1 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/configure.m4: == is not a valid operator for command test.
5 * src/lyxrc.C: add using directive.
7 * src/converter.h: add std:: qualifier.
9 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
11 * src/converter.[Ch] and other files: Change the Format class to a
12 real class, and create two instances: formats and system_format.
14 * src/lyxrc.C (output): Output the difference between formats and
17 * src/frontends/xforms/FormPreferences.C (input): Simplify.
18 (buildFormats): Insert formats into browser.
19 (inputFormats): Made the browser and add button functional.
20 (applyFormats): Update formats from format_vec.
22 * src/converter.C: Changed all (*it). to it->
23 (Format::dummy): New method.
24 (Format::importer): New format flag.
25 (Formats::GetAllFormats): New method.
26 (Formats::Add): Delete format from the map if prettyname is empty.
27 (Converter::Convert): Print an error message if moving the file fails.
28 (Converter::GetReachableTo): New method
30 * src/MenuBackend.[Ch]: Add support for importformats tag.
32 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
34 * lib/configure.m4: Add word->tex and ps->fax converters.
36 * lib/ui/default.ui: Use ImportFormats on file->import menu.
37 Return fax to file menu.
41 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
43 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
46 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
49 * src/lyxfunc.C (processKeyEvent): removed
51 * src/bufferlist.C (emergencyWrite): removed the out commented
54 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
56 * src/LyXView.[Ch]: remove the outcommented raw_callback code
58 * many files: change formatting to be a bit more uniform for
59 if,while,for,switch statements, remove some parantesis not needed.
62 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
64 * config/kde.m4: make config more robust when KDEDIR is set
66 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
68 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
69 not returned a pixmap for "math-insert".
71 * src/LyXAction.C (init): sort the entries a bit.
73 2000-11-03 Juergen Vigna <jug@sad.it>
75 * src/insets/insettabular.h: added fixed number to update codes so
76 that update is only in one direction.
78 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
81 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
82 before call to edit because of redraw.
84 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
86 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
88 * lib/ui/default.ui: Populate "edit_float" menu
90 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
92 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
93 "floats-operate". The name is ugly (and the func also), but this
94 is just a band-aid until we switch to new insets.
96 2000-11-03 Rob Lahaye <lahaye@postech.edu>
98 * lib/ui/default.ui: update again the menu layout (fix some
101 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
103 * src/MenuBackend.h (fulllabel): new method.
105 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
106 the menu shortcuts of a menu are unique and whether they
107 correspond to a letter of the label.
108 (expand): call checkShortcuts when debugging.
110 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
112 * src/insets/insettext.C (InsetButtonPress): shut off warning.
114 2000-11-02 Lior Silberman <lior@Princeton.EDU>
116 * lib/examples/*.lyx : '\language default' => '\language english'
118 * lib/examples/it_splash.lyx : except where it should be italian
120 * lib/templates/*.lyx : the same
122 * doc/*.lyx* : the same
124 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
126 * lib/bind/menus.bind: remove the Layout menu entries, which I
127 somehow forgot earlier.
129 2000-11-03 Rob Lahaye <lahaye@postech.edu>
131 * lib/ui/old-default.ui: keep the old one here for reference (to
134 * lib/ui/default.ui: update the menu layout
136 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
138 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
139 Can now Apply to different insets without closing the dialog.
141 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
142 Can't actually DO anything with them yet, but I'd like a little
145 * src/frontends/xforms/input_validators.[ch]
146 (fl_lowercase_filter): new.
148 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
150 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
151 of MATH_CODE. This fixes a bug with math-macros in RTL text.
153 * src/text.C (PrepareToPrint): Show math-macros block aligned.
155 2000-11-02 Juergen Vigna <jug@sad.it>
157 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
158 on char insertion as it has already be updated by bv->updateInset().
160 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
161 if an inset inside was updated.
163 * lib/configure.cmd: commented out fax-search code
165 2000-11-01 Yves Bastide <stid@acm.org>
167 * src/tabular.C (OldFormatRead): set tabular language to the
170 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
172 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
173 class names with non-letter characters (from Yves Bastide).
175 * lib/ui/default.ui: change Item to OptItem in import menu.
176 Comment out fax stuff.
178 * lib/configure.m4: comment out fax-related stuff.
180 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
182 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
183 useful xforms helper functions. At present contains only formatted().
184 Input a string and it returns it with line breaks so that in fits
187 * src/frontends/xforms/Makefile.am: add new files.
189 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
190 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
193 * src/frontends/xforms/FormPreferences.[Ch]:
194 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
195 but lots of little clean ups. Removed enum State. Make use of
196 formatted(). Constify lots of methods. Perhaps best of all: removed
197 requirement for that horrible reinterpret_cast from pointer to long in
200 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
202 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
203 conditionalize build on xforms < 0.89
205 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
207 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
209 * src/LyXAction.C (init): comment out fax
211 * src/lyxrc.h: comment out the fax enums
212 comment out the fax variables
214 * src/commandtags.h: comment out LFUN_FAX
216 * src/lyxrc.C: disable fax variables.
217 (read): disable parsing of fax variables
218 (output): disable writing of fax variables
219 (getFeedback): now description for fax variables
221 * src/lyxfunc.C: comment out MenuFax
222 (Dispatch): disable LFUN_FAX
224 * src/lyx_cb.C (MenuFax): comment out
226 * src/WorkArea.C: add <cctype>
227 (work_area_handler): better key handling, should be ok now.
228 for accented chars + etc
230 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
231 lyx_sendfax.h and lyx_sendfax_man.C
233 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
234 (show): don't call InitLyXLookup when using xforms 0.89
236 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
238 * src/trans.C (AddDeadkey): better fix, the other one could crash...
240 * src/support/filetools.C (GetFileContents): close to dummy change
242 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
244 * src/trans.C (AddDeadkey): workaround stupid compilers.
246 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
248 * src/frontends/xforms/FormDocument.C (class_update): fix setting
249 of two-sided document.
251 2000-10-31 Juergen Vigna <jug@sad.it>
253 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
255 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
256 xposition to the Edit call.
258 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
260 * src/trans.C (AddDeadkey): cast explicitly to char.
262 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
264 * src/tabular.C (AsciiBottomHLine): simplify?
265 (AsciiTopHLine): simplify?
266 (print_n_chars): simplify
267 (DocBook): remove most of the << endl; we should flush the stream
268 as seldom as possible.
270 (TeXBottomHLine): ditto
273 (write_attribute): try a templified version.
274 (set_row_column_number_info): lesson scope of variables
276 * src/support/lstrings.h (tostr): new specialization of tostr
278 * src/trans.C (AddDeadkey): slightly cleaner fix.
280 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
282 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
283 '%%' in Toc menu labels.
286 * src/insets/insetlatexaccent.C (draw): Correct rendering when
287 font_norm is iso10646-1.
289 * src/font.C (ascent): Fixed for 16bit fonts
290 (descent,lbearing,rbearing): ditto
292 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
294 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
295 (getFeedback): new static method.
297 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
298 Now use combox rather than choice to display languages.
299 Feedback is now output using a new timer callback mechanism, identical
300 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
302 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
304 * src/minibuffer.C: fix for older compilers
306 2000-10-30 Juergen Vigna <jug@sad.it>
308 * src/insets/insettext.C (InsertInset): fixed this as the cursor
309 has to be Left of the inset otherwise LyXText won't find it!
311 * src/BufferView2.C (open_new_inset): delete the inset if it can
314 2000-10-30 Rob Lahaye <lahaye@postech.edu>
318 2000-10-29 Marko Vendelin <markov@ioc.ee>
319 * src/frontends/gnome/FormCitation.C
320 * src/frontends/gnome/FormCitation.h
321 * src/frontends/gnome/FormCopyright.C
322 * src/frontends/gnome/FormCopyright.h
323 * src/frontends/gnome/FormError.C
324 * src/frontends/gnome/FormError.h
325 * src/frontends/gnome/FormIndex.C
326 * src/frontends/gnome/FormIndex.h
327 * src/frontends/gnome/FormPrint.C
328 * src/frontends/gnome/FormPrint.h
329 * src/frontends/gnome/FormRef.C
330 * src/frontends/gnome/FormRef.h
331 * src/frontends/gnome/FormToc.C
332 * src/frontends/gnome/FormToc.h
333 * src/frontends/gnome/FormUrl.C
334 * src/frontends/gnome/FormUrl.h
335 * src/frontends/gnome/Menubar_pimpl.C
336 * src/frontends/gnome/mainapp.C
337 * src/frontends/gnome/mainapp.h
338 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
339 changing update() to updateSlot() where appropriate
341 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
343 * src/frontends/xforms/FormPreferences.[Ch]:
344 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
347 2000-10-28 Juergen Vigna <jug@sad.it>
349 * src/insets/insettabular.C (draw): fixed drawing bug.
351 * src/insets/insettext.C (clear):
353 (SetParagraphData): clearing the TEXT buffers when deleting the
354 paragraphs used by it.
356 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
358 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
360 2000-10-27 Juergen Vigna <jug@sad.it>
362 * src/tabular.C (~LyXTabular): removed not needed anymore.
364 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
367 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
369 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
372 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
375 * src/frontends/xforms/FormPreferences.[Ch]:
376 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
377 Reorganised as modules based on tabs. Much easier to follow the
378 flow and to add new tabs. Added warning and feedback messages.
381 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
383 * src/tabular.h (DocBook): add std:: qualifier.
385 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
387 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
388 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
391 * insettabular.C (DocBook): uses the tabular methods to export
394 * src/insets/insettext.h
395 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
397 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
399 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
402 * src/lyxfunc.C (MenuNew): lessen the scope of fname
403 moved misplaced AllowInput two lines up.
405 * src/buffer.C (readFile): compare float with float, not with int
407 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
409 * src/minibuffer.C: add "using SigC::slot" statement.
411 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
413 * src/frontends/xforms/forms/README: updated section about make.
415 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
416 Tidied some forms up, made two of form_tabular's tabs more
417 self-consistent, fixed Jean-Marc's size problem in form_preferences,
418 fixed translation problem with "Column".
420 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
422 * src/minibuffer.h: use Timeout instead of the xforms timer
424 (setTimer) rewrite for the Timeout, change to unsigned arg
425 (set): change to unsigned timer arg
428 * src/minibuffer.C (TimerCB): removed func
429 (C_MiniBuffer_TimerCB): removed func
430 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
431 (peek_event): use a switch statement
432 (add): don't use fl_add_timer.
433 (Set): rewrite to use the Timeout
436 * src/Timeout.[Ch] (setType): return a Timeout &
437 (setTimeout): ditto, change to unsigned arg for timeout
439 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
441 * src/mathed/formula.C (mathed_string_width): Use string instead
442 of a constant size char array.
444 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
446 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
447 the two recently added operator<< for SMInput and State.
449 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
451 (OkCancelPolicy): ditto
452 (OkCancelReadOnlyPolicy): ditto
453 (NoRepeatedApplyReadOnlyPolicy): ditto
454 (OkApplyCancelReadOnlyPolicy): ditto
455 (OkApplyCancelPolicy): ditto
456 (NoRepeatedApplyPolicy): ditto
458 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
460 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
461 add the usual std:: qualifiers.
463 2000-10-25 Juergen Vigna <jug@sad.it>
465 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
467 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
469 * src/support/filetools.C (MakeRelPath): change some types to
472 * src/frontends/ButtonPolicies.h (operator<<): new operator for
473 ButtonPolicy::SMInput and ButtonPolicy::State.
475 * src/FontLoader.C (reset): small cleanup
476 (unload): small cleanup
478 * src/FontInfo.C (getFontname): initialize error to 10000.0
480 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
482 * src/frontends/xforms/FormPreferences.[Ch]:
483 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
484 TeX encoding and default paper size sections.
486 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
488 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
491 * src/frontends/xforms/FormError.C (disconnect): use erase() to
492 make the message_ empty.
493 (FormError): don't initialize message_ in initializer list.
495 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
497 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
499 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
501 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
503 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
505 * src/frontends/kde/*data.[Ch]: _("") is not
508 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
510 * src/buffer.C: removed redundant using directive.
512 * src/frontends/DialogBase.h: revert to original definition of
515 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
516 stuff into two classes, one for each dialog, requires a new
517 element in the dialogs vector, FormTabularCreate.
519 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
522 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
523 method. Continues Allan's idea, but means that derived classes
524 don't need to worry about "update or hide?".
526 * src/frontends/xforms/FormError.C (showInset): add connection
529 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
530 one for each dialog. FormTabular now contains main tabular dialog
533 * src/frontends/xforms/FormTabularCreate.[Ch]:
534 * src/frontends/xforms/forms/form_tabular_create.fd: the create
537 * src/frontends/xforms/FormGraphics.[Ch]:
538 * src/frontends/xforms/forms/form_graphics.fd
539 * src/frontends/xforms/FormTabular.[Ch]:
540 * src/frontends/xforms/forms/form_tabular.fd: made daughter
541 classes of FormInset.
543 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
544 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
546 * src/frontends/xforms/Makefile.am:
547 * src/frontends/xforms/forms/makefile: added new files.
549 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
550 variable. added Signal0 hide signal, in keeping with other GUI-I
553 * src/support/lstrings.h: removed redundant std:: qualifier as
554 it's already declared in Lsstream.h.
556 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
558 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
562 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
564 * src/tabular.C (Ascii): minimize scope of cell.
566 * src/BufferView2.C (nextWord): return string() instead of 0;
568 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
570 * src/converter.h: add a std:: qualifier
572 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
574 * src/importer.[Ch]: New files. Used for importing files into LyX.
576 * src/lyxfunc.C (doImport): Use the new Importer class.
578 * src/converter.h: Add shortcut member to the Format class.
579 Used for holding the menu shortcut.
581 * src/converter.C and other files: Made a distinction between
582 format name and format extension. New formats can be defined using
583 the \format lyxrc tag.
584 Added two new converter flags: latex and disable.
586 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
588 * src/support/lyxlib.h: unify namespace/struct implementation.
589 Remove extra declarations.
591 * src/support/chdir.C (chdir): remove version taking char const *
593 * src/support/rename.C: ditto.
594 * src/support/lyxsum.C: ditto.
596 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
598 * src/frontends/xforms/FormBase.[Ch]:
599 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
600 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
601 work only for the next call to fl_show_form(). The correct place to set
602 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
603 done. FormBase also stores minw_, minh_ itself. All dialogs derived
604 from FormBase have the minimum size set; no more stupid crashes with
607 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
609 * lib/ui/default.ui: fix shortcut for Insert->Include File.
611 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
613 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
615 * src/support/lyxlib.h: changed second argument of mkdir to
616 unsigned long int (unsigned int would probably have been enough,
617 but...). Removed <sys/types.h> header.
618 * src/support/mkdir.C (mkdir): ditto.
622 2000-10-19 Juergen Vigna <jug@sad.it>
624 * src/lyxfunc.C (MenuNew): small fix (form John)
626 * src/screen.C (Update): removed unneeded code.
628 * src/tabular.C (Ascii): refixed int != uint bug!
630 * src/support/lyxlib.h: added sys/types.h include for now permits
631 compiling, but I don't like this!
633 2000-10-18 Juergen Vigna <jug@sad.it>
635 * src/text2.C (ClearSelection): if we clear the selection we need
636 more refresh so set the status apropriately
638 * src/insets/insettext.C (draw): hopefully finally fixed draw
641 2000-10-12 Juergen Vigna <jug@sad.it>
643 * src/insets/insettext.C (draw): another small fix and make a block
644 so that variables are localized.
646 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
648 * src/support/lstrings.C (lowercase, uppercase):
649 use explicit casts to remove compiler warnings.
651 * src/support/LRegex.C (Impl):
652 * src/support/StrPool.C (add):
653 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
654 (AddPath, MakeDisplayPath):
655 * src/support/lstrings.C (prefixIs, subst):
656 use correct type to remove compiler warnings.
658 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
660 * src/support/lyxlib.h:
661 * src/support/mkdir.C (mkdir): change parameter to mode_t for
662 portability and to remove compiler warning with DEC cxx.
664 * src/support/FileInfo.[Ch] (flagRWX): ditto.
666 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
668 * src/minibuffer.C (peek_event): retun 1 when there has been a
669 mouseclick in the minibuffer.
673 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
675 * src/frontends/xforms/FormParagraph.C: more space above/below
678 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
680 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
681 a char only if real_current_font was changed.
683 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
685 * NEWS: update somewhat for 1.1.6
687 * lib/ui/default.ui: clean up.
689 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
691 * lib/CREDITS: clean up
693 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
695 * src/combox.[Ch] (select): changed argument back to int
696 * src/combox.C (peek_event): removed num_bytes as it is declared but
699 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
700 modified calls to Combox::select() to remove warnings about type
703 * src/insets/insetbutton.C (width): explicit cast to remove warning
704 about type conversion.
706 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
709 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
710 sel_pos_end, refering to cursor position are changed to
711 LyXParagraph::size_type.
713 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
714 consistent with LyXCursor::pos().
715 (inset_pos): changed to LyXParagraph::size_type for same reason.
717 * src/insets/insettext.C (resizeLyXText): changed some temporary
718 variables refing to cursor position to LyXParagraph::size_type.
720 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
722 * src/frontends/kde/<various>: The Great Renaming,
725 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
727 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
729 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
731 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
732 0 when there are no arguments.
734 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
736 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
737 to segfaults when pressing Ok in InsetBibtex dialog.
739 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
741 * forms/layout_forms.fd:
742 * src/layout_forms.C (create_form_form_character): small change to use
743 labelframe rather than engraved frame + text
745 * src/lyx_gui.C (create_forms): initialise choice_language with some
746 arbitrary value to prevent segfault when dialog is shown.
748 2000-10-16 Baruch Even <baruch.even@writeme.com>
750 * src/converter.C (runLaTeX, scanLog): Added a warning when there
751 is no resulting file. This pertains only to LaTeX output.
753 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
755 * src/text.C (Backspace): Make sure that the row of the cursor is
758 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
761 * src/lyx_gui.C (init): Prevent a crash when only one font from
762 menu/popup fonts is not found.
764 * lib/lyxrc.example: Add an example for binding a key for language
767 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
769 * src/converter.C (GetReachable): Changed the returned type to
771 (IsReachable): New method
773 * src/MenuBackend.C (expand): Handle formats that appear more
776 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
778 * src/frontends/support/Makefile.am
779 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
782 * lib/CREDITS: add Garst Reese.
784 * src/support/snprintf.h: add extern "C" {} around the definitions.
786 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
788 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
791 * src/frontends/xforms/FormDocument.C:
792 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
793 compile without "conversion to integral type of smaller size"
796 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
798 * src/text.C (GetColumnNearX): Fixed disabled code.
800 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
802 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
805 * src/support/snprintf.[ch]: new files
807 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
809 * src/frontends/kde/formprintdialog.C: add
810 file browser for selecting postscript output
812 * src/frontends/kde/formprintdialogdata.C:
813 * src/frontends/kde/formprintdialogdata.h: re-generate
816 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
818 * src/frontends/gnome/Makefile.am:
819 * src/frontends/kde/Makefile.am: FormCommand.C
820 disappeared from xforms
822 * src/frontends/kde/FormCitation.C:
823 * src/frontends/kde/FormIndex.C: read-only
826 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
828 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
831 * src/bufferlist.C: add using directive.
833 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
835 * src/support/lyxfunctional.h: version of class_fun for void
836 returns added, const versions of back_inseter_fun and compare_fun
839 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
841 * src/frontends/xforms/FormInset.C (showInset): fix typo.
843 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
845 * ChangeLog: cleanup.
847 * lib/CREDITS: update to add all the contributors we've forgotten.
848 I have obviously missed some, so tell me whether there were
851 2000-10-13 Marko Vendelin <markov@ioc.ee>
853 * src/frontends/gnome/FormCitation.C
854 * src/frontends/gnome/FormCitation.h
855 * src/frontends/gnome/FormError.C
856 * src/frontends/gnome/FormIndex.C
857 * src/frontends/gnome/FormRef.C
858 * src/frontends/gnome/FormRef.h
859 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
861 * src/frontends/gnome/FormCitation.C
862 * src/frontends/gnome/FormCopyright.C
863 * src/frontends/gnome/FormError.C
864 * src/frontends/gnome/FormIndex.C
865 * src/frontends/gnome/FormRef.C
866 * src/frontends/gnome/FormToc.C
867 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
870 * src/frontends/gnome/Menubar_pimpl.C
871 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
874 2000-10-11 Baruch Even <baruch.even@writeme.com>
877 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
878 to convey its real action.
880 * src/minibuffer.C (peek_event): Added action when mouse clicks to
881 clear the minibuffer and prepare to enter a command.
883 * src/mathed/formula.C (LocalDispatch): Changed to conform with
884 the rename from ExecCommand to PrepareForCommand.
885 * src/lyxfunc.C (Dispatch): ditto.
887 2000-10-11 Baruch Even <baruch.even@writeme.com>
889 * src/buffer.C (writeFile): Added test for errors on writing, this
890 catches all errors and not only file system full errors as intended.
892 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
894 * src/lyx_gui.C (create_forms): better fix for crash with
895 translated interface.
897 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
899 * src/frontends/kde/Makefile.am:
900 * src/frontends/kde/FormCopyright.C:
901 * src/frontends/kde/formcopyrightdialog.C:
902 * src/frontends/kde/formcopyrightdialog.h:
903 * src/frontends/kde/formcopyrightdialogdata.C:
904 * src/frontends/kde/formcopyrightdialogdata.h:
905 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
906 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
907 copyright to use qtarch
909 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
911 * src/encoding.C (read): Fixed bug that caused an error message at
914 * po/Makefile.in.in: Fixed rule for ext_l10n.h
916 * lib/lyxrc.example: Fixed hebrew example.
918 2000-10-13 Allan Rae <rae@lyx.org>
920 * src/frontends/xforms/FormPreferences.C (input): reworking the
922 (build, update, apply): New inputs in various tabfolders
924 * src/frontends/xforms/FormToc.C: use new button policy.
925 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
926 dialogs that either can't use any existing policy or where it just
929 * src/frontends/xforms/FormTabular.h: removed copyright notice that
932 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
933 added a bool parameter which is ignored.
935 * src/buffer.C (setReadonly):
936 * src/BufferView_pimpl.C (buffer):
937 * src/frontends/kde/FormCopyright.h (update):
938 * src/frontends/kde/FormCitation.[Ch] (update):
939 * src/frontends/kde/FormIndex.[Ch] (update):
940 * src/frontends/kde/FormPrint.[Ch] (update):
941 * src/frontends/kde/FormRef.[Ch] (update):
942 * src/frontends/kde/FormToc.[Ch] (update):
943 * src/frontends/kde/FormUrl.[Ch] (update):
944 * src/frontends/gnome/FormCopyright.h (update):
945 * src/frontends/gnome/FormCitation.[Ch] (update):
946 * src/frontends/gnome/FormError.[Ch] (update):
947 * src/frontends/gnome/FormIndex.[Ch] (update):
948 * src/frontends/gnome/FormPrint.[Ch] (update):
949 * src/frontends/gnome/FormRef.h (update):
950 * src/frontends/gnome/FormToc.[Ch] (update):
951 * src/frontends/gnome/FormUrl.[Ch] (update):
952 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
953 to updateBufferDependent and DialogBase
955 * src/frontends/xforms/FormCitation.[hC]:
956 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
957 * src/frontends/xforms/FormError.[Ch]:
958 * src/frontends/xforms/FormGraphics.[Ch]:
959 * src/frontends/xforms/FormIndex.[Ch]:
960 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
961 and fixed readOnly handling.
962 * src/frontends/xforms/FormPrint.[Ch]:
963 * src/frontends/xforms/FormRef.[Ch]:
964 * src/frontends/xforms/FormTabular.[Ch]:
965 * src/frontends/xforms/FormToc.[Ch]:
966 * src/frontends/xforms/FormUrl.[Ch]:
967 * src/frontends/xforms/FormInset.[Ch]:
968 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
969 form of updateBufferDependent.
971 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
972 if form()->visible just in case someone does stuff to the form in a
975 * src/frontends/DialogBase.h (enum): removed enum since we can now use
976 the buttoncontroller for everything the enum used to be used for.
977 (update) It would seem we need to force all dialogs to use a bool
978 parameter or have two update functions. I chose to go with one.
979 I did try removing update() from here and FormBase and defining the
980 appropriate update signatures in FormBaseB[DI] but then ran into the
981 problem of the update() call in FormBase::show(). Whatever I did
982 to get around that would require another function and that just
983 got more confusing. Hence the decision to make everyone have an
984 update(bool). An alternative might have been to override show() in
985 FormBaseB[DI] and that would allow the different and appropriate
988 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
989 true == buffer change occurred. I decided against using a default
990 template parameter since not all compilers support that at present.
992 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
994 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
995 army knife" by removing functionality.
996 (clearStore): removed. All such housekeeping on hide()ing the dialog
997 is to be carried out by overloaded disconnect() methods.
998 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
999 superceded by Baruch's neat test (FormGraphics) to update an existing
1000 dialog if a new signal is recieved rather than block all new signals
1002 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1003 only to Inset dialogs.
1004 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1005 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1007 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1009 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1010 as a base class to all inset dialogs. Used solely to connect/disconnect
1011 the Inset::hide signal and to define what action to take on receipt of
1012 a UpdateBufferDependent signal.
1013 (FormCommand): now derived from FormInset.
1015 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1018 * src/frontends/xforms/FormCopyright.[Ch]:
1019 * src/frontends/xforms/FormPreferences.[Ch]:
1020 now derived from FormBaseBI.
1022 * src/frontends/xforms/FormDocument.[Ch]:
1023 * src/frontends/xforms/FormParagraph.[Ch]:
1024 * src/frontends/xforms/FormPrint.[Ch]:
1025 now derived from FormBaseBD.
1027 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1029 * src/frontends/xforms/FormCitation.[Ch]:
1030 * src/frontends/xforms/FormError.[Ch]:
1031 * src/frontends/xforms/FormRef.[Ch]:
1032 * src/frontends/xforms/FormToc.[Ch]:
1033 (clearStore): reworked as disconnect().
1035 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1038 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1040 * src/converter.C (runLaTeX): constify buffer argument
1043 * src/frontends/support/Makefile.am (INCLUDES): fix.
1045 * src/buffer.h: add std:: qualifier
1046 * src/insets/figinset.C (addpidwait): ditto
1047 * src/MenuBackend.C: ditto
1048 * src/buffer.C: ditto
1049 * src/bufferlist.C: ditto
1050 * src/layout.C: ditto
1051 * src/lyxfunc.C: ditto
1053 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1055 * src/lyxtext.h (bidi_level): change return type to
1056 LyXParagraph::size_type.
1058 * src/lyxparagraph.h: change size_type to
1059 TextContainer::difference_type. This should really be
1060 TextContainer::size_type, but we need currently to support signed
1063 2000-10-11 Marko Vendelin <markov@ioc.ee>
1064 * src/frontends/gnome/FormError.h
1065 * src/frontends/gnome/FormRef.C
1066 * src/frontends/gnome/FormRef.h
1067 * src/frontends/gnome/FormError.C
1068 * src/frontends/gnome/Makefile.am
1069 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1070 to Gnome frontend. Both dialogs use "action" area.
1072 2000-10-12 Baruch Even <baruch.even@writeme.com>
1074 * src/graphics/GraphicsCacheItem_pimpl.C:
1075 * src/graphics/Renderer.C:
1076 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1079 2000-10-12 Juergen Vigna <jug@sad.it>
1081 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1082 visible when selecting).
1084 * development/Code_rules/Rules: fixed some typos.
1086 2000-10-09 Baruch Even <baruch.even@writeme.com>
1088 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1089 compiling on egcs 1.1.2 possible.
1091 * src/filedlg.C (comp_direntry::operator() ): ditto.
1093 2000-08-31 Baruch Even <baruch.even@writeme.com>
1095 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1098 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1099 transient it now only gets freed when the object is destructed.
1101 2000-08-24 Baruch Even <baruch.even@writeme.com>
1103 * src/frontends/FormGraphics.h:
1104 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1107 2000-08-20 Baruch Even <baruch.even@writeme.com>
1109 * src/insets/insetgraphics.C:
1110 (draw): Added messages to the drawn rectangle to report status.
1111 (updateInset): Disabled the use of the inline graphics,
1114 2000-08-17 Baruch Even <baruch.even@writeme.com>
1116 * src/frontends/support: Directory added for the support of GUII LyX.
1118 * src/frontends/support/LyXImage.h:
1119 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1122 * src/frontends/support/LyXImage_X.h:
1123 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1124 version of LyXImage, this uses the Xlib Pixmap.
1126 * src/PainterBase.h:
1127 * src/PainterBase.C:
1129 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1130 replacement to Pixmap.
1132 * src/insets/insetgraphics.h:
1133 * src/insets/insetgraphics.C:
1134 * src/graphics/GraphicsCacheItem.h:
1135 * src/graphics/GraphicsCacheItem.C:
1136 * src/graphics/GraphicsCacheItem_pimpl.h:
1137 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1140 * src/graphics/GraphicsCacheItem.h:
1141 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1142 another copy of the object.
1144 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1145 of cacheHandle, this fixed a bug that sent LyX crashing.
1147 * src/graphics/XPM_Renderer.h:
1148 * src/graphics/XPM_Renderer.C:
1149 * src/graphics/EPS_Renderer.h:
1150 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1152 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1154 * src/lyxfunc.C (processKeySym): only handle the
1155 lockinginset/inset stuff if we have a buffer and text loaded...
1157 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1159 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1161 * src/support/lyxfunctional.h: add operator= that takes a reference
1163 * src/lyxserver.C (mkfifo): make first arg const
1165 * src/layout.h: renamed name(...) to setName(...) to work around
1168 * src/buffer.C (setFileName): had to change name of function to
1169 work around bugs in egcs. (renamed from fileName)
1171 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1173 * src/support/translator.h: move helper template classes to
1174 lyxfunctional.h, include "support/lyxfunctional.h"
1176 * src/support/lyxmanip.h: add delaration of fmt
1178 * src/support/lyxfunctional.h: new file
1179 (class_fun_t): new template class
1180 (class_fun): helper template function
1181 (back_insert_fun_iterator): new template class
1182 (back_inserter_fun): helper template function
1183 (compare_memfun_t): new template class
1184 (compare_memfun): helper template function
1185 (equal_1st_in_pair): moved here from translator
1186 (equal_2nd_in_pair): moved here from translator
1188 * src/support/fmt.C: new file
1189 (fmt): new func, can be used for a printf substitute when still
1190 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1192 * src/support/StrPool.C: add some comments
1194 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1197 * src/insets/figinset.C (addpidwait): use std::copy with
1198 ostream_iterator to fill the pidwaitlist
1200 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1202 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1205 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1208 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1210 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1211 (class_update): ditto
1212 (BulletPanel): ditto
1213 (CheckChoiceClass): move initialization of tc and tct
1215 * src/tabular.C: remove current_view
1216 (OldFormatRead): similar to right below [istream::ignore]
1218 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1219 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1220 unused [istream::ignore]
1222 * src/lyxfunc.C: include "support/lyxfunctional.h"
1223 (getInsetByCode): use std::find_if and compare_memfun
1225 * src/lyxfont.C (stateText): remove c_str()
1227 * src/lyx_main.C (setDebuggingLevel): make static
1228 (commandLineHelp): make static
1230 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1231 Screen* together with fl_get_display() and fl_screen
1233 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1234 togheter with fl_get_display() and fl_screen
1235 (create_forms): remove c_str()
1237 * src/layout.C: include "support/lyxfunctional.h"
1238 (hasLayout): use std::find_if and compare_memfun
1239 (GetLayout): use std::find_if and comapre_memfun
1240 (delete_layout): use std::remove_if and compare_memfun
1241 (NumberOfClass): use std:.find_if and compare_memfun
1243 * src/gettext.h: change for the new functions
1245 * src/gettext.C: new file, make _(char const * str) and _(string
1246 const & str) real functions.
1248 * src/font.C (width): rewrite slightly to avoid one extra variable
1250 * src/debug.C: initialize Debug::ANY here
1252 * src/commandtags.h: update number comments
1254 * src/combox.h (get): make const func
1256 (getline): make const
1258 * src/combox.C (input_cb): handle case where fl_get_input can
1261 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1262 "support/lyxfunctional.h", remove current_view variable.
1263 (resize): use std::for_each with std::mem_fun
1264 (getFileNames): use std::copy with back_inserter_fun
1265 (getBuffer): change arg type to unsigned int
1266 (emergencyWriteAll): call emergencyWrite with std::for_each and
1268 (emergencyWrite): new method, the for loop in emergencyWriteAll
1270 (exists): use std::find_if with compare_memfun
1271 (getBuffer): use std::find_if and compare_memfun
1273 * src/buffer.h: add typedefs for iterator_category, value_type
1274 difference_type, pointer and reference for inset_iterator
1275 add postfix ++ for inset_iterator
1276 make inset_iterator::getPos() const
1278 * src/buffer.C: added support/lyxmanip.h
1279 (readFile): use lyxerr << fmt instead of printf
1280 (makeLaTeXFile): use std::copy to write out encodings
1282 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1284 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1285 free and the char * temp.
1286 (hasMenu): use std::find_if and compare_memfun
1289 * src/Makefile.am (lyx_SOURCES): added gettext.C
1291 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1292 string::insert small change to avoid temporary
1294 * src/LColor.C (getGUIName): remove c_str()
1296 * several files: change all occurrences of fl_display to
1299 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1300 that -pedantic is not used for gcc 2.97 (cvs gcc)
1302 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1304 2000-10-11 Allan Rae <rae@lyx.org>
1306 * src/frontends/xforms/FormPreferences.C (input): template path must be
1307 a readable directory. It doesn't need to be writeable.
1308 (build, delete, update, apply): New inputs in the various tabfolders
1310 * src/frontends/xforms/forms/form_preferences.fd:
1311 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1312 several new entries to existing folders. Shuffled some existing stuff
1315 * src/frontends/xforms/forms/form_print.fd:
1316 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1317 Should probably rework PrinterParams as well. Note that the switch to
1318 collated is effectively the same as !unsorted so changing PrinterParams
1319 will require a lot of fiddly changes to reverse the existing logic.
1321 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1323 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1325 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1327 2000-10-10 Allan Rae <rae@lyx.org>
1330 * src/lyxfunc.C (Dispatch):
1332 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1335 * src/lyxrc.C (output): Only write the differences between system lyxrc
1336 and the users settings.
1339 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1341 I'll rewrite this later, after 1.1.6 probably, to keep a single
1342 LyXRC but two instances of a LyXRCStruct.
1344 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1346 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1348 * src/tabular.h: add a few std:: qualifiers.
1350 * src/encoding.C: add using directive.
1351 * src/language.C: ditto.
1353 * src/insets/insetquotes.C (Validate): use languages->lang()
1354 instead of only language.
1356 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1358 * lib/languages: New file.
1360 * lib/encodings: New file.
1362 * src/language.C (Languages): New class.
1363 (read): New method. Reads the languages from the 'languages' file.
1365 * src/encoding.C (Encodings): New class.
1366 (read): New method. Reads the encodings from the 'encodings' file.
1368 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1371 * src/bufferparams.h and a lot of files: Deleted the member language,
1372 and renamed language_info to language
1374 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1375 * src/lyxfont.C (latexWriteStartChanges): ditto.
1376 * src/paragraph.C (validate,TeXOnePar): ditto.
1378 * src/lyxfont.C (update): Restored deleted code.
1380 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1382 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1384 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1386 * src/insets/figinset.[Ch]:
1387 * src/insets/insetinclude.[Ch]:
1388 * src/insets/insetinclude.[Ch]:
1389 * src/insets/insetparent.[Ch]:
1390 * src/insets/insetref.[Ch]:
1391 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1393 * src/insets/*.[Ch]:
1394 * src/mathed/formula.[Ch]:
1395 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1397 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1398 * src/lyx_cb.C (FigureApplyCB):
1399 * src/lyxfunc.C (getStatus, Dispatch):
1400 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1403 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1405 * src/converter.[Ch] (Formats::View):
1406 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1408 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1409 *current_view->buffer(). This will change later, but this patch is way
1412 2000-10-09 Juergen Vigna <jug@sad.it>
1414 * src/text.C (GetRow): small fix.
1416 * src/BufferView_pimpl.C (cursorPrevious):
1417 (cursorNext): added LyXText parameter to function.
1419 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1420 keypress depending on cursor position.
1422 2000-10-06 Juergen Vigna <jug@sad.it>
1424 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1425 (copySelection): redone this function and also copy ascii representa-
1428 * src/tabular.C (Ascii):
1432 (print_n_chars): new functions to realize the ascii export of tabulars.
