1 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/version.h: try the pre2 again
5 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
7 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
9 * src/frontends/kde/FormParagraph.C: added using directive.
11 * src/frontends/kde/paradlg.C: added config.h and using directive.
13 * src/frontends/kde/paradlg.h: added std::qualifier.
15 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
17 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
19 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
21 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
23 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
25 * src/version.h: set back to 1.1.6cvs
27 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
29 * src/version.h: set to 1.1.6pre2
31 2000-11-20 Marko Vendelin <markov@ioc.ee>
33 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
35 * src/frontends/gnome/Makefile.am: updated list of XForms object files
37 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
39 * src/LColor.C (init):
40 * src/lyxrc.C (getDescription): changed some comments as suggested by
43 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
44 disconnect the redrawGUI signal in best-practice fashion.
46 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
47 long_opts_tab to reflect the change in name of this tabfolder, as
48 suggested by Rob Lahaye.
49 (connect, disconnect): new methods. Don't do much at present other than
50 ensuring that we can't resize the dialog. This just makes xforms go
52 (lots of methods in Colors): made void rather than bool. The idea is
53 to have an isOk() function that keeps track of whether any input is
54 genuinely invalid and should therefore block Save, Apply.
55 Easier to manipulate the counters rapidly.
56 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
57 compiler will like this code. Much cleaner way of doing things.
59 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
61 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
62 rather than simple counters, following suggestion by Rob Lahaye.
64 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
65 than engraved frame + text.
67 * src/frontends/xforms/forms/makefile: removed spurious command.
69 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
71 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
73 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
76 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
78 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
79 see what Lars has changed and what is just white space!
80 Now used X directly to ascertain the RGB color associated with the
82 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
84 Added some sort capability.
85 The X11 color name database input is only displayed if the database
86 isn't found in the standard place.
87 Got rid of struct compare_converter; it wasn't used.
88 Probably some other stuff that I've forgotten.
90 * src/frontends/xforms/FormPreferences.h: changed the names of some
91 methods in the Colors struct. Added a couple of structs to help sort
92 colors by name and by RGBColor.
94 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
95 functions into a new class RWInfo.
97 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
98 The dialog is now almost navigable using the keyboard. Unfortunately,
99 the cursor has to be inside a browser for it to be activated. There is
100 no visual feedback for the key shortcuts to the arrow keys (use
101 Alt-appropriate arrow key, Alt-x).
103 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
106 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
107 xform_helpers.[Ch]. See above.
109 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
111 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
113 * src/screen.C (setCursorColor): new method. Sets the color of the
115 (ShowManualCursor): call it.
116 Constify some local variables.
118 * src/LColor.[Ch] (LColor): add entry for cursor
119 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
122 2000-11-19 Juergen Vigna <jug@sad.it>
124 * src/insets/insettabular.C (draw): fixed text border redraw problem.
125 (calculate_dimensions_of_cells): try to boost up when inserting chars.
127 2000-11-15 Rob Lahaye <lahaye@postech.edu>
129 * lib/ui/default.ui: OptItem used for Fax entry
131 2000-11-17 Matej Cepl <cepl@bigfoot.com>
133 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
135 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
137 * src/vspace.C (nextToken): fix so it can handle length phrases like
138 "10mm+-20mm", "40inplus16mmminus10cm" etc.
140 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
142 * src/frontends/xforms/FormPreferences.C: constify several variables
143 (BrowserLyX): rewrite to not need the choice variable
144 (Modify): rewrite to not need the choide variable
145 (compare_converter): make operator const
147 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
148 correct the writing of \set_color
149 (getDescription): return a const string
151 * src/kbsequence.[Ch] (addkey): remove dead code
153 * src/Painter.C (text): remove some commented code
155 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
157 * src/ColorHandler.[Ch]: removed some header files from .h file.
158 Included LColor.h in .C file.
160 * src/LColor.[Ch]: made class copyable so that I could create a
161 system_lcolor instance.
163 * src/Painter.h: removed LColor.h.
165 * src/lyx_gui.C (create_forms): used AddName.
167 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
168 of user preferences/lyxrc file.
170 * src/lyxrc.C (output): output changes to lcolor.
172 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
174 Moved class xformColor to files xform_helpers.[Ch]. These files,
175 Color.[Ch], could now be moved into src if they would be useful to
178 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
179 Also moved FormPreferences::browseFile here as it can be used by any
180 xform dialog with a "Browse" button. FormGraphics is a perfect example.
182 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
183 ReadableFile): changed the FormPreferences methods a little and moved
184 them here as they'll be useful elsewhere also.
186 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
187 Removed some header files and used forward declarations instead.
189 Removed some methods as they'll be useful elsewhere (see above).
191 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
192 Can also now modify the LyX LColors. However, for reasons that I don't
193 yet understand, it appears that we can use
194 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
195 present. The problem appears to lie in ColorHandler, because I can
196 change the color using LColor.SetColor(). Similarly, when reading in a
197 preferences file with some set_color instances, I'll get a warning
198 like: Color sea green is undefined or may not be redefined
199 Bad lyxrc set_color for sea green
201 Once the buffer is loaded, however, I can happily change to this color.
203 Finally, it appears that I have to set the color of "inset frame"
204 explicitly, or it oscillates from "black" to "indian red" with each
207 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
209 * ANNOUNCE: corrected a spelling mistake.
211 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
214 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
216 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
218 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
221 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
222 match the requirements from the standard better. This is required
223 to work with gnu libstdc++-v3
225 * src/frontends/xforms/FormPreferences.C: add explict pair
226 arguments to browse calls. include support/lyxmanip.h remvoe
227 extern fmt. whitespace changes. reorder variables in
228 FormPreferences.h, to match initalizaton order.
230 * several files: constify more local variables.
232 * src/buffer.C: remove some commented functions.
234 * src/DepTable.C (remove_files_with_extension): temporary
235 work around for gcc 2.97
236 * src/filedlg.C (find): ditto
237 * src/Variables.C (set): ditto
238 * src/LyXAction.C (searchActionArg): ditto
239 (retrieveActionArg): ditto
241 * configure.in: check for mktemp too
243 * UPGRADING: prepare for 1.1.6
245 * Makefile.am (lgbtags): add backup tags for when etags are
246 different than usual.
248 * ANNOUNCE: prepare for 1.1.6
250 * src/support/tempname.C (make_tempfile): new function, wrapper
251 around mkstemp and mktemp. Only mkstemp has been tested.
254 2000-11-14 Rob Lahaye <lahaye@postech.edu>
256 * default.ui: capitalized some menu items to improve shortcuts.
258 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
260 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
262 * src/frontends/xforms/Dialogs.C: add "using" directive.
264 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
266 * src/filedlg.C (Select): highlight suggested file in browser, if
269 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
270 each tab folder is encapsulated in its own class.
271 The Language keymaps are now chosen using a text input and a
272 browser button, rather than a Combox.
273 All the browser buttons are now functional, although LyXFileDlg
274 still needs to be modified to make it straighhtforward to return a
275 directory if that is what is desired.
277 * src/frontends/xforms/forms/form_preferences.fd: use text input
278 and browse button to input the Language keymaps. Add a few
279 callbacks for the browse buttons.
281 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
283 * src/support/tempname.C (tempName): small changes to make it
284 safer. remove the '.' before XXXXXX
286 * src/support/filetools.C (TmpFileName): remove func
289 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
290 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
291 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
292 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
294 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
297 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
300 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
301 for bp (this fixes a reproducible hard crash)
303 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
306 * src/frontends/xforms/FormBase.h: make bp_ private
307 (FormBaseBI): remove default for bp
310 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
313 * src/frontends/xforms/Color.C (RGBColor): made several vars
314 const, changed initialization of j to allow it to be const
317 * several files: added const to local variables.
319 * src/lyx_cb.C: removed several function prototypes and moved them
323 (UpdateLayoutPreamble):
325 (MenuInsertLabel): add BufferView as arguemnt
326 (LayoutsCB): make tmp const
328 * src/layout_forms.h: regenerated
330 * src/debug.C: add Debug::FILES
331 (showLevel) (showTags): translate the desc
333 * src/debug.h: add FILES as debug target
335 * src/bufferlist.C: use current_view as an interim measure becuase
336 of added arguments to MenuWrite and MenuWriteAs
338 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
340 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
342 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
343 libstdc++ is compiled with.
345 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
347 * lib/layouts/docbook-book.layout
348 * lib/layouts/docbook.layout
349 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
350 those paragraphs are expresse as SGML comments <!-- -->.
352 * src/LaTeXFeatures.h
353 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
354 parameter, this allows to express all the include files as relative
355 paths to the master buffer. The verbatim insert works as the other
358 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
360 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
362 (MakeDocBookFile): top_element is always written. Some clean up, as
363 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
365 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
366 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
367 a reference is written instead of the name.
368 (Validate): use the relative path for the filename.
370 * src/insets/insetlabel.C (DocBook): write end tag, for XML
373 * src/support/filetools.h
374 * src/support/filetools.C (IsSGMLFilename): added.
377 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
379 * development/OS2/quick_fix.patch:
381 * README.OS2: quick update to the OS/2 port.
383 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
385 * src/converter.C: add "using" directive.
387 * src/frontends/xforms/FormPreferences.C: add "using" directive.
388 (compare_converter): add "int" as return type.
390 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
393 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
395 * src/lyx_gui.C (create_forms): map the xform colours, should a
396 mapping exist. Ie, call XformColor::read().
398 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
399 and struct HSV as HSVColor.
400 (XformColor::read, XformColor::write) : new methods that
401 input/output any changes to the cform GUI colors.
403 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
406 * src/frontends/xforms/FormPreferences.C Lots of little changes
407 associated with the changed name of the RGB and HSV structs. Can
408 now save changes to xforms GUI to file. Commented out
409 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
410 used currently anyway.
412 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
414 * src/converter.C: A lot of changes:
415 - It is no longer possible to choose between two or more ways to
416 export to some format (the new code uses only the shortest path).
417 However, it is still possible to choose between pdflatex/ps2pdf
418 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
419 - Added several methods that makes the FormPreferences code simpler.
420 - Changed the tokens $$FName and $$OutName to $$i and $$o.
422 * src/exporter.C (Export): lyxrc.use_pdf is set before
423 makeLaTeXFile is called. This works but not very nice.
425 * src/frontends/xforms/FormPreferences.C: The formats/converters
426 tabs are now fully functional.
428 * src/buffer.C (getTocList): Add numbers to the captions.
430 * lib/lyxrc.example: Removed fax section
432 * src/support/rename.C (rename): Delete the old file if lyx::copy
435 2000-11-13 Rob Lahaye <lahaye@postech.edu>
437 * lib/ui/default.ui: minor polishing.
439 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
441 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
444 * lib/Makefile.am (DOCINST): do not install everything in the
445 documentation directory.
447 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
449 * src/bufferlist.C (newFile): set the filename to the constructed
452 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
453 constructed "newfileXX.lyx" name to the dialog
455 * src/frontends/DialogBase.h: make update() non-abstract so
456 KDE doesn't need to implement two update methods for every form
458 * src/frontends/kde/Makefile.am: add missing xforms objects
461 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
463 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
465 * src/frontends/xforms/Color.[Ch]: new files, defining the color
466 structs RGB and HSV. May not be the best place for these files.
467 Perhaps move them into src ?
469 * src/frontends/xforms/Makefile.am: added new files.
471 * src/frontends/xforms/forms/form_preferences.fd:
472 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
473 replaced all instances of "colour" with "color"!
475 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
478 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
479 tab. Can now alter the colors of the xform's GUI on the fly. With
480 the aid of a single static Signal (see below), can "Apply" these
481 changes to all currently open dialogs. (Well, to all of the NEW
482 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
483 subsequently opened dialogs will, of course, also have the new
484 color scheme. Cannot yet save (or load) the choices to file, so
485 they are lost when exiting LyX.
487 * src/frontends/Dialogs.h:
488 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
489 Used to trigger a redraw of any dialogs connected to it because,
490 for example, the GUI colours have been re-mapped.
492 * src/frontends/xforms/FormBase.[Ch]:
493 * src/frontends/xforms/FormDocument.[Ch]:
494 * src/frontends/xforms/FormParagraph.[Ch]:
495 * src/frontends/xforms/FormPreferences.[Ch]:
496 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
497 method, to be connected to Dialogs::redrawGUI. Method must be
498 virtual, because dialogs with tabbed folders need to redraw the
499 forms of each tab folder.
501 * src/LyXView.C (d-tor):
502 * src/frontends/xforms/FormBase.C (d-tor): connected
503 Dialogs::redrawGUI signal to redraw().
505 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
506 removed Assert, because it is identical to that in FormBase.
508 2000-11-10 Rob Lahaye <lahaye@postech.edu>
510 * lib/ui/default.ui: minor polishing.
512 2000-11-10 Juergen Vigna <jug@sad.it>
514 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
515 (deleteLyXText): ditto
517 * src/insets/insettabular.C (InsetButtonPress): don't clear the
518 selection on mouse-button-3.
520 * src/insets/insettabular.h: new function clearSelection(), use this
521 functions inside insettabular.C.
523 * src/insets/insettabular.C (TabularFeatures): clear the selection
524 on remove_row/column.
526 * src/insets/inset.C (scroll): fixed some scroll stuff.
528 * src/insets/insettabular.C (draw): fixed another minor draw problem.
530 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
532 * lib/CREDITS: add Yves Bastide
534 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
536 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
537 check whether C library functions are in the global namespace.
539 * configure.in: calls it.
541 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
544 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
546 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
547 iterators to prevent crash.
549 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
551 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
553 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
554 shortcut for xforms CB to the preemptive or post-handler function.
556 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
557 removed the HIDDEN_TIMER as it's no longer used.
558 Various other small changes.
560 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
561 preemptive handler to obtain feedback, rather than the post-handler.
562 (ColoursLoadBrowser): find "black" and "white" based on RGB values
564 Formats tab is now complete. Converters tab is nearly so.
566 2000-11-09 Juergen Vigna <jug@sad.it>
568 * src/insets/insettext.C (~InsetText):
571 (SetParagraphData): set cache.second to 0 after deleting it!
572 (getLyXText): check if cache.second is not 0 if finding it.
574 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
576 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
577 lyxlex to parse the rgb.txt file.
580 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
581 replace the default '#' comment character.
583 * src/support/tempname.C: add "using" directive
584 * src/frontends/ButtonPolicies.C: ditto.
586 * src/support/filetools.C (DirList): add an explicit cast to avoid
587 a compile error (probably not the right fix)
589 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
591 * src/support/filetools.C (DirList): implement using system functions
593 * src/support/tempname.C: new file
595 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
597 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
599 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
602 * src/frontends/xforms/ButtonController.C: new file
604 * src/os2_defines.h: remove getcwd define
606 * src/lyxvc.C: include support/lyxlib.h
607 (showLog): use lyx::tempName
609 * src/lyx_cb.C: comment out includes that we don't need
610 (AutoSave): use lyx::tempName
612 * src/filedlg.C: include support/lyxlib.h
613 (Reread): use lyx::getcwd
615 * src/converter.C: include support/filetools.h
616 (add_options): change to static inline, make tail const
617 (Add): make old_viewer const
618 (GetAllFormats): make it a const method, use const_iterator
619 (enable): make static inline
620 (SplitFormat): make using_format const
622 * src/LaTeX.C (run): use lyx::getcwd
624 * configure.in: check for mkstemp as well
626 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
628 * src/converter.[Ch] (GetAllCommands): new method.
630 * src/support/filetools.[Ch] (DirList): new method.
632 * src/frontends/xforms/FormPreferences.C: started (just!) adding
633 functionality to the converters tab.
634 The formats tab is now nearly complete.
635 The kbmap choices in Languages tab now display the contents of
636 system_lyxdir/kbd/*.kmap in readable form.
638 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
639 Moved some variables into the class.
641 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
642 inactive tab folder to FL_COL1. Haven't yet worked out how to change
643 colour of active folder to lighter grey instead. Any takers?
644 (form_colours): added an "Apply" button.
645 (form_converters): added a "Flags" input field.
646 (form_formats): added a "Shortcut" input field. Note that we can't use
647 names such as "input_shortcut" as this buggers up the sed script stuff.
649 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
657 * src/lyx_sendfax_main.C:
660 * src/spellchecker.C:
661 * src/insets/figinset.C:
662 * src/insets/insetbib.C:
663 * src/insets/insetexternal.C:
664 * src/insets/insetinclude.C:
665 * src/insets/insetinfo.C:
666 * src/mathed/math_panel.C:
667 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
668 all "daughter" dialogs now have identical "feel".
670 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
672 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
673 used (and was only used in one place prior to this patch. Incorrectly!)
675 * src/frontends/xforms/FormDocument.C: changed some instances of
676 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
677 sense. Also added fl_set_input_return() for class_->input_doc_extra and
678 for options_->input_float_placement. This fixes a bug reported by
681 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
682 functionality into d-tor.
684 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
685 input of numerals also.
687 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
688 fl_set_form_atclose(). Can now close dialog from window manager,
689 fixing a bug reported by Rob Lahaye.
691 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
693 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
694 are no longer dark. Haven't yet worked out how to lighten the colour of
695 the active tabfolder. Any ideas anybody?
696 Adjusted Colours tab a little.
697 Added Shortcut field to converters tab. Note that we can't create an
698 fdesign label like "input_shortcut" as this buggers up the sed-script
701 * src/frontends/xforms/FormPreferences.[Ch]:
702 (feedback): fixed crash due to to ob=0.
703 (LanguagesXXX): the kbmap choices now contain the files
704 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
705 be replaced by an input with a file browse button, but since the browse
706 buttons don'y yet work, this'll do for the moment.
707 (FormatsXXX): think that this is now nearly fully functional.
708 Some points/questions though:
709 1. Does "Apply" remove formats if no longer present?
710 2. I think that the browser should list the GUI names rather than the
712 3. Must ensure that we can't delete Formats used by an existing
715 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
716 if this is the best way to do this.
718 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
720 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
722 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
723 for variable assignment.
