1 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
6 * lib/Makefile.am (DOCINST): do not install everything in the
7 documentation directory.
9 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
11 * src/bufferlist.C (newFile): set the filename to the constructed
14 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
15 constructed "newfileXX.lyx" name to the dialog
17 * src/frontends/DialogBase.h: make update() non-abstract so
18 KDE doesn't need to implement two update methods for every form
20 * src/frontends/kde/Makefile.am: add missing xforms objects
23 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
25 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
27 * src/frontends/xforms/Color.[Ch]: new files, defining the color
28 structs RGB and HSV. May not be the best place for these files.
29 Perhaps move them into src ?
31 * src/frontends/xforms/Makefile.am: added new files.
33 * src/frontends/xforms/forms/form_preferences.fd:
34 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
35 replaced all instances of "colour" with "color"!
37 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
40 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
41 tab. Can now alter the colors of the xform's GUI on the fly. With
42 the aid of a single static Signal (see below), can "Apply" these
43 changes to all currently open dialogs. (Well, to all of the NEW
44 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
45 subsequently opened dialogs will, of course, also have the new
46 color scheme. Cannot yet save (or load) the choices to file, so
47 they are lost when exiting LyX.
49 * src/frontends/Dialogs.h:
50 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
51 Used to trigger a redraw of any dialogs connected to it because,
52 for example, the GUI colours have been re-mapped.
54 * src/frontends/xforms/FormBase.[Ch]:
55 * src/frontends/xforms/FormDocument.[Ch]:
56 * src/frontends/xforms/FormParagraph.[Ch]:
57 * src/frontends/xforms/FormPreferences.[Ch]:
58 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
59 method, to be connected to Dialogs::redrawGUI. Method must be
60 virtual, because dialogs with tabbed folders need to redraw the
61 forms of each tab folder.
63 * src/LyXView.C (d-tor):
64 * src/frontends/xforms/FormBase.C (d-tor): connected
65 Dialogs::redrawGUI signal to redraw().
67 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
68 removed Assert, because it is identical to that in FormBase.
70 2000-11-10 Rob Lahaye <lahaye@postech.edu>
72 * lib/ui/default.ui: minor polishing.
74 2000-11-10 Juergen Vigna <jug@sad.it>
76 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
77 (deleteLyXText): ditto
79 * src/insets/insettabular.C (InsetButtonPress): don't clear the
80 selection on mouse-button-3.
82 * src/insets/insettabular.h: new function clearSelection(), use this
83 functions inside insettabular.C.
85 * src/insets/insettabular.C (TabularFeatures): clear the selection
88 * src/insets/inset.C (scroll): fixed some scroll stuff.
90 * src/insets/insettabular.C (draw): fixed another minor draw problem.
92 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
94 * lib/CREDITS: add Yves Bastide
96 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
98 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
99 check whether C library functions are in the global namespace.
101 * configure.in: calls it.
103 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
106 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
108 * src/frontends/xforms/FormParagraph.C (updateLanguage): Check
109 iterators to prevent crash.
111 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
113 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
115 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
116 shortcut for xforms CB to the preemptive or post-handler function.
118 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
119 removed the HIDDEN_TIMER as it's no longer used.
120 Various other small changes.
122 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
123 preemptive handler to obtain feedback, rather than the post-handler.
124 (ColoursLoadBrowser): find "black" and "white" based on RGB values
126 Formats tab is now complete. Converters tab is nearly so.
128 2000-11-09 Juergen Vigna <jug@sad.it>
130 * src/insets/insettext.C (~InsetText):
133 (SetParagraphData): set cache.second to 0 after deleting it!
134 (getLyXText): check if cache.second is not 0 if finding it.
136 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
138 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
139 lyxlex to parse the rgb.txt file.
142 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
143 replace the default '#' comment character.
145 * src/support/tempname.C: add "using" directive
146 * src/frontends/ButtonPolicies.C: ditto.
148 * src/support/filetools.C (DirList): add an explicit cast to avoid
149 a compile error (probably not the right fix)
151 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
153 * src/support/filetools.C (DirList): implement using system functions
155 * src/support/tempname.C: new file
157 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
159 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
161 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
164 * src/frontends/xforms/ButtonController.C: new file
166 * src/os2_defines.h: remove getcwd define
168 * src/lyxvc.C: include support/lyxlib.h
169 (showLog): use lyx::tempName
171 * src/lyx_cb.C: comment out includes that we don't need
172 (AutoSave): use lyx::tempName
174 * src/filedlg.C: include support/lyxlib.h
175 (Reread): use lyx::getcwd
177 * src/converter.C: include support/filetools.h
178 (add_options): change to static inline, make tail const
179 (Add): make old_viewer const
180 (GetAllFormats): make it a const method, use const_iterator
181 (enable): make static inline
182 (SplitFormat): make using_format const
184 * src/LaTeX.C (run): use lyx::getcwd
186 * configure.in: check for mkstemp as well
188 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
190 * src/converter.[Ch] (GetAllCommands): new method.
192 * src/support/filetools.[Ch] (DirList): new method.
194 * src/frontends/xforms/FormPreferences.C: started (just!) adding
195 functionality to the converters tab.
196 The formats tab is now nearly complete.
197 The kbmap choices in Languages tab now display the contents of
198 system_lyxdir/kbd/*.kmap in readable form.
200 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
201 Moved some variables into the class.
203 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
204 inactive tab folder to FL_COL1. Haven't yet worked out how to change
205 colour of active folder to lighter grey instead. Any takers?
206 (form_colours): added an "Apply" button.
207 (form_converters): added a "Flags" input field.
208 (form_formats): added a "Shortcut" input field. Note that we can't use
209 names such as "input_shortcut" as this buggers up the sed script stuff.
211 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
219 * src/lyx_sendfax_main.C:
222 * src/spellchecker.C:
223 * src/insets/figinset.C:
224 * src/insets/insetbib.C:
225 * src/insets/insetexternal.C:
226 * src/insets/insetinclude.C:
227 * src/insets/insetinfo.C:
228 * src/mathed/math_panel.C:
229 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
230 all "daughter" dialogs now have identical "feel".
232 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
234 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
235 used (and was only used in one place prior to this patch. Incorrectly!)
237 * src/frontends/xforms/FormDocument.C: changed some instances of
238 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
239 sense. Also added fl_set_input_return() for class_->input_doc_extra and
240 for options_->input_float_placement. This fixes a bug reported by
243 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
244 functionality into d-tor.
246 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
247 input of numerals also.
249 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
250 fl_set_form_atclose(). Can now close dialog from window manager,
251 fixing a bug reported by Rob Lahaye.
253 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
255 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
256 are no longer dark. Haven't yet worked out how to lighten the colour of
257 the active tabfolder. Any ideas anybody?
258 Adjusted Colours tab a little.
259 Added Shortcut field to converters tab. Note that we can't create an
260 fdesign label like "input_shortcut" as this buggers up the sed-script
263 * src/frontends/xforms/FormPreferences.[Ch]:
264 (feedback): fixed crash due to to ob=0.
265 (LanguagesXXX): the kbmap choices now contain the files
266 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
267 be replaced by an input with a file browse button, but since the browse
268 buttons don'y yet work, this'll do for the moment.
269 (FormatsXXX): think that this is now nearly fully functional.
270 Some points/questions though:
271 1. Does "Apply" remove formats if no longer present?
272 2. I think that the browser should list the GUI names rather than the
274 3. Must ensure that we can't delete Formats used by an existing
277 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
278 if this is the best way to do this.
280 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
282 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
284 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
285 for variable assignment.
287 2000-11-07 Rob Lahaye <lahaye@postech.edu>
289 * src/lib/ui/default.ui: added sub/superscripts to menu as
290 Insert->Special characters and cleaned-up the file a bit
292 2000-11-07 Allan Rae <rae@lyx.org>
294 * src/frontends/xforms/FormPreferences.C (feedback): make sure
295 ob isn't 0 before using it. See comments in function.
297 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
299 * src/frontends/xforms/form_*.C: regenerated
301 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
303 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
305 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
306 compiling with gcc-2.96
308 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
310 * src/support/lyxstring.C: add a couple "using" directives.
312 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
313 a .c_str() here too for good measure.
314 * src/Spacing.C (set): ditto.
315 * src/lyxfunc.C (Dispatch): ditto.
317 * src/insets/insettabular.C (copySelection): change .str() to
318 .str().c_str() to fix problems with lyxstring.
319 * src/support/filetools.C (GetFileContents): ditto.
320 * src/buffer.C (asciiParagraph): ditto.
321 * src/paragraph.C (String): ditto.
323 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
324 * lib/bind/sciword.bind: ditto.
326 * src/LyXAction.C (init): remove "symbol-insert" function, which
327 shared LFUN_INSERT_MATH with "math-insert".
329 * lib/configure.m4: == is not a valid operator for command test.
331 * src/lyxrc.C: add using directive.
333 * src/converter.h: add std:: qualifier.
335 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
337 * src/converter.[Ch] and other files: Change the Format class to a
338 real class, and create two instances: formats and system_format.
340 * src/lyxrc.C (output): Output the difference between formats and
343 * src/frontends/xforms/FormPreferences.C (input): Simplify.
344 (buildFormats): Insert formats into browser.
345 (inputFormats): Made the browser and add button functional.
346 (applyFormats): Update formats from format_vec.
348 * src/converter.C: Changed all (*it). to it->
349 (Format::dummy): New method.
350 (Format::importer): New format flag.
351 (Formats::GetAllFormats): New method.
352 (Formats::Add): Delete format from the map if prettyname is empty.
353 (Converter::Convert): Print an error message if moving the file fails.
354 (Converter::GetReachableTo): New method
356 * src/MenuBackend.[Ch]: Add support for importformats tag.
358 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
360 * lib/configure.m4: Add word->tex and ps->fax converters.
362 * lib/ui/default.ui: Use ImportFormats on file->import menu.
363 Return fax to file menu.
367 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
369 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
372 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
375 * src/lyxfunc.C (processKeyEvent): removed
377 * src/bufferlist.C (emergencyWrite): removed the out commented
378 emergency write code.
380 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
382 * src/LyXView.[Ch]: remove the outcommented raw_callback code
384 * many files: change formatting to be a bit more uniform for
385 if,while,for,switch statements, remove some parantesis not needed.
388 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
390 * config/kde.m4: make config more robust when KDEDIR is set
392 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
394 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
395 not returned a pixmap for "math-insert".
397 * src/LyXAction.C (init): sort the entries a bit.
399 2000-11-03 Juergen Vigna <jug@sad.it>
401 * src/insets/insettabular.h: added fixed number to update codes so
402 that update is only in one direction.
404 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
407 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
408 before call to edit because of redraw.
410 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
412 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
414 * lib/ui/default.ui: Populate "edit_float" menu
416 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
418 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
419 "floats-operate". The name is ugly (and the func also), but this
420 is just a band-aid until we switch to new insets.
422 2000-11-03 Rob Lahaye <lahaye@postech.edu>
424 * lib/ui/default.ui: update again the menu layout (fix some
427 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
429 * src/MenuBackend.h (fulllabel): new method.
431 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
432 the menu shortcuts of a menu are unique and whether they
433 correspond to a letter of the label.
434 (expand): call checkShortcuts when debugging.
436 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
438 * src/insets/insettext.C (InsetButtonPress): shut off warning.
440 2000-11-02 Lior Silberman <lior@Princeton.EDU>
442 * lib/examples/*.lyx : '\language default' => '\language english'
444 * lib/examples/it_splash.lyx : except where it should be italian
446 * lib/templates/*.lyx : the same
448 * doc/*.lyx* : the same
450 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
452 * lib/bind/menus.bind: remove the Layout menu entries, which I
453 somehow forgot earlier.
455 2000-11-03 Rob Lahaye <lahaye@postech.edu>
457 * lib/ui/old-default.ui: keep the old one here for reference (to
460 * lib/ui/default.ui: update the menu layout
462 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
464 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
465 Can now Apply to different insets without closing the dialog.
467 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
468 Can't actually DO anything with them yet, but I'd like a little
471 * src/frontends/xforms/input_validators.[ch]
472 (fl_lowercase_filter): new.
474 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
476 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
477 of MATH_CODE. This fixes a bug with math-macros in RTL text.
479 * src/text.C (PrepareToPrint): Show math-macros block aligned.
481 2000-11-02 Juergen Vigna <jug@sad.it>
483 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
484 on char insertion as it has already be updated by bv->updateInset().
486 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
487 if an inset inside was updated.
489 * lib/configure.cmd: commented out fax-search code
491 2000-11-01 Yves Bastide <stid@acm.org>
493 * src/tabular.C (OldFormatRead): set tabular language to the
496 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
498 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
499 class names with non-letter characters (from Yves Bastide).
501 * lib/ui/default.ui: change Item to OptItem in import menu.
502 Comment out fax stuff.
504 * lib/configure.m4: comment out fax-related stuff.
506 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
508 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
509 useful xforms helper functions. At present contains only formatted().
510 Input a string and it returns it with line breaks so that in fits
513 * src/frontends/xforms/Makefile.am: add new files.
515 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
516 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
519 * src/frontends/xforms/FormPreferences.[Ch]:
520 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
521 but lots of little clean ups. Removed enum State. Make use of
522 formatted(). Constify lots of methods. Perhaps best of all: removed
523 requirement for that horrible reinterpret_cast from pointer to long in
526 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
528 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
529 conditionalize build on xforms < 0.89
531 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
533 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
535 * src/LyXAction.C (init): comment out fax
537 * src/lyxrc.h: comment out the fax enums
538 comment out the fax variables
540 * src/commandtags.h: comment out LFUN_FAX
542 * src/lyxrc.C: disable fax variables.
543 (read): disable parsing of fax variables
544 (output): disable writing of fax variables
545 (getFeedback): now description for fax variables
547 * src/lyxfunc.C: comment out MenuFax
548 (Dispatch): disable LFUN_FAX
550 * src/lyx_cb.C (MenuFax): comment out
552 * src/WorkArea.C: add <cctype>
553 (work_area_handler): better key handling, should be ok now.
554 for accented chars + etc
556 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
557 lyx_sendfax.h and lyx_sendfax_man.C
559 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
560 (show): don't call InitLyXLookup when using xforms 0.89
562 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
564 * src/trans.C (AddDeadkey): better fix, the other one could crash...
566 * src/support/filetools.C (GetFileContents): close to dummy change
568 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
570 * src/trans.C (AddDeadkey): workaround stupid compilers.
572 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
574 * src/frontends/xforms/FormDocument.C (class_update): fix setting
575 of two-sided document.
577 2000-10-31 Juergen Vigna <jug@sad.it>
579 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
581 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
582 xposition to the Edit call.
584 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
586 * src/trans.C (AddDeadkey): cast explicitly to char.
588 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
590 * src/tabular.C (AsciiBottomHLine): simplify?
591 (AsciiTopHLine): simplify?
592 (print_n_chars): simplify
593 (DocBook): remove most of the << endl; we should flush the stream
594 as seldom as possible.
596 (TeXBottomHLine): ditto
599 (write_attribute): try a templified version.
600 (set_row_column_number_info): lesson scope of variables
602 * src/support/lstrings.h (tostr): new specialization of tostr
604 * src/trans.C (AddDeadkey): slightly cleaner fix.
606 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
608 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
609 '%%' in Toc menu labels.
612 * src/insets/insetlatexaccent.C (draw): Correct rendering when
613 font_norm is iso10646-1.
615 * src/font.C (ascent): Fixed for 16bit fonts
616 (descent,lbearing,rbearing): ditto
618 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
620 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
621 (getFeedback): new static method.
623 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
624 Now use combox rather than choice to display languages.
625 Feedback is now output using a new timer callback mechanism, identical
626 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
628 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
630 * src/minibuffer.C: fix for older compilers
632 2000-10-30 Juergen Vigna <jug@sad.it>
634 * src/insets/insettext.C (InsertInset): fixed this as the cursor
635 has to be Left of the inset otherwise LyXText won't find it!
637 * src/BufferView2.C (open_new_inset): delete the inset if it can
640 2000-10-30 Rob Lahaye <lahaye@postech.edu>
644 2000-10-29 Marko Vendelin <markov@ioc.ee>
645 * src/frontends/gnome/FormCitation.C
646 * src/frontends/gnome/FormCitation.h
647 * src/frontends/gnome/FormCopyright.C
648 * src/frontends/gnome/FormCopyright.h
649 * src/frontends/gnome/FormError.C
650 * src/frontends/gnome/FormError.h
651 * src/frontends/gnome/FormIndex.C
652 * src/frontends/gnome/FormIndex.h
653 * src/frontends/gnome/FormPrint.C
654 * src/frontends/gnome/FormPrint.h
655 * src/frontends/gnome/FormRef.C
656 * src/frontends/gnome/FormRef.h
657 * src/frontends/gnome/FormToc.C
658 * src/frontends/gnome/FormToc.h
659 * src/frontends/gnome/FormUrl.C
660 * src/frontends/gnome/FormUrl.h
661 * src/frontends/gnome/Menubar_pimpl.C
662 * src/frontends/gnome/mainapp.C
663 * src/frontends/gnome/mainapp.h
664 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
665 changing update() to updateSlot() where appropriate
667 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
669 * src/frontends/xforms/FormPreferences.[Ch]:
670 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
673 2000-10-28 Juergen Vigna <jug@sad.it>
675 * src/insets/insettabular.C (draw): fixed drawing bug.
677 * src/insets/insettext.C (clear):
679 (SetParagraphData): clearing the TEXT buffers when deleting the
680 paragraphs used by it.
682 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
684 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
686 2000-10-27 Juergen Vigna <jug@sad.it>
688 * src/tabular.C (~LyXTabular): removed not needed anymore.
690 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
693 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
695 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
698 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
701 * src/frontends/xforms/FormPreferences.[Ch]:
702 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
703 Reorganised as modules based on tabs. Much easier to follow the
704 flow and to add new tabs. Added warning and feedback messages.
707 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
709 * src/tabular.h (DocBook): add std:: qualifier.
711 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
713 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
714 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
717 * insettabular.C (DocBook): uses the tabular methods to export
720 * src/insets/insettext.h
721 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
723 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
725 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
728 * src/lyxfunc.C (MenuNew): lessen the scope of fname
729 moved misplaced AllowInput two lines up.
731 * src/buffer.C (readFile): compare float with float, not with int
733 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
735 * src/minibuffer.C: add "using SigC::slot" statement.
737 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
739 * src/frontends/xforms/forms/README: updated section about make.
741 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
742 Tidied some forms up, made two of form_tabular's tabs more
743 self-consistent, fixed Jean-Marc's size problem in form_preferences,
744 fixed translation problem with "Column".
746 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
748 * src/minibuffer.h: use Timeout instead of the xforms timer
750 (setTimer) rewrite for the Timeout, change to unsigned arg
751 (set): change to unsigned timer arg
754 * src/minibuffer.C (TimerCB): removed func
755 (C_MiniBuffer_TimerCB): removed func
756 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
757 (peek_event): use a switch statement
758 (add): don't use fl_add_timer.
759 (Set): rewrite to use the Timeout
762 * src/Timeout.[Ch] (setType): return a Timeout &
763 (setTimeout): ditto, change to unsigned arg for timeout
765 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
767 * src/mathed/formula.C (mathed_string_width): Use string instead
768 of a constant size char array.
770 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
772 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
773 the two recently added operator<< for SMInput and State.
775 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
777 (OkCancelPolicy): ditto
778 (OkCancelReadOnlyPolicy): ditto
779 (NoRepeatedApplyReadOnlyPolicy): ditto
780 (OkApplyCancelReadOnlyPolicy): ditto
781 (OkApplyCancelPolicy): ditto
782 (NoRepeatedApplyPolicy): ditto
784 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
786 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
787 add the usual std:: qualifiers.
789 2000-10-25 Juergen Vigna <jug@sad.it>
791 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
793 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
795 * src/support/filetools.C (MakeRelPath): change some types to
798 * src/frontends/ButtonPolicies.h (operator<<): new operator for
799 ButtonPolicy::SMInput and ButtonPolicy::State.
801 * src/FontLoader.C (reset): small cleanup
802 (unload): small cleanup
804 * src/FontInfo.C (getFontname): initialize error to 10000.0
806 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
808 * src/frontends/xforms/FormPreferences.[Ch]:
809 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
810 TeX encoding and default paper size sections.
812 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
814 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
817 * src/frontends/xforms/FormError.C (disconnect): use erase() to
818 make the message_ empty.
819 (FormError): don't initialize message_ in initializer list.
821 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
823 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
825 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
827 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
829 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
831 * src/frontends/kde/*data.[Ch]: _("") is not
834 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
836 * src/buffer.C: removed redundant using directive.
838 * src/frontends/DialogBase.h: revert to original definition of
841 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
842 stuff into two classes, one for each dialog, requires a new
843 element in the dialogs vector, FormTabularCreate.
845 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
848 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
849 method. Continues Allan's idea, but means that derived classes
850 don't need to worry about "update or hide?".
852 * src/frontends/xforms/FormError.C (showInset): add connection
855 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
856 one for each dialog. FormTabular now contains main tabular dialog
859 * src/frontends/xforms/FormTabularCreate.[Ch]:
860 * src/frontends/xforms/forms/form_tabular_create.fd: the create
863 * src/frontends/xforms/FormGraphics.[Ch]:
864 * src/frontends/xforms/forms/form_graphics.fd
865 * src/frontends/xforms/FormTabular.[Ch]:
866 * src/frontends/xforms/forms/form_tabular.fd: made daughter
867 classes of FormInset.
869 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
870 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
872 * src/frontends/xforms/Makefile.am:
873 * src/frontends/xforms/forms/makefile: added new files.
875 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
876 variable. added Signal0 hide signal, in keeping with other GUI-I
879 * src/support/lstrings.h: removed redundant std:: qualifier as
880 it's already declared in Lsstream.h.
882 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
884 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
888 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
890 * src/tabular.C (Ascii): minimize scope of cell.
892 * src/BufferView2.C (nextWord): return string() instead of 0;
894 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
896 * src/converter.h: add a std:: qualifier
898 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
900 * src/importer.[Ch]: New files. Used for importing files into LyX.
902 * src/lyxfunc.C (doImport): Use the new Importer class.
904 * src/converter.h: Add shortcut member to the Format class.
905 Used for holding the menu shortcut.
907 * src/converter.C and other files: Made a distinction between
908 format name and format extension. New formats can be defined using
909 the \format lyxrc tag.
910 Added two new converter flags: latex and disable.
912 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
914 * src/support/lyxlib.h: unify namespace/struct implementation.
915 Remove extra declarations.
917 * src/support/chdir.C (chdir): remove version taking char const *
919 * src/support/rename.C: ditto.
920 * src/support/lyxsum.C: ditto.
922 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
924 * src/frontends/xforms/FormBase.[Ch]:
925 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
926 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
927 work only for the next call to fl_show_form(). The correct place to set
928 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
929 done. FormBase also stores minw_, minh_ itself. All dialogs derived
930 from FormBase have the minimum size set; no more stupid crashes with
933 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
935 * lib/ui/default.ui: fix shortcut for Insert->Include File.
937 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
939 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
941 * src/support/lyxlib.h: changed second argument of mkdir to
942 unsigned long int (unsigned int would probably have been enough,
943 but...). Removed <sys/types.h> header.
944 * src/support/mkdir.C (mkdir): ditto.
948 2000-10-19 Juergen Vigna <jug@sad.it>
950 * src/lyxfunc.C (MenuNew): small fix (form John)
952 * src/screen.C (Update): removed unneeded code.
954 * src/tabular.C (Ascii): refixed int != uint bug!
956 * src/support/lyxlib.h: added sys/types.h include for now permits
957 compiling, but I don't like this!
959 2000-10-18 Juergen Vigna <jug@sad.it>
961 * src/text2.C (ClearSelection): if we clear the selection we need
962 more refresh so set the status apropriately
964 * src/insets/insettext.C (draw): hopefully finally fixed draw
967 2000-10-12 Juergen Vigna <jug@sad.it>
969 * src/insets/insettext.C (draw): another small fix and make a block
970 so that variables are localized.
972 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
974 * src/support/lstrings.C (lowercase, uppercase):
975 use explicit casts to remove compiler warnings.
977 * src/support/LRegex.C (Impl):
978 * src/support/StrPool.C (add):
979 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
980 (AddPath, MakeDisplayPath):
981 * src/support/lstrings.C (prefixIs, subst):
982 use correct type to remove compiler warnings.
984 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
986 * src/support/lyxlib.h:
987 * src/support/mkdir.C (mkdir): change parameter to mode_t for
988 portability and to remove compiler warning with DEC cxx.
990 * src/support/FileInfo.[Ch] (flagRWX): ditto.
992 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
994 * src/minibuffer.C (peek_event): retun 1 when there has been a
995 mouseclick in the minibuffer.
999 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1001 * src/frontends/xforms/FormParagraph.C: more space above/below
1004 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1006 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1007 a char only if real_current_font was changed.
1009 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1011 * NEWS: update somewhat for 1.1.6
1013 * lib/ui/default.ui: clean up.
1015 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1017 * lib/CREDITS: clean up
1019 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1021 * src/combox.[Ch] (select): changed argument back to int
1022 * src/combox.C (peek_event): removed num_bytes as it is declared but
1025 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1026 modified calls to Combox::select() to remove warnings about type
1029 * src/insets/insetbutton.C (width): explicit cast to remove warning
1030 about type conversion.
1032 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1035 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1036 sel_pos_end, refering to cursor position are changed to
1037 LyXParagraph::size_type.
1039 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1040 consistent with LyXCursor::pos().
1041 (inset_pos): changed to LyXParagraph::size_type for same reason.
1043 * src/insets/insettext.C (resizeLyXText): changed some temporary
1044 variables refing to cursor position to LyXParagraph::size_type.
1046 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1048 * src/frontends/kde/<various>: The Great Renaming,
1051 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1053 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1055 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1057 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1058 0 when there are no arguments.
1060 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1062 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1063 to segfaults when pressing Ok in InsetBibtex dialog.
1065 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1067 * forms/layout_forms.fd:
1068 * src/layout_forms.C (create_form_form_character): small change to use
1069 labelframe rather than engraved frame + text
1071 * src/lyx_gui.C (create_forms): initialise choice_language with some
1072 arbitrary value to prevent segfault when dialog is shown.
1074 2000-10-16 Baruch Even <baruch.even@writeme.com>
1076 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1077 is no resulting file. This pertains only to LaTeX output.
1079 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1081 * src/text.C (Backspace): Make sure that the row of the cursor is
1084 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1087 * src/lyx_gui.C (init): Prevent a crash when only one font from
1088 menu/popup fonts is not found.
1090 * lib/lyxrc.example: Add an example for binding a key for language
1093 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1095 * src/converter.C (GetReachable): Changed the returned type to
1097 (IsReachable): New method
1099 * src/MenuBackend.C (expand): Handle formats that appear more
1102 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1104 * src/frontends/support/Makefile.am
1105 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1108 * lib/CREDITS: add Garst Reese.
1110 * src/support/snprintf.h: add extern "C" {} around the definitions.
1112 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1114 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1117 * src/frontends/xforms/FormDocument.C:
1118 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1119 compile without "conversion to integral type of smaller size"
1122 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1124 * src/text.C (GetColumnNearX): Fixed disabled code.
1126 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1128 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1131 * src/support/snprintf.[ch]: new files
1133 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1135 * src/frontends/kde/formprintdialog.C: add
1136 file browser for selecting postscript output
1138 * src/frontends/kde/formprintdialogdata.C:
1139 * src/frontends/kde/formprintdialogdata.h: re-generate
1142 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1144 * src/frontends/gnome/Makefile.am:
1145 * src/frontends/kde/Makefile.am: FormCommand.C
1146 disappeared from xforms
1148 * src/frontends/kde/FormCitation.C:
1149 * src/frontends/kde/FormIndex.C: read-only
1152 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1154 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1157 * src/bufferlist.C: add using directive.
1159 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1161 * src/support/lyxfunctional.h: version of class_fun for void
1162 returns added, const versions of back_inseter_fun and compare_fun
1165 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1167 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1169 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1171 * ChangeLog: cleanup.
1173 * lib/CREDITS: update to add all the contributors we've forgotten.
1174 I have obviously missed some, so tell me whether there were
1177 2000-10-13 Marko Vendelin <markov@ioc.ee>
1179 * src/frontends/gnome/FormCitation.C
1180 * src/frontends/gnome/FormCitation.h
1181 * src/frontends/gnome/FormError.C
1182 * src/frontends/gnome/FormIndex.C
1183 * src/frontends/gnome/FormRef.C
1184 * src/frontends/gnome/FormRef.h
1185 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1187 * src/frontends/gnome/FormCitation.C
1188 * src/frontends/gnome/FormCopyright.C
1189 * src/frontends/gnome/FormError.C
1190 * src/frontends/gnome/FormIndex.C
1191 * src/frontends/gnome/FormRef.C
1192 * src/frontends/gnome/FormToc.C
1193 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1196 * src/frontends/gnome/Menubar_pimpl.C
1197 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1200 2000-10-11 Baruch Even <baruch.even@writeme.com>
1203 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1204 to convey its real action.
1206 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1207 clear the minibuffer and prepare to enter a command.
1209 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1210 the rename from ExecCommand to PrepareForCommand.
1211 * src/lyxfunc.C (Dispatch): ditto.
1213 2000-10-11 Baruch Even <baruch.even@writeme.com>
1215 * src/buffer.C (writeFile): Added test for errors on writing, this
1216 catches all errors and not only file system full errors as intended.
1218 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1220 * src/lyx_gui.C (create_forms): better fix for crash with
1221 translated interface.
1223 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1225 * src/frontends/kde/Makefile.am:
1226 * src/frontends/kde/FormCopyright.C:
1227 * src/frontends/kde/formcopyrightdialog.C:
1228 * src/frontends/kde/formcopyrightdialog.h:
1229 * src/frontends/kde/formcopyrightdialogdata.C:
1230 * src/frontends/kde/formcopyrightdialogdata.h:
1231 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1232 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1233 copyright to use qtarch
1235 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1237 * src/encoding.C (read): Fixed bug that caused an error message at
1238 the end of the file.
1240 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1242 * lib/lyxrc.example: Fixed hebrew example.
1244 2000-10-13 Allan Rae <rae@lyx.org>
1246 * src/frontends/xforms/FormPreferences.C (input): reworking the
1248 (build, update, apply): New inputs in various tabfolders
1250 * src/frontends/xforms/FormToc.C: use new button policy.
1251 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1252 dialogs that either can't use any existing policy or where it just
1255 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1258 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1259 added a bool parameter which is ignored.
1261 * src/buffer.C (setReadonly):
1262 * src/BufferView_pimpl.C (buffer):
1263 * src/frontends/kde/FormCopyright.h (update):
1264 * src/frontends/kde/FormCitation.[Ch] (update):
1265 * src/frontends/kde/FormIndex.[Ch] (update):
1266 * src/frontends/kde/FormPrint.[Ch] (update):
1267 * src/frontends/kde/FormRef.[Ch] (update):
1268 * src/frontends/kde/FormToc.[Ch] (update):
1269 * src/frontends/kde/FormUrl.[Ch] (update):
1270 * src/frontends/gnome/FormCopyright.h (update):
1271 * src/frontends/gnome/FormCitation.[Ch] (update):
1272 * src/frontends/gnome/FormError.[Ch] (update):
1273 * src/frontends/gnome/FormIndex.[Ch] (update):
1274 * src/frontends/gnome/FormPrint.[Ch] (update):
1275 * src/frontends/gnome/FormRef.h (update):
1276 * src/frontends/gnome/FormToc.[Ch] (update):
1277 * src/frontends/gnome/FormUrl.[Ch] (update):
1278 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1279 to updateBufferDependent and DialogBase
1281 * src/frontends/xforms/FormCitation.[hC]:
1282 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1283 * src/frontends/xforms/FormError.[Ch]:
1284 * src/frontends/xforms/FormGraphics.[Ch]:
1285 * src/frontends/xforms/FormIndex.[Ch]:
1286 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1287 and fixed readOnly handling.
1288 * src/frontends/xforms/FormPrint.[Ch]:
1289 * src/frontends/xforms/FormRef.[Ch]:
1290 * src/frontends/xforms/FormTabular.[Ch]:
1291 * src/frontends/xforms/FormToc.[Ch]:
1292 * src/frontends/xforms/FormUrl.[Ch]:
1293 * src/frontends/xforms/FormInset.[Ch]:
1294 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1295 form of updateBufferDependent.
1297 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1298 if form()->visible just in case someone does stuff to the form in a
1301 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1302 the buttoncontroller for everything the enum used to be used for.
1303 (update) It would seem we need to force all dialogs to use a bool
1304 parameter or have two update functions. I chose to go with one.
1305 I did try removing update() from here and FormBase and defining the
1306 appropriate update signatures in FormBaseB[DI] but then ran into the
1307 problem of the update() call in FormBase::show(). Whatever I did
1308 to get around that would require another function and that just
1309 got more confusing. Hence the decision to make everyone have an
1310 update(bool). An alternative might have been to override show() in
1311 FormBaseB[DI] and that would allow the different and appropriate
1314 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1315 true == buffer change occurred. I decided against using a default
1316 template parameter since not all compilers support that at present.
1318 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1320 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1321 army knife" by removing functionality.
1322 (clearStore): removed. All such housekeeping on hide()ing the dialog
1323 is to be carried out by overloaded disconnect() methods.
1324 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1325 superceded by Baruch's neat test (FormGraphics) to update an existing
1326 dialog if a new signal is recieved rather than block all new signals
1328 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1329 only to Inset dialogs.
1330 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1331 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1333 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1335 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1336 as a base class to all inset dialogs. Used solely to connect/disconnect
1337 the Inset::hide signal and to define what action to take on receipt of
1338 a UpdateBufferDependent signal.
1339 (FormCommand): now derived from FormInset.
1341 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1344 * src/frontends/xforms/FormCopyright.[Ch]:
1345 * src/frontends/xforms/FormPreferences.[Ch]:
1346 now derived from FormBaseBI.
1348 * src/frontends/xforms/FormDocument.[Ch]:
1349 * src/frontends/xforms/FormParagraph.[Ch]:
1350 * src/frontends/xforms/FormPrint.[Ch]:
1351 now derived from FormBaseBD.
1353 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1355 * src/frontends/xforms/FormCitation.[Ch]:
1356 * src/frontends/xforms/FormError.[Ch]:
1357 * src/frontends/xforms/FormRef.[Ch]:
1358 * src/frontends/xforms/FormToc.[Ch]:
1359 (clearStore): reworked as disconnect().
1361 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1364 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1366 * src/converter.C (runLaTeX): constify buffer argument
1369 * src/frontends/support/Makefile.am (INCLUDES): fix.
1371 * src/buffer.h: add std:: qualifier
1372 * src/insets/figinset.C (addpidwait): ditto
1373 * src/MenuBackend.C: ditto
1374 * src/buffer.C: ditto
1375 * src/bufferlist.C: ditto
1376 * src/layout.C: ditto
1377 * src/lyxfunc.C: ditto
1379 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1381 * src/lyxtext.h (bidi_level): change return type to
1382 LyXParagraph::size_type.
1384 * src/lyxparagraph.h: change size_type to
1385 TextContainer::difference_type. This should really be
1386 TextContainer::size_type, but we need currently to support signed
1389 2000-10-11 Marko Vendelin <markov@ioc.ee>
1390 * src/frontends/gnome/FormError.h
1391 * src/frontends/gnome/FormRef.C
1392 * src/frontends/gnome/FormRef.h
1393 * src/frontends/gnome/FormError.C
1394 * src/frontends/gnome/Makefile.am
1395 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1396 to Gnome frontend. Both dialogs use "action" area.
1398 2000-10-12 Baruch Even <baruch.even@writeme.com>
1400 * src/graphics/GraphicsCacheItem_pimpl.C:
1401 * src/graphics/Renderer.C:
1402 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1405 2000-10-12 Juergen Vigna <jug@sad.it>
1407 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1408 visible when selecting).
1410 * development/Code_rules/Rules: fixed some typos.
1412 2000-10-09 Baruch Even <baruch.even@writeme.com>
1414 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1415 compiling on egcs 1.1.2 possible.
1417 * src/filedlg.C (comp_direntry::operator() ): ditto.
1419 2000-08-31 Baruch Even <baruch.even@writeme.com>
1421 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1424 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1425 transient it now only gets freed when the object is destructed.
1427 2000-08-24 Baruch Even <baruch.even@writeme.com>
1429 * src/frontends/FormGraphics.h:
1430 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1433 2000-08-20 Baruch Even <baruch.even@writeme.com>
1435 * src/insets/insetgraphics.C:
1436 (draw): Added messages to the drawn rectangle to report status.
1437 (updateInset): Disabled the use of the inline graphics,
1440 2000-08-17 Baruch Even <baruch.even@writeme.com>
1442 * src/frontends/support: Directory added for the support of GUII LyX.
1444 * src/frontends/support/LyXImage.h:
1445 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1448 * src/frontends/support/LyXImage_X.h:
1449 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1450 version of LyXImage, this uses the Xlib Pixmap.
1452 * src/PainterBase.h:
1453 * src/PainterBase.C:
1455 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1456 replacement to Pixmap.
1458 * src/insets/insetgraphics.h:
1459 * src/insets/insetgraphics.C:
1460 * src/graphics/GraphicsCacheItem.h:
1461 * src/graphics/GraphicsCacheItem.C:
1462 * src/graphics/GraphicsCacheItem_pimpl.h:
1463 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1466 * src/graphics/GraphicsCacheItem.h:
1467 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1468 another copy of the object.
1470 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1471 of cacheHandle, this fixed a bug that sent LyX crashing.
