtocdialog.h: add a depth
1752 * src/frontends/kde/Makefile.am: add QtLyXView.h
1755 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1757 * src/frontends/kde/FormCitation.h: added some using directives.
1759 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1761 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1764 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1767 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1769 * src/buffer.C (pop_tag): revert for the second time a change by
1770 Lars, who seems to really hate having non-local loop variables :)
1772 * src/Lsstream.h: add "using" statements.
1774 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1775 * src/buffer.C (writeFile): ditto
1777 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1779 * src/buffer.C (writeFile): try to fix the locale modified format
1780 number to always be as we want it.
1782 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1783 in XForms 0.89. C-space is now working again.
1785 * src/Lsstream.h src/support/sstream.h: new files.
1787 * also commented out all cases where strstream were used.
1789 * src/Bullet.h (c_str): remove method.
1791 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1793 * a lot of files: get rid of "char const *" and "char *" is as
1794 many places as possible. We only want to use them in interaction
1795 with system of other libraries, not inside lyx.
1797 * a lot of files: return const object is not of pod type. This
1798 helps ensure that temporary objects is not modified. And fits well
1799 with "programming by contract".
1801 * configure.in: check for the locale header too
1803 * Makefile.am (sourcedoc): new tag for generation of doc++
1806 2000-09-14 Juergen Vigna <jug@sad.it>
1808 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1809 callback to check which combo called it and do the right action.
1811 * src/combox.C (combo_cb): added combo * to the callbacks.
1812 (Hide): moved call of callback after Ungrab of the pointer.
1814 * src/intl.h: removed LCombo2 function.
1816 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1817 function as this can now be handled in one function.
1819 * src/combox.h: added Combox * to callback prototype.
1821 * src/frontends/xforms/Toolbar_pimpl.C:
1822 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1824 2000-09-14 Garst Reese <reese@isn.net>
1826 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1827 moved usepackage{xxx}'s to beginning of file. Changed left margin
1828 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1829 underlining from title. Thanks to John Culleton for useful suggestions.
1831 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1833 * src/lyxlex_pimpl.C (setFile): change error message to debug
1836 2000-09-13 Juergen Vigna <jug@sad.it>
1838 * src/frontends/xforms/FormDocument.C: implemented choice_class
1839 as combox and give callback to combo_language so OK/Apply is activated
1842 * src/bufferlist.C (newFile): small fix so already named files
1843 (via an open call) are not requested to be named again on the
1846 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1848 * src/frontends/kde/Makefile.am
1849 * src/frontends/kde/FormRef.C
1850 * src/frontends/kde/FormRef.h
1851 * src/frontends/kde/formrefdialog.C
1852 * src/frontends/kde/formrefdialog.h: implement
1855 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1857 * src/frontends/kde/formtocdialog.C
1858 * src/frontends/kde/formtocdialog.h
1859 * src/frontends/kde/FormToc.C
1860 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1862 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1864 * src/frontends/kde/FormCitation.C: fix thinko
1865 where we didn't always display the reference text
1868 * src/frontends/kde/formurldialog.C
1869 * src/frontends/kde/formurldialog.h
1870 * src/frontends/kde/FormUrl.C
1871 * src/frontends/kde/FormUrl.h: minor cleanups
1873 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1875 * src/frontends/kde/Makefile.am
1876 * src/frontends/kde/FormToc.C
1877 * src/frontends/kde/FormToc.h
1878 * src/frontends/kde/FormCitation.C
1879 * src/frontends/kde/FormCitation.h
1880 * src/frontends/kde/FormIndex.C
1881 * src/frontends/kde/FormIndex.h
1882 * src/frontends/kde/formtocdialog.C
1883 * src/frontends/kde/formtocdialog.h
1884 * src/frontends/kde/formcitationdialog.C
1885 * src/frontends/kde/formcitationdialog.h
1886 * src/frontends/kde/formindexdialog.C
1887 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1889 2000-09-12 Juergen Vigna <jug@sad.it>
1891 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1894 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1896 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1899 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1901 * src/converter.C (Add, Convert): Added support for converter flags:
1902 needaux, resultdir, resultfile.
1903 (Convert): Added new parameter view_file.
1904 (dvips_options): Fixed letter paper option.
1906 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1907 (Export, GetExportableFormats, GetViewableFormats): Added support
1910 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1912 (easyParse): Fixed to work with new export code.
1914 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1917 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1919 * lib/bind/*.bind: Replaced
1920 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1921 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1923 2000-09-11 Juergen Vigna <jug@sad.it>
1925 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1927 * src/main.C (main): now GUII defines global guiruntime!
1929 * src/frontends/gnome/GUIRunTime.C (initApplication):
1930 * src/frontends/kde/GUIRunTime.C (initApplication):
1931 * src/frontends/xforms/GUIRunTime.C (initApplication):
1932 * src/frontends/GUIRunTime.h: added new function initApplication.
1934 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1936 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1938 2000-09-08 Juergen Vigna <jug@sad.it>
1940 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1941 we have already "Reset".
1943 * src/language.C (initL): inserted "default" language and made this
1944 THE default language (and not american!)
1946 * src/paragraph.C: inserted handling of "default" language!
1948 * src/lyxfont.C: ditto
1952 * src/paragraph.C: output the \\par only if we have a following
1953 paragraph otherwise it's not needed.
1955 2000-09-05 Juergen Vigna <jug@sad.it>
1957 * config/pspell.m4: added entry to lyx-flags
1959 * src/spellchecker.C: modified version from Kevin for using pspell
1961 2000-09-01 Marko Vendelin <markov@ioc.ee>
1962 * src/frontends/gnome/Makefile.am
1963 * src/frontends/gnome/FormCitation.C
1964 * src/frontends/gnome/FormCitation.h
1965 * src/frontends/gnome/diainsertcitation_callbacks.c
1966 * src/frontends/gnome/diainsertcitation_callbacks.h
1967 * src/frontends/gnome/diainsertcitation_interface.c
1968 * src/frontends/gnome/diainsertcitation_interface.h
1969 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1970 dialog for Gnome frontend
1972 * src/main.C: Gnome libraries require keeping application name
1973 and its version as strings
1975 * src/frontends/gnome/mainapp.C: Change the name of the main window
1976 from GnomeLyX to PACKAGE
1978 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1980 * src/frontends/Liason.C: add "using: declaration.
1982 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1984 * src/mathed/math_macro.C (Metrics): Set the size of the template
1986 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1988 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1990 * src/converter.C (add_options): New function.
1991 (SetViewer): Change $$FName into '$$FName'.
1992 (View): Add options when running xdvi
1993 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1994 (Convert): The 3rd parameter is now the desired filename. Converts
1995 calls to lyx::rename if necessary.
1996 Add options when running dvips.
1997 (dvi_papersize,dvips_options): New methods.
1999 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2001 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2002 using a call to Converter::dvips_options.
2003 Fixed to work with nex export code.
2005 * src/support/copy.C
2006 * src/support/rename.C: New files
2008 * src/support/syscall.h
2009 * src/support/syscall.C: Added Starttype SystemDontWait.
2011 * lib/ui/default.ui: Changed to work with new export code
2013 * lib/configure.m4: Changed to work with new export code
2015 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2017 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2019 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2020 so that code compiles with DEC cxx.
2022 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2023 to work correctly! Also now supports the additional elements
2026 2000-09-01 Allan Rae <rae@lyx.org>
2028 * src/frontends/ButtonPolicies.C: renamed all the references to
2029 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2031 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2032 since it's a const not a type.
2034 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2036 2000-08-31 Juergen Vigna <jug@sad.it>
2038 * src/insets/figinset.C: Various changes to look if the filename has
2039 an extension and if not add it for inline previewing.
2041 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2043 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2044 make buttonStatus and isReadOnly be const methods. (also reflect
2045 this in derived classes.)
2047 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2048 (nextState): change to be static inline, pass the StateMachine as
2050 (PreferencesPolicy): remove casts
2051 (OkCancelPolicy): remvoe casts
2052 (OkCancelReadOnlyPolicy): remove casts
2053 (NoRepeatedApplyReadOnlyPolicy): remove casts
2054 (OkApplyCancelReadOnlyPolicy): remove casts
2055 (OkApplyCancelPolicy): remove casts
2056 (NoRepeatedApplyPolicy): remove casts
2058 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2060 * src/converter.C: added some using directives
2062 * src/frontends/ButtonPolicies.C: changes to overcome
2063 "need lvalue" error with DEC c++
2065 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2066 to WMHideCB for DEC c++
2068 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2070 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2071 to BulletBMTableCB for DEC c++
2073 2000-08-31 Allan Rae <rae@lyx.org>
2075 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2076 character dialog separately from old document dialogs combo_language.
2079 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2081 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2082 Removed LFUN_REF_CREATE.
2084 * src/MenuBackend.C: Added new tags: toc and references
2086 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2087 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2089 (add_toc, add_references): New methods.
2090 (create_submenu): Handle correctly the case when there is a
2091 seperator after optional menu items.
2093 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2094 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2095 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2097 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2099 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2101 * src/converter.[Ch]: New file for converting between different
2104 * src/export.[Ch]: New file for exporting a LyX file to different
2107 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2108 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2109 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2110 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2111 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2112 RunDocBook, MenuExport.
2114 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2115 Exporter::Preview methods if NEW_EXPORT is defined.
2117 * src/buffer.C (Dispatch): Use Exporter::Export.
2119 * src/lyxrc.C: Added new tags: \converter and \viewer.
2122 * src/LyXAction.C: Define new lyx-function: buffer-update.
2123 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2124 when NEW_EXPORT is defined.
2126 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2128 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2130 * lib/ui/default.ui: Added submenus "view" and "update" to the
2133 * src/filetools.C (GetExtension): New function.
2135 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2137 2000-08-29 Allan Rae <rae@lyx.org>
2139 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2141 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2142 (EnableDocumentLayout): removed
2143 (DisableDocumentLayout): removed
2144 (build): make use of ButtonController's read-only handling to
2145 de/activate various objects. Replaces both of the above functions.
2147 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2148 (readOnly): was read_only
2149 (refresh): fixed dumb mistakes with read_only_ handling
2151 * src/frontends/xforms/forms/form_document.fd:
2152 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2153 tabbed dialogs so the tabs look more like tabs and so its easier to
2154 work out which is the current tab.
2156 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2157 segfault with form_table
2159 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2161 2000-08-28 Juergen Vigna <jug@sad.it>
2163 * acconfig.h: added USE_PSPELL.
2165 * src/config.h.in: added USE_PSPELL.
2167 * autogen.sh: added pspell.m4
2169 * config/pspell.m4: new file.
2171 * src/spellchecker.C: implemented support for pspell libary.
2173 2000-08-25 Juergen Vigna <jug@sad.it>
2175 * src/LyXAction.C (init): renamed LFUN_TABLE to
2176 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2178 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2180 * src/lyxscreen.h: add force_clear variable and fuction to force
2181 a clear area when redrawing in LyXText.
2183 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2185 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2187 * some whitespace and comment changes.
2189 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2191 * src/buffer.C: up te LYX_FORMAT to 2.17
2193 2000-08-23 Juergen Vigna <jug@sad.it>
2195 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2198 * src/insets/insettabular.C (pasteSelection): delete the insets
2199 LyXText as it is not valid anymore.
2200 (copySelection): new function.
2201 (pasteSelection): new function.
2202 (cutSelection): new function.
2203 (LocalDispatch): implemented cut/copy/paste of cell selections.
2205 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2206 don't have a LyXText.
2208 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2210 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2213 2000-08-22 Juergen Vigna <jug@sad.it>
2215 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2216 ifdef form_table out if NEW_TABULAR.
2218 2000-08-21 Juergen Vigna <jug@sad.it>
2220 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2221 (draw): fixed draw position so that the cursor is positioned in the
2223 (InsetMotionNotify): hide/show cursor so the position is updated.
2224 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2225 using cellstart() function where it should be used.
2227 * src/insets/insettext.C (draw): ditto.
2229 * src/tabular.C: fixed initialization of some missing variables and
2230 made BoxType into an enum.
2232 2000-08-22 Marko Vendelin <markov@ioc.ee>
2233 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2234 stock menu item using action numerical value, not its string
2238 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2240 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2241 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2243 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2245 * src/frontends/xforms/GUIRunTime.C: new file
2247 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2248 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2250 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2252 * src/frontends/kde/GUIRunTime.C: new file
2254 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2255 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2257 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2259 * src/frontends/gnome/GUIRunTime.C: new file
2261 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2264 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2265 small change to documetentation.
2267 * src/frontends/GUIRunTime.C: removed file
2269 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2271 * src/lyxparagraph.h: enable NEW_TABULAR as default
2273 * src/lyxfunc.C (processKeySym): remove some commented code
2275 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2276 NEW_TABULAR around the fd_form_table_options.
2278 * src/lyx_gui.C (runTime): call the static member function as
2279 GUIRunTime::runTime().
2281 2000-08-21 Allan Rae <rae@lyx.org>
2283 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2286 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2288 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2290 2000-08-21 Allan Rae <rae@lyx.org>
2292 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2293 keep Garst happy ;-)
2294 * src/frontends/xforms/FormPreferences.C (build): use setOK
2295 * src/frontends/xforms/FormDocument.C (build): use setOK
2296 (FormDocument): use the appropriate policy.
2298 2000-08-21 Allan Rae <rae@lyx.org>
2300 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2301 automatic [de]activation of arbitrary objects when in a read-only state.
2303 * src/frontends/ButtonPolicies.h: More documentation
2304 (isReadOnly): added to support the above.
2306 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2308 2000-08-18 Juergen Vigna <jug@sad.it>
2310 * src/insets/insettabular.C (getStatus): changed to return func_status.
2312 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2313 display toggle menu entries if they are.
2315 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2316 new document layout now.
2318 * src/lyxfunc.C: ditto
2320 * src/lyx_gui_misc.C: ditto
2322 * src/lyx_gui.C: ditto
2324 * lib/ui/default.ui: removed paper and quotes layout as they are now
2325 all in the document layout tabbed folder.
2327 * src/frontends/xforms/forms/form_document.fd: added Restore
2328 button and callbacks for all inputs for Allan's ButtonPolicy.
2330 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2331 (CheckChoiceClass): added missing params setting on class change.
2332 (UpdateLayoutDocument): added for updating the layout on params.
2333 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2334 (FormDocument): Implemented Allan's ButtonPolicy with the
2337 2000-08-17 Allan Rae <rae@lyx.org>
2339 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2340 so we can at least see the credits again.
2342 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2343 controller calls for the appropriate callbacks. Note that since Ok
2344 calls apply followed by cancel, and apply isn't a valid input for the
2345 APPLIED state, the bc_ calls have to be made in the static callback not
2346 within each of the real callbacks.
2348 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2349 (setOk): renamed from setOkay()
2351 2000-08-17 Juergen Vigna <jug@sad.it>
2353 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2354 in the implementation part.
2355 (composeUIInfo): don't show optional menu-items.
2357 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2359 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2361 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2362 text-state when in a text-inset.
2364 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2366 2000-08-17 Marko Vendelin <markov@ioc.ee>
2367 * src/frontends/gnome/FormIndex.C
2368 * src/frontends/gnome/FormIndex.h
2369 * src/frontends/gnome/FormToc.C
2370 * src/frontends/gnome/FormToc.h
2371 * src/frontends/gnome/dialogs
2372 * src/frontends/gnome/diatoc_callbacks.c
2373 * src/frontends/gnome/diatoc_callbacks.h
2374 * src/frontends/gnome/diainsertindex_callbacks.h
2375 * src/frontends/gnome/diainsertindex_callbacks.c
2376 * src/frontends/gnome/diainsertindex_interface.c
2377 * src/frontends/gnome/diainsertindex_interface.h
2378 * src/frontends/gnome/diatoc_interface.h
2379 * src/frontends/gnome/diatoc_interface.c
2380 * src/frontends/gnome/Makefile.am: Table of Contents and
2381 Insert Index dialogs implementation for Gnome frontend
2383 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2385 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2387 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2390 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2392 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2393 destructor. Don't definde if you don't need it
2394 (processEvents): made static, non-blocking events processing for
2396 (runTime): static method. event loop for xforms
2397 * similar as above for kde and gnome.
2399 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2400 new Pimpl is correct
2401 (runTime): new method calss the real frontends runtime func.
2403 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2405 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2407 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2409 2000-08-16 Juergen Vigna <jug@sad.it>
2411 * src/lyx_gui.C (runTime): added GUII RunTime support.
2413 * src/frontends/Makefile.am:
2414 * src/frontends/GUIRunTime.[Ch]:
2415 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2416 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2417 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2419 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2421 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2422 as this is already set in ${FRONTEND_INCLUDE} if needed.
2424 * configure.in (CPPFLAGS): setting the include dir for the frontend
2425 directory and don't set FRONTEND=xforms for now as this is executed
2428 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2430 * src/frontends/kde/Makefile.am:
2431 * src/frontends/kde/FormUrl.C:
2432 * src/frontends/kde/FormUrl.h:
2433 * src/frontends/kde/formurldialog.h:
2434 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2436 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2438 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2440 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2442 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2445 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2447 * src/WorkArea.C (work_area_handler): more work to get te
2448 FL_KEYBOARD to work with xforms 0.88 too, please test.
2450 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2452 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2454 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2457 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2459 * src/Timeout.h: remove Qt::emit hack.
2461 * several files: changes to allo doc++ compilation
2463 * src/lyxfunc.C (processKeySym): new method
2464 (processKeyEvent): comment out if FL_REVISION < 89
2466 * src/WorkArea.C: change some debugging levels.
2467 (WorkArea): set wantkey to FL_KEY_ALL
2468 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2469 clearer code and the use of compose with XForms 0.89. Change to
2470 use signals instead of calling methods in bufferview directly.
2472 * src/Painter.C: change some debugging levels.
2474 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2477 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2478 (workAreaKeyPress): new method
2480 2000-08-14 Juergen Vigna <jug@sad.it>
2482 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2484 * config/kde.m4: addes some features
2486 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2487 include missing xforms dialogs.
2489 * src/Timeout.h: a hack to be able to compile with qt/kde.
2491 * sigc++/.cvsignore: added acinclude.m4
2493 * lib/.cvsignore: added listerros
2495 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2496 xforms tree as objects are needed for other frontends.
2498 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2499 linking with not yet implemented xforms objects.
2501 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2503 2000-08-14 Baruch Even <baruch.even@writeme.com>
2505 * src/frontends/xforms/FormGraphics.h:
2506 * src/frontends/xforms/FormGraphics.C:
2507 * src/frontends/xforms/RadioButtonGroup.h:
2508 * src/frontends/xforms/RadioButtonGroup.C:
2509 * src/insets/insetgraphics.h:
2510 * src/insets/insetgraphics.C:
2511 * src/insets/insetgraphicsParams.h:
2512 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2513 instead of spaces, and various other indentation issues to make the
2514 sources more consistent.
2516 2000-08-14 Marko Vendelin <markov@ioc.ee>
2518 * src/frontends/gnome/dialogs/diaprint.glade
2519 * src/frontends/gnome/FormPrint.C
2520 * src/frontends/gnome/FormPrint.h
2521 * src/frontends/gnome/diaprint_callbacks.c
2522 * src/frontends/gnome/diaprint_callbacks.h
2523 * src/frontends/gnome/diaprint_interface.c
2524 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2527 * src/frontends/gnome/dialogs/diainserturl.glade
2528 * src/frontends/gnome/FormUrl.C
2529 * src/frontends/gnome/FormUrl.h
2530 * src/frontends/gnome/diainserturl_callbacks.c
2531 * src/frontends/gnome/diainserturl_callbacks.h
2532 * src/frontends/gnome/diainserturl_interface.c
2533 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2534 Gnome implementation
2536 * src/frontends/gnome/Dialogs.C
2537 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2538 all other dialogs. Copy all unimplemented dialogs from Xforms
2541 * src/frontends/gnome/support.c
2542 * src/frontends/gnome/support.h: support files generated by Glade
2546 * config/gnome.m4: Gnome configuration scripts
2548 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2549 configure --help message
2551 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2552 only if there are no events pendling in Gnome/Gtk. This enhances
2553 the performance of menus.
2556 2000-08-14 Allan Rae <rae@lyx.org>
2558 * lib/Makefile.am: listerrors cleaning
2560 * lib/listerrors: removed -- generated file
2561 * acinclude.m4: ditto
2562 * sigc++/acinclude.m4: ditto
2564 * src/frontends/xforms/forms/form_citation.fd:
2565 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2568 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2569 `updatesrc` and now we have a `test` target that does what `updatesrc`
2570 used to do. I didn't like having an install target that wasn't related
2573 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2574 on all except FormGraphics. This may yet happen. Followed by a major
2575 cleanup including using FL_TRANSIENT for most of the dialogs. More
2576 changes to come when the ButtonController below is introduced.
2578 * src/frontends/xforms/ButtonController.h: New file for managing up to
2579 four buttons on a dialog according to an externally defined policy.
2580 * src/frontends/xforms/Makefile.am: added above
2582 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2583 Apply and Cancel/Close buttons and everything in between and beyond.
2584 * src/frontends/Makefile.am: added above.
2586 * src/frontends/xforms/forms/form_preferences.fd:
2587 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2588 and removed variable 'status' as a result. Fixed the set_minsize thing.
2589 Use the new screen-font-update after checking screen fonts were changed
2590 Added a "Restore" button to restore the original lyxrc values while
2591 editing. This restores everything not just the last input changed.
2592 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2594 * src/LyXAction.C: screen-font-update added for updating buffers after
2595 screen font settings have been changed.
2596 * src/commandtags.h: ditto
2597 * src/lyxfunc.C: ditto
2599 * forms/lyx.fd: removed screen fonts dialog.
2600 * src/lyx_gui.C: ditto
2601 * src/menus.[Ch]: ditto
2602 * src/lyx.[Ch]: ditto
2603 * src/lyx_cb.C: ditto + code from here moved to make
2604 screen-font-update. And people wonder why progress on GUII is
2605 slow. Look at how scattered this stuff was! It takes forever
2608 * forms/fdfix.sh: Fixup the spacing after commas.
2609 * forms/makefile: Remove date from generated files. Fewer clashes now.
2610 * forms/bullet_forms.C.patch: included someones handwritten changes
2612 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2613 once I've discovered why LyXRC was made noncopyable.
2614 * src/lyx_main.C: ditto
2616 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2618 * src/frontends/xforms/forms/fdfix.sh:
2619 * src/frontends/xforms/forms/fdfixh.sed:
2620 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2621 * src/frontends/xforms/Form*.[hC]:
2622 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2623 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2624 provide a destructor for the struct FD_form_xxxx. Another version of
2625 the set_[max|min]size workaround and a few other cleanups. Actually,
2626 Angus' patch from 20000809.
2628 2000-08-13 Baruch Even <baruch.even@writeme.com>
2630 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2633 2000-08-11 Juergen Vigna <jug@sad.it>
2635 * src/insets/insetgraphics.C (InsetGraphics): changing init
2636 order because of warnings.
2638 * src/frontends/xforms/forms/makefile: adding patching .C with
2641 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2642 from .C.patch to .c.patch
2644 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2645 order because of warning.
2647 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2649 * src/frontends/Liason.C (setMinibuffer): new helper function
2651 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2653 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2655 * lib/ui/default.ui: commented out PaperLayout entry
2657 * src/frontends/xforms/form_document.[Ch]: new added files
2659 * src/frontends/xforms/FormDocument.[Ch]: ditto
2661 * src/frontends/xforms/forms/form_document.fd: ditto
2663 * src/frontends/xforms/forms/form_document.C.patch: ditto
2665 2000-08-10 Juergen Vigna <jug@sad.it>
2667 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2668 (InsetGraphics): initialized cacheHandle to 0.
2669 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2671 2000-08-10 Baruch Even <baruch.even@writeme.com>
2673 * src/graphics/GraphicsCache.h:
2674 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2675 correctly as a cache.
2677 * src/graphics/GraphicsCacheItem.h:
2678 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2681 * src/graphics/GraphicsCacheItem_pimpl.h:
2682 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2685 * src/insets/insetgraphics.h:
2686 * src/insets/insetgraphics.C: Changed from using a signal notification
2687 to polling when image is not loaded.
2689 2000-08-10 Allan Rae <rae@lyx.org>
2691 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2692 that there are two functions that have to been taken out of line by
2693 hand and aren't taken care of in the script. (Just a reminder note)
2695 * sigc++/macros/*.h.m4: Updated as above.
2697 2000-08-09 Juergen Vigna <jug@sad.it>
2699 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2701 * src/insets/insettabular.C: make drawing of single cell smarter.
2703 2000-08-09 Marko Vendelin <markov@ioc.ee>
2704 * src/frontends/gnome/Menubar_pimpl.C
2705 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2706 implementation: new files
2708 * src/frontends/gnome/mainapp.C
2709 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2712 * src/main.C: create Gnome main window
2714 * src/frontends/xforms/Menubar_pimpl.h
2715 * src/frontends/Menubar.C
2716 * src/frontends/Menubar.h: added method Menubar::update that calls
2717 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2719 * src/LyXView.C: calls Menubar::update to update the state
2722 * src/frontends/gnome/Makefile.am: added new files
2724 * src/frontends/Makefile.am: added frontend compiler options
2726 2000-08-08 Juergen Vigna <jug@sad.it>
2728 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2730 * src/bufferlist.C (close):
2731 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2732 documents if exiting without saving.
2734 * src/buffer.C (save): use removeAutosaveFile()
2736 * src/support/filetools.C (removeAutosaveFile): new function.
2738 * src/lyx_cb.C (MenuWrite): returns a bool now.
2739 (MenuWriteAs): check if file could really be saved and revert to the
2741 (MenuWriteAs): removing old autosavefile if existant.
2743 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2744 before Goto toggle declaration, because of compiler warning.
2746 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2748 * src/lyxfunc.C (MenuNew): small fix.
2750 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2752 * src/bufferlist.C (newFile):
2753 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2755 * src/lyxrc.C: added new_ask_filename tag
2757 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2759 * src/lyx.fd: removed code pertaining to form_ref
2760 * src/lyx.[Ch]: ditto
2761 * src/lyx_cb.C: ditto
2762 * src/lyx_gui.C: ditto
2763 * src/lyx_gui_misc.C: ditto
2765 * src/BufferView_pimpl.C (restorePosition): update buffer only
2768 * src/commandtags.h (LFUN_REFTOGGLE): removed
2769 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2770 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2771 (LFUN_REFBACK): renamed LFUN_REF_BACK
2773 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2774 * src/menus.C: ditto
2775 * src/lyxfunc.C (Dispatch): ditto.
2776 InsertRef dialog is now GUI-independent.
2778 * src/texrow.C: added using std::endl;
2780 * src/insets/insetref.[Ch]: strip out large amounts of code.
2781 The inset is now a container and this functionality is now
2782 managed by a new FormRef dialog
2784 * src/frontends/Dialogs.h (showRef, createRef): new signals
2786 * src/frontends/xforms/FormIndex.[Ch],
2787 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2788 when setting dialog's min/max size
2789 * src/frontends/xforms/FormIndex.[Ch]: ditto
2791 * src/frontends/xforms/FormRef.[Ch],
2792 src/frontends/xforms/forms/form_ref.fd: new xforms
2793 implementation of an InsetRef dialog
2795 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2798 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2799 ios::nocreate is not part of the standard. Removed.
2801 2000-08-07 Baruch Even <baruch.even@writeme.com>
2803 * src/graphics/Renderer.h:
2804 * src/graphics/Renderer.C: Added base class for rendering of different
2805 image formats into Pixmaps.
2807 * src/graphics/XPM_Renderer.h:
2808 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2809 in a different class.
2811 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2812 easily add support for other formats.
2814 * src/insets/figinset.C: plugged a leak of an X resource.
2816 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2818 * src/CutAndPaste.[Ch]: make all metods static.
2820 * development/Code_rules/Rules: more work, added section on
2821 Exceptions, and a References section.
2823 * a lot of header files: work to make doc++ able to generate the
2824 source documentation, some workarounds of doc++ problems. Doc++ is
2825 now able to generate the documentation.
