1 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/version.h: set back to 1.1.6cvs
5 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7 * src/version.h: set to 1.1.6pre2
9 2000-11-20 Marko Vendelin <markov@ioc.ee>
11 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
13 * src/frontends/gnome/Makefile.am: updated list of XForms object files
15 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
17 * src/LColor.C (init):
18 * src/lyxrc.C (getDescription): changed some comments as suggested by
21 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
22 disconnect the redrawGUI signal in best-practice fashion.
24 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
25 long_opts_tab to reflect the change in name of this tabfolder, as
26 suggested by Rob Lahaye.
27 (connect, disconnect): new methods. Don't do much at present other than
28 ensuring that we can't resize the dialog. This just makes xforms go
30 (lots of methods in Colors): made void rather than bool. The idea is
31 to have an isOk() function that keeps track of whether any input is
32 genuinely invalid and should therefore block Save, Apply.
33 Easier to manipulate the counters rapidly.
34 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
35 compiler will like this code. Much cleaner way of doing things.
37 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
39 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
40 rather than simple counters, following suggestion by Rob Lahaye.
42 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
43 than engraved frame + text.
45 * src/frontends/xforms/forms/makefile: removed spurious command.
47 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
49 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
51 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
54 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
56 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
57 see what Lars has changed and what is just white space!
58 Now used X directly to ascertain the RGB color associated with the
60 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
62 Added some sort capability.
63 The X11 color name database input is only displayed if the database
64 isn't found in the standard place.
65 Got rid of struct compare_converter; it wasn't used.
66 Probably some other stuff that I've forgotten.
68 * src/frontends/xforms/FormPreferences.h: changed the names of some
69 methods in the Colors struct. Added a couple of structs to help sort
70 colors by name and by RGBColor.
72 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
73 functions into a new class RWInfo.
75 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
76 The dialog is now almost navigable using the keyboard. Unfortunately,
77 the cursor has to be inside a browser for it to be activated. There is
78 no visual feedback for the key shortcuts to the arrow keys (use
79 Alt-appropriate arrow key, Alt-x).
81 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
84 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
85 xform_helpers.[Ch]. See above.
87 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
89 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
91 * src/screen.C (setCursorColor): new method. Sets the color of the
93 (ShowManualCursor): call it.
94 Constify some local variables.
96 * src/LColor.[Ch] (LColor): add entry for cursor
97 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
100 2000-11-19 Juergen Vigna <jug@sad.it>
102 * src/insets/insettabular.C (draw): fixed text border redraw problem.
103 (calculate_dimensions_of_cells): try to boost up when inserting chars.
105 2000-11-15 Rob Lahaye <lahaye@postech.edu>
107 * lib/ui/default.ui: OptItem used for Fax entry
109 2000-11-17 Matej Cepl <cepl@bigfoot.com>
111 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
113 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
115 * src/vspace.C (nextToken): fix so it can handle length phrases like
116 "10mm+-20mm", "40inplus16mmminus10cm" etc.
118 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
120 * src/frontends/xforms/FormPreferences.C: constify several variables
121 (BrowserLyX): rewrite to not need the choice variable
122 (Modify): rewrite to not need the choide variable
123 (compare_converter): make operator const
125 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
126 correct the writing of \set_color
127 (getDescription): return a const string
129 * src/kbsequence.[Ch] (addkey): remove dead code
131 * src/Painter.C (text): remove some commented code
133 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
135 * src/ColorHandler.[Ch]: removed some header files from .h file.
136 Included LColor.h in .C file.
138 * src/LColor.[Ch]: made class copyable so that I could create a
139 system_lcolor instance.
141 * src/Painter.h: removed LColor.h.
143 * src/lyx_gui.C (create_forms): used AddName.
145 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
146 of user preferences/lyxrc file.
148 * src/lyxrc.C (output): output changes to lcolor.
150 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
152 Moved class xformColor to files xform_helpers.[Ch]. These files,
153 Color.[Ch], could now be moved into src if they would be useful to
156 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
157 Also moved FormPreferences::browseFile here as it can be used by any
158 xform dialog with a "Browse" button. FormGraphics is a perfect example.
160 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
161 ReadableFile): changed the FormPreferences methods a little and moved
162 them here as they'll be useful elsewhere also.
164 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
165 Removed some header files and used forward declarations instead.
167 Removed some methods as they'll be useful elsewhere (see above).
169 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
170 Can also now modify the LyX LColors. However, for reasons that I don't
171 yet understand, it appears that we can use
172 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
173 present. The problem appears to lie in ColorHandler, because I can
174 change the color using LColor.SetColor(). Similarly, when reading in a
175 preferences file with some set_color instances, I'll get a warning
176 like: Color sea green is undefined or may not be redefined
177 Bad lyxrc set_color for sea green
179 Once the buffer is loaded, however, I can happily change to this color.
181 Finally, it appears that I have to set the color of "inset frame"
182 explicitly, or it oscillates from "black" to "indian red" with each
185 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
187 * ANNOUNCE: corrected a spelling mistake.
189 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
192 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
194 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
196 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
199 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
200 match the requirements from the standard better. This is required
201 to work with gnu libstdc++-v3
203 * src/frontends/xforms/FormPreferences.C: add explict pair
204 arguments to browse calls. include support/lyxmanip.h remvoe
205 extern fmt. whitespace changes. reorder variables in
206 FormPreferences.h, to match initalizaton order.
208 * several files: constify more local variables.
210 * src/buffer.C: remove some commented functions.
212 * src/DepTable.C (remove_files_with_extension): temporary
213 work around for gcc 2.97
214 * src/filedlg.C (find): ditto
215 * src/Variables.C (set): ditto
216 * src/LyXAction.C (searchActionArg): ditto
217 (retrieveActionArg): ditto
219 * configure.in: check for mktemp too
221 * UPGRADING: prepare for 1.1.6
223 * Makefile.am (lgbtags): add backup tags for when etags are
224 different than usual.
226 * ANNOUNCE: prepare for 1.1.6
228 * src/support/tempname.C (make_tempfile): new function, wrapper
229 around mkstemp and mktemp. Only mkstemp has been tested.
232 2000-11-14 Rob Lahaye <lahaye@postech.edu>
234 * default.ui: capitalized some menu items to improve shortcuts.
236 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
238 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
240 * src/frontends/xforms/Dialogs.C: add "using" directive.
242 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
244 * src/filedlg.C (Select): highlight suggested file in browser, if
247 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
248 each tab folder is encapsulated in its own class.
249 The Language keymaps are now chosen using a text input and a
250 browser button, rather than a Combox.
251 All the browser buttons are now functional, although LyXFileDlg
252 still needs to be modified to make it straighhtforward to return a
253 directory if that is what is desired.
255 * src/frontends/xforms/forms/form_preferences.fd: use text input
256 and browse button to input the Language keymaps. Add a few
257 callbacks for the browse buttons.
259 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
261 * src/support/tempname.C (tempName): small changes to make it
262 safer. remove the '.' before XXXXXX
264 * src/support/filetools.C (TmpFileName): remove func
267 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
268 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
269 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
270 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
272 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
275 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
278 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
279 for bp (this fixes a reproducible hard crash)
281 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
284 * src/frontends/xforms/FormBase.h: make bp_ private
285 (FormBaseBI): remove default for bp
288 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
291 * src/frontends/xforms/Color.C (RGBColor): made several vars
292 const, changed initialization of j to allow it to be const
295 * several files: added const to local variables.
297 * src/lyx_cb.C: removed several function prototypes and moved them
301 (UpdateLayoutPreamble):
303 (MenuInsertLabel): add BufferView as arguemnt
304 (LayoutsCB): make tmp const
306 * src/layout_forms.h: regenerated
308 * src/debug.C: add Debug::FILES
309 (showLevel) (showTags): translate the desc
311 * src/debug.h: add FILES as debug target
313 * src/bufferlist.C: use current_view as an interim measure becuase
314 of added arguments to MenuWrite and MenuWriteAs
316 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
318 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
320 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
321 libstdc++ is compiled with.
323 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
325 * lib/layouts/docbook-book.layout
326 * lib/layouts/docbook.layout
327 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
328 those paragraphs are expresse as SGML comments <!-- -->.
330 * src/LaTeXFeatures.h
331 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
332 parameter, this allows to express all the include files as relative
333 paths to the master buffer. The verbatim insert works as the other
336 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
338 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
340 (MakeDocBookFile): top_element is always written. Some clean up, as
341 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
343 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
344 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
345 a reference is written instead of the name.
346 (Validate): use the relative path for the filename.
348 * src/insets/insetlabel.C (DocBook): write end tag, for XML
351 * src/support/filetools.h
352 * src/support/filetools.C (IsSGMLFilename): added.
355 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
357 * development/OS2/quick_fix.patch:
359 * README.OS2: quick update to the OS/2 port.
361 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
363 * src/converter.C: add "using" directive.
365 * src/frontends/xforms/FormPreferences.C: add "using" directive.
366 (compare_converter): add "int" as return type.
368 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
371 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
373 * src/lyx_gui.C (create_forms): map the xform colours, should a
374 mapping exist. Ie, call XformColor::read().
376 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
377 and struct HSV as HSVColor.
378 (XformColor::read, XformColor::write) : new methods that
379 input/output any changes to the cform GUI colors.
381 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
384 * src/frontends/xforms/FormPreferences.C Lots of little changes
385 associated with the changed name of the RGB and HSV structs. Can
386 now save changes to xforms GUI to file. Commented out
387 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
388 used currently anyway.
390 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
392 * src/converter.C: A lot of changes:
393 - It is no longer possible to choose between two or more ways to
394 export to some format (the new code uses only the shortest path).
395 However, it is still possible to choose between pdflatex/ps2pdf
396 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
397 - Added several methods that makes the FormPreferences code simpler.
398 - Changed the tokens $$FName and $$OutName to $$i and $$o.
400 * src/exporter.C (Export): lyxrc.use_pdf is set before
401 makeLaTeXFile is called. This works but not very nice.
403 * src/frontends/xforms/FormPreferences.C: The formats/converters
404 tabs are now fully functional.
406 * src/buffer.C (getTocList): Add numbers to the captions.
408 * lib/lyxrc.example: Removed fax section
410 * src/support/rename.C (rename): Delete the old file if lyx::copy
413 2000-11-13 Rob Lahaye <lahaye@postech.edu>
415 * lib/ui/default.ui: minor polishing.
417 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
419 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
422 * lib/Makefile.am (DOCINST): do not install everything in the
423 documentation directory.
425 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
427 * src/bufferlist.C (newFile): set the filename to the constructed
430 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
431 constructed "newfileXX.lyx" name to the dialog
433 * src/frontends/DialogBase.h: make update() non-abstract so
434 KDE doesn't need to implement two update methods for every form
436 * src/frontends/kde/Makefile.am: add missing xforms objects
439 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
441 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
443 * src/frontends/xforms/Color.[Ch]: new files, defining the color
444 structs RGB and HSV. May not be the best place for these files.
445 Perhaps move them into src ?
447 * src/frontends/xforms/Makefile.am: added new files.
449 * src/frontends/xforms/forms/form_preferences.fd:
450 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
451 replaced all instances of "colour" with "color"!
453 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
456 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
457 tab. Can now alter the colors of the xform's GUI on the fly. With
458 the aid of a single static Signal (see below), can "Apply" these
459 changes to all currently open dialogs. (Well, to all of the NEW
460 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
461 subsequently opened dialogs will, of course, also have the new
462 color scheme. Cannot yet save (or load) the choices to file, so
463 they are lost when exiting LyX.
465 * src/frontends/Dialogs.h:
466 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
467 Used to trigger a redraw of any dialogs connected to it because,
468 for example, the GUI colours have been re-mapped.
470 * src/frontends/xforms/FormBase.[Ch]:
471 * src/frontends/xforms/FormDocument.[Ch]:
472 * src/frontends/xforms/FormParagraph.[Ch]:
473 * src/frontends/xforms/FormPreferences.[Ch]:
474 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
475 method, to be connected to Dialogs::redrawGUI. Method must be
476 virtual, because dialogs with tabbed folders need to redraw the
477 forms of each tab folder.
479 * src/LyXView.C (d-tor):
480 * src/frontends/xforms/FormBase.C (d-tor): connected
481 Dialogs::redrawGUI signal to redraw().
483 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
484 removed Assert, because it is identical to that in FormBase.
486 2000-11-10 Rob Lahaye <lahaye@postech.edu>
488 * lib/ui/default.ui: minor polishing.
490 2000-11-10 Juergen Vigna <jug@sad.it>
492 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
493 (deleteLyXText): ditto
495 * src/insets/insettabular.C (InsetButtonPress): don't clear the
496 selection on mouse-button-3.
498 * src/insets/insettabular.h: new function clearSelection(), use this
499 functions inside insettabular.C.
501 * src/insets/insettabular.C (TabularFeatures): clear the selection
502 on remove_row/column.
504 * src/insets/inset.C (scroll): fixed some scroll stuff.
506 * src/insets/insettabular.C (draw): fixed another minor draw problem.
508 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
510 * lib/CREDITS: add Yves Bastide
512 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
514 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
515 check whether C library functions are in the global namespace.
517 * configure.in: calls it.
519 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
522 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
524 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
525 iterators to prevent crash.
527 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
529 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
531 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
532 shortcut for xforms CB to the preemptive or post-handler function.
534 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
535 removed the HIDDEN_TIMER as it's no longer used.
536 Various other small changes.
538 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
539 preemptive handler to obtain feedback, rather than the post-handler.
540 (ColoursLoadBrowser): find "black" and "white" based on RGB values
542 Formats tab is now complete. Converters tab is nearly so.
544 2000-11-09 Juergen Vigna <jug@sad.it>
546 * src/insets/insettext.C (~InsetText):
549 (SetParagraphData): set cache.second to 0 after deleting it!
550 (getLyXText): check if cache.second is not 0 if finding it.
552 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
554 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
555 lyxlex to parse the rgb.txt file.
558 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
559 replace the default '#' comment character.
561 * src/support/tempname.C: add "using" directive
562 * src/frontends/ButtonPolicies.C: ditto.
564 * src/support/filetools.C (DirList): add an explicit cast to avoid
565 a compile error (probably not the right fix)
567 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
569 * src/support/filetools.C (DirList): implement using system functions
571 * src/support/tempname.C: new file
573 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
575 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
577 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
580 * src/frontends/xforms/ButtonController.C: new file
582 * src/os2_defines.h: remove getcwd define
584 * src/lyxvc.C: include support/lyxlib.h
585 (showLog): use lyx::tempName
587 * src/lyx_cb.C: comment out includes that we don't need
588 (AutoSave): use lyx::tempName
590 * src/filedlg.C: include support/lyxlib.h
591 (Reread): use lyx::getcwd
593 * src/converter.C: include support/filetools.h
594 (add_options): change to static inline, make tail const
595 (Add): make old_viewer const
596 (GetAllFormats): make it a const method, use const_iterator
597 (enable): make static inline
598 (SplitFormat): make using_format const
600 * src/LaTeX.C (run): use lyx::getcwd
602 * configure.in: check for mkstemp as well
604 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
606 * src/converter.[Ch] (GetAllCommands): new method.
608 * src/support/filetools.[Ch] (DirList): new method.
610 * src/frontends/xforms/FormPreferences.C: started (just!) adding
611 functionality to the converters tab.
612 The formats tab is now nearly complete.
613 The kbmap choices in Languages tab now display the contents of
614 system_lyxdir/kbd/*.kmap in readable form.
616 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
617 Moved some variables into the class.
619 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
620 inactive tab folder to FL_COL1. Haven't yet worked out how to change
621 colour of active folder to lighter grey instead. Any takers?
622 (form_colours): added an "Apply" button.
623 (form_converters): added a "Flags" input field.
624 (form_formats): added a "Shortcut" input field. Note that we can't use
625 names such as "input_shortcut" as this buggers up the sed script stuff.
627 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
635 * src/lyx_sendfax_main.C:
638 * src/spellchecker.C:
639 * src/insets/figinset.C:
640 * src/insets/insetbib.C:
641 * src/insets/insetexternal.C:
642 * src/insets/insetinclude.C:
643 * src/insets/insetinfo.C:
644 * src/mathed/math_panel.C:
645 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
646 all "daughter" dialogs now have identical "feel".
648 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
650 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
651 used (and was only used in one place prior to this patch. Incorrectly!)
653 * src/frontends/xforms/FormDocument.C: changed some instances of
654 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
655 sense. Also added fl_set_input_return() for class_->input_doc_extra and
656 for options_->input_float_placement. This fixes a bug reported by
659 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
660 functionality into d-tor.
662 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
663 input of numerals also.
665 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
666 fl_set_form_atclose(). Can now close dialog from window manager,
667 fixing a bug reported by Rob Lahaye.
669 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
671 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
672 are no longer dark. Haven't yet worked out how to lighten the colour of
673 the active tabfolder. Any ideas anybody?
674 Adjusted Colours tab a little.
675 Added Shortcut field to converters tab. Note that we can't create an
676 fdesign label like "input_shortcut" as this buggers up the sed-script
679 * src/frontends/xforms/FormPreferences.[Ch]:
680 (feedback): fixed crash due to to ob=0.
681 (LanguagesXXX): the kbmap choices now contain the files
682 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
683 be replaced by an input with a file browse button, but since the browse
684 buttons don'y yet work, this'll do for the moment.
685 (FormatsXXX): think that this is now nearly fully functional.
686 Some points/questions though:
687 1. Does "Apply" remove formats if no longer present?
688 2. I think that the browser should list the GUI names rather than the
690 3. Must ensure that we can't delete Formats used by an existing
693 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
694 if this is the best way to do this.
696 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
698 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
700 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
701 for variable assignment.
703 2000-11-07 Rob Lahaye <lahaye@postech.edu>
705 * src/lib/ui/default.ui: added sub/superscripts to menu as
706 Insert->Special characters and cleaned-up the file a bit
708 2000-11-07 Allan Rae <rae@lyx.org>
710 * src/frontends/xforms/FormPreferences.C (feedback): make sure
711 ob isn't 0 before using it. See comments in function.
713 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
715 * src/frontends/xforms/form_*.C: regenerated
717 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
719 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
721 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
722 compiling with gcc-2.96
724 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
726 * src/support/lyxstring.C: add a couple "using" directives.
728 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
729 a .c_str() here too for good measure.
730 * src/Spacing.C (set): ditto.
731 * src/lyxfunc.C (Dispatch): ditto.
733 * src/insets/insettabular.C (copySelection): change .str() to
734 .str().c_str() to fix problems with lyxstring.
735 * src/support/filetools.C (GetFileContents): ditto.
736 * src/buffer.C (asciiParagraph): ditto.
737 * src/paragraph.C (String): ditto.
739 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
740 * lib/bind/sciword.bind: ditto.
742 * src/LyXAction.C (init): remove "symbol-insert" function, which
743 shared LFUN_INSERT_MATH with "math-insert".
745 * lib/configure.m4: == is not a valid operator for command test.
747 * src/lyxrc.C: add using directive.
749 * src/converter.h: add std:: qualifier.
751 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
753 * src/converter.[Ch] and other files: Change the Format class to a
754 real class, and create two instances: formats and system_format.
756 * src/lyxrc.C (output): Output the difference between formats and
759 * src/frontends/xforms/FormPreferences.C (input): Simplify.
760 (buildFormats): Insert formats into browser.
761 (inputFormats): Made the browser and add button functional.
762 (applyFormats): Update formats from format_vec.
764 * src/converter.C: Changed all (*it). to it->
765 (Format::dummy): New method.
766 (Format::importer): New format flag.
767 (Formats::GetAllFormats): New method.
768 (Formats::Add): Delete format from the map if prettyname is empty.
769 (Converter::Convert): Print an error message if moving the file fails.
770 (Converter::GetReachableTo): New method
772 * src/MenuBackend.[Ch]: Add support for importformats tag.
774 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
776 * lib/configure.m4: Add word->tex and ps->fax converters.
778 * lib/ui/default.ui: Use ImportFormats on file->import menu.
779 Return fax to file menu.
783 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
785 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
788 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
791 * src/lyxfunc.C (processKeyEvent): removed
793 * src/bufferlist.C (emergencyWrite): removed the out commented
794 emergency write code.
796 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
798 * src/LyXView.[Ch]: remove the outcommented raw_callback code
800 * many files: change formatting to be a bit more uniform for
801 if,while,for,switch statements, remove some parantesis not needed.
804 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
806 * config/kde.m4: make config more robust when KDEDIR is set
808 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
810 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
811 not returned a pixmap for "math-insert".
813 * src/LyXAction.C (init): sort the entries a bit.
815 2000-11-03 Juergen Vigna <jug@sad.it>
817 * src/insets/insettabular.h: added fixed number to update codes so
818 that update is only in one direction.
820 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
823 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
824 before call to edit because of redraw.
826 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
828 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
830 * lib/ui/default.ui: Populate "edit_float" menu
832 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
834 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
835 "floats-operate". The name is ugly (and the func also), but this
836 is just a band-aid until we switch to new insets.
838 2000-11-03 Rob Lahaye <lahaye@postech.edu>
840 * lib/ui/default.ui: update again the menu layout (fix some
843 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
845 * src/MenuBackend.h (fulllabel): new method.
847 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
848 the menu shortcuts of a menu are unique and whether they
849 correspond to a letter of the label.
850 (expand): call checkShortcuts when debugging.
852 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
854 * src/insets/insettext.C (InsetButtonPress): shut off warning.
856 2000-11-02 Lior Silberman <lior@Princeton.EDU>
858 * lib/examples/*.lyx : '\language default' => '\language english'
860 * lib/examples/it_splash.lyx : except where it should be italian
862 * lib/templates/*.lyx : the same
864 * doc/*.lyx* : the same
866 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
868 * lib/bind/menus.bind: remove the Layout menu entries, which I
869 somehow forgot earlier.
871 2000-11-03 Rob Lahaye <lahaye@postech.edu>
873 * lib/ui/old-default.ui: keep the old one here for reference (to
876 * lib/ui/default.ui: update the menu layout
878 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
880 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
881 Can now Apply to different insets without closing the dialog.
883 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
884 Can't actually DO anything with them yet, but I'd like a little
887 * src/frontends/xforms/input_validators.[ch]
888 (fl_lowercase_filter): new.
890 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
892 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
893 of MATH_CODE. This fixes a bug with math-macros in RTL text.
895 * src/text.C (PrepareToPrint): Show math-macros block aligned.
897 2000-11-02 Juergen Vigna <jug@sad.it>
899 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
900 on char insertion as it has already be updated by bv->updateInset().
902 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
903 if an inset inside was updated.
905 * lib/configure.cmd: commented out fax-search code
907 2000-11-01 Yves Bastide <stid@acm.org>
909 * src/tabular.C (OldFormatRead): set tabular language to the
912 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
914 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
915 class names with non-letter characters (from Yves Bastide).
917 * lib/ui/default.ui: change Item to OptItem in import menu.
918 Comment out fax stuff.
920 * lib/configure.m4: comment out fax-related stuff.
922 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
924 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
925 useful xforms helper functions. At present contains only formatted().
926 Input a string and it returns it with line breaks so that in fits
929 * src/frontends/xforms/Makefile.am: add new files.
931 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
932 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
935 * src/frontends/xforms/FormPreferences.[Ch]:
936 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
937 but lots of little clean ups. Removed enum State. Make use of
938 formatted(). Constify lots of methods. Perhaps best of all: removed
939 requirement for that horrible reinterpret_cast from pointer to long in
942 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
944 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
945 conditionalize build on xforms < 0.89
947 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
949 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
951 * src/LyXAction.C (init): comment out fax
953 * src/lyxrc.h: comment out the fax enums
954 comment out the fax variables
956 * src/commandtags.h: comment out LFUN_FAX
958 * src/lyxrc.C: disable fax variables.
959 (read): disable parsing of fax variables
960 (output): disable writing of fax variables
961 (getFeedback): now description for fax variables
963 * src/lyxfunc.C: comment out MenuFax
964 (Dispatch): disable LFUN_FAX
966 * src/lyx_cb.C (MenuFax): comment out
968 * src/WorkArea.C: add <cctype>
969 (work_area_handler): better key handling, should be ok now.
970 for accented chars + etc
972 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
973 lyx_sendfax.h and lyx_sendfax_man.C
975 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
976 (show): don't call InitLyXLookup when using xforms 0.89
978 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
980 * src/trans.C (AddDeadkey): better fix, the other one could crash...
982 * src/support/filetools.C (GetFileContents): close to dummy change
984 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
986 * src/trans.C (AddDeadkey): workaround stupid compilers.
988 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
990 * src/frontends/xforms/FormDocument.C (class_update): fix setting
991 of two-sided document.
993 2000-10-31 Juergen Vigna <jug@sad.it>
995 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
997 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
998 xposition to the Edit call.
1000 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1002 * src/trans.C (AddDeadkey): cast explicitly to char.
1004 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1006 * src/tabular.C (AsciiBottomHLine): simplify?
1007 (AsciiTopHLine): simplify?
1008 (print_n_chars): simplify
1009 (DocBook): remove most of the << endl; we should flush the stream
1010 as seldom as possible.
1012 (TeXBottomHLine): ditto
1013 (TeXTopHLine): ditto
1015 (write_attribute): try a templified version.
1016 (set_row_column_number_info): lesson scope of variables
1018 * src/support/lstrings.h (tostr): new specialization of tostr
1020 * src/trans.C (AddDeadkey): slightly cleaner fix.
1022 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1024 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1025 '%%' in Toc menu labels.
1028 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1029 font_norm is iso10646-1.
1031 * src/font.C (ascent): Fixed for 16bit fonts
1032 (descent,lbearing,rbearing): ditto
1034 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1036 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1037 (getFeedback): new static method.
1039 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1040 Now use combox rather than choice to display languages.
1041 Feedback is now output using a new timer callback mechanism, identical
1042 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1044 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1046 * src/minibuffer.C: fix for older compilers
1048 2000-10-30 Juergen Vigna <jug@sad.it>
1050 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1051 has to be Left of the inset otherwise LyXText won't find it!
1053 * src/BufferView2.C (open_new_inset): delete the inset if it can
1056 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1058 * lyx.man: fix typo.
1060 2000-10-29 Marko Vendelin <markov@ioc.ee>
1061 * src/frontends/gnome/FormCitation.C
1062 * src/frontends/gnome/FormCitation.h
1063 * src/frontends/gnome/FormCopyright.C
1064 * src/frontends/gnome/FormCopyright.h
1065 * src/frontends/gnome/FormError.C
1066 * src/frontends/gnome/FormError.h
1067 * src/frontends/gnome/FormIndex.C
1068 * src/frontends/gnome/FormIndex.h
1069 * src/frontends/gnome/FormPrint.C
1070 * src/frontends/gnome/FormPrint.h
1071 * src/frontends/gnome/FormRef.C
1072 * src/frontends/gnome/FormRef.h
1073 * src/frontends/gnome/FormToc.C
1074 * src/frontends/gnome/FormToc.h
1075 * src/frontends/gnome/FormUrl.C
1076 * src/frontends/gnome/FormUrl.h
1077 * src/frontends/gnome/Menubar_pimpl.C
1078 * src/frontends/gnome/mainapp.C
1079 * src/frontends/gnome/mainapp.h
1080 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1081 changing update() to updateSlot() where appropriate
1083 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1085 * src/frontends/xforms/FormPreferences.[Ch]:
1086 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1089 2000-10-28 Juergen Vigna <jug@sad.it>
1091 * src/insets/insettabular.C (draw): fixed drawing bug.
1093 * src/insets/insettext.C (clear):
1095 (SetParagraphData): clearing the TEXT buffers when deleting the
1096 paragraphs used by it.
1098 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1100 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1102 2000-10-27 Juergen Vigna <jug@sad.it>
1104 * src/tabular.C (~LyXTabular): removed not needed anymore.
1106 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1109 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1111 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1114 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1117 * src/frontends/xforms/FormPreferences.[Ch]:
1118 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1119 Reorganised as modules based on tabs. Much easier to follow the
1120 flow and to add new tabs. Added warning and feedback messages.
1123 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1125 * src/tabular.h (DocBook): add std:: qualifier.
1127 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1129 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1130 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1133 * insettabular.C (DocBook): uses the tabular methods to export
1136 * src/insets/insettext.h
1137 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1139 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1141 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1144 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1145 moved misplaced AllowInput two lines up.
1147 * src/buffer.C (readFile): compare float with float, not with int
1149 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1151 * src/minibuffer.C: add "using SigC::slot" statement.
1153 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1155 * src/frontends/xforms/forms/README: updated section about make.
1157 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1158 Tidied some forms up, made two of form_tabular's tabs more
1159 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1160 fixed translation problem with "Column".
1162 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1164 * src/minibuffer.h: use Timeout instead of the xforms timer
1166 (setTimer) rewrite for the Timeout, change to unsigned arg
1167 (set): change to unsigned timer arg
1170 * src/minibuffer.C (TimerCB): removed func
1171 (C_MiniBuffer_TimerCB): removed func
1172 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1173 (peek_event): use a switch statement
1174 (add): don't use fl_add_timer.
1175 (Set): rewrite to use the Timeout
1178 * src/Timeout.[Ch] (setType): return a Timeout &
1179 (setTimeout): ditto, change to unsigned arg for timeout
1181 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1183 * src/mathed/formula.C (mathed_string_width): Use string instead
1184 of a constant size char array.
1186 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1188 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1189 the two recently added operator<< for SMInput and State.
1191 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1193 (OkCancelPolicy): ditto
1194 (OkCancelReadOnlyPolicy): ditto
1195 (NoRepeatedApplyReadOnlyPolicy): ditto
1196 (OkApplyCancelReadOnlyPolicy): ditto
1197 (OkApplyCancelPolicy): ditto
1198 (NoRepeatedApplyPolicy): ditto
1200 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1202 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1203 add the usual std:: qualifiers.
1205 2000-10-25 Juergen Vigna <jug@sad.it>
1207 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1209 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1211 * src/support/filetools.C (MakeRelPath): change some types to
1214 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1215 ButtonPolicy::SMInput and ButtonPolicy::State.
1217 * src/FontLoader.C (reset): small cleanup
1218 (unload): small cleanup
1220 * src/FontInfo.C (getFontname): initialize error to 10000.0
1222 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1224 * src/frontends/xforms/FormPreferences.[Ch]:
1225 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1226 TeX encoding and default paper size sections.
1228 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1230 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1233 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1234 make the message_ empty.
1235 (FormError): don't initialize message_ in initializer list.
1237 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1239 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1241 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1243 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1245 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1247 * src/frontends/kde/*data.[Ch]: _("") is not
1250 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1252 * src/buffer.C: removed redundant using directive.
1254 * src/frontends/DialogBase.h: revert to original definition of
1257 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1258 stuff into two classes, one for each dialog, requires a new
1259 element in the dialogs vector, FormTabularCreate.
1261 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1264 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1265 method. Continues Allan's idea, but means that derived classes
1266 don't need to worry about "update or hide?".
1268 * src/frontends/xforms/FormError.C (showInset): add connection
1271 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1272 one for each dialog. FormTabular now contains main tabular dialog
1275 * src/frontends/xforms/FormTabularCreate.[Ch]:
1276 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1279 * src/frontends/xforms/FormGraphics.[Ch]:
1280 * src/frontends/xforms/forms/form_graphics.fd
1281 * src/frontends/xforms/FormTabular.[Ch]:
1282 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1283 classes of FormInset.
1285 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1286 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1288 * src/frontends/xforms/Makefile.am:
1289 * src/frontends/xforms/forms/makefile: added new files.
1291 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1292 variable. added Signal0 hide signal, in keeping with other GUI-I
1295 * src/support/lstrings.h: removed redundant std:: qualifier as
1296 it's already declared in Lsstream.h.
1298 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1300 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1304 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1306 * src/tabular.C (Ascii): minimize scope of cell.
1308 * src/BufferView2.C (nextWord): return string() instead of 0;
1310 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1312 * src/converter.h: add a std:: qualifier
1314 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1316 * src/importer.[Ch]: New files. Used for importing files into LyX.
1318 * src/lyxfunc.C (doImport): Use the new Importer class.
1320 * src/converter.h: Add shortcut member to the Format class.
1321 Used for holding the menu shortcut.
1323 * src/converter.C and other files: Made a distinction between
1324 format name and format extension. New formats can be defined using
1325 the \format lyxrc tag.
1326 Added two new converter flags: latex and disable.
1328 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1330 * src/support/lyxlib.h: unify namespace/struct implementation.
1331 Remove extra declarations.
1333 * src/support/chdir.C (chdir): remove version taking char const *
1335 * src/support/rename.C: ditto.
1336 * src/support/lyxsum.C: ditto.
1338 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1340 * src/frontends/xforms/FormBase.[Ch]:
1341 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1342 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1343 work only for the next call to fl_show_form(). The correct place to set
1344 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1345 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1346 from FormBase have the minimum size set; no more stupid crashes with
1349 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1351 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1353 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1355 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1357 * src/support/lyxlib.h: changed second argument of mkdir to
1358 unsigned long int (unsigned int would probably have been enough,
1359 but...). Removed <sys/types.h> header.
1360 * src/support/mkdir.C (mkdir): ditto.
1364 2000-10-19 Juergen Vigna <jug@sad.it>
1366 * src/lyxfunc.C (MenuNew): small fix (form John)
1368 * src/screen.C (Update): removed unneeded code.
1370 * src/tabular.C (Ascii): refixed int != uint bug!
1372 * src/support/lyxlib.h: added sys/types.h include for now permits
1373 compiling, but I don't like this!
1375 2000-10-18 Juergen Vigna <jug@sad.it>
1377 * src/text2.C (ClearSelection): if we clear the selection we need
1378 more refresh so set the status apropriately
1380 * src/insets/insettext.C (draw): hopefully finally fixed draw
1383 2000-10-12 Juergen Vigna <jug@sad.it>
1385 * src/insets/insettext.C (draw): another small fix and make a block
1386 so that variables are localized.
1388 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1390 * src/support/lstrings.C (lowercase, uppercase):
1391 use explicit casts to remove compiler warnings.
1393 * src/support/LRegex.C (Impl):
1394 * src/support/StrPool.C (add):
1395 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1396 (AddPath, MakeDisplayPath):
1397 * src/support/lstrings.C (prefixIs, subst):
1398 use correct type to remove compiler warnings.
1400 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1402 * src/support/lyxlib.h:
1403 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1404 portability and to remove compiler warning with DEC cxx.
1406 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1408 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1410 * src/minibuffer.C (peek_event): retun 1 when there has been a
1411 mouseclick in the minibuffer.
1415 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1417 * src/frontends/xforms/FormParagraph.C: more space above/below
1420 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1422 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1423 a char only if real_current_font was changed.
1425 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1427 * NEWS: update somewhat for 1.1.6
1429 * lib/ui/default.ui: clean up.
1431 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1433 * lib/CREDITS: clean up
1435 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1437 * src/combox.[Ch] (select): changed argument back to int
1438 * src/combox.C (peek_event): removed num_bytes as it is declared but
1441 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1442 modified calls to Combox::select() to remove warnings about type
1445 * src/insets/insetbutton.C (width): explicit cast to remove warning
1446 about type conversion.
1448 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1451 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1452 sel_pos_end, refering to cursor position are changed to
1453 LyXParagraph::size_type.
1455 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1456 consistent with LyXCursor::pos().
1457 (inset_pos): changed to LyXParagraph::size_type for same reason.
1459 * src/insets/insettext.C (resizeLyXText): changed some temporary
1460 variables refing to cursor position to LyXParagraph::size_type.
1462 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1464 * src/frontends/kde/<various>: The Great Renaming,
1467 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1469 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1471 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1473 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1474 0 when there are no arguments.
1476 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1478 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1479 to segfaults when pressing Ok in InsetBibtex dialog.
1481 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1483 * forms/layout_forms.fd:
1484 * src/layout_forms.C (create_form_form_character): small change to use
1485 labelframe rather than engraved frame + text
1487 * src/lyx_gui.C (create_forms): initialise choice_language with some
1488 arbitrary value to prevent segfault when dialog is shown.
1490 2000-10-16 Baruch Even <baruch.even@writeme.com>
1492 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1493 is no resulting file. This pertains only to LaTeX output.
1495 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1497 * src/text.C (Backspace): Make sure that the row of the cursor is
1500 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1503 * src/lyx_gui.C (init): Prevent a crash when only one font from
1504 menu/popup fonts is not found.
1506 * lib/lyxrc.example: Add an example for binding a key for language
1509 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1511 * src/converter.C (GetReachable): Changed the returned type to
1513 (IsReachable): New method
1515 * src/MenuBackend.C (expand): Handle formats that appear more
1518 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1520 * src/frontends/support/Makefile.am
1521 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1524 * lib/CREDITS: add Garst Reese.
1526 * src/support/snprintf.h: add extern "C" {} around the definitions.
1528 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1530 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1533 * src/frontends/xforms/FormDocument.C:
1534 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1535 compile without "conversion to integral type of smaller size"
1538 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1540 * src/text.C (GetColumnNearX): Fixed disabled code.
1542 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1544 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1547 * src/support/snprintf.[ch]: new files
1549 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1551 * src/frontends/kde/formprintdialog.C: add
1552 file browser for selecting postscript output
1554 * src/frontends/kde/formprintdialogdata.C:
1555 * src/frontends/kde/formprintdialogdata.h: re-generate
1558 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1560 * src/frontends/gnome/Makefile.am:
1561 * src/frontends/kde/Makefile.am: FormCommand.C
1562 disappeared from xforms
1564 * src/frontends/kde/FormCitation.C:
1565 * src/frontends/kde/FormIndex.C: read-only
1568 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1570 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1573 * src/bufferlist.C: add using directive.
1575 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1577 * src/support/lyxfunctional.h: version of class_fun for void
1578 returns added, const versions of back_inseter_fun and compare_fun
1581 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1583 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1585 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1587 * ChangeLog: cleanup.
1589 * lib/CREDITS: update to add all the contributors we've forgotten.
1590 I have obviously missed some, so tell me whether there were
1593 2000-10-13 Marko Vendelin <markov@ioc.ee>
1595 * src/frontends/gnome/FormCitation.C
1596 * src/frontends/gnome/FormCitation.h
1597 * src/frontends/gnome/FormError.C
1598 * src/frontends/gnome/FormIndex.C
1599 * src/frontends/gnome/FormRef.C
1600 * src/frontends/gnome/FormRef.h
1601 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1603 * src/frontends/gnome/FormCitation.C
1604 * src/frontends/gnome/FormCopyright.C
1605 * src/frontends/gnome/FormError.C
1606 * src/frontends/gnome/FormIndex.C
1607 * src/frontends/gnome/FormRef.C
1608 * src/frontends/gnome/FormToc.C
1609 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1612 * src/frontends/gnome/Menubar_pimpl.C
1613 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1616 2000-10-11 Baruch Even <baruch.even@writeme.com>
1619 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1620 to convey its real action.
