1 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
3 * configure.in: add new KDE Makefiles
4 * src/vspace.h: return GlueLength not a normal one
5 * src/support/lstrings.h:
6 * src/support/lstrings.C: add isStrUnsignedInt(),
9 * src/frontends/kde/*: big reorganisation, update
10 FormParagraph, add FormTabCreate
12 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
14 * lib/ui/default.ui: small grammatical change.
16 * src/frontends/xforms/xform_macros.h: removed.
18 * src/frontends/xforms/FormBase.C:
19 * src/frontends/xforms/FormPreferences.C:
20 * src/frontends/xforms/Makefile.am: changes associated with removing
21 xform_macros.h. Should make Lars' debugging a little easier.
23 * src/frontends/xforms/FormPreferences.C:
24 * src/frontends/xforms/FormPreferences.h:
25 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
26 longer use X11 color name database. HSV and RGB dials/sliders.
27 Please let this be the end of this!
29 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
31 * Several files: Allow compilation when the compiler doesn't
34 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
37 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
40 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
42 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
43 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
46 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
48 * src/frontends/xforms/FormRef.C (updateBrowser):
49 * src/frontends/xforms/forms/form_ref.fd: try clicking on
50 different insets with the sort key active. Now apply this patch!
52 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
54 * src/frontends/xforms/FormPrint.C: set to valid()
55 when we update from the passed parameters.
57 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
59 * src/LColor.C (getFromGUIName): internationalise the comparison.
61 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
62 FormPreferences choice.
64 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
67 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
69 * src/lyxrc.C: more detail for the printer program config
72 * src/LColor.C: ert->latex text. LColor needs a big revamp
73 but will have to wait till after 1.1.6
75 * src/buffer.C: bring up a dialog if we load a document
76 with an un-installed text class, rather than just complain
79 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
81 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
82 the browser form for a combox in a tabbed folder. Bug fix courtesy of
83 Steve Lamont <spl@ncmir.ucsd.edu>.
85 * src/frontends/xforms/FormDocument.C (build):
86 * src/frontends/xforms/FormPreferences.C (Language::build):
87 pass tabfolders to Combox::add() in order to use this work around.
89 * src/frontends/xforms/FormCitation.C (connect): remove max size
91 (update): sort list of bibliography keys.
93 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
95 No max size limitation. Same popup for new and existing insets. Fixes
96 bugs reported by Rob Lahaye.
98 * src/frontends/xforms/FormCitation.C (c-tor):
99 * src/frontends/xforms/FormCopyright.C (c-tor):
100 * src/frontends/xforms/FormError.C (c-tor):
101 * src/frontends/xforms/FormGraphics.C (c-tor):
102 * src/frontends/xforms/FormIndex.C (c-tor):
103 * src/frontends/xforms/FormRef.C (c-tor):
104 * src/frontends/xforms/FormToc.C (c-tor):
105 * src/frontends/xforms/FormUrl.C (c-tor):
106 use correct policy for ButtonController.
108 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
110 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
113 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
115 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
116 Some resizing changes.
118 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
120 * configure.in: fix typo
122 * lib/languages: add ukraninian and change no to no_NO
124 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
126 * src/bufferview_funcs.C (FontSize): use setLyXSize
128 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
130 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
131 to check for systems where mkstemp() is available but not declared
132 in headers. The new autoconf macro lyx_CHECK_DECL can be used
133 to check for declarations in headers.
135 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
137 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
139 * forms/makefile: added bibforms.fd, include_form.fd.
140 Removed lyx_sendfax.fd.
142 * src/LaTeXLog.C (ShowLatexLog):
143 * src/LyXAction.C (init):
144 * src/bufferparams.C (readLanguage): altered messages as suggested by
147 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
150 * src/credits.C: made fd_form_credits non-static, so that it can be
151 redrawn should the xforms colors be re-mapped.
152 * src/spellchecker.C ditto fd_form_spell_options.
154 * src/filedlg.[Ch] (redraw):
155 * src/intl.[Ch] (redraw):
156 * src/lyxfr0.[Ch] (redraw):
157 * src/insets/figinset.[Ch] (redraw):
158 * src/insets/insetexternal.[Ch] (redraw):
159 new methods, connected to Dialogs::redrawGUI.
161 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
162 to be connected to Dialogs::redrawGUI.
164 * src/frontends/xforms/FormCitation.C (build):
165 * src/frontends/xforms/FormCopyright.C (build):
166 * src/frontends/xforms/FormError.C (build):
167 * src/frontends/xforms/FormGraphics.C (build):
168 * src/frontends/xforms/FormIndex.C (build):
169 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
170 * src/frontends/xforms/FormToc.C (build):
171 * src/frontends/xforms/FormUrl.C (build):
172 use the ButtonController correctly.
174 * src/frontends/xforms/FormCopyright.C (build):
175 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
176 the .fd file and into build().
178 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
180 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
182 * src/frontends/xforms/forms/form_citation.fd:
183 * src/frontends/xforms/forms/form_copyright.fd:
184 * src/frontends/xforms/forms/form_error.fd:
185 * src/frontends/xforms/forms/form_graphics.fd:
186 * src/frontends/xforms/forms/form_index.fd:
187 * src/frontends/xforms/forms/form_toc.fd:
188 * src/frontends/xforms/forms/form_url.fd:
189 renamed some of the objects. Named others explicitly for the first time.
190 Added Restore and Apply buttons where appropriate.
192 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
195 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
197 * src/version.h: try the pre2 again
199 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
201 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
203 * src/frontends/kde/FormParagraph.C: added using directive.
205 * src/frontends/kde/paradlg.C: added config.h and using directive.
207 * src/frontends/kde/paradlg.h: added std::qualifier.
209 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
211 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
213 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
215 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
217 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
219 * src/version.h: set back to 1.1.6cvs
221 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
223 * src/version.h: set to 1.1.6pre2
225 2000-11-20 Marko Vendelin <markov@ioc.ee>
227 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
229 * src/frontends/gnome/Makefile.am: updated list of XForms object files
231 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
233 * src/LColor.C (init):
234 * src/lyxrc.C (getDescription): changed some comments as suggested by
237 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
238 disconnect the redrawGUI signal in best-practice fashion.
240 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
241 long_opts_tab to reflect the change in name of this tabfolder, as
242 suggested by John Levon.
243 (connect, disconnect): new methods. Don't do much at present other than
244 ensuring that we can't resize the dialog. This just makes xforms go
246 (lots of methods in Colors): made void rather than bool. The idea is
247 to have an isOk() function that keeps track of whether any input is
248 genuinely invalid and should therefore block Save, Apply.
249 Easier to manipulate the counters rapidly.
250 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
251 compiler will like this code. Much cleaner way of doing things.
253 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
255 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
256 rather than simple counters, following suggestion by John Levon.
258 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
259 than engraved frame + text.
261 * src/frontends/xforms/forms/makefile: removed spurious command.
263 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
265 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
267 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
270 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
272 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
273 see what Lars has changed and what is just white space!
274 Now used X directly to ascertain the RGB color associated with the
276 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
278 Added some sort capability.
279 The X11 color name database input is only displayed if the database
280 isn't found in the standard place.
281 Got rid of struct compare_converter; it wasn't used.
282 Probably some other stuff that I've forgotten.
284 * src/frontends/xforms/FormPreferences.h: changed the names of some
285 methods in the Colors struct. Added a couple of structs to help sort
286 colors by name and by RGBColor.
288 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
289 functions into a new class RWInfo.
291 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
292 The dialog is now almost navigable using the keyboard. Unfortunately,
293 the cursor has to be inside a browser for it to be activated. There is
294 no visual feedback for the key shortcuts to the arrow keys (use
295 Alt-appropriate arrow key, Alt-x).
297 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
300 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
301 xform_helpers.[Ch]. See above.
303 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
305 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
307 * src/screen.C (setCursorColor): new method. Sets the color of the
309 (ShowManualCursor): call it.
310 Constify some local variables.
312 * src/LColor.[Ch] (LColor): add entry for cursor
313 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
316 2000-11-19 Juergen Vigna <jug@sad.it>
318 * src/insets/insettabular.C (draw): fixed text border redraw problem.
319 (calculate_dimensions_of_cells): try to boost up when inserting chars.
321 2000-11-15 Rob Lahaye <lahaye@postech.edu>
323 * lib/ui/default.ui: OptItem used for Fax entry
325 2000-11-17 Matej Cepl <cepl@bigfoot.com>
327 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
329 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
331 * src/vspace.C (nextToken): fix so it can handle length phrases like
332 "10mm+-20mm", "40inplus16mmminus10cm" etc.
334 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
336 * src/frontends/xforms/FormPreferences.C: constify several variables
337 (BrowserLyX): rewrite to not need the choice variable
338 (Modify): rewrite to not need the choide variable
339 (compare_converter): make operator const
341 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
342 correct the writing of \set_color
343 (getDescription): return a const string
345 * src/kbsequence.[Ch] (addkey): remove dead code
347 * src/Painter.C (text): remove some commented code
349 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
351 * src/ColorHandler.[Ch]: removed some header files from .h file.
352 Included LColor.h in .C file.
354 * src/LColor.[Ch]: made class copyable so that I could create a
355 system_lcolor instance.
357 * src/Painter.h: removed LColor.h.
359 * src/lyx_gui.C (create_forms): used AddName.
361 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
362 of user preferences/lyxrc file.
364 * src/lyxrc.C (output): output changes to lcolor.
366 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
368 Moved class xformColor to files xform_helpers.[Ch]. These files,
369 Color.[Ch], could now be moved into src if they would be useful to
372 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
373 Also moved FormPreferences::browseFile here as it can be used by any
374 xform dialog with a "Browse" button. FormGraphics is a perfect example.
376 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
377 ReadableFile): changed the FormPreferences methods a little and moved
378 them here as they'll be useful elsewhere also.
380 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
381 Removed some header files and used forward declarations instead.
383 Removed some methods as they'll be useful elsewhere (see above).
385 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
386 Can also now modify the LyX LColors. However, for reasons that I don't
387 yet understand, it appears that we can use
388 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
389 present. The problem appears to lie in ColorHandler, because I can
390 change the color using LColor.SetColor(). Similarly, when reading in a
391 preferences file with some set_color instances, I'll get a warning
392 like: Color sea green is undefined or may not be redefined
393 Bad lyxrc set_color for sea green
395 Once the buffer is loaded, however, I can happily change to this color.
397 Finally, it appears that I have to set the color of "inset frame"
398 explicitly, or it oscillates from "black" to "indian red" with each
401 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
403 * ANNOUNCE: corrected a spelling mistake.
405 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
408 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
410 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
412 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
415 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
416 match the requirements from the standard better. This is required
417 to work with gnu libstdc++-v3
419 * src/frontends/xforms/FormPreferences.C: add explict pair
420 arguments to browse calls. include support/lyxmanip.h remvoe
421 extern fmt. whitespace changes. reorder variables in
422 FormPreferences.h, to match initalizaton order.
424 * several files: constify more local variables.
426 * src/buffer.C: remove some commented functions.
428 * src/DepTable.C (remove_files_with_extension): temporary
429 work around for gcc 2.97
430 * src/filedlg.C (find): ditto
431 * src/Variables.C (set): ditto
432 * src/LyXAction.C (searchActionArg): ditto
433 (retrieveActionArg): ditto
435 * configure.in: check for mktemp too
437 * UPGRADING: prepare for 1.1.6
439 * Makefile.am (lgbtags): add backup tags for when etags are
440 different than usual.
442 * ANNOUNCE: prepare for 1.1.6
444 * src/support/tempname.C (make_tempfile): new function, wrapper
445 around mkstemp and mktemp. Only mkstemp has been tested.
448 2000-11-14 Rob Lahaye <lahaye@postech.edu>
450 * default.ui: capitalized some menu items to improve shortcuts.
452 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
454 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
456 * src/frontends/xforms/Dialogs.C: add "using" directive.
458 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
460 * src/filedlg.C (Select): highlight suggested file in browser, if
463 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
464 each tab folder is encapsulated in its own class.
465 The Language keymaps are now chosen using a text input and a
466 browser button, rather than a Combox.
467 All the browser buttons are now functional, although LyXFileDlg
468 still needs to be modified to make it straighhtforward to return a
469 directory if that is what is desired.
471 * src/frontends/xforms/forms/form_preferences.fd: use text input
472 and browse button to input the Language keymaps. Add a few
473 callbacks for the browse buttons.
475 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
477 * src/support/tempname.C (tempName): small changes to make it
478 safer. remove the '.' before XXXXXX
480 * src/support/filetools.C (TmpFileName): remove func
483 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
484 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
485 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
486 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
488 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
491 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
494 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
495 for bp (this fixes a reproducible hard crash)
497 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
500 * src/frontends/xforms/FormBase.h: make bp_ private
501 (FormBaseBI): remove default for bp
504 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
507 * src/frontends/xforms/Color.C (RGBColor): made several vars
508 const, changed initialization of j to allow it to be const
511 * several files: added const to local variables.
513 * src/lyx_cb.C: removed several function prototypes and moved them
517 (UpdateLayoutPreamble):
519 (MenuInsertLabel): add BufferView as arguemnt
520 (LayoutsCB): make tmp const
522 * src/layout_forms.h: regenerated
524 * src/debug.C: add Debug::FILES
525 (showLevel) (showTags): translate the desc
527 * src/debug.h: add FILES as debug target
529 * src/bufferlist.C: use current_view as an interim measure becuase
530 of added arguments to MenuWrite and MenuWriteAs
532 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
534 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
536 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
537 libstdc++ is compiled with.
539 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
541 * lib/layouts/docbook-book.layout
542 * lib/layouts/docbook.layout
543 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
544 those paragraphs are expresse as SGML comments <!-- -->.
546 * src/LaTeXFeatures.h
547 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
548 parameter, this allows to express all the include files as relative
549 paths to the master buffer. The verbatim insert works as the other
552 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
554 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
556 (MakeDocBookFile): top_element is always written. Some clean up, as
557 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
559 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
560 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
561 a reference is written instead of the name.
562 (Validate): use the relative path for the filename.
564 * src/insets/insetlabel.C (DocBook): write end tag, for XML
567 * src/support/filetools.h
568 * src/support/filetools.C (IsSGMLFilename): added.
571 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
573 * development/OS2/quick_fix.patch:
575 * README.OS2: quick update to the OS/2 port.
577 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
579 * src/converter.C: add "using" directive.
581 * src/frontends/xforms/FormPreferences.C: add "using" directive.
582 (compare_converter): add "int" as return type.
584 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
587 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
589 * src/lyx_gui.C (create_forms): map the xform colours, should a
590 mapping exist. Ie, call XformColor::read().
592 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
593 and struct HSV as HSVColor.
594 (XformColor::read, XformColor::write) : new methods that
595 input/output any changes to the cform GUI colors.
597 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
600 * src/frontends/xforms/FormPreferences.C Lots of little changes
601 associated with the changed name of the RGB and HSV structs. Can
602 now save changes to xforms GUI to file. Commented out
603 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
604 used currently anyway.
606 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
608 * src/converter.C: A lot of changes:
609 - It is no longer possible to choose between two or more ways to
610 export to some format (the new code uses only the shortest path).
611 However, it is still possible to choose between pdflatex/ps2pdf
612 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
613 - Added several methods that makes the FormPreferences code simpler.
614 - Changed the tokens $$FName and $$OutName to $$i and $$o.
616 * src/exporter.C (Export): lyxrc.use_pdf is set before
617 makeLaTeXFile is called. This works but not very nice.
619 * src/frontends/xforms/FormPreferences.C: The formats/converters
620 tabs are now fully functional.
622 * src/buffer.C (getTocList): Add numbers to the captions.
624 * lib/lyxrc.example: Removed fax section
626 * src/support/rename.C (rename): Delete the old file if lyx::copy
629 2000-11-13 Rob Lahaye <lahaye@postech.edu>
631 * lib/ui/default.ui: minor polishing.
633 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
635 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
638 * lib/Makefile.am (DOCINST): do not install everything in the
639 documentation directory.
641 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
643 * src/bufferlist.C (newFile): set the filename to the constructed
646 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
647 constructed "newfileXX.lyx" name to the dialog
649 * src/frontends/DialogBase.h: make update() non-abstract so
650 KDE doesn't need to implement two update methods for every form
652 * src/frontends/kde/Makefile.am: add missing xforms objects
655 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
657 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
659 * src/frontends/xforms/Color.[Ch]: new files, defining the color
660 structs RGB and HSV. May not be the best place for these files.
661 Perhaps move them into src ?
663 * src/frontends/xforms/Makefile.am: added new files.
665 * src/frontends/xforms/forms/form_preferences.fd:
666 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
667 replaced all instances of "colour" with "color"!
669 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
672 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
673 tab. Can now alter the colors of the xform's GUI on the fly. With
674 the aid of a single static Signal (see below), can "Apply" these
675 changes to all currently open dialogs. (Well, to all of the NEW
676 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
677 subsequently opened dialogs will, of course, also have the new
678 color scheme. Cannot yet save (or load) the choices to file, so
679 they are lost when exiting LyX.
681 * src/frontends/Dialogs.h:
682 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
683 Used to trigger a redraw of any dialogs connected to it because,
684 for example, the GUI colours have been re-mapped.
686 * src/frontends/xforms/FormBase.[Ch]:
687 * src/frontends/xforms/FormDocument.[Ch]:
688 * src/frontends/xforms/FormParagraph.[Ch]:
689 * src/frontends/xforms/FormPreferences.[Ch]:
690 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
691 method, to be connected to Dialogs::redrawGUI. Method must be
692 virtual, because dialogs with tabbed folders need to redraw the
693 forms of each tab folder.
695 * src/LyXView.C (d-tor):
696 * src/frontends/xforms/FormBase.C (d-tor): connected
697 Dialogs::redrawGUI signal to redraw().
699 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
700 removed Assert, because it is identical to that in FormBase.
702 2000-11-10 Rob Lahaye <lahaye@postech.edu>
704 * lib/ui/default.ui: minor polishing.
706 2000-11-10 Juergen Vigna <jug@sad.it>
708 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
709 (deleteLyXText): ditto
711 * src/insets/insettabular.C (InsetButtonPress): don't clear the
712 selection on mouse-button-3.
714 * src/insets/insettabular.h: new function clearSelection(), use this
715 functions inside insettabular.C.
717 * src/insets/insettabular.C (TabularFeatures): clear the selection
718 on remove_row/column.
720 * src/insets/inset.C (scroll): fixed some scroll stuff.
722 * src/insets/insettabular.C (draw): fixed another minor draw problem.
724 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
726 * lib/CREDITS: add Yves Bastide
728 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
730 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
731 check whether C library functions are in the global namespace.
733 * configure.in: calls it.
735 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
738 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
740 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
741 iterators to prevent crash.
743 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
745 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
747 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
748 shortcut for xforms CB to the preemptive or post-handler function.
750 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
751 removed the HIDDEN_TIMER as it's no longer used.
752 Various other small changes.
754 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
755 preemptive handler to obtain feedback, rather than the post-handler.
756 (ColoursLoadBrowser): find "black" and "white" based on RGB values
758 Formats tab is now complete. Converters tab is nearly so.
760 2000-11-09 Juergen Vigna <jug@sad.it>
762 * src/insets/insettext.C (~InsetText):
765 (SetParagraphData): set cache.second to 0 after deleting it!
766 (getLyXText): check if cache.second is not 0 if finding it.
768 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
770 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
771 lyxlex to parse the rgb.txt file.
774 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
775 replace the default '#' comment character.
777 * src/support/tempname.C: add "using" directive
778 * src/frontends/ButtonPolicies.C: ditto.
780 * src/support/filetools.C (DirList): add an explicit cast to avoid
781 a compile error (probably not the right fix)
783 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
785 * src/support/filetools.C (DirList): implement using system functions
787 * src/support/tempname.C: new file
789 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
791 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
793 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
796 * src/frontends/xforms/ButtonController.C: new file
798 * src/os2_defines.h: remove getcwd define
800 * src/lyxvc.C: include support/lyxlib.h
801 (showLog): use lyx::tempName
803 * src/lyx_cb.C: comment out includes that we don't need
804 (AutoSave): use lyx::tempName
806 * src/filedlg.C: include support/lyxlib.h
807 (Reread): use lyx::getcwd
809 * src/converter.C: include support/filetools.h
810 (add_options): change to static inline, make tail const
811 (Add): make old_viewer const
812 (GetAllFormats): make it a const method, use const_iterator
813 (enable): make static inline
814 (SplitFormat): make using_format const
816 * src/LaTeX.C (run): use lyx::getcwd
818 * configure.in: check for mkstemp as well
820 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
822 * src/converter.[Ch] (GetAllCommands): new method.
824 * src/support/filetools.[Ch] (DirList): new method.
826 * src/frontends/xforms/FormPreferences.C: started (just!) adding
827 functionality to the converters tab.
828 The formats tab is now nearly complete.
829 The kbmap choices in Languages tab now display the contents of
830 system_lyxdir/kbd/*.kmap in readable form.
832 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
833 Moved some variables into the class.
835 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
836 inactive tab folder to FL_COL1. Haven't yet worked out how to change
837 colour of active folder to lighter grey instead. Any takers?
838 (form_colours): added an "Apply" button.
839 (form_converters): added a "Flags" input field.
840 (form_formats): added a "Shortcut" input field. Note that we can't use
841 names such as "input_shortcut" as this buggers up the sed script stuff.
843 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
851 * src/lyx_sendfax_main.C:
854 * src/spellchecker.C:
855 * src/insets/figinset.C:
856 * src/insets/insetbib.C:
857 * src/insets/insetexternal.C:
858 * src/insets/insetinclude.C:
859 * src/insets/insetinfo.C:
860 * src/mathed/math_panel.C:
861 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
862 all "daughter" dialogs now have identical "feel".
864 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
866 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
867 used (and was only used in one place prior to this patch. Incorrectly!)
869 * src/frontends/xforms/FormDocument.C: changed some instances of
870 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
871 sense. Also added fl_set_input_return() for class_->input_doc_extra and
872 for options_->input_float_placement. This fixes a bug reported by
875 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
876 functionality into d-tor.
878 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
879 input of numerals also.
881 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
882 fl_set_form_atclose(). Can now close dialog from window manager,
883 fixing a bug reported by Rob Lahaye.
885 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
887 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
888 are no longer dark. Haven't yet worked out how to lighten the colour of
889 the active tabfolder. Any ideas anybody?
890 Adjusted Colours tab a little.
891 Added Shortcut field to converters tab. Note that we can't create an
892 fdesign label like "input_shortcut" as this buggers up the sed-script
895 * src/frontends/xforms/FormPreferences.[Ch]:
896 (feedback): fixed crash due to to ob=0.
897 (LanguagesXXX): the kbmap choices now contain the files
898 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
899 be replaced by an input with a file browse button, but since the browse
900 buttons don'y yet work, this'll do for the moment.
901 (FormatsXXX): think that this is now nearly fully functional.
902 Some points/questions though:
903 1. Does "Apply" remove formats if no longer present?
904 2. I think that the browser should list the GUI names rather than the
906 3. Must ensure that we can't delete Formats used by an existing
909 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
910 if this is the best way to do this.
912 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
914 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
916 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
917 for variable assignment.
919 2000-11-07 Rob Lahaye <lahaye@postech.edu>
921 * src/lib/ui/default.ui: added sub/superscripts to menu as
922 Insert->Special characters and cleaned-up the file a bit
924 2000-11-07 Allan Rae <rae@lyx.org>
926 * src/frontends/xforms/FormPreferences.C (feedback): make sure
927 ob isn't 0 before using it. See comments in function.
929 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
931 * src/frontends/xforms/form_*.C: regenerated
933 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
935 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
937 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
938 compiling with gcc-2.96
940 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
942 * src/support/lyxstring.C: add a couple "using" directives.
944 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
945 a .c_str() here too for good measure.
946 * src/Spacing.C (set): ditto.
947 * src/lyxfunc.C (Dispatch): ditto.
949 * src/insets/insettabular.C (copySelection): change .str() to
950 .str().c_str() to fix problems with lyxstring.
951 * src/support/filetools.C (GetFileContents): ditto.
952 * src/buffer.C (asciiParagraph): ditto.
953 * src/paragraph.C (String): ditto.
955 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
956 * lib/bind/sciword.bind: ditto.
958 * src/LyXAction.C (init): remove "symbol-insert" function, which
959 shared LFUN_INSERT_MATH with "math-insert".
961 * lib/configure.m4: == is not a valid operator for command test.
963 * src/lyxrc.C: add using directive.
965 * src/converter.h: add std:: qualifier.
967 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
969 * src/converter.[Ch] and other files: Change the Format class to a
970 real class, and create two instances: formats and system_format.
972 * src/lyxrc.C (output): Output the difference between formats and
975 * src/frontends/xforms/FormPreferences.C (input): Simplify.
976 (buildFormats): Insert formats into browser.
977 (inputFormats): Made the browser and add button functional.
978 (applyFormats): Update formats from format_vec.
980 * src/converter.C: Changed all (*it). to it->
981 (Format::dummy): New method.
982 (Format::importer): New format flag.
983 (Formats::GetAllFormats): New method.
984 (Formats::Add): Delete format from the map if prettyname is empty.
985 (Converter::Convert): Print an error message if moving the file fails.
986 (Converter::GetReachableTo): New method
988 * src/MenuBackend.[Ch]: Add support for importformats tag.
990 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
992 * lib/configure.m4: Add word->tex and ps->fax converters.
994 * lib/ui/default.ui: Use ImportFormats on file->import menu.
995 Return fax to file menu.
999 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1001 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1004 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1007 * src/lyxfunc.C (processKeyEvent): removed
1009 * src/bufferlist.C (emergencyWrite): removed the out commented
1010 emergency write code.
1012 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1014 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1016 * many files: change formatting to be a bit more uniform for
1017 if,while,for,switch statements, remove some parantesis not needed.
1020 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1022 * config/kde.m4: make config more robust when KDEDIR is set
1024 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1026 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1027 not returned a pixmap for "math-insert".
1029 * src/LyXAction.C (init): sort the entries a bit.
1031 2000-11-03 Juergen Vigna <jug@sad.it>
1033 * src/insets/insettabular.h: added fixed number to update codes so
1034 that update is only in one direction.
1036 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1039 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1040 before call to edit because of redraw.
1042 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1044 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1046 * lib/ui/default.ui: Populate "edit_float" menu
1048 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1050 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1051 "floats-operate". The name is ugly (and the func also), but this
1052 is just a band-aid until we switch to new insets.
1054 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1056 * lib/ui/default.ui: update again the menu layout (fix some
1059 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1061 * src/MenuBackend.h (fulllabel): new method.
1063 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1064 the menu shortcuts of a menu are unique and whether they
1065 correspond to a letter of the label.
1066 (expand): call checkShortcuts when debugging.
1068 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1070 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1072 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1074 * lib/examples/*.lyx : '\language default' => '\language english'
1076 * lib/examples/it_splash.lyx : except where it should be italian
1078 * lib/templates/*.lyx : the same
1080 * doc/*.lyx* : the same
1082 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1084 * lib/bind/menus.bind: remove the Layout menu entries, which I
1085 somehow forgot earlier.
1087 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1089 * lib/ui/old-default.ui: keep the old one here for reference (to
1092 * lib/ui/default.ui: update the menu layout
1094 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1096 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1097 Can now Apply to different insets without closing the dialog.
1099 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1100 Can't actually DO anything with them yet, but I'd like a little
1103 * src/frontends/xforms/input_validators.[ch]
1104 (fl_lowercase_filter): new.
1106 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1108 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1109 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1111 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1113 2000-11-02 Juergen Vigna <jug@sad.it>
1115 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1116 on char insertion as it has already be updated by bv->updateInset().
1118 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1119 if an inset inside was updated.
1121 * lib/configure.cmd: commented out fax-search code
1123 2000-11-01 Yves Bastide <stid@acm.org>
1125 * src/tabular.C (OldFormatRead): set tabular language to the
1128 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1130 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1131 class names with non-letter characters (from Yves Bastide).
1133 * lib/ui/default.ui: change Item to OptItem in import menu.
1134 Comment out fax stuff.
1136 * lib/configure.m4: comment out fax-related stuff.
1138 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1140 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1141 useful xforms helper functions. At present contains only formatted().
1142 Input a string and it returns it with line breaks so that in fits
1145 * src/frontends/xforms/Makefile.am: add new files.
1147 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1148 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1151 * src/frontends/xforms/FormPreferences.[Ch]:
1152 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1153 but lots of little clean ups. Removed enum State. Make use of
1154 formatted(). Constify lots of methods. Perhaps best of all: removed
1155 requirement for that horrible reinterpret_cast from pointer to long in
1158 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1160 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1161 conditionalize build on xforms < 0.89
1163 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1165 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1167 * src/LyXAction.C (init): comment out fax
1169 * src/lyxrc.h: comment out the fax enums
1170 comment out the fax variables
1172 * src/commandtags.h: comment out LFUN_FAX
1174 * src/lyxrc.C: disable fax variables.
1175 (read): disable parsing of fax variables
1176 (output): disable writing of fax variables
1177 (getFeedback): now description for fax variables
1179 * src/lyxfunc.C: comment out MenuFax
1180 (Dispatch): disable LFUN_FAX
1182 * src/lyx_cb.C (MenuFax): comment out
1184 * src/WorkArea.C: add <cctype>
1185 (work_area_handler): better key handling, should be ok now.
1186 for accented chars + etc
1188 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1189 lyx_sendfax.h and lyx_sendfax_man.C
1191 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1192 (show): don't call InitLyXLookup when using xforms 0.89
1194 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1196 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1198 * src/support/filetools.C (GetFileContents): close to dummy change
1200 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1202 * src/trans.C (AddDeadkey): workaround stupid compilers.
1204 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1206 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1207 of two-sided document.
1209 2000-10-31 Juergen Vigna <jug@sad.it>
1211 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1213 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1214 xposition to the Edit call.
1216 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1218 * src/trans.C (AddDeadkey): cast explicitly to char.
1220 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1222 * src/tabular.C (AsciiBottomHLine): simplify?
1223 (AsciiTopHLine): simplify?
1224 (print_n_chars): simplify
1225 (DocBook): remove most of the << endl; we should flush the stream
1226 as seldom as possible.
1228 (TeXBottomHLine): ditto
1229 (TeXTopHLine): ditto
1231 (write_attribute): try a templified version.
1232 (set_row_column_number_info): lesson scope of variables
1234 * src/support/lstrings.h (tostr): new specialization of tostr
1236 * src/trans.C (AddDeadkey): slightly cleaner fix.
1238 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1240 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1241 '%%' in Toc menu labels.
1244 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1245 font_norm is iso10646-1.
1247 * src/font.C (ascent): Fixed for 16bit fonts
1248 (descent,lbearing,rbearing): ditto
1250 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1252 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1253 (getFeedback): new static method.
1255 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1256 Now use combox rather than choice to display languages.
1257 Feedback is now output using a new timer callback mechanism, identical
1258 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1260 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1262 * src/minibuffer.C: fix for older compilers
1264 2000-10-30 Juergen Vigna <jug@sad.it>
1266 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1267 has to be Left of the inset otherwise LyXText won't find it!
1269 * src/BufferView2.C (open_new_inset): delete the inset if it can
1272 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1274 * lyx.man: fix typo.
1276 2000-10-29 Marko Vendelin <markov@ioc.ee>
1277 * src/frontends/gnome/FormCitation.C
1278 * src/frontends/gnome/FormCitation.h
1279 * src/frontends/gnome/FormCopyright.C
1280 * src/frontends/gnome/FormCopyright.h
1281 * src/frontends/gnome/FormError.C
1282 * src/frontends/gnome/FormError.h
1283 * src/frontends/gnome/FormIndex.C
1284 * src/frontends/gnome/FormIndex.h
1285 * src/frontends/gnome/FormPrint.C
1286 * src/frontends/gnome/FormPrint.h
1287 * src/frontends/gnome/FormRef.C
1288 * src/frontends/gnome/FormRef.h
1289 * src/frontends/gnome/FormToc.C
1290 * src/frontends/gnome/FormToc.h
1291 * src/frontends/gnome/FormUrl.C
1292 * src/frontends/gnome/FormUrl.h
1293 * src/frontends/gnome/Menubar_pimpl.C
1294 * src/frontends/gnome/mainapp.C
1295 * src/frontends/gnome/mainapp.h
1296 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1297 changing update() to updateSlot() where appropriate
1299 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1301 * src/frontends/xforms/FormPreferences.[Ch]:
1302 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1305 2000-10-28 Juergen Vigna <jug@sad.it>
1307 * src/insets/insettabular.C (draw): fixed drawing bug.
1309 * src/insets/insettext.C (clear):
1311 (SetParagraphData): clearing the TEXT buffers when deleting the
1312 paragraphs used by it.
1314 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1316 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1318 2000-10-27 Juergen Vigna <jug@sad.it>
1320 * src/tabular.C (~LyXTabular): removed not needed anymore.
1322 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1325 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1327 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1330 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1333 * src/frontends/xforms/FormPreferences.[Ch]:
1334 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1335 Reorganised as modules based on tabs. Much easier to follow the
1336 flow and to add new tabs. Added warning and feedback messages.
1339 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1341 * src/tabular.h (DocBook): add std:: qualifier.
1343 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1345 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1346 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1349 * insettabular.C (DocBook): uses the tabular methods to export
1352 * src/insets/insettext.h
1353 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1355 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1357 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1360 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1361 moved misplaced AllowInput two lines up.
1363 * src/buffer.C (readFile): compare float with float, not with int
1365 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1367 * src/minibuffer.C: add "using SigC::slot" statement.
1369 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1371 * src/frontends/xforms/forms/README: updated section about make.
1373 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1374 Tidied some forms up, made two of form_tabular's tabs more
1375 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1376 fixed translation problem with "Column".
1378 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1380 * src/minibuffer.h: use Timeout instead of the xforms timer
1382 (setTimer) rewrite for the Timeout, change to unsigned arg
1383 (set): change to unsigned timer arg
1386 * src/minibuffer.C (TimerCB): removed func
1387 (C_MiniBuffer_TimerCB): removed func
1388 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1389 (peek_event): use a switch statement
1390 (add): don't use fl_add_timer.
1391 (Set): rewrite to use the Timeout
1394 * src/Timeout.[Ch] (setType): return a Timeout &
1395 (setTimeout): ditto, change to unsigned arg for timeout
1397 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1399 * src/mathed/formula.C (mathed_string_width): Use string instead
1400 of a constant size char array.
1402 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1404 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1405 the two recently added operator<< for SMInput and State.
1407 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1409 (OkCancelPolicy): ditto
1410 (OkCancelReadOnlyPolicy): ditto
1411 (NoRepeatedApplyReadOnlyPolicy): ditto
1412 (OkApplyCancelReadOnlyPolicy): ditto
1413 (OkApplyCancelPolicy): ditto
1414 (NoRepeatedApplyPolicy): ditto
1416 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1418 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1419 add the usual std:: qualifiers.
1421 2000-10-25 Juergen Vigna <jug@sad.it>
1423 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1425 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1427 * src/support/filetools.C (MakeRelPath): change some types to
1430 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1431 ButtonPolicy::SMInput and ButtonPolicy::State.
1433 * src/FontLoader.C (reset): small cleanup
1434 (unload): small cleanup
1436 * src/FontInfo.C (getFontname): initialize error to 10000.0
1438 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1440 * src/frontends/xforms/FormPreferences.[Ch]:
1441 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1442 TeX encoding and default paper size sections.
1444 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1446 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1449 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1450 make the message_ empty.
1451 (FormError): don't initialize message_ in initializer list.
1453 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1455 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1457 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1459 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1461 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1463 * src/frontends/kde/*data.[Ch]: _("") is not
1466 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1468 * src/buffer.C: removed redundant using directive.
1470 * src/frontends/DialogBase.h: revert to original definition of
1473 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1474 stuff into two classes, one for each dialog, requires a new
1475 element in the dialogs vector, FormTabularCreate.
1477 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1480 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1481 method. Continues Allan's idea, but means that derived classes
1482 don't need to worry about "update or hide?".
1484 * src/frontends/xforms/FormError.C (showInset): add connection
1487 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1488 one for each dialog. FormTabular now contains main tabular dialog
1491 * src/frontends/xforms/FormTabularCreate.[Ch]:
1492 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1495 * src/frontends/xforms/FormGraphics.[Ch]:
1496 * src/frontends/xforms/forms/form_graphics.fd
1497 * src/frontends/xforms/FormTabular.[Ch]:
1498 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1499 classes of FormInset.
1501 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1502 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1504 * src/frontends/xforms/Makefile.am:
1505 * src/frontends/xforms/forms/makefile: added new files.
1507 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1508 variable. added Signal0 hide signal, in keeping with other GUI-I
1511 * src/support/lstrings.h: removed redundant std:: qualifier as
1512 it's already declared in Lsstream.h.
1514 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1516 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1520 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1522 * src/tabular.C (Ascii): minimize scope of cell.
1524 * src/BufferView2.C (nextWord): return string() instead of 0;
1526 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1528 * src/converter.h: add a std:: qualifier
1530 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1532 * src/importer.[Ch]: New files. Used for importing files into LyX.
1534 * src/lyxfunc.C (doImport): Use the new Importer class.
1536 * src/converter.h: Add shortcut member to the Format class.
1537 Used for holding the menu shortcut.
1539 * src/converter.C and other files: Made a distinction between
1540 format name and format extension. New formats can be defined using
1541 the \format lyxrc tag.
1542 Added two new converter flags: latex and disable.
1544 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1546 * src/support/lyxlib.h: unify namespace/struct implementation.
1547 Remove extra declarations.
1549 * src/support/chdir.C (chdir): remove version taking char const *
1551 * src/support/rename.C: ditto.
1552 * src/support/lyxsum.C: ditto.
1554 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1556 * src/frontends/xforms/FormBase.[Ch]:
1557 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1558 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1559 work only for the next call to fl_show_form(). The correct place to set
1560 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1561 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1562 from FormBase have the minimum size set; no more stupid crashes with
1565 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1567 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1569 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1571 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1573 * src/support/lyxlib.h: changed second argument of mkdir to
1574 unsigned long int (unsigned int would probably have been enough,
1575 but...). Removed <sys/types.h> header.
1576 * src/support/mkdir.C (mkdir): ditto.
1580 2000-10-19 Juergen Vigna <jug@sad.it>
1582 * src/lyxfunc.C (MenuNew): small fix (form John)
1584 * src/screen.C (Update): removed unneeded code.
1586 * src/tabular.C (Ascii): refixed int != uint bug!
1588 * src/support/lyxlib.h: added sys/types.h include for now permits
1589 compiling, but I don't like this!
1591 2000-10-18 Juergen Vigna <jug@sad.it>
1593 * src/text2.C (ClearSelection): if we clear the selection we need
1594 more refresh so set the status apropriately
1596 * src/insets/insettext.C (draw): hopefully finally fixed draw
1599 2000-10-12 Juergen Vigna <jug@sad.it>
1601 * src/insets/insettext.C (draw): another small fix and make a block
1602 so that variables are localized.
1604 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1606 * src/support/lstrings.C (lowercase, uppercase):
1607 use explicit casts to remove compiler warnings.
1609 * src/support/LRegex.C (Impl):
1610 * src/support/StrPool.C (add):
1611 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1612 (AddPath, MakeDisplayPath):
1613 * src/support/lstrings.C (prefixIs, subst):
1614 use correct type to remove compiler warnings.
1616 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1618 * src/support/lyxlib.h:
1619 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1620 portability and to remove compiler warning with DEC cxx.