2827 2000-08-07 Juergen Vigna <jug@sad.it>
2829 * src/insets/insettabular.C (recomputeTextInsets): removed function
2831 * src/tabular.C (SetWidthOfMulticolCell):
2833 (calculate_width_of_column_NMC): fixed return value so that it really
2834 only returns true if the column-width has changed (there where
2835 problems with muliticolumn-cells in this column).
2837 2000-08-04 Juergen Vigna <jug@sad.it>
2839 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2840 also on the scrollstatus of the inset.
2841 (workAreaMotionNotify): ditto.
2843 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2845 2000-08-01 Juergen Vigna <jug@sad.it>
2847 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2849 * src/commandtags.h:
2850 * src/LyXAction.C (init):
2851 * src/insets/inset.C (LocalDispatch): added support for
2854 * src/insets/inset.C (scroll): new functions.
2856 * src/insets/insettext.C (removeNewlines): new function.
2857 (SetAutoBreakRows): removes forced newlines in the text of the
2858 paragraph if autoBreakRows is set to false.
2860 * src/tabular.C (Latex): generates a parbox around the cell contents
2863 * src/frontends/xforms/FormTabular.C (local_update): removed
2864 the radio_useparbox button.
2866 * src/tabular.C (UseParbox): new function
2868 2000-08-06 Baruch Even <baruch.even@writeme.com>
2870 * src/graphics/GraphicsCache.h:
2871 * src/graphics/GraphicsCache.C:
2872 * src/graphics/GraphicsCacheItem.h:
2873 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2876 * src/insets/insetgraphics.h:
2877 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
2878 and the drawing of the inline image.
2880 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
2881 loaded into the wrong position.
2883 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2886 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2888 * src/support/translator.h: move all typedefs to public section
2890 * src/support/filetools.C (MakeLatexName): return string const
2892 (TmpFileName): ditto
2893 (FileOpenSearch): ditto
2895 (LibFileSearch): ditto
2896 (i18nLibFileSearch): ditto
2899 (CreateTmpDir): ditto
2900 (CreateBufferTmpDir): ditto
2901 (CreateLyXTmpDir): ditto
2904 (MakeAbsPath): ditto
2906 (OnlyFilename): ditto
2908 (NormalizePath): ditto
2909 (CleanupPath): ditto
2910 (GetFileContents): ditto
2911 (ReplaceEnvironmentPath): ditto
2912 (MakeRelPath): ditto
2914 (ChangeExtension): ditto
2915 (MakeDisplayPath): ditto
2916 (do_popen): return cmdret const
2917 (findtexfile): return string const
2919 * src/support/DebugStream.h: add some /// to please doc++
2921 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2923 * src/texrow.C (same_rownumber): functor to use with find_if
2924 (getIdFromRow): rewritten to use find_if and to not update the
2925 positions. return true if row is found
2926 (increasePos): new method, use to update positions
2928 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2930 * src/lyxlex_pimpl.C (verifyTable): new method
2933 (GetString): return string const
2934 (pushTable): rewrite to use std::stack
2936 (setFile): better check
2939 * src/lyxlex.h: make LyXLex noncopyable
2941 * src/lyxlex.C (text): return char const * const
2942 (GetString): return string const
2943 (getLongString): return string const
2945 * src/lyx_gui_misc.C (askForText): return pair<...> const
2947 * src/lastfiles.[Ch] (operator): return string const
2949 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2950 istringstream not char const *.
2951 move token.end() out of loop.
2952 (readFile): move initializaton of token
2954 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2955 getIdFromRow is successful.
2957 * lib/bind/emacs.bind: don't include menus bind
2959 * development/Code_rules/Rules: the beginnings of making this
2960 better and covering more of the unwritten rules that we have.
2962 * development/Code_rules/Recommendations: a couple of wording
2965 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2967 * src/support/strerror.c: remove C++ comment.
2969 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2971 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2972 LFUN_INDEX_INSERT_LAST
2974 * src/texrow.C (getIdFromRow): changed from const_iterator to
2975 iterator, allowing code to compile with DEC cxx
2977 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2978 stores part of the class, as suggested by Allan. Will allow
2980 (apply): test to apply uses InsetCommandParams operator!=
2982 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2983 (apply): test to apply uses InsetCommandParams operator!=
2985 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2986 stores part of the class.
2987 (update): removed limits on min/max size.
2989 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2990 (apply): test to apply uses InsetCommandParams operator!=
2992 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2993 (Read, Write, scanCommand, getCommand): moved functionality
2994 into InsetCommandParams.
2996 (getScreenLabel): made pure virtual
2997 new InsetCommandParams operators== and !=
2999 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3000 c-tors based on InsetCommandParams. Removed others.
3001 * src/insets/insetinclude.[Ch]: ditto
3002 * src/insets/insetlabel.[Ch]: ditto
3003 * src/insets/insetparent.[Ch]: ditto
3004 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3006 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3007 insets derived from InsetCommand created using similar c-tors
3008 based on InsetCommandParams
3009 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3010 * src/menus.C (ShowRefsMenu): ditto
3011 * src/paragraph.C (Clone): ditto
3012 * src/text2.C (SetCounter): ditto
3013 * src/lyxfunc.C (Dispatch) ditto
3014 Also recreated old InsetIndex behaviour exactly. Can now
3015 index-insert at the start of a paragraph and index-insert-last
3016 without launching the pop-up.
3018 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3020 * lib/lyxrc.example: mark te pdf options as non functional.
3022 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3023 (isStrDbl): move tmpstr.end() out of loop.
3024 (strToDbl): move intialization of tmpstr
3025 (lowercase): return string const and move tmp.end() out of loop.
3026 (uppercase): return string const and move tmp.edn() out of loop.
3027 (prefixIs): add assertion
3032 (containsOnly): ditto
3033 (containsOnly): ditto
3034 (containsOnly): ditto
3035 (countChar): make last arg char not char const
3036 (token): return string const
3037 (subst): return string const, move tmp.end() out of loop.
3038 (subst): return string const, add assertion
3039 (strip): return string const
3040 (frontStrip): return string const, add assertion
3041 (frontStrip): return string const
3046 * src/support/lstrings.C: add inclde "LAssert.h"
3047 (isStrInt): move tmpstr.end() out of loop.
3049 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3050 toollist.end() out of loop.
3051 (deactivate): move toollist.end() out of loop.
3052 (update): move toollist.end() out of loop.
3053 (updateLayoutList): move tc.end() out of loop.
3054 (add): move toollist.end() out of loop.
3056 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3057 md.end() out of loop.
3059 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3061 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3064 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3065 (Erase): move insetlist.end() out of loop.
3067 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3068 ref to const string as first arg. Move initialization of some
3069 variables, whitespace changes.
3071 * src/kbmap.C (defkey): move table.end() out of loop.
3072 (kb_keymap): move table.end() out of loop.
3073 (findbinding): move table.end() out of loop.
3075 * src/MenuBackend.C (hasMenu): move end() out of loop.
3076 (getMenu): move end() out of loop.
3077 (getMenu): move menulist_.end() out of loop.
3079 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3081 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3084 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3085 (getFromLyXName): move infotab.end() out of loop.
3087 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3088 -fvtable-thunks -ffunction-sections -fdata-sections
3090 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3092 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3095 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3097 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3099 * src/frontends/xforms/FormCitation.[Ch],
3100 src/frontends/xforms/FormIndex.[Ch],
3101 src/frontends/xforms/FormToc.[Ch],
3102 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3104 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3106 * src/commandtags.h: renamed, created some flags for citation
3109 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3111 * src/lyxfunc.C (dispatch): use signals to insert index entry
3113 * src/frontends/Dialogs.h: new signal createIndex
3115 * src/frontends/xforms/FormCommand.[Ch],
3116 src/frontends/xforms/FormCitation.[Ch],
3117 src/frontends/xforms/FormToc.[Ch],
3118 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3120 * src/insets/insetindex.[Ch]: GUI-independent
3122 * src/frontends/xforms/FormIndex.[Ch],
3123 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3126 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3128 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3129 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3131 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3133 * src/insets/insetref.C (Latex): rewrite so that there is now
3134 question that a initialization is requested.
3136 * src/insets/insetcommand.h: reenable the hide signal
3138 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3140 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3141 fix handling of shortcuts (many bugs :)
3142 (add_lastfiles): ditto.
3144 * lib/ui/default.ui: fix a few shortcuts.
3146 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3148 * Makefile.am: Fix ``rpmdist'' target to return the exit
3149 status of the ``rpm'' command, instead of the last command in
3150 the chain (the ``rm lyx.xpm'' command, which always returns
3153 2000-08-02 Allan Rae <rae@lyx.org>
3155 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3156 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3157 * src/frontends/xforms/FormToc.C (FormToc): ditto
3159 * src/frontends/xforms/Makefile.am: A few forgotten files
3161 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3162 Signals-not-copyable-problem Lars' started commenting out.
3164 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3166 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3168 * src/insets/insetcommand.h: Signals is not copyable so anoter
3169 scheme for automatic hiding of forms must be used.
3171 * src/frontends/xforms/FormCitation.h: don't inerit from
3172 noncopyable, FormCommand already does that.
3173 * src/frontends/xforms/FormToc.h: ditto
3174 * src/frontends/xforms/FormUrl.h: ditto
3176 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3178 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3180 * src/insets/insetcommand.h (hide): new SigC::Signal0
3181 (d-tor) new virtual destructor emits hide signal
3183 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3184 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3186 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3187 LOF and LOT. Inset is now GUI-independent
3189 * src/insets/insetloa.[Ch]: redundant
3190 * src/insets/insetlof.[Ch]: ditto
3191 * src/insets/insetlot.[Ch]: ditto
3193 * src/frontends/xforms/forms/form_url.fd: tweaked!
3194 * src/frontends/xforms/forms/form_citation.fd: ditto
3196 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3197 dialogs dealing with InsetCommand insets
3199 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3200 FormCommand base class
3201 * src/frontends/xforms/FormUrl.[Ch]: ditto
3203 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3205 * src/frontends/xforms/FormToc.[Ch]: ditto
3207 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3208 passed a generic InsetCommand pointer
3209 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3211 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3212 and modified InsetTOC class
3213 * src/buffer.C: ditto
3215 * forms/lyx.fd: strip out old FD_form_toc code
3216 * src/lyx_gui_misc.C: ditto
3217 * src/lyx_gui.C: ditto
3218 * src/lyx_cb.C: ditto
3219 * src/lyx.[Ch]: ditto
3221 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3223 * src/support/utility.hpp: tr -d '\r'
3225 2000-08-01 Juergen Vigna <jug@sad.it>
3227 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3229 * src/commandtags.h:
3230 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3231 LFUN_TABULAR_FEATURES.
3233 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3234 LFUN_LAYOUT_TABULAR.
3236 * src/insets/insettabular.C (getStatus): implemented helper function.
3238 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3240 2000-07-31 Juergen Vigna <jug@sad.it>
3242 * src/text.C (draw): fixed screen update problem for text-insets.
3244 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3245 something changed probably this has to be added in various other
3248 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3250 2000-07-31 Baruch Even <baruch.even@writeme.com>
3252 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3253 templates to satisfy compaq cxx.
3256 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3258 * src/support/translator.h (equal_1st_in_pair::operator()): take
3259 const ref pair_type as arg.
3260 (equal_2nd_in_pair::operator()): ditto
3261 (Translator::~Translator): remove empty d-tor.
3263 * src/graphics/GraphicsCache.C: move include config.h to top, also
3264 put initialization of GraphicsCache::singleton here.
3265 (~GraphicsCache): move here
3266 (addFile): take const ref as arg
3269 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3271 * src/BufferView2.C (insertLyXFile): change te with/without header
3274 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3276 * src/frontends/xforms/FormGraphics.C (apply): add some
3277 static_cast. Not very nice, but required by compaq cxx.
3279 * src/frontends/xforms/RadioButtonGroup.h: include header
3280 <utility> instead of <pair.h>
3282 * src/insets/insetgraphicsParams.C: add using directive.
3283 (readResize): change return type to void.
3284 (readOrigin): ditto.
3286 * src/lyxfunc.C (getStatus): add missing break for build-program
3287 function; add test for Literate for export functions.
3289 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3290 entries in Options menu.
3292 2000-07-31 Baruch Even <baruch.even@writeme.com>
3294 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3295 protect against auto-allocation; release icon when needed.
3297 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3299 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3300 on usual typewriter.
3302 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3303 earlier czech.kmap), useful only for programming.
3305 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3307 * src/frontends/xforms/FormCitation.h: fix conditioning around
3310 2000-07-31 Juergen Vigna <jug@sad.it>
3312 * src/frontends/xforms/FormTabular.C (local_update): changed
3313 radio_linebreaks to radio_useparbox and added radio_useminipage.
3315 * src/tabular.C: made support for using minipages/parboxes.
3317 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3319 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3321 (descent): so the cursor is in the middle.
3322 (width): bit smaller box.
3324 * src/insets/insetgraphics.h: added display() function.
3326 2000-07-31 Baruch Even <baruch.even@writeme.com>
3328 * src/frontends/Dialogs.h: Added showGraphics signals.
3330 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3331 xforms form definition of the graphics dialog.
3333 * src/frontends/xforms/FormGraphics.h:
3334 * src/frontends/xforms/FormGraphics.C: Added files, the
3335 GUIndependent code of InsetGraphics
3337 * src/insets/insetgraphics.h:
3338 * src/insets/insetgraphics.C: Major writing to make it work.
3340 * src/insets/insetgraphicsParams.h:
3341 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3342 struct between InsetGraphics and GUI.
3344 * src/LaTeXFeatures.h:
3345 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3346 support for graphicx package.
3348 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3349 for the graphics inset.
3351 * src/support/translator.h: Added file, used in
3352 InsetGraphicsParams. this is a template to translate between two
3355 * src/frontends/xforms/RadioButtonGroup.h:
3356 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3357 way to easily control a radio button group.
3359 2000-07-28 Juergen Vigna <jug@sad.it>
3361 * src/insets/insettabular.C (LocalDispatch):
3362 (TabularFeatures): added support for lyx-functions of tabular features.
3363 (cellstart): refixed this function after someone wrongly changed it.
3365 * src/commandtags.h:
3366 * src/LyXAction.C (init): added support for tabular-features
3368 2000-07-28 Allan Rae <rae@lyx.org>
3370 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3371 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3372 triggers the callback for input checking. As a result we sometimes get
3373 "LyX: This shouldn't happen..." printed to cerr.
3374 (input): Started using status variable since I only free() on
3375 destruction. Some input checking for paths and font sizes.
3377 * src/frontends/xforms/FormPreferences.h: Use status to control
3378 activation of Ok and Apply
3380 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3381 callback. Also resized to stop segfaults with 0.88. The problem is
3382 that xforms-0.88 requires the folder to be wide enough to fit all the
3383 tabs. If it isn't it causes all sorts of problems.
3385 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3387 * src/frontends/xforms/forms/README: Reflect reality.
3389 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3390 * src/frontends/xforms/forms/makefile: ditto.
3392 * src/commandtags.h: Get access to new Preferences dialog
3393 * src/LyXAction.C: ditto
3394 * src/lyxfunc.C: ditto
3395 * lib/ui/default.ui: ditto
3397 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3399 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3401 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3404 * src/frontends/xforms/form_url.[Ch]: added.
3406 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3408 * src/insets/insetbib.h: fixed bug in previous commit
3410 * src/frontends/xforms/FormUrl.h: ditto
3412 * src/frontends/xforms/FormPrint.h: ditto
3414 * src/frontends/xforms/FormPreferences.h: ditto
3416 * src/frontends/xforms/FormCopyright.h: ditto
3418 * src/frontends/xforms/FormCitation.C: ditto
3420 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3421 private copyconstructor and private default contructor
3423 * src/support/Makefile.am: add utility.hpp
3425 * src/support/utility.hpp: new file from boost
3427 * src/insets/insetbib.h: set owner in clone
3429 * src/frontends/xforms/FormCitation.C: added missing include
3432 * src/insets/form_url.[Ch]: removed
3434 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3436 * development/lyx.spec.in
3437 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3438 file/directory re-organization.
3440 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3442 * src/insets/insetcommand.[Ch]: moved the string data and
3443 associated manipulation methods into a new stand-alone class
3444 InsetCommandParams. This class has two additional methods
3445 getAsString() and setFromString() allowing the contents to be
3446 moved around as a single string.
3447 (addContents) method removed.
3448 (setContents) method no longer virtual.
3450 * src/buffer.C (readInset): made use of new InsetCitation,
3451 InsetUrl constructors based on InsetCommandParams.
3453 * src/commandtags.h: add LFUN_INSERT_URL
3455 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3456 independent InsetUrl and use InsetCommandParams to extract
3457 string info and create new Insets.
3459 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3461 * src/frontends/xforms/FormCitation.C (apply): uses
3464 * src/frontends/xforms/form_url.C
3465 * src/frontends/xforms/form_url.h
3466 * src/frontends/xforms/FormUrl.h
3467 * src/frontends/xforms/FormUrl.C
3468 * src/frontends/xforms/forms/form_url.fd: new files
3470 * src/insets/insetcite.[Ch]: removed unused constructors.
3472 * src/insets/insetinclude.[Ch]: no longer store filename
3474 * src/insets/inseturl.[Ch]: GUI-independent.
3476 2000-07-26 Juergen Vigna <jug@sad.it>
3477 * renamed frontend from gtk to gnome as it is that what is realized
3478 and did the necessary changes in the files.
3480 2000-07-26 Marko Vendelin <markov@ioc.ee>
3482 * configure.in: cleaning up gnome configuration scripts
3484 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3486 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3487 shortcuts syndrom by redrawing them explicitely (a better solution
3488 would be appreciated).
3490 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3492 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3495 * src/lyx_cb.C (MenuExport): change html export to do the right
3496 thing depending of the document type (instead of having
3497 html-linuxdoc and html-docbook).
3498 * src/lyxfunc.C (getStatus): update for html
3499 * lib/ui/default.ui: simplify due to the above change.
3500 * src/menus.C (ShowFileMenu): update too (in case we need it).
3502 * src/MenuBackend.C (read): if a menu is defined twice, add the
3503 new entries to the exiting one.
3505 2000-07-26 Juergen Vigna <jug@sad.it>
3507 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3509 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3510 and return a bool if it did actual save the file.
3511 (AutoSave): don't autosave a unnamed doc.
3513 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3514 check if this is an UNNAMED new file and react to it.
3515 (newFile): set buffer to unnamed and change to not mark a new
3516 buffer dirty if I didn't do anything with it.
3518 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3520 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3522 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3523 friend as per Angus's patch posted to lyx-devel.
3525 * src/ext_l10n.h: updated
3527 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3528 gettext on the style string right before inserting them into the
3531 * autogen.sh: add code to extract style strings form layout files,
3532 not good enough yet.
3534 * src/frontends/gtk/.cvsignore: add MAKEFILE
3536 * src/MenuBackend.C (read): run the label strings through gettext
3537 before storing them in the containers.
3539 * src/ext_l10n.h: new file
3541 * autogen.sh : generate the ext_l10n.h file here
3543 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3545 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3548 * lib/ui/default.ui: fix a couple of typos.
3550 * config/gnome/gtk.m4: added (and added to the list of files in
3553 * src/insets/insetinclude.C (unique_id): fix when we are using
3554 lyxstring instead of basic_string<>.
3555 * src/insets/insettext.C (LocalDispatch): ditto.
3556 * src/support/filetools.C: ditto.
3558 * lib/configure.m4: create the ui/ directory if necessary.
3560 * src/LyXView.[Ch] (updateToolbar): new method.
3562 * src/BufferView_pimpl.C (buffer): update the toolbar when
3563 opening/closing buffer.
3565 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3567 * src/LyXAction.C (getActionName): enhance to return also the name
3568 and options of pseudo-actions.
3569 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3571 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3572 as an example of what is possible). Used in File->Build too (more
3573 useful) and in the import/export menus (to mimick the complicated
3574 handling of linuxdoc and friends). Try to update all the entries.
3576 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3579 * src/MenuBackend.C (read): Parse the new OptItem tag.
3581 * src/MenuBackend.h: Add a new optional_ data member (used if the
3582 entry should be omitted when the lyxfunc is disabled).
3584 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3585 function, used as a shortcut.
3586 (create_submenu): align correctly the shortcuts on the widest
3589 * src/MenuBackend.h: MenuItem.label() only returns the label of
3590 the menu without shortcut; new method shortcut().
3592 2000-07-14 Marko Vendelin <markov@ioc.ee>
3594 * src/frontends/gtk/Dialogs.C:
3595 * src/frontends/gtk/FormCopyright.C:
3596 * src/frontends/gtk/FormCopyright.h:
3597 * src/frontends/gtk/Makefile.am: added these source-files for the
3598 Gtk/Gnome support of the Copyright-Dialog.
3600 * src/main.C: added Gnome::Main initialization if using
3601 Gtk/Gnome frontend-GUI.
3603 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3605 * config/gnome/aclocal-include.m4
3606 * config/gnome/compiler-flags.m4
3607 * config/gnome/curses.m4
3608 * config/gnome/gnome--.m4
3609 * config/gnome/gnome-bonobo-check.m4
3610 * config/gnome/gnome-common.m4
3611 * config/gnome/gnome-fileutils.m4
3612 * config/gnome/gnome-ghttp-check.m4
3613 * config/gnome/gnome-gnorba-check.m4
3614 * config/gnome/gnome-guile-checks.m4
3615 * config/gnome/gnome-libgtop-check.m4
3616 * config/gnome/gnome-objc-checks.m4
3617 * config/gnome/gnome-orbit-check.m4
3618 * config/gnome/gnome-print-check.m4
3619 * config/gnome/gnome-pthread-check.m4
3620 * config/gnome/gnome-support.m4
3621 * config/gnome/gnome-undelfs.m4
3622 * config/gnome/gnome-vfs.m4
3623 * config/gnome/gnome-x-checks.m4
3624 * config/gnome/gnome-xml-check.m4
3625 * config/gnome/gnome.m4
3626 * config/gnome/gperf-check.m4
3627 * config/gnome/gtk--.m4
3628 * config/gnome/linger.m4
3629 * config/gnome/need-declaration.m4: added configuration scripts
3630 for Gtk/Gnome frontend-GUI
3632 * configure.in: added support for the --with-frontend=gtk option
3634 * autogen.sh: added config/gnome/* to list of config-files
3636 * acconfig.h: added define for GTKGUI-support
3638 * config/lyxinclude.m4: added --with-frontend[=value] option value
3639 for Gtk/Gnome frontend-GUI support.
3641 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3643 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3647 * src/paragraph.C (GetChar): remove non-const version
3649 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3650 (search_kw): use it.
3652 * src/lyx_main.C (init): if "preferences" exist, read that instead
3654 (ReadRcFile): return bool if the file could be read ok.
3655 (ReadUIFile): add a check to see if lex file is set ok.
3657 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3658 bastring can be used instead of lyxstring (still uses the old code
3659 if std::string is good enough or if lyxstring is used.)
3661 * src/encoding.C: make the arrays static, move ininle functions
3663 * src/encoding.h: from here.
3665 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3666 (parseSingleLyXformat2Token): move inset parsing to separate method
3667 (readInset): new private method
3669 * src/Variables.h: remove virtual from get().
3671 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3672 access to NEW_INSETS and NEW_TABULAR
3674 * src/MenuBackend.h: remove superfluous forward declaration of
3675 MenuItem. Add documentations tags "///", remove empty MenuItem
3676 destructor, remove private default contructor.
3678 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3680 (read): more string mlabel and mname to where they are used
3681 (read): remove unused variables mlabel and mname
3682 (defaults): unconditional clear, make menusetup take advantage of
3683 add returning Menu &.
3685 * src/LyXView.h: define NEW_MENUBAR as default
3687 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3688 to NEW_INSETS and NEW_TABULAR.
3689 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3690 defined. Change some of the "xxxx-inset-insert" functions names to
3693 * several files: more enahncements to NEW_INSETS and the resulting
3696 * lib/lyxrc.example (\date_insert_format): move to misc section
3698 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3699 bastring and use AC_CACHE_CHECK.
3700 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3701 the system have the newest methods. uses AC_CACHE_CHECK
3702 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3703 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3704 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3706 * configure.in: add LYX_CXX_GOOD_STD_STRING
3708 * acinclude.m4: recreated
3710 2000-07-24 Amir Karger <karger@lyx.org>
3712 * README: add Hebrew, Arabic kmaps
3715 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3717 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3720 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3722 * Lot of files: add pragma interface/implementation.
3724 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3726 * lib/ui/default.ui: new file (ans new directory). Contains the
3727 default menu and toolbar.
3729 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3730 global space. Toolbars are now read (as menus) in ui files.
3732 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3734 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3735 is disabled because the document is read-only. We want to have the
3736 toggle state of the function anyway.
3737 (getStatus): add code for LFUN_VC* functions (mimicking what is
3738 done in old-style menus)
3740 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3741 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3743 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3744 * src/BufferView_pimpl.C: ditto.
3745 * src/lyxfunc.C: ditto.
3747 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3748 default). This replaces old-style menus by new ones.
3750 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3751 MenuItem. Contain the data structure of a menu.
3753 * src/insets/insettext.C: use LyXView::setLayout instead of
3754 accessing directly the toolbar combox.
3755 * src/lyxfunc.C (Dispatch): ditto.
3757 * src/LyXView.C (setLayout): new method, which just calls
3758 Toolbar::setLayout().
3759 (updateLayoutChoice): move part of this method in Toolbar.
3761 * src/toolbar.[Ch]: removed.
3763 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3764 implementation the toolbar.
3766 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3767 the toolbar. It might make sense to merge it with ToolbarDefaults
3769 (setLayout): new function.
3770 (updateLayoutList): ditto.
3771 (openLayoutList): ditto.
3773 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3774 xforms implementation of the toolbar.
3775 (get_toolbar_func): comment out, since I do not
3776 know what it is good for.
3778 * src/ToolbarDefaults.h: Add the ItemType enum.
3780 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3781 for a list of allocated C strings. Used in Menubar xforms
3782 implementation to avoid memory leaks.
3784 * src/support/lstrings.[Ch] (uppercase): new version taking and
3788 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3789 * lib/bind/emacs.bind: ditto.
3791 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3793 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3794 forward decl of LyXView.
3796 * src/toolbar.C (toolbarItem): moved from toolbar.h
3797 (toolbarItem::clean): ditto
3798 (toolbarItem::~toolbarItem): ditto
3799 (toolbarItem::operator): ditto
3801 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3803 * src/paragraph.h: control the NEW_TABULAR define from here
3805 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3806 USE_TABULAR_INSETS to NEW_TABULAR
3808 * src/ToolbarDefaults.C: add include "lyxlex.h"
3810 * files using the old table/tabular: use NEW_TABULAR to control
3811 compilation of old tabular stuff.
3813 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3816 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3817 planemet in reading of old style floats, fix the \end_deeper
3818 problem when reading old style floats.
3820 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3822 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3824 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3826 * lib/bind/sciword.bind: updated.
3828 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3830 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3831 layout write problem
3833 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3835 * src/Makefile.am (INCLUDES): remove image directory from include
3838 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3839 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3841 * src/LyXView.C (create_form_form_main): read the application icon
3844 * lib/images/*.xpm: change the icons to use transparent color for
3847 * src/toolbar.C (update): change the color of the button when it
3850 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3852 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3853 setting explicitely the minibuffer.
3854 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3856 * src/LyXView.C (showState): new function. Shows font information
3857 in minibuffer and update toolbar state.
3858 (LyXView): call Toolbar::update after creating the
3861 * src/toolbar.C: change toollist to be a vector instead of a
3863 (BubbleTimerCB): get help string directly from the callback
3864 argument of the corresponding icon (which is the action)
3865 (set): remove unnecessary ugliness.
3866 (update): new function. update the icons (depressed, disabled)
3867 depending of the status of the corresponding action.
3869 * src/toolbar.h: remove help in toolbarItem
3871 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3873 * src/Painter.C (text): Added code for using symbol glyphs from
3874 iso10646 fonts. Currently diabled.
3876 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3879 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3880 magyar,turkish and usorbian.
3882 * src/paragraph.C (isMultiLingual): Made more efficient.
3884 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3887 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3888 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3889 Also changed the prototype to "bool math_insert_greek(char)".
3891 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3893 * lots of files: apply the NEW_INSETS on all code that will not be
3894 needed when we move to use the new insets. Enable the define in
3895 lyxparagrah.h to try it.