1434 2000-10-05 Juergen Vigna <jug@sad.it>
1436 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1437 if we don't have a buffer.
1439 2000-10-10 Allan Rae <rae@lyx.org>
1441 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1442 with closing dialog. It seems that nested tabfolders require hiding
1443 of inner tabfolders before hiding the dialog itself. Actually all I
1444 did was hide the active outer folder.
1446 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1447 unless there really is a buffer. hideBufferDependent is called
1450 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1451 POTFILES.in stays in $(srcdir).
1453 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1455 * lib/lyxrc.example: Few changes.
1457 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1459 * src/BufferView_pimpl.C (buffer): only need one the
1460 updateBufferDependent signal to be emitted once! Moved to the end of
1461 the method to allow bv_->text to be updated first.
1463 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1464 and hSignal_ with Dialogs * and BufferDependency variables.
1465 New Buffer * parent_, initialised when the dialog is launched. Used to
1466 check whether to update() or hide() dialog in the new, private
1467 updateOrHide() method that is connected to the updateBufferDependent
1468 signal. Daughter classes dictate what to do using the
1469 ChangedBufferAction enum, passed to the c-tor.
1471 * src/frontends/xforms/FormCitation.C:
1472 * src/frontends/xforms/FormCommand.C:
1473 * src/frontends/xforms/FormCopyright.C:
1474 * src/frontends/xforms/FormDocument.C:
1475 * src/frontends/xforms/FormError.C:
1476 * src/frontends/xforms/FormIndex.C:
1477 * src/frontends/xforms/FormPreferences.C:
1478 * src/frontends/xforms/FormPrint.C:
1479 * src/frontends/xforms/FormRef.C:
1480 * src/frontends/xforms/FormToc.C:
1481 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1484 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1485 ChangedBufferAction enum.
1487 * src/frontends/xforms/FormParagraph.[Ch]
1488 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1491 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1493 * lib/bind/cua.bind: fix a bit.
1494 * lib/bind/emacs.bind: ditto.
1496 * lib/bind/menus.bind: remove real menu entries from there.
1498 * src/spellchecker.C: make sure we only include strings.h when
1501 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1503 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1504 function. It enlarges the maximum number of pup when needed.
1505 (add_toc2): Open a new menu if maximum number of items per menu has
1508 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1510 * src/frontends/kde/FormPrint.C: fix error reporting
1512 * src/frontends/xforms/FormDocument.C: fix compiler
1515 * lib/.cvsignore: add Literate.nw
1517 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1520 * bufferview_funcs.[Ch]
1523 * text2.C: Add support for numbers in RTL text.
1525 2000-10-06 Allan Rae <rae@lyx.org>
1527 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1528 to be gettext.m4 friendly again. ext_l10n.h is now
1529 generated into $top_srcdir instead of $top_builddir
1530 so that lyx.pot will be built correctly -- without
1531 duplicate parsing of ext_l10n.h.
1533 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1535 * src/frontends/kde/FormCitation.C: make the dialog
1536 behave more sensibly
1538 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1540 * config/kde.m4: fix consecutive ./configure runs,
1541 look for qtarch, fix library order
1543 * src/frontends/kde/Makefile.am: tidy up,
1544 add Print dialog, add .dlg dependencies
1546 * src/frontends/kde/FormPrint.C:
1547 * src/frontends/kde/FormPrint.h:
1548 * src/frontends/kde/formprintdialog.C:
1549 * src/frontends/kde/formprintdialog.h:
1550 * src/frontends/kde/formprintdialogdata.C:
1551 * src/frontends/kde/formprintdialogdata.h:
1552 * src/frontends/kde/dlg/formprintdialog.dlg: add
1555 * src/frontends/kde/dlg/README: Added explanatory readme
1557 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1558 script to double-check qtarch's output
1560 * src/frontends/kde/formindexdialog.C:
1561 * src/frontends/kde/formindexdialogdata.C:
1562 * src/frontends/kde/formindexdialogdata.h:
1563 * src/frontends/kde/dlg/formindexdialog.dlg: update
1564 for qtarch, minor fixes
1566 2000-10-05 Allan Rae <rae@lyx.org>
1568 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1569 dialogs when switching buffers update them instead. It's up to each
1570 dialog to decide if it should still be visible or not.
1571 update() should return a bool to control visiblity within show().
1572 Or perhaps better to set a member variable and use that to control
1575 * lib/build-listerrors: create an empty "listerrors" file just to stop
1576 make trying to regenerate it all the time if you don't have noweb
1579 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1581 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1582 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1583 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1584 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1585 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1587 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1589 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1591 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1592 deleting buffer. Closes all buffer-dependent dialogs.
1594 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1596 * src/frontends/xforms/FormCitation.[Ch]:
1597 * src/frontends/xforms/FormPreferences.[Ch]:
1598 * src/frontends/xforms/FormPrint.[Ch]:
1599 * src/frontends/xforms/FormRef.[Ch]:
1600 * src/frontends/xforms/FormUrl.[Ch]: ditto
1602 * src/frontends/xforms/FormDocument.[Ch]:
1603 * src/frontends/xforms/forms/form_document.C.patch:
1604 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1605 pass through a single input() function.
1607 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1609 * lib/build-listerrors: return status as OK
1611 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1613 * lib/lyxrc.example: Updated to new export code
1615 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1617 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1620 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1623 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1624 LyX-Code is defined.
1625 * lib/layouts/amsbook.layout: ditto.
1627 * boost/Makefile.am: fix typo.
1629 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1631 (add_lastfiles): removed.
1632 (add_documents): removed.
1633 (add_formats): removed.
1635 * src/frontends/Menubar.C: remove useless "using" directive.
1637 * src/MenuBackend.h: add a new MenuItem constructor.
1639 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1642 2000-10-04 Allan Rae <rae@lyx.org>
1644 * lib/Makefile.am (listerrors):
1645 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1646 I haven't got notangle installed so Kayvan please test. The output
1647 should end up in $builddir. This also allows people who don't have
1648 noweb installed to complete the make process without error.
1650 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1651 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1652 by JMarc's picky compiler.
1654 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1657 * src/insets/insettabular.C (setPos): change for loop to not use
1658 sequencing operator. Please check this Jürgen.
1660 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1662 * src/insets/insetcite.C (getScreenLabel): ditto
1663 * src/support/filetools.C (QuoteName): ditto
1664 (ChangeExtension): ditto
1666 * src/BufferView_pimpl.C (scrollCB): make heigt int
1668 * src/BufferView2.C (insertInset): comment out unused arg
1670 * boost/Makefile.am (EXTRADIST): new variable
1672 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1674 * src/exporter.C (IsExportable): Fixed
1676 * lib/configure.m4: Small fix
1678 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1680 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1681 * src/insets/insetbib.C (bibitemWidest): ditto.
1682 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1684 2000-10-03 Juergen Vigna <jug@sad.it>
1686 * src/BufferView2.C (theLockingInset): removed const because of
1687 Agnus's compile problems.
1689 * src/insets/insettext.C (LocalDispatch): set the language of the
1690 surronding paragraph on inserting the first character.
1692 * various files: changed use of BufferView::the_locking_inset.
1694 * src/BufferView2.C (theLockingInset):
1695 (theLockingInset): new functions.
1697 * src/BufferView.h: removed the_locking_inset.
1699 * src/lyxtext.h: added the_locking_inset
1701 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1703 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1705 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1707 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1708 * src/mathed/math_cursor.C (IsAlpha): ditto.
1709 * src/mathed/math_inset.C (strnew): ditto.
1710 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1711 (IMetrics): cxp set but never used; removed.
1712 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1713 that the variable in question has been removed also!
1716 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1717 using the Buffer * passed to Latex(), using the BufferView * passed to
1718 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1720 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1721 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1723 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1724 * src/buffer.C (readInset): used new InsetBibtex c-tor
1725 * (getBibkeyList): used new InsetBibtex::getKeys
1727 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1730 * lib/build-listerrors
1732 * src/exporter.C: Add literate programming support to the export code
1735 * src/lyx_cb.C: Remove old literate code.
1737 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1740 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1741 * src/converter.C (View, Convert): Use QuoteName.
1743 * src/insets/figinset.C (Preview): Use Formats::View.
1745 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1747 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1749 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1750 the top of the function, because compaq cxx complains that the
1751 "goto exit_with_message" when the function is disabled bypasses
1753 (MenuNew): try a better fix for the generation of new file names.
1754 This time, I used AddName() instead of AddPath(), hoping Juergen
1757 2000-10-03 Allan Rae <rae@lyx.org>
1759 * src/frontends/xforms/forms/form_preferences.fd:
1760 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1761 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1762 "Look and Feel"->"General" but will need to be split up further into
1763 general output and general input tabs. Current plan is for four outer
1764 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1765 stuff; "Inputs" for input and import configuration; "Outputs" for
1766 output and export configuration; and one more whatever is left over
1767 called "General". The leftovers at present look like being which
1768 viewers to use, spellchecker, language support and might be better
1769 named "Support". I've put "Paths" in "Inputs" for the moment as this
1770 seems reasonable for now at least.
1771 One problem remains: X error kills LyX when you close Preferences.
1773 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1775 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1776 qualifier from form()
1777 * src/frontends/xforms/FormCitation.[Ch]:
1778 * src/frontends/xforms/FormCopyright.[Ch]:
1779 * src/frontends/xforms/FormDocument.[Ch]:
1780 * src/frontends/xforms/FormError.[Ch]:
1781 * src/frontends/xforms/FormIndex.[Ch]:
1782 * src/frontends/xforms/FormPreferences.[Ch]:
1783 * src/frontends/xforms/FormPrint.[Ch]:
1784 * src/frontends/xforms/FormRef.[Ch]:
1785 * src/frontends/xforms/FormToc.[Ch]:
1786 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1788 * src/frontends/xforms/FormCitation.[Ch]:
1789 * src/frontends/xforms/FormIndex.[Ch]:
1790 * src/frontends/xforms/FormRef.[Ch]:
1791 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1792 with Allan's naming policy
1794 * src/frontends/xforms/FormCitation.C: some static casts to remove
1797 2000-10-02 Juergen Vigna <jug@sad.it>
1799 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1800 now you can type or do stuff inside the table-cell also when in dummy
1801 position, fixed visible cursor.
1803 * src/insets/insettext.C (Edit): fixing cursor-view position.
1805 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1806 be used for equal functions in lyxfunc and insettext.
1808 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1810 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1812 * src/frontends/gnome/FormCitation.h:
1813 * src/frontends/gnome/FormCopyright.h:
1814 * src/frontends/gnome/FormIndex.h:
1815 * src/frontends/gnome/FormPrint.h:
1816 * src/frontends/gnome/FormToc.h:
1817 * src/frontends/gnome/FormUrl.h:
1818 * src/frontends/kde/FormCitation.h:
1819 * src/frontends/kde/FormCopyright.h:
1820 * src/frontends/kde/FormIndex.h:
1821 * src/frontends/kde/FormRef.h:
1822 * src/frontends/kde/FormToc.h:
1823 * src/frontends/kde/FormUrl.h: fix remaining users of
1826 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1828 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1829 from depth argument.
1830 (DocBookHandleCaption): ditto.
1831 (DocBookHandleFootnote): ditto.
1832 (SimpleDocBookOnePar): ditto.
1834 * src/frontends/xforms/FormDocument.h (form): remove extra
1835 FormDocument:: qualifier.
1837 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1839 * sigc++/handle.h: ditto.
1841 * src/lyx_gui_misc.C: add "using" directive.
1843 * src/cheaders/cstddef: new file, needed by the boost library (for
1846 2000-10-02 Juergen Vigna <jug@sad.it>
1848 * src/insets/insettext.C (SetFont): better support.
1850 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1852 * src/screen.C (DrawOneRow): some uint refixes!
1854 2000-10-02 Allan Rae <rae@lyx.org>
1856 * boost/.cvsignore: ignore Makefile as well
1858 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1859 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1861 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1862 Left this one out by accident.
1864 * src/frontends/xforms/FormBase.h (restore): default to calling
1865 update() since that will restore the original/currently-applied values.
1866 Any input() triggered error messages will require the derived classes
1867 to redefine restore().
1869 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1870 avoid a segfault. combo_doc_class is the main concern.
1872 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1874 * Simplify build-listerrors in view of GUI-less export ability!
1876 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1878 * src/lyx_main.C (easyParse): Disable gui when exporting
1880 * src/insets/figinset.C:
1883 * src/lyx_gui_misc.C
1884 * src/tabular.C: Changes to allow no-gui.
1886 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1888 * src/support/utility.hpp: removed file
1889 * src/support/block.h: removed file
1891 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1894 * src/mathed/formula.C: add support/lyxlib.h
1895 * src/mathed/formulamacro.C: ditto
1897 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1898 * src/lyxparagraph.h: ditto
1900 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1901 * src/frontends/Makefile.am (INCLUDES): ditto
1902 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1903 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1904 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1905 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1906 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1907 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1909 * src/BufferView.h: use boost/utility.hpp
1910 * src/LColor.h: ditto
1911 * src/LaTeX.h: ditto
1912 * src/LyXAction.h: ditto
1913 * src/LyXView.h: ditto
1914 * src/bufferlist.h: ditto
1915 * src/lastfiles.h: ditto
1916 * src/layout.h: ditto
1917 * src/lyx_gui.h: ditto
1918 * src/lyx_main.h: ditto
1919 * src/lyxlex.h: ditto
1920 * src/lyxrc.h: ditto
1921 * src/frontends/ButtonPolicies.h: ditto
1922 * src/frontends/Dialogs.h: ditto
1923 * src/frontends/xforms/FormBase.h: ditto
1924 * src/frontends/xforms/FormGraphics.h: ditto
1925 * src/frontends/xforms/FormParagraph.h: ditto
1926 * src/frontends/xforms/FormTabular.h: ditto
1927 * src/graphics/GraphicsCache.h: ditto
1928 * src/graphics/Renderer.h: ditto
1929 * src/insets/ExternalTemplate.h: ditto
1930 * src/insets/insetcommand.h: ditto
1931 * src/support/path.h: ditto
1933 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1934 and introduce clause for 2.97.
1936 * boost/libs/README: new file
1938 * boost/boost/utility.hpp: new file
1940 * boost/boost/config.hpp: new file
1942 * boost/boost/array.hpp: new file
1944 * boost/Makefile.am: new file
1946 * boost/.cvsignore: new file
1948 * configure.in (AC_OUTPUT): add boost/Makefile
1950 * Makefile.am (SUBDIRS): add boost
1952 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1954 * src/support/lstrings.C (suffixIs): Fixed.
1956 2000-10-01 Allan Rae <rae@lyx.org>
1958 * src/PrinterParams.h: moved things around to avoid the "can't
1959 inline call" warning.
1961 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1962 into doc++ documentation.
1964 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1966 * src/frontends/xforms/FormRef.C: make use of button controller
1967 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1968 cleaned up button controller usage.
1969 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1970 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1971 use the button controller
1973 * src/frontends/xforms/forms/*.fd: and associated generated files
1974 updated to reflect changes to FormBase. Some other FormXxxx files
1975 also got minor updates to reflect changes to FormBase.
1977 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1978 (hide): made virtual.
1979 (input): return a bool. true == valid input
1980 (RestoreCB, restore): new
1981 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1982 Changes to allow derived dialogs to use a ButtonController and
1983 make sense when doing so: OK button calls ok() and so on.
1985 * src/frontends/xforms/ButtonController.h (class ButtonController):
1986 Switch from template implementation to taking Policy parameter.
1987 Allows FormBase to provide a ButtonController for any dialog.
1989 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1990 Probably should rename connect and disconnect.
1991 (apply): use the radio button groups
1992 (form): needed by FormBase
1993 (build): setup the radio button groups
1995 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1997 * several files: type changes to reduce the number of warnings and
1998 to unify type hangling a bit. Still much to do.
2000 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2002 * lib/images/*: rename a bunch of icons to match Dekel converter
2005 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2008 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2010 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2012 * sigc++/handle.h: ditto for class Handle.
2014 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2016 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2018 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2020 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2021 removal of the "default" language.
2023 * src/combox.h (getline): Check that sel > 0
2025 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2027 * lib/examples/docbook_example.lyx
2028 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2030 * lib/layouts/docbook-book.layout: new docbook book layout.
2032 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2034 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2036 * src/insets/figinset.C (DocBook):fixed small typo.
2038 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2040 * src/insets/insetinclude.h: string include_label doesn't need to be
2043 2000-09-29 Allan Rae <rae@lyx.org>
2045 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2046 Allow derived type to control connection and disconnection from signals
2047 of its choice if desired.
2049 2000-09-28 Juergen Vigna <jug@sad.it>
2051 * src/insets/insettabular.C (update): fixed cursor setting when
2052 the_locking_inset changed.
2053 (draw): made this a bit cleaner.
2054 (InsetButtonPress): fixed!
2056 * various files: added LyXText Parameter to fitCursor call.
2058 * src/BufferView.C (fitCursor): added LyXText parameter.
2060 * src/insets/insettabular.C (draw): small draw fix.
2062 * src/tabular.C: right setting of left/right celllines.
2064 * src/tabular.[Ch]: fixed various types in funcions and structures.
2065 * src/insets/insettabular.C: ditto
2066 * src/frontends/xforms/FormTabular.C: ditto
2068 2000-09-28 Allan Rae <rae@lyx.org>
2070 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2071 that the #ifdef's had been applied to part of what should have been
2072 a complete condition. It's possible there are other tests that
2073 were specific to tables that are also wrong now that InsetTabular is
2074 being used. Now we need to fix the output of '\n' after a table in a
2075 float for the same reason as the original condition:
2076 "don't insert this if we would be adding it before or after a table
2077 in a float. This little trick is needed in order to allow use of
2078 tables in \subfigures or \subtables."
2079 Juergen can you check this?
2081 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2083 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2084 output to the ostream.
2086 * several files: fixed types based on warnings from cxx
2088 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2090 * src/frontends/kde/Makefile.am: fix rule for
2091 formindexdialogdata_moc.C
2093 * src/.cvsignore: add ext_l10n.h to ignore
2095 * acconfig.h: stop messing with __STRICT_ANSI__
2096 * config/gnome.m4: remove option to set -ansi
2097 * config/kde.m4: remove option to set -ansi
2098 * config/lyxinclude.m4: don't set -ansi
2100 2000-09-27 Juergen Vigna <jug@sad.it>
2102 * various files: remove "default" language check.
2104 * src/insets/insetquotes.C: removed use of current_view.
2106 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2107 the one should have red ears by now!
2109 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2110 in more then one paragraph. Fixed cursor-movement/selection.
2112 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2113 paragraphs inside a text inset.
2115 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2116 text-inset if this owner is an inset.
2118 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2120 * src/Bullet.h: changed type of font, character and size to int
2122 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2124 * src/insets/inseturl.[Ch]:
2125 * src/insets/insetref.[Ch]:
2126 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2128 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2130 * src/buffer.C (readFile): block-if statement rearranged to minimise
2131 bloat. Patch does not reverse Jean-Marc's change ;-)
2133 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2134 Class rewritten to store pointers to hide/update signals directly,
2135 rather than Dialogs *. Also defined an enum to ease use. All xforms
2136 forms can now be derived from this class.
2138 * src/frontends/xforms/FormCommand.[Ch]
2139 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2141 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2144 * src/frontends/xforms/forms/form_citation.fd
2145 * src/frontends/xforms/forms/form_copyright.fd
2146 * src/frontends/xforms/forms/form_error.fd
2147 * src/frontends/xforms/forms/form_index.fd
2148 * src/frontends/xforms/forms/form_ref.fd
2149 * src/frontends/xforms/forms/form_toc.fd
2150 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2152 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2154 * src/insets/insetfoot.C: removed redundent using directive.
2156 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2158 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2159 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2161 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2162 created in the constructors in different groups. Then set() just
2163 have to show the groups as needed. This fixes the redraw problems
2164 (and is how the old menu code worked).
2166 * src/support/lyxlib.h: declare the methods as static when we do
2167 not have namespaces.
2169 2000-09-26 Juergen Vigna <jug@sad.it>
2171 * src/buffer.C (asciiParagraph): new function.
2172 (writeFileAscii): new function with parameter ostream.
2173 (writeFileAscii): use now asciiParagraph.
2175 * various inset files: added the linelen parameter to the Ascii-func.
2177 * src/tabular.C (Write): fixed error in writing file introduced by
2178 the last changes from Lars.
2180 * lib/bind/menus.bind: removed not supported functions.
2182 * src/insets/insettext.C (Ascii): implemented this function.
2184 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2186 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2187 (Write): use of the write_attribute functions.
2189 * src/bufferlist.C (close): fixed reasking question!
2191 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2193 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2194 new files use the everwhere possible.
2197 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2198 src/log_form.C src/lyx.C:
2201 * src/buffer.C (runLaTeX): remove func
2203 * src/PaperLayout.C: removed file
2204 * src/ParagraphExtra.C: likewise
2205 * src/bullet_forms.C: likewise
2206 * src/bullet_forms.h: likewise
2207 * src/bullet_forms_cb.C: likewise
2209 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2210 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2213 * several files: remove all traces of the old fd_form_paragraph,
2214 and functions belonging to that.
2216 * several files: remove all traces of the old fd_form_document,
2217 and functions belonging to that.
2219 * several files: constify local variables were possible.
2221 * several files: remove all code that was dead when NEW_EXPORT was
2224 * several files: removed string::c_str in as many places as
2227 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2228 (e): be a bit more outspoken when patching
2229 (updatesrc): only move files if changed.
2231 * forms/layout_forms.h.patch: regenerated
2233 * forms/layout_forms.fd: remove form_document and form_paragraph
2234 and form_quotes and form_paper and form_table_options and
2235 form_paragraph_extra
2237 * forms/form1.fd: remove form_table
2239 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2240 the fdui->... rewrite. Update some comments to xforms 0.88
2242 * forms/bullet_forms.C.patch: removed file
2243 * forms/bullet_forms.fd: likewise
2244 * forms/bullet_forms.h.patch: likewise
2246 * development/Code_rules/Rules: added a section on switch
2247 statements. Updated some comment to xforms 0.88.
2249 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2251 * src/buffer.C (readFile): make sure that the whole version number
2252 is read after \lyxformat (even when it contains a comma)
2254 * lib/ui/default.ui: change shortcut of math menu to M-a.
2256 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2258 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2261 * src/LyXView.C (updateWindowTitle): show the full files name in
2262 window title, limited to 30 characters.
2264 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2265 When a number of characters has been given, we should not assume
2266 that the string is 0-terminated.
2268 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2269 calls (fixes some memory leaks)
2271 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2272 trans member on exit.
2274 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2276 * src/converter.C (GetReachable): fix typo.
2278 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2279 understand ',' instead of '.'.
2280 (GetInteger): rewrite to use strToInt().
2282 2000-09-26 Juergen Vigna <jug@sad.it>
2284 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2285 better visibility and error-message on wrong VSpace input.
2287 * src/language.C (initL): added english again.
2289 2000-09-25 Juergen Vigna <jug@sad.it>
2291 * src/frontends/kde/Dialogs.C (Dialogs):
2292 * src/frontends/gnome/Dialogs.C (Dialogs):
2293 * src/frontends/kde/Makefile.am:
2294 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2296 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2298 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2300 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2302 * src/frontends/xforms/FormParagraph.C:
2303 * src/frontends/xforms/FormParagraph.h:
2304 * src/frontends/xforms/form_paragraph.C:
2305 * src/frontends/xforms/form_paragraph.h:
2306 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2309 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2311 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2312 Paragraph-Data after use.
2314 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2315 non breakable paragraphs.
2317 2000-09-25 Garst R. Reese <reese@isn.net>
2319 * src/language.C (initL): added missing language_country codes.
2321 2000-09-25 Juergen Vigna <jug@sad.it>
2323 * src/insets/insettext.C (InsetText):
2324 (deleteLyXText): remove the not released LyXText structure!
2326 2000-09-24 Marko Vendelin <markov@ioc.ee>
2328 * src/frontends/gnome/mainapp.C
2329 * src/frontends/gnome/mainapp.h: added support for keyboard
2332 * src/frontends/gnome/FormCitation.C
2333 * src/frontends/gnome/FormCitation.h
2334 * src/frontends/gnome/Makefile.am
2335 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2336 FormCitation to use "action area" in mainapp window
2338 * src/frontends/gnome/Menubar_pimpl.C
2339 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2342 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2344 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2345 width/descent/ascent values if name is empty.
2346 (mathed_string_height): Use std::max.
2348 2000-09-25 Allan Rae <rae@lyx.org>
2350 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2351 segfault. This will be completely redesigned soon.
2353 * sigc++: updated libsigc++. Fixes struct timespec bug.
2355 * development/tools/makeLyXsigc.sh: .cvsignore addition
2357 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2359 * several files: removed almost all traces of the old table
2362 * src/TableLayout.C: removed file
2364 2000-09-22 Juergen Vigna <jug@sad.it>
2366 * src/frontends/kde/Dialogs.C: added credits forms.
2368 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2370 * src/frontends/gnome/Dialogs.C: added some forms.
2372 * src/spellchecker.C (init_spell_checker): set language in pspell code
2373 (RunSpellChecker): some modifications for setting language string.
2375 * src/language.[Ch]: added language_country code.
2377 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2379 * src/frontends/Dialogs.h: added new signal showError.
2380 Rearranged existing signals in some sort of alphabetical order.
2382 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2383 FormError.[Ch], form_error.[Ch]
2384 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2385 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2387 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2388 dialogs. I think that this can be used as the base to all these
2391 * src/frontends/xforms/FormError.[Ch]
2392 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2393 implementation of InsetError dialog.
2395 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2397 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2398 * src/frontends/kde/Makefile.am: ditto
2400 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2402 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2403 macrobf. This fixes a bug of invisible text.
2405 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2407 * lib/doc/LaTeXConfig.lyx.in: updated.
2409 * src/language.C (initL): remove language "francais" and change a
2410 bit the names of the two other french variations.
2412 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2413 string that may not be 0-terminated.
2415 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2417 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2419 2000-09-20 Marko Vendelin <markov@ioc.ee>
2421 * src/frontends/gnome/FormCitation.C
2422 * src/frontends/gnome/FormIndex.C
2423 * src/frontends/gnome/FormToc.C
2424 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2425 the variable initialization to shut up the warnings
2427 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2429 * src/table.[Ch]: deleted files
2431 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2434 2000-09-18 Juergen Vigna <jug@sad.it>
2436 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2437 problems with selection. Inserted new LFUN_PASTESELECTION.
2438 (InsetButtonPress): inserted handling of middle mouse-button paste.
2440 * src/spellchecker.C: changed word to word.c_str().
2442 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2444 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2445 included in the ``make dist'' tarball.
2447 2000-09-15 Juergen Vigna <jug@sad.it>
2449 * src/CutAndPaste.C (cutSelection): small fix return the right
2450 end position after cut inside one paragraph only.
2452 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2453 we are locked as otherwise we don't have a valid cursor position!
2455 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2457 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2459 * src/frontends/kde/FormRef.C: added using directive.
2460 * src/frontends/kde/FormToc.C: ditto
2462 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2464 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2466 2000-09-19 Marko Vendelin <markov@ioc.ee>
2468 * src/frontends/gnome/Menubar_pimpl.C
2469 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2470 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2472 * src/frontends/gnome/mainapp.C
2473 * src/frontends/gnome/mainapp.h: support for menu update used
2476 * src/frontends/gnome/mainapp.C
2477 * src/frontends/gnome/mainapp.h: support for "action" area in the
2478 main window. This area is used by small simple dialogs, such as
2481 * src/frontends/gnome/FormIndex.C
2482 * src/frontends/gnome/FormIndex.h
2483 * src/frontends/gnome/FormUrl.C
2484 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2487 * src/frontends/gnome/FormCitation.C
2488 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2489 action area. Only "Insert new citation" is implemented.
2491 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2493 * src/buffer.C (Dispatch): fix call to Dispatch
2494 * src/insets/insetref.C (Edit): likewise
2495 * src/insets/insetparent.C (Edit): likewise
2496 * src/insets/insetinclude.C (include_cb): likewise
2497 * src/frontends/xforms/FormUrl.C (apply): likewise
2498 * src/frontends/xforms/FormToc.C (apply): likewise
2499 * src/frontends/xforms/FormRef.C (apply): likewise
2500 * src/frontends/xforms/FormIndex.C (apply): likewise
2501 * src/frontends/xforms/FormCitation.C (apply): likewise
2502 * src/lyxserver.C (callback): likewise
2503 * src/lyxfunc.C (processKeySym): likewise
2504 (Dispatch): likewise
2505 (Dispatch): likewise
2506 * src/lyx_cb.C (LayoutsCB): likewise
2508 * Makefile.am (sourcedoc): small change
2510 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2512 * src/main.C (main): Don't make an empty GUIRunTime object. all
2513 methods are static. constify a bit remove unneded using + headers.
2515 * src/tabular.C: some more const to local vars move some loop vars
2517 * src/spellchecker.C: added some c_str after some word for pspell
2519 * src/frontends/GUIRunTime.h: add new static method setDefaults
2520 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2521 * src/frontends/kde/GUIRunTime.C (setDefaults):
2522 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2524 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2525 with strnew in arg, use correct emptystring when calling SetName.
2527 * several files: remove all commented code with relation to
2528 HAVE_SSTREAM beeing false. We now only support stringstream and
2531 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2533 * src/lyxfunc.C: construct correctly the automatic new file
2536 * src/text2.C (IsStringInText): change type of variable i to shut
2539 * src/support/sstream.h: do not use namespaces if the compiler
2540 does not support them.
2542 2000-09-15 Marko Vendelin <markov@ioc.ee>
2543 * src/frontends/gnome/FormCitation.C
2544 * src/frontends/gnome/FormCitation.h
2545 * src/frontends/gnome/diainsertcitation_interface.c
2546 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2547 regexp support to FormCitation [Gnome].
2549 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2552 * configure.in: remove unused KDE/GTKGUI define
2554 * src/frontends/kde/FormRef.C
2555 * src/frontends/kde/FormRef.h
2556 * src/frontends/kde/formrefdialog.C
2557 * src/frontends/kde/formrefdialog.h: double click will
2558 go to reference, now it is possible to change a cross-ref
2561 * src/frontends/kde/FormToc.C
2562 * src/frontends/kde/FormToc.h
2563 * src/frontends/kde/formtocdialog.C
2564 * src/frontends/kde/formtocdialog.h: add a depth
2567 * src/frontends/kde/Makefile.am: add QtLyXView.h
2570 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2572 * src/frontends/kde/FormCitation.h: added some using directives.
2574 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2576 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2579 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2582 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2584 * src/buffer.C (pop_tag): revert for the second time a change by
2585 Lars, who seems to really hate having non-local loop variables :)
2587 * src/Lsstream.h: add "using" statements.
2589 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2590 * src/buffer.C (writeFile): ditto
2592 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2594 * src/buffer.C (writeFile): try to fix the locale modified format
2595 number to always be as we want it.
2597 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2598 in XForms 0.89. C-space is now working again.
2600 * src/Lsstream.h src/support/sstream.h: new files.
2602 * also commented out all cases where strstream were used.
2604 * src/Bullet.h (c_str): remove method.
2606 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2608 * a lot of files: get rid of "char const *" and "char *" is as
2609 many places as possible. We only want to use them in interaction
2610 with system of other libraries, not inside lyx.
2612 * a lot of files: return const object is not of pod type. This
2613 helps ensure that temporary objects is not modified. And fits well
2614 with "programming by contract".
2616 * configure.in: check for the locale header too
2618 * Makefile.am (sourcedoc): new tag for generation of doc++
2621 2000-09-14 Juergen Vigna <jug@sad.it>
2623 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2624 callback to check which combo called it and do the right action.
2626 * src/combox.C (combo_cb): added combo * to the callbacks.
2627 (Hide): moved call of callback after Ungrab of the pointer.
2629 * src/intl.h: removed LCombo2 function.
2631 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2632 function as this can now be handled in one function.
2634 * src/combox.h: added Combox * to callback prototype.
2636 * src/frontends/xforms/Toolbar_pimpl.C:
2637 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2639 2000-09-14 Garst Reese <reese@isn.net>
2641 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2642 moved usepackage{xxx}'s to beginning of file. Changed left margin
2643 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2644 underlining from title. Thanks to John Culleton for useful suggestions.
2646 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2648 * src/lyxlex_pimpl.C (setFile): change error message to debug
2651 2000-09-13 Juergen Vigna <jug@sad.it>
2653 * src/frontends/xforms/FormDocument.C: implemented choice_class
2654 as combox and give callback to combo_language so OK/Apply is activated
2657 * src/bufferlist.C (newFile): small fix so already named files
2658 (via an open call) are not requested to be named again on the
2661 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2663 * src/frontends/kde/Makefile.am
2664 * src/frontends/kde/FormRef.C
2665 * src/frontends/kde/FormRef.h
2666 * src/frontends/kde/formrefdialog.C
2667 * src/frontends/kde/formrefdialog.h: implement
2670 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2672 * src/frontends/kde/formtocdialog.C
2673 * src/frontends/kde/formtocdialog.h
2674 * src/frontends/kde/FormToc.C
2675 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2677 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2679 * src/frontends/kde/FormCitation.C: fix thinko
2680 where we didn't always display the reference text
2683 * src/frontends/kde/formurldialog.C
2684 * src/frontends/kde/formurldialog.h
2685 * src/frontends/kde/FormUrl.C
2686 * src/frontends/kde/FormUrl.h: minor cleanups
2688 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2690 * src/frontends/kde/Makefile.am
2691 * src/frontends/kde/FormToc.C
2692 * src/frontends/kde/FormToc.h
2693 * src/frontends/kde/FormCitation.C
2694 * src/frontends/kde/FormCitation.h
2695 * src/frontends/kde/FormIndex.C
2696 * src/frontends/kde/FormIndex.h
2697 * src/frontends/kde/formtocdialog.C
2698 * src/frontends/kde/formtocdialog.h
2699 * src/frontends/kde/formcitationdialog.C
2700 * src/frontends/kde/formcitationdialog.h
2701 * src/frontends/kde/formindexdialog.C
2702 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2704 2000-09-12 Juergen Vigna <jug@sad.it>
2706 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2709 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2711 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2714 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2716 * src/converter.C (Add, Convert): Added support for converter flags:
2717 needaux, resultdir, resultfile.
2718 (Convert): Added new parameter view_file.
2719 (dvips_options): Fixed letter paper option.
2721 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2722 (Export, GetExportableFormats, GetViewableFormats): Added support
2725 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2727 (easyParse): Fixed to work with new export code.
2729 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2732 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2734 * lib/bind/*.bind: Replaced
2735 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2736 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2738 2000-09-11 Juergen Vigna <jug@sad.it>
2740 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2742 * src/main.C (main): now GUII defines global guiruntime!
2744 * src/frontends/gnome/GUIRunTime.C (initApplication):
2745 * src/frontends/kde/GUIRunTime.C (initApplication):
2746 * src/frontends/xforms/GUIRunTime.C (initApplication):
2747 * src/frontends/GUIRunTime.h: added new function initApplication.
2749 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2751 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2753 2000-09-08 Juergen Vigna <jug@sad.it>
2755 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2756 we have already "Reset".
2758 * src/language.C (initL): inserted "default" language and made this
2759 THE default language (and not american!)
2761 * src/paragraph.C: inserted handling of "default" language!
2763 * src/lyxfont.C: ditto
2767 * src/paragraph.C: output the \\par only if we have a following
2768 paragraph otherwise it's not needed.
2770 2000-09-05 Juergen Vigna <jug@sad.it>
2772 * config/pspell.m4: added entry to lyx-flags
2774 * src/spellchecker.C: modified version from Kevin for using pspell
2776 2000-09-01 Marko Vendelin <markov@ioc.ee>
2777 * src/frontends/gnome/Makefile.am
2778 * src/frontends/gnome/FormCitation.C
2779 * src/frontends/gnome/FormCitation.h
2780 * src/frontends/gnome/diainsertcitation_callbacks.c
2781 * src/frontends/gnome/diainsertcitation_callbacks.h
2782 * src/frontends/gnome/diainsertcitation_interface.c
2783 * src/frontends/gnome/diainsertcitation_interface.h
2784 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2785 dialog for Gnome frontend
2787 * src/main.C: Gnome libraries require keeping application name
2788 and its version as strings
2790 * src/frontends/gnome/mainapp.C: Change the name of the main window
2791 from GnomeLyX to PACKAGE
2793 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2795 * src/frontends/Liason.C: add "using: declaration.