725 2000-11-07 Rob Lahaye <lahaye@postech.edu>
727 * src/lib/ui/default.ui: added sub/superscripts to menu as
728 Insert->Special characters and cleaned-up the file a bit
730 2000-11-07 Allan Rae <rae@lyx.org>
732 * src/frontends/xforms/FormPreferences.C (feedback): make sure
733 ob isn't 0 before using it. See comments in function.
735 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
737 * src/frontends/xforms/form_*.C: regenerated
739 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
741 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
743 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
744 compiling with gcc-2.96
746 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
748 * src/support/lyxstring.C: add a couple "using" directives.
750 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
751 a .c_str() here too for good measure.
752 * src/Spacing.C (set): ditto.
753 * src/lyxfunc.C (Dispatch): ditto.
755 * src/insets/insettabular.C (copySelection): change .str() to
756 .str().c_str() to fix problems with lyxstring.
757 * src/support/filetools.C (GetFileContents): ditto.
758 * src/buffer.C (asciiParagraph): ditto.
759 * src/paragraph.C (String): ditto.
761 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
762 * lib/bind/sciword.bind: ditto.
764 * src/LyXAction.C (init): remove "symbol-insert" function, which
765 shared LFUN_INSERT_MATH with "math-insert".
767 * lib/configure.m4: == is not a valid operator for command test.
769 * src/lyxrc.C: add using directive.
771 * src/converter.h: add std:: qualifier.
773 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
775 * src/converter.[Ch] and other files: Change the Format class to a
776 real class, and create two instances: formats and system_format.
778 * src/lyxrc.C (output): Output the difference between formats and
781 * src/frontends/xforms/FormPreferences.C (input): Simplify.
782 (buildFormats): Insert formats into browser.
783 (inputFormats): Made the browser and add button functional.
784 (applyFormats): Update formats from format_vec.
786 * src/converter.C: Changed all (*it). to it->
787 (Format::dummy): New method.
788 (Format::importer): New format flag.
789 (Formats::GetAllFormats): New method.
790 (Formats::Add): Delete format from the map if prettyname is empty.
791 (Converter::Convert): Print an error message if moving the file fails.
792 (Converter::GetReachableTo): New method
794 * src/MenuBackend.[Ch]: Add support for importformats tag.
796 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
798 * lib/configure.m4: Add word->tex and ps->fax converters.
800 * lib/ui/default.ui: Use ImportFormats on file->import menu.
801 Return fax to file menu.
805 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
807 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
810 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
813 * src/lyxfunc.C (processKeyEvent): removed
815 * src/bufferlist.C (emergencyWrite): removed the out commented
816 emergency write code.
818 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
820 * src/LyXView.[Ch]: remove the outcommented raw_callback code
822 * many files: change formatting to be a bit more uniform for
823 if,while,for,switch statements, remove some parantesis not needed.
826 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
828 * config/kde.m4: make config more robust when KDEDIR is set
830 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
832 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
833 not returned a pixmap for "math-insert".
835 * src/LyXAction.C (init): sort the entries a bit.
837 2000-11-03 Juergen Vigna <jug@sad.it>
839 * src/insets/insettabular.h: added fixed number to update codes so
840 that update is only in one direction.
842 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
845 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
846 before call to edit because of redraw.
848 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
850 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
852 * lib/ui/default.ui: Populate "edit_float" menu
854 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
856 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
857 "floats-operate". The name is ugly (and the func also), but this
858 is just a band-aid until we switch to new insets.
860 2000-11-03 Rob Lahaye <lahaye@postech.edu>
862 * lib/ui/default.ui: update again the menu layout (fix some
865 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
867 * src/MenuBackend.h (fulllabel): new method.
869 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
870 the menu shortcuts of a menu are unique and whether they
871 correspond to a letter of the label.
872 (expand): call checkShortcuts when debugging.
874 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
876 * src/insets/insettext.C (InsetButtonPress): shut off warning.
878 2000-11-02 Lior Silberman <lior@Princeton.EDU>
880 * lib/examples/*.lyx : '\language default' => '\language english'
882 * lib/examples/it_splash.lyx : except where it should be italian
884 * lib/templates/*.lyx : the same
886 * doc/*.lyx* : the same
888 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
890 * lib/bind/menus.bind: remove the Layout menu entries, which I
891 somehow forgot earlier.
893 2000-11-03 Rob Lahaye <lahaye@postech.edu>
895 * lib/ui/old-default.ui: keep the old one here for reference (to
898 * lib/ui/default.ui: update the menu layout
900 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
902 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
903 Can now Apply to different insets without closing the dialog.
905 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
906 Can't actually DO anything with them yet, but I'd like a little
909 * src/frontends/xforms/input_validators.[ch]
910 (fl_lowercase_filter): new.
912 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
914 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
915 of MATH_CODE. This fixes a bug with math-macros in RTL text.
917 * src/text.C (PrepareToPrint): Show math-macros block aligned.
919 2000-11-02 Juergen Vigna <jug@sad.it>
921 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
922 on char insertion as it has already be updated by bv->updateInset().
924 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
925 if an inset inside was updated.
927 * lib/configure.cmd: commented out fax-search code
929 2000-11-01 Yves Bastide <stid@acm.org>
931 * src/tabular.C (OldFormatRead): set tabular language to the
934 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
936 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
937 class names with non-letter characters (from Yves Bastide).
939 * lib/ui/default.ui: change Item to OptItem in import menu.
940 Comment out fax stuff.
942 * lib/configure.m4: comment out fax-related stuff.
944 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
946 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
947 useful xforms helper functions. At present contains only formatted().
948 Input a string and it returns it with line breaks so that in fits
951 * src/frontends/xforms/Makefile.am: add new files.
953 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
954 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
957 * src/frontends/xforms/FormPreferences.[Ch]:
958 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
959 but lots of little clean ups. Removed enum State. Make use of
960 formatted(). Constify lots of methods. Perhaps best of all: removed
961 requirement for that horrible reinterpret_cast from pointer to long in
964 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
966 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
967 conditionalize build on xforms < 0.89
969 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
971 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
973 * src/LyXAction.C (init): comment out fax
975 * src/lyxrc.h: comment out the fax enums
976 comment out the fax variables
978 * src/commandtags.h: comment out LFUN_FAX
980 * src/lyxrc.C: disable fax variables.
981 (read): disable parsing of fax variables
982 (output): disable writing of fax variables
983 (getFeedback): now description for fax variables
985 * src/lyxfunc.C: comment out MenuFax
986 (Dispatch): disable LFUN_FAX
988 * src/lyx_cb.C (MenuFax): comment out
990 * src/WorkArea.C: add <cctype>
991 (work_area_handler): better key handling, should be ok now.
992 for accented chars + etc
994 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
995 lyx_sendfax.h and lyx_sendfax_man.C
997 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
998 (show): don't call InitLyXLookup when using xforms 0.89
1000 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1002 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1004 * src/support/filetools.C (GetFileContents): close to dummy change
1006 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1008 * src/trans.C (AddDeadkey): workaround stupid compilers.
1010 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1012 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1013 of two-sided document.
1015 2000-10-31 Juergen Vigna <jug@sad.it>
1017 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1019 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1020 xposition to the Edit call.
1022 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1024 * src/trans.C (AddDeadkey): cast explicitly to char.
1026 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1028 * src/tabular.C (AsciiBottomHLine): simplify?
1029 (AsciiTopHLine): simplify?
1030 (print_n_chars): simplify
1031 (DocBook): remove most of the << endl; we should flush the stream
1032 as seldom as possible.
1034 (TeXBottomHLine): ditto
1035 (TeXTopHLine): ditto
1037 (write_attribute): try a templified version.
1038 (set_row_column_number_info): lesson scope of variables
1040 * src/support/lstrings.h (tostr): new specialization of tostr
1042 * src/trans.C (AddDeadkey): slightly cleaner fix.
1044 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1046 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1047 '%%' in Toc menu labels.
1050 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1051 font_norm is iso10646-1.
1053 * src/font.C (ascent): Fixed for 16bit fonts
1054 (descent,lbearing,rbearing): ditto
1056 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1058 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1059 (getFeedback): new static method.
1061 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1062 Now use combox rather than choice to display languages.
1063 Feedback is now output using a new timer callback mechanism, identical
1064 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1066 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1068 * src/minibuffer.C: fix for older compilers
1070 2000-10-30 Juergen Vigna <jug@sad.it>
1072 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1073 has to be Left of the inset otherwise LyXText won't find it!
1075 * src/BufferView2.C (open_new_inset): delete the inset if it can
1078 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1080 * lyx.man: fix typo.
1082 2000-10-29 Marko Vendelin <markov@ioc.ee>
1083 * src/frontends/gnome/FormCitation.C
1084 * src/frontends/gnome/FormCitation.h
1085 * src/frontends/gnome/FormCopyright.C
1086 * src/frontends/gnome/FormCopyright.h
1087 * src/frontends/gnome/FormError.C
1088 * src/frontends/gnome/FormError.h
1089 * src/frontends/gnome/FormIndex.C
1090 * src/frontends/gnome/FormIndex.h
1091 * src/frontends/gnome/FormPrint.C
1092 * src/frontends/gnome/FormPrint.h
1093 * src/frontends/gnome/FormRef.C
1094 * src/frontends/gnome/FormRef.h
1095 * src/frontends/gnome/FormToc.C
1096 * src/frontends/gnome/FormToc.h
1097 * src/frontends/gnome/FormUrl.C
1098 * src/frontends/gnome/FormUrl.h
1099 * src/frontends/gnome/Menubar_pimpl.C
1100 * src/frontends/gnome/mainapp.C
1101 * src/frontends/gnome/mainapp.h
1102 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1103 changing update() to updateSlot() where appropriate
1105 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1107 * src/frontends/xforms/FormPreferences.[Ch]:
1108 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1111 2000-10-28 Juergen Vigna <jug@sad.it>
1113 * src/insets/insettabular.C (draw): fixed drawing bug.
1115 * src/insets/insettext.C (clear):
1117 (SetParagraphData): clearing the TEXT buffers when deleting the
1118 paragraphs used by it.
1120 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1122 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1124 2000-10-27 Juergen Vigna <jug@sad.it>
1126 * src/tabular.C (~LyXTabular): removed not needed anymore.
1128 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1131 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1133 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1136 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1139 * src/frontends/xforms/FormPreferences.[Ch]:
1140 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1141 Reorganised as modules based on tabs. Much easier to follow the
1142 flow and to add new tabs. Added warning and feedback messages.
1145 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1147 * src/tabular.h (DocBook): add std:: qualifier.
1149 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1151 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1152 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1155 * insettabular.C (DocBook): uses the tabular methods to export
1158 * src/insets/insettext.h
1159 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1161 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1163 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1166 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1167 moved misplaced AllowInput two lines up.
1169 * src/buffer.C (readFile): compare float with float, not with int
1171 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1173 * src/minibuffer.C: add "using SigC::slot" statement.
1175 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1177 * src/frontends/xforms/forms/README: updated section about make.
1179 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1180 Tidied some forms up, made two of form_tabular's tabs more
1181 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1182 fixed translation problem with "Column".
1184 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1186 * src/minibuffer.h: use Timeout instead of the xforms timer
1188 (setTimer) rewrite for the Timeout, change to unsigned arg
1189 (set): change to unsigned timer arg
1192 * src/minibuffer.C (TimerCB): removed func
1193 (C_MiniBuffer_TimerCB): removed func
1194 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1195 (peek_event): use a switch statement
1196 (add): don't use fl_add_timer.
1197 (Set): rewrite to use the Timeout
1200 * src/Timeout.[Ch] (setType): return a Timeout &
1201 (setTimeout): ditto, change to unsigned arg for timeout
1203 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1205 * src/mathed/formula.C (mathed_string_width): Use string instead
1206 of a constant size char array.
1208 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1210 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1211 the two recently added operator<< for SMInput and State.
1213 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1215 (OkCancelPolicy): ditto
1216 (OkCancelReadOnlyPolicy): ditto
1217 (NoRepeatedApplyReadOnlyPolicy): ditto
1218 (OkApplyCancelReadOnlyPolicy): ditto
1219 (OkApplyCancelPolicy): ditto
1220 (NoRepeatedApplyPolicy): ditto
1222 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1224 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1225 add the usual std:: qualifiers.
1227 2000-10-25 Juergen Vigna <jug@sad.it>
1229 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1231 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1233 * src/support/filetools.C (MakeRelPath): change some types to
1236 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1237 ButtonPolicy::SMInput and ButtonPolicy::State.
1239 * src/FontLoader.C (reset): small cleanup
1240 (unload): small cleanup
1242 * src/FontInfo.C (getFontname): initialize error to 10000.0
1244 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1246 * src/frontends/xforms/FormPreferences.[Ch]:
1247 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1248 TeX encoding and default paper size sections.
1250 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1252 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1255 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1256 make the message_ empty.
1257 (FormError): don't initialize message_ in initializer list.
1259 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1261 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1263 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1265 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1267 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1269 * src/frontends/kde/*data.[Ch]: _("") is not
1272 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1274 * src/buffer.C: removed redundant using directive.
1276 * src/frontends/DialogBase.h: revert to original definition of
1279 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1280 stuff into two classes, one for each dialog, requires a new
1281 element in the dialogs vector, FormTabularCreate.
1283 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1286 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1287 method. Continues Allan's idea, but means that derived classes
1288 don't need to worry about "update or hide?".
1290 * src/frontends/xforms/FormError.C (showInset): add connection
1293 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1294 one for each dialog. FormTabular now contains main tabular dialog
1297 * src/frontends/xforms/FormTabularCreate.[Ch]:
1298 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1301 * src/frontends/xforms/FormGraphics.[Ch]:
1302 * src/frontends/xforms/forms/form_graphics.fd
1303 * src/frontends/xforms/FormTabular.[Ch]:
1304 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1305 classes of FormInset.
1307 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1308 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1310 * src/frontends/xforms/Makefile.am:
1311 * src/frontends/xforms/forms/makefile: added new files.
1313 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1314 variable. added Signal0 hide signal, in keeping with other GUI-I
1317 * src/support/lstrings.h: removed redundant std:: qualifier as
1318 it's already declared in Lsstream.h.
1320 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1322 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1326 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1328 * src/tabular.C (Ascii): minimize scope of cell.
1330 * src/BufferView2.C (nextWord): return string() instead of 0;
1332 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1334 * src/converter.h: add a std:: qualifier
1336 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1338 * src/importer.[Ch]: New files. Used for importing files into LyX.
1340 * src/lyxfunc.C (doImport): Use the new Importer class.
1342 * src/converter.h: Add shortcut member to the Format class.
1343 Used for holding the menu shortcut.
1345 * src/converter.C and other files: Made a distinction between
1346 format name and format extension. New formats can be defined using
1347 the \format lyxrc tag.
1348 Added two new converter flags: latex and disable.
1350 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1352 * src/support/lyxlib.h: unify namespace/struct implementation.
1353 Remove extra declarations.
1355 * src/support/chdir.C (chdir): remove version taking char const *
1357 * src/support/rename.C: ditto.
1358 * src/support/lyxsum.C: ditto.
1360 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1362 * src/frontends/xforms/FormBase.[Ch]:
1363 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1364 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1365 work only for the next call to fl_show_form(). The correct place to set
1366 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1367 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1368 from FormBase have the minimum size set; no more stupid crashes with
1371 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1373 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1375 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1377 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1379 * src/support/lyxlib.h: changed second argument of mkdir to
1380 unsigned long int (unsigned int would probably have been enough,
1381 but...). Removed <sys/types.h> header.
1382 * src/support/mkdir.C (mkdir): ditto.
1386 2000-10-19 Juergen Vigna <jug@sad.it>
1388 * src/lyxfunc.C (MenuNew): small fix (form John)
1390 * src/screen.C (Update): removed unneeded code.
1392 * src/tabular.C (Ascii): refixed int != uint bug!
1394 * src/support/lyxlib.h: added sys/types.h include for now permits
1395 compiling, but I don't like this!
1397 2000-10-18 Juergen Vigna <jug@sad.it>
1399 * src/text2.C (ClearSelection): if we clear the selection we need
1400 more refresh so set the status apropriately
1402 * src/insets/insettext.C (draw): hopefully finally fixed draw
1405 2000-10-12 Juergen Vigna <jug@sad.it>
1407 * src/insets/insettext.C (draw): another small fix and make a block
1408 so that variables are localized.
1410 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1412 * src/support/lstrings.C (lowercase, uppercase):
1413 use explicit casts to remove compiler warnings.
1415 * src/support/LRegex.C (Impl):
1416 * src/support/StrPool.C (add):
1417 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1418 (AddPath, MakeDisplayPath):
1419 * src/support/lstrings.C (prefixIs, subst):
1420 use correct type to remove compiler warnings.
1422 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1424 * src/support/lyxlib.h:
1425 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1426 portability and to remove compiler warning with DEC cxx.
1428 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1430 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1432 * src/minibuffer.C (peek_event): retun 1 when there has been a
1433 mouseclick in the minibuffer.
1437 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1439 * src/frontends/xforms/FormParagraph.C: more space above/below
1442 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1444 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1445 a char only if real_current_font was changed.
1447 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1449 * NEWS: update somewhat for 1.1.6
1451 * lib/ui/default.ui: clean up.
1453 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1455 * lib/CREDITS: clean up
1457 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1459 * src/combox.[Ch] (select): changed argument back to int
1460 * src/combox.C (peek_event): removed num_bytes as it is declared but
1463 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1464 modified calls to Combox::select() to remove warnings about type
1467 * src/insets/insetbutton.C (width): explicit cast to remove warning
1468 about type conversion.
1470 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1473 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1474 sel_pos_end, refering to cursor position are changed to
1475 LyXParagraph::size_type.
1477 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1478 consistent with LyXCursor::pos().
1479 (inset_pos): changed to LyXParagraph::size_type for same reason.
1481 * src/insets/insettext.C (resizeLyXText): changed some temporary
1482 variables refing to cursor position to LyXParagraph::size_type.