1473 * src/graphics/XPM_Renderer.h:
1474 * src/graphics/XPM_Renderer.C:
1475 * src/graphics/EPS_Renderer.h:
1476 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1478 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1480 * src/lyxfunc.C (processKeySym): only handle the
1481 lockinginset/inset stuff if we have a buffer and text loaded...
1483 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1485 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1487 * src/support/lyxfunctional.h: add operator= that takes a reference
1489 * src/lyxserver.C (mkfifo): make first arg const
1491 * src/layout.h: renamed name(...) to setName(...) to work around
1494 * src/buffer.C (setFileName): had to change name of function to
1495 work around bugs in egcs. (renamed from fileName)
1497 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1499 * src/support/translator.h: move helper template classes to
1500 lyxfunctional.h, include "support/lyxfunctional.h"
1502 * src/support/lyxmanip.h: add delaration of fmt
1504 * src/support/lyxfunctional.h: new file
1505 (class_fun_t): new template class
1506 (class_fun): helper template function
1507 (back_insert_fun_iterator): new template class
1508 (back_inserter_fun): helper template function
1509 (compare_memfun_t): new template class
1510 (compare_memfun): helper template function
1511 (equal_1st_in_pair): moved here from translator
1512 (equal_2nd_in_pair): moved here from translator
1514 * src/support/fmt.C: new file
1515 (fmt): new func, can be used for a printf substitute when still
1516 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1518 * src/support/StrPool.C: add some comments
1520 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1523 * src/insets/figinset.C (addpidwait): use std::copy with
1524 ostream_iterator to fill the pidwaitlist
1526 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1528 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1531 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1534 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1536 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1537 (class_update): ditto
1538 (BulletPanel): ditto
1539 (CheckChoiceClass): move initialization of tc and tct
1541 * src/tabular.C: remove current_view
1542 (OldFormatRead): similar to right below [istream::ignore]
1544 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1545 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1546 unused [istream::ignore]
1548 * src/lyxfunc.C: include "support/lyxfunctional.h"
1549 (getInsetByCode): use std::find_if and compare_memfun
1551 * src/lyxfont.C (stateText): remove c_str()
1553 * src/lyx_main.C (setDebuggingLevel): make static
1554 (commandLineHelp): make static
1556 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1557 Screen* together with fl_get_display() and fl_screen
1559 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1560 togheter with fl_get_display() and fl_screen
1561 (create_forms): remove c_str()
1563 * src/layout.C: include "support/lyxfunctional.h"
1564 (hasLayout): use std::find_if and compare_memfun
1565 (GetLayout): use std::find_if and comapre_memfun
1566 (delete_layout): use std::remove_if and compare_memfun
1567 (NumberOfClass): use std:.find_if and compare_memfun
1569 * src/gettext.h: change for the new functions
1571 * src/gettext.C: new file, make _(char const * str) and _(string
1572 const & str) real functions.
1574 * src/font.C (width): rewrite slightly to avoid one extra variable
1576 * src/debug.C: initialize Debug::ANY here
1578 * src/commandtags.h: update number comments
1580 * src/combox.h (get): make const func
1582 (getline): make const
1584 * src/combox.C (input_cb): handle case where fl_get_input can
1587 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1588 "support/lyxfunctional.h", remove current_view variable.
1589 (resize): use std::for_each with std::mem_fun
1590 (getFileNames): use std::copy with back_inserter_fun
1591 (getBuffer): change arg type to unsigned int
1592 (emergencyWriteAll): call emergencyWrite with std::for_each and
1594 (emergencyWrite): new method, the for loop in emergencyWriteAll
1596 (exists): use std::find_if with compare_memfun
1597 (getBuffer): use std::find_if and compare_memfun
1599 * src/buffer.h: add typedefs for iterator_category, value_type
1600 difference_type, pointer and reference for inset_iterator
1601 add postfix ++ for inset_iterator
1602 make inset_iterator::getPos() const
1604 * src/buffer.C: added support/lyxmanip.h
1605 (readFile): use lyxerr << fmt instead of printf
1606 (makeLaTeXFile): use std::copy to write out encodings
1608 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1610 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1611 free and the char * temp.
1612 (hasMenu): use std::find_if and compare_memfun
1615 * src/Makefile.am (lyx_SOURCES): added gettext.C
1617 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1618 string::insert small change to avoid temporary
1620 * src/LColor.C (getGUIName): remove c_str()
1622 * several files: change all occurrences of fl_display to
1625 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1626 that -pedantic is not used for gcc 2.97 (cvs gcc)
1628 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1630 2000-10-11 Allan Rae <rae@lyx.org>
1632 * src/frontends/xforms/FormPreferences.C (input): template path must be
1633 a readable directory. It doesn't need to be writeable.
1634 (build, delete, update, apply): New inputs in the various tabfolders
1636 * src/frontends/xforms/forms/form_preferences.fd:
1637 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1638 several new entries to existing folders. Shuffled some existing stuff
1641 * src/frontends/xforms/forms/form_print.fd:
1642 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1643 Should probably rework PrinterParams as well. Note that the switch to
1644 collated is effectively the same as !unsorted so changing PrinterParams
1645 will require a lot of fiddly changes to reverse the existing logic.
1647 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1649 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1651 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1653 2000-10-10 Allan Rae <rae@lyx.org>
1656 * src/lyxfunc.C (Dispatch):
1658 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1661 * src/lyxrc.C (output): Only write the differences between system lyxrc
1662 and the users settings.
1665 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1667 I'll rewrite this later, after 1.1.6 probably, to keep a single
1668 LyXRC but two instances of a LyXRCStruct.
1670 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1672 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1674 * src/tabular.h: add a few std:: qualifiers.
1676 * src/encoding.C: add using directive.
1677 * src/language.C: ditto.
1679 * src/insets/insetquotes.C (Validate): use languages->lang()
1680 instead of only language.
1682 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1684 * lib/languages: New file.
1686 * lib/encodings: New file.
1688 * src/language.C (Languages): New class.
1689 (read): New method. Reads the languages from the 'languages' file.
1691 * src/encoding.C (Encodings): New class.
1692 (read): New method. Reads the encodings from the 'encodings' file.
1694 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1697 * src/bufferparams.h and a lot of files: Deleted the member language,
1698 and renamed language_info to language
1700 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1701 * src/lyxfont.C (latexWriteStartChanges): ditto.
1702 * src/paragraph.C (validate,TeXOnePar): ditto.
1704 * src/lyxfont.C (update): Restored deleted code.
1706 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1708 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1710 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1712 * src/insets/figinset.[Ch]:
1713 * src/insets/insetinclude.[Ch]:
1714 * src/insets/insetinclude.[Ch]:
1715 * src/insets/insetparent.[Ch]:
1716 * src/insets/insetref.[Ch]:
1717 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1719 * src/insets/*.[Ch]:
1720 * src/mathed/formula.[Ch]:
1721 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1723 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1724 * src/lyx_cb.C (FigureApplyCB):
1725 * src/lyxfunc.C (getStatus, Dispatch):
1726 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1729 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1731 * src/converter.[Ch] (Formats::View):
1732 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1734 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1735 *current_view->buffer(). This will change later, but this patch is way
1738 2000-10-09 Juergen Vigna <jug@sad.it>
1740 * src/text.C (GetRow): small fix.
1742 * src/BufferView_pimpl.C (cursorPrevious):
1743 (cursorNext): added LyXText parameter to function.
1745 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1746 keypress depending on cursor position.
1748 2000-10-06 Juergen Vigna <jug@sad.it>
1750 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1751 (copySelection): redone this function and also copy ascii representa-
1754 * src/tabular.C (Ascii):
1758 (print_n_chars): new functions to realize the ascii export of tabulars.
1760 2000-10-05 Juergen Vigna <jug@sad.it>
1762 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1763 if we don't have a buffer.
1765 2000-10-10 Allan Rae <rae@lyx.org>
1767 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1768 with closing dialog. It seems that nested tabfolders require hiding
1769 of inner tabfolders before hiding the dialog itself. Actually all I
1770 did was hide the active outer folder.
1772 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1773 unless there really is a buffer. hideBufferDependent is called
1776 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1777 POTFILES.in stays in $(srcdir).
1779 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1781 * lib/lyxrc.example: Few changes.
1783 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1785 * src/BufferView_pimpl.C (buffer): only need one the
1786 updateBufferDependent signal to be emitted once! Moved to the end of
1787 the method to allow bv_->text to be updated first.
1789 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1790 and hSignal_ with Dialogs * and BufferDependency variables.
1791 New Buffer * parent_, initialised when the dialog is launched. Used to
1792 check whether to update() or hide() dialog in the new, private
1793 updateOrHide() method that is connected to the updateBufferDependent
1794 signal. Daughter classes dictate what to do using the
1795 ChangedBufferAction enum, passed to the c-tor.
1797 * src/frontends/xforms/FormCitation.C:
1798 * src/frontends/xforms/FormCommand.C:
1799 * src/frontends/xforms/FormCopyright.C:
1800 * src/frontends/xforms/FormDocument.C:
1801 * src/frontends/xforms/FormError.C:
1802 * src/frontends/xforms/FormIndex.C:
1803 * src/frontends/xforms/FormPreferences.C:
1804 * src/frontends/xforms/FormPrint.C:
1805 * src/frontends/xforms/FormRef.C:
1806 * src/frontends/xforms/FormToc.C:
1807 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1810 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1811 ChangedBufferAction enum.
1813 * src/frontends/xforms/FormParagraph.[Ch]
1814 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1817 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1819 * lib/bind/cua.bind: fix a bit.
1820 * lib/bind/emacs.bind: ditto.
1822 * lib/bind/menus.bind: remove real menu entries from there.
1824 * src/spellchecker.C: make sure we only include strings.h when
1827 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1829 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1830 function. It enlarges the maximum number of pup when needed.
1831 (add_toc2): Open a new menu if maximum number of items per menu has
1834 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1836 * src/frontends/kde/FormPrint.C: fix error reporting
1838 * src/frontends/xforms/FormDocument.C: fix compiler
1841 * lib/.cvsignore: add Literate.nw
1843 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1846 * bufferview_funcs.[Ch]
1849 * text2.C: Add support for numbers in RTL text.
1851 2000-10-06 Allan Rae <rae@lyx.org>
1853 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1854 to be gettext.m4 friendly again. ext_l10n.h is now
1855 generated into $top_srcdir instead of $top_builddir
1856 so that lyx.pot will be built correctly -- without
1857 duplicate parsing of ext_l10n.h.
1859 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1861 * src/frontends/kde/FormCitation.C: make the dialog
1862 behave more sensibly
1864 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1866 * config/kde.m4: fix consecutive ./configure runs,
1867 look for qtarch, fix library order
1869 * src/frontends/kde/Makefile.am: tidy up,
1870 add Print dialog, add .dlg dependencies
1872 * src/frontends/kde/FormPrint.C:
1873 * src/frontends/kde/FormPrint.h:
1874 * src/frontends/kde/formprintdialog.C:
1875 * src/frontends/kde/formprintdialog.h:
1876 * src/frontends/kde/formprintdialogdata.C:
1877 * src/frontends/kde/formprintdialogdata.h:
1878 * src/frontends/kde/dlg/formprintdialog.dlg: add
1881 * src/frontends/kde/dlg/README: Added explanatory readme
1883 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1884 script to double-check qtarch's output
1886 * src/frontends/kde/formindexdialog.C:
1887 * src/frontends/kde/formindexdialogdata.C:
1888 * src/frontends/kde/formindexdialogdata.h:
1889 * src/frontends/kde/dlg/formindexdialog.dlg: update
1890 for qtarch, minor fixes
1892 2000-10-05 Allan Rae <rae@lyx.org>
1894 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1895 dialogs when switching buffers update them instead. It's up to each
1896 dialog to decide if it should still be visible or not.
1897 update() should return a bool to control visiblity within show().
1898 Or perhaps better to set a member variable and use that to control
1901 * lib/build-listerrors: create an empty "listerrors" file just to stop
1902 make trying to regenerate it all the time if you don't have noweb
1905 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1907 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1908 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1909 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1910 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1911 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1913 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1915 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1917 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1918 deleting buffer. Closes all buffer-dependent dialogs.
1920 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1922 * src/frontends/xforms/FormCitation.[Ch]:
1923 * src/frontends/xforms/FormPreferences.[Ch]:
1924 * src/frontends/xforms/FormPrint.[Ch]:
1925 * src/frontends/xforms/FormRef.[Ch]:
1926 * src/frontends/xforms/FormUrl.[Ch]: ditto
1928 * src/frontends/xforms/FormDocument.[Ch]:
1929 * src/frontends/xforms/forms/form_document.C.patch:
1930 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1931 pass through a single input() function.
1933 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1935 * lib/build-listerrors: return status as OK
1937 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1939 * lib/lyxrc.example: Updated to new export code
1941 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1943 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1946 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1949 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1950 LyX-Code is defined.
1951 * lib/layouts/amsbook.layout: ditto.
1953 * boost/Makefile.am: fix typo.
1955 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1957 (add_lastfiles): removed.
1958 (add_documents): removed.
1959 (add_formats): removed.
1961 * src/frontends/Menubar.C: remove useless "using" directive.
1963 * src/MenuBackend.h: add a new MenuItem constructor.
1965 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1968 2000-10-04 Allan Rae <rae@lyx.org>
1970 * lib/Makefile.am (listerrors):
1971 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1972 I haven't got notangle installed so Kayvan please test. The output
1973 should end up in $builddir. This also allows people who don't have
1974 noweb installed to complete the make process without error.
1976 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1977 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1978 by JMarc's picky compiler.
1980 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1983 * src/insets/insettabular.C (setPos): change for loop to not use
1984 sequencing operator. Please check this Jürgen.
1986 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1988 * src/insets/insetcite.C (getScreenLabel): ditto
1989 * src/support/filetools.C (QuoteName): ditto
1990 (ChangeExtension): ditto
1992 * src/BufferView_pimpl.C (scrollCB): make heigt int
1994 * src/BufferView2.C (insertInset): comment out unused arg
1996 * boost/Makefile.am (EXTRADIST): new variable
1998 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2000 * src/exporter.C (IsExportable): Fixed
2002 * lib/configure.m4: Small fix
2004 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2006 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2007 * src/insets/insetbib.C (bibitemWidest): ditto.
2008 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2010 2000-10-03 Juergen Vigna <jug@sad.it>
2012 * src/BufferView2.C (theLockingInset): removed const because of
2013 Agnus's compile problems.
2015 * src/insets/insettext.C (LocalDispatch): set the language of the
2016 surronding paragraph on inserting the first character.
2018 * various files: changed use of BufferView::the_locking_inset.
2020 * src/BufferView2.C (theLockingInset):
2021 (theLockingInset): new functions.
2023 * src/BufferView.h: removed the_locking_inset.
2025 * src/lyxtext.h: added the_locking_inset
2027 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2029 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2031 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2033 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2034 * src/mathed/math_cursor.C (IsAlpha): ditto.
2035 * src/mathed/math_inset.C (strnew): ditto.
2036 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2037 (IMetrics): cxp set but never used; removed.
2038 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2039 that the variable in question has been removed also!
2042 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2043 using the Buffer * passed to Latex(), using the BufferView * passed to
2044 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2046 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2047 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2049 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2050 * src/buffer.C (readInset): used new InsetBibtex c-tor
2051 * (getBibkeyList): used new InsetBibtex::getKeys
2053 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2056 * lib/build-listerrors
2058 * src/exporter.C: Add literate programming support to the export code
2061 * src/lyx_cb.C: Remove old literate code.
2063 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2066 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2067 * src/converter.C (View, Convert): Use QuoteName.
2069 * src/insets/figinset.C (Preview): Use Formats::View.
2071 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2073 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2075 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2076 the top of the function, because compaq cxx complains that the
2077 "goto exit_with_message" when the function is disabled bypasses
2079 (MenuNew): try a better fix for the generation of new file names.
2080 This time, I used AddName() instead of AddPath(), hoping Juergen
2083 2000-10-03 Allan Rae <rae@lyx.org>
2085 * src/frontends/xforms/forms/form_preferences.fd:
2086 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2087 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2088 "Look and Feel"->"General" but will need to be split up further into
2089 general output and general input tabs. Current plan is for four outer
2090 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2091 stuff; "Inputs" for input and import configuration; "Outputs" for
2092 output and export configuration; and one more whatever is left over
2093 called "General". The leftovers at present look like being which
2094 viewers to use, spellchecker, language support and might be better
2095 named "Support". I've put "Paths" in "Inputs" for the moment as this
2096 seems reasonable for now at least.
2097 One problem remains: X error kills LyX when you close Preferences.
2099 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2101 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2102 qualifier from form()
2103 * src/frontends/xforms/FormCitation.[Ch]:
2104 * src/frontends/xforms/FormCopyright.[Ch]:
2105 * src/frontends/xforms/FormDocument.[Ch]:
2106 * src/frontends/xforms/FormError.[Ch]:
2107 * src/frontends/xforms/FormIndex.[Ch]:
2108 * src/frontends/xforms/FormPreferences.[Ch]:
2109 * src/frontends/xforms/FormPrint.[Ch]:
2110 * src/frontends/xforms/FormRef.[Ch]:
2111 * src/frontends/xforms/FormToc.[Ch]:
2112 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2114 * src/frontends/xforms/FormCitation.[Ch]:
2115 * src/frontends/xforms/FormIndex.[Ch]:
2116 * src/frontends/xforms/FormRef.[Ch]:
2117 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2118 with Allan's naming policy
2120 * src/frontends/xforms/FormCitation.C: some static casts to remove
2123 2000-10-02 Juergen Vigna <jug@sad.it>
2125 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2126 now you can type or do stuff inside the table-cell also when in dummy
2127 position, fixed visible cursor.
2129 * src/insets/insettext.C (Edit): fixing cursor-view position.
2131 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2132 be used for equal functions in lyxfunc and insettext.
2134 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2136 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2138 * src/frontends/gnome/FormCitation.h:
2139 * src/frontends/gnome/FormCopyright.h:
2140 * src/frontends/gnome/FormIndex.h:
2141 * src/frontends/gnome/FormPrint.h:
2142 * src/frontends/gnome/FormToc.h:
2143 * src/frontends/gnome/FormUrl.h:
2144 * src/frontends/kde/FormCitation.h:
2145 * src/frontends/kde/FormCopyright.h:
2146 * src/frontends/kde/FormIndex.h:
2147 * src/frontends/kde/FormRef.h:
2148 * src/frontends/kde/FormToc.h:
2149 * src/frontends/kde/FormUrl.h: fix remaining users of
2152 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2154 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2155 from depth argument.
2156 (DocBookHandleCaption): ditto.
2157 (DocBookHandleFootnote): ditto.
2158 (SimpleDocBookOnePar): ditto.
2160 * src/frontends/xforms/FormDocument.h (form): remove extra
2161 FormDocument:: qualifier.
2163 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2165 * sigc++/handle.h: ditto.
2167 * src/lyx_gui_misc.C: add "using" directive.
2169 * src/cheaders/cstddef: new file, needed by the boost library (for
2172 2000-10-02 Juergen Vigna <jug@sad.it>
2174 * src/insets/insettext.C (SetFont): better support.
2176 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2178 * src/screen.C (DrawOneRow): some uint refixes!
2180 2000-10-02 Allan Rae <rae@lyx.org>
2182 * boost/.cvsignore: ignore Makefile as well
2184 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2185 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2187 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2188 Left this one out by accident.
2190 * src/frontends/xforms/FormBase.h (restore): default to calling
2191 update() since that will restore the original/currently-applied values.
2192 Any input() triggered error messages will require the derived classes
2193 to redefine restore().
2195 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2196 avoid a segfault. combo_doc_class is the main concern.
2198 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2200 * Simplify build-listerrors in view of GUI-less export ability!
2202 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2204 * src/lyx_main.C (easyParse): Disable gui when exporting
2206 * src/insets/figinset.C:
2209 * src/lyx_gui_misc.C
2210 * src/tabular.C: Changes to allow no-gui.
2212 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2214 * src/support/utility.hpp: removed file
2215 * src/support/block.h: removed file
2217 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2220 * src/mathed/formula.C: add support/lyxlib.h
2221 * src/mathed/formulamacro.C: ditto
2223 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2224 * src/lyxparagraph.h: ditto
2226 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2227 * src/frontends/Makefile.am (INCLUDES): ditto
2228 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2229 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2230 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2231 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2232 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2233 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2235 * src/BufferView.h: use boost/utility.hpp
2236 * src/LColor.h: ditto
2237 * src/LaTeX.h: ditto
2238 * src/LyXAction.h: ditto
2239 * src/LyXView.h: ditto
2240 * src/bufferlist.h: ditto
2241 * src/lastfiles.h: ditto
2242 * src/layout.h: ditto
2243 * src/lyx_gui.h: ditto
2244 * src/lyx_main.h: ditto
2245 * src/lyxlex.h: ditto
2246 * src/lyxrc.h: ditto
2247 * src/frontends/ButtonPolicies.h: ditto
2248 * src/frontends/Dialogs.h: ditto
2249 * src/frontends/xforms/FormBase.h: ditto
2250 * src/frontends/xforms/FormGraphics.h: ditto
2251 * src/frontends/xforms/FormParagraph.h: ditto
2252 * src/frontends/xforms/FormTabular.h: ditto
2253 * src/graphics/GraphicsCache.h: ditto
2254 * src/graphics/Renderer.h: ditto
2255 * src/insets/ExternalTemplate.h: ditto
2256 * src/insets/insetcommand.h: ditto
2257 * src/support/path.h: ditto
2259 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2260 and introduce clause for 2.97.
2262 * boost/libs/README: new file
2264 * boost/boost/utility.hpp: new file
2266 * boost/boost/config.hpp: new file
2268 * boost/boost/array.hpp: new file
2270 * boost/Makefile.am: new file
2272 * boost/.cvsignore: new file
2274 * configure.in (AC_OUTPUT): add boost/Makefile
2276 * Makefile.am (SUBDIRS): add boost
2278 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2280 * src/support/lstrings.C (suffixIs): Fixed.
2282 2000-10-01 Allan Rae <rae@lyx.org>
2284 * src/PrinterParams.h: moved things around to avoid the "can't
2285 inline call" warning.
2287 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2288 into doc++ documentation.
2290 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2292 * src/frontends/xforms/FormRef.C: make use of button controller
2293 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2294 cleaned up button controller usage.
2295 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2296 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2297 use the button controller
2299 * src/frontends/xforms/forms/*.fd: and associated generated files
2300 updated to reflect changes to FormBase. Some other FormXxxx files
2301 also got minor updates to reflect changes to FormBase.
2303 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2304 (hide): made virtual.
2305 (input): return a bool. true == valid input
2306 (RestoreCB, restore): new
2307 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2308 Changes to allow derived dialogs to use a ButtonController and
2309 make sense when doing so: OK button calls ok() and so on.
2311 * src/frontends/xforms/ButtonController.h (class ButtonController):
2312 Switch from template implementation to taking Policy parameter.
2313 Allows FormBase to provide a ButtonController for any dialog.
2315 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2316 Probably should rename connect and disconnect.
2317 (apply): use the radio button groups
2318 (form): needed by FormBase
2319 (build): setup the radio button groups
2321 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2323 * several files: type changes to reduce the number of warnings and
2324 to unify type hangling a bit. Still much to do.
2326 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2328 * lib/images/*: rename a bunch of icons to match Dekel converter
2331 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2334 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2336 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2338 * sigc++/handle.h: ditto for class Handle.
2340 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2342 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2344 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2346 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2347 removal of the "default" language.
2349 * src/combox.h (getline): Check that sel > 0
2351 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2353 * lib/examples/docbook_example.lyx
2354 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2356 * lib/layouts/docbook-book.layout: new docbook book layout.
2358 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2360 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2362 * src/insets/figinset.C (DocBook):fixed small typo.
2364 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2366 * src/insets/insetinclude.h: string include_label doesn't need to be
2369 2000-09-29 Allan Rae <rae@lyx.org>
2371 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2372 Allow derived type to control connection and disconnection from signals
2373 of its choice if desired.
2375 2000-09-28 Juergen Vigna <jug@sad.it>
2377 * src/insets/insettabular.C (update): fixed cursor setting when
2378 the_locking_inset changed.
2379 (draw): made this a bit cleaner.
2380 (InsetButtonPress): fixed!
2382 * various files: added LyXText Parameter to fitCursor call.
2384 * src/BufferView.C (fitCursor): added LyXText parameter.
2386 * src/insets/insettabular.C (draw): small draw fix.
2388 * src/tabular.C: right setting of left/right celllines.
2390 * src/tabular.[Ch]: fixed various types in funcions and structures.
2391 * src/insets/insettabular.C: ditto
2392 * src/frontends/xforms/FormTabular.C: ditto
2394 2000-09-28 Allan Rae <rae@lyx.org>
2396 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2397 that the #ifdef's had been applied to part of what should have been
2398 a complete condition. It's possible there are other tests that
2399 were specific to tables that are also wrong now that InsetTabular is
2400 being used. Now we need to fix the output of '\n' after a table in a
2401 float for the same reason as the original condition:
2402 "don't insert this if we would be adding it before or after a table
2403 in a float. This little trick is needed in order to allow use of
2404 tables in \subfigures or \subtables."
2405 Juergen can you check this?
2407 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2409 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2410 output to the ostream.
2412 * several files: fixed types based on warnings from cxx
2414 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2416 * src/frontends/kde/Makefile.am: fix rule for
2417 formindexdialogdata_moc.C
2419 * src/.cvsignore: add ext_l10n.h to ignore
2421 * acconfig.h: stop messing with __STRICT_ANSI__
2422 * config/gnome.m4: remove option to set -ansi
2423 * config/kde.m4: remove option to set -ansi
2424 * config/lyxinclude.m4: don't set -ansi
2426 2000-09-27 Juergen Vigna <jug@sad.it>
2428 * various files: remove "default" language check.
2430 * src/insets/insetquotes.C: removed use of current_view.
2432 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2433 the one should have red ears by now!
2435 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2436 in more then one paragraph. Fixed cursor-movement/selection.
2438 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2439 paragraphs inside a text inset.
2441 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2442 text-inset if this owner is an inset.
2444 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2446 * src/Bullet.h: changed type of font, character and size to int
2448 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2450 * src/insets/inseturl.[Ch]:
2451 * src/insets/insetref.[Ch]:
2452 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2454 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2456 * src/buffer.C (readFile): block-if statement rearranged to minimise
2457 bloat. Patch does not reverse Jean-Marc's change ;-)
2459 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2460 Class rewritten to store pointers to hide/update signals directly,
2461 rather than Dialogs *. Also defined an enum to ease use. All xforms
2462 forms can now be derived from this class.
2464 * src/frontends/xforms/FormCommand.[Ch]
2465 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2467 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2470 * src/frontends/xforms/forms/form_citation.fd
2471 * src/frontends/xforms/forms/form_copyright.fd
2472 * src/frontends/xforms/forms/form_error.fd
2473 * src/frontends/xforms/forms/form_index.fd
2474 * src/frontends/xforms/forms/form_ref.fd
2475 * src/frontends/xforms/forms/form_toc.fd
2476 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2478 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2480 * src/insets/insetfoot.C: removed redundent using directive.
2482 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2484 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2485 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2487 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2488 created in the constructors in different groups. Then set() just
2489 have to show the groups as needed. This fixes the redraw problems
2490 (and is how the old menu code worked).
2492 * src/support/lyxlib.h: declare the methods as static when we do
2493 not have namespaces.
2495 2000-09-26 Juergen Vigna <jug@sad.it>
2497 * src/buffer.C (asciiParagraph): new function.
2498 (writeFileAscii): new function with parameter ostream.
2499 (writeFileAscii): use now asciiParagraph.
2501 * various inset files: added the linelen parameter to the Ascii-func.
2503 * src/tabular.C (Write): fixed error in writing file introduced by
2504 the last changes from Lars.
2506 * lib/bind/menus.bind: removed not supported functions.
2508 * src/insets/insettext.C (Ascii): implemented this function.
2510 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2512 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2513 (Write): use of the write_attribute functions.
2515 * src/bufferlist.C (close): fixed reasking question!
2517 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2519 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2520 new files use the everwhere possible.
2523 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2524 src/log_form.C src/lyx.C:
2527 * src/buffer.C (runLaTeX): remove func
2529 * src/PaperLayout.C: removed file
2530 * src/ParagraphExtra.C: likewise
2531 * src/bullet_forms.C: likewise
2532 * src/bullet_forms.h: likewise
2533 * src/bullet_forms_cb.C: likewise
2535 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2536 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2539 * several files: remove all traces of the old fd_form_paragraph,
2540 and functions belonging to that.
2542 * several files: remove all traces of the old fd_form_document,
2543 and functions belonging to that.
2545 * several files: constify local variables were possible.
2547 * several files: remove all code that was dead when NEW_EXPORT was
2550 * several files: removed string::c_str in as many places as
2553 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2554 (e): be a bit more outspoken when patching
2555 (updatesrc): only move files if changed.
2557 * forms/layout_forms.h.patch: regenerated
2559 * forms/layout_forms.fd: remove form_document and form_paragraph
2560 and form_quotes and form_paper and form_table_options and
2561 form_paragraph_extra
2563 * forms/form1.fd: remove form_table
2565 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2566 the fdui->... rewrite. Update some comments to xforms 0.88
2568 * forms/bullet_forms.C.patch: removed file
2569 * forms/bullet_forms.fd: likewise
2570 * forms/bullet_forms.h.patch: likewise
2572 * development/Code_rules/Rules: added a section on switch
2573 statements. Updated some comment to xforms 0.88.
2575 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2577 * src/buffer.C (readFile): make sure that the whole version number
2578 is read after \lyxformat (even when it contains a comma)
2580 * lib/ui/default.ui: change shortcut of math menu to M-a.
2582 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2584 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2587 * src/LyXView.C (updateWindowTitle): show the full files name in
2588 window title, limited to 30 characters.
2590 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2591 When a number of characters has been given, we should not assume
2592 that the string is 0-terminated.
2594 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2595 calls (fixes some memory leaks)
2597 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2598 trans member on exit.
2600 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2602 * src/converter.C (GetReachable): fix typo.
2604 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2605 understand ',' instead of '.'.
2606 (GetInteger): rewrite to use strToInt().
2608 2000-09-26 Juergen Vigna <jug@sad.it>
2610 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2611 better visibility and error-message on wrong VSpace input.
2613 * src/language.C (initL): added english again.
2615 2000-09-25 Juergen Vigna <jug@sad.it>
2617 * src/frontends/kde/Dialogs.C (Dialogs):
2618 * src/frontends/gnome/Dialogs.C (Dialogs):
2619 * src/frontends/kde/Makefile.am:
2620 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2622 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2624 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2626 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2628 * src/frontends/xforms/FormParagraph.C:
2629 * src/frontends/xforms/FormParagraph.h:
2630 * src/frontends/xforms/form_paragraph.C:
2631 * src/frontends/xforms/form_paragraph.h:
2632 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2635 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2637 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2638 Paragraph-Data after use.
2640 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2641 non breakable paragraphs.
2643 2000-09-25 Garst R. Reese <reese@isn.net>
2645 * src/language.C (initL): added missing language_country codes.
2647 2000-09-25 Juergen Vigna <jug@sad.it>
2649 * src/insets/insettext.C (InsetText):
2650 (deleteLyXText): remove the not released LyXText structure!
2652 2000-09-24 Marko Vendelin <markov@ioc.ee>
2654 * src/frontends/gnome/mainapp.C
2655 * src/frontends/gnome/mainapp.h: added support for keyboard
2658 * src/frontends/gnome/FormCitation.C
2659 * src/frontends/gnome/FormCitation.h
2660 * src/frontends/gnome/Makefile.am
2661 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2662 FormCitation to use "action area" in mainapp window
2664 * src/frontends/gnome/Menubar_pimpl.C
2665 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2668 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2670 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2671 width/descent/ascent values if name is empty.
2672 (mathed_string_height): Use std::max.
2674 2000-09-25 Allan Rae <rae@lyx.org>
2676 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2677 segfault. This will be completely redesigned soon.
2679 * sigc++: updated libsigc++. Fixes struct timespec bug.
2681 * development/tools/makeLyXsigc.sh: .cvsignore addition
2683 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2685 * several files: removed almost all traces of the old table
2688 * src/TableLayout.C: removed file
2690 2000-09-22 Juergen Vigna <jug@sad.it>
2692 * src/frontends/kde/Dialogs.C: added credits forms.
2694 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2696 * src/frontends/gnome/Dialogs.C: added some forms.
2698 * src/spellchecker.C (init_spell_checker): set language in pspell code
2699 (RunSpellChecker): some modifications for setting language string.
2701 * src/language.[Ch]: added language_country code.
2703 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2705 * src/frontends/Dialogs.h: added new signal showError.
2706 Rearranged existing signals in some sort of alphabetical order.
2708 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2709 FormError.[Ch], form_error.[Ch]
2710 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2711 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2713 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2714 dialogs. I think that this can be used as the base to all these
2717 * src/frontends/xforms/FormError.[Ch]
2718 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2719 implementation of InsetError dialog.
2721 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2723 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2724 * src/frontends/kde/Makefile.am: ditto
2726 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2728 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2729 macrobf. This fixes a bug of invisible text.
2731 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2733 * lib/doc/LaTeXConfig.lyx.in: updated.
2735 * src/language.C (initL): remove language "francais" and change a
2736 bit the names of the two other french variations.
2738 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2739 string that may not be 0-terminated.
2741 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2743 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2745 2000-09-20 Marko Vendelin <markov@ioc.ee>
2747 * src/frontends/gnome/FormCitation.C
2748 * src/frontends/gnome/FormIndex.C
2749 * src/frontends/gnome/FormToc.C
2750 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2751 the variable initialization to shut up the warnings
2753 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2755 * src/table.[Ch]: deleted files
2757 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2760 2000-09-18 Juergen Vigna <jug@sad.it>
2762 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2763 problems with selection. Inserted new LFUN_PASTESELECTION.
2764 (InsetButtonPress): inserted handling of middle mouse-button paste.
2766 * src/spellchecker.C: changed word to word.c_str().
2768 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2770 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2771 included in the ``make dist'' tarball.
2773 2000-09-15 Juergen Vigna <jug@sad.it>
2775 * src/CutAndPaste.C (cutSelection): small fix return the right
2776 end position after cut inside one paragraph only.
2778 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2779 we are locked as otherwise we don't have a valid cursor position!
2781 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2783 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2785 * src/frontends/kde/FormRef.C: added using directive.
2786 * src/frontends/kde/FormToc.C: ditto
2788 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2790 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2792 2000-09-19 Marko Vendelin <markov@ioc.ee>
2794 * src/frontends/gnome/Menubar_pimpl.C
2795 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2796 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2798 * src/frontends/gnome/mainapp.C
2799 * src/frontends/gnome/mainapp.h: support for menu update used
2802 * src/frontends/gnome/mainapp.C
2803 * src/frontends/gnome/mainapp.h: support for "action" area in the
2804 main window. This area is used by small simple dialogs, such as
2807 * src/frontends/gnome/FormIndex.C
2808 * src/frontends/gnome/FormIndex.h
2809 * src/frontends/gnome/FormUrl.C
2810 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2813 * src/frontends/gnome/FormCitation.C
2814 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2815 action area. Only "Insert new citation" is implemented.
2817 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2819 * src/buffer.C (Dispatch): fix call to Dispatch
2820 * src/insets/insetref.C (Edit): likewise
2821 * src/insets/insetparent.C (Edit): likewise
2822 * src/insets/insetinclude.C (include_cb): likewise
2823 * src/frontends/xforms/FormUrl.C (apply): likewise
2824 * src/frontends/xforms/FormToc.C (apply): likewise
2825 * src/frontends/xforms/FormRef.C (apply): likewise
2826 * src/frontends/xforms/FormIndex.C (apply): likewise
2827 * src/frontends/xforms/FormCitation.C (apply): likewise
2828 * src/lyxserver.C (callback): likewise
2829 * src/lyxfunc.C (processKeySym): likewise
2830 (Dispatch): likewise
2831 (Dispatch): likewise
2832 * src/lyx_cb.C (LayoutsCB): likewise
2834 * Makefile.am (sourcedoc): small change
2836 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2838 * src/main.C (main): Don't make an empty GUIRunTime object. all
2839 methods are static. constify a bit remove unneded using + headers.
2841 * src/tabular.C: some more const to local vars move some loop vars
2843 * src/spellchecker.C: added some c_str after some word for pspell
2845 * src/frontends/GUIRunTime.h: add new static method setDefaults
2846 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2847 * src/frontends/kde/GUIRunTime.C (setDefaults):
2848 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2850 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2851 with strnew in arg, use correct emptystring when calling SetName.
2853 * several files: remove all commented code with relation to
2854 HAVE_SSTREAM beeing false. We now only support stringstream and
2857 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2859 * src/lyxfunc.C: construct correctly the automatic new file
2862 * src/text2.C (IsStringInText): change type of variable i to shut
2865 * src/support/sstream.h: do not use namespaces if the compiler
2866 does not support them.
2868 2000-09-15 Marko Vendelin <markov@ioc.ee>
2869 * src/frontends/gnome/FormCitation.C
2870 * src/frontends/gnome/FormCitation.h
2871 * src/frontends/gnome/diainsertcitation_interface.c
2872 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2873 regexp support to FormCitation [Gnome].