2797 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2799 * src/mathed/math_macro.C (Metrics): Set the size of the template
2801 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2803 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2805 * src/converter.C (add_options): New function.
2806 (SetViewer): Change $$FName into '$$FName'.
2807 (View): Add options when running xdvi
2808 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2809 (Convert): The 3rd parameter is now the desired filename. Converts
2810 calls to lyx::rename if necessary.
2811 Add options when running dvips.
2812 (dvi_papersize,dvips_options): New methods.
2814 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2816 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2817 using a call to Converter::dvips_options.
2818 Fixed to work with nex export code.
2820 * src/support/copy.C
2821 * src/support/rename.C: New files
2823 * src/support/syscall.h
2824 * src/support/syscall.C: Added Starttype SystemDontWait.
2826 * lib/ui/default.ui: Changed to work with new export code
2828 * lib/configure.m4: Changed to work with new export code
2830 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2832 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2834 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2835 so that code compiles with DEC cxx.
2837 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2838 to work correctly! Also now supports the additional elements
2841 2000-09-01 Allan Rae <rae@lyx.org>
2843 * src/frontends/ButtonPolicies.C: renamed all the references to
2844 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2846 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2847 since it's a const not a type.
2849 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2851 2000-08-31 Juergen Vigna <jug@sad.it>
2853 * src/insets/figinset.C: Various changes to look if the filename has
2854 an extension and if not add it for inline previewing.
2856 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2858 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2859 make buttonStatus and isReadOnly be const methods. (also reflect
2860 this in derived classes.)
2862 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2863 (nextState): change to be static inline, pass the StateMachine as
2865 (PreferencesPolicy): remove casts
2866 (OkCancelPolicy): remvoe casts
2867 (OkCancelReadOnlyPolicy): remove casts
2868 (NoRepeatedApplyReadOnlyPolicy): remove casts
2869 (OkApplyCancelReadOnlyPolicy): remove casts
2870 (OkApplyCancelPolicy): remove casts
2871 (NoRepeatedApplyPolicy): remove casts
2873 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2875 * src/converter.C: added some using directives
2877 * src/frontends/ButtonPolicies.C: changes to overcome
2878 "need lvalue" error with DEC c++
2880 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2881 to WMHideCB for DEC c++
2883 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2885 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2886 to BulletBMTableCB for DEC c++
2888 2000-08-31 Allan Rae <rae@lyx.org>
2890 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2891 character dialog separately from old document dialogs combo_language.
2894 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2896 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2897 Removed LFUN_REF_CREATE.
2899 * src/MenuBackend.C: Added new tags: toc and references
2901 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2902 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2904 (add_toc, add_references): New methods.
2905 (create_submenu): Handle correctly the case when there is a
2906 seperator after optional menu items.
2908 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2909 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2910 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2912 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2914 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2916 * src/converter.[Ch]: New file for converting between different
2919 * src/export.[Ch]: New file for exporting a LyX file to different
2922 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2923 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2924 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2925 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2926 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2927 RunDocBook, MenuExport.
2929 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2930 Exporter::Preview methods if NEW_EXPORT is defined.
2932 * src/buffer.C (Dispatch): Use Exporter::Export.
2934 * src/lyxrc.C: Added new tags: \converter and \viewer.
2937 * src/LyXAction.C: Define new lyx-function: buffer-update.
2938 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2939 when NEW_EXPORT is defined.
2941 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2943 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2945 * lib/ui/default.ui: Added submenus "view" and "update" to the
2948 * src/filetools.C (GetExtension): New function.
2950 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2952 2000-08-29 Allan Rae <rae@lyx.org>
2954 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2956 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2957 (EnableDocumentLayout): removed
2958 (DisableDocumentLayout): removed
2959 (build): make use of ButtonController's read-only handling to
2960 de/activate various objects. Replaces both of the above functions.
2962 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2963 (readOnly): was read_only
2964 (refresh): fixed dumb mistakes with read_only_ handling
2966 * src/frontends/xforms/forms/form_document.fd:
2967 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2968 tabbed dialogs so the tabs look more like tabs and so its easier to
2969 work out which is the current tab.
2971 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2972 segfault with form_table
2974 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2976 2000-08-28 Juergen Vigna <jug@sad.it>
2978 * acconfig.h: added USE_PSPELL.
2980 * src/config.h.in: added USE_PSPELL.
2982 * autogen.sh: added pspell.m4
2984 * config/pspell.m4: new file.
2986 * src/spellchecker.C: implemented support for pspell libary.
2988 2000-08-25 Juergen Vigna <jug@sad.it>
2990 * src/LyXAction.C (init): renamed LFUN_TABLE to
2991 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2993 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2995 * src/lyxscreen.h: add force_clear variable and fuction to force
2996 a clear area when redrawing in LyXText.
2998 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3000 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3002 * some whitespace and comment changes.
3004 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3006 * src/buffer.C: up te LYX_FORMAT to 2.17
3008 2000-08-23 Juergen Vigna <jug@sad.it>
3010 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3013 * src/insets/insettabular.C (pasteSelection): delete the insets
3014 LyXText as it is not valid anymore.
3015 (copySelection): new function.
3016 (pasteSelection): new function.
3017 (cutSelection): new function.
3018 (LocalDispatch): implemented cut/copy/paste of cell selections.
3020 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3021 don't have a LyXText.
3023 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3025 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3028 2000-08-22 Juergen Vigna <jug@sad.it>
3030 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3031 ifdef form_table out if NEW_TABULAR.
3033 2000-08-21 Juergen Vigna <jug@sad.it>
3035 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3036 (draw): fixed draw position so that the cursor is positioned in the
3038 (InsetMotionNotify): hide/show cursor so the position is updated.
3039 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3040 using cellstart() function where it should be used.
3042 * src/insets/insettext.C (draw): ditto.
3044 * src/tabular.C: fixed initialization of some missing variables and
3045 made BoxType into an enum.
3047 2000-08-22 Marko Vendelin <markov@ioc.ee>
3048 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3049 stock menu item using action numerical value, not its string
3053 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3055 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3056 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3058 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3060 * src/frontends/xforms/GUIRunTime.C: new file
3062 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3063 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3065 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3067 * src/frontends/kde/GUIRunTime.C: new file
3069 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3070 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3072 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3074 * src/frontends/gnome/GUIRunTime.C: new file
3076 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3079 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3080 small change to documetentation.
3082 * src/frontends/GUIRunTime.C: removed file
3084 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3086 * src/lyxparagraph.h: enable NEW_TABULAR as default
3088 * src/lyxfunc.C (processKeySym): remove some commented code
3090 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3091 NEW_TABULAR around the fd_form_table_options.
3093 * src/lyx_gui.C (runTime): call the static member function as
3094 GUIRunTime::runTime().
3096 2000-08-21 Allan Rae <rae@lyx.org>
3098 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3101 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3103 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3105 2000-08-21 Allan Rae <rae@lyx.org>
3107 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3108 keep Garst happy ;-)
3109 * src/frontends/xforms/FormPreferences.C (build): use setOK
3110 * src/frontends/xforms/FormDocument.C (build): use setOK
3111 (FormDocument): use the appropriate policy.
3113 2000-08-21 Allan Rae <rae@lyx.org>
3115 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3116 automatic [de]activation of arbitrary objects when in a read-only state.
3118 * src/frontends/ButtonPolicies.h: More documentation
3119 (isReadOnly): added to support the above.
3121 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3123 2000-08-18 Juergen Vigna <jug@sad.it>
3125 * src/insets/insettabular.C (getStatus): changed to return func_status.
3127 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3128 display toggle menu entries if they are.
3130 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3131 new document layout now.
3133 * src/lyxfunc.C: ditto
3135 * src/lyx_gui_misc.C: ditto
3137 * src/lyx_gui.C: ditto
3139 * lib/ui/default.ui: removed paper and quotes layout as they are now
3140 all in the document layout tabbed folder.
3142 * src/frontends/xforms/forms/form_document.fd: added Restore
3143 button and callbacks for all inputs for Allan's ButtonPolicy.
3145 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3146 (CheckChoiceClass): added missing params setting on class change.
3147 (UpdateLayoutDocument): added for updating the layout on params.
3148 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3149 (FormDocument): Implemented Allan's ButtonPolicy with the
3152 2000-08-17 Allan Rae <rae@lyx.org>
3154 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3155 so we can at least see the credits again.
3157 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3158 controller calls for the appropriate callbacks. Note that since Ok
3159 calls apply followed by cancel, and apply isn't a valid input for the
3160 APPLIED state, the bc_ calls have to be made in the static callback not
3161 within each of the real callbacks.
3163 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3164 (setOk): renamed from setOkay()
3166 2000-08-17 Juergen Vigna <jug@sad.it>
3168 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3169 in the implementation part.
3170 (composeUIInfo): don't show optional menu-items.
3172 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3174 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3176 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3177 text-state when in a text-inset.
3179 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3181 2000-08-17 Marko Vendelin <markov@ioc.ee>
3182 * src/frontends/gnome/FormIndex.C
3183 * src/frontends/gnome/FormIndex.h
3184 * src/frontends/gnome/FormToc.C
3185 * src/frontends/gnome/FormToc.h
3186 * src/frontends/gnome/dialogs
3187 * src/frontends/gnome/diatoc_callbacks.c
3188 * src/frontends/gnome/diatoc_callbacks.h
3189 * src/frontends/gnome/diainsertindex_callbacks.h
3190 * src/frontends/gnome/diainsertindex_callbacks.c
3191 * src/frontends/gnome/diainsertindex_interface.c
3192 * src/frontends/gnome/diainsertindex_interface.h
3193 * src/frontends/gnome/diatoc_interface.h
3194 * src/frontends/gnome/diatoc_interface.c
3195 * src/frontends/gnome/Makefile.am: Table of Contents and
3196 Insert Index dialogs implementation for Gnome frontend
3198 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3200 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3202 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3205 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3207 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3208 destructor. Don't definde if you don't need it
3209 (processEvents): made static, non-blocking events processing for
3211 (runTime): static method. event loop for xforms
3212 * similar as above for kde and gnome.
3214 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3215 new Pimpl is correct
3216 (runTime): new method calss the real frontends runtime func.
3218 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3220 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3222 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3224 2000-08-16 Juergen Vigna <jug@sad.it>
3226 * src/lyx_gui.C (runTime): added GUII RunTime support.
3228 * src/frontends/Makefile.am:
3229 * src/frontends/GUIRunTime.[Ch]:
3230 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3231 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3232 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3234 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3236 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3237 as this is already set in ${FRONTEND_INCLUDE} if needed.
3239 * configure.in (CPPFLAGS): setting the include dir for the frontend
3240 directory and don't set FRONTEND=xforms for now as this is executed
3243 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3245 * src/frontends/kde/Makefile.am:
3246 * src/frontends/kde/FormUrl.C:
3247 * src/frontends/kde/FormUrl.h:
3248 * src/frontends/kde/formurldialog.h:
3249 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3251 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3253 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3255 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3257 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3260 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3262 * src/WorkArea.C (work_area_handler): more work to get te
3263 FL_KEYBOARD to work with xforms 0.88 too, please test.
3265 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3267 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3269 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3272 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3274 * src/Timeout.h: remove Qt::emit hack.
3276 * several files: changes to allo doc++ compilation
3278 * src/lyxfunc.C (processKeySym): new method
3279 (processKeyEvent): comment out if FL_REVISION < 89
3281 * src/WorkArea.C: change some debugging levels.
3282 (WorkArea): set wantkey to FL_KEY_ALL
3283 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3284 clearer code and the use of compose with XForms 0.89. Change to
3285 use signals instead of calling methods in bufferview directly.
3287 * src/Painter.C: change some debugging levels.
3289 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3292 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3293 (workAreaKeyPress): new method
3295 2000-08-14 Juergen Vigna <jug@sad.it>
3297 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3299 * config/kde.m4: addes some features
3301 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3302 include missing xforms dialogs.
3304 * src/Timeout.h: a hack to be able to compile with qt/kde.
3306 * sigc++/.cvsignore: added acinclude.m4
3308 * lib/.cvsignore: added listerros
3310 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3311 xforms tree as objects are needed for other frontends.
3313 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3314 linking with not yet implemented xforms objects.
3316 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3318 2000-08-14 Baruch Even <baruch.even@writeme.com>
3320 * src/frontends/xforms/FormGraphics.h:
3321 * src/frontends/xforms/FormGraphics.C:
3322 * src/frontends/xforms/RadioButtonGroup.h:
3323 * src/frontends/xforms/RadioButtonGroup.C:
3324 * src/insets/insetgraphics.h:
3325 * src/insets/insetgraphics.C:
3326 * src/insets/insetgraphicsParams.h:
3327 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3328 instead of spaces, and various other indentation issues to make the
3329 sources more consistent.
3331 2000-08-14 Marko Vendelin <markov@ioc.ee>
3333 * src/frontends/gnome/dialogs/diaprint.glade
3334 * src/frontends/gnome/FormPrint.C
3335 * src/frontends/gnome/FormPrint.h
3336 * src/frontends/gnome/diaprint_callbacks.c
3337 * src/frontends/gnome/diaprint_callbacks.h
3338 * src/frontends/gnome/diaprint_interface.c
3339 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3342 * src/frontends/gnome/dialogs/diainserturl.glade
3343 * src/frontends/gnome/FormUrl.C
3344 * src/frontends/gnome/FormUrl.h
3345 * src/frontends/gnome/diainserturl_callbacks.c
3346 * src/frontends/gnome/diainserturl_callbacks.h
3347 * src/frontends/gnome/diainserturl_interface.c
3348 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3349 Gnome implementation
3351 * src/frontends/gnome/Dialogs.C
3352 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3353 all other dialogs. Copy all unimplemented dialogs from Xforms
3356 * src/frontends/gnome/support.c
3357 * src/frontends/gnome/support.h: support files generated by Glade
3361 * config/gnome.m4: Gnome configuration scripts
3363 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3364 configure --help message
3366 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3367 only if there are no events pendling in Gnome/Gtk. This enhances
3368 the performance of menus.
3371 2000-08-14 Allan Rae <rae@lyx.org>
3373 * lib/Makefile.am: listerrors cleaning
3375 * lib/listerrors: removed -- generated file
3376 * acinclude.m4: ditto
3377 * sigc++/acinclude.m4: ditto
3379 * src/frontends/xforms/forms/form_citation.fd:
3380 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3383 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3384 `updatesrc` and now we have a `test` target that does what `updatesrc`
3385 used to do. I didn't like having an install target that wasn't related
3388 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3389 on all except FormGraphics. This may yet happen. Followed by a major
3390 cleanup including using FL_TRANSIENT for most of the dialogs. More
3391 changes to come when the ButtonController below is introduced.
3393 * src/frontends/xforms/ButtonController.h: New file for managing up to
3394 four buttons on a dialog according to an externally defined policy.
3395 * src/frontends/xforms/Makefile.am: added above
3397 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3398 Apply and Cancel/Close buttons and everything in between and beyond.
3399 * src/frontends/Makefile.am: added above.
3401 * src/frontends/xforms/forms/form_preferences.fd:
3402 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3403 and removed variable 'status' as a result. Fixed the set_minsize thing.
3404 Use the new screen-font-update after checking screen fonts were changed
3405 Added a "Restore" button to restore the original lyxrc values while
3406 editing. This restores everything not just the last input changed.
3407 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3409 * src/LyXAction.C: screen-font-update added for updating buffers after
3410 screen font settings have been changed.
3411 * src/commandtags.h: ditto
3412 * src/lyxfunc.C: ditto
3414 * forms/lyx.fd: removed screen fonts dialog.
3415 * src/lyx_gui.C: ditto
3416 * src/menus.[Ch]: ditto
3417 * src/lyx.[Ch]: ditto
3418 * src/lyx_cb.C: ditto + code from here moved to make
3419 screen-font-update. And people wonder why progress on GUII is
3420 slow. Look at how scattered this stuff was! It takes forever
3423 * forms/fdfix.sh: Fixup the spacing after commas.
3424 * forms/makefile: Remove date from generated files. Fewer clashes now.
3425 * forms/bullet_forms.C.patch: included someones handwritten changes
3427 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3428 once I've discovered why LyXRC was made noncopyable.
3429 * src/lyx_main.C: ditto
3431 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3433 * src/frontends/xforms/forms/fdfix.sh:
3434 * src/frontends/xforms/forms/fdfixh.sed:
3435 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3436 * src/frontends/xforms/Form*.[hC]:
3437 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3438 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3439 provide a destructor for the struct FD_form_xxxx. Another version of
3440 the set_[max|min]size workaround and a few other cleanups. Actually,
3441 Angus' patch from 20000809.
3443 2000-08-13 Baruch Even <baruch.even@writeme.com>
3445 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3448 2000-08-11 Juergen Vigna <jug@sad.it>
3450 * src/insets/insetgraphics.C (InsetGraphics): changing init
3451 order because of warnings.
3453 * src/frontends/xforms/forms/makefile: adding patching .C with
3456 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3457 from .C.patch to .c.patch
3459 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3460 order because of warning.
3462 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3464 * src/frontends/Liason.C (setMinibuffer): new helper function
3466 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3468 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3470 * lib/ui/default.ui: commented out PaperLayout entry
3472 * src/frontends/xforms/form_document.[Ch]: new added files
3474 * src/frontends/xforms/FormDocument.[Ch]: ditto
3476 * src/frontends/xforms/forms/form_document.fd: ditto
3478 * src/frontends/xforms/forms/form_document.C.patch: ditto
3480 2000-08-10 Juergen Vigna <jug@sad.it>
3482 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3483 (InsetGraphics): initialized cacheHandle to 0.
3484 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3486 2000-08-10 Baruch Even <baruch.even@writeme.com>
3488 * src/graphics/GraphicsCache.h:
3489 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3490 correctly as a cache.
3492 * src/graphics/GraphicsCacheItem.h:
3493 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3496 * src/graphics/GraphicsCacheItem_pimpl.h:
3497 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3500 * src/insets/insetgraphics.h:
3501 * src/insets/insetgraphics.C: Changed from using a signal notification
3502 to polling when image is not loaded.
3504 2000-08-10 Allan Rae <rae@lyx.org>
3506 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3507 that there are two functions that have to been taken out of line by
3508 hand and aren't taken care of in the script. (Just a reminder note)
3510 * sigc++/macros/*.h.m4: Updated as above.
3512 2000-08-09 Juergen Vigna <jug@sad.it>
3514 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3516 * src/insets/insettabular.C: make drawing of single cell smarter.
3518 2000-08-09 Marko Vendelin <markov@ioc.ee>
3519 * src/frontends/gnome/Menubar_pimpl.C
3520 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3521 implementation: new files
3523 * src/frontends/gnome/mainapp.C
3524 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3527 * src/main.C: create Gnome main window
3529 * src/frontends/xforms/Menubar_pimpl.h
3530 * src/frontends/Menubar.C
3531 * src/frontends/Menubar.h: added method Menubar::update that calls
3532 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3534 * src/LyXView.C: calls Menubar::update to update the state
3537 * src/frontends/gnome/Makefile.am: added new files
3539 * src/frontends/Makefile.am: added frontend compiler options
3541 2000-08-08 Juergen Vigna <jug@sad.it>
3543 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3545 * src/bufferlist.C (close):
3546 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3547 documents if exiting without saving.
3549 * src/buffer.C (save): use removeAutosaveFile()
3551 * src/support/filetools.C (removeAutosaveFile): new function.
3553 * src/lyx_cb.C (MenuWrite): returns a bool now.
3554 (MenuWriteAs): check if file could really be saved and revert to the
3556 (MenuWriteAs): removing old autosavefile if existant.
3558 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3559 before Goto toggle declaration, because of compiler warning.
3561 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3563 * src/lyxfunc.C (MenuNew): small fix.
3565 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3567 * src/bufferlist.C (newFile):
3568 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3570 * src/lyxrc.C: added new_ask_filename tag
3572 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3574 * src/lyx.fd: removed code pertaining to form_ref
3575 * src/lyx.[Ch]: ditto
3576 * src/lyx_cb.C: ditto
3577 * src/lyx_gui.C: ditto
3578 * src/lyx_gui_misc.C: ditto
3580 * src/BufferView_pimpl.C (restorePosition): update buffer only
3583 * src/commandtags.h (LFUN_REFTOGGLE): removed
3584 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3585 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3586 (LFUN_REFBACK): renamed LFUN_REF_BACK
3588 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3589 * src/menus.C: ditto
3590 * src/lyxfunc.C (Dispatch): ditto.
3591 InsertRef dialog is now GUI-independent.
3593 * src/texrow.C: added using std::endl;
3595 * src/insets/insetref.[Ch]: strip out large amounts of code.
3596 The inset is now a container and this functionality is now
3597 managed by a new FormRef dialog
3599 * src/frontends/Dialogs.h (showRef, createRef): new signals
3601 * src/frontends/xforms/FormIndex.[Ch],
3602 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3603 when setting dialog's min/max size
3604 * src/frontends/xforms/FormIndex.[Ch]: ditto
3606 * src/frontends/xforms/FormRef.[Ch],
3607 src/frontends/xforms/forms/form_ref.fd: new xforms
3608 implementation of an InsetRef dialog
3610 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3613 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3614 ios::nocreate is not part of the standard. Removed.
3616 2000-08-07 Baruch Even <baruch.even@writeme.com>
3618 * src/graphics/Renderer.h:
3619 * src/graphics/Renderer.C: Added base class for rendering of different
3620 image formats into Pixmaps.
3622 * src/graphics/XPM_Renderer.h:
3623 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3624 in a different class.
3626 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3627 easily add support for other formats.
3629 * src/insets/figinset.C: plugged a leak of an X resource.
3631 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3633 * src/CutAndPaste.[Ch]: make all metods static.
3635 * development/Code_rules/Rules: more work, added section on
3636 Exceptions, and a References section.
3638 * a lot of header files: work to make doc++ able to generate the
3639 source documentation, some workarounds of doc++ problems. Doc++ is
3640 now able to generate the documentation.
3642 2000-08-07 Juergen Vigna <jug@sad.it>
3644 * src/insets/insettabular.C (recomputeTextInsets): removed function
3646 * src/tabular.C (SetWidthOfMulticolCell):
3648 (calculate_width_of_column_NMC): fixed return value so that it really
3649 only returns true if the column-width has changed (there where
3650 problems with muliticolumn-cells in this column).
3652 2000-08-04 Juergen Vigna <jug@sad.it>
3654 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3655 also on the scrollstatus of the inset.
3656 (workAreaMotionNotify): ditto.
3658 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3660 2000-08-01 Juergen Vigna <jug@sad.it>
3662 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3664 * src/commandtags.h:
3665 * src/LyXAction.C (init):
3666 * src/insets/inset.C (LocalDispatch): added support for
3669 * src/insets/inset.C (scroll): new functions.
3671 * src/insets/insettext.C (removeNewlines): new function.
3672 (SetAutoBreakRows): removes forced newlines in the text of the
3673 paragraph if autoBreakRows is set to false.
3675 * src/tabular.C (Latex): generates a parbox around the cell contents
3678 * src/frontends/xforms/FormTabular.C (local_update): removed
3679 the radio_useparbox button.
3681 * src/tabular.C (UseParbox): new function
3683 2000-08-06 Baruch Even <baruch.even@writeme.com>
3685 * src/graphics/GraphicsCache.h:
3686 * src/graphics/GraphicsCache.C:
3687 * src/graphics/GraphicsCacheItem.h:
3688 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3691 * src/insets/insetgraphics.h:
3692 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3693 and the drawing of the inline image.
3695 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3696 loaded into the wrong position.
3698 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3701 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3703 * src/support/translator.h: move all typedefs to public section
3705 * src/support/filetools.C (MakeLatexName): return string const
3707 (TmpFileName): ditto
3708 (FileOpenSearch): ditto
3710 (LibFileSearch): ditto
3711 (i18nLibFileSearch): ditto
3714 (CreateTmpDir): ditto
3715 (CreateBufferTmpDir): ditto
3716 (CreateLyXTmpDir): ditto
3719 (MakeAbsPath): ditto
3721 (OnlyFilename): ditto
3723 (NormalizePath): ditto
3724 (CleanupPath): ditto
3725 (GetFileContents): ditto
3726 (ReplaceEnvironmentPath): ditto
3727 (MakeRelPath): ditto
3729 (ChangeExtension): ditto
3730 (MakeDisplayPath): ditto
3731 (do_popen): return cmdret const
3732 (findtexfile): return string const
3734 * src/support/DebugStream.h: add some /// to please doc++
3736 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3738 * src/texrow.C (same_rownumber): functor to use with find_if
3739 (getIdFromRow): rewritten to use find_if and to not update the
3740 positions. return true if row is found
3741 (increasePos): new method, use to update positions
3743 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3745 * src/lyxlex_pimpl.C (verifyTable): new method
3748 (GetString): return string const
3749 (pushTable): rewrite to use std::stack
3751 (setFile): better check
3754 * src/lyxlex.h: make LyXLex noncopyable
3756 * src/lyxlex.C (text): return char const * const
3757 (GetString): return string const
3758 (getLongString): return string const
3760 * src/lyx_gui_misc.C (askForText): return pair<...> const
3762 * src/lastfiles.[Ch] (operator): return string const
3764 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3765 istringstream not char const *.
3766 move token.end() out of loop.
3767 (readFile): move initializaton of token
3769 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3770 getIdFromRow is successful.
3772 * lib/bind/emacs.bind: don't include menus bind
3774 * development/Code_rules/Rules: the beginnings of making this
3775 better and covering more of the unwritten rules that we have.
3777 * development/Code_rules/Recommendations: a couple of wording
3780 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3782 * src/support/strerror.c: remove C++ comment.
3784 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3786 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3787 LFUN_INDEX_INSERT_LAST
3789 * src/texrow.C (getIdFromRow): changed from const_iterator to
3790 iterator, allowing code to compile with DEC cxx
3792 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3793 stores part of the class, as suggested by Allan. Will allow
3795 (apply): test to apply uses InsetCommandParams operator!=
3797 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3798 (apply): test to apply uses InsetCommandParams operator!=
3800 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3801 stores part of the class.
3802 (update): removed limits on min/max size.
3804 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3805 (apply): test to apply uses InsetCommandParams operator!=
3807 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3808 (Read, Write, scanCommand, getCommand): moved functionality
3809 into InsetCommandParams.
3811 (getScreenLabel): made pure virtual
3812 new InsetCommandParams operators== and !=
3814 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3815 c-tors based on InsetCommandParams. Removed others.
3816 * src/insets/insetinclude.[Ch]: ditto
3817 * src/insets/insetlabel.[Ch]: ditto
3818 * src/insets/insetparent.[Ch]: ditto
3819 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3821 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3822 insets derived from InsetCommand created using similar c-tors
3823 based on InsetCommandParams
3824 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3825 * src/menus.C (ShowRefsMenu): ditto
3826 * src/paragraph.C (Clone): ditto
3827 * src/text2.C (SetCounter): ditto
3828 * src/lyxfunc.C (Dispatch) ditto
3829 Also recreated old InsetIndex behaviour exactly. Can now
3830 index-insert at the start of a paragraph and index-insert-last
3831 without launching the pop-up.
3833 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3835 * lib/lyxrc.example: mark te pdf options as non functional.
3837 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3838 (isStrDbl): move tmpstr.end() out of loop.
3839 (strToDbl): move intialization of tmpstr
3840 (lowercase): return string const and move tmp.end() out of loop.
3841 (uppercase): return string const and move tmp.edn() out of loop.
3842 (prefixIs): add assertion
3847 (containsOnly): ditto
3848 (containsOnly): ditto
3849 (containsOnly): ditto
3850 (countChar): make last arg char not char const
3851 (token): return string const
3852 (subst): return string const, move tmp.end() out of loop.
3853 (subst): return string const, add assertion
3854 (strip): return string const
3855 (frontStrip): return string const, add assertion
3856 (frontStrip): return string const
3861 * src/support/lstrings.C: add inclde "LAssert.h"
3862 (isStrInt): move tmpstr.end() out of loop.
3864 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3865 toollist.end() out of loop.
3866 (deactivate): move toollist.end() out of loop.
3867 (update): move toollist.end() out of loop.
3868 (updateLayoutList): move tc.end() out of loop.
3869 (add): move toollist.end() out of loop.
3871 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3872 md.end() out of loop.
3874 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3876 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3879 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3880 (Erase): move insetlist.end() out of loop.
3882 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3883 ref to const string as first arg. Move initialization of some
3884 variables, whitespace changes.
3886 * src/kbmap.C (defkey): move table.end() out of loop.
3887 (kb_keymap): move table.end() out of loop.
3888 (findbinding): move table.end() out of loop.
3890 * src/MenuBackend.C (hasMenu): move end() out of loop.
3891 (getMenu): move end() out of loop.
3892 (getMenu): move menulist_.end() out of loop.
3894 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3896 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3899 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3900 (getFromLyXName): move infotab.end() out of loop.
3902 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3903 -fvtable-thunks -ffunction-sections -fdata-sections
3905 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3907 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3910 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3912 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3914 * src/frontends/xforms/FormCitation.[Ch],
3915 src/frontends/xforms/FormIndex.[Ch],
3916 src/frontends/xforms/FormToc.[Ch],
3917 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3919 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3921 * src/commandtags.h: renamed, created some flags for citation
3924 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3926 * src/lyxfunc.C (dispatch): use signals to insert index entry
3928 * src/frontends/Dialogs.h: new signal createIndex
3930 * src/frontends/xforms/FormCommand.[Ch],
3931 src/frontends/xforms/FormCitation.[Ch],
3932 src/frontends/xforms/FormToc.[Ch],
3933 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3935 * src/insets/insetindex.[Ch]: GUI-independent
3937 * src/frontends/xforms/FormIndex.[Ch],
3938 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3941 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3943 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3944 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3946 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3948 * src/insets/insetref.C (Latex): rewrite so that there is now
3949 question that a initialization is requested.
3951 * src/insets/insetcommand.h: reenable the hide signal
3953 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3955 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3956 fix handling of shortcuts (many bugs :)
3957 (add_lastfiles): ditto.
3959 * lib/ui/default.ui: fix a few shortcuts.
3961 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3963 * Makefile.am: Fix ``rpmdist'' target to return the exit
3964 status of the ``rpm'' command, instead of the last command in
3965 the chain (the ``rm lyx.xpm'' command, which always returns
3968 2000-08-02 Allan Rae <rae@lyx.org>
3970 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3971 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3972 * src/frontends/xforms/FormToc.C (FormToc): ditto
3974 * src/frontends/xforms/Makefile.am: A few forgotten files
3976 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3977 Signals-not-copyable-problem Lars' started commenting out.
3979 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3981 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3983 * src/insets/insetcommand.h: Signals is not copyable so anoter
3984 scheme for automatic hiding of forms must be used.
3986 * src/frontends/xforms/FormCitation.h: don't inerit from
3987 noncopyable, FormCommand already does that.
3988 * src/frontends/xforms/FormToc.h: ditto
3989 * src/frontends/xforms/FormUrl.h: ditto
3991 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3993 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3995 * src/insets/insetcommand.h (hide): new SigC::Signal0
3996 (d-tor) new virtual destructor emits hide signal
3998 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3999 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4001 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4002 LOF and LOT. Inset is now GUI-independent
4004 * src/insets/insetloa.[Ch]: redundant
4005 * src/insets/insetlof.[Ch]: ditto
4006 * src/insets/insetlot.[Ch]: ditto
4008 * src/frontends/xforms/forms/form_url.fd: tweaked!
4009 * src/frontends/xforms/forms/form_citation.fd: ditto
4011 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4012 dialogs dealing with InsetCommand insets
4014 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4015 FormCommand base class
4016 * src/frontends/xforms/FormUrl.[Ch]: ditto
4018 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4020 * src/frontends/xforms/FormToc.[Ch]: ditto
4022 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4023 passed a generic InsetCommand pointer
4024 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4026 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4027 and modified InsetTOC class
4028 * src/buffer.C: ditto
4030 * forms/lyx.fd: strip out old FD_form_toc code
4031 * src/lyx_gui_misc.C: ditto
4032 * src/lyx_gui.C: ditto
4033 * src/lyx_cb.C: ditto
4034 * src/lyx.[Ch]: ditto
4036 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4038 * src/support/utility.hpp: tr -d '\r'
4040 2000-08-01 Juergen Vigna <jug@sad.it>
4042 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4044 * src/commandtags.h:
4045 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4046 LFUN_TABULAR_FEATURES.
4048 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4049 LFUN_LAYOUT_TABULAR.
4051 * src/insets/insettabular.C (getStatus): implemented helper function.
4053 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4055 2000-07-31 Juergen Vigna <jug@sad.it>
4057 * src/text.C (draw): fixed screen update problem for text-insets.
4059 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4060 something changed probably this has to be added in various other
4063 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4065 2000-07-31 Baruch Even <baruch.even@writeme.com>
4067 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4068 templates to satisfy compaq cxx.
4071 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4073 * src/support/translator.h (equal_1st_in_pair::operator()): take
4074 const ref pair_type as arg.
4075 (equal_2nd_in_pair::operator()): ditto
4076 (Translator::~Translator): remove empty d-tor.
4078 * src/graphics/GraphicsCache.C: move include config.h to top, also
4079 put initialization of GraphicsCache::singleton here.
4080 (~GraphicsCache): move here
4081 (addFile): take const ref as arg
4084 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4086 * src/BufferView2.C (insertLyXFile): change te with/without header
4089 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4091 * src/frontends/xforms/FormGraphics.C (apply): add some
4092 static_cast. Not very nice, but required by compaq cxx.
4094 * src/frontends/xforms/RadioButtonGroup.h: include header
4095 <utility> instead of <pair.h>
4097 * src/insets/insetgraphicsParams.C: add using directive.
4098 (readResize): change return type to void.
4099 (readOrigin): ditto.
4101 * src/lyxfunc.C (getStatus): add missing break for build-program
4102 function; add test for Literate for export functions.
4104 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4105 entries in Options menu.
4107 2000-07-31 Baruch Even <baruch.even@writeme.com>
4109 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4110 protect against auto-allocation; release icon when needed.
4112 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4114 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4115 on usual typewriter.
4117 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4118 earlier czech.kmap), useful only for programming.
4120 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4122 * src/frontends/xforms/FormCitation.h: fix conditioning around
4125 2000-07-31 Juergen Vigna <jug@sad.it>
4127 * src/frontends/xforms/FormTabular.C (local_update): changed
4128 radio_linebreaks to radio_useparbox and added radio_useminipage.
4130 * src/tabular.C: made support for using minipages/parboxes.
4132 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4134 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4136 (descent): so the cursor is in the middle.
4137 (width): bit smaller box.
4139 * src/insets/insetgraphics.h: added display() function.
4141 2000-07-31 Baruch Even <baruch.even@writeme.com>
4143 * src/frontends/Dialogs.h: Added showGraphics signals.
4145 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4146 xforms form definition of the graphics dialog.
4148 * src/frontends/xforms/FormGraphics.h:
4149 * src/frontends/xforms/FormGraphics.C: Added files, the
4150 GUIndependent code of InsetGraphics
4152 * src/insets/insetgraphics.h:
4153 * src/insets/insetgraphics.C: Major writing to make it work.
4155 * src/insets/insetgraphicsParams.h:
4156 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4157 struct between InsetGraphics and GUI.
4159 * src/LaTeXFeatures.h:
4160 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4161 support for graphicx package.
4163 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4164 for the graphics inset.
4166 * src/support/translator.h: Added file, used in
4167 InsetGraphicsParams. this is a template to translate between two
4170 * src/frontends/xforms/RadioButtonGroup.h:
4171 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4172 way to easily control a radio button group.
4174 2000-07-28 Juergen Vigna <jug@sad.it>
4176 * src/insets/insettabular.C (LocalDispatch):
4177 (TabularFeatures): added support for lyx-functions of tabular features.
4178 (cellstart): refixed this function after someone wrongly changed it.
4180 * src/commandtags.h:
4181 * src/LyXAction.C (init): added support for tabular-features
4183 2000-07-28 Allan Rae <rae@lyx.org>
4185 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4186 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4187 triggers the callback for input checking. As a result we sometimes get
4188 "LyX: This shouldn't happen..." printed to cerr.
4189 (input): Started using status variable since I only free() on
4190 destruction. Some input checking for paths and font sizes.
4192 * src/frontends/xforms/FormPreferences.h: Use status to control
4193 activation of Ok and Apply
4195 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4196 callback. Also resized to stop segfaults with 0.88. The problem is
4197 that xforms-0.88 requires the folder to be wide enough to fit all the
4198 tabs. If it isn't it causes all sorts of problems.