1484 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1486 * src/frontends/kde/<various>: The Great Renaming,
1489 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1491 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1493 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1495 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1496 0 when there are no arguments.
1498 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1500 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1501 to segfaults when pressing Ok in InsetBibtex dialog.
1503 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1505 * forms/layout_forms.fd:
1506 * src/layout_forms.C (create_form_form_character): small change to use
1507 labelframe rather than engraved frame + text
1509 * src/lyx_gui.C (create_forms): initialise choice_language with some
1510 arbitrary value to prevent segfault when dialog is shown.
1512 2000-10-16 Baruch Even <baruch.even@writeme.com>
1514 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1515 is no resulting file. This pertains only to LaTeX output.
1517 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1519 * src/text.C (Backspace): Make sure that the row of the cursor is
1522 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1525 * src/lyx_gui.C (init): Prevent a crash when only one font from
1526 menu/popup fonts is not found.
1528 * lib/lyxrc.example: Add an example for binding a key for language
1531 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1533 * src/converter.C (GetReachable): Changed the returned type to
1535 (IsReachable): New method
1537 * src/MenuBackend.C (expand): Handle formats that appear more
1540 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1542 * src/frontends/support/Makefile.am
1543 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1546 * lib/CREDITS: add Garst Reese.
1548 * src/support/snprintf.h: add extern "C" {} around the definitions.
1550 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1552 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1555 * src/frontends/xforms/FormDocument.C:
1556 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1557 compile without "conversion to integral type of smaller size"
1560 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1562 * src/text.C (GetColumnNearX): Fixed disabled code.
1564 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1566 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1569 * src/support/snprintf.[ch]: new files
1571 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1573 * src/frontends/kde/formprintdialog.C: add
1574 file browser for selecting postscript output
1576 * src/frontends/kde/formprintdialogdata.C:
1577 * src/frontends/kde/formprintdialogdata.h: re-generate
1580 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1582 * src/frontends/gnome/Makefile.am:
1583 * src/frontends/kde/Makefile.am: FormCommand.C
1584 disappeared from xforms
1586 * src/frontends/kde/FormCitation.C:
1587 * src/frontends/kde/FormIndex.C: read-only
1590 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1592 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1595 * src/bufferlist.C: add using directive.
1597 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1599 * src/support/lyxfunctional.h: version of class_fun for void
1600 returns added, const versions of back_inseter_fun and compare_fun
1603 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1605 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1607 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1609 * ChangeLog: cleanup.
1611 * lib/CREDITS: update to add all the contributors we've forgotten.
1612 I have obviously missed some, so tell me whether there were
1615 2000-10-13 Marko Vendelin <markov@ioc.ee>
1617 * src/frontends/gnome/FormCitation.C
1618 * src/frontends/gnome/FormCitation.h
1619 * src/frontends/gnome/FormError.C
1620 * src/frontends/gnome/FormIndex.C
1621 * src/frontends/gnome/FormRef.C
1622 * src/frontends/gnome/FormRef.h
1623 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1625 * src/frontends/gnome/FormCitation.C
1626 * src/frontends/gnome/FormCopyright.C
1627 * src/frontends/gnome/FormError.C
1628 * src/frontends/gnome/FormIndex.C
1629 * src/frontends/gnome/FormRef.C
1630 * src/frontends/gnome/FormToc.C
1631 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1634 * src/frontends/gnome/Menubar_pimpl.C
1635 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1638 2000-10-11 Baruch Even <baruch.even@writeme.com>
1641 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1642 to convey its real action.
1644 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1645 clear the minibuffer and prepare to enter a command.
1647 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1648 the rename from ExecCommand to PrepareForCommand.
1649 * src/lyxfunc.C (Dispatch): ditto.
1651 2000-10-11 Baruch Even <baruch.even@writeme.com>
1653 * src/buffer.C (writeFile): Added test for errors on writing, this
1654 catches all errors and not only file system full errors as intended.
1656 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1658 * src/lyx_gui.C (create_forms): better fix for crash with
1659 translated interface.
1661 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1663 * src/frontends/kde/Makefile.am:
1664 * src/frontends/kde/FormCopyright.C:
1665 * src/frontends/kde/formcopyrightdialog.C:
1666 * src/frontends/kde/formcopyrightdialog.h:
1667 * src/frontends/kde/formcopyrightdialogdata.C:
1668 * src/frontends/kde/formcopyrightdialogdata.h:
1669 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1670 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1671 copyright to use qtarch
1673 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1675 * src/encoding.C (read): Fixed bug that caused an error message at
1676 the end of the file.
1678 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1680 * lib/lyxrc.example: Fixed hebrew example.
1682 2000-10-13 Allan Rae <rae@lyx.org>
1684 * src/frontends/xforms/FormPreferences.C (input): reworking the
1686 (build, update, apply): New inputs in various tabfolders
1688 * src/frontends/xforms/FormToc.C: use new button policy.
1689 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1690 dialogs that either can't use any existing policy or where it just
1693 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1696 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1697 added a bool parameter which is ignored.
1699 * src/buffer.C (setReadonly):
1700 * src/BufferView_pimpl.C (buffer):
1701 * src/frontends/kde/FormCopyright.h (update):
1702 * src/frontends/kde/FormCitation.[Ch] (update):
1703 * src/frontends/kde/FormIndex.[Ch] (update):
1704 * src/frontends/kde/FormPrint.[Ch] (update):
1705 * src/frontends/kde/FormRef.[Ch] (update):
1706 * src/frontends/kde/FormToc.[Ch] (update):
1707 * src/frontends/kde/FormUrl.[Ch] (update):
1708 * src/frontends/gnome/FormCopyright.h (update):
1709 * src/frontends/gnome/FormCitation.[Ch] (update):
1710 * src/frontends/gnome/FormError.[Ch] (update):
1711 * src/frontends/gnome/FormIndex.[Ch] (update):
1712 * src/frontends/gnome/FormPrint.[Ch] (update):
1713 * src/frontends/gnome/FormRef.h (update):
1714 * src/frontends/gnome/FormToc.[Ch] (update):
1715 * src/frontends/gnome/FormUrl.[Ch] (update):
1716 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1717 to updateBufferDependent and DialogBase
1719 * src/frontends/xforms/FormCitation.[hC]:
1720 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1721 * src/frontends/xforms/FormError.[Ch]:
1722 * src/frontends/xforms/FormGraphics.[Ch]:
1723 * src/frontends/xforms/FormIndex.[Ch]:
1724 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1725 and fixed readOnly handling.
1726 * src/frontends/xforms/FormPrint.[Ch]:
1727 * src/frontends/xforms/FormRef.[Ch]:
1728 * src/frontends/xforms/FormTabular.[Ch]:
1729 * src/frontends/xforms/FormToc.[Ch]:
1730 * src/frontends/xforms/FormUrl.[Ch]:
1731 * src/frontends/xforms/FormInset.[Ch]:
1732 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1733 form of updateBufferDependent.
1735 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1736 if form()->visible just in case someone does stuff to the form in a
1739 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1740 the buttoncontroller for everything the enum used to be used for.
1741 (update) It would seem we need to force all dialogs to use a bool
1742 parameter or have two update functions. I chose to go with one.
1743 I did try removing update() from here and FormBase and defining the
1744 appropriate update signatures in FormBaseB[DI] but then ran into the
1745 problem of the update() call in FormBase::show(). Whatever I did
1746 to get around that would require another function and that just
1747 got more confusing. Hence the decision to make everyone have an
1748 update(bool). An alternative might have been to override show() in
1749 FormBaseB[DI] and that would allow the different and appropriate
1752 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1753 true == buffer change occurred. I decided against using a default
1754 template parameter since not all compilers support that at present.
1756 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1758 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1759 army knife" by removing functionality.
1760 (clearStore): removed. All such housekeeping on hide()ing the dialog
1761 is to be carried out by overloaded disconnect() methods.
1762 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1763 superceded by Baruch's neat test (FormGraphics) to update an existing
1764 dialog if a new signal is recieved rather than block all new signals
1766 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1767 only to Inset dialogs.
1768 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1769 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1771 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1773 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1774 as a base class to all inset dialogs. Used solely to connect/disconnect
1775 the Inset::hide signal and to define what action to take on receipt of
1776 a UpdateBufferDependent signal.
1777 (FormCommand): now derived from FormInset.
1779 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1782 * src/frontends/xforms/FormCopyright.[Ch]:
1783 * src/frontends/xforms/FormPreferences.[Ch]:
1784 now derived from FormBaseBI.
1786 * src/frontends/xforms/FormDocument.[Ch]:
1787 * src/frontends/xforms/FormParagraph.[Ch]:
1788 * src/frontends/xforms/FormPrint.[Ch]:
1789 now derived from FormBaseBD.
1791 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1793 * src/frontends/xforms/FormCitation.[Ch]:
1794 * src/frontends/xforms/FormError.[Ch]:
1795 * src/frontends/xforms/FormRef.[Ch]:
1796 * src/frontends/xforms/FormToc.[Ch]:
1797 (clearStore): reworked as disconnect().
1799 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1802 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1804 * src/converter.C (runLaTeX): constify buffer argument
1807 * src/frontends/support/Makefile.am (INCLUDES): fix.
1809 * src/buffer.h: add std:: qualifier
1810 * src/insets/figinset.C (addpidwait): ditto
1811 * src/MenuBackend.C: ditto
1812 * src/buffer.C: ditto
1813 * src/bufferlist.C: ditto
1814 * src/layout.C: ditto
1815 * src/lyxfunc.C: ditto
1817 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1819 * src/lyxtext.h (bidi_level): change return type to
1820 LyXParagraph::size_type.
1822 * src/lyxparagraph.h: change size_type to
1823 TextContainer::difference_type. This should really be
1824 TextContainer::size_type, but we need currently to support signed
1827 2000-10-11 Marko Vendelin <markov@ioc.ee>
1828 * src/frontends/gnome/FormError.h
1829 * src/frontends/gnome/FormRef.C
1830 * src/frontends/gnome/FormRef.h
1831 * src/frontends/gnome/FormError.C
1832 * src/frontends/gnome/Makefile.am
1833 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1834 to Gnome frontend. Both dialogs use "action" area.
1836 2000-10-12 Baruch Even <baruch.even@writeme.com>
1838 * src/graphics/GraphicsCacheItem_pimpl.C:
1839 * src/graphics/Renderer.C:
1840 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1843 2000-10-12 Juergen Vigna <jug@sad.it>
1845 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1846 visible when selecting).
1848 * development/Code_rules/Rules: fixed some typos.
1850 2000-10-09 Baruch Even <baruch.even@writeme.com>
1852 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1853 compiling on egcs 1.1.2 possible.
1855 * src/filedlg.C (comp_direntry::operator() ): ditto.
1857 2000-08-31 Baruch Even <baruch.even@writeme.com>
1859 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1862 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1863 transient it now only gets freed when the object is destructed.
1865 2000-08-24 Baruch Even <baruch.even@writeme.com>
1867 * src/frontends/FormGraphics.h:
1868 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1871 2000-08-20 Baruch Even <baruch.even@writeme.com>
1873 * src/insets/insetgraphics.C:
1874 (draw): Added messages to the drawn rectangle to report status.
1875 (updateInset): Disabled the use of the inline graphics,
1878 2000-08-17 Baruch Even <baruch.even@writeme.com>
1880 * src/frontends/support: Directory added for the support of GUII LyX.
1882 * src/frontends/support/LyXImage.h:
1883 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1886 * src/frontends/support/LyXImage_X.h:
1887 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1888 version of LyXImage, this uses the Xlib Pixmap.
1890 * src/PainterBase.h:
1891 * src/PainterBase.C:
1893 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1894 replacement to Pixmap.
1896 * src/insets/insetgraphics.h:
1897 * src/insets/insetgraphics.C:
1898 * src/graphics/GraphicsCacheItem.h:
1899 * src/graphics/GraphicsCacheItem.C:
1900 * src/graphics/GraphicsCacheItem_pimpl.h:
1901 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1904 * src/graphics/GraphicsCacheItem.h:
1905 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1906 another copy of the object.
1908 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1909 of cacheHandle, this fixed a bug that sent LyX crashing.
1911 * src/graphics/XPM_Renderer.h:
1912 * src/graphics/XPM_Renderer.C:
1913 * src/graphics/EPS_Renderer.h:
1914 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1916 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1918 * src/lyxfunc.C (processKeySym): only handle the
1919 lockinginset/inset stuff if we have a buffer and text loaded...
1921 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1923 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1925 * src/support/lyxfunctional.h: add operator= that takes a reference
1927 * src/lyxserver.C (mkfifo): make first arg const
1929 * src/layout.h: renamed name(...) to setName(...) to work around
1932 * src/buffer.C (setFileName): had to change name of function to
1933 work around bugs in egcs. (renamed from fileName)
1935 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1937 * src/support/translator.h: move helper template classes to
1938 lyxfunctional.h, include "support/lyxfunctional.h"
1940 * src/support/lyxmanip.h: add delaration of fmt
1942 * src/support/lyxfunctional.h: new file
1943 (class_fun_t): new template class
1944 (class_fun): helper template function
1945 (back_insert_fun_iterator): new template class
1946 (back_inserter_fun): helper template function
1947 (compare_memfun_t): new template class
1948 (compare_memfun): helper template function
1949 (equal_1st_in_pair): moved here from translator
1950 (equal_2nd_in_pair): moved here from translator
1952 * src/support/fmt.C: new file
1953 (fmt): new func, can be used for a printf substitute when still
1954 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1956 * src/support/StrPool.C: add some comments
1958 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1961 * src/insets/figinset.C (addpidwait): use std::copy with
1962 ostream_iterator to fill the pidwaitlist
1964 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1966 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1969 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1972 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1974 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1975 (class_update): ditto
1976 (BulletPanel): ditto
1977 (CheckChoiceClass): move initialization of tc and tct
1979 * src/tabular.C: remove current_view
1980 (OldFormatRead): similar to right below [istream::ignore]
1982 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1983 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1984 unused [istream::ignore]
1986 * src/lyxfunc.C: include "support/lyxfunctional.h"
1987 (getInsetByCode): use std::find_if and compare_memfun
1989 * src/lyxfont.C (stateText): remove c_str()
1991 * src/lyx_main.C (setDebuggingLevel): make static
1992 (commandLineHelp): make static
1994 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1995 Screen* together with fl_get_display() and fl_screen
1997 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1998 togheter with fl_get_display() and fl_screen
1999 (create_forms): remove c_str()
2001 * src/layout.C: include "support/lyxfunctional.h"
2002 (hasLayout): use std::find_if and compare_memfun
2003 (GetLayout): use std::find_if and comapre_memfun
2004 (delete_layout): use std::remove_if and compare_memfun
2005 (NumberOfClass): use std:.find_if and compare_memfun
2007 * src/gettext.h: change for the new functions
2009 * src/gettext.C: new file, make _(char const * str) and _(string
2010 const & str) real functions.
2012 * src/font.C (width): rewrite slightly to avoid one extra variable
2014 * src/debug.C: initialize Debug::ANY here
2016 * src/commandtags.h: update number comments
2018 * src/combox.h (get): make const func
2020 (getline): make const
2022 * src/combox.C (input_cb): handle case where fl_get_input can
2025 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2026 "support/lyxfunctional.h", remove current_view variable.
2027 (resize): use std::for_each with std::mem_fun
2028 (getFileNames): use std::copy with back_inserter_fun
2029 (getBuffer): change arg type to unsigned int
2030 (emergencyWriteAll): call emergencyWrite with std::for_each and
2032 (emergencyWrite): new method, the for loop in emergencyWriteAll
2034 (exists): use std::find_if with compare_memfun
2035 (getBuffer): use std::find_if and compare_memfun
2037 * src/buffer.h: add typedefs for iterator_category, value_type
2038 difference_type, pointer and reference for inset_iterator
2039 add postfix ++ for inset_iterator
2040 make inset_iterator::getPos() const
2042 * src/buffer.C: added support/lyxmanip.h
2043 (readFile): use lyxerr << fmt instead of printf
2044 (makeLaTeXFile): use std::copy to write out encodings
2046 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2048 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2049 free and the char * temp.
2050 (hasMenu): use std::find_if and compare_memfun
2053 * src/Makefile.am (lyx_SOURCES): added gettext.C
2055 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2056 string::insert small change to avoid temporary
2058 * src/LColor.C (getGUIName): remove c_str()
2060 * several files: change all occurrences of fl_display to
2063 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2064 that -pedantic is not used for gcc 2.97 (cvs gcc)
2066 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2068 2000-10-11 Allan Rae <rae@lyx.org>
2070 * src/frontends/xforms/FormPreferences.C (input): template path must be
2071 a readable directory. It doesn't need to be writeable.
2072 (build, delete, update, apply): New inputs in the various tabfolders
2074 * src/frontends/xforms/forms/form_preferences.fd:
2075 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2076 several new entries to existing folders. Shuffled some existing stuff
2079 * src/frontends/xforms/forms/form_print.fd:
2080 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2081 Should probably rework PrinterParams as well. Note that the switch to
2082 collated is effectively the same as !unsorted so changing PrinterParams
2083 will require a lot of fiddly changes to reverse the existing logic.
2085 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2087 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2089 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2091 2000-10-10 Allan Rae <rae@lyx.org>
2094 * src/lyxfunc.C (Dispatch):
2096 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2099 * src/lyxrc.C (output): Only write the differences between system lyxrc
2100 and the users settings.
2103 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2105 I'll rewrite this later, after 1.1.6 probably, to keep a single
2106 LyXRC but two instances of a LyXRCStruct.
2108 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2110 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2112 * src/tabular.h: add a few std:: qualifiers.
2114 * src/encoding.C: add using directive.
2115 * src/language.C: ditto.
2117 * src/insets/insetquotes.C (Validate): use languages->lang()
2118 instead of only language.
2120 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2122 * lib/languages: New file.
2124 * lib/encodings: New file.
2126 * src/language.C (Languages): New class.
2127 (read): New method. Reads the languages from the 'languages' file.
2129 * src/encoding.C (Encodings): New class.