3897 * src/insets/insettabular.C (cellstart): change to be a static
3899 (InsetTabular): initialize buffer in the initializer list.
3901 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3903 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3904 form_print.h out of the header file. Replaced with forward
3905 declarations of the relevant struct.
3907 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3910 * src/commandtags.h: do not include "debug.h" which does not
3911 belong there. #include it in some other places because of this
3914 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3916 * src/insets/insetcaption.C: add a couple "using" directives.
3918 * src/toolbar.C (add): get the help text directly from lyxaction.
3920 (setPixmap): new function. Loads from disk and sets a pixmap on a
3921 botton; the name of the pixmap file is derived from the command
3924 * src/toolbar.h: remove members isBitmap and pixmap from
3927 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3928 * lib/images/: move many files from images/banner.xpm.
3930 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3932 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3933 * src/toolbar.C: ditto.
3934 * configure.in: ditto.
3935 * INSTALL: document.
3937 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3938 the spellchecker popup is closed from the WM.
3940 2000-07-19 Juergen Vigna <jug@sad.it>
3942 * src/insets/insetfloat.C (Write): small fix because we use the
3943 insetname for the type now!
3945 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3947 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3950 * src/frontends/Dialogs.h: removed hideCitation signal
3952 * src/insets/insetcite.h: added hide signal
3954 * src/insets/insetcite.C (~InsetCitation): emits new signal
3955 (getScreenLabel): "intelligent" label should now fit on the screen!
3957 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3959 * src/frontends/xforms/FormCitation.C (showInset): connects
3960 hide() to the inset's hide signal
3961 (show): modified to use fl_set_object_position rather than
3962 fl_set_object_geometry wherever possible
3964 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3966 * src/insets/lyxinset.h: add caption code
3968 * src/insets/insetfloat.C (type): new method
3970 * src/insets/insetcaption.C (Write): new method
3972 (LyxCode): new method
3974 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3975 to get it right together with using the FloatList.
3977 * src/commandtags.h: add LFUN_INSET_CAPTION
3978 * src/lyxfunc.C (Dispatch): handle it
3980 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3983 * src/Variables.[Ch]: make expand take a const reference, remove
3984 the destructor, some whitespace changes.
3986 * src/LyXAction.C (init): add caption-inset-insert
3988 * src/FloatList.C (FloatList): update the default floats a bit.
3990 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3992 * src/Variables.[Ch]: new files. Intended to be used for language
3993 specific strings (like \chaptername) and filename substitution in
3996 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3998 * lib/kbd/american.kmap: update
4000 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4002 * src/bufferparams.[Ch]: remove member allowAccents.
4004 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4006 * src/LaTeXLog.C: use the log_form.h header.
4007 * src/lyx_gui.C: ditto.
4008 * src/lyx_gui_misc.C: ditto.
4009 * src/lyxvc.h: ditto.
4011 * forms/log_form.fd: new file, created from latexoptions.fd. I
4012 kept the log popup and nuked the options form.
4014 * src/{la,}texoptions.[Ch]: removed.
4015 * src/lyx_cb.C (LaTeXOptions): ditto
4017 * src/lyx_gui.C (create_forms): do not handle the
4018 fd_latex_options form.
4020 2000-07-18 Juergen Vigna <jug@sad.it>
4022 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4023 name of the inset so that it can be requested outside (text2.C).
4025 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4028 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4030 * src/mathed/formula.h (ConvertFont): constify
4032 * src/mathed/formula.C (Read): add warning if \end_inset is not
4033 found on expected place.
4035 * src/insets/lyxinset.h (ConvertFont): consify
4037 * src/insets/insetquotes.C (ConvertFont): constify
4038 * src/insets/insetquotes.h: ditto
4040 * src/insets/insetinfo.h: add labelfont
4042 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4043 (ascent): use labelfont
4047 (Write): make .lyx file a bit nicer
4049 * src/insets/insetfloat.C (Write): simplify somewhat...
4050 (Read): add warning if arg is not found
4052 * src/insets/insetcollapsable.C: add using std::max
4053 (Read): move string token and add warning in arg is not found
4054 (draw): use std::max to get the right ty
4055 (getMaxWidth): simplify by using std::max
4057 * src/insets/insetsection.h: new file
4058 * src/insets/insetsection.C: new file
4059 * src/insets/insetcaption.h: new file
4060 * src/insets/insetcaption.C: new file
4062 * src/insets/inset.C (ConvertFont): constify signature
4064 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4065 insetcaption.[Ch] and insetsection.[Ch]
4067 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4068 uses to use LABEL_COUNTER_CHAPTER instead.
4069 * src/text2.C (SetCounter): here
4071 * src/counters.h: new file
4072 * src/counters.C: new file
4073 * src/Sectioning.h: new file
4074 * src/Sectioning.C: new file
4076 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4078 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4080 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4083 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4086 2000-07-17 Juergen Vigna <jug@sad.it>
4088 * src/tabular.C (Validate): check if array-package is needed.
4089 (SetVAlignment): added support for vertical alignment.
4090 (SetLTFoot): better support for longtable header/footers
4091 (Latex): modified to support added features.
4093 * src/LaTeXFeatures.[Ch]: added array-package.
4095 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4097 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4100 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4102 * configure.in: do not forget to put a space after -isystem.
4104 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4106 * lib/kbd/arabic.kmap: a few fixes.
4108 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4110 * some whitespace chagnes to a number of files.
4112 * src/support/DebugStream.h: change to make it easier for
4113 doc++ to parse correctly.
4114 * src/support/lyxstring.h: ditto
4116 * src/mathed/math_utils.C (compara): change to have only one
4118 (MathedLookupBOP): change because of the above.
4120 * src/mathed/math_delim.C (math_deco_compare): change to have only
4122 (search_deco): change becasue of the above.
4124 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4125 instead of manually coded one.
4127 * src/insets/insetquotes.C (Read): read the \end_inset too
4129 * src/insets/insetlatex.h: remove file
4130 * src/insets/insetlatex.C: remove file
4132 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4134 (InsetPrintIndex): remove destructor
4136 * src/insets/insetinclude.h: remove default constructor
4138 * src/insets/insetfloat.C: work to make it work better
4140 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4142 * src/insets/insetcite.h (InsetCitation): remove default constructor
4144 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4146 * src/text.C (GetColumnNearX): comment out some currently unused code.
4148 * src/paragraph.C (writeFile): move some initializations closer to
4150 (CutIntoMinibuffer): small change to use new matchIT operator
4154 (InsertInset): ditto
4157 (InsetIterator): ditto
4158 (Erase): small change to use new matchFT operator
4160 (GetFontSettings): ditto
4161 (HighestFontInRange): ditto
4164 * src/lyxparagraph.h: some chars changed to value_type
4165 (matchIT): because of some stronger checking (perhaps too strong)
4166 in SGI STL, the two operator() unified to one.
4169 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4171 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4172 the last inset read added
4173 (parseSingleLyXformat2Token): some more (future) compability code added
4174 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4175 (parseSingleLyXformat2Token): set last_inset_read
4176 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4177 (parseSingleLyXformat2Token): don't double intializw string next_token
4179 * src/TextCache.C (text_fits::operator()): add const's to the signature
4180 (has_buffer::operator()): ditto
4182 * src/Floating.h: add some comments on the class
4184 * src/FloatList.[Ch] (typeExist): new method
4187 * src/BackStack.h: added default constructor, wanted by Gcc.
4189 2000-07-14 Juergen Vigna <jug@sad.it>
4191 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4193 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4195 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4196 do a redraw when the window is resized!
4197 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4199 * src/insets/insettext.C (resizeLyXText): added function to correctly
4200 being able to resize the LyXWindow.
4202 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4204 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4206 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4207 crashes when closing dialog to a deleted inset.
4209 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4210 method! Now similar to other insets.
4212 2000-07-13 Juergen Vigna <jug@sad.it>
4214 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4216 * lib/examples/Literate.lyx: small patch!
4218 * src/insets/insetbib.C (Read): added this function because of wrong
4219 Write (without [begin|end]_inset).
4221 2000-07-11 Juergen Vigna <jug@sad.it>
4223 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4224 as the insertInset could not be good!
4226 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4227 the bool param should not be last.
4229 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4231 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4232 did submit that to Karl).
4234 * configure.in: use -isystem instead of -I for X headers. This
4235 fixes a problem on solaris with a recent gcc;
4236 put the front-end code after the X detection code;
4237 configure in sigc++ before lib/
4239 * src/lyx_main.C (commandLineHelp): remove -display from command
4242 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4244 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4245 Also put in Makefile rules for building the ``listerrors''
4246 program for parsing errors from literate programs written in LyX.
4248 * lib/build-listerrors: Added small shell script as part of compile
4249 process. This builds a working ``listerrors'' binary if noweb is
4250 installed and either 1) the VNC X server is installed on the machine,
4251 or 2) the user is compiling from within a GUI. The existence of a GUI
4252 is necessary to use the ``lyx --export'' feature for now. This
4253 hack can be removed once ``lyx --export'' no longer requires a GUI to
4256 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4258 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4259 now passed back correctly from gcc and placed "under" error
4260 buttons in a Literate LyX source.
4262 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4264 * src/text.C (GetColumnNearX): Better behavior when a RTL
4265 paragraph is ended by LTR text.
4267 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4270 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4272 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4273 true when clipboard is empty.
4275 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4277 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4278 row of the paragraph.
4279 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4280 to prevent calculation of bidi tables
4282 2000-07-07 Juergen Vigna <jug@sad.it>
4284 * src/screen.C (ToggleSelection): added y_offset and x_offset
4287 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4290 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4292 * src/insets/insettext.C: fixed Layout-Display!
4294 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4296 * configure.in: add check for strings.h header.
4298 * src/spellchecker.C: include <strings.h> in order to have a
4299 definition for bzero().
4301 2000-07-07 Juergen Vigna <jug@sad.it>
4303 * src/insets/insettext.C (draw): set the status of the bv->text to
4304 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4306 * src/screen.C (DrawOneRow):
4307 (DrawFromTo): redraw the actual row if something has changed in it
4310 * src/text.C (draw): call an update of the toplevel-inset if something
4311 has changed inside while drawing.
4313 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4315 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4317 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4318 processing inside class.
4320 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4321 processing inside class.
4323 * src/insets/insetindex.h new struct Holder, consistent with other
4326 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4327 citation dialog from main code and placed it in src/frontends/xforms.
4328 Dialog launched through signals instead of callbacks
4330 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4332 * lyx.man: update the options description.
4334 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4336 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4337 handle neg values, set min width to 590, add doc about -display
4339 2000-07-05 Juergen Vigna <jug@sad.it>
4341 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4342 calls to BufferView *.
4344 * src/insets/insettext.C (checkAndActivateInset): small fix non
4345 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4347 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4348 their \end_inset token!
4350 2000-07-04 edscott <edscott@imp.mx>
4352 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4353 lib/lyxrc.example: added option \wheel_jump
4355 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4357 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4358 remove support for -width,-height,-xpos and -ypos.
4360 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4362 * src/encoding.[Ch]: New files.
4364 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4365 (text): Call to the underline() method only when needed.
4367 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4369 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4370 encoding(s) for the document.
4372 * src/bufferparams.C (BufferParams): Changed default value of
4375 * src/language.C (newLang): Removed.
4376 (items[]): Added encoding information for all defined languages.
4378 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4379 encoding choice button.
4381 * src/lyxrc.h (font_norm_type): New member variable.
4382 (set_font_norm_type): New method.
4384 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4385 paragraphs with different encodings.
4387 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4388 (TransformChar): Changed to work correctly with Arabic points.
4389 (draw): Added support for drawing Arabic points.
4390 (draw): Removed code for drawing underbars (this is done by
4393 * src/support/textutils.h (IsPrintableNonspace): New function.
4395 * src/BufferView_pimpl.h: Added "using SigC::Object".
4396 * src/LyXView.h: ditto.
4398 * src/insets/insetinclude.h (include_label): Changed to mutable.
4400 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4402 * src/mathed/math_iter.h: remove empty destructor
4404 * src/mathed/math_cursor.h: remove empty destructor
4406 * src/insets/lyxinset.h: add THEOREM_CODE
4408 * src/insets/insettheorem.[Ch]: new files
4410 * src/insets/insetminipage.C: (InsertInset): remove
4412 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4414 (InsertInset): remove
4416 * src/insets/insetlist.C: (InsertList): remove
4418 * src/insets/insetfootlike.[Ch]: new files
4420 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4423 (InsertInset): ditto
4425 * src/insets/insetert.C: remove include Painter.h, reindent
4426 (InsertInset): move to header
4428 * src/insets/insetcollapsable.h: remove explicit from default
4429 contructor, remove empty destructor, add InsertInset
4431 * src/insets/insetcollapsable.C (InsertInset): new func
4433 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4435 * src/vspace.h: add explicit to constructor
4437 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4438 \textcompwordmark, please test this.
4440 * src/lyxrc.C: set ascii_linelen to 65 by default
4442 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4444 * src/commandtags.h: add LFUN_INSET_THEOREM
4446 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4447 (makeLinuxDocFile): remove _some_ of the nice logic
4448 (makeDocBookFile): ditto
4450 * src/Painter.[Ch]: (~Painter): removed
4452 * src/LyXAction.C (init): entry for insettheorem added
4454 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4456 (deplog): code to detect files generated by LaTeX, needs testing
4459 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4461 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4463 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4465 * src/LaTeX.C (deplog): Add a check for files that are going to be
4466 created by the first latex run, part of the project to remove the
4469 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4470 contents to the extension list.
4472 2000-07-04 Juergen Vigna <jug@sad.it>
4474 * src/text.C (NextBreakPoint): added support for needFullRow()
4476 * src/insets/lyxinset.h: added needFullRow()
4478 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4481 * src/insets/insettext.C: lots of changes for update!
4483 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4485 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4487 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4489 * src/insets/insetinclude.C (InsetInclude): fixed
4490 initialization of include_label.
4491 (unique_id): now returns a string.
4493 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4495 * src/LaTeXFeatures.h: new member IncludedFiles, for
4496 a map of key, included file name.
4498 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4499 with the included files for inclusion in SGML preamble,
4500 i. e., linuxdoc and docbook.
4503 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4504 nice (is the generated linuxdoc code to be exported?), that
4505 allows to remove column, and only_body that will be true for
4506 slave documents. Insets are allowed inside SGML font type.
4507 New handling of the SGML preamble for included files.
4508 (makeDocBookFile): the same for docbook.
4510 * src/insets/insetinclude.h:
4511 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4513 (DocBook): new export methods.
4515 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4516 and makeDocBookFile.
4518 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4519 formats to export with command line argument -x.
4521 2000-06-29 Juergen Vigna <jug@sad.it>
4523 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4524 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4526 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4527 region could already been cleared by an inset!
4529 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4531 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4534 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4536 (cursorToggle): remove special handling of lyx focus.
4538 2000-06-28 Juergen Vigna <jug@sad.it>
4540 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4543 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4545 * src/insets/insetindex.C (Edit): add a callback when popup is
4548 * src/insets/insettext.C (LocalDispatch):
4549 * src/insets/insetmarginal.h:
4550 * src/insets/insetlist.h:
4551 * src/insets/insetfoot.h:
4552 * src/insets/insetfloat.h:
4553 * src/insets/insetert.h: add a missing std:: qualifier.
4555 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4557 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4560 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4562 * src/insets/insettext.C (Read): remove tmptok unused variable
4563 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4564 (InsertInset): change for new InsetInset code
4566 * src/insets/insettext.h: add TEXT inline method
4568 * src/insets/insettext.C: remove TEXT macro
4570 * src/insets/insetmarginal.C (Write): new method
4571 (Latex): change output slightly
4573 * src/insets/insetfoot.C (Write): new method
4574 (Latex): change output slightly (don't use endl when no need)
4576 * src/insets/insetert.C (Write): new method
4578 * src/insets/insetcollapsable.h: make button_length, button_top_y
4579 and button_bottm_y protected.
4581 * src/insets/insetcollapsable.C (Write): simplify code by using
4582 tostr. Also do not output the float name, the children class
4583 should to that to get control over own arguments
4585 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4586 src/insets/insetminipage.[Ch]:
4589 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4591 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4593 * src/Makefile.am (lyx_SOURCES): add the new files
4595 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4596 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4597 * src/commandtags.h: ditto
4599 * src/LaTeXFeatures.h: add a std::set of used floattypes
4601 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4603 * src/FloatList.[Ch] src/Floating.h: new files
4605 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4607 * src/lyx_cb.C (TableApplyCB): ditto
4609 * src/text2.C: ditto
4610 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4611 (parseSingleLyXformat2Token): ditto + add code for
4612 backwards compability for old float styles + add code for new insets
4614 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4616 (InsertInset(size_type, Inset *, LyXFont)): new method
4617 (InsetChar(size_type, char)): changed to use the other InsetChar
4618 with a LyXFont(ALL_INHERIT).
4619 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4620 insert the META_INSET.
4622 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4624 * sigc++/thread.h (Threads): from here
4626 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4627 definition out of line
4628 * sigc++/scope.h: from here
4630 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4632 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4633 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4635 * Makefile.am (bindist): new target.
4637 * INSTALL: add instructions for doing a binary distribution.
4639 * development/tools/README.bin.example: update a bit.
4641 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4644 * lib/lyxrc.example: new lyxrc tag \set_color.
4646 * src/lyxfunc.C (Dispatch):
4647 * src/commandtags.h:
4648 * src/LyXAction.C: new lyxfunc "set-color".
4650 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4651 and an x11name given as strings.
4653 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4654 cache when a color is changed.
4656 2000-06-26 Juergen Vigna <jug@sad.it>
4658 * src/lyxrow.C (width): added this functions and variable.
4660 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4663 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4665 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4667 * images/undo_bw.xpm: new icon.
4668 * images/redo_bw.xpm: ditto.
4670 * configure.in (INSTALL_SCRIPT): change value to
4671 ${INSTALL} to avoid failures of install-script target.
4672 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4674 * src/BufferView.h: add a magic "friend" declaration to please
4677 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4679 * forms/cite.fd: modified to allow resizing without messing
4682 * src/insetcite.C: Uses code from cite.fd almost without
4684 User can now resize dialog in the x-direction.
4685 Resizing the dialog in the y-direction is prevented, as the
4686 code does this intelligently already.
4688 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4690 * INSTALL: remove obsolete entry in "problems" section.
4692 * lib/examples/sl_*.lyx: update of the slovenian examples.
4694 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4696 2000-06-23 Juergen Vigna <jug@sad.it>
4698 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4700 * src/buffer.C (resize): delete the LyXText of textinsets.
4702 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4704 * src/insets/lyxinset.h: added another parameter 'cleared' to
4705 the draw() function.
4707 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4708 unlocking inset in inset.
4710 2000-06-22 Juergen Vigna <jug@sad.it>
4712 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4713 of insets and moved first to LyXText.
4715 * src/mathed/formulamacro.[Ch]:
4716 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4718 2000-06-21 Juergen Vigna <jug@sad.it>
4720 * src/text.C (GetVisibleRow): look if I should clear the area or not
4721 using Inset::doClearArea() function.
4723 * src/insets/lyxinset.h: added doClearArea() function and
4724 modified draw(Painter &, ...) to draw(BufferView *, ...)
4726 * src/text2.C (UpdateInset): return bool insted of int
4728 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4730 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4731 combox in the character popup
4733 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4734 BufferParams const & params
4736 2000-06-20 Juergen Vigna <jug@sad.it>
4738 * src/insets/insettext.C (SetParagraphData): set insetowner on
4741 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4743 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4744 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4746 (form_main_): remove
4748 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4749 (create_form_form_main): remove FD_form_main stuff, connect to
4750 autosave_timeout signal
4752 * src/LyXView.[Ch] (getMainForm): remove
4753 (UpdateTimerCB): remove
4754 * src/BufferView_pimpl.h: inherit from SigC::Object
4756 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4757 signal instead of callback
4759 * src/BufferView.[Ch] (cursorToggleCB): remove
4761 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4763 * src/BufferView_pimpl.C: changes because of the one below
4765 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4766 instead of storing a pointer to a LyXText.
4768 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4770 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4772 * src/lyxparagraph.h
4774 * src/paragraph.C: Changed fontlist to a sorted vector.
4776 2000-06-19 Juergen Vigna <jug@sad.it>
4778 * src/BufferView.h: added screen() function.
4780 * src/insets/insettext.C (LocalDispatch): some selection code
4783 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4785 * src/insets/insettext.C (SetParagraphData):
4787 (InsetText): fixes for multiple paragraphs.
4789 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4791 * development/lyx.spec.in: Call configure with ``--without-warnings''
4792 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4793 This should be fine, however, since we generally don't want to be
4794 verbose when making an RPM.
4796 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4798 * lib/scripts/fig2pstex.py: New file
4800 2000-06-16 Juergen Vigna <jug@sad.it>
4802 * src/insets/insettabular.C (UpdateLocal):
4803 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4804 (LocalDispatch): Changed all functions to use LyXText.
4806 2000-06-15 Juergen Vigna <jug@sad.it>
4808 * src/text.C (SetHeightOfRow): call inset::update before requesting
4811 * src/insets/insettext.C (update):
4812 * src/insets/insettabular.C (update): added implementation
4814 * src/insets/lyxinset.h: added update function
4816 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4818 * src/text.C (SelectNextWord): protect against null pointers with
4819 old-style string streams. (fix from Paul Theo Gonciari
4822 * src/cite.[Ch]: remove erroneous files.
4824 * lib/configure.m4: update the list of created directories.
4826 * src/lyxrow.C: include <config.h>
4827 * src/lyxcursor.C: ditto.
4829 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4831 * lib/examples/decimal.lyx: new example file from Mike.
4833 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4834 to find template definitions (from Dekel)
4836 * src/frontends/.cvsignore: add a few things.
4838 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4840 * src/Timeout.C (TimeOut): remove default argument.
4842 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4845 * src/insets/ExternalTemplate.C: add a "using" directive.
4847 * src/lyx_main.h: remove the act_ struct, which seems unused
4850 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4852 * LyX Developers Meeting: All files changed, due to random C++ (by
4853 coincidence) code generator script.
4855 - external inset (cool!)
4856 - initial online editing of preferences
4857 - insettabular breaks insettext(s contents)
4859 - some DocBook fixes
4860 - example files update
4861 - other cool stuff, create a diff and look for yourself.
4863 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4865 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4866 -1 this is a non-line-breaking textinset.
4868 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4869 if there is no width set.
4871 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4873 * Lots of files: Merged the dialogbase branch.
4875 2000-06-09 Allan Rae <rae@lyx.org>
4877 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4878 and the Dispatch methods that used it.
4880 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4881 access to functions formerly kept in Dispatch.
4883 2000-05-19 Allan Rae <rae@lyx.org>
4885 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4886 made to_page and count_copies integers again. from_page remains a
4887 string however because I want to allow entry of a print range like
4888 "1,4,22-25" using this field.
4890 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4891 and printer-params-get. These aren't useful from the minibuffer but
4892 could be used by a script/LyXServer app provided it passes a suitable
4893 auto_mem_buffer. I guess I should take a look at how the LyXServer
4894 works and make it support xtl buffers.
4896 * sigc++/: updated to libsigc++-1.0.1
4898 * src/xtl/: updated to xtl-1.3.pl.11
4900 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4901 those changes done to the files in src/ are actually recreated when
4902 they get regenerated. Please don't ever accept a patch that changes a
4903 dialog unless that patch includes the changes to the corresponding *.fd
4906 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4907 stringOnlyContains, renamed it and generalised it.
4909 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4910 branch. Removed the remaining old form_print code.
4912 2000-04-26 Allan Rae <rae@lyx.org>
4914 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4915 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4917 2000-04-25 Allan Rae <rae@lyx.org>
4919 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4920 against a base of xtl-1.3.pl.4
4922 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4923 filter the Id: entries so they still show the xtl version number
4926 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4927 into the src/xtl code. Patch still pending with José (XTL)
4929 2000-04-24 Allan Rae <rae@lyx.org>
4931 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4932 both more generic and much safer. Use the new template functions.
4933 * src/buffer.[Ch] (Dispatch): ditto.
4935 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4936 and mem buffer more intelligently. Also a little general cleanup.
4939 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4940 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4941 * src/xtl/Makefile.am: ditto.
4942 * src/xtl/.cvsignore: ditto.
4943 * src/Makefile.am: ditto.
4945 * src/PrinterParams.h: Removed the macros member functions. Added a
4946 testInvariant member function. A bit of tidying up and commenting.
4947 Included Angus's idea for fixing operation with egcs-1.1.2.
4949 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4950 cool expansion of XTL's mem_buffer to support automatic memory
4951 management within the buffer itself. Removed the various macros and
4952 replaced them with template functions that use either auto_mem_buffer
4953 or mem_buffer depending on a #define. The mem_buffer support will
4954 disappear as soon as the auto_mem_buffer is confirmed to be good on
4955 other platforms/compilers. That is, it's there so you've got something
4958 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4959 effectively forked XTL. However I expect José will include my code
4960 into the next major release. Also fixed a memory leak.
4961 * src/xtl/text.h: ditto.
4962 * src/xtl/xdr.h: ditto.
4963 * src/xtl/giop.h: ditto.
4965 2000-04-16 Allan Rae <rae@lyx.org>
4967 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4968 by autogen.sh and removed by maintainer-clean anyway.
4969 * .cvsignore, sigc++/.cvsignore: Support the above.
4971 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4973 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4975 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4976 macros, renamed static callback-target member functions to suit new
4977 scheme and made them public.
4978 * src/frontends/xforms/forms/form_print.fd: ditto.
4979 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4981 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4984 * src/xtl/: New directory containing a minimal distribution of XTL.
4985 This is XTL-1.3.pl.4.
4987 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4989 2000-04-15 Allan Rae <rae@lyx.org>
4991 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4993 * sigc++/: Updated to libsigc++-1.0.0
4995 2000-04-14 Allan Rae <rae@lyx.org>
4997 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4998 use the generic ones in future. I'll modify my conversion script.
5000 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5002 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5003 (CloseAllBufferRelatedDialogs): Renamed.
5004 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5006 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5007 of the generic ones. These are the same ones my conversion script
5010 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5011 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5012 * src/buffer.C (Dispatch): ditto
5014 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5015 functions for updating and hiding buffer dependent dialogs.
5016 * src/BufferView.C (buffer): ditto
5017 * src/buffer.C (setReadonly): ditto
5018 * src/lyxfunc.C (CloseBuffer): ditto
5020 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5021 Dialogs.h, and hence all the SigC stuff, into every file that includes
5022 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5024 * src/BufferView2.C: reduce the number of headers included by buffer.h
5026 2000-04-11 Allan Rae <rae@lyx.org>
5028 * src/frontends/xforms/xform_macros.h: A small collection of macros
5029 for building C callbacks.
5031 * src/frontends/xforms/Makefile.am: Added above file.
5033 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5034 scheme again. This time it should work for JMarc. If this is
5035 successful I'll revise my conversion script to automate some of this.
5036 The static member functions in the class also have to be public for
5037 this scheme will work. If the scheme works (it's almost identical to
5038 the way BufferView::cursorToggleCB is handled so it should work) then
5039 FormCopyright and FormPrint will be ready for inclusion into the main
5040 trunk immediately after 1.1.5 is released -- provided we're prepared
5041 for complaints about lame compilers not handling XTL.
5043 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5045 2000-04-07 Allan Rae <rae@lyx.org>
5047 * config/lyxinclude.m4: A bit more tidying up (Angus)
5049 * src/LString.h: JMarc's <string> header fix
5051 * src/PrinterParams.h: Used string for most data to remove some
5052 ugly code in the Print dialog and avoid even uglier code when
5053 appending the ints to a string for output.
5055 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5056 and moved "default:" back to the end of switch statement. Cleaned
5057 up the printing so it uses the right function calls and so the
5058 "print to file" option actually puts the file in the right directory.
5060 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5062 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5063 and Ok+Apply button control into a separate method: input (Angus).
5064 (input) Cleaned it up and improved it to be very thorough now.
5065 (All CB) static_cast used instead of C style cast (Angus). This will
5066 probably change again once we've worked out how to keep gcc-2.8.1 happy
5067 with real C callbacks.