4200 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4202 * src/frontends/xforms/forms/README: Reflect reality.
4204 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4205 * src/frontends/xforms/forms/makefile: ditto.
4207 * src/commandtags.h: Get access to new Preferences dialog
4208 * src/LyXAction.C: ditto
4209 * src/lyxfunc.C: ditto
4210 * lib/ui/default.ui: ditto
4212 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4214 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4216 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4219 * src/frontends/xforms/form_url.[Ch]: added.
4221 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4223 * src/insets/insetbib.h: fixed bug in previous commit
4225 * src/frontends/xforms/FormUrl.h: ditto
4227 * src/frontends/xforms/FormPrint.h: ditto
4229 * src/frontends/xforms/FormPreferences.h: ditto
4231 * src/frontends/xforms/FormCopyright.h: ditto
4233 * src/frontends/xforms/FormCitation.C: ditto
4235 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4236 private copyconstructor and private default contructor
4238 * src/support/Makefile.am: add utility.hpp
4240 * src/support/utility.hpp: new file from boost
4242 * src/insets/insetbib.h: set owner in clone
4244 * src/frontends/xforms/FormCitation.C: added missing include
4247 * src/insets/form_url.[Ch]: removed
4249 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4251 * development/lyx.spec.in
4252 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4253 file/directory re-organization.
4255 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4257 * src/insets/insetcommand.[Ch]: moved the string data and
4258 associated manipulation methods into a new stand-alone class
4259 InsetCommandParams. This class has two additional methods
4260 getAsString() and setFromString() allowing the contents to be
4261 moved around as a single string.
4262 (addContents) method removed.
4263 (setContents) method no longer virtual.
4265 * src/buffer.C (readInset): made use of new InsetCitation,
4266 InsetUrl constructors based on InsetCommandParams.
4268 * src/commandtags.h: add LFUN_INSERT_URL
4270 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4271 independent InsetUrl and use InsetCommandParams to extract
4272 string info and create new Insets.
4274 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4276 * src/frontends/xforms/FormCitation.C (apply): uses
4279 * src/frontends/xforms/form_url.C
4280 * src/frontends/xforms/form_url.h
4281 * src/frontends/xforms/FormUrl.h
4282 * src/frontends/xforms/FormUrl.C
4283 * src/frontends/xforms/forms/form_url.fd: new files
4285 * src/insets/insetcite.[Ch]: removed unused constructors.
4287 * src/insets/insetinclude.[Ch]: no longer store filename
4289 * src/insets/inseturl.[Ch]: GUI-independent.
4291 2000-07-26 Juergen Vigna <jug@sad.it>
4292 * renamed frontend from gtk to gnome as it is that what is realized
4293 and did the necessary changes in the files.
4295 2000-07-26 Marko Vendelin <markov@ioc.ee>
4297 * configure.in: cleaning up gnome configuration scripts
4299 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4301 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4302 shortcuts syndrom by redrawing them explicitely (a better solution
4303 would be appreciated).
4305 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4307 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4310 * src/lyx_cb.C (MenuExport): change html export to do the right
4311 thing depending of the document type (instead of having
4312 html-linuxdoc and html-docbook).
4313 * src/lyxfunc.C (getStatus): update for html
4314 * lib/ui/default.ui: simplify due to the above change.
4315 * src/menus.C (ShowFileMenu): update too (in case we need it).
4317 * src/MenuBackend.C (read): if a menu is defined twice, add the
4318 new entries to the exiting one.
4320 2000-07-26 Juergen Vigna <jug@sad.it>
4322 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4324 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4325 and return a bool if it did actual save the file.
4326 (AutoSave): don't autosave a unnamed doc.
4328 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4329 check if this is an UNNAMED new file and react to it.
4330 (newFile): set buffer to unnamed and change to not mark a new
4331 buffer dirty if I didn't do anything with it.
4333 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4335 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4337 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4338 friend as per Angus's patch posted to lyx-devel.
4340 * src/ext_l10n.h: updated
4342 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4343 gettext on the style string right before inserting them into the
4346 * autogen.sh: add code to extract style strings form layout files,
4347 not good enough yet.
4349 * src/frontends/gtk/.cvsignore: add MAKEFILE
4351 * src/MenuBackend.C (read): run the label strings through gettext
4352 before storing them in the containers.
4354 * src/ext_l10n.h: new file
4356 * autogen.sh : generate the ext_l10n.h file here
4358 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4360 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4363 * lib/ui/default.ui: fix a couple of typos.
4365 * config/gnome/gtk.m4: added (and added to the list of files in
4368 * src/insets/insetinclude.C (unique_id): fix when we are using
4369 lyxstring instead of basic_string<>.
4370 * src/insets/insettext.C (LocalDispatch): ditto.
4371 * src/support/filetools.C: ditto.
4373 * lib/configure.m4: create the ui/ directory if necessary.
4375 * src/LyXView.[Ch] (updateToolbar): new method.
4377 * src/BufferView_pimpl.C (buffer): update the toolbar when
4378 opening/closing buffer.
4380 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4382 * src/LyXAction.C (getActionName): enhance to return also the name
4383 and options of pseudo-actions.
4384 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4386 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4387 as an example of what is possible). Used in File->Build too (more
4388 useful) and in the import/export menus (to mimick the complicated
4389 handling of linuxdoc and friends). Try to update all the entries.
4391 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4394 * src/MenuBackend.C (read): Parse the new OptItem tag.
4396 * src/MenuBackend.h: Add a new optional_ data member (used if the
4397 entry should be omitted when the lyxfunc is disabled).
4399 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4400 function, used as a shortcut.
4401 (create_submenu): align correctly the shortcuts on the widest
4404 * src/MenuBackend.h: MenuItem.label() only returns the label of
4405 the menu without shortcut; new method shortcut().
4407 2000-07-14 Marko Vendelin <markov@ioc.ee>
4409 * src/frontends/gtk/Dialogs.C:
4410 * src/frontends/gtk/FormCopyright.C:
4411 * src/frontends/gtk/FormCopyright.h:
4412 * src/frontends/gtk/Makefile.am: added these source-files for the
4413 Gtk/Gnome support of the Copyright-Dialog.
4415 * src/main.C: added Gnome::Main initialization if using
4416 Gtk/Gnome frontend-GUI.
4418 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4420 * config/gnome/aclocal-include.m4
4421 * config/gnome/compiler-flags.m4
4422 * config/gnome/curses.m4
4423 * config/gnome/gnome--.m4
4424 * config/gnome/gnome-bonobo-check.m4
4425 * config/gnome/gnome-common.m4
4426 * config/gnome/gnome-fileutils.m4
4427 * config/gnome/gnome-ghttp-check.m4
4428 * config/gnome/gnome-gnorba-check.m4
4429 * config/gnome/gnome-guile-checks.m4
4430 * config/gnome/gnome-libgtop-check.m4
4431 * config/gnome/gnome-objc-checks.m4
4432 * config/gnome/gnome-orbit-check.m4
4433 * config/gnome/gnome-print-check.m4
4434 * config/gnome/gnome-pthread-check.m4
4435 * config/gnome/gnome-support.m4
4436 * config/gnome/gnome-undelfs.m4
4437 * config/gnome/gnome-vfs.m4
4438 * config/gnome/gnome-x-checks.m4
4439 * config/gnome/gnome-xml-check.m4
4440 * config/gnome/gnome.m4
4441 * config/gnome/gperf-check.m4
4442 * config/gnome/gtk--.m4
4443 * config/gnome/linger.m4
4444 * config/gnome/need-declaration.m4: added configuration scripts
4445 for Gtk/Gnome frontend-GUI
4447 * configure.in: added support for the --with-frontend=gtk option
4449 * autogen.sh: added config/gnome/* to list of config-files
4451 * acconfig.h: added define for GTKGUI-support
4453 * config/lyxinclude.m4: added --with-frontend[=value] option value
4454 for Gtk/Gnome frontend-GUI support.
4456 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4458 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4462 * src/paragraph.C (GetChar): remove non-const version
4464 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4465 (search_kw): use it.
4467 * src/lyx_main.C (init): if "preferences" exist, read that instead
4469 (ReadRcFile): return bool if the file could be read ok.
4470 (ReadUIFile): add a check to see if lex file is set ok.
4472 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4473 bastring can be used instead of lyxstring (still uses the old code
4474 if std::string is good enough or if lyxstring is used.)
4476 * src/encoding.C: make the arrays static, move ininle functions
4478 * src/encoding.h: from here.
4480 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4481 (parseSingleLyXformat2Token): move inset parsing to separate method
4482 (readInset): new private method
4484 * src/Variables.h: remove virtual from get().
4486 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4487 access to NEW_INSETS and NEW_TABULAR
4489 * src/MenuBackend.h: remove superfluous forward declaration of
4490 MenuItem. Add documentations tags "///", remove empty MenuItem
4491 destructor, remove private default contructor.
4493 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4495 (read): more string mlabel and mname to where they are used
4496 (read): remove unused variables mlabel and mname
4497 (defaults): unconditional clear, make menusetup take advantage of
4498 add returning Menu &.
4500 * src/LyXView.h: define NEW_MENUBAR as default
4502 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4503 to NEW_INSETS and NEW_TABULAR.
4504 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4505 defined. Change some of the "xxxx-inset-insert" functions names to
4508 * several files: more enahncements to NEW_INSETS and the resulting
4511 * lib/lyxrc.example (\date_insert_format): move to misc section
4513 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4514 bastring and use AC_CACHE_CHECK.
4515 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4516 the system have the newest methods. uses AC_CACHE_CHECK
4517 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4518 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4519 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4521 * configure.in: add LYX_CXX_GOOD_STD_STRING
4523 * acinclude.m4: recreated
4525 2000-07-24 Amir Karger <karger@lyx.org>
4527 * README: add Hebrew, Arabic kmaps
4530 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4532 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4535 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4537 * Lot of files: add pragma interface/implementation.
4539 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4541 * lib/ui/default.ui: new file (ans new directory). Contains the
4542 default menu and toolbar.
4544 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4545 global space. Toolbars are now read (as menus) in ui files.
4547 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4549 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4550 is disabled because the document is read-only. We want to have the
4551 toggle state of the function anyway.
4552 (getStatus): add code for LFUN_VC* functions (mimicking what is
4553 done in old-style menus)
4555 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4556 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4558 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4559 * src/BufferView_pimpl.C: ditto.
4560 * src/lyxfunc.C: ditto.
4562 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4563 default). This replaces old-style menus by new ones.
4565 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4566 MenuItem. Contain the data structure of a menu.
4568 * src/insets/insettext.C: use LyXView::setLayout instead of
4569 accessing directly the toolbar combox.
4570 * src/lyxfunc.C (Dispatch): ditto.
4572 * src/LyXView.C (setLayout): new method, which just calls
4573 Toolbar::setLayout().
4574 (updateLayoutChoice): move part of this method in Toolbar.
4576 * src/toolbar.[Ch]: removed.
4578 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4579 implementation the toolbar.
4581 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4582 the toolbar. It might make sense to merge it with ToolbarDefaults
4584 (setLayout): new function.
4585 (updateLayoutList): ditto.
4586 (openLayoutList): ditto.
4588 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4589 xforms implementation of the toolbar.
4590 (get_toolbar_func): comment out, since I do not
4591 know what it is good for.
4593 * src/ToolbarDefaults.h: Add the ItemType enum.
4595 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4596 for a list of allocated C strings. Used in Menubar xforms
4597 implementation to avoid memory leaks.
4599 * src/support/lstrings.[Ch] (uppercase): new version taking and
4603 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4604 * lib/bind/emacs.bind: ditto.
4606 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4608 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4609 forward decl of LyXView.
4611 * src/toolbar.C (toolbarItem): moved from toolbar.h
4612 (toolbarItem::clean): ditto
4613 (toolbarItem::~toolbarItem): ditto
4614 (toolbarItem::operator): ditto
4616 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4618 * src/paragraph.h: control the NEW_TABULAR define from here
4620 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4621 USE_TABULAR_INSETS to NEW_TABULAR
4623 * src/ToolbarDefaults.C: add include "lyxlex.h"
4625 * files using the old table/tabular: use NEW_TABULAR to control
4626 compilation of old tabular stuff.
4628 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4631 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4632 planemet in reading of old style floats, fix the \end_deeper
4633 problem when reading old style floats.
4635 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4637 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4639 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4641 * lib/bind/sciword.bind: updated.
4643 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4645 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4646 layout write problem
4648 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4650 * src/Makefile.am (INCLUDES): remove image directory from include
4653 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4654 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4656 * src/LyXView.C (create_form_form_main): read the application icon
4659 * lib/images/*.xpm: change the icons to use transparent color for
4662 * src/toolbar.C (update): change the color of the button when it
4665 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4667 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4668 setting explicitely the minibuffer.
4669 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4671 * src/LyXView.C (showState): new function. Shows font information
4672 in minibuffer and update toolbar state.
4673 (LyXView): call Toolbar::update after creating the
4676 * src/toolbar.C: change toollist to be a vector instead of a
4678 (BubbleTimerCB): get help string directly from the callback
4679 argument of the corresponding icon (which is the action)
4680 (set): remove unnecessary ugliness.
4681 (update): new function. update the icons (depressed, disabled)
4682 depending of the status of the corresponding action.
4684 * src/toolbar.h: remove help in toolbarItem
4686 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4688 * src/Painter.C (text): Added code for using symbol glyphs from
4689 iso10646 fonts. Currently diabled.
4691 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4694 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4695 magyar,turkish and usorbian.
4697 * src/paragraph.C (isMultiLingual): Made more efficient.
4699 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4702 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4703 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4704 Also changed the prototype to "bool math_insert_greek(char)".
4706 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4708 * lots of files: apply the NEW_INSETS on all code that will not be
4709 needed when we move to use the new insets. Enable the define in
4710 lyxparagrah.h to try it.
4712 * src/insets/insettabular.C (cellstart): change to be a static
4714 (InsetTabular): initialize buffer in the initializer list.
4716 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4718 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4719 form_print.h out of the header file. Replaced with forward
4720 declarations of the relevant struct.
4722 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4725 * src/commandtags.h: do not include "debug.h" which does not
4726 belong there. #include it in some other places because of this
4729 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4731 * src/insets/insetcaption.C: add a couple "using" directives.
4733 * src/toolbar.C (add): get the help text directly from lyxaction.
4735 (setPixmap): new function. Loads from disk and sets a pixmap on a
4736 botton; the name of the pixmap file is derived from the command
4739 * src/toolbar.h: remove members isBitmap and pixmap from
4742 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4743 * lib/images/: move many files from images/banner.xpm.
4745 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4747 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4748 * src/toolbar.C: ditto.
4749 * configure.in: ditto.
4750 * INSTALL: document.
4752 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4753 the spellchecker popup is closed from the WM.
4755 2000-07-19 Juergen Vigna <jug@sad.it>
4757 * src/insets/insetfloat.C (Write): small fix because we use the
4758 insetname for the type now!
4760 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4762 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4765 * src/frontends/Dialogs.h: removed hideCitation signal
4767 * src/insets/insetcite.h: added hide signal
4769 * src/insets/insetcite.C (~InsetCitation): emits new signal
4770 (getScreenLabel): "intelligent" label should now fit on the screen!
4772 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4774 * src/frontends/xforms/FormCitation.C (showInset): connects
4775 hide() to the inset's hide signal
4776 (show): modified to use fl_set_object_position rather than
4777 fl_set_object_geometry wherever possible
4779 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4781 * src/insets/lyxinset.h: add caption code
4783 * src/insets/insetfloat.C (type): new method
4785 * src/insets/insetcaption.C (Write): new method
4787 (LyxCode): new method
4789 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4790 to get it right together with using the FloatList.
4792 * src/commandtags.h: add LFUN_INSET_CAPTION
4793 * src/lyxfunc.C (Dispatch): handle it
4795 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4798 * src/Variables.[Ch]: make expand take a const reference, remove
4799 the destructor, some whitespace changes.
4801 * src/LyXAction.C (init): add caption-inset-insert
4803 * src/FloatList.C (FloatList): update the default floats a bit.
4805 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4807 * src/Variables.[Ch]: new files. Intended to be used for language
4808 specific strings (like \chaptername) and filename substitution in
4811 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4813 * lib/kbd/american.kmap: update
4815 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4817 * src/bufferparams.[Ch]: remove member allowAccents.
4819 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4821 * src/LaTeXLog.C: use the log_form.h header.
4822 * src/lyx_gui.C: ditto.
4823 * src/lyx_gui_misc.C: ditto.
4824 * src/lyxvc.h: ditto.
4826 * forms/log_form.fd: new file, created from latexoptions.fd. I
4827 kept the log popup and nuked the options form.
4829 * src/{la,}texoptions.[Ch]: removed.
4830 * src/lyx_cb.C (LaTeXOptions): ditto
4832 * src/lyx_gui.C (create_forms): do not handle the
4833 fd_latex_options form.
4835 2000-07-18 Juergen Vigna <jug@sad.it>
4837 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4838 name of the inset so that it can be requested outside (text2.C).
4840 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4843 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4845 * src/mathed/formula.h (ConvertFont): constify
4847 * src/mathed/formula.C (Read): add warning if \end_inset is not
4848 found on expected place.
4850 * src/insets/lyxinset.h (ConvertFont): consify
4852 * src/insets/insetquotes.C (ConvertFont): constify
4853 * src/insets/insetquotes.h: ditto
4855 * src/insets/insetinfo.h: add labelfont
4857 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4858 (ascent): use labelfont
4862 (Write): make .lyx file a bit nicer
4864 * src/insets/insetfloat.C (Write): simplify somewhat...
4865 (Read): add warning if arg is not found
4867 * src/insets/insetcollapsable.C: add using std::max
4868 (Read): move string token and add warning in arg is not found
4869 (draw): use std::max to get the right ty
4870 (getMaxWidth): simplify by using std::max
4872 * src/insets/insetsection.h: new file
4873 * src/insets/insetsection.C: new file
4874 * src/insets/insetcaption.h: new file
4875 * src/insets/insetcaption.C: new file
4877 * src/insets/inset.C (ConvertFont): constify signature
4879 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4880 insetcaption.[Ch] and insetsection.[Ch]
4882 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4883 uses to use LABEL_COUNTER_CHAPTER instead.
4884 * src/text2.C (SetCounter): here
4886 * src/counters.h: new file
4887 * src/counters.C: new file
4888 * src/Sectioning.h: new file
4889 * src/Sectioning.C: new file
4891 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4893 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4895 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4898 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4901 2000-07-17 Juergen Vigna <jug@sad.it>
4903 * src/tabular.C (Validate): check if array-package is needed.
4904 (SetVAlignment): added support for vertical alignment.
4905 (SetLTFoot): better support for longtable header/footers
4906 (Latex): modified to support added features.
4908 * src/LaTeXFeatures.[Ch]: added array-package.
4910 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4912 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4915 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4917 * configure.in: do not forget to put a space after -isystem.
4919 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4921 * lib/kbd/arabic.kmap: a few fixes.
4923 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4925 * some whitespace chagnes to a number of files.
4927 * src/support/DebugStream.h: change to make it easier for
4928 doc++ to parse correctly.
4929 * src/support/lyxstring.h: ditto
4931 * src/mathed/math_utils.C (compara): change to have only one
4933 (MathedLookupBOP): change because of the above.
4935 * src/mathed/math_delim.C (math_deco_compare): change to have only
4937 (search_deco): change becasue of the above.
4939 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4940 instead of manually coded one.
4942 * src/insets/insetquotes.C (Read): read the \end_inset too
4944 * src/insets/insetlatex.h: remove file
4945 * src/insets/insetlatex.C: remove file
4947 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4949 (InsetPrintIndex): remove destructor
4951 * src/insets/insetinclude.h: remove default constructor
4953 * src/insets/insetfloat.C: work to make it work better
4955 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4957 * src/insets/insetcite.h (InsetCitation): remove default constructor
4959 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4961 * src/text.C (GetColumnNearX): comment out some currently unused code.
4963 * src/paragraph.C (writeFile): move some initializations closer to
4965 (CutIntoMinibuffer): small change to use new matchIT operator
4969 (InsertInset): ditto
4972 (InsetIterator): ditto
4973 (Erase): small change to use new matchFT operator
4975 (GetFontSettings): ditto
4976 (HighestFontInRange): ditto
4979 * src/lyxparagraph.h: some chars changed to value_type
4980 (matchIT): because of some stronger checking (perhaps too strong)
4981 in SGI STL, the two operator() unified to one.
4984 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4986 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4987 the last inset read added
4988 (parseSingleLyXformat2Token): some more (future) compability code added
4989 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4990 (parseSingleLyXformat2Token): set last_inset_read
4991 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4992 (parseSingleLyXformat2Token): don't double intializw string next_token
4994 * src/TextCache.C (text_fits::operator()): add const's to the signature
4995 (has_buffer::operator()): ditto
4997 * src/Floating.h: add some comments on the class
4999 * src/FloatList.[Ch] (typeExist): new method
5002 * src/BackStack.h: added default constructor, wanted by Gcc.
5004 2000-07-14 Juergen Vigna <jug@sad.it>
5006 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5008 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5010 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5011 do a redraw when the window is resized!
5012 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5014 * src/insets/insettext.C (resizeLyXText): added function to correctly
5015 being able to resize the LyXWindow.
5017 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5019 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5021 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5022 crashes when closing dialog to a deleted inset.
5024 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5025 method! Now similar to other insets.
5027 2000-07-13 Juergen Vigna <jug@sad.it>
5029 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5031 * lib/examples/Literate.lyx: small patch!
5033 * src/insets/insetbib.C (Read): added this function because of wrong
5034 Write (without [begin|end]_inset).
5036 2000-07-11 Juergen Vigna <jug@sad.it>
5038 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5039 as the insertInset could not be good!
5041 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5042 the bool param should not be last.
5044 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5046 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5047 did submit that to Karl).
5049 * configure.in: use -isystem instead of -I for X headers. This
5050 fixes a problem on solaris with a recent gcc;
5051 put the front-end code after the X detection code;
5052 configure in sigc++ before lib/
5054 * src/lyx_main.C (commandLineHelp): remove -display from command
5057 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5059 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5060 Also put in Makefile rules for building the ``listerrors''
5061 program for parsing errors from literate programs written in LyX.
5063 * lib/build-listerrors: Added small shell script as part of compile
5064 process. This builds a working ``listerrors'' binary if noweb is
5065 installed and either 1) the VNC X server is installed on the machine,
5066 or 2) the user is compiling from within a GUI. The existence of a GUI
5067 is necessary to use the ``lyx --export'' feature for now. This
5068 hack can be removed once ``lyx --export'' no longer requires a GUI to
5071 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5073 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5074 now passed back correctly from gcc and placed "under" error
5075 buttons in a Literate LyX source.
5077 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5079 * src/text.C (GetColumnNearX): Better behavior when a RTL
5080 paragraph is ended by LTR text.
5082 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5085 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5087 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5088 true when clipboard is empty.
5090 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5092 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5093 row of the paragraph.
5094 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5095 to prevent calculation of bidi tables
5097 2000-07-07 Juergen Vigna <jug@sad.it>
5099 * src/screen.C (ToggleSelection): added y_offset and x_offset
5102 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5105 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5107 * src/insets/insettext.C: fixed Layout-Display!
5109 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5111 * configure.in: add check for strings.h header.
5113 * src/spellchecker.C: include <strings.h> in order to have a
5114 definition for bzero().
5116 2000-07-07 Juergen Vigna <jug@sad.it>
5118 * src/insets/insettext.C (draw): set the status of the bv->text to
5119 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5121 * src/screen.C (DrawOneRow):
5122 (DrawFromTo): redraw the actual row if something has changed in it
5125 * src/text.C (draw): call an update of the toplevel-inset if something
5126 has changed inside while drawing.
5128 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5130 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5132 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5133 processing inside class.
5135 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5136 processing inside class.
5138 * src/insets/insetindex.h new struct Holder, consistent with other
5141 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5142 citation dialog from main code and placed it in src/frontends/xforms.
5143 Dialog launched through signals instead of callbacks
5145 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5147 * lyx.man: update the options description.
5149 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5151 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5152 handle neg values, set min width to 590, add doc about -display
5154 2000-07-05 Juergen Vigna <jug@sad.it>
5156 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5157 calls to BufferView *.
5159 * src/insets/insettext.C (checkAndActivateInset): small fix non
5160 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5162 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5163 their \end_inset token!
5165 2000-07-04 edscott <edscott@imp.mx>
5167 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5168 lib/lyxrc.example: added option \wheel_jump
5170 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5172 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5173 remove support for -width,-height,-xpos and -ypos.
5175 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5177 * src/encoding.[Ch]: New files.
5179 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5180 (text): Call to the underline() method only when needed.
5182 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5184 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5185 encoding(s) for the document.
5187 * src/bufferparams.C (BufferParams): Changed default value of
5190 * src/language.C (newLang): Removed.
5191 (items[]): Added encoding information for all defined languages.
5193 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5194 encoding choice button.
5196 * src/lyxrc.h (font_norm_type): New member variable.
5197 (set_font_norm_type): New method.
5199 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5200 paragraphs with different encodings.
5202 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5203 (TransformChar): Changed to work correctly with Arabic points.
5204 (draw): Added support for drawing Arabic points.
5205 (draw): Removed code for drawing underbars (this is done by
5208 * src/support/textutils.h (IsPrintableNonspace): New function.
5210 * src/BufferView_pimpl.h: Added "using SigC::Object".
5211 * src/LyXView.h: ditto.
5213 * src/insets/insetinclude.h (include_label): Changed to mutable.
5215 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5217 * src/mathed/math_iter.h: remove empty destructor
5219 * src/mathed/math_cursor.h: remove empty destructor
5221 * src/insets/lyxinset.h: add THEOREM_CODE
5223 * src/insets/insettheorem.[Ch]: new files
5225 * src/insets/insetminipage.C: (InsertInset): remove
5227 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5229 (InsertInset): remove
5231 * src/insets/insetlist.C: (InsertList): remove
5233 * src/insets/insetfootlike.[Ch]: new files
5235 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5238 (InsertInset): ditto
5240 * src/insets/insetert.C: remove include Painter.h, reindent
5241 (InsertInset): move to header
5243 * src/insets/insetcollapsable.h: remove explicit from default
5244 contructor, remove empty destructor, add InsertInset
5246 * src/insets/insetcollapsable.C (InsertInset): new func
5248 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5250 * src/vspace.h: add explicit to constructor
5252 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5253 \textcompwordmark, please test this.
5255 * src/lyxrc.C: set ascii_linelen to 65 by default
5257 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5259 * src/commandtags.h: add LFUN_INSET_THEOREM
5261 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5262 (makeLinuxDocFile): remove _some_ of the nice logic
5263 (makeDocBookFile): ditto
5265 * src/Painter.[Ch]: (~Painter): removed
5267 * src/LyXAction.C (init): entry for insettheorem added
5269 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5271 (deplog): code to detect files generated by LaTeX, needs testing
5274 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5276 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5278 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5280 * src/LaTeX.C (deplog): Add a check for files that are going to be
5281 created by the first latex run, part of the project to remove the
5284 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5285 contents to the extension list.
5287 2000-07-04 Juergen Vigna <jug@sad.it>
5289 * src/text.C (NextBreakPoint): added support for needFullRow()
5291 * src/insets/lyxinset.h: added needFullRow()
5293 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5296 * src/insets/insettext.C: lots of changes for update!
5298 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5300 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5302 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5304 * src/insets/insetinclude.C (InsetInclude): fixed
5305 initialization of include_label.
5306 (unique_id): now returns a string.
5308 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5310 * src/LaTeXFeatures.h: new member IncludedFiles, for
5311 a map of key, included file name.
5313 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5314 with the included files for inclusion in SGML preamble,
5315 i. e., linuxdoc and docbook.
5318 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5319 nice (is the generated linuxdoc code to be exported?), that
5320 allows to remove column, and only_body that will be true for
5321 slave documents. Insets are allowed inside SGML font type.
5322 New handling of the SGML preamble for included files.
5323 (makeDocBookFile): the same for docbook.
5325 * src/insets/insetinclude.h:
5326 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5328 (DocBook): new export methods.
5330 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5331 and makeDocBookFile.
5333 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5334 formats to export with command line argument -x.
5336 2000-06-29 Juergen Vigna <jug@sad.it>
5338 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5339 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5341 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5342 region could already been cleared by an inset!
5344 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5346 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5349 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5351 (cursorToggle): remove special handling of lyx focus.
5353 2000-06-28 Juergen Vigna <jug@sad.it>
5355 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5358 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5360 * src/insets/insetindex.C (Edit): add a callback when popup is
5363 * src/insets/insettext.C (LocalDispatch):
5364 * src/insets/insetmarginal.h:
5365 * src/insets/insetlist.h:
5366 * src/insets/insetfoot.h:
5367 * src/insets/insetfloat.h:
5368 * src/insets/insetert.h: add a missing std:: qualifier.
5370 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5372 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5375 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5377 * src/insets/insettext.C (Read): remove tmptok unused variable
5378 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5379 (InsertInset): change for new InsetInset code
5381 * src/insets/insettext.h: add TEXT inline method
5383 * src/insets/insettext.C: remove TEXT macro
5385 * src/insets/insetmarginal.C (Write): new method
5386 (Latex): change output slightly
5388 * src/insets/insetfoot.C (Write): new method
5389 (Latex): change output slightly (don't use endl when no need)
5391 * src/insets/insetert.C (Write): new method
5393 * src/insets/insetcollapsable.h: make button_length, button_top_y
5394 and button_bottm_y protected.
5396 * src/insets/insetcollapsable.C (Write): simplify code by using
5397 tostr. Also do not output the float name, the children class
5398 should to that to get control over own arguments
5400 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5401 src/insets/insetminipage.[Ch]:
5404 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5406 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5408 * src/Makefile.am (lyx_SOURCES): add the new files
5410 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5411 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5412 * src/commandtags.h: ditto
5414 * src/LaTeXFeatures.h: add a std::set of used floattypes
5416 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5418 * src/FloatList.[Ch] src/Floating.h: new files
5420 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5422 * src/lyx_cb.C (TableApplyCB): ditto
5424 * src/text2.C: ditto
5425 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5426 (parseSingleLyXformat2Token): ditto + add code for
5427 backwards compability for old float styles + add code for new insets
5429 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5431 (InsertInset(size_type, Inset *, LyXFont)): new method
5432 (InsetChar(size_type, char)): changed to use the other InsetChar
5433 with a LyXFont(ALL_INHERIT).
5434 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5435 insert the META_INSET.
5437 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5439 * sigc++/thread.h (Threads): from here
5441 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5442 definition out of line
5443 * sigc++/scope.h: from here
5445 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5447 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5448 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5450 * Makefile.am (bindist): new target.
5452 * INSTALL: add instructions for doing a binary distribution.
5454 * development/tools/README.bin.example: update a bit.
5456 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5459 * lib/lyxrc.example: new lyxrc tag \set_color.
5461 * src/lyxfunc.C (Dispatch):
5462 * src/commandtags.h:
5463 * src/LyXAction.C: new lyxfunc "set-color".
5465 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5466 and an x11name given as strings.
5468 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5469 cache when a color is changed.
5471 2000-06-26 Juergen Vigna <jug@sad.it>
5473 * src/lyxrow.C (width): added this functions and variable.
5475 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5478 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5480 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5482 * images/undo_bw.xpm: new icon.
5483 * images/redo_bw.xpm: ditto.
5485 * configure.in (INSTALL_SCRIPT): change value to
5486 ${INSTALL} to avoid failures of install-script target.
5487 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5489 * src/BufferView.h: add a magic "friend" declaration to please
5492 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5494 * forms/cite.fd: modified to allow resizing without messing
5497 * src/insetcite.C: Uses code from cite.fd almost without
5499 User can now resize dialog in the x-direction.
5500 Resizing the dialog in the y-direction is prevented, as the
5501 code does this intelligently already.
5503 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5505 * INSTALL: remove obsolete entry in "problems" section.
5507 * lib/examples/sl_*.lyx: update of the slovenian examples.
5509 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5511 2000-06-23 Juergen Vigna <jug@sad.it>
5513 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5515 * src/buffer.C (resize): delete the LyXText of textinsets.
5517 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5519 * src/insets/lyxinset.h: added another parameter 'cleared' to
5520 the draw() function.
5522 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5523 unlocking inset in inset.
5525 2000-06-22 Juergen Vigna <jug@sad.it>
5527 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5528 of insets and moved first to LyXText.
5530 * src/mathed/formulamacro.[Ch]:
5531 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5533 2000-06-21 Juergen Vigna <jug@sad.it>
5535 * src/text.C (GetVisibleRow): look if I should clear the area or not
5536 using Inset::doClearArea() function.
5538 * src/insets/lyxinset.h: added doClearArea() function and
5539 modified draw(Painter &, ...) to draw(BufferView *, ...)
5541 * src/text2.C (UpdateInset): return bool insted of int
5543 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5545 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5546 combox in the character popup
5548 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5549 BufferParams const & params
5551 2000-06-20 Juergen Vigna <jug@sad.it>
5553 * src/insets/insettext.C (SetParagraphData): set insetowner on
5556 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5558 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5559 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5561 (form_main_): remove
5563 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5564 (create_form_form_main): remove FD_form_main stuff, connect to
5565 autosave_timeout signal
5567 * src/LyXView.[Ch] (getMainForm): remove
5568 (UpdateTimerCB): remove
5569 * src/BufferView_pimpl.h: inherit from SigC::Object
5571 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5572 signal instead of callback
5574 * src/BufferView.[Ch] (cursorToggleCB): remove
5576 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5578 * src/BufferView_pimpl.C: changes because of the one below
5580 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5581 instead of storing a pointer to a LyXText.
5583 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5585 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5587 * src/lyxparagraph.h
5589 * src/paragraph.C: Changed fontlist to a sorted vector.
5591 2000-06-19 Juergen Vigna <jug@sad.it>
5593 * src/BufferView.h: added screen() function.
5595 * src/insets/insettext.C (LocalDispatch): some selection code
5598 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5600 * src/insets/insettext.C (SetParagraphData):
5602 (InsetText): fixes for multiple paragraphs.
5604 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5606 * development/lyx.spec.in: Call configure with ``--without-warnings''
5607 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5608 This should be fine, however, since we generally don't want to be
5609 verbose when making an RPM.
5611 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5613 * lib/scripts/fig2pstex.py: New file
5615 2000-06-16 Juergen Vigna <jug@sad.it>
5617 * src/insets/insettabular.C (UpdateLocal):
5618 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5619 (LocalDispatch): Changed all functions to use LyXText.
5621 2000-06-15 Juergen Vigna <jug@sad.it>
5623 * src/text.C (SetHeightOfRow): call inset::update before requesting
5626 * src/insets/insettext.C (update):
5627 * src/insets/insettabular.C (update): added implementation
5629 * src/insets/lyxinset.h: added update function
5631 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5633 * src/text.C (SelectNextWord): protect against null pointers with
5634 old-style string streams. (fix from Paul Theo Gonciari
5637 * src/cite.[Ch]: remove erroneous files.
5639 * lib/configure.m4: update the list of created directories.
5641 * src/lyxrow.C: include <config.h>
5642 * src/lyxcursor.C: ditto.
5644 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5646 * lib/examples/decimal.lyx: new example file from Mike.
5648 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5649 to find template definitions (from Dekel)
5651 * src/frontends/.cvsignore: add a few things.
5653 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5655 * src/Timeout.C (TimeOut): remove default argument.
5657 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5660 * src/insets/ExternalTemplate.C: add a "using" directive.
5662 * src/lyx_main.h: remove the act_ struct, which seems unused
5665 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5667 * LyX Developers Meeting: All files changed, due to random C++ (by
5668 coincidence) code generator script.
5670 - external inset (cool!)
5671 - initial online editing of preferences
5672 - insettabular breaks insettext(s contents)
5674 - some DocBook fixes
5675 - example files update
5676 - other cool stuff, create a diff and look for yourself.
5678 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5680 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5681 -1 this is a non-line-breaking textinset.
5683 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5684 if there is no width set.
5686 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5688 * Lots of files: Merged the dialogbase branch.
5690 2000-06-09 Allan Rae <rae@lyx.org>
5692 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5693 and the Dispatch methods that used it.
5695 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5696 access to functions formerly kept in Dispatch.
5698 2000-05-19 Allan Rae <rae@lyx.org>
5700 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5701 made to_page and count_copies integers again. from_page remains a
5702 string however because I want to allow entry of a print range like
5703 "1,4,22-25" using this field.
5705 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5706 and printer-params-get. These aren't useful from the minibuffer but
5707 could be used by a script/LyXServer app provided it passes a suitable
5708 auto_mem_buffer. I guess I should take a look at how the LyXServer
5709 works and make it support xtl buffers.