2130 (read): New method. Reads the encodings from the 'encodings' file.
2132 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2135 * src/bufferparams.h and a lot of files: Deleted the member language,
2136 and renamed language_info to language
2138 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2139 * src/lyxfont.C (latexWriteStartChanges): ditto.
2140 * src/paragraph.C (validate,TeXOnePar): ditto.
2142 * src/lyxfont.C (update): Restored deleted code.
2144 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2146 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2148 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2150 * src/insets/figinset.[Ch]:
2151 * src/insets/insetinclude.[Ch]:
2152 * src/insets/insetinclude.[Ch]:
2153 * src/insets/insetparent.[Ch]:
2154 * src/insets/insetref.[Ch]:
2155 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2157 * src/insets/*.[Ch]:
2158 * src/mathed/formula.[Ch]:
2159 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2161 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2162 * src/lyx_cb.C (FigureApplyCB):
2163 * src/lyxfunc.C (getStatus, Dispatch):
2164 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2167 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2169 * src/converter.[Ch] (Formats::View):
2170 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2172 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2173 *current_view->buffer(). This will change later, but this patch is way
2176 2000-10-09 Juergen Vigna <jug@sad.it>
2178 * src/text.C (GetRow): small fix.
2180 * src/BufferView_pimpl.C (cursorPrevious):
2181 (cursorNext): added LyXText parameter to function.
2183 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2184 keypress depending on cursor position.
2186 2000-10-06 Juergen Vigna <jug@sad.it>
2188 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2189 (copySelection): redone this function and also copy ascii representa-
2192 * src/tabular.C (Ascii):
2196 (print_n_chars): new functions to realize the ascii export of tabulars.
2198 2000-10-05 Juergen Vigna <jug@sad.it>
2200 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2201 if we don't have a buffer.
2203 2000-10-10 Allan Rae <rae@lyx.org>
2205 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2206 with closing dialog. It seems that nested tabfolders require hiding
2207 of inner tabfolders before hiding the dialog itself. Actually all I
2208 did was hide the active outer folder.
2210 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2211 unless there really is a buffer. hideBufferDependent is called
2214 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2215 POTFILES.in stays in $(srcdir).
2217 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2219 * lib/lyxrc.example: Few changes.
2221 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2223 * src/BufferView_pimpl.C (buffer): only need one the
2224 updateBufferDependent signal to be emitted once! Moved to the end of
2225 the method to allow bv_->text to be updated first.
2227 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2228 and hSignal_ with Dialogs * and BufferDependency variables.
2229 New Buffer * parent_, initialised when the dialog is launched. Used to
2230 check whether to update() or hide() dialog in the new, private
2231 updateOrHide() method that is connected to the updateBufferDependent
2232 signal. Daughter classes dictate what to do using the
2233 ChangedBufferAction enum, passed to the c-tor.
2235 * src/frontends/xforms/FormCitation.C:
2236 * src/frontends/xforms/FormCommand.C:
2237 * src/frontends/xforms/FormCopyright.C:
2238 * src/frontends/xforms/FormDocument.C:
2239 * src/frontends/xforms/FormError.C:
2240 * src/frontends/xforms/FormIndex.C:
2241 * src/frontends/xforms/FormPreferences.C:
2242 * src/frontends/xforms/FormPrint.C:
2243 * src/frontends/xforms/FormRef.C:
2244 * src/frontends/xforms/FormToc.C:
2245 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2248 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2249 ChangedBufferAction enum.
2251 * src/frontends/xforms/FormParagraph.[Ch]
2252 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2255 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2257 * lib/bind/cua.bind: fix a bit.
2258 * lib/bind/emacs.bind: ditto.
2260 * lib/bind/menus.bind: remove real menu entries from there.
2262 * src/spellchecker.C: make sure we only include strings.h when
2265 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2267 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2268 function. It enlarges the maximum number of pup when needed.
2269 (add_toc2): Open a new menu if maximum number of items per menu has
2272 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2274 * src/frontends/kde/FormPrint.C: fix error reporting
2276 * src/frontends/xforms/FormDocument.C: fix compiler
2279 * lib/.cvsignore: add Literate.nw
2281 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2284 * bufferview_funcs.[Ch]
2287 * text2.C: Add support for numbers in RTL text.
2289 2000-10-06 Allan Rae <rae@lyx.org>
2291 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2292 to be gettext.m4 friendly again. ext_l10n.h is now
2293 generated into $top_srcdir instead of $top_builddir
2294 so that lyx.pot will be built correctly -- without
2295 duplicate parsing of ext_l10n.h.
2297 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2299 * src/frontends/kde/FormCitation.C: make the dialog
2300 behave more sensibly
2302 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2304 * config/kde.m4: fix consecutive ./configure runs,
2305 look for qtarch, fix library order
2307 * src/frontends/kde/Makefile.am: tidy up,
2308 add Print dialog, add .dlg dependencies
2310 * src/frontends/kde/FormPrint.C:
2311 * src/frontends/kde/FormPrint.h:
2312 * src/frontends/kde/formprintdialog.C:
2313 * src/frontends/kde/formprintdialog.h:
2314 * src/frontends/kde/formprintdialogdata.C:
2315 * src/frontends/kde/formprintdialogdata.h:
2316 * src/frontends/kde/dlg/formprintdialog.dlg: add
2319 * src/frontends/kde/dlg/README: Added explanatory readme
2321 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2322 script to double-check qtarch's output
2324 * src/frontends/kde/formindexdialog.C:
2325 * src/frontends/kde/formindexdialogdata.C:
2326 * src/frontends/kde/formindexdialogdata.h:
2327 * src/frontends/kde/dlg/formindexdialog.dlg: update
2328 for qtarch, minor fixes
2330 2000-10-05 Allan Rae <rae@lyx.org>
2332 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2333 dialogs when switching buffers update them instead. It's up to each
2334 dialog to decide if it should still be visible or not.
2335 update() should return a bool to control visiblity within show().
2336 Or perhaps better to set a member variable and use that to control
2339 * lib/build-listerrors: create an empty "listerrors" file just to stop
2340 make trying to regenerate it all the time if you don't have noweb
2343 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2345 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2346 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2347 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2348 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2349 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2351 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2353 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2355 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2356 deleting buffer. Closes all buffer-dependent dialogs.
2358 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2360 * src/frontends/xforms/FormCitation.[Ch]:
2361 * src/frontends/xforms/FormPreferences.[Ch]:
2362 * src/frontends/xforms/FormPrint.[Ch]:
2363 * src/frontends/xforms/FormRef.[Ch]:
2364 * src/frontends/xforms/FormUrl.[Ch]: ditto
2366 * src/frontends/xforms/FormDocument.[Ch]:
2367 * src/frontends/xforms/forms/form_document.C.patch:
2368 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2369 pass through a single input() function.
2371 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2373 * lib/build-listerrors: return status as OK
2375 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2377 * lib/lyxrc.example: Updated to new export code
2379 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2381 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2384 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2387 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2388 LyX-Code is defined.
2389 * lib/layouts/amsbook.layout: ditto.
2391 * boost/Makefile.am: fix typo.
2393 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2395 (add_lastfiles): removed.
2396 (add_documents): removed.
2397 (add_formats): removed.
2399 * src/frontends/Menubar.C: remove useless "using" directive.
2401 * src/MenuBackend.h: add a new MenuItem constructor.
2403 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2406 2000-10-04 Allan Rae <rae@lyx.org>
2408 * lib/Makefile.am (listerrors):
2409 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2410 I haven't got notangle installed so Kayvan please test. The output
2411 should end up in $builddir. This also allows people who don't have
2412 noweb installed to complete the make process without error.
2414 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2415 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2416 by JMarc's picky compiler.
2418 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2421 * src/insets/insettabular.C (setPos): change for loop to not use
2422 sequencing operator. Please check this Jürgen.
2424 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2426 * src/insets/insetcite.C (getScreenLabel): ditto
2427 * src/support/filetools.C (QuoteName): ditto
2428 (ChangeExtension): ditto
2430 * src/BufferView_pimpl.C (scrollCB): make heigt int
2432 * src/BufferView2.C (insertInset): comment out unused arg
2434 * boost/Makefile.am (EXTRADIST): new variable
2436 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2438 * src/exporter.C (IsExportable): Fixed
2440 * lib/configure.m4: Small fix
2442 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2444 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2445 * src/insets/insetbib.C (bibitemWidest): ditto.
2446 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2448 2000-10-03 Juergen Vigna <jug@sad.it>
2450 * src/BufferView2.C (theLockingInset): removed const because of
2451 Agnus's compile problems.
2453 * src/insets/insettext.C (LocalDispatch): set the language of the
2454 surronding paragraph on inserting the first character.
2456 * various files: changed use of BufferView::the_locking_inset.
2458 * src/BufferView2.C (theLockingInset):
2459 (theLockingInset): new functions.
2461 * src/BufferView.h: removed the_locking_inset.
2463 * src/lyxtext.h: added the_locking_inset
2465 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2467 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2469 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2471 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2472 * src/mathed/math_cursor.C (IsAlpha): ditto.
2473 * src/mathed/math_inset.C (strnew): ditto.
2474 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2475 (IMetrics): cxp set but never used; removed.
2476 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2477 that the variable in question has been removed also!
2480 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2481 using the Buffer * passed to Latex(), using the BufferView * passed to
2482 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2484 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2485 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2487 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2488 * src/buffer.C (readInset): used new InsetBibtex c-tor
2489 * (getBibkeyList): used new InsetBibtex::getKeys
2491 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2494 * lib/build-listerrors
2496 * src/exporter.C: Add literate programming support to the export code
2499 * src/lyx_cb.C: Remove old literate code.
2501 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2504 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2505 * src/converter.C (View, Convert): Use QuoteName.
2507 * src/insets/figinset.C (Preview): Use Formats::View.
2509 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2511 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2513 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2514 the top of the function, because compaq cxx complains that the
2515 "goto exit_with_message" when the function is disabled bypasses
2517 (MenuNew): try a better fix for the generation of new file names.
2518 This time, I used AddName() instead of AddPath(), hoping Juergen
2521 2000-10-03 Allan Rae <rae@lyx.org>
2523 * src/frontends/xforms/forms/form_preferences.fd:
2524 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2525 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2526 "Look and Feel"->"General" but will need to be split up further into
2527 general output and general input tabs. Current plan is for four outer
2528 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2529 stuff; "Inputs" for input and import configuration; "Outputs" for
2530 output and export configuration; and one more whatever is left over
2531 called "General". The leftovers at present look like being which
2532 viewers to use, spellchecker, language support and might be better
2533 named "Support". I've put "Paths" in "Inputs" for the moment as this
2534 seems reasonable for now at least.
2535 One problem remains: X error kills LyX when you close Preferences.
2537 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2539 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2540 qualifier from form()
2541 * src/frontends/xforms/FormCitation.[Ch]:
2542 * src/frontends/xforms/FormCopyright.[Ch]:
2543 * src/frontends/xforms/FormDocument.[Ch]:
2544 * src/frontends/xforms/FormError.[Ch]:
2545 * src/frontends/xforms/FormIndex.[Ch]:
2546 * src/frontends/xforms/FormPreferences.[Ch]:
2547 * src/frontends/xforms/FormPrint.[Ch]:
2548 * src/frontends/xforms/FormRef.[Ch]:
2549 * src/frontends/xforms/FormToc.[Ch]:
2550 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2552 * src/frontends/xforms/FormCitation.[Ch]:
2553 * src/frontends/xforms/FormIndex.[Ch]:
2554 * src/frontends/xforms/FormRef.[Ch]:
2555 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2556 with Allan's naming policy
2558 * src/frontends/xforms/FormCitation.C: some static casts to remove
2561 2000-10-02 Juergen Vigna <jug@sad.it>
2563 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2564 now you can type or do stuff inside the table-cell also when in dummy
2565 position, fixed visible cursor.
2567 * src/insets/insettext.C (Edit): fixing cursor-view position.
2569 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2570 be used for equal functions in lyxfunc and insettext.
2572 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2574 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2576 * src/frontends/gnome/FormCitation.h:
2577 * src/frontends/gnome/FormCopyright.h:
2578 * src/frontends/gnome/FormIndex.h:
2579 * src/frontends/gnome/FormPrint.h:
2580 * src/frontends/gnome/FormToc.h:
2581 * src/frontends/gnome/FormUrl.h:
2582 * src/frontends/kde/FormCitation.h:
2583 * src/frontends/kde/FormCopyright.h:
2584 * src/frontends/kde/FormIndex.h:
2585 * src/frontends/kde/FormRef.h:
2586 * src/frontends/kde/FormToc.h:
2587 * src/frontends/kde/FormUrl.h: fix remaining users of
2590 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2592 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2593 from depth argument.
2594 (DocBookHandleCaption): ditto.
2595 (DocBookHandleFootnote): ditto.
2596 (SimpleDocBookOnePar): ditto.
2598 * src/frontends/xforms/FormDocument.h (form): remove extra
2599 FormDocument:: qualifier.
2601 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2603 * sigc++/handle.h: ditto.
2605 * src/lyx_gui_misc.C: add "using" directive.
2607 * src/cheaders/cstddef: new file, needed by the boost library (for
2610 2000-10-02 Juergen Vigna <jug@sad.it>
2612 * src/insets/insettext.C (SetFont): better support.
2614 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2616 * src/screen.C (DrawOneRow): some uint refixes!
2618 2000-10-02 Allan Rae <rae@lyx.org>
2620 * boost/.cvsignore: ignore Makefile as well
2622 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2623 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2625 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2626 Left this one out by accident.
2628 * src/frontends/xforms/FormBase.h (restore): default to calling
2629 update() since that will restore the original/currently-applied values.
2630 Any input() triggered error messages will require the derived classes
2631 to redefine restore().
2633 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2634 avoid a segfault. combo_doc_class is the main concern.
2636 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2638 * Simplify build-listerrors in view of GUI-less export ability!
2640 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2642 * src/lyx_main.C (easyParse): Disable gui when exporting
2644 * src/insets/figinset.C:
2647 * src/lyx_gui_misc.C
2648 * src/tabular.C: Changes to allow no-gui.
2650 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2652 * src/support/utility.hpp: removed file
2653 * src/support/block.h: removed file
2655 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2658 * src/mathed/formula.C: add support/lyxlib.h
2659 * src/mathed/formulamacro.C: ditto
2661 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2662 * src/lyxparagraph.h: ditto
2664 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2665 * src/frontends/Makefile.am (INCLUDES): ditto
2666 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2667 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2668 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2669 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2670 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2671 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2673 * src/BufferView.h: use boost/utility.hpp
2674 * src/LColor.h: ditto
2675 * src/LaTeX.h: ditto
2676 * src/LyXAction.h: ditto
2677 * src/LyXView.h: ditto
2678 * src/bufferlist.h: ditto
2679 * src/lastfiles.h: ditto
2680 * src/layout.h: ditto
2681 * src/lyx_gui.h: ditto
2682 * src/lyx_main.h: ditto
2683 * src/lyxlex.h: ditto
2684 * src/lyxrc.h: ditto
2685 * src/frontends/ButtonPolicies.h: ditto
2686 * src/frontends/Dialogs.h: ditto
2687 * src/frontends/xforms/FormBase.h: ditto
2688 * src/frontends/xforms/FormGraphics.h: ditto
2689 * src/frontends/xforms/FormParagraph.h: ditto
2690 * src/frontends/xforms/FormTabular.h: ditto
2691 * src/graphics/GraphicsCache.h: ditto
2692 * src/graphics/Renderer.h: ditto
2693 * src/insets/ExternalTemplate.h: ditto
2694 * src/insets/insetcommand.h: ditto
2695 * src/support/path.h: ditto
2697 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2698 and introduce clause for 2.97.
2700 * boost/libs/README: new file
2702 * boost/boost/utility.hpp: new file
2704 * boost/boost/config.hpp: new file
2706 * boost/boost/array.hpp: new file
2708 * boost/Makefile.am: new file
2710 * boost/.cvsignore: new file
2712 * configure.in (AC_OUTPUT): add boost/Makefile
2714 * Makefile.am (SUBDIRS): add boost
2716 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2718 * src/support/lstrings.C (suffixIs): Fixed.
2720 2000-10-01 Allan Rae <rae@lyx.org>
2722 * src/PrinterParams.h: moved things around to avoid the "can't
2723 inline call" warning.
2725 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2726 into doc++ documentation.
2728 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2730 * src/frontends/xforms/FormRef.C: make use of button controller
2731 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2732 cleaned up button controller usage.
2733 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2734 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2735 use the button controller
2737 * src/frontends/xforms/forms/*.fd: and associated generated files
2738 updated to reflect changes to FormBase. Some other FormXxxx files
2739 also got minor updates to reflect changes to FormBase.
2741 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2742 (hide): made virtual.
2743 (input): return a bool. true == valid input
2744 (RestoreCB, restore): new
2745 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2746 Changes to allow derived dialogs to use a ButtonController and
2747 make sense when doing so: OK button calls ok() and so on.
2749 * src/frontends/xforms/ButtonController.h (class ButtonController):
2750 Switch from template implementation to taking Policy parameter.
2751 Allows FormBase to provide a ButtonController for any dialog.
2753 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2754 Probably should rename connect and disconnect.
2755 (apply): use the radio button groups
2756 (form): needed by FormBase
2757 (build): setup the radio button groups
2759 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2761 * several files: type changes to reduce the number of warnings and
2762 to unify type hangling a bit. Still much to do.
2764 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2766 * lib/images/*: rename a bunch of icons to match Dekel converter
2769 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2772 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2774 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2776 * sigc++/handle.h: ditto for class Handle.
2778 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2780 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2782 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2784 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2785 removal of the "default" language.
2787 * src/combox.h (getline): Check that sel > 0
2789 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2791 * lib/examples/docbook_example.lyx
2792 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2794 * lib/layouts/docbook-book.layout: new docbook book layout.
2796 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2798 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2800 * src/insets/figinset.C (DocBook):fixed small typo.