5068 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5069 ignore some of the bool settings and has random numbers instead. Needs
5070 some more investigation. Added other input length checks and checking
5071 of file and printer names.
5073 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5074 would link (Angus). Seems the old code doesn't compile with the pragma
5075 statement either. Separated callback entries from internal methods.
5077 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5079 2000-03-17 Allan Rae <rae@lyx.org>
5081 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5082 need it? Maybe it could go in Dialogs instead? I could make it a
5083 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5084 values to get the bool return value.
5085 (Dispatch): New overloaded method for xtl support.
5087 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5088 extern "C" callback instead of static member functions. Hopefully,
5089 JMarc will be able to compile this. I haven't changed
5090 forms/form_copyright.fd yet. Breaking one of my own rules already.
5092 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5093 because they aren't useful from the minibuffer. Maybe a LyXServer
5094 might want a help message though?
5096 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5098 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5099 xtl which needs both rtti and exceptions.
5101 * src/support/Makefile.am:
5102 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5104 * src/frontends/xforms/input_validators.[ch]: input filters and
5105 validators. These conrol what keys are valid in input boxes.
5106 Use them and write some more. Much better idea than waiting till
5107 after the user has pressed Ok to say that the input fields don't make
5110 * src/frontends/xforms/Makefile.am:
5111 * src/frontends/xforms/forms/form_print.fd:
5112 * src/frontends/xforms/forms/makefile:
5113 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5114 new scheme. Still have to make sure I haven't missed anything from
5115 the current implementation.
5117 * src/Makefile.am, src/PrinterParams.h: New data store.
5119 * other files: Added a couple of copyright notices.
5121 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5123 * src/insets/insetbib.h: move Holder struct in public space.
5125 * src/frontends/include/DialogBase.h: use SigC:: only when
5126 SIGC_CXX_NAMESPACES is defined.
5127 * src/frontends/include/Dialogs.h: ditto.
5129 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5131 * src/frontends/xforms/FormCopyright.[Ch]: do not
5132 mention SigC:: explicitely.
5134 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5136 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5137 deals with testing KDE in main configure.in
5138 * configure.in: ditto.
5140 2000-02-22 Allan Rae <rae@lyx.org>
5142 * Lots of files: Merged from HEAD
5144 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5145 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5147 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5149 * sigc++/: new minidist.
5151 2000-02-14 Allan Rae <rae@lyx.org>
5153 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5155 2000-02-08 Juergen Vigna <jug@sad.it>
5157 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5158 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5160 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5161 for this port and so it is much easier for other people to port
5162 dialogs in a common development environment.
5164 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5165 the QT/KDE implementation.
5167 * src/frontends/kde/Dialogs.C:
5168 * src/frontends/kde/FormCopyright.C:
5169 * src/frontends/kde/FormCopyright.h:
5170 * src/frontends/kde/Makefile.am:
5171 * src/frontends/kde/formcopyrightdialog.C:
5172 * src/frontends/kde/formcopyrightdialog.h:
5173 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5174 for the kde support of the Copyright-Dialog.
5176 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5177 subdir-substitution instead of hardcoded 'xforms' as we now have also
5180 * src/frontends/include/DialogBase.h (Object): just commented the
5181 label after #endif (nasty warning and I don't like warnings ;)
5183 * src/main.C (main): added KApplication initialization if using
5186 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5187 For now only the KDE event-loop is added if frontend==kde.
5189 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5191 * configure.in: added support for the --with-frontend[=value] option
5193 * autogen.sh: added kde.m4 file to list of config-files
5195 * acconfig.h: added define for KDEGUI-support
5197 * config/kde.m4: added configuration functions for KDE-port
5199 * config/lyxinclude.m4: added --with-frontend[=value] option with
5200 support for xforms and KDE.
5202 2000-02-08 Allan Rae <rae@lyx.org>
5204 * all Makefile.am: Fixed up so the make targets dist, distclean,
5205 install and uninstall all work even if builddir != srcdir. Still
5206 have a new sigc++ minidist update to come.
5208 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5210 2000-02-01 Allan Rae <rae@lyx.org>
5212 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5213 Many mods to get builddir != srcdir working.
5215 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5216 for building on NT and so we can do the builddir != srcdir stuff.
5218 2000-01-30 Allan Rae <rae@lyx.org>
5220 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5221 This will stay in "rae" branch. We probably don't really need it in
5222 the main trunk as anyone who wants to help programming it should get
5223 a full library installed also. So they can check both included and
5224 system supplied library compilation.
5226 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5227 Added a 'mini' distribution of libsigc++. If you feel the urge to
5228 change something in these directories - Resist it. If you can't
5229 resist the urge then you should modify the following script and rebuild
5230 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5231 all happen. Still uses a hacked version of libsigc++'s configure.in.
5232 I'm quite happy with the results. I'm not sure the extra work to turn
5233 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5234 worth the trouble and would probably lead to extra maintenance
5236 I haven't tested the following important make targets: install, dist.
5237 Not ready for prime time but very close. Maybe 1.1.5.
5239 * development/tools/makeLyXsigc.sh: A shell script to automatically
5240 generate our mini-dist of libsigc++. It can only be used with a CVS
5241 checkout of libsigc++ not a tarball distribution. It's well commented.
5242 This will end up as part of the libsigc++ distribution so other apps
5243 can easily have an included mini-dist. If someone makes mods to the
5244 sigc++ subpackage without modifying this script to generate those
5245 changes I'll be very upset!
5247 * src/frontends/: Started the gui/system indep structure.
5249 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5250 to access the gui-indep dialogs are in this class. Much improved
5251 design compared to previous revision. Lars, please refrain from
5252 moving this header into src/ like you did with Popups.h last time.
5254 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5256 * src/frontends/xforms/: Started the gui-indep system with a single
5257 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5260 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5261 Here you'll find a very useful makefile and automated fdfix.sh that
5262 makes updating dailogs a no-brainer -- provided you follow the rules
5263 set out in the README. I'm thinking about adding another script to
5264 automatically generate skeleton code for a new dialog given just the
5267 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5268 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5269 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5271 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5273 * src/support/LSubstring.C (operator): simplify
5275 * src/lyxtext.h: removed bparams, use buffer_->params instead
5277 * src/lyxrow.h: make Row a real class, move all variables to
5278 private and use accessors.
5280 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5282 (isRightToLeftPar): ditto
5283 (ChangeLanguage): ditto
5284 (isMultiLingual): ditto
5287 (SimpleTeXOnePar): ditto
5288 (TeXEnvironment): ditto
5289 (GetEndLabel): ditto
5291 (SetOnlyLayout): ditto
5292 (BreakParagraph): ditto
5293 (BreakParagraphConservative): ditto
5294 (GetFontSettings): ditto
5296 (CopyIntoMinibuffer): ditto
5297 (CutIntoMinibuffer): ditto
5298 (PasteParagraph): ditto
5299 (SetPExtraType): ditto
5300 (UnsetPExtraType): ditto
5301 (DocBookContTableRows): ditto
5302 (SimpleDocBookOneTablePar): ditto
5304 (TeXFootnote): ditto
5305 (SimpleTeXOneTablePar): ditto
5306 (TeXContTableRows): ditto
5307 (SimpleTeXSpecialChars): ditto
5310 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5311 to private and use accessors.
5313 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5314 this, we did not use it anymore and has not been for ages. Just a
5315 waste of cpu cycles.
5317 * src/language.h: make Language a real class, move all variables
5318 to private and use accessors.
5320 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5321 (create_view): remove
5322 (update): some changes for new timer
5323 (cursorToggle): use new timer
5324 (beforeChange): change for new timer
5326 * src/BufferView.h (cursorToggleCB): removed last paramter because
5329 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5330 (cursorToggleCB): change because of new timer code
5332 * lib/CREDITS: updated own mailaddress
5334 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5336 * src/support/filetools.C (PutEnv): fix the code in case neither
5337 putenv() nor setenv() have been found.
5339 * INSTALL: mention the install-strip Makefile target.
5341 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5342 read-only documents.
5344 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5346 * lib/reLyX/configure.in (VERSION): avoid using a previously
5347 generated reLyX wrapper to find out $prefix.
5349 * lib/examples/eu_adibide_lyx-atua.lyx:
5350 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5351 translation of the Tutorial (Dooteo)
5353 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5355 * forms/cite.fd: new citation dialog
5357 * src/insetcite.[Ch]: the new citation dialog is moved into
5360 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5363 * src/insets/insetcommand.h: data members made private.
5365 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5367 * LyX 1.1.5 released
5369 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5371 * src/version.h (LYX_RELEASE): to 1.1.5
5373 * src/spellchecker.C (RunSpellChecker): return false if the
5374 spellchecker dies upon creation.
5376 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5378 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5379 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5383 * lib/CREDITS: update entry for Martin Vermeer.
5385 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5387 * src/text.C (draw): Draw foreign language bars at the bottom of
5388 the row instead of at the baseline.
5390 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5392 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5394 * lib/bind/de_menus.bind: updated
5396 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5398 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5400 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5402 * src/menus.C (Limit_string_length): New function
5403 (ShowTocMenu): Limit the number of items/length of items in the
5406 * src/paragraph.C (String): Correct result for a paragraph inside
5409 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5411 * src/bufferlist.C (close): test of buf->getuser() == NULL
5413 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5415 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5416 Do not call to SetCursor when the paragraph is a closed footnote!
5418 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5420 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5423 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5425 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5428 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5429 reference popup, that activates the reference-back action
5431 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5433 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5434 the menus. Also fixed a bug.
5436 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5437 the math panels when switching buffers (unless new buffer is readonly).
5439 * src/BufferView.C (NoSavedPositions)
5440 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5442 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5444 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5445 less of dvi dirty or not.
5447 * src/trans_mgr.[Ch] (insert): change first parameter to string
5450 * src/chset.[Ch] (encodeString): add const to first parameter
5452 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5454 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5458 * src/LaTeX.C (deplog): better searching for dependency files in
5459 the latex log. Uses now regexps.
5461 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5462 instead of the box hack or \hfill.
5464 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5466 * src/lyxfunc.C (doImportHelper): do not create the file before
5467 doing the actual import.
5468 (doImportASCIIasLines): create a new file before doing the insert.
5469 (doImportASCIIasParagraphs): ditto.
5471 * lib/lyxrc.example: remove mention of non-existing commands
5473 * lyx.man: remove mention of color-related switches.
5475 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5477 * src/lyx_gui.C: remove all the color-related ressources, which
5478 are not used anymore.
5480 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5483 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5485 * src/lyxrc.C (read): Add a missing break in the switch
5487 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5489 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5491 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5494 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5496 * src/text.C (draw): draw bars under foreign language words.
5498 * src/LColor.[Ch]: add LColor::language
5500 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5502 * src/lyxcursor.h (boundary): New member variable
5504 * src/text.C (IsBoundary): New methods
5506 * src/text.C: Use the above for currect cursor movement when there
5507 is both RTL & LTR text.
5509 * src/text2.C: ditto
5511 * src/bufferview_funcs.C (ToggleAndShow): ditto
5513 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5515 * src/text.C (DeleteLineForward): set selection to true to avoid
5516 that DeleteEmptyParagraphMechanism does some magic. This is how it
5517 is done in all other functions, and seems reasonable.
5518 (DeleteWordForward): do not jump over non-word stuff, since
5519 CursorRightOneWord() already does it.
5521 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5522 DeleteWordBackward, since they seem safe to me (since selection is
5523 set to "true") DeleteEmptyParagraphMechanism does nothing.
5525 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5527 * src/lyx_main.C (easyParse): simplify the code by factoring the
5528 part that removes parameters from the command line.
5529 (LyX): check wether wrong command line options have been given.
5531 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5533 * src/lyx_main.C : add support for specifying user LyX
5534 directory via command line option -userdir.
5536 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5538 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5539 the number of items per popup.
5540 (Add_to_refs_menu): Ditto.
5542 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5544 * src/lyxparagraph.h: renamed ClearParagraph() to
5545 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5546 textclass as parameter, and do nothing if free_spacing is
5547 true. This fixes part of the line-delete-forward problems.
5549 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5550 (pasteSelection): ditto.
5551 (SwitchLayoutsBetweenClasses): more translatable strings.
5553 * src/text2.C (CutSelection): use StripLeadingSpaces.
5554 (PasteSelection): ditto.
5555 (DeleteEmptyParagraphMechanism): ditto.
5557 2000-05-26 Juergen Vigna <jug@sad.it>
5559 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5560 is not needed in tabular insets.
5562 * src/insets/insettabular.C (TabularFeatures): added missing features.
5564 * src/tabular.C (DeleteColumn):
5566 (AppendRow): implemented this functions
5567 (cellsturct::operator=): clone the inset too;
5569 2000-05-23 Juergen Vigna <jug@sad.it>
5571 * src/insets/insettabular.C (LocalDispatch): better selection support
5572 when having multicolumn-cells.
5574 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5576 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5578 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5580 * src/ColorHandler.C (getGCForeground): put more test into _()
5582 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5585 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5588 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5590 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5591 there are no labels, or when buffer is readonly.
5593 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5594 there are no labels, buffer is SGML, or when buffer is readonly.
5596 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5598 * src/LColor.C (LColor): change a couple of grey40 to grey60
5599 (LColor): rewore initalization to make compiles go some magnitude
5601 (getGUIName): don't use gettext until we need the string.
5603 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5605 * src/Bullet.[Ch]: Fixed a small bug.
5607 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5609 * src/paragraph.C (String): Several fixes/improvements
5611 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5613 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5615 * src/paragraph.C (String): give more correct output.
5617 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5619 * src/lyxfont.C (stateText) Do not output the language if it is
5620 eqaul to the language of the document.
5622 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5623 between two paragraphs with the same language.
5625 * src/paragraph.C (getParLanguage) Return a correct answer for an
5626 empty dummy paragraph.
5628 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5631 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5634 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5635 the menus/popup, if requested fonts are unavailable.
5637 2000-05-22 Juergen Vigna <jug@sad.it>
5639 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5640 movement support (Up/Down/Tab/Shift-Tab).
5641 (LocalDispatch): added also preliminari cursor-selection.
5643 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5645 * src/paragraph.C (PasteParagraph): Hopefully now right!
5647 2000-05-22 Garst R. Reese <reese@isn.net>
5649 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5650 of list, change all references to Environment to Command
5651 * tex/hollywood.cls : rewrite environments as commands, add
5652 \uppercase to interiorshot and exteriorshot to force uppecase.
5653 * tex/broadway.cls : rewrite environments as commands. Tweak
5656 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5658 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5659 size of items: use a constant intead of the hardcoded 40, and more
5660 importantly do not remove the %m and %x tags added at the end.
5661 (Add_to_refs_menu): use vector::size_type instead of
5662 unsigned int as basic types for the variables. _Please_ do not
5663 assume that size_t is equal to unsigned int. On an alpha, this is
5664 unsigned long, which is _not_ the same.
5666 * src/language.C (initL): remove language "hungarian", since it
5667 seems that "magyar" is better.
5669 2000-05-22 Juergen Vigna <jug@sad.it>
5671 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5673 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5676 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5677 next was deleted but not set to 0.
5679 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5681 * src/language.C (initL): change the initialization of languages
5682 so that compiles goes _fast_.
5684 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5687 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5689 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5693 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5695 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5697 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5701 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5704 * src/insets/insetlo*.[Ch]: Made editable
5706 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5708 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5709 the current selection.
5711 * src/BufferView_pimpl.C (stuffClipboard): new method
5713 * src/BufferView.C (stuffClipboard): new method
5715 * src/paragraph.C (String): new method
5717 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5718 LColor::ignore when lyxname is not found.
5720 * src/BufferView.C (pasteSelection): new method
5722 * src/BufferView_pimpl.C (pasteSelection): new method
5724 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5726 * src/WorkArea.C (request_clipboard_cb): new static function
5727 (getClipboard): new method
5728 (putClipboard): new method
5730 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5732 * LyX 1.1.5pre2 released
5734 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5736 * src/vspace.C (operator=): removed
5737 (operator=): removed
5739 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5741 * src/layout.C (NumberOfClass): manually set the type in make_pair
5742 (NumberOfLayout): ditto
5744 * src/language.C: use the Language constructor for ignore_lang
5746 * src/language.h: add constructors to struct Language
5748 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5750 * src/text2.C (SetCursorIntern): comment out #warning
5752 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5754 * src/mathed/math_iter.h: initialize sx and sw to 0
5756 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5758 * forms/lyx.fd: Redesign of form_ref
5760 * src/LaTeXFeatures.[Ch]
5764 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5767 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5768 and Buffer::inset_iterator.
5770 * src/menus.C: Added new menus: TOC and Refs.
5772 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5774 * src/buffer.C (getTocList): New method.
5776 * src/BufferView2.C (ChangeRefs): New method.
5778 * src/buffer.C (getLabelList): New method. It replaces the old
5779 getReferenceList. The return type is vector<string> instead of
5782 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5783 the old getLabel() and GetNumberOfLabels() methods.
5784 * src/insets/insetlabel.C (getLabelList): ditto
5785 * src/mathed/formula.C (getLabelList): ditto
5787 * src/paragraph.C (String): New method.
5789 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5790 Uses the new getTocList() method.
5791 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5792 which automatically updates the contents of the browser.
5793 (RefUpdateCB): Use the new getLabelList method.
5795 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5797 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5799 * src/spellchecker.C: Added using std::reverse;
5801 2000-05-19 Juergen Vigna <jug@sad.it>
5803 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5805 * src/insets/insettext.C (computeTextRows): small fix for display of
5806 1 character after a newline.
5808 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5811 2000-05-18 Juergen Vigna <jug@sad.it>
5813 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5814 when changing width of column.
5816 * src/tabular.C (set_row_column_number_info): setting of
5817 autobreak rows if necessary.
5819 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5821 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5823 * src/vc-backend.*: renamed stat() to status() and vcstat to
5824 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5825 compilation broke. The new name seems more relevant, anyway.
5827 2000-05-17 Juergen Vigna <jug@sad.it>
5829 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5830 which was wrong if the removing caused removing of rows!
5832 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5833 (pushToken): new function.
5835 * src/text2.C (CutSelection): fix problem discovered with purify
5837 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5839 * src/debug.C (showTags): enlarge the first column, now that we
5840 have 6-digits debug codes.
5842 * lib/layouts/hollywood.layout:
5843 * lib/tex/hollywood.cls:
5844 * lib/tex/brodway.cls:
5845 * lib/layouts/brodway.layout: more commands and fewer
5846 environments. Preambles moved in the .cls files. Broadway now has
5847 more options on scene numbering and less whitespace (from Garst)
5849 * src/insets/insetbib.C (getKeys): make sure that we are in the
5850 document directory, in case the bib file is there.
5852 * src/insets/insetbib.C (Latex): revert bogus change.
5854 2000-05-16 Juergen Vigna <jug@sad.it>
5856 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5857 the TabularLayout on cursor move.
5859 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5861 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5864 (draw): fixed cursor position and drawing so that the cursor is
5865 visible when before the tabular-inset.
5867 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5868 when creating from old insettext.
5870 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5872 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5874 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5875 * lib/tex/brodway.cls: ditto
5877 * lib/layouts/brodway.layout: change alignment of parenthical
5880 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5882 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5883 versions 0.88 and 0.89 are supported.
5885 2000-05-15 Juergen Vigna <jug@sad.it>
5887 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5890 * src/insets/insettext.C (computeTextRows): redone completely this
5891 function in a much cleaner way, because of problems when having a
5893 (draw): added a frame border when the inset is locked.
5894 (SetDrawLockedFrame): this sets if we draw the border or not.
5895 (SetFrameColor): this sets the frame color (default=insetframe).
5897 * src/insets/lyxinset.h: added x() and y() functions which return
5898 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5899 function which is needed to see if we have a locking inset of some
5900 type in this inset (needed for now in insettabular).
5902 * src/vspace.C (inPixels): the same function also without a BufferView
5903 parameter as so it is easier to use it in some ocasions.
5905 * src/lyxfunc.C: changed all places where insertInset was used so
5906 that now if it couldn't be inserted it is deleted!
5908 * src/TabularLayout.C:
5909 * src/TableLayout.C: added support for new tabular-inset!
5911 * src/BufferView2.C (insertInset): this now returns a bool if the
5912 inset was really inserted!!!
5914 * src/tabular.C (GetLastCellInRow):
5915 (GetFirstCellInRow): new helper functions.
5916 (Latex): implemented for new tabular class.
5920 (TeXTopHLine): new Latex() helper functions.
5922 2000-05-12 Juergen Vigna <jug@sad.it>
5924 * src/mathed/formulamacro.C (Read):
5925 * src/mathed/formula.C (Read): read also the \end_inset here!
5927 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5929 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5930 crush when saving formulae with unbalanced parenthesis.
5932 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5934 * src/layout.C: Add new keyword "endlabelstring" to layout file
5936 * src/text.C (GetVisibleRow): Draw endlabel string.
5938 * lib/layouts/broadway.layout
5939 * lib/layouts/hollywood.layout: Added endlabel for the
5940 Parenthetical layout.
5942 * lib/layouts/heb-article.layout: Do not use slanted font shape
5943 for Theorem like environments.
5945 * src/buffer.C (makeLaTeXFile): Always add "american" to
5946 the UsedLanguages list if document language is RTL.
5948 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5950 * add addendum to README.OS2 and small patch (from SMiyata)
5952 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5954 * many files: correct the calls to ChangeExtension().
5956 * src/support/filetools.C (ChangeExtension): remove the no_path
5957 argument, which does not belong there. Use OnlyFileName() instead.
5959 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5960 files when LaTeXing a non-nice latex file.
5962 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5963 a chain of "if". Return false when deadkeys are not handled.
5965 * src/lyx_main.C (LyX): adapted the code for default bindings.
5967 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5968 bindings for basic functionality (except deadkeys).
5969 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5971 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5972 several methods: handle override_x_deadkeys.
5974 * src/lyxrc.h: remove the "bindings" map, which did not make much
5975 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5977 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5979 * src/lyxfont.C (stateText): use a saner method to determine
5980 whether the font is "default". Seems to fix the crash with DEC
5983 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5985 2000-05-08 Juergen Vigna <jug@sad.it>
5987 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5988 TabularLayoutMenu with mouse-button-3
5989 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5991 * src/TabularLayout.C: added this file for having a Layout for
5994 2000-05-05 Juergen Vigna <jug@sad.it>
5996 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5997 recalculating inset-widths.
5998 (TabularFeatures): activated this function so that I can change
5999 tabular-features via menu.
6001 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6002 that I can test some functions with the Table menu.
6004 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6006 * src/lyxfont.C (stateText): guard against stupid c++libs.
6008 * src/tabular.C: add using std::vector
6009 some whitespace changes, + removed som autogenerated code.
6011 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6013 2000-05-05 Juergen Vigna <jug@sad.it>
6015 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6016 row, columns and cellstructures.
6018 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6020 * lib/lyxrc.example: remove obsolete entries.
6022 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6023 reading of protected_separator for free_spacing.
6025 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6027 * src/text.C (draw): do not display an exclamation mark in the
6028 margin for margin notes. This is confusing, ugly and
6031 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6032 AMS math' is checked.
6034 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6035 name to see whether including the amsmath package is needed.
6037 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6039 * src/paragraph.C (validate): Compute UsedLanguages correctly
6040 (don't insert the american language if it doesn't appear in the
6043 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6044 The argument of \thanks{} command is considered moving argument
6046 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6049 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6051 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6052 for appendix/minipage/depth. The lines can be now both in the footnote
6053 frame, and outside the frame.
6055 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6058 2000-05-05 Juergen Vigna <jug@sad.it>
6060 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6061 neede only in tabular.[Ch].
6063 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6065 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6067 (Write): write '~' for PROTECTED_SEPARATOR
6069 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6071 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6074 * src/mathed/formula.C (drawStr): rename size to siz.
6076 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6077 possibly fix a bug by not changing the pflags = flags to piflags =
6080 2000-05-05 Juergen Vigna <jug@sad.it>
6082 * src/insets/insetbib.C: moved using directive
6084 * src/ImportNoweb.C: small fix for being able to compile (missing
6087 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6089 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6090 to use clear, since we don't depend on this in the code. Add test
6093 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6095 * (various *.C files): add using std::foo directives to please dec
6098 * replace calls to string::clear() to string::erase() (Angus)
6100 * src/cheaders/cmath: modified to provide std::abs.
6102 2000-05-04 Juergen Vigna <jug@sad.it>
6104 * src/insets/insettext.C: Prepared all for inserting of multiple
6105 paragraphs. Still display stuff to do (alignment and other things),
6106 but I would like to use LyXText to do this when we cleaned out the
6107 table-support stuff.
6109 * src/insets/insettabular.C: Changed lot of stuff and added lots
6110 of functionality still a lot to do.
6112 * src/tabular.C: Various functions changed name and moved to be
6113 const functions. Added new Read and Write functions and changed
6114 lots of things so it works good with tabular-insets (also removed
6115 some stuff which is not needed anymore * hacks *).
6117 * src/lyxcursor.h: added operators == and != which just look if
6118 par and pos are (not) equal.
6120 * src/buffer.C (latexParagraphs): inserted this function to latex
6121 all paragraphs form par to endpar as then I can use this too for
6124 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6125 so that I can call this to from text insets with their own cursor.
6127 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6128 output off all paragraphs (because of the fix below)!
6130 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6131 the very last paragraph (this could be also the last paragraph of an
6134 * src/texrow.h: added rows() call which returns the count-variable.
6136 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6138 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6140 * lib/configure.m4: better autodetection of DocBook tools.
6142 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6144 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6146 * src/lyx_cb.C: add using std::reverse;
6148 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6151 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6152 selected files. Should fix repeated errors from generated files.
6154 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6156 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6158 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6159 the spellchecker popup.
6161 * lib/lyxrc.example: Removed the \number_inset section
6163 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6165 * src/insets/figinset.C (various): Use IsFileReadable() to make
6166 sure that the file actually exist. Relying on ghostscripts errors
6167 is a bad idea since they can lead to X server crashes.
6169 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6171 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6174 * lib/lyxrc.example: smallish typo in description of
6175 \view_dvi_paper_option
6177 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6180 * src/lyxfunc.C: doImportHelper to factor out common code of the
6181 various import methods. New functions doImportASCIIasLines,
6182 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6183 doImportLinuxDoc for the format specific parts.
6186 * buffer.C: Dispatch returns now a bool to indicate success
6189 * lyx_gui.C: Add getLyXView() for member access
6191 * lyx_main.C: Change logic for batch commands: First try
6192 Buffer::Dispatch (possibly without GUI), if that fails, use
6195 * lyx_main.C: Add support for --import command line switch.
6196 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6197 Available Formats: Everything accepted by 'buffer-import <format>'
6199 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6201 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6204 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6205 documents will be reformatted upon reentry.
6207 2000-04-27 Juergen Vigna <jug@sad.it>
6209 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6210 correctly only last pos this was a bug.
6212 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6214 * release of lyx-1.1.5pre1
6216 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6218 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6220 * src/menus.C: revert the change of naming (Figure->Graphic...)
6221 from 2000-04-11. It was incomplete and bad.
6223 * src/LColor.[Ch]: add LColor::depthbar.
6224 * src/text.C (GetVisibleRow): use it.
6226 * README: update the languages list.
6228 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6230 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6233 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6235 * README: remove sections that were just wrong.
6237 * src/text2.C (GetRowNearY): remove currentrow code
6239 * src/text.C (GetRow): remove currentrow code
6241 * src/screen.C (Update): rewritten a bit.
6242 (SmallUpdate): removed func
6244 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6246 (FullRebreak): return bool
6247 (currentrow): remove var
6248 (currentrow_y): ditto
6250 * src/lyxscreen.h (Draw): change arg to unsigned long
6251 (FitCursor): return bool
6252 (FitManualCursor): ditto
6253 (Smallpdate): remove func
6254 (first): change to unsigned long
6255 (DrawOneRow): change second arg to long (from long &)
6256 (screen_refresh_y): remove var
6257 (scree_refresh_row): ditto
6259 * src/lyxrow.h: change baseline to usigned int from unsigned
6260 short, this brings some implicit/unsigned issues out in the open.
6262 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6264 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6265 instead of smallUpdate.