1622 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1623 clear the minibuffer and prepare to enter a command.
1625 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1626 the rename from ExecCommand to PrepareForCommand.
1627 * src/lyxfunc.C (Dispatch): ditto.
1629 2000-10-11 Baruch Even <baruch.even@writeme.com>
1631 * src/buffer.C (writeFile): Added test for errors on writing, this
1632 catches all errors and not only file system full errors as intended.
1634 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1636 * src/lyx_gui.C (create_forms): better fix for crash with
1637 translated interface.
1639 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1641 * src/frontends/kde/Makefile.am:
1642 * src/frontends/kde/FormCopyright.C:
1643 * src/frontends/kde/formcopyrightdialog.C:
1644 * src/frontends/kde/formcopyrightdialog.h:
1645 * src/frontends/kde/formcopyrightdialogdata.C:
1646 * src/frontends/kde/formcopyrightdialogdata.h:
1647 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1648 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1649 copyright to use qtarch
1651 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1653 * src/encoding.C (read): Fixed bug that caused an error message at
1654 the end of the file.
1656 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1658 * lib/lyxrc.example: Fixed hebrew example.
1660 2000-10-13 Allan Rae <rae@lyx.org>
1662 * src/frontends/xforms/FormPreferences.C (input): reworking the
1664 (build, update, apply): New inputs in various tabfolders
1666 * src/frontends/xforms/FormToc.C: use new button policy.
1667 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1668 dialogs that either can't use any existing policy or where it just
1671 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1674 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1675 added a bool parameter which is ignored.
1677 * src/buffer.C (setReadonly):
1678 * src/BufferView_pimpl.C (buffer):
1679 * src/frontends/kde/FormCopyright.h (update):
1680 * src/frontends/kde/FormCitation.[Ch] (update):
1681 * src/frontends/kde/FormIndex.[Ch] (update):
1682 * src/frontends/kde/FormPrint.[Ch] (update):
1683 * src/frontends/kde/FormRef.[Ch] (update):
1684 * src/frontends/kde/FormToc.[Ch] (update):
1685 * src/frontends/kde/FormUrl.[Ch] (update):
1686 * src/frontends/gnome/FormCopyright.h (update):
1687 * src/frontends/gnome/FormCitation.[Ch] (update):
1688 * src/frontends/gnome/FormError.[Ch] (update):
1689 * src/frontends/gnome/FormIndex.[Ch] (update):
1690 * src/frontends/gnome/FormPrint.[Ch] (update):
1691 * src/frontends/gnome/FormRef.h (update):
1692 * src/frontends/gnome/FormToc.[Ch] (update):
1693 * src/frontends/gnome/FormUrl.[Ch] (update):
1694 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1695 to updateBufferDependent and DialogBase
1697 * src/frontends/xforms/FormCitation.[hC]:
1698 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1699 * src/frontends/xforms/FormError.[Ch]:
1700 * src/frontends/xforms/FormGraphics.[Ch]:
1701 * src/frontends/xforms/FormIndex.[Ch]:
1702 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1703 and fixed readOnly handling.
1704 * src/frontends/xforms/FormPrint.[Ch]:
1705 * src/frontends/xforms/FormRef.[Ch]:
1706 * src/frontends/xforms/FormTabular.[Ch]:
1707 * src/frontends/xforms/FormToc.[Ch]:
1708 * src/frontends/xforms/FormUrl.[Ch]:
1709 * src/frontends/xforms/FormInset.[Ch]:
1710 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1711 form of updateBufferDependent.
1713 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1714 if form()->visible just in case someone does stuff to the form in a
1717 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1718 the buttoncontroller for everything the enum used to be used for.
1719 (update) It would seem we need to force all dialogs to use a bool
1720 parameter or have two update functions. I chose to go with one.
1721 I did try removing update() from here and FormBase and defining the
1722 appropriate update signatures in FormBaseB[DI] but then ran into the
1723 problem of the update() call in FormBase::show(). Whatever I did
1724 to get around that would require another function and that just
1725 got more confusing. Hence the decision to make everyone have an
1726 update(bool). An alternative might have been to override show() in
1727 FormBaseB[DI] and that would allow the different and appropriate
1730 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1731 true == buffer change occurred. I decided against using a default
1732 template parameter since not all compilers support that at present.
1734 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1736 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1737 army knife" by removing functionality.
1738 (clearStore): removed. All such housekeeping on hide()ing the dialog
1739 is to be carried out by overloaded disconnect() methods.
1740 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1741 superceded by Baruch's neat test (FormGraphics) to update an existing
1742 dialog if a new signal is recieved rather than block all new signals
1744 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1745 only to Inset dialogs.
1746 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1747 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1749 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1751 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1752 as a base class to all inset dialogs. Used solely to connect/disconnect
1753 the Inset::hide signal and to define what action to take on receipt of
1754 a UpdateBufferDependent signal.
1755 (FormCommand): now derived from FormInset.
1757 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1760 * src/frontends/xforms/FormCopyright.[Ch]:
1761 * src/frontends/xforms/FormPreferences.[Ch]:
1762 now derived from FormBaseBI.
1764 * src/frontends/xforms/FormDocument.[Ch]:
1765 * src/frontends/xforms/FormParagraph.[Ch]:
1766 * src/frontends/xforms/FormPrint.[Ch]:
1767 now derived from FormBaseBD.
1769 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1771 * src/frontends/xforms/FormCitation.[Ch]:
1772 * src/frontends/xforms/FormError.[Ch]:
1773 * src/frontends/xforms/FormRef.[Ch]:
1774 * src/frontends/xforms/FormToc.[Ch]:
1775 (clearStore): reworked as disconnect().
1777 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1780 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1782 * src/converter.C (runLaTeX): constify buffer argument
1785 * src/frontends/support/Makefile.am (INCLUDES): fix.
1787 * src/buffer.h: add std:: qualifier
1788 * src/insets/figinset.C (addpidwait): ditto
1789 * src/MenuBackend.C: ditto
1790 * src/buffer.C: ditto
1791 * src/bufferlist.C: ditto
1792 * src/layout.C: ditto
1793 * src/lyxfunc.C: ditto
1795 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1797 * src/lyxtext.h (bidi_level): change return type to
1798 LyXParagraph::size_type.
1800 * src/lyxparagraph.h: change size_type to
1801 TextContainer::difference_type. This should really be
1802 TextContainer::size_type, but we need currently to support signed
1805 2000-10-11 Marko Vendelin <markov@ioc.ee>
1806 * src/frontends/gnome/FormError.h
1807 * src/frontends/gnome/FormRef.C
1808 * src/frontends/gnome/FormRef.h
1809 * src/frontends/gnome/FormError.C
1810 * src/frontends/gnome/Makefile.am
1811 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1812 to Gnome frontend. Both dialogs use "action" area.
1814 2000-10-12 Baruch Even <baruch.even@writeme.com>
1816 * src/graphics/GraphicsCacheItem_pimpl.C:
1817 * src/graphics/Renderer.C:
1818 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1821 2000-10-12 Juergen Vigna <jug@sad.it>
1823 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1824 visible when selecting).
1826 * development/Code_rules/Rules: fixed some typos.
1828 2000-10-09 Baruch Even <baruch.even@writeme.com>
1830 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1831 compiling on egcs 1.1.2 possible.
1833 * src/filedlg.C (comp_direntry::operator() ): ditto.
1835 2000-08-31 Baruch Even <baruch.even@writeme.com>
1837 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1840 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1841 transient it now only gets freed when the object is destructed.
1843 2000-08-24 Baruch Even <baruch.even@writeme.com>
1845 * src/frontends/FormGraphics.h:
1846 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1849 2000-08-20 Baruch Even <baruch.even@writeme.com>
1851 * src/insets/insetgraphics.C:
1852 (draw): Added messages to the drawn rectangle to report status.
1853 (updateInset): Disabled the use of the inline graphics,
1856 2000-08-17 Baruch Even <baruch.even@writeme.com>
1858 * src/frontends/support: Directory added for the support of GUII LyX.
1860 * src/frontends/support/LyXImage.h:
1861 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1864 * src/frontends/support/LyXImage_X.h:
1865 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1866 version of LyXImage, this uses the Xlib Pixmap.
1868 * src/PainterBase.h:
1869 * src/PainterBase.C:
1871 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1872 replacement to Pixmap.
1874 * src/insets/insetgraphics.h:
1875 * src/insets/insetgraphics.C:
1876 * src/graphics/GraphicsCacheItem.h:
1877 * src/graphics/GraphicsCacheItem.C:
1878 * src/graphics/GraphicsCacheItem_pimpl.h:
1879 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1882 * src/graphics/GraphicsCacheItem.h:
1883 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1884 another copy of the object.
1886 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1887 of cacheHandle, this fixed a bug that sent LyX crashing.
1889 * src/graphics/XPM_Renderer.h:
1890 * src/graphics/XPM_Renderer.C:
1891 * src/graphics/EPS_Renderer.h:
1892 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1894 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1896 * src/lyxfunc.C (processKeySym): only handle the
1897 lockinginset/inset stuff if we have a buffer and text loaded...
1899 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1901 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1903 * src/support/lyxfunctional.h: add operator= that takes a reference
1905 * src/lyxserver.C (mkfifo): make first arg const
1907 * src/layout.h: renamed name(...) to setName(...) to work around
1910 * src/buffer.C (setFileName): had to change name of function to
1911 work around bugs in egcs. (renamed from fileName)
1913 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1915 * src/support/translator.h: move helper template classes to
1916 lyxfunctional.h, include "support/lyxfunctional.h"
1918 * src/support/lyxmanip.h: add delaration of fmt
1920 * src/support/lyxfunctional.h: new file
1921 (class_fun_t): new template class
1922 (class_fun): helper template function
1923 (back_insert_fun_iterator): new template class
1924 (back_inserter_fun): helper template function
1925 (compare_memfun_t): new template class
1926 (compare_memfun): helper template function
1927 (equal_1st_in_pair): moved here from translator
1928 (equal_2nd_in_pair): moved here from translator
1930 * src/support/fmt.C: new file
1931 (fmt): new func, can be used for a printf substitute when still
1932 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1934 * src/support/StrPool.C: add some comments
1936 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1939 * src/insets/figinset.C (addpidwait): use std::copy with
1940 ostream_iterator to fill the pidwaitlist
1942 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1944 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1947 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1950 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1952 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1953 (class_update): ditto
1954 (BulletPanel): ditto
1955 (CheckChoiceClass): move initialization of tc and tct
1957 * src/tabular.C: remove current_view
1958 (OldFormatRead): similar to right below [istream::ignore]
1960 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1961 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1962 unused [istream::ignore]
1964 * src/lyxfunc.C: include "support/lyxfunctional.h"
1965 (getInsetByCode): use std::find_if and compare_memfun
1967 * src/lyxfont.C (stateText): remove c_str()
1969 * src/lyx_main.C (setDebuggingLevel): make static
1970 (commandLineHelp): make static
1972 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1973 Screen* together with fl_get_display() and fl_screen
1975 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1976 togheter with fl_get_display() and fl_screen
1977 (create_forms): remove c_str()
1979 * src/layout.C: include "support/lyxfunctional.h"
1980 (hasLayout): use std::find_if and compare_memfun
1981 (GetLayout): use std::find_if and comapre_memfun
1982 (delete_layout): use std::remove_if and compare_memfun
1983 (NumberOfClass): use std:.find_if and compare_memfun
1985 * src/gettext.h: change for the new functions
1987 * src/gettext.C: new file, make _(char const * str) and _(string
1988 const & str) real functions.
1990 * src/font.C (width): rewrite slightly to avoid one extra variable
1992 * src/debug.C: initialize Debug::ANY here
1994 * src/commandtags.h: update number comments
1996 * src/combox.h (get): make const func
1998 (getline): make const
2000 * src/combox.C (input_cb): handle case where fl_get_input can
2003 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2004 "support/lyxfunctional.h", remove current_view variable.
2005 (resize): use std::for_each with std::mem_fun
2006 (getFileNames): use std::copy with back_inserter_fun
2007 (getBuffer): change arg type to unsigned int
2008 (emergencyWriteAll): call emergencyWrite with std::for_each and
2010 (emergencyWrite): new method, the for loop in emergencyWriteAll
2012 (exists): use std::find_if with compare_memfun
2013 (getBuffer): use std::find_if and compare_memfun
2015 * src/buffer.h: add typedefs for iterator_category, value_type
2016 difference_type, pointer and reference for inset_iterator
2017 add postfix ++ for inset_iterator
2018 make inset_iterator::getPos() const
2020 * src/buffer.C: added support/lyxmanip.h
2021 (readFile): use lyxerr << fmt instead of printf
2022 (makeLaTeXFile): use std::copy to write out encodings
2024 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2026 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2027 free and the char * temp.
2028 (hasMenu): use std::find_if and compare_memfun
2031 * src/Makefile.am (lyx_SOURCES): added gettext.C
2033 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2034 string::insert small change to avoid temporary
2036 * src/LColor.C (getGUIName): remove c_str()
2038 * several files: change all occurrences of fl_display to
2041 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2042 that -pedantic is not used for gcc 2.97 (cvs gcc)
2044 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2046 2000-10-11 Allan Rae <rae@lyx.org>
2048 * src/frontends/xforms/FormPreferences.C (input): template path must be
2049 a readable directory. It doesn't need to be writeable.
2050 (build, delete, update, apply): New inputs in the various tabfolders
2052 * src/frontends/xforms/forms/form_preferences.fd:
2053 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2054 several new entries to existing folders. Shuffled some existing stuff
2057 * src/frontends/xforms/forms/form_print.fd:
2058 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2059 Should probably rework PrinterParams as well. Note that the switch to
2060 collated is effectively the same as !unsorted so changing PrinterParams
2061 will require a lot of fiddly changes to reverse the existing logic.
2063 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2065 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2067 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2069 2000-10-10 Allan Rae <rae@lyx.org>
2072 * src/lyxfunc.C (Dispatch):
2074 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2077 * src/lyxrc.C (output): Only write the differences between system lyxrc
2078 and the users settings.
2081 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2083 I'll rewrite this later, after 1.1.6 probably, to keep a single
2084 LyXRC but two instances of a LyXRCStruct.
2086 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2088 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2090 * src/tabular.h: add a few std:: qualifiers.
2092 * src/encoding.C: add using directive.
2093 * src/language.C: ditto.
2095 * src/insets/insetquotes.C (Validate): use languages->lang()
2096 instead of only language.
2098 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2100 * lib/languages: New file.
2102 * lib/encodings: New file.
2104 * src/language.C (Languages): New class.
2105 (read): New method. Reads the languages from the 'languages' file.
2107 * src/encoding.C (Encodings): New class.
2108 (read): New method. Reads the encodings from the 'encodings' file.
2110 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2113 * src/bufferparams.h and a lot of files: Deleted the member language,
2114 and renamed language_info to language
2116 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2117 * src/lyxfont.C (latexWriteStartChanges): ditto.
2118 * src/paragraph.C (validate,TeXOnePar): ditto.
2120 * src/lyxfont.C (update): Restored deleted code.
2122 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2124 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2126 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2128 * src/insets/figinset.[Ch]:
2129 * src/insets/insetinclude.[Ch]:
2130 * src/insets/insetinclude.[Ch]:
2131 * src/insets/insetparent.[Ch]:
2132 * src/insets/insetref.[Ch]:
2133 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2135 * src/insets/*.[Ch]:
2136 * src/mathed/formula.[Ch]:
2137 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2139 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2140 * src/lyx_cb.C (FigureApplyCB):
2141 * src/lyxfunc.C (getStatus, Dispatch):
2142 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2145 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2147 * src/converter.[Ch] (Formats::View):
2148 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2150 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2151 *current_view->buffer(). This will change later, but this patch is way
2154 2000-10-09 Juergen Vigna <jug@sad.it>
2156 * src/text.C (GetRow): small fix.
2158 * src/BufferView_pimpl.C (cursorPrevious):
2159 (cursorNext): added LyXText parameter to function.
2161 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2162 keypress depending on cursor position.
2164 2000-10-06 Juergen Vigna <jug@sad.it>
2166 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2167 (copySelection): redone this function and also copy ascii representa-
2170 * src/tabular.C (Ascii):
2174 (print_n_chars): new functions to realize the ascii export of tabulars.
2176 2000-10-05 Juergen Vigna <jug@sad.it>
2178 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2179 if we don't have a buffer.
2181 2000-10-10 Allan Rae <rae@lyx.org>
2183 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2184 with closing dialog. It seems that nested tabfolders require hiding
2185 of inner tabfolders before hiding the dialog itself. Actually all I
2186 did was hide the active outer folder.
2188 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2189 unless there really is a buffer. hideBufferDependent is called
2192 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2193 POTFILES.in stays in $(srcdir).
2195 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2197 * lib/lyxrc.example: Few changes.
2199 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2201 * src/BufferView_pimpl.C (buffer): only need one the
2202 updateBufferDependent signal to be emitted once! Moved to the end of
2203 the method to allow bv_->text to be updated first.
2205 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2206 and hSignal_ with Dialogs * and BufferDependency variables.
2207 New Buffer * parent_, initialised when the dialog is launched. Used to
2208 check whether to update() or hide() dialog in the new, private
2209 updateOrHide() method that is connected to the updateBufferDependent
2210 signal. Daughter classes dictate what to do using the
2211 ChangedBufferAction enum, passed to the c-tor.
2213 * src/frontends/xforms/FormCitation.C:
2214 * src/frontends/xforms/FormCommand.C:
2215 * src/frontends/xforms/FormCopyright.C:
2216 * src/frontends/xforms/FormDocument.C:
2217 * src/frontends/xforms/FormError.C:
2218 * src/frontends/xforms/FormIndex.C:
2219 * src/frontends/xforms/FormPreferences.C:
2220 * src/frontends/xforms/FormPrint.C:
2221 * src/frontends/xforms/FormRef.C:
2222 * src/frontends/xforms/FormToc.C:
2223 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2226 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2227 ChangedBufferAction enum.
2229 * src/frontends/xforms/FormParagraph.[Ch]
2230 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2233 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2235 * lib/bind/cua.bind: fix a bit.
2236 * lib/bind/emacs.bind: ditto.
2238 * lib/bind/menus.bind: remove real menu entries from there.
2240 * src/spellchecker.C: make sure we only include strings.h when
2243 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2245 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2246 function. It enlarges the maximum number of pup when needed.
2247 (add_toc2): Open a new menu if maximum number of items per menu has
2250 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2252 * src/frontends/kde/FormPrint.C: fix error reporting
2254 * src/frontends/xforms/FormDocument.C: fix compiler
2257 * lib/.cvsignore: add Literate.nw
2259 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2262 * bufferview_funcs.[Ch]
2265 * text2.C: Add support for numbers in RTL text.
2267 2000-10-06 Allan Rae <rae@lyx.org>
2269 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2270 to be gettext.m4 friendly again. ext_l10n.h is now
2271 generated into $top_srcdir instead of $top_builddir
2272 so that lyx.pot will be built correctly -- without
2273 duplicate parsing of ext_l10n.h.
2275 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2277 * src/frontends/kde/FormCitation.C: make the dialog
2278 behave more sensibly
2280 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2282 * config/kde.m4: fix consecutive ./configure runs,
2283 look for qtarch, fix library order
2285 * src/frontends/kde/Makefile.am: tidy up,
2286 add Print dialog, add .dlg dependencies
2288 * src/frontends/kde/FormPrint.C:
2289 * src/frontends/kde/FormPrint.h:
2290 * src/frontends/kde/formprintdialog.C:
2291 * src/frontends/kde/formprintdialog.h:
2292 * src/frontends/kde/formprintdialogdata.C:
2293 * src/frontends/kde/formprintdialogdata.h:
2294 * src/frontends/kde/dlg/formprintdialog.dlg: add
2297 * src/frontends/kde/dlg/README: Added explanatory readme
2299 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2300 script to double-check qtarch's output
2302 * src/frontends/kde/formindexdialog.C:
2303 * src/frontends/kde/formindexdialogdata.C:
2304 * src/frontends/kde/formindexdialogdata.h:
2305 * src/frontends/kde/dlg/formindexdialog.dlg: update
2306 for qtarch, minor fixes
2308 2000-10-05 Allan Rae <rae@lyx.org>
2310 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2311 dialogs when switching buffers update them instead. It's up to each
2312 dialog to decide if it should still be visible or not.
2313 update() should return a bool to control visiblity within show().
2314 Or perhaps better to set a member variable and use that to control
2317 * lib/build-listerrors: create an empty "listerrors" file just to stop
2318 make trying to regenerate it all the time if you don't have noweb
2321 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2323 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2324 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2325 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2326 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2327 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2329 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2331 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2333 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2334 deleting buffer. Closes all buffer-dependent dialogs.
2336 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2338 * src/frontends/xforms/FormCitation.[Ch]:
2339 * src/frontends/xforms/FormPreferences.[Ch]:
2340 * src/frontends/xforms/FormPrint.[Ch]:
2341 * src/frontends/xforms/FormRef.[Ch]:
2342 * src/frontends/xforms/FormUrl.[Ch]: ditto
2344 * src/frontends/xforms/FormDocument.[Ch]:
2345 * src/frontends/xforms/forms/form_document.C.patch:
2346 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2347 pass through a single input() function.
2349 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2351 * lib/build-listerrors: return status as OK
2353 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2355 * lib/lyxrc.example: Updated to new export code
2357 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2359 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2362 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2365 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2366 LyX-Code is defined.
2367 * lib/layouts/amsbook.layout: ditto.
2369 * boost/Makefile.am: fix typo.
2371 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2373 (add_lastfiles): removed.
2374 (add_documents): removed.
2375 (add_formats): removed.
2377 * src/frontends/Menubar.C: remove useless "using" directive.
2379 * src/MenuBackend.h: add a new MenuItem constructor.
2381 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2384 2000-10-04 Allan Rae <rae@lyx.org>
2386 * lib/Makefile.am (listerrors):
2387 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2388 I haven't got notangle installed so Kayvan please test. The output
2389 should end up in $builddir. This also allows people who don't have
2390 noweb installed to complete the make process without error.
2392 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2393 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2394 by JMarc's picky compiler.
2396 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2399 * src/insets/insettabular.C (setPos): change for loop to not use
2400 sequencing operator. Please check this Jürgen.
2402 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2404 * src/insets/insetcite.C (getScreenLabel): ditto
2405 * src/support/filetools.C (QuoteName): ditto
2406 (ChangeExtension): ditto
2408 * src/BufferView_pimpl.C (scrollCB): make heigt int
2410 * src/BufferView2.C (insertInset): comment out unused arg
2412 * boost/Makefile.am (EXTRADIST): new variable
2414 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2416 * src/exporter.C (IsExportable): Fixed
2418 * lib/configure.m4: Small fix
2420 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2422 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2423 * src/insets/insetbib.C (bibitemWidest): ditto.
2424 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2426 2000-10-03 Juergen Vigna <jug@sad.it>
2428 * src/BufferView2.C (theLockingInset): removed const because of
2429 Agnus's compile problems.
2431 * src/insets/insettext.C (LocalDispatch): set the language of the
2432 surronding paragraph on inserting the first character.
2434 * various files: changed use of BufferView::the_locking_inset.
2436 * src/BufferView2.C (theLockingInset):
2437 (theLockingInset): new functions.
2439 * src/BufferView.h: removed the_locking_inset.
2441 * src/lyxtext.h: added the_locking_inset
2443 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2445 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2447 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2449 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2450 * src/mathed/math_cursor.C (IsAlpha): ditto.
2451 * src/mathed/math_inset.C (strnew): ditto.
2452 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2453 (IMetrics): cxp set but never used; removed.
2454 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2455 that the variable in question has been removed also!
2458 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2459 using the Buffer * passed to Latex(), using the BufferView * passed to
2460 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2462 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2463 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2465 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2466 * src/buffer.C (readInset): used new InsetBibtex c-tor
2467 * (getBibkeyList): used new InsetBibtex::getKeys
2469 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2472 * lib/build-listerrors
2474 * src/exporter.C: Add literate programming support to the export code
2477 * src/lyx_cb.C: Remove old literate code.
2479 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2482 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2483 * src/converter.C (View, Convert): Use QuoteName.
2485 * src/insets/figinset.C (Preview): Use Formats::View.
2487 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2489 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2491 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2492 the top of the function, because compaq cxx complains that the
2493 "goto exit_with_message" when the function is disabled bypasses
2495 (MenuNew): try a better fix for the generation of new file names.
2496 This time, I used AddName() instead of AddPath(), hoping Juergen
2499 2000-10-03 Allan Rae <rae@lyx.org>
2501 * src/frontends/xforms/forms/form_preferences.fd:
2502 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2503 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2504 "Look and Feel"->"General" but will need to be split up further into
2505 general output and general input tabs. Current plan is for four outer
2506 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2507 stuff; "Inputs" for input and import configuration; "Outputs" for
2508 output and export configuration; and one more whatever is left over
2509 called "General". The leftovers at present look like being which
2510 viewers to use, spellchecker, language support and might be better
2511 named "Support". I've put "Paths" in "Inputs" for the moment as this
2512 seems reasonable for now at least.
2513 One problem remains: X error kills LyX when you close Preferences.
2515 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2517 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2518 qualifier from form()
2519 * src/frontends/xforms/FormCitation.[Ch]:
2520 * src/frontends/xforms/FormCopyright.[Ch]:
2521 * src/frontends/xforms/FormDocument.[Ch]:
2522 * src/frontends/xforms/FormError.[Ch]:
2523 * src/frontends/xforms/FormIndex.[Ch]:
2524 * src/frontends/xforms/FormPreferences.[Ch]:
2525 * src/frontends/xforms/FormPrint.[Ch]:
2526 * src/frontends/xforms/FormRef.[Ch]:
2527 * src/frontends/xforms/FormToc.[Ch]:
2528 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2530 * src/frontends/xforms/FormCitation.[Ch]:
2531 * src/frontends/xforms/FormIndex.[Ch]:
2532 * src/frontends/xforms/FormRef.[Ch]:
2533 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2534 with Allan's naming policy
2536 * src/frontends/xforms/FormCitation.C: some static casts to remove
2539 2000-10-02 Juergen Vigna <jug@sad.it>
2541 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2542 now you can type or do stuff inside the table-cell also when in dummy
2543 position, fixed visible cursor.
2545 * src/insets/insettext.C (Edit): fixing cursor-view position.
2547 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2548 be used for equal functions in lyxfunc and insettext.
2550 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2552 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2554 * src/frontends/gnome/FormCitation.h:
2555 * src/frontends/gnome/FormCopyright.h:
2556 * src/frontends/gnome/FormIndex.h:
2557 * src/frontends/gnome/FormPrint.h:
2558 * src/frontends/gnome/FormToc.h:
2559 * src/frontends/gnome/FormUrl.h:
2560 * src/frontends/kde/FormCitation.h:
2561 * src/frontends/kde/FormCopyright.h:
2562 * src/frontends/kde/FormIndex.h:
2563 * src/frontends/kde/FormRef.h:
2564 * src/frontends/kde/FormToc.h:
2565 * src/frontends/kde/FormUrl.h: fix remaining users of
2568 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2570 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2571 from depth argument.
2572 (DocBookHandleCaption): ditto.
2573 (DocBookHandleFootnote): ditto.
2574 (SimpleDocBookOnePar): ditto.
2576 * src/frontends/xforms/FormDocument.h (form): remove extra
2577 FormDocument:: qualifier.
2579 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2581 * sigc++/handle.h: ditto.
2583 * src/lyx_gui_misc.C: add "using" directive.
2585 * src/cheaders/cstddef: new file, needed by the boost library (for
2588 2000-10-02 Juergen Vigna <jug@sad.it>
2590 * src/insets/insettext.C (SetFont): better support.
2592 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2594 * src/screen.C (DrawOneRow): some uint refixes!
2596 2000-10-02 Allan Rae <rae@lyx.org>
2598 * boost/.cvsignore: ignore Makefile as well
2600 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2601 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2603 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2604 Left this one out by accident.
2606 * src/frontends/xforms/FormBase.h (restore): default to calling
2607 update() since that will restore the original/currently-applied values.
2608 Any input() triggered error messages will require the derived classes
2609 to redefine restore().
2611 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2612 avoid a segfault. combo_doc_class is the main concern.
2614 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2616 * Simplify build-listerrors in view of GUI-less export ability!
2618 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2620 * src/lyx_main.C (easyParse): Disable gui when exporting
2622 * src/insets/figinset.C:
2625 * src/lyx_gui_misc.C
2626 * src/tabular.C: Changes to allow no-gui.
2628 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2630 * src/support/utility.hpp: removed file
2631 * src/support/block.h: removed file
2633 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2636 * src/mathed/formula.C: add support/lyxlib.h
2637 * src/mathed/formulamacro.C: ditto
2639 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2640 * src/lyxparagraph.h: ditto
2642 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2643 * src/frontends/Makefile.am (INCLUDES): ditto
2644 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2645 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2646 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2647 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2648 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2649 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2651 * src/BufferView.h: use boost/utility.hpp
2652 * src/LColor.h: ditto
2653 * src/LaTeX.h: ditto
2654 * src/LyXAction.h: ditto
2655 * src/LyXView.h: ditto
2656 * src/bufferlist.h: ditto
2657 * src/lastfiles.h: ditto
2658 * src/layout.h: ditto
2659 * src/lyx_gui.h: ditto
2660 * src/lyx_main.h: ditto
2661 * src/lyxlex.h: ditto
2662 * src/lyxrc.h: ditto
2663 * src/frontends/ButtonPolicies.h: ditto
2664 * src/frontends/Dialogs.h: ditto
2665 * src/frontends/xforms/FormBase.h: ditto
2666 * src/frontends/xforms/FormGraphics.h: ditto
2667 * src/frontends/xforms/FormParagraph.h: ditto
2668 * src/frontends/xforms/FormTabular.h: ditto
2669 * src/graphics/GraphicsCache.h: ditto
2670 * src/graphics/Renderer.h: ditto
2671 * src/insets/ExternalTemplate.h: ditto
2672 * src/insets/insetcommand.h: ditto
2673 * src/support/path.h: ditto
2675 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2676 and introduce clause for 2.97.
2678 * boost/libs/README: new file
2680 * boost/boost/utility.hpp: new file
2682 * boost/boost/config.hpp: new file
2684 * boost/boost/array.hpp: new file
2686 * boost/Makefile.am: new file
2688 * boost/.cvsignore: new file
2690 * configure.in (AC_OUTPUT): add boost/Makefile
2692 * Makefile.am (SUBDIRS): add boost
2694 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2696 * src/support/lstrings.C (suffixIs): Fixed.
2698 2000-10-01 Allan Rae <rae@lyx.org>
2700 * src/PrinterParams.h: moved things around to avoid the "can't
2701 inline call" warning.
2703 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2704 into doc++ documentation.
2706 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2708 * src/frontends/xforms/FormRef.C: make use of button controller
2709 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2710 cleaned up button controller usage.
2711 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2712 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2713 use the button controller
2715 * src/frontends/xforms/forms/*.fd: and associated generated files
2716 updated to reflect changes to FormBase. Some other FormXxxx files
2717 also got minor updates to reflect changes to FormBase.
2719 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2720 (hide): made virtual.
2721 (input): return a bool. true == valid input
2722 (RestoreCB, restore): new
2723 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2724 Changes to allow derived dialogs to use a ButtonController and
2725 make sense when doing so: OK button calls ok() and so on.
2727 * src/frontends/xforms/ButtonController.h (class ButtonController):
2728 Switch from template implementation to taking Policy parameter.
2729 Allows FormBase to provide a ButtonController for any dialog.
2731 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2732 Probably should rename connect and disconnect.
2733 (apply): use the radio button groups
2734 (form): needed by FormBase
2735 (build): setup the radio button groups
2737 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2739 * several files: type changes to reduce the number of warnings and
2740 to unify type hangling a bit. Still much to do.
2742 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2744 * lib/images/*: rename a bunch of icons to match Dekel converter
2747 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2750 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2752 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2754 * sigc++/handle.h: ditto for class Handle.
2756 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2758 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2760 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2762 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2763 removal of the "default" language.
2765 * src/combox.h (getline): Check that sel > 0
2767 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2769 * lib/examples/docbook_example.lyx
2770 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2772 * lib/layouts/docbook-book.layout: new docbook book layout.
2774 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2776 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2778 * src/insets/figinset.C (DocBook):fixed small typo.
2780 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2782 * src/insets/insetinclude.h: string include_label doesn't need to be
2785 2000-09-29 Allan Rae <rae@lyx.org>
2787 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2788 Allow derived type to control connection and disconnection from signals
2789 of its choice if desired.
2791 2000-09-28 Juergen Vigna <jug@sad.it>
2793 * src/insets/insettabular.C (update): fixed cursor setting when
2794 the_locking_inset changed.
2795 (draw): made this a bit cleaner.
2796 (InsetButtonPress): fixed!
2798 * various files: added LyXText Parameter to fitCursor call.
2800 * src/BufferView.C (fitCursor): added LyXText parameter.
2802 * src/insets/insettabular.C (draw): small draw fix.
2804 * src/tabular.C: right setting of left/right celllines.
2806 * src/tabular.[Ch]: fixed various types in funcions and structures.
2807 * src/insets/insettabular.C: ditto
2808 * src/frontends/xforms/FormTabular.C: ditto
2810 2000-09-28 Allan Rae <rae@lyx.org>
2812 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2813 that the #ifdef's had been applied to part of what should have been
2814 a complete condition. It's possible there are other tests that
2815 were specific to tables that are also wrong now that InsetTabular is
2816 being used. Now we need to fix the output of '\n' after a table in a
2817 float for the same reason as the original condition:
2818 "don't insert this if we would be adding it before or after a table
2819 in a float. This little trick is needed in order to allow use of
2820 tables in \subfigures or \subtables."
2821 Juergen can you check this?
2823 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2825 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2826 output to the ostream.
2828 * several files: fixed types based on warnings from cxx
2830 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2832 * src/frontends/kde/Makefile.am: fix rule for
2833 formindexdialogdata_moc.C
2835 * src/.cvsignore: add ext_l10n.h to ignore
2837 * acconfig.h: stop messing with __STRICT_ANSI__
2838 * config/gnome.m4: remove option to set -ansi
2839 * config/kde.m4: remove option to set -ansi
2840 * config/lyxinclude.m4: don't set -ansi
2842 2000-09-27 Juergen Vigna <jug@sad.it>
2844 * various files: remove "default" language check.
2846 * src/insets/insetquotes.C: removed use of current_view.
2848 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2849 the one should have red ears by now!
2851 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2852 in more then one paragraph. Fixed cursor-movement/selection.
2854 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2855 paragraphs inside a text inset.
2857 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2858 text-inset if this owner is an inset.
2860 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2862 * src/Bullet.h: changed type of font, character and size to int
2864 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2866 * src/insets/inseturl.[Ch]:
2867 * src/insets/insetref.[Ch]:
2868 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2870 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2872 * src/buffer.C (readFile): block-if statement rearranged to minimise
2873 bloat. Patch does not reverse Jean-Marc's change ;-)
2875 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2876 Class rewritten to store pointers to hide/update signals directly,
2877 rather than Dialogs *. Also defined an enum to ease use. All xforms
2878 forms can now be derived from this class.
2880 * src/frontends/xforms/FormCommand.[Ch]
2881 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2883 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2886 * src/frontends/xforms/forms/form_citation.fd
2887 * src/frontends/xforms/forms/form_copyright.fd
2888 * src/frontends/xforms/forms/form_error.fd
2889 * src/frontends/xforms/forms/form_index.fd
2890 * src/frontends/xforms/forms/form_ref.fd
2891 * src/frontends/xforms/forms/form_toc.fd
2892 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2894 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2896 * src/insets/insetfoot.C: removed redundent using directive.
2898 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2900 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2901 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2903 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2904 created in the constructors in different groups. Then set() just
2905 have to show the groups as needed. This fixes the redraw problems
2906 (and is how the old menu code worked).
2908 * src/support/lyxlib.h: declare the methods as static when we do
2909 not have namespaces.
2911 2000-09-26 Juergen Vigna <jug@sad.it>
2913 * src/buffer.C (asciiParagraph): new function.
2914 (writeFileAscii): new function with parameter ostream.
2915 (writeFileAscii): use now asciiParagraph.
2917 * various inset files: added the linelen parameter to the Ascii-func.
2919 * src/tabular.C (Write): fixed error in writing file introduced by
2920 the last changes from Lars.
2922 * lib/bind/menus.bind: removed not supported functions.
2924 * src/insets/insettext.C (Ascii): implemented this function.
2926 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2928 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2929 (Write): use of the write_attribute functions.
2931 * src/bufferlist.C (close): fixed reasking question!
2933 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2935 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2936 new files use the everwhere possible.
2939 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2940 src/log_form.C src/lyx.C:
2943 * src/buffer.C (runLaTeX): remove func
2945 * src/PaperLayout.C: removed file
2946 * src/ParagraphExtra.C: likewise
2947 * src/bullet_forms.C: likewise
2948 * src/bullet_forms.h: likewise
2949 * src/bullet_forms_cb.C: likewise
2951 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2952 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2955 * several files: remove all traces of the old fd_form_paragraph,
2956 and functions belonging to that.
2958 * several files: remove all traces of the old fd_form_document,
2959 and functions belonging to that.
2961 * several files: constify local variables were possible.
2963 * several files: remove all code that was dead when NEW_EXPORT was
2966 * several files: removed string::c_str in as many places as
2969 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2970 (e): be a bit more outspoken when patching
2971 (updatesrc): only move files if changed.
2973 * forms/layout_forms.h.patch: regenerated
2975 * forms/layout_forms.fd: remove form_document and form_paragraph
2976 and form_quotes and form_paper and form_table_options and
2977 form_paragraph_extra
2979 * forms/form1.fd: remove form_table
2981 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2982 the fdui->... rewrite. Update some comments to xforms 0.88
2984 * forms/bullet_forms.C.patch: removed file
2985 * forms/bullet_forms.fd: likewise
2986 * forms/bullet_forms.h.patch: likewise
2988 * development/Code_rules/Rules: added a section on switch
2989 statements. Updated some comment to xforms 0.88.
2991 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2993 * src/buffer.C (readFile): make sure that the whole version number
2994 is read after \lyxformat (even when it contains a comma)
2996 * lib/ui/default.ui: change shortcut of math menu to M-a.
2998 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3000 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3003 * src/LyXView.C (updateWindowTitle): show the full files name in
3004 window title, limited to 30 characters.
3006 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3007 When a number of characters has been given, we should not assume
3008 that the string is 0-terminated.
3010 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3011 calls (fixes some memory leaks)
3013 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3014 trans member on exit.
3016 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3018 * src/converter.C (GetReachable): fix typo.
3020 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3021 understand ',' instead of '.'.
3022 (GetInteger): rewrite to use strToInt().
3024 2000-09-26 Juergen Vigna <jug@sad.it>
3026 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3027 better visibility and error-message on wrong VSpace input.