2875 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2878 * configure.in: remove unused KDE/GTKGUI define
2880 * src/frontends/kde/FormRef.C
2881 * src/frontends/kde/FormRef.h
2882 * src/frontends/kde/formrefdialog.C
2883 * src/frontends/kde/formrefdialog.h: double click will
2884 go to reference, now it is possible to change a cross-ref
2887 * src/frontends/kde/FormToc.C
2888 * src/frontends/kde/FormToc.h
2889 * src/frontends/kde/formtocdialog.C
2890 * src/frontends/kde/formtocdialog.h: add a depth
2893 * src/frontends/kde/Makefile.am: add QtLyXView.h
2896 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2898 * src/frontends/kde/FormCitation.h: added some using directives.
2900 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2902 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2905 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2908 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2910 * src/buffer.C (pop_tag): revert for the second time a change by
2911 Lars, who seems to really hate having non-local loop variables :)
2913 * src/Lsstream.h: add "using" statements.
2915 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2916 * src/buffer.C (writeFile): ditto
2918 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2920 * src/buffer.C (writeFile): try to fix the locale modified format
2921 number to always be as we want it.
2923 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2924 in XForms 0.89. C-space is now working again.
2926 * src/Lsstream.h src/support/sstream.h: new files.
2928 * also commented out all cases where strstream were used.
2930 * src/Bullet.h (c_str): remove method.
2932 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2934 * a lot of files: get rid of "char const *" and "char *" is as
2935 many places as possible. We only want to use them in interaction
2936 with system of other libraries, not inside lyx.
2938 * a lot of files: return const object is not of pod type. This
2939 helps ensure that temporary objects is not modified. And fits well
2940 with "programming by contract".
2942 * configure.in: check for the locale header too
2944 * Makefile.am (sourcedoc): new tag for generation of doc++
2947 2000-09-14 Juergen Vigna <jug@sad.it>
2949 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2950 callback to check which combo called it and do the right action.
2952 * src/combox.C (combo_cb): added combo * to the callbacks.
2953 (Hide): moved call of callback after Ungrab of the pointer.
2955 * src/intl.h: removed LCombo2 function.
2957 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2958 function as this can now be handled in one function.
2960 * src/combox.h: added Combox * to callback prototype.
2962 * src/frontends/xforms/Toolbar_pimpl.C:
2963 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2965 2000-09-14 Garst Reese <reese@isn.net>
2967 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2968 moved usepackage{xxx}'s to beginning of file. Changed left margin
2969 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2970 underlining from title. Thanks to John Culleton for useful suggestions.
2972 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2974 * src/lyxlex_pimpl.C (setFile): change error message to debug
2977 2000-09-13 Juergen Vigna <jug@sad.it>
2979 * src/frontends/xforms/FormDocument.C: implemented choice_class
2980 as combox and give callback to combo_language so OK/Apply is activated
2983 * src/bufferlist.C (newFile): small fix so already named files
2984 (via an open call) are not requested to be named again on the
2987 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2989 * src/frontends/kde/Makefile.am
2990 * src/frontends/kde/FormRef.C
2991 * src/frontends/kde/FormRef.h
2992 * src/frontends/kde/formrefdialog.C
2993 * src/frontends/kde/formrefdialog.h: implement
2996 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2998 * src/frontends/kde/formtocdialog.C
2999 * src/frontends/kde/formtocdialog.h
3000 * src/frontends/kde/FormToc.C
3001 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3003 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3005 * src/frontends/kde/FormCitation.C: fix thinko
3006 where we didn't always display the reference text
3009 * src/frontends/kde/formurldialog.C
3010 * src/frontends/kde/formurldialog.h
3011 * src/frontends/kde/FormUrl.C
3012 * src/frontends/kde/FormUrl.h: minor cleanups
3014 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3016 * src/frontends/kde/Makefile.am
3017 * src/frontends/kde/FormToc.C
3018 * src/frontends/kde/FormToc.h
3019 * src/frontends/kde/FormCitation.C
3020 * src/frontends/kde/FormCitation.h
3021 * src/frontends/kde/FormIndex.C
3022 * src/frontends/kde/FormIndex.h
3023 * src/frontends/kde/formtocdialog.C
3024 * src/frontends/kde/formtocdialog.h
3025 * src/frontends/kde/formcitationdialog.C
3026 * src/frontends/kde/formcitationdialog.h
3027 * src/frontends/kde/formindexdialog.C
3028 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3030 2000-09-12 Juergen Vigna <jug@sad.it>
3032 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3035 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3037 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3040 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3042 * src/converter.C (Add, Convert): Added support for converter flags:
3043 needaux, resultdir, resultfile.
3044 (Convert): Added new parameter view_file.
3045 (dvips_options): Fixed letter paper option.
3047 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3048 (Export, GetExportableFormats, GetViewableFormats): Added support
3051 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3053 (easyParse): Fixed to work with new export code.
3055 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3058 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3060 * lib/bind/*.bind: Replaced
3061 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3062 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3064 2000-09-11 Juergen Vigna <jug@sad.it>
3066 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3068 * src/main.C (main): now GUII defines global guiruntime!
3070 * src/frontends/gnome/GUIRunTime.C (initApplication):
3071 * src/frontends/kde/GUIRunTime.C (initApplication):
3072 * src/frontends/xforms/GUIRunTime.C (initApplication):
3073 * src/frontends/GUIRunTime.h: added new function initApplication.
3075 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3077 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3079 2000-09-08 Juergen Vigna <jug@sad.it>
3081 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3082 we have already "Reset".
3084 * src/language.C (initL): inserted "default" language and made this
3085 THE default language (and not american!)
3087 * src/paragraph.C: inserted handling of "default" language!
3089 * src/lyxfont.C: ditto
3093 * src/paragraph.C: output the \\par only if we have a following
3094 paragraph otherwise it's not needed.
3096 2000-09-05 Juergen Vigna <jug@sad.it>
3098 * config/pspell.m4: added entry to lyx-flags
3100 * src/spellchecker.C: modified version from Kevin for using pspell
3102 2000-09-01 Marko Vendelin <markov@ioc.ee>
3103 * src/frontends/gnome/Makefile.am
3104 * src/frontends/gnome/FormCitation.C
3105 * src/frontends/gnome/FormCitation.h
3106 * src/frontends/gnome/diainsertcitation_callbacks.c
3107 * src/frontends/gnome/diainsertcitation_callbacks.h
3108 * src/frontends/gnome/diainsertcitation_interface.c
3109 * src/frontends/gnome/diainsertcitation_interface.h
3110 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3111 dialog for Gnome frontend
3113 * src/main.C: Gnome libraries require keeping application name
3114 and its version as strings
3116 * src/frontends/gnome/mainapp.C: Change the name of the main window
3117 from GnomeLyX to PACKAGE
3119 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3121 * src/frontends/Liason.C: add "using: declaration.
3123 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3125 * src/mathed/math_macro.C (Metrics): Set the size of the template
3127 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3129 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3131 * src/converter.C (add_options): New function.
3132 (SetViewer): Change $$FName into '$$FName'.
3133 (View): Add options when running xdvi
3134 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3135 (Convert): The 3rd parameter is now the desired filename. Converts
3136 calls to lyx::rename if necessary.
3137 Add options when running dvips.
3138 (dvi_papersize,dvips_options): New methods.
3140 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3142 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3143 using a call to Converter::dvips_options.
3144 Fixed to work with nex export code.
3146 * src/support/copy.C
3147 * src/support/rename.C: New files
3149 * src/support/syscall.h
3150 * src/support/syscall.C: Added Starttype SystemDontWait.
3152 * lib/ui/default.ui: Changed to work with new export code
3154 * lib/configure.m4: Changed to work with new export code
3156 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3158 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3160 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3161 so that code compiles with DEC cxx.
3163 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3164 to work correctly! Also now supports the additional elements
3167 2000-09-01 Allan Rae <rae@lyx.org>
3169 * src/frontends/ButtonPolicies.C: renamed all the references to
3170 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3172 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3173 since it's a const not a type.
3175 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3177 2000-08-31 Juergen Vigna <jug@sad.it>
3179 * src/insets/figinset.C: Various changes to look if the filename has
3180 an extension and if not add it for inline previewing.
3182 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3184 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3185 make buttonStatus and isReadOnly be const methods. (also reflect
3186 this in derived classes.)
3188 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3189 (nextState): change to be static inline, pass the StateMachine as
3191 (PreferencesPolicy): remove casts
3192 (OkCancelPolicy): remvoe casts
3193 (OkCancelReadOnlyPolicy): remove casts
3194 (NoRepeatedApplyReadOnlyPolicy): remove casts
3195 (OkApplyCancelReadOnlyPolicy): remove casts
3196 (OkApplyCancelPolicy): remove casts
3197 (NoRepeatedApplyPolicy): remove casts
3199 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3201 * src/converter.C: added some using directives
3203 * src/frontends/ButtonPolicies.C: changes to overcome
3204 "need lvalue" error with DEC c++
3206 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3207 to WMHideCB for DEC c++
3209 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3211 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3212 to BulletBMTableCB for DEC c++
3214 2000-08-31 Allan Rae <rae@lyx.org>
3216 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3217 character dialog separately from old document dialogs combo_language.
3220 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3222 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3223 Removed LFUN_REF_CREATE.
3225 * src/MenuBackend.C: Added new tags: toc and references
3227 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3228 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3230 (add_toc, add_references): New methods.
3231 (create_submenu): Handle correctly the case when there is a
3232 seperator after optional menu items.
3234 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3235 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3236 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3238 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3240 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3242 * src/converter.[Ch]: New file for converting between different
3245 * src/export.[Ch]: New file for exporting a LyX file to different
3248 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3249 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3250 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3251 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3252 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3253 RunDocBook, MenuExport.
3255 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3256 Exporter::Preview methods if NEW_EXPORT is defined.
3258 * src/buffer.C (Dispatch): Use Exporter::Export.
3260 * src/lyxrc.C: Added new tags: \converter and \viewer.
3263 * src/LyXAction.C: Define new lyx-function: buffer-update.
3264 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3265 when NEW_EXPORT is defined.
3267 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3269 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3271 * lib/ui/default.ui: Added submenus "view" and "update" to the
3274 * src/filetools.C (GetExtension): New function.
3276 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3278 2000-08-29 Allan Rae <rae@lyx.org>
3280 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3282 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3283 (EnableDocumentLayout): removed
3284 (DisableDocumentLayout): removed
3285 (build): make use of ButtonController's read-only handling to
3286 de/activate various objects. Replaces both of the above functions.
3288 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3289 (readOnly): was read_only
3290 (refresh): fixed dumb mistakes with read_only_ handling
3292 * src/frontends/xforms/forms/form_document.fd:
3293 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3294 tabbed dialogs so the tabs look more like tabs and so its easier to
3295 work out which is the current tab.
3297 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3298 segfault with form_table
3300 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3302 2000-08-28 Juergen Vigna <jug@sad.it>
3304 * acconfig.h: added USE_PSPELL.
3306 * src/config.h.in: added USE_PSPELL.
3308 * autogen.sh: added pspell.m4
3310 * config/pspell.m4: new file.
3312 * src/spellchecker.C: implemented support for pspell libary.
3314 2000-08-25 Juergen Vigna <jug@sad.it>
3316 * src/LyXAction.C (init): renamed LFUN_TABLE to
3317 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3319 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3321 * src/lyxscreen.h: add force_clear variable and fuction to force
3322 a clear area when redrawing in LyXText.
3324 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3326 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3328 * some whitespace and comment changes.
3330 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3332 * src/buffer.C: up te LYX_FORMAT to 2.17
3334 2000-08-23 Juergen Vigna <jug@sad.it>
3336 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3339 * src/insets/insettabular.C (pasteSelection): delete the insets
3340 LyXText as it is not valid anymore.
3341 (copySelection): new function.
3342 (pasteSelection): new function.
3343 (cutSelection): new function.
3344 (LocalDispatch): implemented cut/copy/paste of cell selections.
3346 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3347 don't have a LyXText.
3349 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3351 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3354 2000-08-22 Juergen Vigna <jug@sad.it>
3356 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3357 ifdef form_table out if NEW_TABULAR.
3359 2000-08-21 Juergen Vigna <jug@sad.it>
3361 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3362 (draw): fixed draw position so that the cursor is positioned in the
3364 (InsetMotionNotify): hide/show cursor so the position is updated.
3365 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3366 using cellstart() function where it should be used.
3368 * src/insets/insettext.C (draw): ditto.
3370 * src/tabular.C: fixed initialization of some missing variables and
3371 made BoxType into an enum.
3373 2000-08-22 Marko Vendelin <markov@ioc.ee>
3374 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3375 stock menu item using action numerical value, not its string
3379 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3381 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3382 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3384 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3386 * src/frontends/xforms/GUIRunTime.C: new file
3388 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3389 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3391 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3393 * src/frontends/kde/GUIRunTime.C: new file
3395 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3396 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3398 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3400 * src/frontends/gnome/GUIRunTime.C: new file
3402 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3405 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3406 small change to documetentation.
3408 * src/frontends/GUIRunTime.C: removed file
3410 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3412 * src/lyxparagraph.h: enable NEW_TABULAR as default
3414 * src/lyxfunc.C (processKeySym): remove some commented code
3416 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3417 NEW_TABULAR around the fd_form_table_options.
3419 * src/lyx_gui.C (runTime): call the static member function as
3420 GUIRunTime::runTime().
3422 2000-08-21 Allan Rae <rae@lyx.org>
3424 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3427 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3429 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3431 2000-08-21 Allan Rae <rae@lyx.org>
3433 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3434 keep Garst happy ;-)
3435 * src/frontends/xforms/FormPreferences.C (build): use setOK
3436 * src/frontends/xforms/FormDocument.C (build): use setOK
3437 (FormDocument): use the appropriate policy.
3439 2000-08-21 Allan Rae <rae@lyx.org>
3441 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3442 automatic [de]activation of arbitrary objects when in a read-only state.
3444 * src/frontends/ButtonPolicies.h: More documentation
3445 (isReadOnly): added to support the above.
3447 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3449 2000-08-18 Juergen Vigna <jug@sad.it>
3451 * src/insets/insettabular.C (getStatus): changed to return func_status.
3453 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3454 display toggle menu entries if they are.
3456 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3457 new document layout now.
3459 * src/lyxfunc.C: ditto
3461 * src/lyx_gui_misc.C: ditto
3463 * src/lyx_gui.C: ditto
3465 * lib/ui/default.ui: removed paper and quotes layout as they are now
3466 all in the document layout tabbed folder.
3468 * src/frontends/xforms/forms/form_document.fd: added Restore
3469 button and callbacks for all inputs for Allan's ButtonPolicy.
3471 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3472 (CheckChoiceClass): added missing params setting on class change.
3473 (UpdateLayoutDocument): added for updating the layout on params.
3474 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3475 (FormDocument): Implemented Allan's ButtonPolicy with the
3478 2000-08-17 Allan Rae <rae@lyx.org>
3480 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3481 so we can at least see the credits again.
3483 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3484 controller calls for the appropriate callbacks. Note that since Ok
3485 calls apply followed by cancel, and apply isn't a valid input for the
3486 APPLIED state, the bc_ calls have to be made in the static callback not
3487 within each of the real callbacks.
3489 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3490 (setOk): renamed from setOkay()
3492 2000-08-17 Juergen Vigna <jug@sad.it>
3494 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3495 in the implementation part.
3496 (composeUIInfo): don't show optional menu-items.
3498 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3500 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3502 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3503 text-state when in a text-inset.
3505 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3507 2000-08-17 Marko Vendelin <markov@ioc.ee>
3508 * src/frontends/gnome/FormIndex.C
3509 * src/frontends/gnome/FormIndex.h
3510 * src/frontends/gnome/FormToc.C
3511 * src/frontends/gnome/FormToc.h
3512 * src/frontends/gnome/dialogs
3513 * src/frontends/gnome/diatoc_callbacks.c
3514 * src/frontends/gnome/diatoc_callbacks.h
3515 * src/frontends/gnome/diainsertindex_callbacks.h
3516 * src/frontends/gnome/diainsertindex_callbacks.c
3517 * src/frontends/gnome/diainsertindex_interface.c
3518 * src/frontends/gnome/diainsertindex_interface.h
3519 * src/frontends/gnome/diatoc_interface.h
3520 * src/frontends/gnome/diatoc_interface.c
3521 * src/frontends/gnome/Makefile.am: Table of Contents and
3522 Insert Index dialogs implementation for Gnome frontend
3524 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3526 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3528 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3531 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3533 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3534 destructor. Don't definde if you don't need it
3535 (processEvents): made static, non-blocking events processing for
3537 (runTime): static method. event loop for xforms
3538 * similar as above for kde and gnome.
3540 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3541 new Pimpl is correct
3542 (runTime): new method calss the real frontends runtime func.
3544 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3546 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3548 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3550 2000-08-16 Juergen Vigna <jug@sad.it>
3552 * src/lyx_gui.C (runTime): added GUII RunTime support.
3554 * src/frontends/Makefile.am:
3555 * src/frontends/GUIRunTime.[Ch]:
3556 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3557 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3558 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3560 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3562 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3563 as this is already set in ${FRONTEND_INCLUDE} if needed.
3565 * configure.in (CPPFLAGS): setting the include dir for the frontend
3566 directory and don't set FRONTEND=xforms for now as this is executed
3569 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3571 * src/frontends/kde/Makefile.am:
3572 * src/frontends/kde/FormUrl.C:
3573 * src/frontends/kde/FormUrl.h:
3574 * src/frontends/kde/formurldialog.h:
3575 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3577 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3579 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3581 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3583 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3586 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3588 * src/WorkArea.C (work_area_handler): more work to get te
3589 FL_KEYBOARD to work with xforms 0.88 too, please test.
3591 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3593 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3595 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3598 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3600 * src/Timeout.h: remove Qt::emit hack.
3602 * several files: changes to allo doc++ compilation
3604 * src/lyxfunc.C (processKeySym): new method
3605 (processKeyEvent): comment out if FL_REVISION < 89
3607 * src/WorkArea.C: change some debugging levels.
3608 (WorkArea): set wantkey to FL_KEY_ALL
3609 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3610 clearer code and the use of compose with XForms 0.89. Change to
3611 use signals instead of calling methods in bufferview directly.
3613 * src/Painter.C: change some debugging levels.
3615 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3618 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3619 (workAreaKeyPress): new method
3621 2000-08-14 Juergen Vigna <jug@sad.it>
3623 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3625 * config/kde.m4: addes some features
3627 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3628 include missing xforms dialogs.
3630 * src/Timeout.h: a hack to be able to compile with qt/kde.
3632 * sigc++/.cvsignore: added acinclude.m4
3634 * lib/.cvsignore: added listerros
3636 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3637 xforms tree as objects are needed for other frontends.
3639 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3640 linking with not yet implemented xforms objects.
3642 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3644 2000-08-14 Baruch Even <baruch.even@writeme.com>
3646 * src/frontends/xforms/FormGraphics.h:
3647 * src/frontends/xforms/FormGraphics.C:
3648 * src/frontends/xforms/RadioButtonGroup.h:
3649 * src/frontends/xforms/RadioButtonGroup.C:
3650 * src/insets/insetgraphics.h:
3651 * src/insets/insetgraphics.C:
3652 * src/insets/insetgraphicsParams.h:
3653 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3654 instead of spaces, and various other indentation issues to make the
3655 sources more consistent.
3657 2000-08-14 Marko Vendelin <markov@ioc.ee>
3659 * src/frontends/gnome/dialogs/diaprint.glade
3660 * src/frontends/gnome/FormPrint.C
3661 * src/frontends/gnome/FormPrint.h
3662 * src/frontends/gnome/diaprint_callbacks.c
3663 * src/frontends/gnome/diaprint_callbacks.h
3664 * src/frontends/gnome/diaprint_interface.c
3665 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3668 * src/frontends/gnome/dialogs/diainserturl.glade
3669 * src/frontends/gnome/FormUrl.C
3670 * src/frontends/gnome/FormUrl.h
3671 * src/frontends/gnome/diainserturl_callbacks.c
3672 * src/frontends/gnome/diainserturl_callbacks.h
3673 * src/frontends/gnome/diainserturl_interface.c
3674 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3675 Gnome implementation
3677 * src/frontends/gnome/Dialogs.C
3678 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3679 all other dialogs. Copy all unimplemented dialogs from Xforms
3682 * src/frontends/gnome/support.c
3683 * src/frontends/gnome/support.h: support files generated by Glade
3687 * config/gnome.m4: Gnome configuration scripts
3689 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3690 configure --help message
3692 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3693 only if there are no events pendling in Gnome/Gtk. This enhances
3694 the performance of menus.
3697 2000-08-14 Allan Rae <rae@lyx.org>
3699 * lib/Makefile.am: listerrors cleaning
3701 * lib/listerrors: removed -- generated file
3702 * acinclude.m4: ditto
3703 * sigc++/acinclude.m4: ditto
3705 * src/frontends/xforms/forms/form_citation.fd:
3706 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3709 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3710 `updatesrc` and now we have a `test` target that does what `updatesrc`
3711 used to do. I didn't like having an install target that wasn't related
3714 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3715 on all except FormGraphics. This may yet happen. Followed by a major
3716 cleanup including using FL_TRANSIENT for most of the dialogs. More
3717 changes to come when the ButtonController below is introduced.
3719 * src/frontends/xforms/ButtonController.h: New file for managing up to
3720 four buttons on a dialog according to an externally defined policy.
3721 * src/frontends/xforms/Makefile.am: added above
3723 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3724 Apply and Cancel/Close buttons and everything in between and beyond.
3725 * src/frontends/Makefile.am: added above.
3727 * src/frontends/xforms/forms/form_preferences.fd:
3728 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3729 and removed variable 'status' as a result. Fixed the set_minsize thing.
3730 Use the new screen-font-update after checking screen fonts were changed
3731 Added a "Restore" button to restore the original lyxrc values while
3732 editing. This restores everything not just the last input changed.
3733 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3735 * src/LyXAction.C: screen-font-update added for updating buffers after
3736 screen font settings have been changed.
3737 * src/commandtags.h: ditto
3738 * src/lyxfunc.C: ditto
3740 * forms/lyx.fd: removed screen fonts dialog.
3741 * src/lyx_gui.C: ditto
3742 * src/menus.[Ch]: ditto
3743 * src/lyx.[Ch]: ditto
3744 * src/lyx_cb.C: ditto + code from here moved to make
3745 screen-font-update. And people wonder why progress on GUII is
3746 slow. Look at how scattered this stuff was! It takes forever
3749 * forms/fdfix.sh: Fixup the spacing after commas.
3750 * forms/makefile: Remove date from generated files. Fewer clashes now.
3751 * forms/bullet_forms.C.patch: included someones handwritten changes
3753 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3754 once I've discovered why LyXRC was made noncopyable.
3755 * src/lyx_main.C: ditto
3757 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3759 * src/frontends/xforms/forms/fdfix.sh:
3760 * src/frontends/xforms/forms/fdfixh.sed:
3761 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3762 * src/frontends/xforms/Form*.[hC]:
3763 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3764 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3765 provide a destructor for the struct FD_form_xxxx. Another version of
3766 the set_[max|min]size workaround and a few other cleanups. Actually,
3767 Angus' patch from 20000809.
3769 2000-08-13 Baruch Even <baruch.even@writeme.com>
3771 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3774 2000-08-11 Juergen Vigna <jug@sad.it>
3776 * src/insets/insetgraphics.C (InsetGraphics): changing init
3777 order because of warnings.
3779 * src/frontends/xforms/forms/makefile: adding patching .C with
3782 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3783 from .C.patch to .c.patch
3785 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3786 order because of warning.
3788 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3790 * src/frontends/Liason.C (setMinibuffer): new helper function
3792 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3794 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3796 * lib/ui/default.ui: commented out PaperLayout entry
3798 * src/frontends/xforms/form_document.[Ch]: new added files
3800 * src/frontends/xforms/FormDocument.[Ch]: ditto
3802 * src/frontends/xforms/forms/form_document.fd: ditto
3804 * src/frontends/xforms/forms/form_document.C.patch: ditto
3806 2000-08-10 Juergen Vigna <jug@sad.it>
3808 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3809 (InsetGraphics): initialized cacheHandle to 0.
3810 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3812 2000-08-10 Baruch Even <baruch.even@writeme.com>
3814 * src/graphics/GraphicsCache.h:
3815 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3816 correctly as a cache.
3818 * src/graphics/GraphicsCacheItem.h:
3819 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3822 * src/graphics/GraphicsCacheItem_pimpl.h:
3823 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3826 * src/insets/insetgraphics.h:
3827 * src/insets/insetgraphics.C: Changed from using a signal notification
3828 to polling when image is not loaded.
3830 2000-08-10 Allan Rae <rae@lyx.org>
3832 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3833 that there are two functions that have to been taken out of line by
3834 hand and aren't taken care of in the script. (Just a reminder note)
3836 * sigc++/macros/*.h.m4: Updated as above.
3838 2000-08-09 Juergen Vigna <jug@sad.it>
3840 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3842 * src/insets/insettabular.C: make drawing of single cell smarter.
3844 2000-08-09 Marko Vendelin <markov@ioc.ee>
3845 * src/frontends/gnome/Menubar_pimpl.C
3846 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3847 implementation: new files
3849 * src/frontends/gnome/mainapp.C
3850 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3853 * src/main.C: create Gnome main window
3855 * src/frontends/xforms/Menubar_pimpl.h
3856 * src/frontends/Menubar.C
3857 * src/frontends/Menubar.h: added method Menubar::update that calls
3858 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3860 * src/LyXView.C: calls Menubar::update to update the state
3863 * src/frontends/gnome/Makefile.am: added new files
3865 * src/frontends/Makefile.am: added frontend compiler options
3867 2000-08-08 Juergen Vigna <jug@sad.it>
3869 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3871 * src/bufferlist.C (close):
3872 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3873 documents if exiting without saving.
3875 * src/buffer.C (save): use removeAutosaveFile()
3877 * src/support/filetools.C (removeAutosaveFile): new function.
3879 * src/lyx_cb.C (MenuWrite): returns a bool now.
3880 (MenuWriteAs): check if file could really be saved and revert to the
3882 (MenuWriteAs): removing old autosavefile if existant.
3884 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3885 before Goto toggle declaration, because of compiler warning.
3887 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3889 * src/lyxfunc.C (MenuNew): small fix.
3891 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3893 * src/bufferlist.C (newFile):
3894 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3896 * src/lyxrc.C: added new_ask_filename tag
3898 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3900 * src/lyx.fd: removed code pertaining to form_ref
3901 * src/lyx.[Ch]: ditto
3902 * src/lyx_cb.C: ditto
3903 * src/lyx_gui.C: ditto
3904 * src/lyx_gui_misc.C: ditto
3906 * src/BufferView_pimpl.C (restorePosition): update buffer only
3909 * src/commandtags.h (LFUN_REFTOGGLE): removed
3910 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3911 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3912 (LFUN_REFBACK): renamed LFUN_REF_BACK
3914 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3915 * src/menus.C: ditto
3916 * src/lyxfunc.C (Dispatch): ditto.
3917 InsertRef dialog is now GUI-independent.
3919 * src/texrow.C: added using std::endl;
3921 * src/insets/insetref.[Ch]: strip out large amounts of code.
3922 The inset is now a container and this functionality is now
3923 managed by a new FormRef dialog
3925 * src/frontends/Dialogs.h (showRef, createRef): new signals
3927 * src/frontends/xforms/FormIndex.[Ch],
3928 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3929 when setting dialog's min/max size
3930 * src/frontends/xforms/FormIndex.[Ch]: ditto
3932 * src/frontends/xforms/FormRef.[Ch],
3933 src/frontends/xforms/forms/form_ref.fd: new xforms
3934 implementation of an InsetRef dialog
3936 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3939 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3940 ios::nocreate is not part of the standard. Removed.
3942 2000-08-07 Baruch Even <baruch.even@writeme.com>
3944 * src/graphics/Renderer.h:
3945 * src/graphics/Renderer.C: Added base class for rendering of different
3946 image formats into Pixmaps.
3948 * src/graphics/XPM_Renderer.h:
3949 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3950 in a different class.
3952 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3953 easily add support for other formats.
3955 * src/insets/figinset.C: plugged a leak of an X resource.
3957 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3959 * src/CutAndPaste.[Ch]: make all metods static.
3961 * development/Code_rules/Rules: more work, added section on
3962 Exceptions, and a References section.
3964 * a lot of header files: work to make doc++ able to generate the
3965 source documentation, some workarounds of doc++ problems. Doc++ is
3966 now able to generate the documentation.
3968 2000-08-07 Juergen Vigna <jug@sad.it>
3970 * src/insets/insettabular.C (recomputeTextInsets): removed function
3972 * src/tabular.C (SetWidthOfMulticolCell):
3974 (calculate_width_of_column_NMC): fixed return value so that it really
3975 only returns true if the column-width has changed (there where
3976 problems with muliticolumn-cells in this column).
3978 2000-08-04 Juergen Vigna <jug@sad.it>
3980 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3981 also on the scrollstatus of the inset.
3982 (workAreaMotionNotify): ditto.
3984 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3986 2000-08-01 Juergen Vigna <jug@sad.it>
3988 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3990 * src/commandtags.h:
3991 * src/LyXAction.C (init):
3992 * src/insets/inset.C (LocalDispatch): added support for
3995 * src/insets/inset.C (scroll): new functions.
3997 * src/insets/insettext.C (removeNewlines): new function.
3998 (SetAutoBreakRows): removes forced newlines in the text of the
3999 paragraph if autoBreakRows is set to false.
4001 * src/tabular.C (Latex): generates a parbox around the cell contents
4004 * src/frontends/xforms/FormTabular.C (local_update): removed
4005 the radio_useparbox button.
4007 * src/tabular.C (UseParbox): new function
4009 2000-08-06 Baruch Even <baruch.even@writeme.com>
4011 * src/graphics/GraphicsCache.h:
4012 * src/graphics/GraphicsCache.C:
4013 * src/graphics/GraphicsCacheItem.h:
4014 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4017 * src/insets/insetgraphics.h:
4018 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4019 and the drawing of the inline image.
4021 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4022 loaded into the wrong position.
4024 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4027 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4029 * src/support/translator.h: move all typedefs to public section
4031 * src/support/filetools.C (MakeLatexName): return string const
4033 (TmpFileName): ditto
4034 (FileOpenSearch): ditto
4036 (LibFileSearch): ditto
4037 (i18nLibFileSearch): ditto
4040 (CreateTmpDir): ditto
4041 (CreateBufferTmpDir): ditto
4042 (CreateLyXTmpDir): ditto
4045 (MakeAbsPath): ditto
4047 (OnlyFilename): ditto
4049 (NormalizePath): ditto
4050 (CleanupPath): ditto
4051 (GetFileContents): ditto
4052 (ReplaceEnvironmentPath): ditto
4053 (MakeRelPath): ditto
4055 (ChangeExtension): ditto
4056 (MakeDisplayPath): ditto
4057 (do_popen): return cmdret const
4058 (findtexfile): return string const
4060 * src/support/DebugStream.h: add some /// to please doc++
4062 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4064 * src/texrow.C (same_rownumber): functor to use with find_if
4065 (getIdFromRow): rewritten to use find_if and to not update the
4066 positions. return true if row is found
4067 (increasePos): new method, use to update positions
4069 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4071 * src/lyxlex_pimpl.C (verifyTable): new method
4074 (GetString): return string const
4075 (pushTable): rewrite to use std::stack
4077 (setFile): better check
4080 * src/lyxlex.h: make LyXLex noncopyable
4082 * src/lyxlex.C (text): return char const * const
4083 (GetString): return string const
4084 (getLongString): return string const
4086 * src/lyx_gui_misc.C (askForText): return pair<...> const
4088 * src/lastfiles.[Ch] (operator): return string const
4090 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4091 istringstream not char const *.
4092 move token.end() out of loop.
4093 (readFile): move initializaton of token
4095 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4096 getIdFromRow is successful.
4098 * lib/bind/emacs.bind: don't include menus bind
4100 * development/Code_rules/Rules: the beginnings of making this
4101 better and covering more of the unwritten rules that we have.
4103 * development/Code_rules/Recommendations: a couple of wording
4106 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4108 * src/support/strerror.c: remove C++ comment.
4110 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4112 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4113 LFUN_INDEX_INSERT_LAST
4115 * src/texrow.C (getIdFromRow): changed from const_iterator to
4116 iterator, allowing code to compile with DEC cxx
4118 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4119 stores part of the class, as suggested by Allan. Will allow
4121 (apply): test to apply uses InsetCommandParams operator!=
4123 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4124 (apply): test to apply uses InsetCommandParams operator!=
4126 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4127 stores part of the class.
4128 (update): removed limits on min/max size.
4130 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4131 (apply): test to apply uses InsetCommandParams operator!=
4133 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4134 (Read, Write, scanCommand, getCommand): moved functionality
4135 into InsetCommandParams.
4137 (getScreenLabel): made pure virtual
4138 new InsetCommandParams operators== and !=
4140 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4141 c-tors based on InsetCommandParams. Removed others.
4142 * src/insets/insetinclude.[Ch]: ditto
4143 * src/insets/insetlabel.[Ch]: ditto
4144 * src/insets/insetparent.[Ch]: ditto
4145 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4147 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4148 insets derived from InsetCommand created using similar c-tors
4149 based on InsetCommandParams
4150 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4151 * src/menus.C (ShowRefsMenu): ditto
4152 * src/paragraph.C (Clone): ditto
4153 * src/text2.C (SetCounter): ditto
4154 * src/lyxfunc.C (Dispatch) ditto
4155 Also recreated old InsetIndex behaviour exactly. Can now
4156 index-insert at the start of a paragraph and index-insert-last
4157 without launching the pop-up.
4159 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4161 * lib/lyxrc.example: mark te pdf options as non functional.
4163 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4164 (isStrDbl): move tmpstr.end() out of loop.
4165 (strToDbl): move intialization of tmpstr
4166 (lowercase): return string const and move tmp.end() out of loop.
4167 (uppercase): return string const and move tmp.edn() out of loop.
4168 (prefixIs): add assertion
4173 (containsOnly): ditto
4174 (containsOnly): ditto
4175 (containsOnly): ditto
4176 (countChar): make last arg char not char const
4177 (token): return string const
4178 (subst): return string const, move tmp.end() out of loop.
4179 (subst): return string const, add assertion
4180 (strip): return string const
4181 (frontStrip): return string const, add assertion
4182 (frontStrip): return string const
4187 * src/support/lstrings.C: add inclde "LAssert.h"
4188 (isStrInt): move tmpstr.end() out of loop.
4190 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4191 toollist.end() out of loop.
4192 (deactivate): move toollist.end() out of loop.
4193 (update): move toollist.end() out of loop.
4194 (updateLayoutList): move tc.end() out of loop.
4195 (add): move toollist.end() out of loop.
4197 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4198 md.end() out of loop.
4200 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4202 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4205 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4206 (Erase): move insetlist.end() out of loop.
4208 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4209 ref to const string as first arg. Move initialization of some
4210 variables, whitespace changes.
4212 * src/kbmap.C (defkey): move table.end() out of loop.
4213 (kb_keymap): move table.end() out of loop.
4214 (findbinding): move table.end() out of loop.
4216 * src/MenuBackend.C (hasMenu): move end() out of loop.
4217 (getMenu): move end() out of loop.
4218 (getMenu): move menulist_.end() out of loop.
4220 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4222 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4225 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4226 (getFromLyXName): move infotab.end() out of loop.
4228 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4229 -fvtable-thunks -ffunction-sections -fdata-sections
4231 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4233 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4236 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4238 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4240 * src/frontends/xforms/FormCitation.[Ch],
4241 src/frontends/xforms/FormIndex.[Ch],
4242 src/frontends/xforms/FormToc.[Ch],
4243 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4245 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4247 * src/commandtags.h: renamed, created some flags for citation
4250 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4252 * src/lyxfunc.C (dispatch): use signals to insert index entry
4254 * src/frontends/Dialogs.h: new signal createIndex
4256 * src/frontends/xforms/FormCommand.[Ch],
4257 src/frontends/xforms/FormCitation.[Ch],
4258 src/frontends/xforms/FormToc.[Ch],
4259 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4261 * src/insets/insetindex.[Ch]: GUI-independent
4263 * src/frontends/xforms/FormIndex.[Ch],
4264 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4267 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4269 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4270 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4272 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4274 * src/insets/insetref.C (Latex): rewrite so that there is now
4275 question that a initialization is requested.
4277 * src/insets/insetcommand.h: reenable the hide signal
4279 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4281 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4282 fix handling of shortcuts (many bugs :)
4283 (add_lastfiles): ditto.
4285 * lib/ui/default.ui: fix a few shortcuts.
4287 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4289 * Makefile.am: Fix ``rpmdist'' target to return the exit
4290 status of the ``rpm'' command, instead of the last command in
4291 the chain (the ``rm lyx.xpm'' command, which always returns
4294 2000-08-02 Allan Rae <rae@lyx.org>
4296 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4297 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4298 * src/frontends/xforms/FormToc.C (FormToc): ditto
4300 * src/frontends/xforms/Makefile.am: A few forgotten files
4302 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4303 Signals-not-copyable-problem Lars' started commenting out.
4305 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4307 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4309 * src/insets/insetcommand.h: Signals is not copyable so anoter
4310 scheme for automatic hiding of forms must be used.
4312 * src/frontends/xforms/FormCitation.h: don't inerit from
4313 noncopyable, FormCommand already does that.
4314 * src/frontends/xforms/FormToc.h: ditto
4315 * src/frontends/xforms/FormUrl.h: ditto
4317 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4319 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4321 * src/insets/insetcommand.h (hide): new SigC::Signal0
4322 (d-tor) new virtual destructor emits hide signal
4324 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4325 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4327 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4328 LOF and LOT. Inset is now GUI-independent
4330 * src/insets/insetloa.[Ch]: redundant
4331 * src/insets/insetlof.[Ch]: ditto
4332 * src/insets/insetlot.[Ch]: ditto
4334 * src/frontends/xforms/forms/form_url.fd: tweaked!