2802 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2804 * src/insets/insetinclude.h: string include_label doesn't need to be
2807 2000-09-29 Allan Rae <rae@lyx.org>
2809 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2810 Allow derived type to control connection and disconnection from signals
2811 of its choice if desired.
2813 2000-09-28 Juergen Vigna <jug@sad.it>
2815 * src/insets/insettabular.C (update): fixed cursor setting when
2816 the_locking_inset changed.
2817 (draw): made this a bit cleaner.
2818 (InsetButtonPress): fixed!
2820 * various files: added LyXText Parameter to fitCursor call.
2822 * src/BufferView.C (fitCursor): added LyXText parameter.
2824 * src/insets/insettabular.C (draw): small draw fix.
2826 * src/tabular.C: right setting of left/right celllines.
2828 * src/tabular.[Ch]: fixed various types in funcions and structures.
2829 * src/insets/insettabular.C: ditto
2830 * src/frontends/xforms/FormTabular.C: ditto
2832 2000-09-28 Allan Rae <rae@lyx.org>
2834 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2835 that the #ifdef's had been applied to part of what should have been
2836 a complete condition. It's possible there are other tests that
2837 were specific to tables that are also wrong now that InsetTabular is
2838 being used. Now we need to fix the output of '\n' after a table in a
2839 float for the same reason as the original condition:
2840 "don't insert this if we would be adding it before or after a table
2841 in a float. This little trick is needed in order to allow use of
2842 tables in \subfigures or \subtables."
2843 Juergen can you check this?
2845 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2847 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2848 output to the ostream.
2850 * several files: fixed types based on warnings from cxx
2852 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2854 * src/frontends/kde/Makefile.am: fix rule for
2855 formindexdialogdata_moc.C
2857 * src/.cvsignore: add ext_l10n.h to ignore
2859 * acconfig.h: stop messing with __STRICT_ANSI__
2860 * config/gnome.m4: remove option to set -ansi
2861 * config/kde.m4: remove option to set -ansi
2862 * config/lyxinclude.m4: don't set -ansi
2864 2000-09-27 Juergen Vigna <jug@sad.it>
2866 * various files: remove "default" language check.
2868 * src/insets/insetquotes.C: removed use of current_view.
2870 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2871 the one should have red ears by now!
2873 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2874 in more then one paragraph. Fixed cursor-movement/selection.
2876 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2877 paragraphs inside a text inset.
2879 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2880 text-inset if this owner is an inset.
2882 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2884 * src/Bullet.h: changed type of font, character and size to int
2886 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2888 * src/insets/inseturl.[Ch]:
2889 * src/insets/insetref.[Ch]:
2890 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2892 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2894 * src/buffer.C (readFile): block-if statement rearranged to minimise
2895 bloat. Patch does not reverse Jean-Marc's change ;-)
2897 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2898 Class rewritten to store pointers to hide/update signals directly,
2899 rather than Dialogs *. Also defined an enum to ease use. All xforms
2900 forms can now be derived from this class.
2902 * src/frontends/xforms/FormCommand.[Ch]
2903 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2905 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2908 * src/frontends/xforms/forms/form_citation.fd
2909 * src/frontends/xforms/forms/form_copyright.fd
2910 * src/frontends/xforms/forms/form_error.fd
2911 * src/frontends/xforms/forms/form_index.fd
2912 * src/frontends/xforms/forms/form_ref.fd
2913 * src/frontends/xforms/forms/form_toc.fd
2914 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2916 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2918 * src/insets/insetfoot.C: removed redundent using directive.
2920 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2922 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2923 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2925 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2926 created in the constructors in different groups. Then set() just
2927 have to show the groups as needed. This fixes the redraw problems
2928 (and is how the old menu code worked).
2930 * src/support/lyxlib.h: declare the methods as static when we do
2931 not have namespaces.
2933 2000-09-26 Juergen Vigna <jug@sad.it>
2935 * src/buffer.C (asciiParagraph): new function.
2936 (writeFileAscii): new function with parameter ostream.
2937 (writeFileAscii): use now asciiParagraph.
2939 * various inset files: added the linelen parameter to the Ascii-func.
2941 * src/tabular.C (Write): fixed error in writing file introduced by
2942 the last changes from Lars.
2944 * lib/bind/menus.bind: removed not supported functions.
2946 * src/insets/insettext.C (Ascii): implemented this function.
2948 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2950 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2951 (Write): use of the write_attribute functions.
2953 * src/bufferlist.C (close): fixed reasking question!
2955 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2957 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2958 new files use the everwhere possible.
2961 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2962 src/log_form.C src/lyx.C:
2965 * src/buffer.C (runLaTeX): remove func
2967 * src/PaperLayout.C: removed file
2968 * src/ParagraphExtra.C: likewise
2969 * src/bullet_forms.C: likewise
2970 * src/bullet_forms.h: likewise
2971 * src/bullet_forms_cb.C: likewise
2973 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2974 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2977 * several files: remove all traces of the old fd_form_paragraph,
2978 and functions belonging to that.
2980 * several files: remove all traces of the old fd_form_document,
2981 and functions belonging to that.
2983 * several files: constify local variables were possible.
2985 * several files: remove all code that was dead when NEW_EXPORT was
2988 * several files: removed string::c_str in as many places as
2991 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2992 (e): be a bit more outspoken when patching
2993 (updatesrc): only move files if changed.
2995 * forms/layout_forms.h.patch: regenerated
2997 * forms/layout_forms.fd: remove form_document and form_paragraph
2998 and form_quotes and form_paper and form_table_options and
2999 form_paragraph_extra
3001 * forms/form1.fd: remove form_table
3003 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3004 the fdui->... rewrite. Update some comments to xforms 0.88
3006 * forms/bullet_forms.C.patch: removed file
3007 * forms/bullet_forms.fd: likewise
3008 * forms/bullet_forms.h.patch: likewise
3010 * development/Code_rules/Rules: added a section on switch
3011 statements. Updated some comment to xforms 0.88.
3013 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3015 * src/buffer.C (readFile): make sure that the whole version number
3016 is read after \lyxformat (even when it contains a comma)
3018 * lib/ui/default.ui: change shortcut of math menu to M-a.
3020 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3022 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3025 * src/LyXView.C (updateWindowTitle): show the full files name in
3026 window title, limited to 30 characters.
3028 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3029 When a number of characters has been given, we should not assume
3030 that the string is 0-terminated.
3032 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3033 calls (fixes some memory leaks)
3035 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3036 trans member on exit.
3038 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3040 * src/converter.C (GetReachable): fix typo.
3042 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3043 understand ',' instead of '.'.
3044 (GetInteger): rewrite to use strToInt().
3046 2000-09-26 Juergen Vigna <jug@sad.it>
3048 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3049 better visibility and error-message on wrong VSpace input.
3051 * src/language.C (initL): added english again.
3053 2000-09-25 Juergen Vigna <jug@sad.it>
3055 * src/frontends/kde/Dialogs.C (Dialogs):
3056 * src/frontends/gnome/Dialogs.C (Dialogs):
3057 * src/frontends/kde/Makefile.am:
3058 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3060 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3062 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3064 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3066 * src/frontends/xforms/FormParagraph.C:
3067 * src/frontends/xforms/FormParagraph.h:
3068 * src/frontends/xforms/form_paragraph.C:
3069 * src/frontends/xforms/form_paragraph.h:
3070 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3073 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3075 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3076 Paragraph-Data after use.
3078 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3079 non breakable paragraphs.
3081 2000-09-25 Garst R. Reese <reese@isn.net>
3083 * src/language.C (initL): added missing language_country codes.
3085 2000-09-25 Juergen Vigna <jug@sad.it>
3087 * src/insets/insettext.C (InsetText):
3088 (deleteLyXText): remove the not released LyXText structure!
3090 2000-09-24 Marko Vendelin <markov@ioc.ee>
3092 * src/frontends/gnome/mainapp.C
3093 * src/frontends/gnome/mainapp.h: added support for keyboard
3096 * src/frontends/gnome/FormCitation.C
3097 * src/frontends/gnome/FormCitation.h
3098 * src/frontends/gnome/Makefile.am
3099 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3100 FormCitation to use "action area" in mainapp window
3102 * src/frontends/gnome/Menubar_pimpl.C
3103 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3106 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3108 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3109 width/descent/ascent values if name is empty.
3110 (mathed_string_height): Use std::max.
3112 2000-09-25 Allan Rae <rae@lyx.org>
3114 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3115 segfault. This will be completely redesigned soon.
3117 * sigc++: updated libsigc++. Fixes struct timespec bug.
3119 * development/tools/makeLyXsigc.sh: .cvsignore addition
3121 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3123 * several files: removed almost all traces of the old table
3126 * src/TableLayout.C: removed file
3128 2000-09-22 Juergen Vigna <jug@sad.it>
3130 * src/frontends/kde/Dialogs.C: added credits forms.
3132 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3134 * src/frontends/gnome/Dialogs.C: added some forms.
3136 * src/spellchecker.C (init_spell_checker): set language in pspell code
3137 (RunSpellChecker): some modifications for setting language string.
3139 * src/language.[Ch]: added language_country code.
3141 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3143 * src/frontends/Dialogs.h: added new signal showError.
3144 Rearranged existing signals in some sort of alphabetical order.
3146 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3147 FormError.[Ch], form_error.[Ch]
3148 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3149 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3151 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3152 dialogs. I think that this can be used as the base to all these
3155 * src/frontends/xforms/FormError.[Ch]
3156 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3157 implementation of InsetError dialog.
3159 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3161 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3162 * src/frontends/kde/Makefile.am: ditto
3164 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3166 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3167 macrobf. This fixes a bug of invisible text.
3169 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3171 * lib/doc/LaTeXConfig.lyx.in: updated.
3173 * src/language.C (initL): remove language "francais" and change a
3174 bit the names of the two other french variations.
3176 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3177 string that may not be 0-terminated.
3179 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3181 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3183 2000-09-20 Marko Vendelin <markov@ioc.ee>
3185 * src/frontends/gnome/FormCitation.C
3186 * src/frontends/gnome/FormIndex.C
3187 * src/frontends/gnome/FormToc.C
3188 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3189 the variable initialization to shut up the warnings
3191 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3193 * src/table.[Ch]: deleted files
3195 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3198 2000-09-18 Juergen Vigna <jug@sad.it>
3200 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3201 problems with selection. Inserted new LFUN_PASTESELECTION.
3202 (InsetButtonPress): inserted handling of middle mouse-button paste.
3204 * src/spellchecker.C: changed word to word.c_str().
3206 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3208 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3209 included in the ``make dist'' tarball.
3211 2000-09-15 Juergen Vigna <jug@sad.it>
3213 * src/CutAndPaste.C (cutSelection): small fix return the right
3214 end position after cut inside one paragraph only.
3216 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3217 we are locked as otherwise we don't have a valid cursor position!
3219 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3221 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3223 * src/frontends/kde/FormRef.C: added using directive.
3224 * src/frontends/kde/FormToc.C: ditto
3226 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3228 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3230 2000-09-19 Marko Vendelin <markov@ioc.ee>
3232 * src/frontends/gnome/Menubar_pimpl.C
3233 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3234 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3236 * src/frontends/gnome/mainapp.C
3237 * src/frontends/gnome/mainapp.h: support for menu update used
3240 * src/frontends/gnome/mainapp.C
3241 * src/frontends/gnome/mainapp.h: support for "action" area in the
3242 main window. This area is used by small simple dialogs, such as
3245 * src/frontends/gnome/FormIndex.C
3246 * src/frontends/gnome/FormIndex.h
3247 * src/frontends/gnome/FormUrl.C
3248 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3251 * src/frontends/gnome/FormCitation.C
3252 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3253 action area. Only "Insert new citation" is implemented.
3255 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3257 * src/buffer.C (Dispatch): fix call to Dispatch
3258 * src/insets/insetref.C (Edit): likewise
3259 * src/insets/insetparent.C (Edit): likewise
3260 * src/insets/insetinclude.C (include_cb): likewise
3261 * src/frontends/xforms/FormUrl.C (apply): likewise
3262 * src/frontends/xforms/FormToc.C (apply): likewise
3263 * src/frontends/xforms/FormRef.C (apply): likewise
3264 * src/frontends/xforms/FormIndex.C (apply): likewise
3265 * src/frontends/xforms/FormCitation.C (apply): likewise
3266 * src/lyxserver.C (callback): likewise
3267 * src/lyxfunc.C (processKeySym): likewise
3268 (Dispatch): likewise
3269 (Dispatch): likewise
3270 * src/lyx_cb.C (LayoutsCB): likewise
3272 * Makefile.am (sourcedoc): small change
3274 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3276 * src/main.C (main): Don't make an empty GUIRunTime object. all
3277 methods are static. constify a bit remove unneded using + headers.
3279 * src/tabular.C: some more const to local vars move some loop vars
3281 * src/spellchecker.C: added some c_str after some word for pspell
3283 * src/frontends/GUIRunTime.h: add new static method setDefaults
3284 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3285 * src/frontends/kde/GUIRunTime.C (setDefaults):
3286 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3288 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3289 with strnew in arg, use correct emptystring when calling SetName.
3291 * several files: remove all commented code with relation to
3292 HAVE_SSTREAM beeing false. We now only support stringstream and
3295 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3297 * src/lyxfunc.C: construct correctly the automatic new file
3300 * src/text2.C (IsStringInText): change type of variable i to shut
3303 * src/support/sstream.h: do not use namespaces if the compiler
3304 does not support them.
3306 2000-09-15 Marko Vendelin <markov@ioc.ee>
3307 * src/frontends/gnome/FormCitation.C
3308 * src/frontends/gnome/FormCitation.h
3309 * src/frontends/gnome/diainsertcitation_interface.c
3310 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3311 regexp support to FormCitation [Gnome].
3313 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3316 * configure.in: remove unused KDE/GTKGUI define
3318 * src/frontends/kde/FormRef.C
3319 * src/frontends/kde/FormRef.h
3320 * src/frontends/kde/formrefdialog.C
3321 * src/frontends/kde/formrefdialog.h: double click will
3322 go to reference, now it is possible to change a cross-ref
3325 * src/frontends/kde/FormToc.C
3326 * src/frontends/kde/FormToc.h
3327 * src/frontends/kde/formtocdialog.C
3328 * src/frontends/kde/formtocdialog.h: add a depth
3331 * src/frontends/kde/Makefile.am: add QtLyXView.h
3334 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3336 * src/frontends/kde/FormCitation.h: added some using directives.
3338 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3340 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3343 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3346 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3348 * src/buffer.C (pop_tag): revert for the second time a change by
3349 Lars, who seems to really hate having non-local loop variables :)
3351 * src/Lsstream.h: add "using" statements.
3353 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3354 * src/buffer.C (writeFile): ditto
3356 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3358 * src/buffer.C (writeFile): try to fix the locale modified format
3359 number to always be as we want it.
3361 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3362 in XForms 0.89. C-space is now working again.
3364 * src/Lsstream.h src/support/sstream.h: new files.
3366 * also commented out all cases where strstream were used.
3368 * src/Bullet.h (c_str): remove method.
3370 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3372 * a lot of files: get rid of "char const *" and "char *" is as
3373 many places as possible. We only want to use them in interaction
3374 with system of other libraries, not inside lyx.
3376 * a lot of files: return const object is not of pod type. This
3377 helps ensure that temporary objects is not modified. And fits well
3378 with "programming by contract".
3380 * configure.in: check for the locale header too
3382 * Makefile.am (sourcedoc): new tag for generation of doc++
3385 2000-09-14 Juergen Vigna <jug@sad.it>
3387 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3388 callback to check which combo called it and do the right action.
3390 * src/combox.C (combo_cb): added combo * to the callbacks.
3391 (Hide): moved call of callback after Ungrab of the pointer.
3393 * src/intl.h: removed LCombo2 function.
3395 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3396 function as this can now be handled in one function.
3398 * src/combox.h: added Combox * to callback prototype.
3400 * src/frontends/xforms/Toolbar_pimpl.C:
3401 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3403 2000-09-14 Garst Reese <reese@isn.net>
3405 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3406 moved usepackage{xxx}'s to beginning of file. Changed left margin
3407 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3408 underlining from title. Thanks to John Culleton for useful suggestions.
3410 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3412 * src/lyxlex_pimpl.C (setFile): change error message to debug
3415 2000-09-13 Juergen Vigna <jug@sad.it>
3417 * src/frontends/xforms/FormDocument.C: implemented choice_class
3418 as combox and give callback to combo_language so OK/Apply is activated
3421 * src/bufferlist.C (newFile): small fix so already named files
3422 (via an open call) are not requested to be named again on the
3425 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3427 * src/frontends/kde/Makefile.am
3428 * src/frontends/kde/FormRef.C
3429 * src/frontends/kde/FormRef.h
3430 * src/frontends/kde/formrefdialog.C
3431 * src/frontends/kde/formrefdialog.h: implement
3434 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3436 * src/frontends/kde/formtocdialog.C
3437 * src/frontends/kde/formtocdialog.h
3438 * src/frontends/kde/FormToc.C
3439 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3441 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3443 * src/frontends/kde/FormCitation.C: fix thinko
3444 where we didn't always display the reference text
3447 * src/frontends/kde/formurldialog.C
3448 * src/frontends/kde/formurldialog.h
3449 * src/frontends/kde/FormUrl.C
3450 * src/frontends/kde/FormUrl.h: minor cleanups
3452 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3454 * src/frontends/kde/Makefile.am
3455 * src/frontends/kde/FormToc.C
3456 * src/frontends/kde/FormToc.h
3457 * src/frontends/kde/FormCitation.C
3458 * src/frontends/kde/FormCitation.h
3459 * src/frontends/kde/FormIndex.C
3460 * src/frontends/kde/FormIndex.h
3461 * src/frontends/kde/formtocdialog.C
3462 * src/frontends/kde/formtocdialog.h
3463 * src/frontends/kde/formcitationdialog.C
3464 * src/frontends/kde/formcitationdialog.h
3465 * src/frontends/kde/formindexdialog.C
3466 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3468 2000-09-12 Juergen Vigna <jug@sad.it>
3470 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3473 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3475 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3478 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3480 * src/converter.C (Add, Convert): Added support for converter flags:
3481 needaux, resultdir, resultfile.