3029 * src/language.C (initL): added english again.
3031 2000-09-25 Juergen Vigna <jug@sad.it>
3033 * src/frontends/kde/Dialogs.C (Dialogs):
3034 * src/frontends/gnome/Dialogs.C (Dialogs):
3035 * src/frontends/kde/Makefile.am:
3036 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3038 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3040 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3042 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3044 * src/frontends/xforms/FormParagraph.C:
3045 * src/frontends/xforms/FormParagraph.h:
3046 * src/frontends/xforms/form_paragraph.C:
3047 * src/frontends/xforms/form_paragraph.h:
3048 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3051 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3053 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3054 Paragraph-Data after use.
3056 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3057 non breakable paragraphs.
3059 2000-09-25 Garst R. Reese <reese@isn.net>
3061 * src/language.C (initL): added missing language_country codes.
3063 2000-09-25 Juergen Vigna <jug@sad.it>
3065 * src/insets/insettext.C (InsetText):
3066 (deleteLyXText): remove the not released LyXText structure!
3068 2000-09-24 Marko Vendelin <markov@ioc.ee>
3070 * src/frontends/gnome/mainapp.C
3071 * src/frontends/gnome/mainapp.h: added support for keyboard
3074 * src/frontends/gnome/FormCitation.C
3075 * src/frontends/gnome/FormCitation.h
3076 * src/frontends/gnome/Makefile.am
3077 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3078 FormCitation to use "action area" in mainapp window
3080 * src/frontends/gnome/Menubar_pimpl.C
3081 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3084 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3086 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3087 width/descent/ascent values if name is empty.
3088 (mathed_string_height): Use std::max.
3090 2000-09-25 Allan Rae <rae@lyx.org>
3092 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3093 segfault. This will be completely redesigned soon.
3095 * sigc++: updated libsigc++. Fixes struct timespec bug.
3097 * development/tools/makeLyXsigc.sh: .cvsignore addition
3099 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3101 * several files: removed almost all traces of the old table
3104 * src/TableLayout.C: removed file
3106 2000-09-22 Juergen Vigna <jug@sad.it>
3108 * src/frontends/kde/Dialogs.C: added credits forms.
3110 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3112 * src/frontends/gnome/Dialogs.C: added some forms.
3114 * src/spellchecker.C (init_spell_checker): set language in pspell code
3115 (RunSpellChecker): some modifications for setting language string.
3117 * src/language.[Ch]: added language_country code.
3119 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3121 * src/frontends/Dialogs.h: added new signal showError.
3122 Rearranged existing signals in some sort of alphabetical order.
3124 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3125 FormError.[Ch], form_error.[Ch]
3126 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3127 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3129 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3130 dialogs. I think that this can be used as the base to all these
3133 * src/frontends/xforms/FormError.[Ch]
3134 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3135 implementation of InsetError dialog.
3137 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3139 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3140 * src/frontends/kde/Makefile.am: ditto
3142 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3144 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3145 macrobf. This fixes a bug of invisible text.
3147 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3149 * lib/doc/LaTeXConfig.lyx.in: updated.
3151 * src/language.C (initL): remove language "francais" and change a
3152 bit the names of the two other french variations.
3154 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3155 string that may not be 0-terminated.
3157 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3159 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3161 2000-09-20 Marko Vendelin <markov@ioc.ee>
3163 * src/frontends/gnome/FormCitation.C
3164 * src/frontends/gnome/FormIndex.C
3165 * src/frontends/gnome/FormToc.C
3166 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3167 the variable initialization to shut up the warnings
3169 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3171 * src/table.[Ch]: deleted files
3173 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3176 2000-09-18 Juergen Vigna <jug@sad.it>
3178 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3179 problems with selection. Inserted new LFUN_PASTESELECTION.
3180 (InsetButtonPress): inserted handling of middle mouse-button paste.
3182 * src/spellchecker.C: changed word to word.c_str().
3184 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3186 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3187 included in the ``make dist'' tarball.
3189 2000-09-15 Juergen Vigna <jug@sad.it>
3191 * src/CutAndPaste.C (cutSelection): small fix return the right
3192 end position after cut inside one paragraph only.
3194 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3195 we are locked as otherwise we don't have a valid cursor position!
3197 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3199 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3201 * src/frontends/kde/FormRef.C: added using directive.
3202 * src/frontends/kde/FormToc.C: ditto
3204 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3206 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3208 2000-09-19 Marko Vendelin <markov@ioc.ee>
3210 * src/frontends/gnome/Menubar_pimpl.C
3211 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3212 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3214 * src/frontends/gnome/mainapp.C
3215 * src/frontends/gnome/mainapp.h: support for menu update used
3218 * src/frontends/gnome/mainapp.C
3219 * src/frontends/gnome/mainapp.h: support for "action" area in the
3220 main window. This area is used by small simple dialogs, such as
3223 * src/frontends/gnome/FormIndex.C
3224 * src/frontends/gnome/FormIndex.h
3225 * src/frontends/gnome/FormUrl.C
3226 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3229 * src/frontends/gnome/FormCitation.C
3230 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3231 action area. Only "Insert new citation" is implemented.
3233 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3235 * src/buffer.C (Dispatch): fix call to Dispatch
3236 * src/insets/insetref.C (Edit): likewise
3237 * src/insets/insetparent.C (Edit): likewise
3238 * src/insets/insetinclude.C (include_cb): likewise
3239 * src/frontends/xforms/FormUrl.C (apply): likewise
3240 * src/frontends/xforms/FormToc.C (apply): likewise
3241 * src/frontends/xforms/FormRef.C (apply): likewise
3242 * src/frontends/xforms/FormIndex.C (apply): likewise
3243 * src/frontends/xforms/FormCitation.C (apply): likewise
3244 * src/lyxserver.C (callback): likewise
3245 * src/lyxfunc.C (processKeySym): likewise
3246 (Dispatch): likewise
3247 (Dispatch): likewise
3248 * src/lyx_cb.C (LayoutsCB): likewise
3250 * Makefile.am (sourcedoc): small change
3252 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3254 * src/main.C (main): Don't make an empty GUIRunTime object. all
3255 methods are static. constify a bit remove unneded using + headers.
3257 * src/tabular.C: some more const to local vars move some loop vars
3259 * src/spellchecker.C: added some c_str after some word for pspell
3261 * src/frontends/GUIRunTime.h: add new static method setDefaults
3262 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3263 * src/frontends/kde/GUIRunTime.C (setDefaults):
3264 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3266 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3267 with strnew in arg, use correct emptystring when calling SetName.
3269 * several files: remove all commented code with relation to
3270 HAVE_SSTREAM beeing false. We now only support stringstream and
3273 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3275 * src/lyxfunc.C: construct correctly the automatic new file
3278 * src/text2.C (IsStringInText): change type of variable i to shut
3281 * src/support/sstream.h: do not use namespaces if the compiler
3282 does not support them.
3284 2000-09-15 Marko Vendelin <markov@ioc.ee>
3285 * src/frontends/gnome/FormCitation.C
3286 * src/frontends/gnome/FormCitation.h
3287 * src/frontends/gnome/diainsertcitation_interface.c
3288 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3289 regexp support to FormCitation [Gnome].
3291 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3294 * configure.in: remove unused KDE/GTKGUI define
3296 * src/frontends/kde/FormRef.C
3297 * src/frontends/kde/FormRef.h
3298 * src/frontends/kde/formrefdialog.C
3299 * src/frontends/kde/formrefdialog.h: double click will
3300 go to reference, now it is possible to change a cross-ref
3303 * src/frontends/kde/FormToc.C
3304 * src/frontends/kde/FormToc.h
3305 * src/frontends/kde/formtocdialog.C
3306 * src/frontends/kde/formtocdialog.h: add a depth
3309 * src/frontends/kde/Makefile.am: add QtLyXView.h
3312 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3314 * src/frontends/kde/FormCitation.h: added some using directives.
3316 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3318 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3321 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3324 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3326 * src/buffer.C (pop_tag): revert for the second time a change by
3327 Lars, who seems to really hate having non-local loop variables :)
3329 * src/Lsstream.h: add "using" statements.
3331 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3332 * src/buffer.C (writeFile): ditto
3334 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3336 * src/buffer.C (writeFile): try to fix the locale modified format
3337 number to always be as we want it.
3339 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3340 in XForms 0.89. C-space is now working again.
3342 * src/Lsstream.h src/support/sstream.h: new files.
3344 * also commented out all cases where strstream were used.
3346 * src/Bullet.h (c_str): remove method.
3348 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3350 * a lot of files: get rid of "char const *" and "char *" is as
3351 many places as possible. We only want to use them in interaction
3352 with system of other libraries, not inside lyx.
3354 * a lot of files: return const object is not of pod type. This
3355 helps ensure that temporary objects is not modified. And fits well
3356 with "programming by contract".
3358 * configure.in: check for the locale header too
3360 * Makefile.am (sourcedoc): new tag for generation of doc++
3363 2000-09-14 Juergen Vigna <jug@sad.it>
3365 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3366 callback to check which combo called it and do the right action.
3368 * src/combox.C (combo_cb): added combo * to the callbacks.
3369 (Hide): moved call of callback after Ungrab of the pointer.
3371 * src/intl.h: removed LCombo2 function.
3373 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3374 function as this can now be handled in one function.
3376 * src/combox.h: added Combox * to callback prototype.
3378 * src/frontends/xforms/Toolbar_pimpl.C:
3379 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3381 2000-09-14 Garst Reese <reese@isn.net>
3383 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3384 moved usepackage{xxx}'s to beginning of file. Changed left margin
3385 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3386 underlining from title. Thanks to John Culleton for useful suggestions.
3388 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3390 * src/lyxlex_pimpl.C (setFile): change error message to debug
3393 2000-09-13 Juergen Vigna <jug@sad.it>
3395 * src/frontends/xforms/FormDocument.C: implemented choice_class
3396 as combox and give callback to combo_language so OK/Apply is activated
3399 * src/bufferlist.C (newFile): small fix so already named files
3400 (via an open call) are not requested to be named again on the
3403 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3405 * src/frontends/kde/Makefile.am
3406 * src/frontends/kde/FormRef.C
3407 * src/frontends/kde/FormRef.h
3408 * src/frontends/kde/formrefdialog.C
3409 * src/frontends/kde/formrefdialog.h: implement
3412 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3414 * src/frontends/kde/formtocdialog.C
3415 * src/frontends/kde/formtocdialog.h
3416 * src/frontends/kde/FormToc.C
3417 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3419 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3421 * src/frontends/kde/FormCitation.C: fix thinko
3422 where we didn't always display the reference text
3425 * src/frontends/kde/formurldialog.C
3426 * src/frontends/kde/formurldialog.h
3427 * src/frontends/kde/FormUrl.C
3428 * src/frontends/kde/FormUrl.h: minor cleanups
3430 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3432 * src/frontends/kde/Makefile.am
3433 * src/frontends/kde/FormToc.C
3434 * src/frontends/kde/FormToc.h
3435 * src/frontends/kde/FormCitation.C
3436 * src/frontends/kde/FormCitation.h
3437 * src/frontends/kde/FormIndex.C
3438 * src/frontends/kde/FormIndex.h
3439 * src/frontends/kde/formtocdialog.C
3440 * src/frontends/kde/formtocdialog.h
3441 * src/frontends/kde/formcitationdialog.C
3442 * src/frontends/kde/formcitationdialog.h
3443 * src/frontends/kde/formindexdialog.C
3444 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3446 2000-09-12 Juergen Vigna <jug@sad.it>
3448 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3451 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3453 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3456 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3458 * src/converter.C (Add, Convert): Added support for converter flags:
3459 needaux, resultdir, resultfile.
3460 (Convert): Added new parameter view_file.
3461 (dvips_options): Fixed letter paper option.
3463 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3464 (Export, GetExportableFormats, GetViewableFormats): Added support
3467 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3469 (easyParse): Fixed to work with new export code.
3471 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3474 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3476 * lib/bind/*.bind: Replaced
3477 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3478 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3480 2000-09-11 Juergen Vigna <jug@sad.it>
3482 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3484 * src/main.C (main): now GUII defines global guiruntime!
3486 * src/frontends/gnome/GUIRunTime.C (initApplication):
3487 * src/frontends/kde/GUIRunTime.C (initApplication):
3488 * src/frontends/xforms/GUIRunTime.C (initApplication):
3489 * src/frontends/GUIRunTime.h: added new function initApplication.
3491 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3493 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3495 2000-09-08 Juergen Vigna <jug@sad.it>
3497 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3498 we have already "Reset".
3500 * src/language.C (initL): inserted "default" language and made this
3501 THE default language (and not american!)
3503 * src/paragraph.C: inserted handling of "default" language!
3505 * src/lyxfont.C: ditto
3509 * src/paragraph.C: output the \\par only if we have a following
3510 paragraph otherwise it's not needed.
3512 2000-09-05 Juergen Vigna <jug@sad.it>
3514 * config/pspell.m4: added entry to lyx-flags
3516 * src/spellchecker.C: modified version from Kevin for using pspell
3518 2000-09-01 Marko Vendelin <markov@ioc.ee>
3519 * src/frontends/gnome/Makefile.am
3520 * src/frontends/gnome/FormCitation.C
3521 * src/frontends/gnome/FormCitation.h
3522 * src/frontends/gnome/diainsertcitation_callbacks.c
3523 * src/frontends/gnome/diainsertcitation_callbacks.h
3524 * src/frontends/gnome/diainsertcitation_interface.c
3525 * src/frontends/gnome/diainsertcitation_interface.h
3526 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3527 dialog for Gnome frontend
3529 * src/main.C: Gnome libraries require keeping application name
3530 and its version as strings
3532 * src/frontends/gnome/mainapp.C: Change the name of the main window
3533 from GnomeLyX to PACKAGE
3535 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3537 * src/frontends/Liason.C: add "using: declaration.
3539 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3541 * src/mathed/math_macro.C (Metrics): Set the size of the template
3543 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3545 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3547 * src/converter.C (add_options): New function.
3548 (SetViewer): Change $$FName into '$$FName'.
3549 (View): Add options when running xdvi
3550 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3551 (Convert): The 3rd parameter is now the desired filename. Converts
3552 calls to lyx::rename if necessary.
3553 Add options when running dvips.
3554 (dvi_papersize,dvips_options): New methods.
3556 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3558 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3559 using a call to Converter::dvips_options.
3560 Fixed to work with nex export code.
3562 * src/support/copy.C
3563 * src/support/rename.C: New files
3565 * src/support/syscall.h
3566 * src/support/syscall.C: Added Starttype SystemDontWait.
3568 * lib/ui/default.ui: Changed to work with new export code
3570 * lib/configure.m4: Changed to work with new export code
3572 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3574 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3576 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3577 so that code compiles with DEC cxx.
3579 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3580 to work correctly! Also now supports the additional elements
3583 2000-09-01 Allan Rae <rae@lyx.org>
3585 * src/frontends/ButtonPolicies.C: renamed all the references to
3586 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3588 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3589 since it's a const not a type.
3591 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3593 2000-08-31 Juergen Vigna <jug@sad.it>
3595 * src/insets/figinset.C: Various changes to look if the filename has
3596 an extension and if not add it for inline previewing.
3598 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3600 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3601 make buttonStatus and isReadOnly be const methods. (also reflect
3602 this in derived classes.)
3604 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3605 (nextState): change to be static inline, pass the StateMachine as
3607 (PreferencesPolicy): remove casts
3608 (OkCancelPolicy): remvoe casts
3609 (OkCancelReadOnlyPolicy): remove casts
3610 (NoRepeatedApplyReadOnlyPolicy): remove casts
3611 (OkApplyCancelReadOnlyPolicy): remove casts
3612 (OkApplyCancelPolicy): remove casts
3613 (NoRepeatedApplyPolicy): remove casts
3615 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3617 * src/converter.C: added some using directives
3619 * src/frontends/ButtonPolicies.C: changes to overcome
3620 "need lvalue" error with DEC c++
3622 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3623 to WMHideCB for DEC c++
3625 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3627 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3628 to BulletBMTableCB for DEC c++
3630 2000-08-31 Allan Rae <rae@lyx.org>
3632 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3633 character dialog separately from old document dialogs combo_language.
3636 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3638 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3639 Removed LFUN_REF_CREATE.
3641 * src/MenuBackend.C: Added new tags: toc and references
3643 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3644 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3646 (add_toc, add_references): New methods.
3647 (create_submenu): Handle correctly the case when there is a
3648 seperator after optional menu items.
3650 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3651 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3652 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3654 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3656 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3658 * src/converter.[Ch]: New file for converting between different
3661 * src/export.[Ch]: New file for exporting a LyX file to different
3664 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3665 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3666 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3667 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3668 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3669 RunDocBook, MenuExport.
3671 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3672 Exporter::Preview methods if NEW_EXPORT is defined.
3674 * src/buffer.C (Dispatch): Use Exporter::Export.
3676 * src/lyxrc.C: Added new tags: \converter and \viewer.
3679 * src/LyXAction.C: Define new lyx-function: buffer-update.
3680 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3681 when NEW_EXPORT is defined.
3683 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3685 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3687 * lib/ui/default.ui: Added submenus "view" and "update" to the
3690 * src/filetools.C (GetExtension): New function.
3692 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3694 2000-08-29 Allan Rae <rae@lyx.org>
3696 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3698 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3699 (EnableDocumentLayout): removed
3700 (DisableDocumentLayout): removed
3701 (build): make use of ButtonController's read-only handling to
3702 de/activate various objects. Replaces both of the above functions.
3704 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3705 (readOnly): was read_only
3706 (refresh): fixed dumb mistakes with read_only_ handling
3708 * src/frontends/xforms/forms/form_document.fd:
3709 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3710 tabbed dialogs so the tabs look more like tabs and so its easier to
3711 work out which is the current tab.
3713 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3714 segfault with form_table
3716 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3718 2000-08-28 Juergen Vigna <jug@sad.it>
3720 * acconfig.h: added USE_PSPELL.
3722 * src/config.h.in: added USE_PSPELL.
3724 * autogen.sh: added pspell.m4
3726 * config/pspell.m4: new file.
3728 * src/spellchecker.C: implemented support for pspell libary.
3730 2000-08-25 Juergen Vigna <jug@sad.it>
3732 * src/LyXAction.C (init): renamed LFUN_TABLE to
3733 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3735 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3737 * src/lyxscreen.h: add force_clear variable and fuction to force
3738 a clear area when redrawing in LyXText.
3740 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3742 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3744 * some whitespace and comment changes.
3746 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3748 * src/buffer.C: up te LYX_FORMAT to 2.17
3750 2000-08-23 Juergen Vigna <jug@sad.it>
3752 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3755 * src/insets/insettabular.C (pasteSelection): delete the insets
3756 LyXText as it is not valid anymore.
3757 (copySelection): new function.
3758 (pasteSelection): new function.
3759 (cutSelection): new function.
3760 (LocalDispatch): implemented cut/copy/paste of cell selections.
3762 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3763 don't have a LyXText.
3765 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3767 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3770 2000-08-22 Juergen Vigna <jug@sad.it>
3772 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3773 ifdef form_table out if NEW_TABULAR.
3775 2000-08-21 Juergen Vigna <jug@sad.it>
3777 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3778 (draw): fixed draw position so that the cursor is positioned in the
3780 (InsetMotionNotify): hide/show cursor so the position is updated.
3781 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3782 using cellstart() function where it should be used.
3784 * src/insets/insettext.C (draw): ditto.
3786 * src/tabular.C: fixed initialization of some missing variables and
3787 made BoxType into an enum.
3789 2000-08-22 Marko Vendelin <markov@ioc.ee>
3790 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3791 stock menu item using action numerical value, not its string
3795 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3797 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3798 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3800 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3802 * src/frontends/xforms/GUIRunTime.C: new file
3804 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3805 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3807 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3809 * src/frontends/kde/GUIRunTime.C: new file
3811 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3812 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3814 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3816 * src/frontends/gnome/GUIRunTime.C: new file
3818 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3821 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3822 small change to documetentation.
3824 * src/frontends/GUIRunTime.C: removed file
3826 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3828 * src/lyxparagraph.h: enable NEW_TABULAR as default
3830 * src/lyxfunc.C (processKeySym): remove some commented code
3832 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3833 NEW_TABULAR around the fd_form_table_options.
3835 * src/lyx_gui.C (runTime): call the static member function as
3836 GUIRunTime::runTime().
3838 2000-08-21 Allan Rae <rae@lyx.org>
3840 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3843 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3845 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3847 2000-08-21 Allan Rae <rae@lyx.org>
3849 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3850 keep Garst happy ;-)
3851 * src/frontends/xforms/FormPreferences.C (build): use setOK
3852 * src/frontends/xforms/FormDocument.C (build): use setOK
3853 (FormDocument): use the appropriate policy.
3855 2000-08-21 Allan Rae <rae@lyx.org>
3857 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3858 automatic [de]activation of arbitrary objects when in a read-only state.
3860 * src/frontends/ButtonPolicies.h: More documentation
3861 (isReadOnly): added to support the above.
3863 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3865 2000-08-18 Juergen Vigna <jug@sad.it>
3867 * src/insets/insettabular.C (getStatus): changed to return func_status.
3869 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3870 display toggle menu entries if they are.
3872 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3873 new document layout now.
3875 * src/lyxfunc.C: ditto
3877 * src/lyx_gui_misc.C: ditto
3879 * src/lyx_gui.C: ditto
3881 * lib/ui/default.ui: removed paper and quotes layout as they are now
3882 all in the document layout tabbed folder.
3884 * src/frontends/xforms/forms/form_document.fd: added Restore
3885 button and callbacks for all inputs for Allan's ButtonPolicy.
3887 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3888 (CheckChoiceClass): added missing params setting on class change.
3889 (UpdateLayoutDocument): added for updating the layout on params.
3890 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3891 (FormDocument): Implemented Allan's ButtonPolicy with the
3894 2000-08-17 Allan Rae <rae@lyx.org>
3896 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3897 so we can at least see the credits again.
3899 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3900 controller calls for the appropriate callbacks. Note that since Ok
3901 calls apply followed by cancel, and apply isn't a valid input for the
3902 APPLIED state, the bc_ calls have to be made in the static callback not
3903 within each of the real callbacks.
3905 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3906 (setOk): renamed from setOkay()
3908 2000-08-17 Juergen Vigna <jug@sad.it>
3910 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3911 in the implementation part.
3912 (composeUIInfo): don't show optional menu-items.
3914 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3916 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3918 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3919 text-state when in a text-inset.
3921 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3923 2000-08-17 Marko Vendelin <markov@ioc.ee>
3924 * src/frontends/gnome/FormIndex.C
3925 * src/frontends/gnome/FormIndex.h
3926 * src/frontends/gnome/FormToc.C
3927 * src/frontends/gnome/FormToc.h
3928 * src/frontends/gnome/dialogs
3929 * src/frontends/gnome/diatoc_callbacks.c
3930 * src/frontends/gnome/diatoc_callbacks.h
3931 * src/frontends/gnome/diainsertindex_callbacks.h
3932 * src/frontends/gnome/diainsertindex_callbacks.c
3933 * src/frontends/gnome/diainsertindex_interface.c
3934 * src/frontends/gnome/diainsertindex_interface.h
3935 * src/frontends/gnome/diatoc_interface.h
3936 * src/frontends/gnome/diatoc_interface.c
3937 * src/frontends/gnome/Makefile.am: Table of Contents and
3938 Insert Index dialogs implementation for Gnome frontend
3940 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3942 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3944 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3947 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3949 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3950 destructor. Don't definde if you don't need it
3951 (processEvents): made static, non-blocking events processing for
3953 (runTime): static method. event loop for xforms
3954 * similar as above for kde and gnome.
3956 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3957 new Pimpl is correct
3958 (runTime): new method calss the real frontends runtime func.
3960 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3962 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3964 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3966 2000-08-16 Juergen Vigna <jug@sad.it>
3968 * src/lyx_gui.C (runTime): added GUII RunTime support.
3970 * src/frontends/Makefile.am:
3971 * src/frontends/GUIRunTime.[Ch]:
3972 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3973 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3974 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3976 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3978 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3979 as this is already set in ${FRONTEND_INCLUDE} if needed.
3981 * configure.in (CPPFLAGS): setting the include dir for the frontend
3982 directory and don't set FRONTEND=xforms for now as this is executed
3985 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3987 * src/frontends/kde/Makefile.am:
3988 * src/frontends/kde/FormUrl.C:
3989 * src/frontends/kde/FormUrl.h:
3990 * src/frontends/kde/formurldialog.h:
3991 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3993 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3995 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3997 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3999 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4002 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4004 * src/WorkArea.C (work_area_handler): more work to get te
4005 FL_KEYBOARD to work with xforms 0.88 too, please test.
4007 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4009 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4011 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4014 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4016 * src/Timeout.h: remove Qt::emit hack.
4018 * several files: changes to allo doc++ compilation
4020 * src/lyxfunc.C (processKeySym): new method
4021 (processKeyEvent): comment out if FL_REVISION < 89
4023 * src/WorkArea.C: change some debugging levels.
4024 (WorkArea): set wantkey to FL_KEY_ALL
4025 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4026 clearer code and the use of compose with XForms 0.89. Change to
4027 use signals instead of calling methods in bufferview directly.
4029 * src/Painter.C: change some debugging levels.
4031 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4034 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4035 (workAreaKeyPress): new method
4037 2000-08-14 Juergen Vigna <jug@sad.it>
4039 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4041 * config/kde.m4: addes some features
4043 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4044 include missing xforms dialogs.
4046 * src/Timeout.h: a hack to be able to compile with qt/kde.
4048 * sigc++/.cvsignore: added acinclude.m4
4050 * lib/.cvsignore: added listerros
4052 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4053 xforms tree as objects are needed for other frontends.
4055 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4056 linking with not yet implemented xforms objects.
4058 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4060 2000-08-14 Baruch Even <baruch.even@writeme.com>
4062 * src/frontends/xforms/FormGraphics.h:
4063 * src/frontends/xforms/FormGraphics.C:
4064 * src/frontends/xforms/RadioButtonGroup.h:
4065 * src/frontends/xforms/RadioButtonGroup.C:
4066 * src/insets/insetgraphics.h:
4067 * src/insets/insetgraphics.C:
4068 * src/insets/insetgraphicsParams.h:
4069 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4070 instead of spaces, and various other indentation issues to make the
4071 sources more consistent.
4073 2000-08-14 Marko Vendelin <markov@ioc.ee>
4075 * src/frontends/gnome/dialogs/diaprint.glade
4076 * src/frontends/gnome/FormPrint.C
4077 * src/frontends/gnome/FormPrint.h
4078 * src/frontends/gnome/diaprint_callbacks.c
4079 * src/frontends/gnome/diaprint_callbacks.h
4080 * src/frontends/gnome/diaprint_interface.c
4081 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4084 * src/frontends/gnome/dialogs/diainserturl.glade
4085 * src/frontends/gnome/FormUrl.C
4086 * src/frontends/gnome/FormUrl.h
4087 * src/frontends/gnome/diainserturl_callbacks.c
4088 * src/frontends/gnome/diainserturl_callbacks.h
4089 * src/frontends/gnome/diainserturl_interface.c
4090 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4091 Gnome implementation
4093 * src/frontends/gnome/Dialogs.C
4094 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4095 all other dialogs. Copy all unimplemented dialogs from Xforms
4098 * src/frontends/gnome/support.c
4099 * src/frontends/gnome/support.h: support files generated by Glade
4103 * config/gnome.m4: Gnome configuration scripts
4105 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4106 configure --help message
4108 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4109 only if there are no events pendling in Gnome/Gtk. This enhances
4110 the performance of menus.
4113 2000-08-14 Allan Rae <rae@lyx.org>
4115 * lib/Makefile.am: listerrors cleaning
4117 * lib/listerrors: removed -- generated file
4118 * acinclude.m4: ditto
4119 * sigc++/acinclude.m4: ditto
4121 * src/frontends/xforms/forms/form_citation.fd:
4122 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4125 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4126 `updatesrc` and now we have a `test` target that does what `updatesrc`
4127 used to do. I didn't like having an install target that wasn't related
4130 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4131 on all except FormGraphics. This may yet happen. Followed by a major
4132 cleanup including using FL_TRANSIENT for most of the dialogs. More
4133 changes to come when the ButtonController below is introduced.
4135 * src/frontends/xforms/ButtonController.h: New file for managing up to
4136 four buttons on a dialog according to an externally defined policy.
4137 * src/frontends/xforms/Makefile.am: added above
4139 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4140 Apply and Cancel/Close buttons and everything in between and beyond.
4141 * src/frontends/Makefile.am: added above.
4143 * src/frontends/xforms/forms/form_preferences.fd:
4144 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4145 and removed variable 'status' as a result. Fixed the set_minsize thing.
4146 Use the new screen-font-update after checking screen fonts were changed
4147 Added a "Restore" button to restore the original lyxrc values while
4148 editing. This restores everything not just the last input changed.
4149 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4151 * src/LyXAction.C: screen-font-update added for updating buffers after
4152 screen font settings have been changed.
4153 * src/commandtags.h: ditto
4154 * src/lyxfunc.C: ditto
4156 * forms/lyx.fd: removed screen fonts dialog.
4157 * src/lyx_gui.C: ditto
4158 * src/menus.[Ch]: ditto
4159 * src/lyx.[Ch]: ditto
4160 * src/lyx_cb.C: ditto + code from here moved to make
4161 screen-font-update. And people wonder why progress on GUII is
4162 slow. Look at how scattered this stuff was! It takes forever
4165 * forms/fdfix.sh: Fixup the spacing after commas.
4166 * forms/makefile: Remove date from generated files. Fewer clashes now.
4167 * forms/bullet_forms.C.patch: included someones handwritten changes
4169 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4170 once I've discovered why LyXRC was made noncopyable.
4171 * src/lyx_main.C: ditto
4173 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4175 * src/frontends/xforms/forms/fdfix.sh:
4176 * src/frontends/xforms/forms/fdfixh.sed:
4177 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4178 * src/frontends/xforms/Form*.[hC]:
4179 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4180 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4181 provide a destructor for the struct FD_form_xxxx. Another version of
4182 the set_[max|min]size workaround and a few other cleanups. Actually,
4183 Angus' patch from 20000809.
4185 2000-08-13 Baruch Even <baruch.even@writeme.com>
4187 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4190 2000-08-11 Juergen Vigna <jug@sad.it>
4192 * src/insets/insetgraphics.C (InsetGraphics): changing init
4193 order because of warnings.
4195 * src/frontends/xforms/forms/makefile: adding patching .C with
4198 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4199 from .C.patch to .c.patch
4201 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4202 order because of warning.
4204 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4206 * src/frontends/Liason.C (setMinibuffer): new helper function
4208 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4210 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4212 * lib/ui/default.ui: commented out PaperLayout entry
4214 * src/frontends/xforms/form_document.[Ch]: new added files
4216 * src/frontends/xforms/FormDocument.[Ch]: ditto
4218 * src/frontends/xforms/forms/form_document.fd: ditto
4220 * src/frontends/xforms/forms/form_document.C.patch: ditto
4222 2000-08-10 Juergen Vigna <jug@sad.it>
4224 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4225 (InsetGraphics): initialized cacheHandle to 0.
4226 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4228 2000-08-10 Baruch Even <baruch.even@writeme.com>
4230 * src/graphics/GraphicsCache.h:
4231 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4232 correctly as a cache.
4234 * src/graphics/GraphicsCacheItem.h:
4235 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4238 * src/graphics/GraphicsCacheItem_pimpl.h:
4239 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4242 * src/insets/insetgraphics.h:
4243 * src/insets/insetgraphics.C: Changed from using a signal notification
4244 to polling when image is not loaded.
4246 2000-08-10 Allan Rae <rae@lyx.org>
4248 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4249 that there are two functions that have to been taken out of line by
4250 hand and aren't taken care of in the script. (Just a reminder note)
4252 * sigc++/macros/*.h.m4: Updated as above.
4254 2000-08-09 Juergen Vigna <jug@sad.it>
4256 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4258 * src/insets/insettabular.C: make drawing of single cell smarter.
4260 2000-08-09 Marko Vendelin <markov@ioc.ee>
4261 * src/frontends/gnome/Menubar_pimpl.C
4262 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4263 implementation: new files
4265 * src/frontends/gnome/mainapp.C
4266 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4269 * src/main.C: create Gnome main window
4271 * src/frontends/xforms/Menubar_pimpl.h
4272 * src/frontends/Menubar.C
4273 * src/frontends/Menubar.h: added method Menubar::update that calls
4274 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4276 * src/LyXView.C: calls Menubar::update to update the state
4279 * src/frontends/gnome/Makefile.am: added new files
4281 * src/frontends/Makefile.am: added frontend compiler options
4283 2000-08-08 Juergen Vigna <jug@sad.it>
4285 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4287 * src/bufferlist.C (close):
4288 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4289 documents if exiting without saving.
4291 * src/buffer.C (save): use removeAutosaveFile()
4293 * src/support/filetools.C (removeAutosaveFile): new function.
4295 * src/lyx_cb.C (MenuWrite): returns a bool now.
4296 (MenuWriteAs): check if file could really be saved and revert to the
4298 (MenuWriteAs): removing old autosavefile if existant.
4300 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4301 before Goto toggle declaration, because of compiler warning.
4303 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4305 * src/lyxfunc.C (MenuNew): small fix.
4307 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4309 * src/bufferlist.C (newFile):
4310 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4312 * src/lyxrc.C: added new_ask_filename tag
4314 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4316 * src/lyx.fd: removed code pertaining to form_ref
4317 * src/lyx.[Ch]: ditto
4318 * src/lyx_cb.C: ditto
4319 * src/lyx_gui.C: ditto
4320 * src/lyx_gui_misc.C: ditto
4322 * src/BufferView_pimpl.C (restorePosition): update buffer only
4325 * src/commandtags.h (LFUN_REFTOGGLE): removed
4326 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4327 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4328 (LFUN_REFBACK): renamed LFUN_REF_BACK
4330 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4331 * src/menus.C: ditto
4332 * src/lyxfunc.C (Dispatch): ditto.
4333 InsertRef dialog is now GUI-independent.
4335 * src/texrow.C: added using std::endl;
4337 * src/insets/insetref.[Ch]: strip out large amounts of code.
4338 The inset is now a container and this functionality is now
4339 managed by a new FormRef dialog
4341 * src/frontends/Dialogs.h (showRef, createRef): new signals
4343 * src/frontends/xforms/FormIndex.[Ch],
4344 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4345 when setting dialog's min/max size
4346 * src/frontends/xforms/FormIndex.[Ch]: ditto
4348 * src/frontends/xforms/FormRef.[Ch],
4349 src/frontends/xforms/forms/form_ref.fd: new xforms
4350 implementation of an InsetRef dialog
4352 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4355 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4356 ios::nocreate is not part of the standard. Removed.
4358 2000-08-07 Baruch Even <baruch.even@writeme.com>
4360 * src/graphics/Renderer.h:
4361 * src/graphics/Renderer.C: Added base class for rendering of different
4362 image formats into Pixmaps.
4364 * src/graphics/XPM_Renderer.h:
4365 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4366 in a different class.
4368 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4369 easily add support for other formats.
4371 * src/insets/figinset.C: plugged a leak of an X resource.
4373 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4375 * src/CutAndPaste.[Ch]: make all metods static.
4377 * development/Code_rules/Rules: more work, added section on
4378 Exceptions, and a References section.
4380 * a lot of header files: work to make doc++ able to generate the
4381 source documentation, some workarounds of doc++ problems. Doc++ is
4382 now able to generate the documentation.
4384 2000-08-07 Juergen Vigna <jug@sad.it>
4386 * src/insets/insettabular.C (recomputeTextInsets): removed function
4388 * src/tabular.C (SetWidthOfMulticolCell):
4390 (calculate_width_of_column_NMC): fixed return value so that it really
4391 only returns true if the column-width has changed (there where
4392 problems with muliticolumn-cells in this column).
4394 2000-08-04 Juergen Vigna <jug@sad.it>
4396 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4397 also on the scrollstatus of the inset.
4398 (workAreaMotionNotify): ditto.
4400 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4402 2000-08-01 Juergen Vigna <jug@sad.it>
4404 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4406 * src/commandtags.h:
4407 * src/LyXAction.C (init):
4408 * src/insets/inset.C (LocalDispatch): added support for
4411 * src/insets/inset.C (scroll): new functions.
4413 * src/insets/insettext.C (removeNewlines): new function.
4414 (SetAutoBreakRows): removes forced newlines in the text of the
4415 paragraph if autoBreakRows is set to false.
4417 * src/tabular.C (Latex): generates a parbox around the cell contents
4420 * src/frontends/xforms/FormTabular.C (local_update): removed
4421 the radio_useparbox button.
4423 * src/tabular.C (UseParbox): new function
4425 2000-08-06 Baruch Even <baruch.even@writeme.com>
4427 * src/graphics/GraphicsCache.h:
4428 * src/graphics/GraphicsCache.C:
4429 * src/graphics/GraphicsCacheItem.h:
4430 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4433 * src/insets/insetgraphics.h:
4434 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4435 and the drawing of the inline image.
4437 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4438 loaded into the wrong position.
4440 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4443 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4445 * src/support/translator.h: move all typedefs to public section
4447 * src/support/filetools.C (MakeLatexName): return string const
4449 (TmpFileName): ditto
4450 (FileOpenSearch): ditto
4452 (LibFileSearch): ditto
4453 (i18nLibFileSearch): ditto
4456 (CreateTmpDir): ditto
4457 (CreateBufferTmpDir): ditto
4458 (CreateLyXTmpDir): ditto
4461 (MakeAbsPath): ditto
4463 (OnlyFilename): ditto
4465 (NormalizePath): ditto
4466 (CleanupPath): ditto
4467 (GetFileContents): ditto
4468 (ReplaceEnvironmentPath): ditto
4469 (MakeRelPath): ditto
4471 (ChangeExtension): ditto
4472 (MakeDisplayPath): ditto
4473 (do_popen): return cmdret const
4474 (findtexfile): return string const
4476 * src/support/DebugStream.h: add some /// to please doc++
4478 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4480 * src/texrow.C (same_rownumber): functor to use with find_if
4481 (getIdFromRow): rewritten to use find_if and to not update the
4482 positions. return true if row is found
4483 (increasePos): new method, use to update positions
4485 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4487 * src/lyxlex_pimpl.C (verifyTable): new method
4490 (GetString): return string const
4491 (pushTable): rewrite to use std::stack
4493 (setFile): better check
4496 * src/lyxlex.h: make LyXLex noncopyable
4498 * src/lyxlex.C (text): return char const * const
4499 (GetString): return string const
4500 (getLongString): return string const
4502 * src/lyx_gui_misc.C (askForText): return pair<...> const
4504 * src/lastfiles.[Ch] (operator): return string const
4506 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4507 istringstream not char const *.