5711 * sigc++/: updated to libsigc++-1.0.1
5713 * src/xtl/: updated to xtl-1.3.pl.11
5715 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5716 those changes done to the files in src/ are actually recreated when
5717 they get regenerated. Please don't ever accept a patch that changes a
5718 dialog unless that patch includes the changes to the corresponding *.fd
5721 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5722 stringOnlyContains, renamed it and generalised it.
5724 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5725 branch. Removed the remaining old form_print code.
5727 2000-04-26 Allan Rae <rae@lyx.org>
5729 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5730 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5732 2000-04-25 Allan Rae <rae@lyx.org>
5734 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5735 against a base of xtl-1.3.pl.4
5737 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5738 filter the Id: entries so they still show the xtl version number
5741 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5742 into the src/xtl code. Patch still pending with José (XTL)
5744 2000-04-24 Allan Rae <rae@lyx.org>
5746 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5747 both more generic and much safer. Use the new template functions.
5748 * src/buffer.[Ch] (Dispatch): ditto.
5750 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5751 and mem buffer more intelligently. Also a little general cleanup.
5754 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5755 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5756 * src/xtl/Makefile.am: ditto.
5757 * src/xtl/.cvsignore: ditto.
5758 * src/Makefile.am: ditto.
5760 * src/PrinterParams.h: Removed the macros member functions. Added a
5761 testInvariant member function. A bit of tidying up and commenting.
5762 Included Angus's idea for fixing operation with egcs-1.1.2.
5764 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5765 cool expansion of XTL's mem_buffer to support automatic memory
5766 management within the buffer itself. Removed the various macros and
5767 replaced them with template functions that use either auto_mem_buffer
5768 or mem_buffer depending on a #define. The mem_buffer support will
5769 disappear as soon as the auto_mem_buffer is confirmed to be good on
5770 other platforms/compilers. That is, it's there so you've got something
5773 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5774 effectively forked XTL. However I expect José will include my code
5775 into the next major release. Also fixed a memory leak.
5776 * src/xtl/text.h: ditto.
5777 * src/xtl/xdr.h: ditto.
5778 * src/xtl/giop.h: ditto.
5780 2000-04-16 Allan Rae <rae@lyx.org>
5782 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5783 by autogen.sh and removed by maintainer-clean anyway.
5784 * .cvsignore, sigc++/.cvsignore: Support the above.
5786 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5788 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5790 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5791 macros, renamed static callback-target member functions to suit new
5792 scheme and made them public.
5793 * src/frontends/xforms/forms/form_print.fd: ditto.
5794 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5796 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5799 * src/xtl/: New directory containing a minimal distribution of XTL.
5800 This is XTL-1.3.pl.4.
5802 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5804 2000-04-15 Allan Rae <rae@lyx.org>
5806 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5808 * sigc++/: Updated to libsigc++-1.0.0
5810 2000-04-14 Allan Rae <rae@lyx.org>
5812 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5813 use the generic ones in future. I'll modify my conversion script.
5815 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5817 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5818 (CloseAllBufferRelatedDialogs): Renamed.
5819 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5821 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5822 of the generic ones. These are the same ones my conversion script
5825 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5826 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5827 * src/buffer.C (Dispatch): ditto
5829 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5830 functions for updating and hiding buffer dependent dialogs.
5831 * src/BufferView.C (buffer): ditto
5832 * src/buffer.C (setReadonly): ditto
5833 * src/lyxfunc.C (CloseBuffer): ditto
5835 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5836 Dialogs.h, and hence all the SigC stuff, into every file that includes
5837 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5839 * src/BufferView2.C: reduce the number of headers included by buffer.h
5841 2000-04-11 Allan Rae <rae@lyx.org>
5843 * src/frontends/xforms/xform_macros.h: A small collection of macros
5844 for building C callbacks.
5846 * src/frontends/xforms/Makefile.am: Added above file.
5848 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5849 scheme again. This time it should work for JMarc. If this is
5850 successful I'll revise my conversion script to automate some of this.
5851 The static member functions in the class also have to be public for
5852 this scheme will work. If the scheme works (it's almost identical to
5853 the way BufferView::cursorToggleCB is handled so it should work) then
5854 FormCopyright and FormPrint will be ready for inclusion into the main
5855 trunk immediately after 1.1.5 is released -- provided we're prepared
5856 for complaints about lame compilers not handling XTL.
5858 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5860 2000-04-07 Allan Rae <rae@lyx.org>
5862 * config/lyxinclude.m4: A bit more tidying up (Angus)
5864 * src/LString.h: JMarc's <string> header fix
5866 * src/PrinterParams.h: Used string for most data to remove some
5867 ugly code in the Print dialog and avoid even uglier code when
5868 appending the ints to a string for output.
5870 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5871 and moved "default:" back to the end of switch statement. Cleaned
5872 up the printing so it uses the right function calls and so the
5873 "print to file" option actually puts the file in the right directory.
5875 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5877 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5878 and Ok+Apply button control into a separate method: input (Angus).
5879 (input) Cleaned it up and improved it to be very thorough now.
5880 (All CB) static_cast used instead of C style cast (Angus). This will
5881 probably change again once we've worked out how to keep gcc-2.8.1 happy
5882 with real C callbacks.
5883 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5884 ignore some of the bool settings and has random numbers instead. Needs
5885 some more investigation. Added other input length checks and checking
5886 of file and printer names.
5888 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5889 would link (Angus). Seems the old code doesn't compile with the pragma
5890 statement either. Separated callback entries from internal methods.
5892 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5894 2000-03-17 Allan Rae <rae@lyx.org>
5896 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5897 need it? Maybe it could go in Dialogs instead? I could make it a
5898 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5899 values to get the bool return value.
5900 (Dispatch): New overloaded method for xtl support.
5902 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5903 extern "C" callback instead of static member functions. Hopefully,
5904 JMarc will be able to compile this. I haven't changed
5905 forms/form_copyright.fd yet. Breaking one of my own rules already.
5907 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5908 because they aren't useful from the minibuffer. Maybe a LyXServer
5909 might want a help message though?
5911 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5913 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5914 xtl which needs both rtti and exceptions.
5916 * src/support/Makefile.am:
5917 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5919 * src/frontends/xforms/input_validators.[ch]: input filters and
5920 validators. These conrol what keys are valid in input boxes.
5921 Use them and write some more. Much better idea than waiting till
5922 after the user has pressed Ok to say that the input fields don't make
5925 * src/frontends/xforms/Makefile.am:
5926 * src/frontends/xforms/forms/form_print.fd:
5927 * src/frontends/xforms/forms/makefile:
5928 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5929 new scheme. Still have to make sure I haven't missed anything from
5930 the current implementation.
5932 * src/Makefile.am, src/PrinterParams.h: New data store.
5934 * other files: Added a couple of copyright notices.
5936 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5938 * src/insets/insetbib.h: move Holder struct in public space.
5940 * src/frontends/include/DialogBase.h: use SigC:: only when
5941 SIGC_CXX_NAMESPACES is defined.
5942 * src/frontends/include/Dialogs.h: ditto.
5944 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5946 * src/frontends/xforms/FormCopyright.[Ch]: do not
5947 mention SigC:: explicitely.
5949 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5951 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5952 deals with testing KDE in main configure.in
5953 * configure.in: ditto.
5955 2000-02-22 Allan Rae <rae@lyx.org>
5957 * Lots of files: Merged from HEAD
5959 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5960 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5962 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5964 * sigc++/: new minidist.
5966 2000-02-14 Allan Rae <rae@lyx.org>
5968 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5970 2000-02-08 Juergen Vigna <jug@sad.it>
5972 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5973 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5975 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5976 for this port and so it is much easier for other people to port
5977 dialogs in a common development environment.
5979 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5980 the QT/KDE implementation.
5982 * src/frontends/kde/Dialogs.C:
5983 * src/frontends/kde/FormCopyright.C:
5984 * src/frontends/kde/FormCopyright.h:
5985 * src/frontends/kde/Makefile.am:
5986 * src/frontends/kde/formcopyrightdialog.C:
5987 * src/frontends/kde/formcopyrightdialog.h:
5988 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5989 for the kde support of the Copyright-Dialog.
5991 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5992 subdir-substitution instead of hardcoded 'xforms' as we now have also
5995 * src/frontends/include/DialogBase.h (Object): just commented the
5996 label after #endif (nasty warning and I don't like warnings ;)
5998 * src/main.C (main): added KApplication initialization if using
6001 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6002 For now only the KDE event-loop is added if frontend==kde.
6004 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6006 * configure.in: added support for the --with-frontend[=value] option
6008 * autogen.sh: added kde.m4 file to list of config-files
6010 * acconfig.h: added define for KDEGUI-support
6012 * config/kde.m4: added configuration functions for KDE-port
6014 * config/lyxinclude.m4: added --with-frontend[=value] option with
6015 support for xforms and KDE.
6017 2000-02-08 Allan Rae <rae@lyx.org>
6019 * all Makefile.am: Fixed up so the make targets dist, distclean,
6020 install and uninstall all work even if builddir != srcdir. Still
6021 have a new sigc++ minidist update to come.
6023 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6025 2000-02-01 Allan Rae <rae@lyx.org>
6027 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6028 Many mods to get builddir != srcdir working.
6030 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6031 for building on NT and so we can do the builddir != srcdir stuff.
6033 2000-01-30 Allan Rae <rae@lyx.org>
6035 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6036 This will stay in "rae" branch. We probably don't really need it in
6037 the main trunk as anyone who wants to help programming it should get
6038 a full library installed also. So they can check both included and
6039 system supplied library compilation.
6041 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6042 Added a 'mini' distribution of libsigc++. If you feel the urge to
6043 change something in these directories - Resist it. If you can't
6044 resist the urge then you should modify the following script and rebuild
6045 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6046 all happen. Still uses a hacked version of libsigc++'s configure.in.
6047 I'm quite happy with the results. I'm not sure the extra work to turn
6048 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6049 worth the trouble and would probably lead to extra maintenance
6051 I haven't tested the following important make targets: install, dist.
6052 Not ready for prime time but very close. Maybe 1.1.5.
6054 * development/tools/makeLyXsigc.sh: A shell script to automatically
6055 generate our mini-dist of libsigc++. It can only be used with a CVS
6056 checkout of libsigc++ not a tarball distribution. It's well commented.
6057 This will end up as part of the libsigc++ distribution so other apps
6058 can easily have an included mini-dist. If someone makes mods to the
6059 sigc++ subpackage without modifying this script to generate those
6060 changes I'll be very upset!
6062 * src/frontends/: Started the gui/system indep structure.
6064 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6065 to access the gui-indep dialogs are in this class. Much improved
6066 design compared to previous revision. Lars, please refrain from
6067 moving this header into src/ like you did with Popups.h last time.
6069 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6071 * src/frontends/xforms/: Started the gui-indep system with a single
6072 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6075 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6076 Here you'll find a very useful makefile and automated fdfix.sh that
6077 makes updating dailogs a no-brainer -- provided you follow the rules
6078 set out in the README. I'm thinking about adding another script to
6079 automatically generate skeleton code for a new dialog given just the
6082 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6083 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6084 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6086 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6088 * src/support/LSubstring.C (operator): simplify
6090 * src/lyxtext.h: removed bparams, use buffer_->params instead
6092 * src/lyxrow.h: make Row a real class, move all variables to
6093 private and use accessors.
6095 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6097 (isRightToLeftPar): ditto
6098 (ChangeLanguage): ditto
6099 (isMultiLingual): ditto
6102 (SimpleTeXOnePar): ditto
6103 (TeXEnvironment): ditto
6104 (GetEndLabel): ditto
6106 (SetOnlyLayout): ditto
6107 (BreakParagraph): ditto
6108 (BreakParagraphConservative): ditto
6109 (GetFontSettings): ditto
6111 (CopyIntoMinibuffer): ditto
6112 (CutIntoMinibuffer): ditto
6113 (PasteParagraph): ditto
6114 (SetPExtraType): ditto
6115 (UnsetPExtraType): ditto
6116 (DocBookContTableRows): ditto
6117 (SimpleDocBookOneTablePar): ditto
6119 (TeXFootnote): ditto
6120 (SimpleTeXOneTablePar): ditto
6121 (TeXContTableRows): ditto
6122 (SimpleTeXSpecialChars): ditto
6125 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6126 to private and use accessors.
6128 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6129 this, we did not use it anymore and has not been for ages. Just a
6130 waste of cpu cycles.
6132 * src/language.h: make Language a real class, move all variables
6133 to private and use accessors.
6135 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6136 (create_view): remove
6137 (update): some changes for new timer
6138 (cursorToggle): use new timer
6139 (beforeChange): change for new timer
6141 * src/BufferView.h (cursorToggleCB): removed last paramter because
6144 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6145 (cursorToggleCB): change because of new timer code
6147 * lib/CREDITS: updated own mailaddress
6149 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6151 * src/support/filetools.C (PutEnv): fix the code in case neither
6152 putenv() nor setenv() have been found.
6154 * INSTALL: mention the install-strip Makefile target.
6156 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6157 read-only documents.
6159 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6161 * lib/reLyX/configure.in (VERSION): avoid using a previously
6162 generated reLyX wrapper to find out $prefix.
6164 * lib/examples/eu_adibide_lyx-atua.lyx:
6165 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6166 translation of the Tutorial (Dooteo)
6168 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6170 * forms/cite.fd: new citation dialog
6172 * src/insetcite.[Ch]: the new citation dialog is moved into
6175 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6178 * src/insets/insetcommand.h: data members made private.
6180 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6182 * LyX 1.1.5 released
6184 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6186 * src/version.h (LYX_RELEASE): to 1.1.5
6188 * src/spellchecker.C (RunSpellChecker): return false if the
6189 spellchecker dies upon creation.
6191 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6193 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6194 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6198 * lib/CREDITS: update entry for Martin Vermeer.
6200 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6202 * src/text.C (draw): Draw foreign language bars at the bottom of
6203 the row instead of at the baseline.
6205 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6207 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6209 * lib/bind/de_menus.bind: updated
6211 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6213 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6215 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6217 * src/menus.C (Limit_string_length): New function
6218 (ShowTocMenu): Limit the number of items/length of items in the
6221 * src/paragraph.C (String): Correct result for a paragraph inside
6224 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6226 * src/bufferlist.C (close): test of buf->getuser() == NULL
6228 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6230 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6231 Do not call to SetCursor when the paragraph is a closed footnote!
6233 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6235 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6238 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6240 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6243 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6244 reference popup, that activates the reference-back action
6246 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6248 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6249 the menus. Also fixed a bug.
6251 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6252 the math panels when switching buffers (unless new buffer is readonly).
6254 * src/BufferView.C (NoSavedPositions)
6255 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6257 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6259 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6260 less of dvi dirty or not.
6262 * src/trans_mgr.[Ch] (insert): change first parameter to string
6265 * src/chset.[Ch] (encodeString): add const to first parameter
6267 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6269 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6273 * src/LaTeX.C (deplog): better searching for dependency files in
6274 the latex log. Uses now regexps.
6276 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6277 instead of the box hack or \hfill.
6279 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6281 * src/lyxfunc.C (doImportHelper): do not create the file before
6282 doing the actual import.
6283 (doImportASCIIasLines): create a new file before doing the insert.
6284 (doImportASCIIasParagraphs): ditto.
6286 * lib/lyxrc.example: remove mention of non-existing commands
6288 * lyx.man: remove mention of color-related switches.
6290 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6292 * src/lyx_gui.C: remove all the color-related ressources, which
6293 are not used anymore.
6295 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6298 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6300 * src/lyxrc.C (read): Add a missing break in the switch
6302 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6304 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6306 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6309 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6311 * src/text.C (draw): draw bars under foreign language words.
6313 * src/LColor.[Ch]: add LColor::language
6315 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6317 * src/lyxcursor.h (boundary): New member variable
6319 * src/text.C (IsBoundary): New methods
6321 * src/text.C: Use the above for currect cursor movement when there
6322 is both RTL & LTR text.
6324 * src/text2.C: ditto
6326 * src/bufferview_funcs.C (ToggleAndShow): ditto
6328 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6330 * src/text.C (DeleteLineForward): set selection to true to avoid
6331 that DeleteEmptyParagraphMechanism does some magic. This is how it
6332 is done in all other functions, and seems reasonable.
6333 (DeleteWordForward): do not jump over non-word stuff, since
6334 CursorRightOneWord() already does it.
6336 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6337 DeleteWordBackward, since they seem safe to me (since selection is
6338 set to "true") DeleteEmptyParagraphMechanism does nothing.
6340 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6342 * src/lyx_main.C (easyParse): simplify the code by factoring the
6343 part that removes parameters from the command line.
6344 (LyX): check wether wrong command line options have been given.
6346 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6348 * src/lyx_main.C : add support for specifying user LyX
6349 directory via command line option -userdir.
6351 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6353 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6354 the number of items per popup.
6355 (Add_to_refs_menu): Ditto.
6357 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6359 * src/lyxparagraph.h: renamed ClearParagraph() to
6360 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6361 textclass as parameter, and do nothing if free_spacing is
6362 true. This fixes part of the line-delete-forward problems.
6364 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6365 (pasteSelection): ditto.
6366 (SwitchLayoutsBetweenClasses): more translatable strings.
6368 * src/text2.C (CutSelection): use StripLeadingSpaces.
6369 (PasteSelection): ditto.
6370 (DeleteEmptyParagraphMechanism): ditto.
6372 2000-05-26 Juergen Vigna <jug@sad.it>
6374 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6375 is not needed in tabular insets.
6377 * src/insets/insettabular.C (TabularFeatures): added missing features.
6379 * src/tabular.C (DeleteColumn):
6381 (AppendRow): implemented this functions
6382 (cellsturct::operator=): clone the inset too;
6384 2000-05-23 Juergen Vigna <jug@sad.it>
6386 * src/insets/insettabular.C (LocalDispatch): better selection support
6387 when having multicolumn-cells.
6389 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6391 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6393 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6395 * src/ColorHandler.C (getGCForeground): put more test into _()
6397 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6400 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6403 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6405 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6406 there are no labels, or when buffer is readonly.
6408 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6409 there are no labels, buffer is SGML, or when buffer is readonly.
6411 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6413 * src/LColor.C (LColor): change a couple of grey40 to grey60
6414 (LColor): rewore initalization to make compiles go some magnitude
6416 (getGUIName): don't use gettext until we need the string.
6418 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6420 * src/Bullet.[Ch]: Fixed a small bug.
6422 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6424 * src/paragraph.C (String): Several fixes/improvements
6426 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6428 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6430 * src/paragraph.C (String): give more correct output.
6432 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6434 * src/lyxfont.C (stateText) Do not output the language if it is
6435 eqaul to the language of the document.
6437 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6438 between two paragraphs with the same language.
6440 * src/paragraph.C (getParLanguage) Return a correct answer for an
6441 empty dummy paragraph.
6443 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6446 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6449 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6450 the menus/popup, if requested fonts are unavailable.
6452 2000-05-22 Juergen Vigna <jug@sad.it>
6454 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6455 movement support (Up/Down/Tab/Shift-Tab).
6456 (LocalDispatch): added also preliminari cursor-selection.
6458 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6460 * src/paragraph.C (PasteParagraph): Hopefully now right!
6462 2000-05-22 Garst R. Reese <reese@isn.net>
6464 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6465 of list, change all references to Environment to Command
6466 * tex/hollywood.cls : rewrite environments as commands, add
6467 \uppercase to interiorshot and exteriorshot to force uppecase.
6468 * tex/broadway.cls : rewrite environments as commands. Tweak
6471 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6473 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6474 size of items: use a constant intead of the hardcoded 40, and more
6475 importantly do not remove the %m and %x tags added at the end.
6476 (Add_to_refs_menu): use vector::size_type instead of
6477 unsigned int as basic types for the variables. _Please_ do not
6478 assume that size_t is equal to unsigned int. On an alpha, this is
6479 unsigned long, which is _not_ the same.
6481 * src/language.C (initL): remove language "hungarian", since it
6482 seems that "magyar" is better.
6484 2000-05-22 Juergen Vigna <jug@sad.it>
6486 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6488 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6491 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6492 next was deleted but not set to 0.
6494 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6496 * src/language.C (initL): change the initialization of languages
6497 so that compiles goes _fast_.
6499 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6502 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6504 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6508 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6510 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6512 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6516 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6519 * src/insets/insetlo*.[Ch]: Made editable
6521 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6523 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6524 the current selection.
6526 * src/BufferView_pimpl.C (stuffClipboard): new method
6528 * src/BufferView.C (stuffClipboard): new method
6530 * src/paragraph.C (String): new method
6532 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6533 LColor::ignore when lyxname is not found.
6535 * src/BufferView.C (pasteSelection): new method
6537 * src/BufferView_pimpl.C (pasteSelection): new method
6539 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6541 * src/WorkArea.C (request_clipboard_cb): new static function
6542 (getClipboard): new method
6543 (putClipboard): new method
6545 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6547 * LyX 1.1.5pre2 released
6549 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6551 * src/vspace.C (operator=): removed
6552 (operator=): removed
6554 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6556 * src/layout.C (NumberOfClass): manually set the type in make_pair
6557 (NumberOfLayout): ditto
6559 * src/language.C: use the Language constructor for ignore_lang
6561 * src/language.h: add constructors to struct Language
6563 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6565 * src/text2.C (SetCursorIntern): comment out #warning
6567 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6569 * src/mathed/math_iter.h: initialize sx and sw to 0
6571 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6573 * forms/lyx.fd: Redesign of form_ref
6575 * src/LaTeXFeatures.[Ch]
6579 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6582 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6583 and Buffer::inset_iterator.
6585 * src/menus.C: Added new menus: TOC and Refs.
6587 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6589 * src/buffer.C (getTocList): New method.
6591 * src/BufferView2.C (ChangeRefs): New method.
6593 * src/buffer.C (getLabelList): New method. It replaces the old
6594 getReferenceList. The return type is vector<string> instead of
6597 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6598 the old getLabel() and GetNumberOfLabels() methods.
6599 * src/insets/insetlabel.C (getLabelList): ditto
6600 * src/mathed/formula.C (getLabelList): ditto
6602 * src/paragraph.C (String): New method.
6604 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6605 Uses the new getTocList() method.
6606 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6607 which automatically updates the contents of the browser.
6608 (RefUpdateCB): Use the new getLabelList method.
6610 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6612 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6614 * src/spellchecker.C: Added using std::reverse;
6616 2000-05-19 Juergen Vigna <jug@sad.it>
6618 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6620 * src/insets/insettext.C (computeTextRows): small fix for display of
6621 1 character after a newline.
6623 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6626 2000-05-18 Juergen Vigna <jug@sad.it>
6628 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6629 when changing width of column.
6631 * src/tabular.C (set_row_column_number_info): setting of
6632 autobreak rows if necessary.
6634 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6636 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6638 * src/vc-backend.*: renamed stat() to status() and vcstat to
6639 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6640 compilation broke. The new name seems more relevant, anyway.
6642 2000-05-17 Juergen Vigna <jug@sad.it>
6644 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6645 which was wrong if the removing caused removing of rows!
6647 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6648 (pushToken): new function.
6650 * src/text2.C (CutSelection): fix problem discovered with purify
6652 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6654 * src/debug.C (showTags): enlarge the first column, now that we
6655 have 6-digits debug codes.
6657 * lib/layouts/hollywood.layout:
6658 * lib/tex/hollywood.cls:
6659 * lib/tex/brodway.cls:
6660 * lib/layouts/brodway.layout: more commands and fewer
6661 environments. Preambles moved in the .cls files. Broadway now has
6662 more options on scene numbering and less whitespace (from Garst)
6664 * src/insets/insetbib.C (getKeys): make sure that we are in the
6665 document directory, in case the bib file is there.
6667 * src/insets/insetbib.C (Latex): revert bogus change.
6669 2000-05-16 Juergen Vigna <jug@sad.it>
6671 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6672 the TabularLayout on cursor move.
6674 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6676 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6679 (draw): fixed cursor position and drawing so that the cursor is
6680 visible when before the tabular-inset.
6682 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6683 when creating from old insettext.
6685 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6687 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6689 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6690 * lib/tex/brodway.cls: ditto
6692 * lib/layouts/brodway.layout: change alignment of parenthical
6695 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6697 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6698 versions 0.88 and 0.89 are supported.
6700 2000-05-15 Juergen Vigna <jug@sad.it>
6702 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6705 * src/insets/insettext.C (computeTextRows): redone completely this
6706 function in a much cleaner way, because of problems when having a
6708 (draw): added a frame border when the inset is locked.
6709 (SetDrawLockedFrame): this sets if we draw the border or not.
6710 (SetFrameColor): this sets the frame color (default=insetframe).
6712 * src/insets/lyxinset.h: added x() and y() functions which return
6713 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6714 function which is needed to see if we have a locking inset of some
6715 type in this inset (needed for now in insettabular).
6717 * src/vspace.C (inPixels): the same function also without a BufferView
6718 parameter as so it is easier to use it in some ocasions.
6720 * src/lyxfunc.C: changed all places where insertInset was used so
6721 that now if it couldn't be inserted it is deleted!
6723 * src/TabularLayout.C:
6724 * src/TableLayout.C: added support for new tabular-inset!
6726 * src/BufferView2.C (insertInset): this now returns a bool if the
6727 inset was really inserted!!!
6729 * src/tabular.C (GetLastCellInRow):
6730 (GetFirstCellInRow): new helper functions.
6731 (Latex): implemented for new tabular class.
6735 (TeXTopHLine): new Latex() helper functions.
6737 2000-05-12 Juergen Vigna <jug@sad.it>
6739 * src/mathed/formulamacro.C (Read):
6740 * src/mathed/formula.C (Read): read also the \end_inset here!
6742 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6744 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6745 crush when saving formulae with unbalanced parenthesis.
6747 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6749 * src/layout.C: Add new keyword "endlabelstring" to layout file
6751 * src/text.C (GetVisibleRow): Draw endlabel string.
6753 * lib/layouts/broadway.layout
6754 * lib/layouts/hollywood.layout: Added endlabel for the
6755 Parenthetical layout.
6757 * lib/layouts/heb-article.layout: Do not use slanted font shape
6758 for Theorem like environments.
6760 * src/buffer.C (makeLaTeXFile): Always add "american" to
6761 the UsedLanguages list if document language is RTL.
6763 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6765 * add addendum to README.OS2 and small patch (from SMiyata)
6767 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6769 * many files: correct the calls to ChangeExtension().
6771 * src/support/filetools.C (ChangeExtension): remove the no_path
6772 argument, which does not belong there. Use OnlyFileName() instead.
6774 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6775 files when LaTeXing a non-nice latex file.
6777 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6778 a chain of "if". Return false when deadkeys are not handled.
6780 * src/lyx_main.C (LyX): adapted the code for default bindings.
6782 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6783 bindings for basic functionality (except deadkeys).
6784 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6786 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6787 several methods: handle override_x_deadkeys.
6789 * src/lyxrc.h: remove the "bindings" map, which did not make much
6790 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6792 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6794 * src/lyxfont.C (stateText): use a saner method to determine
6795 whether the font is "default". Seems to fix the crash with DEC
6798 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6800 2000-05-08 Juergen Vigna <jug@sad.it>
6802 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6803 TabularLayoutMenu with mouse-button-3
6804 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6806 * src/TabularLayout.C: added this file for having a Layout for
6809 2000-05-05 Juergen Vigna <jug@sad.it>
6811 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6812 recalculating inset-widths.
6813 (TabularFeatures): activated this function so that I can change
6814 tabular-features via menu.
6816 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6817 that I can test some functions with the Table menu.
6819 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6821 * src/lyxfont.C (stateText): guard against stupid c++libs.
6823 * src/tabular.C: add using std::vector
6824 some whitespace changes, + removed som autogenerated code.
6826 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6828 2000-05-05 Juergen Vigna <jug@sad.it>
6830 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6831 row, columns and cellstructures.
6833 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6835 * lib/lyxrc.example: remove obsolete entries.
6837 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6838 reading of protected_separator for free_spacing.
6840 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6842 * src/text.C (draw): do not display an exclamation mark in the
6843 margin for margin notes. This is confusing, ugly and
6846 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6847 AMS math' is checked.
6849 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6850 name to see whether including the amsmath package is needed.
6852 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6854 * src/paragraph.C (validate): Compute UsedLanguages correctly
6855 (don't insert the american language if it doesn't appear in the
6858 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6859 The argument of \thanks{} command is considered moving argument
6861 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6864 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6866 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6867 for appendix/minipage/depth. The lines can be now both in the footnote
6868 frame, and outside the frame.
6870 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6873 2000-05-05 Juergen Vigna <jug@sad.it>
6875 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6876 neede only in tabular.[Ch].
6878 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6880 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6882 (Write): write '~' for PROTECTED_SEPARATOR
6884 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6886 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6889 * src/mathed/formula.C (drawStr): rename size to siz.
6891 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6892 possibly fix a bug by not changing the pflags = flags to piflags =
6895 2000-05-05 Juergen Vigna <jug@sad.it>
6897 * src/insets/insetbib.C: moved using directive
6899 * src/ImportNoweb.C: small fix for being able to compile (missing
6902 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6904 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6905 to use clear, since we don't depend on this in the code. Add test
6908 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6910 * (various *.C files): add using std::foo directives to please dec
6913 * replace calls to string::clear() to string::erase() (Angus)
6915 * src/cheaders/cmath: modified to provide std::abs.
6917 2000-05-04 Juergen Vigna <jug@sad.it>
6919 * src/insets/insettext.C: Prepared all for inserting of multiple
6920 paragraphs. Still display stuff to do (alignment and other things),
6921 but I would like to use LyXText to do this when we cleaned out the
6922 table-support stuff.
6924 * src/insets/insettabular.C: Changed lot of stuff and added lots
6925 of functionality still a lot to do.
6927 * src/tabular.C: Various functions changed name and moved to be
6928 const functions. Added new Read and Write functions and changed
6929 lots of things so it works good with tabular-insets (also removed
6930 some stuff which is not needed anymore * hacks *).
6932 * src/lyxcursor.h: added operators == and != which just look if
6933 par and pos are (not) equal.
6935 * src/buffer.C (latexParagraphs): inserted this function to latex
6936 all paragraphs form par to endpar as then I can use this too for
6939 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6940 so that I can call this to from text insets with their own cursor.
6942 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6943 output off all paragraphs (because of the fix below)!
6945 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6946 the very last paragraph (this could be also the last paragraph of an
6949 * src/texrow.h: added rows() call which returns the count-variable.
6951 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6953 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6955 * lib/configure.m4: better autodetection of DocBook tools.
6957 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6959 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6961 * src/lyx_cb.C: add using std::reverse;
6963 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6966 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6967 selected files. Should fix repeated errors from generated files.
6969 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6971 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6973 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6974 the spellchecker popup.
6976 * lib/lyxrc.example: Removed the \number_inset section
6978 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6980 * src/insets/figinset.C (various): Use IsFileReadable() to make
6981 sure that the file actually exist. Relying on ghostscripts errors
6982 is a bad idea since they can lead to X server crashes.
6984 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6986 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6989 * lib/lyxrc.example: smallish typo in description of
6990 \view_dvi_paper_option
6992 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6995 * src/lyxfunc.C: doImportHelper to factor out common code of the
6996 various import methods. New functions doImportASCIIasLines,
6997 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6998 doImportLinuxDoc for the format specific parts.
7001 * buffer.C: Dispatch returns now a bool to indicate success
7004 * lyx_gui.C: Add getLyXView() for member access
7006 * lyx_main.C: Change logic for batch commands: First try
7007 Buffer::Dispatch (possibly without GUI), if that fails, use
7010 * lyx_main.C: Add support for --import command line switch.
7011 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7012 Available Formats: Everything accepted by 'buffer-import <format>'
7014 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7016 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7019 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7020 documents will be reformatted upon reentry.
7022 2000-04-27 Juergen Vigna <jug@sad.it>
7024 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7025 correctly only last pos this was a bug.
7027 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7029 * release of lyx-1.1.5pre1
7031 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7033 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7035 * src/menus.C: revert the change of naming (Figure->Graphic...)
7036 from 2000-04-11. It was incomplete and bad.
7038 * src/LColor.[Ch]: add LColor::depthbar.
7039 * src/text.C (GetVisibleRow): use it.
7041 * README: update the languages list.
7043 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7045 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7048 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7050 * README: remove sections that were just wrong.
7052 * src/text2.C (GetRowNearY): remove currentrow code
7054 * src/text.C (GetRow): remove currentrow code
7056 * src/screen.C (Update): rewritten a bit.
7057 (SmallUpdate): removed func
7059 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7061 (FullRebreak): return bool
7062 (currentrow): remove var
7063 (currentrow_y): ditto
7065 * src/lyxscreen.h (Draw): change arg to unsigned long
7066 (FitCursor): return bool
7067 (FitManualCursor): ditto
7068 (Smallpdate): remove func
7069 (first): change to unsigned long
7070 (DrawOneRow): change second arg to long (from long &)
7071 (screen_refresh_y): remove var
7072 (scree_refresh_row): ditto
7074 * src/lyxrow.h: change baseline to usigned int from unsigned
7075 short, this brings some implicit/unsigned issues out in the open.
7077 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7079 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7080 instead of smallUpdate.
7082 * src/lyxcursor.h: change y to unsigned long
7084 * src/buffer.h: don't call updateScrollbar after fitcursor
7086 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7087 where they are used. Removed "\\direction", this was not present
7088 in 1.1.4 and is already obsolete. Commented out some code that I
7089 believe to never be called.
7090 (runLiterate): don't call updateScrollbar after fitCursor
7092 (buildProgram): ditto
7095 * src/WorkArea.h (workWidth): change return val to unsigned
7098 (redraw): remove the button redraws
7099 (setScrollbarValue): change for scrollbar
7100 (getScrollbarValue): change for scrollbar
7101 (getScrollbarBounds): change for scrollbar
7103 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7104 (C_WorkArea_down_cb): removed func
7105 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7106 (resize): change for scrollbar
7107 (setScrollbar): ditto
7108 (setScrollbarBounds): ditto
7109 (setScrollbarIncrements): ditto
7110 (up_cb): removed func
7111 (down_cb): removed func
7112 (scroll_cb): change for scrollbar
7113 (work_area_handler): ditto
7115 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7116 when FitCursor did something.
7117 (updateScrollbar): some unsigned changes
7118 (downCB): removed func
7119 (scrollUpOnePage): removed func
7120 (scrollDownOnePage): remvoed func
7121 (workAreaMotionNotify): don't call screen->FitCursor but use
7122 fitCursor instead. and bool return val
7123 (workAreaButtonPress): ditto
7124 (workAreaButtonRelease): some unsigned changes
7125 (checkInsetHit): ditto
7126 (workAreaExpose): ditto
7127 (update): parts rewritten, comments about the signed char arg added
7128 (smallUpdate): removed func
7129 (cursorPrevious): call needed updateScrollbar
7132 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7135 * src/BufferView.[Ch] (upCB): removed func
7136 (downCB): removed func
7137 (smallUpdate): removed func
7139 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7141 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7142 currentrow, currentrow_y optimization. This did not help a lot and
7143 if we want to do this kind of optimization we should rather use
7144 cursor.row instead of the currentrow.
7146 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7147 buffer spacing and klyx spacing support.
7149 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7151 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7154 2000-04-26 Juergen Vigna <jug@sad.it>
7156 * src/insets/figinset.C: fixes to Lars sstream changes!
7158 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7160 * A lot of files: Added Ascii(ostream &) methods to all inset
7161 classes. Used when exporting to ASCII.
7163 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7164 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7167 * src/text2.C (ToggleFree): Disabled implicit word selection when
7168 there is a change in the language
7170 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7171 no output was generated for end-of-sentence inset.
7173 * src/insets/lyxinset.h
7176 * src/paragraph.C: Removed the insetnumber code
7178 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7180 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7182 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7183 no_babel and no_epsfig completely from the file.
7184 (parseSingleLyXformat2Token): add handling for per-paragraph
7185 spacing as written by klyx.
7187 * src/insets/figinset.C: applied patch by Andre. Made it work with
7190 2000-04-20 Juergen Vigna <jug@sad.it>
7192 * src/insets/insettext.C (cutSelection):
7193 (copySelection): Fixed with selection from right to left.
7194 (draw): now the rows are not recalculated at every draw.
7195 (computeTextRows): for now reset the inset-owner here (this is
7196 important for an undo or copy where the inset-owner is not set
7199 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7200 motion to the_locking_inset screen->first was forgotten, this was
7201 not important till we got multiline insets.