3482 (Convert): Added new parameter view_file.
3483 (dvips_options): Fixed letter paper option.
3485 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3486 (Export, GetExportableFormats, GetViewableFormats): Added support
3489 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3491 (easyParse): Fixed to work with new export code.
3493 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3496 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3498 * lib/bind/*.bind: Replaced
3499 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3500 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3502 2000-09-11 Juergen Vigna <jug@sad.it>
3504 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3506 * src/main.C (main): now GUII defines global guiruntime!
3508 * src/frontends/gnome/GUIRunTime.C (initApplication):
3509 * src/frontends/kde/GUIRunTime.C (initApplication):
3510 * src/frontends/xforms/GUIRunTime.C (initApplication):
3511 * src/frontends/GUIRunTime.h: added new function initApplication.
3513 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3515 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3517 2000-09-08 Juergen Vigna <jug@sad.it>
3519 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3520 we have already "Reset".
3522 * src/language.C (initL): inserted "default" language and made this
3523 THE default language (and not american!)
3525 * src/paragraph.C: inserted handling of "default" language!
3527 * src/lyxfont.C: ditto
3531 * src/paragraph.C: output the \\par only if we have a following
3532 paragraph otherwise it's not needed.
3534 2000-09-05 Juergen Vigna <jug@sad.it>
3536 * config/pspell.m4: added entry to lyx-flags
3538 * src/spellchecker.C: modified version from Kevin for using pspell
3540 2000-09-01 Marko Vendelin <markov@ioc.ee>
3541 * src/frontends/gnome/Makefile.am
3542 * src/frontends/gnome/FormCitation.C
3543 * src/frontends/gnome/FormCitation.h
3544 * src/frontends/gnome/diainsertcitation_callbacks.c
3545 * src/frontends/gnome/diainsertcitation_callbacks.h
3546 * src/frontends/gnome/diainsertcitation_interface.c
3547 * src/frontends/gnome/diainsertcitation_interface.h
3548 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3549 dialog for Gnome frontend
3551 * src/main.C: Gnome libraries require keeping application name
3552 and its version as strings
3554 * src/frontends/gnome/mainapp.C: Change the name of the main window
3555 from GnomeLyX to PACKAGE
3557 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3559 * src/frontends/Liason.C: add "using: declaration.
3561 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3563 * src/mathed/math_macro.C (Metrics): Set the size of the template
3565 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3567 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3569 * src/converter.C (add_options): New function.
3570 (SetViewer): Change $$FName into '$$FName'.
3571 (View): Add options when running xdvi
3572 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3573 (Convert): The 3rd parameter is now the desired filename. Converts
3574 calls to lyx::rename if necessary.
3575 Add options when running dvips.
3576 (dvi_papersize,dvips_options): New methods.
3578 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3580 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3581 using a call to Converter::dvips_options.
3582 Fixed to work with nex export code.
3584 * src/support/copy.C
3585 * src/support/rename.C: New files
3587 * src/support/syscall.h
3588 * src/support/syscall.C: Added Starttype SystemDontWait.
3590 * lib/ui/default.ui: Changed to work with new export code
3592 * lib/configure.m4: Changed to work with new export code
3594 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3596 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3598 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3599 so that code compiles with DEC cxx.
3601 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3602 to work correctly! Also now supports the additional elements
3605 2000-09-01 Allan Rae <rae@lyx.org>
3607 * src/frontends/ButtonPolicies.C: renamed all the references to
3608 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3610 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3611 since it's a const not a type.
3613 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3615 2000-08-31 Juergen Vigna <jug@sad.it>
3617 * src/insets/figinset.C: Various changes to look if the filename has
3618 an extension and if not add it for inline previewing.
3620 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3622 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3623 make buttonStatus and isReadOnly be const methods. (also reflect
3624 this in derived classes.)
3626 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3627 (nextState): change to be static inline, pass the StateMachine as
3629 (PreferencesPolicy): remove casts
3630 (OkCancelPolicy): remvoe casts
3631 (OkCancelReadOnlyPolicy): remove casts
3632 (NoRepeatedApplyReadOnlyPolicy): remove casts
3633 (OkApplyCancelReadOnlyPolicy): remove casts
3634 (OkApplyCancelPolicy): remove casts
3635 (NoRepeatedApplyPolicy): remove casts
3637 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3639 * src/converter.C: added some using directives
3641 * src/frontends/ButtonPolicies.C: changes to overcome
3642 "need lvalue" error with DEC c++
3644 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3645 to WMHideCB for DEC c++
3647 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3649 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3650 to BulletBMTableCB for DEC c++
3652 2000-08-31 Allan Rae <rae@lyx.org>
3654 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3655 character dialog separately from old document dialogs combo_language.
3658 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3660 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3661 Removed LFUN_REF_CREATE.
3663 * src/MenuBackend.C: Added new tags: toc and references
3665 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3666 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3668 (add_toc, add_references): New methods.
3669 (create_submenu): Handle correctly the case when there is a
3670 seperator after optional menu items.
3672 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3673 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3674 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3676 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3678 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3680 * src/converter.[Ch]: New file for converting between different
3683 * src/export.[Ch]: New file for exporting a LyX file to different
3686 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3687 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3688 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3689 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3690 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3691 RunDocBook, MenuExport.
3693 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3694 Exporter::Preview methods if NEW_EXPORT is defined.
3696 * src/buffer.C (Dispatch): Use Exporter::Export.
3698 * src/lyxrc.C: Added new tags: \converter and \viewer.
3701 * src/LyXAction.C: Define new lyx-function: buffer-update.
3702 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3703 when NEW_EXPORT is defined.
3705 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3707 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3709 * lib/ui/default.ui: Added submenus "view" and "update" to the
3712 * src/filetools.C (GetExtension): New function.
3714 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3716 2000-08-29 Allan Rae <rae@lyx.org>
3718 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3720 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3721 (EnableDocumentLayout): removed
3722 (DisableDocumentLayout): removed
3723 (build): make use of ButtonController's read-only handling to
3724 de/activate various objects. Replaces both of the above functions.
3726 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3727 (readOnly): was read_only
3728 (refresh): fixed dumb mistakes with read_only_ handling
3730 * src/frontends/xforms/forms/form_document.fd:
3731 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3732 tabbed dialogs so the tabs look more like tabs and so its easier to
3733 work out which is the current tab.
3735 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3736 segfault with form_table
3738 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3740 2000-08-28 Juergen Vigna <jug@sad.it>
3742 * acconfig.h: added USE_PSPELL.
3744 * src/config.h.in: added USE_PSPELL.
3746 * autogen.sh: added pspell.m4
3748 * config/pspell.m4: new file.
3750 * src/spellchecker.C: implemented support for pspell libary.
3752 2000-08-25 Juergen Vigna <jug@sad.it>
3754 * src/LyXAction.C (init): renamed LFUN_TABLE to
3755 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3757 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3759 * src/lyxscreen.h: add force_clear variable and fuction to force
3760 a clear area when redrawing in LyXText.
3762 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3764 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3766 * some whitespace and comment changes.
3768 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3770 * src/buffer.C: up te LYX_FORMAT to 2.17
3772 2000-08-23 Juergen Vigna <jug@sad.it>
3774 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3777 * src/insets/insettabular.C (pasteSelection): delete the insets
3778 LyXText as it is not valid anymore.
3779 (copySelection): new function.
3780 (pasteSelection): new function.
3781 (cutSelection): new function.
3782 (LocalDispatch): implemented cut/copy/paste of cell selections.
3784 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3785 don't have a LyXText.
3787 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3789 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3792 2000-08-22 Juergen Vigna <jug@sad.it>
3794 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3795 ifdef form_table out if NEW_TABULAR.
3797 2000-08-21 Juergen Vigna <jug@sad.it>
3799 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3800 (draw): fixed draw position so that the cursor is positioned in the
3802 (InsetMotionNotify): hide/show cursor so the position is updated.
3803 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3804 using cellstart() function where it should be used.
3806 * src/insets/insettext.C (draw): ditto.
3808 * src/tabular.C: fixed initialization of some missing variables and
3809 made BoxType into an enum.
3811 2000-08-22 Marko Vendelin <markov@ioc.ee>
3812 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3813 stock menu item using action numerical value, not its string
3817 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3819 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3820 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3822 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3824 * src/frontends/xforms/GUIRunTime.C: new file
3826 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3827 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3829 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3831 * src/frontends/kde/GUIRunTime.C: new file
3833 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3834 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3836 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3838 * src/frontends/gnome/GUIRunTime.C: new file
3840 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3843 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3844 small change to documetentation.
3846 * src/frontends/GUIRunTime.C: removed file
3848 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3850 * src/lyxparagraph.h: enable NEW_TABULAR as default
3852 * src/lyxfunc.C (processKeySym): remove some commented code
3854 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3855 NEW_TABULAR around the fd_form_table_options.
3857 * src/lyx_gui.C (runTime): call the static member function as
3858 GUIRunTime::runTime().
3860 2000-08-21 Allan Rae <rae@lyx.org>
3862 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3865 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3867 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3869 2000-08-21 Allan Rae <rae@lyx.org>
3871 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3872 keep Garst happy ;-)
3873 * src/frontends/xforms/FormPreferences.C (build): use setOK
3874 * src/frontends/xforms/FormDocument.C (build): use setOK
3875 (FormDocument): use the appropriate policy.
3877 2000-08-21 Allan Rae <rae@lyx.org>
3879 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3880 automatic [de]activation of arbitrary objects when in a read-only state.
3882 * src/frontends/ButtonPolicies.h: More documentation
3883 (isReadOnly): added to support the above.
3885 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3887 2000-08-18 Juergen Vigna <jug@sad.it>
3889 * src/insets/insettabular.C (getStatus): changed to return func_status.
3891 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3892 display toggle menu entries if they are.
3894 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3895 new document layout now.
3897 * src/lyxfunc.C: ditto
3899 * src/lyx_gui_misc.C: ditto
3901 * src/lyx_gui.C: ditto
3903 * lib/ui/default.ui: removed paper and quotes layout as they are now
3904 all in the document layout tabbed folder.
3906 * src/frontends/xforms/forms/form_document.fd: added Restore
3907 button and callbacks for all inputs for Allan's ButtonPolicy.
3909 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3910 (CheckChoiceClass): added missing params setting on class change.
3911 (UpdateLayoutDocument): added for updating the layout on params.
3912 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3913 (FormDocument): Implemented Allan's ButtonPolicy with the
3916 2000-08-17 Allan Rae <rae@lyx.org>
3918 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3919 so we can at least see the credits again.
3921 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3922 controller calls for the appropriate callbacks. Note that since Ok
3923 calls apply followed by cancel, and apply isn't a valid input for the
3924 APPLIED state, the bc_ calls have to be made in the static callback not
3925 within each of the real callbacks.
3927 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3928 (setOk): renamed from setOkay()
3930 2000-08-17 Juergen Vigna <jug@sad.it>
3932 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3933 in the implementation part.
3934 (composeUIInfo): don't show optional menu-items.
3936 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3938 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3940 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3941 text-state when in a text-inset.
3943 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3945 2000-08-17 Marko Vendelin <markov@ioc.ee>
3946 * src/frontends/gnome/FormIndex.C
3947 * src/frontends/gnome/FormIndex.h
3948 * src/frontends/gnome/FormToc.C
3949 * src/frontends/gnome/FormToc.h
3950 * src/frontends/gnome/dialogs
3951 * src/frontends/gnome/diatoc_callbacks.c
3952 * src/frontends/gnome/diatoc_callbacks.h
3953 * src/frontends/gnome/diainsertindex_callbacks.h
3954 * src/frontends/gnome/diainsertindex_callbacks.c
3955 * src/frontends/gnome/diainsertindex_interface.c
3956 * src/frontends/gnome/diainsertindex_interface.h
3957 * src/frontends/gnome/diatoc_interface.h
3958 * src/frontends/gnome/diatoc_interface.c
3959 * src/frontends/gnome/Makefile.am: Table of Contents and
3960 Insert Index dialogs implementation for Gnome frontend
3962 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3964 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3966 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3969 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3971 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3972 destructor. Don't definde if you don't need it
3973 (processEvents): made static, non-blocking events processing for
3975 (runTime): static method. event loop for xforms
3976 * similar as above for kde and gnome.
3978 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3979 new Pimpl is correct
3980 (runTime): new method calss the real frontends runtime func.
3982 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3984 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3986 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3988 2000-08-16 Juergen Vigna <jug@sad.it>
3990 * src/lyx_gui.C (runTime): added GUII RunTime support.
3992 * src/frontends/Makefile.am:
3993 * src/frontends/GUIRunTime.[Ch]:
3994 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3995 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3996 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3998 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4000 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4001 as this is already set in ${FRONTEND_INCLUDE} if needed.
4003 * configure.in (CPPFLAGS): setting the include dir for the frontend
4004 directory and don't set FRONTEND=xforms for now as this is executed
4007 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4009 * src/frontends/kde/Makefile.am:
4010 * src/frontends/kde/FormUrl.C:
4011 * src/frontends/kde/FormUrl.h:
4012 * src/frontends/kde/formurldialog.h:
4013 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4015 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4017 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4019 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4021 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4024 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4026 * src/WorkArea.C (work_area_handler): more work to get te
4027 FL_KEYBOARD to work with xforms 0.88 too, please test.
4029 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4031 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4033 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4036 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4038 * src/Timeout.h: remove Qt::emit hack.
4040 * several files: changes to allo doc++ compilation
4042 * src/lyxfunc.C (processKeySym): new method
4043 (processKeyEvent): comment out if FL_REVISION < 89
4045 * src/WorkArea.C: change some debugging levels.
4046 (WorkArea): set wantkey to FL_KEY_ALL
4047 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4048 clearer code and the use of compose with XForms 0.89. Change to
4049 use signals instead of calling methods in bufferview directly.
4051 * src/Painter.C: change some debugging levels.
4053 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4056 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4057 (workAreaKeyPress): new method
4059 2000-08-14 Juergen Vigna <jug@sad.it>
4061 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4063 * config/kde.m4: addes some features
4065 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4066 include missing xforms dialogs.
4068 * src/Timeout.h: a hack to be able to compile with qt/kde.
4070 * sigc++/.cvsignore: added acinclude.m4
4072 * lib/.cvsignore: added listerros
4074 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4075 xforms tree as objects are needed for other frontends.
4077 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4078 linking with not yet implemented xforms objects.
4080 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4082 2000-08-14 Baruch Even <baruch.even@writeme.com>
4084 * src/frontends/xforms/FormGraphics.h:
4085 * src/frontends/xforms/FormGraphics.C:
4086 * src/frontends/xforms/RadioButtonGroup.h:
4087 * src/frontends/xforms/RadioButtonGroup.C:
4088 * src/insets/insetgraphics.h:
4089 * src/insets/insetgraphics.C:
4090 * src/insets/insetgraphicsParams.h:
4091 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4092 instead of spaces, and various other indentation issues to make the
4093 sources more consistent.
4095 2000-08-14 Marko Vendelin <markov@ioc.ee>
4097 * src/frontends/gnome/dialogs/diaprint.glade
4098 * src/frontends/gnome/FormPrint.C
4099 * src/frontends/gnome/FormPrint.h
4100 * src/frontends/gnome/diaprint_callbacks.c
4101 * src/frontends/gnome/diaprint_callbacks.h
4102 * src/frontends/gnome/diaprint_interface.c
4103 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4106 * src/frontends/gnome/dialogs/diainserturl.glade
4107 * src/frontends/gnome/FormUrl.C
4108 * src/frontends/gnome/FormUrl.h
4109 * src/frontends/gnome/diainserturl_callbacks.c
4110 * src/frontends/gnome/diainserturl_callbacks.h
4111 * src/frontends/gnome/diainserturl_interface.c
4112 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4113 Gnome implementation
4115 * src/frontends/gnome/Dialogs.C
4116 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4117 all other dialogs. Copy all unimplemented dialogs from Xforms
4120 * src/frontends/gnome/support.c
4121 * src/frontends/gnome/support.h: support files generated by Glade
4125 * config/gnome.m4: Gnome configuration scripts
4127 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4128 configure --help message
4130 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4131 only if there are no events pendling in Gnome/Gtk. This enhances
4132 the performance of menus.
4135 2000-08-14 Allan Rae <rae@lyx.org>
4137 * lib/Makefile.am: listerrors cleaning
4139 * lib/listerrors: removed -- generated file
4140 * acinclude.m4: ditto
4141 * sigc++/acinclude.m4: ditto
4143 * src/frontends/xforms/forms/form_citation.fd:
4144 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4147 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4148 `updatesrc` and now we have a `test` target that does what `updatesrc`
4149 used to do. I didn't like having an install target that wasn't related
4152 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4153 on all except FormGraphics. This may yet happen. Followed by a major
4154 cleanup including using FL_TRANSIENT for most of the dialogs. More
4155 changes to come when the ButtonController below is introduced.
4157 * src/frontends/xforms/ButtonController.h: New file for managing up to
4158 four buttons on a dialog according to an externally defined policy.
4159 * src/frontends/xforms/Makefile.am: added above
4161 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4162 Apply and Cancel/Close buttons and everything in between and beyond.
4163 * src/frontends/Makefile.am: added above.
4165 * src/frontends/xforms/forms/form_preferences.fd:
4166 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4167 and removed variable 'status' as a result. Fixed the set_minsize thing.
4168 Use the new screen-font-update after checking screen fonts were changed
4169 Added a "Restore" button to restore the original lyxrc values while
4170 editing. This restores everything not just the last input changed.
4171 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4173 * src/LyXAction.C: screen-font-update added for updating buffers after
4174 screen font settings have been changed.
4175 * src/commandtags.h: ditto
4176 * src/lyxfunc.C: ditto
4178 * forms/lyx.fd: removed screen fonts dialog.