4335 * src/frontends/xforms/forms/form_citation.fd: ditto
4337 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4338 dialogs dealing with InsetCommand insets
4340 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4341 FormCommand base class
4342 * src/frontends/xforms/FormUrl.[Ch]: ditto
4344 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4346 * src/frontends/xforms/FormToc.[Ch]: ditto
4348 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4349 passed a generic InsetCommand pointer
4350 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4352 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4353 and modified InsetTOC class
4354 * src/buffer.C: ditto
4356 * forms/lyx.fd: strip out old FD_form_toc code
4357 * src/lyx_gui_misc.C: ditto
4358 * src/lyx_gui.C: ditto
4359 * src/lyx_cb.C: ditto
4360 * src/lyx.[Ch]: ditto
4362 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4364 * src/support/utility.hpp: tr -d '\r'
4366 2000-08-01 Juergen Vigna <jug@sad.it>
4368 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4370 * src/commandtags.h:
4371 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4372 LFUN_TABULAR_FEATURES.
4374 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4375 LFUN_LAYOUT_TABULAR.
4377 * src/insets/insettabular.C (getStatus): implemented helper function.
4379 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4381 2000-07-31 Juergen Vigna <jug@sad.it>
4383 * src/text.C (draw): fixed screen update problem for text-insets.
4385 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4386 something changed probably this has to be added in various other
4389 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4391 2000-07-31 Baruch Even <baruch.even@writeme.com>
4393 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4394 templates to satisfy compaq cxx.
4397 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4399 * src/support/translator.h (equal_1st_in_pair::operator()): take
4400 const ref pair_type as arg.
4401 (equal_2nd_in_pair::operator()): ditto
4402 (Translator::~Translator): remove empty d-tor.
4404 * src/graphics/GraphicsCache.C: move include config.h to top, also
4405 put initialization of GraphicsCache::singleton here.
4406 (~GraphicsCache): move here
4407 (addFile): take const ref as arg
4410 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4412 * src/BufferView2.C (insertLyXFile): change te with/without header
4415 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4417 * src/frontends/xforms/FormGraphics.C (apply): add some
4418 static_cast. Not very nice, but required by compaq cxx.
4420 * src/frontends/xforms/RadioButtonGroup.h: include header
4421 <utility> instead of <pair.h>
4423 * src/insets/insetgraphicsParams.C: add using directive.
4424 (readResize): change return type to void.
4425 (readOrigin): ditto.
4427 * src/lyxfunc.C (getStatus): add missing break for build-program
4428 function; add test for Literate for export functions.
4430 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4431 entries in Options menu.
4433 2000-07-31 Baruch Even <baruch.even@writeme.com>
4435 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4436 protect against auto-allocation; release icon when needed.
4438 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4440 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4441 on usual typewriter.
4443 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4444 earlier czech.kmap), useful only for programming.
4446 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4448 * src/frontends/xforms/FormCitation.h: fix conditioning around
4451 2000-07-31 Juergen Vigna <jug@sad.it>
4453 * src/frontends/xforms/FormTabular.C (local_update): changed
4454 radio_linebreaks to radio_useparbox and added radio_useminipage.
4456 * src/tabular.C: made support for using minipages/parboxes.
4458 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4460 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4462 (descent): so the cursor is in the middle.
4463 (width): bit smaller box.
4465 * src/insets/insetgraphics.h: added display() function.
4467 2000-07-31 Baruch Even <baruch.even@writeme.com>
4469 * src/frontends/Dialogs.h: Added showGraphics signals.
4471 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4472 xforms form definition of the graphics dialog.
4474 * src/frontends/xforms/FormGraphics.h:
4475 * src/frontends/xforms/FormGraphics.C: Added files, the
4476 GUIndependent code of InsetGraphics
4478 * src/insets/insetgraphics.h:
4479 * src/insets/insetgraphics.C: Major writing to make it work.
4481 * src/insets/insetgraphicsParams.h:
4482 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4483 struct between InsetGraphics and GUI.
4485 * src/LaTeXFeatures.h:
4486 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4487 support for graphicx package.
4489 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4490 for the graphics inset.
4492 * src/support/translator.h: Added file, used in
4493 InsetGraphicsParams. this is a template to translate between two
4496 * src/frontends/xforms/RadioButtonGroup.h:
4497 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4498 way to easily control a radio button group.
4500 2000-07-28 Juergen Vigna <jug@sad.it>
4502 * src/insets/insettabular.C (LocalDispatch):
4503 (TabularFeatures): added support for lyx-functions of tabular features.
4504 (cellstart): refixed this function after someone wrongly changed it.
4506 * src/commandtags.h:
4507 * src/LyXAction.C (init): added support for tabular-features
4509 2000-07-28 Allan Rae <rae@lyx.org>
4511 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4512 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4513 triggers the callback for input checking. As a result we sometimes get
4514 "LyX: This shouldn't happen..." printed to cerr.
4515 (input): Started using status variable since I only free() on
4516 destruction. Some input checking for paths and font sizes.
4518 * src/frontends/xforms/FormPreferences.h: Use status to control
4519 activation of Ok and Apply
4521 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4522 callback. Also resized to stop segfaults with 0.88. The problem is
4523 that xforms-0.88 requires the folder to be wide enough to fit all the
4524 tabs. If it isn't it causes all sorts of problems.
4526 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4528 * src/frontends/xforms/forms/README: Reflect reality.
4530 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4531 * src/frontends/xforms/forms/makefile: ditto.
4533 * src/commandtags.h: Get access to new Preferences dialog
4534 * src/LyXAction.C: ditto
4535 * src/lyxfunc.C: ditto
4536 * lib/ui/default.ui: ditto
4538 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4540 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4542 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4545 * src/frontends/xforms/form_url.[Ch]: added.
4547 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4549 * src/insets/insetbib.h: fixed bug in previous commit
4551 * src/frontends/xforms/FormUrl.h: ditto
4553 * src/frontends/xforms/FormPrint.h: ditto
4555 * src/frontends/xforms/FormPreferences.h: ditto
4557 * src/frontends/xforms/FormCopyright.h: ditto
4559 * src/frontends/xforms/FormCitation.C: ditto
4561 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4562 private copyconstructor and private default contructor
4564 * src/support/Makefile.am: add utility.hpp
4566 * src/support/utility.hpp: new file from boost
4568 * src/insets/insetbib.h: set owner in clone
4570 * src/frontends/xforms/FormCitation.C: added missing include
4573 * src/insets/form_url.[Ch]: removed
4575 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4577 * development/lyx.spec.in
4578 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4579 file/directory re-organization.
4581 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4583 * src/insets/insetcommand.[Ch]: moved the string data and
4584 associated manipulation methods into a new stand-alone class
4585 InsetCommandParams. This class has two additional methods
4586 getAsString() and setFromString() allowing the contents to be
4587 moved around as a single string.
4588 (addContents) method removed.
4589 (setContents) method no longer virtual.
4591 * src/buffer.C (readInset): made use of new InsetCitation,
4592 InsetUrl constructors based on InsetCommandParams.
4594 * src/commandtags.h: add LFUN_INSERT_URL
4596 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4597 independent InsetUrl and use InsetCommandParams to extract
4598 string info and create new Insets.
4600 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4602 * src/frontends/xforms/FormCitation.C (apply): uses
4605 * src/frontends/xforms/form_url.C
4606 * src/frontends/xforms/form_url.h
4607 * src/frontends/xforms/FormUrl.h
4608 * src/frontends/xforms/FormUrl.C
4609 * src/frontends/xforms/forms/form_url.fd: new files
4611 * src/insets/insetcite.[Ch]: removed unused constructors.
4613 * src/insets/insetinclude.[Ch]: no longer store filename
4615 * src/insets/inseturl.[Ch]: GUI-independent.
4617 2000-07-26 Juergen Vigna <jug@sad.it>
4618 * renamed frontend from gtk to gnome as it is that what is realized
4619 and did the necessary changes in the files.
4621 2000-07-26 Marko Vendelin <markov@ioc.ee>
4623 * configure.in: cleaning up gnome configuration scripts
4625 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4627 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4628 shortcuts syndrom by redrawing them explicitely (a better solution
4629 would be appreciated).
4631 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4633 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4636 * src/lyx_cb.C (MenuExport): change html export to do the right
4637 thing depending of the document type (instead of having
4638 html-linuxdoc and html-docbook).
4639 * src/lyxfunc.C (getStatus): update for html
4640 * lib/ui/default.ui: simplify due to the above change.
4641 * src/menus.C (ShowFileMenu): update too (in case we need it).
4643 * src/MenuBackend.C (read): if a menu is defined twice, add the
4644 new entries to the exiting one.
4646 2000-07-26 Juergen Vigna <jug@sad.it>
4648 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4650 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4651 and return a bool if it did actual save the file.
4652 (AutoSave): don't autosave a unnamed doc.
4654 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4655 check if this is an UNNAMED new file and react to it.
4656 (newFile): set buffer to unnamed and change to not mark a new
4657 buffer dirty if I didn't do anything with it.
4659 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4661 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4663 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4664 friend as per Angus's patch posted to lyx-devel.
4666 * src/ext_l10n.h: updated
4668 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4669 gettext on the style string right before inserting them into the
4672 * autogen.sh: add code to extract style strings form layout files,
4673 not good enough yet.
4675 * src/frontends/gtk/.cvsignore: add MAKEFILE
4677 * src/MenuBackend.C (read): run the label strings through gettext
4678 before storing them in the containers.
4680 * src/ext_l10n.h: new file
4682 * autogen.sh : generate the ext_l10n.h file here
4684 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4686 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4689 * lib/ui/default.ui: fix a couple of typos.
4691 * config/gnome/gtk.m4: added (and added to the list of files in
4694 * src/insets/insetinclude.C (unique_id): fix when we are using
4695 lyxstring instead of basic_string<>.
4696 * src/insets/insettext.C (LocalDispatch): ditto.
4697 * src/support/filetools.C: ditto.
4699 * lib/configure.m4: create the ui/ directory if necessary.
4701 * src/LyXView.[Ch] (updateToolbar): new method.
4703 * src/BufferView_pimpl.C (buffer): update the toolbar when
4704 opening/closing buffer.
4706 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4708 * src/LyXAction.C (getActionName): enhance to return also the name
4709 and options of pseudo-actions.
4710 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4712 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4713 as an example of what is possible). Used in File->Build too (more
4714 useful) and in the import/export menus (to mimick the complicated
4715 handling of linuxdoc and friends). Try to update all the entries.
4717 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4720 * src/MenuBackend.C (read): Parse the new OptItem tag.
4722 * src/MenuBackend.h: Add a new optional_ data member (used if the
4723 entry should be omitted when the lyxfunc is disabled).
4725 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4726 function, used as a shortcut.
4727 (create_submenu): align correctly the shortcuts on the widest
4730 * src/MenuBackend.h: MenuItem.label() only returns the label of
4731 the menu without shortcut; new method shortcut().
4733 2000-07-14 Marko Vendelin <markov@ioc.ee>
4735 * src/frontends/gtk/Dialogs.C:
4736 * src/frontends/gtk/FormCopyright.C:
4737 * src/frontends/gtk/FormCopyright.h:
4738 * src/frontends/gtk/Makefile.am: added these source-files for the
4739 Gtk/Gnome support of the Copyright-Dialog.
4741 * src/main.C: added Gnome::Main initialization if using
4742 Gtk/Gnome frontend-GUI.
4744 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4746 * config/gnome/aclocal-include.m4
4747 * config/gnome/compiler-flags.m4
4748 * config/gnome/curses.m4
4749 * config/gnome/gnome--.m4
4750 * config/gnome/gnome-bonobo-check.m4
4751 * config/gnome/gnome-common.m4
4752 * config/gnome/gnome-fileutils.m4
4753 * config/gnome/gnome-ghttp-check.m4
4754 * config/gnome/gnome-gnorba-check.m4
4755 * config/gnome/gnome-guile-checks.m4
4756 * config/gnome/gnome-libgtop-check.m4
4757 * config/gnome/gnome-objc-checks.m4
4758 * config/gnome/gnome-orbit-check.m4
4759 * config/gnome/gnome-print-check.m4
4760 * config/gnome/gnome-pthread-check.m4
4761 * config/gnome/gnome-support.m4
4762 * config/gnome/gnome-undelfs.m4
4763 * config/gnome/gnome-vfs.m4
4764 * config/gnome/gnome-x-checks.m4
4765 * config/gnome/gnome-xml-check.m4
4766 * config/gnome/gnome.m4
4767 * config/gnome/gperf-check.m4
4768 * config/gnome/gtk--.m4
4769 * config/gnome/linger.m4
4770 * config/gnome/need-declaration.m4: added configuration scripts
4771 for Gtk/Gnome frontend-GUI
4773 * configure.in: added support for the --with-frontend=gtk option
4775 * autogen.sh: added config/gnome/* to list of config-files
4777 * acconfig.h: added define for GTKGUI-support
4779 * config/lyxinclude.m4: added --with-frontend[=value] option value
4780 for Gtk/Gnome frontend-GUI support.
4782 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4784 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4788 * src/paragraph.C (GetChar): remove non-const version
4790 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4791 (search_kw): use it.
4793 * src/lyx_main.C (init): if "preferences" exist, read that instead
4795 (ReadRcFile): return bool if the file could be read ok.
4796 (ReadUIFile): add a check to see if lex file is set ok.
4798 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4799 bastring can be used instead of lyxstring (still uses the old code
4800 if std::string is good enough or if lyxstring is used.)
4802 * src/encoding.C: make the arrays static, move ininle functions
4804 * src/encoding.h: from here.
4806 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4807 (parseSingleLyXformat2Token): move inset parsing to separate method
4808 (readInset): new private method
4810 * src/Variables.h: remove virtual from get().
4812 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4813 access to NEW_INSETS and NEW_TABULAR
4815 * src/MenuBackend.h: remove superfluous forward declaration of
4816 MenuItem. Add documentations tags "///", remove empty MenuItem
4817 destructor, remove private default contructor.
4819 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4821 (read): more string mlabel and mname to where they are used
4822 (read): remove unused variables mlabel and mname
4823 (defaults): unconditional clear, make menusetup take advantage of
4824 add returning Menu &.
4826 * src/LyXView.h: define NEW_MENUBAR as default
4828 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4829 to NEW_INSETS and NEW_TABULAR.
4830 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4831 defined. Change some of the "xxxx-inset-insert" functions names to
4834 * several files: more enahncements to NEW_INSETS and the resulting
4837 * lib/lyxrc.example (\date_insert_format): move to misc section
4839 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4840 bastring and use AC_CACHE_CHECK.
4841 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4842 the system have the newest methods. uses AC_CACHE_CHECK
4843 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4844 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4845 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4847 * configure.in: add LYX_CXX_GOOD_STD_STRING
4849 * acinclude.m4: recreated
4851 2000-07-24 Amir Karger <karger@lyx.org>
4853 * README: add Hebrew, Arabic kmaps
4856 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4858 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4861 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4863 * Lot of files: add pragma interface/implementation.
4865 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4867 * lib/ui/default.ui: new file (ans new directory). Contains the
4868 default menu and toolbar.
4870 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4871 global space. Toolbars are now read (as menus) in ui files.
4873 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4875 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4876 is disabled because the document is read-only. We want to have the
4877 toggle state of the function anyway.
4878 (getStatus): add code for LFUN_VC* functions (mimicking what is
4879 done in old-style menus)
4881 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4882 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4884 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4885 * src/BufferView_pimpl.C: ditto.
4886 * src/lyxfunc.C: ditto.
4888 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4889 default). This replaces old-style menus by new ones.
4891 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4892 MenuItem. Contain the data structure of a menu.
4894 * src/insets/insettext.C: use LyXView::setLayout instead of
4895 accessing directly the toolbar combox.
4896 * src/lyxfunc.C (Dispatch): ditto.
4898 * src/LyXView.C (setLayout): new method, which just calls
4899 Toolbar::setLayout().
4900 (updateLayoutChoice): move part of this method in Toolbar.
4902 * src/toolbar.[Ch]: removed.
4904 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4905 implementation the toolbar.
4907 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4908 the toolbar. It might make sense to merge it with ToolbarDefaults
4910 (setLayout): new function.
4911 (updateLayoutList): ditto.
4912 (openLayoutList): ditto.
4914 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4915 xforms implementation of the toolbar.
4916 (get_toolbar_func): comment out, since I do not
4917 know what it is good for.
4919 * src/ToolbarDefaults.h: Add the ItemType enum.
4921 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4922 for a list of allocated C strings. Used in Menubar xforms
4923 implementation to avoid memory leaks.
4925 * src/support/lstrings.[Ch] (uppercase): new version taking and
4929 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4930 * lib/bind/emacs.bind: ditto.
4932 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4934 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4935 forward decl of LyXView.
4937 * src/toolbar.C (toolbarItem): moved from toolbar.h
4938 (toolbarItem::clean): ditto
4939 (toolbarItem::~toolbarItem): ditto
4940 (toolbarItem::operator): ditto
4942 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4944 * src/paragraph.h: control the NEW_TABULAR define from here
4946 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4947 USE_TABULAR_INSETS to NEW_TABULAR
4949 * src/ToolbarDefaults.C: add include "lyxlex.h"
4951 * files using the old table/tabular: use NEW_TABULAR to control
4952 compilation of old tabular stuff.
4954 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4957 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4958 planemet in reading of old style floats, fix the \end_deeper
4959 problem when reading old style floats.
4961 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4963 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4965 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4967 * lib/bind/sciword.bind: updated.
4969 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4971 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4972 layout write problem
4974 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4976 * src/Makefile.am (INCLUDES): remove image directory from include
4979 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4980 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4982 * src/LyXView.C (create_form_form_main): read the application icon
4985 * lib/images/*.xpm: change the icons to use transparent color for
4988 * src/toolbar.C (update): change the color of the button when it
4991 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4993 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4994 setting explicitely the minibuffer.
4995 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4997 * src/LyXView.C (showState): new function. Shows font information
4998 in minibuffer and update toolbar state.
4999 (LyXView): call Toolbar::update after creating the
5002 * src/toolbar.C: change toollist to be a vector instead of a
5004 (BubbleTimerCB): get help string directly from the callback
5005 argument of the corresponding icon (which is the action)
5006 (set): remove unnecessary ugliness.
5007 (update): new function. update the icons (depressed, disabled)
5008 depending of the status of the corresponding action.
5010 * src/toolbar.h: remove help in toolbarItem
5012 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5014 * src/Painter.C (text): Added code for using symbol glyphs from
5015 iso10646 fonts. Currently diabled.
5017 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5020 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5021 magyar,turkish and usorbian.
5023 * src/paragraph.C (isMultiLingual): Made more efficient.
5025 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5028 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5029 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5030 Also changed the prototype to "bool math_insert_greek(char)".
5032 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5034 * lots of files: apply the NEW_INSETS on all code that will not be
5035 needed when we move to use the new insets. Enable the define in
5036 lyxparagrah.h to try it.
5038 * src/insets/insettabular.C (cellstart): change to be a static
5040 (InsetTabular): initialize buffer in the initializer list.
5042 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5044 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5045 form_print.h out of the header file. Replaced with forward
5046 declarations of the relevant struct.
5048 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5051 * src/commandtags.h: do not include "debug.h" which does not
5052 belong there. #include it in some other places because of this
5055 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5057 * src/insets/insetcaption.C: add a couple "using" directives.
5059 * src/toolbar.C (add): get the help text directly from lyxaction.
5061 (setPixmap): new function. Loads from disk and sets a pixmap on a
5062 botton; the name of the pixmap file is derived from the command
5065 * src/toolbar.h: remove members isBitmap and pixmap from
5068 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5069 * lib/images/: move many files from images/banner.xpm.
5071 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5073 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5074 * src/toolbar.C: ditto.
5075 * configure.in: ditto.
5076 * INSTALL: document.
5078 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5079 the spellchecker popup is closed from the WM.
5081 2000-07-19 Juergen Vigna <jug@sad.it>
5083 * src/insets/insetfloat.C (Write): small fix because we use the
5084 insetname for the type now!
5086 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5088 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5091 * src/frontends/Dialogs.h: removed hideCitation signal
5093 * src/insets/insetcite.h: added hide signal
5095 * src/insets/insetcite.C (~InsetCitation): emits new signal
5096 (getScreenLabel): "intelligent" label should now fit on the screen!
5098 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5100 * src/frontends/xforms/FormCitation.C (showInset): connects
5101 hide() to the inset's hide signal
5102 (show): modified to use fl_set_object_position rather than
5103 fl_set_object_geometry wherever possible
5105 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5107 * src/insets/lyxinset.h: add caption code
5109 * src/insets/insetfloat.C (type): new method
5111 * src/insets/insetcaption.C (Write): new method
5113 (LyxCode): new method
5115 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5116 to get it right together with using the FloatList.
5118 * src/commandtags.h: add LFUN_INSET_CAPTION
5119 * src/lyxfunc.C (Dispatch): handle it
5121 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5124 * src/Variables.[Ch]: make expand take a const reference, remove
5125 the destructor, some whitespace changes.
5127 * src/LyXAction.C (init): add caption-inset-insert
5129 * src/FloatList.C (FloatList): update the default floats a bit.
5131 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5133 * src/Variables.[Ch]: new files. Intended to be used for language
5134 specific strings (like \chaptername) and filename substitution in
5137 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5139 * lib/kbd/american.kmap: update
5141 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5143 * src/bufferparams.[Ch]: remove member allowAccents.
5145 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5147 * src/LaTeXLog.C: use the log_form.h header.
5148 * src/lyx_gui.C: ditto.
5149 * src/lyx_gui_misc.C: ditto.
5150 * src/lyxvc.h: ditto.
5152 * forms/log_form.fd: new file, created from latexoptions.fd. I
5153 kept the log popup and nuked the options form.
5155 * src/{la,}texoptions.[Ch]: removed.
5156 * src/lyx_cb.C (LaTeXOptions): ditto
5158 * src/lyx_gui.C (create_forms): do not handle the
5159 fd_latex_options form.
5161 2000-07-18 Juergen Vigna <jug@sad.it>
5163 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5164 name of the inset so that it can be requested outside (text2.C).
5166 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5169 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5171 * src/mathed/formula.h (ConvertFont): constify
5173 * src/mathed/formula.C (Read): add warning if \end_inset is not
5174 found on expected place.
5176 * src/insets/lyxinset.h (ConvertFont): consify
5178 * src/insets/insetquotes.C (ConvertFont): constify
5179 * src/insets/insetquotes.h: ditto
5181 * src/insets/insetinfo.h: add labelfont
5183 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5184 (ascent): use labelfont
5188 (Write): make .lyx file a bit nicer
5190 * src/insets/insetfloat.C (Write): simplify somewhat...
5191 (Read): add warning if arg is not found
5193 * src/insets/insetcollapsable.C: add using std::max
5194 (Read): move string token and add warning in arg is not found
5195 (draw): use std::max to get the right ty
5196 (getMaxWidth): simplify by using std::max
5198 * src/insets/insetsection.h: new file
5199 * src/insets/insetsection.C: new file
5200 * src/insets/insetcaption.h: new file
5201 * src/insets/insetcaption.C: new file
5203 * src/insets/inset.C (ConvertFont): constify signature
5205 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5206 insetcaption.[Ch] and insetsection.[Ch]
5208 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5209 uses to use LABEL_COUNTER_CHAPTER instead.
5210 * src/text2.C (SetCounter): here
5212 * src/counters.h: new file
5213 * src/counters.C: new file
5214 * src/Sectioning.h: new file
5215 * src/Sectioning.C: new file
5217 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5219 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5221 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5224 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5227 2000-07-17 Juergen Vigna <jug@sad.it>
5229 * src/tabular.C (Validate): check if array-package is needed.
5230 (SetVAlignment): added support for vertical alignment.
5231 (SetLTFoot): better support for longtable header/footers
5232 (Latex): modified to support added features.
5234 * src/LaTeXFeatures.[Ch]: added array-package.
5236 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5238 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5241 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5243 * configure.in: do not forget to put a space after -isystem.
5245 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5247 * lib/kbd/arabic.kmap: a few fixes.
5249 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5251 * some whitespace chagnes to a number of files.
5253 * src/support/DebugStream.h: change to make it easier for
5254 doc++ to parse correctly.
5255 * src/support/lyxstring.h: ditto
5257 * src/mathed/math_utils.C (compara): change to have only one
5259 (MathedLookupBOP): change because of the above.
5261 * src/mathed/math_delim.C (math_deco_compare): change to have only
5263 (search_deco): change becasue of the above.
5265 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5266 instead of manually coded one.
5268 * src/insets/insetquotes.C (Read): read the \end_inset too
5270 * src/insets/insetlatex.h: remove file
5271 * src/insets/insetlatex.C: remove file
5273 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5275 (InsetPrintIndex): remove destructor
5277 * src/insets/insetinclude.h: remove default constructor
5279 * src/insets/insetfloat.C: work to make it work better
5281 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5283 * src/insets/insetcite.h (InsetCitation): remove default constructor
5285 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5287 * src/text.C (GetColumnNearX): comment out some currently unused code.
5289 * src/paragraph.C (writeFile): move some initializations closer to
5291 (CutIntoMinibuffer): small change to use new matchIT operator
5295 (InsertInset): ditto
5298 (InsetIterator): ditto
5299 (Erase): small change to use new matchFT operator
5301 (GetFontSettings): ditto
5302 (HighestFontInRange): ditto
5305 * src/lyxparagraph.h: some chars changed to value_type
5306 (matchIT): because of some stronger checking (perhaps too strong)
5307 in SGI STL, the two operator() unified to one.
5310 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5312 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5313 the last inset read added
5314 (parseSingleLyXformat2Token): some more (future) compability code added
5315 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5316 (parseSingleLyXformat2Token): set last_inset_read
5317 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5318 (parseSingleLyXformat2Token): don't double intializw string next_token
5320 * src/TextCache.C (text_fits::operator()): add const's to the signature
5321 (has_buffer::operator()): ditto
5323 * src/Floating.h: add some comments on the class
5325 * src/FloatList.[Ch] (typeExist): new method
5328 * src/BackStack.h: added default constructor, wanted by Gcc.
5330 2000-07-14 Juergen Vigna <jug@sad.it>
5332 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5334 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5336 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5337 do a redraw when the window is resized!
5338 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5340 * src/insets/insettext.C (resizeLyXText): added function to correctly
5341 being able to resize the LyXWindow.
5343 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5345 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5347 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5348 crashes when closing dialog to a deleted inset.
5350 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5351 method! Now similar to other insets.
5353 2000-07-13 Juergen Vigna <jug@sad.it>
5355 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5357 * lib/examples/Literate.lyx: small patch!
5359 * src/insets/insetbib.C (Read): added this function because of wrong
5360 Write (without [begin|end]_inset).
5362 2000-07-11 Juergen Vigna <jug@sad.it>
5364 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5365 as the insertInset could not be good!
5367 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5368 the bool param should not be last.
5370 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5372 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5373 did submit that to Karl).
5375 * configure.in: use -isystem instead of -I for X headers. This
5376 fixes a problem on solaris with a recent gcc;
5377 put the front-end code after the X detection code;
5378 configure in sigc++ before lib/
5380 * src/lyx_main.C (commandLineHelp): remove -display from command
5383 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5385 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5386 Also put in Makefile rules for building the ``listerrors''
5387 program for parsing errors from literate programs written in LyX.
5389 * lib/build-listerrors: Added small shell script as part of compile
5390 process. This builds a working ``listerrors'' binary if noweb is
5391 installed and either 1) the VNC X server is installed on the machine,
5392 or 2) the user is compiling from within a GUI. The existence of a GUI
5393 is necessary to use the ``lyx --export'' feature for now. This
5394 hack can be removed once ``lyx --export'' no longer requires a GUI to
5397 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5399 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5400 now passed back correctly from gcc and placed "under" error
5401 buttons in a Literate LyX source.
5403 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5405 * src/text.C (GetColumnNearX): Better behavior when a RTL
5406 paragraph is ended by LTR text.
5408 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5411 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5413 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5414 true when clipboard is empty.
5416 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5418 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5419 row of the paragraph.
5420 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5421 to prevent calculation of bidi tables
5423 2000-07-07 Juergen Vigna <jug@sad.it>
5425 * src/screen.C (ToggleSelection): added y_offset and x_offset
5428 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5431 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5433 * src/insets/insettext.C: fixed Layout-Display!
5435 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5437 * configure.in: add check for strings.h header.
5439 * src/spellchecker.C: include <strings.h> in order to have a
5440 definition for bzero().
5442 2000-07-07 Juergen Vigna <jug@sad.it>
5444 * src/insets/insettext.C (draw): set the status of the bv->text to
5445 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5447 * src/screen.C (DrawOneRow):
5448 (DrawFromTo): redraw the actual row if something has changed in it
5451 * src/text.C (draw): call an update of the toplevel-inset if something
5452 has changed inside while drawing.
5454 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5456 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5458 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5459 processing inside class.
5461 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5462 processing inside class.
5464 * src/insets/insetindex.h new struct Holder, consistent with other
5467 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5468 citation dialog from main code and placed it in src/frontends/xforms.
5469 Dialog launched through signals instead of callbacks
5471 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5473 * lyx.man: update the options description.
5475 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5477 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5478 handle neg values, set min width to 590, add doc about -display
5480 2000-07-05 Juergen Vigna <jug@sad.it>
5482 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5483 calls to BufferView *.
5485 * src/insets/insettext.C (checkAndActivateInset): small fix non
5486 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5488 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5489 their \end_inset token!
5491 2000-07-04 edscott <edscott@imp.mx>
5493 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5494 lib/lyxrc.example: added option \wheel_jump
5496 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5498 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5499 remove support for -width,-height,-xpos and -ypos.
5501 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5503 * src/encoding.[Ch]: New files.
5505 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5506 (text): Call to the underline() method only when needed.
5508 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5510 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5511 encoding(s) for the document.
5513 * src/bufferparams.C (BufferParams): Changed default value of
5516 * src/language.C (newLang): Removed.
5517 (items[]): Added encoding information for all defined languages.
5519 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5520 encoding choice button.
5522 * src/lyxrc.h (font_norm_type): New member variable.
5523 (set_font_norm_type): New method.
5525 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5526 paragraphs with different encodings.
5528 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5529 (TransformChar): Changed to work correctly with Arabic points.
5530 (draw): Added support for drawing Arabic points.
5531 (draw): Removed code for drawing underbars (this is done by
5534 * src/support/textutils.h (IsPrintableNonspace): New function.
5536 * src/BufferView_pimpl.h: Added "using SigC::Object".
5537 * src/LyXView.h: ditto.
5539 * src/insets/insetinclude.h (include_label): Changed to mutable.
5541 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5543 * src/mathed/math_iter.h: remove empty destructor
5545 * src/mathed/math_cursor.h: remove empty destructor
5547 * src/insets/lyxinset.h: add THEOREM_CODE
5549 * src/insets/insettheorem.[Ch]: new files
5551 * src/insets/insetminipage.C: (InsertInset): remove
5553 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5555 (InsertInset): remove
5557 * src/insets/insetlist.C: (InsertList): remove
5559 * src/insets/insetfootlike.[Ch]: new files
5561 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5564 (InsertInset): ditto
5566 * src/insets/insetert.C: remove include Painter.h, reindent
5567 (InsertInset): move to header
5569 * src/insets/insetcollapsable.h: remove explicit from default
5570 contructor, remove empty destructor, add InsertInset
5572 * src/insets/insetcollapsable.C (InsertInset): new func
5574 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5576 * src/vspace.h: add explicit to constructor
5578 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5579 \textcompwordmark, please test this.
5581 * src/lyxrc.C: set ascii_linelen to 65 by default
5583 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5585 * src/commandtags.h: add LFUN_INSET_THEOREM
5587 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5588 (makeLinuxDocFile): remove _some_ of the nice logic
5589 (makeDocBookFile): ditto
5591 * src/Painter.[Ch]: (~Painter): removed
5593 * src/LyXAction.C (init): entry for insettheorem added
5595 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5597 (deplog): code to detect files generated by LaTeX, needs testing
5600 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5602 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5604 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5606 * src/LaTeX.C (deplog): Add a check for files that are going to be
5607 created by the first latex run, part of the project to remove the
5610 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5611 contents to the extension list.
5613 2000-07-04 Juergen Vigna <jug@sad.it>
5615 * src/text.C (NextBreakPoint): added support for needFullRow()
5617 * src/insets/lyxinset.h: added needFullRow()
5619 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5622 * src/insets/insettext.C: lots of changes for update!
5624 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5626 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5628 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5630 * src/insets/insetinclude.C (InsetInclude): fixed
5631 initialization of include_label.
5632 (unique_id): now returns a string.
5634 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5636 * src/LaTeXFeatures.h: new member IncludedFiles, for
5637 a map of key, included file name.
5639 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5640 with the included files for inclusion in SGML preamble,
5641 i. e., linuxdoc and docbook.
5644 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5645 nice (is the generated linuxdoc code to be exported?), that
5646 allows to remove column, and only_body that will be true for
5647 slave documents. Insets are allowed inside SGML font type.
5648 New handling of the SGML preamble for included files.
5649 (makeDocBookFile): the same for docbook.
5651 * src/insets/insetinclude.h:
5652 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5654 (DocBook): new export methods.
5656 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5657 and makeDocBookFile.
5659 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5660 formats to export with command line argument -x.
5662 2000-06-29 Juergen Vigna <jug@sad.it>
5664 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5665 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5667 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5668 region could already been cleared by an inset!
5670 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5672 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5675 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5677 (cursorToggle): remove special handling of lyx focus.
5679 2000-06-28 Juergen Vigna <jug@sad.it>
5681 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5684 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5686 * src/insets/insetindex.C (Edit): add a callback when popup is
5689 * src/insets/insettext.C (LocalDispatch):
5690 * src/insets/insetmarginal.h:
5691 * src/insets/insetlist.h:
5692 * src/insets/insetfoot.h:
5693 * src/insets/insetfloat.h:
5694 * src/insets/insetert.h: add a missing std:: qualifier.
5696 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5698 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5701 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5703 * src/insets/insettext.C (Read): remove tmptok unused variable
5704 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5705 (InsertInset): change for new InsetInset code
5707 * src/insets/insettext.h: add TEXT inline method
5709 * src/insets/insettext.C: remove TEXT macro
5711 * src/insets/insetmarginal.C (Write): new method
5712 (Latex): change output slightly
5714 * src/insets/insetfoot.C (Write): new method
5715 (Latex): change output slightly (don't use endl when no need)
5717 * src/insets/insetert.C (Write): new method
5719 * src/insets/insetcollapsable.h: make button_length, button_top_y
5720 and button_bottm_y protected.
5722 * src/insets/insetcollapsable.C (Write): simplify code by using
5723 tostr. Also do not output the float name, the children class
5724 should to that to get control over own arguments
5726 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5727 src/insets/insetminipage.[Ch]:
5730 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5732 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5734 * src/Makefile.am (lyx_SOURCES): add the new files
5736 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5737 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5738 * src/commandtags.h: ditto
5740 * src/LaTeXFeatures.h: add a std::set of used floattypes
5742 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5744 * src/FloatList.[Ch] src/Floating.h: new files
5746 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5748 * src/lyx_cb.C (TableApplyCB): ditto
5750 * src/text2.C: ditto
5751 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5752 (parseSingleLyXformat2Token): ditto + add code for
5753 backwards compability for old float styles + add code for new insets
5755 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5757 (InsertInset(size_type, Inset *, LyXFont)): new method
5758 (InsetChar(size_type, char)): changed to use the other InsetChar
5759 with a LyXFont(ALL_INHERIT).
5760 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5761 insert the META_INSET.
5763 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5765 * sigc++/thread.h (Threads): from here
5767 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5768 definition out of line
5769 * sigc++/scope.h: from here
5771 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5773 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5774 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5776 * Makefile.am (bindist): new target.
5778 * INSTALL: add instructions for doing a binary distribution.
5780 * development/tools/README.bin.example: update a bit.
5782 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5785 * lib/lyxrc.example: new lyxrc tag \set_color.
5787 * src/lyxfunc.C (Dispatch):
5788 * src/commandtags.h:
5789 * src/LyXAction.C: new lyxfunc "set-color".
5791 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5792 and an x11name given as strings.
5794 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5795 cache when a color is changed.
5797 2000-06-26 Juergen Vigna <jug@sad.it>
5799 * src/lyxrow.C (width): added this functions and variable.
5801 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5804 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5806 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5808 * images/undo_bw.xpm: new icon.
5809 * images/redo_bw.xpm: ditto.
5811 * configure.in (INSTALL_SCRIPT): change value to
5812 ${INSTALL} to avoid failures of install-script target.
5813 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5815 * src/BufferView.h: add a magic "friend" declaration to please
5818 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5820 * forms/cite.fd: modified to allow resizing without messing
5823 * src/insetcite.C: Uses code from cite.fd almost without
5825 User can now resize dialog in the x-direction.
5826 Resizing the dialog in the y-direction is prevented, as the
5827 code does this intelligently already.
5829 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5831 * INSTALL: remove obsolete entry in "problems" section.
5833 * lib/examples/sl_*.lyx: update of the slovenian examples.
5835 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5837 2000-06-23 Juergen Vigna <jug@sad.it>
5839 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5841 * src/buffer.C (resize): delete the LyXText of textinsets.
5843 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5845 * src/insets/lyxinset.h: added another parameter 'cleared' to
5846 the draw() function.
5848 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5849 unlocking inset in inset.
5851 2000-06-22 Juergen Vigna <jug@sad.it>
5853 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5854 of insets and moved first to LyXText.