1622 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1624 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1626 * src/minibuffer.C (peek_event): retun 1 when there has been a
1627 mouseclick in the minibuffer.
1631 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1633 * src/frontends/xforms/FormParagraph.C: more space above/below
1636 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1638 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1639 a char only if real_current_font was changed.
1641 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1643 * NEWS: update somewhat for 1.1.6
1645 * lib/ui/default.ui: clean up.
1647 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1649 * lib/CREDITS: clean up
1651 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1653 * src/combox.[Ch] (select): changed argument back to int
1654 * src/combox.C (peek_event): removed num_bytes as it is declared but
1657 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1658 modified calls to Combox::select() to remove warnings about type
1661 * src/insets/insetbutton.C (width): explicit cast to remove warning
1662 about type conversion.
1664 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1667 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1668 sel_pos_end, refering to cursor position are changed to
1669 LyXParagraph::size_type.
1671 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1672 consistent with LyXCursor::pos().
1673 (inset_pos): changed to LyXParagraph::size_type for same reason.
1675 * src/insets/insettext.C (resizeLyXText): changed some temporary
1676 variables refing to cursor position to LyXParagraph::size_type.
1678 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1680 * src/frontends/kde/<various>: The Great Renaming,
1683 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1685 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1687 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1689 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1690 0 when there are no arguments.
1692 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1694 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1695 to segfaults when pressing Ok in InsetBibtex dialog.
1697 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1699 * forms/layout_forms.fd:
1700 * src/layout_forms.C (create_form_form_character): small change to use
1701 labelframe rather than engraved frame + text
1703 * src/lyx_gui.C (create_forms): initialise choice_language with some
1704 arbitrary value to prevent segfault when dialog is shown.
1706 2000-10-16 Baruch Even <baruch.even@writeme.com>
1708 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1709 is no resulting file. This pertains only to LaTeX output.
1711 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1713 * src/text.C (Backspace): Make sure that the row of the cursor is
1716 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1719 * src/lyx_gui.C (init): Prevent a crash when only one font from
1720 menu/popup fonts is not found.
1722 * lib/lyxrc.example: Add an example for binding a key for language
1725 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1727 * src/converter.C (GetReachable): Changed the returned type to
1729 (IsReachable): New method
1731 * src/MenuBackend.C (expand): Handle formats that appear more
1734 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1736 * src/frontends/support/Makefile.am
1737 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1740 * lib/CREDITS: add Garst Reese.
1742 * src/support/snprintf.h: add extern "C" {} around the definitions.
1744 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1746 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1749 * src/frontends/xforms/FormDocument.C:
1750 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1751 compile without "conversion to integral type of smaller size"
1754 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1756 * src/text.C (GetColumnNearX): Fixed disabled code.
1758 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1760 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1763 * src/support/snprintf.[ch]: new files
1765 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1767 * src/frontends/kde/formprintdialog.C: add
1768 file browser for selecting postscript output
1770 * src/frontends/kde/formprintdialogdata.C:
1771 * src/frontends/kde/formprintdialogdata.h: re-generate
1774 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1776 * src/frontends/gnome/Makefile.am:
1777 * src/frontends/kde/Makefile.am: FormCommand.C
1778 disappeared from xforms
1780 * src/frontends/kde/FormCitation.C:
1781 * src/frontends/kde/FormIndex.C: read-only
1784 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1786 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1789 * src/bufferlist.C: add using directive.
1791 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1793 * src/support/lyxfunctional.h: version of class_fun for void
1794 returns added, const versions of back_inseter_fun and compare_fun
1797 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1799 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1801 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1803 * ChangeLog: cleanup.
1805 * lib/CREDITS: update to add all the contributors we've forgotten.
1806 I have obviously missed some, so tell me whether there were
1809 2000-10-13 Marko Vendelin <markov@ioc.ee>
1811 * src/frontends/gnome/FormCitation.C
1812 * src/frontends/gnome/FormCitation.h
1813 * src/frontends/gnome/FormError.C
1814 * src/frontends/gnome/FormIndex.C
1815 * src/frontends/gnome/FormRef.C
1816 * src/frontends/gnome/FormRef.h
1817 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1819 * src/frontends/gnome/FormCitation.C
1820 * src/frontends/gnome/FormCopyright.C
1821 * src/frontends/gnome/FormError.C
1822 * src/frontends/gnome/FormIndex.C
1823 * src/frontends/gnome/FormRef.C
1824 * src/frontends/gnome/FormToc.C
1825 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1828 * src/frontends/gnome/Menubar_pimpl.C
1829 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1832 2000-10-11 Baruch Even <baruch.even@writeme.com>
1835 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1836 to convey its real action.
1838 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1839 clear the minibuffer and prepare to enter a command.
1841 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1842 the rename from ExecCommand to PrepareForCommand.
1843 * src/lyxfunc.C (Dispatch): ditto.
1845 2000-10-11 Baruch Even <baruch.even@writeme.com>
1847 * src/buffer.C (writeFile): Added test for errors on writing, this
1848 catches all errors and not only file system full errors as intended.
1850 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1852 * src/lyx_gui.C (create_forms): better fix for crash with
1853 translated interface.
1855 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1857 * src/frontends/kde/Makefile.am:
1858 * src/frontends/kde/FormCopyright.C:
1859 * src/frontends/kde/formcopyrightdialog.C:
1860 * src/frontends/kde/formcopyrightdialog.h:
1861 * src/frontends/kde/formcopyrightdialogdata.C:
1862 * src/frontends/kde/formcopyrightdialogdata.h:
1863 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1864 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1865 copyright to use qtarch
1867 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1869 * src/encoding.C (read): Fixed bug that caused an error message at
1870 the end of the file.
1872 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1874 * lib/lyxrc.example: Fixed hebrew example.
1876 2000-10-13 Allan Rae <rae@lyx.org>
1878 * src/frontends/xforms/FormPreferences.C (input): reworking the
1880 (build, update, apply): New inputs in various tabfolders
1882 * src/frontends/xforms/FormToc.C: use new button policy.
1883 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1884 dialogs that either can't use any existing policy or where it just
1887 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1890 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1891 added a bool parameter which is ignored.
1893 * src/buffer.C (setReadonly):
1894 * src/BufferView_pimpl.C (buffer):
1895 * src/frontends/kde/FormCopyright.h (update):
1896 * src/frontends/kde/FormCitation.[Ch] (update):
1897 * src/frontends/kde/FormIndex.[Ch] (update):
1898 * src/frontends/kde/FormPrint.[Ch] (update):
1899 * src/frontends/kde/FormRef.[Ch] (update):
1900 * src/frontends/kde/FormToc.[Ch] (update):
1901 * src/frontends/kde/FormUrl.[Ch] (update):
1902 * src/frontends/gnome/FormCopyright.h (update):
1903 * src/frontends/gnome/FormCitation.[Ch] (update):
1904 * src/frontends/gnome/FormError.[Ch] (update):
1905 * src/frontends/gnome/FormIndex.[Ch] (update):
1906 * src/frontends/gnome/FormPrint.[Ch] (update):
1907 * src/frontends/gnome/FormRef.h (update):
1908 * src/frontends/gnome/FormToc.[Ch] (update):
1909 * src/frontends/gnome/FormUrl.[Ch] (update):
1910 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1911 to updateBufferDependent and DialogBase
1913 * src/frontends/xforms/FormCitation.[hC]:
1914 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1915 * src/frontends/xforms/FormError.[Ch]:
1916 * src/frontends/xforms/FormGraphics.[Ch]:
1917 * src/frontends/xforms/FormIndex.[Ch]:
1918 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1919 and fixed readOnly handling.
1920 * src/frontends/xforms/FormPrint.[Ch]:
1921 * src/frontends/xforms/FormRef.[Ch]:
1922 * src/frontends/xforms/FormTabular.[Ch]:
1923 * src/frontends/xforms/FormToc.[Ch]:
1924 * src/frontends/xforms/FormUrl.[Ch]:
1925 * src/frontends/xforms/FormInset.[Ch]:
1926 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1927 form of updateBufferDependent.
1929 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1930 if form()->visible just in case someone does stuff to the form in a
1933 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1934 the buttoncontroller for everything the enum used to be used for.
1935 (update) It would seem we need to force all dialogs to use a bool
1936 parameter or have two update functions. I chose to go with one.
1937 I did try removing update() from here and FormBase and defining the
1938 appropriate update signatures in FormBaseB[DI] but then ran into the
1939 problem of the update() call in FormBase::show(). Whatever I did
1940 to get around that would require another function and that just
1941 got more confusing. Hence the decision to make everyone have an
1942 update(bool). An alternative might have been to override show() in
1943 FormBaseB[DI] and that would allow the different and appropriate
1946 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1947 true == buffer change occurred. I decided against using a default
1948 template parameter since not all compilers support that at present.
1950 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1952 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1953 army knife" by removing functionality.
1954 (clearStore): removed. All such housekeeping on hide()ing the dialog
1955 is to be carried out by overloaded disconnect() methods.
1956 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1957 superceded by Baruch's neat test (FormGraphics) to update an existing
1958 dialog if a new signal is recieved rather than block all new signals
1960 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1961 only to Inset dialogs.
1962 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1963 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1965 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1967 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1968 as a base class to all inset dialogs. Used solely to connect/disconnect
1969 the Inset::hide signal and to define what action to take on receipt of
1970 a UpdateBufferDependent signal.
1971 (FormCommand): now derived from FormInset.
1973 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1976 * src/frontends/xforms/FormCopyright.[Ch]:
1977 * src/frontends/xforms/FormPreferences.[Ch]:
1978 now derived from FormBaseBI.
1980 * src/frontends/xforms/FormDocument.[Ch]:
1981 * src/frontends/xforms/FormParagraph.[Ch]:
1982 * src/frontends/xforms/FormPrint.[Ch]:
1983 now derived from FormBaseBD.
1985 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1987 * src/frontends/xforms/FormCitation.[Ch]:
1988 * src/frontends/xforms/FormError.[Ch]:
1989 * src/frontends/xforms/FormRef.[Ch]:
1990 * src/frontends/xforms/FormToc.[Ch]:
1991 (clearStore): reworked as disconnect().
1993 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1996 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1998 * src/converter.C (runLaTeX): constify buffer argument
2001 * src/frontends/support/Makefile.am (INCLUDES): fix.
2003 * src/buffer.h: add std:: qualifier
2004 * src/insets/figinset.C (addpidwait): ditto
2005 * src/MenuBackend.C: ditto
2006 * src/buffer.C: ditto
2007 * src/bufferlist.C: ditto
2008 * src/layout.C: ditto
2009 * src/lyxfunc.C: ditto
2011 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2013 * src/lyxtext.h (bidi_level): change return type to
2014 LyXParagraph::size_type.
2016 * src/lyxparagraph.h: change size_type to
2017 TextContainer::difference_type. This should really be
2018 TextContainer::size_type, but we need currently to support signed
2021 2000-10-11 Marko Vendelin <markov@ioc.ee>
2022 * src/frontends/gnome/FormError.h
2023 * src/frontends/gnome/FormRef.C
2024 * src/frontends/gnome/FormRef.h
2025 * src/frontends/gnome/FormError.C
2026 * src/frontends/gnome/Makefile.am
2027 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2028 to Gnome frontend. Both dialogs use "action" area.
2030 2000-10-12 Baruch Even <baruch.even@writeme.com>
2032 * src/graphics/GraphicsCacheItem_pimpl.C:
2033 * src/graphics/Renderer.C:
2034 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2037 2000-10-12 Juergen Vigna <jug@sad.it>
2039 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2040 visible when selecting).
2042 * development/Code_rules/Rules: fixed some typos.
2044 2000-10-09 Baruch Even <baruch.even@writeme.com>
2046 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2047 compiling on egcs 1.1.2 possible.
2049 * src/filedlg.C (comp_direntry::operator() ): ditto.
2051 2000-08-31 Baruch Even <baruch.even@writeme.com>
2053 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2056 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2057 transient it now only gets freed when the object is destructed.
2059 2000-08-24 Baruch Even <baruch.even@writeme.com>
2061 * src/frontends/FormGraphics.h:
2062 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2065 2000-08-20 Baruch Even <baruch.even@writeme.com>
2067 * src/insets/insetgraphics.C:
2068 (draw): Added messages to the drawn rectangle to report status.
2069 (updateInset): Disabled the use of the inline graphics,
2072 2000-08-17 Baruch Even <baruch.even@writeme.com>
2074 * src/frontends/support: Directory added for the support of GUII LyX.
2076 * src/frontends/support/LyXImage.h:
2077 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2080 * src/frontends/support/LyXImage_X.h:
2081 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2082 version of LyXImage, this uses the Xlib Pixmap.
2084 * src/PainterBase.h:
2085 * src/PainterBase.C:
2087 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2088 replacement to Pixmap.
2090 * src/insets/insetgraphics.h:
2091 * src/insets/insetgraphics.C:
2092 * src/graphics/GraphicsCacheItem.h:
2093 * src/graphics/GraphicsCacheItem.C:
2094 * src/graphics/GraphicsCacheItem_pimpl.h:
2095 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2098 * src/graphics/GraphicsCacheItem.h:
2099 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2100 another copy of the object.
2102 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2103 of cacheHandle, this fixed a bug that sent LyX crashing.
2105 * src/graphics/XPM_Renderer.h:
2106 * src/graphics/XPM_Renderer.C:
2107 * src/graphics/EPS_Renderer.h:
2108 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2110 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2112 * src/lyxfunc.C (processKeySym): only handle the
2113 lockinginset/inset stuff if we have a buffer and text loaded...
2115 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2117 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2119 * src/support/lyxfunctional.h: add operator= that takes a reference
2121 * src/lyxserver.C (mkfifo): make first arg const
2123 * src/layout.h: renamed name(...) to setName(...) to work around
2126 * src/buffer.C (setFileName): had to change name of function to
2127 work around bugs in egcs. (renamed from fileName)
2129 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2131 * src/support/translator.h: move helper template classes to
2132 lyxfunctional.h, include "support/lyxfunctional.h"
2134 * src/support/lyxmanip.h: add delaration of fmt
2136 * src/support/lyxfunctional.h: new file
2137 (class_fun_t): new template class
2138 (class_fun): helper template function
2139 (back_insert_fun_iterator): new template class
2140 (back_inserter_fun): helper template function
2141 (compare_memfun_t): new template class
2142 (compare_memfun): helper template function
2143 (equal_1st_in_pair): moved here from translator
2144 (equal_2nd_in_pair): moved here from translator
2146 * src/support/fmt.C: new file
2147 (fmt): new func, can be used for a printf substitute when still
2148 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2150 * src/support/StrPool.C: add some comments
2152 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2155 * src/insets/figinset.C (addpidwait): use std::copy with
2156 ostream_iterator to fill the pidwaitlist
2158 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2160 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2163 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2166 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2168 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2169 (class_update): ditto
2170 (BulletPanel): ditto
2171 (CheckChoiceClass): move initialization of tc and tct
2173 * src/tabular.C: remove current_view
2174 (OldFormatRead): similar to right below [istream::ignore]
2176 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2177 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2178 unused [istream::ignore]
2180 * src/lyxfunc.C: include "support/lyxfunctional.h"
2181 (getInsetByCode): use std::find_if and compare_memfun
2183 * src/lyxfont.C (stateText): remove c_str()
2185 * src/lyx_main.C (setDebuggingLevel): make static
2186 (commandLineHelp): make static
2188 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2189 Screen* together with fl_get_display() and fl_screen
2191 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2192 togheter with fl_get_display() and fl_screen
2193 (create_forms): remove c_str()
2195 * src/layout.C: include "support/lyxfunctional.h"
2196 (hasLayout): use std::find_if and compare_memfun
2197 (GetLayout): use std::find_if and comapre_memfun
2198 (delete_layout): use std::remove_if and compare_memfun
2199 (NumberOfClass): use std:.find_if and compare_memfun
2201 * src/gettext.h: change for the new functions
2203 * src/gettext.C: new file, make _(char const * str) and _(string
2204 const & str) real functions.
2206 * src/font.C (width): rewrite slightly to avoid one extra variable
2208 * src/debug.C: initialize Debug::ANY here
2210 * src/commandtags.h: update number comments
2212 * src/combox.h (get): make const func
2214 (getline): make const
2216 * src/combox.C (input_cb): handle case where fl_get_input can
2219 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2220 "support/lyxfunctional.h", remove current_view variable.
2221 (resize): use std::for_each with std::mem_fun
2222 (getFileNames): use std::copy with back_inserter_fun
2223 (getBuffer): change arg type to unsigned int
2224 (emergencyWriteAll): call emergencyWrite with std::for_each and
2226 (emergencyWrite): new method, the for loop in emergencyWriteAll
2228 (exists): use std::find_if with compare_memfun
2229 (getBuffer): use std::find_if and compare_memfun
2231 * src/buffer.h: add typedefs for iterator_category, value_type
2232 difference_type, pointer and reference for inset_iterator
2233 add postfix ++ for inset_iterator
2234 make inset_iterator::getPos() const
2236 * src/buffer.C: added support/lyxmanip.h
2237 (readFile): use lyxerr << fmt instead of printf
2238 (makeLaTeXFile): use std::copy to write out encodings
2240 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2242 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2243 free and the char * temp.
2244 (hasMenu): use std::find_if and compare_memfun
2247 * src/Makefile.am (lyx_SOURCES): added gettext.C
2249 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2250 string::insert small change to avoid temporary
2252 * src/LColor.C (getGUIName): remove c_str()
2254 * several files: change all occurrences of fl_display to
2257 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2258 that -pedantic is not used for gcc 2.97 (cvs gcc)
2260 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2262 2000-10-11 Allan Rae <rae@lyx.org>
2264 * src/frontends/xforms/FormPreferences.C (input): template path must be
2265 a readable directory. It doesn't need to be writeable.
2266 (build, delete, update, apply): New inputs in the various tabfolders
2268 * src/frontends/xforms/forms/form_preferences.fd:
2269 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2270 several new entries to existing folders. Shuffled some existing stuff
2273 * src/frontends/xforms/forms/form_print.fd:
2274 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2275 Should probably rework PrinterParams as well. Note that the switch to
2276 collated is effectively the same as !unsorted so changing PrinterParams
2277 will require a lot of fiddly changes to reverse the existing logic.
2279 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2281 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2283 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2285 2000-10-10 Allan Rae <rae@lyx.org>
2288 * src/lyxfunc.C (Dispatch):
2290 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2293 * src/lyxrc.C (output): Only write the differences between system lyxrc
2294 and the users settings.
2297 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2299 I'll rewrite this later, after 1.1.6 probably, to keep a single
2300 LyXRC but two instances of a LyXRCStruct.
2302 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2304 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2306 * src/tabular.h: add a few std:: qualifiers.
2308 * src/encoding.C: add using directive.
2309 * src/language.C: ditto.
2311 * src/insets/insetquotes.C (Validate): use languages->lang()
2312 instead of only language.
2314 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2316 * lib/languages: New file.
2318 * lib/encodings: New file.
2320 * src/language.C (Languages): New class.
2321 (read): New method. Reads the languages from the 'languages' file.
2323 * src/encoding.C (Encodings): New class.
2324 (read): New method. Reads the encodings from the 'encodings' file.
2326 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2329 * src/bufferparams.h and a lot of files: Deleted the member language,
2330 and renamed language_info to language
2332 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2333 * src/lyxfont.C (latexWriteStartChanges): ditto.
2334 * src/paragraph.C (validate,TeXOnePar): ditto.
2336 * src/lyxfont.C (update): Restored deleted code.
2338 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2340 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2342 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2344 * src/insets/figinset.[Ch]:
2345 * src/insets/insetinclude.[Ch]:
2346 * src/insets/insetinclude.[Ch]:
2347 * src/insets/insetparent.[Ch]:
2348 * src/insets/insetref.[Ch]:
2349 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2351 * src/insets/*.[Ch]:
2352 * src/mathed/formula.[Ch]:
2353 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2355 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2356 * src/lyx_cb.C (FigureApplyCB):
2357 * src/lyxfunc.C (getStatus, Dispatch):
2358 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2361 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2363 * src/converter.[Ch] (Formats::View):
2364 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2366 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2367 *current_view->buffer(). This will change later, but this patch is way
2370 2000-10-09 Juergen Vigna <jug@sad.it>
2372 * src/text.C (GetRow): small fix.
2374 * src/BufferView_pimpl.C (cursorPrevious):
2375 (cursorNext): added LyXText parameter to function.
2377 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2378 keypress depending on cursor position.
2380 2000-10-06 Juergen Vigna <jug@sad.it>
2382 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2383 (copySelection): redone this function and also copy ascii representa-
2386 * src/tabular.C (Ascii):
2390 (print_n_chars): new functions to realize the ascii export of tabulars.
2392 2000-10-05 Juergen Vigna <jug@sad.it>
2394 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2395 if we don't have a buffer.
2397 2000-10-10 Allan Rae <rae@lyx.org>
2399 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2400 with closing dialog. It seems that nested tabfolders require hiding
2401 of inner tabfolders before hiding the dialog itself. Actually all I
2402 did was hide the active outer folder.
2404 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2405 unless there really is a buffer. hideBufferDependent is called
2408 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2409 POTFILES.in stays in $(srcdir).
2411 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2413 * lib/lyxrc.example: Few changes.
2415 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2417 * src/BufferView_pimpl.C (buffer): only need one the
2418 updateBufferDependent signal to be emitted once! Moved to the end of
2419 the method to allow bv_->text to be updated first.
2421 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2422 and hSignal_ with Dialogs * and BufferDependency variables.
2423 New Buffer * parent_, initialised when the dialog is launched. Used to
2424 check whether to update() or hide() dialog in the new, private
2425 updateOrHide() method that is connected to the updateBufferDependent
2426 signal. Daughter classes dictate what to do using the
2427 ChangedBufferAction enum, passed to the c-tor.
2429 * src/frontends/xforms/FormCitation.C:
2430 * src/frontends/xforms/FormCommand.C:
2431 * src/frontends/xforms/FormCopyright.C:
2432 * src/frontends/xforms/FormDocument.C:
2433 * src/frontends/xforms/FormError.C:
2434 * src/frontends/xforms/FormIndex.C:
2435 * src/frontends/xforms/FormPreferences.C:
2436 * src/frontends/xforms/FormPrint.C:
2437 * src/frontends/xforms/FormRef.C:
2438 * src/frontends/xforms/FormToc.C:
2439 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2442 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2443 ChangedBufferAction enum.
2445 * src/frontends/xforms/FormParagraph.[Ch]
2446 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2449 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2451 * lib/bind/cua.bind: fix a bit.
2452 * lib/bind/emacs.bind: ditto.
2454 * lib/bind/menus.bind: remove real menu entries from there.
2456 * src/spellchecker.C: make sure we only include strings.h when
2459 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2461 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2462 function. It enlarges the maximum number of pup when needed.
2463 (add_toc2): Open a new menu if maximum number of items per menu has
2466 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2468 * src/frontends/kde/FormPrint.C: fix error reporting
2470 * src/frontends/xforms/FormDocument.C: fix compiler
2473 * lib/.cvsignore: add Literate.nw
2475 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2478 * bufferview_funcs.[Ch]
2481 * text2.C: Add support for numbers in RTL text.
2483 2000-10-06 Allan Rae <rae@lyx.org>
2485 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2486 to be gettext.m4 friendly again. ext_l10n.h is now
2487 generated into $top_srcdir instead of $top_builddir
2488 so that lyx.pot will be built correctly -- without
2489 duplicate parsing of ext_l10n.h.
2491 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2493 * src/frontends/kde/FormCitation.C: make the dialog
2494 behave more sensibly
2496 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2498 * config/kde.m4: fix consecutive ./configure runs,
2499 look for qtarch, fix library order
2501 * src/frontends/kde/Makefile.am: tidy up,
2502 add Print dialog, add .dlg dependencies
2504 * src/frontends/kde/FormPrint.C:
2505 * src/frontends/kde/FormPrint.h:
2506 * src/frontends/kde/formprintdialog.C:
2507 * src/frontends/kde/formprintdialog.h:
2508 * src/frontends/kde/formprintdialogdata.C:
2509 * src/frontends/kde/formprintdialogdata.h:
2510 * src/frontends/kde/dlg/formprintdialog.dlg: add
2513 * src/frontends/kde/dlg/README: Added explanatory readme
2515 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2516 script to double-check qtarch's output
2518 * src/frontends/kde/formindexdialog.C:
2519 * src/frontends/kde/formindexdialogdata.C:
2520 * src/frontends/kde/formindexdialogdata.h:
2521 * src/frontends/kde/dlg/formindexdialog.dlg: update
2522 for qtarch, minor fixes
2524 2000-10-05 Allan Rae <rae@lyx.org>
2526 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2527 dialogs when switching buffers update them instead. It's up to each
2528 dialog to decide if it should still be visible or not.
2529 update() should return a bool to control visiblity within show().
2530 Or perhaps better to set a member variable and use that to control
2533 * lib/build-listerrors: create an empty "listerrors" file just to stop
2534 make trying to regenerate it all the time if you don't have noweb
2537 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2539 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2540 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2541 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2542 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2543 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2545 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2547 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2549 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2550 deleting buffer. Closes all buffer-dependent dialogs.
2552 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2554 * src/frontends/xforms/FormCitation.[Ch]:
2555 * src/frontends/xforms/FormPreferences.[Ch]:
2556 * src/frontends/xforms/FormPrint.[Ch]:
2557 * src/frontends/xforms/FormRef.[Ch]:
2558 * src/frontends/xforms/FormUrl.[Ch]: ditto
2560 * src/frontends/xforms/FormDocument.[Ch]:
2561 * src/frontends/xforms/forms/form_document.C.patch:
2562 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2563 pass through a single input() function.
2565 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2567 * lib/build-listerrors: return status as OK
2569 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2571 * lib/lyxrc.example: Updated to new export code
2573 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2575 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2578 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2581 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2582 LyX-Code is defined.
2583 * lib/layouts/amsbook.layout: ditto.
2585 * boost/Makefile.am: fix typo.
2587 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2589 (add_lastfiles): removed.
2590 (add_documents): removed.
2591 (add_formats): removed.
2593 * src/frontends/Menubar.C: remove useless "using" directive.
2595 * src/MenuBackend.h: add a new MenuItem constructor.
2597 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2600 2000-10-04 Allan Rae <rae@lyx.org>
2602 * lib/Makefile.am (listerrors):
2603 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2604 I haven't got notangle installed so Kayvan please test. The output
2605 should end up in $builddir. This also allows people who don't have
2606 noweb installed to complete the make process without error.
2608 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2609 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2610 by JMarc's picky compiler.
2612 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2615 * src/insets/insettabular.C (setPos): change for loop to not use
2616 sequencing operator. Please check this Jürgen.
2618 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2620 * src/insets/insetcite.C (getScreenLabel): ditto
2621 * src/support/filetools.C (QuoteName): ditto
2622 (ChangeExtension): ditto
2624 * src/BufferView_pimpl.C (scrollCB): make heigt int
2626 * src/BufferView2.C (insertInset): comment out unused arg
2628 * boost/Makefile.am (EXTRADIST): new variable
2630 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2632 * src/exporter.C (IsExportable): Fixed
2634 * lib/configure.m4: Small fix
2636 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2638 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2639 * src/insets/insetbib.C (bibitemWidest): ditto.
2640 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2642 2000-10-03 Juergen Vigna <jug@sad.it>
2644 * src/BufferView2.C (theLockingInset): removed const because of
2645 Agnus's compile problems.
2647 * src/insets/insettext.C (LocalDispatch): set the language of the
2648 surronding paragraph on inserting the first character.
2650 * various files: changed use of BufferView::the_locking_inset.
2652 * src/BufferView2.C (theLockingInset):
2653 (theLockingInset): new functions.
2655 * src/BufferView.h: removed the_locking_inset.
2657 * src/lyxtext.h: added the_locking_inset
2659 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2661 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2663 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2665 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2666 * src/mathed/math_cursor.C (IsAlpha): ditto.
2667 * src/mathed/math_inset.C (strnew): ditto.
2668 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2669 (IMetrics): cxp set but never used; removed.
2670 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2671 that the variable in question has been removed also!
2674 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2675 using the Buffer * passed to Latex(), using the BufferView * passed to
2676 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2678 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2679 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2681 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2682 * src/buffer.C (readInset): used new InsetBibtex c-tor
2683 * (getBibkeyList): used new InsetBibtex::getKeys
2685 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2688 * lib/build-listerrors
2690 * src/exporter.C: Add literate programming support to the export code
2693 * src/lyx_cb.C: Remove old literate code.
2695 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2698 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2699 * src/converter.C (View, Convert): Use QuoteName.
2701 * src/insets/figinset.C (Preview): Use Formats::View.
2703 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2705 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2707 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2708 the top of the function, because compaq cxx complains that the
2709 "goto exit_with_message" when the function is disabled bypasses
2711 (MenuNew): try a better fix for the generation of new file names.
2712 This time, I used AddName() instead of AddPath(), hoping Juergen
2715 2000-10-03 Allan Rae <rae@lyx.org>
2717 * src/frontends/xforms/forms/form_preferences.fd:
2718 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2719 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2720 "Look and Feel"->"General" but will need to be split up further into
2721 general output and general input tabs. Current plan is for four outer
2722 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2723 stuff; "Inputs" for input and import configuration; "Outputs" for
2724 output and export configuration; and one more whatever is left over
2725 called "General". The leftovers at present look like being which
2726 viewers to use, spellchecker, language support and might be better
2727 named "Support". I've put "Paths" in "Inputs" for the moment as this
2728 seems reasonable for now at least.
2729 One problem remains: X error kills LyX when you close Preferences.
2731 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2733 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2734 qualifier from form()
2735 * src/frontends/xforms/FormCitation.[Ch]:
2736 * src/frontends/xforms/FormCopyright.[Ch]:
2737 * src/frontends/xforms/FormDocument.[Ch]:
2738 * src/frontends/xforms/FormError.[Ch]:
2739 * src/frontends/xforms/FormIndex.[Ch]:
2740 * src/frontends/xforms/FormPreferences.[Ch]:
2741 * src/frontends/xforms/FormPrint.[Ch]:
2742 * src/frontends/xforms/FormRef.[Ch]:
2743 * src/frontends/xforms/FormToc.[Ch]:
2744 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2746 * src/frontends/xforms/FormCitation.[Ch]:
2747 * src/frontends/xforms/FormIndex.[Ch]:
2748 * src/frontends/xforms/FormRef.[Ch]:
2749 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2750 with Allan's naming policy
2752 * src/frontends/xforms/FormCitation.C: some static casts to remove
2755 2000-10-02 Juergen Vigna <jug@sad.it>
2757 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2758 now you can type or do stuff inside the table-cell also when in dummy
2759 position, fixed visible cursor.
2761 * src/insets/insettext.C (Edit): fixing cursor-view position.
2763 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2764 be used for equal functions in lyxfunc and insettext.
2766 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2768 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2770 * src/frontends/gnome/FormCitation.h:
2771 * src/frontends/gnome/FormCopyright.h:
2772 * src/frontends/gnome/FormIndex.h:
2773 * src/frontends/gnome/FormPrint.h:
2774 * src/frontends/gnome/FormToc.h:
2775 * src/frontends/gnome/FormUrl.h:
2776 * src/frontends/kde/FormCitation.h:
2777 * src/frontends/kde/FormCopyright.h:
2778 * src/frontends/kde/FormIndex.h:
2779 * src/frontends/kde/FormRef.h:
2780 * src/frontends/kde/FormToc.h:
2781 * src/frontends/kde/FormUrl.h: fix remaining users of
2784 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2786 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2787 from depth argument.
2788 (DocBookHandleCaption): ditto.
2789 (DocBookHandleFootnote): ditto.
2790 (SimpleDocBookOnePar): ditto.
2792 * src/frontends/xforms/FormDocument.h (form): remove extra
2793 FormDocument:: qualifier.
2795 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2797 * sigc++/handle.h: ditto.
2799 * src/lyx_gui_misc.C: add "using" directive.
2801 * src/cheaders/cstddef: new file, needed by the boost library (for
2804 2000-10-02 Juergen Vigna <jug@sad.it>
2806 * src/insets/insettext.C (SetFont): better support.
2808 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2810 * src/screen.C (DrawOneRow): some uint refixes!
2812 2000-10-02 Allan Rae <rae@lyx.org>
2814 * boost/.cvsignore: ignore Makefile as well
2816 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2817 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2819 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2820 Left this one out by accident.
2822 * src/frontends/xforms/FormBase.h (restore): default to calling
2823 update() since that will restore the original/currently-applied values.
2824 Any input() triggered error messages will require the derived classes
2825 to redefine restore().
2827 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2828 avoid a segfault. combo_doc_class is the main concern.
2830 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2832 * Simplify build-listerrors in view of GUI-less export ability!
2834 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2836 * src/lyx_main.C (easyParse): Disable gui when exporting
2838 * src/insets/figinset.C:
2841 * src/lyx_gui_misc.C
2842 * src/tabular.C: Changes to allow no-gui.
2844 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2846 * src/support/utility.hpp: removed file
2847 * src/support/block.h: removed file
2849 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2852 * src/mathed/formula.C: add support/lyxlib.h
2853 * src/mathed/formulamacro.C: ditto
2855 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2856 * src/lyxparagraph.h: ditto
2858 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2859 * src/frontends/Makefile.am (INCLUDES): ditto
2860 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2861 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2862 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2863 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2864 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2865 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2867 * src/BufferView.h: use boost/utility.hpp
2868 * src/LColor.h: ditto
2869 * src/LaTeX.h: ditto
2870 * src/LyXAction.h: ditto
2871 * src/LyXView.h: ditto
2872 * src/bufferlist.h: ditto
2873 * src/lastfiles.h: ditto
2874 * src/layout.h: ditto
2875 * src/lyx_gui.h: ditto
2876 * src/lyx_main.h: ditto
2877 * src/lyxlex.h: ditto
2878 * src/lyxrc.h: ditto
2879 * src/frontends/ButtonPolicies.h: ditto
2880 * src/frontends/Dialogs.h: ditto
2881 * src/frontends/xforms/FormBase.h: ditto
2882 * src/frontends/xforms/FormGraphics.h: ditto
2883 * src/frontends/xforms/FormParagraph.h: ditto
2884 * src/frontends/xforms/FormTabular.h: ditto
2885 * src/graphics/GraphicsCache.h: ditto
2886 * src/graphics/Renderer.h: ditto
2887 * src/insets/ExternalTemplate.h: ditto
2888 * src/insets/insetcommand.h: ditto
2889 * src/support/path.h: ditto
2891 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2892 and introduce clause for 2.97.
2894 * boost/libs/README: new file
2896 * boost/boost/utility.hpp: new file
2898 * boost/boost/config.hpp: new file
2900 * boost/boost/array.hpp: new file
2902 * boost/Makefile.am: new file
2904 * boost/.cvsignore: new file
2906 * configure.in (AC_OUTPUT): add boost/Makefile
2908 * Makefile.am (SUBDIRS): add boost
2910 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2912 * src/support/lstrings.C (suffixIs): Fixed.
2914 2000-10-01 Allan Rae <rae@lyx.org>
2916 * src/PrinterParams.h: moved things around to avoid the "can't
2917 inline call" warning.
2919 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2920 into doc++ documentation.
2922 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2924 * src/frontends/xforms/FormRef.C: make use of button controller
2925 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2926 cleaned up button controller usage.
2927 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2928 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2929 use the button controller
2931 * src/frontends/xforms/forms/*.fd: and associated generated files
2932 updated to reflect changes to FormBase. Some other FormXxxx files
2933 also got minor updates to reflect changes to FormBase.
2935 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2936 (hide): made virtual.
2937 (input): return a bool. true == valid input
2938 (RestoreCB, restore): new
2939 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2940 Changes to allow derived dialogs to use a ButtonController and
2941 make sense when doing so: OK button calls ok() and so on.
2943 * src/frontends/xforms/ButtonController.h (class ButtonController):
2944 Switch from template implementation to taking Policy parameter.
2945 Allows FormBase to provide a ButtonController for any dialog.
2947 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2948 Probably should rename connect and disconnect.
2949 (apply): use the radio button groups
2950 (form): needed by FormBase
2951 (build): setup the radio button groups
2953 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2955 * several files: type changes to reduce the number of warnings and
2956 to unify type hangling a bit. Still much to do.
2958 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2960 * lib/images/*: rename a bunch of icons to match Dekel converter
2963 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2966 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2968 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2970 * sigc++/handle.h: ditto for class Handle.
2972 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2974 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2976 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2978 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2979 removal of the "default" language.
2981 * src/combox.h (getline): Check that sel > 0
2983 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2985 * lib/examples/docbook_example.lyx
2986 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2988 * lib/layouts/docbook-book.layout: new docbook book layout.
2990 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2992 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2994 * src/insets/figinset.C (DocBook):fixed small typo.
2996 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2998 * src/insets/insetinclude.h: string include_label doesn't need to be
3001 2000-09-29 Allan Rae <rae@lyx.org>
3003 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3004 Allow derived type to control connection and disconnection from signals
3005 of its choice if desired.
3007 2000-09-28 Juergen Vigna <jug@sad.it>
3009 * src/insets/insettabular.C (update): fixed cursor setting when
3010 the_locking_inset changed.
3011 (draw): made this a bit cleaner.
3012 (InsetButtonPress): fixed!
3014 * various files: added LyXText Parameter to fitCursor call.
3016 * src/BufferView.C (fitCursor): added LyXText parameter.
3018 * src/insets/insettabular.C (draw): small draw fix.
3020 * src/tabular.C: right setting of left/right celllines.
3022 * src/tabular.[Ch]: fixed various types in funcions and structures.
3023 * src/insets/insettabular.C: ditto
3024 * src/frontends/xforms/FormTabular.C: ditto
3026 2000-09-28 Allan Rae <rae@lyx.org>
3028 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3029 that the #ifdef's had been applied to part of what should have been
3030 a complete condition. It's possible there are other tests that
3031 were specific to tables that are also wrong now that InsetTabular is
3032 being used. Now we need to fix the output of '\n' after a table in a
3033 float for the same reason as the original condition:
3034 "don't insert this if we would be adding it before or after a table
3035 in a float. This little trick is needed in order to allow use of
3036 tables in \subfigures or \subtables."
3037 Juergen can you check this?
3039 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3041 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3042 output to the ostream.
3044 * several files: fixed types based on warnings from cxx
3046 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3048 * src/frontends/kde/Makefile.am: fix rule for
3049 formindexdialogdata_moc.C
3051 * src/.cvsignore: add ext_l10n.h to ignore
3053 * acconfig.h: stop messing with __STRICT_ANSI__
3054 * config/gnome.m4: remove option to set -ansi
3055 * config/kde.m4: remove option to set -ansi
3056 * config/lyxinclude.m4: don't set -ansi
3058 2000-09-27 Juergen Vigna <jug@sad.it>
3060 * various files: remove "default" language check.
3062 * src/insets/insetquotes.C: removed use of current_view.
3064 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3065 the one should have red ears by now!
3067 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3068 in more then one paragraph. Fixed cursor-movement/selection.
3070 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3071 paragraphs inside a text inset.
3073 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3074 text-inset if this owner is an inset.
3076 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3078 * src/Bullet.h: changed type of font, character and size to int
3080 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3082 * src/insets/inseturl.[Ch]:
3083 * src/insets/insetref.[Ch]:
3084 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3086 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3088 * src/buffer.C (readFile): block-if statement rearranged to minimise
3089 bloat. Patch does not reverse Jean-Marc's change ;-)
3091 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3092 Class rewritten to store pointers to hide/update signals directly,
3093 rather than Dialogs *. Also defined an enum to ease use. All xforms
3094 forms can now be derived from this class.