4179 * src/lyx_gui.C: ditto
4180 * src/menus.[Ch]: ditto
4181 * src/lyx.[Ch]: ditto
4182 * src/lyx_cb.C: ditto + code from here moved to make
4183 screen-font-update. And people wonder why progress on GUII is
4184 slow. Look at how scattered this stuff was! It takes forever
4187 * forms/fdfix.sh: Fixup the spacing after commas.
4188 * forms/makefile: Remove date from generated files. Fewer clashes now.
4189 * forms/bullet_forms.C.patch: included someones handwritten changes
4191 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4192 once I've discovered why LyXRC was made noncopyable.
4193 * src/lyx_main.C: ditto
4195 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4197 * src/frontends/xforms/forms/fdfix.sh:
4198 * src/frontends/xforms/forms/fdfixh.sed:
4199 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4200 * src/frontends/xforms/Form*.[hC]:
4201 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4202 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4203 provide a destructor for the struct FD_form_xxxx. Another version of
4204 the set_[max|min]size workaround and a few other cleanups. Actually,
4205 Angus' patch from 20000809.
4207 2000-08-13 Baruch Even <baruch.even@writeme.com>
4209 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4212 2000-08-11 Juergen Vigna <jug@sad.it>
4214 * src/insets/insetgraphics.C (InsetGraphics): changing init
4215 order because of warnings.
4217 * src/frontends/xforms/forms/makefile: adding patching .C with
4220 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4221 from .C.patch to .c.patch
4223 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4224 order because of warning.
4226 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4228 * src/frontends/Liason.C (setMinibuffer): new helper function
4230 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4232 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4234 * lib/ui/default.ui: commented out PaperLayout entry
4236 * src/frontends/xforms/form_document.[Ch]: new added files
4238 * src/frontends/xforms/FormDocument.[Ch]: ditto
4240 * src/frontends/xforms/forms/form_document.fd: ditto
4242 * src/frontends/xforms/forms/form_document.C.patch: ditto
4244 2000-08-10 Juergen Vigna <jug@sad.it>
4246 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4247 (InsetGraphics): initialized cacheHandle to 0.
4248 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4250 2000-08-10 Baruch Even <baruch.even@writeme.com>
4252 * src/graphics/GraphicsCache.h:
4253 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4254 correctly as a cache.
4256 * src/graphics/GraphicsCacheItem.h:
4257 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4260 * src/graphics/GraphicsCacheItem_pimpl.h:
4261 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4264 * src/insets/insetgraphics.h:
4265 * src/insets/insetgraphics.C: Changed from using a signal notification
4266 to polling when image is not loaded.
4268 2000-08-10 Allan Rae <rae@lyx.org>
4270 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4271 that there are two functions that have to been taken out of line by
4272 hand and aren't taken care of in the script. (Just a reminder note)
4274 * sigc++/macros/*.h.m4: Updated as above.
4276 2000-08-09 Juergen Vigna <jug@sad.it>
4278 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4280 * src/insets/insettabular.C: make drawing of single cell smarter.
4282 2000-08-09 Marko Vendelin <markov@ioc.ee>
4283 * src/frontends/gnome/Menubar_pimpl.C
4284 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4285 implementation: new files
4287 * src/frontends/gnome/mainapp.C
4288 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4291 * src/main.C: create Gnome main window
4293 * src/frontends/xforms/Menubar_pimpl.h
4294 * src/frontends/Menubar.C
4295 * src/frontends/Menubar.h: added method Menubar::update that calls
4296 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4298 * src/LyXView.C: calls Menubar::update to update the state
4301 * src/frontends/gnome/Makefile.am: added new files
4303 * src/frontends/Makefile.am: added frontend compiler options
4305 2000-08-08 Juergen Vigna <jug@sad.it>
4307 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4309 * src/bufferlist.C (close):
4310 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4311 documents if exiting without saving.
4313 * src/buffer.C (save): use removeAutosaveFile()
4315 * src/support/filetools.C (removeAutosaveFile): new function.
4317 * src/lyx_cb.C (MenuWrite): returns a bool now.
4318 (MenuWriteAs): check if file could really be saved and revert to the
4320 (MenuWriteAs): removing old autosavefile if existant.
4322 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4323 before Goto toggle declaration, because of compiler warning.
4325 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4327 * src/lyxfunc.C (MenuNew): small fix.
4329 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4331 * src/bufferlist.C (newFile):
4332 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4334 * src/lyxrc.C: added new_ask_filename tag
4336 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4338 * src/lyx.fd: removed code pertaining to form_ref
4339 * src/lyx.[Ch]: ditto
4340 * src/lyx_cb.C: ditto
4341 * src/lyx_gui.C: ditto
4342 * src/lyx_gui_misc.C: ditto
4344 * src/BufferView_pimpl.C (restorePosition): update buffer only
4347 * src/commandtags.h (LFUN_REFTOGGLE): removed
4348 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4349 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4350 (LFUN_REFBACK): renamed LFUN_REF_BACK
4352 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4353 * src/menus.C: ditto
4354 * src/lyxfunc.C (Dispatch): ditto.
4355 InsertRef dialog is now GUI-independent.
4357 * src/texrow.C: added using std::endl;
4359 * src/insets/insetref.[Ch]: strip out large amounts of code.
4360 The inset is now a container and this functionality is now
4361 managed by a new FormRef dialog
4363 * src/frontends/Dialogs.h (showRef, createRef): new signals
4365 * src/frontends/xforms/FormIndex.[Ch],
4366 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4367 when setting dialog's min/max size
4368 * src/frontends/xforms/FormIndex.[Ch]: ditto
4370 * src/frontends/xforms/FormRef.[Ch],
4371 src/frontends/xforms/forms/form_ref.fd: new xforms
4372 implementation of an InsetRef dialog
4374 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4377 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4378 ios::nocreate is not part of the standard. Removed.
4380 2000-08-07 Baruch Even <baruch.even@writeme.com>
4382 * src/graphics/Renderer.h:
4383 * src/graphics/Renderer.C: Added base class for rendering of different
4384 image formats into Pixmaps.
4386 * src/graphics/XPM_Renderer.h:
4387 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4388 in a different class.
4390 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4391 easily add support for other formats.
4393 * src/insets/figinset.C: plugged a leak of an X resource.
4395 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4397 * src/CutAndPaste.[Ch]: make all metods static.
4399 * development/Code_rules/Rules: more work, added section on
4400 Exceptions, and a References section.
4402 * a lot of header files: work to make doc++ able to generate the
4403 source documentation, some workarounds of doc++ problems. Doc++ is
4404 now able to generate the documentation.
4406 2000-08-07 Juergen Vigna <jug@sad.it>
4408 * src/insets/insettabular.C (recomputeTextInsets): removed function
4410 * src/tabular.C (SetWidthOfMulticolCell):
4412 (calculate_width_of_column_NMC): fixed return value so that it really
4413 only returns true if the column-width has changed (there where
4414 problems with muliticolumn-cells in this column).
4416 2000-08-04 Juergen Vigna <jug@sad.it>
4418 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4419 also on the scrollstatus of the inset.
4420 (workAreaMotionNotify): ditto.
4422 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4424 2000-08-01 Juergen Vigna <jug@sad.it>
4426 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4428 * src/commandtags.h:
4429 * src/LyXAction.C (init):
4430 * src/insets/inset.C (LocalDispatch): added support for
4433 * src/insets/inset.C (scroll): new functions.
4435 * src/insets/insettext.C (removeNewlines): new function.
4436 (SetAutoBreakRows): removes forced newlines in the text of the
4437 paragraph if autoBreakRows is set to false.
4439 * src/tabular.C (Latex): generates a parbox around the cell contents
4442 * src/frontends/xforms/FormTabular.C (local_update): removed
4443 the radio_useparbox button.
4445 * src/tabular.C (UseParbox): new function
4447 2000-08-06 Baruch Even <baruch.even@writeme.com>
4449 * src/graphics/GraphicsCache.h:
4450 * src/graphics/GraphicsCache.C:
4451 * src/graphics/GraphicsCacheItem.h:
4452 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4455 * src/insets/insetgraphics.h:
4456 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4457 and the drawing of the inline image.
4459 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4460 loaded into the wrong position.
4462 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4465 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4467 * src/support/translator.h: move all typedefs to public section
4469 * src/support/filetools.C (MakeLatexName): return string const
4471 (TmpFileName): ditto
4472 (FileOpenSearch): ditto
4474 (LibFileSearch): ditto
4475 (i18nLibFileSearch): ditto
4478 (CreateTmpDir): ditto
4479 (CreateBufferTmpDir): ditto
4480 (CreateLyXTmpDir): ditto
4483 (MakeAbsPath): ditto
4485 (OnlyFilename): ditto
4487 (NormalizePath): ditto
4488 (CleanupPath): ditto
4489 (GetFileContents): ditto
4490 (ReplaceEnvironmentPath): ditto
4491 (MakeRelPath): ditto
4493 (ChangeExtension): ditto
4494 (MakeDisplayPath): ditto
4495 (do_popen): return cmdret const
4496 (findtexfile): return string const
4498 * src/support/DebugStream.h: add some /// to please doc++
4500 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4502 * src/texrow.C (same_rownumber): functor to use with find_if
4503 (getIdFromRow): rewritten to use find_if and to not update the
4504 positions. return true if row is found
4505 (increasePos): new method, use to update positions
4507 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4509 * src/lyxlex_pimpl.C (verifyTable): new method
4512 (GetString): return string const
4513 (pushTable): rewrite to use std::stack
4515 (setFile): better check
4518 * src/lyxlex.h: make LyXLex noncopyable
4520 * src/lyxlex.C (text): return char const * const
4521 (GetString): return string const
4522 (getLongString): return string const
4524 * src/lyx_gui_misc.C (askForText): return pair<...> const
4526 * src/lastfiles.[Ch] (operator): return string const
4528 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4529 istringstream not char const *.
4530 move token.end() out of loop.
4531 (readFile): move initializaton of token
4533 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4534 getIdFromRow is successful.
4536 * lib/bind/emacs.bind: don't include menus bind
4538 * development/Code_rules/Rules: the beginnings of making this
4539 better and covering more of the unwritten rules that we have.
4541 * development/Code_rules/Recommendations: a couple of wording
4544 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4546 * src/support/strerror.c: remove C++ comment.
4548 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4550 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4551 LFUN_INDEX_INSERT_LAST
4553 * src/texrow.C (getIdFromRow): changed from const_iterator to
4554 iterator, allowing code to compile with DEC cxx
4556 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4557 stores part of the class, as suggested by Allan. Will allow
4559 (apply): test to apply uses InsetCommandParams operator!=
4561 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4562 (apply): test to apply uses InsetCommandParams operator!=
4564 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4565 stores part of the class.
4566 (update): removed limits on min/max size.
4568 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4569 (apply): test to apply uses InsetCommandParams operator!=
4571 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4572 (Read, Write, scanCommand, getCommand): moved functionality
4573 into InsetCommandParams.
4575 (getScreenLabel): made pure virtual
4576 new InsetCommandParams operators== and !=
4578 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4579 c-tors based on InsetCommandParams. Removed others.
4580 * src/insets/insetinclude.[Ch]: ditto
4581 * src/insets/insetlabel.[Ch]: ditto
4582 * src/insets/insetparent.[Ch]: ditto
4583 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4585 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4586 insets derived from InsetCommand created using similar c-tors
4587 based on InsetCommandParams
4588 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4589 * src/menus.C (ShowRefsMenu): ditto
4590 * src/paragraph.C (Clone): ditto
4591 * src/text2.C (SetCounter): ditto
4592 * src/lyxfunc.C (Dispatch) ditto
4593 Also recreated old InsetIndex behaviour exactly. Can now
4594 index-insert at the start of a paragraph and index-insert-last
4595 without launching the pop-up.
4597 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4599 * lib/lyxrc.example: mark te pdf options as non functional.
4601 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4602 (isStrDbl): move tmpstr.end() out of loop.
4603 (strToDbl): move intialization of tmpstr
4604 (lowercase): return string const and move tmp.end() out of loop.
4605 (uppercase): return string const and move tmp.edn() out of loop.
4606 (prefixIs): add assertion
4611 (containsOnly): ditto
4612 (containsOnly): ditto
4613 (containsOnly): ditto
4614 (countChar): make last arg char not char const
4615 (token): return string const
4616 (subst): return string const, move tmp.end() out of loop.
4617 (subst): return string const, add assertion
4618 (strip): return string const
4619 (frontStrip): return string const, add assertion
4620 (frontStrip): return string const
4625 * src/support/lstrings.C: add inclde "LAssert.h"
4626 (isStrInt): move tmpstr.end() out of loop.
4628 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4629 toollist.end() out of loop.
4630 (deactivate): move toollist.end() out of loop.
4631 (update): move toollist.end() out of loop.
4632 (updateLayoutList): move tc.end() out of loop.
4633 (add): move toollist.end() out of loop.
4635 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4636 md.end() out of loop.
4638 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4640 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4643 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4644 (Erase): move insetlist.end() out of loop.
4646 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4647 ref to const string as first arg. Move initialization of some
4648 variables, whitespace changes.
4650 * src/kbmap.C (defkey): move table.end() out of loop.
4651 (kb_keymap): move table.end() out of loop.
4652 (findbinding): move table.end() out of loop.
4654 * src/MenuBackend.C (hasMenu): move end() out of loop.
4655 (getMenu): move end() out of loop.
4656 (getMenu): move menulist_.end() out of loop.
4658 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4660 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4663 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4664 (getFromLyXName): move infotab.end() out of loop.
4666 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4667 -fvtable-thunks -ffunction-sections -fdata-sections
4669 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4671 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4674 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4676 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4678 * src/frontends/xforms/FormCitation.[Ch],
4679 src/frontends/xforms/FormIndex.[Ch],
4680 src/frontends/xforms/FormToc.[Ch],
4681 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4683 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4685 * src/commandtags.h: renamed, created some flags for citation
4688 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4690 * src/lyxfunc.C (dispatch): use signals to insert index entry
4692 * src/frontends/Dialogs.h: new signal createIndex
4694 * src/frontends/xforms/FormCommand.[Ch],
4695 src/frontends/xforms/FormCitation.[Ch],
4696 src/frontends/xforms/FormToc.[Ch],
4697 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4699 * src/insets/insetindex.[Ch]: GUI-independent
4701 * src/frontends/xforms/FormIndex.[Ch],
4702 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4705 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4707 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4708 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4710 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4712 * src/insets/insetref.C (Latex): rewrite so that there is now
4713 question that a initialization is requested.
4715 * src/insets/insetcommand.h: reenable the hide signal
4717 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4719 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4720 fix handling of shortcuts (many bugs :)
4721 (add_lastfiles): ditto.
4723 * lib/ui/default.ui: fix a few shortcuts.
4725 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4727 * Makefile.am: Fix ``rpmdist'' target to return the exit
4728 status of the ``rpm'' command, instead of the last command in
4729 the chain (the ``rm lyx.xpm'' command, which always returns
4732 2000-08-02 Allan Rae <rae@lyx.org>
4734 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4735 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4736 * src/frontends/xforms/FormToc.C (FormToc): ditto
4738 * src/frontends/xforms/Makefile.am: A few forgotten files
4740 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4741 Signals-not-copyable-problem Lars' started commenting out.
4743 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4745 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4747 * src/insets/insetcommand.h: Signals is not copyable so anoter
4748 scheme for automatic hiding of forms must be used.
4750 * src/frontends/xforms/FormCitation.h: don't inerit from
4751 noncopyable, FormCommand already does that.
4752 * src/frontends/xforms/FormToc.h: ditto
4753 * src/frontends/xforms/FormUrl.h: ditto
4755 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4757 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4759 * src/insets/insetcommand.h (hide): new SigC::Signal0
4760 (d-tor) new virtual destructor emits hide signal
4762 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4763 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4765 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4766 LOF and LOT. Inset is now GUI-independent
4768 * src/insets/insetloa.[Ch]: redundant
4769 * src/insets/insetlof.[Ch]: ditto
4770 * src/insets/insetlot.[Ch]: ditto
4772 * src/frontends/xforms/forms/form_url.fd: tweaked!
4773 * src/frontends/xforms/forms/form_citation.fd: ditto
4775 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4776 dialogs dealing with InsetCommand insets
4778 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4779 FormCommand base class
4780 * src/frontends/xforms/FormUrl.[Ch]: ditto
4782 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4784 * src/frontends/xforms/FormToc.[Ch]: ditto
4786 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4787 passed a generic InsetCommand pointer
4788 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4790 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4791 and modified InsetTOC class
4792 * src/buffer.C: ditto
4794 * forms/lyx.fd: strip out old FD_form_toc code
4795 * src/lyx_gui_misc.C: ditto
4796 * src/lyx_gui.C: ditto
4797 * src/lyx_cb.C: ditto
4798 * src/lyx.[Ch]: ditto
4800 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4802 * src/support/utility.hpp: tr -d '\r'
4804 2000-08-01 Juergen Vigna <jug@sad.it>
4806 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4808 * src/commandtags.h:
4809 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4810 LFUN_TABULAR_FEATURES.
4812 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4813 LFUN_LAYOUT_TABULAR.
4815 * src/insets/insettabular.C (getStatus): implemented helper function.
4817 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4819 2000-07-31 Juergen Vigna <jug@sad.it>
4821 * src/text.C (draw): fixed screen update problem for text-insets.
4823 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4824 something changed probably this has to be added in various other
4827 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4829 2000-07-31 Baruch Even <baruch.even@writeme.com>
4831 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4832 templates to satisfy compaq cxx.
4835 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4837 * src/support/translator.h (equal_1st_in_pair::operator()): take
4838 const ref pair_type as arg.
4839 (equal_2nd_in_pair::operator()): ditto
4840 (Translator::~Translator): remove empty d-tor.
4842 * src/graphics/GraphicsCache.C: move include config.h to top, also
4843 put initialization of GraphicsCache::singleton here.
4844 (~GraphicsCache): move here
4845 (addFile): take const ref as arg
4848 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4850 * src/BufferView2.C (insertLyXFile): change te with/without header
4853 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4855 * src/frontends/xforms/FormGraphics.C (apply): add some
4856 static_cast. Not very nice, but required by compaq cxx.