5856 * src/mathed/formulamacro.[Ch]:
5857 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5859 2000-06-21 Juergen Vigna <jug@sad.it>
5861 * src/text.C (GetVisibleRow): look if I should clear the area or not
5862 using Inset::doClearArea() function.
5864 * src/insets/lyxinset.h: added doClearArea() function and
5865 modified draw(Painter &, ...) to draw(BufferView *, ...)
5867 * src/text2.C (UpdateInset): return bool insted of int
5869 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5871 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5872 combox in the character popup
5874 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5875 BufferParams const & params
5877 2000-06-20 Juergen Vigna <jug@sad.it>
5879 * src/insets/insettext.C (SetParagraphData): set insetowner on
5882 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5884 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5885 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5887 (form_main_): remove
5889 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5890 (create_form_form_main): remove FD_form_main stuff, connect to
5891 autosave_timeout signal
5893 * src/LyXView.[Ch] (getMainForm): remove
5894 (UpdateTimerCB): remove
5895 * src/BufferView_pimpl.h: inherit from SigC::Object
5897 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5898 signal instead of callback
5900 * src/BufferView.[Ch] (cursorToggleCB): remove
5902 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5904 * src/BufferView_pimpl.C: changes because of the one below
5906 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5907 instead of storing a pointer to a LyXText.
5909 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5911 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5913 * src/lyxparagraph.h
5915 * src/paragraph.C: Changed fontlist to a sorted vector.
5917 2000-06-19 Juergen Vigna <jug@sad.it>
5919 * src/BufferView.h: added screen() function.
5921 * src/insets/insettext.C (LocalDispatch): some selection code
5924 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5926 * src/insets/insettext.C (SetParagraphData):
5928 (InsetText): fixes for multiple paragraphs.
5930 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5932 * development/lyx.spec.in: Call configure with ``--without-warnings''
5933 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5934 This should be fine, however, since we generally don't want to be
5935 verbose when making an RPM.
5937 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5939 * lib/scripts/fig2pstex.py: New file
5941 2000-06-16 Juergen Vigna <jug@sad.it>
5943 * src/insets/insettabular.C (UpdateLocal):
5944 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5945 (LocalDispatch): Changed all functions to use LyXText.
5947 2000-06-15 Juergen Vigna <jug@sad.it>
5949 * src/text.C (SetHeightOfRow): call inset::update before requesting
5952 * src/insets/insettext.C (update):
5953 * src/insets/insettabular.C (update): added implementation
5955 * src/insets/lyxinset.h: added update function
5957 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5959 * src/text.C (SelectNextWord): protect against null pointers with
5960 old-style string streams. (fix from Paul Theo Gonciari
5963 * src/cite.[Ch]: remove erroneous files.
5965 * lib/configure.m4: update the list of created directories.
5967 * src/lyxrow.C: include <config.h>
5968 * src/lyxcursor.C: ditto.
5970 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5972 * lib/examples/decimal.lyx: new example file from Mike.
5974 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5975 to find template definitions (from Dekel)
5977 * src/frontends/.cvsignore: add a few things.
5979 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5981 * src/Timeout.C (TimeOut): remove default argument.
5983 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5986 * src/insets/ExternalTemplate.C: add a "using" directive.
5988 * src/lyx_main.h: remove the act_ struct, which seems unused
5991 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5993 * LyX Developers Meeting: All files changed, due to random C++ (by
5994 coincidence) code generator script.
5996 - external inset (cool!)
5997 - initial online editing of preferences
5998 - insettabular breaks insettext(s contents)
6000 - some DocBook fixes
6001 - example files update
6002 - other cool stuff, create a diff and look for yourself.
6004 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6006 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6007 -1 this is a non-line-breaking textinset.
6009 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6010 if there is no width set.
6012 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6014 * Lots of files: Merged the dialogbase branch.
6016 2000-06-09 Allan Rae <rae@lyx.org>
6018 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6019 and the Dispatch methods that used it.
6021 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6022 access to functions formerly kept in Dispatch.
6024 2000-05-19 Allan Rae <rae@lyx.org>
6026 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6027 made to_page and count_copies integers again. from_page remains a
6028 string however because I want to allow entry of a print range like
6029 "1,4,22-25" using this field.
6031 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6032 and printer-params-get. These aren't useful from the minibuffer but
6033 could be used by a script/LyXServer app provided it passes a suitable
6034 auto_mem_buffer. I guess I should take a look at how the LyXServer
6035 works and make it support xtl buffers.
6037 * sigc++/: updated to libsigc++-1.0.1
6039 * src/xtl/: updated to xtl-1.3.pl.11
6041 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6042 those changes done to the files in src/ are actually recreated when
6043 they get regenerated. Please don't ever accept a patch that changes a
6044 dialog unless that patch includes the changes to the corresponding *.fd
6047 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6048 stringOnlyContains, renamed it and generalised it.
6050 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6051 branch. Removed the remaining old form_print code.
6053 2000-04-26 Allan Rae <rae@lyx.org>
6055 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6056 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6058 2000-04-25 Allan Rae <rae@lyx.org>
6060 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6061 against a base of xtl-1.3.pl.4
6063 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6064 filter the Id: entries so they still show the xtl version number
6067 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6068 into the src/xtl code. Patch still pending with José (XTL)
6070 2000-04-24 Allan Rae <rae@lyx.org>
6072 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6073 both more generic and much safer. Use the new template functions.
6074 * src/buffer.[Ch] (Dispatch): ditto.
6076 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6077 and mem buffer more intelligently. Also a little general cleanup.
6080 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6081 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6082 * src/xtl/Makefile.am: ditto.
6083 * src/xtl/.cvsignore: ditto.
6084 * src/Makefile.am: ditto.
6086 * src/PrinterParams.h: Removed the macros member functions. Added a
6087 testInvariant member function. A bit of tidying up and commenting.
6088 Included Angus's idea for fixing operation with egcs-1.1.2.
6090 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6091 cool expansion of XTL's mem_buffer to support automatic memory
6092 management within the buffer itself. Removed the various macros and
6093 replaced them with template functions that use either auto_mem_buffer
6094 or mem_buffer depending on a #define. The mem_buffer support will
6095 disappear as soon as the auto_mem_buffer is confirmed to be good on
6096 other platforms/compilers. That is, it's there so you've got something
6099 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6100 effectively forked XTL. However I expect José will include my code
6101 into the next major release. Also fixed a memory leak.
6102 * src/xtl/text.h: ditto.
6103 * src/xtl/xdr.h: ditto.
6104 * src/xtl/giop.h: ditto.
6106 2000-04-16 Allan Rae <rae@lyx.org>
6108 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6109 by autogen.sh and removed by maintainer-clean anyway.
6110 * .cvsignore, sigc++/.cvsignore: Support the above.
6112 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6114 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6116 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6117 macros, renamed static callback-target member functions to suit new
6118 scheme and made them public.
6119 * src/frontends/xforms/forms/form_print.fd: ditto.
6120 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6122 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6125 * src/xtl/: New directory containing a minimal distribution of XTL.
6126 This is XTL-1.3.pl.4.
6128 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6130 2000-04-15 Allan Rae <rae@lyx.org>
6132 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6134 * sigc++/: Updated to libsigc++-1.0.0
6136 2000-04-14 Allan Rae <rae@lyx.org>
6138 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6139 use the generic ones in future. I'll modify my conversion script.
6141 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6143 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6144 (CloseAllBufferRelatedDialogs): Renamed.
6145 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6147 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6148 of the generic ones. These are the same ones my conversion script
6151 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6152 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6153 * src/buffer.C (Dispatch): ditto
6155 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6156 functions for updating and hiding buffer dependent dialogs.
6157 * src/BufferView.C (buffer): ditto
6158 * src/buffer.C (setReadonly): ditto
6159 * src/lyxfunc.C (CloseBuffer): ditto
6161 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6162 Dialogs.h, and hence all the SigC stuff, into every file that includes
6163 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6165 * src/BufferView2.C: reduce the number of headers included by buffer.h
6167 2000-04-11 Allan Rae <rae@lyx.org>
6169 * src/frontends/xforms/xform_macros.h: A small collection of macros
6170 for building C callbacks.
6172 * src/frontends/xforms/Makefile.am: Added above file.
6174 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6175 scheme again. This time it should work for JMarc. If this is
6176 successful I'll revise my conversion script to automate some of this.
6177 The static member functions in the class also have to be public for
6178 this scheme will work. If the scheme works (it's almost identical to
6179 the way BufferView::cursorToggleCB is handled so it should work) then
6180 FormCopyright and FormPrint will be ready for inclusion into the main
6181 trunk immediately after 1.1.5 is released -- provided we're prepared
6182 for complaints about lame compilers not handling XTL.
6184 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6186 2000-04-07 Allan Rae <rae@lyx.org>
6188 * config/lyxinclude.m4: A bit more tidying up (Angus)
6190 * src/LString.h: JMarc's <string> header fix
6192 * src/PrinterParams.h: Used string for most data to remove some
6193 ugly code in the Print dialog and avoid even uglier code when
6194 appending the ints to a string for output.
6196 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6197 and moved "default:" back to the end of switch statement. Cleaned
6198 up the printing so it uses the right function calls and so the
6199 "print to file" option actually puts the file in the right directory.
6201 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6203 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6204 and Ok+Apply button control into a separate method: input (Angus).
6205 (input) Cleaned it up and improved it to be very thorough now.
6206 (All CB) static_cast used instead of C style cast (Angus). This will
6207 probably change again once we've worked out how to keep gcc-2.8.1 happy
6208 with real C callbacks.
6209 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6210 ignore some of the bool settings and has random numbers instead. Needs
6211 some more investigation. Added other input length checks and checking
6212 of file and printer names.
6214 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6215 would link (Angus). Seems the old code doesn't compile with the pragma
6216 statement either. Separated callback entries from internal methods.
6218 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6220 2000-03-17 Allan Rae <rae@lyx.org>
6222 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6223 need it? Maybe it could go in Dialogs instead? I could make it a
6224 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6225 values to get the bool return value.
6226 (Dispatch): New overloaded method for xtl support.
6228 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6229 extern "C" callback instead of static member functions. Hopefully,
6230 JMarc will be able to compile this. I haven't changed
6231 forms/form_copyright.fd yet. Breaking one of my own rules already.
6233 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6234 because they aren't useful from the minibuffer. Maybe a LyXServer
6235 might want a help message though?
6237 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6239 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6240 xtl which needs both rtti and exceptions.
6242 * src/support/Makefile.am:
6243 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6245 * src/frontends/xforms/input_validators.[ch]: input filters and
6246 validators. These conrol what keys are valid in input boxes.
6247 Use them and write some more. Much better idea than waiting till
6248 after the user has pressed Ok to say that the input fields don't make
6251 * src/frontends/xforms/Makefile.am:
6252 * src/frontends/xforms/forms/form_print.fd:
6253 * src/frontends/xforms/forms/makefile:
6254 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6255 new scheme. Still have to make sure I haven't missed anything from
6256 the current implementation.
6258 * src/Makefile.am, src/PrinterParams.h: New data store.
6260 * other files: Added a couple of copyright notices.
6262 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6264 * src/insets/insetbib.h: move Holder struct in public space.
6266 * src/frontends/include/DialogBase.h: use SigC:: only when
6267 SIGC_CXX_NAMESPACES is defined.
6268 * src/frontends/include/Dialogs.h: ditto.
6270 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6272 * src/frontends/xforms/FormCopyright.[Ch]: do not
6273 mention SigC:: explicitely.
6275 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6277 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6278 deals with testing KDE in main configure.in
6279 * configure.in: ditto.
6281 2000-02-22 Allan Rae <rae@lyx.org>
6283 * Lots of files: Merged from HEAD
6285 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6286 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6288 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6290 * sigc++/: new minidist.
6292 2000-02-14 Allan Rae <rae@lyx.org>
6294 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6296 2000-02-08 Juergen Vigna <jug@sad.it>
6298 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6299 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6301 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6302 for this port and so it is much easier for other people to port
6303 dialogs in a common development environment.
6305 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6306 the QT/KDE implementation.
6308 * src/frontends/kde/Dialogs.C:
6309 * src/frontends/kde/FormCopyright.C:
6310 * src/frontends/kde/FormCopyright.h:
6311 * src/frontends/kde/Makefile.am:
6312 * src/frontends/kde/formcopyrightdialog.C:
6313 * src/frontends/kde/formcopyrightdialog.h:
6314 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6315 for the kde support of the Copyright-Dialog.
6317 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6318 subdir-substitution instead of hardcoded 'xforms' as we now have also
6321 * src/frontends/include/DialogBase.h (Object): just commented the
6322 label after #endif (nasty warning and I don't like warnings ;)
6324 * src/main.C (main): added KApplication initialization if using
6327 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6328 For now only the KDE event-loop is added if frontend==kde.
6330 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6332 * configure.in: added support for the --with-frontend[=value] option
6334 * autogen.sh: added kde.m4 file to list of config-files
6336 * acconfig.h: added define for KDEGUI-support
6338 * config/kde.m4: added configuration functions for KDE-port
6340 * config/lyxinclude.m4: added --with-frontend[=value] option with
6341 support for xforms and KDE.
6343 2000-02-08 Allan Rae <rae@lyx.org>
6345 * all Makefile.am: Fixed up so the make targets dist, distclean,
6346 install and uninstall all work even if builddir != srcdir. Still
6347 have a new sigc++ minidist update to come.
6349 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6351 2000-02-01 Allan Rae <rae@lyx.org>
6353 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6354 Many mods to get builddir != srcdir working.
6356 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6357 for building on NT and so we can do the builddir != srcdir stuff.
6359 2000-01-30 Allan Rae <rae@lyx.org>
6361 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6362 This will stay in "rae" branch. We probably don't really need it in
6363 the main trunk as anyone who wants to help programming it should get
6364 a full library installed also. So they can check both included and
6365 system supplied library compilation.
6367 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6368 Added a 'mini' distribution of libsigc++. If you feel the urge to
6369 change something in these directories - Resist it. If you can't
6370 resist the urge then you should modify the following script and rebuild
6371 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6372 all happen. Still uses a hacked version of libsigc++'s configure.in.
6373 I'm quite happy with the results. I'm not sure the extra work to turn
6374 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6375 worth the trouble and would probably lead to extra maintenance
6377 I haven't tested the following important make targets: install, dist.
6378 Not ready for prime time but very close. Maybe 1.1.5.
6380 * development/tools/makeLyXsigc.sh: A shell script to automatically
6381 generate our mini-dist of libsigc++. It can only be used with a CVS
6382 checkout of libsigc++ not a tarball distribution. It's well commented.
6383 This will end up as part of the libsigc++ distribution so other apps
6384 can easily have an included mini-dist. If someone makes mods to the
6385 sigc++ subpackage without modifying this script to generate those
6386 changes I'll be very upset!
6388 * src/frontends/: Started the gui/system indep structure.
6390 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6391 to access the gui-indep dialogs are in this class. Much improved
6392 design compared to previous revision. Lars, please refrain from
6393 moving this header into src/ like you did with Popups.h last time.
6395 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6397 * src/frontends/xforms/: Started the gui-indep system with a single
6398 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6401 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6402 Here you'll find a very useful makefile and automated fdfix.sh that
6403 makes updating dailogs a no-brainer -- provided you follow the rules
6404 set out in the README. I'm thinking about adding another script to
6405 automatically generate skeleton code for a new dialog given just the
6408 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6409 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6410 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6412 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6414 * src/support/LSubstring.C (operator): simplify
6416 * src/lyxtext.h: removed bparams, use buffer_->params instead
6418 * src/lyxrow.h: make Row a real class, move all variables to
6419 private and use accessors.
6421 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6423 (isRightToLeftPar): ditto
6424 (ChangeLanguage): ditto
6425 (isMultiLingual): ditto
6428 (SimpleTeXOnePar): ditto
6429 (TeXEnvironment): ditto
6430 (GetEndLabel): ditto
6432 (SetOnlyLayout): ditto
6433 (BreakParagraph): ditto
6434 (BreakParagraphConservative): ditto
6435 (GetFontSettings): ditto
6437 (CopyIntoMinibuffer): ditto
6438 (CutIntoMinibuffer): ditto
6439 (PasteParagraph): ditto
6440 (SetPExtraType): ditto
6441 (UnsetPExtraType): ditto
6442 (DocBookContTableRows): ditto
6443 (SimpleDocBookOneTablePar): ditto
6445 (TeXFootnote): ditto
6446 (SimpleTeXOneTablePar): ditto
6447 (TeXContTableRows): ditto
6448 (SimpleTeXSpecialChars): ditto
6451 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6452 to private and use accessors.
6454 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6455 this, we did not use it anymore and has not been for ages. Just a
6456 waste of cpu cycles.
6458 * src/language.h: make Language a real class, move all variables
6459 to private and use accessors.
6461 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6462 (create_view): remove
6463 (update): some changes for new timer
6464 (cursorToggle): use new timer
6465 (beforeChange): change for new timer
6467 * src/BufferView.h (cursorToggleCB): removed last paramter because
6470 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6471 (cursorToggleCB): change because of new timer code
6473 * lib/CREDITS: updated own mailaddress
6475 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6477 * src/support/filetools.C (PutEnv): fix the code in case neither
6478 putenv() nor setenv() have been found.
6480 * INSTALL: mention the install-strip Makefile target.
6482 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6483 read-only documents.
6485 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6487 * lib/reLyX/configure.in (VERSION): avoid using a previously
6488 generated reLyX wrapper to find out $prefix.
6490 * lib/examples/eu_adibide_lyx-atua.lyx:
6491 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6492 translation of the Tutorial (Dooteo)
6494 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6496 * forms/cite.fd: new citation dialog
6498 * src/insetcite.[Ch]: the new citation dialog is moved into
6501 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6504 * src/insets/insetcommand.h: data members made private.
6506 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6508 * LyX 1.1.5 released
6510 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6512 * src/version.h (LYX_RELEASE): to 1.1.5
6514 * src/spellchecker.C (RunSpellChecker): return false if the
6515 spellchecker dies upon creation.
6517 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6519 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6520 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6524 * lib/CREDITS: update entry for Martin Vermeer.
6526 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6528 * src/text.C (draw): Draw foreign language bars at the bottom of
6529 the row instead of at the baseline.
6531 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6533 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6535 * lib/bind/de_menus.bind: updated
6537 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6539 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6541 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6543 * src/menus.C (Limit_string_length): New function
6544 (ShowTocMenu): Limit the number of items/length of items in the
6547 * src/paragraph.C (String): Correct result for a paragraph inside
6550 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6552 * src/bufferlist.C (close): test of buf->getuser() == NULL
6554 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6556 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6557 Do not call to SetCursor when the paragraph is a closed footnote!
6559 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6561 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6564 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6566 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6569 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6570 reference popup, that activates the reference-back action
6572 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6574 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6575 the menus. Also fixed a bug.
6577 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6578 the math panels when switching buffers (unless new buffer is readonly).
6580 * src/BufferView.C (NoSavedPositions)
6581 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6583 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6585 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6586 less of dvi dirty or not.
6588 * src/trans_mgr.[Ch] (insert): change first parameter to string
6591 * src/chset.[Ch] (encodeString): add const to first parameter
6593 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6595 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6599 * src/LaTeX.C (deplog): better searching for dependency files in
6600 the latex log. Uses now regexps.
6602 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6603 instead of the box hack or \hfill.
6605 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6607 * src/lyxfunc.C (doImportHelper): do not create the file before
6608 doing the actual import.
6609 (doImportASCIIasLines): create a new file before doing the insert.
6610 (doImportASCIIasParagraphs): ditto.
6612 * lib/lyxrc.example: remove mention of non-existing commands
6614 * lyx.man: remove mention of color-related switches.
6616 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6618 * src/lyx_gui.C: remove all the color-related ressources, which
6619 are not used anymore.
6621 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6624 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6626 * src/lyxrc.C (read): Add a missing break in the switch
6628 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6630 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6632 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6635 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6637 * src/text.C (draw): draw bars under foreign language words.
6639 * src/LColor.[Ch]: add LColor::language
6641 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6643 * src/lyxcursor.h (boundary): New member variable
6645 * src/text.C (IsBoundary): New methods
6647 * src/text.C: Use the above for currect cursor movement when there
6648 is both RTL & LTR text.
6650 * src/text2.C: ditto
6652 * src/bufferview_funcs.C (ToggleAndShow): ditto
6654 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6656 * src/text.C (DeleteLineForward): set selection to true to avoid
6657 that DeleteEmptyParagraphMechanism does some magic. This is how it
6658 is done in all other functions, and seems reasonable.
6659 (DeleteWordForward): do not jump over non-word stuff, since
6660 CursorRightOneWord() already does it.
6662 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6663 DeleteWordBackward, since they seem safe to me (since selection is
6664 set to "true") DeleteEmptyParagraphMechanism does nothing.
6666 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6668 * src/lyx_main.C (easyParse): simplify the code by factoring the
6669 part that removes parameters from the command line.
6670 (LyX): check wether wrong command line options have been given.
6672 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6674 * src/lyx_main.C : add support for specifying user LyX
6675 directory via command line option -userdir.
6677 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6679 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6680 the number of items per popup.
6681 (Add_to_refs_menu): Ditto.
6683 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6685 * src/lyxparagraph.h: renamed ClearParagraph() to
6686 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6687 textclass as parameter, and do nothing if free_spacing is
6688 true. This fixes part of the line-delete-forward problems.
6690 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6691 (pasteSelection): ditto.
6692 (SwitchLayoutsBetweenClasses): more translatable strings.
6694 * src/text2.C (CutSelection): use StripLeadingSpaces.
6695 (PasteSelection): ditto.
6696 (DeleteEmptyParagraphMechanism): ditto.
6698 2000-05-26 Juergen Vigna <jug@sad.it>
6700 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6701 is not needed in tabular insets.
6703 * src/insets/insettabular.C (TabularFeatures): added missing features.
6705 * src/tabular.C (DeleteColumn):
6707 (AppendRow): implemented this functions
6708 (cellsturct::operator=): clone the inset too;
6710 2000-05-23 Juergen Vigna <jug@sad.it>
6712 * src/insets/insettabular.C (LocalDispatch): better selection support
6713 when having multicolumn-cells.
6715 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6717 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6719 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6721 * src/ColorHandler.C (getGCForeground): put more test into _()
6723 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6726 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6729 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6731 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6732 there are no labels, or when buffer is readonly.
6734 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6735 there are no labels, buffer is SGML, or when buffer is readonly.
6737 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6739 * src/LColor.C (LColor): change a couple of grey40 to grey60
6740 (LColor): rewore initalization to make compiles go some magnitude
6742 (getGUIName): don't use gettext until we need the string.
6744 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6746 * src/Bullet.[Ch]: Fixed a small bug.
6748 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6750 * src/paragraph.C (String): Several fixes/improvements
6752 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6754 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6756 * src/paragraph.C (String): give more correct output.
6758 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6760 * src/lyxfont.C (stateText) Do not output the language if it is
6761 eqaul to the language of the document.
6763 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6764 between two paragraphs with the same language.
6766 * src/paragraph.C (getParLanguage) Return a correct answer for an
6767 empty dummy paragraph.
6769 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6772 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6775 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6776 the menus/popup, if requested fonts are unavailable.
6778 2000-05-22 Juergen Vigna <jug@sad.it>
6780 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6781 movement support (Up/Down/Tab/Shift-Tab).
6782 (LocalDispatch): added also preliminari cursor-selection.
6784 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6786 * src/paragraph.C (PasteParagraph): Hopefully now right!
6788 2000-05-22 Garst R. Reese <reese@isn.net>
6790 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6791 of list, change all references to Environment to Command
6792 * tex/hollywood.cls : rewrite environments as commands, add
6793 \uppercase to interiorshot and exteriorshot to force uppecase.
6794 * tex/broadway.cls : rewrite environments as commands. Tweak
6797 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6799 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6800 size of items: use a constant intead of the hardcoded 40, and more
6801 importantly do not remove the %m and %x tags added at the end.
6802 (Add_to_refs_menu): use vector::size_type instead of
6803 unsigned int as basic types for the variables. _Please_ do not
6804 assume that size_t is equal to unsigned int. On an alpha, this is
6805 unsigned long, which is _not_ the same.
6807 * src/language.C (initL): remove language "hungarian", since it
6808 seems that "magyar" is better.
6810 2000-05-22 Juergen Vigna <jug@sad.it>
6812 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6814 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6817 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6818 next was deleted but not set to 0.
6820 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6822 * src/language.C (initL): change the initialization of languages
6823 so that compiles goes _fast_.
6825 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6828 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6830 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6834 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6836 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6838 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6842 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6845 * src/insets/insetlo*.[Ch]: Made editable
6847 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6849 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6850 the current selection.
6852 * src/BufferView_pimpl.C (stuffClipboard): new method
6854 * src/BufferView.C (stuffClipboard): new method
6856 * src/paragraph.C (String): new method
6858 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6859 LColor::ignore when lyxname is not found.
6861 * src/BufferView.C (pasteSelection): new method
6863 * src/BufferView_pimpl.C (pasteSelection): new method
6865 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6867 * src/WorkArea.C (request_clipboard_cb): new static function
6868 (getClipboard): new method
6869 (putClipboard): new method
6871 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6873 * LyX 1.1.5pre2 released
6875 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6877 * src/vspace.C (operator=): removed
6878 (operator=): removed
6880 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6882 * src/layout.C (NumberOfClass): manually set the type in make_pair
6883 (NumberOfLayout): ditto
6885 * src/language.C: use the Language constructor for ignore_lang
6887 * src/language.h: add constructors to struct Language
6889 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6891 * src/text2.C (SetCursorIntern): comment out #warning
6893 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6895 * src/mathed/math_iter.h: initialize sx and sw to 0
6897 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6899 * forms/lyx.fd: Redesign of form_ref
6901 * src/LaTeXFeatures.[Ch]
6905 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6908 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6909 and Buffer::inset_iterator.
6911 * src/menus.C: Added new menus: TOC and Refs.
6913 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6915 * src/buffer.C (getTocList): New method.
6917 * src/BufferView2.C (ChangeRefs): New method.
6919 * src/buffer.C (getLabelList): New method. It replaces the old
6920 getReferenceList. The return type is vector<string> instead of
6923 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6924 the old getLabel() and GetNumberOfLabels() methods.
6925 * src/insets/insetlabel.C (getLabelList): ditto
6926 * src/mathed/formula.C (getLabelList): ditto
6928 * src/paragraph.C (String): New method.
6930 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6931 Uses the new getTocList() method.
6932 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6933 which automatically updates the contents of the browser.
6934 (RefUpdateCB): Use the new getLabelList method.
6936 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6938 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6940 * src/spellchecker.C: Added using std::reverse;
6942 2000-05-19 Juergen Vigna <jug@sad.it>
6944 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6946 * src/insets/insettext.C (computeTextRows): small fix for display of
6947 1 character after a newline.
6949 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6952 2000-05-18 Juergen Vigna <jug@sad.it>
6954 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6955 when changing width of column.
6957 * src/tabular.C (set_row_column_number_info): setting of
6958 autobreak rows if necessary.
6960 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6962 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6964 * src/vc-backend.*: renamed stat() to status() and vcstat to
6965 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6966 compilation broke. The new name seems more relevant, anyway.
6968 2000-05-17 Juergen Vigna <jug@sad.it>
6970 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6971 which was wrong if the removing caused removing of rows!
6973 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6974 (pushToken): new function.
6976 * src/text2.C (CutSelection): fix problem discovered with purify
6978 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6980 * src/debug.C (showTags): enlarge the first column, now that we
6981 have 6-digits debug codes.
6983 * lib/layouts/hollywood.layout:
6984 * lib/tex/hollywood.cls:
6985 * lib/tex/brodway.cls:
6986 * lib/layouts/brodway.layout: more commands and fewer
6987 environments. Preambles moved in the .cls files. Broadway now has
6988 more options on scene numbering and less whitespace (from Garst)
6990 * src/insets/insetbib.C (getKeys): make sure that we are in the
6991 document directory, in case the bib file is there.
6993 * src/insets/insetbib.C (Latex): revert bogus change.
6995 2000-05-16 Juergen Vigna <jug@sad.it>
6997 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6998 the TabularLayout on cursor move.
7000 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7002 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7005 (draw): fixed cursor position and drawing so that the cursor is
7006 visible when before the tabular-inset.
7008 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7009 when creating from old insettext.
7011 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7013 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7015 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7016 * lib/tex/brodway.cls: ditto
7018 * lib/layouts/brodway.layout: change alignment of parenthical
7021 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7023 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7024 versions 0.88 and 0.89 are supported.
7026 2000-05-15 Juergen Vigna <jug@sad.it>
7028 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7031 * src/insets/insettext.C (computeTextRows): redone completely this
7032 function in a much cleaner way, because of problems when having a
7034 (draw): added a frame border when the inset is locked.
7035 (SetDrawLockedFrame): this sets if we draw the border or not.
7036 (SetFrameColor): this sets the frame color (default=insetframe).
7038 * src/insets/lyxinset.h: added x() and y() functions which return
7039 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7040 function which is needed to see if we have a locking inset of some
7041 type in this inset (needed for now in insettabular).
7043 * src/vspace.C (inPixels): the same function also without a BufferView
7044 parameter as so it is easier to use it in some ocasions.
7046 * src/lyxfunc.C: changed all places where insertInset was used so
7047 that now if it couldn't be inserted it is deleted!
7049 * src/TabularLayout.C:
7050 * src/TableLayout.C: added support for new tabular-inset!
7052 * src/BufferView2.C (insertInset): this now returns a bool if the
7053 inset was really inserted!!!
7055 * src/tabular.C (GetLastCellInRow):
7056 (GetFirstCellInRow): new helper functions.
7057 (Latex): implemented for new tabular class.
7061 (TeXTopHLine): new Latex() helper functions.
7063 2000-05-12 Juergen Vigna <jug@sad.it>
7065 * src/mathed/formulamacro.C (Read):
7066 * src/mathed/formula.C (Read): read also the \end_inset here!
7068 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7070 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7071 crush when saving formulae with unbalanced parenthesis.
7073 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7075 * src/layout.C: Add new keyword "endlabelstring" to layout file
7077 * src/text.C (GetVisibleRow): Draw endlabel string.
7079 * lib/layouts/broadway.layout
7080 * lib/layouts/hollywood.layout: Added endlabel for the
7081 Parenthetical layout.
7083 * lib/layouts/heb-article.layout: Do not use slanted font shape
7084 for Theorem like environments.
7086 * src/buffer.C (makeLaTeXFile): Always add "american" to
7087 the UsedLanguages list if document language is RTL.
7089 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7091 * add addendum to README.OS2 and small patch (from SMiyata)
7093 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7095 * many files: correct the calls to ChangeExtension().
7097 * src/support/filetools.C (ChangeExtension): remove the no_path
7098 argument, which does not belong there. Use OnlyFileName() instead.
7100 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7101 files when LaTeXing a non-nice latex file.
7103 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7104 a chain of "if". Return false when deadkeys are not handled.
7106 * src/lyx_main.C (LyX): adapted the code for default bindings.
7108 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7109 bindings for basic functionality (except deadkeys).
7110 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7112 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7113 several methods: handle override_x_deadkeys.
7115 * src/lyxrc.h: remove the "bindings" map, which did not make much
7116 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7118 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7120 * src/lyxfont.C (stateText): use a saner method to determine
7121 whether the font is "default". Seems to fix the crash with DEC
7124 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7126 2000-05-08 Juergen Vigna <jug@sad.it>
7128 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7129 TabularLayoutMenu with mouse-button-3
7130 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7132 * src/TabularLayout.C: added this file for having a Layout for
7135 2000-05-05 Juergen Vigna <jug@sad.it>
7137 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7138 recalculating inset-widths.
7139 (TabularFeatures): activated this function so that I can change
7140 tabular-features via menu.
7142 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7143 that I can test some functions with the Table menu.
7145 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7147 * src/lyxfont.C (stateText): guard against stupid c++libs.
7149 * src/tabular.C: add using std::vector
7150 some whitespace changes, + removed som autogenerated code.
7152 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7154 2000-05-05 Juergen Vigna <jug@sad.it>
7156 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7157 row, columns and cellstructures.
7159 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7161 * lib/lyxrc.example: remove obsolete entries.
7163 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7164 reading of protected_separator for free_spacing.
7166 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7168 * src/text.C (draw): do not display an exclamation mark in the
7169 margin for margin notes. This is confusing, ugly and
7172 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7173 AMS math' is checked.
7175 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7176 name to see whether including the amsmath package is needed.
7178 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7180 * src/paragraph.C (validate): Compute UsedLanguages correctly
7181 (don't insert the american language if it doesn't appear in the
7184 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7185 The argument of \thanks{} command is considered moving argument
7187 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7190 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7192 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7193 for appendix/minipage/depth. The lines can be now both in the footnote
7194 frame, and outside the frame.
7196 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7199 2000-05-05 Juergen Vigna <jug@sad.it>
7201 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7202 neede only in tabular.[Ch].
7204 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7206 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7208 (Write): write '~' for PROTECTED_SEPARATOR
7210 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7212 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7215 * src/mathed/formula.C (drawStr): rename size to siz.
7217 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7218 possibly fix a bug by not changing the pflags = flags to piflags =
7221 2000-05-05 Juergen Vigna <jug@sad.it>
7223 * src/insets/insetbib.C: moved using directive
7225 * src/ImportNoweb.C: small fix for being able to compile (missing
7228 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7230 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7231 to use clear, since we don't depend on this in the code. Add test
7234 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7236 * (various *.C files): add using std::foo directives to please dec
7239 * replace calls to string::clear() to string::erase() (Angus)
7241 * src/cheaders/cmath: modified to provide std::abs.
7243 2000-05-04 Juergen Vigna <jug@sad.it>
7245 * src/insets/insettext.C: Prepared all for inserting of multiple
7246 paragraphs. Still display stuff to do (alignment and other things),
7247 but I would like to use LyXText to do this when we cleaned out the
7248 table-support stuff.
7250 * src/insets/insettabular.C: Changed lot of stuff and added lots
7251 of functionality still a lot to do.
7253 * src/tabular.C: Various functions changed name and moved to be
7254 const functions. Added new Read and Write functions and changed
7255 lots of things so it works good with tabular-insets (also removed
7256 some stuff which is not needed anymore * hacks *).
7258 * src/lyxcursor.h: added operators == and != which just look if
7259 par and pos are (not) equal.
7261 * src/buffer.C (latexParagraphs): inserted this function to latex
7262 all paragraphs form par to endpar as then I can use this too for
7265 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7266 so that I can call this to from text insets with their own cursor.
7268 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7269 output off all paragraphs (because of the fix below)!
7271 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7272 the very last paragraph (this could be also the last paragraph of an
7275 * src/texrow.h: added rows() call which returns the count-variable.
7277 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7279 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7281 * lib/configure.m4: better autodetection of DocBook tools.
7283 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7285 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7287 * src/lyx_cb.C: add using std::reverse;
7289 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7292 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7293 selected files. Should fix repeated errors from generated files.
7295 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7297 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7299 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7300 the spellchecker popup.
7302 * lib/lyxrc.example: Removed the \number_inset section
7304 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7306 * src/insets/figinset.C (various): Use IsFileReadable() to make
7307 sure that the file actually exist. Relying on ghostscripts errors
7308 is a bad idea since they can lead to X server crashes.
7310 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7312 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7315 * lib/lyxrc.example: smallish typo in description of
7316 \view_dvi_paper_option
7318 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7321 * src/lyxfunc.C: doImportHelper to factor out common code of the
7322 various import methods. New functions doImportASCIIasLines,
7323 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7324 doImportLinuxDoc for the format specific parts.
7327 * buffer.C: Dispatch returns now a bool to indicate success
7330 * lyx_gui.C: Add getLyXView() for member access
7332 * lyx_main.C: Change logic for batch commands: First try
7333 Buffer::Dispatch (possibly without GUI), if that fails, use
7336 * lyx_main.C: Add support for --import command line switch.
7337 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7338 Available Formats: Everything accepted by 'buffer-import <format>'
7340 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7342 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7345 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7346 documents will be reformatted upon reentry.
7348 2000-04-27 Juergen Vigna <jug@sad.it>
7350 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7351 correctly only last pos this was a bug.
7353 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7355 * release of lyx-1.1.5pre1
7357 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7359 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7361 * src/menus.C: revert the change of naming (Figure->Graphic...)
7362 from 2000-04-11. It was incomplete and bad.
7364 * src/LColor.[Ch]: add LColor::depthbar.
7365 * src/text.C (GetVisibleRow): use it.
7367 * README: update the languages list.
7369 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7371 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7374 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7376 * README: remove sections that were just wrong.
7378 * src/text2.C (GetRowNearY): remove currentrow code
7380 * src/text.C (GetRow): remove currentrow code
7382 * src/screen.C (Update): rewritten a bit.
7383 (SmallUpdate): removed func
7385 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7387 (FullRebreak): return bool
7388 (currentrow): remove var
7389 (currentrow_y): ditto
7391 * src/lyxscreen.h (Draw): change arg to unsigned long
7392 (FitCursor): return bool
7393 (FitManualCursor): ditto
7394 (Smallpdate): remove func
7395 (first): change to unsigned long
7396 (DrawOneRow): change second arg to long (from long &)
7397 (screen_refresh_y): remove var
7398 (scree_refresh_row): ditto
7400 * src/lyxrow.h: change baseline to usigned int from unsigned
7401 short, this brings some implicit/unsigned issues out in the open.
7403 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7405 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7406 instead of smallUpdate.