7203 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7205 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7206 code seems to be alright (it is code changed by Dekel, and the
7207 intent is indeed that all macros should be defined \protect'ed)
7209 * NEWS: a bit of reorganisation of the new user-visible features.
7211 2000-04-19 Juergen Vigna <jug@sad.it>
7213 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7214 position. Set the inset_owner of the used paragraph so that it knows
7215 that it is inside an inset. Fixed cursor handling with mouse and
7216 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7217 and cleanups to make TextInsets work better.
7219 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7220 Changed parameters of various functions and added LockInsetInInset().
7222 * src/insets/insettext.C:
7224 * src/insets/insetcollapsable.h:
7225 * src/insets/insetcollapsable.C:
7226 * src/insets/insetfoot.h:
7227 * src/insets/insetfoot.C:
7228 * src/insets/insetert.h:
7229 * src/insets/insetert.C: cleaned up the code so that it works now
7230 correctly with insettext.
7232 * src/insets/inset.C:
7233 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7234 that insets in insets are supported right.
7237 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7239 * src/paragraph.C: some small fixes
7241 * src/debug.h: inserted INSETS debug info
7243 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7244 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7246 * src/commandtags.h:
7247 * src/LyXAction.C: insert code for InsetTabular.
7249 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7250 not Button1MotionMask.
7251 (workAreaButtonRelease): send always a InsetButtonRelease event to
7253 (checkInsetHit): some setCursor fixes (always with insets).
7255 * src/BufferView2.C (lockInset): returns a bool now and extended for
7256 locking insets inside insets.
7257 (showLockedInsetCursor): it is important to have the cursor always
7258 before the locked inset.
7259 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7261 * src/BufferView.h: made lockInset return a bool.
7263 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7265 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7266 that is used also internally but can be called as public to have back
7267 a cursor pos which is not set internally.
7268 (SetCursorIntern): Changed to use above function.
7270 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7272 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7277 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7278 patches for things that should be in or should be changed.
7280 * src/* [insetfiles]: change "usigned char fragile" to bool
7281 fragile. There was only one point that could that be questioned
7282 and that is commented in formulamacro.C. Grep for "CHECK".
7284 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7285 (DeleteBuffer): take it out of CutAndPaste and make it static.
7287 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7289 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7290 output the spacing envir commands. Also the new commands used in
7291 the LaTeX output makes the result better.
7293 * src/Spacing.C (writeEnvirBegin): new method
7294 (writeEnvirEnd): new method
7296 2000-04-18 Juergen Vigna <jug@sad.it>
7298 * src/CutAndPaste.C: made textclass a static member of the class
7299 as otherwise it is not accesed right!!!
7301 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7303 * forms/layout_forms.fd
7304 * src/layout_forms.h
7305 * src/layout_forms.C (create_form_form_character)
7306 * src/lyx_cb.C (UserFreeFont)
7307 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7308 documents (in the layout->character popup).
7310 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7312 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7313 \spell_command was in fact not honored (from Kevin Atkinson).
7315 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7318 * src/lyx_gui.h: make lyxViews private (Angus)
7320 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7322 * src/mathed/math_write.C
7323 (MathMatrixInset::Write) Put \protect before \begin{array} and
7324 \end{array} if fragile
7325 (MathParInset::Write): Put \protect before \\ if fragile
7327 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7329 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7330 initialization if the LyXColorHandler must be done after the
7331 connections to the XServer has been established.
7333 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7334 get the background pixel from the lyxColorhandler so that the
7335 figures are rendered with the correct background color.
7336 (NextToken): removed functions.
7337 (GetPSSizes): use ifs >> string instead of NextToken.
7339 * src/Painter.[Ch]: the color cache moved out of this file.
7341 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7344 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7346 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7347 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7349 * src/BufferView.C (enterView): new func
7350 (leaveView): new func
7352 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7354 (leaveView): new func, undefines xterm cursor when approp.
7356 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7357 (AllowInput): delete the Workarea cursor handling from this func.
7359 * src/Painter.C (underline): draw a slimer underline in most cases.
7361 * src/lyx_main.C (error_handler): use extern "C"
7363 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7365 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7366 sent directly to me.
7368 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7369 to the list by Dekel.
7371 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7374 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7375 methods from lyx_cb.here.
7377 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7380 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7382 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7383 instead of using current_view directly.
7385 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7387 * src/LyXAction.C (init): add the paragraph-spacing command.
7389 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7391 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7393 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7394 different from the documents.
7396 * src/text.C (SetHeightOfRow): take paragraph spacing into
7397 account, paragraph spacing takes precedence over buffer spacing
7398 (GetVisibleRow): ditto
7400 * src/paragraph.C (writeFile): output the spacing parameter too.
7401 (validate): set the correct features if spacing is used in the
7403 (Clear): set spacing to default
7404 (MakeSameLayout): spacing too
7405 (HasSameLayout): spacing too
7406 (SetLayout): spacing too
7407 (TeXOnePar): output the spacing commands
7409 * src/lyxparagraph.h: added a spacing variable for use with
7410 per-paragraph spacing.
7412 * src/Spacing.h: add a Default spacing and a method to check if
7413 the current spacing is default. also added an operator==
7415 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7418 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7420 * src/lyxserver.C (callback): fix dispatch of functions
7422 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7423 printf() into lyxerr call.
7425 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7428 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7429 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7430 the "Float" from each of the subitems.
7431 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7433 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7434 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7435 documented the change so that the workaround can be nuked later.
7437 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7440 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7442 * src/buffer.C (getLatexName): ditto
7443 (setReadonly): ditto
7445 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7447 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7448 avoid some uses of current_view. Added also a bufferParams()
7449 method to get at this.
7451 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7453 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7455 * src/lyxparagraph.[Ch]: removed
7456 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7457 with operators used by lower_bound and
7458 upper_bound in InsetTable's
7459 Make struct InsetTable private again. Used matchpos.
7461 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7463 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7464 document, the language of existing text is changed (unless the
7465 document is multi-lingual)
7467 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7469 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7471 * A lot of files: A rewrite of the Right-to-Left support.
7473 2000-04-10 Juergen Vigna <jug@sad.it>
7475 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7476 misplaced cursor when inset in inset is locked.
7478 * src/insets/insettext.C (LocalDispatch): small fix so that a
7479 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7481 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7482 footnote font should be decreased in size twice when displaying.
7484 * src/insets/insettext.C (GetDrawFont): inserted this function as
7485 the drawing-font may differ from the real paragraph font.
7487 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7488 insets (inset in inset!).
7490 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7491 function here because we don't want footnotes inside footnotes.
7493 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7495 (init): now set the inset_owner in paragraph.C
7496 (LocalDispatch): added some resetPos() in the right position
7499 (pasteSelection): changed to use the new CutAndPaste-Class.
7501 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7502 which tells if it is allowed to insert another inset inside this one.
7504 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7505 SwitchLayoutsBetweenClasses.
7507 * src/text2.C (InsertInset): checking of the new paragraph-function
7509 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7510 is not needed anymore here!
7513 (PasteSelection): redone (also with #ifdef) so that now this uses
7514 the CutAndPaste-Class.
7515 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7518 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7519 from/to text/insets.
7521 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7522 so that the paragraph knows if it is inside an (text)-inset.
7523 (InsertFromMinibuffer): changed return-value to bool as now it
7524 may happen that an inset is not inserted in the paragraph.
7525 (InsertInsetAllowed): this checks if it is allowed to insert an
7526 inset in this paragraph.
7528 (BreakParagraphConservative):
7529 (BreakParagraph) : small change for the above change of the return
7530 value of InsertFromMinibuffer.
7532 * src/lyxparagraph.h: added inset_owner and the functions to handle
7533 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7535 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7537 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7538 functions from BufferView to BufferView::Pimpl to ease maintence.
7540 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7541 correctly. Also use SetCursorIntern instead of SetCursor.
7543 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7546 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7548 * src/WorkArea.C (belowMouse): manually implement below mouse.
7550 * src/*: Add "explicit" on several constructors, I added probably
7551 some unneeded ones. A couple of changes to code because of this.
7553 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7554 implementation and private parts from the users of BufferView. Not
7557 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7558 implementation and private parts from the users of LyXLex. Not
7561 * src/BufferView_pimpl.[Ch]: new files
7563 * src/lyxlex_pimpl.[Ch]: new files
7565 * src/LyXView.[Ch]: some inline functions move out-of-line
7567 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7569 * src/lyxparagraph.h: make struct InsetTable public.
7571 * src/support/lyxstring.h: change lyxstring::difference_type to be
7572 ptrdiff_t. Add std:: modifiers to streams.
7574 * src/font.C: include the <cctype> header, for islower() and
7577 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7579 * src/font.[Ch]: new files. Contains the metric functions for
7580 fonts, takes a LyXFont as parameter. Better separation of concepts.
7582 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7583 changes because of this.
7585 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7587 * src/*: compile with -Winline and move functions that don't
7590 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7593 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7595 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7596 (various files changed because of this)
7598 * src/Painter.C (text): fixed the drawing of smallcaps.
7600 * src/lyxfont.[Ch] (drawText): removed unused member func.
7603 * src/*.C: added needed "using" statements and "std::" qualifiers.
7605 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7607 * src/*.h: removed all use of "using" from header files use
7608 qualifier std:: instead.
7610 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7612 * src/text.C (Backspace): some additional cleanups (we already
7613 know whether cursor.pos is 0 or not).
7615 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7616 automake does not provide one).
7618 * src/bmtable.h: replace C++ comments with C comments.
7620 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7622 * src/screen.C (ShowCursor): Change the shape of the cursor if
7623 the current language is not equal to the language of the document.
7624 (If the cursor change its shape unexpectedly, then you've found a bug)
7626 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7629 * src/insets/insetnumber.[Ch]: New files.
7631 * src/LyXAction.C (init)
7632 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7635 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7637 * src/lyxparagraph.h
7638 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7639 (the vector is kept sorted).
7641 * src/text.C (GetVisibleRow): Draw selection correctly when there
7642 is both LTR and RTL text.
7644 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7645 which is much faster.
7647 * src/text.C (GetVisibleRow and other): Do not draw the last space
7648 in a row if the direction of the last letter is not equal to the
7649 direction of the paragraph.
7651 * src/lyxfont.C (latexWriteStartChanges):
7652 Check that font language is not equal to basefont language.
7653 (latexWriteEndChanges): ditto
7655 * src/lyx_cb.C (StyleReset): Don't change the language while using
7656 the font-default command.
7658 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7659 empty paragraph before a footnote.
7661 * src/insets/insetcommand.C (draw): Increase x correctly.
7663 * src/screen.C (ShowCursor): Change cursor shape if
7664 current language != document language.
7666 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7668 2000-03-31 Juergen Vigna <jug@sad.it>
7670 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7671 (Clone): changed mode how the paragraph-data is copied to the
7672 new clone-paragraph.
7674 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7675 GetInset(pos) with no inset anymore there (in inset UNDO)
7677 * src/insets/insetcommand.C (draw): small fix as here x is
7678 incremented not as much as width() returns (2 before, 2 behind = 4)
7680 2000-03-30 Juergen Vigna <jug@sad.it>
7682 * src/insets/insettext.C (InsetText): small fix in initialize
7683 widthOffset (should not be done in the init() function)
7685 2000-03-29 Amir Karger <karger@lyx.org>
7687 * lib/examples/it_ItemizeBullets.lyx: translation by
7690 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7692 2000-03-29 Juergen Vigna <jug@sad.it>
7694 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7696 * src/insets/insetfoot.C (Clone): small change as for the below
7697 new init function in the text-inset
7699 * src/insets/insettext.C (init): new function as I've seen that
7700 clone did not copy the Paragraph-Data!
7701 (LocalDispatch): Added code so that now we have some sort of Undo
7702 functionality (well actually we HAVE Undo ;)
7704 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7706 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7708 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7711 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7713 * src/main.C: added a runtime check that verifies that the xforms
7714 header used when building LyX and the library used when running
7715 LyX match. Exit with a message if they don't match. This is a
7716 version number check only.
7718 * src/buffer.C (save): Don't allocate memory on the heap for
7719 struct utimbuf times.
7721 * *: some using changes, use iosfwd instead of the real headers.
7723 * src/lyxfont.C use char const * instead of string for the static
7724 strings. Rewrite some functions to use sstream.
7726 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7728 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7731 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7733 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7734 of Geodesy (from Martin Vermeer)
7736 * lib/layouts/svjour.inc: include file for the Springer svjour
7737 class. It can be used to support journals other than JoG.
7739 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7740 Miskiewicz <misiek@pld.org.pl>)
7741 * lib/reLyX/Makefile.am: ditto.
7743 2000-03-27 Juergen Vigna <jug@sad.it>
7745 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7746 also some modifications with operations on selected text.
7748 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7749 problems with clicking on insets (last famous words ;)
7751 * src/insets/insetcommand.C (draw):
7752 (width): Changed to have a bit of space before and after the inset so
7753 that the blinking cursor can be seen (otherwise it was hidden)
7755 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7757 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7758 would not be added to the link list when an installed gettext (not
7759 part of libc) is found.
7761 2000-03-24 Juergen Vigna <jug@sad.it>
7763 * src/insets/insetcollapsable.C (Edit):
7764 * src/mathed/formula.C (InsetButtonRelease):
7765 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7768 * src/BufferView.C (workAreaButtonPress):
7769 (workAreaButtonRelease):
7770 (checkInsetHit): Finally fixed the clicking on insets be handled
7773 * src/insets/insetert.C (Edit): inserted this call so that ERT
7774 insets work always with LaTeX-font
7776 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7778 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7779 caused lyx to startup with no GUI in place, causing in a crash
7780 upon startup when called with arguments.
7782 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7784 * src/FontLoader.C: better initialization of dummyXFontStruct.
7786 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7788 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7789 for linuxdoc and docbook import and export format options.
7791 * lib/lyxrc.example Example of default values for the previous flags.
7793 * src/lyx_cb.C Use those flags instead of the hardwired values for
7794 linuxdoc and docbook export.
7796 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7799 * src/menus.C Added menus entries for the new import/exports formats.
7801 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7803 * src/lyxrc.*: Added support for running without Gui
7806 * src/FontLoader.C: sensible defaults if no fonts are needed
7808 * src/lyx_cb.C: New function ShowMessage (writes either to the
7809 minibuffer or cout in case of no gui
7810 New function AskOverwrite for common stuff
7811 Consequently various changes to call these functions
7813 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7814 wild guess at sensible screen resolution when having no gui
7816 * src/lyxfont.C: no gui, no fonts... set some defaults
7818 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7820 * src/LColor.C: made the command inset background a bit lighter.
7822 2000-03-20 Hartmut Goebel <goebel@noris.net>
7824 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7825 stdstruct.inc. Koma-Script added some title elements which
7826 otherwise have been listed below "bibliography". This split allows
7827 adding title elements to where they belong.
7829 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7830 define the additional title elements and then include
7833 * many other layout files: changed to include stdtitle.inc just
7834 before stdstruct.inc.
7836 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7838 * src/buffer.C: (save) Added the option to store all backup files
7839 in a single directory
7841 * src/lyxrc.[Ch]: Added variable \backupdir_path
7843 * lib/lyxrc.example: Added descriptions of recently added variables
7845 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7846 bibtex inset, not closing the bibtex popup when deleting the inset)
7848 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7850 * src/lyx_cb.C: add a couple using directives.
7852 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7853 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7854 import based on the filename.
7856 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7857 file would be imported at start, if the filename where of a sgml file.
7859 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7861 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7863 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7864 * src/lyxfont.h Replaced the member variable bits.direction by the
7865 member variable lang. Made many changes in other files.
7866 This allows having a multi-lingual document
7868 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7869 that change the current language to <l>.
7870 Removed the command "font-rtl"
7872 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7873 format for Hebrew documents)
7875 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7876 When auto_mathmode is "true", pressing a digit key in normal mode
7877 will cause entering into mathmode.
7878 If auto_mathmode is "rtl" then this behavior will be active only
7879 when writing right-to-left text.
7881 * src/text2.C (InsertStringA) The string is inserted using the
7884 * src/paragraph.C (GetEndLabel) Gives a correct result for
7885 footnote paragraphs.
7887 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7889 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7891 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7892 front of PasteParagraph. Never insert a ' '. This should at least
7893 fix some cause for the segfaults that we have been experiencing,
7894 it also fixes backspace behaviour slightly. (Phu!)
7896 * src/support/lstrings.C (compare_no_case): some change to make it
7897 compile with gcc 2.95.2 and stdlibc++-v3
7899 * src/text2.C (MeltFootnoteEnvironment): change type o
7900 first_footnote_par_is_not_empty to bool.
7902 * src/lyxparagraph.h: make text private. Changes in other files
7904 (fitToSize): new function
7905 (setContentsFromPar): new function
7906 (clearContents): new function
7907 (SetChar): new function
7909 * src/paragraph.C (readSimpleWholeFile): deleted.
7911 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7912 the file, just use a simple string instead. Also read the file in
7913 a more maintainable manner.
7915 * src/text2.C (InsertStringA): deleted.
7916 (InsertStringB): deleted.
7918 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7920 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7921 RedoParagraphs from the doublespace handling part, just set status
7922 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7923 done, but perhaps not like this.)
7925 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7927 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7928 character when inserting an inset.
7930 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7932 * src/bufferparams.C (readLanguage): now takes "default" into
7935 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7936 also initialize the toplevel_keymap with the default bindings from
7939 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7941 * all files using lyxrc: have lyxrc as a real variable and not a
7942 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7945 * src/lyxrc.C: remove double call to defaultKeyBindings
7947 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7948 toolbar defauls using lyxlex. Remove enums, structs, functions
7951 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7952 toolbar defaults. Also store default keybindings in a map.
7954 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7955 storing the toolbar defaults without any xforms dependencies.
7957 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7958 applied. Changed to use iterators.
7960 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7962 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7963 systems that don't have LINGUAS set to begin with.
7965 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7967 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7968 the list by Dekel Tsur.
7970 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7972 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7973 * src/insets/form_graphics.C: ditto.
7975 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7977 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7979 * src/bufferparams.C (readLanguage): use the new language map
7981 * src/intl.C (InitKeyMapper): use the new language map
7983 * src/lyx_gui.C (create_forms): use the new language map
7985 * src/language.[Ch]: New files. Used for holding the information
7986 about each language. Now! Use this new language map enhance it and
7987 make it really usable for our needs.
7989 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7991 * screen.C (ShowCursor): Removed duplicate code.
7992 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7993 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7995 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7998 * src/text.C Added TransformChar method. Used for rendering Arabic
7999 text correctly (change the glyphs of the letter according to the
8000 position in the word)
8005 * src/lyxrc.C Added lyxrc command {language_command_begin,
8006 language_command_end,language_command_ltr,language_command_rtl,
8007 language_package} which allows the use of either arabtex or Omega
8010 * src/lyx_gui.C (init)
8012 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8013 to use encoding for menu fonts which is different than the encoding
8016 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8017 do not load the babel package.
8018 To write an English document with Hebrew/Arabic, change the document
8019 language to "english".
8021 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8022 (alphaCounter): changed to return char
8023 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8025 * lib/lyxrc.example Added examples for Hebrew/Arabic
8028 * src/layout.C Added layout command endlabeltype
8030 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8032 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8034 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8036 * src/mathed/math_delim.C (search_deco): return a
8037 math_deco_struct* instead of index.
8039 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8041 * All files with a USE_OSTREAM_ONLY within: removed all code that
8042 was unused when USE_OSTREAM_ONLY is defined.
8044 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8045 of any less. Removed header and using.
8047 * src/text.C (GetVisibleRow): draw the string "Page Break
8048 (top/bottom)" on screen when drawing a pagebreak line.
8050 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8052 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8054 * src/mathed/math_macro.C (draw): do some cast magic.
8057 * src/mathed/math_defs.h: change byte* argument to byte const*.
8059 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8061 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8062 know it is right to return InsetFoot* too, but cxx does not like
8065 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8067 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8069 * src/mathed/math_delim.C: change == to proper assignment.
8071 2000-03-09 Juergen Vigna <jug@sad.it>
8073 * src/insets/insettext.C (setPos): fixed various cursor positioning
8074 problems (via mouse and cursor-keys)
8075 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8076 inset (still a small display problem but it works ;)
8078 * src/insets/insetcollapsable.C (draw): added button_top_y and
8079 button_bottom_y to have correct values for clicking on the inset.
8081 * src/support/lyxalgo.h: commented out 'using std::less'
8083 2000-03-08 Juergen Vigna <jug@sad.it>
8085 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8086 Button-Release event closes as it is alos the Release-Event
8089 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8091 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8093 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8094 can add multiple spaces in Scrap (literate programming) styles...
8095 which, by the way, is how I got hooked on LyX to begin with.
8097 * src/mathed/formula.C (Write): Added dummy variable to an
8098 inset::Latex() call.
8099 (Latex): Add free_spacing boolean to inset::Latex()
8101 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8103 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8104 virtual function to include the free_spacing boolean from
8105 the containing paragraph's style.
8107 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8108 Added free_spacing boolean arg to match inset.h
8110 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8111 Added free_spacing boolean arg to match inset.h
8113 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8114 Added free_spacing boolean and made sure that if in a free_spacing
8115 paragraph, that we output normal space if there is a protected space.
8117 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8118 Added free_spacing boolean arg to match inset.h
8120 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8121 Added free_spacing boolean arg to match inset.h
8123 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8124 Added free_spacing boolean arg to match inset.h
8126 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8127 Added free_spacing boolean arg to match inset.h
8129 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8130 Added free_spacing boolean arg to match inset.h
8132 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8133 free_spacing boolean arg to match inset.h
8135 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8136 Added free_spacing boolean arg to match inset.h
8138 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8139 Added free_spacing boolean arg to match inset.h
8141 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8142 Added free_spacing boolean arg to match inset.h
8144 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8145 Added free_spacing boolean arg to match inset.h
8147 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8148 Added free_spacing boolean arg to match inset.h
8150 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8151 free_spacing boolean arg to match inset.h
8153 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8154 free_spacing boolean arg to match inset.h
8156 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8157 ignore free_spacing paragraphs. The user's spaces are left
8160 * src/text.C (InsertChar): Fixed the free_spacing layout
8161 attribute behavior. Now, if free_spacing is set, you can
8162 add multiple spaces in a paragraph with impunity (and they
8163 get output verbatim).
8164 (SelectSelectedWord): Added dummy argument to inset::Latex()
8167 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8170 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8171 paragraph layouts now only input a simple space instead.
8172 Special character insets don't make any sense in free-spacing
8175 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8176 hard-spaces in the *input* file to simple spaces if the layout
8177 is free-spacing. This converts old files which had to have
8178 hard-spaces in free-spacing layouts where a simple space was
8180 (writeFileAscii): Added free_spacing check to pass to the newly
8181 reworked inset::Latex(...) methods. The inset::Latex() code
8182 ensures that hard-spaces in free-spacing paragraphs get output
8183 as spaces (rather than "~").
8185 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8187 * src/mathed/math_delim.C (draw): draw the empty placeholder
8188 delims with a onoffdash line.
8189 (struct math_deco_compare): struct that holds the "functors" used
8190 for the sort and the binary search in math_deco_table.
8191 (class init_deco_table): class used for initial sort of the
8193 (search_deco): use lower_bound to do a binary search in the
8196 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8198 * src/lyxrc.C: a small secret thingie...
8200 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8201 and to not flush the stream as often as it used to.
8203 * src/support/lyxalgo.h: new file
8204 (sorted): template function used for checking if a sequence is
8205 sorted or not. Two versions with and without user supplied
8206 compare. Uses same compare as std::sort.
8208 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8209 it and give warning on lyxerr.
8211 (struct compare_tags): struct with function operators used for
8212 checking if sorted, sorting and lower_bound.
8213 (search_kw): use lower_bound instead of manually implemented
8216 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8218 * src/insets/insetcollapsable.h: fix Clone() declaration.
8219 * src/insets/insetfoot.h: ditto.
8221 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8223 2000-03-08 Juergen Vigna <jug@sad.it>
8225 * src/insets/lyxinset.h: added owner call which tells us if
8226 this inset is inside another inset. Changed also the return-type
8227 of Editable to an enum so it tells clearer what the return-value is.
8229 * src/insets/insettext.C (computeTextRows): fixed computing of
8230 textinsets which split automatically on more rows.
8232 * src/insets/insetert.[Ch]: changed this to be of BaseType
8235 * src/insets/insetfoot.[Ch]: added footnote inset
8237 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8238 collapsable insets (like footnote, ert, ...)
8240 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8242 * src/lyxdraw.h: remvoe file
8244 * src/lyxdraw.C: remove file
8246 * src/insets/insettext.C: added <algorithm>.
8248 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8250 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8251 (matrix_cb): case MM_OK use string stream
8253 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8256 * src/mathed/math_macro.C (draw): use string stream
8257 (Metrics): use string stream
8259 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8260 directly to the ostream.
8262 * src/vspace.C (asString): use string stream.
8263 (asString): use string stream
8264 (asLatexString): use string stream
8266 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8267 setting Spacing::Other.
8269 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8270 sprintf when creating the stretch vale.
8272 * src/text2.C (alphaCounter): changed to return a string and to
8273 not use a static variable internally. Also fixed a one-off bug.
8274 (SetCounter): changed the drawing of the labels to use string
8275 streams instead of sprintf.
8277 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8278 manipulator to use a scheme that does not require library support.
8279 This is also the way it is done in the new GNU libstdc++. Should
8280 work with DEC cxx now.
8282 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8284 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8285 end. This fixes a bug.
8287 * src/mathed (all files concerned with file writing): apply the
8288 USE_OSTREAM_ONLY changes to mathed too.
8290 * src/support/DebugStream.h: make the constructor explicit.
8292 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8293 count and ostream squashed.
8295 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8297 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8299 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8300 ostringstream uses STL strings, and we might not.
8302 * src/insets/insetspecialchar.C: add using directive.
8303 * src/insets/insettext.C: ditto.
8305 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8307 * lib/layouts/seminar.layout: feeble attempt at a layout for
8308 seminar.cls, far from completet and could really use some looking
8309 at from people used to write layout files.
8311 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8312 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8313 a lot nicer and works nicely with ostreams.
8315 * src/mathed/formula.C (draw): a slightly different solution that
8316 the one posted to the list, but I think this one works too. (font
8317 size wrong in headers.)
8319 * src/insets/insettext.C (computeTextRows): some fiddling on
8320 Jürgens turf, added some comments that he should read.
8322 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8323 used and it gave compiler warnings.
8324 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8327 * src/lyx_gui.C (create_forms): do the right thing when
8328 show_banner is true/false.
8330 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8331 show_banner is false.
8333 * most file writing files: Now use iostreams to do almost all of
8334 the writing. Also instead of passing string &, we now use
8335 stringstreams. mathed output is still not adapted to iostreams.
8336 This change can be turned off by commenting out all the occurences
8337 of the "#define USE_OSTREAM_ONLY 1" lines.
8339 * src/WorkArea.C (createPixmap): don't output debug messages.
8340 (WorkArea): don't output debug messages.
8342 * lib/lyxrc.example: added a comment about the new variable
8345 * development/Code_rules/Rules: Added some more commente about how
8346 to build class interfaces and on how better encapsulation can be
8349 2000-03-03 Juergen Vigna <jug@sad.it>
8351 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8352 automatically with the width of the LyX-Window
8354 * src/insets/insettext.C (computeTextRows): fixed update bug in
8355 displaying text-insets (scrollvalues where not initialized!)
8357 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8359 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8360 id in the check of the result from lower_bound is not enough since
8361 lower_bound can return last too, and then res->id will not be a
8364 * all insets and some code that use them: I have conditionalized
8365 removed the Latex(string & out, ...) this means that only the
8366 Latex(ostream &, ...) will be used. This is a work in progress to
8367 move towards using streams for all output of files.
8369 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8372 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8374 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8375 routine (this fixes bug where greek letters were surrounded by too
8378 * src/support/filetools.C (findtexfile): change a bit the search
8379 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8380 no longer passed to kpsewhich, we may have to change that later.
8382 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8383 warning options to avoid problems with X header files (from Angus
8385 * acinclude.m4: regenerated.
8387 2000-03-02 Juergen Vigna <jug@sad.it>
8389 * src/insets/insettext.C (WriteParagraphData): Using the
8390 par->writeFile() function for writing paragraph-data.
8391 (Read): Using buffer->parseSingleLyXformat2Token()-function
8392 for parsing paragraph data!
8394 * src/buffer.C (readLyXformat2): removed all parse data and using
8395 the new parseSingleLyXformat2Token()-function.
8396 (parseSingleLyXformat2Token): added this function to parse (read)
8397 lyx-file-format (this is called also from text-insets now!)
8399 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8401 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8404 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8405 directly instead of going through a func. One very bad thing: a
8406 static LyXFindReplace, but I don't know where to place it.
8408 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8409 string instead of char[]. Also changed to static.
8410 (GetSelectionOrWordAtCursor): changed to static inline
8411 (SetSelectionOverLenChars): ditto.
8413 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8414 current_view and global variables. both classes has changed names
8415 and LyXFindReplace is not inherited from SearchForm.
8417 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8418 fl_form_search form.
8420 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8422 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8424 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8425 bound (from Kayvan).
8427 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8429 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8431 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8433 * some things that I should comment but the local pub says head to
8436 * comment out all code that belongs to the Roff code for Ascii
8437 export of tables. (this is unused)
8439 * src/LyXView.C: use correct type for global variable
8440 current_layout. (LyXTextClass::size_type)
8442 * some code to get the new insetgraphics closer to working I'd be
8443 grateful for any help.
8445 * src/BufferView2.C (insertInset): use the return type of
8446 NumberOfLayout properly. (also changes in other files)
8448 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8449 this as a test. I want to know what breaks because of this.
8451 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8453 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8455 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8456 to use a \makebox in the label, this allows proper justification
8457 with out using protected spaces or multiple hfills. Now it is
8458 "label" for left justified, "\hfill label\hfill" for center, and
8459 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8460 should be changed accordingly.
8462 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8464 * src/lyxtext.h: change SetLayout() to take a
8465 LyXTextClass::size_type instead of a char (when there is more than
8466 127 layouts in a class); also change type of copylayouttype.
8467 * src/text2.C (SetLayout): ditto.
8468 * src/LyXView.C (updateLayoutChoice): ditto.
8470 * src/LaTeX.C (scanLogFile): errors where the line number was not
8471 given just after the '!'-line were ignored (from Dekel Tsur).
8473 * lib/lyxrc.example: fix description of \date_insert_format
8475 * lib/layouts/llncs.layout: new layout, contributed by Martin
8478 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8480 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8481 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8482 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8483 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8484 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8485 paragraph.C, text.C, text2.C)
8487 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8489 * src/insets/insettext.C (LocalDispatch): remove extra break
8492 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8493 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8495 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8496 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8498 * src/insets/insetbib.h: move InsetBibkey::Holder and
8499 InsetCitation::Holder in public space.
8501 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8503 * src/insets/insettext.h: small change to get the new files from
8504 Juergen to compile (use "string", not "class string").
8506 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8507 const & as parameter to LocalDispatch, use LyXFont const & as
8508 paramter to some other func. This also had impacto on lyxinsets.h
8509 and the two mathed insets.
8511 2000-02-24 Juergen Vigna <jug@sad.it>
8514 * src/commandtags.h:
8516 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8520 * src/BufferView2.C: added/updated code for various inset-functions
8522 * src/insets/insetert.[Ch]: added implementation of InsetERT
8524 * src/insets/insettext.[Ch]: added implementation of InsetText
8526 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8527 (draw): added preliminary code for inset scrolling not finshed yet
8529 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8530 as it is in lyxfunc.C now
8532 * src/insets/lyxinset.h: Added functions for text-insets
8534 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8536 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8537 BufferView and reimplement the list as a queue put inside its own
8540 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8542 * several files: use the new interface to the "updateinsetlist"
8544 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8546 (work_area_handler): call BufferView::trippleClick on trippleclick.
8548 * src/BufferView.C (doubleClick): new function, selects word on
8550 (trippleClick): new function, selects line on trippleclick.
8552 2000-02-22 Allan Rae <rae@lyx.org>
8554 * lib/bind/xemacs.bind: buffer-previous not supported
8556 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8558 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8561 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8563 * src/bufferlist.C: get rid of current_view from this file
8565 * src/spellchecker.C: get rid of current_view from this file
8567 * src/vspace.C: get rid of current_view from this file
8568 (inPixels): added BufferView parameter for this func
8569 (asLatexCommand): added a BufferParams for this func
8571 * src/text.C src/text2.C: get rid of current_view from these
8574 * src/lyxfont.C (getFontDirection): move this function here from
8577 * src/bufferparams.C (getDocumentDirection): move this function
8580 * src/paragraph.C (getParDirection): move this function here from
8582 (getLetterDirection): ditto
8584 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8586 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8587 resize due to wrong pixmap beeing used. Also took the opurtunity
8588 to make the LyXScreen stateless on regard to WorkArea and some
8589 general cleanup in the same files.
8591 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8593 * src/Makefile.am: add missing direction.h
8595 * src/PainterBase.h: made the width functions const.
8597 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8600 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8602 * src/insets/insetlatexaccent.C (draw): make the accents draw
8603 better, at present this will only work well with iso8859-1.
8605 * several files: remove the old drawing code, now we use the new
8608 * several files: remove support for mono_video, reverse_video and
8611 2000-02-17 Juergen Vigna <jug@sad.it>
8613 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8614 int ** as we have to return the pointer, otherwise we have only
8615 NULL pointers in the returning function.
8617 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8619 * src/LaTeX.C (operator()): quote file name when running latex.
8621 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8623 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8624 (bubble tip), this removes our special handling of this.
8626 * Remove all code that is unused now that we have the new
8627 workarea. (Code that are not active when NEW_WA is defined.)
8629 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8631 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8633 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8634 nonexisting layout; correctly redirect obsoleted layouts.
8636 * lib/lyxrc.example: document \view_dvi_paper_option
8638 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8641 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8642 (PreviewDVI): handle the view_dvi_paper_option variable.
8643 [Both from Roland Krause]
8645 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8647 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8648 char const *, int, LyXFont)
8649 (text(int, int, string, LyXFont)): ditto
8651 * src/text.C (InsertCharInTable): attempt to fix the double-space
8652 feature in tables too.
8653 (BackspaceInTable): ditto.
8654 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8656 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8658 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8660 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8661 newly found text in textcache to this.
8662 (buffer): set the owner of the text put into the textcache to 0
8664 * src/insets/figinset.C (draw): fixed the drawing of figures with
8667 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8668 drawing of mathframe, hfills, protected space, table lines. I have
8669 now no outstanding drawing problems with the new Painter code.
8671 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8673 * src/PainterBase.C (ellipse, circle): do not specify the default
8676 * src/LColor.h: add using directive.
8678 * src/Painter.[Ch]: change return type of methods from Painter& to
8679 PainterBase&. Add a using directive.
8681 * src/WorkArea.C: wrap xforms callbacks in C functions
8684 * lib/layouts/foils.layout: font fix and simplifications from Carl
8687 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8689 * a lot of files: The Painter, LColor and WorkArea from the old
8690 devel branch has been ported to lyx-devel. Some new files and a
8691 lot of #ifdeffed code. The new workarea is enabled by default, but
8692 if you want to test the new Painter and LColor you have to compile
8693 with USE_PAINTER defined (do this in config.h f.ex.) There are
8694 still some rought edges, and I'd like some help to clear those
8695 out. It looks stable (loads and displays the Userguide very well).
8698 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8700 * src/buffer.C (pop_tag): revert to the previous implementation
8701 (use a global variable for both loops).
8703 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8705 * src/lyxrc.C (LyXRC): change slightly default date format.
8707 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8708 there is an English text with a footnote that starts with a Hebrew
8709 paragraph, or vice versa.
8710 (TeXFootnote): ditto.
8712 * src/text.C (LeftMargin): allow for negative values for
8713 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8716 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8717 for input encoding (cyrillic)
8719 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8721 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8724 * src/toolbar.C (set): ditto
8725 * src/insets/insetbib.C (create_form_citation_form): ditto
8727 * lib/CREDITS: added Dekel Tsur.
8729 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8730 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8731 hebrew supports files from Dekel Tsur.
8733 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8734 <tzafrir@technion.ac.il>
8736 * src/lyxrc.C: put \date_insert_format at the right place.
8738 * src/buffer.C (makeLaTeXFile): fix the handling of
8739 BufferParams::sides when writing out latex files.
8741 * src/BufferView2.C: add a "using" directive.