3096 * src/frontends/xforms/FormCommand.[Ch]
3097 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3099 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3102 * src/frontends/xforms/forms/form_citation.fd
3103 * src/frontends/xforms/forms/form_copyright.fd
3104 * src/frontends/xforms/forms/form_error.fd
3105 * src/frontends/xforms/forms/form_index.fd
3106 * src/frontends/xforms/forms/form_ref.fd
3107 * src/frontends/xforms/forms/form_toc.fd
3108 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3110 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3112 * src/insets/insetfoot.C: removed redundent using directive.
3114 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3116 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3117 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3119 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3120 created in the constructors in different groups. Then set() just
3121 have to show the groups as needed. This fixes the redraw problems
3122 (and is how the old menu code worked).
3124 * src/support/lyxlib.h: declare the methods as static when we do
3125 not have namespaces.
3127 2000-09-26 Juergen Vigna <jug@sad.it>
3129 * src/buffer.C (asciiParagraph): new function.
3130 (writeFileAscii): new function with parameter ostream.
3131 (writeFileAscii): use now asciiParagraph.
3133 * various inset files: added the linelen parameter to the Ascii-func.
3135 * src/tabular.C (Write): fixed error in writing file introduced by
3136 the last changes from Lars.
3138 * lib/bind/menus.bind: removed not supported functions.
3140 * src/insets/insettext.C (Ascii): implemented this function.
3142 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3144 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3145 (Write): use of the write_attribute functions.
3147 * src/bufferlist.C (close): fixed reasking question!
3149 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3151 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3152 new files use the everwhere possible.
3155 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3156 src/log_form.C src/lyx.C:
3159 * src/buffer.C (runLaTeX): remove func
3161 * src/PaperLayout.C: removed file
3162 * src/ParagraphExtra.C: likewise
3163 * src/bullet_forms.C: likewise
3164 * src/bullet_forms.h: likewise
3165 * src/bullet_forms_cb.C: likewise
3167 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3168 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3171 * several files: remove all traces of the old fd_form_paragraph,
3172 and functions belonging to that.
3174 * several files: remove all traces of the old fd_form_document,
3175 and functions belonging to that.
3177 * several files: constify local variables were possible.
3179 * several files: remove all code that was dead when NEW_EXPORT was
3182 * several files: removed string::c_str in as many places as
3185 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3186 (e): be a bit more outspoken when patching
3187 (updatesrc): only move files if changed.
3189 * forms/layout_forms.h.patch: regenerated
3191 * forms/layout_forms.fd: remove form_document and form_paragraph
3192 and form_quotes and form_paper and form_table_options and
3193 form_paragraph_extra
3195 * forms/form1.fd: remove form_table
3197 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3198 the fdui->... rewrite. Update some comments to xforms 0.88
3200 * forms/bullet_forms.C.patch: removed file
3201 * forms/bullet_forms.fd: likewise
3202 * forms/bullet_forms.h.patch: likewise
3204 * development/Code_rules/Rules: added a section on switch
3205 statements. Updated some comment to xforms 0.88.
3207 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3209 * src/buffer.C (readFile): make sure that the whole version number
3210 is read after \lyxformat (even when it contains a comma)
3212 * lib/ui/default.ui: change shortcut of math menu to M-a.
3214 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3216 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3219 * src/LyXView.C (updateWindowTitle): show the full files name in
3220 window title, limited to 30 characters.
3222 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3223 When a number of characters has been given, we should not assume
3224 that the string is 0-terminated.
3226 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3227 calls (fixes some memory leaks)
3229 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3230 trans member on exit.
3232 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3234 * src/converter.C (GetReachable): fix typo.
3236 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3237 understand ',' instead of '.'.
3238 (GetInteger): rewrite to use strToInt().
3240 2000-09-26 Juergen Vigna <jug@sad.it>
3242 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3243 better visibility and error-message on wrong VSpace input.
3245 * src/language.C (initL): added english again.
3247 2000-09-25 Juergen Vigna <jug@sad.it>
3249 * src/frontends/kde/Dialogs.C (Dialogs):
3250 * src/frontends/gnome/Dialogs.C (Dialogs):
3251 * src/frontends/kde/Makefile.am:
3252 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3254 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3256 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3258 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3260 * src/frontends/xforms/FormParagraph.C:
3261 * src/frontends/xforms/FormParagraph.h:
3262 * src/frontends/xforms/form_paragraph.C:
3263 * src/frontends/xforms/form_paragraph.h:
3264 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3267 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3269 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3270 Paragraph-Data after use.
3272 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3273 non breakable paragraphs.
3275 2000-09-25 Garst R. Reese <reese@isn.net>
3277 * src/language.C (initL): added missing language_country codes.
3279 2000-09-25 Juergen Vigna <jug@sad.it>
3281 * src/insets/insettext.C (InsetText):
3282 (deleteLyXText): remove the not released LyXText structure!
3284 2000-09-24 Marko Vendelin <markov@ioc.ee>
3286 * src/frontends/gnome/mainapp.C
3287 * src/frontends/gnome/mainapp.h: added support for keyboard
3290 * src/frontends/gnome/FormCitation.C
3291 * src/frontends/gnome/FormCitation.h
3292 * src/frontends/gnome/Makefile.am
3293 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3294 FormCitation to use "action area" in mainapp window
3296 * src/frontends/gnome/Menubar_pimpl.C
3297 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3300 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3302 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3303 width/descent/ascent values if name is empty.
3304 (mathed_string_height): Use std::max.
3306 2000-09-25 Allan Rae <rae@lyx.org>
3308 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3309 segfault. This will be completely redesigned soon.
3311 * sigc++: updated libsigc++. Fixes struct timespec bug.
3313 * development/tools/makeLyXsigc.sh: .cvsignore addition
3315 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3317 * several files: removed almost all traces of the old table
3320 * src/TableLayout.C: removed file
3322 2000-09-22 Juergen Vigna <jug@sad.it>
3324 * src/frontends/kde/Dialogs.C: added credits forms.
3326 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3328 * src/frontends/gnome/Dialogs.C: added some forms.
3330 * src/spellchecker.C (init_spell_checker): set language in pspell code
3331 (RunSpellChecker): some modifications for setting language string.
3333 * src/language.[Ch]: added language_country code.
3335 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3337 * src/frontends/Dialogs.h: added new signal showError.
3338 Rearranged existing signals in some sort of alphabetical order.
3340 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3341 FormError.[Ch], form_error.[Ch]
3342 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3343 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3345 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3346 dialogs. I think that this can be used as the base to all these
3349 * src/frontends/xforms/FormError.[Ch]
3350 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3351 implementation of InsetError dialog.
3353 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3355 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3356 * src/frontends/kde/Makefile.am: ditto
3358 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3360 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3361 macrobf. This fixes a bug of invisible text.
3363 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3365 * lib/doc/LaTeXConfig.lyx.in: updated.
3367 * src/language.C (initL): remove language "francais" and change a
3368 bit the names of the two other french variations.
3370 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3371 string that may not be 0-terminated.
3373 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3375 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3377 2000-09-20 Marko Vendelin <markov@ioc.ee>
3379 * src/frontends/gnome/FormCitation.C
3380 * src/frontends/gnome/FormIndex.C
3381 * src/frontends/gnome/FormToc.C
3382 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3383 the variable initialization to shut up the warnings
3385 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3387 * src/table.[Ch]: deleted files
3389 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3392 2000-09-18 Juergen Vigna <jug@sad.it>
3394 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3395 problems with selection. Inserted new LFUN_PASTESELECTION.
3396 (InsetButtonPress): inserted handling of middle mouse-button paste.
3398 * src/spellchecker.C: changed word to word.c_str().
3400 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3402 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3403 included in the ``make dist'' tarball.
3405 2000-09-15 Juergen Vigna <jug@sad.it>
3407 * src/CutAndPaste.C (cutSelection): small fix return the right
3408 end position after cut inside one paragraph only.
3410 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3411 we are locked as otherwise we don't have a valid cursor position!
3413 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3415 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3417 * src/frontends/kde/FormRef.C: added using directive.
3418 * src/frontends/kde/FormToc.C: ditto
3420 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3422 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3424 2000-09-19 Marko Vendelin <markov@ioc.ee>
3426 * src/frontends/gnome/Menubar_pimpl.C
3427 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3428 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3430 * src/frontends/gnome/mainapp.C
3431 * src/frontends/gnome/mainapp.h: support for menu update used
3434 * src/frontends/gnome/mainapp.C
3435 * src/frontends/gnome/mainapp.h: support for "action" area in the
3436 main window. This area is used by small simple dialogs, such as
3439 * src/frontends/gnome/FormIndex.C
3440 * src/frontends/gnome/FormIndex.h
3441 * src/frontends/gnome/FormUrl.C
3442 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3445 * src/frontends/gnome/FormCitation.C
3446 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3447 action area. Only "Insert new citation" is implemented.
3449 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3451 * src/buffer.C (Dispatch): fix call to Dispatch
3452 * src/insets/insetref.C (Edit): likewise
3453 * src/insets/insetparent.C (Edit): likewise
3454 * src/insets/insetinclude.C (include_cb): likewise
3455 * src/frontends/xforms/FormUrl.C (apply): likewise
3456 * src/frontends/xforms/FormToc.C (apply): likewise
3457 * src/frontends/xforms/FormRef.C (apply): likewise
3458 * src/frontends/xforms/FormIndex.C (apply): likewise
3459 * src/frontends/xforms/FormCitation.C (apply): likewise
3460 * src/lyxserver.C (callback): likewise
3461 * src/lyxfunc.C (processKeySym): likewise
3462 (Dispatch): likewise
3463 (Dispatch): likewise
3464 * src/lyx_cb.C (LayoutsCB): likewise
3466 * Makefile.am (sourcedoc): small change
3468 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3470 * src/main.C (main): Don't make an empty GUIRunTime object. all
3471 methods are static. constify a bit remove unneded using + headers.
3473 * src/tabular.C: some more const to local vars move some loop vars
3475 * src/spellchecker.C: added some c_str after some word for pspell
3477 * src/frontends/GUIRunTime.h: add new static method setDefaults
3478 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3479 * src/frontends/kde/GUIRunTime.C (setDefaults):
3480 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3482 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3483 with strnew in arg, use correct emptystring when calling SetName.
3485 * several files: remove all commented code with relation to
3486 HAVE_SSTREAM beeing false. We now only support stringstream and
3489 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3491 * src/lyxfunc.C: construct correctly the automatic new file
3494 * src/text2.C (IsStringInText): change type of variable i to shut
3497 * src/support/sstream.h: do not use namespaces if the compiler
3498 does not support them.
3500 2000-09-15 Marko Vendelin <markov@ioc.ee>
3501 * src/frontends/gnome/FormCitation.C
3502 * src/frontends/gnome/FormCitation.h
3503 * src/frontends/gnome/diainsertcitation_interface.c
3504 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3505 regexp support to FormCitation [Gnome].
3507 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3510 * configure.in: remove unused KDE/GTKGUI define
3512 * src/frontends/kde/FormRef.C
3513 * src/frontends/kde/FormRef.h
3514 * src/frontends/kde/formrefdialog.C
3515 * src/frontends/kde/formrefdialog.h: double click will
3516 go to reference, now it is possible to change a cross-ref
3519 * src/frontends/kde/FormToc.C
3520 * src/frontends/kde/FormToc.h
3521 * src/frontends/kde/formtocdialog.C
3522 * src/frontends/kde/formtocdialog.h: add a depth
3525 * src/frontends/kde/Makefile.am: add QtLyXView.h
3528 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3530 * src/frontends/kde/FormCitation.h: added some using directives.
3532 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3534 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3537 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3540 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3542 * src/buffer.C (pop_tag): revert for the second time a change by
3543 Lars, who seems to really hate having non-local loop variables :)
3545 * src/Lsstream.h: add "using" statements.
3547 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3548 * src/buffer.C (writeFile): ditto
3550 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3552 * src/buffer.C (writeFile): try to fix the locale modified format
3553 number to always be as we want it.
3555 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3556 in XForms 0.89. C-space is now working again.
3558 * src/Lsstream.h src/support/sstream.h: new files.
3560 * also commented out all cases where strstream were used.
3562 * src/Bullet.h (c_str): remove method.
3564 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3566 * a lot of files: get rid of "char const *" and "char *" is as
3567 many places as possible. We only want to use them in interaction
3568 with system of other libraries, not inside lyx.
3570 * a lot of files: return const object is not of pod type. This
3571 helps ensure that temporary objects is not modified. And fits well
3572 with "programming by contract".
3574 * configure.in: check for the locale header too
3576 * Makefile.am (sourcedoc): new tag for generation of doc++
3579 2000-09-14 Juergen Vigna <jug@sad.it>
3581 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3582 callback to check which combo called it and do the right action.
3584 * src/combox.C (combo_cb): added combo * to the callbacks.
3585 (Hide): moved call of callback after Ungrab of the pointer.
3587 * src/intl.h: removed LCombo2 function.
3589 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3590 function as this can now be handled in one function.
3592 * src/combox.h: added Combox * to callback prototype.
3594 * src/frontends/xforms/Toolbar_pimpl.C:
3595 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3597 2000-09-14 Garst Reese <reese@isn.net>
3599 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3600 moved usepackage{xxx}'s to beginning of file. Changed left margin
3601 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3602 underlining from title. Thanks to John Culleton for useful suggestions.
3604 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3606 * src/lyxlex_pimpl.C (setFile): change error message to debug
3609 2000-09-13 Juergen Vigna <jug@sad.it>
3611 * src/frontends/xforms/FormDocument.C: implemented choice_class
3612 as combox and give callback to combo_language so OK/Apply is activated
3615 * src/bufferlist.C (newFile): small fix so already named files
3616 (via an open call) are not requested to be named again on the
3619 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3621 * src/frontends/kde/Makefile.am
3622 * src/frontends/kde/FormRef.C
3623 * src/frontends/kde/FormRef.h
3624 * src/frontends/kde/formrefdialog.C
3625 * src/frontends/kde/formrefdialog.h: implement
3628 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3630 * src/frontends/kde/formtocdialog.C
3631 * src/frontends/kde/formtocdialog.h
3632 * src/frontends/kde/FormToc.C
3633 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3635 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3637 * src/frontends/kde/FormCitation.C: fix thinko
3638 where we didn't always display the reference text
3641 * src/frontends/kde/formurldialog.C
3642 * src/frontends/kde/formurldialog.h
3643 * src/frontends/kde/FormUrl.C
3644 * src/frontends/kde/FormUrl.h: minor cleanups
3646 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3648 * src/frontends/kde/Makefile.am
3649 * src/frontends/kde/FormToc.C
3650 * src/frontends/kde/FormToc.h
3651 * src/frontends/kde/FormCitation.C
3652 * src/frontends/kde/FormCitation.h
3653 * src/frontends/kde/FormIndex.C
3654 * src/frontends/kde/FormIndex.h
3655 * src/frontends/kde/formtocdialog.C
3656 * src/frontends/kde/formtocdialog.h
3657 * src/frontends/kde/formcitationdialog.C
3658 * src/frontends/kde/formcitationdialog.h
3659 * src/frontends/kde/formindexdialog.C
3660 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3662 2000-09-12 Juergen Vigna <jug@sad.it>
3664 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3667 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3669 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3672 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3674 * src/converter.C (Add, Convert): Added support for converter flags:
3675 needaux, resultdir, resultfile.
3676 (Convert): Added new parameter view_file.
3677 (dvips_options): Fixed letter paper option.
3679 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3680 (Export, GetExportableFormats, GetViewableFormats): Added support
3683 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3685 (easyParse): Fixed to work with new export code.
3687 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3690 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3692 * lib/bind/*.bind: Replaced
3693 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3694 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3696 2000-09-11 Juergen Vigna <jug@sad.it>
3698 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3700 * src/main.C (main): now GUII defines global guiruntime!
3702 * src/frontends/gnome/GUIRunTime.C (initApplication):
3703 * src/frontends/kde/GUIRunTime.C (initApplication):
3704 * src/frontends/xforms/GUIRunTime.C (initApplication):
3705 * src/frontends/GUIRunTime.h: added new function initApplication.
3707 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3709 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3711 2000-09-08 Juergen Vigna <jug@sad.it>
3713 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3714 we have already "Reset".
3716 * src/language.C (initL): inserted "default" language and made this
3717 THE default language (and not american!)
3719 * src/paragraph.C: inserted handling of "default" language!
3721 * src/lyxfont.C: ditto
3725 * src/paragraph.C: output the \\par only if we have a following
3726 paragraph otherwise it's not needed.
3728 2000-09-05 Juergen Vigna <jug@sad.it>
3730 * config/pspell.m4: added entry to lyx-flags
3732 * src/spellchecker.C: modified version from Kevin for using pspell
3734 2000-09-01 Marko Vendelin <markov@ioc.ee>
3735 * src/frontends/gnome/Makefile.am
3736 * src/frontends/gnome/FormCitation.C
3737 * src/frontends/gnome/FormCitation.h
3738 * src/frontends/gnome/diainsertcitation_callbacks.c
3739 * src/frontends/gnome/diainsertcitation_callbacks.h
3740 * src/frontends/gnome/diainsertcitation_interface.c
3741 * src/frontends/gnome/diainsertcitation_interface.h
3742 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3743 dialog for Gnome frontend
3745 * src/main.C: Gnome libraries require keeping application name
3746 and its version as strings
3748 * src/frontends/gnome/mainapp.C: Change the name of the main window
3749 from GnomeLyX to PACKAGE
3751 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3753 * src/frontends/Liason.C: add "using: declaration.
3755 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3757 * src/mathed/math_macro.C (Metrics): Set the size of the template
3759 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3761 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3763 * src/converter.C (add_options): New function.
3764 (SetViewer): Change $$FName into '$$FName'.
3765 (View): Add options when running xdvi
3766 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3767 (Convert): The 3rd parameter is now the desired filename. Converts
3768 calls to lyx::rename if necessary.
3769 Add options when running dvips.
3770 (dvi_papersize,dvips_options): New methods.
3772 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3774 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3775 using a call to Converter::dvips_options.
3776 Fixed to work with nex export code.
3778 * src/support/copy.C
3779 * src/support/rename.C: New files
3781 * src/support/syscall.h
3782 * src/support/syscall.C: Added Starttype SystemDontWait.
3784 * lib/ui/default.ui: Changed to work with new export code
3786 * lib/configure.m4: Changed to work with new export code
3788 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3790 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3792 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3793 so that code compiles with DEC cxx.
3795 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3796 to work correctly! Also now supports the additional elements
3799 2000-09-01 Allan Rae <rae@lyx.org>
3801 * src/frontends/ButtonPolicies.C: renamed all the references to
3802 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3804 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3805 since it's a const not a type.
3807 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3809 2000-08-31 Juergen Vigna <jug@sad.it>
3811 * src/insets/figinset.C: Various changes to look if the filename has
3812 an extension and if not add it for inline previewing.
3814 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3816 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3817 make buttonStatus and isReadOnly be const methods. (also reflect
3818 this in derived classes.)
3820 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3821 (nextState): change to be static inline, pass the StateMachine as
3823 (PreferencesPolicy): remove casts
3824 (OkCancelPolicy): remvoe casts
3825 (OkCancelReadOnlyPolicy): remove casts
3826 (NoRepeatedApplyReadOnlyPolicy): remove casts
3827 (OkApplyCancelReadOnlyPolicy): remove casts
3828 (OkApplyCancelPolicy): remove casts
3829 (NoRepeatedApplyPolicy): remove casts
3831 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3833 * src/converter.C: added some using directives
3835 * src/frontends/ButtonPolicies.C: changes to overcome
3836 "need lvalue" error with DEC c++
3838 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3839 to WMHideCB for DEC c++
3841 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3843 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3844 to BulletBMTableCB for DEC c++
3846 2000-08-31 Allan Rae <rae@lyx.org>
3848 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3849 character dialog separately from old document dialogs combo_language.
3852 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3854 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3855 Removed LFUN_REF_CREATE.
3857 * src/MenuBackend.C: Added new tags: toc and references
3859 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3860 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3862 (add_toc, add_references): New methods.
3863 (create_submenu): Handle correctly the case when there is a
3864 seperator after optional menu items.
3866 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3867 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3868 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3870 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3872 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3874 * src/converter.[Ch]: New file for converting between different
3877 * src/export.[Ch]: New file for exporting a LyX file to different
3880 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3881 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3882 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3883 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3884 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3885 RunDocBook, MenuExport.
3887 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3888 Exporter::Preview methods if NEW_EXPORT is defined.
3890 * src/buffer.C (Dispatch): Use Exporter::Export.
3892 * src/lyxrc.C: Added new tags: \converter and \viewer.
3895 * src/LyXAction.C: Define new lyx-function: buffer-update.
3896 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3897 when NEW_EXPORT is defined.
3899 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3901 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3903 * lib/ui/default.ui: Added submenus "view" and "update" to the
3906 * src/filetools.C (GetExtension): New function.
3908 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3910 2000-08-29 Allan Rae <rae@lyx.org>
3912 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3914 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3915 (EnableDocumentLayout): removed
3916 (DisableDocumentLayout): removed
3917 (build): make use of ButtonController's read-only handling to
3918 de/activate various objects. Replaces both of the above functions.
3920 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3921 (readOnly): was read_only
3922 (refresh): fixed dumb mistakes with read_only_ handling
3924 * src/frontends/xforms/forms/form_document.fd:
3925 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3926 tabbed dialogs so the tabs look more like tabs and so its easier to
3927 work out which is the current tab.
3929 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3930 segfault with form_table
3932 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3934 2000-08-28 Juergen Vigna <jug@sad.it>
3936 * acconfig.h: added USE_PSPELL.
3938 * src/config.h.in: added USE_PSPELL.
3940 * autogen.sh: added pspell.m4
3942 * config/pspell.m4: new file.
3944 * src/spellchecker.C: implemented support for pspell libary.
3946 2000-08-25 Juergen Vigna <jug@sad.it>
3948 * src/LyXAction.C (init): renamed LFUN_TABLE to
3949 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3951 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3953 * src/lyxscreen.h: add force_clear variable and fuction to force
3954 a clear area when redrawing in LyXText.
3956 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3958 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3960 * some whitespace and comment changes.
3962 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3964 * src/buffer.C: up te LYX_FORMAT to 2.17
3966 2000-08-23 Juergen Vigna <jug@sad.it>
3968 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3971 * src/insets/insettabular.C (pasteSelection): delete the insets
3972 LyXText as it is not valid anymore.
3973 (copySelection): new function.
3974 (pasteSelection): new function.
3975 (cutSelection): new function.
3976 (LocalDispatch): implemented cut/copy/paste of cell selections.
3978 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3979 don't have a LyXText.
3981 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3983 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3986 2000-08-22 Juergen Vigna <jug@sad.it>
3988 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3989 ifdef form_table out if NEW_TABULAR.
3991 2000-08-21 Juergen Vigna <jug@sad.it>
3993 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3994 (draw): fixed draw position so that the cursor is positioned in the
3996 (InsetMotionNotify): hide/show cursor so the position is updated.
3997 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3998 using cellstart() function where it should be used.
4000 * src/insets/insettext.C (draw): ditto.
4002 * src/tabular.C: fixed initialization of some missing variables and
4003 made BoxType into an enum.
4005 2000-08-22 Marko Vendelin <markov@ioc.ee>
4006 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4007 stock menu item using action numerical value, not its string
4011 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4013 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4014 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4016 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4018 * src/frontends/xforms/GUIRunTime.C: new file
4020 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4021 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4023 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4025 * src/frontends/kde/GUIRunTime.C: new file
4027 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4028 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4030 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4032 * src/frontends/gnome/GUIRunTime.C: new file
4034 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4037 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4038 small change to documetentation.
4040 * src/frontends/GUIRunTime.C: removed file
4042 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4044 * src/lyxparagraph.h: enable NEW_TABULAR as default
4046 * src/lyxfunc.C (processKeySym): remove some commented code
4048 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4049 NEW_TABULAR around the fd_form_table_options.
4051 * src/lyx_gui.C (runTime): call the static member function as
4052 GUIRunTime::runTime().
4054 2000-08-21 Allan Rae <rae@lyx.org>
4056 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4059 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4061 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4063 2000-08-21 Allan Rae <rae@lyx.org>
4065 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4066 keep Garst happy ;-)
4067 * src/frontends/xforms/FormPreferences.C (build): use setOK
4068 * src/frontends/xforms/FormDocument.C (build): use setOK
4069 (FormDocument): use the appropriate policy.
4071 2000-08-21 Allan Rae <rae@lyx.org>
4073 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4074 automatic [de]activation of arbitrary objects when in a read-only state.
4076 * src/frontends/ButtonPolicies.h: More documentation
4077 (isReadOnly): added to support the above.
4079 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4081 2000-08-18 Juergen Vigna <jug@sad.it>
4083 * src/insets/insettabular.C (getStatus): changed to return func_status.
4085 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4086 display toggle menu entries if they are.
4088 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4089 new document layout now.
4091 * src/lyxfunc.C: ditto
4093 * src/lyx_gui_misc.C: ditto
4095 * src/lyx_gui.C: ditto
4097 * lib/ui/default.ui: removed paper and quotes layout as they are now
4098 all in the document layout tabbed folder.
4100 * src/frontends/xforms/forms/form_document.fd: added Restore
4101 button and callbacks for all inputs for Allan's ButtonPolicy.
4103 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4104 (CheckChoiceClass): added missing params setting on class change.
4105 (UpdateLayoutDocument): added for updating the layout on params.
4106 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4107 (FormDocument): Implemented Allan's ButtonPolicy with the
4110 2000-08-17 Allan Rae <rae@lyx.org>
4112 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4113 so we can at least see the credits again.
4115 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4116 controller calls for the appropriate callbacks. Note that since Ok
4117 calls apply followed by cancel, and apply isn't a valid input for the
4118 APPLIED state, the bc_ calls have to be made in the static callback not
4119 within each of the real callbacks.
4121 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4122 (setOk): renamed from setOkay()
4124 2000-08-17 Juergen Vigna <jug@sad.it>
4126 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4127 in the implementation part.
4128 (composeUIInfo): don't show optional menu-items.
4130 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4132 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4134 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4135 text-state when in a text-inset.
4137 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4139 2000-08-17 Marko Vendelin <markov@ioc.ee>
4140 * src/frontends/gnome/FormIndex.C
4141 * src/frontends/gnome/FormIndex.h
4142 * src/frontends/gnome/FormToc.C
4143 * src/frontends/gnome/FormToc.h
4144 * src/frontends/gnome/dialogs
4145 * src/frontends/gnome/diatoc_callbacks.c
4146 * src/frontends/gnome/diatoc_callbacks.h
4147 * src/frontends/gnome/diainsertindex_callbacks.h
4148 * src/frontends/gnome/diainsertindex_callbacks.c
4149 * src/frontends/gnome/diainsertindex_interface.c
4150 * src/frontends/gnome/diainsertindex_interface.h
4151 * src/frontends/gnome/diatoc_interface.h
4152 * src/frontends/gnome/diatoc_interface.c
4153 * src/frontends/gnome/Makefile.am: Table of Contents and
4154 Insert Index dialogs implementation for Gnome frontend
4156 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4158 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4160 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4163 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4165 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4166 destructor. Don't definde if you don't need it
4167 (processEvents): made static, non-blocking events processing for
4169 (runTime): static method. event loop for xforms
4170 * similar as above for kde and gnome.
4172 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4173 new Pimpl is correct
4174 (runTime): new method calss the real frontends runtime func.
4176 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4178 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4180 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4182 2000-08-16 Juergen Vigna <jug@sad.it>
4184 * src/lyx_gui.C (runTime): added GUII RunTime support.
4186 * src/frontends/Makefile.am:
4187 * src/frontends/GUIRunTime.[Ch]:
4188 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4189 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4190 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4192 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4194 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4195 as this is already set in ${FRONTEND_INCLUDE} if needed.
4197 * configure.in (CPPFLAGS): setting the include dir for the frontend
4198 directory and don't set FRONTEND=xforms for now as this is executed
4201 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4203 * src/frontends/kde/Makefile.am:
4204 * src/frontends/kde/FormUrl.C:
4205 * src/frontends/kde/FormUrl.h:
4206 * src/frontends/kde/formurldialog.h:
4207 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4209 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4211 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4213 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4215 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4218 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4220 * src/WorkArea.C (work_area_handler): more work to get te
4221 FL_KEYBOARD to work with xforms 0.88 too, please test.
4223 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4225 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4227 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4230 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4232 * src/Timeout.h: remove Qt::emit hack.
4234 * several files: changes to allo doc++ compilation
4236 * src/lyxfunc.C (processKeySym): new method
4237 (processKeyEvent): comment out if FL_REVISION < 89
4239 * src/WorkArea.C: change some debugging levels.
4240 (WorkArea): set wantkey to FL_KEY_ALL
4241 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4242 clearer code and the use of compose with XForms 0.89. Change to
4243 use signals instead of calling methods in bufferview directly.
4245 * src/Painter.C: change some debugging levels.
4247 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4250 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4251 (workAreaKeyPress): new method
4253 2000-08-14 Juergen Vigna <jug@sad.it>
4255 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4257 * config/kde.m4: addes some features
4259 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4260 include missing xforms dialogs.
4262 * src/Timeout.h: a hack to be able to compile with qt/kde.
4264 * sigc++/.cvsignore: added acinclude.m4
4266 * lib/.cvsignore: added listerros
4268 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4269 xforms tree as objects are needed for other frontends.
4271 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4272 linking with not yet implemented xforms objects.
4274 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4276 2000-08-14 Baruch Even <baruch.even@writeme.com>
4278 * src/frontends/xforms/FormGraphics.h:
4279 * src/frontends/xforms/FormGraphics.C:
4280 * src/frontends/xforms/RadioButtonGroup.h:
4281 * src/frontends/xforms/RadioButtonGroup.C:
4282 * src/insets/insetgraphics.h:
4283 * src/insets/insetgraphics.C:
4284 * src/insets/insetgraphicsParams.h:
4285 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4286 instead of spaces, and various other indentation issues to make the
4287 sources more consistent.
4289 2000-08-14 Marko Vendelin <markov@ioc.ee>
4291 * src/frontends/gnome/dialogs/diaprint.glade
4292 * src/frontends/gnome/FormPrint.C
4293 * src/frontends/gnome/FormPrint.h
4294 * src/frontends/gnome/diaprint_callbacks.c
4295 * src/frontends/gnome/diaprint_callbacks.h
4296 * src/frontends/gnome/diaprint_interface.c
4297 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4300 * src/frontends/gnome/dialogs/diainserturl.glade
4301 * src/frontends/gnome/FormUrl.C
4302 * src/frontends/gnome/FormUrl.h
4303 * src/frontends/gnome/diainserturl_callbacks.c
4304 * src/frontends/gnome/diainserturl_callbacks.h
4305 * src/frontends/gnome/diainserturl_interface.c
4306 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4307 Gnome implementation
4309 * src/frontends/gnome/Dialogs.C
4310 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4311 all other dialogs. Copy all unimplemented dialogs from Xforms
4314 * src/frontends/gnome/support.c
4315 * src/frontends/gnome/support.h: support files generated by Glade
4319 * config/gnome.m4: Gnome configuration scripts
4321 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4322 configure --help message
4324 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4325 only if there are no events pendling in Gnome/Gtk. This enhances
4326 the performance of menus.
4329 2000-08-14 Allan Rae <rae@lyx.org>
4331 * lib/Makefile.am: listerrors cleaning
4333 * lib/listerrors: removed -- generated file
4334 * acinclude.m4: ditto
4335 * sigc++/acinclude.m4: ditto
4337 * src/frontends/xforms/forms/form_citation.fd:
4338 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4341 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4342 `updatesrc` and now we have a `test` target that does what `updatesrc`
4343 used to do. I didn't like having an install target that wasn't related
4346 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4347 on all except FormGraphics. This may yet happen. Followed by a major
4348 cleanup including using FL_TRANSIENT for most of the dialogs. More
4349 changes to come when the ButtonController below is introduced.
4351 * src/frontends/xforms/ButtonController.h: New file for managing up to
4352 four buttons on a dialog according to an externally defined policy.
4353 * src/frontends/xforms/Makefile.am: added above
4355 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4356 Apply and Cancel/Close buttons and everything in between and beyond.
4357 * src/frontends/Makefile.am: added above.
4359 * src/frontends/xforms/forms/form_preferences.fd:
4360 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4361 and removed variable 'status' as a result. Fixed the set_minsize thing.
4362 Use the new screen-font-update after checking screen fonts were changed
4363 Added a "Restore" button to restore the original lyxrc values while
4364 editing. This restores everything not just the last input changed.
4365 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4367 * src/LyXAction.C: screen-font-update added for updating buffers after
4368 screen font settings have been changed.
4369 * src/commandtags.h: ditto
4370 * src/lyxfunc.C: ditto
4372 * forms/lyx.fd: removed screen fonts dialog.
4373 * src/lyx_gui.C: ditto
4374 * src/menus.[Ch]: ditto
4375 * src/lyx.[Ch]: ditto
4376 * src/lyx_cb.C: ditto + code from here moved to make
4377 screen-font-update. And people wonder why progress on GUII is
4378 slow. Look at how scattered this stuff was! It takes forever
4381 * forms/fdfix.sh: Fixup the spacing after commas.
4382 * forms/makefile: Remove date from generated files. Fewer clashes now.
4383 * forms/bullet_forms.C.patch: included someones handwritten changes
4385 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4386 once I've discovered why LyXRC was made noncopyable.
4387 * src/lyx_main.C: ditto
4389 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4391 * src/frontends/xforms/forms/fdfix.sh:
4392 * src/frontends/xforms/forms/fdfixh.sed:
4393 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4394 * src/frontends/xforms/Form*.[hC]:
4395 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4396 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4397 provide a destructor for the struct FD_form_xxxx. Another version of
4398 the set_[max|min]size workaround and a few other cleanups. Actually,
4399 Angus' patch from 20000809.
4401 2000-08-13 Baruch Even <baruch.even@writeme.com>
4403 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4406 2000-08-11 Juergen Vigna <jug@sad.it>
4408 * src/insets/insetgraphics.C (InsetGraphics): changing init
4409 order because of warnings.
4411 * src/frontends/xforms/forms/makefile: adding patching .C with
4414 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4415 from .C.patch to .c.patch
4417 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4418 order because of warning.
4420 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4422 * src/frontends/Liason.C (setMinibuffer): new helper function
4424 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4426 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4428 * lib/ui/default.ui: commented out PaperLayout entry
4430 * src/frontends/xforms/form_document.[Ch]: new added files
4432 * src/frontends/xforms/FormDocument.[Ch]: ditto
4434 * src/frontends/xforms/forms/form_document.fd: ditto
4436 * src/frontends/xforms/forms/form_document.C.patch: ditto
4438 2000-08-10 Juergen Vigna <jug@sad.it>
4440 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4441 (InsetGraphics): initialized cacheHandle to 0.
4442 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4444 2000-08-10 Baruch Even <baruch.even@writeme.com>
4446 * src/graphics/GraphicsCache.h:
4447 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4448 correctly as a cache.
4450 * src/graphics/GraphicsCacheItem.h:
4451 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4454 * src/graphics/GraphicsCacheItem_pimpl.h:
4455 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4458 * src/insets/insetgraphics.h:
4459 * src/insets/insetgraphics.C: Changed from using a signal notification
4460 to polling when image is not loaded.
4462 2000-08-10 Allan Rae <rae@lyx.org>
4464 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4465 that there are two functions that have to been taken out of line by
4466 hand and aren't taken care of in the script. (Just a reminder note)
4468 * sigc++/macros/*.h.m4: Updated as above.
4470 2000-08-09 Juergen Vigna <jug@sad.it>
4472 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4474 * src/insets/insettabular.C: make drawing of single cell smarter.
4476 2000-08-09 Marko Vendelin <markov@ioc.ee>
4477 * src/frontends/gnome/Menubar_pimpl.C
4478 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4479 implementation: new files
4481 * src/frontends/gnome/mainapp.C
4482 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4485 * src/main.C: create Gnome main window
4487 * src/frontends/xforms/Menubar_pimpl.h
4488 * src/frontends/Menubar.C
4489 * src/frontends/Menubar.h: added method Menubar::update that calls
4490 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4492 * src/LyXView.C: calls Menubar::update to update the state
4495 * src/frontends/gnome/Makefile.am: added new files
4497 * src/frontends/Makefile.am: added frontend compiler options
4499 2000-08-08 Juergen Vigna <jug@sad.it>
4501 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4503 * src/bufferlist.C (close):
4504 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4505 documents if exiting without saving.
4507 * src/buffer.C (save): use removeAutosaveFile()
4509 * src/support/filetools.C (removeAutosaveFile): new function.
4511 * src/lyx_cb.C (MenuWrite): returns a bool now.
4512 (MenuWriteAs): check if file could really be saved and revert to the
4514 (MenuWriteAs): removing old autosavefile if existant.
4516 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4517 before Goto toggle declaration, because of compiler warning.
4519 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4521 * src/lyxfunc.C (MenuNew): small fix.
4523 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4525 * src/bufferlist.C (newFile):
4526 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4528 * src/lyxrc.C: added new_ask_filename tag
4530 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4532 * src/lyx.fd: removed code pertaining to form_ref
4533 * src/lyx.[Ch]: ditto
4534 * src/lyx_cb.C: ditto
4535 * src/lyx_gui.C: ditto
4536 * src/lyx_gui_misc.C: ditto
4538 * src/BufferView_pimpl.C (restorePosition): update buffer only
4541 * src/commandtags.h (LFUN_REFTOGGLE): removed
4542 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4543 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4544 (LFUN_REFBACK): renamed LFUN_REF_BACK
4546 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4547 * src/menus.C: ditto
4548 * src/lyxfunc.C (Dispatch): ditto.
4549 InsertRef dialog is now GUI-independent.
4551 * src/texrow.C: added using std::endl;
4553 * src/insets/insetref.[Ch]: strip out large amounts of code.
4554 The inset is now a container and this functionality is now
4555 managed by a new FormRef dialog
4557 * src/frontends/Dialogs.h (showRef, createRef): new signals
4559 * src/frontends/xforms/FormIndex.[Ch],
4560 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4561 when setting dialog's min/max size
4562 * src/frontends/xforms/FormIndex.[Ch]: ditto
4564 * src/frontends/xforms/FormRef.[Ch],
4565 src/frontends/xforms/forms/form_ref.fd: new xforms
4566 implementation of an InsetRef dialog
4568 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4571 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4572 ios::nocreate is not part of the standard. Removed.
4574 2000-08-07 Baruch Even <baruch.even@writeme.com>
4576 * src/graphics/Renderer.h:
4577 * src/graphics/Renderer.C: Added base class for rendering of different
4578 image formats into Pixmaps.
4580 * src/graphics/XPM_Renderer.h:
4581 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4582 in a different class.
4584 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4585 easily add support for other formats.
4587 * src/insets/figinset.C: plugged a leak of an X resource.
4589 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4591 * src/CutAndPaste.[Ch]: make all metods static.
4593 * development/Code_rules/Rules: more work, added section on
4594 Exceptions, and a References section.
4596 * a lot of header files: work to make doc++ able to generate the
4597 source documentation, some workarounds of doc++ problems. Doc++ is
4598 now able to generate the documentation.