6267 * src/lyxcursor.h: change y to unsigned long
6269 * src/buffer.h: don't call updateScrollbar after fitcursor
6271 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6272 where they are used. Removed "\\direction", this was not present
6273 in 1.1.4 and is already obsolete. Commented out some code that I
6274 believe to never be called.
6275 (runLiterate): don't call updateScrollbar after fitCursor
6277 (buildProgram): ditto
6280 * src/WorkArea.h (workWidth): change return val to unsigned
6283 (redraw): remove the button redraws
6284 (setScrollbarValue): change for scrollbar
6285 (getScrollbarValue): change for scrollbar
6286 (getScrollbarBounds): change for scrollbar
6288 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6289 (C_WorkArea_down_cb): removed func
6290 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6291 (resize): change for scrollbar
6292 (setScrollbar): ditto
6293 (setScrollbarBounds): ditto
6294 (setScrollbarIncrements): ditto
6295 (up_cb): removed func
6296 (down_cb): removed func
6297 (scroll_cb): change for scrollbar
6298 (work_area_handler): ditto
6300 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6301 when FitCursor did something.
6302 (updateScrollbar): some unsigned changes
6303 (downCB): removed func
6304 (scrollUpOnePage): removed func
6305 (scrollDownOnePage): remvoed func
6306 (workAreaMotionNotify): don't call screen->FitCursor but use
6307 fitCursor instead. and bool return val
6308 (workAreaButtonPress): ditto
6309 (workAreaButtonRelease): some unsigned changes
6310 (checkInsetHit): ditto
6311 (workAreaExpose): ditto
6312 (update): parts rewritten, comments about the signed char arg added
6313 (smallUpdate): removed func
6314 (cursorPrevious): call needed updateScrollbar
6317 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6320 * src/BufferView.[Ch] (upCB): removed func
6321 (downCB): removed func
6322 (smallUpdate): removed func
6324 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6326 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6327 currentrow, currentrow_y optimization. This did not help a lot and
6328 if we want to do this kind of optimization we should rather use
6329 cursor.row instead of the currentrow.
6331 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6332 buffer spacing and klyx spacing support.
6334 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6336 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6339 2000-04-26 Juergen Vigna <jug@sad.it>
6341 * src/insets/figinset.C: fixes to Lars sstream changes!
6343 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6345 * A lot of files: Added Ascii(ostream &) methods to all inset
6346 classes. Used when exporting to ASCII.
6348 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6349 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6352 * src/text2.C (ToggleFree): Disabled implicit word selection when
6353 there is a change in the language
6355 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6356 no output was generated for end-of-sentence inset.
6358 * src/insets/lyxinset.h
6361 * src/paragraph.C: Removed the insetnumber code
6363 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6365 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6367 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6368 no_babel and no_epsfig completely from the file.
6369 (parseSingleLyXformat2Token): add handling for per-paragraph
6370 spacing as written by klyx.
6372 * src/insets/figinset.C: applied patch by Andre. Made it work with
6375 2000-04-20 Juergen Vigna <jug@sad.it>
6377 * src/insets/insettext.C (cutSelection):
6378 (copySelection): Fixed with selection from right to left.
6379 (draw): now the rows are not recalculated at every draw.
6380 (computeTextRows): for now reset the inset-owner here (this is
6381 important for an undo or copy where the inset-owner is not set
6384 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6385 motion to the_locking_inset screen->first was forgotten, this was
6386 not important till we got multiline insets.
6388 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6390 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6391 code seems to be alright (it is code changed by Dekel, and the
6392 intent is indeed that all macros should be defined \protect'ed)
6394 * NEWS: a bit of reorganisation of the new user-visible features.
6396 2000-04-19 Juergen Vigna <jug@sad.it>
6398 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6399 position. Set the inset_owner of the used paragraph so that it knows
6400 that it is inside an inset. Fixed cursor handling with mouse and
6401 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6402 and cleanups to make TextInsets work better.
6404 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6405 Changed parameters of various functions and added LockInsetInInset().
6407 * src/insets/insettext.C:
6409 * src/insets/insetcollapsable.h:
6410 * src/insets/insetcollapsable.C:
6411 * src/insets/insetfoot.h:
6412 * src/insets/insetfoot.C:
6413 * src/insets/insetert.h:
6414 * src/insets/insetert.C: cleaned up the code so that it works now
6415 correctly with insettext.
6417 * src/insets/inset.C:
6418 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6419 that insets in insets are supported right.
6422 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6424 * src/paragraph.C: some small fixes
6426 * src/debug.h: inserted INSETS debug info
6428 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6429 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6431 * src/commandtags.h:
6432 * src/LyXAction.C: insert code for InsetTabular.
6434 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6435 not Button1MotionMask.
6436 (workAreaButtonRelease): send always a InsetButtonRelease event to
6438 (checkInsetHit): some setCursor fixes (always with insets).
6440 * src/BufferView2.C (lockInset): returns a bool now and extended for
6441 locking insets inside insets.
6442 (showLockedInsetCursor): it is important to have the cursor always
6443 before the locked inset.
6444 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6446 * src/BufferView.h: made lockInset return a bool.
6448 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6450 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6451 that is used also internally but can be called as public to have back
6452 a cursor pos which is not set internally.
6453 (SetCursorIntern): Changed to use above function.
6455 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6457 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6462 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6463 patches for things that should be in or should be changed.
6465 * src/* [insetfiles]: change "usigned char fragile" to bool
6466 fragile. There was only one point that could that be questioned
6467 and that is commented in formulamacro.C. Grep for "CHECK".
6469 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6470 (DeleteBuffer): take it out of CutAndPaste and make it static.
6472 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6474 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6475 output the spacing envir commands. Also the new commands used in
6476 the LaTeX output makes the result better.
6478 * src/Spacing.C (writeEnvirBegin): new method
6479 (writeEnvirEnd): new method
6481 2000-04-18 Juergen Vigna <jug@sad.it>
6483 * src/CutAndPaste.C: made textclass a static member of the class
6484 as otherwise it is not accesed right!!!
6486 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6488 * forms/layout_forms.fd
6489 * src/layout_forms.h
6490 * src/layout_forms.C (create_form_form_character)
6491 * src/lyx_cb.C (UserFreeFont)
6492 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6493 documents (in the layout->character popup).
6495 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6497 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6498 \spell_command was in fact not honored (from Kevin Atkinson).
6500 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6503 * src/lyx_gui.h: make lyxViews private (Angus)
6505 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6507 * src/mathed/math_write.C
6508 (MathMatrixInset::Write) Put \protect before \begin{array} and
6509 \end{array} if fragile
6510 (MathParInset::Write): Put \protect before \\ if fragile
6512 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6514 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6515 initialization if the LyXColorHandler must be done after the
6516 connections to the XServer has been established.
6518 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6519 get the background pixel from the lyxColorhandler so that the
6520 figures are rendered with the correct background color.
6521 (NextToken): removed functions.
6522 (GetPSSizes): use ifs >> string instead of NextToken.
6524 * src/Painter.[Ch]: the color cache moved out of this file.
6526 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6529 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6531 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6532 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6534 * src/BufferView.C (enterView): new func
6535 (leaveView): new func
6537 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6539 (leaveView): new func, undefines xterm cursor when approp.
6541 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6542 (AllowInput): delete the Workarea cursor handling from this func.
6544 * src/Painter.C (underline): draw a slimer underline in most cases.
6546 * src/lyx_main.C (error_handler): use extern "C"
6548 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6550 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6551 sent directly to me.
6553 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6554 to the list by Dekel.
6556 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6559 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6560 methods from lyx_cb.here.
6562 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6565 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6567 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6568 instead of using current_view directly.
6570 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6572 * src/LyXAction.C (init): add the paragraph-spacing command.
6574 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6576 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6578 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6579 different from the documents.
6581 * src/text.C (SetHeightOfRow): take paragraph spacing into
6582 account, paragraph spacing takes precedence over buffer spacing
6583 (GetVisibleRow): ditto
6585 * src/paragraph.C (writeFile): output the spacing parameter too.
6586 (validate): set the correct features if spacing is used in the
6588 (Clear): set spacing to default
6589 (MakeSameLayout): spacing too
6590 (HasSameLayout): spacing too
6591 (SetLayout): spacing too
6592 (TeXOnePar): output the spacing commands
6594 * src/lyxparagraph.h: added a spacing variable for use with
6595 per-paragraph spacing.
6597 * src/Spacing.h: add a Default spacing and a method to check if
6598 the current spacing is default. also added an operator==
6600 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6603 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6605 * src/lyxserver.C (callback): fix dispatch of functions
6607 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6608 printf() into lyxerr call.
6610 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6613 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6614 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6615 the "Float" from each of the subitems.
6616 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6618 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6619 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6620 documented the change so that the workaround can be nuked later.
6622 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6625 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6627 * src/buffer.C (getLatexName): ditto
6628 (setReadonly): ditto
6630 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6632 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6633 avoid some uses of current_view. Added also a bufferParams()
6634 method to get at this.
6636 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6638 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6640 * src/lyxparagraph.[Ch]: removed
6641 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6642 with operators used by lower_bound and
6643 upper_bound in InsetTable's
6644 Make struct InsetTable private again. Used matchpos.
6646 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6648 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6649 document, the language of existing text is changed (unless the
6650 document is multi-lingual)
6652 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6654 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6656 * A lot of files: A rewrite of the Right-to-Left support.
6658 2000-04-10 Juergen Vigna <jug@sad.it>
6660 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6661 misplaced cursor when inset in inset is locked.
6663 * src/insets/insettext.C (LocalDispatch): small fix so that a
6664 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6666 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6667 footnote font should be decreased in size twice when displaying.
6669 * src/insets/insettext.C (GetDrawFont): inserted this function as
6670 the drawing-font may differ from the real paragraph font.
6672 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6673 insets (inset in inset!).
6675 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6676 function here because we don't want footnotes inside footnotes.
6678 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6680 (init): now set the inset_owner in paragraph.C
6681 (LocalDispatch): added some resetPos() in the right position
6684 (pasteSelection): changed to use the new CutAndPaste-Class.
6686 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6687 which tells if it is allowed to insert another inset inside this one.
6689 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6690 SwitchLayoutsBetweenClasses.
6692 * src/text2.C (InsertInset): checking of the new paragraph-function
6694 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6695 is not needed anymore here!
6698 (PasteSelection): redone (also with #ifdef) so that now this uses
6699 the CutAndPaste-Class.
6700 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6703 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6704 from/to text/insets.
6706 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6707 so that the paragraph knows if it is inside an (text)-inset.
6708 (InsertFromMinibuffer): changed return-value to bool as now it
6709 may happen that an inset is not inserted in the paragraph.
6710 (InsertInsetAllowed): this checks if it is allowed to insert an
6711 inset in this paragraph.
6713 (BreakParagraphConservative):
6714 (BreakParagraph) : small change for the above change of the return
6715 value of InsertFromMinibuffer.
6717 * src/lyxparagraph.h: added inset_owner and the functions to handle
6718 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6720 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6722 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6723 functions from BufferView to BufferView::Pimpl to ease maintence.
6725 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6726 correctly. Also use SetCursorIntern instead of SetCursor.
6728 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6731 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6733 * src/WorkArea.C (belowMouse): manually implement below mouse.
6735 * src/*: Add "explicit" on several constructors, I added probably
6736 some unneeded ones. A couple of changes to code because of this.
6738 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6739 implementation and private parts from the users of BufferView. Not
6742 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6743 implementation and private parts from the users of LyXLex. Not
6746 * src/BufferView_pimpl.[Ch]: new files
6748 * src/lyxlex_pimpl.[Ch]: new files
6750 * src/LyXView.[Ch]: some inline functions move out-of-line
6752 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6754 * src/lyxparagraph.h: make struct InsetTable public.
6756 * src/support/lyxstring.h: change lyxstring::difference_type to be
6757 ptrdiff_t. Add std:: modifiers to streams.
6759 * src/font.C: include the <cctype> header, for islower() and
6762 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6764 * src/font.[Ch]: new files. Contains the metric functions for
6765 fonts, takes a LyXFont as parameter. Better separation of concepts.
6767 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6768 changes because of this.
6770 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6772 * src/*: compile with -Winline and move functions that don't
6775 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6778 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6780 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6781 (various files changed because of this)
6783 * src/Painter.C (text): fixed the drawing of smallcaps.
6785 * src/lyxfont.[Ch] (drawText): removed unused member func.
6788 * src/*.C: added needed "using" statements and "std::" qualifiers.
6790 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6792 * src/*.h: removed all use of "using" from header files use
6793 qualifier std:: instead.
6795 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6797 * src/text.C (Backspace): some additional cleanups (we already
6798 know whether cursor.pos is 0 or not).
6800 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6801 automake does not provide one).
6803 * src/bmtable.h: replace C++ comments with C comments.
6805 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6807 * src/screen.C (ShowCursor): Change the shape of the cursor if
6808 the current language is not equal to the language of the document.
6809 (If the cursor change its shape unexpectedly, then you've found a bug)
6811 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6814 * src/insets/insetnumber.[Ch]: New files.
6816 * src/LyXAction.C (init)
6817 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6820 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6822 * src/lyxparagraph.h
6823 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6824 (the vector is kept sorted).
6826 * src/text.C (GetVisibleRow): Draw selection correctly when there
6827 is both LTR and RTL text.
6829 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6830 which is much faster.
6832 * src/text.C (GetVisibleRow and other): Do not draw the last space
6833 in a row if the direction of the last letter is not equal to the
6834 direction of the paragraph.
6836 * src/lyxfont.C (latexWriteStartChanges):
6837 Check that font language is not equal to basefont language.
6838 (latexWriteEndChanges): ditto
6840 * src/lyx_cb.C (StyleReset): Don't change the language while using
6841 the font-default command.
6843 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6844 empty paragraph before a footnote.
6846 * src/insets/insetcommand.C (draw): Increase x correctly.
6848 * src/screen.C (ShowCursor): Change cursor shape if
6849 current language != document language.
6851 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6853 2000-03-31 Juergen Vigna <jug@sad.it>
6855 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6856 (Clone): changed mode how the paragraph-data is copied to the
6857 new clone-paragraph.
6859 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6860 GetInset(pos) with no inset anymore there (in inset UNDO)
6862 * src/insets/insetcommand.C (draw): small fix as here x is
6863 incremented not as much as width() returns (2 before, 2 behind = 4)
6865 2000-03-30 Juergen Vigna <jug@sad.it>
6867 * src/insets/insettext.C (InsetText): small fix in initialize
6868 widthOffset (should not be done in the init() function)
6870 2000-03-29 Amir Karger <karger@lyx.org>
6872 * lib/examples/it_ItemizeBullets.lyx: translation by
6875 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6877 2000-03-29 Juergen Vigna <jug@sad.it>
6879 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6881 * src/insets/insetfoot.C (Clone): small change as for the below
6882 new init function in the text-inset
6884 * src/insets/insettext.C (init): new function as I've seen that
6885 clone did not copy the Paragraph-Data!
6886 (LocalDispatch): Added code so that now we have some sort of Undo
6887 functionality (well actually we HAVE Undo ;)
6889 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6891 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6893 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6896 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6898 * src/main.C: added a runtime check that verifies that the xforms
6899 header used when building LyX and the library used when running
6900 LyX match. Exit with a message if they don't match. This is a
6901 version number check only.
6903 * src/buffer.C (save): Don't allocate memory on the heap for
6904 struct utimbuf times.
6906 * *: some using changes, use iosfwd instead of the real headers.
6908 * src/lyxfont.C use char const * instead of string for the static
6909 strings. Rewrite some functions to use sstream.
6911 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6913 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6916 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6918 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6919 of Geodesy (from Martin Vermeer)
6921 * lib/layouts/svjour.inc: include file for the Springer svjour
6922 class. It can be used to support journals other than JoG.
6924 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6925 Miskiewicz <misiek@pld.org.pl>)
6926 * lib/reLyX/Makefile.am: ditto.
6928 2000-03-27 Juergen Vigna <jug@sad.it>
6930 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6931 also some modifications with operations on selected text.
6933 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6934 problems with clicking on insets (last famous words ;)
6936 * src/insets/insetcommand.C (draw):
6937 (width): Changed to have a bit of space before and after the inset so
6938 that the blinking cursor can be seen (otherwise it was hidden)
6940 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6942 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6943 would not be added to the link list when an installed gettext (not
6944 part of libc) is found.
6946 2000-03-24 Juergen Vigna <jug@sad.it>
6948 * src/insets/insetcollapsable.C (Edit):
6949 * src/mathed/formula.C (InsetButtonRelease):
6950 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6953 * src/BufferView.C (workAreaButtonPress):
6954 (workAreaButtonRelease):
6955 (checkInsetHit): Finally fixed the clicking on insets be handled
6958 * src/insets/insetert.C (Edit): inserted this call so that ERT
6959 insets work always with LaTeX-font
6961 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6963 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6964 caused lyx to startup with no GUI in place, causing in a crash
6965 upon startup when called with arguments.
6967 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6969 * src/FontLoader.C: better initialization of dummyXFontStruct.
6971 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6973 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6974 for linuxdoc and docbook import and export format options.
6976 * lib/lyxrc.example Example of default values for the previous flags.
6978 * src/lyx_cb.C Use those flags instead of the hardwired values for
6979 linuxdoc and docbook export.
6981 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6984 * src/menus.C Added menus entries for the new import/exports formats.
6986 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6988 * src/lyxrc.*: Added support for running without Gui
6991 * src/FontLoader.C: sensible defaults if no fonts are needed
6993 * src/lyx_cb.C: New function ShowMessage (writes either to the
6994 minibuffer or cout in case of no gui
6995 New function AskOverwrite for common stuff
6996 Consequently various changes to call these functions
6998 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6999 wild guess at sensible screen resolution when having no gui
7001 * src/lyxfont.C: no gui, no fonts... set some defaults
7003 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7005 * src/LColor.C: made the command inset background a bit lighter.
7007 2000-03-20 Hartmut Goebel <goebel@noris.net>
7009 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7010 stdstruct.inc. Koma-Script added some title elements which
7011 otherwise have been listed below "bibliography". This split allows
7012 adding title elements to where they belong.
7014 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7015 define the additional title elements and then include
7018 * many other layout files: changed to include stdtitle.inc just
7019 before stdstruct.inc.
7021 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7023 * src/buffer.C: (save) Added the option to store all backup files
7024 in a single directory
7026 * src/lyxrc.[Ch]: Added variable \backupdir_path
7028 * lib/lyxrc.example: Added descriptions of recently added variables
7030 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7031 bibtex inset, not closing the bibtex popup when deleting the inset)
7033 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7035 * src/lyx_cb.C: add a couple using directives.
7037 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7038 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7039 import based on the filename.
7041 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7042 file would be imported at start, if the filename where of a sgml file.
7044 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7046 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7048 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7049 * src/lyxfont.h Replaced the member variable bits.direction by the
7050 member variable lang. Made many changes in other files.
7051 This allows having a multi-lingual document
7053 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7054 that change the current language to <l>.
7055 Removed the command "font-rtl"
7057 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7058 format for Hebrew documents)
7060 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7061 When auto_mathmode is "true", pressing a digit key in normal mode
7062 will cause entering into mathmode.
7063 If auto_mathmode is "rtl" then this behavior will be active only
7064 when writing right-to-left text.
7066 * src/text2.C (InsertStringA) The string is inserted using the
7069 * src/paragraph.C (GetEndLabel) Gives a correct result for
7070 footnote paragraphs.
7072 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7074 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7076 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7077 front of PasteParagraph. Never insert a ' '. This should at least
7078 fix some cause for the segfaults that we have been experiencing,
7079 it also fixes backspace behaviour slightly. (Phu!)
7081 * src/support/lstrings.C (compare_no_case): some change to make it
7082 compile with gcc 2.95.2 and stdlibc++-v3
7084 * src/text2.C (MeltFootnoteEnvironment): change type o
7085 first_footnote_par_is_not_empty to bool.
7087 * src/lyxparagraph.h: make text private. Changes in other files
7089 (fitToSize): new function
7090 (setContentsFromPar): new function
7091 (clearContents): new function
7092 (SetChar): new function
7094 * src/paragraph.C (readSimpleWholeFile): deleted.
7096 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7097 the file, just use a simple string instead. Also read the file in
7098 a more maintainable manner.
7100 * src/text2.C (InsertStringA): deleted.
7101 (InsertStringB): deleted.
7103 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7105 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7106 RedoParagraphs from the doublespace handling part, just set status
7107 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7108 done, but perhaps not like this.)
7110 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7112 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7113 character when inserting an inset.
7115 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7117 * src/bufferparams.C (readLanguage): now takes "default" into
7120 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7121 also initialize the toplevel_keymap with the default bindings from
7124 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7126 * all files using lyxrc: have lyxrc as a real variable and not a
7127 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7130 * src/lyxrc.C: remove double call to defaultKeyBindings
7132 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7133 toolbar defauls using lyxlex. Remove enums, structs, functions
7136 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7137 toolbar defaults. Also store default keybindings in a map.
7139 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7140 storing the toolbar defaults without any xforms dependencies.
7142 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7143 applied. Changed to use iterators.
7145 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7147 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7148 systems that don't have LINGUAS set to begin with.
7150 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7152 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7153 the list by Dekel Tsur.
7155 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7157 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7158 * src/insets/form_graphics.C: ditto.
7160 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7162 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7164 * src/bufferparams.C (readLanguage): use the new language map
7166 * src/intl.C (InitKeyMapper): use the new language map
7168 * src/lyx_gui.C (create_forms): use the new language map
7170 * src/language.[Ch]: New files. Used for holding the information
7171 about each language. Now! Use this new language map enhance it and
7172 make it really usable for our needs.
7174 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7176 * screen.C (ShowCursor): Removed duplicate code.
7177 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7178 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7180 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7183 * src/text.C Added TransformChar method. Used for rendering Arabic
7184 text correctly (change the glyphs of the letter according to the
7185 position in the word)
7190 * src/lyxrc.C Added lyxrc command {language_command_begin,
7191 language_command_end,language_command_ltr,language_command_rtl,
7192 language_package} which allows the use of either arabtex or Omega
7195 * src/lyx_gui.C (init)
7197 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7198 to use encoding for menu fonts which is different than the encoding
7201 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7202 do not load the babel package.
7203 To write an English document with Hebrew/Arabic, change the document
7204 language to "english".
7206 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7207 (alphaCounter): changed to return char
7208 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7210 * lib/lyxrc.example Added examples for Hebrew/Arabic
7213 * src/layout.C Added layout command endlabeltype
7215 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7217 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7219 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7221 * src/mathed/math_delim.C (search_deco): return a
7222 math_deco_struct* instead of index.
7224 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7226 * All files with a USE_OSTREAM_ONLY within: removed all code that
7227 was unused when USE_OSTREAM_ONLY is defined.
7229 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7230 of any less. Removed header and using.
7232 * src/text.C (GetVisibleRow): draw the string "Page Break
7233 (top/bottom)" on screen when drawing a pagebreak line.
7235 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7237 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7239 * src/mathed/math_macro.C (draw): do some cast magic.
7242 * src/mathed/math_defs.h: change byte* argument to byte const*.
7244 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7246 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7247 know it is right to return InsetFoot* too, but cxx does not like
7250 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7252 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7254 * src/mathed/math_delim.C: change == to proper assignment.
7256 2000-03-09 Juergen Vigna <jug@sad.it>
7258 * src/insets/insettext.C (setPos): fixed various cursor positioning
7259 problems (via mouse and cursor-keys)
7260 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7261 inset (still a small display problem but it works ;)
7263 * src/insets/insetcollapsable.C (draw): added button_top_y and
7264 button_bottom_y to have correct values for clicking on the inset.
7266 * src/support/lyxalgo.h: commented out 'using std::less'
7268 2000-03-08 Juergen Vigna <jug@sad.it>
7270 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7271 Button-Release event closes as it is alos the Release-Event
7274 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7276 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7278 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7279 can add multiple spaces in Scrap (literate programming) styles...
7280 which, by the way, is how I got hooked on LyX to begin with.
7282 * src/mathed/formula.C (Write): Added dummy variable to an
7283 inset::Latex() call.
7284 (Latex): Add free_spacing boolean to inset::Latex()
7286 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7288 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7289 virtual function to include the free_spacing boolean from
7290 the containing paragraph's style.
7292 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7293 Added free_spacing boolean arg to match inset.h
7295 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7296 Added free_spacing boolean arg to match inset.h
7298 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7299 Added free_spacing boolean and made sure that if in a free_spacing
7300 paragraph, that we output normal space if there is a protected space.
7302 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7303 Added free_spacing boolean arg to match inset.h
7305 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7306 Added free_spacing boolean arg to match inset.h
7308 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7309 Added free_spacing boolean arg to match inset.h
7311 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7312 Added free_spacing boolean arg to match inset.h
7314 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7315 Added free_spacing boolean arg to match inset.h
7317 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7318 free_spacing boolean arg to match inset.h
7320 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7321 Added free_spacing boolean arg to match inset.h
7323 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7324 Added free_spacing boolean arg to match inset.h
7326 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7327 Added free_spacing boolean arg to match inset.h
7329 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7330 Added free_spacing boolean arg to match inset.h
7332 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7333 Added free_spacing boolean arg to match inset.h
7335 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7336 free_spacing boolean arg to match inset.h
7338 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7339 free_spacing boolean arg to match inset.h
7341 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7342 ignore free_spacing paragraphs. The user's spaces are left
7345 * src/text.C (InsertChar): Fixed the free_spacing layout
7346 attribute behavior. Now, if free_spacing is set, you can
7347 add multiple spaces in a paragraph with impunity (and they
7348 get output verbatim).
7349 (SelectSelectedWord): Added dummy argument to inset::Latex()
7352 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7355 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7356 paragraph layouts now only input a simple space instead.
7357 Special character insets don't make any sense in free-spacing
7360 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7361 hard-spaces in the *input* file to simple spaces if the layout
7362 is free-spacing. This converts old files which had to have
7363 hard-spaces in free-spacing layouts where a simple space was
7365 (writeFileAscii): Added free_spacing check to pass to the newly
7366 reworked inset::Latex(...) methods. The inset::Latex() code
7367 ensures that hard-spaces in free-spacing paragraphs get output
7368 as spaces (rather than "~").
7370 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7372 * src/mathed/math_delim.C (draw): draw the empty placeholder
7373 delims with a onoffdash line.
7374 (struct math_deco_compare): struct that holds the "functors" used
7375 for the sort and the binary search in math_deco_table.
7376 (class init_deco_table): class used for initial sort of the
7378 (search_deco): use lower_bound to do a binary search in the
7381 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7383 * src/lyxrc.C: a small secret thingie...
7385 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7386 and to not flush the stream as often as it used to.
7388 * src/support/lyxalgo.h: new file
7389 (sorted): template function used for checking if a sequence is
7390 sorted or not. Two versions with and without user supplied
7391 compare. Uses same compare as std::sort.
7393 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7394 it and give warning on lyxerr.
7396 (struct compare_tags): struct with function operators used for
7397 checking if sorted, sorting and lower_bound.
7398 (search_kw): use lower_bound instead of manually implemented
7401 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7403 * src/insets/insetcollapsable.h: fix Clone() declaration.
7404 * src/insets/insetfoot.h: ditto.
7406 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7408 2000-03-08 Juergen Vigna <jug@sad.it>
7410 * src/insets/lyxinset.h: added owner call which tells us if
7411 this inset is inside another inset. Changed also the return-type
7412 of Editable to an enum so it tells clearer what the return-value is.
7414 * src/insets/insettext.C (computeTextRows): fixed computing of
7415 textinsets which split automatically on more rows.
7417 * src/insets/insetert.[Ch]: changed this to be of BaseType
7420 * src/insets/insetfoot.[Ch]: added footnote inset
7422 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7423 collapsable insets (like footnote, ert, ...)
7425 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7427 * src/lyxdraw.h: remvoe file
7429 * src/lyxdraw.C: remove file
7431 * src/insets/insettext.C: added <algorithm>.
7433 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7435 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7436 (matrix_cb): case MM_OK use string stream
7438 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7441 * src/mathed/math_macro.C (draw): use string stream
7442 (Metrics): use string stream
7444 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7445 directly to the ostream.
7447 * src/vspace.C (asString): use string stream.
7448 (asString): use string stream
7449 (asLatexString): use string stream
7451 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7452 setting Spacing::Other.