4508 move token.end() out of loop.
4509 (readFile): move initializaton of token
4511 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4512 getIdFromRow is successful.
4514 * lib/bind/emacs.bind: don't include menus bind
4516 * development/Code_rules/Rules: the beginnings of making this
4517 better and covering more of the unwritten rules that we have.
4519 * development/Code_rules/Recommendations: a couple of wording
4522 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4524 * src/support/strerror.c: remove C++ comment.
4526 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4528 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4529 LFUN_INDEX_INSERT_LAST
4531 * src/texrow.C (getIdFromRow): changed from const_iterator to
4532 iterator, allowing code to compile with DEC cxx
4534 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4535 stores part of the class, as suggested by Allan. Will allow
4537 (apply): test to apply uses InsetCommandParams operator!=
4539 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4540 (apply): test to apply uses InsetCommandParams operator!=
4542 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4543 stores part of the class.
4544 (update): removed limits on min/max size.
4546 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4547 (apply): test to apply uses InsetCommandParams operator!=
4549 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4550 (Read, Write, scanCommand, getCommand): moved functionality
4551 into InsetCommandParams.
4553 (getScreenLabel): made pure virtual
4554 new InsetCommandParams operators== and !=
4556 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4557 c-tors based on InsetCommandParams. Removed others.
4558 * src/insets/insetinclude.[Ch]: ditto
4559 * src/insets/insetlabel.[Ch]: ditto
4560 * src/insets/insetparent.[Ch]: ditto
4561 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4563 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4564 insets derived from InsetCommand created using similar c-tors
4565 based on InsetCommandParams
4566 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4567 * src/menus.C (ShowRefsMenu): ditto
4568 * src/paragraph.C (Clone): ditto
4569 * src/text2.C (SetCounter): ditto
4570 * src/lyxfunc.C (Dispatch) ditto
4571 Also recreated old InsetIndex behaviour exactly. Can now
4572 index-insert at the start of a paragraph and index-insert-last
4573 without launching the pop-up.
4575 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4577 * lib/lyxrc.example: mark te pdf options as non functional.
4579 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4580 (isStrDbl): move tmpstr.end() out of loop.
4581 (strToDbl): move intialization of tmpstr
4582 (lowercase): return string const and move tmp.end() out of loop.
4583 (uppercase): return string const and move tmp.edn() out of loop.
4584 (prefixIs): add assertion
4589 (containsOnly): ditto
4590 (containsOnly): ditto
4591 (containsOnly): ditto
4592 (countChar): make last arg char not char const
4593 (token): return string const
4594 (subst): return string const, move tmp.end() out of loop.
4595 (subst): return string const, add assertion
4596 (strip): return string const
4597 (frontStrip): return string const, add assertion
4598 (frontStrip): return string const
4603 * src/support/lstrings.C: add inclde "LAssert.h"
4604 (isStrInt): move tmpstr.end() out of loop.
4606 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4607 toollist.end() out of loop.
4608 (deactivate): move toollist.end() out of loop.
4609 (update): move toollist.end() out of loop.
4610 (updateLayoutList): move tc.end() out of loop.
4611 (add): move toollist.end() out of loop.
4613 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4614 md.end() out of loop.
4616 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4618 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4621 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4622 (Erase): move insetlist.end() out of loop.
4624 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4625 ref to const string as first arg. Move initialization of some
4626 variables, whitespace changes.
4628 * src/kbmap.C (defkey): move table.end() out of loop.
4629 (kb_keymap): move table.end() out of loop.
4630 (findbinding): move table.end() out of loop.
4632 * src/MenuBackend.C (hasMenu): move end() out of loop.
4633 (getMenu): move end() out of loop.
4634 (getMenu): move menulist_.end() out of loop.
4636 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4638 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4641 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4642 (getFromLyXName): move infotab.end() out of loop.
4644 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4645 -fvtable-thunks -ffunction-sections -fdata-sections
4647 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4649 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4652 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4654 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4656 * src/frontends/xforms/FormCitation.[Ch],
4657 src/frontends/xforms/FormIndex.[Ch],
4658 src/frontends/xforms/FormToc.[Ch],
4659 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4661 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4663 * src/commandtags.h: renamed, created some flags for citation
4666 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4668 * src/lyxfunc.C (dispatch): use signals to insert index entry
4670 * src/frontends/Dialogs.h: new signal createIndex
4672 * src/frontends/xforms/FormCommand.[Ch],
4673 src/frontends/xforms/FormCitation.[Ch],
4674 src/frontends/xforms/FormToc.[Ch],
4675 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4677 * src/insets/insetindex.[Ch]: GUI-independent
4679 * src/frontends/xforms/FormIndex.[Ch],
4680 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4683 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4685 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4686 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4688 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4690 * src/insets/insetref.C (Latex): rewrite so that there is now
4691 question that a initialization is requested.
4693 * src/insets/insetcommand.h: reenable the hide signal
4695 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4697 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4698 fix handling of shortcuts (many bugs :)
4699 (add_lastfiles): ditto.
4701 * lib/ui/default.ui: fix a few shortcuts.
4703 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4705 * Makefile.am: Fix ``rpmdist'' target to return the exit
4706 status of the ``rpm'' command, instead of the last command in
4707 the chain (the ``rm lyx.xpm'' command, which always returns
4710 2000-08-02 Allan Rae <rae@lyx.org>
4712 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4713 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4714 * src/frontends/xforms/FormToc.C (FormToc): ditto
4716 * src/frontends/xforms/Makefile.am: A few forgotten files
4718 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4719 Signals-not-copyable-problem Lars' started commenting out.
4721 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4723 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4725 * src/insets/insetcommand.h: Signals is not copyable so anoter
4726 scheme for automatic hiding of forms must be used.
4728 * src/frontends/xforms/FormCitation.h: don't inerit from
4729 noncopyable, FormCommand already does that.
4730 * src/frontends/xforms/FormToc.h: ditto
4731 * src/frontends/xforms/FormUrl.h: ditto
4733 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4735 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4737 * src/insets/insetcommand.h (hide): new SigC::Signal0
4738 (d-tor) new virtual destructor emits hide signal
4740 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4741 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4743 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4744 LOF and LOT. Inset is now GUI-independent
4746 * src/insets/insetloa.[Ch]: redundant
4747 * src/insets/insetlof.[Ch]: ditto
4748 * src/insets/insetlot.[Ch]: ditto
4750 * src/frontends/xforms/forms/form_url.fd: tweaked!
4751 * src/frontends/xforms/forms/form_citation.fd: ditto
4753 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4754 dialogs dealing with InsetCommand insets
4756 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4757 FormCommand base class
4758 * src/frontends/xforms/FormUrl.[Ch]: ditto
4760 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4762 * src/frontends/xforms/FormToc.[Ch]: ditto
4764 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4765 passed a generic InsetCommand pointer
4766 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4768 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4769 and modified InsetTOC class
4770 * src/buffer.C: ditto
4772 * forms/lyx.fd: strip out old FD_form_toc code
4773 * src/lyx_gui_misc.C: ditto
4774 * src/lyx_gui.C: ditto
4775 * src/lyx_cb.C: ditto
4776 * src/lyx.[Ch]: ditto
4778 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4780 * src/support/utility.hpp: tr -d '\r'
4782 2000-08-01 Juergen Vigna <jug@sad.it>
4784 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4786 * src/commandtags.h:
4787 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4788 LFUN_TABULAR_FEATURES.
4790 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4791 LFUN_LAYOUT_TABULAR.
4793 * src/insets/insettabular.C (getStatus): implemented helper function.
4795 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4797 2000-07-31 Juergen Vigna <jug@sad.it>
4799 * src/text.C (draw): fixed screen update problem for text-insets.
4801 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4802 something changed probably this has to be added in various other
4805 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4807 2000-07-31 Baruch Even <baruch.even@writeme.com>
4809 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4810 templates to satisfy compaq cxx.
4813 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4815 * src/support/translator.h (equal_1st_in_pair::operator()): take
4816 const ref pair_type as arg.
4817 (equal_2nd_in_pair::operator()): ditto
4818 (Translator::~Translator): remove empty d-tor.
4820 * src/graphics/GraphicsCache.C: move include config.h to top, also
4821 put initialization of GraphicsCache::singleton here.
4822 (~GraphicsCache): move here
4823 (addFile): take const ref as arg
4826 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4828 * src/BufferView2.C (insertLyXFile): change te with/without header
4831 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4833 * src/frontends/xforms/FormGraphics.C (apply): add some
4834 static_cast. Not very nice, but required by compaq cxx.
4836 * src/frontends/xforms/RadioButtonGroup.h: include header
4837 <utility> instead of <pair.h>
4839 * src/insets/insetgraphicsParams.C: add using directive.
4840 (readResize): change return type to void.
4841 (readOrigin): ditto.
4843 * src/lyxfunc.C (getStatus): add missing break for build-program
4844 function; add test for Literate for export functions.
4846 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4847 entries in Options menu.
4849 2000-07-31 Baruch Even <baruch.even@writeme.com>
4851 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4852 protect against auto-allocation; release icon when needed.
4854 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4856 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4857 on usual typewriter.
4859 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4860 earlier czech.kmap), useful only for programming.
4862 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4864 * src/frontends/xforms/FormCitation.h: fix conditioning around
4867 2000-07-31 Juergen Vigna <jug@sad.it>
4869 * src/frontends/xforms/FormTabular.C (local_update): changed
4870 radio_linebreaks to radio_useparbox and added radio_useminipage.
4872 * src/tabular.C: made support for using minipages/parboxes.
4874 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4876 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4878 (descent): so the cursor is in the middle.
4879 (width): bit smaller box.
4881 * src/insets/insetgraphics.h: added display() function.
4883 2000-07-31 Baruch Even <baruch.even@writeme.com>
4885 * src/frontends/Dialogs.h: Added showGraphics signals.
4887 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4888 xforms form definition of the graphics dialog.
4890 * src/frontends/xforms/FormGraphics.h:
4891 * src/frontends/xforms/FormGraphics.C: Added files, the
4892 GUIndependent code of InsetGraphics
4894 * src/insets/insetgraphics.h:
4895 * src/insets/insetgraphics.C: Major writing to make it work.
4897 * src/insets/insetgraphicsParams.h:
4898 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4899 struct between InsetGraphics and GUI.
4901 * src/LaTeXFeatures.h:
4902 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4903 support for graphicx package.
4905 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4906 for the graphics inset.
4908 * src/support/translator.h: Added file, used in
4909 InsetGraphicsParams. this is a template to translate between two
4912 * src/frontends/xforms/RadioButtonGroup.h:
4913 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4914 way to easily control a radio button group.
4916 2000-07-28 Juergen Vigna <jug@sad.it>
4918 * src/insets/insettabular.C (LocalDispatch):
4919 (TabularFeatures): added support for lyx-functions of tabular features.
4920 (cellstart): refixed this function after someone wrongly changed it.
4922 * src/commandtags.h:
4923 * src/LyXAction.C (init): added support for tabular-features
4925 2000-07-28 Allan Rae <rae@lyx.org>
4927 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4928 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4929 triggers the callback for input checking. As a result we sometimes get
4930 "LyX: This shouldn't happen..." printed to cerr.
4931 (input): Started using status variable since I only free() on
4932 destruction. Some input checking for paths and font sizes.
4934 * src/frontends/xforms/FormPreferences.h: Use status to control
4935 activation of Ok and Apply
4937 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4938 callback. Also resized to stop segfaults with 0.88. The problem is
4939 that xforms-0.88 requires the folder to be wide enough to fit all the
4940 tabs. If it isn't it causes all sorts of problems.
4942 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4944 * src/frontends/xforms/forms/README: Reflect reality.
4946 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4947 * src/frontends/xforms/forms/makefile: ditto.
4949 * src/commandtags.h: Get access to new Preferences dialog
4950 * src/LyXAction.C: ditto
4951 * src/lyxfunc.C: ditto
4952 * lib/ui/default.ui: ditto
4954 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4956 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4958 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4961 * src/frontends/xforms/form_url.[Ch]: added.
4963 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4965 * src/insets/insetbib.h: fixed bug in previous commit
4967 * src/frontends/xforms/FormUrl.h: ditto
4969 * src/frontends/xforms/FormPrint.h: ditto
4971 * src/frontends/xforms/FormPreferences.h: ditto
4973 * src/frontends/xforms/FormCopyright.h: ditto
4975 * src/frontends/xforms/FormCitation.C: ditto
4977 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4978 private copyconstructor and private default contructor
4980 * src/support/Makefile.am: add utility.hpp
4982 * src/support/utility.hpp: new file from boost
4984 * src/insets/insetbib.h: set owner in clone
4986 * src/frontends/xforms/FormCitation.C: added missing include
4989 * src/insets/form_url.[Ch]: removed
4991 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4993 * development/lyx.spec.in
4994 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4995 file/directory re-organization.
4997 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4999 * src/insets/insetcommand.[Ch]: moved the string data and
5000 associated manipulation methods into a new stand-alone class
5001 InsetCommandParams. This class has two additional methods
5002 getAsString() and setFromString() allowing the contents to be
5003 moved around as a single string.
5004 (addContents) method removed.
5005 (setContents) method no longer virtual.
5007 * src/buffer.C (readInset): made use of new InsetCitation,
5008 InsetUrl constructors based on InsetCommandParams.
5010 * src/commandtags.h: add LFUN_INSERT_URL
5012 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5013 independent InsetUrl and use InsetCommandParams to extract
5014 string info and create new Insets.
5016 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5018 * src/frontends/xforms/FormCitation.C (apply): uses
5021 * src/frontends/xforms/form_url.C
5022 * src/frontends/xforms/form_url.h
5023 * src/frontends/xforms/FormUrl.h
5024 * src/frontends/xforms/FormUrl.C
5025 * src/frontends/xforms/forms/form_url.fd: new files
5027 * src/insets/insetcite.[Ch]: removed unused constructors.
5029 * src/insets/insetinclude.[Ch]: no longer store filename
5031 * src/insets/inseturl.[Ch]: GUI-independent.
5033 2000-07-26 Juergen Vigna <jug@sad.it>
5034 * renamed frontend from gtk to gnome as it is that what is realized
5035 and did the necessary changes in the files.
5037 2000-07-26 Marko Vendelin <markov@ioc.ee>
5039 * configure.in: cleaning up gnome configuration scripts
5041 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5043 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5044 shortcuts syndrom by redrawing them explicitely (a better solution
5045 would be appreciated).
5047 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5049 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5052 * src/lyx_cb.C (MenuExport): change html export to do the right
5053 thing depending of the document type (instead of having
5054 html-linuxdoc and html-docbook).
5055 * src/lyxfunc.C (getStatus): update for html
5056 * lib/ui/default.ui: simplify due to the above change.
5057 * src/menus.C (ShowFileMenu): update too (in case we need it).
5059 * src/MenuBackend.C (read): if a menu is defined twice, add the
5060 new entries to the exiting one.
5062 2000-07-26 Juergen Vigna <jug@sad.it>
5064 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5066 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5067 and return a bool if it did actual save the file.
5068 (AutoSave): don't autosave a unnamed doc.
5070 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5071 check if this is an UNNAMED new file and react to it.
5072 (newFile): set buffer to unnamed and change to not mark a new
5073 buffer dirty if I didn't do anything with it.
5075 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5077 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5079 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5080 friend as per Angus's patch posted to lyx-devel.
5082 * src/ext_l10n.h: updated
5084 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5085 gettext on the style string right before inserting them into the
5088 * autogen.sh: add code to extract style strings form layout files,
5089 not good enough yet.
5091 * src/frontends/gtk/.cvsignore: add MAKEFILE
5093 * src/MenuBackend.C (read): run the label strings through gettext
5094 before storing them in the containers.
5096 * src/ext_l10n.h: new file
5098 * autogen.sh : generate the ext_l10n.h file here
5100 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5102 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5105 * lib/ui/default.ui: fix a couple of typos.
5107 * config/gnome/gtk.m4: added (and added to the list of files in
5110 * src/insets/insetinclude.C (unique_id): fix when we are using
5111 lyxstring instead of basic_string<>.
5112 * src/insets/insettext.C (LocalDispatch): ditto.
5113 * src/support/filetools.C: ditto.
5115 * lib/configure.m4: create the ui/ directory if necessary.
5117 * src/LyXView.[Ch] (updateToolbar): new method.
5119 * src/BufferView_pimpl.C (buffer): update the toolbar when
5120 opening/closing buffer.
5122 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5124 * src/LyXAction.C (getActionName): enhance to return also the name
5125 and options of pseudo-actions.
5126 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5128 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5129 as an example of what is possible). Used in File->Build too (more
5130 useful) and in the import/export menus (to mimick the complicated
5131 handling of linuxdoc and friends). Try to update all the entries.
5133 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5136 * src/MenuBackend.C (read): Parse the new OptItem tag.
5138 * src/MenuBackend.h: Add a new optional_ data member (used if the
5139 entry should be omitted when the lyxfunc is disabled).
5141 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5142 function, used as a shortcut.
5143 (create_submenu): align correctly the shortcuts on the widest
5146 * src/MenuBackend.h: MenuItem.label() only returns the label of
5147 the menu without shortcut; new method shortcut().
5149 2000-07-14 Marko Vendelin <markov@ioc.ee>
5151 * src/frontends/gtk/Dialogs.C:
5152 * src/frontends/gtk/FormCopyright.C:
5153 * src/frontends/gtk/FormCopyright.h:
5154 * src/frontends/gtk/Makefile.am: added these source-files for the
5155 Gtk/Gnome support of the Copyright-Dialog.
5157 * src/main.C: added Gnome::Main initialization if using
5158 Gtk/Gnome frontend-GUI.
5160 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5162 * config/gnome/aclocal-include.m4
5163 * config/gnome/compiler-flags.m4
5164 * config/gnome/curses.m4
5165 * config/gnome/gnome--.m4
5166 * config/gnome/gnome-bonobo-check.m4
5167 * config/gnome/gnome-common.m4
5168 * config/gnome/gnome-fileutils.m4
5169 * config/gnome/gnome-ghttp-check.m4
5170 * config/gnome/gnome-gnorba-check.m4
5171 * config/gnome/gnome-guile-checks.m4
5172 * config/gnome/gnome-libgtop-check.m4
5173 * config/gnome/gnome-objc-checks.m4
5174 * config/gnome/gnome-orbit-check.m4
5175 * config/gnome/gnome-print-check.m4
5176 * config/gnome/gnome-pthread-check.m4
5177 * config/gnome/gnome-support.m4
5178 * config/gnome/gnome-undelfs.m4
5179 * config/gnome/gnome-vfs.m4
5180 * config/gnome/gnome-x-checks.m4
5181 * config/gnome/gnome-xml-check.m4
5182 * config/gnome/gnome.m4
5183 * config/gnome/gperf-check.m4
5184 * config/gnome/gtk--.m4
5185 * config/gnome/linger.m4
5186 * config/gnome/need-declaration.m4: added configuration scripts
5187 for Gtk/Gnome frontend-GUI
5189 * configure.in: added support for the --with-frontend=gtk option
5191 * autogen.sh: added config/gnome/* to list of config-files
5193 * acconfig.h: added define for GTKGUI-support
5195 * config/lyxinclude.m4: added --with-frontend[=value] option value
5196 for Gtk/Gnome frontend-GUI support.
5198 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5200 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5204 * src/paragraph.C (GetChar): remove non-const version
5206 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5207 (search_kw): use it.
5209 * src/lyx_main.C (init): if "preferences" exist, read that instead
5211 (ReadRcFile): return bool if the file could be read ok.
5212 (ReadUIFile): add a check to see if lex file is set ok.
5214 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5215 bastring can be used instead of lyxstring (still uses the old code
5216 if std::string is good enough or if lyxstring is used.)
5218 * src/encoding.C: make the arrays static, move ininle functions
5220 * src/encoding.h: from here.
5222 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5223 (parseSingleLyXformat2Token): move inset parsing to separate method
5224 (readInset): new private method
5226 * src/Variables.h: remove virtual from get().
5228 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5229 access to NEW_INSETS and NEW_TABULAR
5231 * src/MenuBackend.h: remove superfluous forward declaration of
5232 MenuItem. Add documentations tags "///", remove empty MenuItem
5233 destructor, remove private default contructor.
5235 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5237 (read): more string mlabel and mname to where they are used
5238 (read): remove unused variables mlabel and mname
5239 (defaults): unconditional clear, make menusetup take advantage of
5240 add returning Menu &.
5242 * src/LyXView.h: define NEW_MENUBAR as default
5244 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5245 to NEW_INSETS and NEW_TABULAR.
5246 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5247 defined. Change some of the "xxxx-inset-insert" functions names to
5250 * several files: more enahncements to NEW_INSETS and the resulting
5253 * lib/lyxrc.example (\date_insert_format): move to misc section
5255 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5256 bastring and use AC_CACHE_CHECK.
5257 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5258 the system have the newest methods. uses AC_CACHE_CHECK
5259 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5260 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5261 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5263 * configure.in: add LYX_CXX_GOOD_STD_STRING
5265 * acinclude.m4: recreated
5267 2000-07-24 Amir Karger <karger@lyx.org>
5269 * README: add Hebrew, Arabic kmaps
5272 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5274 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5277 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5279 * Lot of files: add pragma interface/implementation.
5281 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5283 * lib/ui/default.ui: new file (ans new directory). Contains the
5284 default menu and toolbar.
5286 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5287 global space. Toolbars are now read (as menus) in ui files.
5289 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5291 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5292 is disabled because the document is read-only. We want to have the
5293 toggle state of the function anyway.
5294 (getStatus): add code for LFUN_VC* functions (mimicking what is
5295 done in old-style menus)
5297 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5298 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5300 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5301 * src/BufferView_pimpl.C: ditto.
5302 * src/lyxfunc.C: ditto.
5304 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5305 default). This replaces old-style menus by new ones.
5307 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5308 MenuItem. Contain the data structure of a menu.
5310 * src/insets/insettext.C: use LyXView::setLayout instead of
5311 accessing directly the toolbar combox.
5312 * src/lyxfunc.C (Dispatch): ditto.
5314 * src/LyXView.C (setLayout): new method, which just calls
5315 Toolbar::setLayout().
5316 (updateLayoutChoice): move part of this method in Toolbar.
5318 * src/toolbar.[Ch]: removed.
5320 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5321 implementation the toolbar.
5323 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5324 the toolbar. It might make sense to merge it with ToolbarDefaults
5326 (setLayout): new function.
5327 (updateLayoutList): ditto.
5328 (openLayoutList): ditto.
5330 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5331 xforms implementation of the toolbar.
5332 (get_toolbar_func): comment out, since I do not
5333 know what it is good for.
5335 * src/ToolbarDefaults.h: Add the ItemType enum.
5337 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5338 for a list of allocated C strings. Used in Menubar xforms
5339 implementation to avoid memory leaks.
5341 * src/support/lstrings.[Ch] (uppercase): new version taking and
5345 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5346 * lib/bind/emacs.bind: ditto.
5348 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5350 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5351 forward decl of LyXView.
5353 * src/toolbar.C (toolbarItem): moved from toolbar.h
5354 (toolbarItem::clean): ditto
5355 (toolbarItem::~toolbarItem): ditto
5356 (toolbarItem::operator): ditto
5358 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5360 * src/paragraph.h: control the NEW_TABULAR define from here
5362 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5363 USE_TABULAR_INSETS to NEW_TABULAR
5365 * src/ToolbarDefaults.C: add include "lyxlex.h"
5367 * files using the old table/tabular: use NEW_TABULAR to control
5368 compilation of old tabular stuff.
5370 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5373 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5374 planemet in reading of old style floats, fix the \end_deeper
5375 problem when reading old style floats.
5377 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5379 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5381 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5383 * lib/bind/sciword.bind: updated.
5385 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5387 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5388 layout write problem
5390 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5392 * src/Makefile.am (INCLUDES): remove image directory from include
5395 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5396 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5398 * src/LyXView.C (create_form_form_main): read the application icon
5401 * lib/images/*.xpm: change the icons to use transparent color for
5404 * src/toolbar.C (update): change the color of the button when it
5407 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5409 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5410 setting explicitely the minibuffer.
5411 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5413 * src/LyXView.C (showState): new function. Shows font information
5414 in minibuffer and update toolbar state.
5415 (LyXView): call Toolbar::update after creating the
5418 * src/toolbar.C: change toollist to be a vector instead of a
5420 (BubbleTimerCB): get help string directly from the callback
5421 argument of the corresponding icon (which is the action)
5422 (set): remove unnecessary ugliness.
5423 (update): new function. update the icons (depressed, disabled)
5424 depending of the status of the corresponding action.
5426 * src/toolbar.h: remove help in toolbarItem
5428 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5430 * src/Painter.C (text): Added code for using symbol glyphs from
5431 iso10646 fonts. Currently diabled.
5433 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5436 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5437 magyar,turkish and usorbian.
5439 * src/paragraph.C (isMultiLingual): Made more efficient.
5441 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5444 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5445 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5446 Also changed the prototype to "bool math_insert_greek(char)".
5448 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5450 * lots of files: apply the NEW_INSETS on all code that will not be
5451 needed when we move to use the new insets. Enable the define in
5452 lyxparagrah.h to try it.
5454 * src/insets/insettabular.C (cellstart): change to be a static
5456 (InsetTabular): initialize buffer in the initializer list.
5458 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5460 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5461 form_print.h out of the header file. Replaced with forward
5462 declarations of the relevant struct.
5464 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5467 * src/commandtags.h: do not include "debug.h" which does not
5468 belong there. #include it in some other places because of this
5471 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5473 * src/insets/insetcaption.C: add a couple "using" directives.
5475 * src/toolbar.C (add): get the help text directly from lyxaction.
5477 (setPixmap): new function. Loads from disk and sets a pixmap on a
5478 botton; the name of the pixmap file is derived from the command
5481 * src/toolbar.h: remove members isBitmap and pixmap from
5484 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5485 * lib/images/: move many files from images/banner.xpm.
5487 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5489 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5490 * src/toolbar.C: ditto.
5491 * configure.in: ditto.
5492 * INSTALL: document.
5494 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5495 the spellchecker popup is closed from the WM.
5497 2000-07-19 Juergen Vigna <jug@sad.it>
5499 * src/insets/insetfloat.C (Write): small fix because we use the
5500 insetname for the type now!
5502 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5504 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5507 * src/frontends/Dialogs.h: removed hideCitation signal
5509 * src/insets/insetcite.h: added hide signal
5511 * src/insets/insetcite.C (~InsetCitation): emits new signal
5512 (getScreenLabel): "intelligent" label should now fit on the screen!
5514 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5516 * src/frontends/xforms/FormCitation.C (showInset): connects
5517 hide() to the inset's hide signal
5518 (show): modified to use fl_set_object_position rather than
5519 fl_set_object_geometry wherever possible
5521 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5523 * src/insets/lyxinset.h: add caption code
5525 * src/insets/insetfloat.C (type): new method
5527 * src/insets/insetcaption.C (Write): new method
5529 (LyxCode): new method
5531 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5532 to get it right together with using the FloatList.
5534 * src/commandtags.h: add LFUN_INSET_CAPTION
5535 * src/lyxfunc.C (Dispatch): handle it
5537 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5540 * src/Variables.[Ch]: make expand take a const reference, remove
5541 the destructor, some whitespace changes.
5543 * src/LyXAction.C (init): add caption-inset-insert
5545 * src/FloatList.C (FloatList): update the default floats a bit.
5547 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5549 * src/Variables.[Ch]: new files. Intended to be used for language
5550 specific strings (like \chaptername) and filename substitution in
5553 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5555 * lib/kbd/american.kmap: update
5557 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5559 * src/bufferparams.[Ch]: remove member allowAccents.
5561 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5563 * src/LaTeXLog.C: use the log_form.h header.
5564 * src/lyx_gui.C: ditto.
5565 * src/lyx_gui_misc.C: ditto.
5566 * src/lyxvc.h: ditto.
5568 * forms/log_form.fd: new file, created from latexoptions.fd. I
5569 kept the log popup and nuked the options form.
5571 * src/{la,}texoptions.[Ch]: removed.
5572 * src/lyx_cb.C (LaTeXOptions): ditto
5574 * src/lyx_gui.C (create_forms): do not handle the
5575 fd_latex_options form.
5577 2000-07-18 Juergen Vigna <jug@sad.it>
5579 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5580 name of the inset so that it can be requested outside (text2.C).
5582 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5585 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5587 * src/mathed/formula.h (ConvertFont): constify
5589 * src/mathed/formula.C (Read): add warning if \end_inset is not
5590 found on expected place.
5592 * src/insets/lyxinset.h (ConvertFont): consify
5594 * src/insets/insetquotes.C (ConvertFont): constify
5595 * src/insets/insetquotes.h: ditto
5597 * src/insets/insetinfo.h: add labelfont
5599 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5600 (ascent): use labelfont
5604 (Write): make .lyx file a bit nicer
5606 * src/insets/insetfloat.C (Write): simplify somewhat...
5607 (Read): add warning if arg is not found
5609 * src/insets/insetcollapsable.C: add using std::max
5610 (Read): move string token and add warning in arg is not found
5611 (draw): use std::max to get the right ty
5612 (getMaxWidth): simplify by using std::max
5614 * src/insets/insetsection.h: new file
5615 * src/insets/insetsection.C: new file
5616 * src/insets/insetcaption.h: new file
5617 * src/insets/insetcaption.C: new file
5619 * src/insets/inset.C (ConvertFont): constify signature
5621 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5622 insetcaption.[Ch] and insetsection.[Ch]
5624 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5625 uses to use LABEL_COUNTER_CHAPTER instead.
5626 * src/text2.C (SetCounter): here
5628 * src/counters.h: new file
5629 * src/counters.C: new file
5630 * src/Sectioning.h: new file
5631 * src/Sectioning.C: new file
5633 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5635 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5637 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5640 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5643 2000-07-17 Juergen Vigna <jug@sad.it>
5645 * src/tabular.C (Validate): check if array-package is needed.
5646 (SetVAlignment): added support for vertical alignment.
5647 (SetLTFoot): better support for longtable header/footers
5648 (Latex): modified to support added features.
5650 * src/LaTeXFeatures.[Ch]: added array-package.
5652 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5654 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5657 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5659 * configure.in: do not forget to put a space after -isystem.
5661 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5663 * lib/kbd/arabic.kmap: a few fixes.
5665 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5667 * some whitespace chagnes to a number of files.
5669 * src/support/DebugStream.h: change to make it easier for
5670 doc++ to parse correctly.
5671 * src/support/lyxstring.h: ditto
5673 * src/mathed/math_utils.C (compara): change to have only one
5675 (MathedLookupBOP): change because of the above.
5677 * src/mathed/math_delim.C (math_deco_compare): change to have only
5679 (search_deco): change becasue of the above.
5681 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5682 instead of manually coded one.
5684 * src/insets/insetquotes.C (Read): read the \end_inset too
5686 * src/insets/insetlatex.h: remove file
5687 * src/insets/insetlatex.C: remove file
5689 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5691 (InsetPrintIndex): remove destructor
5693 * src/insets/insetinclude.h: remove default constructor
5695 * src/insets/insetfloat.C: work to make it work better
5697 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5699 * src/insets/insetcite.h (InsetCitation): remove default constructor
5701 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5703 * src/text.C (GetColumnNearX): comment out some currently unused code.
5705 * src/paragraph.C (writeFile): move some initializations closer to
5707 (CutIntoMinibuffer): small change to use new matchIT operator
5711 (InsertInset): ditto
5714 (InsetIterator): ditto
5715 (Erase): small change to use new matchFT operator
5717 (GetFontSettings): ditto
5718 (HighestFontInRange): ditto
5721 * src/lyxparagraph.h: some chars changed to value_type
5722 (matchIT): because of some stronger checking (perhaps too strong)
5723 in SGI STL, the two operator() unified to one.
5726 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5728 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5729 the last inset read added
5730 (parseSingleLyXformat2Token): some more (future) compability code added
5731 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5732 (parseSingleLyXformat2Token): set last_inset_read
5733 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5734 (parseSingleLyXformat2Token): don't double intializw string next_token
5736 * src/TextCache.C (text_fits::operator()): add const's to the signature
5737 (has_buffer::operator()): ditto
5739 * src/Floating.h: add some comments on the class
5741 * src/FloatList.[Ch] (typeExist): new method
5744 * src/BackStack.h: added default constructor, wanted by Gcc.
5746 2000-07-14 Juergen Vigna <jug@sad.it>
5748 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5750 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5752 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5753 do a redraw when the window is resized!
5754 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5756 * src/insets/insettext.C (resizeLyXText): added function to correctly
5757 being able to resize the LyXWindow.
5759 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5761 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5763 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5764 crashes when closing dialog to a deleted inset.
5766 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5767 method! Now similar to other insets.
5769 2000-07-13 Juergen Vigna <jug@sad.it>
5771 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5773 * lib/examples/Literate.lyx: small patch!
5775 * src/insets/insetbib.C (Read): added this function because of wrong
5776 Write (without [begin|end]_inset).
5778 2000-07-11 Juergen Vigna <jug@sad.it>
5780 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5781 as the insertInset could not be good!
5783 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5784 the bool param should not be last.
5786 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5788 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5789 did submit that to Karl).
5791 * configure.in: use -isystem instead of -I for X headers. This
5792 fixes a problem on solaris with a recent gcc;
5793 put the front-end code after the X detection code;
5794 configure in sigc++ before lib/
5796 * src/lyx_main.C (commandLineHelp): remove -display from command
5799 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5801 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5802 Also put in Makefile rules for building the ``listerrors''
5803 program for parsing errors from literate programs written in LyX.
5805 * lib/build-listerrors: Added small shell script as part of compile
5806 process. This builds a working ``listerrors'' binary if noweb is
5807 installed and either 1) the VNC X server is installed on the machine,
5808 or 2) the user is compiling from within a GUI. The existence of a GUI
5809 is necessary to use the ``lyx --export'' feature for now. This
5810 hack can be removed once ``lyx --export'' no longer requires a GUI to
5813 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5815 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5816 now passed back correctly from gcc and placed "under" error
5817 buttons in a Literate LyX source.
5819 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5821 * src/text.C (GetColumnNearX): Better behavior when a RTL
5822 paragraph is ended by LTR text.
5824 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5827 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5829 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5830 true when clipboard is empty.
5832 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5834 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5835 row of the paragraph.
5836 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5837 to prevent calculation of bidi tables
5839 2000-07-07 Juergen Vigna <jug@sad.it>
5841 * src/screen.C (ToggleSelection): added y_offset and x_offset
5844 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5847 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5849 * src/insets/insettext.C: fixed Layout-Display!
5851 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5853 * configure.in: add check for strings.h header.
5855 * src/spellchecker.C: include <strings.h> in order to have a
5856 definition for bzero().
5858 2000-07-07 Juergen Vigna <jug@sad.it>
5860 * src/insets/insettext.C (draw): set the status of the bv->text to
5861 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5863 * src/screen.C (DrawOneRow):
5864 (DrawFromTo): redraw the actual row if something has changed in it
5867 * src/text.C (draw): call an update of the toplevel-inset if something
5868 has changed inside while drawing.
5870 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5872 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5874 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5875 processing inside class.
5877 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5878 processing inside class.
5880 * src/insets/insetindex.h new struct Holder, consistent with other
5883 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5884 citation dialog from main code and placed it in src/frontends/xforms.
5885 Dialog launched through signals instead of callbacks
5887 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5889 * lyx.man: update the options description.
5891 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5893 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5894 handle neg values, set min width to 590, add doc about -display
5896 2000-07-05 Juergen Vigna <jug@sad.it>
5898 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5899 calls to BufferView *.
5901 * src/insets/insettext.C (checkAndActivateInset): small fix non
5902 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5904 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5905 their \end_inset token!
5907 2000-07-04 edscott <edscott@imp.mx>
5909 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5910 lib/lyxrc.example: added option \wheel_jump
5912 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5914 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5915 remove support for -width,-height,-xpos and -ypos.
5917 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5919 * src/encoding.[Ch]: New files.
5921 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5922 (text): Call to the underline() method only when needed.
5924 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5926 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5927 encoding(s) for the document.
5929 * src/bufferparams.C (BufferParams): Changed default value of
5932 * src/language.C (newLang): Removed.
5933 (items[]): Added encoding information for all defined languages.
5935 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5936 encoding choice button.
5938 * src/lyxrc.h (font_norm_type): New member variable.
5939 (set_font_norm_type): New method.
5941 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5942 paragraphs with different encodings.
5944 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5945 (TransformChar): Changed to work correctly with Arabic points.
5946 (draw): Added support for drawing Arabic points.
5947 (draw): Removed code for drawing underbars (this is done by
5950 * src/support/textutils.h (IsPrintableNonspace): New function.
5952 * src/BufferView_pimpl.h: Added "using SigC::Object".
5953 * src/LyXView.h: ditto.
5955 * src/insets/insetinclude.h (include_label): Changed to mutable.
5957 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5959 * src/mathed/math_iter.h: remove empty destructor
5961 * src/mathed/math_cursor.h: remove empty destructor
5963 * src/insets/lyxinset.h: add THEOREM_CODE
5965 * src/insets/insettheorem.[Ch]: new files
5967 * src/insets/insetminipage.C: (InsertInset): remove
5969 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5971 (InsertInset): remove
5973 * src/insets/insetlist.C: (InsertList): remove
5975 * src/insets/insetfootlike.[Ch]: new files
5977 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5980 (InsertInset): ditto
5982 * src/insets/insetert.C: remove include Painter.h, reindent
5983 (InsertInset): move to header
5985 * src/insets/insetcollapsable.h: remove explicit from default
5986 contructor, remove empty destructor, add InsertInset
5988 * src/insets/insetcollapsable.C (InsertInset): new func
5990 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5992 * src/vspace.h: add explicit to constructor
5994 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5995 \textcompwordmark, please test this.
5997 * src/lyxrc.C: set ascii_linelen to 65 by default
5999 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6001 * src/commandtags.h: add LFUN_INSET_THEOREM
6003 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6004 (makeLinuxDocFile): remove _some_ of the nice logic
6005 (makeDocBookFile): ditto
6007 * src/Painter.[Ch]: (~Painter): removed
6009 * src/LyXAction.C (init): entry for insettheorem added
6011 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6013 (deplog): code to detect files generated by LaTeX, needs testing
6016 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6018 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6020 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6022 * src/LaTeX.C (deplog): Add a check for files that are going to be
6023 created by the first latex run, part of the project to remove the
6026 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6027 contents to the extension list.
6029 2000-07-04 Juergen Vigna <jug@sad.it>
6031 * src/text.C (NextBreakPoint): added support for needFullRow()
6033 * src/insets/lyxinset.h: added needFullRow()
6035 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6038 * src/insets/insettext.C: lots of changes for update!
6040 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6042 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6044 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6046 * src/insets/insetinclude.C (InsetInclude): fixed
6047 initialization of include_label.
6048 (unique_id): now returns a string.