7408 * src/lyxcursor.h: change y to unsigned long
7410 * src/buffer.h: don't call updateScrollbar after fitcursor
7412 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7413 where they are used. Removed "\\direction", this was not present
7414 in 1.1.4 and is already obsolete. Commented out some code that I
7415 believe to never be called.
7416 (runLiterate): don't call updateScrollbar after fitCursor
7418 (buildProgram): ditto
7421 * src/WorkArea.h (workWidth): change return val to unsigned
7424 (redraw): remove the button redraws
7425 (setScrollbarValue): change for scrollbar
7426 (getScrollbarValue): change for scrollbar
7427 (getScrollbarBounds): change for scrollbar
7429 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7430 (C_WorkArea_down_cb): removed func
7431 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7432 (resize): change for scrollbar
7433 (setScrollbar): ditto
7434 (setScrollbarBounds): ditto
7435 (setScrollbarIncrements): ditto
7436 (up_cb): removed func
7437 (down_cb): removed func
7438 (scroll_cb): change for scrollbar
7439 (work_area_handler): ditto
7441 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7442 when FitCursor did something.
7443 (updateScrollbar): some unsigned changes
7444 (downCB): removed func
7445 (scrollUpOnePage): removed func
7446 (scrollDownOnePage): remvoed func
7447 (workAreaMotionNotify): don't call screen->FitCursor but use
7448 fitCursor instead. and bool return val
7449 (workAreaButtonPress): ditto
7450 (workAreaButtonRelease): some unsigned changes
7451 (checkInsetHit): ditto
7452 (workAreaExpose): ditto
7453 (update): parts rewritten, comments about the signed char arg added
7454 (smallUpdate): removed func
7455 (cursorPrevious): call needed updateScrollbar
7458 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7461 * src/BufferView.[Ch] (upCB): removed func
7462 (downCB): removed func
7463 (smallUpdate): removed func
7465 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7467 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7468 currentrow, currentrow_y optimization. This did not help a lot and
7469 if we want to do this kind of optimization we should rather use
7470 cursor.row instead of the currentrow.
7472 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7473 buffer spacing and klyx spacing support.
7475 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7477 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7480 2000-04-26 Juergen Vigna <jug@sad.it>
7482 * src/insets/figinset.C: fixes to Lars sstream changes!
7484 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7486 * A lot of files: Added Ascii(ostream &) methods to all inset
7487 classes. Used when exporting to ASCII.
7489 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7490 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7493 * src/text2.C (ToggleFree): Disabled implicit word selection when
7494 there is a change in the language
7496 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7497 no output was generated for end-of-sentence inset.
7499 * src/insets/lyxinset.h
7502 * src/paragraph.C: Removed the insetnumber code
7504 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7506 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7508 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7509 no_babel and no_epsfig completely from the file.
7510 (parseSingleLyXformat2Token): add handling for per-paragraph
7511 spacing as written by klyx.
7513 * src/insets/figinset.C: applied patch by Andre. Made it work with
7516 2000-04-20 Juergen Vigna <jug@sad.it>
7518 * src/insets/insettext.C (cutSelection):
7519 (copySelection): Fixed with selection from right to left.
7520 (draw): now the rows are not recalculated at every draw.
7521 (computeTextRows): for now reset the inset-owner here (this is
7522 important for an undo or copy where the inset-owner is not set
7525 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7526 motion to the_locking_inset screen->first was forgotten, this was
7527 not important till we got multiline insets.
7529 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7531 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7532 code seems to be alright (it is code changed by Dekel, and the
7533 intent is indeed that all macros should be defined \protect'ed)
7535 * NEWS: a bit of reorganisation of the new user-visible features.
7537 2000-04-19 Juergen Vigna <jug@sad.it>
7539 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7540 position. Set the inset_owner of the used paragraph so that it knows
7541 that it is inside an inset. Fixed cursor handling with mouse and
7542 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7543 and cleanups to make TextInsets work better.
7545 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7546 Changed parameters of various functions and added LockInsetInInset().
7548 * src/insets/insettext.C:
7550 * src/insets/insetcollapsable.h:
7551 * src/insets/insetcollapsable.C:
7552 * src/insets/insetfoot.h:
7553 * src/insets/insetfoot.C:
7554 * src/insets/insetert.h:
7555 * src/insets/insetert.C: cleaned up the code so that it works now
7556 correctly with insettext.
7558 * src/insets/inset.C:
7559 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7560 that insets in insets are supported right.
7563 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7565 * src/paragraph.C: some small fixes
7567 * src/debug.h: inserted INSETS debug info
7569 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7570 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7572 * src/commandtags.h:
7573 * src/LyXAction.C: insert code for InsetTabular.
7575 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7576 not Button1MotionMask.
7577 (workAreaButtonRelease): send always a InsetButtonRelease event to
7579 (checkInsetHit): some setCursor fixes (always with insets).
7581 * src/BufferView2.C (lockInset): returns a bool now and extended for
7582 locking insets inside insets.
7583 (showLockedInsetCursor): it is important to have the cursor always
7584 before the locked inset.
7585 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7587 * src/BufferView.h: made lockInset return a bool.
7589 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7591 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7592 that is used also internally but can be called as public to have back
7593 a cursor pos which is not set internally.
7594 (SetCursorIntern): Changed to use above function.
7596 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7598 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7603 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7604 patches for things that should be in or should be changed.
7606 * src/* [insetfiles]: change "usigned char fragile" to bool
7607 fragile. There was only one point that could that be questioned
7608 and that is commented in formulamacro.C. Grep for "CHECK".
7610 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7611 (DeleteBuffer): take it out of CutAndPaste and make it static.
7613 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7615 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7616 output the spacing envir commands. Also the new commands used in
7617 the LaTeX output makes the result better.
7619 * src/Spacing.C (writeEnvirBegin): new method
7620 (writeEnvirEnd): new method
7622 2000-04-18 Juergen Vigna <jug@sad.it>
7624 * src/CutAndPaste.C: made textclass a static member of the class
7625 as otherwise it is not accesed right!!!
7627 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7629 * forms/layout_forms.fd
7630 * src/layout_forms.h
7631 * src/layout_forms.C (create_form_form_character)
7632 * src/lyx_cb.C (UserFreeFont)
7633 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7634 documents (in the layout->character popup).
7636 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7638 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7639 \spell_command was in fact not honored (from Kevin Atkinson).
7641 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7644 * src/lyx_gui.h: make lyxViews private (Angus)
7646 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7648 * src/mathed/math_write.C
7649 (MathMatrixInset::Write) Put \protect before \begin{array} and
7650 \end{array} if fragile
7651 (MathParInset::Write): Put \protect before \\ if fragile
7653 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7655 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7656 initialization if the LyXColorHandler must be done after the
7657 connections to the XServer has been established.
7659 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7660 get the background pixel from the lyxColorhandler so that the
7661 figures are rendered with the correct background color.
7662 (NextToken): removed functions.
7663 (GetPSSizes): use ifs >> string instead of NextToken.
7665 * src/Painter.[Ch]: the color cache moved out of this file.
7667 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7670 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7672 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7673 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7675 * src/BufferView.C (enterView): new func
7676 (leaveView): new func
7678 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7680 (leaveView): new func, undefines xterm cursor when approp.
7682 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7683 (AllowInput): delete the Workarea cursor handling from this func.
7685 * src/Painter.C (underline): draw a slimer underline in most cases.
7687 * src/lyx_main.C (error_handler): use extern "C"
7689 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7691 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7692 sent directly to me.
7694 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7695 to the list by Dekel.
7697 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7700 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7701 methods from lyx_cb.here.
7703 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7706 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7708 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7709 instead of using current_view directly.
7711 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7713 * src/LyXAction.C (init): add the paragraph-spacing command.
7715 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7717 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7719 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7720 different from the documents.
7722 * src/text.C (SetHeightOfRow): take paragraph spacing into
7723 account, paragraph spacing takes precedence over buffer spacing
7724 (GetVisibleRow): ditto
7726 * src/paragraph.C (writeFile): output the spacing parameter too.
7727 (validate): set the correct features if spacing is used in the
7729 (Clear): set spacing to default
7730 (MakeSameLayout): spacing too
7731 (HasSameLayout): spacing too
7732 (SetLayout): spacing too
7733 (TeXOnePar): output the spacing commands
7735 * src/lyxparagraph.h: added a spacing variable for use with
7736 per-paragraph spacing.
7738 * src/Spacing.h: add a Default spacing and a method to check if
7739 the current spacing is default. also added an operator==
7741 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7744 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7746 * src/lyxserver.C (callback): fix dispatch of functions
7748 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7749 printf() into lyxerr call.
7751 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7754 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7755 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7756 the "Float" from each of the subitems.
7757 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7759 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7760 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7761 documented the change so that the workaround can be nuked later.
7763 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7766 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7768 * src/buffer.C (getLatexName): ditto
7769 (setReadonly): ditto
7771 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7773 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7774 avoid some uses of current_view. Added also a bufferParams()
7775 method to get at this.
7777 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7779 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7781 * src/lyxparagraph.[Ch]: removed
7782 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7783 with operators used by lower_bound and
7784 upper_bound in InsetTable's
7785 Make struct InsetTable private again. Used matchpos.
7787 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7789 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7790 document, the language of existing text is changed (unless the
7791 document is multi-lingual)
7793 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7795 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7797 * A lot of files: A rewrite of the Right-to-Left support.
7799 2000-04-10 Juergen Vigna <jug@sad.it>
7801 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7802 misplaced cursor when inset in inset is locked.
7804 * src/insets/insettext.C (LocalDispatch): small fix so that a
7805 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7807 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7808 footnote font should be decreased in size twice when displaying.
7810 * src/insets/insettext.C (GetDrawFont): inserted this function as
7811 the drawing-font may differ from the real paragraph font.
7813 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7814 insets (inset in inset!).
7816 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7817 function here because we don't want footnotes inside footnotes.
7819 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7821 (init): now set the inset_owner in paragraph.C
7822 (LocalDispatch): added some resetPos() in the right position
7825 (pasteSelection): changed to use the new CutAndPaste-Class.
7827 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7828 which tells if it is allowed to insert another inset inside this one.
7830 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7831 SwitchLayoutsBetweenClasses.
7833 * src/text2.C (InsertInset): checking of the new paragraph-function
7835 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7836 is not needed anymore here!
7839 (PasteSelection): redone (also with #ifdef) so that now this uses
7840 the CutAndPaste-Class.
7841 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7844 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7845 from/to text/insets.
7847 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7848 so that the paragraph knows if it is inside an (text)-inset.
7849 (InsertFromMinibuffer): changed return-value to bool as now it
7850 may happen that an inset is not inserted in the paragraph.
7851 (InsertInsetAllowed): this checks if it is allowed to insert an
7852 inset in this paragraph.
7854 (BreakParagraphConservative):
7855 (BreakParagraph) : small change for the above change of the return
7856 value of InsertFromMinibuffer.
7858 * src/lyxparagraph.h: added inset_owner and the functions to handle
7859 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7861 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7863 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7864 functions from BufferView to BufferView::Pimpl to ease maintence.
7866 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7867 correctly. Also use SetCursorIntern instead of SetCursor.
7869 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7872 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7874 * src/WorkArea.C (belowMouse): manually implement below mouse.
7876 * src/*: Add "explicit" on several constructors, I added probably
7877 some unneeded ones. A couple of changes to code because of this.
7879 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7880 implementation and private parts from the users of BufferView. Not
7883 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7884 implementation and private parts from the users of LyXLex. Not
7887 * src/BufferView_pimpl.[Ch]: new files
7889 * src/lyxlex_pimpl.[Ch]: new files
7891 * src/LyXView.[Ch]: some inline functions move out-of-line
7893 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7895 * src/lyxparagraph.h: make struct InsetTable public.
7897 * src/support/lyxstring.h: change lyxstring::difference_type to be
7898 ptrdiff_t. Add std:: modifiers to streams.
7900 * src/font.C: include the <cctype> header, for islower() and
7903 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7905 * src/font.[Ch]: new files. Contains the metric functions for
7906 fonts, takes a LyXFont as parameter. Better separation of concepts.
7908 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7909 changes because of this.
7911 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7913 * src/*: compile with -Winline and move functions that don't
7916 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7919 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7921 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7922 (various files changed because of this)
7924 * src/Painter.C (text): fixed the drawing of smallcaps.
7926 * src/lyxfont.[Ch] (drawText): removed unused member func.
7929 * src/*.C: added needed "using" statements and "std::" qualifiers.
7931 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7933 * src/*.h: removed all use of "using" from header files use
7934 qualifier std:: instead.
7936 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7938 * src/text.C (Backspace): some additional cleanups (we already
7939 know whether cursor.pos is 0 or not).
7941 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7942 automake does not provide one).
7944 * src/bmtable.h: replace C++ comments with C comments.
7946 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7948 * src/screen.C (ShowCursor): Change the shape of the cursor if
7949 the current language is not equal to the language of the document.
7950 (If the cursor change its shape unexpectedly, then you've found a bug)
7952 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7955 * src/insets/insetnumber.[Ch]: New files.
7957 * src/LyXAction.C (init)
7958 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7961 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7963 * src/lyxparagraph.h
7964 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7965 (the vector is kept sorted).
7967 * src/text.C (GetVisibleRow): Draw selection correctly when there
7968 is both LTR and RTL text.
7970 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7971 which is much faster.
7973 * src/text.C (GetVisibleRow and other): Do not draw the last space
7974 in a row if the direction of the last letter is not equal to the
7975 direction of the paragraph.
7977 * src/lyxfont.C (latexWriteStartChanges):
7978 Check that font language is not equal to basefont language.
7979 (latexWriteEndChanges): ditto
7981 * src/lyx_cb.C (StyleReset): Don't change the language while using
7982 the font-default command.
7984 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7985 empty paragraph before a footnote.
7987 * src/insets/insetcommand.C (draw): Increase x correctly.
7989 * src/screen.C (ShowCursor): Change cursor shape if
7990 current language != document language.
7992 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7994 2000-03-31 Juergen Vigna <jug@sad.it>
7996 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7997 (Clone): changed mode how the paragraph-data is copied to the
7998 new clone-paragraph.
8000 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8001 GetInset(pos) with no inset anymore there (in inset UNDO)
8003 * src/insets/insetcommand.C (draw): small fix as here x is
8004 incremented not as much as width() returns (2 before, 2 behind = 4)
8006 2000-03-30 Juergen Vigna <jug@sad.it>
8008 * src/insets/insettext.C (InsetText): small fix in initialize
8009 widthOffset (should not be done in the init() function)
8011 2000-03-29 Amir Karger <karger@lyx.org>
8013 * lib/examples/it_ItemizeBullets.lyx: translation by
8016 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8018 2000-03-29 Juergen Vigna <jug@sad.it>
8020 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8022 * src/insets/insetfoot.C (Clone): small change as for the below
8023 new init function in the text-inset
8025 * src/insets/insettext.C (init): new function as I've seen that
8026 clone did not copy the Paragraph-Data!
8027 (LocalDispatch): Added code so that now we have some sort of Undo
8028 functionality (well actually we HAVE Undo ;)
8030 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8032 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8034 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8037 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8039 * src/main.C: added a runtime check that verifies that the xforms
8040 header used when building LyX and the library used when running
8041 LyX match. Exit with a message if they don't match. This is a
8042 version number check only.
8044 * src/buffer.C (save): Don't allocate memory on the heap for
8045 struct utimbuf times.
8047 * *: some using changes, use iosfwd instead of the real headers.
8049 * src/lyxfont.C use char const * instead of string for the static
8050 strings. Rewrite some functions to use sstream.
8052 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8054 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8057 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8059 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8060 of Geodesy (from Martin Vermeer)
8062 * lib/layouts/svjour.inc: include file for the Springer svjour
8063 class. It can be used to support journals other than JoG.
8065 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8066 Miskiewicz <misiek@pld.org.pl>)
8067 * lib/reLyX/Makefile.am: ditto.
8069 2000-03-27 Juergen Vigna <jug@sad.it>
8071 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8072 also some modifications with operations on selected text.
8074 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8075 problems with clicking on insets (last famous words ;)
8077 * src/insets/insetcommand.C (draw):
8078 (width): Changed to have a bit of space before and after the inset so
8079 that the blinking cursor can be seen (otherwise it was hidden)
8081 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8083 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8084 would not be added to the link list when an installed gettext (not
8085 part of libc) is found.
8087 2000-03-24 Juergen Vigna <jug@sad.it>
8089 * src/insets/insetcollapsable.C (Edit):
8090 * src/mathed/formula.C (InsetButtonRelease):
8091 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8094 * src/BufferView.C (workAreaButtonPress):
8095 (workAreaButtonRelease):
8096 (checkInsetHit): Finally fixed the clicking on insets be handled
8099 * src/insets/insetert.C (Edit): inserted this call so that ERT
8100 insets work always with LaTeX-font
8102 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8104 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8105 caused lyx to startup with no GUI in place, causing in a crash
8106 upon startup when called with arguments.
8108 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8110 * src/FontLoader.C: better initialization of dummyXFontStruct.
8112 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8114 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8115 for linuxdoc and docbook import and export format options.
8117 * lib/lyxrc.example Example of default values for the previous flags.
8119 * src/lyx_cb.C Use those flags instead of the hardwired values for
8120 linuxdoc and docbook export.
8122 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8125 * src/menus.C Added menus entries for the new import/exports formats.
8127 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8129 * src/lyxrc.*: Added support for running without Gui
8132 * src/FontLoader.C: sensible defaults if no fonts are needed
8134 * src/lyx_cb.C: New function ShowMessage (writes either to the
8135 minibuffer or cout in case of no gui
8136 New function AskOverwrite for common stuff
8137 Consequently various changes to call these functions
8139 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8140 wild guess at sensible screen resolution when having no gui
8142 * src/lyxfont.C: no gui, no fonts... set some defaults
8144 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8146 * src/LColor.C: made the command inset background a bit lighter.
8148 2000-03-20 Hartmut Goebel <goebel@noris.net>
8150 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8151 stdstruct.inc. Koma-Script added some title elements which
8152 otherwise have been listed below "bibliography". This split allows
8153 adding title elements to where they belong.
8155 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8156 define the additional title elements and then include
8159 * many other layout files: changed to include stdtitle.inc just
8160 before stdstruct.inc.
8162 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8164 * src/buffer.C: (save) Added the option to store all backup files
8165 in a single directory
8167 * src/lyxrc.[Ch]: Added variable \backupdir_path
8169 * lib/lyxrc.example: Added descriptions of recently added variables
8171 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8172 bibtex inset, not closing the bibtex popup when deleting the inset)
8174 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8176 * src/lyx_cb.C: add a couple using directives.
8178 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8179 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8180 import based on the filename.
8182 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8183 file would be imported at start, if the filename where of a sgml file.
8185 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8187 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8189 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8190 * src/lyxfont.h Replaced the member variable bits.direction by the
8191 member variable lang. Made many changes in other files.
8192 This allows having a multi-lingual document
8194 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8195 that change the current language to <l>.
8196 Removed the command "font-rtl"
8198 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8199 format for Hebrew documents)
8201 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8202 When auto_mathmode is "true", pressing a digit key in normal mode
8203 will cause entering into mathmode.
8204 If auto_mathmode is "rtl" then this behavior will be active only
8205 when writing right-to-left text.
8207 * src/text2.C (InsertStringA) The string is inserted using the
8210 * src/paragraph.C (GetEndLabel) Gives a correct result for
8211 footnote paragraphs.
8213 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8215 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8217 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8218 front of PasteParagraph. Never insert a ' '. This should at least
8219 fix some cause for the segfaults that we have been experiencing,
8220 it also fixes backspace behaviour slightly. (Phu!)
8222 * src/support/lstrings.C (compare_no_case): some change to make it
8223 compile with gcc 2.95.2 and stdlibc++-v3
8225 * src/text2.C (MeltFootnoteEnvironment): change type o
8226 first_footnote_par_is_not_empty to bool.
8228 * src/lyxparagraph.h: make text private. Changes in other files
8230 (fitToSize): new function
8231 (setContentsFromPar): new function
8232 (clearContents): new function
8233 (SetChar): new function
8235 * src/paragraph.C (readSimpleWholeFile): deleted.
8237 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8238 the file, just use a simple string instead. Also read the file in
8239 a more maintainable manner.
8241 * src/text2.C (InsertStringA): deleted.
8242 (InsertStringB): deleted.
8244 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8246 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8247 RedoParagraphs from the doublespace handling part, just set status
8248 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8249 done, but perhaps not like this.)
8251 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8253 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8254 character when inserting an inset.
8256 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8258 * src/bufferparams.C (readLanguage): now takes "default" into
8261 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8262 also initialize the toplevel_keymap with the default bindings from
8265 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8267 * all files using lyxrc: have lyxrc as a real variable and not a
8268 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8271 * src/lyxrc.C: remove double call to defaultKeyBindings
8273 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8274 toolbar defauls using lyxlex. Remove enums, structs, functions
8277 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8278 toolbar defaults. Also store default keybindings in a map.
8280 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8281 storing the toolbar defaults without any xforms dependencies.
8283 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8284 applied. Changed to use iterators.
8286 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8288 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8289 systems that don't have LINGUAS set to begin with.
8291 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8293 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8294 the list by Dekel Tsur.
8296 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8298 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8299 * src/insets/form_graphics.C: ditto.
8301 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8303 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8305 * src/bufferparams.C (readLanguage): use the new language map
8307 * src/intl.C (InitKeyMapper): use the new language map
8309 * src/lyx_gui.C (create_forms): use the new language map
8311 * src/language.[Ch]: New files. Used for holding the information
8312 about each language. Now! Use this new language map enhance it and
8313 make it really usable for our needs.
8315 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8317 * screen.C (ShowCursor): Removed duplicate code.
8318 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8319 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8321 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8324 * src/text.C Added TransformChar method. Used for rendering Arabic
8325 text correctly (change the glyphs of the letter according to the
8326 position in the word)
8331 * src/lyxrc.C Added lyxrc command {language_command_begin,
8332 language_command_end,language_command_ltr,language_command_rtl,
8333 language_package} which allows the use of either arabtex or Omega
8336 * src/lyx_gui.C (init)
8338 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8339 to use encoding for menu fonts which is different than the encoding
8342 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8343 do not load the babel package.
8344 To write an English document with Hebrew/Arabic, change the document
8345 language to "english".
8347 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8348 (alphaCounter): changed to return char
8349 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8351 * lib/lyxrc.example Added examples for Hebrew/Arabic
8354 * src/layout.C Added layout command endlabeltype
8356 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8358 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8360 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8362 * src/mathed/math_delim.C (search_deco): return a
8363 math_deco_struct* instead of index.
8365 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8367 * All files with a USE_OSTREAM_ONLY within: removed all code that
8368 was unused when USE_OSTREAM_ONLY is defined.
8370 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8371 of any less. Removed header and using.
8373 * src/text.C (GetVisibleRow): draw the string "Page Break
8374 (top/bottom)" on screen when drawing a pagebreak line.
8376 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8378 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8380 * src/mathed/math_macro.C (draw): do some cast magic.
8383 * src/mathed/math_defs.h: change byte* argument to byte const*.
8385 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8387 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8388 know it is right to return InsetFoot* too, but cxx does not like
8391 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8393 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8395 * src/mathed/math_delim.C: change == to proper assignment.
8397 2000-03-09 Juergen Vigna <jug@sad.it>
8399 * src/insets/insettext.C (setPos): fixed various cursor positioning
8400 problems (via mouse and cursor-keys)
8401 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8402 inset (still a small display problem but it works ;)
8404 * src/insets/insetcollapsable.C (draw): added button_top_y and
8405 button_bottom_y to have correct values for clicking on the inset.
8407 * src/support/lyxalgo.h: commented out 'using std::less'
8409 2000-03-08 Juergen Vigna <jug@sad.it>
8411 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8412 Button-Release event closes as it is alos the Release-Event
8415 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8417 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8419 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8420 can add multiple spaces in Scrap (literate programming) styles...
8421 which, by the way, is how I got hooked on LyX to begin with.
8423 * src/mathed/formula.C (Write): Added dummy variable to an
8424 inset::Latex() call.
8425 (Latex): Add free_spacing boolean to inset::Latex()
8427 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8429 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8430 virtual function to include the free_spacing boolean from
8431 the containing paragraph's style.
8433 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8434 Added free_spacing boolean arg to match inset.h
8436 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8437 Added free_spacing boolean arg to match inset.h
8439 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8440 Added free_spacing boolean and made sure that if in a free_spacing
8441 paragraph, that we output normal space if there is a protected space.
8443 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8444 Added free_spacing boolean arg to match inset.h
8446 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8447 Added free_spacing boolean arg to match inset.h
8449 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8450 Added free_spacing boolean arg to match inset.h
8452 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8453 Added free_spacing boolean arg to match inset.h
8455 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8456 Added free_spacing boolean arg to match inset.h
8458 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8459 free_spacing boolean arg to match inset.h
8461 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8462 Added free_spacing boolean arg to match inset.h
8464 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8465 Added free_spacing boolean arg to match inset.h
8467 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8468 Added free_spacing boolean arg to match inset.h
8470 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8471 Added free_spacing boolean arg to match inset.h
8473 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8474 Added free_spacing boolean arg to match inset.h
8476 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8477 free_spacing boolean arg to match inset.h
8479 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8480 free_spacing boolean arg to match inset.h
8482 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8483 ignore free_spacing paragraphs. The user's spaces are left
8486 * src/text.C (InsertChar): Fixed the free_spacing layout
8487 attribute behavior. Now, if free_spacing is set, you can
8488 add multiple spaces in a paragraph with impunity (and they
8489 get output verbatim).
8490 (SelectSelectedWord): Added dummy argument to inset::Latex()
8493 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8496 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8497 paragraph layouts now only input a simple space instead.
8498 Special character insets don't make any sense in free-spacing
8501 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8502 hard-spaces in the *input* file to simple spaces if the layout
8503 is free-spacing. This converts old files which had to have
8504 hard-spaces in free-spacing layouts where a simple space was
8506 (writeFileAscii): Added free_spacing check to pass to the newly
8507 reworked inset::Latex(...) methods. The inset::Latex() code
8508 ensures that hard-spaces in free-spacing paragraphs get output
8509 as spaces (rather than "~").
8511 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8513 * src/mathed/math_delim.C (draw): draw the empty placeholder
8514 delims with a onoffdash line.
8515 (struct math_deco_compare): struct that holds the "functors" used
8516 for the sort and the binary search in math_deco_table.
8517 (class init_deco_table): class used for initial sort of the
8519 (search_deco): use lower_bound to do a binary search in the
8522 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8524 * src/lyxrc.C: a small secret thingie...
8526 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8527 and to not flush the stream as often as it used to.
8529 * src/support/lyxalgo.h: new file
8530 (sorted): template function used for checking if a sequence is
8531 sorted or not. Two versions with and without user supplied
8532 compare. Uses same compare as std::sort.
8534 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8535 it and give warning on lyxerr.
8537 (struct compare_tags): struct with function operators used for
8538 checking if sorted, sorting and lower_bound.
8539 (search_kw): use lower_bound instead of manually implemented
8542 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8544 * src/insets/insetcollapsable.h: fix Clone() declaration.
8545 * src/insets/insetfoot.h: ditto.
8547 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8549 2000-03-08 Juergen Vigna <jug@sad.it>
8551 * src/insets/lyxinset.h: added owner call which tells us if
8552 this inset is inside another inset. Changed also the return-type
8553 of Editable to an enum so it tells clearer what the return-value is.
8555 * src/insets/insettext.C (computeTextRows): fixed computing of
8556 textinsets which split automatically on more rows.
8558 * src/insets/insetert.[Ch]: changed this to be of BaseType
8561 * src/insets/insetfoot.[Ch]: added footnote inset
8563 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8564 collapsable insets (like footnote, ert, ...)
8566 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8568 * src/lyxdraw.h: remvoe file
8570 * src/lyxdraw.C: remove file
8572 * src/insets/insettext.C: added <algorithm>.
8574 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8576 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8577 (matrix_cb): case MM_OK use string stream
8579 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8582 * src/mathed/math_macro.C (draw): use string stream
8583 (Metrics): use string stream
8585 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8586 directly to the ostream.
8588 * src/vspace.C (asString): use string stream.
8589 (asString): use string stream
8590 (asLatexString): use string stream
8592 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8593 setting Spacing::Other.
8595 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8596 sprintf when creating the stretch vale.
8598 * src/text2.C (alphaCounter): changed to return a string and to
8599 not use a static variable internally. Also fixed a one-off bug.
8600 (SetCounter): changed the drawing of the labels to use string
8601 streams instead of sprintf.
8603 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8604 manipulator to use a scheme that does not require library support.
8605 This is also the way it is done in the new GNU libstdc++. Should
8606 work with DEC cxx now.
8608 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8610 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8611 end. This fixes a bug.
8613 * src/mathed (all files concerned with file writing): apply the
8614 USE_OSTREAM_ONLY changes to mathed too.
8616 * src/support/DebugStream.h: make the constructor explicit.
8618 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8619 count and ostream squashed.
8621 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8623 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8625 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8626 ostringstream uses STL strings, and we might not.
8628 * src/insets/insetspecialchar.C: add using directive.
8629 * src/insets/insettext.C: ditto.
8631 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8633 * lib/layouts/seminar.layout: feeble attempt at a layout for
8634 seminar.cls, far from completet and could really use some looking
8635 at from people used to write layout files.
8637 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8638 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8639 a lot nicer and works nicely with ostreams.
8641 * src/mathed/formula.C (draw): a slightly different solution that
8642 the one posted to the list, but I think this one works too. (font
8643 size wrong in headers.)
8645 * src/insets/insettext.C (computeTextRows): some fiddling on
8646 Jürgens turf, added some comments that he should read.
8648 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8649 used and it gave compiler warnings.
8650 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8653 * src/lyx_gui.C (create_forms): do the right thing when
8654 show_banner is true/false.
8656 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8657 show_banner is false.
8659 * most file writing files: Now use iostreams to do almost all of
8660 the writing. Also instead of passing string &, we now use
8661 stringstreams. mathed output is still not adapted to iostreams.
8662 This change can be turned off by commenting out all the occurences
8663 of the "#define USE_OSTREAM_ONLY 1" lines.
8665 * src/WorkArea.C (createPixmap): don't output debug messages.
8666 (WorkArea): don't output debug messages.
8668 * lib/lyxrc.example: added a comment about the new variable
8671 * development/Code_rules/Rules: Added some more commente about how
8672 to build class interfaces and on how better encapsulation can be
8675 2000-03-03 Juergen Vigna <jug@sad.it>
8677 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8678 automatically with the width of the LyX-Window
8680 * src/insets/insettext.C (computeTextRows): fixed update bug in
8681 displaying text-insets (scrollvalues where not initialized!)
8683 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8685 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8686 id in the check of the result from lower_bound is not enough since
8687 lower_bound can return last too, and then res->id will not be a
8690 * all insets and some code that use them: I have conditionalized
8691 removed the Latex(string & out, ...) this means that only the
8692 Latex(ostream &, ...) will be used. This is a work in progress to
8693 move towards using streams for all output of files.
8695 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8698 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8700 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8701 routine (this fixes bug where greek letters were surrounded by too
8704 * src/support/filetools.C (findtexfile): change a bit the search
8705 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8706 no longer passed to kpsewhich, we may have to change that later.
8708 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8709 warning options to avoid problems with X header files (from Angus
8711 * acinclude.m4: regenerated.
8713 2000-03-02 Juergen Vigna <jug@sad.it>
8715 * src/insets/insettext.C (WriteParagraphData): Using the
8716 par->writeFile() function for writing paragraph-data.
8717 (Read): Using buffer->parseSingleLyXformat2Token()-function
8718 for parsing paragraph data!
8720 * src/buffer.C (readLyXformat2): removed all parse data and using
8721 the new parseSingleLyXformat2Token()-function.
8722 (parseSingleLyXformat2Token): added this function to parse (read)
8723 lyx-file-format (this is called also from text-insets now!)
8725 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8727 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8730 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8731 directly instead of going through a func. One very bad thing: a
8732 static LyXFindReplace, but I don't know where to place it.
8734 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8735 string instead of char[]. Also changed to static.
8736 (GetSelectionOrWordAtCursor): changed to static inline
8737 (SetSelectionOverLenChars): ditto.
8739 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8740 current_view and global variables. both classes has changed names
8741 and LyXFindReplace is not inherited from SearchForm.
8743 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8744 fl_form_search form.
8746 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8748 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8750 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8751 bound (from Kayvan).
8753 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8755 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8757 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8759 * some things that I should comment but the local pub says head to
8762 * comment out all code that belongs to the Roff code for Ascii
8763 export of tables. (this is unused)
8765 * src/LyXView.C: use correct type for global variable
8766 current_layout. (LyXTextClass::size_type)
8768 * some code to get the new insetgraphics closer to working I'd be
8769 grateful for any help.
8771 * src/BufferView2.C (insertInset): use the return type of
8772 NumberOfLayout properly. (also changes in other files)
8774 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8775 this as a test. I want to know what breaks because of this.
8777 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8779 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8781 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8782 to use a \makebox in the label, this allows proper justification
8783 with out using protected spaces or multiple hfills. Now it is
8784 "label" for left justified, "\hfill label\hfill" for center, and
8785 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8786 should be changed accordingly.
8788 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8790 * src/lyxtext.h: change SetLayout() to take a
8791 LyXTextClass::size_type instead of a char (when there is more than
8792 127 layouts in a class); also change type of copylayouttype.
8793 * src/text2.C (SetLayout): ditto.
8794 * src/LyXView.C (updateLayoutChoice): ditto.
8796 * src/LaTeX.C (scanLogFile): errors where the line number was not
8797 given just after the '!'-line were ignored (from Dekel Tsur).
8799 * lib/lyxrc.example: fix description of \date_insert_format
8801 * lib/layouts/llncs.layout: new layout, contributed by Martin
8804 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8806 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8807 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8808 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8809 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8810 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8811 paragraph.C, text.C, text2.C)
8813 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8815 * src/insets/insettext.C (LocalDispatch): remove extra break
8818 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8819 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8821 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8822 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8824 * src/insets/insetbib.h: move InsetBibkey::Holder and
8825 InsetCitation::Holder in public space.
8827 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8829 * src/insets/insettext.h: small change to get the new files from
8830 Juergen to compile (use "string", not "class string").
8832 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8833 const & as parameter to LocalDispatch, use LyXFont const & as
8834 paramter to some other func. This also had impacto on lyxinsets.h
8835 and the two mathed insets.
8837 2000-02-24 Juergen Vigna <jug@sad.it>
8840 * src/commandtags.h:
8842 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8846 * src/BufferView2.C: added/updated code for various inset-functions
8848 * src/insets/insetert.[Ch]: added implementation of InsetERT
8850 * src/insets/insettext.[Ch]: added implementation of InsetText
8852 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8853 (draw): added preliminary code for inset scrolling not finshed yet
8855 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8856 as it is in lyxfunc.C now
8858 * src/insets/lyxinset.h: Added functions for text-insets
8860 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8862 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8863 BufferView and reimplement the list as a queue put inside its own
8866 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8868 * several files: use the new interface to the "updateinsetlist"
8870 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8872 (work_area_handler): call BufferView::trippleClick on trippleclick.
8874 * src/BufferView.C (doubleClick): new function, selects word on
8876 (trippleClick): new function, selects line on trippleclick.
8878 2000-02-22 Allan Rae <rae@lyx.org>
8880 * lib/bind/xemacs.bind: buffer-previous not supported
8882 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8884 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8887 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8889 * src/bufferlist.C: get rid of current_view from this file
8891 * src/spellchecker.C: get rid of current_view from this file
8893 * src/vspace.C: get rid of current_view from this file
8894 (inPixels): added BufferView parameter for this func
8895 (asLatexCommand): added a BufferParams for this func
8897 * src/text.C src/text2.C: get rid of current_view from these
8900 * src/lyxfont.C (getFontDirection): move this function here from
8903 * src/bufferparams.C (getDocumentDirection): move this function
8906 * src/paragraph.C (getParDirection): move this function here from
8908 (getLetterDirection): ditto
8910 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8912 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8913 resize due to wrong pixmap beeing used. Also took the opurtunity
8914 to make the LyXScreen stateless on regard to WorkArea and some
8915 general cleanup in the same files.
8917 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8919 * src/Makefile.am: add missing direction.h
8921 * src/PainterBase.h: made the width functions const.
8923 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8926 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8928 * src/insets/insetlatexaccent.C (draw): make the accents draw
8929 better, at present this will only work well with iso8859-1.
8931 * several files: remove the old drawing code, now we use the new
8934 * several files: remove support for mono_video, reverse_video and
8937 2000-02-17 Juergen Vigna <jug@sad.it>
8939 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8940 int ** as we have to return the pointer, otherwise we have only
8941 NULL pointers in the returning function.
8943 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8945 * src/LaTeX.C (operator()): quote file name when running latex.
8947 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8949 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8950 (bubble tip), this removes our special handling of this.
8952 * Remove all code that is unused now that we have the new
8953 workarea. (Code that are not active when NEW_WA is defined.)
8955 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8957 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8959 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8960 nonexisting layout; correctly redirect obsoleted layouts.
8962 * lib/lyxrc.example: document \view_dvi_paper_option
8964 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8967 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8968 (PreviewDVI): handle the view_dvi_paper_option variable.
8969 [Both from Roland Krause]
8971 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8973 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8974 char const *, int, LyXFont)
8975 (text(int, int, string, LyXFont)): ditto
8977 * src/text.C (InsertCharInTable): attempt to fix the double-space
8978 feature in tables too.
8979 (BackspaceInTable): ditto.
8980 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8982 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8984 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8986 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8987 newly found text in textcache to this.