7454 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7455 sprintf when creating the stretch vale.
7457 * src/text2.C (alphaCounter): changed to return a string and to
7458 not use a static variable internally. Also fixed a one-off bug.
7459 (SetCounter): changed the drawing of the labels to use string
7460 streams instead of sprintf.
7462 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7463 manipulator to use a scheme that does not require library support.
7464 This is also the way it is done in the new GNU libstdc++. Should
7465 work with DEC cxx now.
7467 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7469 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7470 end. This fixes a bug.
7472 * src/mathed (all files concerned with file writing): apply the
7473 USE_OSTREAM_ONLY changes to mathed too.
7475 * src/support/DebugStream.h: make the constructor explicit.
7477 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7478 count and ostream squashed.
7480 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7482 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7484 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7485 ostringstream uses STL strings, and we might not.
7487 * src/insets/insetspecialchar.C: add using directive.
7488 * src/insets/insettext.C: ditto.
7490 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7492 * lib/layouts/seminar.layout: feeble attempt at a layout for
7493 seminar.cls, far from completet and could really use some looking
7494 at from people used to write layout files.
7496 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7497 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7498 a lot nicer and works nicely with ostreams.
7500 * src/mathed/formula.C (draw): a slightly different solution that
7501 the one posted to the list, but I think this one works too. (font
7502 size wrong in headers.)
7504 * src/insets/insettext.C (computeTextRows): some fiddling on
7505 Jürgens turf, added some comments that he should read.
7507 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7508 used and it gave compiler warnings.
7509 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7512 * src/lyx_gui.C (create_forms): do the right thing when
7513 show_banner is true/false.
7515 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7516 show_banner is false.
7518 * most file writing files: Now use iostreams to do almost all of
7519 the writing. Also instead of passing string &, we now use
7520 stringstreams. mathed output is still not adapted to iostreams.
7521 This change can be turned off by commenting out all the occurences
7522 of the "#define USE_OSTREAM_ONLY 1" lines.
7524 * src/WorkArea.C (createPixmap): don't output debug messages.
7525 (WorkArea): don't output debug messages.
7527 * lib/lyxrc.example: added a comment about the new variable
7530 * development/Code_rules/Rules: Added some more commente about how
7531 to build class interfaces and on how better encapsulation can be
7534 2000-03-03 Juergen Vigna <jug@sad.it>
7536 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7537 automatically with the width of the LyX-Window
7539 * src/insets/insettext.C (computeTextRows): fixed update bug in
7540 displaying text-insets (scrollvalues where not initialized!)
7542 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7544 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7545 id in the check of the result from lower_bound is not enough since
7546 lower_bound can return last too, and then res->id will not be a
7549 * all insets and some code that use them: I have conditionalized
7550 removed the Latex(string & out, ...) this means that only the
7551 Latex(ostream &, ...) will be used. This is a work in progress to
7552 move towards using streams for all output of files.
7554 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7557 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7559 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7560 routine (this fixes bug where greek letters were surrounded by too
7563 * src/support/filetools.C (findtexfile): change a bit the search
7564 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7565 no longer passed to kpsewhich, we may have to change that later.
7567 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7568 warning options to avoid problems with X header files (from Angus
7570 * acinclude.m4: regenerated.
7572 2000-03-02 Juergen Vigna <jug@sad.it>
7574 * src/insets/insettext.C (WriteParagraphData): Using the
7575 par->writeFile() function for writing paragraph-data.
7576 (Read): Using buffer->parseSingleLyXformat2Token()-function
7577 for parsing paragraph data!
7579 * src/buffer.C (readLyXformat2): removed all parse data and using
7580 the new parseSingleLyXformat2Token()-function.
7581 (parseSingleLyXformat2Token): added this function to parse (read)
7582 lyx-file-format (this is called also from text-insets now!)
7584 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7586 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7589 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7590 directly instead of going through a func. One very bad thing: a
7591 static LyXFindReplace, but I don't know where to place it.
7593 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7594 string instead of char[]. Also changed to static.
7595 (GetSelectionOrWordAtCursor): changed to static inline
7596 (SetSelectionOverLenChars): ditto.
7598 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7599 current_view and global variables. both classes has changed names
7600 and LyXFindReplace is not inherited from SearchForm.
7602 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7603 fl_form_search form.
7605 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7607 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7609 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7610 bound (from Kayvan).
7612 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7614 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7616 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7618 * some things that I should comment but the local pub says head to
7621 * comment out all code that belongs to the Roff code for Ascii
7622 export of tables. (this is unused)
7624 * src/LyXView.C: use correct type for global variable
7625 current_layout. (LyXTextClass::size_type)
7627 * some code to get the new insetgraphics closer to working I'd be
7628 grateful for any help.
7630 * src/BufferView2.C (insertInset): use the return type of
7631 NumberOfLayout properly. (also changes in other files)
7633 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7634 this as a test. I want to know what breaks because of this.
7636 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7638 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7640 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7641 to use a \makebox in the label, this allows proper justification
7642 with out using protected spaces or multiple hfills. Now it is
7643 "label" for left justified, "\hfill label\hfill" for center, and
7644 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7645 should be changed accordingly.
7647 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7649 * src/lyxtext.h: change SetLayout() to take a
7650 LyXTextClass::size_type instead of a char (when there is more than
7651 127 layouts in a class); also change type of copylayouttype.
7652 * src/text2.C (SetLayout): ditto.
7653 * src/LyXView.C (updateLayoutChoice): ditto.
7655 * src/LaTeX.C (scanLogFile): errors where the line number was not
7656 given just after the '!'-line were ignored (from Dekel Tsur).
7658 * lib/lyxrc.example: fix description of \date_insert_format
7660 * lib/layouts/llncs.layout: new layout, contributed by Martin
7663 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7665 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7666 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7667 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7668 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7669 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7670 paragraph.C, text.C, text2.C)
7672 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7674 * src/insets/insettext.C (LocalDispatch): remove extra break
7677 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7678 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7680 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7681 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7683 * src/insets/insetbib.h: move InsetBibkey::Holder and
7684 InsetCitation::Holder in public space.
7686 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7688 * src/insets/insettext.h: small change to get the new files from
7689 Juergen to compile (use "string", not "class string").
7691 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7692 const & as parameter to LocalDispatch, use LyXFont const & as
7693 paramter to some other func. This also had impacto on lyxinsets.h
7694 and the two mathed insets.
7696 2000-02-24 Juergen Vigna <jug@sad.it>
7699 * src/commandtags.h:
7701 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7705 * src/BufferView2.C: added/updated code for various inset-functions
7707 * src/insets/insetert.[Ch]: added implementation of InsetERT
7709 * src/insets/insettext.[Ch]: added implementation of InsetText
7711 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7712 (draw): added preliminary code for inset scrolling not finshed yet
7714 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7715 as it is in lyxfunc.C now
7717 * src/insets/lyxinset.h: Added functions for text-insets
7719 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7721 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7722 BufferView and reimplement the list as a queue put inside its own
7725 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7727 * several files: use the new interface to the "updateinsetlist"
7729 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7731 (work_area_handler): call BufferView::trippleClick on trippleclick.
7733 * src/BufferView.C (doubleClick): new function, selects word on
7735 (trippleClick): new function, selects line on trippleclick.
7737 2000-02-22 Allan Rae <rae@lyx.org>
7739 * lib/bind/xemacs.bind: buffer-previous not supported
7741 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7743 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7746 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7748 * src/bufferlist.C: get rid of current_view from this file
7750 * src/spellchecker.C: get rid of current_view from this file
7752 * src/vspace.C: get rid of current_view from this file
7753 (inPixels): added BufferView parameter for this func
7754 (asLatexCommand): added a BufferParams for this func
7756 * src/text.C src/text2.C: get rid of current_view from these
7759 * src/lyxfont.C (getFontDirection): move this function here from
7762 * src/bufferparams.C (getDocumentDirection): move this function
7765 * src/paragraph.C (getParDirection): move this function here from
7767 (getLetterDirection): ditto
7769 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7771 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7772 resize due to wrong pixmap beeing used. Also took the opurtunity
7773 to make the LyXScreen stateless on regard to WorkArea and some
7774 general cleanup in the same files.
7776 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7778 * src/Makefile.am: add missing direction.h
7780 * src/PainterBase.h: made the width functions const.
7782 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7785 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7787 * src/insets/insetlatexaccent.C (draw): make the accents draw
7788 better, at present this will only work well with iso8859-1.
7790 * several files: remove the old drawing code, now we use the new
7793 * several files: remove support for mono_video, reverse_video and
7796 2000-02-17 Juergen Vigna <jug@sad.it>
7798 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7799 int ** as we have to return the pointer, otherwise we have only
7800 NULL pointers in the returning function.
7802 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7804 * src/LaTeX.C (operator()): quote file name when running latex.
7806 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7808 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7809 (bubble tip), this removes our special handling of this.
7811 * Remove all code that is unused now that we have the new
7812 workarea. (Code that are not active when NEW_WA is defined.)
7814 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7816 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7818 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7819 nonexisting layout; correctly redirect obsoleted layouts.
7821 * lib/lyxrc.example: document \view_dvi_paper_option
7823 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7826 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7827 (PreviewDVI): handle the view_dvi_paper_option variable.
7828 [Both from Roland Krause]
7830 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7832 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7833 char const *, int, LyXFont)
7834 (text(int, int, string, LyXFont)): ditto
7836 * src/text.C (InsertCharInTable): attempt to fix the double-space
7837 feature in tables too.
7838 (BackspaceInTable): ditto.
7839 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7841 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7843 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7845 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7846 newly found text in textcache to this.
7847 (buffer): set the owner of the text put into the textcache to 0
7849 * src/insets/figinset.C (draw): fixed the drawing of figures with
7852 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7853 drawing of mathframe, hfills, protected space, table lines. I have
7854 now no outstanding drawing problems with the new Painter code.
7856 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7858 * src/PainterBase.C (ellipse, circle): do not specify the default
7861 * src/LColor.h: add using directive.
7863 * src/Painter.[Ch]: change return type of methods from Painter& to
7864 PainterBase&. Add a using directive.
7866 * src/WorkArea.C: wrap xforms callbacks in C functions
7869 * lib/layouts/foils.layout: font fix and simplifications from Carl
7872 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7874 * a lot of files: The Painter, LColor and WorkArea from the old
7875 devel branch has been ported to lyx-devel. Some new files and a
7876 lot of #ifdeffed code. The new workarea is enabled by default, but
7877 if you want to test the new Painter and LColor you have to compile
7878 with USE_PAINTER defined (do this in config.h f.ex.) There are
7879 still some rought edges, and I'd like some help to clear those
7880 out. It looks stable (loads and displays the Userguide very well).
7883 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7885 * src/buffer.C (pop_tag): revert to the previous implementation
7886 (use a global variable for both loops).
7888 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7890 * src/lyxrc.C (LyXRC): change slightly default date format.
7892 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7893 there is an English text with a footnote that starts with a Hebrew
7894 paragraph, or vice versa.
7895 (TeXFootnote): ditto.
7897 * src/text.C (LeftMargin): allow for negative values for
7898 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7901 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7902 for input encoding (cyrillic)
7904 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7906 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7909 * src/toolbar.C (set): ditto
7910 * src/insets/insetbib.C (create_form_citation_form): ditto
7912 * lib/CREDITS: added Dekel Tsur.
7914 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7915 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7916 hebrew supports files from Dekel Tsur.
7918 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7919 <tzafrir@technion.ac.il>
7921 * src/lyxrc.C: put \date_insert_format at the right place.
7923 * src/buffer.C (makeLaTeXFile): fix the handling of
7924 BufferParams::sides when writing out latex files.
7926 * src/BufferView2.C: add a "using" directive.
7928 * src/support/lyxsum.C (sum): when we use lyxstring,
7929 ostringstream::str needs an additional .c_str().
7931 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7933 * src/support/filetools.C (ChangeExtension): patch from Etienne
7936 * src/TextCache.C (show): remove const_cast and make second
7937 parameter non-const LyXText *.
7939 * src/TextCache.h: use non const LyXText in show.
7941 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7944 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7946 * src/support/lyxsum.C: rework to be more flexible.
7948 * several places: don't check if a pointer is 0 if you are going
7951 * src/text.C: remove some dead code.
7953 * src/insets/figinset.C: remove some dead code
7955 * src/buffer.C: move the BufferView funcs to BufferView2.C
7956 remove all support for insetlatexdel
7957 remove support for oldpapersize stuff
7958 made some member funcs const
7960 * src/kbmap.C: use a std::list to store the bindings in.
7962 * src/BufferView2.C: new file
7964 * src/kbsequence.[Ch]: new files
7966 * src/LyXAction.C + others: remove all trace of buffer-previous
7968 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7969 only have one copy in the binary of this table.
7971 * hebrew patch: moved some functions from LyXText to more
7972 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7974 * several files: remove support for XForms older than 0.88
7976 remove some #if 0 #endif code
7978 * src/TextCache.[Ch]: new file. Holds the textcache.
7980 * src/BufferView.C: changes to use the new TextCache interface.
7981 (waitForX): remove the now unused code.
7983 * src/BackStack.h: remove some commented code
7985 * lib/bind/emacs.bind: remove binding for buffer-previous
7987 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7989 * applied the hebrew patch.
7991 * src/lyxrow.h: make sure that all Row variables are initialized.
7993 * src/text2.C (TextHandleUndo): comment out a delete, this might
7994 introduce a memory leak, but should also help us to not try to
7995 read freed memory. We need to look at this one.
7997 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7998 (LyXParagraph): initalize footnotekind.
8000 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8001 forgot this when applying the patch. Please heed the warnings.
8003 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8004 (aka. reformat problem)
8006 * src/bufferlist.C (exists): made const, and use const_iterator
8007 (isLoaded): new func.
8008 (release): use std::find to find the correct buffer.
8010 * src/bufferlist.h: made getState a const func.
8011 made empty a const func.
8012 made exists a const func.
8015 2000-02-01 Juergen Vigna <jug@sad.it>
8017 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8019 * po/it.po: updated a bit the italian po file and also changed the
8020 'file nuovo' for newfile to 'filenuovo' without a space, this did
8023 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8024 for the new insert_date command.
8026 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8027 from jdblair, to insert a date into the current text conforming to
8028 a strftime format (for now only considering the locale-set and not
8029 the document-language).
8031 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8033 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8034 Bounds Read error seen by purify. The problem was that islower is
8035 a macros which takes an unsigned char and uses it as an index for
8036 in array of characters properties (and is thus subject to the
8040 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8041 correctly the paper sides radio buttons.
8042 (UpdateDocumentButtons): ditto.
8044 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8046 * src/kbmap.C (getsym + others): change to return unsigned int,
8047 returning a long can give problems on 64 bit systems. (I assume
8048 that int is 32bit on 64bit systems)
8050 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8052 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8053 LyXLookupString to be zero-terminated. Really fixes problems seen
8056 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8058 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8059 write a (char*)0 to the lyxerr stream.
8061 * src/lastfiles.C: move algorithm before the using statemets.
8063 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8065 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8066 complains otherwise).
8067 * src/table.C: ditto
8069 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8072 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8073 that I removed earlier... It is really needed.
8075 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8077 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8079 * INSTALL: update xforms home page URL.
8081 * lib/configure.m4: fix a bug with unreadable layout files.
8083 * src/table.C (calculate_width_of_column): add "using std::max"
8086 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8088 * several files: marked several lines with "DEL LINE", this is
8089 lines that can be deleted without changing anything.
8090 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8091 checks this anyway */
8094 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8096 * src/DepTable.C (update): add a "+" at the end when the checksum
8097 is different. (debugging string only)
8099 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8100 the next inset to not be displayed. This should also fix the list
8101 of labels in the "Insert Crossreference" dialog.
8103 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8105 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8106 when regex was not found.
8108 * src/support/lstrings.C (lowercase): use handcoded transform always.
8111 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8112 old_cursor.par->prev could be 0.
8114 * several files: changed post inc/dec to pre inc/dec
8116 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8117 write the lastfiles to file.
8119 * src/BufferView.C (buffer): only show TextCache info when debugging
8121 (resizeCurrentBuffer): ditto
8122 (workAreaExpose): ditto
8124 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8126 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8128 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8129 a bit better by removing the special case for \i and \j.
8131 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8133 * src/lyx_main.C (easyParse): remove test for bad comand line
8134 options, since this broke all xforms-related parsing.
8136 * src/kbmap.C (getsym): set return type to unsigned long, as
8137 declared in header. On an alpha, long is _not_ the same as int.
8139 * src/support/LOstream.h: add a "using std::flush;"
8141 * src/insets/figinset.C: ditto.
8143 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8145 * src/bufferlist.C (write): use blinding fast file copy instead of
8146 "a char at a time", now we are doing it the C++ way.
8148 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8149 std::list<int> instead.
8150 (addpidwait): reflect move to std::list<int>
8151 (sigchldchecker): ditto
8153 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8156 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8157 that obviously was wrong...
8159 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8160 c, this avoids warnings with purify and islower.
8162 * src/insets/figinset.C: rename struct queue to struct
8163 queue_element and rewrite to use a std::queue. gsqueue is now a
8164 std::queue<queue_element>
8165 (runqueue): reflect move to std::queue
8168 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8169 we would get "1" "0" instead of "true" "false. Also make the tostr
8172 2000-01-21 Juergen Vigna <jug@sad.it>
8174 * src/buffer.C (writeFileAscii): Disabled code for special groff
8175 handling of tabulars till I fix this in table.C
8177 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8179 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8181 * src/support/lyxlib.h: ditto.
8183 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8185 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8186 and 'j' look better. This might fix the "macron" bug that has been
8189 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8190 functions as one template function. Delete the old versions.
8192 * src/support/lyxsum.C: move using std::ifstream inside
8195 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8198 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8200 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8202 * src/insets/figinset.C (InitFigures): use new instead of malloc
8203 to allocate memory for figures and bitmaps.
8204 (DoneFigures): use delete[] instead of free to deallocate memory
8205 for figures and bitmaps.
8206 (runqueue): use new to allocate
8207 (getfigdata): use new/delete[] instead of malloc/free
8208 (RegisterFigure): ditto
8210 * some files: moved some declarations closer to first use, small
8211 whitespace changes use preincrement instead of postincrement where
8212 it does not make a difference.
8214 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8215 step on the way to use stl::containers for key maps.
8217 * src/bufferlist.h: add a typedef for const_iterator and const
8218 versions of begin and end.
8220 * src/bufferlist.[Ch]: change name of member variable _state to
8221 state_. (avoid reserved names)
8223 (getFileNames): returns the filenames of the buffers in a vector.
8225 * configure.in (ALL_LINGUAS): added ro
8227 * src/support/putenv.C: new file
8229 * src/support/mkdir.C: new file
8231 2000-01-20 Allan Rae <rae@lyx.org>
8233 * lib/layouts/IEEEtran.layout: Added several theorem environments
8235 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8236 couple of minor additions.
8238 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8239 (except for those in footnotes of course)
8241 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8243 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8245 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8246 std::sort and std::lower_bound instead of qsort and handwritten
8248 (struct compara): struct that holds the functors used by std::sort
8249 and std::lower_bound in MathedLookupBOP.
8251 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8253 * src/support/LAssert.h: do not do partial specialization. We do
8256 * src/support/lyxlib.h: note that lyx::getUserName() and
8257 lyx::date() are not in use right now. Should these be suppressed?
8259 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8260 (makeLinuxDocFile): do not put date and user name in linuxdoc
8263 * src/support/lyxlib.h (kill): change first argument to long int,
8264 since that's what solaris uses.
8266 * src/support/kill.C (kill): fix declaration to match prototype.
8268 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8269 actually check whether namespaces are supported. This is not what
8272 * src/support/lyxsum.C: add a using directive.
8274 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8276 * src/support/kill.C: if we have namespace support we don't have
8277 to include lyxlib.h.
8279 * src/support/lyxlib.h: use namespace lyx if supported.
8281 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8283 * src/support/date.C: new file
8285 * src/support/chdir.C: new file
8287 * src/support/getUserName.C: new file
8289 * src/support/getcwd.C: new file
8291 * src/support/abort.C: new file
8293 * src/support/kill.C: new file
8295 * src/support/lyxlib.h: moved all the functions in this file
8296 insede struct lyx. Added also kill and abort to this struct. This
8297 is a way to avoid the "kill is not defined in <csignal>", we make
8298 C++ wrappers for functions that are not ANSI C or ANSI C++.
8300 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8301 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8302 lyx it has been renamed to sum.
8304 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8306 * src/text.C: add using directives for std::min and std::max.
8308 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8310 * src/texrow.C (getIdFromRow): actually return something useful in
8311 id and pos. Hopefully fixes the bug with positionning of errorbox
8314 * src/lyx_main.C (easyParse): output an error and exit if an
8315 incorrect command line option has been given.
8317 * src/spellchecker.C (ispell_check_word): document a memory leak.
8319 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8320 where a "struct utimbuf" is allocated with "new" and deleted with
8323 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8325 * src/text2.C (CutSelection): don't delete double spaces.
8326 (PasteSelection): ditto
8327 (CopySelection): ditto
8329 * src/text.C (Backspace): don't delete double spaces.
8331 * src/lyxlex.C (next): fix a bug that were only present with
8332 conformant std::istream::get to read comment lines, use
8333 std::istream::getline instead. This seems to fix the problem.
8335 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8337 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8338 allowed to insert space before space" editing problem. Please read
8339 commends at the beginning of the function. Comments about usage
8342 * src/text.C (InsertChar): fix for the "not allowed to insert
8343 space before space" editing problem.
8345 * src/text2.C (DeleteEmptyParagraphMechanism): when
8346 IsEmptyTableRow can only return false this last "else if" will
8347 always be a no-op. Commented out.
8349 * src/text.C (RedoParagraph): As far as I can understand tmp
8350 cursor is not really needed.
8352 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8353 present it could only return false anyway.
8354 (several functions): Did something not so smart...added a const
8355 specifier on a lot of methods.
8357 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8358 and add a tmp->text.resize. The LyXParagraph constructor does the
8360 (BreakParagraphConservative): ditto
8362 * src/support/path.h (Path): add a define so that the wrong usage
8363 "Path("/tmp") will be flagged as a compilation error:
8364 "`unnamed_Path' undeclared (first use this function)"
8366 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8368 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8369 which was bogus for several reasons.
8371 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8375 * autogen.sh: do not use "type -path" (what's that anyway?).
8377 * src/support/filetools.C (findtexfile): remove extraneous space
8378 which caused a kpsewhich warning (at least with kpathsea version
8381 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8383 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8385 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8387 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8389 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8391 * src/paragraph.C (BreakParagraph): do not reserve space on text
8392 if we don't need to (otherwise, if pos_end < pos, we end up
8393 reserving huge amounts of memory due to bad unsigned karma).
8394 (BreakParagraphConservative): ditto, although I have not seen
8395 evidence the bug can happen here.
8397 * src/lyxparagraph.h: add a using std::list.
8399 2000-01-11 Juergen Vigna <jug@sad.it>
8401 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8404 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8406 * src/vc-backend.C (doVCCommand): change to be static and take one
8407 more parameter: the path to chdir too be fore executing the command.
8408 (retrive): new function equiv to "co -r"
8410 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8411 file_not_found_hook is true.
8413 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8415 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8416 if a file is readwrite,readonly...anything else.
8418 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8420 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8421 (CreatePostscript): name change from MenuRunDVIPS (or something)
8422 (PreviewPostscript): name change from MenuPreviewPS
8423 (PreviewDVI): name change from MenuPreviewDVI
8425 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8426 \view_pdf_command., \pdf_to_ps_command
8428 * lib/configure.m4: added search for PDF viewer, and search for
8429 PDF to PS converter.
8430 (lyxrc.defaults output): add \pdflatex_command,
8431 \view_pdf_command and \pdf_to_ps_command.
8433 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8435 * src/bufferlist.C (write): we don't use blocksize for anything so
8438 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8440 * src/support/block.h: disable operator T* (), since it causes
8441 problems with both compilers I tried. See comments in the file.
8443 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8446 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8447 variable LYX_DIR_10x to LYX_DIR_11x.
8449 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8451 * INSTALL: document --with-lyxname.
8454 * configure.in: new configure flag --with-lyxname which allows to
8455 choose the name under which lyx is installed. Default is "lyx", of
8456 course. It used to be possible to do this with --program-suffix,
8457 but the later has in fact a different meaning for autoconf.
8459 * src/support/lstrings.h (lstrchr): reformat a bit.
8461 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8462 * src/mathed/math_defs.h: ditto.
8464 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8466 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8467 true, decides if we create a backup file or not when saving. New
8468 tag and variable \pdf_mode, defaults to false. New tag and
8469 variable \pdflatex_command, defaults to pdflatex. New tag and
8470 variable \view_pdf_command, defaults to xpdf. New tag and variable
8471 \pdf_to_ps_command, defaults to pdf2ps.
8473 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8475 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8476 does not have a BufferView.
8477 (unlockInset): ditto + don't access the_locking_inset if the
8478 buffer does not have a BufferView.
8480 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8481 certain circumstances so that we don't continue a keyboard
8482 operation long after the key was released. Try f.ex. to load a
8483 large document, press PageDown for some seconds and then release
8484 it. Before this change the document would contine to scroll for
8485 some time, with this change it stops imidiatly.
8487 * src/support/block.h: don't allocate more space than needed. As
8488 long as we don't try to write to the arr[x] in a array_type arr[x]
8489 it is perfectly ok. (if you write to it you might segfault).
8490 added operator value_type*() so that is possible to pass the array
8491 to functions expecting a C-pointer.
8493 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8496 * intl/*: updated to gettext 0.10.35, tried to add our own
8497 required modifications. Please verify.
8499 * po/*: updated to gettext 0.10.35, tried to add our own required
8500 modifications. Please verify.
8502 * src/support/lstrings.C (tostr): go at fixing the problem with
8503 cxx and stringstream. When stringstream is used return
8504 oss.str().c_str() so that problems with lyxstring and basic_string
8505 are avoided. Note that the best solution would be for cxx to use
8506 basic_string all the way, but it is not conformant yet. (it seems)
8508 * src/lyx_cb.C + other files: moved several global functions to
8509 class BufferView, some have been moved to BufferView.[Ch] others
8510 are still located in lyx_cb.C. Code changes because of this. (part
8511 of "get rid of current_view project".)
8513 * src/buffer.C + other files: moved several Buffer functions to
8514 class BufferView, the functions are still present in buffer.C.
8515 Code changes because of this.
8517 * config/lcmessage.m4: updated to most recent. used when creating
8520 * config/progtest.m4: updated to most recent. used when creating
8523 * config/gettext.m4: updated to most recent. applied patch for
8526 * config/gettext.m4.patch: new file that shows what changes we
8527 have done to the local copy of gettext.m4.
8529 * config/libtool.m4: new file, used in creation of acinclude.m4
8531 * config/lyxinclude.m4: new file, this is the lyx created m4
8532 macros, used in making acinclude.m4.
8534 * autogen.sh: GNU m4 discovered as a separate task not as part of
8535 the lib/configure creation.
8536 Generate acinlucde from files in config. Actually cat
8537 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8538 easier to upgrade .m4 files that really are external.
8540 * src/Spacing.h: moved using std::istringstream to right after
8541 <sstream>. This should fix the problem seen with some compilers.
8543 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8545 * src/lyx_cb.C: began some work to remove the dependency a lot of
8546 functions have on BufferView::text, even if not really needed.
8547 (GetCurrentTextClass): removed this func, it only hid the
8550 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8551 forgot this in last commit.
8553 * src/Bullet.C (bulletEntry): use static char const *[] for the
8554 tables, becuase of this the return arg had to change to string.
8556 (~Bullet): removed unneeded destructor
8558 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8559 (insetSleep): moved from Buffer
8560 (insetWakeup): moved from Buffer
8561 (insetUnlock): moved from Buffer
8563 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8564 from Buffer to BufferView.
8566 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8568 * config/ltmain.sh: updated to version 1.3.4 of libtool
8570 * config/ltconfig: updated to version 1.3.4 of libtool
8572 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8575 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8576 Did I get that right?
8578 * src/lyxlex.h: add a "using" directive or two.
8579 * src/Spacing.h: ditto.
8580 * src/insets/figinset.C: ditto.