6050 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6052 * src/LaTeXFeatures.h: new member IncludedFiles, for
6053 a map of key, included file name.
6055 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6056 with the included files for inclusion in SGML preamble,
6057 i. e., linuxdoc and docbook.
6060 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6061 nice (is the generated linuxdoc code to be exported?), that
6062 allows to remove column, and only_body that will be true for
6063 slave documents. Insets are allowed inside SGML font type.
6064 New handling of the SGML preamble for included files.
6065 (makeDocBookFile): the same for docbook.
6067 * src/insets/insetinclude.h:
6068 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6070 (DocBook): new export methods.
6072 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6073 and makeDocBookFile.
6075 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6076 formats to export with command line argument -x.
6078 2000-06-29 Juergen Vigna <jug@sad.it>
6080 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6081 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6083 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6084 region could already been cleared by an inset!
6086 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6088 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6091 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6093 (cursorToggle): remove special handling of lyx focus.
6095 2000-06-28 Juergen Vigna <jug@sad.it>
6097 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6100 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6102 * src/insets/insetindex.C (Edit): add a callback when popup is
6105 * src/insets/insettext.C (LocalDispatch):
6106 * src/insets/insetmarginal.h:
6107 * src/insets/insetlist.h:
6108 * src/insets/insetfoot.h:
6109 * src/insets/insetfloat.h:
6110 * src/insets/insetert.h: add a missing std:: qualifier.
6112 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6114 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6117 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6119 * src/insets/insettext.C (Read): remove tmptok unused variable
6120 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6121 (InsertInset): change for new InsetInset code
6123 * src/insets/insettext.h: add TEXT inline method
6125 * src/insets/insettext.C: remove TEXT macro
6127 * src/insets/insetmarginal.C (Write): new method
6128 (Latex): change output slightly
6130 * src/insets/insetfoot.C (Write): new method
6131 (Latex): change output slightly (don't use endl when no need)
6133 * src/insets/insetert.C (Write): new method
6135 * src/insets/insetcollapsable.h: make button_length, button_top_y
6136 and button_bottm_y protected.
6138 * src/insets/insetcollapsable.C (Write): simplify code by using
6139 tostr. Also do not output the float name, the children class
6140 should to that to get control over own arguments
6142 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6143 src/insets/insetminipage.[Ch]:
6146 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6148 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6150 * src/Makefile.am (lyx_SOURCES): add the new files
6152 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6153 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6154 * src/commandtags.h: ditto
6156 * src/LaTeXFeatures.h: add a std::set of used floattypes
6158 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6160 * src/FloatList.[Ch] src/Floating.h: new files
6162 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6164 * src/lyx_cb.C (TableApplyCB): ditto
6166 * src/text2.C: ditto
6167 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6168 (parseSingleLyXformat2Token): ditto + add code for
6169 backwards compability for old float styles + add code for new insets
6171 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6173 (InsertInset(size_type, Inset *, LyXFont)): new method
6174 (InsetChar(size_type, char)): changed to use the other InsetChar
6175 with a LyXFont(ALL_INHERIT).
6176 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6177 insert the META_INSET.
6179 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6181 * sigc++/thread.h (Threads): from here
6183 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6184 definition out of line
6185 * sigc++/scope.h: from here
6187 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6189 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6190 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6192 * Makefile.am (bindist): new target.
6194 * INSTALL: add instructions for doing a binary distribution.
6196 * development/tools/README.bin.example: update a bit.
6198 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6201 * lib/lyxrc.example: new lyxrc tag \set_color.
6203 * src/lyxfunc.C (Dispatch):
6204 * src/commandtags.h:
6205 * src/LyXAction.C: new lyxfunc "set-color".
6207 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6208 and an x11name given as strings.
6210 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6211 cache when a color is changed.
6213 2000-06-26 Juergen Vigna <jug@sad.it>
6215 * src/lyxrow.C (width): added this functions and variable.
6217 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6220 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6222 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6224 * images/undo_bw.xpm: new icon.
6225 * images/redo_bw.xpm: ditto.
6227 * configure.in (INSTALL_SCRIPT): change value to
6228 ${INSTALL} to avoid failures of install-script target.
6229 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6231 * src/BufferView.h: add a magic "friend" declaration to please
6234 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6236 * forms/cite.fd: modified to allow resizing without messing
6239 * src/insetcite.C: Uses code from cite.fd almost without
6241 User can now resize dialog in the x-direction.
6242 Resizing the dialog in the y-direction is prevented, as the
6243 code does this intelligently already.
6245 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6247 * INSTALL: remove obsolete entry in "problems" section.
6249 * lib/examples/sl_*.lyx: update of the slovenian examples.
6251 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6253 2000-06-23 Juergen Vigna <jug@sad.it>
6255 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6257 * src/buffer.C (resize): delete the LyXText of textinsets.
6259 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6261 * src/insets/lyxinset.h: added another parameter 'cleared' to
6262 the draw() function.
6264 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6265 unlocking inset in inset.
6267 2000-06-22 Juergen Vigna <jug@sad.it>
6269 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6270 of insets and moved first to LyXText.
6272 * src/mathed/formulamacro.[Ch]:
6273 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6275 2000-06-21 Juergen Vigna <jug@sad.it>
6277 * src/text.C (GetVisibleRow): look if I should clear the area or not
6278 using Inset::doClearArea() function.
6280 * src/insets/lyxinset.h: added doClearArea() function and
6281 modified draw(Painter &, ...) to draw(BufferView *, ...)
6283 * src/text2.C (UpdateInset): return bool insted of int
6285 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6287 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6288 combox in the character popup
6290 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6291 BufferParams const & params
6293 2000-06-20 Juergen Vigna <jug@sad.it>
6295 * src/insets/insettext.C (SetParagraphData): set insetowner on
6298 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6300 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6301 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6303 (form_main_): remove
6305 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6306 (create_form_form_main): remove FD_form_main stuff, connect to
6307 autosave_timeout signal
6309 * src/LyXView.[Ch] (getMainForm): remove
6310 (UpdateTimerCB): remove
6311 * src/BufferView_pimpl.h: inherit from SigC::Object
6313 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6314 signal instead of callback
6316 * src/BufferView.[Ch] (cursorToggleCB): remove
6318 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6320 * src/BufferView_pimpl.C: changes because of the one below
6322 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6323 instead of storing a pointer to a LyXText.
6325 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6327 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6329 * src/lyxparagraph.h
6331 * src/paragraph.C: Changed fontlist to a sorted vector.
6333 2000-06-19 Juergen Vigna <jug@sad.it>
6335 * src/BufferView.h: added screen() function.
6337 * src/insets/insettext.C (LocalDispatch): some selection code
6340 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6342 * src/insets/insettext.C (SetParagraphData):
6344 (InsetText): fixes for multiple paragraphs.
6346 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6348 * development/lyx.spec.in: Call configure with ``--without-warnings''
6349 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6350 This should be fine, however, since we generally don't want to be
6351 verbose when making an RPM.
6353 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6355 * lib/scripts/fig2pstex.py: New file
6357 2000-06-16 Juergen Vigna <jug@sad.it>
6359 * src/insets/insettabular.C (UpdateLocal):
6360 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6361 (LocalDispatch): Changed all functions to use LyXText.
6363 2000-06-15 Juergen Vigna <jug@sad.it>
6365 * src/text.C (SetHeightOfRow): call inset::update before requesting
6368 * src/insets/insettext.C (update):
6369 * src/insets/insettabular.C (update): added implementation
6371 * src/insets/lyxinset.h: added update function
6373 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6375 * src/text.C (SelectNextWord): protect against null pointers with
6376 old-style string streams. (fix from Paul Theo Gonciari
6379 * src/cite.[Ch]: remove erroneous files.
6381 * lib/configure.m4: update the list of created directories.
6383 * src/lyxrow.C: include <config.h>
6384 * src/lyxcursor.C: ditto.
6386 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6388 * lib/examples/decimal.lyx: new example file from Mike.
6390 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6391 to find template definitions (from Dekel)
6393 * src/frontends/.cvsignore: add a few things.
6395 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6397 * src/Timeout.C (TimeOut): remove default argument.
6399 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6402 * src/insets/ExternalTemplate.C: add a "using" directive.
6404 * src/lyx_main.h: remove the act_ struct, which seems unused
6407 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6409 * LyX Developers Meeting: All files changed, due to random C++ (by
6410 coincidence) code generator script.
6412 - external inset (cool!)
6413 - initial online editing of preferences
6414 - insettabular breaks insettext(s contents)
6416 - some DocBook fixes
6417 - example files update
6418 - other cool stuff, create a diff and look for yourself.
6420 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6422 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6423 -1 this is a non-line-breaking textinset.
6425 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6426 if there is no width set.
6428 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6430 * Lots of files: Merged the dialogbase branch.
6432 2000-06-09 Allan Rae <rae@lyx.org>
6434 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6435 and the Dispatch methods that used it.
6437 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6438 access to functions formerly kept in Dispatch.
6440 2000-05-19 Allan Rae <rae@lyx.org>
6442 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6443 made to_page and count_copies integers again. from_page remains a
6444 string however because I want to allow entry of a print range like
6445 "1,4,22-25" using this field.
6447 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6448 and printer-params-get. These aren't useful from the minibuffer but
6449 could be used by a script/LyXServer app provided it passes a suitable
6450 auto_mem_buffer. I guess I should take a look at how the LyXServer
6451 works and make it support xtl buffers.
6453 * sigc++/: updated to libsigc++-1.0.1
6455 * src/xtl/: updated to xtl-1.3.pl.11
6457 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6458 those changes done to the files in src/ are actually recreated when
6459 they get regenerated. Please don't ever accept a patch that changes a
6460 dialog unless that patch includes the changes to the corresponding *.fd
6463 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6464 stringOnlyContains, renamed it and generalised it.
6466 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6467 branch. Removed the remaining old form_print code.
6469 2000-04-26 Allan Rae <rae@lyx.org>
6471 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6472 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6474 2000-04-25 Allan Rae <rae@lyx.org>
6476 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6477 against a base of xtl-1.3.pl.4
6479 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6480 filter the Id: entries so they still show the xtl version number
6483 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6484 into the src/xtl code. Patch still pending with José (XTL)
6486 2000-04-24 Allan Rae <rae@lyx.org>
6488 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6489 both more generic and much safer. Use the new template functions.
6490 * src/buffer.[Ch] (Dispatch): ditto.
6492 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6493 and mem buffer more intelligently. Also a little general cleanup.
6496 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6497 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6498 * src/xtl/Makefile.am: ditto.
6499 * src/xtl/.cvsignore: ditto.
6500 * src/Makefile.am: ditto.
6502 * src/PrinterParams.h: Removed the macros member functions. Added a
6503 testInvariant member function. A bit of tidying up and commenting.
6504 Included Angus's idea for fixing operation with egcs-1.1.2.
6506 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6507 cool expansion of XTL's mem_buffer to support automatic memory
6508 management within the buffer itself. Removed the various macros and
6509 replaced them with template functions that use either auto_mem_buffer
6510 or mem_buffer depending on a #define. The mem_buffer support will
6511 disappear as soon as the auto_mem_buffer is confirmed to be good on
6512 other platforms/compilers. That is, it's there so you've got something
6515 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6516 effectively forked XTL. However I expect José will include my code
6517 into the next major release. Also fixed a memory leak.
6518 * src/xtl/text.h: ditto.
6519 * src/xtl/xdr.h: ditto.
6520 * src/xtl/giop.h: ditto.
6522 2000-04-16 Allan Rae <rae@lyx.org>
6524 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6525 by autogen.sh and removed by maintainer-clean anyway.
6526 * .cvsignore, sigc++/.cvsignore: Support the above.
6528 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6530 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6532 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6533 macros, renamed static callback-target member functions to suit new
6534 scheme and made them public.
6535 * src/frontends/xforms/forms/form_print.fd: ditto.
6536 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6538 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6541 * src/xtl/: New directory containing a minimal distribution of XTL.
6542 This is XTL-1.3.pl.4.
6544 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6546 2000-04-15 Allan Rae <rae@lyx.org>
6548 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6550 * sigc++/: Updated to libsigc++-1.0.0
6552 2000-04-14 Allan Rae <rae@lyx.org>
6554 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6555 use the generic ones in future. I'll modify my conversion script.
6557 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6559 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6560 (CloseAllBufferRelatedDialogs): Renamed.
6561 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6563 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6564 of the generic ones. These are the same ones my conversion script
6567 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6568 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6569 * src/buffer.C (Dispatch): ditto
6571 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6572 functions for updating and hiding buffer dependent dialogs.
6573 * src/BufferView.C (buffer): ditto
6574 * src/buffer.C (setReadonly): ditto
6575 * src/lyxfunc.C (CloseBuffer): ditto
6577 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6578 Dialogs.h, and hence all the SigC stuff, into every file that includes
6579 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6581 * src/BufferView2.C: reduce the number of headers included by buffer.h
6583 2000-04-11 Allan Rae <rae@lyx.org>
6585 * src/frontends/xforms/xform_macros.h: A small collection of macros
6586 for building C callbacks.
6588 * src/frontends/xforms/Makefile.am: Added above file.
6590 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6591 scheme again. This time it should work for JMarc. If this is
6592 successful I'll revise my conversion script to automate some of this.
6593 The static member functions in the class also have to be public for
6594 this scheme will work. If the scheme works (it's almost identical to
6595 the way BufferView::cursorToggleCB is handled so it should work) then
6596 FormCopyright and FormPrint will be ready for inclusion into the main
6597 trunk immediately after 1.1.5 is released -- provided we're prepared
6598 for complaints about lame compilers not handling XTL.
6600 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6602 2000-04-07 Allan Rae <rae@lyx.org>
6604 * config/lyxinclude.m4: A bit more tidying up (Angus)
6606 * src/LString.h: JMarc's <string> header fix
6608 * src/PrinterParams.h: Used string for most data to remove some
6609 ugly code in the Print dialog and avoid even uglier code when
6610 appending the ints to a string for output.
6612 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6613 and moved "default:" back to the end of switch statement. Cleaned
6614 up the printing so it uses the right function calls and so the
6615 "print to file" option actually puts the file in the right directory.
6617 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6619 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6620 and Ok+Apply button control into a separate method: input (Angus).
6621 (input) Cleaned it up and improved it to be very thorough now.
6622 (All CB) static_cast used instead of C style cast (Angus). This will
6623 probably change again once we've worked out how to keep gcc-2.8.1 happy
6624 with real C callbacks.
6625 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6626 ignore some of the bool settings and has random numbers instead. Needs
6627 some more investigation. Added other input length checks and checking
6628 of file and printer names.
6630 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6631 would link (Angus). Seems the old code doesn't compile with the pragma
6632 statement either. Separated callback entries from internal methods.
6634 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6636 2000-03-17 Allan Rae <rae@lyx.org>
6638 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6639 need it? Maybe it could go in Dialogs instead? I could make it a
6640 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6641 values to get the bool return value.
6642 (Dispatch): New overloaded method for xtl support.
6644 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6645 extern "C" callback instead of static member functions. Hopefully,
6646 JMarc will be able to compile this. I haven't changed
6647 forms/form_copyright.fd yet. Breaking one of my own rules already.
6649 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6650 because they aren't useful from the minibuffer. Maybe a LyXServer
6651 might want a help message though?
6653 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6655 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6656 xtl which needs both rtti and exceptions.
6658 * src/support/Makefile.am:
6659 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6661 * src/frontends/xforms/input_validators.[ch]: input filters and
6662 validators. These conrol what keys are valid in input boxes.
6663 Use them and write some more. Much better idea than waiting till
6664 after the user has pressed Ok to say that the input fields don't make
6667 * src/frontends/xforms/Makefile.am:
6668 * src/frontends/xforms/forms/form_print.fd:
6669 * src/frontends/xforms/forms/makefile:
6670 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6671 new scheme. Still have to make sure I haven't missed anything from
6672 the current implementation.
6674 * src/Makefile.am, src/PrinterParams.h: New data store.
6676 * other files: Added a couple of copyright notices.
6678 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6680 * src/insets/insetbib.h: move Holder struct in public space.
6682 * src/frontends/include/DialogBase.h: use SigC:: only when
6683 SIGC_CXX_NAMESPACES is defined.
6684 * src/frontends/include/Dialogs.h: ditto.
6686 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6688 * src/frontends/xforms/FormCopyright.[Ch]: do not
6689 mention SigC:: explicitely.
6691 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6693 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6694 deals with testing KDE in main configure.in
6695 * configure.in: ditto.
6697 2000-02-22 Allan Rae <rae@lyx.org>
6699 * Lots of files: Merged from HEAD
6701 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6702 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6704 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6706 * sigc++/: new minidist.
6708 2000-02-14 Allan Rae <rae@lyx.org>
6710 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6712 2000-02-08 Juergen Vigna <jug@sad.it>
6714 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6715 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6717 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6718 for this port and so it is much easier for other people to port
6719 dialogs in a common development environment.
6721 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6722 the QT/KDE implementation.
6724 * src/frontends/kde/Dialogs.C:
6725 * src/frontends/kde/FormCopyright.C:
6726 * src/frontends/kde/FormCopyright.h:
6727 * src/frontends/kde/Makefile.am:
6728 * src/frontends/kde/formcopyrightdialog.C:
6729 * src/frontends/kde/formcopyrightdialog.h:
6730 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6731 for the kde support of the Copyright-Dialog.
6733 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6734 subdir-substitution instead of hardcoded 'xforms' as we now have also
6737 * src/frontends/include/DialogBase.h (Object): just commented the
6738 label after #endif (nasty warning and I don't like warnings ;)
6740 * src/main.C (main): added KApplication initialization if using
6743 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6744 For now only the KDE event-loop is added if frontend==kde.
6746 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6748 * configure.in: added support for the --with-frontend[=value] option
6750 * autogen.sh: added kde.m4 file to list of config-files
6752 * acconfig.h: added define for KDEGUI-support
6754 * config/kde.m4: added configuration functions for KDE-port
6756 * config/lyxinclude.m4: added --with-frontend[=value] option with
6757 support for xforms and KDE.
6759 2000-02-08 Allan Rae <rae@lyx.org>
6761 * all Makefile.am: Fixed up so the make targets dist, distclean,
6762 install and uninstall all work even if builddir != srcdir. Still
6763 have a new sigc++ minidist update to come.
6765 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6767 2000-02-01 Allan Rae <rae@lyx.org>
6769 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6770 Many mods to get builddir != srcdir working.
6772 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6773 for building on NT and so we can do the builddir != srcdir stuff.
6775 2000-01-30 Allan Rae <rae@lyx.org>
6777 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6778 This will stay in "rae" branch. We probably don't really need it in
6779 the main trunk as anyone who wants to help programming it should get
6780 a full library installed also. So they can check both included and
6781 system supplied library compilation.
6783 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6784 Added a 'mini' distribution of libsigc++. If you feel the urge to
6785 change something in these directories - Resist it. If you can't
6786 resist the urge then you should modify the following script and rebuild
6787 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6788 all happen. Still uses a hacked version of libsigc++'s configure.in.
6789 I'm quite happy with the results. I'm not sure the extra work to turn
6790 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6791 worth the trouble and would probably lead to extra maintenance
6793 I haven't tested the following important make targets: install, dist.
6794 Not ready for prime time but very close. Maybe 1.1.5.
6796 * development/tools/makeLyXsigc.sh: A shell script to automatically
6797 generate our mini-dist of libsigc++. It can only be used with a CVS
6798 checkout of libsigc++ not a tarball distribution. It's well commented.
6799 This will end up as part of the libsigc++ distribution so other apps
6800 can easily have an included mini-dist. If someone makes mods to the
6801 sigc++ subpackage without modifying this script to generate those
6802 changes I'll be very upset!
6804 * src/frontends/: Started the gui/system indep structure.
6806 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6807 to access the gui-indep dialogs are in this class. Much improved
6808 design compared to previous revision. Lars, please refrain from
6809 moving this header into src/ like you did with Popups.h last time.
6811 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6813 * src/frontends/xforms/: Started the gui-indep system with a single
6814 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6817 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6818 Here you'll find a very useful makefile and automated fdfix.sh that
6819 makes updating dailogs a no-brainer -- provided you follow the rules
6820 set out in the README. I'm thinking about adding another script to
6821 automatically generate skeleton code for a new dialog given just the
6824 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6825 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6826 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6828 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6830 * src/support/LSubstring.C (operator): simplify
6832 * src/lyxtext.h: removed bparams, use buffer_->params instead
6834 * src/lyxrow.h: make Row a real class, move all variables to
6835 private and use accessors.
6837 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6839 (isRightToLeftPar): ditto
6840 (ChangeLanguage): ditto
6841 (isMultiLingual): ditto
6844 (SimpleTeXOnePar): ditto
6845 (TeXEnvironment): ditto
6846 (GetEndLabel): ditto
6848 (SetOnlyLayout): ditto
6849 (BreakParagraph): ditto
6850 (BreakParagraphConservative): ditto
6851 (GetFontSettings): ditto
6853 (CopyIntoMinibuffer): ditto
6854 (CutIntoMinibuffer): ditto
6855 (PasteParagraph): ditto
6856 (SetPExtraType): ditto
6857 (UnsetPExtraType): ditto
6858 (DocBookContTableRows): ditto
6859 (SimpleDocBookOneTablePar): ditto
6861 (TeXFootnote): ditto
6862 (SimpleTeXOneTablePar): ditto
6863 (TeXContTableRows): ditto
6864 (SimpleTeXSpecialChars): ditto
6867 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6868 to private and use accessors.
6870 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6871 this, we did not use it anymore and has not been for ages. Just a
6872 waste of cpu cycles.
6874 * src/language.h: make Language a real class, move all variables
6875 to private and use accessors.
6877 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6878 (create_view): remove
6879 (update): some changes for new timer
6880 (cursorToggle): use new timer
6881 (beforeChange): change for new timer
6883 * src/BufferView.h (cursorToggleCB): removed last paramter because
6886 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6887 (cursorToggleCB): change because of new timer code
6889 * lib/CREDITS: updated own mailaddress
6891 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6893 * src/support/filetools.C (PutEnv): fix the code in case neither
6894 putenv() nor setenv() have been found.
6896 * INSTALL: mention the install-strip Makefile target.
6898 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6899 read-only documents.
6901 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6903 * lib/reLyX/configure.in (VERSION): avoid using a previously
6904 generated reLyX wrapper to find out $prefix.
6906 * lib/examples/eu_adibide_lyx-atua.lyx:
6907 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6908 translation of the Tutorial (Dooteo)
6910 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6912 * forms/cite.fd: new citation dialog
6914 * src/insetcite.[Ch]: the new citation dialog is moved into
6917 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6920 * src/insets/insetcommand.h: data members made private.
6922 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6924 * LyX 1.1.5 released
6926 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6928 * src/version.h (LYX_RELEASE): to 1.1.5
6930 * src/spellchecker.C (RunSpellChecker): return false if the
6931 spellchecker dies upon creation.
6933 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6935 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6936 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6940 * lib/CREDITS: update entry for Martin Vermeer.
6942 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6944 * src/text.C (draw): Draw foreign language bars at the bottom of
6945 the row instead of at the baseline.
6947 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6949 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6951 * lib/bind/de_menus.bind: updated
6953 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6955 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6957 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6959 * src/menus.C (Limit_string_length): New function
6960 (ShowTocMenu): Limit the number of items/length of items in the
6963 * src/paragraph.C (String): Correct result for a paragraph inside
6966 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6968 * src/bufferlist.C (close): test of buf->getuser() == NULL
6970 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6972 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6973 Do not call to SetCursor when the paragraph is a closed footnote!
6975 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6977 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6980 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6982 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6985 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6986 reference popup, that activates the reference-back action
6988 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6990 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6991 the menus. Also fixed a bug.
6993 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6994 the math panels when switching buffers (unless new buffer is readonly).
6996 * src/BufferView.C (NoSavedPositions)
6997 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6999 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7001 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7002 less of dvi dirty or not.
7004 * src/trans_mgr.[Ch] (insert): change first parameter to string
7007 * src/chset.[Ch] (encodeString): add const to first parameter
7009 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7011 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7015 * src/LaTeX.C (deplog): better searching for dependency files in
7016 the latex log. Uses now regexps.
7018 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7019 instead of the box hack or \hfill.
7021 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7023 * src/lyxfunc.C (doImportHelper): do not create the file before
7024 doing the actual import.
7025 (doImportASCIIasLines): create a new file before doing the insert.
7026 (doImportASCIIasParagraphs): ditto.
7028 * lib/lyxrc.example: remove mention of non-existing commands
7030 * lyx.man: remove mention of color-related switches.
7032 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7034 * src/lyx_gui.C: remove all the color-related ressources, which
7035 are not used anymore.
7037 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7040 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7042 * src/lyxrc.C (read): Add a missing break in the switch
7044 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7046 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7048 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7051 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7053 * src/text.C (draw): draw bars under foreign language words.
7055 * src/LColor.[Ch]: add LColor::language
7057 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7059 * src/lyxcursor.h (boundary): New member variable
7061 * src/text.C (IsBoundary): New methods
7063 * src/text.C: Use the above for currect cursor movement when there
7064 is both RTL & LTR text.
7066 * src/text2.C: ditto
7068 * src/bufferview_funcs.C (ToggleAndShow): ditto
7070 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7072 * src/text.C (DeleteLineForward): set selection to true to avoid
7073 that DeleteEmptyParagraphMechanism does some magic. This is how it
7074 is done in all other functions, and seems reasonable.
7075 (DeleteWordForward): do not jump over non-word stuff, since
7076 CursorRightOneWord() already does it.
7078 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7079 DeleteWordBackward, since they seem safe to me (since selection is
7080 set to "true") DeleteEmptyParagraphMechanism does nothing.
7082 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7084 * src/lyx_main.C (easyParse): simplify the code by factoring the
7085 part that removes parameters from the command line.
7086 (LyX): check wether wrong command line options have been given.
7088 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7090 * src/lyx_main.C : add support for specifying user LyX
7091 directory via command line option -userdir.
7093 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7095 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7096 the number of items per popup.
7097 (Add_to_refs_menu): Ditto.
7099 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7101 * src/lyxparagraph.h: renamed ClearParagraph() to
7102 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7103 textclass as parameter, and do nothing if free_spacing is
7104 true. This fixes part of the line-delete-forward problems.
7106 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7107 (pasteSelection): ditto.
7108 (SwitchLayoutsBetweenClasses): more translatable strings.
7110 * src/text2.C (CutSelection): use StripLeadingSpaces.
7111 (PasteSelection): ditto.
7112 (DeleteEmptyParagraphMechanism): ditto.
7114 2000-05-26 Juergen Vigna <jug@sad.it>
7116 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7117 is not needed in tabular insets.
7119 * src/insets/insettabular.C (TabularFeatures): added missing features.
7121 * src/tabular.C (DeleteColumn):
7123 (AppendRow): implemented this functions
7124 (cellsturct::operator=): clone the inset too;
7126 2000-05-23 Juergen Vigna <jug@sad.it>
7128 * src/insets/insettabular.C (LocalDispatch): better selection support
7129 when having multicolumn-cells.
7131 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7133 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7135 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7137 * src/ColorHandler.C (getGCForeground): put more test into _()
7139 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7142 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7145 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7147 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7148 there are no labels, or when buffer is readonly.
7150 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7151 there are no labels, buffer is SGML, or when buffer is readonly.
7153 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7155 * src/LColor.C (LColor): change a couple of grey40 to grey60
7156 (LColor): rewore initalization to make compiles go some magnitude
7158 (getGUIName): don't use gettext until we need the string.
7160 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7162 * src/Bullet.[Ch]: Fixed a small bug.
7164 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7166 * src/paragraph.C (String): Several fixes/improvements
7168 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7170 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7172 * src/paragraph.C (String): give more correct output.
7174 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7176 * src/lyxfont.C (stateText) Do not output the language if it is
7177 eqaul to the language of the document.
7179 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7180 between two paragraphs with the same language.
7182 * src/paragraph.C (getParLanguage) Return a correct answer for an
7183 empty dummy paragraph.
7185 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7188 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7191 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7192 the menus/popup, if requested fonts are unavailable.
7194 2000-05-22 Juergen Vigna <jug@sad.it>
7196 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7197 movement support (Up/Down/Tab/Shift-Tab).
7198 (LocalDispatch): added also preliminari cursor-selection.
7200 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7202 * src/paragraph.C (PasteParagraph): Hopefully now right!
7204 2000-05-22 Garst R. Reese <reese@isn.net>
7206 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7207 of list, change all references to Environment to Command
7208 * tex/hollywood.cls : rewrite environments as commands, add
7209 \uppercase to interiorshot and exteriorshot to force uppecase.
7210 * tex/broadway.cls : rewrite environments as commands. Tweak
7213 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7215 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7216 size of items: use a constant intead of the hardcoded 40, and more
7217 importantly do not remove the %m and %x tags added at the end.
7218 (Add_to_refs_menu): use vector::size_type instead of
7219 unsigned int as basic types for the variables. _Please_ do not
7220 assume that size_t is equal to unsigned int. On an alpha, this is
7221 unsigned long, which is _not_ the same.
7223 * src/language.C (initL): remove language "hungarian", since it
7224 seems that "magyar" is better.
7226 2000-05-22 Juergen Vigna <jug@sad.it>
7228 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7230 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7233 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7234 next was deleted but not set to 0.
7236 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7238 * src/language.C (initL): change the initialization of languages
7239 so that compiles goes _fast_.
7241 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7244 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7246 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7250 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7252 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7254 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7258 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7261 * src/insets/insetlo*.[Ch]: Made editable
7263 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7265 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7266 the current selection.
7268 * src/BufferView_pimpl.C (stuffClipboard): new method
7270 * src/BufferView.C (stuffClipboard): new method
7272 * src/paragraph.C (String): new method
7274 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7275 LColor::ignore when lyxname is not found.
7277 * src/BufferView.C (pasteSelection): new method
7279 * src/BufferView_pimpl.C (pasteSelection): new method
7281 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7283 * src/WorkArea.C (request_clipboard_cb): new static function
7284 (getClipboard): new method
7285 (putClipboard): new method
7287 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7289 * LyX 1.1.5pre2 released
7291 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7293 * src/vspace.C (operator=): removed
7294 (operator=): removed
7296 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7298 * src/layout.C (NumberOfClass): manually set the type in make_pair
7299 (NumberOfLayout): ditto
7301 * src/language.C: use the Language constructor for ignore_lang
7303 * src/language.h: add constructors to struct Language
7305 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7307 * src/text2.C (SetCursorIntern): comment out #warning
7309 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7311 * src/mathed/math_iter.h: initialize sx and sw to 0
7313 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7315 * forms/lyx.fd: Redesign of form_ref
7317 * src/LaTeXFeatures.[Ch]
7321 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7324 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7325 and Buffer::inset_iterator.
7327 * src/menus.C: Added new menus: TOC and Refs.
7329 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7331 * src/buffer.C (getTocList): New method.
7333 * src/BufferView2.C (ChangeRefs): New method.
7335 * src/buffer.C (getLabelList): New method. It replaces the old
7336 getReferenceList. The return type is vector<string> instead of
7339 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7340 the old getLabel() and GetNumberOfLabels() methods.
7341 * src/insets/insetlabel.C (getLabelList): ditto
7342 * src/mathed/formula.C (getLabelList): ditto
7344 * src/paragraph.C (String): New method.
7346 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7347 Uses the new getTocList() method.
7348 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7349 which automatically updates the contents of the browser.
7350 (RefUpdateCB): Use the new getLabelList method.
7352 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7354 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7356 * src/spellchecker.C: Added using std::reverse;
7358 2000-05-19 Juergen Vigna <jug@sad.it>
7360 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7362 * src/insets/insettext.C (computeTextRows): small fix for display of
7363 1 character after a newline.
7365 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7368 2000-05-18 Juergen Vigna <jug@sad.it>
7370 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7371 when changing width of column.
7373 * src/tabular.C (set_row_column_number_info): setting of
7374 autobreak rows if necessary.
7376 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7378 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7380 * src/vc-backend.*: renamed stat() to status() and vcstat to
7381 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7382 compilation broke. The new name seems more relevant, anyway.
7384 2000-05-17 Juergen Vigna <jug@sad.it>
7386 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7387 which was wrong if the removing caused removing of rows!
7389 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7390 (pushToken): new function.
7392 * src/text2.C (CutSelection): fix problem discovered with purify
7394 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7396 * src/debug.C (showTags): enlarge the first column, now that we
7397 have 6-digits debug codes.
7399 * lib/layouts/hollywood.layout:
7400 * lib/tex/hollywood.cls:
7401 * lib/tex/brodway.cls:
7402 * lib/layouts/brodway.layout: more commands and fewer
7403 environments. Preambles moved in the .cls files. Broadway now has
7404 more options on scene numbering and less whitespace (from Garst)
7406 * src/insets/insetbib.C (getKeys): make sure that we are in the
7407 document directory, in case the bib file is there.
7409 * src/insets/insetbib.C (Latex): revert bogus change.
7411 2000-05-16 Juergen Vigna <jug@sad.it>
7413 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7414 the TabularLayout on cursor move.
7416 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7418 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7421 (draw): fixed cursor position and drawing so that the cursor is
7422 visible when before the tabular-inset.
7424 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7425 when creating from old insettext.
7427 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7429 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7431 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7432 * lib/tex/brodway.cls: ditto
7434 * lib/layouts/brodway.layout: change alignment of parenthical
7437 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7439 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7440 versions 0.88 and 0.89 are supported.
7442 2000-05-15 Juergen Vigna <jug@sad.it>
7444 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7447 * src/insets/insettext.C (computeTextRows): redone completely this
7448 function in a much cleaner way, because of problems when having a
7450 (draw): added a frame border when the inset is locked.
7451 (SetDrawLockedFrame): this sets if we draw the border or not.
7452 (SetFrameColor): this sets the frame color (default=insetframe).
7454 * src/insets/lyxinset.h: added x() and y() functions which return
7455 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7456 function which is needed to see if we have a locking inset of some
7457 type in this inset (needed for now in insettabular).
7459 * src/vspace.C (inPixels): the same function also without a BufferView
7460 parameter as so it is easier to use it in some ocasions.
7462 * src/lyxfunc.C: changed all places where insertInset was used so
7463 that now if it couldn't be inserted it is deleted!
7465 * src/TabularLayout.C:
7466 * src/TableLayout.C: added support for new tabular-inset!
7468 * src/BufferView2.C (insertInset): this now returns a bool if the
7469 inset was really inserted!!!
7471 * src/tabular.C (GetLastCellInRow):
7472 (GetFirstCellInRow): new helper functions.
7473 (Latex): implemented for new tabular class.
7477 (TeXTopHLine): new Latex() helper functions.
7479 2000-05-12 Juergen Vigna <jug@sad.it>
7481 * src/mathed/formulamacro.C (Read):
7482 * src/mathed/formula.C (Read): read also the \end_inset here!
7484 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7486 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7487 crush when saving formulae with unbalanced parenthesis.
7489 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7491 * src/layout.C: Add new keyword "endlabelstring" to layout file
7493 * src/text.C (GetVisibleRow): Draw endlabel string.
7495 * lib/layouts/broadway.layout
7496 * lib/layouts/hollywood.layout: Added endlabel for the
7497 Parenthetical layout.
7499 * lib/layouts/heb-article.layout: Do not use slanted font shape
7500 for Theorem like environments.
7502 * src/buffer.C (makeLaTeXFile): Always add "american" to
7503 the UsedLanguages list if document language is RTL.
7505 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7507 * add addendum to README.OS2 and small patch (from SMiyata)
7509 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7511 * many files: correct the calls to ChangeExtension().
7513 * src/support/filetools.C (ChangeExtension): remove the no_path
7514 argument, which does not belong there. Use OnlyFileName() instead.
7516 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7517 files when LaTeXing a non-nice latex file.
7519 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7520 a chain of "if". Return false when deadkeys are not handled.
7522 * src/lyx_main.C (LyX): adapted the code for default bindings.
7524 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7525 bindings for basic functionality (except deadkeys).
7526 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7528 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7529 several methods: handle override_x_deadkeys.
7531 * src/lyxrc.h: remove the "bindings" map, which did not make much
7532 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7534 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7536 * src/lyxfont.C (stateText): use a saner method to determine
7537 whether the font is "default". Seems to fix the crash with DEC
7540 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7542 2000-05-08 Juergen Vigna <jug@sad.it>
7544 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7545 TabularLayoutMenu with mouse-button-3
7546 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7548 * src/TabularLayout.C: added this file for having a Layout for
7551 2000-05-05 Juergen Vigna <jug@sad.it>
7553 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7554 recalculating inset-widths.
7555 (TabularFeatures): activated this function so that I can change
7556 tabular-features via menu.
7558 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7559 that I can test some functions with the Table menu.
7561 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7563 * src/lyxfont.C (stateText): guard against stupid c++libs.
7565 * src/tabular.C: add using std::vector
7566 some whitespace changes, + removed som autogenerated code.
7568 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7570 2000-05-05 Juergen Vigna <jug@sad.it>
7572 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7573 row, columns and cellstructures.
7575 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7577 * lib/lyxrc.example: remove obsolete entries.
7579 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7580 reading of protected_separator for free_spacing.
7582 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7584 * src/text.C (draw): do not display an exclamation mark in the
7585 margin for margin notes. This is confusing, ugly and
7588 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7589 AMS math' is checked.
7591 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7592 name to see whether including the amsmath package is needed.
7594 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7596 * src/paragraph.C (validate): Compute UsedLanguages correctly
7597 (don't insert the american language if it doesn't appear in the
7600 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7601 The argument of \thanks{} command is considered moving argument
7603 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7606 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7608 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7609 for appendix/minipage/depth. The lines can be now both in the footnote
7610 frame, and outside the frame.
7612 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7615 2000-05-05 Juergen Vigna <jug@sad.it>
7617 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7618 neede only in tabular.[Ch].
7620 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7622 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7624 (Write): write '~' for PROTECTED_SEPARATOR
7626 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7628 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7631 * src/mathed/formula.C (drawStr): rename size to siz.
7633 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7634 possibly fix a bug by not changing the pflags = flags to piflags =
7637 2000-05-05 Juergen Vigna <jug@sad.it>
7639 * src/insets/insetbib.C: moved using directive
7641 * src/ImportNoweb.C: small fix for being able to compile (missing
7644 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7646 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7647 to use clear, since we don't depend on this in the code. Add test
7650 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7652 * (various *.C files): add using std::foo directives to please dec
7655 * replace calls to string::clear() to string::erase() (Angus)
7657 * src/cheaders/cmath: modified to provide std::abs.
7659 2000-05-04 Juergen Vigna <jug@sad.it>
7661 * src/insets/insettext.C: Prepared all for inserting of multiple
7662 paragraphs. Still display stuff to do (alignment and other things),
7663 but I would like to use LyXText to do this when we cleaned out the
7664 table-support stuff.