8988 (buffer): set the owner of the text put into the textcache to 0
8990 * src/insets/figinset.C (draw): fixed the drawing of figures with
8993 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8994 drawing of mathframe, hfills, protected space, table lines. I have
8995 now no outstanding drawing problems with the new Painter code.
8997 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8999 * src/PainterBase.C (ellipse, circle): do not specify the default
9002 * src/LColor.h: add using directive.
9004 * src/Painter.[Ch]: change return type of methods from Painter& to
9005 PainterBase&. Add a using directive.
9007 * src/WorkArea.C: wrap xforms callbacks in C functions
9010 * lib/layouts/foils.layout: font fix and simplifications from Carl
9013 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9015 * a lot of files: The Painter, LColor and WorkArea from the old
9016 devel branch has been ported to lyx-devel. Some new files and a
9017 lot of #ifdeffed code. The new workarea is enabled by default, but
9018 if you want to test the new Painter and LColor you have to compile
9019 with USE_PAINTER defined (do this in config.h f.ex.) There are
9020 still some rought edges, and I'd like some help to clear those
9021 out. It looks stable (loads and displays the Userguide very well).
9024 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9026 * src/buffer.C (pop_tag): revert to the previous implementation
9027 (use a global variable for both loops).
9029 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9031 * src/lyxrc.C (LyXRC): change slightly default date format.
9033 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9034 there is an English text with a footnote that starts with a Hebrew
9035 paragraph, or vice versa.
9036 (TeXFootnote): ditto.
9038 * src/text.C (LeftMargin): allow for negative values for
9039 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9042 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9043 for input encoding (cyrillic)
9045 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9047 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9050 * src/toolbar.C (set): ditto
9051 * src/insets/insetbib.C (create_form_citation_form): ditto
9053 * lib/CREDITS: added Dekel Tsur.
9055 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9056 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9057 hebrew supports files from Dekel Tsur.
9059 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9060 <tzafrir@technion.ac.il>
9062 * src/lyxrc.C: put \date_insert_format at the right place.
9064 * src/buffer.C (makeLaTeXFile): fix the handling of
9065 BufferParams::sides when writing out latex files.
9067 * src/BufferView2.C: add a "using" directive.
9069 * src/support/lyxsum.C (sum): when we use lyxstring,
9070 ostringstream::str needs an additional .c_str().
9072 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9074 * src/support/filetools.C (ChangeExtension): patch from Etienne
9077 * src/TextCache.C (show): remove const_cast and make second
9078 parameter non-const LyXText *.
9080 * src/TextCache.h: use non const LyXText in show.
9082 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9085 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9087 * src/support/lyxsum.C: rework to be more flexible.
9089 * several places: don't check if a pointer is 0 if you are going
9092 * src/text.C: remove some dead code.
9094 * src/insets/figinset.C: remove some dead code
9096 * src/buffer.C: move the BufferView funcs to BufferView2.C
9097 remove all support for insetlatexdel
9098 remove support for oldpapersize stuff
9099 made some member funcs const
9101 * src/kbmap.C: use a std::list to store the bindings in.
9103 * src/BufferView2.C: new file
9105 * src/kbsequence.[Ch]: new files
9107 * src/LyXAction.C + others: remove all trace of buffer-previous
9109 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9110 only have one copy in the binary of this table.
9112 * hebrew patch: moved some functions from LyXText to more
9113 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9115 * several files: remove support for XForms older than 0.88
9117 remove some #if 0 #endif code
9119 * src/TextCache.[Ch]: new file. Holds the textcache.
9121 * src/BufferView.C: changes to use the new TextCache interface.
9122 (waitForX): remove the now unused code.
9124 * src/BackStack.h: remove some commented code
9126 * lib/bind/emacs.bind: remove binding for buffer-previous
9128 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9130 * applied the hebrew patch.
9132 * src/lyxrow.h: make sure that all Row variables are initialized.
9134 * src/text2.C (TextHandleUndo): comment out a delete, this might
9135 introduce a memory leak, but should also help us to not try to
9136 read freed memory. We need to look at this one.
9138 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9139 (LyXParagraph): initalize footnotekind.
9141 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9142 forgot this when applying the patch. Please heed the warnings.
9144 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9145 (aka. reformat problem)
9147 * src/bufferlist.C (exists): made const, and use const_iterator
9148 (isLoaded): new func.
9149 (release): use std::find to find the correct buffer.
9151 * src/bufferlist.h: made getState a const func.
9152 made empty a const func.
9153 made exists a const func.
9156 2000-02-01 Juergen Vigna <jug@sad.it>
9158 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9160 * po/it.po: updated a bit the italian po file and also changed the
9161 'file nuovo' for newfile to 'filenuovo' without a space, this did
9164 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9165 for the new insert_date command.
9167 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9168 from jdblair, to insert a date into the current text conforming to
9169 a strftime format (for now only considering the locale-set and not
9170 the document-language).
9172 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9174 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9175 Bounds Read error seen by purify. The problem was that islower is
9176 a macros which takes an unsigned char and uses it as an index for
9177 in array of characters properties (and is thus subject to the
9181 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9182 correctly the paper sides radio buttons.
9183 (UpdateDocumentButtons): ditto.
9185 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9187 * src/kbmap.C (getsym + others): change to return unsigned int,
9188 returning a long can give problems on 64 bit systems. (I assume
9189 that int is 32bit on 64bit systems)
9191 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9193 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9194 LyXLookupString to be zero-terminated. Really fixes problems seen
9197 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9199 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9200 write a (char*)0 to the lyxerr stream.
9202 * src/lastfiles.C: move algorithm before the using statemets.
9204 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9206 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9207 complains otherwise).
9208 * src/table.C: ditto
9210 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9213 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9214 that I removed earlier... It is really needed.
9216 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9218 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9220 * INSTALL: update xforms home page URL.
9222 * lib/configure.m4: fix a bug with unreadable layout files.
9224 * src/table.C (calculate_width_of_column): add "using std::max"
9227 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9229 * several files: marked several lines with "DEL LINE", this is
9230 lines that can be deleted without changing anything.
9231 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9232 checks this anyway */
9235 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9237 * src/DepTable.C (update): add a "+" at the end when the checksum
9238 is different. (debugging string only)
9240 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9241 the next inset to not be displayed. This should also fix the list
9242 of labels in the "Insert Crossreference" dialog.
9244 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9246 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9247 when regex was not found.
9249 * src/support/lstrings.C (lowercase): use handcoded transform always.
9252 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9253 old_cursor.par->prev could be 0.
9255 * several files: changed post inc/dec to pre inc/dec
9257 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9258 write the lastfiles to file.
9260 * src/BufferView.C (buffer): only show TextCache info when debugging
9262 (resizeCurrentBuffer): ditto
9263 (workAreaExpose): ditto
9265 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9267 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9269 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9270 a bit better by removing the special case for \i and \j.
9272 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9274 * src/lyx_main.C (easyParse): remove test for bad comand line
9275 options, since this broke all xforms-related parsing.
9277 * src/kbmap.C (getsym): set return type to unsigned long, as
9278 declared in header. On an alpha, long is _not_ the same as int.
9280 * src/support/LOstream.h: add a "using std::flush;"
9282 * src/insets/figinset.C: ditto.
9284 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9286 * src/bufferlist.C (write): use blinding fast file copy instead of
9287 "a char at a time", now we are doing it the C++ way.
9289 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9290 std::list<int> instead.
9291 (addpidwait): reflect move to std::list<int>
9292 (sigchldchecker): ditto
9294 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9297 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9298 that obviously was wrong...
9300 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9301 c, this avoids warnings with purify and islower.
9303 * src/insets/figinset.C: rename struct queue to struct
9304 queue_element and rewrite to use a std::queue. gsqueue is now a
9305 std::queue<queue_element>
9306 (runqueue): reflect move to std::queue
9309 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9310 we would get "1" "0" instead of "true" "false. Also make the tostr
9313 2000-01-21 Juergen Vigna <jug@sad.it>
9315 * src/buffer.C (writeFileAscii): Disabled code for special groff
9316 handling of tabulars till I fix this in table.C
9318 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9320 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9322 * src/support/lyxlib.h: ditto.
9324 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9326 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9327 and 'j' look better. This might fix the "macron" bug that has been
9330 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9331 functions as one template function. Delete the old versions.
9333 * src/support/lyxsum.C: move using std::ifstream inside
9336 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9339 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9341 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9343 * src/insets/figinset.C (InitFigures): use new instead of malloc
9344 to allocate memory for figures and bitmaps.
9345 (DoneFigures): use delete[] instead of free to deallocate memory
9346 for figures and bitmaps.
9347 (runqueue): use new to allocate
9348 (getfigdata): use new/delete[] instead of malloc/free
9349 (RegisterFigure): ditto
9351 * some files: moved some declarations closer to first use, small
9352 whitespace changes use preincrement instead of postincrement where
9353 it does not make a difference.
9355 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9356 step on the way to use stl::containers for key maps.
9358 * src/bufferlist.h: add a typedef for const_iterator and const
9359 versions of begin and end.
9361 * src/bufferlist.[Ch]: change name of member variable _state to
9362 state_. (avoid reserved names)
9364 (getFileNames): returns the filenames of the buffers in a vector.
9366 * configure.in (ALL_LINGUAS): added ro
9368 * src/support/putenv.C: new file
9370 * src/support/mkdir.C: new file
9372 2000-01-20 Allan Rae <rae@lyx.org>
9374 * lib/layouts/IEEEtran.layout: Added several theorem environments
9376 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9377 couple of minor additions.
9379 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9380 (except for those in footnotes of course)
9382 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9384 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9386 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9387 std::sort and std::lower_bound instead of qsort and handwritten
9389 (struct compara): struct that holds the functors used by std::sort
9390 and std::lower_bound in MathedLookupBOP.
9392 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9394 * src/support/LAssert.h: do not do partial specialization. We do
9397 * src/support/lyxlib.h: note that lyx::getUserName() and
9398 lyx::date() are not in use right now. Should these be suppressed?
9400 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9401 (makeLinuxDocFile): do not put date and user name in linuxdoc
9404 * src/support/lyxlib.h (kill): change first argument to long int,
9405 since that's what solaris uses.
9407 * src/support/kill.C (kill): fix declaration to match prototype.
9409 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9410 actually check whether namespaces are supported. This is not what
9413 * src/support/lyxsum.C: add a using directive.
9415 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9417 * src/support/kill.C: if we have namespace support we don't have
9418 to include lyxlib.h.
9420 * src/support/lyxlib.h: use namespace lyx if supported.
9422 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9424 * src/support/date.C: new file
9426 * src/support/chdir.C: new file
9428 * src/support/getUserName.C: new file
9430 * src/support/getcwd.C: new file
9432 * src/support/abort.C: new file
9434 * src/support/kill.C: new file
9436 * src/support/lyxlib.h: moved all the functions in this file
9437 insede struct lyx. Added also kill and abort to this struct. This
9438 is a way to avoid the "kill is not defined in <csignal>", we make
9439 C++ wrappers for functions that are not ANSI C or ANSI C++.
9441 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9442 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9443 lyx it has been renamed to sum.
9445 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9447 * src/text.C: add using directives for std::min and std::max.
9449 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9451 * src/texrow.C (getIdFromRow): actually return something useful in
9452 id and pos. Hopefully fixes the bug with positionning of errorbox
9455 * src/lyx_main.C (easyParse): output an error and exit if an
9456 incorrect command line option has been given.
9458 * src/spellchecker.C (ispell_check_word): document a memory leak.
9460 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9461 where a "struct utimbuf" is allocated with "new" and deleted with
9464 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9466 * src/text2.C (CutSelection): don't delete double spaces.
9467 (PasteSelection): ditto
9468 (CopySelection): ditto
9470 * src/text.C (Backspace): don't delete double spaces.
9472 * src/lyxlex.C (next): fix a bug that were only present with
9473 conformant std::istream::get to read comment lines, use
9474 std::istream::getline instead. This seems to fix the problem.
9476 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9478 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9479 allowed to insert space before space" editing problem. Please read
9480 commends at the beginning of the function. Comments about usage
9483 * src/text.C (InsertChar): fix for the "not allowed to insert
9484 space before space" editing problem.
9486 * src/text2.C (DeleteEmptyParagraphMechanism): when
9487 IsEmptyTableRow can only return false this last "else if" will
9488 always be a no-op. Commented out.
9490 * src/text.C (RedoParagraph): As far as I can understand tmp
9491 cursor is not really needed.
9493 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9494 present it could only return false anyway.
9495 (several functions): Did something not so smart...added a const
9496 specifier on a lot of methods.
9498 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9499 and add a tmp->text.resize. The LyXParagraph constructor does the
9501 (BreakParagraphConservative): ditto
9503 * src/support/path.h (Path): add a define so that the wrong usage
9504 "Path("/tmp") will be flagged as a compilation error:
9505 "`unnamed_Path' undeclared (first use this function)"
9507 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9509 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9510 which was bogus for several reasons.
9512 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9516 * autogen.sh: do not use "type -path" (what's that anyway?).
9518 * src/support/filetools.C (findtexfile): remove extraneous space
9519 which caused a kpsewhich warning (at least with kpathsea version
9522 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9524 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9526 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9528 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9530 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9532 * src/paragraph.C (BreakParagraph): do not reserve space on text
9533 if we don't need to (otherwise, if pos_end < pos, we end up
9534 reserving huge amounts of memory due to bad unsigned karma).
9535 (BreakParagraphConservative): ditto, although I have not seen
9536 evidence the bug can happen here.
9538 * src/lyxparagraph.h: add a using std::list.
9540 2000-01-11 Juergen Vigna <jug@sad.it>
9542 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9545 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9547 * src/vc-backend.C (doVCCommand): change to be static and take one
9548 more parameter: the path to chdir too be fore executing the command.
9549 (retrive): new function equiv to "co -r"
9551 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9552 file_not_found_hook is true.
9554 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9556 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9557 if a file is readwrite,readonly...anything else.
9559 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9561 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9562 (CreatePostscript): name change from MenuRunDVIPS (or something)
9563 (PreviewPostscript): name change from MenuPreviewPS
9564 (PreviewDVI): name change from MenuPreviewDVI
9566 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9567 \view_pdf_command., \pdf_to_ps_command
9569 * lib/configure.m4: added search for PDF viewer, and search for
9570 PDF to PS converter.
9571 (lyxrc.defaults output): add \pdflatex_command,
9572 \view_pdf_command and \pdf_to_ps_command.
9574 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9576 * src/bufferlist.C (write): we don't use blocksize for anything so
9579 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9581 * src/support/block.h: disable operator T* (), since it causes
9582 problems with both compilers I tried. See comments in the file.
9584 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9587 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9588 variable LYX_DIR_10x to LYX_DIR_11x.
9590 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9592 * INSTALL: document --with-lyxname.
9595 * configure.in: new configure flag --with-lyxname which allows to
9596 choose the name under which lyx is installed. Default is "lyx", of
9597 course. It used to be possible to do this with --program-suffix,
9598 but the later has in fact a different meaning for autoconf.
9600 * src/support/lstrings.h (lstrchr): reformat a bit.
9602 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9603 * src/mathed/math_defs.h: ditto.
9605 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9607 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9608 true, decides if we create a backup file or not when saving. New
9609 tag and variable \pdf_mode, defaults to false. New tag and
9610 variable \pdflatex_command, defaults to pdflatex. New tag and
9611 variable \view_pdf_command, defaults to xpdf. New tag and variable
9612 \pdf_to_ps_command, defaults to pdf2ps.
9614 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9616 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9617 does not have a BufferView.
9618 (unlockInset): ditto + don't access the_locking_inset if the
9619 buffer does not have a BufferView.
9621 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9622 certain circumstances so that we don't continue a keyboard
9623 operation long after the key was released. Try f.ex. to load a
9624 large document, press PageDown for some seconds and then release
9625 it. Before this change the document would contine to scroll for
9626 some time, with this change it stops imidiatly.
9628 * src/support/block.h: don't allocate more space than needed. As
9629 long as we don't try to write to the arr[x] in a array_type arr[x]
9630 it is perfectly ok. (if you write to it you might segfault).
9631 added operator value_type*() so that is possible to pass the array
9632 to functions expecting a C-pointer.
9634 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9637 * intl/*: updated to gettext 0.10.35, tried to add our own
9638 required modifications. Please verify.
9640 * po/*: updated to gettext 0.10.35, tried to add our own required
9641 modifications. Please verify.
9643 * src/support/lstrings.C (tostr): go at fixing the problem with
9644 cxx and stringstream. When stringstream is used return
9645 oss.str().c_str() so that problems with lyxstring and basic_string
9646 are avoided. Note that the best solution would be for cxx to use
9647 basic_string all the way, but it is not conformant yet. (it seems)
9649 * src/lyx_cb.C + other files: moved several global functions to
9650 class BufferView, some have been moved to BufferView.[Ch] others
9651 are still located in lyx_cb.C. Code changes because of this. (part
9652 of "get rid of current_view project".)
9654 * src/buffer.C + other files: moved several Buffer functions to
9655 class BufferView, the functions are still present in buffer.C.
9656 Code changes because of this.
9658 * config/lcmessage.m4: updated to most recent. used when creating
9661 * config/progtest.m4: updated to most recent. used when creating
9664 * config/gettext.m4: updated to most recent. applied patch for
9667 * config/gettext.m4.patch: new file that shows what changes we
9668 have done to the local copy of gettext.m4.
9670 * config/libtool.m4: new file, used in creation of acinclude.m4
9672 * config/lyxinclude.m4: new file, this is the lyx created m4
9673 macros, used in making acinclude.m4.
9675 * autogen.sh: GNU m4 discovered as a separate task not as part of
9676 the lib/configure creation.
9677 Generate acinlucde from files in config. Actually cat
9678 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9679 easier to upgrade .m4 files that really are external.
9681 * src/Spacing.h: moved using std::istringstream to right after
9682 <sstream>. This should fix the problem seen with some compilers.
9684 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9686 * src/lyx_cb.C: began some work to remove the dependency a lot of
9687 functions have on BufferView::text, even if not really needed.
9688 (GetCurrentTextClass): removed this func, it only hid the
9691 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9692 forgot this in last commit.
9694 * src/Bullet.C (bulletEntry): use static char const *[] for the
9695 tables, becuase of this the return arg had to change to string.
9697 (~Bullet): removed unneeded destructor
9699 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9700 (insetSleep): moved from Buffer
9701 (insetWakeup): moved from Buffer
9702 (insetUnlock): moved from Buffer
9704 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9705 from Buffer to BufferView.
9707 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9709 * config/ltmain.sh: updated to version 1.3.4 of libtool
9711 * config/ltconfig: updated to version 1.3.4 of libtool
9713 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9716 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9717 Did I get that right?
9719 * src/lyxlex.h: add a "using" directive or two.
9720 * src/Spacing.h: ditto.
9721 * src/insets/figinset.C: ditto.
9722 * src/support/filetools.C: ditto.
9723 * src/support/lstrings.C: ditto.
9724 * src/BufferView.C: ditto.
9725 * src/bufferlist.C: ditto.
9726 * src/lyx_cb.C: ditto.
9727 * src/lyxlex.C: ditto.
9729 * NEWS: add some changes for 1.1.4.
9731 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9733 * src/BufferView.C: first go at a TextCache to speed up switching
9736 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9738 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9739 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9740 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9741 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9744 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9745 members of the struct are correctly initialized to 0 (detected by
9747 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9748 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9750 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9751 pidwait, since it was allocated with "new". This was potentially
9752 very bad. Thanks to Michael Schmitt for running purify for us.
9755 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9757 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9759 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9761 1999-12-30 Allan Rae <rae@lyx.org>
9763 * lib/templates/IEEEtran.lyx: minor change
9765 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9766 src/mathed/formula.C (LocalDispatch): askForText changes
9768 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9769 know when a user has cancelled input. Fixes annoying problems with
9770 inserting labels and version control.
9772 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9774 * src/support/lstrings.C (tostr): rewritten to use strstream and
9777 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9779 * src/support/filetools.C (IsFileWriteable): use fstream to check
9780 (IsDirWriteable): use fileinfo to check
9782 * src/support/filetools.h (FilePtr): whole class deleted
9784 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9786 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9788 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9790 * src/bufferlist.C (write): use ifstream and ofstream instead of
9793 * src/Spacing.h: use istrstream instead of sscanf
9795 * src/mathed/math_defs.h: change first arg to istream from FILE*
9797 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9799 * src/mathed/math_parser.C: have yyis to be an istream
9800 (LexGetArg): use istream (yyis)
9802 (mathed_parse): ditto
9803 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9805 * src/mathed/formula.C (Read): rewritten to use istream
9807 * src/mathed/formulamacro.C (Read): rewritten to use istream
9809 * src/lyxlex.h (~LyXLex): deleted desturctor
9810 (getStream): new function, returns an istream
9811 (getFile): deleted funtion
9812 (IsOK): return is.good();
9814 * src/lyxlex.C (LyXLex): delete file and owns_file
9815 (setFile): open an filebuf and assign that to a istream instead of
9817 (setStream): new function, takes an istream as arg.
9818 (setFile): deleted function
9819 (EatLine): rewritten us use istream instead of FILE*
9823 * src/table.C (LyXTable): use istream instead of FILE*
9824 (Read): rewritten to take an istream instead of FILE*
9826 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9828 * src/buffer.C (Dispatch): remove an extraneous break statement.
9830 * src/support/filetools.C (QuoteName): change to do simple
9831 'quoting'. More work is necessary. Also changed to do nothing
9832 under emx (needs fix too).
9833 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9835 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9836 config.h.in to the AC_DEFINE_UNQUOTED() call.
9837 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9838 needs char * as argument (because Solaris 7 declares it like
9841 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9842 remove definition of BZERO.
9844 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9846 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9847 defined, "lyxregex.h" if not.
9849 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9851 (REGEX): new variable that is set to regex.c lyxregex.h when
9852 AM_CONDITIONAL USE_REGEX is set.
9853 (libsupport_la_SOURCES): add $(REGEX)
9855 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9858 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9861 * configure.in: add call to LYX_REGEX
9863 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9864 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9866 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9868 * lib/bind/fi_menus.bind: new file, from
9869 pauli.virtanen@saunalahti.fi.
9871 * src/buffer.C (getBibkeyList): pass the parameter delim to
9872 InsetInclude::getKeys and InsetBibtex::getKeys.
9874 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9875 is passed to Buffer::getBibkeyList
9877 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9878 instead of the hardcoded comma.
9880 * src/insets/insetbib.C (getKeys): make sure that there are not
9881 leading blanks in bibtex keys. Normal latex does not care, but
9882 harvard.sty seems to dislike blanks at the beginning of citation
9883 keys. In particular, the retturn value of the function is
9885 * INSTALL: make it clear that libstdc++ is needed and that gcc
9886 2.7.x probably does not work.
9888 * src/support/filetools.C (findtexfile): make debug message go to
9890 * src/insets/insetbib.C (getKeys): ditto
9892 * src/debug.C (showTags): make sure that the output is correctly
9895 * configure.in: add a comment for TWO_COLOR_ICON define.
9897 * acconfig.h: remove all the entries that already defined in
9898 configure.in or acinclude.m4.
9900 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9901 to avoid user name, date and copyright.
9903 1999-12-21 Juergen Vigna <jug@sad.it>
9905 * src/table.C (Read): Now read bogus row format informations
9906 if the format is < 5 so that afterwards the table can
9907 be read by lyx but without any format-info. Fixed the
9908 crash we experienced when not doing this.
9910 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9912 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9913 (RedoDrawingOfParagraph): ditto
9914 (RedoParagraphs): ditto
9915 (RemoveTableRow): ditto
9917 * src/text.C (Fill): rename arg paperwidth -> paper_width
9919 * src/buffer.C (insertLyXFile): rename var filename -> fname
9920 (writeFile): rename arg filename -> fname
9921 (writeFileAscii): ditto
9922 (makeLaTeXFile): ditto
9923 (makeLinuxDocFile): ditto
9924 (makeDocBookFile): ditto
9926 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9929 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9931 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9934 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9935 compiled by a C compiler not C++.
9937 * src/layout.h (LyXTextClass): added typedef for const_iterator
9938 (LyXTextClassList): added typedef for const_iterator + member
9939 functions begin and end.
9941 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9942 iterators to fill the choice_class.
9943 (updateLayoutChoice): rewritten to use iterators to fill the
9944 layoutlist in the toolbar.
9946 * src/BufferView.h (BufferView::work_area_width): removed unused
9949 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9951 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9952 (sgmlCloseTag): ditto
9954 * src/support/lstrings.h: return type of countChar changed to
9957 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9958 what version of this func to use. Also made to return unsigned int.
9960 * configure.in: call LYX_STD_COUNT
9962 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9963 conforming std::count.
9965 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9967 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9968 and a subscript would give bad display (patch from Dekel Tsur
9969 <dekel@math.tau.ac.il>).
9971 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9973 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9976 * src/chset.h: add a few 'using' directives
9978 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9979 triggered when no buffer is active
9981 * src/layout.C: removed `break' after `return' in switch(), since
9984 * src/lyx_main.C (init): make sure LyX can be ran in place even
9985 when libtool has done its magic with shared libraries. Fix the
9986 test for the case when the system directory has not been found.
9988 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9989 name for the latex file.
9990 (MenuMakeHTML): ditto
9992 * src/buffer.h: add an optional boolean argument, which is passed
9995 1999-12-20 Allan Rae <rae@lyx.org>
9997 * lib/templates/IEEEtran.lyx: small correction and update.
9999 * configure.in: Attempted to use LYX_PATH_HEADER
10001 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10003 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10004 input from JMarc. Now use preprocessor to find the header.
10005 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10006 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10007 LYX_STL_STRING_FWD. See comments in file.
10009 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10011 * The global MiniBuffer * minibuffer variable is dead.
10013 * The global FD_form_main * fd_form_main variable is dead.
10015 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10017 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10019 * src/table.h: add the LOstream.h header
10020 * src/debug.h: ditto
10022 * src/LyXAction.h: change the explaination of the ReadOnly
10023 attribute: is indicates that the function _can_ be used.
10025 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10028 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10030 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10036 * src/paragraph.C (GetWord): assert on pos>=0
10039 * src/support/lyxstring.C: condition the use of an invariant on
10041 * src/support/lyxstring.h: ditto
10043 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10044 Use LAssert.h instead of plain assert().
10046 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10048 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10049 * src/support/filetools.C: ditto
10051 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10054 * INSTALL: document the new configure flags
10056 * configure.in: suppress --with-debug; add --enable-assertions
10058 * acinclude.m4: various changes in alignment of help strings.
10060 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10062 * src/kbmap.C: commented out the use of the hash map in kb_map,
10063 beginning of movement to a stl::container.
10065 * several files: removed code that was not in effect when
10066 MOVE_TEXT was defined.
10068 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10069 for escaping should not be used. We can discuss if the string
10070 should be enclosed in f.ex. [] instead of "".
10072 * src/trans_mgr.C (insert): use the new returned value from
10073 encodeString to get deadkeys and keymaps done correctly.
10075 * src/chset.C (encodeString): changed to return a pair, to tell
10076 what to use if we know the string.
10078 * src/lyxscreen.h (fillArc): new function.
10080 * src/FontInfo.C (resize): rewritten to use more std::string like
10081 structore, especially string::replace.
10083 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10086 * configure.in (chmod +x some scripts): remove config/gcc-hack
10088 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10090 * src/buffer.C (writeFile): change once again the top comment in a
10091 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10092 instead of an hardcoded version number.
10093 (makeDocBookFile): ditto
10095 * src/version.h: add new define LYX_DOCVERSION
10097 * po/de.po: update from Pit Sütterlin
10098 * lib/bind/de_menus.bind: ditto.
10100 * src/lyxfunc.C (Dispatch): call MenuExport()
10101 * src/buffer.C (Dispatch): ditto
10103 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10104 LyXFunc::Dispatch().
10105 (MenuExport): new function, moved from
10106 LyXFunc::Dispatch().
10108 * src/trans_mgr.C (insert): small cleanup
10109 * src/chset.C (loadFile): ditto
10111 * lib/kbd/iso8859-1.cdef: add missing backslashes
10113 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10115 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10116 help with placing the manually drawn accents better.
10118 (Draw): x2 and hg changed to float to minimize rounding errors and
10119 help place the accents better.
10121 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10122 unsigned short to char is just wrong...cast the char to unsigned
10123 char instead so that the two values can compare sanely. This
10124 should also make the display of insetlatexaccents better and
10125 perhaps also some other insets.
10127 (lbearing): new function
10130 1999-12-15 Allan Rae <rae@lyx.org>
10132 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10133 header that provides a wrapper around the very annoying SGI STL header
10136 * src/support/lyxstring.C, src/LString.h:
10137 removed old SGI-STL-compatability attempts.
10139 * configure.in: Use LYX_STL_STRING_FWD.
10141 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10142 stl_string_fwd.h is around and try to determine it's location.
10143 Major improvement over previous SGI STL 3.2 compatability.
10144 Three small problems remain with this function due to my zero
10145 knowledge of autoconf. JMarc and lgb see the comments in the code.
10147 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10149 * src/broken_const.h, config/hack-gcc, config/README: removed
10151 * configure.in: remove --with-gcc-hack option; do not call
10154 * INSTALL: remove documentation of --with-broken-const and
10157 * acconfig.h: remove all trace of BROKEN_CONST define
10159 * src/buffer.C (makeDocBookFile): update version number in output
10161 (SimpleDocBookOnePar): fix an assert when trying to a character
10162 access beyond string length
10165 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10167 * po/de.po: fix the Export menu
10169 * lyx.man: update the description of -dbg
10171 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10172 (commandLineHelp): updated
10173 (easyParse): show list of available debug levels if -dbg is passed
10176 * src/Makefile.am: add debug.C
10178 * src/debug.h: moved some code to debug.C
10180 * src/debug.C: new file. Contains code to set and show debug
10183 * src/layout.C: remove 'break' after 'continue' in switch
10184 statements, since these cannot be reached.
10186 1999-12-13 Allan Rae <rae@lyx.org>
10188 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10189 (in_word_set): hash() -> math_hash()
10191 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10193 * acconfig.h: Added a test for whether we are using exceptions in the
10194 current compilation run. If so USING_EXCEPTIONS is defined.
10196 * config.in: Check for existance of stl_string_fwd.h
10197 * src/LString.h: If compiling --with-included-string and SGI's
10198 STL version 3.2 is present (see above test) we need to block their
10199 forward declaration of string and supply a __get_c_string().
10200 However, it turns out this is only necessary if compiling with
10201 exceptions enabled so I've a bit more to add yet.
10203 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10204 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10205 src/support/LRegex.h, src/undo.h:
10206 Shuffle the order of the included files a little to ensure that
10207 LString.h gets included before anything that includes stl_string_fwd.h
10209 * src/support/lyxstring.C: We need to #include LString.h instead of
10210 lyxstring.h to get the necessary definition of __get_c_string.
10211 (__get_c_string): New function. This is defined static just like SGI's
10212 although why they need to do this I'm not sure. Perhaps it should be
10213 in lstrings.C instead.
10215 * lib/templates/IEEEtran.lyx: New template file.
10217 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10219 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10220 * intl/Makefile.in (MKINSTALLDIRS): ditto
10222 * src/LyXAction.C (init): changed to hold the LFUN data in a
10223 automatic array in stead of in callso to newFunc, this speeds up
10224 compilation a lot. Also all the memory used by the array is
10225 returned when the init is completed.
10227 * a lot of files: compiled with -Wold-style-cast, changed most of
10228 the reported offenders to C++ style casts. Did not change the
10229 offenders in C files.
10231 * src/trans.h (Match): change argument type to unsigned int.
10233 * src/support/DebugStream.C: fix some types on the streambufs so
10234 that it works on a conforming implementation.
10236 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10238 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10240 * src/support/lyxstring.C: remove the inline added earlier since
10241 they cause a bunch of unsatisfied symbols when linking with dec
10242 cxx. Cxx likes to have the body of inlines at the place where they
10245 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10246 accessing negative bounds in array. This fixes the crash when
10247 inserting accented characters.
10248 * src/trans.h (Match): ditto
10250 * src/buffer.C (Dispatch): since this is a void, it should not try
10251 to return anything...
10253 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10255 * src/buffer.h: removed the two friends from Buffer. Some changes
10256 because of this. Buffer::getFileName and Buffer::setFileName
10257 renamed to Buffer::fileName() and Buffer::fileName(...).
10259 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10261 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10262 and Buffer::update(short) to BufferView. This move is currently
10263 controlled by a define MOVE_TEXT, this will be removed when all
10264 shows to be ok. This move paves the way for better separation
10265 between buffer contents and buffer view. One side effect is that
10266 the BufferView needs a rebreak when swiching buffers, if we want
10267 to avoid this we can add a cache that holds pointers to LyXText's
10268 that is not currently in use.
10270 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10273 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10275 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10277 * lyx_main.C: new command line option -x (or --execute) and
10278 -e (or --export). Now direct conversion from .lyx to .tex
10279 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10280 Unfortunately, X is still needed and the GUI pops up during the
10283 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10285 * src/Spacing.C: add a using directive to bring stream stuff into
10287 * src/paragraph.C: ditto
10288 * src/buffer.C: ditto
10290 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10291 from Lars' announcement).
10293 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10294 example files from Tino Meinen.
10296 1999-12-06 Allan Rae <rae@lyx.org>
10298 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10300 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10302 * src/support/lyxstring.C: added a lot of inline for no good
10305 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10306 latexWriteEndChanges, they were not used.
10308 * src/layout.h (operator<<): output operator for PageSides
10310 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10312 * some example files: loaded in LyX 1.0.4 and saved again to update
10313 certain constructs (table format)
10315 * a lot of files: did the change to use fstream/iostream for all
10316 writing of files. Done with a close look at Andre Poenitz's patch.
10318 * some files: whitespace changes.
10320 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10322 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10323 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10324 architecture, we provide our own. It is used unconditionnally, but
10325 I do not think this is a performance problem. Thanks to Angus
10326 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10327 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10329 (GetInset): use my_memcpy.
10333 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10334 it is easier to understand, but it uses less TeX-only constructs now.
10336 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10337 elements contain spaces
10339 * lib/configure: regenerated
10341 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10342 elements contain spaces; display the list of programs that are
10345 * autogen.sh: make sure lib/configure is executable
10347 * lib/examples/*: rename the tutorial examples to begin with the
10348 two-letters language code.
10350 * src/lyxfunc.C (getStatus): do not query current font if no
10353 * src/lyx_cb.C (RunScript): use QuoteName
10354 (MenuRunDvips): ditto
10355 (PrintApplyCB): ditto
10357 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10358 around argument, so that it works well with the current shell.
10359 Does not work properly with OS/2 shells currently.
10361 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10362 * src/LyXSendto.C (SendtoApplyCB): ditto
10363 * src/lyxfunc.C (Dispatch): ditto
10364 * src/buffer.C (runLaTeX): ditto
10365 (runLiterate): ditto
10366 (buildProgram): ditto
10368 * src/lyx_cb.C (RunScript): ditto
10369 (MenuMakeLaTeX): ditto
10371 * src/buffer.h (getLatexName): new method
10373 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10375 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10377 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10378 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10379 (create_math_panel): ditto
10381 * src/lyxfunc.C (getStatus): re-activate the code which gets
10382 current font and cursor; add test for export to html.
10384 * src/lyxrc.C (read): remove unreachable break statements; add a
10387 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10389 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10391 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10392 introduced by faulty regex.
10393 * src/buffer.C: ditto
10394 * src/lastfiles.C: ditto
10395 * src/paragraph.C: ditto
10396 * src/table.C: ditto
10397 * src/vspace.C: ditto
10398 * src/insets/figinset.C: ditto
10399 Note: most of these is absolutely harmless, except the one in
10400 src/mathed formula.C.
10402 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10404 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10405 operation, yielding correct results for the reLyX command.
10407 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10409 * src/support/filetools.C (ExpandPath): removed an over eager
10411 (ReplaceEnvironmentPath): ditto
10413 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10414 shows that we are doing something fishy in our code...
10415 (BubblePost): ditto
10418 * src/lyxrc.C (read): use a double switch trick to get more help
10419 from the compiler. (the same trick is used in layout.C)
10420 (write): new function. opens a ofstream and pass that to output
10421 (output): new function, takes a ostream and writes the lyxrc
10422 elemts to it. uses a dummy switch to make sure no elements are
10425 * src/lyxlex.h: added a struct pushpophelper for use in functions
10426 with more than one exit point.
10428 * src/lyxlex.[Ch] (GetInteger): made it const
10432 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10434 * src/layout.[hC] : LayoutTags splitted into several enums, new
10435 methods created, better error handling cleaner use of lyxlex. Read
10438 * src/bmtable.[Ch]: change some member prototypes because of the
10439 image const changes.
10441 * commandtags.h, src/LyXAction.C (init): new function:
10442 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10443 This file is not read automatically but you can add \input
10444 preferences to your lyxrc if you want to. We need to discuss how
10447 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10448 in .aux, also remove .bib and .bst files from dependencies when
10451 * src/BufferView.C, src/LyXView.C: add const_cast several places
10452 because of changes to images.
10454 * lib/images/*: same change as for images/*
10456 * lib/lyxrc.example: Default for accept_compound is false not no.
10458 * images/*: changed to be const, however I have som misgivings
10459 about this change so it might be changed back.
10461 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10463 * lib/configure, po/POTFILES.in: regenerated
10465 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10467 * config/lib_configure.m4: removed
10469 * lib/configure.m4: new file (was config/lib_configure.m4)
10471 * configure.in: do not test for rtti, since we do not use it.
10473 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10475 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10476 doubling of allocated space scheme. This makes it faster for large
10477 strings end to use less memory for small strings. xtra rememoved.