4600 2000-08-07 Juergen Vigna <jug@sad.it>
4602 * src/insets/insettabular.C (recomputeTextInsets): removed function
4604 * src/tabular.C (SetWidthOfMulticolCell):
4606 (calculate_width_of_column_NMC): fixed return value so that it really
4607 only returns true if the column-width has changed (there where
4608 problems with muliticolumn-cells in this column).
4610 2000-08-04 Juergen Vigna <jug@sad.it>
4612 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4613 also on the scrollstatus of the inset.
4614 (workAreaMotionNotify): ditto.
4616 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4618 2000-08-01 Juergen Vigna <jug@sad.it>
4620 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4622 * src/commandtags.h:
4623 * src/LyXAction.C (init):
4624 * src/insets/inset.C (LocalDispatch): added support for
4627 * src/insets/inset.C (scroll): new functions.
4629 * src/insets/insettext.C (removeNewlines): new function.
4630 (SetAutoBreakRows): removes forced newlines in the text of the
4631 paragraph if autoBreakRows is set to false.
4633 * src/tabular.C (Latex): generates a parbox around the cell contents
4636 * src/frontends/xforms/FormTabular.C (local_update): removed
4637 the radio_useparbox button.
4639 * src/tabular.C (UseParbox): new function
4641 2000-08-06 Baruch Even <baruch.even@writeme.com>
4643 * src/graphics/GraphicsCache.h:
4644 * src/graphics/GraphicsCache.C:
4645 * src/graphics/GraphicsCacheItem.h:
4646 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4649 * src/insets/insetgraphics.h:
4650 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4651 and the drawing of the inline image.
4653 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4654 loaded into the wrong position.
4656 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4659 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4661 * src/support/translator.h: move all typedefs to public section
4663 * src/support/filetools.C (MakeLatexName): return string const
4665 (TmpFileName): ditto
4666 (FileOpenSearch): ditto
4668 (LibFileSearch): ditto
4669 (i18nLibFileSearch): ditto
4672 (CreateTmpDir): ditto
4673 (CreateBufferTmpDir): ditto
4674 (CreateLyXTmpDir): ditto
4677 (MakeAbsPath): ditto
4679 (OnlyFilename): ditto
4681 (NormalizePath): ditto
4682 (CleanupPath): ditto
4683 (GetFileContents): ditto
4684 (ReplaceEnvironmentPath): ditto
4685 (MakeRelPath): ditto
4687 (ChangeExtension): ditto
4688 (MakeDisplayPath): ditto
4689 (do_popen): return cmdret const
4690 (findtexfile): return string const
4692 * src/support/DebugStream.h: add some /// to please doc++
4694 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4696 * src/texrow.C (same_rownumber): functor to use with find_if
4697 (getIdFromRow): rewritten to use find_if and to not update the
4698 positions. return true if row is found
4699 (increasePos): new method, use to update positions
4701 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4703 * src/lyxlex_pimpl.C (verifyTable): new method
4706 (GetString): return string const
4707 (pushTable): rewrite to use std::stack
4709 (setFile): better check
4712 * src/lyxlex.h: make LyXLex noncopyable
4714 * src/lyxlex.C (text): return char const * const
4715 (GetString): return string const
4716 (getLongString): return string const
4718 * src/lyx_gui_misc.C (askForText): return pair<...> const
4720 * src/lastfiles.[Ch] (operator): return string const
4722 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4723 istringstream not char const *.
4724 move token.end() out of loop.
4725 (readFile): move initializaton of token
4727 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4728 getIdFromRow is successful.
4730 * lib/bind/emacs.bind: don't include menus bind
4732 * development/Code_rules/Rules: the beginnings of making this
4733 better and covering more of the unwritten rules that we have.
4735 * development/Code_rules/Recommendations: a couple of wording
4738 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4740 * src/support/strerror.c: remove C++ comment.
4742 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4744 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4745 LFUN_INDEX_INSERT_LAST
4747 * src/texrow.C (getIdFromRow): changed from const_iterator to
4748 iterator, allowing code to compile with DEC cxx
4750 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4751 stores part of the class, as suggested by Allan. Will allow
4753 (apply): test to apply uses InsetCommandParams operator!=
4755 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4756 (apply): test to apply uses InsetCommandParams operator!=
4758 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4759 stores part of the class.
4760 (update): removed limits on min/max size.
4762 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4763 (apply): test to apply uses InsetCommandParams operator!=
4765 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4766 (Read, Write, scanCommand, getCommand): moved functionality
4767 into InsetCommandParams.
4769 (getScreenLabel): made pure virtual
4770 new InsetCommandParams operators== and !=
4772 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4773 c-tors based on InsetCommandParams. Removed others.
4774 * src/insets/insetinclude.[Ch]: ditto
4775 * src/insets/insetlabel.[Ch]: ditto
4776 * src/insets/insetparent.[Ch]: ditto
4777 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4779 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4780 insets derived from InsetCommand created using similar c-tors
4781 based on InsetCommandParams
4782 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4783 * src/menus.C (ShowRefsMenu): ditto
4784 * src/paragraph.C (Clone): ditto
4785 * src/text2.C (SetCounter): ditto
4786 * src/lyxfunc.C (Dispatch) ditto
4787 Also recreated old InsetIndex behaviour exactly. Can now
4788 index-insert at the start of a paragraph and index-insert-last
4789 without launching the pop-up.
4791 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4793 * lib/lyxrc.example: mark te pdf options as non functional.
4795 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4796 (isStrDbl): move tmpstr.end() out of loop.
4797 (strToDbl): move intialization of tmpstr
4798 (lowercase): return string const and move tmp.end() out of loop.
4799 (uppercase): return string const and move tmp.edn() out of loop.
4800 (prefixIs): add assertion
4805 (containsOnly): ditto
4806 (containsOnly): ditto
4807 (containsOnly): ditto
4808 (countChar): make last arg char not char const
4809 (token): return string const
4810 (subst): return string const, move tmp.end() out of loop.
4811 (subst): return string const, add assertion
4812 (strip): return string const
4813 (frontStrip): return string const, add assertion
4814 (frontStrip): return string const
4819 * src/support/lstrings.C: add inclde "LAssert.h"
4820 (isStrInt): move tmpstr.end() out of loop.
4822 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4823 toollist.end() out of loop.
4824 (deactivate): move toollist.end() out of loop.
4825 (update): move toollist.end() out of loop.
4826 (updateLayoutList): move tc.end() out of loop.
4827 (add): move toollist.end() out of loop.
4829 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4830 md.end() out of loop.
4832 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4834 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4837 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4838 (Erase): move insetlist.end() out of loop.
4840 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4841 ref to const string as first arg. Move initialization of some
4842 variables, whitespace changes.
4844 * src/kbmap.C (defkey): move table.end() out of loop.
4845 (kb_keymap): move table.end() out of loop.
4846 (findbinding): move table.end() out of loop.
4848 * src/MenuBackend.C (hasMenu): move end() out of loop.
4849 (getMenu): move end() out of loop.
4850 (getMenu): move menulist_.end() out of loop.
4852 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4854 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4857 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4858 (getFromLyXName): move infotab.end() out of loop.
4860 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4861 -fvtable-thunks -ffunction-sections -fdata-sections
4863 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4865 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4868 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4870 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4872 * src/frontends/xforms/FormCitation.[Ch],
4873 src/frontends/xforms/FormIndex.[Ch],
4874 src/frontends/xforms/FormToc.[Ch],
4875 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4877 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4879 * src/commandtags.h: renamed, created some flags for citation
4882 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4884 * src/lyxfunc.C (dispatch): use signals to insert index entry
4886 * src/frontends/Dialogs.h: new signal createIndex
4888 * src/frontends/xforms/FormCommand.[Ch],
4889 src/frontends/xforms/FormCitation.[Ch],
4890 src/frontends/xforms/FormToc.[Ch],
4891 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4893 * src/insets/insetindex.[Ch]: GUI-independent
4895 * src/frontends/xforms/FormIndex.[Ch],
4896 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4899 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4901 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4902 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4904 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4906 * src/insets/insetref.C (Latex): rewrite so that there is now
4907 question that a initialization is requested.
4909 * src/insets/insetcommand.h: reenable the hide signal
4911 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4913 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4914 fix handling of shortcuts (many bugs :)
4915 (add_lastfiles): ditto.
4917 * lib/ui/default.ui: fix a few shortcuts.
4919 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4921 * Makefile.am: Fix ``rpmdist'' target to return the exit
4922 status of the ``rpm'' command, instead of the last command in
4923 the chain (the ``rm lyx.xpm'' command, which always returns
4926 2000-08-02 Allan Rae <rae@lyx.org>
4928 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4929 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4930 * src/frontends/xforms/FormToc.C (FormToc): ditto
4932 * src/frontends/xforms/Makefile.am: A few forgotten files
4934 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4935 Signals-not-copyable-problem Lars' started commenting out.
4937 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4939 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4941 * src/insets/insetcommand.h: Signals is not copyable so anoter
4942 scheme for automatic hiding of forms must be used.
4944 * src/frontends/xforms/FormCitation.h: don't inerit from
4945 noncopyable, FormCommand already does that.
4946 * src/frontends/xforms/FormToc.h: ditto
4947 * src/frontends/xforms/FormUrl.h: ditto
4949 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4951 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4953 * src/insets/insetcommand.h (hide): new SigC::Signal0
4954 (d-tor) new virtual destructor emits hide signal
4956 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4957 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4959 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4960 LOF and LOT. Inset is now GUI-independent
4962 * src/insets/insetloa.[Ch]: redundant
4963 * src/insets/insetlof.[Ch]: ditto
4964 * src/insets/insetlot.[Ch]: ditto
4966 * src/frontends/xforms/forms/form_url.fd: tweaked!
4967 * src/frontends/xforms/forms/form_citation.fd: ditto
4969 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4970 dialogs dealing with InsetCommand insets
4972 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4973 FormCommand base class
4974 * src/frontends/xforms/FormUrl.[Ch]: ditto
4976 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4978 * src/frontends/xforms/FormToc.[Ch]: ditto
4980 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4981 passed a generic InsetCommand pointer
4982 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4984 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4985 and modified InsetTOC class
4986 * src/buffer.C: ditto
4988 * forms/lyx.fd: strip out old FD_form_toc code
4989 * src/lyx_gui_misc.C: ditto
4990 * src/lyx_gui.C: ditto
4991 * src/lyx_cb.C: ditto
4992 * src/lyx.[Ch]: ditto
4994 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4996 * src/support/utility.hpp: tr -d '\r'
4998 2000-08-01 Juergen Vigna <jug@sad.it>
5000 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5002 * src/commandtags.h:
5003 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5004 LFUN_TABULAR_FEATURES.
5006 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5007 LFUN_LAYOUT_TABULAR.
5009 * src/insets/insettabular.C (getStatus): implemented helper function.
5011 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5013 2000-07-31 Juergen Vigna <jug@sad.it>
5015 * src/text.C (draw): fixed screen update problem for text-insets.
5017 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5018 something changed probably this has to be added in various other
5021 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5023 2000-07-31 Baruch Even <baruch.even@writeme.com>
5025 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5026 templates to satisfy compaq cxx.
5029 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5031 * src/support/translator.h (equal_1st_in_pair::operator()): take
5032 const ref pair_type as arg.
5033 (equal_2nd_in_pair::operator()): ditto
5034 (Translator::~Translator): remove empty d-tor.
5036 * src/graphics/GraphicsCache.C: move include config.h to top, also
5037 put initialization of GraphicsCache::singleton here.
5038 (~GraphicsCache): move here
5039 (addFile): take const ref as arg
5042 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5044 * src/BufferView2.C (insertLyXFile): change te with/without header
5047 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5049 * src/frontends/xforms/FormGraphics.C (apply): add some
5050 static_cast. Not very nice, but required by compaq cxx.
5052 * src/frontends/xforms/RadioButtonGroup.h: include header
5053 <utility> instead of <pair.h>
5055 * src/insets/insetgraphicsParams.C: add using directive.
5056 (readResize): change return type to void.
5057 (readOrigin): ditto.
5059 * src/lyxfunc.C (getStatus): add missing break for build-program
5060 function; add test for Literate for export functions.
5062 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5063 entries in Options menu.
5065 2000-07-31 Baruch Even <baruch.even@writeme.com>
5067 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5068 protect against auto-allocation; release icon when needed.
5070 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5072 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5073 on usual typewriter.
5075 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5076 earlier czech.kmap), useful only for programming.
5078 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5080 * src/frontends/xforms/FormCitation.h: fix conditioning around
5083 2000-07-31 Juergen Vigna <jug@sad.it>
5085 * src/frontends/xforms/FormTabular.C (local_update): changed
5086 radio_linebreaks to radio_useparbox and added radio_useminipage.
5088 * src/tabular.C: made support for using minipages/parboxes.
5090 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5092 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5094 (descent): so the cursor is in the middle.
5095 (width): bit smaller box.
5097 * src/insets/insetgraphics.h: added display() function.
5099 2000-07-31 Baruch Even <baruch.even@writeme.com>
5101 * src/frontends/Dialogs.h: Added showGraphics signals.
5103 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5104 xforms form definition of the graphics dialog.
5106 * src/frontends/xforms/FormGraphics.h:
5107 * src/frontends/xforms/FormGraphics.C: Added files, the
5108 GUIndependent code of InsetGraphics
5110 * src/insets/insetgraphics.h:
5111 * src/insets/insetgraphics.C: Major writing to make it work.
5113 * src/insets/insetgraphicsParams.h:
5114 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5115 struct between InsetGraphics and GUI.
5117 * src/LaTeXFeatures.h:
5118 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5119 support for graphicx package.
5121 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5122 for the graphics inset.
5124 * src/support/translator.h: Added file, used in
5125 InsetGraphicsParams. this is a template to translate between two
5128 * src/frontends/xforms/RadioButtonGroup.h:
5129 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5130 way to easily control a radio button group.
5132 2000-07-28 Juergen Vigna <jug@sad.it>
5134 * src/insets/insettabular.C (LocalDispatch):
5135 (TabularFeatures): added support for lyx-functions of tabular features.
5136 (cellstart): refixed this function after someone wrongly changed it.
5138 * src/commandtags.h:
5139 * src/LyXAction.C (init): added support for tabular-features
5141 2000-07-28 Allan Rae <rae@lyx.org>
5143 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5144 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5145 triggers the callback for input checking. As a result we sometimes get
5146 "LyX: This shouldn't happen..." printed to cerr.
5147 (input): Started using status variable since I only free() on
5148 destruction. Some input checking for paths and font sizes.
5150 * src/frontends/xforms/FormPreferences.h: Use status to control
5151 activation of Ok and Apply
5153 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5154 callback. Also resized to stop segfaults with 0.88. The problem is
5155 that xforms-0.88 requires the folder to be wide enough to fit all the
5156 tabs. If it isn't it causes all sorts of problems.
5158 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5160 * src/frontends/xforms/forms/README: Reflect reality.
5162 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5163 * src/frontends/xforms/forms/makefile: ditto.
5165 * src/commandtags.h: Get access to new Preferences dialog
5166 * src/LyXAction.C: ditto
5167 * src/lyxfunc.C: ditto
5168 * lib/ui/default.ui: ditto
5170 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5172 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5174 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5177 * src/frontends/xforms/form_url.[Ch]: added.
5179 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5181 * src/insets/insetbib.h: fixed bug in previous commit
5183 * src/frontends/xforms/FormUrl.h: ditto
5185 * src/frontends/xforms/FormPrint.h: ditto
5187 * src/frontends/xforms/FormPreferences.h: ditto
5189 * src/frontends/xforms/FormCopyright.h: ditto
5191 * src/frontends/xforms/FormCitation.C: ditto
5193 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5194 private copyconstructor and private default contructor
5196 * src/support/Makefile.am: add utility.hpp
5198 * src/support/utility.hpp: new file from boost
5200 * src/insets/insetbib.h: set owner in clone
5202 * src/frontends/xforms/FormCitation.C: added missing include
5205 * src/insets/form_url.[Ch]: removed
5207 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5209 * development/lyx.spec.in
5210 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5211 file/directory re-organization.
5213 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5215 * src/insets/insetcommand.[Ch]: moved the string data and
5216 associated manipulation methods into a new stand-alone class
5217 InsetCommandParams. This class has two additional methods
5218 getAsString() and setFromString() allowing the contents to be
5219 moved around as a single string.
5220 (addContents) method removed.
5221 (setContents) method no longer virtual.
5223 * src/buffer.C (readInset): made use of new InsetCitation,
5224 InsetUrl constructors based on InsetCommandParams.
5226 * src/commandtags.h: add LFUN_INSERT_URL
5228 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5229 independent InsetUrl and use InsetCommandParams to extract
5230 string info and create new Insets.
5232 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5234 * src/frontends/xforms/FormCitation.C (apply): uses
5237 * src/frontends/xforms/form_url.C
5238 * src/frontends/xforms/form_url.h
5239 * src/frontends/xforms/FormUrl.h
5240 * src/frontends/xforms/FormUrl.C
5241 * src/frontends/xforms/forms/form_url.fd: new files
5243 * src/insets/insetcite.[Ch]: removed unused constructors.
5245 * src/insets/insetinclude.[Ch]: no longer store filename
5247 * src/insets/inseturl.[Ch]: GUI-independent.
5249 2000-07-26 Juergen Vigna <jug@sad.it>
5250 * renamed frontend from gtk to gnome as it is that what is realized
5251 and did the necessary changes in the files.
5253 2000-07-26 Marko Vendelin <markov@ioc.ee>
5255 * configure.in: cleaning up gnome configuration scripts
5257 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5259 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5260 shortcuts syndrom by redrawing them explicitely (a better solution
5261 would be appreciated).
5263 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5265 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5268 * src/lyx_cb.C (MenuExport): change html export to do the right
5269 thing depending of the document type (instead of having
5270 html-linuxdoc and html-docbook).
5271 * src/lyxfunc.C (getStatus): update for html
5272 * lib/ui/default.ui: simplify due to the above change.
5273 * src/menus.C (ShowFileMenu): update too (in case we need it).
5275 * src/MenuBackend.C (read): if a menu is defined twice, add the
5276 new entries to the exiting one.
5278 2000-07-26 Juergen Vigna <jug@sad.it>
5280 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5282 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5283 and return a bool if it did actual save the file.
5284 (AutoSave): don't autosave a unnamed doc.
5286 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5287 check if this is an UNNAMED new file and react to it.
5288 (newFile): set buffer to unnamed and change to not mark a new
5289 buffer dirty if I didn't do anything with it.
5291 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5293 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5295 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5296 friend as per Angus's patch posted to lyx-devel.
5298 * src/ext_l10n.h: updated
5300 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5301 gettext on the style string right before inserting them into the
5304 * autogen.sh: add code to extract style strings form layout files,
5305 not good enough yet.
5307 * src/frontends/gtk/.cvsignore: add MAKEFILE
5309 * src/MenuBackend.C (read): run the label strings through gettext
5310 before storing them in the containers.
5312 * src/ext_l10n.h: new file
5314 * autogen.sh : generate the ext_l10n.h file here
5316 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5318 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5321 * lib/ui/default.ui: fix a couple of typos.
5323 * config/gnome/gtk.m4: added (and added to the list of files in
5326 * src/insets/insetinclude.C (unique_id): fix when we are using
5327 lyxstring instead of basic_string<>.
5328 * src/insets/insettext.C (LocalDispatch): ditto.
5329 * src/support/filetools.C: ditto.
5331 * lib/configure.m4: create the ui/ directory if necessary.
5333 * src/LyXView.[Ch] (updateToolbar): new method.
5335 * src/BufferView_pimpl.C (buffer): update the toolbar when
5336 opening/closing buffer.
5338 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5340 * src/LyXAction.C (getActionName): enhance to return also the name
5341 and options of pseudo-actions.
5342 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5344 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5345 as an example of what is possible). Used in File->Build too (more
5346 useful) and in the import/export menus (to mimick the complicated
5347 handling of linuxdoc and friends). Try to update all the entries.
5349 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5352 * src/MenuBackend.C (read): Parse the new OptItem tag.
5354 * src/MenuBackend.h: Add a new optional_ data member (used if the
5355 entry should be omitted when the lyxfunc is disabled).
5357 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5358 function, used as a shortcut.
5359 (create_submenu): align correctly the shortcuts on the widest
5362 * src/MenuBackend.h: MenuItem.label() only returns the label of
5363 the menu without shortcut; new method shortcut().
5365 2000-07-14 Marko Vendelin <markov@ioc.ee>
5367 * src/frontends/gtk/Dialogs.C:
5368 * src/frontends/gtk/FormCopyright.C:
5369 * src/frontends/gtk/FormCopyright.h:
5370 * src/frontends/gtk/Makefile.am: added these source-files for the
5371 Gtk/Gnome support of the Copyright-Dialog.
5373 * src/main.C: added Gnome::Main initialization if using
5374 Gtk/Gnome frontend-GUI.
5376 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5378 * config/gnome/aclocal-include.m4
5379 * config/gnome/compiler-flags.m4
5380 * config/gnome/curses.m4
5381 * config/gnome/gnome--.m4
5382 * config/gnome/gnome-bonobo-check.m4
5383 * config/gnome/gnome-common.m4
5384 * config/gnome/gnome-fileutils.m4
5385 * config/gnome/gnome-ghttp-check.m4
5386 * config/gnome/gnome-gnorba-check.m4
5387 * config/gnome/gnome-guile-checks.m4
5388 * config/gnome/gnome-libgtop-check.m4
5389 * config/gnome/gnome-objc-checks.m4
5390 * config/gnome/gnome-orbit-check.m4
5391 * config/gnome/gnome-print-check.m4
5392 * config/gnome/gnome-pthread-check.m4
5393 * config/gnome/gnome-support.m4
5394 * config/gnome/gnome-undelfs.m4
5395 * config/gnome/gnome-vfs.m4
5396 * config/gnome/gnome-x-checks.m4
5397 * config/gnome/gnome-xml-check.m4
5398 * config/gnome/gnome.m4
5399 * config/gnome/gperf-check.m4
5400 * config/gnome/gtk--.m4
5401 * config/gnome/linger.m4
5402 * config/gnome/need-declaration.m4: added configuration scripts
5403 for Gtk/Gnome frontend-GUI
5405 * configure.in: added support for the --with-frontend=gtk option
5407 * autogen.sh: added config/gnome/* to list of config-files
5409 * acconfig.h: added define for GTKGUI-support
5411 * config/lyxinclude.m4: added --with-frontend[=value] option value
5412 for Gtk/Gnome frontend-GUI support.
5414 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5416 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5420 * src/paragraph.C (GetChar): remove non-const version
5422 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5423 (search_kw): use it.
5425 * src/lyx_main.C (init): if "preferences" exist, read that instead
5427 (ReadRcFile): return bool if the file could be read ok.
5428 (ReadUIFile): add a check to see if lex file is set ok.
5430 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5431 bastring can be used instead of lyxstring (still uses the old code
5432 if std::string is good enough or if lyxstring is used.)
5434 * src/encoding.C: make the arrays static, move ininle functions
5436 * src/encoding.h: from here.
5438 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5439 (parseSingleLyXformat2Token): move inset parsing to separate method
5440 (readInset): new private method
5442 * src/Variables.h: remove virtual from get().
5444 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5445 access to NEW_INSETS and NEW_TABULAR
5447 * src/MenuBackend.h: remove superfluous forward declaration of
5448 MenuItem. Add documentations tags "///", remove empty MenuItem
5449 destructor, remove private default contructor.
5451 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5453 (read): more string mlabel and mname to where they are used
5454 (read): remove unused variables mlabel and mname
5455 (defaults): unconditional clear, make menusetup take advantage of
5456 add returning Menu &.
5458 * src/LyXView.h: define NEW_MENUBAR as default
5460 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5461 to NEW_INSETS and NEW_TABULAR.
5462 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5463 defined. Change some of the "xxxx-inset-insert" functions names to
5466 * several files: more enahncements to NEW_INSETS and the resulting
5469 * lib/lyxrc.example (\date_insert_format): move to misc section
5471 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5472 bastring and use AC_CACHE_CHECK.
5473 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5474 the system have the newest methods. uses AC_CACHE_CHECK
5475 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5476 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5477 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5479 * configure.in: add LYX_CXX_GOOD_STD_STRING
5481 * acinclude.m4: recreated
5483 2000-07-24 Amir Karger <karger@lyx.org>
5485 * README: add Hebrew, Arabic kmaps
5488 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5490 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5493 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5495 * Lot of files: add pragma interface/implementation.
5497 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5499 * lib/ui/default.ui: new file (ans new directory). Contains the
5500 default menu and toolbar.
5502 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5503 global space. Toolbars are now read (as menus) in ui files.
5505 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5507 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5508 is disabled because the document is read-only. We want to have the
5509 toggle state of the function anyway.
5510 (getStatus): add code for LFUN_VC* functions (mimicking what is
5511 done in old-style menus)
5513 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5514 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5516 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5517 * src/BufferView_pimpl.C: ditto.
5518 * src/lyxfunc.C: ditto.
5520 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5521 default). This replaces old-style menus by new ones.
5523 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5524 MenuItem. Contain the data structure of a menu.
5526 * src/insets/insettext.C: use LyXView::setLayout instead of
5527 accessing directly the toolbar combox.
5528 * src/lyxfunc.C (Dispatch): ditto.
5530 * src/LyXView.C (setLayout): new method, which just calls
5531 Toolbar::setLayout().
5532 (updateLayoutChoice): move part of this method in Toolbar.
5534 * src/toolbar.[Ch]: removed.
5536 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5537 implementation the toolbar.
5539 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5540 the toolbar. It might make sense to merge it with ToolbarDefaults
5542 (setLayout): new function.
5543 (updateLayoutList): ditto.
5544 (openLayoutList): ditto.
5546 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5547 xforms implementation of the toolbar.
5548 (get_toolbar_func): comment out, since I do not
5549 know what it is good for.
5551 * src/ToolbarDefaults.h: Add the ItemType enum.
5553 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5554 for a list of allocated C strings. Used in Menubar xforms
5555 implementation to avoid memory leaks.
5557 * src/support/lstrings.[Ch] (uppercase): new version taking and
5561 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5562 * lib/bind/emacs.bind: ditto.
5564 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5566 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5567 forward decl of LyXView.
5569 * src/toolbar.C (toolbarItem): moved from toolbar.h
5570 (toolbarItem::clean): ditto
5571 (toolbarItem::~toolbarItem): ditto
5572 (toolbarItem::operator): ditto
5574 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5576 * src/paragraph.h: control the NEW_TABULAR define from here
5578 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5579 USE_TABULAR_INSETS to NEW_TABULAR
5581 * src/ToolbarDefaults.C: add include "lyxlex.h"
5583 * files using the old table/tabular: use NEW_TABULAR to control
5584 compilation of old tabular stuff.
5586 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5589 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5590 planemet in reading of old style floats, fix the \end_deeper
5591 problem when reading old style floats.
5593 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5595 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5597 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5599 * lib/bind/sciword.bind: updated.
5601 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5603 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5604 layout write problem
5606 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5608 * src/Makefile.am (INCLUDES): remove image directory from include
5611 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5612 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5614 * src/LyXView.C (create_form_form_main): read the application icon
5617 * lib/images/*.xpm: change the icons to use transparent color for
5620 * src/toolbar.C (update): change the color of the button when it
5623 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5625 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5626 setting explicitely the minibuffer.
5627 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5629 * src/LyXView.C (showState): new function. Shows font information
5630 in minibuffer and update toolbar state.
5631 (LyXView): call Toolbar::update after creating the
5634 * src/toolbar.C: change toollist to be a vector instead of a
5636 (BubbleTimerCB): get help string directly from the callback
5637 argument of the corresponding icon (which is the action)
5638 (set): remove unnecessary ugliness.
5639 (update): new function. update the icons (depressed, disabled)
5640 depending of the status of the corresponding action.
5642 * src/toolbar.h: remove help in toolbarItem
5644 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5646 * src/Painter.C (text): Added code for using symbol glyphs from
5647 iso10646 fonts. Currently diabled.
5649 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5652 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5653 magyar,turkish and usorbian.
5655 * src/paragraph.C (isMultiLingual): Made more efficient.
5657 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5660 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5661 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5662 Also changed the prototype to "bool math_insert_greek(char)".
5664 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5666 * lots of files: apply the NEW_INSETS on all code that will not be
5667 needed when we move to use the new insets. Enable the define in
5668 lyxparagrah.h to try it.
5670 * src/insets/insettabular.C (cellstart): change to be a static
5672 (InsetTabular): initialize buffer in the initializer list.
5674 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5676 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5677 form_print.h out of the header file. Replaced with forward
5678 declarations of the relevant struct.
5680 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5683 * src/commandtags.h: do not include "debug.h" which does not
5684 belong there. #include it in some other places because of this
5687 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5689 * src/insets/insetcaption.C: add a couple "using" directives.
5691 * src/toolbar.C (add): get the help text directly from lyxaction.
5693 (setPixmap): new function. Loads from disk and sets a pixmap on a
5694 botton; the name of the pixmap file is derived from the command
5697 * src/toolbar.h: remove members isBitmap and pixmap from
5700 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5701 * lib/images/: move many files from images/banner.xpm.
5703 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5705 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5706 * src/toolbar.C: ditto.
5707 * configure.in: ditto.
5708 * INSTALL: document.
5710 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5711 the spellchecker popup is closed from the WM.
5713 2000-07-19 Juergen Vigna <jug@sad.it>
5715 * src/insets/insetfloat.C (Write): small fix because we use the
5716 insetname for the type now!
5718 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5720 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5723 * src/frontends/Dialogs.h: removed hideCitation signal
5725 * src/insets/insetcite.h: added hide signal
5727 * src/insets/insetcite.C (~InsetCitation): emits new signal
5728 (getScreenLabel): "intelligent" label should now fit on the screen!
5730 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5732 * src/frontends/xforms/FormCitation.C (showInset): connects
5733 hide() to the inset's hide signal
5734 (show): modified to use fl_set_object_position rather than
5735 fl_set_object_geometry wherever possible
5737 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5739 * src/insets/lyxinset.h: add caption code
5741 * src/insets/insetfloat.C (type): new method
5743 * src/insets/insetcaption.C (Write): new method
5745 (LyxCode): new method
5747 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5748 to get it right together with using the FloatList.
5750 * src/commandtags.h: add LFUN_INSET_CAPTION
5751 * src/lyxfunc.C (Dispatch): handle it
5753 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5756 * src/Variables.[Ch]: make expand take a const reference, remove
5757 the destructor, some whitespace changes.
5759 * src/LyXAction.C (init): add caption-inset-insert
5761 * src/FloatList.C (FloatList): update the default floats a bit.
5763 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5765 * src/Variables.[Ch]: new files. Intended to be used for language
5766 specific strings (like \chaptername) and filename substitution in
5769 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5771 * lib/kbd/american.kmap: update
5773 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5775 * src/bufferparams.[Ch]: remove member allowAccents.
5777 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5779 * src/LaTeXLog.C: use the log_form.h header.
5780 * src/lyx_gui.C: ditto.
5781 * src/lyx_gui_misc.C: ditto.
5782 * src/lyxvc.h: ditto.
5784 * forms/log_form.fd: new file, created from latexoptions.fd. I
5785 kept the log popup and nuked the options form.
5787 * src/{la,}texoptions.[Ch]: removed.
5788 * src/lyx_cb.C (LaTeXOptions): ditto
5790 * src/lyx_gui.C (create_forms): do not handle the
5791 fd_latex_options form.
5793 2000-07-18 Juergen Vigna <jug@sad.it>
5795 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5796 name of the inset so that it can be requested outside (text2.C).
5798 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5801 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5803 * src/mathed/formula.h (ConvertFont): constify
5805 * src/mathed/formula.C (Read): add warning if \end_inset is not
5806 found on expected place.
5808 * src/insets/lyxinset.h (ConvertFont): consify
5810 * src/insets/insetquotes.C (ConvertFont): constify
5811 * src/insets/insetquotes.h: ditto
5813 * src/insets/insetinfo.h: add labelfont
5815 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5816 (ascent): use labelfont
5820 (Write): make .lyx file a bit nicer
5822 * src/insets/insetfloat.C (Write): simplify somewhat...
5823 (Read): add warning if arg is not found
5825 * src/insets/insetcollapsable.C: add using std::max
5826 (Read): move string token and add warning in arg is not found
5827 (draw): use std::max to get the right ty
5828 (getMaxWidth): simplify by using std::max
5830 * src/insets/insetsection.h: new file
5831 * src/insets/insetsection.C: new file
5832 * src/insets/insetcaption.h: new file
5833 * src/insets/insetcaption.C: new file
5835 * src/insets/inset.C (ConvertFont): constify signature
5837 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5838 insetcaption.[Ch] and insetsection.[Ch]
5840 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5841 uses to use LABEL_COUNTER_CHAPTER instead.
5842 * src/text2.C (SetCounter): here
5844 * src/counters.h: new file
5845 * src/counters.C: new file
5846 * src/Sectioning.h: new file
5847 * src/Sectioning.C: new file
5849 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5851 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5853 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5856 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5859 2000-07-17 Juergen Vigna <jug@sad.it>
5861 * src/tabular.C (Validate): check if array-package is needed.
5862 (SetVAlignment): added support for vertical alignment.
5863 (SetLTFoot): better support for longtable header/footers
5864 (Latex): modified to support added features.
5866 * src/LaTeXFeatures.[Ch]: added array-package.
5868 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5870 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5873 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5875 * configure.in: do not forget to put a space after -isystem.
5877 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5879 * lib/kbd/arabic.kmap: a few fixes.
5881 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5883 * some whitespace chagnes to a number of files.
5885 * src/support/DebugStream.h: change to make it easier for
5886 doc++ to parse correctly.
5887 * src/support/lyxstring.h: ditto
5889 * src/mathed/math_utils.C (compara): change to have only one
5891 (MathedLookupBOP): change because of the above.
5893 * src/mathed/math_delim.C (math_deco_compare): change to have only
5895 (search_deco): change becasue of the above.
5897 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5898 instead of manually coded one.
5900 * src/insets/insetquotes.C (Read): read the \end_inset too
5902 * src/insets/insetlatex.h: remove file
5903 * src/insets/insetlatex.C: remove file
5905 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5907 (InsetPrintIndex): remove destructor
5909 * src/insets/insetinclude.h: remove default constructor
5911 * src/insets/insetfloat.C: work to make it work better
5913 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5915 * src/insets/insetcite.h (InsetCitation): remove default constructor
5917 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5919 * src/text.C (GetColumnNearX): comment out some currently unused code.
5921 * src/paragraph.C (writeFile): move some initializations closer to
5923 (CutIntoMinibuffer): small change to use new matchIT operator
5927 (InsertInset): ditto
5930 (InsetIterator): ditto
5931 (Erase): small change to use new matchFT operator
5933 (GetFontSettings): ditto
5934 (HighestFontInRange): ditto
5937 * src/lyxparagraph.h: some chars changed to value_type
5938 (matchIT): because of some stronger checking (perhaps too strong)
5939 in SGI STL, the two operator() unified to one.
5942 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5944 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5945 the last inset read added
5946 (parseSingleLyXformat2Token): some more (future) compability code added
5947 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5948 (parseSingleLyXformat2Token): set last_inset_read
5949 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5950 (parseSingleLyXformat2Token): don't double intializw string next_token
5952 * src/TextCache.C (text_fits::operator()): add const's to the signature
5953 (has_buffer::operator()): ditto
5955 * src/Floating.h: add some comments on the class
5957 * src/FloatList.[Ch] (typeExist): new method
5960 * src/BackStack.h: added default constructor, wanted by Gcc.
5962 2000-07-14 Juergen Vigna <jug@sad.it>
5964 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5966 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5968 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5969 do a redraw when the window is resized!
5970 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5972 * src/insets/insettext.C (resizeLyXText): added function to correctly
5973 being able to resize the LyXWindow.
5975 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5977 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5979 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5980 crashes when closing dialog to a deleted inset.
5982 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5983 method! Now similar to other insets.
5985 2000-07-13 Juergen Vigna <jug@sad.it>
5987 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5989 * lib/examples/Literate.lyx: small patch!
5991 * src/insets/insetbib.C (Read): added this function because of wrong
5992 Write (without [begin|end]_inset).
5994 2000-07-11 Juergen Vigna <jug@sad.it>
5996 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5997 as the insertInset could not be good!
5999 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6000 the bool param should not be last.
6002 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6004 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6005 did submit that to Karl).
6007 * configure.in: use -isystem instead of -I for X headers. This
6008 fixes a problem on solaris with a recent gcc;
6009 put the front-end code after the X detection code;
6010 configure in sigc++ before lib/
6012 * src/lyx_main.C (commandLineHelp): remove -display from command
6015 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6017 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6018 Also put in Makefile rules for building the ``listerrors''
6019 program for parsing errors from literate programs written in LyX.
6021 * lib/build-listerrors: Added small shell script as part of compile
6022 process. This builds a working ``listerrors'' binary if noweb is
6023 installed and either 1) the VNC X server is installed on the machine,
6024 or 2) the user is compiling from within a GUI. The existence of a GUI
6025 is necessary to use the ``lyx --export'' feature for now. This
6026 hack can be removed once ``lyx --export'' no longer requires a GUI to
6029 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6031 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6032 now passed back correctly from gcc and placed "under" error
6033 buttons in a Literate LyX source.
6035 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6037 * src/text.C (GetColumnNearX): Better behavior when a RTL
6038 paragraph is ended by LTR text.
6040 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6043 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6045 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6046 true when clipboard is empty.
6048 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6050 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6051 row of the paragraph.
6052 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6053 to prevent calculation of bidi tables
6055 2000-07-07 Juergen Vigna <jug@sad.it>
6057 * src/screen.C (ToggleSelection): added y_offset and x_offset
6060 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6063 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6065 * src/insets/insettext.C: fixed Layout-Display!
6067 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6069 * configure.in: add check for strings.h header.
6071 * src/spellchecker.C: include <strings.h> in order to have a
6072 definition for bzero().
6074 2000-07-07 Juergen Vigna <jug@sad.it>
6076 * src/insets/insettext.C (draw): set the status of the bv->text to
6077 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6079 * src/screen.C (DrawOneRow):
6080 (DrawFromTo): redraw the actual row if something has changed in it
6083 * src/text.C (draw): call an update of the toplevel-inset if something
6084 has changed inside while drawing.
6086 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6088 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6090 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6091 processing inside class.
6093 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6094 processing inside class.
6096 * src/insets/insetindex.h new struct Holder, consistent with other
6099 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6100 citation dialog from main code and placed it in src/frontends/xforms.
6101 Dialog launched through signals instead of callbacks
6103 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6105 * lyx.man: update the options description.
6107 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6109 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6110 handle neg values, set min width to 590, add doc about -display
6112 2000-07-05 Juergen Vigna <jug@sad.it>
6114 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6115 calls to BufferView *.
6117 * src/insets/insettext.C (checkAndActivateInset): small fix non
6118 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6120 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6121 their \end_inset token!
6123 2000-07-04 edscott <edscott@imp.mx>
6125 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6126 lib/lyxrc.example: added option \wheel_jump
6128 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6130 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6131 remove support for -width,-height,-xpos and -ypos.
6133 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6135 * src/encoding.[Ch]: New files.
6137 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6138 (text): Call to the underline() method only when needed.
6140 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6142 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6143 encoding(s) for the document.
6145 * src/bufferparams.C (BufferParams): Changed default value of
6148 * src/language.C (newLang): Removed.
6149 (items[]): Added encoding information for all defined languages.
6151 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6152 encoding choice button.
6154 * src/lyxrc.h (font_norm_type): New member variable.