8743 * src/support/lyxsum.C (sum): when we use lyxstring,
8744 ostringstream::str needs an additional .c_str().
8746 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8748 * src/support/filetools.C (ChangeExtension): patch from Etienne
8751 * src/TextCache.C (show): remove const_cast and make second
8752 parameter non-const LyXText *.
8754 * src/TextCache.h: use non const LyXText in show.
8756 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8759 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8761 * src/support/lyxsum.C: rework to be more flexible.
8763 * several places: don't check if a pointer is 0 if you are going
8766 * src/text.C: remove some dead code.
8768 * src/insets/figinset.C: remove some dead code
8770 * src/buffer.C: move the BufferView funcs to BufferView2.C
8771 remove all support for insetlatexdel
8772 remove support for oldpapersize stuff
8773 made some member funcs const
8775 * src/kbmap.C: use a std::list to store the bindings in.
8777 * src/BufferView2.C: new file
8779 * src/kbsequence.[Ch]: new files
8781 * src/LyXAction.C + others: remove all trace of buffer-previous
8783 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8784 only have one copy in the binary of this table.
8786 * hebrew patch: moved some functions from LyXText to more
8787 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8789 * several files: remove support for XForms older than 0.88
8791 remove some #if 0 #endif code
8793 * src/TextCache.[Ch]: new file. Holds the textcache.
8795 * src/BufferView.C: changes to use the new TextCache interface.
8796 (waitForX): remove the now unused code.
8798 * src/BackStack.h: remove some commented code
8800 * lib/bind/emacs.bind: remove binding for buffer-previous
8802 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8804 * applied the hebrew patch.
8806 * src/lyxrow.h: make sure that all Row variables are initialized.
8808 * src/text2.C (TextHandleUndo): comment out a delete, this might
8809 introduce a memory leak, but should also help us to not try to
8810 read freed memory. We need to look at this one.
8812 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8813 (LyXParagraph): initalize footnotekind.
8815 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8816 forgot this when applying the patch. Please heed the warnings.
8818 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8819 (aka. reformat problem)
8821 * src/bufferlist.C (exists): made const, and use const_iterator
8822 (isLoaded): new func.
8823 (release): use std::find to find the correct buffer.
8825 * src/bufferlist.h: made getState a const func.
8826 made empty a const func.
8827 made exists a const func.
8830 2000-02-01 Juergen Vigna <jug@sad.it>
8832 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8834 * po/it.po: updated a bit the italian po file and also changed the
8835 'file nuovo' for newfile to 'filenuovo' without a space, this did
8838 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8839 for the new insert_date command.
8841 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8842 from jdblair, to insert a date into the current text conforming to
8843 a strftime format (for now only considering the locale-set and not
8844 the document-language).
8846 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8848 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8849 Bounds Read error seen by purify. The problem was that islower is
8850 a macros which takes an unsigned char and uses it as an index for
8851 in array of characters properties (and is thus subject to the
8855 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8856 correctly the paper sides radio buttons.
8857 (UpdateDocumentButtons): ditto.
8859 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8861 * src/kbmap.C (getsym + others): change to return unsigned int,
8862 returning a long can give problems on 64 bit systems. (I assume
8863 that int is 32bit on 64bit systems)
8865 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8867 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8868 LyXLookupString to be zero-terminated. Really fixes problems seen
8871 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8873 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8874 write a (char*)0 to the lyxerr stream.
8876 * src/lastfiles.C: move algorithm before the using statemets.
8878 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8880 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8881 complains otherwise).
8882 * src/table.C: ditto
8884 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8887 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8888 that I removed earlier... It is really needed.
8890 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8892 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8894 * INSTALL: update xforms home page URL.
8896 * lib/configure.m4: fix a bug with unreadable layout files.
8898 * src/table.C (calculate_width_of_column): add "using std::max"
8901 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8903 * several files: marked several lines with "DEL LINE", this is
8904 lines that can be deleted without changing anything.
8905 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8906 checks this anyway */
8909 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8911 * src/DepTable.C (update): add a "+" at the end when the checksum
8912 is different. (debugging string only)
8914 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8915 the next inset to not be displayed. This should also fix the list
8916 of labels in the "Insert Crossreference" dialog.
8918 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8920 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8921 when regex was not found.
8923 * src/support/lstrings.C (lowercase): use handcoded transform always.
8926 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8927 old_cursor.par->prev could be 0.
8929 * several files: changed post inc/dec to pre inc/dec
8931 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8932 write the lastfiles to file.
8934 * src/BufferView.C (buffer): only show TextCache info when debugging
8936 (resizeCurrentBuffer): ditto
8937 (workAreaExpose): ditto
8939 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8941 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8943 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8944 a bit better by removing the special case for \i and \j.
8946 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8948 * src/lyx_main.C (easyParse): remove test for bad comand line
8949 options, since this broke all xforms-related parsing.
8951 * src/kbmap.C (getsym): set return type to unsigned long, as
8952 declared in header. On an alpha, long is _not_ the same as int.
8954 * src/support/LOstream.h: add a "using std::flush;"
8956 * src/insets/figinset.C: ditto.
8958 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8960 * src/bufferlist.C (write): use blinding fast file copy instead of
8961 "a char at a time", now we are doing it the C++ way.
8963 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8964 std::list<int> instead.
8965 (addpidwait): reflect move to std::list<int>
8966 (sigchldchecker): ditto
8968 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8971 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8972 that obviously was wrong...
8974 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8975 c, this avoids warnings with purify and islower.
8977 * src/insets/figinset.C: rename struct queue to struct
8978 queue_element and rewrite to use a std::queue. gsqueue is now a
8979 std::queue<queue_element>
8980 (runqueue): reflect move to std::queue
8983 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8984 we would get "1" "0" instead of "true" "false. Also make the tostr
8987 2000-01-21 Juergen Vigna <jug@sad.it>
8989 * src/buffer.C (writeFileAscii): Disabled code for special groff
8990 handling of tabulars till I fix this in table.C
8992 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8994 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8996 * src/support/lyxlib.h: ditto.
8998 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9000 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9001 and 'j' look better. This might fix the "macron" bug that has been
9004 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9005 functions as one template function. Delete the old versions.
9007 * src/support/lyxsum.C: move using std::ifstream inside
9010 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9013 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9015 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9017 * src/insets/figinset.C (InitFigures): use new instead of malloc
9018 to allocate memory for figures and bitmaps.
9019 (DoneFigures): use delete[] instead of free to deallocate memory
9020 for figures and bitmaps.
9021 (runqueue): use new to allocate
9022 (getfigdata): use new/delete[] instead of malloc/free
9023 (RegisterFigure): ditto
9025 * some files: moved some declarations closer to first use, small
9026 whitespace changes use preincrement instead of postincrement where
9027 it does not make a difference.
9029 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9030 step on the way to use stl::containers for key maps.
9032 * src/bufferlist.h: add a typedef for const_iterator and const
9033 versions of begin and end.
9035 * src/bufferlist.[Ch]: change name of member variable _state to
9036 state_. (avoid reserved names)
9038 (getFileNames): returns the filenames of the buffers in a vector.
9040 * configure.in (ALL_LINGUAS): added ro
9042 * src/support/putenv.C: new file
9044 * src/support/mkdir.C: new file
9046 2000-01-20 Allan Rae <rae@lyx.org>
9048 * lib/layouts/IEEEtran.layout: Added several theorem environments
9050 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9051 couple of minor additions.
9053 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9054 (except for those in footnotes of course)
9056 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9058 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9060 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9061 std::sort and std::lower_bound instead of qsort and handwritten
9063 (struct compara): struct that holds the functors used by std::sort
9064 and std::lower_bound in MathedLookupBOP.
9066 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9068 * src/support/LAssert.h: do not do partial specialization. We do
9071 * src/support/lyxlib.h: note that lyx::getUserName() and
9072 lyx::date() are not in use right now. Should these be suppressed?
9074 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9075 (makeLinuxDocFile): do not put date and user name in linuxdoc
9078 * src/support/lyxlib.h (kill): change first argument to long int,
9079 since that's what solaris uses.
9081 * src/support/kill.C (kill): fix declaration to match prototype.
9083 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9084 actually check whether namespaces are supported. This is not what
9087 * src/support/lyxsum.C: add a using directive.
9089 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9091 * src/support/kill.C: if we have namespace support we don't have
9092 to include lyxlib.h.
9094 * src/support/lyxlib.h: use namespace lyx if supported.
9096 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9098 * src/support/date.C: new file
9100 * src/support/chdir.C: new file
9102 * src/support/getUserName.C: new file
9104 * src/support/getcwd.C: new file
9106 * src/support/abort.C: new file
9108 * src/support/kill.C: new file
9110 * src/support/lyxlib.h: moved all the functions in this file
9111 insede struct lyx. Added also kill and abort to this struct. This
9112 is a way to avoid the "kill is not defined in <csignal>", we make
9113 C++ wrappers for functions that are not ANSI C or ANSI C++.
9115 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9116 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9117 lyx it has been renamed to sum.
9119 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9121 * src/text.C: add using directives for std::min and std::max.
9123 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9125 * src/texrow.C (getIdFromRow): actually return something useful in
9126 id and pos. Hopefully fixes the bug with positionning of errorbox
9129 * src/lyx_main.C (easyParse): output an error and exit if an
9130 incorrect command line option has been given.
9132 * src/spellchecker.C (ispell_check_word): document a memory leak.
9134 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9135 where a "struct utimbuf" is allocated with "new" and deleted with
9138 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9140 * src/text2.C (CutSelection): don't delete double spaces.
9141 (PasteSelection): ditto
9142 (CopySelection): ditto
9144 * src/text.C (Backspace): don't delete double spaces.
9146 * src/lyxlex.C (next): fix a bug that were only present with
9147 conformant std::istream::get to read comment lines, use
9148 std::istream::getline instead. This seems to fix the problem.
9150 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9152 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9153 allowed to insert space before space" editing problem. Please read
9154 commends at the beginning of the function. Comments about usage
9157 * src/text.C (InsertChar): fix for the "not allowed to insert
9158 space before space" editing problem.
9160 * src/text2.C (DeleteEmptyParagraphMechanism): when
9161 IsEmptyTableRow can only return false this last "else if" will
9162 always be a no-op. Commented out.
9164 * src/text.C (RedoParagraph): As far as I can understand tmp
9165 cursor is not really needed.
9167 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9168 present it could only return false anyway.
9169 (several functions): Did something not so smart...added a const
9170 specifier on a lot of methods.
9172 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9173 and add a tmp->text.resize. The LyXParagraph constructor does the
9175 (BreakParagraphConservative): ditto
9177 * src/support/path.h (Path): add a define so that the wrong usage
9178 "Path("/tmp") will be flagged as a compilation error:
9179 "`unnamed_Path' undeclared (first use this function)"
9181 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9183 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9184 which was bogus for several reasons.
9186 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9190 * autogen.sh: do not use "type -path" (what's that anyway?).
9192 * src/support/filetools.C (findtexfile): remove extraneous space
9193 which caused a kpsewhich warning (at least with kpathsea version
9196 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9198 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9200 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9202 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9204 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9206 * src/paragraph.C (BreakParagraph): do not reserve space on text
9207 if we don't need to (otherwise, if pos_end < pos, we end up
9208 reserving huge amounts of memory due to bad unsigned karma).
9209 (BreakParagraphConservative): ditto, although I have not seen
9210 evidence the bug can happen here.
9212 * src/lyxparagraph.h: add a using std::list.
9214 2000-01-11 Juergen Vigna <jug@sad.it>
9216 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9219 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9221 * src/vc-backend.C (doVCCommand): change to be static and take one
9222 more parameter: the path to chdir too be fore executing the command.
9223 (retrive): new function equiv to "co -r"
9225 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9226 file_not_found_hook is true.
9228 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9230 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9231 if a file is readwrite,readonly...anything else.
9233 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9235 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9236 (CreatePostscript): name change from MenuRunDVIPS (or something)
9237 (PreviewPostscript): name change from MenuPreviewPS
9238 (PreviewDVI): name change from MenuPreviewDVI
9240 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9241 \view_pdf_command., \pdf_to_ps_command
9243 * lib/configure.m4: added search for PDF viewer, and search for
9244 PDF to PS converter.
9245 (lyxrc.defaults output): add \pdflatex_command,
9246 \view_pdf_command and \pdf_to_ps_command.
9248 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9250 * src/bufferlist.C (write): we don't use blocksize for anything so
9253 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9255 * src/support/block.h: disable operator T* (), since it causes
9256 problems with both compilers I tried. See comments in the file.
9258 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9261 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9262 variable LYX_DIR_10x to LYX_DIR_11x.
9264 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9266 * INSTALL: document --with-lyxname.
9269 * configure.in: new configure flag --with-lyxname which allows to
9270 choose the name under which lyx is installed. Default is "lyx", of
9271 course. It used to be possible to do this with --program-suffix,
9272 but the later has in fact a different meaning for autoconf.
9274 * src/support/lstrings.h (lstrchr): reformat a bit.
9276 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9277 * src/mathed/math_defs.h: ditto.
9279 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9281 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9282 true, decides if we create a backup file or not when saving. New
9283 tag and variable \pdf_mode, defaults to false. New tag and
9284 variable \pdflatex_command, defaults to pdflatex. New tag and
9285 variable \view_pdf_command, defaults to xpdf. New tag and variable
9286 \pdf_to_ps_command, defaults to pdf2ps.
9288 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9290 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9291 does not have a BufferView.
9292 (unlockInset): ditto + don't access the_locking_inset if the
9293 buffer does not have a BufferView.
9295 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9296 certain circumstances so that we don't continue a keyboard
9297 operation long after the key was released. Try f.ex. to load a
9298 large document, press PageDown for some seconds and then release
9299 it. Before this change the document would contine to scroll for
9300 some time, with this change it stops imidiatly.
9302 * src/support/block.h: don't allocate more space than needed. As
9303 long as we don't try to write to the arr[x] in a array_type arr[x]
9304 it is perfectly ok. (if you write to it you might segfault).
9305 added operator value_type*() so that is possible to pass the array
9306 to functions expecting a C-pointer.
9308 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9311 * intl/*: updated to gettext 0.10.35, tried to add our own
9312 required modifications. Please verify.
9314 * po/*: updated to gettext 0.10.35, tried to add our own required
9315 modifications. Please verify.
9317 * src/support/lstrings.C (tostr): go at fixing the problem with
9318 cxx and stringstream. When stringstream is used return
9319 oss.str().c_str() so that problems with lyxstring and basic_string
9320 are avoided. Note that the best solution would be for cxx to use
9321 basic_string all the way, but it is not conformant yet. (it seems)
9323 * src/lyx_cb.C + other files: moved several global functions to
9324 class BufferView, some have been moved to BufferView.[Ch] others
9325 are still located in lyx_cb.C. Code changes because of this. (part
9326 of "get rid of current_view project".)
9328 * src/buffer.C + other files: moved several Buffer functions to
9329 class BufferView, the functions are still present in buffer.C.
9330 Code changes because of this.
9332 * config/lcmessage.m4: updated to most recent. used when creating
9335 * config/progtest.m4: updated to most recent. used when creating
9338 * config/gettext.m4: updated to most recent. applied patch for
9341 * config/gettext.m4.patch: new file that shows what changes we
9342 have done to the local copy of gettext.m4.
9344 * config/libtool.m4: new file, used in creation of acinclude.m4
9346 * config/lyxinclude.m4: new file, this is the lyx created m4
9347 macros, used in making acinclude.m4.
9349 * autogen.sh: GNU m4 discovered as a separate task not as part of
9350 the lib/configure creation.
9351 Generate acinlucde from files in config. Actually cat
9352 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9353 easier to upgrade .m4 files that really are external.
9355 * src/Spacing.h: moved using std::istringstream to right after
9356 <sstream>. This should fix the problem seen with some compilers.
9358 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9360 * src/lyx_cb.C: began some work to remove the dependency a lot of
9361 functions have on BufferView::text, even if not really needed.
9362 (GetCurrentTextClass): removed this func, it only hid the
9365 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9366 forgot this in last commit.
9368 * src/Bullet.C (bulletEntry): use static char const *[] for the
9369 tables, becuase of this the return arg had to change to string.
9371 (~Bullet): removed unneeded destructor
9373 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9374 (insetSleep): moved from Buffer
9375 (insetWakeup): moved from Buffer
9376 (insetUnlock): moved from Buffer
9378 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9379 from Buffer to BufferView.
9381 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9383 * config/ltmain.sh: updated to version 1.3.4 of libtool
9385 * config/ltconfig: updated to version 1.3.4 of libtool
9387 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9390 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9391 Did I get that right?
9393 * src/lyxlex.h: add a "using" directive or two.
9394 * src/Spacing.h: ditto.
9395 * src/insets/figinset.C: ditto.
9396 * src/support/filetools.C: ditto.
9397 * src/support/lstrings.C: ditto.
9398 * src/BufferView.C: ditto.
9399 * src/bufferlist.C: ditto.
9400 * src/lyx_cb.C: ditto.
9401 * src/lyxlex.C: ditto.
9403 * NEWS: add some changes for 1.1.4.
9405 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9407 * src/BufferView.C: first go at a TextCache to speed up switching
9410 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9412 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9413 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9414 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9415 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9418 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9419 members of the struct are correctly initialized to 0 (detected by
9421 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9422 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9424 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9425 pidwait, since it was allocated with "new". This was potentially
9426 very bad. Thanks to Michael Schmitt for running purify for us.
9429 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9431 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9433 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9435 1999-12-30 Allan Rae <rae@lyx.org>
9437 * lib/templates/IEEEtran.lyx: minor change
9439 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9440 src/mathed/formula.C (LocalDispatch): askForText changes
9442 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9443 know when a user has cancelled input. Fixes annoying problems with
9444 inserting labels and version control.
9446 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9448 * src/support/lstrings.C (tostr): rewritten to use strstream and
9451 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9453 * src/support/filetools.C (IsFileWriteable): use fstream to check
9454 (IsDirWriteable): use fileinfo to check
9456 * src/support/filetools.h (FilePtr): whole class deleted
9458 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9460 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9462 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9464 * src/bufferlist.C (write): use ifstream and ofstream instead of
9467 * src/Spacing.h: use istrstream instead of sscanf
9469 * src/mathed/math_defs.h: change first arg to istream from FILE*
9471 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9473 * src/mathed/math_parser.C: have yyis to be an istream
9474 (LexGetArg): use istream (yyis)
9476 (mathed_parse): ditto
9477 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9479 * src/mathed/formula.C (Read): rewritten to use istream
9481 * src/mathed/formulamacro.C (Read): rewritten to use istream
9483 * src/lyxlex.h (~LyXLex): deleted desturctor
9484 (getStream): new function, returns an istream
9485 (getFile): deleted funtion
9486 (IsOK): return is.good();
9488 * src/lyxlex.C (LyXLex): delete file and owns_file
9489 (setFile): open an filebuf and assign that to a istream instead of
9491 (setStream): new function, takes an istream as arg.
9492 (setFile): deleted function
9493 (EatLine): rewritten us use istream instead of FILE*
9497 * src/table.C (LyXTable): use istream instead of FILE*
9498 (Read): rewritten to take an istream instead of FILE*
9500 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9502 * src/buffer.C (Dispatch): remove an extraneous break statement.
9504 * src/support/filetools.C (QuoteName): change to do simple
9505 'quoting'. More work is necessary. Also changed to do nothing
9506 under emx (needs fix too).
9507 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9509 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9510 config.h.in to the AC_DEFINE_UNQUOTED() call.
9511 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9512 needs char * as argument (because Solaris 7 declares it like
9515 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9516 remove definition of BZERO.
9518 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9520 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9521 defined, "lyxregex.h" if not.
9523 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9525 (REGEX): new variable that is set to regex.c lyxregex.h when
9526 AM_CONDITIONAL USE_REGEX is set.
9527 (libsupport_la_SOURCES): add $(REGEX)
9529 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9532 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9535 * configure.in: add call to LYX_REGEX
9537 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9538 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9540 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9542 * lib/bind/fi_menus.bind: new file, from
9543 pauli.virtanen@saunalahti.fi.
9545 * src/buffer.C (getBibkeyList): pass the parameter delim to
9546 InsetInclude::getKeys and InsetBibtex::getKeys.
9548 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9549 is passed to Buffer::getBibkeyList
9551 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9552 instead of the hardcoded comma.
9554 * src/insets/insetbib.C (getKeys): make sure that there are not
9555 leading blanks in bibtex keys. Normal latex does not care, but
9556 harvard.sty seems to dislike blanks at the beginning of citation
9557 keys. In particular, the retturn value of the function is
9559 * INSTALL: make it clear that libstdc++ is needed and that gcc
9560 2.7.x probably does not work.
9562 * src/support/filetools.C (findtexfile): make debug message go to
9564 * src/insets/insetbib.C (getKeys): ditto
9566 * src/debug.C (showTags): make sure that the output is correctly
9569 * configure.in: add a comment for TWO_COLOR_ICON define.
9571 * acconfig.h: remove all the entries that already defined in
9572 configure.in or acinclude.m4.
9574 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9575 to avoid user name, date and copyright.
9577 1999-12-21 Juergen Vigna <jug@sad.it>
9579 * src/table.C (Read): Now read bogus row format informations
9580 if the format is < 5 so that afterwards the table can
9581 be read by lyx but without any format-info. Fixed the
9582 crash we experienced when not doing this.
9584 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9586 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9587 (RedoDrawingOfParagraph): ditto
9588 (RedoParagraphs): ditto
9589 (RemoveTableRow): ditto
9591 * src/text.C (Fill): rename arg paperwidth -> paper_width
9593 * src/buffer.C (insertLyXFile): rename var filename -> fname
9594 (writeFile): rename arg filename -> fname
9595 (writeFileAscii): ditto
9596 (makeLaTeXFile): ditto
9597 (makeLinuxDocFile): ditto
9598 (makeDocBookFile): ditto
9600 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9603 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9605 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9608 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9609 compiled by a C compiler not C++.
9611 * src/layout.h (LyXTextClass): added typedef for const_iterator
9612 (LyXTextClassList): added typedef for const_iterator + member
9613 functions begin and end.
9615 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9616 iterators to fill the choice_class.
9617 (updateLayoutChoice): rewritten to use iterators to fill the
9618 layoutlist in the toolbar.
9620 * src/BufferView.h (BufferView::work_area_width): removed unused
9623 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9625 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9626 (sgmlCloseTag): ditto
9628 * src/support/lstrings.h: return type of countChar changed to
9631 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9632 what version of this func to use. Also made to return unsigned int.
9634 * configure.in: call LYX_STD_COUNT
9636 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9637 conforming std::count.
9639 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9641 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9642 and a subscript would give bad display (patch from Dekel Tsur
9643 <dekel@math.tau.ac.il>).
9645 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9647 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9650 * src/chset.h: add a few 'using' directives
9652 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9653 triggered when no buffer is active
9655 * src/layout.C: removed `break' after `return' in switch(), since
9658 * src/lyx_main.C (init): make sure LyX can be ran in place even
9659 when libtool has done its magic with shared libraries. Fix the
9660 test for the case when the system directory has not been found.
9662 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9663 name for the latex file.
9664 (MenuMakeHTML): ditto
9666 * src/buffer.h: add an optional boolean argument, which is passed
9669 1999-12-20 Allan Rae <rae@lyx.org>
9671 * lib/templates/IEEEtran.lyx: small correction and update.
9673 * configure.in: Attempted to use LYX_PATH_HEADER
9675 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9677 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9678 input from JMarc. Now use preprocessor to find the header.
9679 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9680 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9681 LYX_STL_STRING_FWD. See comments in file.
9683 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9685 * The global MiniBuffer * minibuffer variable is dead.
9687 * The global FD_form_main * fd_form_main variable is dead.
9689 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9691 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9693 * src/table.h: add the LOstream.h header
9694 * src/debug.h: ditto
9696 * src/LyXAction.h: change the explaination of the ReadOnly
9697 attribute: is indicates that the function _can_ be used.
9699 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9702 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9704 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9710 * src/paragraph.C (GetWord): assert on pos>=0
9713 * src/support/lyxstring.C: condition the use of an invariant on
9715 * src/support/lyxstring.h: ditto
9717 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9718 Use LAssert.h instead of plain assert().
9720 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9722 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9723 * src/support/filetools.C: ditto
9725 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9728 * INSTALL: document the new configure flags
9730 * configure.in: suppress --with-debug; add --enable-assertions
9732 * acinclude.m4: various changes in alignment of help strings.
9734 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9736 * src/kbmap.C: commented out the use of the hash map in kb_map,
9737 beginning of movement to a stl::container.
9739 * several files: removed code that was not in effect when
9740 MOVE_TEXT was defined.
9742 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9743 for escaping should not be used. We can discuss if the string
9744 should be enclosed in f.ex. [] instead of "".
9746 * src/trans_mgr.C (insert): use the new returned value from
9747 encodeString to get deadkeys and keymaps done correctly.
9749 * src/chset.C (encodeString): changed to return a pair, to tell
9750 what to use if we know the string.
9752 * src/lyxscreen.h (fillArc): new function.
9754 * src/FontInfo.C (resize): rewritten to use more std::string like
9755 structore, especially string::replace.
9757 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9760 * configure.in (chmod +x some scripts): remove config/gcc-hack
9762 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9764 * src/buffer.C (writeFile): change once again the top comment in a
9765 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9766 instead of an hardcoded version number.
9767 (makeDocBookFile): ditto
9769 * src/version.h: add new define LYX_DOCVERSION
9771 * po/de.po: update from Pit Sütterlin
9772 * lib/bind/de_menus.bind: ditto.
9774 * src/lyxfunc.C (Dispatch): call MenuExport()
9775 * src/buffer.C (Dispatch): ditto
9777 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9778 LyXFunc::Dispatch().
9779 (MenuExport): new function, moved from
9780 LyXFunc::Dispatch().
9782 * src/trans_mgr.C (insert): small cleanup
9783 * src/chset.C (loadFile): ditto
9785 * lib/kbd/iso8859-1.cdef: add missing backslashes
9787 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9789 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9790 help with placing the manually drawn accents better.
9792 (Draw): x2 and hg changed to float to minimize rounding errors and
9793 help place the accents better.
9795 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9796 unsigned short to char is just wrong...cast the char to unsigned
9797 char instead so that the two values can compare sanely. This
9798 should also make the display of insetlatexaccents better and
9799 perhaps also some other insets.
9801 (lbearing): new function
9804 1999-12-15 Allan Rae <rae@lyx.org>
9806 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9807 header that provides a wrapper around the very annoying SGI STL header
9810 * src/support/lyxstring.C, src/LString.h:
9811 removed old SGI-STL-compatability attempts.
9813 * configure.in: Use LYX_STL_STRING_FWD.
9815 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9816 stl_string_fwd.h is around and try to determine it's location.
9817 Major improvement over previous SGI STL 3.2 compatability.
9818 Three small problems remain with this function due to my zero
9819 knowledge of autoconf. JMarc and lgb see the comments in the code.
9821 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9823 * src/broken_const.h, config/hack-gcc, config/README: removed
9825 * configure.in: remove --with-gcc-hack option; do not call
9828 * INSTALL: remove documentation of --with-broken-const and
9831 * acconfig.h: remove all trace of BROKEN_CONST define
9833 * src/buffer.C (makeDocBookFile): update version number in output
9835 (SimpleDocBookOnePar): fix an assert when trying to a character
9836 access beyond string length
9839 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9841 * po/de.po: fix the Export menu
9843 * lyx.man: update the description of -dbg
9845 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9846 (commandLineHelp): updated
9847 (easyParse): show list of available debug levels if -dbg is passed
9850 * src/Makefile.am: add debug.C
9852 * src/debug.h: moved some code to debug.C
9854 * src/debug.C: new file. Contains code to set and show debug
9857 * src/layout.C: remove 'break' after 'continue' in switch
9858 statements, since these cannot be reached.
9860 1999-12-13 Allan Rae <rae@lyx.org>
9862 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9863 (in_word_set): hash() -> math_hash()
9865 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9867 * acconfig.h: Added a test for whether we are using exceptions in the
9868 current compilation run. If so USING_EXCEPTIONS is defined.
9870 * config.in: Check for existance of stl_string_fwd.h
9871 * src/LString.h: If compiling --with-included-string and SGI's
9872 STL version 3.2 is present (see above test) we need to block their
9873 forward declaration of string and supply a __get_c_string().
9874 However, it turns out this is only necessary if compiling with
9875 exceptions enabled so I've a bit more to add yet.
9877 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9878 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9879 src/support/LRegex.h, src/undo.h:
9880 Shuffle the order of the included files a little to ensure that
9881 LString.h gets included before anything that includes stl_string_fwd.h
9883 * src/support/lyxstring.C: We need to #include LString.h instead of
9884 lyxstring.h to get the necessary definition of __get_c_string.
9885 (__get_c_string): New function. This is defined static just like SGI's
9886 although why they need to do this I'm not sure. Perhaps it should be
9887 in lstrings.C instead.
9889 * lib/templates/IEEEtran.lyx: New template file.
9891 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9893 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9894 * intl/Makefile.in (MKINSTALLDIRS): ditto
9896 * src/LyXAction.C (init): changed to hold the LFUN data in a
9897 automatic array in stead of in callso to newFunc, this speeds up
9898 compilation a lot. Also all the memory used by the array is
9899 returned when the init is completed.
9901 * a lot of files: compiled with -Wold-style-cast, changed most of
9902 the reported offenders to C++ style casts. Did not change the
9903 offenders in C files.
9905 * src/trans.h (Match): change argument type to unsigned int.
9907 * src/support/DebugStream.C: fix some types on the streambufs so
9908 that it works on a conforming implementation.
9910 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9912 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9914 * src/support/lyxstring.C: remove the inline added earlier since
9915 they cause a bunch of unsatisfied symbols when linking with dec
9916 cxx. Cxx likes to have the body of inlines at the place where they
9919 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9920 accessing negative bounds in array. This fixes the crash when
9921 inserting accented characters.
9922 * src/trans.h (Match): ditto
9924 * src/buffer.C (Dispatch): since this is a void, it should not try
9925 to return anything...
9927 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9929 * src/buffer.h: removed the two friends from Buffer. Some changes
9930 because of this. Buffer::getFileName and Buffer::setFileName
9931 renamed to Buffer::fileName() and Buffer::fileName(...).
9933 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9935 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9936 and Buffer::update(short) to BufferView. This move is currently
9937 controlled by a define MOVE_TEXT, this will be removed when all
9938 shows to be ok. This move paves the way for better separation
9939 between buffer contents and buffer view. One side effect is that
9940 the BufferView needs a rebreak when swiching buffers, if we want
9941 to avoid this we can add a cache that holds pointers to LyXText's
9942 that is not currently in use.
9944 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9947 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9949 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9951 * lyx_main.C: new command line option -x (or --execute) and
9952 -e (or --export). Now direct conversion from .lyx to .tex
9953 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9954 Unfortunately, X is still needed and the GUI pops up during the
9957 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9959 * src/Spacing.C: add a using directive to bring stream stuff into
9961 * src/paragraph.C: ditto
9962 * src/buffer.C: ditto
9964 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9965 from Lars' announcement).
9967 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9968 example files from Tino Meinen.
9970 1999-12-06 Allan Rae <rae@lyx.org>
9972 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9974 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9976 * src/support/lyxstring.C: added a lot of inline for no good
9979 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9980 latexWriteEndChanges, they were not used.
9982 * src/layout.h (operator<<): output operator for PageSides
9984 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9986 * some example files: loaded in LyX 1.0.4 and saved again to update
9987 certain constructs (table format)
9989 * a lot of files: did the change to use fstream/iostream for all
9990 writing of files. Done with a close look at Andre Poenitz's patch.
9992 * some files: whitespace changes.
9994 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9996 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9997 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9998 architecture, we provide our own. It is used unconditionnally, but
9999 I do not think this is a performance problem. Thanks to Angus
10000 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10001 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10003 (GetInset): use my_memcpy.
10007 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10008 it is easier to understand, but it uses less TeX-only constructs now.
10010 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10011 elements contain spaces
10013 * lib/configure: regenerated
10015 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10016 elements contain spaces; display the list of programs that are
10019 * autogen.sh: make sure lib/configure is executable
10021 * lib/examples/*: rename the tutorial examples to begin with the
10022 two-letters language code.
10024 * src/lyxfunc.C (getStatus): do not query current font if no
10027 * src/lyx_cb.C (RunScript): use QuoteName
10028 (MenuRunDvips): ditto
10029 (PrintApplyCB): ditto
10031 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10032 around argument, so that it works well with the current shell.
10033 Does not work properly with OS/2 shells currently.
10035 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10036 * src/LyXSendto.C (SendtoApplyCB): ditto
10037 * src/lyxfunc.C (Dispatch): ditto
10038 * src/buffer.C (runLaTeX): ditto
10039 (runLiterate): ditto
10040 (buildProgram): ditto
10042 * src/lyx_cb.C (RunScript): ditto
10043 (MenuMakeLaTeX): ditto
10045 * src/buffer.h (getLatexName): new method
10047 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10049 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10051 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10052 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10053 (create_math_panel): ditto
10055 * src/lyxfunc.C (getStatus): re-activate the code which gets
10056 current font and cursor; add test for export to html.
10058 * src/lyxrc.C (read): remove unreachable break statements; add a
10061 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10063 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10065 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10066 introduced by faulty regex.
10067 * src/buffer.C: ditto
10068 * src/lastfiles.C: ditto
10069 * src/paragraph.C: ditto
10070 * src/table.C: ditto
10071 * src/vspace.C: ditto
10072 * src/insets/figinset.C: ditto
10073 Note: most of these is absolutely harmless, except the one in
10074 src/mathed formula.C.
10076 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10078 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10079 operation, yielding correct results for the reLyX command.
10081 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10083 * src/support/filetools.C (ExpandPath): removed an over eager
10085 (ReplaceEnvironmentPath): ditto
10087 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10088 shows that we are doing something fishy in our code...
10089 (BubblePost): ditto
10092 * src/lyxrc.C (read): use a double switch trick to get more help
10093 from the compiler. (the same trick is used in layout.C)
10094 (write): new function. opens a ofstream and pass that to output
10095 (output): new function, takes a ostream and writes the lyxrc
10096 elemts to it. uses a dummy switch to make sure no elements are
10099 * src/lyxlex.h: added a struct pushpophelper for use in functions
10100 with more than one exit point.
10102 * src/lyxlex.[Ch] (GetInteger): made it const
10106 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10108 * src/layout.[hC] : LayoutTags splitted into several enums, new
10109 methods created, better error handling cleaner use of lyxlex. Read
10112 * src/bmtable.[Ch]: change some member prototypes because of the
10113 image const changes.
10115 * commandtags.h, src/LyXAction.C (init): new function:
10116 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10117 This file is not read automatically but you can add \input
10118 preferences to your lyxrc if you want to. We need to discuss how
10121 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10122 in .aux, also remove .bib and .bst files from dependencies when
10125 * src/BufferView.C, src/LyXView.C: add const_cast several places
10126 because of changes to images.
10128 * lib/images/*: same change as for images/*
10130 * lib/lyxrc.example: Default for accept_compound is false not no.
10132 * images/*: changed to be const, however I have som misgivings
10133 about this change so it might be changed back.
10135 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10137 * lib/configure, po/POTFILES.in: regenerated
10139 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10141 * config/lib_configure.m4: removed
10143 * lib/configure.m4: new file (was config/lib_configure.m4)
10145 * configure.in: do not test for rtti, since we do not use it.
10147 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10149 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10150 doubling of allocated space scheme. This makes it faster for large
10151 strings end to use less memory for small strings. xtra rememoved.
10153 * src/insets/figinset.C (waitalarm): commented out.
10154 (GhostscriptMsg): use static_cast
10155 (GhostscriptMsg): use new instead of malloc to allocate memory for
10156 cmap. also delete the memory after use.
10158 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10160 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10161 for changes in bibtex database or style.
10162 (runBibTeX): remove all .bib and .bst files from dep before we
10164 (run): use scanAuc in when dep file already exist.
10166 * src/DepTable.C (remove_files_with_extension): new method
10167 (exist): new method
10169 * src/DepTable.[Ch]: made many of the methods const.
10171 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10173 * src/bufferparams.C: make sure that the default textclass is
10174 "article". It used to be the first one by description order, but
10175 now the first one is "docbook".
10177 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10178 string; call Debug::value.
10179 (easyParse): pass complete argument to setDebuggingLevel().
10181 * src/debug.h (value): fix the code that parses debug levels.
10183 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10186 * src/LyXAction.C: use Debug::ACTION as debug channel.
10188 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10190 * NEWS: updated for the future 1.1.3 release.