8581 * src/support/filetools.C: ditto.
8582 * src/support/lstrings.C: ditto.
8583 * src/BufferView.C: ditto.
8584 * src/bufferlist.C: ditto.
8585 * src/lyx_cb.C: ditto.
8586 * src/lyxlex.C: ditto.
8588 * NEWS: add some changes for 1.1.4.
8590 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8592 * src/BufferView.C: first go at a TextCache to speed up switching
8595 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8597 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8598 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8599 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8600 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8603 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8604 members of the struct are correctly initialized to 0 (detected by
8606 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8607 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8609 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8610 pidwait, since it was allocated with "new". This was potentially
8611 very bad. Thanks to Michael Schmitt for running purify for us.
8614 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8616 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8618 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8620 1999-12-30 Allan Rae <rae@lyx.org>
8622 * lib/templates/IEEEtran.lyx: minor change
8624 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8625 src/mathed/formula.C (LocalDispatch): askForText changes
8627 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8628 know when a user has cancelled input. Fixes annoying problems with
8629 inserting labels and version control.
8631 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8633 * src/support/lstrings.C (tostr): rewritten to use strstream and
8636 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8638 * src/support/filetools.C (IsFileWriteable): use fstream to check
8639 (IsDirWriteable): use fileinfo to check
8641 * src/support/filetools.h (FilePtr): whole class deleted
8643 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8645 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8647 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8649 * src/bufferlist.C (write): use ifstream and ofstream instead of
8652 * src/Spacing.h: use istrstream instead of sscanf
8654 * src/mathed/math_defs.h: change first arg to istream from FILE*
8656 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8658 * src/mathed/math_parser.C: have yyis to be an istream
8659 (LexGetArg): use istream (yyis)
8661 (mathed_parse): ditto
8662 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8664 * src/mathed/formula.C (Read): rewritten to use istream
8666 * src/mathed/formulamacro.C (Read): rewritten to use istream
8668 * src/lyxlex.h (~LyXLex): deleted desturctor
8669 (getStream): new function, returns an istream
8670 (getFile): deleted funtion
8671 (IsOK): return is.good();
8673 * src/lyxlex.C (LyXLex): delete file and owns_file
8674 (setFile): open an filebuf and assign that to a istream instead of
8676 (setStream): new function, takes an istream as arg.
8677 (setFile): deleted function
8678 (EatLine): rewritten us use istream instead of FILE*
8682 * src/table.C (LyXTable): use istream instead of FILE*
8683 (Read): rewritten to take an istream instead of FILE*
8685 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8687 * src/buffer.C (Dispatch): remove an extraneous break statement.
8689 * src/support/filetools.C (QuoteName): change to do simple
8690 'quoting'. More work is necessary. Also changed to do nothing
8691 under emx (needs fix too).
8692 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8694 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8695 config.h.in to the AC_DEFINE_UNQUOTED() call.
8696 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8697 needs char * as argument (because Solaris 7 declares it like
8700 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8701 remove definition of BZERO.
8703 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8705 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8706 defined, "lyxregex.h" if not.
8708 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8710 (REGEX): new variable that is set to regex.c lyxregex.h when
8711 AM_CONDITIONAL USE_REGEX is set.
8712 (libsupport_la_SOURCES): add $(REGEX)
8714 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8717 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8720 * configure.in: add call to LYX_REGEX
8722 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8723 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8725 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8727 * lib/bind/fi_menus.bind: new file, from
8728 pauli.virtanen@saunalahti.fi.
8730 * src/buffer.C (getBibkeyList): pass the parameter delim to
8731 InsetInclude::getKeys and InsetBibtex::getKeys.
8733 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8734 is passed to Buffer::getBibkeyList
8736 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8737 instead of the hardcoded comma.
8739 * src/insets/insetbib.C (getKeys): make sure that there are not
8740 leading blanks in bibtex keys. Normal latex does not care, but
8741 harvard.sty seems to dislike blanks at the beginning of citation
8742 keys. In particular, the retturn value of the function is
8744 * INSTALL: make it clear that libstdc++ is needed and that gcc
8745 2.7.x probably does not work.
8747 * src/support/filetools.C (findtexfile): make debug message go to
8749 * src/insets/insetbib.C (getKeys): ditto
8751 * src/debug.C (showTags): make sure that the output is correctly
8754 * configure.in: add a comment for TWO_COLOR_ICON define.
8756 * acconfig.h: remove all the entries that already defined in
8757 configure.in or acinclude.m4.
8759 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8760 to avoid user name, date and copyright.
8762 1999-12-21 Juergen Vigna <jug@sad.it>
8764 * src/table.C (Read): Now read bogus row format informations
8765 if the format is < 5 so that afterwards the table can
8766 be read by lyx but without any format-info. Fixed the
8767 crash we experienced when not doing this.
8769 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8771 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8772 (RedoDrawingOfParagraph): ditto
8773 (RedoParagraphs): ditto
8774 (RemoveTableRow): ditto
8776 * src/text.C (Fill): rename arg paperwidth -> paper_width
8778 * src/buffer.C (insertLyXFile): rename var filename -> fname
8779 (writeFile): rename arg filename -> fname
8780 (writeFileAscii): ditto
8781 (makeLaTeXFile): ditto
8782 (makeLinuxDocFile): ditto
8783 (makeDocBookFile): ditto
8785 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8788 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8790 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8793 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8794 compiled by a C compiler not C++.
8796 * src/layout.h (LyXTextClass): added typedef for const_iterator
8797 (LyXTextClassList): added typedef for const_iterator + member
8798 functions begin and end.
8800 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8801 iterators to fill the choice_class.
8802 (updateLayoutChoice): rewritten to use iterators to fill the
8803 layoutlist in the toolbar.
8805 * src/BufferView.h (BufferView::work_area_width): removed unused
8808 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8810 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8811 (sgmlCloseTag): ditto
8813 * src/support/lstrings.h: return type of countChar changed to
8816 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8817 what version of this func to use. Also made to return unsigned int.
8819 * configure.in: call LYX_STD_COUNT
8821 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8822 conforming std::count.
8824 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8826 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8827 and a subscript would give bad display (patch from Dekel Tsur
8828 <dekel@math.tau.ac.il>).
8830 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8832 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8835 * src/chset.h: add a few 'using' directives
8837 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8838 triggered when no buffer is active
8840 * src/layout.C: removed `break' after `return' in switch(), since
8843 * src/lyx_main.C (init): make sure LyX can be ran in place even
8844 when libtool has done its magic with shared libraries. Fix the
8845 test for the case when the system directory has not been found.
8847 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8848 name for the latex file.
8849 (MenuMakeHTML): ditto
8851 * src/buffer.h: add an optional boolean argument, which is passed
8854 1999-12-20 Allan Rae <rae@lyx.org>
8856 * lib/templates/IEEEtran.lyx: small correction and update.
8858 * configure.in: Attempted to use LYX_PATH_HEADER
8860 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8862 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8863 input from JMarc. Now use preprocessor to find the header.
8864 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8865 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8866 LYX_STL_STRING_FWD. See comments in file.
8868 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8870 * The global MiniBuffer * minibuffer variable is dead.
8872 * The global FD_form_main * fd_form_main variable is dead.
8874 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8876 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8878 * src/table.h: add the LOstream.h header
8879 * src/debug.h: ditto
8881 * src/LyXAction.h: change the explaination of the ReadOnly
8882 attribute: is indicates that the function _can_ be used.
8884 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8887 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8889 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8895 * src/paragraph.C (GetWord): assert on pos>=0
8898 * src/support/lyxstring.C: condition the use of an invariant on
8900 * src/support/lyxstring.h: ditto
8902 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8903 Use LAssert.h instead of plain assert().
8905 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8907 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8908 * src/support/filetools.C: ditto
8910 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8913 * INSTALL: document the new configure flags
8915 * configure.in: suppress --with-debug; add --enable-assertions
8917 * acinclude.m4: various changes in alignment of help strings.
8919 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8921 * src/kbmap.C: commented out the use of the hash map in kb_map,
8922 beginning of movement to a stl::container.
8924 * several files: removed code that was not in effect when
8925 MOVE_TEXT was defined.
8927 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8928 for escaping should not be used. We can discuss if the string
8929 should be enclosed in f.ex. [] instead of "".
8931 * src/trans_mgr.C (insert): use the new returned value from
8932 encodeString to get deadkeys and keymaps done correctly.
8934 * src/chset.C (encodeString): changed to return a pair, to tell
8935 what to use if we know the string.
8937 * src/lyxscreen.h (fillArc): new function.
8939 * src/FontInfo.C (resize): rewritten to use more std::string like
8940 structore, especially string::replace.
8942 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8945 * configure.in (chmod +x some scripts): remove config/gcc-hack
8947 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8949 * src/buffer.C (writeFile): change once again the top comment in a
8950 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8951 instead of an hardcoded version number.
8952 (makeDocBookFile): ditto
8954 * src/version.h: add new define LYX_DOCVERSION
8956 * po/de.po: update from Pit Sütterlin
8957 * lib/bind/de_menus.bind: ditto.
8959 * src/lyxfunc.C (Dispatch): call MenuExport()
8960 * src/buffer.C (Dispatch): ditto
8962 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8963 LyXFunc::Dispatch().
8964 (MenuExport): new function, moved from
8965 LyXFunc::Dispatch().
8967 * src/trans_mgr.C (insert): small cleanup
8968 * src/chset.C (loadFile): ditto
8970 * lib/kbd/iso8859-1.cdef: add missing backslashes
8972 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8974 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8975 help with placing the manually drawn accents better.
8977 (Draw): x2 and hg changed to float to minimize rounding errors and
8978 help place the accents better.
8980 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8981 unsigned short to char is just wrong...cast the char to unsigned
8982 char instead so that the two values can compare sanely. This
8983 should also make the display of insetlatexaccents better and
8984 perhaps also some other insets.
8986 (lbearing): new function
8989 1999-12-15 Allan Rae <rae@lyx.org>
8991 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8992 header that provides a wrapper around the very annoying SGI STL header
8995 * src/support/lyxstring.C, src/LString.h:
8996 removed old SGI-STL-compatability attempts.
8998 * configure.in: Use LYX_STL_STRING_FWD.
9000 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9001 stl_string_fwd.h is around and try to determine it's location.
9002 Major improvement over previous SGI STL 3.2 compatability.
9003 Three small problems remain with this function due to my zero
9004 knowledge of autoconf. JMarc and lgb see the comments in the code.
9006 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9008 * src/broken_const.h, config/hack-gcc, config/README: removed
9010 * configure.in: remove --with-gcc-hack option; do not call
9013 * INSTALL: remove documentation of --with-broken-const and
9016 * acconfig.h: remove all trace of BROKEN_CONST define
9018 * src/buffer.C (makeDocBookFile): update version number in output
9020 (SimpleDocBookOnePar): fix an assert when trying to a character
9021 access beyond string length
9024 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9026 * po/de.po: fix the Export menu
9028 * lyx.man: update the description of -dbg
9030 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9031 (commandLineHelp): updated
9032 (easyParse): show list of available debug levels if -dbg is passed
9035 * src/Makefile.am: add debug.C
9037 * src/debug.h: moved some code to debug.C
9039 * src/debug.C: new file. Contains code to set and show debug
9042 * src/layout.C: remove 'break' after 'continue' in switch
9043 statements, since these cannot be reached.
9045 1999-12-13 Allan Rae <rae@lyx.org>
9047 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9048 (in_word_set): hash() -> math_hash()
9050 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9052 * acconfig.h: Added a test for whether we are using exceptions in the
9053 current compilation run. If so USING_EXCEPTIONS is defined.
9055 * config.in: Check for existance of stl_string_fwd.h
9056 * src/LString.h: If compiling --with-included-string and SGI's
9057 STL version 3.2 is present (see above test) we need to block their
9058 forward declaration of string and supply a __get_c_string().
9059 However, it turns out this is only necessary if compiling with
9060 exceptions enabled so I've a bit more to add yet.
9062 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9063 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9064 src/support/LRegex.h, src/undo.h:
9065 Shuffle the order of the included files a little to ensure that
9066 LString.h gets included before anything that includes stl_string_fwd.h
9068 * src/support/lyxstring.C: We need to #include LString.h instead of
9069 lyxstring.h to get the necessary definition of __get_c_string.
9070 (__get_c_string): New function. This is defined static just like SGI's
9071 although why they need to do this I'm not sure. Perhaps it should be
9072 in lstrings.C instead.
9074 * lib/templates/IEEEtran.lyx: New template file.
9076 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9078 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9079 * intl/Makefile.in (MKINSTALLDIRS): ditto
9081 * src/LyXAction.C (init): changed to hold the LFUN data in a
9082 automatic array in stead of in callso to newFunc, this speeds up
9083 compilation a lot. Also all the memory used by the array is
9084 returned when the init is completed.
9086 * a lot of files: compiled with -Wold-style-cast, changed most of
9087 the reported offenders to C++ style casts. Did not change the
9088 offenders in C files.
9090 * src/trans.h (Match): change argument type to unsigned int.
9092 * src/support/DebugStream.C: fix some types on the streambufs so
9093 that it works on a conforming implementation.
9095 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9097 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9099 * src/support/lyxstring.C: remove the inline added earlier since
9100 they cause a bunch of unsatisfied symbols when linking with dec
9101 cxx. Cxx likes to have the body of inlines at the place where they
9104 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9105 accessing negative bounds in array. This fixes the crash when
9106 inserting accented characters.
9107 * src/trans.h (Match): ditto
9109 * src/buffer.C (Dispatch): since this is a void, it should not try
9110 to return anything...
9112 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9114 * src/buffer.h: removed the two friends from Buffer. Some changes
9115 because of this. Buffer::getFileName and Buffer::setFileName
9116 renamed to Buffer::fileName() and Buffer::fileName(...).
9118 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9120 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9121 and Buffer::update(short) to BufferView. This move is currently
9122 controlled by a define MOVE_TEXT, this will be removed when all
9123 shows to be ok. This move paves the way for better separation
9124 between buffer contents and buffer view. One side effect is that
9125 the BufferView needs a rebreak when swiching buffers, if we want
9126 to avoid this we can add a cache that holds pointers to LyXText's
9127 that is not currently in use.
9129 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9132 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9134 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9136 * lyx_main.C: new command line option -x (or --execute) and
9137 -e (or --export). Now direct conversion from .lyx to .tex
9138 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9139 Unfortunately, X is still needed and the GUI pops up during the
9142 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9144 * src/Spacing.C: add a using directive to bring stream stuff into
9146 * src/paragraph.C: ditto
9147 * src/buffer.C: ditto
9149 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9150 from Lars' announcement).
9152 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9153 example files from Tino Meinen.
9155 1999-12-06 Allan Rae <rae@lyx.org>
9157 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9159 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9161 * src/support/lyxstring.C: added a lot of inline for no good
9164 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9165 latexWriteEndChanges, they were not used.
9167 * src/layout.h (operator<<): output operator for PageSides
9169 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9171 * some example files: loaded in LyX 1.0.4 and saved again to update
9172 certain constructs (table format)
9174 * a lot of files: did the change to use fstream/iostream for all
9175 writing of files. Done with a close look at Andre Poenitz's patch.
9177 * some files: whitespace changes.
9179 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9181 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9182 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9183 architecture, we provide our own. It is used unconditionnally, but
9184 I do not think this is a performance problem. Thanks to Angus
9185 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9186 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9188 (GetInset): use my_memcpy.
9192 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9193 it is easier to understand, but it uses less TeX-only constructs now.
9195 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9196 elements contain spaces
9198 * lib/configure: regenerated
9200 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9201 elements contain spaces; display the list of programs that are
9204 * autogen.sh: make sure lib/configure is executable
9206 * lib/examples/*: rename the tutorial examples to begin with the
9207 two-letters language code.
9209 * src/lyxfunc.C (getStatus): do not query current font if no
9212 * src/lyx_cb.C (RunScript): use QuoteName
9213 (MenuRunDvips): ditto
9214 (PrintApplyCB): ditto
9216 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9217 around argument, so that it works well with the current shell.
9218 Does not work properly with OS/2 shells currently.
9220 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9221 * src/LyXSendto.C (SendtoApplyCB): ditto
9222 * src/lyxfunc.C (Dispatch): ditto
9223 * src/buffer.C (runLaTeX): ditto
9224 (runLiterate): ditto
9225 (buildProgram): ditto
9227 * src/lyx_cb.C (RunScript): ditto
9228 (MenuMakeLaTeX): ditto
9230 * src/buffer.h (getLatexName): new method
9232 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9234 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9236 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9237 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9238 (create_math_panel): ditto
9240 * src/lyxfunc.C (getStatus): re-activate the code which gets
9241 current font and cursor; add test for export to html.
9243 * src/lyxrc.C (read): remove unreachable break statements; add a
9246 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9248 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9250 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9251 introduced by faulty regex.
9252 * src/buffer.C: ditto
9253 * src/lastfiles.C: ditto
9254 * src/paragraph.C: ditto
9255 * src/table.C: ditto
9256 * src/vspace.C: ditto
9257 * src/insets/figinset.C: ditto
9258 Note: most of these is absolutely harmless, except the one in
9259 src/mathed formula.C.
9261 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9263 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9264 operation, yielding correct results for the reLyX command.
9266 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9268 * src/support/filetools.C (ExpandPath): removed an over eager
9270 (ReplaceEnvironmentPath): ditto
9272 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9273 shows that we are doing something fishy in our code...
9277 * src/lyxrc.C (read): use a double switch trick to get more help
9278 from the compiler. (the same trick is used in layout.C)
9279 (write): new function. opens a ofstream and pass that to output
9280 (output): new function, takes a ostream and writes the lyxrc
9281 elemts to it. uses a dummy switch to make sure no elements are
9284 * src/lyxlex.h: added a struct pushpophelper for use in functions
9285 with more than one exit point.
9287 * src/lyxlex.[Ch] (GetInteger): made it const
9291 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9293 * src/layout.[hC] : LayoutTags splitted into several enums, new
9294 methods created, better error handling cleaner use of lyxlex. Read
9297 * src/bmtable.[Ch]: change some member prototypes because of the
9298 image const changes.
9300 * commandtags.h, src/LyXAction.C (init): new function:
9301 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9302 This file is not read automatically but you can add \input
9303 preferences to your lyxrc if you want to. We need to discuss how
9306 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9307 in .aux, also remove .bib and .bst files from dependencies when
9310 * src/BufferView.C, src/LyXView.C: add const_cast several places
9311 because of changes to images.
9313 * lib/images/*: same change as for images/*
9315 * lib/lyxrc.example: Default for accept_compound is false not no.
9317 * images/*: changed to be const, however I have som misgivings
9318 about this change so it might be changed back.
9320 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9322 * lib/configure, po/POTFILES.in: regenerated
9324 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9326 * config/lib_configure.m4: removed
9328 * lib/configure.m4: new file (was config/lib_configure.m4)
9330 * configure.in: do not test for rtti, since we do not use it.
9332 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9334 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9335 doubling of allocated space scheme. This makes it faster for large
9336 strings end to use less memory for small strings. xtra rememoved.
9338 * src/insets/figinset.C (waitalarm): commented out.
9339 (GhostscriptMsg): use static_cast
9340 (GhostscriptMsg): use new instead of malloc to allocate memory for
9341 cmap. also delete the memory after use.
9343 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9345 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9346 for changes in bibtex database or style.
9347 (runBibTeX): remove all .bib and .bst files from dep before we
9349 (run): use scanAuc in when dep file already exist.
9351 * src/DepTable.C (remove_files_with_extension): new method
9354 * src/DepTable.[Ch]: made many of the methods const.
9356 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9358 * src/bufferparams.C: make sure that the default textclass is
9359 "article". It used to be the first one by description order, but
9360 now the first one is "docbook".
9362 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9363 string; call Debug::value.
9364 (easyParse): pass complete argument to setDebuggingLevel().
9366 * src/debug.h (value): fix the code that parses debug levels.
9368 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9371 * src/LyXAction.C: use Debug::ACTION as debug channel.
9373 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9375 * NEWS: updated for the future 1.1.3 release.
9377 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9378 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9379 it should. This is of course a controversial change (since many
9380 people will find that their lyx workscreen is suddenly full of
9381 red), but done for the sake of correctness.
9383 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9384 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9386 * src/insets/inseterror.h, src/insets/inseturl.h,
9387 src/insets/insetinfo.h, src/insets/figinset.h,
9388 src/mathed/formulamacro.h, src/mathed/math_macro.h
9389 (EditMessage): add a missing const and add _() to make sure that
9392 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9393 src/insets/insetbib.C, src/support/filetools.C: add `using'
9396 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9397 doing 'Insert index of last word' at the beginning of a paragraph.
9399 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9401 * several files: white-space changes.
9403 * src/mathed/formula.C: removed IsAlpha and IsDigit
9405 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9406 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9409 * src/insets/figinset.C (GetPSSizes): don't break when
9410 "EndComments" is seen. But break when a boundingbox is read.
9412 * all classes inherited from Inset: return value of Clone
9413 changed back to Inset *.
9415 * all classes inherited form MathInset: return value of Clone
9416 changed back to MathedInset *.
9418 * src/insets/figinset.C (runqueue): use a ofstream to output the
9419 gs/ps file. Might need some setpresicion or setw. However I can
9420 see no problem with the current code.
9421 (runqueue): use sleep instead of the alarm/signal code. I just
9422 can't see the difference.
9424 * src/paragraph.C (LyXParagraph): reserve space in the new
9425 paragraph and resize the inserted paragraph to just fit.
9427 * src/lyxfunc.h (operator|=): added operator for func_status.
9429 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9430 check for readable file.
9432 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9433 check for readable file.
9434 (MenuMakeLinuxDoc): ditto
9435 (MenuMakeDocBook): ditto
9436 (MenuMakeAscii): ditto
9437 (InsertAsciiFile): split the test for openable and readable
9439 * src/bmtable.C (draw_bitmaptable): use
9440 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9442 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9443 findtexfile from LaTeX to filetools.
9445 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9446 instead of FilePtr. Needs to be verified by a literate user.
9448 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9450 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9451 (EditMessage): likewise.
9453 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9454 respectively as \textasciitilde and \textasciicircum.
9456 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9458 * src/support/lyxstring.h: made the methods that take iterators
9461 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9462 (regexMatch): made is use the real regex class.
9464 * src/support/Makefile.am: changed to use libtool
9466 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9468 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9470 (MathIsInset ++): changed several macros to be inline functions
9473 * src/mathed/Makefile.am: changed to use libtool
9475 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9477 * src/insets/inset* : Clone changed to const and return type is
9478 the true insettype not just Inset*.
9480 * src/insets/Makefile.am: changed to use libtool
9482 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9484 * src/undo.[Ch] : added empty() and changed some of the method
9487 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9489 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9490 setID use block<> for the bullets array, added const several places.
9492 * src/lyxfunc.C (getStatus): new function
9494 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9495 LyXAction, added const to several funtions.
9497 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9498 a std::map, and to store the dir items in a vector.
9500 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9503 * src/LyXView.[Ch] + other files : changed currentView to view.
9505 * src/LyXAction.[Ch] : ported from the old devel branch.
9507 * src/.cvsignore: added .libs and a.out
9509 * configure.in : changes to use libtool.
9511 * acinclude.m4 : inserted libtool.m4
9513 * .cvsignore: added libtool
9515 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9517 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9518 file name in insets and mathed directories (otherwise the
9519 dependency is not taken in account under cygwin).
9521 * src/text2.C (InsertString[AB]): make sure that we do not try to
9522 read characters past the string length.
9524 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9526 * lib/doc/LaTeXConfig.lyx.in,
9527 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9529 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9530 file saying who created them and when this heppened; this is
9531 useless and annoys tools like cvs.
9533 * lib/layouts/g-brief-{en,de}.layout,
9534 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9535 from Thomas Hartkens <thomas@hartkens.de>.
9537 * src/{insets,mathed}/Makefile.am: do not declare an empty
9538 LDFLAGS, so that it can be set at configure time (useful on Irix
9541 * lib/reLyX/configure.in: make sure that the prefix is set
9542 correctly in LYX_DIR.
9544 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9546 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9547 be used by 'command-sequence' this allows to bind a key to a
9548 sequence of LyX-commands
9549 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9551 * src/LyXAction.C: add "command-sequence"
9553 * src/LyXFunction.C: handling of "command-sequence"
9555 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9556 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9558 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9560 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9562 * src/buffer.C (writeFile): Do not output a comment giving user
9563 and date at the beginning of a .lyx file. This is useless and
9564 annoys cvs anyway; update version number to 1.1.
9566 * src/Makefile.am (LYX_DIR): add this definition, so that a
9567 default path is hardcoded in LyX.
9569 * configure.in: Use LYX_GNU_GETTEXT.
9571 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9572 AM_GNU_GETTEXT with a bug fixed.
9574 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9576 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9578 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9579 which is used to point to LyX data is now LYX_DIR_11x.
9581 * lyx.man: convert to a unix text file; small updates.
9583 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9585 * src/support/LSubstring.[Ch]: made the second arg of most of the
9586 constructors be a const reference.
9588 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9591 * src/support/lyxstring.[Ch] (swap): added missing member function
9592 and specialization of swap(str, str);
9594 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9596 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9597 trace of the old one.
9599 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9600 put the member definitions in undo.C.
9602 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9603 NEW_TEXT and have now only code that was included when this was
9606 * src/intl.C (LCombo): use static_cast
9608 (DispatchCallback): ditto
9610 * src/definitions.h: removed whole file
9612 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9614 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9615 parsing and stores in a std:map. a regex defines the file format.
9616 removed unneeded members.
9618 * src/bufferparams.h: added several enums from definitions.h here.
9619 Removed unsused destructor. Changed some types to use proper enum
9620 types. use block to have the temp_bullets and user_defined_bullets
9621 and to make the whole class assignable.
9623 * src/bufferparams.C (Copy): removed this functions, use a default
9626 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9629 * src/buffer.C (readLyXformat2): commend out all that have with
9630 oldpapersize to do. also comment out all that hve to do with
9631 insetlatex and insetlatexdel.
9632 (setOldPaperStuff): commented out
9634 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9636 * src/LyXAction.C: remove use of inset-latex-insert
9638 * src/mathed/math_panel.C (button_cb): use static_cast
9640 * src/insets/Makefile.am (insets_o_SOURCES): removed
9643 * src/support/lyxstring.C (helper): use the unsigned long
9644 specifier, UL, instead of a static_cast.
9646 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9648 * src/support/block.h: new file. to be used as a c-style array in
9649 classes, so that the class can be assignable.
9651 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9653 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9654 NULL, make sure to return an empty string (it is not possible to
9655 set a string to NULL).
9657 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9659 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9661 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9663 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9664 link line, so that Irix users (for example) can set it explicitely to
9667 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9668 it can be overidden at make time (static or dynamic link, for
9671 * src/vc-backend.C, src/LaTeXFeatures.h,
9672 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9673 statements to bring templates to global namespace.
9675 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9677 * src/support/lyxstring.C (operator[] const): make it standard
9680 * src/minibuffer.C (Init): changed to reflect that more
9681 information is given from the lyxvc and need not be provided here.
9683 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9685 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9687 * src/LyXView.C (UpdateTimerCB): use static_cast
9688 (KeyPressMask_raw_callback): ditto
9690 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9691 buffer_, a lot of changes because of this. currentBuffer() ->
9692 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9693 also changes to other files because of this.
9695 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9697 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9698 have no support for RCS and partial support for CVS, will be
9701 * src/insets/ several files: changes because of function name
9702 changes in Bufferview and LyXView.
9704 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9706 * src/support/LSubstring.[Ch]: new files. These implement a
9707 Substring that can be very convenient to use. i.e. is this
9709 string a = "Mary had a little sheep";
9710 Substring(a, "sheep") = "lamb";
9711 a is now "Mary has a little lamb".
9713 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9714 out patterns and subpatterns of strings. It is used by LSubstring
9715 and also by vc-backend.C
9717 * src/support/lyxstring.C: went over all the assertions used and
9718 tried to correct the wrong ones and flag which of them is required
9719 by the standard. some bugs found because of this. Also removed a
9720 couple of assertions.
9722 * src/support/Makefile.am (libsupport_a_SOURCES): added
9723 LSubstring.[Ch] and LRegex.[Ch]
9725 * src/support/FileInfo.h: have struct stat buf as an object and
9726 not a pointer to one, some changes because of this.