7666 * src/insets/insettabular.C: Changed lot of stuff and added lots
7667 of functionality still a lot to do.
7669 * src/tabular.C: Various functions changed name and moved to be
7670 const functions. Added new Read and Write functions and changed
7671 lots of things so it works good with tabular-insets (also removed
7672 some stuff which is not needed anymore * hacks *).
7674 * src/lyxcursor.h: added operators == and != which just look if
7675 par and pos are (not) equal.
7677 * src/buffer.C (latexParagraphs): inserted this function to latex
7678 all paragraphs form par to endpar as then I can use this too for
7681 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7682 so that I can call this to from text insets with their own cursor.
7684 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7685 output off all paragraphs (because of the fix below)!
7687 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7688 the very last paragraph (this could be also the last paragraph of an
7691 * src/texrow.h: added rows() call which returns the count-variable.
7693 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7695 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7697 * lib/configure.m4: better autodetection of DocBook tools.
7699 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7701 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7703 * src/lyx_cb.C: add using std::reverse;
7705 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7708 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7709 selected files. Should fix repeated errors from generated files.
7711 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7713 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7715 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7716 the spellchecker popup.
7718 * lib/lyxrc.example: Removed the \number_inset section
7720 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7722 * src/insets/figinset.C (various): Use IsFileReadable() to make
7723 sure that the file actually exist. Relying on ghostscripts errors
7724 is a bad idea since they can lead to X server crashes.
7726 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7728 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7731 * lib/lyxrc.example: smallish typo in description of
7732 \view_dvi_paper_option
7734 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7737 * src/lyxfunc.C: doImportHelper to factor out common code of the
7738 various import methods. New functions doImportASCIIasLines,
7739 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7740 doImportLinuxDoc for the format specific parts.
7743 * buffer.C: Dispatch returns now a bool to indicate success
7746 * lyx_gui.C: Add getLyXView() for member access
7748 * lyx_main.C: Change logic for batch commands: First try
7749 Buffer::Dispatch (possibly without GUI), if that fails, use
7752 * lyx_main.C: Add support for --import command line switch.
7753 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7754 Available Formats: Everything accepted by 'buffer-import <format>'
7756 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7758 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7761 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7762 documents will be reformatted upon reentry.
7764 2000-04-27 Juergen Vigna <jug@sad.it>
7766 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7767 correctly only last pos this was a bug.
7769 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7771 * release of lyx-1.1.5pre1
7773 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7775 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7777 * src/menus.C: revert the change of naming (Figure->Graphic...)
7778 from 2000-04-11. It was incomplete and bad.
7780 * src/LColor.[Ch]: add LColor::depthbar.
7781 * src/text.C (GetVisibleRow): use it.
7783 * README: update the languages list.
7785 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7787 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7790 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7792 * README: remove sections that were just wrong.
7794 * src/text2.C (GetRowNearY): remove currentrow code
7796 * src/text.C (GetRow): remove currentrow code
7798 * src/screen.C (Update): rewritten a bit.
7799 (SmallUpdate): removed func
7801 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7803 (FullRebreak): return bool
7804 (currentrow): remove var
7805 (currentrow_y): ditto
7807 * src/lyxscreen.h (Draw): change arg to unsigned long
7808 (FitCursor): return bool
7809 (FitManualCursor): ditto
7810 (Smallpdate): remove func
7811 (first): change to unsigned long
7812 (DrawOneRow): change second arg to long (from long &)
7813 (screen_refresh_y): remove var
7814 (scree_refresh_row): ditto
7816 * src/lyxrow.h: change baseline to usigned int from unsigned
7817 short, this brings some implicit/unsigned issues out in the open.
7819 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7821 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7822 instead of smallUpdate.
7824 * src/lyxcursor.h: change y to unsigned long
7826 * src/buffer.h: don't call updateScrollbar after fitcursor
7828 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7829 where they are used. Removed "\\direction", this was not present
7830 in 1.1.4 and is already obsolete. Commented out some code that I
7831 believe to never be called.
7832 (runLiterate): don't call updateScrollbar after fitCursor
7834 (buildProgram): ditto
7837 * src/WorkArea.h (workWidth): change return val to unsigned
7840 (redraw): remove the button redraws
7841 (setScrollbarValue): change for scrollbar
7842 (getScrollbarValue): change for scrollbar
7843 (getScrollbarBounds): change for scrollbar
7845 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7846 (C_WorkArea_down_cb): removed func
7847 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7848 (resize): change for scrollbar
7849 (setScrollbar): ditto
7850 (setScrollbarBounds): ditto
7851 (setScrollbarIncrements): ditto
7852 (up_cb): removed func
7853 (down_cb): removed func
7854 (scroll_cb): change for scrollbar
7855 (work_area_handler): ditto
7857 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7858 when FitCursor did something.
7859 (updateScrollbar): some unsigned changes
7860 (downCB): removed func
7861 (scrollUpOnePage): removed func
7862 (scrollDownOnePage): remvoed func
7863 (workAreaMotionNotify): don't call screen->FitCursor but use
7864 fitCursor instead. and bool return val
7865 (workAreaButtonPress): ditto
7866 (workAreaButtonRelease): some unsigned changes
7867 (checkInsetHit): ditto
7868 (workAreaExpose): ditto
7869 (update): parts rewritten, comments about the signed char arg added
7870 (smallUpdate): removed func
7871 (cursorPrevious): call needed updateScrollbar
7874 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7877 * src/BufferView.[Ch] (upCB): removed func
7878 (downCB): removed func
7879 (smallUpdate): removed func
7881 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7883 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7884 currentrow, currentrow_y optimization. This did not help a lot and
7885 if we want to do this kind of optimization we should rather use
7886 cursor.row instead of the currentrow.
7888 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7889 buffer spacing and klyx spacing support.
7891 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7893 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7896 2000-04-26 Juergen Vigna <jug@sad.it>
7898 * src/insets/figinset.C: fixes to Lars sstream changes!
7900 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7902 * A lot of files: Added Ascii(ostream &) methods to all inset
7903 classes. Used when exporting to ASCII.
7905 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7906 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7909 * src/text2.C (ToggleFree): Disabled implicit word selection when
7910 there is a change in the language
7912 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7913 no output was generated for end-of-sentence inset.
7915 * src/insets/lyxinset.h
7918 * src/paragraph.C: Removed the insetnumber code
7920 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7922 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7924 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7925 no_babel and no_epsfig completely from the file.
7926 (parseSingleLyXformat2Token): add handling for per-paragraph
7927 spacing as written by klyx.
7929 * src/insets/figinset.C: applied patch by Andre. Made it work with
7932 2000-04-20 Juergen Vigna <jug@sad.it>
7934 * src/insets/insettext.C (cutSelection):
7935 (copySelection): Fixed with selection from right to left.
7936 (draw): now the rows are not recalculated at every draw.
7937 (computeTextRows): for now reset the inset-owner here (this is
7938 important for an undo or copy where the inset-owner is not set
7941 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7942 motion to the_locking_inset screen->first was forgotten, this was
7943 not important till we got multiline insets.
7945 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7947 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7948 code seems to be alright (it is code changed by Dekel, and the
7949 intent is indeed that all macros should be defined \protect'ed)
7951 * NEWS: a bit of reorganisation of the new user-visible features.
7953 2000-04-19 Juergen Vigna <jug@sad.it>
7955 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7956 position. Set the inset_owner of the used paragraph so that it knows
7957 that it is inside an inset. Fixed cursor handling with mouse and
7958 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7959 and cleanups to make TextInsets work better.
7961 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7962 Changed parameters of various functions and added LockInsetInInset().
7964 * src/insets/insettext.C:
7966 * src/insets/insetcollapsable.h:
7967 * src/insets/insetcollapsable.C:
7968 * src/insets/insetfoot.h:
7969 * src/insets/insetfoot.C:
7970 * src/insets/insetert.h:
7971 * src/insets/insetert.C: cleaned up the code so that it works now
7972 correctly with insettext.
7974 * src/insets/inset.C:
7975 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7976 that insets in insets are supported right.
7979 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7981 * src/paragraph.C: some small fixes
7983 * src/debug.h: inserted INSETS debug info
7985 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7986 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7988 * src/commandtags.h:
7989 * src/LyXAction.C: insert code for InsetTabular.
7991 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7992 not Button1MotionMask.
7993 (workAreaButtonRelease): send always a InsetButtonRelease event to
7995 (checkInsetHit): some setCursor fixes (always with insets).
7997 * src/BufferView2.C (lockInset): returns a bool now and extended for
7998 locking insets inside insets.
7999 (showLockedInsetCursor): it is important to have the cursor always
8000 before the locked inset.
8001 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8003 * src/BufferView.h: made lockInset return a bool.
8005 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8007 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8008 that is used also internally but can be called as public to have back
8009 a cursor pos which is not set internally.
8010 (SetCursorIntern): Changed to use above function.
8012 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8014 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8019 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8020 patches for things that should be in or should be changed.
8022 * src/* [insetfiles]: change "usigned char fragile" to bool
8023 fragile. There was only one point that could that be questioned
8024 and that is commented in formulamacro.C. Grep for "CHECK".
8026 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8027 (DeleteBuffer): take it out of CutAndPaste and make it static.
8029 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8031 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8032 output the spacing envir commands. Also the new commands used in
8033 the LaTeX output makes the result better.
8035 * src/Spacing.C (writeEnvirBegin): new method
8036 (writeEnvirEnd): new method
8038 2000-04-18 Juergen Vigna <jug@sad.it>
8040 * src/CutAndPaste.C: made textclass a static member of the class
8041 as otherwise it is not accesed right!!!
8043 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8045 * forms/layout_forms.fd
8046 * src/layout_forms.h
8047 * src/layout_forms.C (create_form_form_character)
8048 * src/lyx_cb.C (UserFreeFont)
8049 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8050 documents (in the layout->character popup).
8052 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8054 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8055 \spell_command was in fact not honored (from Kevin Atkinson).
8057 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8060 * src/lyx_gui.h: make lyxViews private (Angus)
8062 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8064 * src/mathed/math_write.C
8065 (MathMatrixInset::Write) Put \protect before \begin{array} and
8066 \end{array} if fragile
8067 (MathParInset::Write): Put \protect before \\ if fragile
8069 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8071 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8072 initialization if the LyXColorHandler must be done after the
8073 connections to the XServer has been established.
8075 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8076 get the background pixel from the lyxColorhandler so that the
8077 figures are rendered with the correct background color.
8078 (NextToken): removed functions.
8079 (GetPSSizes): use ifs >> string instead of NextToken.
8081 * src/Painter.[Ch]: the color cache moved out of this file.
8083 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8086 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8088 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8089 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8091 * src/BufferView.C (enterView): new func
8092 (leaveView): new func
8094 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8096 (leaveView): new func, undefines xterm cursor when approp.
8098 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8099 (AllowInput): delete the Workarea cursor handling from this func.
8101 * src/Painter.C (underline): draw a slimer underline in most cases.
8103 * src/lyx_main.C (error_handler): use extern "C"
8105 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8107 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8108 sent directly to me.
8110 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8111 to the list by Dekel.
8113 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8116 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8117 methods from lyx_cb.here.
8119 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8122 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8124 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8125 instead of using current_view directly.
8127 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8129 * src/LyXAction.C (init): add the paragraph-spacing command.
8131 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8133 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8135 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8136 different from the documents.
8138 * src/text.C (SetHeightOfRow): take paragraph spacing into
8139 account, paragraph spacing takes precedence over buffer spacing
8140 (GetVisibleRow): ditto
8142 * src/paragraph.C (writeFile): output the spacing parameter too.
8143 (validate): set the correct features if spacing is used in the
8145 (Clear): set spacing to default
8146 (MakeSameLayout): spacing too
8147 (HasSameLayout): spacing too
8148 (SetLayout): spacing too
8149 (TeXOnePar): output the spacing commands
8151 * src/lyxparagraph.h: added a spacing variable for use with
8152 per-paragraph spacing.
8154 * src/Spacing.h: add a Default spacing and a method to check if
8155 the current spacing is default. also added an operator==
8157 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8160 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8162 * src/lyxserver.C (callback): fix dispatch of functions
8164 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8165 printf() into lyxerr call.
8167 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8170 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8171 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8172 the "Float" from each of the subitems.
8173 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8175 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8176 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8177 documented the change so that the workaround can be nuked later.
8179 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8182 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8184 * src/buffer.C (getLatexName): ditto
8185 (setReadonly): ditto
8187 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8189 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8190 avoid some uses of current_view. Added also a bufferParams()
8191 method to get at this.
8193 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8195 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8197 * src/lyxparagraph.[Ch]: removed
8198 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8199 with operators used by lower_bound and
8200 upper_bound in InsetTable's
8201 Make struct InsetTable private again. Used matchpos.
8203 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8205 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8206 document, the language of existing text is changed (unless the
8207 document is multi-lingual)
8209 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8211 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8213 * A lot of files: A rewrite of the Right-to-Left support.
8215 2000-04-10 Juergen Vigna <jug@sad.it>
8217 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8218 misplaced cursor when inset in inset is locked.
8220 * src/insets/insettext.C (LocalDispatch): small fix so that a
8221 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8223 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8224 footnote font should be decreased in size twice when displaying.
8226 * src/insets/insettext.C (GetDrawFont): inserted this function as
8227 the drawing-font may differ from the real paragraph font.
8229 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8230 insets (inset in inset!).
8232 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8233 function here because we don't want footnotes inside footnotes.
8235 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8237 (init): now set the inset_owner in paragraph.C
8238 (LocalDispatch): added some resetPos() in the right position
8241 (pasteSelection): changed to use the new CutAndPaste-Class.
8243 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8244 which tells if it is allowed to insert another inset inside this one.
8246 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8247 SwitchLayoutsBetweenClasses.
8249 * src/text2.C (InsertInset): checking of the new paragraph-function
8251 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8252 is not needed anymore here!
8255 (PasteSelection): redone (also with #ifdef) so that now this uses
8256 the CutAndPaste-Class.
8257 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8260 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8261 from/to text/insets.
8263 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8264 so that the paragraph knows if it is inside an (text)-inset.
8265 (InsertFromMinibuffer): changed return-value to bool as now it
8266 may happen that an inset is not inserted in the paragraph.
8267 (InsertInsetAllowed): this checks if it is allowed to insert an
8268 inset in this paragraph.
8270 (BreakParagraphConservative):
8271 (BreakParagraph) : small change for the above change of the return
8272 value of InsertFromMinibuffer.
8274 * src/lyxparagraph.h: added inset_owner and the functions to handle
8275 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8277 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8279 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8280 functions from BufferView to BufferView::Pimpl to ease maintence.
8282 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8283 correctly. Also use SetCursorIntern instead of SetCursor.
8285 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8288 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8290 * src/WorkArea.C (belowMouse): manually implement below mouse.
8292 * src/*: Add "explicit" on several constructors, I added probably
8293 some unneeded ones. A couple of changes to code because of this.
8295 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8296 implementation and private parts from the users of BufferView. Not
8299 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8300 implementation and private parts from the users of LyXLex. Not
8303 * src/BufferView_pimpl.[Ch]: new files
8305 * src/lyxlex_pimpl.[Ch]: new files
8307 * src/LyXView.[Ch]: some inline functions move out-of-line
8309 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8311 * src/lyxparagraph.h: make struct InsetTable public.
8313 * src/support/lyxstring.h: change lyxstring::difference_type to be
8314 ptrdiff_t. Add std:: modifiers to streams.
8316 * src/font.C: include the <cctype> header, for islower() and
8319 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8321 * src/font.[Ch]: new files. Contains the metric functions for
8322 fonts, takes a LyXFont as parameter. Better separation of concepts.
8324 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8325 changes because of this.
8327 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8329 * src/*: compile with -Winline and move functions that don't
8332 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8335 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8337 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8338 (various files changed because of this)
8340 * src/Painter.C (text): fixed the drawing of smallcaps.
8342 * src/lyxfont.[Ch] (drawText): removed unused member func.
8345 * src/*.C: added needed "using" statements and "std::" qualifiers.
8347 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8349 * src/*.h: removed all use of "using" from header files use
8350 qualifier std:: instead.
8352 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8354 * src/text.C (Backspace): some additional cleanups (we already
8355 know whether cursor.pos is 0 or not).
8357 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8358 automake does not provide one).
8360 * src/bmtable.h: replace C++ comments with C comments.
8362 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8364 * src/screen.C (ShowCursor): Change the shape of the cursor if
8365 the current language is not equal to the language of the document.
8366 (If the cursor change its shape unexpectedly, then you've found a bug)
8368 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8371 * src/insets/insetnumber.[Ch]: New files.
8373 * src/LyXAction.C (init)
8374 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8377 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8379 * src/lyxparagraph.h
8380 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8381 (the vector is kept sorted).
8383 * src/text.C (GetVisibleRow): Draw selection correctly when there
8384 is both LTR and RTL text.
8386 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8387 which is much faster.
8389 * src/text.C (GetVisibleRow and other): Do not draw the last space
8390 in a row if the direction of the last letter is not equal to the
8391 direction of the paragraph.
8393 * src/lyxfont.C (latexWriteStartChanges):
8394 Check that font language is not equal to basefont language.
8395 (latexWriteEndChanges): ditto
8397 * src/lyx_cb.C (StyleReset): Don't change the language while using
8398 the font-default command.
8400 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8401 empty paragraph before a footnote.
8403 * src/insets/insetcommand.C (draw): Increase x correctly.
8405 * src/screen.C (ShowCursor): Change cursor shape if
8406 current language != document language.
8408 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8410 2000-03-31 Juergen Vigna <jug@sad.it>
8412 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8413 (Clone): changed mode how the paragraph-data is copied to the
8414 new clone-paragraph.
8416 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8417 GetInset(pos) with no inset anymore there (in inset UNDO)
8419 * src/insets/insetcommand.C (draw): small fix as here x is
8420 incremented not as much as width() returns (2 before, 2 behind = 4)
8422 2000-03-30 Juergen Vigna <jug@sad.it>
8424 * src/insets/insettext.C (InsetText): small fix in initialize
8425 widthOffset (should not be done in the init() function)
8427 2000-03-29 Amir Karger <karger@lyx.org>
8429 * lib/examples/it_ItemizeBullets.lyx: translation by
8432 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8434 2000-03-29 Juergen Vigna <jug@sad.it>
8436 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8438 * src/insets/insetfoot.C (Clone): small change as for the below
8439 new init function in the text-inset
8441 * src/insets/insettext.C (init): new function as I've seen that
8442 clone did not copy the Paragraph-Data!
8443 (LocalDispatch): Added code so that now we have some sort of Undo
8444 functionality (well actually we HAVE Undo ;)
8446 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8448 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8450 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8453 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8455 * src/main.C: added a runtime check that verifies that the xforms
8456 header used when building LyX and the library used when running
8457 LyX match. Exit with a message if they don't match. This is a
8458 version number check only.
8460 * src/buffer.C (save): Don't allocate memory on the heap for
8461 struct utimbuf times.
8463 * *: some using changes, use iosfwd instead of the real headers.
8465 * src/lyxfont.C use char const * instead of string for the static
8466 strings. Rewrite some functions to use sstream.
8468 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8470 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8473 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8475 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8476 of Geodesy (from Martin Vermeer)
8478 * lib/layouts/svjour.inc: include file for the Springer svjour
8479 class. It can be used to support journals other than JoG.
8481 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8482 Miskiewicz <misiek@pld.org.pl>)
8483 * lib/reLyX/Makefile.am: ditto.
8485 2000-03-27 Juergen Vigna <jug@sad.it>
8487 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8488 also some modifications with operations on selected text.
8490 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8491 problems with clicking on insets (last famous words ;)
8493 * src/insets/insetcommand.C (draw):
8494 (width): Changed to have a bit of space before and after the inset so
8495 that the blinking cursor can be seen (otherwise it was hidden)
8497 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8499 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8500 would not be added to the link list when an installed gettext (not
8501 part of libc) is found.
8503 2000-03-24 Juergen Vigna <jug@sad.it>
8505 * src/insets/insetcollapsable.C (Edit):
8506 * src/mathed/formula.C (InsetButtonRelease):
8507 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8510 * src/BufferView.C (workAreaButtonPress):
8511 (workAreaButtonRelease):
8512 (checkInsetHit): Finally fixed the clicking on insets be handled
8515 * src/insets/insetert.C (Edit): inserted this call so that ERT
8516 insets work always with LaTeX-font
8518 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8520 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8521 caused lyx to startup with no GUI in place, causing in a crash
8522 upon startup when called with arguments.
8524 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8526 * src/FontLoader.C: better initialization of dummyXFontStruct.
8528 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8530 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8531 for linuxdoc and docbook import and export format options.
8533 * lib/lyxrc.example Example of default values for the previous flags.
8535 * src/lyx_cb.C Use those flags instead of the hardwired values for
8536 linuxdoc and docbook export.
8538 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8541 * src/menus.C Added menus entries for the new import/exports formats.
8543 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8545 * src/lyxrc.*: Added support for running without Gui
8548 * src/FontLoader.C: sensible defaults if no fonts are needed
8550 * src/lyx_cb.C: New function ShowMessage (writes either to the
8551 minibuffer or cout in case of no gui
8552 New function AskOverwrite for common stuff
8553 Consequently various changes to call these functions
8555 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8556 wild guess at sensible screen resolution when having no gui
8558 * src/lyxfont.C: no gui, no fonts... set some defaults
8560 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8562 * src/LColor.C: made the command inset background a bit lighter.
8564 2000-03-20 Hartmut Goebel <goebel@noris.net>
8566 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8567 stdstruct.inc. Koma-Script added some title elements which
8568 otherwise have been listed below "bibliography". This split allows
8569 adding title elements to where they belong.
8571 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8572 define the additional title elements and then include
8575 * many other layout files: changed to include stdtitle.inc just
8576 before stdstruct.inc.
8578 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8580 * src/buffer.C: (save) Added the option to store all backup files
8581 in a single directory
8583 * src/lyxrc.[Ch]: Added variable \backupdir_path
8585 * lib/lyxrc.example: Added descriptions of recently added variables
8587 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8588 bibtex inset, not closing the bibtex popup when deleting the inset)
8590 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8592 * src/lyx_cb.C: add a couple using directives.
8594 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8595 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8596 import based on the filename.
8598 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8599 file would be imported at start, if the filename where of a sgml file.
8601 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8603 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8605 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8606 * src/lyxfont.h Replaced the member variable bits.direction by the
8607 member variable lang. Made many changes in other files.
8608 This allows having a multi-lingual document
8610 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8611 that change the current language to <l>.
8612 Removed the command "font-rtl"
8614 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8615 format for Hebrew documents)
8617 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8618 When auto_mathmode is "true", pressing a digit key in normal mode
8619 will cause entering into mathmode.
8620 If auto_mathmode is "rtl" then this behavior will be active only
8621 when writing right-to-left text.
8623 * src/text2.C (InsertStringA) The string is inserted using the
8626 * src/paragraph.C (GetEndLabel) Gives a correct result for
8627 footnote paragraphs.
8629 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8631 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8633 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8634 front of PasteParagraph. Never insert a ' '. This should at least
8635 fix some cause for the segfaults that we have been experiencing,
8636 it also fixes backspace behaviour slightly. (Phu!)
8638 * src/support/lstrings.C (compare_no_case): some change to make it
8639 compile with gcc 2.95.2 and stdlibc++-v3
8641 * src/text2.C (MeltFootnoteEnvironment): change type o
8642 first_footnote_par_is_not_empty to bool.
8644 * src/lyxparagraph.h: make text private. Changes in other files
8646 (fitToSize): new function
8647 (setContentsFromPar): new function
8648 (clearContents): new function
8649 (SetChar): new function
8651 * src/paragraph.C (readSimpleWholeFile): deleted.
8653 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8654 the file, just use a simple string instead. Also read the file in
8655 a more maintainable manner.
8657 * src/text2.C (InsertStringA): deleted.
8658 (InsertStringB): deleted.
8660 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8662 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8663 RedoParagraphs from the doublespace handling part, just set status
8664 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8665 done, but perhaps not like this.)
8667 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8669 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8670 character when inserting an inset.
8672 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8674 * src/bufferparams.C (readLanguage): now takes "default" into
8677 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8678 also initialize the toplevel_keymap with the default bindings from
8681 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8683 * all files using lyxrc: have lyxrc as a real variable and not a
8684 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8687 * src/lyxrc.C: remove double call to defaultKeyBindings
8689 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8690 toolbar defauls using lyxlex. Remove enums, structs, functions
8693 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8694 toolbar defaults. Also store default keybindings in a map.
8696 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8697 storing the toolbar defaults without any xforms dependencies.
8699 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8700 applied. Changed to use iterators.
8702 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8704 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8705 systems that don't have LINGUAS set to begin with.
8707 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8709 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8710 the list by Dekel Tsur.
8712 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8714 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8715 * src/insets/form_graphics.C: ditto.
8717 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8719 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8721 * src/bufferparams.C (readLanguage): use the new language map
8723 * src/intl.C (InitKeyMapper): use the new language map
8725 * src/lyx_gui.C (create_forms): use the new language map
8727 * src/language.[Ch]: New files. Used for holding the information
8728 about each language. Now! Use this new language map enhance it and
8729 make it really usable for our needs.
8731 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8733 * screen.C (ShowCursor): Removed duplicate code.
8734 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8735 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8737 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8740 * src/text.C Added TransformChar method. Used for rendering Arabic
8741 text correctly (change the glyphs of the letter according to the
8742 position in the word)
8747 * src/lyxrc.C Added lyxrc command {language_command_begin,
8748 language_command_end,language_command_ltr,language_command_rtl,
8749 language_package} which allows the use of either arabtex or Omega
8752 * src/lyx_gui.C (init)
8754 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8755 to use encoding for menu fonts which is different than the encoding
8758 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8759 do not load the babel package.
8760 To write an English document with Hebrew/Arabic, change the document
8761 language to "english".
8763 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8764 (alphaCounter): changed to return char
8765 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8767 * lib/lyxrc.example Added examples for Hebrew/Arabic
8770 * src/layout.C Added layout command endlabeltype
8772 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8774 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8776 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8778 * src/mathed/math_delim.C (search_deco): return a
8779 math_deco_struct* instead of index.
8781 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8783 * All files with a USE_OSTREAM_ONLY within: removed all code that
8784 was unused when USE_OSTREAM_ONLY is defined.
8786 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8787 of any less. Removed header and using.
8789 * src/text.C (GetVisibleRow): draw the string "Page Break
8790 (top/bottom)" on screen when drawing a pagebreak line.
8792 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8794 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8796 * src/mathed/math_macro.C (draw): do some cast magic.
8799 * src/mathed/math_defs.h: change byte* argument to byte const*.
8801 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8803 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8804 know it is right to return InsetFoot* too, but cxx does not like
8807 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8809 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8811 * src/mathed/math_delim.C: change == to proper assignment.
8813 2000-03-09 Juergen Vigna <jug@sad.it>
8815 * src/insets/insettext.C (setPos): fixed various cursor positioning
8816 problems (via mouse and cursor-keys)
8817 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8818 inset (still a small display problem but it works ;)
8820 * src/insets/insetcollapsable.C (draw): added button_top_y and
8821 button_bottom_y to have correct values for clicking on the inset.
8823 * src/support/lyxalgo.h: commented out 'using std::less'
8825 2000-03-08 Juergen Vigna <jug@sad.it>
8827 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8828 Button-Release event closes as it is alos the Release-Event
8831 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8833 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8835 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8836 can add multiple spaces in Scrap (literate programming) styles...
8837 which, by the way, is how I got hooked on LyX to begin with.
8839 * src/mathed/formula.C (Write): Added dummy variable to an
8840 inset::Latex() call.
8841 (Latex): Add free_spacing boolean to inset::Latex()
8843 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8845 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8846 virtual function to include the free_spacing boolean from
8847 the containing paragraph's style.
8849 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8850 Added free_spacing boolean arg to match inset.h
8852 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8853 Added free_spacing boolean arg to match inset.h
8855 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8856 Added free_spacing boolean and made sure that if in a free_spacing
8857 paragraph, that we output normal space if there is a protected space.
8859 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8860 Added free_spacing boolean arg to match inset.h
8862 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8863 Added free_spacing boolean arg to match inset.h
8865 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8866 Added free_spacing boolean arg to match inset.h
8868 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8869 Added free_spacing boolean arg to match inset.h
8871 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8872 Added free_spacing boolean arg to match inset.h
8874 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8875 free_spacing boolean arg to match inset.h
8877 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8878 Added free_spacing boolean arg to match inset.h
8880 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8881 Added free_spacing boolean arg to match inset.h
8883 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8884 Added free_spacing boolean arg to match inset.h
8886 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8887 Added free_spacing boolean arg to match inset.h
8889 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8890 Added free_spacing boolean arg to match inset.h
8892 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8893 free_spacing boolean arg to match inset.h
8895 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8896 free_spacing boolean arg to match inset.h
8898 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8899 ignore free_spacing paragraphs. The user's spaces are left
8902 * src/text.C (InsertChar): Fixed the free_spacing layout
8903 attribute behavior. Now, if free_spacing is set, you can
8904 add multiple spaces in a paragraph with impunity (and they
8905 get output verbatim).
8906 (SelectSelectedWord): Added dummy argument to inset::Latex()
8909 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8912 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8913 paragraph layouts now only input a simple space instead.
8914 Special character insets don't make any sense in free-spacing
8917 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8918 hard-spaces in the *input* file to simple spaces if the layout
8919 is free-spacing. This converts old files which had to have
8920 hard-spaces in free-spacing layouts where a simple space was
8922 (writeFileAscii): Added free_spacing check to pass to the newly
8923 reworked inset::Latex(...) methods. The inset::Latex() code
8924 ensures that hard-spaces in free-spacing paragraphs get output
8925 as spaces (rather than "~").
8927 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8929 * src/mathed/math_delim.C (draw): draw the empty placeholder
8930 delims with a onoffdash line.
8931 (struct math_deco_compare): struct that holds the "functors" used
8932 for the sort and the binary search in math_deco_table.
8933 (class init_deco_table): class used for initial sort of the
8935 (search_deco): use lower_bound to do a binary search in the
8938 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8940 * src/lyxrc.C: a small secret thingie...
8942 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8943 and to not flush the stream as often as it used to.
8945 * src/support/lyxalgo.h: new file
8946 (sorted): template function used for checking if a sequence is
8947 sorted or not. Two versions with and without user supplied
8948 compare. Uses same compare as std::sort.
8950 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8951 it and give warning on lyxerr.
8953 (struct compare_tags): struct with function operators used for
8954 checking if sorted, sorting and lower_bound.
8955 (search_kw): use lower_bound instead of manually implemented
8958 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8960 * src/insets/insetcollapsable.h: fix Clone() declaration.
8961 * src/insets/insetfoot.h: ditto.
8963 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8965 2000-03-08 Juergen Vigna <jug@sad.it>
8967 * src/insets/lyxinset.h: added owner call which tells us if
8968 this inset is inside another inset. Changed also the return-type
8969 of Editable to an enum so it tells clearer what the return-value is.
8971 * src/insets/insettext.C (computeTextRows): fixed computing of
8972 textinsets which split automatically on more rows.
8974 * src/insets/insetert.[Ch]: changed this to be of BaseType
8977 * src/insets/insetfoot.[Ch]: added footnote inset
8979 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8980 collapsable insets (like footnote, ert, ...)
8982 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8984 * src/lyxdraw.h: remvoe file
8986 * src/lyxdraw.C: remove file
8988 * src/insets/insettext.C: added <algorithm>.
8990 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8992 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8993 (matrix_cb): case MM_OK use string stream
8995 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8998 * src/mathed/math_macro.C (draw): use string stream
8999 (Metrics): use string stream
9001 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9002 directly to the ostream.
9004 * src/vspace.C (asString): use string stream.
9005 (asString): use string stream
9006 (asLatexString): use string stream
9008 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9009 setting Spacing::Other.
9011 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9012 sprintf when creating the stretch vale.
9014 * src/text2.C (alphaCounter): changed to return a string and to
9015 not use a static variable internally. Also fixed a one-off bug.
9016 (SetCounter): changed the drawing of the labels to use string
9017 streams instead of sprintf.
9019 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9020 manipulator to use a scheme that does not require library support.
9021 This is also the way it is done in the new GNU libstdc++. Should
9022 work with DEC cxx now.
9024 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9026 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9027 end. This fixes a bug.
9029 * src/mathed (all files concerned with file writing): apply the
9030 USE_OSTREAM_ONLY changes to mathed too.
9032 * src/support/DebugStream.h: make the constructor explicit.
9034 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9035 count and ostream squashed.
9037 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9039 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9041 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9042 ostringstream uses STL strings, and we might not.
9044 * src/insets/insetspecialchar.C: add using directive.
9045 * src/insets/insettext.C: ditto.
9047 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9049 * lib/layouts/seminar.layout: feeble attempt at a layout for
9050 seminar.cls, far from completet and could really use some looking
9051 at from people used to write layout files.
9053 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9054 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9055 a lot nicer and works nicely with ostreams.
9057 * src/mathed/formula.C (draw): a slightly different solution that
9058 the one posted to the list, but I think this one works too. (font
9059 size wrong in headers.)
9061 * src/insets/insettext.C (computeTextRows): some fiddling on
9062 Jürgens turf, added some comments that he should read.
9064 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9065 used and it gave compiler warnings.
9066 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9069 * src/lyx_gui.C (create_forms): do the right thing when
9070 show_banner is true/false.
9072 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9073 show_banner is false.
9075 * most file writing files: Now use iostreams to do almost all of
9076 the writing. Also instead of passing string &, we now use
9077 stringstreams. mathed output is still not adapted to iostreams.
9078 This change can be turned off by commenting out all the occurences
9079 of the "#define USE_OSTREAM_ONLY 1" lines.
9081 * src/WorkArea.C (createPixmap): don't output debug messages.
9082 (WorkArea): don't output debug messages.
9084 * lib/lyxrc.example: added a comment about the new variable
9087 * development/Code_rules/Rules: Added some more commente about how
9088 to build class interfaces and on how better encapsulation can be
9091 2000-03-03 Juergen Vigna <jug@sad.it>
9093 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9094 automatically with the width of the LyX-Window
9096 * src/insets/insettext.C (computeTextRows): fixed update bug in
9097 displaying text-insets (scrollvalues where not initialized!)
9099 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9101 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9102 id in the check of the result from lower_bound is not enough since
9103 lower_bound can return last too, and then res->id will not be a
9106 * all insets and some code that use them: I have conditionalized
9107 removed the Latex(string & out, ...) this means that only the
9108 Latex(ostream &, ...) will be used. This is a work in progress to
9109 move towards using streams for all output of files.
9111 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9114 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9116 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9117 routine (this fixes bug where greek letters were surrounded by too
9120 * src/support/filetools.C (findtexfile): change a bit the search
9121 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9122 no longer passed to kpsewhich, we may have to change that later.
9124 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9125 warning options to avoid problems with X header files (from Angus
9127 * acinclude.m4: regenerated.
9129 2000-03-02 Juergen Vigna <jug@sad.it>
9131 * src/insets/insettext.C (WriteParagraphData): Using the
9132 par->writeFile() function for writing paragraph-data.
9133 (Read): Using buffer->parseSingleLyXformat2Token()-function
9134 for parsing paragraph data!
9136 * src/buffer.C (readLyXformat2): removed all parse data and using
9137 the new parseSingleLyXformat2Token()-function.
9138 (parseSingleLyXformat2Token): added this function to parse (read)
9139 lyx-file-format (this is called also from text-insets now!)
9141 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9143 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9146 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9147 directly instead of going through a func. One very bad thing: a
9148 static LyXFindReplace, but I don't know where to place it.
9150 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9151 string instead of char[]. Also changed to static.
9152 (GetSelectionOrWordAtCursor): changed to static inline
9153 (SetSelectionOverLenChars): ditto.
9155 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9156 current_view and global variables. both classes has changed names
9157 and LyXFindReplace is not inherited from SearchForm.
9159 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9160 fl_form_search form.
9162 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9164 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9166 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9167 bound (from Kayvan).
9169 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9171 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9173 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9175 * some things that I should comment but the local pub says head to
9178 * comment out all code that belongs to the Roff code for Ascii
9179 export of tables. (this is unused)
9181 * src/LyXView.C: use correct type for global variable
9182 current_layout. (LyXTextClass::size_type)
9184 * some code to get the new insetgraphics closer to working I'd be
9185 grateful for any help.
9187 * src/BufferView2.C (insertInset): use the return type of
9188 NumberOfLayout properly. (also changes in other files)
9190 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9191 this as a test. I want to know what breaks because of this.
9193 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9195 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9197 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9198 to use a \makebox in the label, this allows proper justification
9199 with out using protected spaces or multiple hfills. Now it is
9200 "label" for left justified, "\hfill label\hfill" for center, and
9201 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9202 should be changed accordingly.
9204 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9206 * src/lyxtext.h: change SetLayout() to take a
9207 LyXTextClass::size_type instead of a char (when there is more than
9208 127 layouts in a class); also change type of copylayouttype.
9209 * src/text2.C (SetLayout): ditto.
9210 * src/LyXView.C (updateLayoutChoice): ditto.
9212 * src/LaTeX.C (scanLogFile): errors where the line number was not
9213 given just after the '!'-line were ignored (from Dekel Tsur).
9215 * lib/lyxrc.example: fix description of \date_insert_format
9217 * lib/layouts/llncs.layout: new layout, contributed by Martin
9220 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9222 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9223 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9224 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9225 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9226 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9227 paragraph.C, text.C, text2.C)
9229 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9231 * src/insets/insettext.C (LocalDispatch): remove extra break
9234 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9235 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9237 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9238 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9240 * src/insets/insetbib.h: move InsetBibkey::Holder and
9241 InsetCitation::Holder in public space.
9243 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9245 * src/insets/insettext.h: small change to get the new files from
9246 Juergen to compile (use "string", not "class string").
9248 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9249 const & as parameter to LocalDispatch, use LyXFont const & as
9250 paramter to some other func. This also had impacto on lyxinsets.h
9251 and the two mathed insets.
9253 2000-02-24 Juergen Vigna <jug@sad.it>
9256 * src/commandtags.h:
9258 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9262 * src/BufferView2.C: added/updated code for various inset-functions
9264 * src/insets/insetert.[Ch]: added implementation of InsetERT
9266 * src/insets/insettext.[Ch]: added implementation of InsetText
9268 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9269 (draw): added preliminary code for inset scrolling not finshed yet
9271 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9272 as it is in lyxfunc.C now
9274 * src/insets/lyxinset.h: Added functions for text-insets
9276 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9278 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9279 BufferView and reimplement the list as a queue put inside its own
9282 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9284 * several files: use the new interface to the "updateinsetlist"
9286 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9288 (work_area_handler): call BufferView::trippleClick on trippleclick.
9290 * src/BufferView.C (doubleClick): new function, selects word on
9292 (trippleClick): new function, selects line on trippleclick.