10192 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10193 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10194 it should. This is of course a controversial change (since many
10195 people will find that their lyx workscreen is suddenly full of
10196 red), but done for the sake of correctness.
10198 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10199 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10201 * src/insets/inseterror.h, src/insets/inseturl.h,
10202 src/insets/insetinfo.h, src/insets/figinset.h,
10203 src/mathed/formulamacro.h, src/mathed/math_macro.h
10204 (EditMessage): add a missing const and add _() to make sure that
10205 translation happens
10207 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10208 src/insets/insetbib.C, src/support/filetools.C: add `using'
10209 directives for cxx.
10211 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10212 doing 'Insert index of last word' at the beginning of a paragraph.
10214 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10216 * several files: white-space changes.
10218 * src/mathed/formula.C: removed IsAlpha and IsDigit
10220 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10221 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10224 * src/insets/figinset.C (GetPSSizes): don't break when
10225 "EndComments" is seen. But break when a boundingbox is read.
10227 * all classes inherited from Inset: return value of Clone
10228 changed back to Inset *.
10230 * all classes inherited form MathInset: return value of Clone
10231 changed back to MathedInset *.
10233 * src/insets/figinset.C (runqueue): use a ofstream to output the
10234 gs/ps file. Might need some setpresicion or setw. However I can
10235 see no problem with the current code.
10236 (runqueue): use sleep instead of the alarm/signal code. I just
10237 can't see the difference.
10239 * src/paragraph.C (LyXParagraph): reserve space in the new
10240 paragraph and resize the inserted paragraph to just fit.
10242 * src/lyxfunc.h (operator|=): added operator for func_status.
10244 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10245 check for readable file.
10247 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10248 check for readable file.
10249 (MenuMakeLinuxDoc): ditto
10250 (MenuMakeDocBook): ditto
10251 (MenuMakeAscii): ditto
10252 (InsertAsciiFile): split the test for openable and readable
10254 * src/bmtable.C (draw_bitmaptable): use
10255 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10257 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10258 findtexfile from LaTeX to filetools.
10260 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10261 instead of FilePtr. Needs to be verified by a literate user.
10263 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10265 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10266 (EditMessage): likewise.
10268 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10269 respectively as \textasciitilde and \textasciicircum.
10271 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10273 * src/support/lyxstring.h: made the methods that take iterators
10274 use const_iterator.
10276 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10277 (regexMatch): made is use the real regex class.
10279 * src/support/Makefile.am: changed to use libtool
10281 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10283 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10285 (MathIsInset ++): changed several macros to be inline functions
10288 * src/mathed/Makefile.am: changed to use libtool
10290 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10292 * src/insets/inset* : Clone changed to const and return type is
10293 the true insettype not just Inset*.
10295 * src/insets/Makefile.am: changed to use libtool
10297 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10299 * src/undo.[Ch] : added empty() and changed some of the method
10302 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10304 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10305 setID use block<> for the bullets array, added const several places.
10307 * src/lyxfunc.C (getStatus): new function
10309 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10310 LyXAction, added const to several funtions.
10312 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10313 a std::map, and to store the dir items in a vector.
10315 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10318 * src/LyXView.[Ch] + other files : changed currentView to view.
10320 * src/LyXAction.[Ch] : ported from the old devel branch.
10322 * src/.cvsignore: added .libs and a.out
10324 * configure.in : changes to use libtool.
10326 * acinclude.m4 : inserted libtool.m4
10328 * .cvsignore: added libtool
10330 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10332 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10333 file name in insets and mathed directories (otherwise the
10334 dependency is not taken in account under cygwin).
10336 * src/text2.C (InsertString[AB]): make sure that we do not try to
10337 read characters past the string length.
10339 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10341 * lib/doc/LaTeXConfig.lyx.in,
10342 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10344 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10345 file saying who created them and when this heppened; this is
10346 useless and annoys tools like cvs.
10348 * lib/layouts/g-brief-{en,de}.layout,
10349 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10350 from Thomas Hartkens <thomas@hartkens.de>.
10352 * src/{insets,mathed}/Makefile.am: do not declare an empty
10353 LDFLAGS, so that it can be set at configure time (useful on Irix
10356 * lib/reLyX/configure.in: make sure that the prefix is set
10357 correctly in LYX_DIR.
10359 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10361 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10362 be used by 'command-sequence' this allows to bind a key to a
10363 sequence of LyX-commands
10364 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10366 * src/LyXAction.C: add "command-sequence"
10368 * src/LyXFunction.C: handling of "command-sequence"
10370 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10371 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10373 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10375 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10377 * src/buffer.C (writeFile): Do not output a comment giving user
10378 and date at the beginning of a .lyx file. This is useless and
10379 annoys cvs anyway; update version number to 1.1.
10381 * src/Makefile.am (LYX_DIR): add this definition, so that a
10382 default path is hardcoded in LyX.
10384 * configure.in: Use LYX_GNU_GETTEXT.
10386 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10387 AM_GNU_GETTEXT with a bug fixed.
10389 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10391 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10393 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10394 which is used to point to LyX data is now LYX_DIR_11x.
10396 * lyx.man: convert to a unix text file; small updates.
10398 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10400 * src/support/LSubstring.[Ch]: made the second arg of most of the
10401 constructors be a const reference.
10403 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10406 * src/support/lyxstring.[Ch] (swap): added missing member function
10407 and specialization of swap(str, str);
10409 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10411 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10412 trace of the old one.
10414 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10415 put the member definitions in undo.C.
10417 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10418 NEW_TEXT and have now only code that was included when this was
10421 * src/intl.C (LCombo): use static_cast
10423 (DispatchCallback): ditto
10425 * src/definitions.h: removed whole file
10427 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10429 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10430 parsing and stores in a std:map. a regex defines the file format.
10431 removed unneeded members.
10433 * src/bufferparams.h: added several enums from definitions.h here.
10434 Removed unsused destructor. Changed some types to use proper enum
10435 types. use block to have the temp_bullets and user_defined_bullets
10436 and to make the whole class assignable.
10438 * src/bufferparams.C (Copy): removed this functions, use a default
10439 assignment instead.
10441 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10444 * src/buffer.C (readLyXformat2): commend out all that have with
10445 oldpapersize to do. also comment out all that hve to do with
10446 insetlatex and insetlatexdel.
10447 (setOldPaperStuff): commented out
10449 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10451 * src/LyXAction.C: remove use of inset-latex-insert
10453 * src/mathed/math_panel.C (button_cb): use static_cast
10455 * src/insets/Makefile.am (insets_o_SOURCES): removed
10458 * src/support/lyxstring.C (helper): use the unsigned long
10459 specifier, UL, instead of a static_cast.
10461 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10463 * src/support/block.h: new file. to be used as a c-style array in
10464 classes, so that the class can be assignable.
10466 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10468 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10469 NULL, make sure to return an empty string (it is not possible to
10470 set a string to NULL).
10472 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10474 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10476 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10478 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10479 link line, so that Irix users (for example) can set it explicitely to
10482 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10483 it can be overidden at make time (static or dynamic link, for
10486 * src/vc-backend.C, src/LaTeXFeatures.h,
10487 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10488 statements to bring templates to global namespace.
10490 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10492 * src/support/lyxstring.C (operator[] const): make it standard
10495 * src/minibuffer.C (Init): changed to reflect that more
10496 information is given from the lyxvc and need not be provided here.
10498 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10500 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10502 * src/LyXView.C (UpdateTimerCB): use static_cast
10503 (KeyPressMask_raw_callback): ditto
10505 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10506 buffer_, a lot of changes because of this. currentBuffer() ->
10507 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10508 also changes to other files because of this.
10510 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10512 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10513 have no support for RCS and partial support for CVS, will be
10516 * src/insets/ several files: changes because of function name
10517 changes in Bufferview and LyXView.
10519 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10521 * src/support/LSubstring.[Ch]: new files. These implement a
10522 Substring that can be very convenient to use. i.e. is this
10524 string a = "Mary had a little sheep";
10525 Substring(a, "sheep") = "lamb";
10526 a is now "Mary has a little lamb".
10528 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10529 out patterns and subpatterns of strings. It is used by LSubstring
10530 and also by vc-backend.C
10532 * src/support/lyxstring.C: went over all the assertions used and
10533 tried to correct the wrong ones and flag which of them is required
10534 by the standard. some bugs found because of this. Also removed a
10535 couple of assertions.
10537 * src/support/Makefile.am (libsupport_a_SOURCES): added
10538 LSubstring.[Ch] and LRegex.[Ch]
10540 * src/support/FileInfo.h: have struct stat buf as an object and
10541 not a pointer to one, some changes because of this.
10543 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10544 information in layout when adding the layouts preamble to the
10545 textclass preamble.
10547 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10550 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10551 because of bug in OS/2.
10553 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10555 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10556 \verbatim@font instead of \ttfamily, so that it can be redefined.
10558 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10559 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10560 src/layout.h, src/text2.C: add 'using' directive to bring the
10561 STL templates we need from the std:: namespace to the global one.
10562 Needed by DEC cxx in strict ansi mode.
10564 * src/support/LIstream.h,src/support/LOstream.h,
10565 src/support/lyxstring.h,src/table.h,
10566 src/lyxlookup.h: do not include <config.h> in header
10567 files. This should be done in the .C files only.
10569 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10573 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10575 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10576 from Kayvan to fix the tth invokation.
10578 * development/lyx.spec.in: updates from Kayvan to reflect the
10579 changes of file names.
10581 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10583 * src/text2.C (InsertStringB): use std::copy
10584 (InsertStringA): use std::copy
10586 * src/bufferlist.C: use a vector to store the buffers in. This is
10587 an internal change and should not affect any other thing.
10589 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10592 * src/text.C (Fill): fix potential bug, one off bug.
10594 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10596 * src/Makefile.am (lyx_main.o): add more files it depends on.
10598 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10600 * src/support/lyxstring.C: use size_t for the reference count,
10601 size, reserved memory and xtra.
10602 (internal_compare): new private member function. Now the compare
10603 functions should work for std::strings that have embedded '\0'
10605 (compare): all compare functions rewritten to use
10608 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10610 * src/support/lyxstring.C (compare): pass c_str()
10611 (compare): pass c_str
10612 (compare): pass c_str
10614 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10616 * src/support/DebugStream.C: <config.h> was not included correctly.
10618 * lib/configure: forgot to re-generate it :( I'll make this file
10619 auto generated soon.
10621 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10623 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10626 * src/support/lyxstring.C: some changes from length() to rep->sz.
10627 avoids a function call.
10629 * src/support/filetools.C (SpaceLess): yet another version of the
10630 algorithm...now per Jean-Marc's suggestions.
10632 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10634 * src/layout.C (less_textclass_desc): functor for use in sorting
10636 (LyXTextClass::Read): sort the textclasses after reading.
10638 * src/support/filetools.C (SpaceLess): new version of the
10639 SpaceLess functions. What problems does this one give? Please
10642 * images/banner_bw.xbm: made the arrays unsigned char *
10644 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10646 * src/support/lyxstring.C (find): remove bogus assertion in the
10647 two versions of find where this has not been done yet.
10649 * src/support/lyxlib.h: add missing int return type to
10652 * src/menus.C (ShowFileMenu): disable exporting to html if no
10653 html export command is present.
10655 * config/lib_configure.m4: add a test for an HTML converter. The
10656 programs checked for are, in this order: tth, latex2html and
10659 * lib/configure: generated from config/lib_configure.m4.
10661 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10662 html converter. The parameters are now passed through $$FName and
10663 $$OutName, instead of standard input/output.
10665 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10667 * lib/lyxrc.example: update description of \html_command.
10668 add "quotes" around \screen_font_xxx font setting examples to help
10669 people who use fonts with spaces in their names.
10671 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10673 * Distribution files: updates for v1.1.2
10675 * src/support/lyxstring.C (find): remove bogus assert and return
10676 npos for the same condition.
10678 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10680 * added patch for OS/2 from SMiyata.
10682 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10684 * src/text2.C (CutSelection): make space_wrapped a bool
10685 (CutSelection): dont declare int i until we have to.
10686 (alphaCounter): return a char const *.
10688 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10690 * src/support/syscall.C (Systemcalls::kill):
10691 src/support/filetools.C (PutEnv, PutEnvPath):
10692 src/lyx_cb.C (addNewlineAndDepth):
10693 src/FontInfo.C (FontInfo::resize): condition some #warning
10694 directives with WITH_WARNINGS.
10697 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10699 * src/layout.[Ch] + several files: access to class variables
10700 limited and made accessor functions instead a lot of code changed
10701 becuase of this. Also instead of returning pointers often a const
10702 reference is returned instead.
10704 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10706 * src/Makefile.am (dist-hook): added used to remove the CVS from
10707 cheaders upon creating a dist
10708 (EXTRA_DIST): added cheaders
10710 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10711 a character not as a small integer.
10713 * src/support/lyxstring.C (find): removed Assert and added i >=
10714 rep->sz to the first if.
10716 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10718 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10719 src/LyXView.C src/buffer.C src/bufferparams.C
10720 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10721 src/text2.C src/insets/insetinclude.C:
10722 lyxlayout renamed to textclasslist.
10724 * src/layout.C: some lyxerr changes.
10726 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10727 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10728 (LyXLayoutList): removed all traces of this class.
10729 (LyXTextClass::Read): rewrote LT_STYLE
10730 (LyXTextClass::hasLayout): new function
10731 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10732 both const and nonconst version.
10733 (LyXTextClass::delete_layout): new function.
10734 (LyXTextClassList::Style): bug fix. do the right thing if layout
10736 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10737 (LyXTextClassList::NameOfLayout): ditto
10738 (LyXTextClassList::Load): ditto
10740 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10742 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10744 * src/LyXAction.C (LookupFunc): added a workaround for sun
10745 compiler, on the other hand...we don't know if the current code
10746 compiles on sun at all...
10748 * src/support/filetools.C (CleanupPath): subst fix
10750 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10753 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10754 complained about this one?
10756 * src/insets/insetinclude.C (Latex): subst fix
10758 * src/insets/insetbib.C (getKeys): subst fix
10760 * src/LyXSendto.C (SendtoApplyCB): subst fix
10762 * src/lyx_main.C (init): subst fix
10764 * src/layout.C (Read): subst fix
10766 * src/lyx_sendfax_main.C (button_send): subst fix
10768 * src/buffer.C (RoffAsciiTable): subst fix
10770 * src/lyx_cb.C (MenuFax): subst fix
10771 (PrintApplyCB): subst fix
10773 1999-10-26 Juergen Vigna <jug@sad.it>
10775 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10777 (Read): Cleaned up this code so now we read only format vestion >= 5
10779 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10781 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10782 come nobody has complained about this one?
10784 * src/insets/insetinclude.C (Latex): subst fix
10786 * src/insets/insetbib.C (getKeys): subst fix
10788 * src/lyx_main.C (init): subst fix
10790 * src/layout.C (Read): subst fix
10792 * src/buffer.C (RoffAsciiTable): subst fix
10794 * src/lyx_cb.C (MenuFax): subst fix.
10796 * src/layout.[hC] + some other files: rewrote to use
10797 std::container to store textclasses and layouts in.
10798 Simplified, removed a lot of code. Make all classes
10799 assignable. Further simplifications and review of type
10800 use still to be one.
10802 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10803 lastfiles to create the lastfiles partr of the menu.
10805 * src/lastfiles.[Ch]: rewritten to use deque to store the
10806 lastfiles in. Uses fstream for reading and writing. Simplifies
10809 * src/support/syscall.C: remove explicit cast.
10811 * src/BufferView.C (CursorToggleCB): removed code snippets that
10812 were commented out.
10813 use explicat C++ style casts instead of C style casts. also use
10814 u_vdata instea of passing pointers in longs.
10816 * src/PaperLayout.C: removed code snippets that were commented out.
10818 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10820 * src/lyx_main.C: removed code snippets that wer commented out.
10822 * src/paragraph.C: removed code snippets that were commented out.
10824 * src/lyxvc.C (logClose): use static_cast
10826 (viewLog): remove explicit cast to void*
10827 (showLog): removed old commented code
10829 * src/menus.C: use static_cast instead of C style casts. use
10830 u_vdata instead of u_ldata. remove explicit cast to (long) for
10831 pointers. Removed old code that was commented out.
10833 * src/insets/inset.C: removed old commented func
10835 * src/insets/insetref.C (InsetRef): removed old code that had been
10836 commented out for a long time.
10838 (escape): removed C style cast
10840 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10842 * src/insets/insetlatex.C (Draw): removed old commented code
10843 (Read): rewritten to use string
10845 * src/insets/insetlabel.C (escape): removed C style cast
10847 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10849 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10850 old commented code.
10852 * src/insets/insetinclude.h: removed a couple of stupid bools
10854 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10855 (Clone): remove C style cast
10856 (getKeys): changed list to lst because of std::list
10858 * src/insets/inseterror.C (Draw): removed som old commented code.
10860 * src/insets/insetcommand.C (Draw): removed some old commented code.
10862 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10863 commented out forever.
10864 (bibitem_cb): use static_cast instead of C style cast
10865 use of vdata changed to u_vdata.
10867 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10869 (CloseUrlCB): use static_cast instead of C style cast.
10870 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10872 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10873 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10874 (CloseInfoCB): static_cast from ob->u_vdata instead.
10875 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10878 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10879 (C_InsetError_CloseErrorCB): forward the ob parameter
10880 (CloseErrorCB): static_cast from ob->u_vdata instead.
10882 * src/vspace.h: include LString.h since we use string in this class.
10884 * src/vspace.C (lyx_advance): changed name from advance because of
10885 nameclash with stl. And since we cannot use namespaces yet...I
10886 used a lyx_ prefix instead. Expect this to change when we begin
10889 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10891 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10892 and removed now defunct constructor and deconstructor.
10894 * src/BufferView.h: have backstack as a object not as a pointer.
10895 removed initialization from constructor. added include for BackStack
10897 * development/lyx.spec.in (%build): add CFLAGS also.
10899 * src/screen.C (drawFrame): removed another warning.
10901 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10903 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10904 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10905 README and ANNOUNCE a bit for the next release. More work is
10908 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10909 unbreakable if we are in freespacing mode (LyX-Code), but not in
10912 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10914 * src/BackStack.h: fixed initialization order in constructor
10916 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10918 * acinclude.m4 (VERSION): new rules for when a version is
10919 development, added also a variable for prerelease.
10920 (warnings): we set with_warnings=yes for prereleases
10921 (lyx_opt): prereleases compile with same optimization as development
10922 (CXXFLAGS): only use pedantic if we are a development version
10924 * src/BufferView.C (restorePosition): don't do anything if the
10925 backstack is empty.
10927 * src/BackStack.h: added member empty, use this to test if there
10928 is anything to pop...
10930 1999-10-25 Juergen Vigna <jug@sad.it>
10933 * forms/layout_forms.fd +
10934 * forms/latexoptions.fd +
10935 * lyx.fd: changed for various form resize issues
10937 * src/mathed/math_panel.C +
10938 * src/insets/inseterror.C +
10939 * src/insets/insetinfo.C +
10940 * src/insets/inseturl.C +
10941 * src/insets/inseturl.h +
10943 * src/LyXSendto.C +
10944 * src/PaperLayout.C +
10945 * src/ParagraphExtra.C +
10946 * src/TableLayout.C +
10948 * src/layout_forms.C +
10955 * src/menus.C: fixed various resize issues. So now forms can be
10956 resized savely or not be resized at all.
10958 * forms/form_url.fd +
10959 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10962 * src/insets/Makefile.am: added files form_url.[Ch]
10964 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10966 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10967 (and presumably 6.2).
10969 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10970 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10971 remaining static member callbacks.
10973 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10976 * src/support/lyxstring.h: declare struct Srep as friend of
10977 lyxstring, since DEC cxx complains otherwise.
10979 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10981 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10983 * src/LaTeX.C (run): made run_bibtex also depend on files with
10985 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10986 are put into the dependency file.
10988 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10989 the code has shown itself to work
10990 (create_ispell_pipe): removed another warning, added a comment
10993 * src/minibuffer.C (ExecutingCB): removed code that has been
10994 commented out a long time
10996 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10997 out code + a warning.
10999 * src/support/lyxstring.h: comment out the three private
11000 operators, when compiling with string ansi conforming compilers
11001 they make problems.
11003 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11005 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11006 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11009 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11012 * src/mathed/math_panel.C (create_math_panel): remove explicit
11015 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11018 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11019 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11020 to XCreatePixmapFromBitmapData
11021 (fl_set_bmtable_data): change the last argument to be unsigned
11023 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11024 and bh to be unsigned int, remove explicit casts in call to
11025 XReadBitmapFileData.
11027 * images/arrows.xbm: made the arrays unsigned char *
11028 * images/varsz.xbm: ditto
11029 * images/misc.xbm: ditto
11030 * images/greek.xbm: ditto
11031 * images/dots.xbm: ditto
11032 * images/brel.xbm: ditto
11033 * images/bop.xbm: ditto
11035 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11037 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11038 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11039 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11041 (LYX_CXX_CHEADERS): added <clocale> to the test.
11043 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11045 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11047 * src/support/lyxstring.C (append): fixed something that must be a
11048 bug, rep->assign was used instead of rep->append.
11050 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11053 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11054 lyx insert double chars. Fix spotted by Kayvan.
11056 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11058 * Fixed the tth support. I messed up with the Emacs patch apply feature
11059 and omitted the changes in lyxrc.C.
11061 1999-10-22 Juergen Vigna <jug@sad.it>
11063 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11065 * src/lyx_cb.C (MenuInsertRef) +
11066 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11067 the form cannot be resized under it limits (fixes a segfault)
11069 * src/lyx.C (create_form_form_ref) +
11070 * forms/lyx.fd: Changed Gravity on name input field so that it is
11073 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11075 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11076 <ostream> and <istream>.
11078 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11079 whether <fstream> provides the latest standard features, or if we
11080 have an oldstyle library (like in egcs).
11081 (LYX_CXX_STL_STRING): fix the test.
11083 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11084 code on MODERN_STL_STREAM.
11086 * src/support/lyxstring.h: use L{I,O}stream.h.
11088 * src/support/L{I,O}stream.h: new files, designed to setup
11089 correctly streams for our use
11090 - includes the right header depending on STL capabilities
11091 - puts std::ostream and std::endl (for LOStream.h) or
11092 std::istream (LIStream.h) in toplevel namespace.
11094 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11096 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11097 was a bib file that had been changed we ensure that bibtex is run.
11098 (runBibTeX): enhanced to extract the names of the bib files and
11099 getting their absolute path and enter them into the dep file.
11100 (findtexfile): static func that is used to look for tex-files,
11101 checks for absolute patchs and tries also with kpsewhich.
11102 Alternative ways of finding the correct files are wanted. Will
11104 (do_popen): function that runs a command using popen and returns
11105 the whole output of that command in a string. Should be moved to
11108 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11109 file with extension ext has changed.
11111 * src/insets/figinset.C: added ifdef guards around the fl_free
11112 code that jug commented out. Now it is commented out when
11113 compiling with XForms == 0.89.
11115 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11116 to lyxstring.C, and only keep a forward declaration in
11117 lyxstring.h. Simplifies the header file a bit and should help a
11118 bit on compile time too. Also changes to Srep will not mandate a
11119 recompile of code just using string.
11120 (~lyxstring): definition moved here since it uses srep.
11121 (size): definition moved here since it uses srep.
11123 * src/support/lyxstring.h: removed a couple of "inline" that should
11126 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11128 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11131 1999-10-21 Juergen Vigna <jug@sad.it>
11133 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11134 set to left if I just remove the width entry (or it is empty).
11136 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11137 paragraph when having dummy paragraphs.
11139 1999-10-20 Juergen Vigna <jug@sad.it>
11141 * src/insets/figinset.C: just commented some fl_free_form calls
11142 and added warnings so that this calls should be activated later
11143 again. This avoids for now a segfault, but we have a memory leak!
11145 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11146 'const char * argument' to 'string argument', this should
11147 fix some Asserts() in lyxstring.C.
11149 * src/lyxfunc.h: Removed the function argAsString(const char *)
11150 as it is not used anymore.
11152 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11154 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11157 * src/Literate.h: some funcs moved from public to private to make
11158 interface clearer. Unneeded args removed.
11160 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11162 (scanBuildLogFile): ditto
11164 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11165 normal TeX Error. Still room for improvement.
11167 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11169 * src/buffer.C (insertErrors): changes to make the error
11170 desctription show properly.
11172 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11175 * src/support/lyxstring.C (helper): changed to use
11176 sizeof(object->rep->ref).
11177 (operator>>): changed to use a pointer instead.
11179 * src/support/lyxstring.h: changed const reference & to value_type
11180 const & lets see if that helps.
11182 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11184 * Makefile.am (rpmdist): fixed to have non static package and
11187 * src/support/lyxstring.C: removed the compilation guards
11189 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11192 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11193 conditional compile of lyxstring.Ch
11195 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11196 stupid check, but it is a lot better than the bastring hack.
11197 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11199 * several files: changed string::erase into string::clear. Not
11202 * src/chset.C (encodeString): use a char temporary instead
11204 * src/table.C (TexEndOfCell): added tostr around
11205 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11206 (TexEndOfCell): ditto
11207 (TexEndOfCell): ditto
11208 (TexEndOfCell): ditto
11209 (DocBookEndOfCell): ditto
11210 (DocBookEndOfCell): ditto
11211 (DocBookEndOfCell): ditto
11212 (DocBookEndOfCell): ditto
11214 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11216 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11218 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11219 (MenuBuildProg): added tostr around ret
11220 (MenuRunChktex): added tostr around ret
11221 (DocumentApplyCB): added tostr around ret
11223 * src/chset.C (encodeString): added tostr around t->ic
11225 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11226 (makeLaTeXFile): added tostr around tocdepth
11227 (makeLaTeXFile): added tostr around ftcound - 1
11229 * src/insets/insetbib.C (setCounter): added tostr around counter.
11231 * src/support/lyxstring.h: added an operator+=(int) to catch more
11234 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11235 (lyxstring): We DON'T allow NULL pointers.
11237 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11239 * src/mathed/math_macro.C (MathMacroArgument::Write,
11240 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11241 when writing them out.
11243 * src/LString.C: remove, since it is not used anymore.
11245 * src/support/lyxstring.C: condition the content to
11246 USE_INCLUDED_STRING macro.
11248 * src/mathed/math_symbols.C, src/support/lstrings.C,
11249 src/support/lyxstring.C: add `using' directive to specify what
11250 we need in <algorithm>. I do not think that we need to
11251 conditionalize this, but any thought is appreciated.
11253 * many files: change all callback functions to "C" linkage
11254 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11255 strict_ansi. Those who were static are now global.
11256 The case of callbacks which are static class members is
11257 trickier, since we have to make C wrappers around them (see
11258 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11259 did not finish this yet, since it defeats the purpose of
11260 encapsulation, and I am not sure what the best route is.
11262 1999-10-19 Juergen Vigna <jug@sad.it>
11264 * src/support/lyxstring.C (lyxstring): we permit to have a null
11265 pointer as assignment value and just don't assign it.
11267 * src/vspace.C (nextToken): corrected this function substituting
11268 find_first(_not)_of with find_last_of.
11270 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11271 (TableOptCloseCB) (TableSpeCloseCB):
11272 inserted fl_set_focus call for problem with fl_hide_form() in
11275 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11277 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11280 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11282 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11283 LyXLex::next() and not eatline() to get its argument.
11285 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11287 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11288 instead, use fstreams for io of the depfile, removed unneeded
11289 functions and variables.
11291 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11292 vector instead, removed all functions and variables that is not in
11295 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11297 * src/buffer.C (insertErrors): use new interface to TeXError
11299 * Makefile.am (rpmdist): added a rpmdist target
11301 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11302 per Kayvan's instructions.
11304 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11306 * src/Makefile.am: add a definition for localedir, so that locales
11307 are found after installation (Kayvan)
11309 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11311 * development/.cvsignore: new file.
11313 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11315 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11316 C++ compiler provides wrappers for C headers and use our alternate
11319 * configure.in: use LYX_CXX_CHEADERS.
11321 * src/cheader/: new directory, populated with cname headers from
11322 libstdc++-2.8.1. They are a bit old, but probably good enough for
11323 what we want (support compilers who lack them).
11325 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11326 from includes. It turns out is was stupid.
11328 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11330 * lib/Makefile.am (install-data-local): forgot a ';'
11331 (install-data-local): forgot a '\'
11332 (libinstalldirs): needed after all. reintroduced.
11334 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11336 * configure.in (AC_OUTPUT): added lyx.spec
11338 * development/lyx.spec: removed file
11340 * development/lyx.spec.in: new file
11342 * po/*.po: merged with lyx.pot becuase of make distcheck
11344 * lib/Makefile.am (dist-hook): added dist-hook so that
11345 documentation files will be included when doing a make
11346 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11347 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11349 more: tried to make install do the right thing, exclude CVS dirs
11352 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11353 Path would fit in more nicely.
11355 * all files that used to use pathstack: uses now Path instead.
11356 This change was a lot easier than expected.
11358 * src/support/path.h: new file
11360 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11362 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11364 * src/support/lyxstring.C (getline): Default arg was given for
11367 * Configure.cmd: removed file
11369 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11371 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11372 streams classes and types, add the proper 'using' statements when
11373 MODERN_STL is defined.
11375 * src/debug.h: move the << operator definition after the inclusion
11378 * src/support/filetools.C: include "LAssert.h", which is needed
11381 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11384 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11385 include "debug.h" to define a proper ostream.
11387 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11389 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11390 method to the SystemCall class which can kill a process, but it's
11391 not fully implemented yet.
11393 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11395 * src/support/FileInfo.h: Better documentation
11397 * src/lyxfunc.C: Added support for buffer-export html
11399 * src/menus.C: Added Export->As HTML...
11401 * lib/bind/*.bind: Added short-cut for buffer-export html
11403 * src/lyxrc.*: Added support for new \tth_command
11405 * lib/lyxrc.example: Added stuff for new \tth_command
11407 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11409 * lib/Makefile.am (IMAGES): removed images/README
11410 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11411 installes in correct place. Check permisions is installed
11414 * src/LaTeX.C: some no-op changes moved declaration of some
11417 * src/LaTeX.h (LATEX_H): changed include guard name
11419 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11421 * lib/reLyX/Makefile.am: install noweb2lyx.
11423 * lib/Makefile.am: install configure.
11425 * lib/reLyX/configure.in: declare a config aux dir; set package
11426 name to lyx (not sure what the best solution is); generate noweb2lyx.
11428 * lib/layouts/egs.layout: fix the bibliography layout.
11430 1999-10-08 Jürgen Vigna <jug@sad.it>
11432 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11433 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11434 it returned without continuing to search the path.
11436 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11438 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11439 also fixes a bug. It is not allowed to do tricks with std::strings
11440 like: string a("hei"); &a[e]; this will not give what you
11441 think... Any reason for the complexity in this func?
11443 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11445 * Updated README and INSTALL a bit, mostly to check that my
11446 CVS rights are correctly set up.
11448 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11450 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11451 does not allow '\0' chars but lyxstring and std::string does.
11453 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11455 * autogen.sh (AUTOCONF): let the autogen script create the
11456 POTFILES.in file too. POTFILES.in should perhaps now not be
11457 included in the cvs module.
11459 * some more files changed to use C++ includes instead of C ones.
11461 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11463 (Reread): added tostr to nlink. buggy output otherwise.
11464 (Reread): added a string() around szMode when assigning to Buffer,
11465 without this I got a log of garbled info strings.
11467 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11470 * I have added several ostream & operator<<(ostream &, some_type)
11471 functions. This has been done to avoid casting and warnings when
11472 outputting enums to lyxerr. This as thus eliminated a lot of
11473 explicit casts and has made the code clearer. Among the enums
11474 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11475 mathed enums, some font enum the Debug::type enum.
11477 * src/support/lyxstring.h (clear): missing method. equivalent of
11480 * all files that contained "stderr": rewrote constructs that used
11481 stderr to use lyxerr instead. (except bmtable)
11483 * src/support/DebugStream.h (level): and the passed t with
11484 Debug::ANY to avoid spurious bits set.
11486 * src/debug.h (Debug::type value): made it accept strings of the
11487 type INFO,INIT,KEY.
11489 * configure.in (Check for programs): Added a check for kpsewhich,
11490 the latex generation will use this later to better the dicovery of
11493 * src/BufferView.C (create_view): we don't need to cast this to
11494 (void*) that is done automatically.
11495 (WorkAreaButtonPress): removed some dead code.
11497 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11499 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11500 is not overwritten when translated (David Sua'rez de Lis).
11502 * lib/CREDITS: Added David Sua'rez de Lis
11504 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11506 * src/bufferparams.C (BufferParams): default input encoding is now
11509 * acinclude.m4 (cross_compiling): comment out macro
11510 LYX_GXX_STRENGTH_REDUCE.
11512 * acconfig.h: make sure that const is not defined (to empty) when
11513 we are compiling C++. Remove commented out code using SIZEOF_xx
11516 * configure.in : move the test for const and inline as late as
11517 possible so that these C tests do not interefere with C++ ones.
11518 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11519 has not been proven.
11521 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11523 * src/table.C (getDocBookAlign): remove bad default value for
11524 isColumn parameter.
11526 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11528 (ShowFileMenu2): ditto.
11530 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11531 of files to ignore.
11533 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11535 * Most files: finished the change from the old error code to use
11536 DebugStream for all lyxerr debugging. Only minor changes remain
11537 (e.g. the setting of debug levels using strings instead of number)
11539 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11541 * src/layout.C (Add): Changed to use compare_no_case instead of
11544 * src/FontInfo.C: changed loop variable type too string::size_type.
11546 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11548 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11549 set ETAGS_ARGS to --c++
11551 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11553 * src/table.C (DocBookEndOfCell): commented out two unused variables
11555 * src/paragraph.C: commented out four unused variables.
11557 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11558 insed a if clause with type string::size_type.
11560 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11563 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11565 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11566 variable, also changed loop to go from 0 to lenght + 1, instead of
11567 -1 to length. This should be correct.
11569 * src/LaTeX.C (scanError): use string::size_type as loop variable
11572 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11573 (l.896) since y_tmp and row was not used anyway.
11575 * src/insets/insetref.C (escape): use string::size_type as loop
11578 * src/insets/insetquotes.C (Width): use string::size_type as loop
11580 (Draw): use string::size_type as loop variable type.
11582 * src/insets/insetlatexaccent.C (checkContents): use
11583 string::size_type as loop variable type.
11585 * src/insets/insetlabel.C (escape): use string::size_type as loop
11588 * src/insets/insetinfo.C: added an extern for current_view.
11590 * src/insets/insetcommand.C (scanCommand): use string::size_type
11591 as loop variable type.
11593 * most files: removed the RCS tags. With them we had to recompile
11594 a lot of files after a simple cvs commit. Also we have never used
11595 them for anything meaningful.
11597 * most files: tags-query-replace NULL 0. As adviced several plases
11598 we now use "0" instead of "NULL" in our code.
11600 * src/support/filetools.C (SpaceLess): use string::size_type as
11601 loop variable type.
11603 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11605 * src/paragraph.C: fixed up some more string stuff.
11607 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11609 * src/support/filetools.h: make modestr a std::string.
11611 * src/filetools.C (GetEnv): made ch really const.
11613 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11614 made code that used these use max/min from <algorithm> instead.
11616 * changed several c library include files to their equivalent c++
11617 library include files. All is not changed yet.
11619 * created a support subdir in src, put lyxstring and lstrings
11620 there + the extra files atexit, fileblock, strerror. Created
11621 Makefile.am. edited configure.in and src/Makefile.am to use this
11622 new subdir. More files moved to support.
11624 * imported som of the functions from repository lyx, filetools
11626 * ran tags-query-replace on LString -> string, corrected the bogus
11627 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11628 is still some errors in there. This is errors where too much or
11629 too litle get deleted from strings (string::erase, string::substr,
11630 string::replace), there can also be some off by one errors, or
11631 just plain wrong use of functions from lstrings. Viewing of quotes
11634 * LyX is now running fairly well with string, but there are
11635 certainly some bugs yet (see above) also string is quite different
11636 from LString among others in that it does not allow null pointers
11637 passed in and will abort if it gets any.
11639 * Added the revtex4 files I forgot when setting up the repository.
11641 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11643 * All over: Tried to clean everything up so that only the files
11644 that we really need are included in the cvs repository.
11645 * Switched to use automake.
11646 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11647 * Install has not been checked.
11649 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11651 * po/pt.po: Three errors:
11652 l.533 and l.538 format specification error
11653 l. 402 duplicate entry, I just deleted it.