9728 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9729 information in layout when adding the layouts preamble to the
9732 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9735 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9736 because of bug in OS/2.
9738 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9740 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9741 \verbatim@font instead of \ttfamily, so that it can be redefined.
9743 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9744 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9745 src/layout.h, src/text2.C: add 'using' directive to bring the
9746 STL templates we need from the std:: namespace to the global one.
9747 Needed by DEC cxx in strict ansi mode.
9749 * src/support/LIstream.h,src/support/LOstream.h,
9750 src/support/lyxstring.h,src/table.h,
9751 src/lyxlookup.h: do not include <config.h> in header
9752 files. This should be done in the .C files only.
9754 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9758 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9760 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9761 from Kayvan to fix the tth invokation.
9763 * development/lyx.spec.in: updates from Kayvan to reflect the
9764 changes of file names.
9766 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9768 * src/text2.C (InsertStringB): use std::copy
9769 (InsertStringA): use std::copy
9771 * src/bufferlist.C: use a vector to store the buffers in. This is
9772 an internal change and should not affect any other thing.
9774 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9777 * src/text.C (Fill): fix potential bug, one off bug.
9779 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9781 * src/Makefile.am (lyx_main.o): add more files it depends on.
9783 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9785 * src/support/lyxstring.C: use size_t for the reference count,
9786 size, reserved memory and xtra.
9787 (internal_compare): new private member function. Now the compare
9788 functions should work for std::strings that have embedded '\0'
9790 (compare): all compare functions rewritten to use
9793 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9795 * src/support/lyxstring.C (compare): pass c_str()
9796 (compare): pass c_str
9797 (compare): pass c_str
9799 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9801 * src/support/DebugStream.C: <config.h> was not included correctly.
9803 * lib/configure: forgot to re-generate it :( I'll make this file
9804 auto generated soon.
9806 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9808 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9811 * src/support/lyxstring.C: some changes from length() to rep->sz.
9812 avoids a function call.
9814 * src/support/filetools.C (SpaceLess): yet another version of the
9815 algorithm...now per Jean-Marc's suggestions.
9817 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9819 * src/layout.C (less_textclass_desc): functor for use in sorting
9821 (LyXTextClass::Read): sort the textclasses after reading.
9823 * src/support/filetools.C (SpaceLess): new version of the
9824 SpaceLess functions. What problems does this one give? Please
9827 * images/banner_bw.xbm: made the arrays unsigned char *
9829 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9831 * src/support/lyxstring.C (find): remove bogus assertion in the
9832 two versions of find where this has not been done yet.
9834 * src/support/lyxlib.h: add missing int return type to
9837 * src/menus.C (ShowFileMenu): disable exporting to html if no
9838 html export command is present.
9840 * config/lib_configure.m4: add a test for an HTML converter. The
9841 programs checked for are, in this order: tth, latex2html and
9844 * lib/configure: generated from config/lib_configure.m4.
9846 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9847 html converter. The parameters are now passed through $$FName and
9848 $$OutName, instead of standard input/output.
9850 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9852 * lib/lyxrc.example: update description of \html_command.
9853 add "quotes" around \screen_font_xxx font setting examples to help
9854 people who use fonts with spaces in their names.
9856 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9858 * Distribution files: updates for v1.1.2
9860 * src/support/lyxstring.C (find): remove bogus assert and return
9861 npos for the same condition.
9863 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9865 * added patch for OS/2 from SMiyata.
9867 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9869 * src/text2.C (CutSelection): make space_wrapped a bool
9870 (CutSelection): dont declare int i until we have to.
9871 (alphaCounter): return a char const *.
9873 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9875 * src/support/syscall.C (Systemcalls::kill):
9876 src/support/filetools.C (PutEnv, PutEnvPath):
9877 src/lyx_cb.C (addNewlineAndDepth):
9878 src/FontInfo.C (FontInfo::resize): condition some #warning
9879 directives with WITH_WARNINGS.
9882 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9884 * src/layout.[Ch] + several files: access to class variables
9885 limited and made accessor functions instead a lot of code changed
9886 becuase of this. Also instead of returning pointers often a const
9887 reference is returned instead.
9889 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9891 * src/Makefile.am (dist-hook): added used to remove the CVS from
9892 cheaders upon creating a dist
9893 (EXTRA_DIST): added cheaders
9895 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9896 a character not as a small integer.
9898 * src/support/lyxstring.C (find): removed Assert and added i >=
9899 rep->sz to the first if.
9901 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9903 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9904 src/LyXView.C src/buffer.C src/bufferparams.C
9905 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9906 src/text2.C src/insets/insetinclude.C:
9907 lyxlayout renamed to textclasslist.
9909 * src/layout.C: some lyxerr changes.
9911 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9912 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9913 (LyXLayoutList): removed all traces of this class.
9914 (LyXTextClass::Read): rewrote LT_STYLE
9915 (LyXTextClass::hasLayout): new function
9916 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9917 both const and nonconst version.
9918 (LyXTextClass::delete_layout): new function.
9919 (LyXTextClassList::Style): bug fix. do the right thing if layout
9921 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9922 (LyXTextClassList::NameOfLayout): ditto
9923 (LyXTextClassList::Load): ditto
9925 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9927 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9929 * src/LyXAction.C (LookupFunc): added a workaround for sun
9930 compiler, on the other hand...we don't know if the current code
9931 compiles on sun at all...
9933 * src/support/filetools.C (CleanupPath): subst fix
9935 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9938 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9939 complained about this one?
9941 * src/insets/insetinclude.C (Latex): subst fix
9943 * src/insets/insetbib.C (getKeys): subst fix
9945 * src/LyXSendto.C (SendtoApplyCB): subst fix
9947 * src/lyx_main.C (init): subst fix
9949 * src/layout.C (Read): subst fix
9951 * src/lyx_sendfax_main.C (button_send): subst fix
9953 * src/buffer.C (RoffAsciiTable): subst fix
9955 * src/lyx_cb.C (MenuFax): subst fix
9956 (PrintApplyCB): subst fix
9958 1999-10-26 Juergen Vigna <jug@sad.it>
9960 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9962 (Read): Cleaned up this code so now we read only format vestion >= 5
9964 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9966 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9967 come nobody has complained about this one?
9969 * src/insets/insetinclude.C (Latex): subst fix
9971 * src/insets/insetbib.C (getKeys): subst fix
9973 * src/lyx_main.C (init): subst fix
9975 * src/layout.C (Read): subst fix
9977 * src/buffer.C (RoffAsciiTable): subst fix
9979 * src/lyx_cb.C (MenuFax): subst fix.
9981 * src/layout.[hC] + some other files: rewrote to use
9982 std::container to store textclasses and layouts in.
9983 Simplified, removed a lot of code. Make all classes
9984 assignable. Further simplifications and review of type
9985 use still to be one.
9987 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9988 lastfiles to create the lastfiles partr of the menu.
9990 * src/lastfiles.[Ch]: rewritten to use deque to store the
9991 lastfiles in. Uses fstream for reading and writing. Simplifies
9994 * src/support/syscall.C: remove explicit cast.
9996 * src/BufferView.C (CursorToggleCB): removed code snippets that
9998 use explicat C++ style casts instead of C style casts. also use
9999 u_vdata instea of passing pointers in longs.
10001 * src/PaperLayout.C: removed code snippets that were commented out.
10003 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10005 * src/lyx_main.C: removed code snippets that wer commented out.
10007 * src/paragraph.C: removed code snippets that were commented out.
10009 * src/lyxvc.C (logClose): use static_cast
10011 (viewLog): remove explicit cast to void*
10012 (showLog): removed old commented code
10014 * src/menus.C: use static_cast instead of C style casts. use
10015 u_vdata instead of u_ldata. remove explicit cast to (long) for
10016 pointers. Removed old code that was commented out.
10018 * src/insets/inset.C: removed old commented func
10020 * src/insets/insetref.C (InsetRef): removed old code that had been
10021 commented out for a long time.
10023 (escape): removed C style cast
10025 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10027 * src/insets/insetlatex.C (Draw): removed old commented code
10028 (Read): rewritten to use string
10030 * src/insets/insetlabel.C (escape): removed C style cast
10032 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10034 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10035 old commented code.
10037 * src/insets/insetinclude.h: removed a couple of stupid bools
10039 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10040 (Clone): remove C style cast
10041 (getKeys): changed list to lst because of std::list
10043 * src/insets/inseterror.C (Draw): removed som old commented code.
10045 * src/insets/insetcommand.C (Draw): removed some old commented code.
10047 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10048 commented out forever.
10049 (bibitem_cb): use static_cast instead of C style cast
10050 use of vdata changed to u_vdata.
10052 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10054 (CloseUrlCB): use static_cast instead of C style cast.
10055 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10057 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10058 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10059 (CloseInfoCB): static_cast from ob->u_vdata instead.
10060 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10063 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10064 (C_InsetError_CloseErrorCB): forward the ob parameter
10065 (CloseErrorCB): static_cast from ob->u_vdata instead.
10067 * src/vspace.h: include LString.h since we use string in this class.
10069 * src/vspace.C (lyx_advance): changed name from advance because of
10070 nameclash with stl. And since we cannot use namespaces yet...I
10071 used a lyx_ prefix instead. Expect this to change when we begin
10074 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10076 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10077 and removed now defunct constructor and deconstructor.
10079 * src/BufferView.h: have backstack as a object not as a pointer.
10080 removed initialization from constructor. added include for BackStack
10082 * development/lyx.spec.in (%build): add CFLAGS also.
10084 * src/screen.C (drawFrame): removed another warning.
10086 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10088 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10089 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10090 README and ANNOUNCE a bit for the next release. More work is
10093 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10094 unbreakable if we are in freespacing mode (LyX-Code), but not in
10097 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10099 * src/BackStack.h: fixed initialization order in constructor
10101 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10103 * acinclude.m4 (VERSION): new rules for when a version is
10104 development, added also a variable for prerelease.
10105 (warnings): we set with_warnings=yes for prereleases
10106 (lyx_opt): prereleases compile with same optimization as development
10107 (CXXFLAGS): only use pedantic if we are a development version
10109 * src/BufferView.C (restorePosition): don't do anything if the
10110 backstack is empty.
10112 * src/BackStack.h: added member empty, use this to test if there
10113 is anything to pop...
10115 1999-10-25 Juergen Vigna <jug@sad.it>
10118 * forms/layout_forms.fd +
10119 * forms/latexoptions.fd +
10120 * lyx.fd: changed for various form resize issues
10122 * src/mathed/math_panel.C +
10123 * src/insets/inseterror.C +
10124 * src/insets/insetinfo.C +
10125 * src/insets/inseturl.C +
10126 * src/insets/inseturl.h +
10128 * src/LyXSendto.C +
10129 * src/PaperLayout.C +
10130 * src/ParagraphExtra.C +
10131 * src/TableLayout.C +
10133 * src/layout_forms.C +
10140 * src/menus.C: fixed various resize issues. So now forms can be
10141 resized savely or not be resized at all.
10143 * forms/form_url.fd +
10144 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10147 * src/insets/Makefile.am: added files form_url.[Ch]
10149 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10151 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10152 (and presumably 6.2).
10154 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10155 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10156 remaining static member callbacks.
10158 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10161 * src/support/lyxstring.h: declare struct Srep as friend of
10162 lyxstring, since DEC cxx complains otherwise.
10164 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10166 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10168 * src/LaTeX.C (run): made run_bibtex also depend on files with
10170 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10171 are put into the dependency file.
10173 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10174 the code has shown itself to work
10175 (create_ispell_pipe): removed another warning, added a comment
10178 * src/minibuffer.C (ExecutingCB): removed code that has been
10179 commented out a long time
10181 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10182 out code + a warning.
10184 * src/support/lyxstring.h: comment out the three private
10185 operators, when compiling with string ansi conforming compilers
10186 they make problems.
10188 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10190 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10191 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10194 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10197 * src/mathed/math_panel.C (create_math_panel): remove explicit
10200 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10203 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10204 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10205 to XCreatePixmapFromBitmapData
10206 (fl_set_bmtable_data): change the last argument to be unsigned
10208 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10209 and bh to be unsigned int, remove explicit casts in call to
10210 XReadBitmapFileData.
10212 * images/arrows.xbm: made the arrays unsigned char *
10213 * images/varsz.xbm: ditto
10214 * images/misc.xbm: ditto
10215 * images/greek.xbm: ditto
10216 * images/dots.xbm: ditto
10217 * images/brel.xbm: ditto
10218 * images/bop.xbm: ditto
10220 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10222 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10223 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10224 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10226 (LYX_CXX_CHEADERS): added <clocale> to the test.
10228 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10230 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10232 * src/support/lyxstring.C (append): fixed something that must be a
10233 bug, rep->assign was used instead of rep->append.
10235 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10238 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10239 lyx insert double chars. Fix spotted by Kayvan.
10241 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10243 * Fixed the tth support. I messed up with the Emacs patch apply feature
10244 and omitted the changes in lyxrc.C.
10246 1999-10-22 Juergen Vigna <jug@sad.it>
10248 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10250 * src/lyx_cb.C (MenuInsertRef) +
10251 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10252 the form cannot be resized under it limits (fixes a segfault)
10254 * src/lyx.C (create_form_form_ref) +
10255 * forms/lyx.fd: Changed Gravity on name input field so that it is
10258 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10260 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10261 <ostream> and <istream>.
10263 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10264 whether <fstream> provides the latest standard features, or if we
10265 have an oldstyle library (like in egcs).
10266 (LYX_CXX_STL_STRING): fix the test.
10268 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10269 code on MODERN_STL_STREAM.
10271 * src/support/lyxstring.h: use L{I,O}stream.h.
10273 * src/support/L{I,O}stream.h: new files, designed to setup
10274 correctly streams for our use
10275 - includes the right header depending on STL capabilities
10276 - puts std::ostream and std::endl (for LOStream.h) or
10277 std::istream (LIStream.h) in toplevel namespace.
10279 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10281 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10282 was a bib file that had been changed we ensure that bibtex is run.
10283 (runBibTeX): enhanced to extract the names of the bib files and
10284 getting their absolute path and enter them into the dep file.
10285 (findtexfile): static func that is used to look for tex-files,
10286 checks for absolute patchs and tries also with kpsewhich.
10287 Alternative ways of finding the correct files are wanted. Will
10289 (do_popen): function that runs a command using popen and returns
10290 the whole output of that command in a string. Should be moved to
10293 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10294 file with extension ext has changed.
10296 * src/insets/figinset.C: added ifdef guards around the fl_free
10297 code that jug commented out. Now it is commented out when
10298 compiling with XForms == 0.89.
10300 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10301 to lyxstring.C, and only keep a forward declaration in
10302 lyxstring.h. Simplifies the header file a bit and should help a
10303 bit on compile time too. Also changes to Srep will not mandate a
10304 recompile of code just using string.
10305 (~lyxstring): definition moved here since it uses srep.
10306 (size): definition moved here since it uses srep.
10308 * src/support/lyxstring.h: removed a couple of "inline" that should
10311 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10313 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10316 1999-10-21 Juergen Vigna <jug@sad.it>
10318 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10319 set to left if I just remove the width entry (or it is empty).
10321 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10322 paragraph when having dummy paragraphs.
10324 1999-10-20 Juergen Vigna <jug@sad.it>
10326 * src/insets/figinset.C: just commented some fl_free_form calls
10327 and added warnings so that this calls should be activated later
10328 again. This avoids for now a segfault, but we have a memory leak!
10330 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10331 'const char * argument' to 'string argument', this should
10332 fix some Asserts() in lyxstring.C.
10334 * src/lyxfunc.h: Removed the function argAsString(const char *)
10335 as it is not used anymore.
10337 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10339 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10342 * src/Literate.h: some funcs moved from public to private to make
10343 interface clearer. Unneeded args removed.
10345 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10347 (scanBuildLogFile): ditto
10349 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10350 normal TeX Error. Still room for improvement.
10352 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10354 * src/buffer.C (insertErrors): changes to make the error
10355 desctription show properly.
10357 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10360 * src/support/lyxstring.C (helper): changed to use
10361 sizeof(object->rep->ref).
10362 (operator>>): changed to use a pointer instead.
10364 * src/support/lyxstring.h: changed const reference & to value_type
10365 const & lets see if that helps.
10367 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10369 * Makefile.am (rpmdist): fixed to have non static package and
10372 * src/support/lyxstring.C: removed the compilation guards
10374 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10377 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10378 conditional compile of lyxstring.Ch
10380 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10381 stupid check, but it is a lot better than the bastring hack.
10382 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10384 * several files: changed string::erase into string::clear. Not
10387 * src/chset.C (encodeString): use a char temporary instead
10389 * src/table.C (TexEndOfCell): added tostr around
10390 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10391 (TexEndOfCell): ditto
10392 (TexEndOfCell): ditto
10393 (TexEndOfCell): ditto
10394 (DocBookEndOfCell): ditto
10395 (DocBookEndOfCell): ditto
10396 (DocBookEndOfCell): ditto
10397 (DocBookEndOfCell): ditto
10399 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10401 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10403 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10404 (MenuBuildProg): added tostr around ret
10405 (MenuRunChktex): added tostr around ret
10406 (DocumentApplyCB): added tostr around ret
10408 * src/chset.C (encodeString): added tostr around t->ic
10410 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10411 (makeLaTeXFile): added tostr around tocdepth
10412 (makeLaTeXFile): added tostr around ftcound - 1
10414 * src/insets/insetbib.C (setCounter): added tostr around counter.
10416 * src/support/lyxstring.h: added an operator+=(int) to catch more
10419 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10420 (lyxstring): We DON'T allow NULL pointers.
10422 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10424 * src/mathed/math_macro.C (MathMacroArgument::Write,
10425 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10426 when writing them out.
10428 * src/LString.C: remove, since it is not used anymore.
10430 * src/support/lyxstring.C: condition the content to
10431 USE_INCLUDED_STRING macro.
10433 * src/mathed/math_symbols.C, src/support/lstrings.C,
10434 src/support/lyxstring.C: add `using' directive to specify what
10435 we need in <algorithm>. I do not think that we need to
10436 conditionalize this, but any thought is appreciated.
10438 * many files: change all callback functions to "C" linkage
10439 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10440 strict_ansi. Those who were static are now global.
10441 The case of callbacks which are static class members is
10442 trickier, since we have to make C wrappers around them (see
10443 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10444 did not finish this yet, since it defeats the purpose of
10445 encapsulation, and I am not sure what the best route is.
10447 1999-10-19 Juergen Vigna <jug@sad.it>
10449 * src/support/lyxstring.C (lyxstring): we permit to have a null
10450 pointer as assignment value and just don't assign it.
10452 * src/vspace.C (nextToken): corrected this function substituting
10453 find_first(_not)_of with find_last_of.
10455 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10456 (TableOptCloseCB) (TableSpeCloseCB):
10457 inserted fl_set_focus call for problem with fl_hide_form() in
10460 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10462 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10465 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10467 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10468 LyXLex::next() and not eatline() to get its argument.
10470 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10472 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10473 instead, use fstreams for io of the depfile, removed unneeded
10474 functions and variables.
10476 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10477 vector instead, removed all functions and variables that is not in
10480 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10482 * src/buffer.C (insertErrors): use new interface to TeXError
10484 * Makefile.am (rpmdist): added a rpmdist target
10486 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10487 per Kayvan's instructions.
10489 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10491 * src/Makefile.am: add a definition for localedir, so that locales
10492 are found after installation (Kayvan)
10494 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10496 * development/.cvsignore: new file.
10498 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10500 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10501 C++ compiler provides wrappers for C headers and use our alternate
10504 * configure.in: use LYX_CXX_CHEADERS.
10506 * src/cheader/: new directory, populated with cname headers from
10507 libstdc++-2.8.1. They are a bit old, but probably good enough for
10508 what we want (support compilers who lack them).
10510 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10511 from includes. It turns out is was stupid.
10513 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10515 * lib/Makefile.am (install-data-local): forgot a ';'
10516 (install-data-local): forgot a '\'
10517 (libinstalldirs): needed after all. reintroduced.
10519 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10521 * configure.in (AC_OUTPUT): added lyx.spec
10523 * development/lyx.spec: removed file
10525 * development/lyx.spec.in: new file
10527 * po/*.po: merged with lyx.pot becuase of make distcheck
10529 * lib/Makefile.am (dist-hook): added dist-hook so that
10530 documentation files will be included when doing a make
10531 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10532 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10534 more: tried to make install do the right thing, exclude CVS dirs
10537 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10538 Path would fit in more nicely.
10540 * all files that used to use pathstack: uses now Path instead.
10541 This change was a lot easier than expected.
10543 * src/support/path.h: new file
10545 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10547 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10549 * src/support/lyxstring.C (getline): Default arg was given for
10552 * Configure.cmd: removed file
10554 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10556 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10557 streams classes and types, add the proper 'using' statements when
10558 MODERN_STL is defined.
10560 * src/debug.h: move the << operator definition after the inclusion
10563 * src/support/filetools.C: include "LAssert.h", which is needed
10566 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10569 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10570 include "debug.h" to define a proper ostream.
10572 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10574 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10575 method to the SystemCall class which can kill a process, but it's
10576 not fully implemented yet.
10578 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10580 * src/support/FileInfo.h: Better documentation
10582 * src/lyxfunc.C: Added support for buffer-export html
10584 * src/menus.C: Added Export->As HTML...
10586 * lib/bind/*.bind: Added short-cut for buffer-export html
10588 * src/lyxrc.*: Added support for new \tth_command
10590 * lib/lyxrc.example: Added stuff for new \tth_command
10592 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10594 * lib/Makefile.am (IMAGES): removed images/README
10595 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10596 installes in correct place. Check permisions is installed
10599 * src/LaTeX.C: some no-op changes moved declaration of some
10602 * src/LaTeX.h (LATEX_H): changed include guard name
10604 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10606 * lib/reLyX/Makefile.am: install noweb2lyx.
10608 * lib/Makefile.am: install configure.
10610 * lib/reLyX/configure.in: declare a config aux dir; set package
10611 name to lyx (not sure what the best solution is); generate noweb2lyx.
10613 * lib/layouts/egs.layout: fix the bibliography layout.
10615 1999-10-08 Jürgen Vigna <jug@sad.it>
10617 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10618 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10619 it returned without continuing to search the path.
10621 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10623 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10624 also fixes a bug. It is not allowed to do tricks with std::strings
10625 like: string a("hei"); &a[e]; this will not give what you
10626 think... Any reason for the complexity in this func?
10628 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10630 * Updated README and INSTALL a bit, mostly to check that my
10631 CVS rights are correctly set up.
10633 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10635 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10636 does not allow '\0' chars but lyxstring and std::string does.
10638 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10640 * autogen.sh (AUTOCONF): let the autogen script create the
10641 POTFILES.in file too. POTFILES.in should perhaps now not be
10642 included in the cvs module.
10644 * some more files changed to use C++ includes instead of C ones.
10646 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10648 (Reread): added tostr to nlink. buggy output otherwise.
10649 (Reread): added a string() around szMode when assigning to Buffer,
10650 without this I got a log of garbled info strings.
10652 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10655 * I have added several ostream & operator<<(ostream &, some_type)
10656 functions. This has been done to avoid casting and warnings when
10657 outputting enums to lyxerr. This as thus eliminated a lot of
10658 explicit casts and has made the code clearer. Among the enums
10659 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10660 mathed enums, some font enum the Debug::type enum.
10662 * src/support/lyxstring.h (clear): missing method. equivalent of
10665 * all files that contained "stderr": rewrote constructs that used
10666 stderr to use lyxerr instead. (except bmtable)
10668 * src/support/DebugStream.h (level): and the passed t with
10669 Debug::ANY to avoid spurious bits set.
10671 * src/debug.h (Debug::type value): made it accept strings of the
10672 type INFO,INIT,KEY.
10674 * configure.in (Check for programs): Added a check for kpsewhich,
10675 the latex generation will use this later to better the dicovery of
10678 * src/BufferView.C (create_view): we don't need to cast this to
10679 (void*) that is done automatically.
10680 (WorkAreaButtonPress): removed some dead code.
10682 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10684 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10685 is not overwritten when translated (David Sua'rez de Lis).
10687 * lib/CREDITS: Added David Sua'rez de Lis
10689 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10691 * src/bufferparams.C (BufferParams): default input encoding is now
10694 * acinclude.m4 (cross_compiling): comment out macro
10695 LYX_GXX_STRENGTH_REDUCE.
10697 * acconfig.h: make sure that const is not defined (to empty) when
10698 we are compiling C++. Remove commented out code using SIZEOF_xx
10701 * configure.in : move the test for const and inline as late as
10702 possible so that these C tests do not interefere with C++ ones.
10703 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10704 has not been proven.
10706 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10708 * src/table.C (getDocBookAlign): remove bad default value for
10709 isColumn parameter.
10711 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10713 (ShowFileMenu2): ditto.
10715 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10716 of files to ignore.
10718 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10720 * Most files: finished the change from the old error code to use
10721 DebugStream for all lyxerr debugging. Only minor changes remain
10722 (e.g. the setting of debug levels using strings instead of number)
10724 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10726 * src/layout.C (Add): Changed to use compare_no_case instead of
10729 * src/FontInfo.C: changed loop variable type too string::size_type.
10731 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10733 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10734 set ETAGS_ARGS to --c++
10736 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10738 * src/table.C (DocBookEndOfCell): commented out two unused variables
10740 * src/paragraph.C: commented out four unused variables.
10742 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10743 insed a if clause with type string::size_type.
10745 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10748 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10750 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10751 variable, also changed loop to go from 0 to lenght + 1, instead of
10752 -1 to length. This should be correct.
10754 * src/LaTeX.C (scanError): use string::size_type as loop variable
10757 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10758 (l.896) since y_tmp and row was not used anyway.
10760 * src/insets/insetref.C (escape): use string::size_type as loop
10763 * src/insets/insetquotes.C (Width): use string::size_type as loop
10765 (Draw): use string::size_type as loop variable type.
10767 * src/insets/insetlatexaccent.C (checkContents): use
10768 string::size_type as loop variable type.
10770 * src/insets/insetlabel.C (escape): use string::size_type as loop
10773 * src/insets/insetinfo.C: added an extern for current_view.
10775 * src/insets/insetcommand.C (scanCommand): use string::size_type
10776 as loop variable type.
10778 * most files: removed the RCS tags. With them we had to recompile
10779 a lot of files after a simple cvs commit. Also we have never used
10780 them for anything meaningful.
10782 * most files: tags-query-replace NULL 0. As adviced several plases
10783 we now use "0" instead of "NULL" in our code.
10785 * src/support/filetools.C (SpaceLess): use string::size_type as
10786 loop variable type.
10788 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10790 * src/paragraph.C: fixed up some more string stuff.
10792 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10794 * src/support/filetools.h: make modestr a std::string.
10796 * src/filetools.C (GetEnv): made ch really const.
10798 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10799 made code that used these use max/min from <algorithm> instead.
10801 * changed several c library include files to their equivalent c++
10802 library include files. All is not changed yet.
10804 * created a support subdir in src, put lyxstring and lstrings
10805 there + the extra files atexit, fileblock, strerror. Created
10806 Makefile.am. edited configure.in and src/Makefile.am to use this
10807 new subdir. More files moved to support.
10809 * imported som of the functions from repository lyx, filetools
10811 * ran tags-query-replace on LString -> string, corrected the bogus
10812 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10813 is still some errors in there. This is errors where too much or
10814 too litle get deleted from strings (string::erase, string::substr,
10815 string::replace), there can also be some off by one errors, or
10816 just plain wrong use of functions from lstrings. Viewing of quotes
10819 * LyX is now running fairly well with string, but there are
10820 certainly some bugs yet (see above) also string is quite different
10821 from LString among others in that it does not allow null pointers
10822 passed in and will abort if it gets any.
10824 * Added the revtex4 files I forgot when setting up the repository.
10826 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10828 * All over: Tried to clean everything up so that only the files
10829 that we really need are included in the cvs repository.
10830 * Switched to use automake.
10831 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10832 * Install has not been checked.
10834 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10836 * po/pt.po: Three errors:
10837 l.533 and l.538 format specification error
10838 l. 402 duplicate entry, I just deleted it.