6155 (set_font_norm_type): New method.
6157 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6158 paragraphs with different encodings.
6160 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6161 (TransformChar): Changed to work correctly with Arabic points.
6162 (draw): Added support for drawing Arabic points.
6163 (draw): Removed code for drawing underbars (this is done by
6166 * src/support/textutils.h (IsPrintableNonspace): New function.
6168 * src/BufferView_pimpl.h: Added "using SigC::Object".
6169 * src/LyXView.h: ditto.
6171 * src/insets/insetinclude.h (include_label): Changed to mutable.
6173 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6175 * src/mathed/math_iter.h: remove empty destructor
6177 * src/mathed/math_cursor.h: remove empty destructor
6179 * src/insets/lyxinset.h: add THEOREM_CODE
6181 * src/insets/insettheorem.[Ch]: new files
6183 * src/insets/insetminipage.C: (InsertInset): remove
6185 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6187 (InsertInset): remove
6189 * src/insets/insetlist.C: (InsertList): remove
6191 * src/insets/insetfootlike.[Ch]: new files
6193 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6196 (InsertInset): ditto
6198 * src/insets/insetert.C: remove include Painter.h, reindent
6199 (InsertInset): move to header
6201 * src/insets/insetcollapsable.h: remove explicit from default
6202 contructor, remove empty destructor, add InsertInset
6204 * src/insets/insetcollapsable.C (InsertInset): new func
6206 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6208 * src/vspace.h: add explicit to constructor
6210 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6211 \textcompwordmark, please test this.
6213 * src/lyxrc.C: set ascii_linelen to 65 by default
6215 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6217 * src/commandtags.h: add LFUN_INSET_THEOREM
6219 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6220 (makeLinuxDocFile): remove _some_ of the nice logic
6221 (makeDocBookFile): ditto
6223 * src/Painter.[Ch]: (~Painter): removed
6225 * src/LyXAction.C (init): entry for insettheorem added
6227 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6229 (deplog): code to detect files generated by LaTeX, needs testing
6232 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6234 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6236 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6238 * src/LaTeX.C (deplog): Add a check for files that are going to be
6239 created by the first latex run, part of the project to remove the
6242 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6243 contents to the extension list.
6245 2000-07-04 Juergen Vigna <jug@sad.it>
6247 * src/text.C (NextBreakPoint): added support for needFullRow()
6249 * src/insets/lyxinset.h: added needFullRow()
6251 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6254 * src/insets/insettext.C: lots of changes for update!
6256 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6258 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6260 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6262 * src/insets/insetinclude.C (InsetInclude): fixed
6263 initialization of include_label.
6264 (unique_id): now returns a string.
6266 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6268 * src/LaTeXFeatures.h: new member IncludedFiles, for
6269 a map of key, included file name.
6271 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6272 with the included files for inclusion in SGML preamble,
6273 i. e., linuxdoc and docbook.
6276 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6277 nice (is the generated linuxdoc code to be exported?), that
6278 allows to remove column, and only_body that will be true for
6279 slave documents. Insets are allowed inside SGML font type.
6280 New handling of the SGML preamble for included files.
6281 (makeDocBookFile): the same for docbook.
6283 * src/insets/insetinclude.h:
6284 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6286 (DocBook): new export methods.
6288 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6289 and makeDocBookFile.
6291 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6292 formats to export with command line argument -x.
6294 2000-06-29 Juergen Vigna <jug@sad.it>
6296 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6297 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6299 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6300 region could already been cleared by an inset!
6302 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6304 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6307 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6309 (cursorToggle): remove special handling of lyx focus.
6311 2000-06-28 Juergen Vigna <jug@sad.it>
6313 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6316 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6318 * src/insets/insetindex.C (Edit): add a callback when popup is
6321 * src/insets/insettext.C (LocalDispatch):
6322 * src/insets/insetmarginal.h:
6323 * src/insets/insetlist.h:
6324 * src/insets/insetfoot.h:
6325 * src/insets/insetfloat.h:
6326 * src/insets/insetert.h: add a missing std:: qualifier.
6328 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6330 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6333 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6335 * src/insets/insettext.C (Read): remove tmptok unused variable
6336 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6337 (InsertInset): change for new InsetInset code
6339 * src/insets/insettext.h: add TEXT inline method
6341 * src/insets/insettext.C: remove TEXT macro
6343 * src/insets/insetmarginal.C (Write): new method
6344 (Latex): change output slightly
6346 * src/insets/insetfoot.C (Write): new method
6347 (Latex): change output slightly (don't use endl when no need)
6349 * src/insets/insetert.C (Write): new method
6351 * src/insets/insetcollapsable.h: make button_length, button_top_y
6352 and button_bottm_y protected.
6354 * src/insets/insetcollapsable.C (Write): simplify code by using
6355 tostr. Also do not output the float name, the children class
6356 should to that to get control over own arguments
6358 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6359 src/insets/insetminipage.[Ch]:
6362 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6364 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6366 * src/Makefile.am (lyx_SOURCES): add the new files
6368 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6369 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6370 * src/commandtags.h: ditto
6372 * src/LaTeXFeatures.h: add a std::set of used floattypes
6374 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6376 * src/FloatList.[Ch] src/Floating.h: new files
6378 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6380 * src/lyx_cb.C (TableApplyCB): ditto
6382 * src/text2.C: ditto
6383 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6384 (parseSingleLyXformat2Token): ditto + add code for
6385 backwards compability for old float styles + add code for new insets
6387 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6389 (InsertInset(size_type, Inset *, LyXFont)): new method
6390 (InsetChar(size_type, char)): changed to use the other InsetChar
6391 with a LyXFont(ALL_INHERIT).
6392 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6393 insert the META_INSET.
6395 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6397 * sigc++/thread.h (Threads): from here
6399 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6400 definition out of line
6401 * sigc++/scope.h: from here
6403 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6405 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6406 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6408 * Makefile.am (bindist): new target.
6410 * INSTALL: add instructions for doing a binary distribution.
6412 * development/tools/README.bin.example: update a bit.
6414 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6417 * lib/lyxrc.example: new lyxrc tag \set_color.
6419 * src/lyxfunc.C (Dispatch):
6420 * src/commandtags.h:
6421 * src/LyXAction.C: new lyxfunc "set-color".
6423 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6424 and an x11name given as strings.
6426 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6427 cache when a color is changed.
6429 2000-06-26 Juergen Vigna <jug@sad.it>
6431 * src/lyxrow.C (width): added this functions and variable.
6433 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6436 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6438 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6440 * images/undo_bw.xpm: new icon.
6441 * images/redo_bw.xpm: ditto.
6443 * configure.in (INSTALL_SCRIPT): change value to
6444 ${INSTALL} to avoid failures of install-script target.
6445 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6447 * src/BufferView.h: add a magic "friend" declaration to please
6450 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6452 * forms/cite.fd: modified to allow resizing without messing
6455 * src/insetcite.C: Uses code from cite.fd almost without
6457 User can now resize dialog in the x-direction.
6458 Resizing the dialog in the y-direction is prevented, as the
6459 code does this intelligently already.
6461 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6463 * INSTALL: remove obsolete entry in "problems" section.
6465 * lib/examples/sl_*.lyx: update of the slovenian examples.
6467 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6469 2000-06-23 Juergen Vigna <jug@sad.it>
6471 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6473 * src/buffer.C (resize): delete the LyXText of textinsets.
6475 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6477 * src/insets/lyxinset.h: added another parameter 'cleared' to
6478 the draw() function.
6480 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6481 unlocking inset in inset.
6483 2000-06-22 Juergen Vigna <jug@sad.it>
6485 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6486 of insets and moved first to LyXText.
6488 * src/mathed/formulamacro.[Ch]:
6489 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6491 2000-06-21 Juergen Vigna <jug@sad.it>
6493 * src/text.C (GetVisibleRow): look if I should clear the area or not
6494 using Inset::doClearArea() function.
6496 * src/insets/lyxinset.h: added doClearArea() function and
6497 modified draw(Painter &, ...) to draw(BufferView *, ...)
6499 * src/text2.C (UpdateInset): return bool insted of int
6501 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6503 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6504 combox in the character popup
6506 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6507 BufferParams const & params
6509 2000-06-20 Juergen Vigna <jug@sad.it>
6511 * src/insets/insettext.C (SetParagraphData): set insetowner on
6514 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6516 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6517 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6519 (form_main_): remove
6521 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6522 (create_form_form_main): remove FD_form_main stuff, connect to
6523 autosave_timeout signal
6525 * src/LyXView.[Ch] (getMainForm): remove
6526 (UpdateTimerCB): remove
6527 * src/BufferView_pimpl.h: inherit from SigC::Object
6529 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6530 signal instead of callback
6532 * src/BufferView.[Ch] (cursorToggleCB): remove
6534 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6536 * src/BufferView_pimpl.C: changes because of the one below
6538 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6539 instead of storing a pointer to a LyXText.
6541 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6543 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6545 * src/lyxparagraph.h
6547 * src/paragraph.C: Changed fontlist to a sorted vector.
6549 2000-06-19 Juergen Vigna <jug@sad.it>
6551 * src/BufferView.h: added screen() function.
6553 * src/insets/insettext.C (LocalDispatch): some selection code
6556 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6558 * src/insets/insettext.C (SetParagraphData):
6560 (InsetText): fixes for multiple paragraphs.
6562 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6564 * development/lyx.spec.in: Call configure with ``--without-warnings''
6565 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6566 This should be fine, however, since we generally don't want to be
6567 verbose when making an RPM.
6569 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6571 * lib/scripts/fig2pstex.py: New file
6573 2000-06-16 Juergen Vigna <jug@sad.it>
6575 * src/insets/insettabular.C (UpdateLocal):
6576 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6577 (LocalDispatch): Changed all functions to use LyXText.
6579 2000-06-15 Juergen Vigna <jug@sad.it>
6581 * src/text.C (SetHeightOfRow): call inset::update before requesting
6584 * src/insets/insettext.C (update):
6585 * src/insets/insettabular.C (update): added implementation
6587 * src/insets/lyxinset.h: added update function
6589 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6591 * src/text.C (SelectNextWord): protect against null pointers with
6592 old-style string streams. (fix from Paul Theo Gonciari
6595 * src/cite.[Ch]: remove erroneous files.
6597 * lib/configure.m4: update the list of created directories.
6599 * src/lyxrow.C: include <config.h>
6600 * src/lyxcursor.C: ditto.
6602 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6604 * lib/examples/decimal.lyx: new example file from Mike.
6606 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6607 to find template definitions (from Dekel)
6609 * src/frontends/.cvsignore: add a few things.
6611 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6613 * src/Timeout.C (TimeOut): remove default argument.
6615 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6618 * src/insets/ExternalTemplate.C: add a "using" directive.
6620 * src/lyx_main.h: remove the act_ struct, which seems unused
6623 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6625 * LyX Developers Meeting: All files changed, due to random C++ (by
6626 coincidence) code generator script.
6628 - external inset (cool!)
6629 - initial online editing of preferences
6630 - insettabular breaks insettext(s contents)
6632 - some DocBook fixes
6633 - example files update
6634 - other cool stuff, create a diff and look for yourself.
6636 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6638 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6639 -1 this is a non-line-breaking textinset.
6641 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6642 if there is no width set.
6644 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6646 * Lots of files: Merged the dialogbase branch.
6648 2000-06-09 Allan Rae <rae@lyx.org>
6650 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6651 and the Dispatch methods that used it.
6653 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6654 access to functions formerly kept in Dispatch.
6656 2000-05-19 Allan Rae <rae@lyx.org>
6658 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6659 made to_page and count_copies integers again. from_page remains a
6660 string however because I want to allow entry of a print range like
6661 "1,4,22-25" using this field.
6663 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6664 and printer-params-get. These aren't useful from the minibuffer but
6665 could be used by a script/LyXServer app provided it passes a suitable
6666 auto_mem_buffer. I guess I should take a look at how the LyXServer
6667 works and make it support xtl buffers.
6669 * sigc++/: updated to libsigc++-1.0.1
6671 * src/xtl/: updated to xtl-1.3.pl.11
6673 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6674 those changes done to the files in src/ are actually recreated when
6675 they get regenerated. Please don't ever accept a patch that changes a
6676 dialog unless that patch includes the changes to the corresponding *.fd
6679 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6680 stringOnlyContains, renamed it and generalised it.
6682 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6683 branch. Removed the remaining old form_print code.
6685 2000-04-26 Allan Rae <rae@lyx.org>
6687 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6688 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6690 2000-04-25 Allan Rae <rae@lyx.org>
6692 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6693 against a base of xtl-1.3.pl.4
6695 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6696 filter the Id: entries so they still show the xtl version number
6699 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6700 into the src/xtl code. Patch still pending with José (XTL)
6702 2000-04-24 Allan Rae <rae@lyx.org>
6704 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6705 both more generic and much safer. Use the new template functions.
6706 * src/buffer.[Ch] (Dispatch): ditto.
6708 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6709 and mem buffer more intelligently. Also a little general cleanup.
6712 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6713 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6714 * src/xtl/Makefile.am: ditto.
6715 * src/xtl/.cvsignore: ditto.
6716 * src/Makefile.am: ditto.
6718 * src/PrinterParams.h: Removed the macros member functions. Added a
6719 testInvariant member function. A bit of tidying up and commenting.
6720 Included Angus's idea for fixing operation with egcs-1.1.2.
6722 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6723 cool expansion of XTL's mem_buffer to support automatic memory
6724 management within the buffer itself. Removed the various macros and
6725 replaced them with template functions that use either auto_mem_buffer
6726 or mem_buffer depending on a #define. The mem_buffer support will
6727 disappear as soon as the auto_mem_buffer is confirmed to be good on
6728 other platforms/compilers. That is, it's there so you've got something
6731 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6732 effectively forked XTL. However I expect José will include my code
6733 into the next major release. Also fixed a memory leak.
6734 * src/xtl/text.h: ditto.
6735 * src/xtl/xdr.h: ditto.
6736 * src/xtl/giop.h: ditto.
6738 2000-04-16 Allan Rae <rae@lyx.org>
6740 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6741 by autogen.sh and removed by maintainer-clean anyway.
6742 * .cvsignore, sigc++/.cvsignore: Support the above.
6744 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6746 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6748 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6749 macros, renamed static callback-target member functions to suit new
6750 scheme and made them public.
6751 * src/frontends/xforms/forms/form_print.fd: ditto.
6752 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6754 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6757 * src/xtl/: New directory containing a minimal distribution of XTL.
6758 This is XTL-1.3.pl.4.
6760 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6762 2000-04-15 Allan Rae <rae@lyx.org>
6764 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6766 * sigc++/: Updated to libsigc++-1.0.0
6768 2000-04-14 Allan Rae <rae@lyx.org>
6770 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6771 use the generic ones in future. I'll modify my conversion script.
6773 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6775 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6776 (CloseAllBufferRelatedDialogs): Renamed.
6777 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6779 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6780 of the generic ones. These are the same ones my conversion script
6783 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6784 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6785 * src/buffer.C (Dispatch): ditto
6787 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6788 functions for updating and hiding buffer dependent dialogs.
6789 * src/BufferView.C (buffer): ditto
6790 * src/buffer.C (setReadonly): ditto
6791 * src/lyxfunc.C (CloseBuffer): ditto
6793 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6794 Dialogs.h, and hence all the SigC stuff, into every file that includes
6795 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6797 * src/BufferView2.C: reduce the number of headers included by buffer.h
6799 2000-04-11 Allan Rae <rae@lyx.org>
6801 * src/frontends/xforms/xform_macros.h: A small collection of macros
6802 for building C callbacks.
6804 * src/frontends/xforms/Makefile.am: Added above file.
6806 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6807 scheme again. This time it should work for JMarc. If this is
6808 successful I'll revise my conversion script to automate some of this.
6809 The static member functions in the class also have to be public for
6810 this scheme will work. If the scheme works (it's almost identical to
6811 the way BufferView::cursorToggleCB is handled so it should work) then
6812 FormCopyright and FormPrint will be ready for inclusion into the main
6813 trunk immediately after 1.1.5 is released -- provided we're prepared
6814 for complaints about lame compilers not handling XTL.
6816 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6818 2000-04-07 Allan Rae <rae@lyx.org>
6820 * config/lyxinclude.m4: A bit more tidying up (Angus)
6822 * src/LString.h: JMarc's <string> header fix
6824 * src/PrinterParams.h: Used string for most data to remove some
6825 ugly code in the Print dialog and avoid even uglier code when
6826 appending the ints to a string for output.
6828 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6829 and moved "default:" back to the end of switch statement. Cleaned
6830 up the printing so it uses the right function calls and so the
6831 "print to file" option actually puts the file in the right directory.
6833 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6835 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6836 and Ok+Apply button control into a separate method: input (Angus).
6837 (input) Cleaned it up and improved it to be very thorough now.
6838 (All CB) static_cast used instead of C style cast (Angus). This will
6839 probably change again once we've worked out how to keep gcc-2.8.1 happy
6840 with real C callbacks.
6841 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6842 ignore some of the bool settings and has random numbers instead. Needs
6843 some more investigation. Added other input length checks and checking
6844 of file and printer names.
6846 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6847 would link (Angus). Seems the old code doesn't compile with the pragma
6848 statement either. Separated callback entries from internal methods.
6850 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6852 2000-03-17 Allan Rae <rae@lyx.org>
6854 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6855 need it? Maybe it could go in Dialogs instead? I could make it a
6856 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6857 values to get the bool return value.
6858 (Dispatch): New overloaded method for xtl support.
6860 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6861 extern "C" callback instead of static member functions. Hopefully,
6862 JMarc will be able to compile this. I haven't changed
6863 forms/form_copyright.fd yet. Breaking one of my own rules already.
6865 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6866 because they aren't useful from the minibuffer. Maybe a LyXServer
6867 might want a help message though?
6869 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6871 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6872 xtl which needs both rtti and exceptions.
6874 * src/support/Makefile.am:
6875 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6877 * src/frontends/xforms/input_validators.[ch]: input filters and
6878 validators. These conrol what keys are valid in input boxes.
6879 Use them and write some more. Much better idea than waiting till
6880 after the user has pressed Ok to say that the input fields don't make
6883 * src/frontends/xforms/Makefile.am:
6884 * src/frontends/xforms/forms/form_print.fd:
6885 * src/frontends/xforms/forms/makefile:
6886 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6887 new scheme. Still have to make sure I haven't missed anything from
6888 the current implementation.
6890 * src/Makefile.am, src/PrinterParams.h: New data store.
6892 * other files: Added a couple of copyright notices.
6894 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6896 * src/insets/insetbib.h: move Holder struct in public space.
6898 * src/frontends/include/DialogBase.h: use SigC:: only when
6899 SIGC_CXX_NAMESPACES is defined.
6900 * src/frontends/include/Dialogs.h: ditto.
6902 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6904 * src/frontends/xforms/FormCopyright.[Ch]: do not
6905 mention SigC:: explicitely.
6907 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6909 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6910 deals with testing KDE in main configure.in
6911 * configure.in: ditto.
6913 2000-02-22 Allan Rae <rae@lyx.org>
6915 * Lots of files: Merged from HEAD
6917 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6918 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6920 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6922 * sigc++/: new minidist.
6924 2000-02-14 Allan Rae <rae@lyx.org>
6926 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6928 2000-02-08 Juergen Vigna <jug@sad.it>
6930 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6931 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6933 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6934 for this port and so it is much easier for other people to port
6935 dialogs in a common development environment.
6937 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6938 the QT/KDE implementation.
6940 * src/frontends/kde/Dialogs.C:
6941 * src/frontends/kde/FormCopyright.C:
6942 * src/frontends/kde/FormCopyright.h:
6943 * src/frontends/kde/Makefile.am:
6944 * src/frontends/kde/formcopyrightdialog.C:
6945 * src/frontends/kde/formcopyrightdialog.h:
6946 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6947 for the kde support of the Copyright-Dialog.
6949 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6950 subdir-substitution instead of hardcoded 'xforms' as we now have also
6953 * src/frontends/include/DialogBase.h (Object): just commented the
6954 label after #endif (nasty warning and I don't like warnings ;)
6956 * src/main.C (main): added KApplication initialization if using
6959 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6960 For now only the KDE event-loop is added if frontend==kde.
6962 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6964 * configure.in: added support for the --with-frontend[=value] option
6966 * autogen.sh: added kde.m4 file to list of config-files
6968 * acconfig.h: added define for KDEGUI-support
6970 * config/kde.m4: added configuration functions for KDE-port
6972 * config/lyxinclude.m4: added --with-frontend[=value] option with
6973 support for xforms and KDE.
6975 2000-02-08 Allan Rae <rae@lyx.org>
6977 * all Makefile.am: Fixed up so the make targets dist, distclean,
6978 install and uninstall all work even if builddir != srcdir. Still
6979 have a new sigc++ minidist update to come.
6981 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6983 2000-02-01 Allan Rae <rae@lyx.org>
6985 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6986 Many mods to get builddir != srcdir working.
6988 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6989 for building on NT and so we can do the builddir != srcdir stuff.
6991 2000-01-30 Allan Rae <rae@lyx.org>
6993 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6994 This will stay in "rae" branch. We probably don't really need it in
6995 the main trunk as anyone who wants to help programming it should get
6996 a full library installed also. So they can check both included and
6997 system supplied library compilation.
6999 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7000 Added a 'mini' distribution of libsigc++. If you feel the urge to
7001 change something in these directories - Resist it. If you can't
7002 resist the urge then you should modify the following script and rebuild
7003 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7004 all happen. Still uses a hacked version of libsigc++'s configure.in.
7005 I'm quite happy with the results. I'm not sure the extra work to turn
7006 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7007 worth the trouble and would probably lead to extra maintenance
7009 I haven't tested the following important make targets: install, dist.
7010 Not ready for prime time but very close. Maybe 1.1.5.
7012 * development/tools/makeLyXsigc.sh: A shell script to automatically
7013 generate our mini-dist of libsigc++. It can only be used with a CVS
7014 checkout of libsigc++ not a tarball distribution. It's well commented.
7015 This will end up as part of the libsigc++ distribution so other apps
7016 can easily have an included mini-dist. If someone makes mods to the
7017 sigc++ subpackage without modifying this script to generate those
7018 changes I'll be very upset!
7020 * src/frontends/: Started the gui/system indep structure.
7022 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7023 to access the gui-indep dialogs are in this class. Much improved
7024 design compared to previous revision. Lars, please refrain from
7025 moving this header into src/ like you did with Popups.h last time.
7027 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7029 * src/frontends/xforms/: Started the gui-indep system with a single
7030 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7033 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7034 Here you'll find a very useful makefile and automated fdfix.sh that
7035 makes updating dailogs a no-brainer -- provided you follow the rules
7036 set out in the README. I'm thinking about adding another script to
7037 automatically generate skeleton code for a new dialog given just the
7040 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7041 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7042 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7044 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7046 * src/support/LSubstring.C (operator): simplify
7048 * src/lyxtext.h: removed bparams, use buffer_->params instead
7050 * src/lyxrow.h: make Row a real class, move all variables to
7051 private and use accessors.
7053 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7055 (isRightToLeftPar): ditto
7056 (ChangeLanguage): ditto
7057 (isMultiLingual): ditto
7060 (SimpleTeXOnePar): ditto
7061 (TeXEnvironment): ditto
7062 (GetEndLabel): ditto
7064 (SetOnlyLayout): ditto
7065 (BreakParagraph): ditto
7066 (BreakParagraphConservative): ditto
7067 (GetFontSettings): ditto
7069 (CopyIntoMinibuffer): ditto
7070 (CutIntoMinibuffer): ditto
7071 (PasteParagraph): ditto
7072 (SetPExtraType): ditto
7073 (UnsetPExtraType): ditto
7074 (DocBookContTableRows): ditto
7075 (SimpleDocBookOneTablePar): ditto
7077 (TeXFootnote): ditto
7078 (SimpleTeXOneTablePar): ditto
7079 (TeXContTableRows): ditto
7080 (SimpleTeXSpecialChars): ditto
7083 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7084 to private and use accessors.
7086 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7087 this, we did not use it anymore and has not been for ages. Just a
7088 waste of cpu cycles.
7090 * src/language.h: make Language a real class, move all variables
7091 to private and use accessors.
7093 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7094 (create_view): remove
7095 (update): some changes for new timer
7096 (cursorToggle): use new timer
7097 (beforeChange): change for new timer
7099 * src/BufferView.h (cursorToggleCB): removed last paramter because
7102 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7103 (cursorToggleCB): change because of new timer code
7105 * lib/CREDITS: updated own mailaddress
7107 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7109 * src/support/filetools.C (PutEnv): fix the code in case neither
7110 putenv() nor setenv() have been found.
7112 * INSTALL: mention the install-strip Makefile target.
7114 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7115 read-only documents.
7117 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7119 * lib/reLyX/configure.in (VERSION): avoid using a previously
7120 generated reLyX wrapper to find out $prefix.
7122 * lib/examples/eu_adibide_lyx-atua.lyx:
7123 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7124 translation of the Tutorial (Dooteo)
7126 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7128 * forms/cite.fd: new citation dialog
7130 * src/insetcite.[Ch]: the new citation dialog is moved into
7133 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7136 * src/insets/insetcommand.h: data members made private.
7138 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7140 * LyX 1.1.5 released
7142 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7144 * src/version.h (LYX_RELEASE): to 1.1.5
7146 * src/spellchecker.C (RunSpellChecker): return false if the
7147 spellchecker dies upon creation.
7149 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7151 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7152 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7156 * lib/CREDITS: update entry for Martin Vermeer.
7158 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7160 * src/text.C (draw): Draw foreign language bars at the bottom of
7161 the row instead of at the baseline.
7163 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7165 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7167 * lib/bind/de_menus.bind: updated
7169 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7171 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7173 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7175 * src/menus.C (Limit_string_length): New function
7176 (ShowTocMenu): Limit the number of items/length of items in the
7179 * src/paragraph.C (String): Correct result for a paragraph inside
7182 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7184 * src/bufferlist.C (close): test of buf->getuser() == NULL
7186 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7188 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7189 Do not call to SetCursor when the paragraph is a closed footnote!
7191 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7193 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7196 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7198 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7201 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7202 reference popup, that activates the reference-back action
7204 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7206 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7207 the menus. Also fixed a bug.
7209 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7210 the math panels when switching buffers (unless new buffer is readonly).
7212 * src/BufferView.C (NoSavedPositions)
7213 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7215 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7217 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7218 less of dvi dirty or not.
7220 * src/trans_mgr.[Ch] (insert): change first parameter to string
7223 * src/chset.[Ch] (encodeString): add const to first parameter
7225 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7227 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7231 * src/LaTeX.C (deplog): better searching for dependency files in
7232 the latex log. Uses now regexps.
7234 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7235 instead of the box hack or \hfill.
7237 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7239 * src/lyxfunc.C (doImportHelper): do not create the file before
7240 doing the actual import.
7241 (doImportASCIIasLines): create a new file before doing the insert.
7242 (doImportASCIIasParagraphs): ditto.
7244 * lib/lyxrc.example: remove mention of non-existing commands
7246 * lyx.man: remove mention of color-related switches.
7248 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7250 * src/lyx_gui.C: remove all the color-related ressources, which
7251 are not used anymore.
7253 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7256 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7258 * src/lyxrc.C (read): Add a missing break in the switch
7260 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7262 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7264 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7267 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7269 * src/text.C (draw): draw bars under foreign language words.
7271 * src/LColor.[Ch]: add LColor::language
7273 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7275 * src/lyxcursor.h (boundary): New member variable
7277 * src/text.C (IsBoundary): New methods
7279 * src/text.C: Use the above for currect cursor movement when there
7280 is both RTL & LTR text.
7282 * src/text2.C: ditto
7284 * src/bufferview_funcs.C (ToggleAndShow): ditto
7286 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7288 * src/text.C (DeleteLineForward): set selection to true to avoid
7289 that DeleteEmptyParagraphMechanism does some magic. This is how it
7290 is done in all other functions, and seems reasonable.
7291 (DeleteWordForward): do not jump over non-word stuff, since
7292 CursorRightOneWord() already does it.
7294 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7295 DeleteWordBackward, since they seem safe to me (since selection is
7296 set to "true") DeleteEmptyParagraphMechanism does nothing.
7298 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7300 * src/lyx_main.C (easyParse): simplify the code by factoring the
7301 part that removes parameters from the command line.
7302 (LyX): check wether wrong command line options have been given.
7304 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7306 * src/lyx_main.C : add support for specifying user LyX
7307 directory via command line option -userdir.
7309 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7311 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7312 the number of items per popup.
7313 (Add_to_refs_menu): Ditto.
7315 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7317 * src/lyxparagraph.h: renamed ClearParagraph() to
7318 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7319 textclass as parameter, and do nothing if free_spacing is
7320 true. This fixes part of the line-delete-forward problems.
7322 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7323 (pasteSelection): ditto.
7324 (SwitchLayoutsBetweenClasses): more translatable strings.
7326 * src/text2.C (CutSelection): use StripLeadingSpaces.
7327 (PasteSelection): ditto.
7328 (DeleteEmptyParagraphMechanism): ditto.
7330 2000-05-26 Juergen Vigna <jug@sad.it>
7332 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7333 is not needed in tabular insets.
7335 * src/insets/insettabular.C (TabularFeatures): added missing features.
7337 * src/tabular.C (DeleteColumn):
7339 (AppendRow): implemented this functions
7340 (cellsturct::operator=): clone the inset too;
7342 2000-05-23 Juergen Vigna <jug@sad.it>
7344 * src/insets/insettabular.C (LocalDispatch): better selection support
7345 when having multicolumn-cells.
7347 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7349 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7351 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7353 * src/ColorHandler.C (getGCForeground): put more test into _()
7355 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7358 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7361 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7363 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7364 there are no labels, or when buffer is readonly.
7366 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7367 there are no labels, buffer is SGML, or when buffer is readonly.
7369 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7371 * src/LColor.C (LColor): change a couple of grey40 to grey60
7372 (LColor): rewore initalization to make compiles go some magnitude
7374 (getGUIName): don't use gettext until we need the string.
7376 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7378 * src/Bullet.[Ch]: Fixed a small bug.
7380 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7382 * src/paragraph.C (String): Several fixes/improvements
7384 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7386 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7388 * src/paragraph.C (String): give more correct output.
7390 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7392 * src/lyxfont.C (stateText) Do not output the language if it is
7393 eqaul to the language of the document.
7395 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7396 between two paragraphs with the same language.
7398 * src/paragraph.C (getParLanguage) Return a correct answer for an
7399 empty dummy paragraph.
7401 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7404 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7407 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7408 the menus/popup, if requested fonts are unavailable.
7410 2000-05-22 Juergen Vigna <jug@sad.it>
7412 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7413 movement support (Up/Down/Tab/Shift-Tab).
7414 (LocalDispatch): added also preliminari cursor-selection.
7416 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7418 * src/paragraph.C (PasteParagraph): Hopefully now right!
7420 2000-05-22 Garst R. Reese <reese@isn.net>
7422 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7423 of list, change all references to Environment to Command
7424 * tex/hollywood.cls : rewrite environments as commands, add
7425 \uppercase to interiorshot and exteriorshot to force uppecase.
7426 * tex/broadway.cls : rewrite environments as commands. Tweak
7429 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7431 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7432 size of items: use a constant intead of the hardcoded 40, and more
7433 importantly do not remove the %m and %x tags added at the end.
7434 (Add_to_refs_menu): use vector::size_type instead of
7435 unsigned int as basic types for the variables. _Please_ do not
7436 assume that size_t is equal to unsigned int. On an alpha, this is
7437 unsigned long, which is _not_ the same.
7439 * src/language.C (initL): remove language "hungarian", since it
7440 seems that "magyar" is better.
7442 2000-05-22 Juergen Vigna <jug@sad.it>
7444 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7446 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7449 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7450 next was deleted but not set to 0.
7452 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7454 * src/language.C (initL): change the initialization of languages
7455 so that compiles goes _fast_.
7457 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7460 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7462 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7466 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7468 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7470 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7474 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7477 * src/insets/insetlo*.[Ch]: Made editable
7479 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7481 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7482 the current selection.
7484 * src/BufferView_pimpl.C (stuffClipboard): new method
7486 * src/BufferView.C (stuffClipboard): new method
7488 * src/paragraph.C (String): new method
7490 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7491 LColor::ignore when lyxname is not found.
7493 * src/BufferView.C (pasteSelection): new method
7495 * src/BufferView_pimpl.C (pasteSelection): new method
7497 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7499 * src/WorkArea.C (request_clipboard_cb): new static function
7500 (getClipboard): new method
7501 (putClipboard): new method
7503 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7505 * LyX 1.1.5pre2 released
7507 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7509 * src/vspace.C (operator=): removed
7510 (operator=): removed
7512 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7514 * src/layout.C (NumberOfClass): manually set the type in make_pair
7515 (NumberOfLayout): ditto
7517 * src/language.C: use the Language constructor for ignore_lang
7519 * src/language.h: add constructors to struct Language
7521 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7523 * src/text2.C (SetCursorIntern): comment out #warning
7525 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7527 * src/mathed/math_iter.h: initialize sx and sw to 0
7529 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7531 * forms/lyx.fd: Redesign of form_ref
7533 * src/LaTeXFeatures.[Ch]
7537 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7540 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7541 and Buffer::inset_iterator.
7543 * src/menus.C: Added new menus: TOC and Refs.
7545 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7547 * src/buffer.C (getTocList): New method.
7549 * src/BufferView2.C (ChangeRefs): New method.
7551 * src/buffer.C (getLabelList): New method. It replaces the old
7552 getReferenceList. The return type is vector<string> instead of
7555 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7556 the old getLabel() and GetNumberOfLabels() methods.
7557 * src/insets/insetlabel.C (getLabelList): ditto
7558 * src/mathed/formula.C (getLabelList): ditto
7560 * src/paragraph.C (String): New method.
7562 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7563 Uses the new getTocList() method.
7564 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7565 which automatically updates the contents of the browser.
7566 (RefUpdateCB): Use the new getLabelList method.
7568 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7570 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7572 * src/spellchecker.C: Added using std::reverse;
7574 2000-05-19 Juergen Vigna <jug@sad.it>
7576 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7578 * src/insets/insettext.C (computeTextRows): small fix for display of
7579 1 character after a newline.
7581 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7584 2000-05-18 Juergen Vigna <jug@sad.it>
7586 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7587 when changing width of column.
7589 * src/tabular.C (set_row_column_number_info): setting of
7590 autobreak rows if necessary.
7592 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7594 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7596 * src/vc-backend.*: renamed stat() to status() and vcstat to
7597 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7598 compilation broke. The new name seems more relevant, anyway.
7600 2000-05-17 Juergen Vigna <jug@sad.it>
7602 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7603 which was wrong if the removing caused removing of rows!
7605 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7606 (pushToken): new function.
7608 * src/text2.C (CutSelection): fix problem discovered with purify
7610 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7612 * src/debug.C (showTags): enlarge the first column, now that we
7613 have 6-digits debug codes.
7615 * lib/layouts/hollywood.layout:
7616 * lib/tex/hollywood.cls:
7617 * lib/tex/brodway.cls:
7618 * lib/layouts/brodway.layout: more commands and fewer
7619 environments. Preambles moved in the .cls files. Broadway now has
7620 more options on scene numbering and less whitespace (from Garst)
7622 * src/insets/insetbib.C (getKeys): make sure that we are in the
7623 document directory, in case the bib file is there.
7625 * src/insets/insetbib.C (Latex): revert bogus change.
7627 2000-05-16 Juergen Vigna <jug@sad.it>
7629 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7630 the TabularLayout on cursor move.
7632 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7634 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7637 (draw): fixed cursor position and drawing so that the cursor is
7638 visible when before the tabular-inset.
7640 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7641 when creating from old insettext.
7643 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7645 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7647 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7648 * lib/tex/brodway.cls: ditto
7650 * lib/layouts/brodway.layout: change alignment of parenthical
7653 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7655 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7656 versions 0.88 and 0.89 are supported.
7658 2000-05-15 Juergen Vigna <jug@sad.it>
7660 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7663 * src/insets/insettext.C (computeTextRows): redone completely this
7664 function in a much cleaner way, because of problems when having a
7666 (draw): added a frame border when the inset is locked.
7667 (SetDrawLockedFrame): this sets if we draw the border or not.
7668 (SetFrameColor): this sets the frame color (default=insetframe).
7670 * src/insets/lyxinset.h: added x() and y() functions which return
7671 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7672 function which is needed to see if we have a locking inset of some
7673 type in this inset (needed for now in insettabular).
7675 * src/vspace.C (inPixels): the same function also without a BufferView
7676 parameter as so it is easier to use it in some ocasions.
7678 * src/lyxfunc.C: changed all places where insertInset was used so
7679 that now if it couldn't be inserted it is deleted!
7681 * src/TabularLayout.C:
7682 * src/TableLayout.C: added support for new tabular-inset!
7684 * src/BufferView2.C (insertInset): this now returns a bool if the
7685 inset was really inserted!!!
7687 * src/tabular.C (GetLastCellInRow):
7688 (GetFirstCellInRow): new helper functions.
7689 (Latex): implemented for new tabular class.
7693 (TeXTopHLine): new Latex() helper functions.
7695 2000-05-12 Juergen Vigna <jug@sad.it>
7697 * src/mathed/formulamacro.C (Read):
7698 * src/mathed/formula.C (Read): read also the \end_inset here!
7700 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7702 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7703 crush when saving formulae with unbalanced parenthesis.
7705 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7707 * src/layout.C: Add new keyword "endlabelstring" to layout file
7709 * src/text.C (GetVisibleRow): Draw endlabel string.
7711 * lib/layouts/broadway.layout
7712 * lib/layouts/hollywood.layout: Added endlabel for the
7713 Parenthetical layout.
7715 * lib/layouts/heb-article.layout: Do not use slanted font shape
7716 for Theorem like environments.
7718 * src/buffer.C (makeLaTeXFile): Always add "american" to
7719 the UsedLanguages list if document language is RTL.
7721 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7723 * add addendum to README.OS2 and small patch (from SMiyata)
7725 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7727 * many files: correct the calls to ChangeExtension().
7729 * src/support/filetools.C (ChangeExtension): remove the no_path
7730 argument, which does not belong there. Use OnlyFileName() instead.
7732 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7733 files when LaTeXing a non-nice latex file.
7735 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7736 a chain of "if". Return false when deadkeys are not handled.
7738 * src/lyx_main.C (LyX): adapted the code for default bindings.
7740 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7741 bindings for basic functionality (except deadkeys).
7742 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7744 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7745 several methods: handle override_x_deadkeys.
7747 * src/lyxrc.h: remove the "bindings" map, which did not make much
7748 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7750 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7752 * src/lyxfont.C (stateText): use a saner method to determine
7753 whether the font is "default". Seems to fix the crash with DEC
7756 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7758 2000-05-08 Juergen Vigna <jug@sad.it>
7760 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7761 TabularLayoutMenu with mouse-button-3
7762 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7764 * src/TabularLayout.C: added this file for having a Layout for
7767 2000-05-05 Juergen Vigna <jug@sad.it>
7769 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7770 recalculating inset-widths.
7771 (TabularFeatures): activated this function so that I can change
7772 tabular-features via menu.
7774 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7775 that I can test some functions with the Table menu.
7777 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7779 * src/lyxfont.C (stateText): guard against stupid c++libs.
7781 * src/tabular.C: add using std::vector
7782 some whitespace changes, + removed som autogenerated code.