9294 2000-02-22 Allan Rae <rae@lyx.org>
9296 * lib/bind/xemacs.bind: buffer-previous not supported
9298 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9300 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9303 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9305 * src/bufferlist.C: get rid of current_view from this file
9307 * src/spellchecker.C: get rid of current_view from this file
9309 * src/vspace.C: get rid of current_view from this file
9310 (inPixels): added BufferView parameter for this func
9311 (asLatexCommand): added a BufferParams for this func
9313 * src/text.C src/text2.C: get rid of current_view from these
9316 * src/lyxfont.C (getFontDirection): move this function here from
9319 * src/bufferparams.C (getDocumentDirection): move this function
9322 * src/paragraph.C (getParDirection): move this function here from
9324 (getLetterDirection): ditto
9326 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9328 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9329 resize due to wrong pixmap beeing used. Also took the opurtunity
9330 to make the LyXScreen stateless on regard to WorkArea and some
9331 general cleanup in the same files.
9333 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9335 * src/Makefile.am: add missing direction.h
9337 * src/PainterBase.h: made the width functions const.
9339 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9342 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9344 * src/insets/insetlatexaccent.C (draw): make the accents draw
9345 better, at present this will only work well with iso8859-1.
9347 * several files: remove the old drawing code, now we use the new
9350 * several files: remove support for mono_video, reverse_video and
9353 2000-02-17 Juergen Vigna <jug@sad.it>
9355 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9356 int ** as we have to return the pointer, otherwise we have only
9357 NULL pointers in the returning function.
9359 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9361 * src/LaTeX.C (operator()): quote file name when running latex.
9363 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9365 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9366 (bubble tip), this removes our special handling of this.
9368 * Remove all code that is unused now that we have the new
9369 workarea. (Code that are not active when NEW_WA is defined.)
9371 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9373 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9375 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9376 nonexisting layout; correctly redirect obsoleted layouts.
9378 * lib/lyxrc.example: document \view_dvi_paper_option
9380 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9383 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9384 (PreviewDVI): handle the view_dvi_paper_option variable.
9385 [Both from Roland Krause]
9387 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9389 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9390 char const *, int, LyXFont)
9391 (text(int, int, string, LyXFont)): ditto
9393 * src/text.C (InsertCharInTable): attempt to fix the double-space
9394 feature in tables too.
9395 (BackspaceInTable): ditto.
9396 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9398 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9400 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9402 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9403 newly found text in textcache to this.
9404 (buffer): set the owner of the text put into the textcache to 0
9406 * src/insets/figinset.C (draw): fixed the drawing of figures with
9409 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9410 drawing of mathframe, hfills, protected space, table lines. I have
9411 now no outstanding drawing problems with the new Painter code.
9413 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9415 * src/PainterBase.C (ellipse, circle): do not specify the default
9418 * src/LColor.h: add using directive.
9420 * src/Painter.[Ch]: change return type of methods from Painter& to
9421 PainterBase&. Add a using directive.
9423 * src/WorkArea.C: wrap xforms callbacks in C functions
9426 * lib/layouts/foils.layout: font fix and simplifications from Carl
9429 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9431 * a lot of files: The Painter, LColor and WorkArea from the old
9432 devel branch has been ported to lyx-devel. Some new files and a
9433 lot of #ifdeffed code. The new workarea is enabled by default, but
9434 if you want to test the new Painter and LColor you have to compile
9435 with USE_PAINTER defined (do this in config.h f.ex.) There are
9436 still some rought edges, and I'd like some help to clear those
9437 out. It looks stable (loads and displays the Userguide very well).
9440 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9442 * src/buffer.C (pop_tag): revert to the previous implementation
9443 (use a global variable for both loops).
9445 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9447 * src/lyxrc.C (LyXRC): change slightly default date format.
9449 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9450 there is an English text with a footnote that starts with a Hebrew
9451 paragraph, or vice versa.
9452 (TeXFootnote): ditto.
9454 * src/text.C (LeftMargin): allow for negative values for
9455 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9458 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9459 for input encoding (cyrillic)
9461 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9463 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9466 * src/toolbar.C (set): ditto
9467 * src/insets/insetbib.C (create_form_citation_form): ditto
9469 * lib/CREDITS: added Dekel Tsur.
9471 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9472 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9473 hebrew supports files from Dekel Tsur.
9475 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9476 <tzafrir@technion.ac.il>
9478 * src/lyxrc.C: put \date_insert_format at the right place.
9480 * src/buffer.C (makeLaTeXFile): fix the handling of
9481 BufferParams::sides when writing out latex files.
9483 * src/BufferView2.C: add a "using" directive.
9485 * src/support/lyxsum.C (sum): when we use lyxstring,
9486 ostringstream::str needs an additional .c_str().
9488 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9490 * src/support/filetools.C (ChangeExtension): patch from Etienne
9493 * src/TextCache.C (show): remove const_cast and make second
9494 parameter non-const LyXText *.
9496 * src/TextCache.h: use non const LyXText in show.
9498 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9501 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9503 * src/support/lyxsum.C: rework to be more flexible.
9505 * several places: don't check if a pointer is 0 if you are going
9508 * src/text.C: remove some dead code.
9510 * src/insets/figinset.C: remove some dead code
9512 * src/buffer.C: move the BufferView funcs to BufferView2.C
9513 remove all support for insetlatexdel
9514 remove support for oldpapersize stuff
9515 made some member funcs const
9517 * src/kbmap.C: use a std::list to store the bindings in.
9519 * src/BufferView2.C: new file
9521 * src/kbsequence.[Ch]: new files
9523 * src/LyXAction.C + others: remove all trace of buffer-previous
9525 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9526 only have one copy in the binary of this table.
9528 * hebrew patch: moved some functions from LyXText to more
9529 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9531 * several files: remove support for XForms older than 0.88
9533 remove some #if 0 #endif code
9535 * src/TextCache.[Ch]: new file. Holds the textcache.
9537 * src/BufferView.C: changes to use the new TextCache interface.
9538 (waitForX): remove the now unused code.
9540 * src/BackStack.h: remove some commented code
9542 * lib/bind/emacs.bind: remove binding for buffer-previous
9544 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9546 * applied the hebrew patch.
9548 * src/lyxrow.h: make sure that all Row variables are initialized.
9550 * src/text2.C (TextHandleUndo): comment out a delete, this might
9551 introduce a memory leak, but should also help us to not try to
9552 read freed memory. We need to look at this one.
9554 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9555 (LyXParagraph): initalize footnotekind.
9557 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9558 forgot this when applying the patch. Please heed the warnings.
9560 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9561 (aka. reformat problem)
9563 * src/bufferlist.C (exists): made const, and use const_iterator
9564 (isLoaded): new func.
9565 (release): use std::find to find the correct buffer.
9567 * src/bufferlist.h: made getState a const func.
9568 made empty a const func.
9569 made exists a const func.
9572 2000-02-01 Juergen Vigna <jug@sad.it>
9574 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9576 * po/it.po: updated a bit the italian po file and also changed the
9577 'file nuovo' for newfile to 'filenuovo' without a space, this did
9580 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9581 for the new insert_date command.
9583 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9584 from jdblair, to insert a date into the current text conforming to
9585 a strftime format (for now only considering the locale-set and not
9586 the document-language).
9588 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9590 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9591 Bounds Read error seen by purify. The problem was that islower is
9592 a macros which takes an unsigned char and uses it as an index for
9593 in array of characters properties (and is thus subject to the
9597 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9598 correctly the paper sides radio buttons.
9599 (UpdateDocumentButtons): ditto.
9601 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9603 * src/kbmap.C (getsym + others): change to return unsigned int,
9604 returning a long can give problems on 64 bit systems. (I assume
9605 that int is 32bit on 64bit systems)
9607 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9609 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9610 LyXLookupString to be zero-terminated. Really fixes problems seen
9613 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9615 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9616 write a (char*)0 to the lyxerr stream.
9618 * src/lastfiles.C: move algorithm before the using statemets.
9620 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9622 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9623 complains otherwise).
9624 * src/table.C: ditto
9626 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9629 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9630 that I removed earlier... It is really needed.
9632 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9634 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9636 * INSTALL: update xforms home page URL.
9638 * lib/configure.m4: fix a bug with unreadable layout files.
9640 * src/table.C (calculate_width_of_column): add "using std::max"
9643 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9645 * several files: marked several lines with "DEL LINE", this is
9646 lines that can be deleted without changing anything.
9647 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9648 checks this anyway */
9651 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9653 * src/DepTable.C (update): add a "+" at the end when the checksum
9654 is different. (debugging string only)
9656 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9657 the next inset to not be displayed. This should also fix the list
9658 of labels in the "Insert Crossreference" dialog.
9660 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9662 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9663 when regex was not found.
9665 * src/support/lstrings.C (lowercase): use handcoded transform always.
9668 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9669 old_cursor.par->prev could be 0.
9671 * several files: changed post inc/dec to pre inc/dec
9673 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9674 write the lastfiles to file.
9676 * src/BufferView.C (buffer): only show TextCache info when debugging
9678 (resizeCurrentBuffer): ditto
9679 (workAreaExpose): ditto
9681 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9683 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9685 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9686 a bit better by removing the special case for \i and \j.
9688 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9690 * src/lyx_main.C (easyParse): remove test for bad comand line
9691 options, since this broke all xforms-related parsing.
9693 * src/kbmap.C (getsym): set return type to unsigned long, as
9694 declared in header. On an alpha, long is _not_ the same as int.
9696 * src/support/LOstream.h: add a "using std::flush;"
9698 * src/insets/figinset.C: ditto.
9700 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9702 * src/bufferlist.C (write): use blinding fast file copy instead of
9703 "a char at a time", now we are doing it the C++ way.
9705 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9706 std::list<int> instead.
9707 (addpidwait): reflect move to std::list<int>
9708 (sigchldchecker): ditto
9710 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9713 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9714 that obviously was wrong...
9716 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9717 c, this avoids warnings with purify and islower.
9719 * src/insets/figinset.C: rename struct queue to struct
9720 queue_element and rewrite to use a std::queue. gsqueue is now a
9721 std::queue<queue_element>
9722 (runqueue): reflect move to std::queue
9725 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9726 we would get "1" "0" instead of "true" "false. Also make the tostr
9729 2000-01-21 Juergen Vigna <jug@sad.it>
9731 * src/buffer.C (writeFileAscii): Disabled code for special groff
9732 handling of tabulars till I fix this in table.C
9734 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9736 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9738 * src/support/lyxlib.h: ditto.
9740 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9742 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9743 and 'j' look better. This might fix the "macron" bug that has been
9746 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9747 functions as one template function. Delete the old versions.
9749 * src/support/lyxsum.C: move using std::ifstream inside
9752 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9755 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9757 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9759 * src/insets/figinset.C (InitFigures): use new instead of malloc
9760 to allocate memory for figures and bitmaps.
9761 (DoneFigures): use delete[] instead of free to deallocate memory
9762 for figures and bitmaps.
9763 (runqueue): use new to allocate
9764 (getfigdata): use new/delete[] instead of malloc/free
9765 (RegisterFigure): ditto
9767 * some files: moved some declarations closer to first use, small
9768 whitespace changes use preincrement instead of postincrement where
9769 it does not make a difference.
9771 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9772 step on the way to use stl::containers for key maps.
9774 * src/bufferlist.h: add a typedef for const_iterator and const
9775 versions of begin and end.
9777 * src/bufferlist.[Ch]: change name of member variable _state to
9778 state_. (avoid reserved names)
9780 (getFileNames): returns the filenames of the buffers in a vector.
9782 * configure.in (ALL_LINGUAS): added ro
9784 * src/support/putenv.C: new file
9786 * src/support/mkdir.C: new file
9788 2000-01-20 Allan Rae <rae@lyx.org>
9790 * lib/layouts/IEEEtran.layout: Added several theorem environments
9792 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9793 couple of minor additions.
9795 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9796 (except for those in footnotes of course)
9798 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9800 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9802 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9803 std::sort and std::lower_bound instead of qsort and handwritten
9805 (struct compara): struct that holds the functors used by std::sort
9806 and std::lower_bound in MathedLookupBOP.
9808 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9810 * src/support/LAssert.h: do not do partial specialization. We do
9813 * src/support/lyxlib.h: note that lyx::getUserName() and
9814 lyx::date() are not in use right now. Should these be suppressed?
9816 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9817 (makeLinuxDocFile): do not put date and user name in linuxdoc
9820 * src/support/lyxlib.h (kill): change first argument to long int,
9821 since that's what solaris uses.
9823 * src/support/kill.C (kill): fix declaration to match prototype.
9825 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9826 actually check whether namespaces are supported. This is not what
9829 * src/support/lyxsum.C: add a using directive.
9831 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9833 * src/support/kill.C: if we have namespace support we don't have
9834 to include lyxlib.h.
9836 * src/support/lyxlib.h: use namespace lyx if supported.
9838 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9840 * src/support/date.C: new file
9842 * src/support/chdir.C: new file
9844 * src/support/getUserName.C: new file
9846 * src/support/getcwd.C: new file
9848 * src/support/abort.C: new file
9850 * src/support/kill.C: new file
9852 * src/support/lyxlib.h: moved all the functions in this file
9853 insede struct lyx. Added also kill and abort to this struct. This
9854 is a way to avoid the "kill is not defined in <csignal>", we make
9855 C++ wrappers for functions that are not ANSI C or ANSI C++.
9857 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9858 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9859 lyx it has been renamed to sum.
9861 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9863 * src/text.C: add using directives for std::min and std::max.
9865 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9867 * src/texrow.C (getIdFromRow): actually return something useful in
9868 id and pos. Hopefully fixes the bug with positionning of errorbox
9871 * src/lyx_main.C (easyParse): output an error and exit if an
9872 incorrect command line option has been given.
9874 * src/spellchecker.C (ispell_check_word): document a memory leak.
9876 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9877 where a "struct utimbuf" is allocated with "new" and deleted with
9880 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9882 * src/text2.C (CutSelection): don't delete double spaces.
9883 (PasteSelection): ditto
9884 (CopySelection): ditto
9886 * src/text.C (Backspace): don't delete double spaces.
9888 * src/lyxlex.C (next): fix a bug that were only present with
9889 conformant std::istream::get to read comment lines, use
9890 std::istream::getline instead. This seems to fix the problem.
9892 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9894 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9895 allowed to insert space before space" editing problem. Please read
9896 commends at the beginning of the function. Comments about usage
9899 * src/text.C (InsertChar): fix for the "not allowed to insert
9900 space before space" editing problem.
9902 * src/text2.C (DeleteEmptyParagraphMechanism): when
9903 IsEmptyTableRow can only return false this last "else if" will
9904 always be a no-op. Commented out.
9906 * src/text.C (RedoParagraph): As far as I can understand tmp
9907 cursor is not really needed.
9909 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9910 present it could only return false anyway.
9911 (several functions): Did something not so smart...added a const
9912 specifier on a lot of methods.
9914 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9915 and add a tmp->text.resize. The LyXParagraph constructor does the
9917 (BreakParagraphConservative): ditto
9919 * src/support/path.h (Path): add a define so that the wrong usage
9920 "Path("/tmp") will be flagged as a compilation error:
9921 "`unnamed_Path' undeclared (first use this function)"
9923 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9925 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9926 which was bogus for several reasons.
9928 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9932 * autogen.sh: do not use "type -path" (what's that anyway?).
9934 * src/support/filetools.C (findtexfile): remove extraneous space
9935 which caused a kpsewhich warning (at least with kpathsea version
9938 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9940 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9942 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9944 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9946 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9948 * src/paragraph.C (BreakParagraph): do not reserve space on text
9949 if we don't need to (otherwise, if pos_end < pos, we end up
9950 reserving huge amounts of memory due to bad unsigned karma).
9951 (BreakParagraphConservative): ditto, although I have not seen
9952 evidence the bug can happen here.
9954 * src/lyxparagraph.h: add a using std::list.
9956 2000-01-11 Juergen Vigna <jug@sad.it>
9958 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9961 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9963 * src/vc-backend.C (doVCCommand): change to be static and take one
9964 more parameter: the path to chdir too be fore executing the command.
9965 (retrive): new function equiv to "co -r"
9967 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9968 file_not_found_hook is true.
9970 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9972 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9973 if a file is readwrite,readonly...anything else.
9975 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9977 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9978 (CreatePostscript): name change from MenuRunDVIPS (or something)
9979 (PreviewPostscript): name change from MenuPreviewPS
9980 (PreviewDVI): name change from MenuPreviewDVI
9982 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9983 \view_pdf_command., \pdf_to_ps_command
9985 * lib/configure.m4: added search for PDF viewer, and search for
9986 PDF to PS converter.
9987 (lyxrc.defaults output): add \pdflatex_command,
9988 \view_pdf_command and \pdf_to_ps_command.
9990 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9992 * src/bufferlist.C (write): we don't use blocksize for anything so
9995 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9997 * src/support/block.h: disable operator T* (), since it causes
9998 problems with both compilers I tried. See comments in the file.
10000 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10003 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10004 variable LYX_DIR_10x to LYX_DIR_11x.
10006 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10008 * INSTALL: document --with-lyxname.
10011 * configure.in: new configure flag --with-lyxname which allows to
10012 choose the name under which lyx is installed. Default is "lyx", of
10013 course. It used to be possible to do this with --program-suffix,
10014 but the later has in fact a different meaning for autoconf.
10016 * src/support/lstrings.h (lstrchr): reformat a bit.
10018 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10019 * src/mathed/math_defs.h: ditto.
10021 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10023 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10024 true, decides if we create a backup file or not when saving. New
10025 tag and variable \pdf_mode, defaults to false. New tag and
10026 variable \pdflatex_command, defaults to pdflatex. New tag and
10027 variable \view_pdf_command, defaults to xpdf. New tag and variable
10028 \pdf_to_ps_command, defaults to pdf2ps.
10030 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10032 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10033 does not have a BufferView.
10034 (unlockInset): ditto + don't access the_locking_inset if the
10035 buffer does not have a BufferView.
10037 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10038 certain circumstances so that we don't continue a keyboard
10039 operation long after the key was released. Try f.ex. to load a
10040 large document, press PageDown for some seconds and then release
10041 it. Before this change the document would contine to scroll for
10042 some time, with this change it stops imidiatly.
10044 * src/support/block.h: don't allocate more space than needed. As
10045 long as we don't try to write to the arr[x] in a array_type arr[x]
10046 it is perfectly ok. (if you write to it you might segfault).
10047 added operator value_type*() so that is possible to pass the array
10048 to functions expecting a C-pointer.
10050 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10053 * intl/*: updated to gettext 0.10.35, tried to add our own
10054 required modifications. Please verify.
10056 * po/*: updated to gettext 0.10.35, tried to add our own required
10057 modifications. Please verify.
10059 * src/support/lstrings.C (tostr): go at fixing the problem with
10060 cxx and stringstream. When stringstream is used return
10061 oss.str().c_str() so that problems with lyxstring and basic_string
10062 are avoided. Note that the best solution would be for cxx to use
10063 basic_string all the way, but it is not conformant yet. (it seems)
10065 * src/lyx_cb.C + other files: moved several global functions to
10066 class BufferView, some have been moved to BufferView.[Ch] others
10067 are still located in lyx_cb.C. Code changes because of this. (part
10068 of "get rid of current_view project".)
10070 * src/buffer.C + other files: moved several Buffer functions to
10071 class BufferView, the functions are still present in buffer.C.
10072 Code changes because of this.
10074 * config/lcmessage.m4: updated to most recent. used when creating
10077 * config/progtest.m4: updated to most recent. used when creating
10080 * config/gettext.m4: updated to most recent. applied patch for
10083 * config/gettext.m4.patch: new file that shows what changes we
10084 have done to the local copy of gettext.m4.
10086 * config/libtool.m4: new file, used in creation of acinclude.m4
10088 * config/lyxinclude.m4: new file, this is the lyx created m4
10089 macros, used in making acinclude.m4.
10091 * autogen.sh: GNU m4 discovered as a separate task not as part of
10092 the lib/configure creation.
10093 Generate acinlucde from files in config. Actually cat
10094 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10095 easier to upgrade .m4 files that really are external.
10097 * src/Spacing.h: moved using std::istringstream to right after
10098 <sstream>. This should fix the problem seen with some compilers.
10100 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10102 * src/lyx_cb.C: began some work to remove the dependency a lot of
10103 functions have on BufferView::text, even if not really needed.
10104 (GetCurrentTextClass): removed this func, it only hid the
10107 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10108 forgot this in last commit.
10110 * src/Bullet.C (bulletEntry): use static char const *[] for the
10111 tables, becuase of this the return arg had to change to string.
10112 (bulletSize): ditto
10113 (~Bullet): removed unneeded destructor
10115 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10116 (insetSleep): moved from Buffer
10117 (insetWakeup): moved from Buffer
10118 (insetUnlock): moved from Buffer
10120 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10121 from Buffer to BufferView.
10123 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10125 * config/ltmain.sh: updated to version 1.3.4 of libtool
10127 * config/ltconfig: updated to version 1.3.4 of libtool
10129 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10132 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10133 Did I get that right?
10135 * src/lyxlex.h: add a "using" directive or two.
10136 * src/Spacing.h: ditto.
10137 * src/insets/figinset.C: ditto.
10138 * src/support/filetools.C: ditto.
10139 * src/support/lstrings.C: ditto.
10140 * src/BufferView.C: ditto.
10141 * src/bufferlist.C: ditto.
10142 * src/lyx_cb.C: ditto.
10143 * src/lyxlex.C: ditto.
10145 * NEWS: add some changes for 1.1.4.
10147 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10149 * src/BufferView.C: first go at a TextCache to speed up switching
10152 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10154 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10155 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10156 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10157 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10160 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10161 members of the struct are correctly initialized to 0 (detected by
10163 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10164 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10166 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10167 pidwait, since it was allocated with "new". This was potentially
10168 very bad. Thanks to Michael Schmitt for running purify for us.
10171 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10173 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10175 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10177 1999-12-30 Allan Rae <rae@lyx.org>
10179 * lib/templates/IEEEtran.lyx: minor change
10181 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10182 src/mathed/formula.C (LocalDispatch): askForText changes
10184 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10185 know when a user has cancelled input. Fixes annoying problems with
10186 inserting labels and version control.
10188 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10190 * src/support/lstrings.C (tostr): rewritten to use strstream and
10193 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10195 * src/support/filetools.C (IsFileWriteable): use fstream to check
10196 (IsDirWriteable): use fileinfo to check
10198 * src/support/filetools.h (FilePtr): whole class deleted
10200 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10202 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10204 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10206 * src/bufferlist.C (write): use ifstream and ofstream instead of
10209 * src/Spacing.h: use istrstream instead of sscanf
10211 * src/mathed/math_defs.h: change first arg to istream from FILE*
10213 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10215 * src/mathed/math_parser.C: have yyis to be an istream
10216 (LexGetArg): use istream (yyis)
10218 (mathed_parse): ditto
10219 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10221 * src/mathed/formula.C (Read): rewritten to use istream
10223 * src/mathed/formulamacro.C (Read): rewritten to use istream
10225 * src/lyxlex.h (~LyXLex): deleted desturctor
10226 (getStream): new function, returns an istream
10227 (getFile): deleted funtion
10228 (IsOK): return is.good();
10230 * src/lyxlex.C (LyXLex): delete file and owns_file
10231 (setFile): open an filebuf and assign that to a istream instead of
10233 (setStream): new function, takes an istream as arg.
10234 (setFile): deleted function
10235 (EatLine): rewritten us use istream instead of FILE*
10239 * src/table.C (LyXTable): use istream instead of FILE*
10240 (Read): rewritten to take an istream instead of FILE*
10242 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10244 * src/buffer.C (Dispatch): remove an extraneous break statement.
10246 * src/support/filetools.C (QuoteName): change to do simple
10247 'quoting'. More work is necessary. Also changed to do nothing
10248 under emx (needs fix too).
10249 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10251 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10252 config.h.in to the AC_DEFINE_UNQUOTED() call.
10253 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10254 needs char * as argument (because Solaris 7 declares it like
10257 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10258 remove definition of BZERO.
10260 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10262 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10263 defined, "lyxregex.h" if not.
10265 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10267 (REGEX): new variable that is set to regex.c lyxregex.h when
10268 AM_CONDITIONAL USE_REGEX is set.
10269 (libsupport_la_SOURCES): add $(REGEX)
10271 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10274 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10277 * configure.in: add call to LYX_REGEX
10279 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10280 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10282 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10284 * lib/bind/fi_menus.bind: new file, from
10285 pauli.virtanen@saunalahti.fi.
10287 * src/buffer.C (getBibkeyList): pass the parameter delim to
10288 InsetInclude::getKeys and InsetBibtex::getKeys.
10290 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10291 is passed to Buffer::getBibkeyList
10293 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10294 instead of the hardcoded comma.
10296 * src/insets/insetbib.C (getKeys): make sure that there are not
10297 leading blanks in bibtex keys. Normal latex does not care, but
10298 harvard.sty seems to dislike blanks at the beginning of citation
10299 keys. In particular, the retturn value of the function is
10301 * INSTALL: make it clear that libstdc++ is needed and that gcc
10302 2.7.x probably does not work.
10304 * src/support/filetools.C (findtexfile): make debug message go to
10306 * src/insets/insetbib.C (getKeys): ditto
10308 * src/debug.C (showTags): make sure that the output is correctly
10311 * configure.in: add a comment for TWO_COLOR_ICON define.
10313 * acconfig.h: remove all the entries that already defined in
10314 configure.in or acinclude.m4.
10316 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10317 to avoid user name, date and copyright.
10319 1999-12-21 Juergen Vigna <jug@sad.it>
10321 * src/table.C (Read): Now read bogus row format informations
10322 if the format is < 5 so that afterwards the table can
10323 be read by lyx but without any format-info. Fixed the
10324 crash we experienced when not doing this.
10326 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10328 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10329 (RedoDrawingOfParagraph): ditto
10330 (RedoParagraphs): ditto
10331 (RemoveTableRow): ditto
10333 * src/text.C (Fill): rename arg paperwidth -> paper_width
10335 * src/buffer.C (insertLyXFile): rename var filename -> fname
10336 (writeFile): rename arg filename -> fname
10337 (writeFileAscii): ditto
10338 (makeLaTeXFile): ditto
10339 (makeLinuxDocFile): ditto
10340 (makeDocBookFile): ditto
10342 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10345 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10347 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10350 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10351 compiled by a C compiler not C++.
10353 * src/layout.h (LyXTextClass): added typedef for const_iterator
10354 (LyXTextClassList): added typedef for const_iterator + member
10355 functions begin and end.
10357 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10358 iterators to fill the choice_class.
10359 (updateLayoutChoice): rewritten to use iterators to fill the
10360 layoutlist in the toolbar.
10362 * src/BufferView.h (BufferView::work_area_width): removed unused
10365 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10367 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10368 (sgmlCloseTag): ditto
10370 * src/support/lstrings.h: return type of countChar changed to
10373 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10374 what version of this func to use. Also made to return unsigned int.
10376 * configure.in: call LYX_STD_COUNT
10378 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10379 conforming std::count.
10381 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10383 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10384 and a subscript would give bad display (patch from Dekel Tsur
10385 <dekel@math.tau.ac.il>).
10387 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10389 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10392 * src/chset.h: add a few 'using' directives
10394 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10395 triggered when no buffer is active
10397 * src/layout.C: removed `break' after `return' in switch(), since
10400 * src/lyx_main.C (init): make sure LyX can be ran in place even
10401 when libtool has done its magic with shared libraries. Fix the
10402 test for the case when the system directory has not been found.
10404 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10405 name for the latex file.
10406 (MenuMakeHTML): ditto
10408 * src/buffer.h: add an optional boolean argument, which is passed
10409 to ChangeExtension.
10411 1999-12-20 Allan Rae <rae@lyx.org>
10413 * lib/templates/IEEEtran.lyx: small correction and update.
10415 * configure.in: Attempted to use LYX_PATH_HEADER
10417 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10419 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10420 input from JMarc. Now use preprocessor to find the header.
10421 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10422 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10423 LYX_STL_STRING_FWD. See comments in file.
10425 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10427 * The global MiniBuffer * minibuffer variable is dead.
10429 * The global FD_form_main * fd_form_main variable is dead.
10431 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10433 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10435 * src/table.h: add the LOstream.h header
10436 * src/debug.h: ditto
10438 * src/LyXAction.h: change the explaination of the ReadOnly
10439 attribute: is indicates that the function _can_ be used.
10441 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10444 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10446 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10452 * src/paragraph.C (GetWord): assert on pos>=0
10455 * src/support/lyxstring.C: condition the use of an invariant on
10457 * src/support/lyxstring.h: ditto
10459 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10460 Use LAssert.h instead of plain assert().
10462 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10464 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10465 * src/support/filetools.C: ditto
10467 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10470 * INSTALL: document the new configure flags
10472 * configure.in: suppress --with-debug; add --enable-assertions
10474 * acinclude.m4: various changes in alignment of help strings.
10476 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10478 * src/kbmap.C: commented out the use of the hash map in kb_map,
10479 beginning of movement to a stl::container.
10481 * several files: removed code that was not in effect when
10482 MOVE_TEXT was defined.
10484 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10485 for escaping should not be used. We can discuss if the string
10486 should be enclosed in f.ex. [] instead of "".
10488 * src/trans_mgr.C (insert): use the new returned value from
10489 encodeString to get deadkeys and keymaps done correctly.
10491 * src/chset.C (encodeString): changed to return a pair, to tell
10492 what to use if we know the string.
10494 * src/lyxscreen.h (fillArc): new function.
10496 * src/FontInfo.C (resize): rewritten to use more std::string like
10497 structore, especially string::replace.
10499 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10502 * configure.in (chmod +x some scripts): remove config/gcc-hack
10504 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10506 * src/buffer.C (writeFile): change once again the top comment in a
10507 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10508 instead of an hardcoded version number.
10509 (makeDocBookFile): ditto
10511 * src/version.h: add new define LYX_DOCVERSION
10513 * po/de.po: update from Pit Sütterlin
10514 * lib/bind/de_menus.bind: ditto.
10516 * src/lyxfunc.C (Dispatch): call MenuExport()
10517 * src/buffer.C (Dispatch): ditto
10519 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10520 LyXFunc::Dispatch().
10521 (MenuExport): new function, moved from
10522 LyXFunc::Dispatch().
10524 * src/trans_mgr.C (insert): small cleanup
10525 * src/chset.C (loadFile): ditto
10527 * lib/kbd/iso8859-1.cdef: add missing backslashes
10529 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10531 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10532 help with placing the manually drawn accents better.
10534 (Draw): x2 and hg changed to float to minimize rounding errors and
10535 help place the accents better.
10537 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10538 unsigned short to char is just wrong...cast the char to unsigned
10539 char instead so that the two values can compare sanely. This
10540 should also make the display of insetlatexaccents better and
10541 perhaps also some other insets.
10543 (lbearing): new function
10546 1999-12-15 Allan Rae <rae@lyx.org>
10548 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10549 header that provides a wrapper around the very annoying SGI STL header
10552 * src/support/lyxstring.C, src/LString.h:
10553 removed old SGI-STL-compatability attempts.
10555 * configure.in: Use LYX_STL_STRING_FWD.
10557 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10558 stl_string_fwd.h is around and try to determine it's location.
10559 Major improvement over previous SGI STL 3.2 compatability.
10560 Three small problems remain with this function due to my zero
10561 knowledge of autoconf. JMarc and lgb see the comments in the code.
10563 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10565 * src/broken_const.h, config/hack-gcc, config/README: removed
10567 * configure.in: remove --with-gcc-hack option; do not call
10570 * INSTALL: remove documentation of --with-broken-const and
10573 * acconfig.h: remove all trace of BROKEN_CONST define
10575 * src/buffer.C (makeDocBookFile): update version number in output
10577 (SimpleDocBookOnePar): fix an assert when trying to a character
10578 access beyond string length
10581 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10583 * po/de.po: fix the Export menu
10585 * lyx.man: update the description of -dbg
10587 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10588 (commandLineHelp): updated
10589 (easyParse): show list of available debug levels if -dbg is passed
10592 * src/Makefile.am: add debug.C
10594 * src/debug.h: moved some code to debug.C
10596 * src/debug.C: new file. Contains code to set and show debug
10599 * src/layout.C: remove 'break' after 'continue' in switch
10600 statements, since these cannot be reached.
10602 1999-12-13 Allan Rae <rae@lyx.org>
10604 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10605 (in_word_set): hash() -> math_hash()
10607 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10609 * acconfig.h: Added a test for whether we are using exceptions in the
10610 current compilation run. If so USING_EXCEPTIONS is defined.
10612 * config.in: Check for existance of stl_string_fwd.h
10613 * src/LString.h: If compiling --with-included-string and SGI's
10614 STL version 3.2 is present (see above test) we need to block their
10615 forward declaration of string and supply a __get_c_string().
10616 However, it turns out this is only necessary if compiling with
10617 exceptions enabled so I've a bit more to add yet.
10619 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10620 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10621 src/support/LRegex.h, src/undo.h:
10622 Shuffle the order of the included files a little to ensure that
10623 LString.h gets included before anything that includes stl_string_fwd.h
10625 * src/support/lyxstring.C: We need to #include LString.h instead of
10626 lyxstring.h to get the necessary definition of __get_c_string.
10627 (__get_c_string): New function. This is defined static just like SGI's
10628 although why they need to do this I'm not sure. Perhaps it should be
10629 in lstrings.C instead.
10631 * lib/templates/IEEEtran.lyx: New template file.
10633 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10635 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10636 * intl/Makefile.in (MKINSTALLDIRS): ditto
10638 * src/LyXAction.C (init): changed to hold the LFUN data in a
10639 automatic array in stead of in callso to newFunc, this speeds up
10640 compilation a lot. Also all the memory used by the array is
10641 returned when the init is completed.
10643 * a lot of files: compiled with -Wold-style-cast, changed most of
10644 the reported offenders to C++ style casts. Did not change the
10645 offenders in C files.
10647 * src/trans.h (Match): change argument type to unsigned int.
10649 * src/support/DebugStream.C: fix some types on the streambufs so
10650 that it works on a conforming implementation.
10652 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10654 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10656 * src/support/lyxstring.C: remove the inline added earlier since
10657 they cause a bunch of unsatisfied symbols when linking with dec
10658 cxx. Cxx likes to have the body of inlines at the place where they
10661 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10662 accessing negative bounds in array. This fixes the crash when
10663 inserting accented characters.
10664 * src/trans.h (Match): ditto
10666 * src/buffer.C (Dispatch): since this is a void, it should not try
10667 to return anything...
10669 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10671 * src/buffer.h: removed the two friends from Buffer. Some changes
10672 because of this. Buffer::getFileName and Buffer::setFileName
10673 renamed to Buffer::fileName() and Buffer::fileName(...).
10675 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10677 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10678 and Buffer::update(short) to BufferView. This move is currently
10679 controlled by a define MOVE_TEXT, this will be removed when all
10680 shows to be ok. This move paves the way for better separation
10681 between buffer contents and buffer view. One side effect is that
10682 the BufferView needs a rebreak when swiching buffers, if we want
10683 to avoid this we can add a cache that holds pointers to LyXText's
10684 that is not currently in use.
10686 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10689 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10691 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10693 * lyx_main.C: new command line option -x (or --execute) and
10694 -e (or --export). Now direct conversion from .lyx to .tex
10695 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10696 Unfortunately, X is still needed and the GUI pops up during the
10699 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10701 * src/Spacing.C: add a using directive to bring stream stuff into
10703 * src/paragraph.C: ditto
10704 * src/buffer.C: ditto
10706 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10707 from Lars' announcement).
10709 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10710 example files from Tino Meinen.
10712 1999-12-06 Allan Rae <rae@lyx.org>
10714 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10716 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10718 * src/support/lyxstring.C: added a lot of inline for no good
10721 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10722 latexWriteEndChanges, they were not used.
10724 * src/layout.h (operator<<): output operator for PageSides
10726 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10728 * some example files: loaded in LyX 1.0.4 and saved again to update
10729 certain constructs (table format)
10731 * a lot of files: did the change to use fstream/iostream for all
10732 writing of files. Done with a close look at Andre Poenitz's patch.
10734 * some files: whitespace changes.
10736 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10738 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10739 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10740 architecture, we provide our own. It is used unconditionnally, but
10741 I do not think this is a performance problem. Thanks to Angus
10742 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10743 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10745 (GetInset): use my_memcpy.
10749 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10750 it is easier to understand, but it uses less TeX-only constructs now.
10752 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10753 elements contain spaces
10755 * lib/configure: regenerated
10757 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10758 elements contain spaces; display the list of programs that are
10761 * autogen.sh: make sure lib/configure is executable
10763 * lib/examples/*: rename the tutorial examples to begin with the
10764 two-letters language code.
10766 * src/lyxfunc.C (getStatus): do not query current font if no
10769 * src/lyx_cb.C (RunScript): use QuoteName
10770 (MenuRunDvips): ditto
10771 (PrintApplyCB): ditto
10773 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10774 around argument, so that it works well with the current shell.
10775 Does not work properly with OS/2 shells currently.
10777 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10778 * src/LyXSendto.C (SendtoApplyCB): ditto
10779 * src/lyxfunc.C (Dispatch): ditto
10780 * src/buffer.C (runLaTeX): ditto
10781 (runLiterate): ditto
10782 (buildProgram): ditto
10784 * src/lyx_cb.C (RunScript): ditto
10785 (MenuMakeLaTeX): ditto
10787 * src/buffer.h (getLatexName): new method
10789 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10791 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10793 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10794 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10795 (create_math_panel): ditto
10797 * src/lyxfunc.C (getStatus): re-activate the code which gets
10798 current font and cursor; add test for export to html.
10800 * src/lyxrc.C (read): remove unreachable break statements; add a
10803 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10805 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10807 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10808 introduced by faulty regex.
10809 * src/buffer.C: ditto
10810 * src/lastfiles.C: ditto
10811 * src/paragraph.C: ditto
10812 * src/table.C: ditto
10813 * src/vspace.C: ditto
10814 * src/insets/figinset.C: ditto
10815 Note: most of these is absolutely harmless, except the one in
10816 src/mathed formula.C.
10818 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10820 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10821 operation, yielding correct results for the reLyX command.
10823 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10825 * src/support/filetools.C (ExpandPath): removed an over eager
10827 (ReplaceEnvironmentPath): ditto
10829 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10830 shows that we are doing something fishy in our code...
10831 (BubblePost): ditto
10834 * src/lyxrc.C (read): use a double switch trick to get more help
10835 from the compiler. (the same trick is used in layout.C)
10836 (write): new function. opens a ofstream and pass that to output
10837 (output): new function, takes a ostream and writes the lyxrc
10838 elemts to it. uses a dummy switch to make sure no elements are
10841 * src/lyxlex.h: added a struct pushpophelper for use in functions
10842 with more than one exit point.