10479 * src/insets/figinset.C (waitalarm): commented out.
10480 (GhostscriptMsg): use static_cast
10481 (GhostscriptMsg): use new instead of malloc to allocate memory for
10482 cmap. also delete the memory after use.
10484 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10486 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10487 for changes in bibtex database or style.
10488 (runBibTeX): remove all .bib and .bst files from dep before we
10490 (run): use scanAuc in when dep file already exist.
10492 * src/DepTable.C (remove_files_with_extension): new method
10493 (exist): new method
10495 * src/DepTable.[Ch]: made many of the methods const.
10497 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10499 * src/bufferparams.C: make sure that the default textclass is
10500 "article". It used to be the first one by description order, but
10501 now the first one is "docbook".
10503 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10504 string; call Debug::value.
10505 (easyParse): pass complete argument to setDebuggingLevel().
10507 * src/debug.h (value): fix the code that parses debug levels.
10509 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10512 * src/LyXAction.C: use Debug::ACTION as debug channel.
10514 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10516 * NEWS: updated for the future 1.1.3 release.
10518 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10519 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10520 it should. This is of course a controversial change (since many
10521 people will find that their lyx workscreen is suddenly full of
10522 red), but done for the sake of correctness.
10524 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10525 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10527 * src/insets/inseterror.h, src/insets/inseturl.h,
10528 src/insets/insetinfo.h, src/insets/figinset.h,
10529 src/mathed/formulamacro.h, src/mathed/math_macro.h
10530 (EditMessage): add a missing const and add _() to make sure that
10531 translation happens
10533 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10534 src/insets/insetbib.C, src/support/filetools.C: add `using'
10535 directives for cxx.
10537 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10538 doing 'Insert index of last word' at the beginning of a paragraph.
10540 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10542 * several files: white-space changes.
10544 * src/mathed/formula.C: removed IsAlpha and IsDigit
10546 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10547 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10550 * src/insets/figinset.C (GetPSSizes): don't break when
10551 "EndComments" is seen. But break when a boundingbox is read.
10553 * all classes inherited from Inset: return value of Clone
10554 changed back to Inset *.
10556 * all classes inherited form MathInset: return value of Clone
10557 changed back to MathedInset *.
10559 * src/insets/figinset.C (runqueue): use a ofstream to output the
10560 gs/ps file. Might need some setpresicion or setw. However I can
10561 see no problem with the current code.
10562 (runqueue): use sleep instead of the alarm/signal code. I just
10563 can't see the difference.
10565 * src/paragraph.C (LyXParagraph): reserve space in the new
10566 paragraph and resize the inserted paragraph to just fit.
10568 * src/lyxfunc.h (operator|=): added operator for func_status.
10570 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10571 check for readable file.
10573 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10574 check for readable file.
10575 (MenuMakeLinuxDoc): ditto
10576 (MenuMakeDocBook): ditto
10577 (MenuMakeAscii): ditto
10578 (InsertAsciiFile): split the test for openable and readable
10580 * src/bmtable.C (draw_bitmaptable): use
10581 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10583 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10584 findtexfile from LaTeX to filetools.
10586 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10587 instead of FilePtr. Needs to be verified by a literate user.
10589 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10591 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10592 (EditMessage): likewise.
10594 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10595 respectively as \textasciitilde and \textasciicircum.
10597 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10599 * src/support/lyxstring.h: made the methods that take iterators
10600 use const_iterator.
10602 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10603 (regexMatch): made is use the real regex class.
10605 * src/support/Makefile.am: changed to use libtool
10607 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10609 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10611 (MathIsInset ++): changed several macros to be inline functions
10614 * src/mathed/Makefile.am: changed to use libtool
10616 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10618 * src/insets/inset* : Clone changed to const and return type is
10619 the true insettype not just Inset*.
10621 * src/insets/Makefile.am: changed to use libtool
10623 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10625 * src/undo.[Ch] : added empty() and changed some of the method
10628 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10630 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10631 setID use block<> for the bullets array, added const several places.
10633 * src/lyxfunc.C (getStatus): new function
10635 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10636 LyXAction, added const to several funtions.
10638 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10639 a std::map, and to store the dir items in a vector.
10641 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10644 * src/LyXView.[Ch] + other files : changed currentView to view.
10646 * src/LyXAction.[Ch] : ported from the old devel branch.
10648 * src/.cvsignore: added .libs and a.out
10650 * configure.in : changes to use libtool.
10652 * acinclude.m4 : inserted libtool.m4
10654 * .cvsignore: added libtool
10656 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10658 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10659 file name in insets and mathed directories (otherwise the
10660 dependency is not taken in account under cygwin).
10662 * src/text2.C (InsertString[AB]): make sure that we do not try to
10663 read characters past the string length.
10665 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10667 * lib/doc/LaTeXConfig.lyx.in,
10668 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10670 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10671 file saying who created them and when this heppened; this is
10672 useless and annoys tools like cvs.
10674 * lib/layouts/g-brief-{en,de}.layout,
10675 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10676 from Thomas Hartkens <thomas@hartkens.de>.
10678 * src/{insets,mathed}/Makefile.am: do not declare an empty
10679 LDFLAGS, so that it can be set at configure time (useful on Irix
10682 * lib/reLyX/configure.in: make sure that the prefix is set
10683 correctly in LYX_DIR.
10685 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10687 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10688 be used by 'command-sequence' this allows to bind a key to a
10689 sequence of LyX-commands
10690 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10692 * src/LyXAction.C: add "command-sequence"
10694 * src/LyXFunction.C: handling of "command-sequence"
10696 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10697 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10699 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10701 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10703 * src/buffer.C (writeFile): Do not output a comment giving user
10704 and date at the beginning of a .lyx file. This is useless and
10705 annoys cvs anyway; update version number to 1.1.
10707 * src/Makefile.am (LYX_DIR): add this definition, so that a
10708 default path is hardcoded in LyX.
10710 * configure.in: Use LYX_GNU_GETTEXT.
10712 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10713 AM_GNU_GETTEXT with a bug fixed.
10715 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10717 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10719 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10720 which is used to point to LyX data is now LYX_DIR_11x.
10722 * lyx.man: convert to a unix text file; small updates.
10724 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10726 * src/support/LSubstring.[Ch]: made the second arg of most of the
10727 constructors be a const reference.
10729 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10732 * src/support/lyxstring.[Ch] (swap): added missing member function
10733 and specialization of swap(str, str);
10735 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10737 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10738 trace of the old one.
10740 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10741 put the member definitions in undo.C.
10743 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10744 NEW_TEXT and have now only code that was included when this was
10747 * src/intl.C (LCombo): use static_cast
10749 (DispatchCallback): ditto
10751 * src/definitions.h: removed whole file
10753 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10755 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10756 parsing and stores in a std:map. a regex defines the file format.
10757 removed unneeded members.
10759 * src/bufferparams.h: added several enums from definitions.h here.
10760 Removed unsused destructor. Changed some types to use proper enum
10761 types. use block to have the temp_bullets and user_defined_bullets
10762 and to make the whole class assignable.
10764 * src/bufferparams.C (Copy): removed this functions, use a default
10765 assignment instead.
10767 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10770 * src/buffer.C (readLyXformat2): commend out all that have with
10771 oldpapersize to do. also comment out all that hve to do with
10772 insetlatex and insetlatexdel.
10773 (setOldPaperStuff): commented out
10775 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10777 * src/LyXAction.C: remove use of inset-latex-insert
10779 * src/mathed/math_panel.C (button_cb): use static_cast
10781 * src/insets/Makefile.am (insets_o_SOURCES): removed
10784 * src/support/lyxstring.C (helper): use the unsigned long
10785 specifier, UL, instead of a static_cast.
10787 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10789 * src/support/block.h: new file. to be used as a c-style array in
10790 classes, so that the class can be assignable.
10792 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10794 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10795 NULL, make sure to return an empty string (it is not possible to
10796 set a string to NULL).
10798 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10800 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10802 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10804 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10805 link line, so that Irix users (for example) can set it explicitely to
10808 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10809 it can be overidden at make time (static or dynamic link, for
10812 * src/vc-backend.C, src/LaTeXFeatures.h,
10813 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10814 statements to bring templates to global namespace.
10816 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10818 * src/support/lyxstring.C (operator[] const): make it standard
10821 * src/minibuffer.C (Init): changed to reflect that more
10822 information is given from the lyxvc and need not be provided here.
10824 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10826 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10828 * src/LyXView.C (UpdateTimerCB): use static_cast
10829 (KeyPressMask_raw_callback): ditto
10831 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10832 buffer_, a lot of changes because of this. currentBuffer() ->
10833 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10834 also changes to other files because of this.
10836 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10838 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10839 have no support for RCS and partial support for CVS, will be
10842 * src/insets/ several files: changes because of function name
10843 changes in Bufferview and LyXView.
10845 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10847 * src/support/LSubstring.[Ch]: new files. These implement a
10848 Substring that can be very convenient to use. i.e. is this
10850 string a = "Mary had a little sheep";
10851 Substring(a, "sheep") = "lamb";
10852 a is now "Mary has a little lamb".
10854 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10855 out patterns and subpatterns of strings. It is used by LSubstring
10856 and also by vc-backend.C
10858 * src/support/lyxstring.C: went over all the assertions used and
10859 tried to correct the wrong ones and flag which of them is required
10860 by the standard. some bugs found because of this. Also removed a
10861 couple of assertions.
10863 * src/support/Makefile.am (libsupport_a_SOURCES): added
10864 LSubstring.[Ch] and LRegex.[Ch]
10866 * src/support/FileInfo.h: have struct stat buf as an object and
10867 not a pointer to one, some changes because of this.
10869 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10870 information in layout when adding the layouts preamble to the
10871 textclass preamble.
10873 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10876 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10877 because of bug in OS/2.
10879 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10881 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10882 \verbatim@font instead of \ttfamily, so that it can be redefined.
10884 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10885 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10886 src/layout.h, src/text2.C: add 'using' directive to bring the
10887 STL templates we need from the std:: namespace to the global one.
10888 Needed by DEC cxx in strict ansi mode.
10890 * src/support/LIstream.h,src/support/LOstream.h,
10891 src/support/lyxstring.h,src/table.h,
10892 src/lyxlookup.h: do not include <config.h> in header
10893 files. This should be done in the .C files only.
10895 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10899 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10901 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10902 from Kayvan to fix the tth invokation.
10904 * development/lyx.spec.in: updates from Kayvan to reflect the
10905 changes of file names.
10907 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10909 * src/text2.C (InsertStringB): use std::copy
10910 (InsertStringA): use std::copy
10912 * src/bufferlist.C: use a vector to store the buffers in. This is
10913 an internal change and should not affect any other thing.
10915 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10918 * src/text.C (Fill): fix potential bug, one off bug.
10920 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10922 * src/Makefile.am (lyx_main.o): add more files it depends on.
10924 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10926 * src/support/lyxstring.C: use size_t for the reference count,
10927 size, reserved memory and xtra.
10928 (internal_compare): new private member function. Now the compare
10929 functions should work for std::strings that have embedded '\0'
10931 (compare): all compare functions rewritten to use
10934 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10936 * src/support/lyxstring.C (compare): pass c_str()
10937 (compare): pass c_str
10938 (compare): pass c_str
10940 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10942 * src/support/DebugStream.C: <config.h> was not included correctly.
10944 * lib/configure: forgot to re-generate it :( I'll make this file
10945 auto generated soon.
10947 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10949 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10952 * src/support/lyxstring.C: some changes from length() to rep->sz.
10953 avoids a function call.
10955 * src/support/filetools.C (SpaceLess): yet another version of the
10956 algorithm...now per Jean-Marc's suggestions.
10958 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10960 * src/layout.C (less_textclass_desc): functor for use in sorting
10962 (LyXTextClass::Read): sort the textclasses after reading.
10964 * src/support/filetools.C (SpaceLess): new version of the
10965 SpaceLess functions. What problems does this one give? Please
10968 * images/banner_bw.xbm: made the arrays unsigned char *
10970 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10972 * src/support/lyxstring.C (find): remove bogus assertion in the
10973 two versions of find where this has not been done yet.
10975 * src/support/lyxlib.h: add missing int return type to
10978 * src/menus.C (ShowFileMenu): disable exporting to html if no
10979 html export command is present.
10981 * config/lib_configure.m4: add a test for an HTML converter. The
10982 programs checked for are, in this order: tth, latex2html and
10985 * lib/configure: generated from config/lib_configure.m4.
10987 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10988 html converter. The parameters are now passed through $$FName and
10989 $$OutName, instead of standard input/output.
10991 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10993 * lib/lyxrc.example: update description of \html_command.
10994 add "quotes" around \screen_font_xxx font setting examples to help
10995 people who use fonts with spaces in their names.
10997 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10999 * Distribution files: updates for v1.1.2
11001 * src/support/lyxstring.C (find): remove bogus assert and return
11002 npos for the same condition.
11004 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11006 * added patch for OS/2 from SMiyata.
11008 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11010 * src/text2.C (CutSelection): make space_wrapped a bool
11011 (CutSelection): dont declare int i until we have to.
11012 (alphaCounter): return a char const *.
11014 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11016 * src/support/syscall.C (Systemcalls::kill):
11017 src/support/filetools.C (PutEnv, PutEnvPath):
11018 src/lyx_cb.C (addNewlineAndDepth):
11019 src/FontInfo.C (FontInfo::resize): condition some #warning
11020 directives with WITH_WARNINGS.
11023 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11025 * src/layout.[Ch] + several files: access to class variables
11026 limited and made accessor functions instead a lot of code changed
11027 becuase of this. Also instead of returning pointers often a const
11028 reference is returned instead.
11030 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11032 * src/Makefile.am (dist-hook): added used to remove the CVS from
11033 cheaders upon creating a dist
11034 (EXTRA_DIST): added cheaders
11036 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11037 a character not as a small integer.
11039 * src/support/lyxstring.C (find): removed Assert and added i >=
11040 rep->sz to the first if.
11042 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11044 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11045 src/LyXView.C src/buffer.C src/bufferparams.C
11046 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11047 src/text2.C src/insets/insetinclude.C:
11048 lyxlayout renamed to textclasslist.
11050 * src/layout.C: some lyxerr changes.
11052 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11053 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11054 (LyXLayoutList): removed all traces of this class.
11055 (LyXTextClass::Read): rewrote LT_STYLE
11056 (LyXTextClass::hasLayout): new function
11057 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11058 both const and nonconst version.
11059 (LyXTextClass::delete_layout): new function.
11060 (LyXTextClassList::Style): bug fix. do the right thing if layout
11062 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11063 (LyXTextClassList::NameOfLayout): ditto
11064 (LyXTextClassList::Load): ditto
11066 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11068 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11070 * src/LyXAction.C (LookupFunc): added a workaround for sun
11071 compiler, on the other hand...we don't know if the current code
11072 compiles on sun at all...
11074 * src/support/filetools.C (CleanupPath): subst fix
11076 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11079 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11080 complained about this one?
11082 * src/insets/insetinclude.C (Latex): subst fix
11084 * src/insets/insetbib.C (getKeys): subst fix
11086 * src/LyXSendto.C (SendtoApplyCB): subst fix
11088 * src/lyx_main.C (init): subst fix
11090 * src/layout.C (Read): subst fix
11092 * src/lyx_sendfax_main.C (button_send): subst fix
11094 * src/buffer.C (RoffAsciiTable): subst fix
11096 * src/lyx_cb.C (MenuFax): subst fix
11097 (PrintApplyCB): subst fix
11099 1999-10-26 Juergen Vigna <jug@sad.it>
11101 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11103 (Read): Cleaned up this code so now we read only format vestion >= 5
11105 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11107 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11108 come nobody has complained about this one?
11110 * src/insets/insetinclude.C (Latex): subst fix
11112 * src/insets/insetbib.C (getKeys): subst fix
11114 * src/lyx_main.C (init): subst fix
11116 * src/layout.C (Read): subst fix
11118 * src/buffer.C (RoffAsciiTable): subst fix
11120 * src/lyx_cb.C (MenuFax): subst fix.
11122 * src/layout.[hC] + some other files: rewrote to use
11123 std::container to store textclasses and layouts in.
11124 Simplified, removed a lot of code. Make all classes
11125 assignable. Further simplifications and review of type
11126 use still to be one.
11128 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11129 lastfiles to create the lastfiles partr of the menu.
11131 * src/lastfiles.[Ch]: rewritten to use deque to store the
11132 lastfiles in. Uses fstream for reading and writing. Simplifies
11135 * src/support/syscall.C: remove explicit cast.
11137 * src/BufferView.C (CursorToggleCB): removed code snippets that
11138 were commented out.
11139 use explicat C++ style casts instead of C style casts. also use
11140 u_vdata instea of passing pointers in longs.
11142 * src/PaperLayout.C: removed code snippets that were commented out.
11144 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11146 * src/lyx_main.C: removed code snippets that wer commented out.
11148 * src/paragraph.C: removed code snippets that were commented out.
11150 * src/lyxvc.C (logClose): use static_cast
11152 (viewLog): remove explicit cast to void*
11153 (showLog): removed old commented code
11155 * src/menus.C: use static_cast instead of C style casts. use
11156 u_vdata instead of u_ldata. remove explicit cast to (long) for
11157 pointers. Removed old code that was commented out.
11159 * src/insets/inset.C: removed old commented func
11161 * src/insets/insetref.C (InsetRef): removed old code that had been
11162 commented out for a long time.
11164 (escape): removed C style cast
11166 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11168 * src/insets/insetlatex.C (Draw): removed old commented code
11169 (Read): rewritten to use string
11171 * src/insets/insetlabel.C (escape): removed C style cast
11173 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11175 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11176 old commented code.
11178 * src/insets/insetinclude.h: removed a couple of stupid bools
11180 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11181 (Clone): remove C style cast
11182 (getKeys): changed list to lst because of std::list
11184 * src/insets/inseterror.C (Draw): removed som old commented code.
11186 * src/insets/insetcommand.C (Draw): removed some old commented code.
11188 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11189 commented out forever.
11190 (bibitem_cb): use static_cast instead of C style cast
11191 use of vdata changed to u_vdata.
11193 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11195 (CloseUrlCB): use static_cast instead of C style cast.
11196 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11198 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11199 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11200 (CloseInfoCB): static_cast from ob->u_vdata instead.
11201 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11204 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11205 (C_InsetError_CloseErrorCB): forward the ob parameter
11206 (CloseErrorCB): static_cast from ob->u_vdata instead.
11208 * src/vspace.h: include LString.h since we use string in this class.
11210 * src/vspace.C (lyx_advance): changed name from advance because of
11211 nameclash with stl. And since we cannot use namespaces yet...I
11212 used a lyx_ prefix instead. Expect this to change when we begin
11215 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11217 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11218 and removed now defunct constructor and deconstructor.
11220 * src/BufferView.h: have backstack as a object not as a pointer.
11221 removed initialization from constructor. added include for BackStack
11223 * development/lyx.spec.in (%build): add CFLAGS also.
11225 * src/screen.C (drawFrame): removed another warning.
11227 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11229 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11230 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11231 README and ANNOUNCE a bit for the next release. More work is
11234 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11235 unbreakable if we are in freespacing mode (LyX-Code), but not in
11238 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11240 * src/BackStack.h: fixed initialization order in constructor
11242 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11244 * acinclude.m4 (VERSION): new rules for when a version is
11245 development, added also a variable for prerelease.
11246 (warnings): we set with_warnings=yes for prereleases
11247 (lyx_opt): prereleases compile with same optimization as development
11248 (CXXFLAGS): only use pedantic if we are a development version
11250 * src/BufferView.C (restorePosition): don't do anything if the
11251 backstack is empty.
11253 * src/BackStack.h: added member empty, use this to test if there
11254 is anything to pop...
11256 1999-10-25 Juergen Vigna <jug@sad.it>
11259 * forms/layout_forms.fd +
11260 * forms/latexoptions.fd +
11261 * lyx.fd: changed for various form resize issues
11263 * src/mathed/math_panel.C +
11264 * src/insets/inseterror.C +
11265 * src/insets/insetinfo.C +
11266 * src/insets/inseturl.C +
11267 * src/insets/inseturl.h +
11269 * src/LyXSendto.C +
11270 * src/PaperLayout.C +
11271 * src/ParagraphExtra.C +
11272 * src/TableLayout.C +
11274 * src/layout_forms.C +
11281 * src/menus.C: fixed various resize issues. So now forms can be
11282 resized savely or not be resized at all.
11284 * forms/form_url.fd +
11285 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11288 * src/insets/Makefile.am: added files form_url.[Ch]
11290 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11292 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11293 (and presumably 6.2).
11295 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11296 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11297 remaining static member callbacks.
11299 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11302 * src/support/lyxstring.h: declare struct Srep as friend of
11303 lyxstring, since DEC cxx complains otherwise.
11305 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11307 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11309 * src/LaTeX.C (run): made run_bibtex also depend on files with
11311 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11312 are put into the dependency file.
11314 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11315 the code has shown itself to work
11316 (create_ispell_pipe): removed another warning, added a comment
11319 * src/minibuffer.C (ExecutingCB): removed code that has been
11320 commented out a long time
11322 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11323 out code + a warning.
11325 * src/support/lyxstring.h: comment out the three private
11326 operators, when compiling with string ansi conforming compilers
11327 they make problems.
11329 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11331 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11332 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11335 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11338 * src/mathed/math_panel.C (create_math_panel): remove explicit
11341 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11344 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11345 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11346 to XCreatePixmapFromBitmapData
11347 (fl_set_bmtable_data): change the last argument to be unsigned
11349 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11350 and bh to be unsigned int, remove explicit casts in call to
11351 XReadBitmapFileData.
11353 * images/arrows.xbm: made the arrays unsigned char *
11354 * images/varsz.xbm: ditto
11355 * images/misc.xbm: ditto
11356 * images/greek.xbm: ditto
11357 * images/dots.xbm: ditto
11358 * images/brel.xbm: ditto
11359 * images/bop.xbm: ditto
11361 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11363 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11364 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11365 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11367 (LYX_CXX_CHEADERS): added <clocale> to the test.
11369 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11371 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11373 * src/support/lyxstring.C (append): fixed something that must be a
11374 bug, rep->assign was used instead of rep->append.
11376 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11379 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11380 lyx insert double chars. Fix spotted by Kayvan.
11382 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11384 * Fixed the tth support. I messed up with the Emacs patch apply feature
11385 and omitted the changes in lyxrc.C.
11387 1999-10-22 Juergen Vigna <jug@sad.it>
11389 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11391 * src/lyx_cb.C (MenuInsertRef) +
11392 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11393 the form cannot be resized under it limits (fixes a segfault)
11395 * src/lyx.C (create_form_form_ref) +
11396 * forms/lyx.fd: Changed Gravity on name input field so that it is
11399 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11401 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11402 <ostream> and <istream>.
11404 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11405 whether <fstream> provides the latest standard features, or if we
11406 have an oldstyle library (like in egcs).
11407 (LYX_CXX_STL_STRING): fix the test.
11409 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11410 code on MODERN_STL_STREAM.
11412 * src/support/lyxstring.h: use L{I,O}stream.h.
11414 * src/support/L{I,O}stream.h: new files, designed to setup
11415 correctly streams for our use
11416 - includes the right header depending on STL capabilities
11417 - puts std::ostream and std::endl (for LOStream.h) or
11418 std::istream (LIStream.h) in toplevel namespace.
11420 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11422 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11423 was a bib file that had been changed we ensure that bibtex is run.
11424 (runBibTeX): enhanced to extract the names of the bib files and
11425 getting their absolute path and enter them into the dep file.
11426 (findtexfile): static func that is used to look for tex-files,
11427 checks for absolute patchs and tries also with kpsewhich.
11428 Alternative ways of finding the correct files are wanted. Will
11430 (do_popen): function that runs a command using popen and returns
11431 the whole output of that command in a string. Should be moved to
11434 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11435 file with extension ext has changed.
11437 * src/insets/figinset.C: added ifdef guards around the fl_free
11438 code that jug commented out. Now it is commented out when
11439 compiling with XForms == 0.89.
11441 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11442 to lyxstring.C, and only keep a forward declaration in
11443 lyxstring.h. Simplifies the header file a bit and should help a
11444 bit on compile time too. Also changes to Srep will not mandate a
11445 recompile of code just using string.
11446 (~lyxstring): definition moved here since it uses srep.
11447 (size): definition moved here since it uses srep.
11449 * src/support/lyxstring.h: removed a couple of "inline" that should
11452 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11454 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11457 1999-10-21 Juergen Vigna <jug@sad.it>
11459 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11460 set to left if I just remove the width entry (or it is empty).
11462 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11463 paragraph when having dummy paragraphs.
11465 1999-10-20 Juergen Vigna <jug@sad.it>
11467 * src/insets/figinset.C: just commented some fl_free_form calls
11468 and added warnings so that this calls should be activated later
11469 again. This avoids for now a segfault, but we have a memory leak!
11471 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11472 'const char * argument' to 'string argument', this should
11473 fix some Asserts() in lyxstring.C.
11475 * src/lyxfunc.h: Removed the function argAsString(const char *)
11476 as it is not used anymore.
11478 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11480 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11483 * src/Literate.h: some funcs moved from public to private to make
11484 interface clearer. Unneeded args removed.
11486 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11488 (scanBuildLogFile): ditto
11490 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11491 normal TeX Error. Still room for improvement.
11493 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11495 * src/buffer.C (insertErrors): changes to make the error
11496 desctription show properly.
11498 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11501 * src/support/lyxstring.C (helper): changed to use
11502 sizeof(object->rep->ref).
11503 (operator>>): changed to use a pointer instead.
11505 * src/support/lyxstring.h: changed const reference & to value_type
11506 const & lets see if that helps.
11508 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11510 * Makefile.am (rpmdist): fixed to have non static package and
11513 * src/support/lyxstring.C: removed the compilation guards
11515 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11518 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11519 conditional compile of lyxstring.Ch
11521 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11522 stupid check, but it is a lot better than the bastring hack.
11523 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11525 * several files: changed string::erase into string::clear. Not
11528 * src/chset.C (encodeString): use a char temporary instead
11530 * src/table.C (TexEndOfCell): added tostr around
11531 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11532 (TexEndOfCell): ditto
11533 (TexEndOfCell): ditto
11534 (TexEndOfCell): ditto
11535 (DocBookEndOfCell): ditto
11536 (DocBookEndOfCell): ditto
11537 (DocBookEndOfCell): ditto
11538 (DocBookEndOfCell): ditto
11540 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11542 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11544 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11545 (MenuBuildProg): added tostr around ret
11546 (MenuRunChktex): added tostr around ret
11547 (DocumentApplyCB): added tostr around ret
11549 * src/chset.C (encodeString): added tostr around t->ic
11551 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11552 (makeLaTeXFile): added tostr around tocdepth
11553 (makeLaTeXFile): added tostr around ftcound - 1
11555 * src/insets/insetbib.C (setCounter): added tostr around counter.
11557 * src/support/lyxstring.h: added an operator+=(int) to catch more
11560 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11561 (lyxstring): We DON'T allow NULL pointers.
11563 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11565 * src/mathed/math_macro.C (MathMacroArgument::Write,
11566 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11567 when writing them out.
11569 * src/LString.C: remove, since it is not used anymore.
11571 * src/support/lyxstring.C: condition the content to
11572 USE_INCLUDED_STRING macro.
11574 * src/mathed/math_symbols.C, src/support/lstrings.C,
11575 src/support/lyxstring.C: add `using' directive to specify what
11576 we need in <algorithm>. I do not think that we need to
11577 conditionalize this, but any thought is appreciated.
11579 * many files: change all callback functions to "C" linkage
11580 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11581 strict_ansi. Those who were static are now global.
11582 The case of callbacks which are static class members is
11583 trickier, since we have to make C wrappers around them (see
11584 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11585 did not finish this yet, since it defeats the purpose of
11586 encapsulation, and I am not sure what the best route is.
11588 1999-10-19 Juergen Vigna <jug@sad.it>
11590 * src/support/lyxstring.C (lyxstring): we permit to have a null
11591 pointer as assignment value and just don't assign it.
11593 * src/vspace.C (nextToken): corrected this function substituting
11594 find_first(_not)_of with find_last_of.
11596 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11597 (TableOptCloseCB) (TableSpeCloseCB):
11598 inserted fl_set_focus call for problem with fl_hide_form() in
11601 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11603 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11606 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11608 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11609 LyXLex::next() and not eatline() to get its argument.
11611 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11613 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11614 instead, use fstreams for io of the depfile, removed unneeded
11615 functions and variables.
11617 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11618 vector instead, removed all functions and variables that is not in
11621 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11623 * src/buffer.C (insertErrors): use new interface to TeXError
11625 * Makefile.am (rpmdist): added a rpmdist target
11627 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11628 per Kayvan's instructions.
11630 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11632 * src/Makefile.am: add a definition for localedir, so that locales
11633 are found after installation (Kayvan)
11635 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11637 * development/.cvsignore: new file.
11639 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11641 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11642 C++ compiler provides wrappers for C headers and use our alternate
11645 * configure.in: use LYX_CXX_CHEADERS.
11647 * src/cheader/: new directory, populated with cname headers from
11648 libstdc++-2.8.1. They are a bit old, but probably good enough for
11649 what we want (support compilers who lack them).
11651 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11652 from includes. It turns out is was stupid.
11654 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11656 * lib/Makefile.am (install-data-local): forgot a ';'
11657 (install-data-local): forgot a '\'
11658 (libinstalldirs): needed after all. reintroduced.
11660 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11662 * configure.in (AC_OUTPUT): added lyx.spec
11664 * development/lyx.spec: removed file
11666 * development/lyx.spec.in: new file
11668 * po/*.po: merged with lyx.pot becuase of make distcheck
11670 * lib/Makefile.am (dist-hook): added dist-hook so that
11671 documentation files will be included when doing a make
11672 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11673 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11675 more: tried to make install do the right thing, exclude CVS dirs
11678 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11679 Path would fit in more nicely.
11681 * all files that used to use pathstack: uses now Path instead.
11682 This change was a lot easier than expected.
11684 * src/support/path.h: new file
11686 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11688 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11690 * src/support/lyxstring.C (getline): Default arg was given for
11693 * Configure.cmd: removed file
11695 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11697 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11698 streams classes and types, add the proper 'using' statements when
11699 MODERN_STL is defined.
11701 * src/debug.h: move the << operator definition after the inclusion
11704 * src/support/filetools.C: include "LAssert.h", which is needed
11707 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11710 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11711 include "debug.h" to define a proper ostream.
11713 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11715 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11716 method to the SystemCall class which can kill a process, but it's
11717 not fully implemented yet.
11719 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11721 * src/support/FileInfo.h: Better documentation
11723 * src/lyxfunc.C: Added support for buffer-export html
11725 * src/menus.C: Added Export->As HTML...
11727 * lib/bind/*.bind: Added short-cut for buffer-export html
11729 * src/lyxrc.*: Added support for new \tth_command
11731 * lib/lyxrc.example: Added stuff for new \tth_command
11733 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11735 * lib/Makefile.am (IMAGES): removed images/README
11736 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11737 installes in correct place. Check permisions is installed
11740 * src/LaTeX.C: some no-op changes moved declaration of some
11743 * src/LaTeX.h (LATEX_H): changed include guard name
11745 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11747 * lib/reLyX/Makefile.am: install noweb2lyx.
11749 * lib/Makefile.am: install configure.
11751 * lib/reLyX/configure.in: declare a config aux dir; set package
11752 name to lyx (not sure what the best solution is); generate noweb2lyx.
11754 * lib/layouts/egs.layout: fix the bibliography layout.
11756 1999-10-08 Jürgen Vigna <jug@sad.it>
11758 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11759 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11760 it returned without continuing to search the path.
11762 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11764 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11765 also fixes a bug. It is not allowed to do tricks with std::strings
11766 like: string a("hei"); &a[e]; this will not give what you
11767 think... Any reason for the complexity in this func?
11769 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11771 * Updated README and INSTALL a bit, mostly to check that my
11772 CVS rights are correctly set up.
11774 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11776 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11777 does not allow '\0' chars but lyxstring and std::string does.
11779 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11781 * autogen.sh (AUTOCONF): let the autogen script create the
11782 POTFILES.in file too. POTFILES.in should perhaps now not be
11783 included in the cvs module.
11785 * some more files changed to use C++ includes instead of C ones.
11787 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11789 (Reread): added tostr to nlink. buggy output otherwise.
11790 (Reread): added a string() around szMode when assigning to Buffer,
11791 without this I got a log of garbled info strings.
11793 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11796 * I have added several ostream & operator<<(ostream &, some_type)
11797 functions. This has been done to avoid casting and warnings when
11798 outputting enums to lyxerr. This as thus eliminated a lot of
11799 explicit casts and has made the code clearer. Among the enums
11800 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11801 mathed enums, some font enum the Debug::type enum.
11803 * src/support/lyxstring.h (clear): missing method. equivalent of
11806 * all files that contained "stderr": rewrote constructs that used
11807 stderr to use lyxerr instead. (except bmtable)
11809 * src/support/DebugStream.h (level): and the passed t with
11810 Debug::ANY to avoid spurious bits set.
11812 * src/debug.h (Debug::type value): made it accept strings of the
11813 type INFO,INIT,KEY.
11815 * configure.in (Check for programs): Added a check for kpsewhich,
11816 the latex generation will use this later to better the dicovery of
11819 * src/BufferView.C (create_view): we don't need to cast this to
11820 (void*) that is done automatically.
11821 (WorkAreaButtonPress): removed some dead code.
11823 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11825 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11826 is not overwritten when translated (David Sua'rez de Lis).
11828 * lib/CREDITS: Added David Sua'rez de Lis
11830 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11832 * src/bufferparams.C (BufferParams): default input encoding is now
11835 * acinclude.m4 (cross_compiling): comment out macro
11836 LYX_GXX_STRENGTH_REDUCE.
11838 * acconfig.h: make sure that const is not defined (to empty) when
11839 we are compiling C++. Remove commented out code using SIZEOF_xx
11842 * configure.in : move the test for const and inline as late as
11843 possible so that these C tests do not interefere with C++ ones.
11844 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11845 has not been proven.
11847 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11849 * src/table.C (getDocBookAlign): remove bad default value for
11850 isColumn parameter.
11852 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11854 (ShowFileMenu2): ditto.
11856 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11857 of files to ignore.
11859 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11861 * Most files: finished the change from the old error code to use
11862 DebugStream for all lyxerr debugging. Only minor changes remain
11863 (e.g. the setting of debug levels using strings instead of number)
11865 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11867 * src/layout.C (Add): Changed to use compare_no_case instead of
11870 * src/FontInfo.C: changed loop variable type too string::size_type.
11872 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11874 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11875 set ETAGS_ARGS to --c++
11877 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11879 * src/table.C (DocBookEndOfCell): commented out two unused variables
11881 * src/paragraph.C: commented out four unused variables.
11883 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11884 insed a if clause with type string::size_type.
11886 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11889 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11891 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11892 variable, also changed loop to go from 0 to lenght + 1, instead of
11893 -1 to length. This should be correct.
11895 * src/LaTeX.C (scanError): use string::size_type as loop variable
11898 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11899 (l.896) since y_tmp and row was not used anyway.
11901 * src/insets/insetref.C (escape): use string::size_type as loop
11904 * src/insets/insetquotes.C (Width): use string::size_type as loop
11906 (Draw): use string::size_type as loop variable type.
11908 * src/insets/insetlatexaccent.C (checkContents): use
11909 string::size_type as loop variable type.
11911 * src/insets/insetlabel.C (escape): use string::size_type as loop
11914 * src/insets/insetinfo.C: added an extern for current_view.
11916 * src/insets/insetcommand.C (scanCommand): use string::size_type
11917 as loop variable type.
11919 * most files: removed the RCS tags. With them we had to recompile
11920 a lot of files after a simple cvs commit. Also we have never used
11921 them for anything meaningful.
11923 * most files: tags-query-replace NULL 0. As adviced several plases
11924 we now use "0" instead of "NULL" in our code.
11926 * src/support/filetools.C (SpaceLess): use string::size_type as
11927 loop variable type.
11929 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11931 * src/paragraph.C: fixed up some more string stuff.
11933 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11935 * src/support/filetools.h: make modestr a std::string.
11937 * src/filetools.C (GetEnv): made ch really const.
11939 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11940 made code that used these use max/min from <algorithm> instead.
11942 * changed several c library include files to their equivalent c++
11943 library include files. All is not changed yet.
11945 * created a support subdir in src, put lyxstring and lstrings
11946 there + the extra files atexit, fileblock, strerror. Created
11947 Makefile.am. edited configure.in and src/Makefile.am to use this
11948 new subdir. More files moved to support.
11950 * imported som of the functions from repository lyx, filetools
11952 * ran tags-query-replace on LString -> string, corrected the bogus
11953 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11954 is still some errors in there. This is errors where too much or
11955 too litle get deleted from strings (string::erase, string::substr,
11956 string::replace), there can also be some off by one errors, or
11957 just plain wrong use of functions from lstrings. Viewing of quotes
11960 * LyX is now running fairly well with string, but there are
11961 certainly some bugs yet (see above) also string is quite different
11962 from LString among others in that it does not allow null pointers
11963 passed in and will abort if it gets any.
11965 * Added the revtex4 files I forgot when setting up the repository.
11967 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11969 * All over: Tried to clean everything up so that only the files
11970 that we really need are included in the cvs repository.
11971 * Switched to use automake.
11972 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11973 * Install has not been checked.
11975 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11977 * po/pt.po: Three errors:
11978 l.533 and l.538 format specification error
11979 l. 402 duplicate entry, I just deleted it.