7784 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7786 2000-05-05 Juergen Vigna <jug@sad.it>
7788 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7789 row, columns and cellstructures.
7791 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7793 * lib/lyxrc.example: remove obsolete entries.
7795 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7796 reading of protected_separator for free_spacing.
7798 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7800 * src/text.C (draw): do not display an exclamation mark in the
7801 margin for margin notes. This is confusing, ugly and
7804 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7805 AMS math' is checked.
7807 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7808 name to see whether including the amsmath package is needed.
7810 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7812 * src/paragraph.C (validate): Compute UsedLanguages correctly
7813 (don't insert the american language if it doesn't appear in the
7816 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7817 The argument of \thanks{} command is considered moving argument
7819 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7822 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7824 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7825 for appendix/minipage/depth. The lines can be now both in the footnote
7826 frame, and outside the frame.
7828 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7831 2000-05-05 Juergen Vigna <jug@sad.it>
7833 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7834 neede only in tabular.[Ch].
7836 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7838 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7840 (Write): write '~' for PROTECTED_SEPARATOR
7842 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7844 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7847 * src/mathed/formula.C (drawStr): rename size to siz.
7849 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7850 possibly fix a bug by not changing the pflags = flags to piflags =
7853 2000-05-05 Juergen Vigna <jug@sad.it>
7855 * src/insets/insetbib.C: moved using directive
7857 * src/ImportNoweb.C: small fix for being able to compile (missing
7860 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7862 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7863 to use clear, since we don't depend on this in the code. Add test
7866 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7868 * (various *.C files): add using std::foo directives to please dec
7871 * replace calls to string::clear() to string::erase() (Angus)
7873 * src/cheaders/cmath: modified to provide std::abs.
7875 2000-05-04 Juergen Vigna <jug@sad.it>
7877 * src/insets/insettext.C: Prepared all for inserting of multiple
7878 paragraphs. Still display stuff to do (alignment and other things),
7879 but I would like to use LyXText to do this when we cleaned out the
7880 table-support stuff.
7882 * src/insets/insettabular.C: Changed lot of stuff and added lots
7883 of functionality still a lot to do.
7885 * src/tabular.C: Various functions changed name and moved to be
7886 const functions. Added new Read and Write functions and changed
7887 lots of things so it works good with tabular-insets (also removed
7888 some stuff which is not needed anymore * hacks *).
7890 * src/lyxcursor.h: added operators == and != which just look if
7891 par and pos are (not) equal.
7893 * src/buffer.C (latexParagraphs): inserted this function to latex
7894 all paragraphs form par to endpar as then I can use this too for
7897 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7898 so that I can call this to from text insets with their own cursor.
7900 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7901 output off all paragraphs (because of the fix below)!
7903 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7904 the very last paragraph (this could be also the last paragraph of an
7907 * src/texrow.h: added rows() call which returns the count-variable.
7909 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7911 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7913 * lib/configure.m4: better autodetection of DocBook tools.
7915 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7917 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7919 * src/lyx_cb.C: add using std::reverse;
7921 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7924 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7925 selected files. Should fix repeated errors from generated files.
7927 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7929 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7931 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7932 the spellchecker popup.
7934 * lib/lyxrc.example: Removed the \number_inset section
7936 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7938 * src/insets/figinset.C (various): Use IsFileReadable() to make
7939 sure that the file actually exist. Relying on ghostscripts errors
7940 is a bad idea since they can lead to X server crashes.
7942 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7944 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7947 * lib/lyxrc.example: smallish typo in description of
7948 \view_dvi_paper_option
7950 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7953 * src/lyxfunc.C: doImportHelper to factor out common code of the
7954 various import methods. New functions doImportASCIIasLines,
7955 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7956 doImportLinuxDoc for the format specific parts.
7959 * buffer.C: Dispatch returns now a bool to indicate success
7962 * lyx_gui.C: Add getLyXView() for member access
7964 * lyx_main.C: Change logic for batch commands: First try
7965 Buffer::Dispatch (possibly without GUI), if that fails, use
7968 * lyx_main.C: Add support for --import command line switch.
7969 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7970 Available Formats: Everything accepted by 'buffer-import <format>'
7972 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7974 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7977 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7978 documents will be reformatted upon reentry.
7980 2000-04-27 Juergen Vigna <jug@sad.it>
7982 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7983 correctly only last pos this was a bug.
7985 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7987 * release of lyx-1.1.5pre1
7989 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7991 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7993 * src/menus.C: revert the change of naming (Figure->Graphic...)
7994 from 2000-04-11. It was incomplete and bad.
7996 * src/LColor.[Ch]: add LColor::depthbar.
7997 * src/text.C (GetVisibleRow): use it.
7999 * README: update the languages list.
8001 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8003 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8006 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8008 * README: remove sections that were just wrong.
8010 * src/text2.C (GetRowNearY): remove currentrow code
8012 * src/text.C (GetRow): remove currentrow code
8014 * src/screen.C (Update): rewritten a bit.
8015 (SmallUpdate): removed func
8017 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8019 (FullRebreak): return bool
8020 (currentrow): remove var
8021 (currentrow_y): ditto
8023 * src/lyxscreen.h (Draw): change arg to unsigned long
8024 (FitCursor): return bool
8025 (FitManualCursor): ditto
8026 (Smallpdate): remove func
8027 (first): change to unsigned long
8028 (DrawOneRow): change second arg to long (from long &)
8029 (screen_refresh_y): remove var
8030 (scree_refresh_row): ditto
8032 * src/lyxrow.h: change baseline to usigned int from unsigned
8033 short, this brings some implicit/unsigned issues out in the open.
8035 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8037 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8038 instead of smallUpdate.
8040 * src/lyxcursor.h: change y to unsigned long
8042 * src/buffer.h: don't call updateScrollbar after fitcursor
8044 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8045 where they are used. Removed "\\direction", this was not present
8046 in 1.1.4 and is already obsolete. Commented out some code that I
8047 believe to never be called.
8048 (runLiterate): don't call updateScrollbar after fitCursor
8050 (buildProgram): ditto
8053 * src/WorkArea.h (workWidth): change return val to unsigned
8056 (redraw): remove the button redraws
8057 (setScrollbarValue): change for scrollbar
8058 (getScrollbarValue): change for scrollbar
8059 (getScrollbarBounds): change for scrollbar
8061 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8062 (C_WorkArea_down_cb): removed func
8063 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8064 (resize): change for scrollbar
8065 (setScrollbar): ditto
8066 (setScrollbarBounds): ditto
8067 (setScrollbarIncrements): ditto
8068 (up_cb): removed func
8069 (down_cb): removed func
8070 (scroll_cb): change for scrollbar
8071 (work_area_handler): ditto
8073 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8074 when FitCursor did something.
8075 (updateScrollbar): some unsigned changes
8076 (downCB): removed func
8077 (scrollUpOnePage): removed func
8078 (scrollDownOnePage): remvoed func
8079 (workAreaMotionNotify): don't call screen->FitCursor but use
8080 fitCursor instead. and bool return val
8081 (workAreaButtonPress): ditto
8082 (workAreaButtonRelease): some unsigned changes
8083 (checkInsetHit): ditto
8084 (workAreaExpose): ditto
8085 (update): parts rewritten, comments about the signed char arg added
8086 (smallUpdate): removed func
8087 (cursorPrevious): call needed updateScrollbar
8090 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8093 * src/BufferView.[Ch] (upCB): removed func
8094 (downCB): removed func
8095 (smallUpdate): removed func
8097 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8099 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8100 currentrow, currentrow_y optimization. This did not help a lot and
8101 if we want to do this kind of optimization we should rather use
8102 cursor.row instead of the currentrow.
8104 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8105 buffer spacing and klyx spacing support.
8107 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8109 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8112 2000-04-26 Juergen Vigna <jug@sad.it>
8114 * src/insets/figinset.C: fixes to Lars sstream changes!
8116 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8118 * A lot of files: Added Ascii(ostream &) methods to all inset
8119 classes. Used when exporting to ASCII.
8121 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8122 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8125 * src/text2.C (ToggleFree): Disabled implicit word selection when
8126 there is a change in the language
8128 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8129 no output was generated for end-of-sentence inset.
8131 * src/insets/lyxinset.h
8134 * src/paragraph.C: Removed the insetnumber code
8136 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8138 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8140 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8141 no_babel and no_epsfig completely from the file.
8142 (parseSingleLyXformat2Token): add handling for per-paragraph
8143 spacing as written by klyx.
8145 * src/insets/figinset.C: applied patch by Andre. Made it work with
8148 2000-04-20 Juergen Vigna <jug@sad.it>
8150 * src/insets/insettext.C (cutSelection):
8151 (copySelection): Fixed with selection from right to left.
8152 (draw): now the rows are not recalculated at every draw.
8153 (computeTextRows): for now reset the inset-owner here (this is
8154 important for an undo or copy where the inset-owner is not set
8157 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8158 motion to the_locking_inset screen->first was forgotten, this was
8159 not important till we got multiline insets.
8161 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8163 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8164 code seems to be alright (it is code changed by Dekel, and the
8165 intent is indeed that all macros should be defined \protect'ed)
8167 * NEWS: a bit of reorganisation of the new user-visible features.
8169 2000-04-19 Juergen Vigna <jug@sad.it>
8171 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8172 position. Set the inset_owner of the used paragraph so that it knows
8173 that it is inside an inset. Fixed cursor handling with mouse and
8174 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8175 and cleanups to make TextInsets work better.
8177 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8178 Changed parameters of various functions and added LockInsetInInset().
8180 * src/insets/insettext.C:
8182 * src/insets/insetcollapsable.h:
8183 * src/insets/insetcollapsable.C:
8184 * src/insets/insetfoot.h:
8185 * src/insets/insetfoot.C:
8186 * src/insets/insetert.h:
8187 * src/insets/insetert.C: cleaned up the code so that it works now
8188 correctly with insettext.
8190 * src/insets/inset.C:
8191 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8192 that insets in insets are supported right.
8195 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8197 * src/paragraph.C: some small fixes
8199 * src/debug.h: inserted INSETS debug info
8201 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8202 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8204 * src/commandtags.h:
8205 * src/LyXAction.C: insert code for InsetTabular.
8207 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8208 not Button1MotionMask.
8209 (workAreaButtonRelease): send always a InsetButtonRelease event to
8211 (checkInsetHit): some setCursor fixes (always with insets).
8213 * src/BufferView2.C (lockInset): returns a bool now and extended for
8214 locking insets inside insets.
8215 (showLockedInsetCursor): it is important to have the cursor always
8216 before the locked inset.
8217 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8219 * src/BufferView.h: made lockInset return a bool.
8221 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8223 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8224 that is used also internally but can be called as public to have back
8225 a cursor pos which is not set internally.
8226 (SetCursorIntern): Changed to use above function.
8228 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8230 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8235 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8236 patches for things that should be in or should be changed.
8238 * src/* [insetfiles]: change "usigned char fragile" to bool
8239 fragile. There was only one point that could that be questioned
8240 and that is commented in formulamacro.C. Grep for "CHECK".
8242 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8243 (DeleteBuffer): take it out of CutAndPaste and make it static.
8245 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8247 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8248 output the spacing envir commands. Also the new commands used in
8249 the LaTeX output makes the result better.
8251 * src/Spacing.C (writeEnvirBegin): new method
8252 (writeEnvirEnd): new method
8254 2000-04-18 Juergen Vigna <jug@sad.it>
8256 * src/CutAndPaste.C: made textclass a static member of the class
8257 as otherwise it is not accesed right!!!
8259 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8261 * forms/layout_forms.fd
8262 * src/layout_forms.h
8263 * src/layout_forms.C (create_form_form_character)
8264 * src/lyx_cb.C (UserFreeFont)
8265 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8266 documents (in the layout->character popup).
8268 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8270 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8271 \spell_command was in fact not honored (from Kevin Atkinson).
8273 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8276 * src/lyx_gui.h: make lyxViews private (Angus)
8278 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8280 * src/mathed/math_write.C
8281 (MathMatrixInset::Write) Put \protect before \begin{array} and
8282 \end{array} if fragile
8283 (MathParInset::Write): Put \protect before \\ if fragile
8285 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8287 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8288 initialization if the LyXColorHandler must be done after the
8289 connections to the XServer has been established.
8291 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8292 get the background pixel from the lyxColorhandler so that the
8293 figures are rendered with the correct background color.
8294 (NextToken): removed functions.
8295 (GetPSSizes): use ifs >> string instead of NextToken.
8297 * src/Painter.[Ch]: the color cache moved out of this file.
8299 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8302 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8304 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8305 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8307 * src/BufferView.C (enterView): new func
8308 (leaveView): new func
8310 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8312 (leaveView): new func, undefines xterm cursor when approp.
8314 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8315 (AllowInput): delete the Workarea cursor handling from this func.
8317 * src/Painter.C (underline): draw a slimer underline in most cases.
8319 * src/lyx_main.C (error_handler): use extern "C"
8321 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8323 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8324 sent directly to me.
8326 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8327 to the list by Dekel.
8329 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8332 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8333 methods from lyx_cb.here.
8335 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8338 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8340 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8341 instead of using current_view directly.
8343 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8345 * src/LyXAction.C (init): add the paragraph-spacing command.
8347 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8349 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8351 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8352 different from the documents.
8354 * src/text.C (SetHeightOfRow): take paragraph spacing into
8355 account, paragraph spacing takes precedence over buffer spacing
8356 (GetVisibleRow): ditto
8358 * src/paragraph.C (writeFile): output the spacing parameter too.
8359 (validate): set the correct features if spacing is used in the
8361 (Clear): set spacing to default
8362 (MakeSameLayout): spacing too
8363 (HasSameLayout): spacing too
8364 (SetLayout): spacing too
8365 (TeXOnePar): output the spacing commands
8367 * src/lyxparagraph.h: added a spacing variable for use with
8368 per-paragraph spacing.
8370 * src/Spacing.h: add a Default spacing and a method to check if
8371 the current spacing is default. also added an operator==
8373 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8376 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8378 * src/lyxserver.C (callback): fix dispatch of functions
8380 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8381 printf() into lyxerr call.
8383 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8386 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8387 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8388 the "Float" from each of the subitems.
8389 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8391 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8392 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8393 documented the change so that the workaround can be nuked later.
8395 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8398 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8400 * src/buffer.C (getLatexName): ditto
8401 (setReadonly): ditto
8403 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8405 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8406 avoid some uses of current_view. Added also a bufferParams()
8407 method to get at this.
8409 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8411 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8413 * src/lyxparagraph.[Ch]: removed
8414 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8415 with operators used by lower_bound and
8416 upper_bound in InsetTable's
8417 Make struct InsetTable private again. Used matchpos.
8419 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8421 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8422 document, the language of existing text is changed (unless the
8423 document is multi-lingual)
8425 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8427 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8429 * A lot of files: A rewrite of the Right-to-Left support.
8431 2000-04-10 Juergen Vigna <jug@sad.it>
8433 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8434 misplaced cursor when inset in inset is locked.
8436 * src/insets/insettext.C (LocalDispatch): small fix so that a
8437 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8439 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8440 footnote font should be decreased in size twice when displaying.
8442 * src/insets/insettext.C (GetDrawFont): inserted this function as
8443 the drawing-font may differ from the real paragraph font.
8445 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8446 insets (inset in inset!).
8448 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8449 function here because we don't want footnotes inside footnotes.
8451 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8453 (init): now set the inset_owner in paragraph.C
8454 (LocalDispatch): added some resetPos() in the right position
8457 (pasteSelection): changed to use the new CutAndPaste-Class.
8459 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8460 which tells if it is allowed to insert another inset inside this one.
8462 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8463 SwitchLayoutsBetweenClasses.
8465 * src/text2.C (InsertInset): checking of the new paragraph-function
8467 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8468 is not needed anymore here!
8471 (PasteSelection): redone (also with #ifdef) so that now this uses
8472 the CutAndPaste-Class.
8473 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8476 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8477 from/to text/insets.
8479 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8480 so that the paragraph knows if it is inside an (text)-inset.
8481 (InsertFromMinibuffer): changed return-value to bool as now it
8482 may happen that an inset is not inserted in the paragraph.
8483 (InsertInsetAllowed): this checks if it is allowed to insert an
8484 inset in this paragraph.
8486 (BreakParagraphConservative):
8487 (BreakParagraph) : small change for the above change of the return
8488 value of InsertFromMinibuffer.
8490 * src/lyxparagraph.h: added inset_owner and the functions to handle
8491 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8493 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8495 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8496 functions from BufferView to BufferView::Pimpl to ease maintence.
8498 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8499 correctly. Also use SetCursorIntern instead of SetCursor.
8501 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8504 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8506 * src/WorkArea.C (belowMouse): manually implement below mouse.
8508 * src/*: Add "explicit" on several constructors, I added probably
8509 some unneeded ones. A couple of changes to code because of this.
8511 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8512 implementation and private parts from the users of BufferView. Not
8515 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8516 implementation and private parts from the users of LyXLex. Not
8519 * src/BufferView_pimpl.[Ch]: new files
8521 * src/lyxlex_pimpl.[Ch]: new files
8523 * src/LyXView.[Ch]: some inline functions move out-of-line
8525 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8527 * src/lyxparagraph.h: make struct InsetTable public.
8529 * src/support/lyxstring.h: change lyxstring::difference_type to be
8530 ptrdiff_t. Add std:: modifiers to streams.
8532 * src/font.C: include the <cctype> header, for islower() and
8535 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8537 * src/font.[Ch]: new files. Contains the metric functions for
8538 fonts, takes a LyXFont as parameter. Better separation of concepts.
8540 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8541 changes because of this.
8543 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8545 * src/*: compile with -Winline and move functions that don't
8548 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8551 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8553 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8554 (various files changed because of this)
8556 * src/Painter.C (text): fixed the drawing of smallcaps.
8558 * src/lyxfont.[Ch] (drawText): removed unused member func.
8561 * src/*.C: added needed "using" statements and "std::" qualifiers.
8563 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8565 * src/*.h: removed all use of "using" from header files use
8566 qualifier std:: instead.
8568 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8570 * src/text.C (Backspace): some additional cleanups (we already
8571 know whether cursor.pos is 0 or not).
8573 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8574 automake does not provide one).
8576 * src/bmtable.h: replace C++ comments with C comments.
8578 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8580 * src/screen.C (ShowCursor): Change the shape of the cursor if
8581 the current language is not equal to the language of the document.
8582 (If the cursor change its shape unexpectedly, then you've found a bug)
8584 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8587 * src/insets/insetnumber.[Ch]: New files.
8589 * src/LyXAction.C (init)
8590 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8593 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8595 * src/lyxparagraph.h
8596 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8597 (the vector is kept sorted).
8599 * src/text.C (GetVisibleRow): Draw selection correctly when there
8600 is both LTR and RTL text.
8602 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8603 which is much faster.
8605 * src/text.C (GetVisibleRow and other): Do not draw the last space
8606 in a row if the direction of the last letter is not equal to the
8607 direction of the paragraph.
8609 * src/lyxfont.C (latexWriteStartChanges):
8610 Check that font language is not equal to basefont language.
8611 (latexWriteEndChanges): ditto
8613 * src/lyx_cb.C (StyleReset): Don't change the language while using
8614 the font-default command.
8616 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8617 empty paragraph before a footnote.
8619 * src/insets/insetcommand.C (draw): Increase x correctly.
8621 * src/screen.C (ShowCursor): Change cursor shape if
8622 current language != document language.
8624 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8626 2000-03-31 Juergen Vigna <jug@sad.it>
8628 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8629 (Clone): changed mode how the paragraph-data is copied to the
8630 new clone-paragraph.
8632 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8633 GetInset(pos) with no inset anymore there (in inset UNDO)
8635 * src/insets/insetcommand.C (draw): small fix as here x is
8636 incremented not as much as width() returns (2 before, 2 behind = 4)
8638 2000-03-30 Juergen Vigna <jug@sad.it>
8640 * src/insets/insettext.C (InsetText): small fix in initialize
8641 widthOffset (should not be done in the init() function)
8643 2000-03-29 Amir Karger <karger@lyx.org>
8645 * lib/examples/it_ItemizeBullets.lyx: translation by
8648 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8650 2000-03-29 Juergen Vigna <jug@sad.it>
8652 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8654 * src/insets/insetfoot.C (Clone): small change as for the below
8655 new init function in the text-inset
8657 * src/insets/insettext.C (init): new function as I've seen that
8658 clone did not copy the Paragraph-Data!
8659 (LocalDispatch): Added code so that now we have some sort of Undo
8660 functionality (well actually we HAVE Undo ;)
8662 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8664 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8666 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8669 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8671 * src/main.C: added a runtime check that verifies that the xforms
8672 header used when building LyX and the library used when running
8673 LyX match. Exit with a message if they don't match. This is a
8674 version number check only.
8676 * src/buffer.C (save): Don't allocate memory on the heap for
8677 struct utimbuf times.
8679 * *: some using changes, use iosfwd instead of the real headers.
8681 * src/lyxfont.C use char const * instead of string for the static
8682 strings. Rewrite some functions to use sstream.
8684 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8686 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8689 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8691 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8692 of Geodesy (from Martin Vermeer)
8694 * lib/layouts/svjour.inc: include file for the Springer svjour
8695 class. It can be used to support journals other than JoG.
8697 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8698 Miskiewicz <misiek@pld.org.pl>)
8699 * lib/reLyX/Makefile.am: ditto.
8701 2000-03-27 Juergen Vigna <jug@sad.it>
8703 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8704 also some modifications with operations on selected text.
8706 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8707 problems with clicking on insets (last famous words ;)
8709 * src/insets/insetcommand.C (draw):
8710 (width): Changed to have a bit of space before and after the inset so
8711 that the blinking cursor can be seen (otherwise it was hidden)
8713 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8715 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8716 would not be added to the link list when an installed gettext (not
8717 part of libc) is found.
8719 2000-03-24 Juergen Vigna <jug@sad.it>
8721 * src/insets/insetcollapsable.C (Edit):
8722 * src/mathed/formula.C (InsetButtonRelease):
8723 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8726 * src/BufferView.C (workAreaButtonPress):
8727 (workAreaButtonRelease):
8728 (checkInsetHit): Finally fixed the clicking on insets be handled
8731 * src/insets/insetert.C (Edit): inserted this call so that ERT
8732 insets work always with LaTeX-font
8734 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8736 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8737 caused lyx to startup with no GUI in place, causing in a crash
8738 upon startup when called with arguments.
8740 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8742 * src/FontLoader.C: better initialization of dummyXFontStruct.
8744 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8746 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8747 for linuxdoc and docbook import and export format options.
8749 * lib/lyxrc.example Example of default values for the previous flags.
8751 * src/lyx_cb.C Use those flags instead of the hardwired values for
8752 linuxdoc and docbook export.
8754 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8757 * src/menus.C Added menus entries for the new import/exports formats.
8759 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8761 * src/lyxrc.*: Added support for running without Gui
8764 * src/FontLoader.C: sensible defaults if no fonts are needed
8766 * src/lyx_cb.C: New function ShowMessage (writes either to the
8767 minibuffer or cout in case of no gui
8768 New function AskOverwrite for common stuff
8769 Consequently various changes to call these functions
8771 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8772 wild guess at sensible screen resolution when having no gui
8774 * src/lyxfont.C: no gui, no fonts... set some defaults
8776 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8778 * src/LColor.C: made the command inset background a bit lighter.
8780 2000-03-20 Hartmut Goebel <goebel@noris.net>
8782 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8783 stdstruct.inc. Koma-Script added some title elements which
8784 otherwise have been listed below "bibliography". This split allows
8785 adding title elements to where they belong.
8787 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8788 define the additional title elements and then include
8791 * many other layout files: changed to include stdtitle.inc just
8792 before stdstruct.inc.
8794 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8796 * src/buffer.C: (save) Added the option to store all backup files
8797 in a single directory
8799 * src/lyxrc.[Ch]: Added variable \backupdir_path
8801 * lib/lyxrc.example: Added descriptions of recently added variables
8803 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8804 bibtex inset, not closing the bibtex popup when deleting the inset)
8806 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8808 * src/lyx_cb.C: add a couple using directives.
8810 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8811 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8812 import based on the filename.
8814 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8815 file would be imported at start, if the filename where of a sgml file.
8817 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8819 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8821 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8822 * src/lyxfont.h Replaced the member variable bits.direction by the
8823 member variable lang. Made many changes in other files.
8824 This allows having a multi-lingual document
8826 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8827 that change the current language to <l>.
8828 Removed the command "font-rtl"
8830 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8831 format for Hebrew documents)
8833 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8834 When auto_mathmode is "true", pressing a digit key in normal mode
8835 will cause entering into mathmode.
8836 If auto_mathmode is "rtl" then this behavior will be active only
8837 when writing right-to-left text.
8839 * src/text2.C (InsertStringA) The string is inserted using the
8842 * src/paragraph.C (GetEndLabel) Gives a correct result for
8843 footnote paragraphs.
8845 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8847 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8849 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8850 front of PasteParagraph. Never insert a ' '. This should at least
8851 fix some cause for the segfaults that we have been experiencing,
8852 it also fixes backspace behaviour slightly. (Phu!)
8854 * src/support/lstrings.C (compare_no_case): some change to make it
8855 compile with gcc 2.95.2 and stdlibc++-v3
8857 * src/text2.C (MeltFootnoteEnvironment): change type o
8858 first_footnote_par_is_not_empty to bool.
8860 * src/lyxparagraph.h: make text private. Changes in other files
8862 (fitToSize): new function
8863 (setContentsFromPar): new function
8864 (clearContents): new function
8865 (SetChar): new function
8867 * src/paragraph.C (readSimpleWholeFile): deleted.
8869 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8870 the file, just use a simple string instead. Also read the file in
8871 a more maintainable manner.
8873 * src/text2.C (InsertStringA): deleted.
8874 (InsertStringB): deleted.
8876 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8878 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8879 RedoParagraphs from the doublespace handling part, just set status
8880 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8881 done, but perhaps not like this.)
8883 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8885 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8886 character when inserting an inset.
8888 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8890 * src/bufferparams.C (readLanguage): now takes "default" into
8893 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8894 also initialize the toplevel_keymap with the default bindings from
8897 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8899 * all files using lyxrc: have lyxrc as a real variable and not a
8900 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8903 * src/lyxrc.C: remove double call to defaultKeyBindings
8905 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8906 toolbar defauls using lyxlex. Remove enums, structs, functions
8909 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8910 toolbar defaults. Also store default keybindings in a map.
8912 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8913 storing the toolbar defaults without any xforms dependencies.
8915 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8916 applied. Changed to use iterators.
8918 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8920 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8921 systems that don't have LINGUAS set to begin with.
8923 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8925 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8926 the list by Dekel Tsur.
8928 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8930 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8931 * src/insets/form_graphics.C: ditto.
8933 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8935 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8937 * src/bufferparams.C (readLanguage): use the new language map
8939 * src/intl.C (InitKeyMapper): use the new language map
8941 * src/lyx_gui.C (create_forms): use the new language map
8943 * src/language.[Ch]: New files. Used for holding the information
8944 about each language. Now! Use this new language map enhance it and
8945 make it really usable for our needs.
8947 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8949 * screen.C (ShowCursor): Removed duplicate code.
8950 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8951 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8953 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8956 * src/text.C Added TransformChar method. Used for rendering Arabic
8957 text correctly (change the glyphs of the letter according to the
8958 position in the word)
8963 * src/lyxrc.C Added lyxrc command {language_command_begin,
8964 language_command_end,language_command_ltr,language_command_rtl,
8965 language_package} which allows the use of either arabtex or Omega
8968 * src/lyx_gui.C (init)
8970 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8971 to use encoding for menu fonts which is different than the encoding
8974 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8975 do not load the babel package.
8976 To write an English document with Hebrew/Arabic, change the document
8977 language to "english".
8979 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8980 (alphaCounter): changed to return char
8981 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8983 * lib/lyxrc.example Added examples for Hebrew/Arabic
8986 * src/layout.C Added layout command endlabeltype
8988 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8990 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8992 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8994 * src/mathed/math_delim.C (search_deco): return a
8995 math_deco_struct* instead of index.
8997 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8999 * All files with a USE_OSTREAM_ONLY within: removed all code that
9000 was unused when USE_OSTREAM_ONLY is defined.
9002 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9003 of any less. Removed header and using.
9005 * src/text.C (GetVisibleRow): draw the string "Page Break
9006 (top/bottom)" on screen when drawing a pagebreak line.
9008 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9010 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9012 * src/mathed/math_macro.C (draw): do some cast magic.
9015 * src/mathed/math_defs.h: change byte* argument to byte const*.
9017 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9019 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9020 know it is right to return InsetFoot* too, but cxx does not like
9023 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9025 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9027 * src/mathed/math_delim.C: change == to proper assignment.
9029 2000-03-09 Juergen Vigna <jug@sad.it>
9031 * src/insets/insettext.C (setPos): fixed various cursor positioning
9032 problems (via mouse and cursor-keys)
9033 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9034 inset (still a small display problem but it works ;)
9036 * src/insets/insetcollapsable.C (draw): added button_top_y and
9037 button_bottom_y to have correct values for clicking on the inset.
9039 * src/support/lyxalgo.h: commented out 'using std::less'
9041 2000-03-08 Juergen Vigna <jug@sad.it>
9043 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9044 Button-Release event closes as it is alos the Release-Event
9047 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9049 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9051 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9052 can add multiple spaces in Scrap (literate programming) styles...
9053 which, by the way, is how I got hooked on LyX to begin with.
9055 * src/mathed/formula.C (Write): Added dummy variable to an
9056 inset::Latex() call.
9057 (Latex): Add free_spacing boolean to inset::Latex()
9059 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9061 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9062 virtual function to include the free_spacing boolean from
9063 the containing paragraph's style.
9065 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9066 Added free_spacing boolean arg to match inset.h
9068 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9069 Added free_spacing boolean arg to match inset.h
9071 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9072 Added free_spacing boolean and made sure that if in a free_spacing
9073 paragraph, that we output normal space if there is a protected space.
9075 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9076 Added free_spacing boolean arg to match inset.h
9078 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9079 Added free_spacing boolean arg to match inset.h
9081 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9082 Added free_spacing boolean arg to match inset.h
9084 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9085 Added free_spacing boolean arg to match inset.h
9087 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9088 Added free_spacing boolean arg to match inset.h
9090 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9091 free_spacing boolean arg to match inset.h
9093 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9094 Added free_spacing boolean arg to match inset.h
9096 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9097 Added free_spacing boolean arg to match inset.h
9099 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9100 Added free_spacing boolean arg to match inset.h
9102 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9103 Added free_spacing boolean arg to match inset.h
9105 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9106 Added free_spacing boolean arg to match inset.h
9108 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9109 free_spacing boolean arg to match inset.h
9111 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9112 free_spacing boolean arg to match inset.h
9114 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9115 ignore free_spacing paragraphs. The user's spaces are left
9118 * src/text.C (InsertChar): Fixed the free_spacing layout
9119 attribute behavior. Now, if free_spacing is set, you can
9120 add multiple spaces in a paragraph with impunity (and they
9121 get output verbatim).
9122 (SelectSelectedWord): Added dummy argument to inset::Latex()
9125 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9128 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9129 paragraph layouts now only input a simple space instead.
9130 Special character insets don't make any sense in free-spacing
9133 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9134 hard-spaces in the *input* file to simple spaces if the layout
9135 is free-spacing. This converts old files which had to have
9136 hard-spaces in free-spacing layouts where a simple space was
9138 (writeFileAscii): Added free_spacing check to pass to the newly
9139 reworked inset::Latex(...) methods. The inset::Latex() code
9140 ensures that hard-spaces in free-spacing paragraphs get output
9141 as spaces (rather than "~").
9143 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9145 * src/mathed/math_delim.C (draw): draw the empty placeholder
9146 delims with a onoffdash line.
9147 (struct math_deco_compare): struct that holds the "functors" used
9148 for the sort and the binary search in math_deco_table.
9149 (class init_deco_table): class used for initial sort of the
9151 (search_deco): use lower_bound to do a binary search in the
9154 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9156 * src/lyxrc.C: a small secret thingie...
9158 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9159 and to not flush the stream as often as it used to.
9161 * src/support/lyxalgo.h: new file
9162 (sorted): template function used for checking if a sequence is
9163 sorted or not. Two versions with and without user supplied
9164 compare. Uses same compare as std::sort.
9166 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9167 it and give warning on lyxerr.
9169 (struct compare_tags): struct with function operators used for
9170 checking if sorted, sorting and lower_bound.
9171 (search_kw): use lower_bound instead of manually implemented
9174 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9176 * src/insets/insetcollapsable.h: fix Clone() declaration.
9177 * src/insets/insetfoot.h: ditto.
9179 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9181 2000-03-08 Juergen Vigna <jug@sad.it>
9183 * src/insets/lyxinset.h: added owner call which tells us if
9184 this inset is inside another inset. Changed also the return-type
9185 of Editable to an enum so it tells clearer what the return-value is.
9187 * src/insets/insettext.C (computeTextRows): fixed computing of
9188 textinsets which split automatically on more rows.
9190 * src/insets/insetert.[Ch]: changed this to be of BaseType
9193 * src/insets/insetfoot.[Ch]: added footnote inset
9195 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9196 collapsable insets (like footnote, ert, ...)
9198 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9200 * src/lyxdraw.h: remvoe file
9202 * src/lyxdraw.C: remove file
9204 * src/insets/insettext.C: added <algorithm>.
9206 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9208 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9209 (matrix_cb): case MM_OK use string stream
9211 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9214 * src/mathed/math_macro.C (draw): use string stream
9215 (Metrics): use string stream
9217 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9218 directly to the ostream.
9220 * src/vspace.C (asString): use string stream.
9221 (asString): use string stream
9222 (asLatexString): use string stream
9224 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9225 setting Spacing::Other.
9227 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9228 sprintf when creating the stretch vale.
9230 * src/text2.C (alphaCounter): changed to return a string and to
9231 not use a static variable internally. Also fixed a one-off bug.
9232 (SetCounter): changed the drawing of the labels to use string
9233 streams instead of sprintf.
9235 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9236 manipulator to use a scheme that does not require library support.
9237 This is also the way it is done in the new GNU libstdc++. Should
9238 work with DEC cxx now.
9240 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9242 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9243 end. This fixes a bug.
9245 * src/mathed (all files concerned with file writing): apply the
9246 USE_OSTREAM_ONLY changes to mathed too.
9248 * src/support/DebugStream.h: make the constructor explicit.
9250 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9251 count and ostream squashed.
9253 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9255 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9257 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9258 ostringstream uses STL strings, and we might not.
9260 * src/insets/insetspecialchar.C: add using directive.
9261 * src/insets/insettext.C: ditto.
9263 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9265 * lib/layouts/seminar.layout: feeble attempt at a layout for
9266 seminar.cls, far from completet and could really use some looking
9267 at from people used to write layout files.
9269 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9270 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9271 a lot nicer and works nicely with ostreams.
9273 * src/mathed/formula.C (draw): a slightly different solution that
9274 the one posted to the list, but I think this one works too. (font
9275 size wrong in headers.)
9277 * src/insets/insettext.C (computeTextRows): some fiddling on
9278 Jürgens turf, added some comments that he should read.
9280 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9281 used and it gave compiler warnings.
9282 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9285 * src/lyx_gui.C (create_forms): do the right thing when
9286 show_banner is true/false.
9288 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9289 show_banner is false.
9291 * most file writing files: Now use iostreams to do almost all of
9292 the writing. Also instead of passing string &, we now use
9293 stringstreams. mathed output is still not adapted to iostreams.
9294 This change can be turned off by commenting out all the occurences
9295 of the "#define USE_OSTREAM_ONLY 1" lines.
9297 * src/WorkArea.C (createPixmap): don't output debug messages.
9298 (WorkArea): don't output debug messages.
9300 * lib/lyxrc.example: added a comment about the new variable
9303 * development/Code_rules/Rules: Added some more commente about how
9304 to build class interfaces and on how better encapsulation can be
9307 2000-03-03 Juergen Vigna <jug@sad.it>
9309 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9310 automatically with the width of the LyX-Window
9312 * src/insets/insettext.C (computeTextRows): fixed update bug in
9313 displaying text-insets (scrollvalues where not initialized!)
9315 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9317 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9318 id in the check of the result from lower_bound is not enough since
9319 lower_bound can return last too, and then res->id will not be a
9322 * all insets and some code that use them: I have conditionalized
9323 removed the Latex(string & out, ...) this means that only the
9324 Latex(ostream &, ...) will be used. This is a work in progress to
9325 move towards using streams for all output of files.
9327 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9330 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9332 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9333 routine (this fixes bug where greek letters were surrounded by too
9336 * src/support/filetools.C (findtexfile): change a bit the search
9337 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9338 no longer passed to kpsewhich, we may have to change that later.
9340 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9341 warning options to avoid problems with X header files (from Angus
9343 * acinclude.m4: regenerated.
9345 2000-03-02 Juergen Vigna <jug@sad.it>
9347 * src/insets/insettext.C (WriteParagraphData): Using the
9348 par->writeFile() function for writing paragraph-data.
9349 (Read): Using buffer->parseSingleLyXformat2Token()-function
9350 for parsing paragraph data!
9352 * src/buffer.C (readLyXformat2): removed all parse data and using
9353 the new parseSingleLyXformat2Token()-function.
9354 (parseSingleLyXformat2Token): added this function to parse (read)
9355 lyx-file-format (this is called also from text-insets now!)
9357 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9359 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9362 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9363 directly instead of going through a func. One very bad thing: a
9364 static LyXFindReplace, but I don't know where to place it.
9366 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9367 string instead of char[]. Also changed to static.
9368 (GetSelectionOrWordAtCursor): changed to static inline
9369 (SetSelectionOverLenChars): ditto.
9371 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9372 current_view and global variables. both classes has changed names
9373 and LyXFindReplace is not inherited from SearchForm.
9375 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9376 fl_form_search form.
9378 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9380 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9382 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9383 bound (from Kayvan).
9385 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9387 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9389 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9391 * some things that I should comment but the local pub says head to
9394 * comment out all code that belongs to the Roff code for Ascii
9395 export of tables. (this is unused)
9397 * src/LyXView.C: use correct type for global variable
9398 current_layout. (LyXTextClass::size_type)
9400 * some code to get the new insetgraphics closer to working I'd be
9401 grateful for any help.
9403 * src/BufferView2.C (insertInset): use the return type of
9404 NumberOfLayout properly. (also changes in other files)
9406 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9407 this as a test. I want to know what breaks because of this.
9409 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9411 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9413 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9414 to use a \makebox in the label, this allows proper justification
9415 with out using protected spaces or multiple hfills. Now it is
9416 "label" for left justified, "\hfill label\hfill" for center, and
9417 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9418 should be changed accordingly.
9420 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9422 * src/lyxtext.h: change SetLayout() to take a
9423 LyXTextClass::size_type instead of a char (when there is more than
9424 127 layouts in a class); also change type of copylayouttype.
9425 * src/text2.C (SetLayout): ditto.
9426 * src/LyXView.C (updateLayoutChoice): ditto.
9428 * src/LaTeX.C (scanLogFile): errors where the line number was not
9429 given just after the '!'-line were ignored (from Dekel Tsur).