10844 * src/lyxlex.[Ch] (GetInteger): made it const
10848 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10850 * src/layout.[hC] : LayoutTags splitted into several enums, new
10851 methods created, better error handling cleaner use of lyxlex. Read
10854 * src/bmtable.[Ch]: change some member prototypes because of the
10855 image const changes.
10857 * commandtags.h, src/LyXAction.C (init): new function:
10858 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10859 This file is not read automatically but you can add \input
10860 preferences to your lyxrc if you want to. We need to discuss how
10863 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10864 in .aux, also remove .bib and .bst files from dependencies when
10867 * src/BufferView.C, src/LyXView.C: add const_cast several places
10868 because of changes to images.
10870 * lib/images/*: same change as for images/*
10872 * lib/lyxrc.example: Default for accept_compound is false not no.
10874 * images/*: changed to be const, however I have som misgivings
10875 about this change so it might be changed back.
10877 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10879 * lib/configure, po/POTFILES.in: regenerated
10881 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10883 * config/lib_configure.m4: removed
10885 * lib/configure.m4: new file (was config/lib_configure.m4)
10887 * configure.in: do not test for rtti, since we do not use it.
10889 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10891 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10892 doubling of allocated space scheme. This makes it faster for large
10893 strings end to use less memory for small strings. xtra rememoved.
10895 * src/insets/figinset.C (waitalarm): commented out.
10896 (GhostscriptMsg): use static_cast
10897 (GhostscriptMsg): use new instead of malloc to allocate memory for
10898 cmap. also delete the memory after use.
10900 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10902 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10903 for changes in bibtex database or style.
10904 (runBibTeX): remove all .bib and .bst files from dep before we
10906 (run): use scanAuc in when dep file already exist.
10908 * src/DepTable.C (remove_files_with_extension): new method
10909 (exist): new method
10911 * src/DepTable.[Ch]: made many of the methods const.
10913 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10915 * src/bufferparams.C: make sure that the default textclass is
10916 "article". It used to be the first one by description order, but
10917 now the first one is "docbook".
10919 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10920 string; call Debug::value.
10921 (easyParse): pass complete argument to setDebuggingLevel().
10923 * src/debug.h (value): fix the code that parses debug levels.
10925 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10928 * src/LyXAction.C: use Debug::ACTION as debug channel.
10930 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10932 * NEWS: updated for the future 1.1.3 release.
10934 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10935 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10936 it should. This is of course a controversial change (since many
10937 people will find that their lyx workscreen is suddenly full of
10938 red), but done for the sake of correctness.
10940 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10941 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10943 * src/insets/inseterror.h, src/insets/inseturl.h,
10944 src/insets/insetinfo.h, src/insets/figinset.h,
10945 src/mathed/formulamacro.h, src/mathed/math_macro.h
10946 (EditMessage): add a missing const and add _() to make sure that
10947 translation happens
10949 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10950 src/insets/insetbib.C, src/support/filetools.C: add `using'
10951 directives for cxx.
10953 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10954 doing 'Insert index of last word' at the beginning of a paragraph.
10956 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10958 * several files: white-space changes.
10960 * src/mathed/formula.C: removed IsAlpha and IsDigit
10962 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10963 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10966 * src/insets/figinset.C (GetPSSizes): don't break when
10967 "EndComments" is seen. But break when a boundingbox is read.
10969 * all classes inherited from Inset: return value of Clone
10970 changed back to Inset *.
10972 * all classes inherited form MathInset: return value of Clone
10973 changed back to MathedInset *.
10975 * src/insets/figinset.C (runqueue): use a ofstream to output the
10976 gs/ps file. Might need some setpresicion or setw. However I can
10977 see no problem with the current code.
10978 (runqueue): use sleep instead of the alarm/signal code. I just
10979 can't see the difference.
10981 * src/paragraph.C (LyXParagraph): reserve space in the new
10982 paragraph and resize the inserted paragraph to just fit.
10984 * src/lyxfunc.h (operator|=): added operator for func_status.
10986 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10987 check for readable file.
10989 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10990 check for readable file.
10991 (MenuMakeLinuxDoc): ditto
10992 (MenuMakeDocBook): ditto
10993 (MenuMakeAscii): ditto
10994 (InsertAsciiFile): split the test for openable and readable
10996 * src/bmtable.C (draw_bitmaptable): use
10997 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10999 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11000 findtexfile from LaTeX to filetools.
11002 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11003 instead of FilePtr. Needs to be verified by a literate user.
11005 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11007 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11008 (EditMessage): likewise.
11010 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11011 respectively as \textasciitilde and \textasciicircum.
11013 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11015 * src/support/lyxstring.h: made the methods that take iterators
11016 use const_iterator.
11018 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11019 (regexMatch): made is use the real regex class.
11021 * src/support/Makefile.am: changed to use libtool
11023 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11025 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11027 (MathIsInset ++): changed several macros to be inline functions
11030 * src/mathed/Makefile.am: changed to use libtool
11032 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11034 * src/insets/inset* : Clone changed to const and return type is
11035 the true insettype not just Inset*.
11037 * src/insets/Makefile.am: changed to use libtool
11039 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11041 * src/undo.[Ch] : added empty() and changed some of the method
11044 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11046 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11047 setID use block<> for the bullets array, added const several places.
11049 * src/lyxfunc.C (getStatus): new function
11051 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11052 LyXAction, added const to several funtions.
11054 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11055 a std::map, and to store the dir items in a vector.
11057 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11060 * src/LyXView.[Ch] + other files : changed currentView to view.
11062 * src/LyXAction.[Ch] : ported from the old devel branch.
11064 * src/.cvsignore: added .libs and a.out
11066 * configure.in : changes to use libtool.
11068 * acinclude.m4 : inserted libtool.m4
11070 * .cvsignore: added libtool
11072 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11074 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11075 file name in insets and mathed directories (otherwise the
11076 dependency is not taken in account under cygwin).
11078 * src/text2.C (InsertString[AB]): make sure that we do not try to
11079 read characters past the string length.
11081 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11083 * lib/doc/LaTeXConfig.lyx.in,
11084 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11086 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11087 file saying who created them and when this heppened; this is
11088 useless and annoys tools like cvs.
11090 * lib/layouts/g-brief-{en,de}.layout,
11091 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11092 from Thomas Hartkens <thomas@hartkens.de>.
11094 * src/{insets,mathed}/Makefile.am: do not declare an empty
11095 LDFLAGS, so that it can be set at configure time (useful on Irix
11098 * lib/reLyX/configure.in: make sure that the prefix is set
11099 correctly in LYX_DIR.
11101 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11103 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11104 be used by 'command-sequence' this allows to bind a key to a
11105 sequence of LyX-commands
11106 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11108 * src/LyXAction.C: add "command-sequence"
11110 * src/LyXFunction.C: handling of "command-sequence"
11112 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11113 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11115 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11117 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11119 * src/buffer.C (writeFile): Do not output a comment giving user
11120 and date at the beginning of a .lyx file. This is useless and
11121 annoys cvs anyway; update version number to 1.1.
11123 * src/Makefile.am (LYX_DIR): add this definition, so that a
11124 default path is hardcoded in LyX.
11126 * configure.in: Use LYX_GNU_GETTEXT.
11128 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11129 AM_GNU_GETTEXT with a bug fixed.
11131 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11133 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11135 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11136 which is used to point to LyX data is now LYX_DIR_11x.
11138 * lyx.man: convert to a unix text file; small updates.
11140 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11142 * src/support/LSubstring.[Ch]: made the second arg of most of the
11143 constructors be a const reference.
11145 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11148 * src/support/lyxstring.[Ch] (swap): added missing member function
11149 and specialization of swap(str, str);
11151 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11153 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11154 trace of the old one.
11156 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11157 put the member definitions in undo.C.
11159 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11160 NEW_TEXT and have now only code that was included when this was
11163 * src/intl.C (LCombo): use static_cast
11165 (DispatchCallback): ditto
11167 * src/definitions.h: removed whole file
11169 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11171 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11172 parsing and stores in a std:map. a regex defines the file format.
11173 removed unneeded members.
11175 * src/bufferparams.h: added several enums from definitions.h here.
11176 Removed unsused destructor. Changed some types to use proper enum
11177 types. use block to have the temp_bullets and user_defined_bullets
11178 and to make the whole class assignable.
11180 * src/bufferparams.C (Copy): removed this functions, use a default
11181 assignment instead.
11183 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11186 * src/buffer.C (readLyXformat2): commend out all that have with
11187 oldpapersize to do. also comment out all that hve to do with
11188 insetlatex and insetlatexdel.
11189 (setOldPaperStuff): commented out
11191 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11193 * src/LyXAction.C: remove use of inset-latex-insert
11195 * src/mathed/math_panel.C (button_cb): use static_cast
11197 * src/insets/Makefile.am (insets_o_SOURCES): removed
11200 * src/support/lyxstring.C (helper): use the unsigned long
11201 specifier, UL, instead of a static_cast.
11203 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11205 * src/support/block.h: new file. to be used as a c-style array in
11206 classes, so that the class can be assignable.
11208 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11210 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11211 NULL, make sure to return an empty string (it is not possible to
11212 set a string to NULL).
11214 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11216 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11218 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11220 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11221 link line, so that Irix users (for example) can set it explicitely to
11224 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11225 it can be overidden at make time (static or dynamic link, for
11228 * src/vc-backend.C, src/LaTeXFeatures.h,
11229 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11230 statements to bring templates to global namespace.
11232 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11234 * src/support/lyxstring.C (operator[] const): make it standard
11237 * src/minibuffer.C (Init): changed to reflect that more
11238 information is given from the lyxvc and need not be provided here.
11240 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11242 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11244 * src/LyXView.C (UpdateTimerCB): use static_cast
11245 (KeyPressMask_raw_callback): ditto
11247 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11248 buffer_, a lot of changes because of this. currentBuffer() ->
11249 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11250 also changes to other files because of this.
11252 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11254 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11255 have no support for RCS and partial support for CVS, will be
11258 * src/insets/ several files: changes because of function name
11259 changes in Bufferview and LyXView.
11261 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11263 * src/support/LSubstring.[Ch]: new files. These implement a
11264 Substring that can be very convenient to use. i.e. is this
11266 string a = "Mary had a little sheep";
11267 Substring(a, "sheep") = "lamb";
11268 a is now "Mary has a little lamb".
11270 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11271 out patterns and subpatterns of strings. It is used by LSubstring
11272 and also by vc-backend.C
11274 * src/support/lyxstring.C: went over all the assertions used and
11275 tried to correct the wrong ones and flag which of them is required
11276 by the standard. some bugs found because of this. Also removed a
11277 couple of assertions.
11279 * src/support/Makefile.am (libsupport_a_SOURCES): added
11280 LSubstring.[Ch] and LRegex.[Ch]
11282 * src/support/FileInfo.h: have struct stat buf as an object and
11283 not a pointer to one, some changes because of this.
11285 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11286 information in layout when adding the layouts preamble to the
11287 textclass preamble.
11289 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11292 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11293 because of bug in OS/2.
11295 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11297 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11298 \verbatim@font instead of \ttfamily, so that it can be redefined.
11300 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11301 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11302 src/layout.h, src/text2.C: add 'using' directive to bring the
11303 STL templates we need from the std:: namespace to the global one.
11304 Needed by DEC cxx in strict ansi mode.
11306 * src/support/LIstream.h,src/support/LOstream.h,
11307 src/support/lyxstring.h,src/table.h,
11308 src/lyxlookup.h: do not include <config.h> in header
11309 files. This should be done in the .C files only.
11311 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11315 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11317 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11318 from Kayvan to fix the tth invokation.
11320 * development/lyx.spec.in: updates from Kayvan to reflect the
11321 changes of file names.
11323 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11325 * src/text2.C (InsertStringB): use std::copy
11326 (InsertStringA): use std::copy
11328 * src/bufferlist.C: use a vector to store the buffers in. This is
11329 an internal change and should not affect any other thing.
11331 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11334 * src/text.C (Fill): fix potential bug, one off bug.
11336 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11338 * src/Makefile.am (lyx_main.o): add more files it depends on.
11340 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11342 * src/support/lyxstring.C: use size_t for the reference count,
11343 size, reserved memory and xtra.
11344 (internal_compare): new private member function. Now the compare
11345 functions should work for std::strings that have embedded '\0'
11347 (compare): all compare functions rewritten to use
11350 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11352 * src/support/lyxstring.C (compare): pass c_str()
11353 (compare): pass c_str
11354 (compare): pass c_str
11356 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11358 * src/support/DebugStream.C: <config.h> was not included correctly.
11360 * lib/configure: forgot to re-generate it :( I'll make this file
11361 auto generated soon.
11363 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11365 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11368 * src/support/lyxstring.C: some changes from length() to rep->sz.
11369 avoids a function call.
11371 * src/support/filetools.C (SpaceLess): yet another version of the
11372 algorithm...now per Jean-Marc's suggestions.
11374 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11376 * src/layout.C (less_textclass_desc): functor for use in sorting
11378 (LyXTextClass::Read): sort the textclasses after reading.
11380 * src/support/filetools.C (SpaceLess): new version of the
11381 SpaceLess functions. What problems does this one give? Please
11384 * images/banner_bw.xbm: made the arrays unsigned char *
11386 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11388 * src/support/lyxstring.C (find): remove bogus assertion in the
11389 two versions of find where this has not been done yet.
11391 * src/support/lyxlib.h: add missing int return type to
11394 * src/menus.C (ShowFileMenu): disable exporting to html if no
11395 html export command is present.
11397 * config/lib_configure.m4: add a test for an HTML converter. The
11398 programs checked for are, in this order: tth, latex2html and
11401 * lib/configure: generated from config/lib_configure.m4.
11403 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11404 html converter. The parameters are now passed through $$FName and
11405 $$OutName, instead of standard input/output.
11407 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11409 * lib/lyxrc.example: update description of \html_command.
11410 add "quotes" around \screen_font_xxx font setting examples to help
11411 people who use fonts with spaces in their names.
11413 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11415 * Distribution files: updates for v1.1.2
11417 * src/support/lyxstring.C (find): remove bogus assert and return
11418 npos for the same condition.
11420 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11422 * added patch for OS/2 from SMiyata.
11424 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11426 * src/text2.C (CutSelection): make space_wrapped a bool
11427 (CutSelection): dont declare int i until we have to.
11428 (alphaCounter): return a char const *.
11430 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11432 * src/support/syscall.C (Systemcalls::kill):
11433 src/support/filetools.C (PutEnv, PutEnvPath):
11434 src/lyx_cb.C (addNewlineAndDepth):
11435 src/FontInfo.C (FontInfo::resize): condition some #warning
11436 directives with WITH_WARNINGS.
11439 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11441 * src/layout.[Ch] + several files: access to class variables
11442 limited and made accessor functions instead a lot of code changed
11443 becuase of this. Also instead of returning pointers often a const
11444 reference is returned instead.
11446 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11448 * src/Makefile.am (dist-hook): added used to remove the CVS from
11449 cheaders upon creating a dist
11450 (EXTRA_DIST): added cheaders
11452 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11453 a character not as a small integer.
11455 * src/support/lyxstring.C (find): removed Assert and added i >=
11456 rep->sz to the first if.
11458 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11460 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11461 src/LyXView.C src/buffer.C src/bufferparams.C
11462 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11463 src/text2.C src/insets/insetinclude.C:
11464 lyxlayout renamed to textclasslist.
11466 * src/layout.C: some lyxerr changes.
11468 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11469 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11470 (LyXLayoutList): removed all traces of this class.
11471 (LyXTextClass::Read): rewrote LT_STYLE
11472 (LyXTextClass::hasLayout): new function
11473 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11474 both const and nonconst version.
11475 (LyXTextClass::delete_layout): new function.
11476 (LyXTextClassList::Style): bug fix. do the right thing if layout
11478 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11479 (LyXTextClassList::NameOfLayout): ditto
11480 (LyXTextClassList::Load): ditto
11482 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11484 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11486 * src/LyXAction.C (LookupFunc): added a workaround for sun
11487 compiler, on the other hand...we don't know if the current code
11488 compiles on sun at all...
11490 * src/support/filetools.C (CleanupPath): subst fix
11492 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11495 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11496 complained about this one?
11498 * src/insets/insetinclude.C (Latex): subst fix
11500 * src/insets/insetbib.C (getKeys): subst fix
11502 * src/LyXSendto.C (SendtoApplyCB): subst fix
11504 * src/lyx_main.C (init): subst fix
11506 * src/layout.C (Read): subst fix
11508 * src/lyx_sendfax_main.C (button_send): subst fix
11510 * src/buffer.C (RoffAsciiTable): subst fix
11512 * src/lyx_cb.C (MenuFax): subst fix
11513 (PrintApplyCB): subst fix
11515 1999-10-26 Juergen Vigna <jug@sad.it>
11517 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11519 (Read): Cleaned up this code so now we read only format vestion >= 5
11521 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11523 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11524 come nobody has complained about this one?
11526 * src/insets/insetinclude.C (Latex): subst fix
11528 * src/insets/insetbib.C (getKeys): subst fix
11530 * src/lyx_main.C (init): subst fix
11532 * src/layout.C (Read): subst fix
11534 * src/buffer.C (RoffAsciiTable): subst fix
11536 * src/lyx_cb.C (MenuFax): subst fix.
11538 * src/layout.[hC] + some other files: rewrote to use
11539 std::container to store textclasses and layouts in.
11540 Simplified, removed a lot of code. Make all classes
11541 assignable. Further simplifications and review of type
11542 use still to be one.
11544 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11545 lastfiles to create the lastfiles partr of the menu.
11547 * src/lastfiles.[Ch]: rewritten to use deque to store the
11548 lastfiles in. Uses fstream for reading and writing. Simplifies
11551 * src/support/syscall.C: remove explicit cast.
11553 * src/BufferView.C (CursorToggleCB): removed code snippets that
11554 were commented out.
11555 use explicat C++ style casts instead of C style casts. also use
11556 u_vdata instea of passing pointers in longs.
11558 * src/PaperLayout.C: removed code snippets that were commented out.
11560 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11562 * src/lyx_main.C: removed code snippets that wer commented out.
11564 * src/paragraph.C: removed code snippets that were commented out.
11566 * src/lyxvc.C (logClose): use static_cast
11568 (viewLog): remove explicit cast to void*
11569 (showLog): removed old commented code
11571 * src/menus.C: use static_cast instead of C style casts. use
11572 u_vdata instead of u_ldata. remove explicit cast to (long) for
11573 pointers. Removed old code that was commented out.
11575 * src/insets/inset.C: removed old commented func
11577 * src/insets/insetref.C (InsetRef): removed old code that had been
11578 commented out for a long time.
11580 (escape): removed C style cast
11582 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11584 * src/insets/insetlatex.C (Draw): removed old commented code
11585 (Read): rewritten to use string
11587 * src/insets/insetlabel.C (escape): removed C style cast
11589 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11591 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11592 old commented code.
11594 * src/insets/insetinclude.h: removed a couple of stupid bools
11596 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11597 (Clone): remove C style cast
11598 (getKeys): changed list to lst because of std::list
11600 * src/insets/inseterror.C (Draw): removed som old commented code.
11602 * src/insets/insetcommand.C (Draw): removed some old commented code.
11604 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11605 commented out forever.
11606 (bibitem_cb): use static_cast instead of C style cast
11607 use of vdata changed to u_vdata.
11609 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11611 (CloseUrlCB): use static_cast instead of C style cast.
11612 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11614 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11615 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11616 (CloseInfoCB): static_cast from ob->u_vdata instead.
11617 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11620 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11621 (C_InsetError_CloseErrorCB): forward the ob parameter
11622 (CloseErrorCB): static_cast from ob->u_vdata instead.
11624 * src/vspace.h: include LString.h since we use string in this class.
11626 * src/vspace.C (lyx_advance): changed name from advance because of
11627 nameclash with stl. And since we cannot use namespaces yet...I
11628 used a lyx_ prefix instead. Expect this to change when we begin
11631 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11633 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11634 and removed now defunct constructor and deconstructor.
11636 * src/BufferView.h: have backstack as a object not as a pointer.
11637 removed initialization from constructor. added include for BackStack
11639 * development/lyx.spec.in (%build): add CFLAGS also.
11641 * src/screen.C (drawFrame): removed another warning.
11643 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11645 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11646 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11647 README and ANNOUNCE a bit for the next release. More work is
11650 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11651 unbreakable if we are in freespacing mode (LyX-Code), but not in
11654 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11656 * src/BackStack.h: fixed initialization order in constructor
11658 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11660 * acinclude.m4 (VERSION): new rules for when a version is
11661 development, added also a variable for prerelease.
11662 (warnings): we set with_warnings=yes for prereleases
11663 (lyx_opt): prereleases compile with same optimization as development
11664 (CXXFLAGS): only use pedantic if we are a development version
11666 * src/BufferView.C (restorePosition): don't do anything if the
11667 backstack is empty.
11669 * src/BackStack.h: added member empty, use this to test if there
11670 is anything to pop...
11672 1999-10-25 Juergen Vigna <jug@sad.it>
11675 * forms/layout_forms.fd +
11676 * forms/latexoptions.fd +
11677 * lyx.fd: changed for various form resize issues
11679 * src/mathed/math_panel.C +
11680 * src/insets/inseterror.C +
11681 * src/insets/insetinfo.C +
11682 * src/insets/inseturl.C +
11683 * src/insets/inseturl.h +
11685 * src/LyXSendto.C +
11686 * src/PaperLayout.C +
11687 * src/ParagraphExtra.C +
11688 * src/TableLayout.C +
11690 * src/layout_forms.C +
11697 * src/menus.C: fixed various resize issues. So now forms can be
11698 resized savely or not be resized at all.
11700 * forms/form_url.fd +
11701 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11704 * src/insets/Makefile.am: added files form_url.[Ch]
11706 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11708 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11709 (and presumably 6.2).
11711 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11712 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11713 remaining static member callbacks.
11715 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11718 * src/support/lyxstring.h: declare struct Srep as friend of
11719 lyxstring, since DEC cxx complains otherwise.
11721 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11723 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11725 * src/LaTeX.C (run): made run_bibtex also depend on files with
11727 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11728 are put into the dependency file.
11730 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11731 the code has shown itself to work
11732 (create_ispell_pipe): removed another warning, added a comment
11735 * src/minibuffer.C (ExecutingCB): removed code that has been
11736 commented out a long time
11738 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11739 out code + a warning.
11741 * src/support/lyxstring.h: comment out the three private
11742 operators, when compiling with string ansi conforming compilers
11743 they make problems.
11745 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11747 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11748 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11751 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11754 * src/mathed/math_panel.C (create_math_panel): remove explicit
11757 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11760 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11761 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11762 to XCreatePixmapFromBitmapData
11763 (fl_set_bmtable_data): change the last argument to be unsigned
11765 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11766 and bh to be unsigned int, remove explicit casts in call to
11767 XReadBitmapFileData.
11769 * images/arrows.xbm: made the arrays unsigned char *
11770 * images/varsz.xbm: ditto
11771 * images/misc.xbm: ditto
11772 * images/greek.xbm: ditto
11773 * images/dots.xbm: ditto
11774 * images/brel.xbm: ditto
11775 * images/bop.xbm: ditto
11777 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11779 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11780 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11781 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11783 (LYX_CXX_CHEADERS): added <clocale> to the test.
11785 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11787 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11789 * src/support/lyxstring.C (append): fixed something that must be a
11790 bug, rep->assign was used instead of rep->append.
11792 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11795 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11796 lyx insert double chars. Fix spotted by Kayvan.
11798 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11800 * Fixed the tth support. I messed up with the Emacs patch apply feature
11801 and omitted the changes in lyxrc.C.
11803 1999-10-22 Juergen Vigna <jug@sad.it>
11805 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11807 * src/lyx_cb.C (MenuInsertRef) +
11808 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11809 the form cannot be resized under it limits (fixes a segfault)
11811 * src/lyx.C (create_form_form_ref) +
11812 * forms/lyx.fd: Changed Gravity on name input field so that it is
11815 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11817 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11818 <ostream> and <istream>.
11820 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11821 whether <fstream> provides the latest standard features, or if we
11822 have an oldstyle library (like in egcs).
11823 (LYX_CXX_STL_STRING): fix the test.
11825 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11826 code on MODERN_STL_STREAM.
11828 * src/support/lyxstring.h: use L{I,O}stream.h.
11830 * src/support/L{I,O}stream.h: new files, designed to setup
11831 correctly streams for our use
11832 - includes the right header depending on STL capabilities
11833 - puts std::ostream and std::endl (for LOStream.h) or
11834 std::istream (LIStream.h) in toplevel namespace.
11836 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11838 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11839 was a bib file that had been changed we ensure that bibtex is run.
11840 (runBibTeX): enhanced to extract the names of the bib files and
11841 getting their absolute path and enter them into the dep file.
11842 (findtexfile): static func that is used to look for tex-files,
11843 checks for absolute patchs and tries also with kpsewhich.
11844 Alternative ways of finding the correct files are wanted. Will
11846 (do_popen): function that runs a command using popen and returns
11847 the whole output of that command in a string. Should be moved to
11850 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11851 file with extension ext has changed.
11853 * src/insets/figinset.C: added ifdef guards around the fl_free
11854 code that jug commented out. Now it is commented out when
11855 compiling with XForms == 0.89.
11857 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11858 to lyxstring.C, and only keep a forward declaration in
11859 lyxstring.h. Simplifies the header file a bit and should help a
11860 bit on compile time too. Also changes to Srep will not mandate a
11861 recompile of code just using string.
11862 (~lyxstring): definition moved here since it uses srep.
11863 (size): definition moved here since it uses srep.
11865 * src/support/lyxstring.h: removed a couple of "inline" that should
11868 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11870 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11873 1999-10-21 Juergen Vigna <jug@sad.it>
11875 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11876 set to left if I just remove the width entry (or it is empty).
11878 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11879 paragraph when having dummy paragraphs.
11881 1999-10-20 Juergen Vigna <jug@sad.it>
11883 * src/insets/figinset.C: just commented some fl_free_form calls
11884 and added warnings so that this calls should be activated later
11885 again. This avoids for now a segfault, but we have a memory leak!
11887 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11888 'const char * argument' to 'string argument', this should
11889 fix some Asserts() in lyxstring.C.
11891 * src/lyxfunc.h: Removed the function argAsString(const char *)
11892 as it is not used anymore.
11894 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11896 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11899 * src/Literate.h: some funcs moved from public to private to make
11900 interface clearer. Unneeded args removed.
11902 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11904 (scanBuildLogFile): ditto
11906 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11907 normal TeX Error. Still room for improvement.
11909 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11911 * src/buffer.C (insertErrors): changes to make the error
11912 desctription show properly.
11914 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11917 * src/support/lyxstring.C (helper): changed to use
11918 sizeof(object->rep->ref).
11919 (operator>>): changed to use a pointer instead.
11921 * src/support/lyxstring.h: changed const reference & to value_type
11922 const & lets see if that helps.
11924 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11926 * Makefile.am (rpmdist): fixed to have non static package and
11929 * src/support/lyxstring.C: removed the compilation guards
11931 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11934 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11935 conditional compile of lyxstring.Ch
11937 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11938 stupid check, but it is a lot better than the bastring hack.
11939 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11941 * several files: changed string::erase into string::clear. Not
11944 * src/chset.C (encodeString): use a char temporary instead
11946 * src/table.C (TexEndOfCell): added tostr around
11947 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11948 (TexEndOfCell): ditto
11949 (TexEndOfCell): ditto
11950 (TexEndOfCell): ditto
11951 (DocBookEndOfCell): ditto
11952 (DocBookEndOfCell): ditto
11953 (DocBookEndOfCell): ditto
11954 (DocBookEndOfCell): ditto
11956 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11958 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11960 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11961 (MenuBuildProg): added tostr around ret
11962 (MenuRunChktex): added tostr around ret
11963 (DocumentApplyCB): added tostr around ret
11965 * src/chset.C (encodeString): added tostr around t->ic
11967 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11968 (makeLaTeXFile): added tostr around tocdepth
11969 (makeLaTeXFile): added tostr around ftcound - 1
11971 * src/insets/insetbib.C (setCounter): added tostr around counter.
11973 * src/support/lyxstring.h: added an operator+=(int) to catch more
11976 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11977 (lyxstring): We DON'T allow NULL pointers.
11979 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11981 * src/mathed/math_macro.C (MathMacroArgument::Write,
11982 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11983 when writing them out.
11985 * src/LString.C: remove, since it is not used anymore.
11987 * src/support/lyxstring.C: condition the content to
11988 USE_INCLUDED_STRING macro.
11990 * src/mathed/math_symbols.C, src/support/lstrings.C,
11991 src/support/lyxstring.C: add `using' directive to specify what
11992 we need in <algorithm>. I do not think that we need to
11993 conditionalize this, but any thought is appreciated.
11995 * many files: change all callback functions to "C" linkage
11996 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11997 strict_ansi. Those who were static are now global.
11998 The case of callbacks which are static class members is
11999 trickier, since we have to make C wrappers around them (see
12000 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12001 did not finish this yet, since it defeats the purpose of
12002 encapsulation, and I am not sure what the best route is.
12004 1999-10-19 Juergen Vigna <jug@sad.it>
12006 * src/support/lyxstring.C (lyxstring): we permit to have a null
12007 pointer as assignment value and just don't assign it.
12009 * src/vspace.C (nextToken): corrected this function substituting
12010 find_first(_not)_of with find_last_of.
12012 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12013 (TableOptCloseCB) (TableSpeCloseCB):
12014 inserted fl_set_focus call for problem with fl_hide_form() in
12017 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12019 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12022 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12024 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12025 LyXLex::next() and not eatline() to get its argument.
12027 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12029 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12030 instead, use fstreams for io of the depfile, removed unneeded
12031 functions and variables.
12033 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12034 vector instead, removed all functions and variables that is not in
12037 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12039 * src/buffer.C (insertErrors): use new interface to TeXError
12041 * Makefile.am (rpmdist): added a rpmdist target
12043 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12044 per Kayvan's instructions.
12046 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12048 * src/Makefile.am: add a definition for localedir, so that locales
12049 are found after installation (Kayvan)
12051 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12053 * development/.cvsignore: new file.
12055 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12057 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12058 C++ compiler provides wrappers for C headers and use our alternate
12061 * configure.in: use LYX_CXX_CHEADERS.
12063 * src/cheader/: new directory, populated with cname headers from
12064 libstdc++-2.8.1. They are a bit old, but probably good enough for
12065 what we want (support compilers who lack them).
12067 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12068 from includes. It turns out is was stupid.
12070 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12072 * lib/Makefile.am (install-data-local): forgot a ';'
12073 (install-data-local): forgot a '\'
12074 (libinstalldirs): needed after all. reintroduced.
12076 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12078 * configure.in (AC_OUTPUT): added lyx.spec
12080 * development/lyx.spec: removed file
12082 * development/lyx.spec.in: new file
12084 * po/*.po: merged with lyx.pot becuase of make distcheck
12086 * lib/Makefile.am (dist-hook): added dist-hook so that
12087 documentation files will be included when doing a make
12088 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12089 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12091 more: tried to make install do the right thing, exclude CVS dirs
12094 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12095 Path would fit in more nicely.
12097 * all files that used to use pathstack: uses now Path instead.
12098 This change was a lot easier than expected.
12100 * src/support/path.h: new file
12102 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12104 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12106 * src/support/lyxstring.C (getline): Default arg was given for
12109 * Configure.cmd: removed file
12111 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12113 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12114 streams classes and types, add the proper 'using' statements when
12115 MODERN_STL is defined.
12117 * src/debug.h: move the << operator definition after the inclusion
12120 * src/support/filetools.C: include "LAssert.h", which is needed
12123 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12126 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12127 include "debug.h" to define a proper ostream.
12129 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12131 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12132 method to the SystemCall class which can kill a process, but it's
12133 not fully implemented yet.
12135 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12137 * src/support/FileInfo.h: Better documentation
12139 * src/lyxfunc.C: Added support for buffer-export html
12141 * src/menus.C: Added Export->As HTML...
12143 * lib/bind/*.bind: Added short-cut for buffer-export html
12145 * src/lyxrc.*: Added support for new \tth_command
12147 * lib/lyxrc.example: Added stuff for new \tth_command
12149 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12151 * lib/Makefile.am (IMAGES): removed images/README
12152 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12153 installes in correct place. Check permisions is installed
12156 * src/LaTeX.C: some no-op changes moved declaration of some
12159 * src/LaTeX.h (LATEX_H): changed include guard name
12161 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12163 * lib/reLyX/Makefile.am: install noweb2lyx.
12165 * lib/Makefile.am: install configure.
12167 * lib/reLyX/configure.in: declare a config aux dir; set package
12168 name to lyx (not sure what the best solution is); generate noweb2lyx.
12170 * lib/layouts/egs.layout: fix the bibliography layout.
12172 1999-10-08 Jürgen Vigna <jug@sad.it>
12174 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12175 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12176 it returned without continuing to search the path.
12178 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12180 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12181 also fixes a bug. It is not allowed to do tricks with std::strings
12182 like: string a("hei"); &a[e]; this will not give what you
12183 think... Any reason for the complexity in this func?
12185 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12187 * Updated README and INSTALL a bit, mostly to check that my
12188 CVS rights are correctly set up.
12190 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12192 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12193 does not allow '\0' chars but lyxstring and std::string does.
12195 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12197 * autogen.sh (AUTOCONF): let the autogen script create the
12198 POTFILES.in file too. POTFILES.in should perhaps now not be
12199 included in the cvs module.
12201 * some more files changed to use C++ includes instead of C ones.
12203 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12205 (Reread): added tostr to nlink. buggy output otherwise.
12206 (Reread): added a string() around szMode when assigning to Buffer,
12207 without this I got a log of garbled info strings.
12209 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12212 * I have added several ostream & operator<<(ostream &, some_type)
12213 functions. This has been done to avoid casting and warnings when
12214 outputting enums to lyxerr. This as thus eliminated a lot of
12215 explicit casts and has made the code clearer. Among the enums
12216 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12217 mathed enums, some font enum the Debug::type enum.
12219 * src/support/lyxstring.h (clear): missing method. equivalent of
12222 * all files that contained "stderr": rewrote constructs that used
12223 stderr to use lyxerr instead. (except bmtable)
12225 * src/support/DebugStream.h (level): and the passed t with
12226 Debug::ANY to avoid spurious bits set.
12228 * src/debug.h (Debug::type value): made it accept strings of the
12229 type INFO,INIT,KEY.
12231 * configure.in (Check for programs): Added a check for kpsewhich,
12232 the latex generation will use this later to better the dicovery of
12235 * src/BufferView.C (create_view): we don't need to cast this to
12236 (void*) that is done automatically.
12237 (WorkAreaButtonPress): removed some dead code.
12239 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12241 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12242 is not overwritten when translated (David Sua'rez de Lis).
12244 * lib/CREDITS: Added David Sua'rez de Lis
12246 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12248 * src/bufferparams.C (BufferParams): default input encoding is now
12251 * acinclude.m4 (cross_compiling): comment out macro
12252 LYX_GXX_STRENGTH_REDUCE.
12254 * acconfig.h: make sure that const is not defined (to empty) when
12255 we are compiling C++. Remove commented out code using SIZEOF_xx
12258 * configure.in : move the test for const and inline as late as
12259 possible so that these C tests do not interefere with C++ ones.
12260 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12261 has not been proven.
12263 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12265 * src/table.C (getDocBookAlign): remove bad default value for
12266 isColumn parameter.
12268 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12270 (ShowFileMenu2): ditto.
12272 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12273 of files to ignore.
12275 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12277 * Most files: finished the change from the old error code to use
12278 DebugStream for all lyxerr debugging. Only minor changes remain
12279 (e.g. the setting of debug levels using strings instead of number)
12281 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12283 * src/layout.C (Add): Changed to use compare_no_case instead of
12286 * src/FontInfo.C: changed loop variable type too string::size_type.
12288 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12290 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12291 set ETAGS_ARGS to --c++
12293 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12295 * src/table.C (DocBookEndOfCell): commented out two unused variables
12297 * src/paragraph.C: commented out four unused variables.
12299 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12300 insed a if clause with type string::size_type.
12302 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12305 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12307 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12308 variable, also changed loop to go from 0 to lenght + 1, instead of
12309 -1 to length. This should be correct.
12311 * src/LaTeX.C (scanError): use string::size_type as loop variable
12314 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12315 (l.896) since y_tmp and row was not used anyway.
12317 * src/insets/insetref.C (escape): use string::size_type as loop
12320 * src/insets/insetquotes.C (Width): use string::size_type as loop
12322 (Draw): use string::size_type as loop variable type.
12324 * src/insets/insetlatexaccent.C (checkContents): use
12325 string::size_type as loop variable type.
12327 * src/insets/insetlabel.C (escape): use string::size_type as loop
12330 * src/insets/insetinfo.C: added an extern for current_view.
12332 * src/insets/insetcommand.C (scanCommand): use string::size_type
12333 as loop variable type.
12335 * most files: removed the RCS tags. With them we had to recompile
12336 a lot of files after a simple cvs commit. Also we have never used
12337 them for anything meaningful.
12339 * most files: tags-query-replace NULL 0. As adviced several plases
12340 we now use "0" instead of "NULL" in our code.
12342 * src/support/filetools.C (SpaceLess): use string::size_type as
12343 loop variable type.
12345 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12347 * src/paragraph.C: fixed up some more string stuff.
12349 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12351 * src/support/filetools.h: make modestr a std::string.
12353 * src/filetools.C (GetEnv): made ch really const.
12355 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12356 made code that used these use max/min from <algorithm> instead.
12358 * changed several c library include files to their equivalent c++
12359 library include files. All is not changed yet.
12361 * created a support subdir in src, put lyxstring and lstrings
12362 there + the extra files atexit, fileblock, strerror. Created
12363 Makefile.am. edited configure.in and src/Makefile.am to use this
12364 new subdir. More files moved to support.
12366 * imported som of the functions from repository lyx, filetools
12368 * ran tags-query-replace on LString -> string, corrected the bogus
12369 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12370 is still some errors in there. This is errors where too much or
12371 too litle get deleted from strings (string::erase, string::substr,
12372 string::replace), there can also be some off by one errors, or
12373 just plain wrong use of functions from lstrings. Viewing of quotes
12376 * LyX is now running fairly well with string, but there are
12377 certainly some bugs yet (see above) also string is quite different
12378 from LString among others in that it does not allow null pointers
12379 passed in and will abort if it gets any.
12381 * Added the revtex4 files I forgot when setting up the repository.
12383 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12385 * All over: Tried to clean everything up so that only the files
12386 that we really need are included in the cvs repository.
12387 * Switched to use automake.
12388 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12389 * Install has not been checked.
12391 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12393 * po/pt.po: Three errors:
12394 l.533 and l.538 format specification error
12395 l. 402 duplicate entry, I just deleted it.