9431 * lib/lyxrc.example: fix description of \date_insert_format
9433 * lib/layouts/llncs.layout: new layout, contributed by Martin
9436 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9438 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9439 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9440 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9441 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9442 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9443 paragraph.C, text.C, text2.C)
9445 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9447 * src/insets/insettext.C (LocalDispatch): remove extra break
9450 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9451 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9453 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9454 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9456 * src/insets/insetbib.h: move InsetBibkey::Holder and
9457 InsetCitation::Holder in public space.
9459 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9461 * src/insets/insettext.h: small change to get the new files from
9462 Juergen to compile (use "string", not "class string").
9464 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9465 const & as parameter to LocalDispatch, use LyXFont const & as
9466 paramter to some other func. This also had impacto on lyxinsets.h
9467 and the two mathed insets.
9469 2000-02-24 Juergen Vigna <jug@sad.it>
9472 * src/commandtags.h:
9474 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9478 * src/BufferView2.C: added/updated code for various inset-functions
9480 * src/insets/insetert.[Ch]: added implementation of InsetERT
9482 * src/insets/insettext.[Ch]: added implementation of InsetText
9484 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9485 (draw): added preliminary code for inset scrolling not finshed yet
9487 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9488 as it is in lyxfunc.C now
9490 * src/insets/lyxinset.h: Added functions for text-insets
9492 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9494 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9495 BufferView and reimplement the list as a queue put inside its own
9498 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9500 * several files: use the new interface to the "updateinsetlist"
9502 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9504 (work_area_handler): call BufferView::trippleClick on trippleclick.
9506 * src/BufferView.C (doubleClick): new function, selects word on
9508 (trippleClick): new function, selects line on trippleclick.
9510 2000-02-22 Allan Rae <rae@lyx.org>
9512 * lib/bind/xemacs.bind: buffer-previous not supported
9514 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9516 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9519 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9521 * src/bufferlist.C: get rid of current_view from this file
9523 * src/spellchecker.C: get rid of current_view from this file
9525 * src/vspace.C: get rid of current_view from this file
9526 (inPixels): added BufferView parameter for this func
9527 (asLatexCommand): added a BufferParams for this func
9529 * src/text.C src/text2.C: get rid of current_view from these
9532 * src/lyxfont.C (getFontDirection): move this function here from
9535 * src/bufferparams.C (getDocumentDirection): move this function
9538 * src/paragraph.C (getParDirection): move this function here from
9540 (getLetterDirection): ditto
9542 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9544 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9545 resize due to wrong pixmap beeing used. Also took the opurtunity
9546 to make the LyXScreen stateless on regard to WorkArea and some
9547 general cleanup in the same files.
9549 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9551 * src/Makefile.am: add missing direction.h
9553 * src/PainterBase.h: made the width functions const.
9555 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9558 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9560 * src/insets/insetlatexaccent.C (draw): make the accents draw
9561 better, at present this will only work well with iso8859-1.
9563 * several files: remove the old drawing code, now we use the new
9566 * several files: remove support for mono_video, reverse_video and
9569 2000-02-17 Juergen Vigna <jug@sad.it>
9571 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9572 int ** as we have to return the pointer, otherwise we have only
9573 NULL pointers in the returning function.
9575 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9577 * src/LaTeX.C (operator()): quote file name when running latex.
9579 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9581 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9582 (bubble tip), this removes our special handling of this.
9584 * Remove all code that is unused now that we have the new
9585 workarea. (Code that are not active when NEW_WA is defined.)
9587 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9589 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9591 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9592 nonexisting layout; correctly redirect obsoleted layouts.
9594 * lib/lyxrc.example: document \view_dvi_paper_option
9596 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9599 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9600 (PreviewDVI): handle the view_dvi_paper_option variable.
9601 [Both from Roland Krause]
9603 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9605 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9606 char const *, int, LyXFont)
9607 (text(int, int, string, LyXFont)): ditto
9609 * src/text.C (InsertCharInTable): attempt to fix the double-space
9610 feature in tables too.
9611 (BackspaceInTable): ditto.
9612 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9614 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9616 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9618 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9619 newly found text in textcache to this.
9620 (buffer): set the owner of the text put into the textcache to 0
9622 * src/insets/figinset.C (draw): fixed the drawing of figures with
9625 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9626 drawing of mathframe, hfills, protected space, table lines. I have
9627 now no outstanding drawing problems with the new Painter code.
9629 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9631 * src/PainterBase.C (ellipse, circle): do not specify the default
9634 * src/LColor.h: add using directive.
9636 * src/Painter.[Ch]: change return type of methods from Painter& to
9637 PainterBase&. Add a using directive.
9639 * src/WorkArea.C: wrap xforms callbacks in C functions
9642 * lib/layouts/foils.layout: font fix and simplifications from Carl
9645 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9647 * a lot of files: The Painter, LColor and WorkArea from the old
9648 devel branch has been ported to lyx-devel. Some new files and a
9649 lot of #ifdeffed code. The new workarea is enabled by default, but
9650 if you want to test the new Painter and LColor you have to compile
9651 with USE_PAINTER defined (do this in config.h f.ex.) There are
9652 still some rought edges, and I'd like some help to clear those
9653 out. It looks stable (loads and displays the Userguide very well).
9656 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9658 * src/buffer.C (pop_tag): revert to the previous implementation
9659 (use a global variable for both loops).
9661 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9663 * src/lyxrc.C (LyXRC): change slightly default date format.
9665 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9666 there is an English text with a footnote that starts with a Hebrew
9667 paragraph, or vice versa.
9668 (TeXFootnote): ditto.
9670 * src/text.C (LeftMargin): allow for negative values for
9671 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9674 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9675 for input encoding (cyrillic)
9677 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9679 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9682 * src/toolbar.C (set): ditto
9683 * src/insets/insetbib.C (create_form_citation_form): ditto
9685 * lib/CREDITS: added Dekel Tsur.
9687 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9688 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9689 hebrew supports files from Dekel Tsur.
9691 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9692 <tzafrir@technion.ac.il>
9694 * src/lyxrc.C: put \date_insert_format at the right place.
9696 * src/buffer.C (makeLaTeXFile): fix the handling of
9697 BufferParams::sides when writing out latex files.
9699 * src/BufferView2.C: add a "using" directive.
9701 * src/support/lyxsum.C (sum): when we use lyxstring,
9702 ostringstream::str needs an additional .c_str().
9704 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9706 * src/support/filetools.C (ChangeExtension): patch from Etienne
9709 * src/TextCache.C (show): remove const_cast and make second
9710 parameter non-const LyXText *.
9712 * src/TextCache.h: use non const LyXText in show.
9714 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9717 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9719 * src/support/lyxsum.C: rework to be more flexible.
9721 * several places: don't check if a pointer is 0 if you are going
9724 * src/text.C: remove some dead code.
9726 * src/insets/figinset.C: remove some dead code
9728 * src/buffer.C: move the BufferView funcs to BufferView2.C
9729 remove all support for insetlatexdel
9730 remove support for oldpapersize stuff
9731 made some member funcs const
9733 * src/kbmap.C: use a std::list to store the bindings in.
9735 * src/BufferView2.C: new file
9737 * src/kbsequence.[Ch]: new files
9739 * src/LyXAction.C + others: remove all trace of buffer-previous
9741 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9742 only have one copy in the binary of this table.
9744 * hebrew patch: moved some functions from LyXText to more
9745 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9747 * several files: remove support for XForms older than 0.88
9749 remove some #if 0 #endif code
9751 * src/TextCache.[Ch]: new file. Holds the textcache.
9753 * src/BufferView.C: changes to use the new TextCache interface.
9754 (waitForX): remove the now unused code.
9756 * src/BackStack.h: remove some commented code
9758 * lib/bind/emacs.bind: remove binding for buffer-previous
9760 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9762 * applied the hebrew patch.
9764 * src/lyxrow.h: make sure that all Row variables are initialized.
9766 * src/text2.C (TextHandleUndo): comment out a delete, this might
9767 introduce a memory leak, but should also help us to not try to
9768 read freed memory. We need to look at this one.
9770 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9771 (LyXParagraph): initalize footnotekind.
9773 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9774 forgot this when applying the patch. Please heed the warnings.
9776 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9777 (aka. reformat problem)
9779 * src/bufferlist.C (exists): made const, and use const_iterator
9780 (isLoaded): new func.
9781 (release): use std::find to find the correct buffer.
9783 * src/bufferlist.h: made getState a const func.
9784 made empty a const func.
9785 made exists a const func.
9788 2000-02-01 Juergen Vigna <jug@sad.it>
9790 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9792 * po/it.po: updated a bit the italian po file and also changed the
9793 'file nuovo' for newfile to 'filenuovo' without a space, this did
9796 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9797 for the new insert_date command.
9799 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9800 from jdblair, to insert a date into the current text conforming to
9801 a strftime format (for now only considering the locale-set and not
9802 the document-language).
9804 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9806 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9807 Bounds Read error seen by purify. The problem was that islower is
9808 a macros which takes an unsigned char and uses it as an index for
9809 in array of characters properties (and is thus subject to the
9813 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9814 correctly the paper sides radio buttons.
9815 (UpdateDocumentButtons): ditto.
9817 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9819 * src/kbmap.C (getsym + others): change to return unsigned int,
9820 returning a long can give problems on 64 bit systems. (I assume
9821 that int is 32bit on 64bit systems)
9823 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9825 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9826 LyXLookupString to be zero-terminated. Really fixes problems seen
9829 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9831 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9832 write a (char*)0 to the lyxerr stream.
9834 * src/lastfiles.C: move algorithm before the using statemets.
9836 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9838 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9839 complains otherwise).
9840 * src/table.C: ditto
9842 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9845 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9846 that I removed earlier... It is really needed.
9848 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9850 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9852 * INSTALL: update xforms home page URL.
9854 * lib/configure.m4: fix a bug with unreadable layout files.
9856 * src/table.C (calculate_width_of_column): add "using std::max"
9859 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9861 * several files: marked several lines with "DEL LINE", this is
9862 lines that can be deleted without changing anything.
9863 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9864 checks this anyway */
9867 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9869 * src/DepTable.C (update): add a "+" at the end when the checksum
9870 is different. (debugging string only)
9872 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9873 the next inset to not be displayed. This should also fix the list
9874 of labels in the "Insert Crossreference" dialog.
9876 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9878 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9879 when regex was not found.
9881 * src/support/lstrings.C (lowercase): use handcoded transform always.
9884 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9885 old_cursor.par->prev could be 0.
9887 * several files: changed post inc/dec to pre inc/dec
9889 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9890 write the lastfiles to file.
9892 * src/BufferView.C (buffer): only show TextCache info when debugging
9894 (resizeCurrentBuffer): ditto
9895 (workAreaExpose): ditto
9897 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9899 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9901 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9902 a bit better by removing the special case for \i and \j.
9904 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9906 * src/lyx_main.C (easyParse): remove test for bad comand line
9907 options, since this broke all xforms-related parsing.
9909 * src/kbmap.C (getsym): set return type to unsigned long, as
9910 declared in header. On an alpha, long is _not_ the same as int.
9912 * src/support/LOstream.h: add a "using std::flush;"
9914 * src/insets/figinset.C: ditto.
9916 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9918 * src/bufferlist.C (write): use blinding fast file copy instead of
9919 "a char at a time", now we are doing it the C++ way.
9921 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9922 std::list<int> instead.
9923 (addpidwait): reflect move to std::list<int>
9924 (sigchldchecker): ditto
9926 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9929 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9930 that obviously was wrong...
9932 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9933 c, this avoids warnings with purify and islower.
9935 * src/insets/figinset.C: rename struct queue to struct
9936 queue_element and rewrite to use a std::queue. gsqueue is now a
9937 std::queue<queue_element>
9938 (runqueue): reflect move to std::queue
9941 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9942 we would get "1" "0" instead of "true" "false. Also make the tostr
9945 2000-01-21 Juergen Vigna <jug@sad.it>
9947 * src/buffer.C (writeFileAscii): Disabled code for special groff
9948 handling of tabulars till I fix this in table.C
9950 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9952 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9954 * src/support/lyxlib.h: ditto.
9956 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9958 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9959 and 'j' look better. This might fix the "macron" bug that has been
9962 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9963 functions as one template function. Delete the old versions.
9965 * src/support/lyxsum.C: move using std::ifstream inside
9968 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9971 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9973 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9975 * src/insets/figinset.C (InitFigures): use new instead of malloc
9976 to allocate memory for figures and bitmaps.
9977 (DoneFigures): use delete[] instead of free to deallocate memory
9978 for figures and bitmaps.
9979 (runqueue): use new to allocate
9980 (getfigdata): use new/delete[] instead of malloc/free
9981 (RegisterFigure): ditto
9983 * some files: moved some declarations closer to first use, small
9984 whitespace changes use preincrement instead of postincrement where
9985 it does not make a difference.
9987 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9988 step on the way to use stl::containers for key maps.
9990 * src/bufferlist.h: add a typedef for const_iterator and const
9991 versions of begin and end.
9993 * src/bufferlist.[Ch]: change name of member variable _state to
9994 state_. (avoid reserved names)
9996 (getFileNames): returns the filenames of the buffers in a vector.
9998 * configure.in (ALL_LINGUAS): added ro
10000 * src/support/putenv.C: new file
10002 * src/support/mkdir.C: new file
10004 2000-01-20 Allan Rae <rae@lyx.org>
10006 * lib/layouts/IEEEtran.layout: Added several theorem environments
10008 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10009 couple of minor additions.
10011 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10012 (except for those in footnotes of course)
10014 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10016 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10018 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10019 std::sort and std::lower_bound instead of qsort and handwritten
10021 (struct compara): struct that holds the functors used by std::sort
10022 and std::lower_bound in MathedLookupBOP.
10024 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10026 * src/support/LAssert.h: do not do partial specialization. We do
10027 not really need it.
10029 * src/support/lyxlib.h: note that lyx::getUserName() and
10030 lyx::date() are not in use right now. Should these be suppressed?
10032 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10033 (makeLinuxDocFile): do not put date and user name in linuxdoc
10036 * src/support/lyxlib.h (kill): change first argument to long int,
10037 since that's what solaris uses.
10039 * src/support/kill.C (kill): fix declaration to match prototype.
10041 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10042 actually check whether namespaces are supported. This is not what
10045 * src/support/lyxsum.C: add a using directive.
10047 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10049 * src/support/kill.C: if we have namespace support we don't have
10050 to include lyxlib.h.
10052 * src/support/lyxlib.h: use namespace lyx if supported.
10054 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10056 * src/support/date.C: new file
10058 * src/support/chdir.C: new file
10060 * src/support/getUserName.C: new file
10062 * src/support/getcwd.C: new file
10064 * src/support/abort.C: new file
10066 * src/support/kill.C: new file
10068 * src/support/lyxlib.h: moved all the functions in this file
10069 insede struct lyx. Added also kill and abort to this struct. This
10070 is a way to avoid the "kill is not defined in <csignal>", we make
10071 C++ wrappers for functions that are not ANSI C or ANSI C++.
10073 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10074 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10075 lyx it has been renamed to sum.
10077 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10079 * src/text.C: add using directives for std::min and std::max.
10081 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10083 * src/texrow.C (getIdFromRow): actually return something useful in
10084 id and pos. Hopefully fixes the bug with positionning of errorbox
10087 * src/lyx_main.C (easyParse): output an error and exit if an
10088 incorrect command line option has been given.
10090 * src/spellchecker.C (ispell_check_word): document a memory leak.
10092 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10093 where a "struct utimbuf" is allocated with "new" and deleted with
10096 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10098 * src/text2.C (CutSelection): don't delete double spaces.
10099 (PasteSelection): ditto
10100 (CopySelection): ditto
10102 * src/text.C (Backspace): don't delete double spaces.
10104 * src/lyxlex.C (next): fix a bug that were only present with
10105 conformant std::istream::get to read comment lines, use
10106 std::istream::getline instead. This seems to fix the problem.
10108 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10110 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10111 allowed to insert space before space" editing problem. Please read
10112 commends at the beginning of the function. Comments about usage
10115 * src/text.C (InsertChar): fix for the "not allowed to insert
10116 space before space" editing problem.
10118 * src/text2.C (DeleteEmptyParagraphMechanism): when
10119 IsEmptyTableRow can only return false this last "else if" will
10120 always be a no-op. Commented out.
10122 * src/text.C (RedoParagraph): As far as I can understand tmp
10123 cursor is not really needed.
10125 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10126 present it could only return false anyway.
10127 (several functions): Did something not so smart...added a const
10128 specifier on a lot of methods.
10130 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10131 and add a tmp->text.resize. The LyXParagraph constructor does the
10133 (BreakParagraphConservative): ditto
10135 * src/support/path.h (Path): add a define so that the wrong usage
10136 "Path("/tmp") will be flagged as a compilation error:
10137 "`unnamed_Path' undeclared (first use this function)"
10139 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10141 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10142 which was bogus for several reasons.
10144 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10146 (runBibTeX): ditto.
10148 * autogen.sh: do not use "type -path" (what's that anyway?).
10150 * src/support/filetools.C (findtexfile): remove extraneous space
10151 which caused a kpsewhich warning (at least with kpathsea version
10154 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10156 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10158 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10160 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10162 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10164 * src/paragraph.C (BreakParagraph): do not reserve space on text
10165 if we don't need to (otherwise, if pos_end < pos, we end up
10166 reserving huge amounts of memory due to bad unsigned karma).
10167 (BreakParagraphConservative): ditto, although I have not seen
10168 evidence the bug can happen here.
10170 * src/lyxparagraph.h: add a using std::list.
10172 2000-01-11 Juergen Vigna <jug@sad.it>
10174 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10175 could not be found.
10177 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10179 * src/vc-backend.C (doVCCommand): change to be static and take one
10180 more parameter: the path to chdir too be fore executing the command.
10181 (retrive): new function equiv to "co -r"
10183 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10184 file_not_found_hook is true.
10186 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10188 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10189 if a file is readwrite,readonly...anything else.
10191 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10193 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10194 (CreatePostscript): name change from MenuRunDVIPS (or something)
10195 (PreviewPostscript): name change from MenuPreviewPS
10196 (PreviewDVI): name change from MenuPreviewDVI
10198 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10199 \view_pdf_command., \pdf_to_ps_command
10201 * lib/configure.m4: added search for PDF viewer, and search for
10202 PDF to PS converter.
10203 (lyxrc.defaults output): add \pdflatex_command,
10204 \view_pdf_command and \pdf_to_ps_command.
10206 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10208 * src/bufferlist.C (write): we don't use blocksize for anything so
10211 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10213 * src/support/block.h: disable operator T* (), since it causes
10214 problems with both compilers I tried. See comments in the file.
10216 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10219 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10220 variable LYX_DIR_10x to LYX_DIR_11x.
10222 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10224 * INSTALL: document --with-lyxname.
10227 * configure.in: new configure flag --with-lyxname which allows to
10228 choose the name under which lyx is installed. Default is "lyx", of
10229 course. It used to be possible to do this with --program-suffix,
10230 but the later has in fact a different meaning for autoconf.
10232 * src/support/lstrings.h (lstrchr): reformat a bit.
10234 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10235 * src/mathed/math_defs.h: ditto.
10237 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10239 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10240 true, decides if we create a backup file or not when saving. New
10241 tag and variable \pdf_mode, defaults to false. New tag and
10242 variable \pdflatex_command, defaults to pdflatex. New tag and
10243 variable \view_pdf_command, defaults to xpdf. New tag and variable
10244 \pdf_to_ps_command, defaults to pdf2ps.
10246 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10248 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10249 does not have a BufferView.
10250 (unlockInset): ditto + don't access the_locking_inset if the
10251 buffer does not have a BufferView.
10253 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10254 certain circumstances so that we don't continue a keyboard
10255 operation long after the key was released. Try f.ex. to load a
10256 large document, press PageDown for some seconds and then release
10257 it. Before this change the document would contine to scroll for
10258 some time, with this change it stops imidiatly.
10260 * src/support/block.h: don't allocate more space than needed. As
10261 long as we don't try to write to the arr[x] in a array_type arr[x]
10262 it is perfectly ok. (if you write to it you might segfault).
10263 added operator value_type*() so that is possible to pass the array
10264 to functions expecting a C-pointer.
10266 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10269 * intl/*: updated to gettext 0.10.35, tried to add our own
10270 required modifications. Please verify.
10272 * po/*: updated to gettext 0.10.35, tried to add our own required
10273 modifications. Please verify.
10275 * src/support/lstrings.C (tostr): go at fixing the problem with
10276 cxx and stringstream. When stringstream is used return
10277 oss.str().c_str() so that problems with lyxstring and basic_string
10278 are avoided. Note that the best solution would be for cxx to use
10279 basic_string all the way, but it is not conformant yet. (it seems)
10281 * src/lyx_cb.C + other files: moved several global functions to
10282 class BufferView, some have been moved to BufferView.[Ch] others
10283 are still located in lyx_cb.C. Code changes because of this. (part
10284 of "get rid of current_view project".)
10286 * src/buffer.C + other files: moved several Buffer functions to
10287 class BufferView, the functions are still present in buffer.C.
10288 Code changes because of this.
10290 * config/lcmessage.m4: updated to most recent. used when creating
10293 * config/progtest.m4: updated to most recent. used when creating
10296 * config/gettext.m4: updated to most recent. applied patch for
10299 * config/gettext.m4.patch: new file that shows what changes we
10300 have done to the local copy of gettext.m4.
10302 * config/libtool.m4: new file, used in creation of acinclude.m4
10304 * config/lyxinclude.m4: new file, this is the lyx created m4
10305 macros, used in making acinclude.m4.
10307 * autogen.sh: GNU m4 discovered as a separate task not as part of
10308 the lib/configure creation.
10309 Generate acinlucde from files in config. Actually cat
10310 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10311 easier to upgrade .m4 files that really are external.
10313 * src/Spacing.h: moved using std::istringstream to right after
10314 <sstream>. This should fix the problem seen with some compilers.
10316 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10318 * src/lyx_cb.C: began some work to remove the dependency a lot of
10319 functions have on BufferView::text, even if not really needed.
10320 (GetCurrentTextClass): removed this func, it only hid the
10323 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10324 forgot this in last commit.
10326 * src/Bullet.C (bulletEntry): use static char const *[] for the
10327 tables, becuase of this the return arg had to change to string.
10328 (bulletSize): ditto
10329 (~Bullet): removed unneeded destructor
10331 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10332 (insetSleep): moved from Buffer
10333 (insetWakeup): moved from Buffer
10334 (insetUnlock): moved from Buffer
10336 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10337 from Buffer to BufferView.
10339 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10341 * config/ltmain.sh: updated to version 1.3.4 of libtool
10343 * config/ltconfig: updated to version 1.3.4 of libtool
10345 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10348 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10349 Did I get that right?
10351 * src/lyxlex.h: add a "using" directive or two.
10352 * src/Spacing.h: ditto.
10353 * src/insets/figinset.C: ditto.
10354 * src/support/filetools.C: ditto.
10355 * src/support/lstrings.C: ditto.
10356 * src/BufferView.C: ditto.
10357 * src/bufferlist.C: ditto.
10358 * src/lyx_cb.C: ditto.
10359 * src/lyxlex.C: ditto.
10361 * NEWS: add some changes for 1.1.4.
10363 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10365 * src/BufferView.C: first go at a TextCache to speed up switching
10368 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10370 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10371 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10372 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10373 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10376 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10377 members of the struct are correctly initialized to 0 (detected by
10379 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10380 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10382 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10383 pidwait, since it was allocated with "new". This was potentially
10384 very bad. Thanks to Michael Schmitt for running purify for us.
10387 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10389 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10391 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10393 1999-12-30 Allan Rae <rae@lyx.org>
10395 * lib/templates/IEEEtran.lyx: minor change
10397 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10398 src/mathed/formula.C (LocalDispatch): askForText changes
10400 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10401 know when a user has cancelled input. Fixes annoying problems with
10402 inserting labels and version control.
10404 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10406 * src/support/lstrings.C (tostr): rewritten to use strstream and
10409 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10411 * src/support/filetools.C (IsFileWriteable): use fstream to check
10412 (IsDirWriteable): use fileinfo to check
10414 * src/support/filetools.h (FilePtr): whole class deleted
10416 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10418 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10420 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10422 * src/bufferlist.C (write): use ifstream and ofstream instead of
10425 * src/Spacing.h: use istrstream instead of sscanf
10427 * src/mathed/math_defs.h: change first arg to istream from FILE*
10429 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10431 * src/mathed/math_parser.C: have yyis to be an istream
10432 (LexGetArg): use istream (yyis)
10434 (mathed_parse): ditto
10435 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10437 * src/mathed/formula.C (Read): rewritten to use istream
10439 * src/mathed/formulamacro.C (Read): rewritten to use istream
10441 * src/lyxlex.h (~LyXLex): deleted desturctor
10442 (getStream): new function, returns an istream
10443 (getFile): deleted funtion
10444 (IsOK): return is.good();
10446 * src/lyxlex.C (LyXLex): delete file and owns_file
10447 (setFile): open an filebuf and assign that to a istream instead of
10449 (setStream): new function, takes an istream as arg.
10450 (setFile): deleted function
10451 (EatLine): rewritten us use istream instead of FILE*
10455 * src/table.C (LyXTable): use istream instead of FILE*
10456 (Read): rewritten to take an istream instead of FILE*
10458 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10460 * src/buffer.C (Dispatch): remove an extraneous break statement.
10462 * src/support/filetools.C (QuoteName): change to do simple
10463 'quoting'. More work is necessary. Also changed to do nothing
10464 under emx (needs fix too).
10465 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10467 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10468 config.h.in to the AC_DEFINE_UNQUOTED() call.
10469 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10470 needs char * as argument (because Solaris 7 declares it like
10473 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10474 remove definition of BZERO.
10476 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10478 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10479 defined, "lyxregex.h" if not.
10481 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10483 (REGEX): new variable that is set to regex.c lyxregex.h when
10484 AM_CONDITIONAL USE_REGEX is set.
10485 (libsupport_la_SOURCES): add $(REGEX)
10487 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10490 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10493 * configure.in: add call to LYX_REGEX
10495 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10496 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10498 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10500 * lib/bind/fi_menus.bind: new file, from
10501 pauli.virtanen@saunalahti.fi.
10503 * src/buffer.C (getBibkeyList): pass the parameter delim to
10504 InsetInclude::getKeys and InsetBibtex::getKeys.
10506 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10507 is passed to Buffer::getBibkeyList
10509 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10510 instead of the hardcoded comma.
10512 * src/insets/insetbib.C (getKeys): make sure that there are not
10513 leading blanks in bibtex keys. Normal latex does not care, but
10514 harvard.sty seems to dislike blanks at the beginning of citation
10515 keys. In particular, the retturn value of the function is
10517 * INSTALL: make it clear that libstdc++ is needed and that gcc
10518 2.7.x probably does not work.
10520 * src/support/filetools.C (findtexfile): make debug message go to
10522 * src/insets/insetbib.C (getKeys): ditto
10524 * src/debug.C (showTags): make sure that the output is correctly
10527 * configure.in: add a comment for TWO_COLOR_ICON define.
10529 * acconfig.h: remove all the entries that already defined in
10530 configure.in or acinclude.m4.
10532 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10533 to avoid user name, date and copyright.
10535 1999-12-21 Juergen Vigna <jug@sad.it>
10537 * src/table.C (Read): Now read bogus row format informations
10538 if the format is < 5 so that afterwards the table can
10539 be read by lyx but without any format-info. Fixed the
10540 crash we experienced when not doing this.
10542 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10544 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10545 (RedoDrawingOfParagraph): ditto
10546 (RedoParagraphs): ditto
10547 (RemoveTableRow): ditto
10549 * src/text.C (Fill): rename arg paperwidth -> paper_width
10551 * src/buffer.C (insertLyXFile): rename var filename -> fname
10552 (writeFile): rename arg filename -> fname
10553 (writeFileAscii): ditto
10554 (makeLaTeXFile): ditto
10555 (makeLinuxDocFile): ditto
10556 (makeDocBookFile): ditto
10558 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10561 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10563 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10566 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10567 compiled by a C compiler not C++.
10569 * src/layout.h (LyXTextClass): added typedef for const_iterator
10570 (LyXTextClassList): added typedef for const_iterator + member
10571 functions begin and end.
10573 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10574 iterators to fill the choice_class.
10575 (updateLayoutChoice): rewritten to use iterators to fill the
10576 layoutlist in the toolbar.
10578 * src/BufferView.h (BufferView::work_area_width): removed unused
10581 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10583 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10584 (sgmlCloseTag): ditto
10586 * src/support/lstrings.h: return type of countChar changed to
10589 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10590 what version of this func to use. Also made to return unsigned int.
10592 * configure.in: call LYX_STD_COUNT
10594 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10595 conforming std::count.
10597 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10599 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10600 and a subscript would give bad display (patch from Dekel Tsur
10601 <dekel@math.tau.ac.il>).
10603 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10605 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10608 * src/chset.h: add a few 'using' directives
10610 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10611 triggered when no buffer is active
10613 * src/layout.C: removed `break' after `return' in switch(), since
10616 * src/lyx_main.C (init): make sure LyX can be ran in place even
10617 when libtool has done its magic with shared libraries. Fix the
10618 test for the case when the system directory has not been found.
10620 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10621 name for the latex file.
10622 (MenuMakeHTML): ditto
10624 * src/buffer.h: add an optional boolean argument, which is passed
10625 to ChangeExtension.
10627 1999-12-20 Allan Rae <rae@lyx.org>
10629 * lib/templates/IEEEtran.lyx: small correction and update.
10631 * configure.in: Attempted to use LYX_PATH_HEADER
10633 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10635 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10636 input from JMarc. Now use preprocessor to find the header.
10637 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10638 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10639 LYX_STL_STRING_FWD. See comments in file.
10641 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10643 * The global MiniBuffer * minibuffer variable is dead.
10645 * The global FD_form_main * fd_form_main variable is dead.
10647 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10649 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10651 * src/table.h: add the LOstream.h header
10652 * src/debug.h: ditto
10654 * src/LyXAction.h: change the explaination of the ReadOnly
10655 attribute: is indicates that the function _can_ be used.
10657 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10660 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10662 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10668 * src/paragraph.C (GetWord): assert on pos>=0
10671 * src/support/lyxstring.C: condition the use of an invariant on
10673 * src/support/lyxstring.h: ditto
10675 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10676 Use LAssert.h instead of plain assert().
10678 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10680 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10681 * src/support/filetools.C: ditto
10683 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10686 * INSTALL: document the new configure flags
10688 * configure.in: suppress --with-debug; add --enable-assertions
10690 * acinclude.m4: various changes in alignment of help strings.
10692 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10694 * src/kbmap.C: commented out the use of the hash map in kb_map,
10695 beginning of movement to a stl::container.
10697 * several files: removed code that was not in effect when
10698 MOVE_TEXT was defined.
10700 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10701 for escaping should not be used. We can discuss if the string
10702 should be enclosed in f.ex. [] instead of "".
10704 * src/trans_mgr.C (insert): use the new returned value from
10705 encodeString to get deadkeys and keymaps done correctly.
10707 * src/chset.C (encodeString): changed to return a pair, to tell
10708 what to use if we know the string.
10710 * src/lyxscreen.h (fillArc): new function.
10712 * src/FontInfo.C (resize): rewritten to use more std::string like
10713 structore, especially string::replace.
10715 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10718 * configure.in (chmod +x some scripts): remove config/gcc-hack
10720 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10722 * src/buffer.C (writeFile): change once again the top comment in a
10723 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10724 instead of an hardcoded version number.
10725 (makeDocBookFile): ditto
10727 * src/version.h: add new define LYX_DOCVERSION
10729 * po/de.po: update from Pit Sütterlin
10730 * lib/bind/de_menus.bind: ditto.
10732 * src/lyxfunc.C (Dispatch): call MenuExport()
10733 * src/buffer.C (Dispatch): ditto
10735 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10736 LyXFunc::Dispatch().
10737 (MenuExport): new function, moved from
10738 LyXFunc::Dispatch().
10740 * src/trans_mgr.C (insert): small cleanup
10741 * src/chset.C (loadFile): ditto
10743 * lib/kbd/iso8859-1.cdef: add missing backslashes
10745 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10747 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10748 help with placing the manually drawn accents better.
10750 (Draw): x2 and hg changed to float to minimize rounding errors and
10751 help place the accents better.
10753 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10754 unsigned short to char is just wrong...cast the char to unsigned
10755 char instead so that the two values can compare sanely. This
10756 should also make the display of insetlatexaccents better and
10757 perhaps also some other insets.
10759 (lbearing): new function
10762 1999-12-15 Allan Rae <rae@lyx.org>
10764 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10765 header that provides a wrapper around the very annoying SGI STL header
10768 * src/support/lyxstring.C, src/LString.h:
10769 removed old SGI-STL-compatability attempts.
10771 * configure.in: Use LYX_STL_STRING_FWD.
10773 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10774 stl_string_fwd.h is around and try to determine it's location.
10775 Major improvement over previous SGI STL 3.2 compatability.
10776 Three small problems remain with this function due to my zero
10777 knowledge of autoconf. JMarc and lgb see the comments in the code.
10779 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10781 * src/broken_const.h, config/hack-gcc, config/README: removed
10783 * configure.in: remove --with-gcc-hack option; do not call
10786 * INSTALL: remove documentation of --with-broken-const and
10789 * acconfig.h: remove all trace of BROKEN_CONST define
10791 * src/buffer.C (makeDocBookFile): update version number in output
10793 (SimpleDocBookOnePar): fix an assert when trying to a character
10794 access beyond string length
10797 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10799 * po/de.po: fix the Export menu
10801 * lyx.man: update the description of -dbg
10803 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10804 (commandLineHelp): updated
10805 (easyParse): show list of available debug levels if -dbg is passed
10808 * src/Makefile.am: add debug.C
10810 * src/debug.h: moved some code to debug.C
10812 * src/debug.C: new file. Contains code to set and show debug
10815 * src/layout.C: remove 'break' after 'continue' in switch
10816 statements, since these cannot be reached.
10818 1999-12-13 Allan Rae <rae@lyx.org>
10820 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10821 (in_word_set): hash() -> math_hash()
10823 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10825 * acconfig.h: Added a test for whether we are using exceptions in the
10826 current compilation run. If so USING_EXCEPTIONS is defined.
10828 * config.in: Check for existance of stl_string_fwd.h
10829 * src/LString.h: If compiling --with-included-string and SGI's
10830 STL version 3.2 is present (see above test) we need to block their
10831 forward declaration of string and supply a __get_c_string().
10832 However, it turns out this is only necessary if compiling with
10833 exceptions enabled so I've a bit more to add yet.
10835 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10836 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10837 src/support/LRegex.h, src/undo.h:
10838 Shuffle the order of the included files a little to ensure that
10839 LString.h gets included before anything that includes stl_string_fwd.h
10841 * src/support/lyxstring.C: We need to #include LString.h instead of
10842 lyxstring.h to get the necessary definition of __get_c_string.
10843 (__get_c_string): New function. This is defined static just like SGI's
10844 although why they need to do this I'm not sure. Perhaps it should be
10845 in lstrings.C instead.
10847 * lib/templates/IEEEtran.lyx: New template file.
10849 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10851 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10852 * intl/Makefile.in (MKINSTALLDIRS): ditto
10854 * src/LyXAction.C (init): changed to hold the LFUN data in a
10855 automatic array in stead of in callso to newFunc, this speeds up
10856 compilation a lot. Also all the memory used by the array is
10857 returned when the init is completed.
10859 * a lot of files: compiled with -Wold-style-cast, changed most of
10860 the reported offenders to C++ style casts. Did not change the
10861 offenders in C files.
10863 * src/trans.h (Match): change argument type to unsigned int.
10865 * src/support/DebugStream.C: fix some types on the streambufs so
10866 that it works on a conforming implementation.
10868 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10870 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10872 * src/support/lyxstring.C: remove the inline added earlier since
10873 they cause a bunch of unsatisfied symbols when linking with dec
10874 cxx. Cxx likes to have the body of inlines at the place where they
10877 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10878 accessing negative bounds in array. This fixes the crash when
10879 inserting accented characters.
10880 * src/trans.h (Match): ditto
10882 * src/buffer.C (Dispatch): since this is a void, it should not try
10883 to return anything...
10885 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10887 * src/buffer.h: removed the two friends from Buffer. Some changes
10888 because of this. Buffer::getFileName and Buffer::setFileName
10889 renamed to Buffer::fileName() and Buffer::fileName(...).
10891 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10893 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10894 and Buffer::update(short) to BufferView. This move is currently
10895 controlled by a define MOVE_TEXT, this will be removed when all
10896 shows to be ok. This move paves the way for better separation
10897 between buffer contents and buffer view. One side effect is that
10898 the BufferView needs a rebreak when swiching buffers, if we want
10899 to avoid this we can add a cache that holds pointers to LyXText's
10900 that is not currently in use.
10902 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10905 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10907 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10909 * lyx_main.C: new command line option -x (or --execute) and
10910 -e (or --export). Now direct conversion from .lyx to .tex
10911 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10912 Unfortunately, X is still needed and the GUI pops up during the
10915 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10917 * src/Spacing.C: add a using directive to bring stream stuff into
10919 * src/paragraph.C: ditto
10920 * src/buffer.C: ditto
10922 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10923 from Lars' announcement).
10925 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10926 example files from Tino Meinen.
10928 1999-12-06 Allan Rae <rae@lyx.org>
10930 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10932 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10934 * src/support/lyxstring.C: added a lot of inline for no good
10937 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10938 latexWriteEndChanges, they were not used.
10940 * src/layout.h (operator<<): output operator for PageSides
10942 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10944 * some example files: loaded in LyX 1.0.4 and saved again to update
10945 certain constructs (table format)
10947 * a lot of files: did the change to use fstream/iostream for all
10948 writing of files. Done with a close look at Andre Poenitz's patch.
10950 * some files: whitespace changes.
10952 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10954 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10955 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10956 architecture, we provide our own. It is used unconditionnally, but
10957 I do not think this is a performance problem. Thanks to Angus
10958 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10959 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10961 (GetInset): use my_memcpy.
10965 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10966 it is easier to understand, but it uses less TeX-only constructs now.
10968 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10969 elements contain spaces
10971 * lib/configure: regenerated
10973 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10974 elements contain spaces; display the list of programs that are
10977 * autogen.sh: make sure lib/configure is executable
10979 * lib/examples/*: rename the tutorial examples to begin with the
10980 two-letters language code.
10982 * src/lyxfunc.C (getStatus): do not query current font if no
10985 * src/lyx_cb.C (RunScript): use QuoteName
10986 (MenuRunDvips): ditto
10987 (PrintApplyCB): ditto
10989 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10990 around argument, so that it works well with the current shell.
10991 Does not work properly with OS/2 shells currently.
10993 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10994 * src/LyXSendto.C (SendtoApplyCB): ditto
10995 * src/lyxfunc.C (Dispatch): ditto
10996 * src/buffer.C (runLaTeX): ditto
10997 (runLiterate): ditto
10998 (buildProgram): ditto
11000 * src/lyx_cb.C (RunScript): ditto
11001 (MenuMakeLaTeX): ditto
11003 * src/buffer.h (getLatexName): new method
11005 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11007 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11009 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11010 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11011 (create_math_panel): ditto
11013 * src/lyxfunc.C (getStatus): re-activate the code which gets
11014 current font and cursor; add test for export to html.
11016 * src/lyxrc.C (read): remove unreachable break statements; add a
11019 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11021 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11023 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11024 introduced by faulty regex.
11025 * src/buffer.C: ditto
11026 * src/lastfiles.C: ditto
11027 * src/paragraph.C: ditto
11028 * src/table.C: ditto
11029 * src/vspace.C: ditto
11030 * src/insets/figinset.C: ditto
11031 Note: most of these is absolutely harmless, except the one in
11032 src/mathed formula.C.
11034 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11036 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11037 operation, yielding correct results for the reLyX command.
11039 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11041 * src/support/filetools.C (ExpandPath): removed an over eager
11043 (ReplaceEnvironmentPath): ditto
11045 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11046 shows that we are doing something fishy in our code...
11047 (BubblePost): ditto
11050 * src/lyxrc.C (read): use a double switch trick to get more help
11051 from the compiler. (the same trick is used in layout.C)
11052 (write): new function. opens a ofstream and pass that to output
11053 (output): new function, takes a ostream and writes the lyxrc
11054 elemts to it. uses a dummy switch to make sure no elements are
11057 * src/lyxlex.h: added a struct pushpophelper for use in functions
11058 with more than one exit point.
11060 * src/lyxlex.[Ch] (GetInteger): made it const
11064 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11066 * src/layout.[hC] : LayoutTags splitted into several enums, new
11067 methods created, better error handling cleaner use of lyxlex. Read
11070 * src/bmtable.[Ch]: change some member prototypes because of the
11071 image const changes.
11073 * commandtags.h, src/LyXAction.C (init): new function:
11074 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11075 This file is not read automatically but you can add \input
11076 preferences to your lyxrc if you want to. We need to discuss how
11079 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11080 in .aux, also remove .bib and .bst files from dependencies when
11083 * src/BufferView.C, src/LyXView.C: add const_cast several places
11084 because of changes to images.
11086 * lib/images/*: same change as for images/*
11088 * lib/lyxrc.example: Default for accept_compound is false not no.
11090 * images/*: changed to be const, however I have som misgivings
11091 about this change so it might be changed back.
11093 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11095 * lib/configure, po/POTFILES.in: regenerated
11097 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11099 * config/lib_configure.m4: removed
11101 * lib/configure.m4: new file (was config/lib_configure.m4)
11103 * configure.in: do not test for rtti, since we do not use it.
11105 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11107 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11108 doubling of allocated space scheme. This makes it faster for large
11109 strings end to use less memory for small strings. xtra rememoved.
11111 * src/insets/figinset.C (waitalarm): commented out.
11112 (GhostscriptMsg): use static_cast
11113 (GhostscriptMsg): use new instead of malloc to allocate memory for
11114 cmap. also delete the memory after use.
11116 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11118 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11119 for changes in bibtex database or style.
11120 (runBibTeX): remove all .bib and .bst files from dep before we
11122 (run): use scanAuc in when dep file already exist.
11124 * src/DepTable.C (remove_files_with_extension): new method
11125 (exist): new method
11127 * src/DepTable.[Ch]: made many of the methods const.
11129 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11131 * src/bufferparams.C: make sure that the default textclass is
11132 "article". It used to be the first one by description order, but
11133 now the first one is "docbook".
11135 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11136 string; call Debug::value.
11137 (easyParse): pass complete argument to setDebuggingLevel().
11139 * src/debug.h (value): fix the code that parses debug levels.
11141 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11144 * src/LyXAction.C: use Debug::ACTION as debug channel.
11146 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11148 * NEWS: updated for the future 1.1.3 release.
11150 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11151 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11152 it should. This is of course a controversial change (since many
11153 people will find that their lyx workscreen is suddenly full of
11154 red), but done for the sake of correctness.
11156 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11157 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11159 * src/insets/inseterror.h, src/insets/inseturl.h,
11160 src/insets/insetinfo.h, src/insets/figinset.h,
11161 src/mathed/formulamacro.h, src/mathed/math_macro.h
11162 (EditMessage): add a missing const and add _() to make sure that
11163 translation happens
11165 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11166 src/insets/insetbib.C, src/support/filetools.C: add `using'
11167 directives for cxx.
11169 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11170 doing 'Insert index of last word' at the beginning of a paragraph.
11172 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11174 * several files: white-space changes.
11176 * src/mathed/formula.C: removed IsAlpha and IsDigit
11178 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11179 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11182 * src/insets/figinset.C (GetPSSizes): don't break when
11183 "EndComments" is seen. But break when a boundingbox is read.
11185 * all classes inherited from Inset: return value of Clone
11186 changed back to Inset *.
11188 * all classes inherited form MathInset: return value of Clone
11189 changed back to MathedInset *.
11191 * src/insets/figinset.C (runqueue): use a ofstream to output the
11192 gs/ps file. Might need some setpresicion or setw. However I can
11193 see no problem with the current code.
11194 (runqueue): use sleep instead of the alarm/signal code. I just
11195 can't see the difference.
11197 * src/paragraph.C (LyXParagraph): reserve space in the new
11198 paragraph and resize the inserted paragraph to just fit.
11200 * src/lyxfunc.h (operator|=): added operator for func_status.
11202 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11203 check for readable file.
11205 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11206 check for readable file.
11207 (MenuMakeLinuxDoc): ditto
11208 (MenuMakeDocBook): ditto
11209 (MenuMakeAscii): ditto
11210 (InsertAsciiFile): split the test for openable and readable
11212 * src/bmtable.C (draw_bitmaptable): use
11213 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11215 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11216 findtexfile from LaTeX to filetools.
11218 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11219 instead of FilePtr. Needs to be verified by a literate user.
11221 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11223 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11224 (EditMessage): likewise.
11226 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11227 respectively as \textasciitilde and \textasciicircum.
11229 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11231 * src/support/lyxstring.h: made the methods that take iterators
11232 use const_iterator.
11234 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11235 (regexMatch): made is use the real regex class.
11237 * src/support/Makefile.am: changed to use libtool
11239 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11241 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11243 (MathIsInset ++): changed several macros to be inline functions
11246 * src/mathed/Makefile.am: changed to use libtool
11248 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11250 * src/insets/inset* : Clone changed to const and return type is
11251 the true insettype not just Inset*.
11253 * src/insets/Makefile.am: changed to use libtool
11255 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11257 * src/undo.[Ch] : added empty() and changed some of the method
11260 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11262 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11263 setID use block<> for the bullets array, added const several places.
11265 * src/lyxfunc.C (getStatus): new function
11267 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11268 LyXAction, added const to several funtions.
11270 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11271 a std::map, and to store the dir items in a vector.
11273 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11276 * src/LyXView.[Ch] + other files : changed currentView to view.
11278 * src/LyXAction.[Ch] : ported from the old devel branch.
11280 * src/.cvsignore: added .libs and a.out
11282 * configure.in : changes to use libtool.
11284 * acinclude.m4 : inserted libtool.m4
11286 * .cvsignore: added libtool
11288 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11290 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11291 file name in insets and mathed directories (otherwise the
11292 dependency is not taken in account under cygwin).
11294 * src/text2.C (InsertString[AB]): make sure that we do not try to
11295 read characters past the string length.
11297 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11299 * lib/doc/LaTeXConfig.lyx.in,
11300 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11302 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11303 file saying who created them and when this heppened; this is
11304 useless and annoys tools like cvs.
11306 * lib/layouts/g-brief-{en,de}.layout,
11307 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11308 from Thomas Hartkens <thomas@hartkens.de>.
11310 * src/{insets,mathed}/Makefile.am: do not declare an empty
11311 LDFLAGS, so that it can be set at configure time (useful on Irix
11314 * lib/reLyX/configure.in: make sure that the prefix is set
11315 correctly in LYX_DIR.
11317 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11319 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11320 be used by 'command-sequence' this allows to bind a key to a
11321 sequence of LyX-commands
11322 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11324 * src/LyXAction.C: add "command-sequence"
11326 * src/LyXFunction.C: handling of "command-sequence"
11328 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11329 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11331 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11333 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11335 * src/buffer.C (writeFile): Do not output a comment giving user
11336 and date at the beginning of a .lyx file. This is useless and
11337 annoys cvs anyway; update version number to 1.1.
11339 * src/Makefile.am (LYX_DIR): add this definition, so that a
11340 default path is hardcoded in LyX.
11342 * configure.in: Use LYX_GNU_GETTEXT.
11344 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11345 AM_GNU_GETTEXT with a bug fixed.
11347 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11349 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11351 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11352 which is used to point to LyX data is now LYX_DIR_11x.
11354 * lyx.man: convert to a unix text file; small updates.
11356 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11358 * src/support/LSubstring.[Ch]: made the second arg of most of the
11359 constructors be a const reference.
11361 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11364 * src/support/lyxstring.[Ch] (swap): added missing member function
11365 and specialization of swap(str, str);
11367 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11369 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11370 trace of the old one.
11372 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11373 put the member definitions in undo.C.
11375 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11376 NEW_TEXT and have now only code that was included when this was
11379 * src/intl.C (LCombo): use static_cast
11381 (DispatchCallback): ditto
11383 * src/definitions.h: removed whole file
11385 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11387 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11388 parsing and stores in a std:map. a regex defines the file format.
11389 removed unneeded members.
11391 * src/bufferparams.h: added several enums from definitions.h here.
11392 Removed unsused destructor. Changed some types to use proper enum
11393 types. use block to have the temp_bullets and user_defined_bullets
11394 and to make the whole class assignable.
11396 * src/bufferparams.C (Copy): removed this functions, use a default
11397 assignment instead.
11399 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11402 * src/buffer.C (readLyXformat2): commend out all that have with
11403 oldpapersize to do. also comment out all that hve to do with
11404 insetlatex and insetlatexdel.
11405 (setOldPaperStuff): commented out
11407 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11409 * src/LyXAction.C: remove use of inset-latex-insert
11411 * src/mathed/math_panel.C (button_cb): use static_cast
11413 * src/insets/Makefile.am (insets_o_SOURCES): removed
11416 * src/support/lyxstring.C (helper): use the unsigned long
11417 specifier, UL, instead of a static_cast.
11419 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11421 * src/support/block.h: new file. to be used as a c-style array in
11422 classes, so that the class can be assignable.
11424 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11426 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11427 NULL, make sure to return an empty string (it is not possible to
11428 set a string to NULL).
11430 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11432 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11434 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11436 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11437 link line, so that Irix users (for example) can set it explicitely to
11440 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11441 it can be overidden at make time (static or dynamic link, for
11444 * src/vc-backend.C, src/LaTeXFeatures.h,
11445 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11446 statements to bring templates to global namespace.
11448 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11450 * src/support/lyxstring.C (operator[] const): make it standard
11453 * src/minibuffer.C (Init): changed to reflect that more
11454 information is given from the lyxvc and need not be provided here.
11456 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11458 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11460 * src/LyXView.C (UpdateTimerCB): use static_cast
11461 (KeyPressMask_raw_callback): ditto
11463 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11464 buffer_, a lot of changes because of this. currentBuffer() ->
11465 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11466 also changes to other files because of this.
11468 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11470 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11471 have no support for RCS and partial support for CVS, will be
11474 * src/insets/ several files: changes because of function name
11475 changes in Bufferview and LyXView.
11477 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11479 * src/support/LSubstring.[Ch]: new files. These implement a
11480 Substring that can be very convenient to use. i.e. is this
11482 string a = "Mary had a little sheep";
11483 Substring(a, "sheep") = "lamb";
11484 a is now "Mary has a little lamb".
11486 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11487 out patterns and subpatterns of strings. It is used by LSubstring
11488 and also by vc-backend.C
11490 * src/support/lyxstring.C: went over all the assertions used and
11491 tried to correct the wrong ones and flag which of them is required
11492 by the standard. some bugs found because of this. Also removed a
11493 couple of assertions.
11495 * src/support/Makefile.am (libsupport_a_SOURCES): added
11496 LSubstring.[Ch] and LRegex.[Ch]
11498 * src/support/FileInfo.h: have struct stat buf as an object and
11499 not a pointer to one, some changes because of this.
11501 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11502 information in layout when adding the layouts preamble to the
11503 textclass preamble.
11505 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11508 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11509 because of bug in OS/2.
11511 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11513 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11514 \verbatim@font instead of \ttfamily, so that it can be redefined.
11516 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11517 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11518 src/layout.h, src/text2.C: add 'using' directive to bring the
11519 STL templates we need from the std:: namespace to the global one.
11520 Needed by DEC cxx in strict ansi mode.
11522 * src/support/LIstream.h,src/support/LOstream.h,
11523 src/support/lyxstring.h,src/table.h,
11524 src/lyxlookup.h: do not include <config.h> in header
11525 files. This should be done in the .C files only.
11527 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11531 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11533 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11534 from Kayvan to fix the tth invokation.
11536 * development/lyx.spec.in: updates from Kayvan to reflect the
11537 changes of file names.
11539 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11541 * src/text2.C (InsertStringB): use std::copy
11542 (InsertStringA): use std::copy
11544 * src/bufferlist.C: use a vector to store the buffers in. This is
11545 an internal change and should not affect any other thing.
11547 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11550 * src/text.C (Fill): fix potential bug, one off bug.
11552 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11554 * src/Makefile.am (lyx_main.o): add more files it depends on.
11556 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11558 * src/support/lyxstring.C: use size_t for the reference count,
11559 size, reserved memory and xtra.
11560 (internal_compare): new private member function. Now the compare
11561 functions should work for std::strings that have embedded '\0'
11563 (compare): all compare functions rewritten to use
11566 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11568 * src/support/lyxstring.C (compare): pass c_str()
11569 (compare): pass c_str
11570 (compare): pass c_str
11572 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11574 * src/support/DebugStream.C: <config.h> was not included correctly.
11576 * lib/configure: forgot to re-generate it :( I'll make this file
11577 auto generated soon.
11579 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11581 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11584 * src/support/lyxstring.C: some changes from length() to rep->sz.
11585 avoids a function call.
11587 * src/support/filetools.C (SpaceLess): yet another version of the
11588 algorithm...now per Jean-Marc's suggestions.
11590 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11592 * src/layout.C (less_textclass_desc): functor for use in sorting
11594 (LyXTextClass::Read): sort the textclasses after reading.
11596 * src/support/filetools.C (SpaceLess): new version of the
11597 SpaceLess functions. What problems does this one give? Please
11600 * images/banner_bw.xbm: made the arrays unsigned char *
11602 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11604 * src/support/lyxstring.C (find): remove bogus assertion in the
11605 two versions of find where this has not been done yet.
11607 * src/support/lyxlib.h: add missing int return type to
11610 * src/menus.C (ShowFileMenu): disable exporting to html if no
11611 html export command is present.
11613 * config/lib_configure.m4: add a test for an HTML converter. The
11614 programs checked for are, in this order: tth, latex2html and
11617 * lib/configure: generated from config/lib_configure.m4.
11619 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11620 html converter. The parameters are now passed through $$FName and
11621 $$OutName, instead of standard input/output.
11623 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11625 * lib/lyxrc.example: update description of \html_command.
11626 add "quotes" around \screen_font_xxx font setting examples to help
11627 people who use fonts with spaces in their names.
11629 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11631 * Distribution files: updates for v1.1.2
11633 * src/support/lyxstring.C (find): remove bogus assert and return
11634 npos for the same condition.
11636 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11638 * added patch for OS/2 from SMiyata.
11640 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11642 * src/text2.C (CutSelection): make space_wrapped a bool
11643 (CutSelection): dont declare int i until we have to.
11644 (alphaCounter): return a char const *.
11646 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11648 * src/support/syscall.C (Systemcalls::kill):
11649 src/support/filetools.C (PutEnv, PutEnvPath):
11650 src/lyx_cb.C (addNewlineAndDepth):
11651 src/FontInfo.C (FontInfo::resize): condition some #warning
11652 directives with WITH_WARNINGS.
11655 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11657 * src/layout.[Ch] + several files: access to class variables
11658 limited and made accessor functions instead a lot of code changed
11659 becuase of this. Also instead of returning pointers often a const
11660 reference is returned instead.
11662 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11664 * src/Makefile.am (dist-hook): added used to remove the CVS from
11665 cheaders upon creating a dist
11666 (EXTRA_DIST): added cheaders
11668 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11669 a character not as a small integer.
11671 * src/support/lyxstring.C (find): removed Assert and added i >=
11672 rep->sz to the first if.
11674 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11676 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11677 src/LyXView.C src/buffer.C src/bufferparams.C
11678 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11679 src/text2.C src/insets/insetinclude.C:
11680 lyxlayout renamed to textclasslist.
11682 * src/layout.C: some lyxerr changes.
11684 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11685 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11686 (LyXLayoutList): removed all traces of this class.
11687 (LyXTextClass::Read): rewrote LT_STYLE
11688 (LyXTextClass::hasLayout): new function
11689 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11690 both const and nonconst version.
11691 (LyXTextClass::delete_layout): new function.
11692 (LyXTextClassList::Style): bug fix. do the right thing if layout
11694 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11695 (LyXTextClassList::NameOfLayout): ditto
11696 (LyXTextClassList::Load): ditto
11698 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11700 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11702 * src/LyXAction.C (LookupFunc): added a workaround for sun
11703 compiler, on the other hand...we don't know if the current code
11704 compiles on sun at all...
11706 * src/support/filetools.C (CleanupPath): subst fix
11708 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11711 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11712 complained about this one?
11714 * src/insets/insetinclude.C (Latex): subst fix
11716 * src/insets/insetbib.C (getKeys): subst fix
11718 * src/LyXSendto.C (SendtoApplyCB): subst fix
11720 * src/lyx_main.C (init): subst fix
11722 * src/layout.C (Read): subst fix
11724 * src/lyx_sendfax_main.C (button_send): subst fix
11726 * src/buffer.C (RoffAsciiTable): subst fix
11728 * src/lyx_cb.C (MenuFax): subst fix
11729 (PrintApplyCB): subst fix
11731 1999-10-26 Juergen Vigna <jug@sad.it>
11733 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11735 (Read): Cleaned up this code so now we read only format vestion >= 5
11737 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11739 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11740 come nobody has complained about this one?
11742 * src/insets/insetinclude.C (Latex): subst fix
11744 * src/insets/insetbib.C (getKeys): subst fix
11746 * src/lyx_main.C (init): subst fix
11748 * src/layout.C (Read): subst fix
11750 * src/buffer.C (RoffAsciiTable): subst fix
11752 * src/lyx_cb.C (MenuFax): subst fix.
11754 * src/layout.[hC] + some other files: rewrote to use
11755 std::container to store textclasses and layouts in.
11756 Simplified, removed a lot of code. Make all classes
11757 assignable. Further simplifications and review of type
11758 use still to be one.
11760 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11761 lastfiles to create the lastfiles partr of the menu.
11763 * src/lastfiles.[Ch]: rewritten to use deque to store the
11764 lastfiles in. Uses fstream for reading and writing. Simplifies
11767 * src/support/syscall.C: remove explicit cast.
11769 * src/BufferView.C (CursorToggleCB): removed code snippets that
11770 were commented out.
11771 use explicat C++ style casts instead of C style casts. also use
11772 u_vdata instea of passing pointers in longs.
11774 * src/PaperLayout.C: removed code snippets that were commented out.
11776 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11778 * src/lyx_main.C: removed code snippets that wer commented out.
11780 * src/paragraph.C: removed code snippets that were commented out.
11782 * src/lyxvc.C (logClose): use static_cast
11784 (viewLog): remove explicit cast to void*
11785 (showLog): removed old commented code
11787 * src/menus.C: use static_cast instead of C style casts. use
11788 u_vdata instead of u_ldata. remove explicit cast to (long) for
11789 pointers. Removed old code that was commented out.
11791 * src/insets/inset.C: removed old commented func
11793 * src/insets/insetref.C (InsetRef): removed old code that had been
11794 commented out for a long time.
11796 (escape): removed C style cast
11798 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11800 * src/insets/insetlatex.C (Draw): removed old commented code
11801 (Read): rewritten to use string
11803 * src/insets/insetlabel.C (escape): removed C style cast
11805 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11807 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11808 old commented code.
11810 * src/insets/insetinclude.h: removed a couple of stupid bools
11812 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11813 (Clone): remove C style cast
11814 (getKeys): changed list to lst because of std::list
11816 * src/insets/inseterror.C (Draw): removed som old commented code.
11818 * src/insets/insetcommand.C (Draw): removed some old commented code.
11820 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11821 commented out forever.
11822 (bibitem_cb): use static_cast instead of C style cast
11823 use of vdata changed to u_vdata.
11825 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11827 (CloseUrlCB): use static_cast instead of C style cast.
11828 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11830 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11831 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11832 (CloseInfoCB): static_cast from ob->u_vdata instead.
11833 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11836 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11837 (C_InsetError_CloseErrorCB): forward the ob parameter
11838 (CloseErrorCB): static_cast from ob->u_vdata instead.
11840 * src/vspace.h: include LString.h since we use string in this class.
11842 * src/vspace.C (lyx_advance): changed name from advance because of
11843 nameclash with stl. And since we cannot use namespaces yet...I
11844 used a lyx_ prefix instead. Expect this to change when we begin
11847 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11849 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11850 and removed now defunct constructor and deconstructor.
11852 * src/BufferView.h: have backstack as a object not as a pointer.
11853 removed initialization from constructor. added include for BackStack
11855 * development/lyx.spec.in (%build): add CFLAGS also.
11857 * src/screen.C (drawFrame): removed another warning.
11859 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11861 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11862 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11863 README and ANNOUNCE a bit for the next release. More work is
11866 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11867 unbreakable if we are in freespacing mode (LyX-Code), but not in
11870 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11872 * src/BackStack.h: fixed initialization order in constructor
11874 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11876 * acinclude.m4 (VERSION): new rules for when a version is
11877 development, added also a variable for prerelease.
11878 (warnings): we set with_warnings=yes for prereleases
11879 (lyx_opt): prereleases compile with same optimization as development
11880 (CXXFLAGS): only use pedantic if we are a development version
11882 * src/BufferView.C (restorePosition): don't do anything if the
11883 backstack is empty.
11885 * src/BackStack.h: added member empty, use this to test if there
11886 is anything to pop...
11888 1999-10-25 Juergen Vigna <jug@sad.it>
11891 * forms/layout_forms.fd +
11892 * forms/latexoptions.fd +
11893 * lyx.fd: changed for various form resize issues
11895 * src/mathed/math_panel.C +
11896 * src/insets/inseterror.C +
11897 * src/insets/insetinfo.C +
11898 * src/insets/inseturl.C +
11899 * src/insets/inseturl.h +
11901 * src/LyXSendto.C +
11902 * src/PaperLayout.C +
11903 * src/ParagraphExtra.C +
11904 * src/TableLayout.C +
11906 * src/layout_forms.C +
11913 * src/menus.C: fixed various resize issues. So now forms can be
11914 resized savely or not be resized at all.
11916 * forms/form_url.fd +
11917 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11920 * src/insets/Makefile.am: added files form_url.[Ch]
11922 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11924 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11925 (and presumably 6.2).
11927 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11928 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11929 remaining static member callbacks.
11931 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11934 * src/support/lyxstring.h: declare struct Srep as friend of
11935 lyxstring, since DEC cxx complains otherwise.
11937 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11939 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11941 * src/LaTeX.C (run): made run_bibtex also depend on files with
11943 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11944 are put into the dependency file.
11946 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11947 the code has shown itself to work
11948 (create_ispell_pipe): removed another warning, added a comment
11951 * src/minibuffer.C (ExecutingCB): removed code that has been
11952 commented out a long time
11954 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11955 out code + a warning.
11957 * src/support/lyxstring.h: comment out the three private
11958 operators, when compiling with string ansi conforming compilers
11959 they make problems.
11961 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11963 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11964 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11967 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11970 * src/mathed/math_panel.C (create_math_panel): remove explicit
11973 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11976 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11977 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11978 to XCreatePixmapFromBitmapData
11979 (fl_set_bmtable_data): change the last argument to be unsigned
11981 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11982 and bh to be unsigned int, remove explicit casts in call to
11983 XReadBitmapFileData.
11985 * images/arrows.xbm: made the arrays unsigned char *
11986 * images/varsz.xbm: ditto
11987 * images/misc.xbm: ditto
11988 * images/greek.xbm: ditto
11989 * images/dots.xbm: ditto
11990 * images/brel.xbm: ditto
11991 * images/bop.xbm: ditto
11993 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11995 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11996 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11997 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11999 (LYX_CXX_CHEADERS): added <clocale> to the test.
12001 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12003 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12005 * src/support/lyxstring.C (append): fixed something that must be a
12006 bug, rep->assign was used instead of rep->append.
12008 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12011 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12012 lyx insert double chars. Fix spotted by Kayvan.
12014 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12016 * Fixed the tth support. I messed up with the Emacs patch apply feature
12017 and omitted the changes in lyxrc.C.
12019 1999-10-22 Juergen Vigna <jug@sad.it>
12021 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12023 * src/lyx_cb.C (MenuInsertRef) +
12024 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12025 the form cannot be resized under it limits (fixes a segfault)
12027 * src/lyx.C (create_form_form_ref) +
12028 * forms/lyx.fd: Changed Gravity on name input field so that it is
12031 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12033 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12034 <ostream> and <istream>.
12036 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12037 whether <fstream> provides the latest standard features, or if we
12038 have an oldstyle library (like in egcs).
12039 (LYX_CXX_STL_STRING): fix the test.
12041 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12042 code on MODERN_STL_STREAM.
12044 * src/support/lyxstring.h: use L{I,O}stream.h.
12046 * src/support/L{I,O}stream.h: new files, designed to setup
12047 correctly streams for our use
12048 - includes the right header depending on STL capabilities
12049 - puts std::ostream and std::endl (for LOStream.h) or
12050 std::istream (LIStream.h) in toplevel namespace.
12052 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12054 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12055 was a bib file that had been changed we ensure that bibtex is run.
12056 (runBibTeX): enhanced to extract the names of the bib files and
12057 getting their absolute path and enter them into the dep file.
12058 (findtexfile): static func that is used to look for tex-files,
12059 checks for absolute patchs and tries also with kpsewhich.
12060 Alternative ways of finding the correct files are wanted. Will
12062 (do_popen): function that runs a command using popen and returns
12063 the whole output of that command in a string. Should be moved to
12066 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12067 file with extension ext has changed.
12069 * src/insets/figinset.C: added ifdef guards around the fl_free
12070 code that jug commented out. Now it is commented out when
12071 compiling with XForms == 0.89.
12073 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12074 to lyxstring.C, and only keep a forward declaration in
12075 lyxstring.h. Simplifies the header file a bit and should help a
12076 bit on compile time too. Also changes to Srep will not mandate a
12077 recompile of code just using string.
12078 (~lyxstring): definition moved here since it uses srep.
12079 (size): definition moved here since it uses srep.
12081 * src/support/lyxstring.h: removed a couple of "inline" that should
12084 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12086 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12089 1999-10-21 Juergen Vigna <jug@sad.it>
12091 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12092 set to left if I just remove the width entry (or it is empty).
12094 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12095 paragraph when having dummy paragraphs.
12097 1999-10-20 Juergen Vigna <jug@sad.it>
12099 * src/insets/figinset.C: just commented some fl_free_form calls
12100 and added warnings so that this calls should be activated later
12101 again. This avoids for now a segfault, but we have a memory leak!
12103 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12104 'const char * argument' to 'string argument', this should
12105 fix some Asserts() in lyxstring.C.
12107 * src/lyxfunc.h: Removed the function argAsString(const char *)
12108 as it is not used anymore.
12110 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12112 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12115 * src/Literate.h: some funcs moved from public to private to make
12116 interface clearer. Unneeded args removed.
12118 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12120 (scanBuildLogFile): ditto
12122 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12123 normal TeX Error. Still room for improvement.
12125 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12127 * src/buffer.C (insertErrors): changes to make the error
12128 desctription show properly.
12130 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12133 * src/support/lyxstring.C (helper): changed to use
12134 sizeof(object->rep->ref).
12135 (operator>>): changed to use a pointer instead.
12137 * src/support/lyxstring.h: changed const reference & to value_type
12138 const & lets see if that helps.
12140 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12142 * Makefile.am (rpmdist): fixed to have non static package and
12145 * src/support/lyxstring.C: removed the compilation guards
12147 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12150 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12151 conditional compile of lyxstring.Ch
12153 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12154 stupid check, but it is a lot better than the bastring hack.
12155 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12157 * several files: changed string::erase into string::clear. Not
12160 * src/chset.C (encodeString): use a char temporary instead
12162 * src/table.C (TexEndOfCell): added tostr around
12163 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12164 (TexEndOfCell): ditto
12165 (TexEndOfCell): ditto
12166 (TexEndOfCell): ditto
12167 (DocBookEndOfCell): ditto
12168 (DocBookEndOfCell): ditto
12169 (DocBookEndOfCell): ditto
12170 (DocBookEndOfCell): ditto
12172 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12174 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12176 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12177 (MenuBuildProg): added tostr around ret
12178 (MenuRunChktex): added tostr around ret
12179 (DocumentApplyCB): added tostr around ret
12181 * src/chset.C (encodeString): added tostr around t->ic
12183 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12184 (makeLaTeXFile): added tostr around tocdepth
12185 (makeLaTeXFile): added tostr around ftcound - 1
12187 * src/insets/insetbib.C (setCounter): added tostr around counter.
12189 * src/support/lyxstring.h: added an operator+=(int) to catch more
12192 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12193 (lyxstring): We DON'T allow NULL pointers.
12195 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12197 * src/mathed/math_macro.C (MathMacroArgument::Write,
12198 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12199 when writing them out.
12201 * src/LString.C: remove, since it is not used anymore.
12203 * src/support/lyxstring.C: condition the content to
12204 USE_INCLUDED_STRING macro.
12206 * src/mathed/math_symbols.C, src/support/lstrings.C,
12207 src/support/lyxstring.C: add `using' directive to specify what
12208 we need in <algorithm>. I do not think that we need to
12209 conditionalize this, but any thought is appreciated.
12211 * many files: change all callback functions to "C" linkage
12212 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12213 strict_ansi. Those who were static are now global.
12214 The case of callbacks which are static class members is
12215 trickier, since we have to make C wrappers around them (see
12216 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12217 did not finish this yet, since it defeats the purpose of
12218 encapsulation, and I am not sure what the best route is.
12220 1999-10-19 Juergen Vigna <jug@sad.it>
12222 * src/support/lyxstring.C (lyxstring): we permit to have a null
12223 pointer as assignment value and just don't assign it.
12225 * src/vspace.C (nextToken): corrected this function substituting
12226 find_first(_not)_of with find_last_of.
12228 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12229 (TableOptCloseCB) (TableSpeCloseCB):
12230 inserted fl_set_focus call for problem with fl_hide_form() in
12233 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12235 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12238 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12240 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12241 LyXLex::next() and not eatline() to get its argument.
12243 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12245 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12246 instead, use fstreams for io of the depfile, removed unneeded
12247 functions and variables.
12249 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12250 vector instead, removed all functions and variables that is not in
12253 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12255 * src/buffer.C (insertErrors): use new interface to TeXError
12257 * Makefile.am (rpmdist): added a rpmdist target
12259 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12260 per Kayvan's instructions.
12262 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12264 * src/Makefile.am: add a definition for localedir, so that locales
12265 are found after installation (Kayvan)
12267 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12269 * development/.cvsignore: new file.
12271 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12273 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12274 C++ compiler provides wrappers for C headers and use our alternate
12277 * configure.in: use LYX_CXX_CHEADERS.
12279 * src/cheader/: new directory, populated with cname headers from
12280 libstdc++-2.8.1. They are a bit old, but probably good enough for
12281 what we want (support compilers who lack them).
12283 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12284 from includes. It turns out is was stupid.
12286 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12288 * lib/Makefile.am (install-data-local): forgot a ';'
12289 (install-data-local): forgot a '\'
12290 (libinstalldirs): needed after all. reintroduced.
12292 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12294 * configure.in (AC_OUTPUT): added lyx.spec
12296 * development/lyx.spec: removed file
12298 * development/lyx.spec.in: new file
12300 * po/*.po: merged with lyx.pot becuase of make distcheck
12302 * lib/Makefile.am (dist-hook): added dist-hook so that
12303 documentation files will be included when doing a make
12304 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12305 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12307 more: tried to make install do the right thing, exclude CVS dirs
12310 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12311 Path would fit in more nicely.
12313 * all files that used to use pathstack: uses now Path instead.
12314 This change was a lot easier than expected.
12316 * src/support/path.h: new file
12318 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12320 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12322 * src/support/lyxstring.C (getline): Default arg was given for
12325 * Configure.cmd: removed file
12327 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12329 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12330 streams classes and types, add the proper 'using' statements when
12331 MODERN_STL is defined.
12333 * src/debug.h: move the << operator definition after the inclusion
12336 * src/support/filetools.C: include "LAssert.h", which is needed
12339 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12342 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12343 include "debug.h" to define a proper ostream.
12345 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12347 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12348 method to the SystemCall class which can kill a process, but it's
12349 not fully implemented yet.
12351 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12353 * src/support/FileInfo.h: Better documentation
12355 * src/lyxfunc.C: Added support for buffer-export html
12357 * src/menus.C: Added Export->As HTML...
12359 * lib/bind/*.bind: Added short-cut for buffer-export html
12361 * src/lyxrc.*: Added support for new \tth_command
12363 * lib/lyxrc.example: Added stuff for new \tth_command
12365 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12367 * lib/Makefile.am (IMAGES): removed images/README
12368 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12369 installes in correct place. Check permisions is installed
12372 * src/LaTeX.C: some no-op changes moved declaration of some
12375 * src/LaTeX.h (LATEX_H): changed include guard name
12377 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12379 * lib/reLyX/Makefile.am: install noweb2lyx.
12381 * lib/Makefile.am: install configure.
12383 * lib/reLyX/configure.in: declare a config aux dir; set package
12384 name to lyx (not sure what the best solution is); generate noweb2lyx.
12386 * lib/layouts/egs.layout: fix the bibliography layout.
12388 1999-10-08 Jürgen Vigna <jug@sad.it>
12390 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12391 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12392 it returned without continuing to search the path.
12394 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12396 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12397 also fixes a bug. It is not allowed to do tricks with std::strings
12398 like: string a("hei"); &a[e]; this will not give what you
12399 think... Any reason for the complexity in this func?
12401 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12403 * Updated README and INSTALL a bit, mostly to check that my
12404 CVS rights are correctly set up.
12406 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12408 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12409 does not allow '\0' chars but lyxstring and std::string does.
12411 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12413 * autogen.sh (AUTOCONF): let the autogen script create the
12414 POTFILES.in file too. POTFILES.in should perhaps now not be
12415 included in the cvs module.
12417 * some more files changed to use C++ includes instead of C ones.
12419 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12421 (Reread): added tostr to nlink. buggy output otherwise.
12422 (Reread): added a string() around szMode when assigning to Buffer,
12423 without this I got a log of garbled info strings.
12425 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12428 * I have added several ostream & operator<<(ostream &, some_type)
12429 functions. This has been done to avoid casting and warnings when
12430 outputting enums to lyxerr. This as thus eliminated a lot of
12431 explicit casts and has made the code clearer. Among the enums
12432 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12433 mathed enums, some font enum the Debug::type enum.
12435 * src/support/lyxstring.h (clear): missing method. equivalent of
12438 * all files that contained "stderr": rewrote constructs that used
12439 stderr to use lyxerr instead. (except bmtable)
12441 * src/support/DebugStream.h (level): and the passed t with
12442 Debug::ANY to avoid spurious bits set.
12444 * src/debug.h (Debug::type value): made it accept strings of the
12445 type INFO,INIT,KEY.
12447 * configure.in (Check for programs): Added a check for kpsewhich,
12448 the latex generation will use this later to better the dicovery of
12451 * src/BufferView.C (create_view): we don't need to cast this to
12452 (void*) that is done automatically.
12453 (WorkAreaButtonPress): removed some dead code.
12455 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12457 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12458 is not overwritten when translated (David Sua'rez de Lis).
12460 * lib/CREDITS: Added David Sua'rez de Lis
12462 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12464 * src/bufferparams.C (BufferParams): default input encoding is now
12467 * acinclude.m4 (cross_compiling): comment out macro
12468 LYX_GXX_STRENGTH_REDUCE.
12470 * acconfig.h: make sure that const is not defined (to empty) when
12471 we are compiling C++. Remove commented out code using SIZEOF_xx
12474 * configure.in : move the test for const and inline as late as
12475 possible so that these C tests do not interefere with C++ ones.
12476 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12477 has not been proven.
12479 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12481 * src/table.C (getDocBookAlign): remove bad default value for
12482 isColumn parameter.
12484 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12486 (ShowFileMenu2): ditto.
12488 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12489 of files to ignore.
12491 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12493 * Most files: finished the change from the old error code to use
12494 DebugStream for all lyxerr debugging. Only minor changes remain
12495 (e.g. the setting of debug levels using strings instead of number)
12497 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12499 * src/layout.C (Add): Changed to use compare_no_case instead of
12502 * src/FontInfo.C: changed loop variable type too string::size_type.
12504 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12506 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12507 set ETAGS_ARGS to --c++
12509 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12511 * src/table.C (DocBookEndOfCell): commented out two unused variables
12513 * src/paragraph.C: commented out four unused variables.
12515 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12516 insed a if clause with type string::size_type.
12518 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12521 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12523 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12524 variable, also changed loop to go from 0 to lenght + 1, instead of
12525 -1 to length. This should be correct.
12527 * src/LaTeX.C (scanError): use string::size_type as loop variable
12530 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12531 (l.896) since y_tmp and row was not used anyway.
12533 * src/insets/insetref.C (escape): use string::size_type as loop
12536 * src/insets/insetquotes.C (Width): use string::size_type as loop
12538 (Draw): use string::size_type as loop variable type.
12540 * src/insets/insetlatexaccent.C (checkContents): use
12541 string::size_type as loop variable type.
12543 * src/insets/insetlabel.C (escape): use string::size_type as loop
12546 * src/insets/insetinfo.C: added an extern for current_view.
12548 * src/insets/insetcommand.C (scanCommand): use string::size_type
12549 as loop variable type.
12551 * most files: removed the RCS tags. With them we had to recompile
12552 a lot of files after a simple cvs commit. Also we have never used
12553 them for anything meaningful.
12555 * most files: tags-query-replace NULL 0. As adviced several plases
12556 we now use "0" instead of "NULL" in our code.
12558 * src/support/filetools.C (SpaceLess): use string::size_type as
12559 loop variable type.
12561 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12563 * src/paragraph.C: fixed up some more string stuff.
12565 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12567 * src/support/filetools.h: make modestr a std::string.
12569 * src/filetools.C (GetEnv): made ch really const.
12571 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12572 made code that used these use max/min from <algorithm> instead.
12574 * changed several c library include files to their equivalent c++
12575 library include files. All is not changed yet.
12577 * created a support subdir in src, put lyxstring and lstrings
12578 there + the extra files atexit, fileblock, strerror. Created
12579 Makefile.am. edited configure.in and src/Makefile.am to use this
12580 new subdir. More files moved to support.
12582 * imported som of the functions from repository lyx, filetools
12584 * ran tags-query-replace on LString -> string, corrected the bogus
12585 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12586 is still some errors in there. This is errors where too much or
12587 too litle get deleted from strings (string::erase, string::substr,
12588 string::replace), there can also be some off by one errors, or
12589 just plain wrong use of functions from lstrings. Viewing of quotes
12592 * LyX is now running fairly well with string, but there are
12593 certainly some bugs yet (see above) also string is quite different
12594 from LString among others in that it does not allow null pointers
12595 passed in and will abort if it gets any.
12597 * Added the revtex4 files I forgot when setting up the repository.
12599 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12601 * All over: Tried to clean everything up so that only the files
12602 that we really need are included in the cvs repository.
12603 * Switched to use automake.
12604 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12605 * Install has not been checked.
12607 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12609 * po/pt.po: Three errors:
12610 l.533 and l.538 format specification error
12611 l. 402 duplicate entry, I just deleted it.