4858 * src/frontends/xforms/RadioButtonGroup.h: include header
4859 <utility> instead of <pair.h>
4861 * src/insets/insetgraphicsParams.C: add using directive.
4862 (readResize): change return type to void.
4863 (readOrigin): ditto.
4865 * src/lyxfunc.C (getStatus): add missing break for build-program
4866 function; add test for Literate for export functions.
4868 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4869 entries in Options menu.
4871 2000-07-31 Baruch Even <baruch.even@writeme.com>
4873 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4874 protect against auto-allocation; release icon when needed.
4876 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4878 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4879 on usual typewriter.
4881 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4882 earlier czech.kmap), useful only for programming.
4884 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4886 * src/frontends/xforms/FormCitation.h: fix conditioning around
4889 2000-07-31 Juergen Vigna <jug@sad.it>
4891 * src/frontends/xforms/FormTabular.C (local_update): changed
4892 radio_linebreaks to radio_useparbox and added radio_useminipage.
4894 * src/tabular.C: made support for using minipages/parboxes.
4896 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4898 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4900 (descent): so the cursor is in the middle.
4901 (width): bit smaller box.
4903 * src/insets/insetgraphics.h: added display() function.
4905 2000-07-31 Baruch Even <baruch.even@writeme.com>
4907 * src/frontends/Dialogs.h: Added showGraphics signals.
4909 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4910 xforms form definition of the graphics dialog.
4912 * src/frontends/xforms/FormGraphics.h:
4913 * src/frontends/xforms/FormGraphics.C: Added files, the
4914 GUIndependent code of InsetGraphics
4916 * src/insets/insetgraphics.h:
4917 * src/insets/insetgraphics.C: Major writing to make it work.
4919 * src/insets/insetgraphicsParams.h:
4920 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4921 struct between InsetGraphics and GUI.
4923 * src/LaTeXFeatures.h:
4924 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4925 support for graphicx package.
4927 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4928 for the graphics inset.
4930 * src/support/translator.h: Added file, used in
4931 InsetGraphicsParams. this is a template to translate between two
4934 * src/frontends/xforms/RadioButtonGroup.h:
4935 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4936 way to easily control a radio button group.
4938 2000-07-28 Juergen Vigna <jug@sad.it>
4940 * src/insets/insettabular.C (LocalDispatch):
4941 (TabularFeatures): added support for lyx-functions of tabular features.
4942 (cellstart): refixed this function after someone wrongly changed it.
4944 * src/commandtags.h:
4945 * src/LyXAction.C (init): added support for tabular-features
4947 2000-07-28 Allan Rae <rae@lyx.org>
4949 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4950 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4951 triggers the callback for input checking. As a result we sometimes get
4952 "LyX: This shouldn't happen..." printed to cerr.
4953 (input): Started using status variable since I only free() on
4954 destruction. Some input checking for paths and font sizes.
4956 * src/frontends/xforms/FormPreferences.h: Use status to control
4957 activation of Ok and Apply
4959 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4960 callback. Also resized to stop segfaults with 0.88. The problem is
4961 that xforms-0.88 requires the folder to be wide enough to fit all the
4962 tabs. If it isn't it causes all sorts of problems.
4964 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4966 * src/frontends/xforms/forms/README: Reflect reality.
4968 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4969 * src/frontends/xforms/forms/makefile: ditto.
4971 * src/commandtags.h: Get access to new Preferences dialog
4972 * src/LyXAction.C: ditto
4973 * src/lyxfunc.C: ditto
4974 * lib/ui/default.ui: ditto
4976 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4978 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4980 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4983 * src/frontends/xforms/form_url.[Ch]: added.
4985 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4987 * src/insets/insetbib.h: fixed bug in previous commit
4989 * src/frontends/xforms/FormUrl.h: ditto
4991 * src/frontends/xforms/FormPrint.h: ditto
4993 * src/frontends/xforms/FormPreferences.h: ditto
4995 * src/frontends/xforms/FormCopyright.h: ditto
4997 * src/frontends/xforms/FormCitation.C: ditto
4999 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5000 private copyconstructor and private default contructor
5002 * src/support/Makefile.am: add utility.hpp
5004 * src/support/utility.hpp: new file from boost
5006 * src/insets/insetbib.h: set owner in clone
5008 * src/frontends/xforms/FormCitation.C: added missing include
5011 * src/insets/form_url.[Ch]: removed
5013 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5015 * development/lyx.spec.in
5016 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5017 file/directory re-organization.
5019 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5021 * src/insets/insetcommand.[Ch]: moved the string data and
5022 associated manipulation methods into a new stand-alone class
5023 InsetCommandParams. This class has two additional methods
5024 getAsString() and setFromString() allowing the contents to be
5025 moved around as a single string.
5026 (addContents) method removed.
5027 (setContents) method no longer virtual.
5029 * src/buffer.C (readInset): made use of new InsetCitation,
5030 InsetUrl constructors based on InsetCommandParams.
5032 * src/commandtags.h: add LFUN_INSERT_URL
5034 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5035 independent InsetUrl and use InsetCommandParams to extract
5036 string info and create new Insets.
5038 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5040 * src/frontends/xforms/FormCitation.C (apply): uses
5043 * src/frontends/xforms/form_url.C
5044 * src/frontends/xforms/form_url.h
5045 * src/frontends/xforms/FormUrl.h
5046 * src/frontends/xforms/FormUrl.C
5047 * src/frontends/xforms/forms/form_url.fd: new files
5049 * src/insets/insetcite.[Ch]: removed unused constructors.
5051 * src/insets/insetinclude.[Ch]: no longer store filename
5053 * src/insets/inseturl.[Ch]: GUI-independent.
5055 2000-07-26 Juergen Vigna <jug@sad.it>
5056 * renamed frontend from gtk to gnome as it is that what is realized
5057 and did the necessary changes in the files.
5059 2000-07-26 Marko Vendelin <markov@ioc.ee>
5061 * configure.in: cleaning up gnome configuration scripts
5063 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5065 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5066 shortcuts syndrom by redrawing them explicitely (a better solution
5067 would be appreciated).
5069 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5071 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5074 * src/lyx_cb.C (MenuExport): change html export to do the right
5075 thing depending of the document type (instead of having
5076 html-linuxdoc and html-docbook).
5077 * src/lyxfunc.C (getStatus): update for html
5078 * lib/ui/default.ui: simplify due to the above change.
5079 * src/menus.C (ShowFileMenu): update too (in case we need it).
5081 * src/MenuBackend.C (read): if a menu is defined twice, add the
5082 new entries to the exiting one.
5084 2000-07-26 Juergen Vigna <jug@sad.it>
5086 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5088 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5089 and return a bool if it did actual save the file.
5090 (AutoSave): don't autosave a unnamed doc.
5092 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5093 check if this is an UNNAMED new file and react to it.
5094 (newFile): set buffer to unnamed and change to not mark a new
5095 buffer dirty if I didn't do anything with it.
5097 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5099 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5101 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5102 friend as per Angus's patch posted to lyx-devel.
5104 * src/ext_l10n.h: updated
5106 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5107 gettext on the style string right before inserting them into the
5110 * autogen.sh: add code to extract style strings form layout files,
5111 not good enough yet.
5113 * src/frontends/gtk/.cvsignore: add MAKEFILE
5115 * src/MenuBackend.C (read): run the label strings through gettext
5116 before storing them in the containers.
5118 * src/ext_l10n.h: new file
5120 * autogen.sh : generate the ext_l10n.h file here
5122 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5124 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5127 * lib/ui/default.ui: fix a couple of typos.
5129 * config/gnome/gtk.m4: added (and added to the list of files in
5132 * src/insets/insetinclude.C (unique_id): fix when we are using
5133 lyxstring instead of basic_string<>.
5134 * src/insets/insettext.C (LocalDispatch): ditto.
5135 * src/support/filetools.C: ditto.
5137 * lib/configure.m4: create the ui/ directory if necessary.
5139 * src/LyXView.[Ch] (updateToolbar): new method.
5141 * src/BufferView_pimpl.C (buffer): update the toolbar when
5142 opening/closing buffer.
5144 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5146 * src/LyXAction.C (getActionName): enhance to return also the name
5147 and options of pseudo-actions.
5148 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5150 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5151 as an example of what is possible). Used in File->Build too (more
5152 useful) and in the import/export menus (to mimick the complicated
5153 handling of linuxdoc and friends). Try to update all the entries.
5155 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5158 * src/MenuBackend.C (read): Parse the new OptItem tag.
5160 * src/MenuBackend.h: Add a new optional_ data member (used if the
5161 entry should be omitted when the lyxfunc is disabled).
5163 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5164 function, used as a shortcut.
5165 (create_submenu): align correctly the shortcuts on the widest
5168 * src/MenuBackend.h: MenuItem.label() only returns the label of
5169 the menu without shortcut; new method shortcut().
5171 2000-07-14 Marko Vendelin <markov@ioc.ee>
5173 * src/frontends/gtk/Dialogs.C:
5174 * src/frontends/gtk/FormCopyright.C:
5175 * src/frontends/gtk/FormCopyright.h:
5176 * src/frontends/gtk/Makefile.am: added these source-files for the
5177 Gtk/Gnome support of the Copyright-Dialog.
5179 * src/main.C: added Gnome::Main initialization if using
5180 Gtk/Gnome frontend-GUI.
5182 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5184 * config/gnome/aclocal-include.m4
5185 * config/gnome/compiler-flags.m4
5186 * config/gnome/curses.m4
5187 * config/gnome/gnome--.m4
5188 * config/gnome/gnome-bonobo-check.m4
5189 * config/gnome/gnome-common.m4
5190 * config/gnome/gnome-fileutils.m4
5191 * config/gnome/gnome-ghttp-check.m4
5192 * config/gnome/gnome-gnorba-check.m4
5193 * config/gnome/gnome-guile-checks.m4
5194 * config/gnome/gnome-libgtop-check.m4
5195 * config/gnome/gnome-objc-checks.m4
5196 * config/gnome/gnome-orbit-check.m4
5197 * config/gnome/gnome-print-check.m4
5198 * config/gnome/gnome-pthread-check.m4
5199 * config/gnome/gnome-support.m4
5200 * config/gnome/gnome-undelfs.m4
5201 * config/gnome/gnome-vfs.m4
5202 * config/gnome/gnome-x-checks.m4
5203 * config/gnome/gnome-xml-check.m4
5204 * config/gnome/gnome.m4
5205 * config/gnome/gperf-check.m4
5206 * config/gnome/gtk--.m4
5207 * config/gnome/linger.m4
5208 * config/gnome/need-declaration.m4: added configuration scripts
5209 for Gtk/Gnome frontend-GUI
5211 * configure.in: added support for the --with-frontend=gtk option
5213 * autogen.sh: added config/gnome/* to list of config-files
5215 * acconfig.h: added define for GTKGUI-support
5217 * config/lyxinclude.m4: added --with-frontend[=value] option value
5218 for Gtk/Gnome frontend-GUI support.
5220 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5222 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5226 * src/paragraph.C (GetChar): remove non-const version
5228 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5229 (search_kw): use it.
5231 * src/lyx_main.C (init): if "preferences" exist, read that instead
5233 (ReadRcFile): return bool if the file could be read ok.
5234 (ReadUIFile): add a check to see if lex file is set ok.
5236 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5237 bastring can be used instead of lyxstring (still uses the old code
5238 if std::string is good enough or if lyxstring is used.)
5240 * src/encoding.C: make the arrays static, move ininle functions
5242 * src/encoding.h: from here.
5244 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5245 (parseSingleLyXformat2Token): move inset parsing to separate method
5246 (readInset): new private method
5248 * src/Variables.h: remove virtual from get().
5250 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5251 access to NEW_INSETS and NEW_TABULAR
5253 * src/MenuBackend.h: remove superfluous forward declaration of
5254 MenuItem. Add documentations tags "///", remove empty MenuItem
5255 destructor, remove private default contructor.
5257 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5259 (read): more string mlabel and mname to where they are used
5260 (read): remove unused variables mlabel and mname
5261 (defaults): unconditional clear, make menusetup take advantage of
5262 add returning Menu &.
5264 * src/LyXView.h: define NEW_MENUBAR as default
5266 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5267 to NEW_INSETS and NEW_TABULAR.
5268 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5269 defined. Change some of the "xxxx-inset-insert" functions names to
5272 * several files: more enahncements to NEW_INSETS and the resulting
5275 * lib/lyxrc.example (\date_insert_format): move to misc section
5277 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5278 bastring and use AC_CACHE_CHECK.
5279 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5280 the system have the newest methods. uses AC_CACHE_CHECK
5281 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5282 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5283 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5285 * configure.in: add LYX_CXX_GOOD_STD_STRING
5287 * acinclude.m4: recreated
5289 2000-07-24 Amir Karger <karger@lyx.org>
5291 * README: add Hebrew, Arabic kmaps
5294 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5296 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5299 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5301 * Lot of files: add pragma interface/implementation.
5303 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5305 * lib/ui/default.ui: new file (ans new directory). Contains the
5306 default menu and toolbar.
5308 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5309 global space. Toolbars are now read (as menus) in ui files.
5311 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5313 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5314 is disabled because the document is read-only. We want to have the
5315 toggle state of the function anyway.
5316 (getStatus): add code for LFUN_VC* functions (mimicking what is
5317 done in old-style menus)
5319 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5320 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5322 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5323 * src/BufferView_pimpl.C: ditto.
5324 * src/lyxfunc.C: ditto.
5326 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5327 default). This replaces old-style menus by new ones.
5329 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5330 MenuItem. Contain the data structure of a menu.
5332 * src/insets/insettext.C: use LyXView::setLayout instead of
5333 accessing directly the toolbar combox.
5334 * src/lyxfunc.C (Dispatch): ditto.
5336 * src/LyXView.C (setLayout): new method, which just calls
5337 Toolbar::setLayout().
5338 (updateLayoutChoice): move part of this method in Toolbar.
5340 * src/toolbar.[Ch]: removed.
5342 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5343 implementation the toolbar.
5345 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5346 the toolbar. It might make sense to merge it with ToolbarDefaults
5348 (setLayout): new function.
5349 (updateLayoutList): ditto.
5350 (openLayoutList): ditto.
5352 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5353 xforms implementation of the toolbar.
5354 (get_toolbar_func): comment out, since I do not
5355 know what it is good for.
5357 * src/ToolbarDefaults.h: Add the ItemType enum.
5359 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5360 for a list of allocated C strings. Used in Menubar xforms
5361 implementation to avoid memory leaks.
5363 * src/support/lstrings.[Ch] (uppercase): new version taking and
5367 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5368 * lib/bind/emacs.bind: ditto.
5370 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5372 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5373 forward decl of LyXView.
5375 * src/toolbar.C (toolbarItem): moved from toolbar.h
5376 (toolbarItem::clean): ditto
5377 (toolbarItem::~toolbarItem): ditto
5378 (toolbarItem::operator): ditto
5380 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5382 * src/paragraph.h: control the NEW_TABULAR define from here
5384 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5385 USE_TABULAR_INSETS to NEW_TABULAR
5387 * src/ToolbarDefaults.C: add include "lyxlex.h"
5389 * files using the old table/tabular: use NEW_TABULAR to control
5390 compilation of old tabular stuff.
5392 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5395 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5396 planemet in reading of old style floats, fix the \end_deeper
5397 problem when reading old style floats.
5399 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5401 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5403 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5405 * lib/bind/sciword.bind: updated.
5407 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5409 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5410 layout write problem
5412 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5414 * src/Makefile.am (INCLUDES): remove image directory from include
5417 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5418 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5420 * src/LyXView.C (create_form_form_main): read the application icon
5423 * lib/images/*.xpm: change the icons to use transparent color for
5426 * src/toolbar.C (update): change the color of the button when it
5429 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5431 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5432 setting explicitely the minibuffer.
5433 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5435 * src/LyXView.C (showState): new function. Shows font information
5436 in minibuffer and update toolbar state.
5437 (LyXView): call Toolbar::update after creating the
5440 * src/toolbar.C: change toollist to be a vector instead of a
5442 (BubbleTimerCB): get help string directly from the callback
5443 argument of the corresponding icon (which is the action)
5444 (set): remove unnecessary ugliness.
5445 (update): new function. update the icons (depressed, disabled)
5446 depending of the status of the corresponding action.
5448 * src/toolbar.h: remove help in toolbarItem
5450 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5452 * src/Painter.C (text): Added code for using symbol glyphs from
5453 iso10646 fonts. Currently diabled.
5455 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5458 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5459 magyar,turkish and usorbian.
5461 * src/paragraph.C (isMultiLingual): Made more efficient.
5463 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5466 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5467 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5468 Also changed the prototype to "bool math_insert_greek(char)".
5470 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5472 * lots of files: apply the NEW_INSETS on all code that will not be
5473 needed when we move to use the new insets. Enable the define in
5474 lyxparagrah.h to try it.
5476 * src/insets/insettabular.C (cellstart): change to be a static
5478 (InsetTabular): initialize buffer in the initializer list.
5480 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5482 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5483 form_print.h out of the header file. Replaced with forward
5484 declarations of the relevant struct.
5486 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5489 * src/commandtags.h: do not include "debug.h" which does not
5490 belong there. #include it in some other places because of this
5493 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5495 * src/insets/insetcaption.C: add a couple "using" directives.
5497 * src/toolbar.C (add): get the help text directly from lyxaction.
5499 (setPixmap): new function. Loads from disk and sets a pixmap on a
5500 botton; the name of the pixmap file is derived from the command
5503 * src/toolbar.h: remove members isBitmap and pixmap from
5506 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5507 * lib/images/: move many files from images/banner.xpm.
5509 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5511 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5512 * src/toolbar.C: ditto.
5513 * configure.in: ditto.
5514 * INSTALL: document.
5516 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5517 the spellchecker popup is closed from the WM.
5519 2000-07-19 Juergen Vigna <jug@sad.it>
5521 * src/insets/insetfloat.C (Write): small fix because we use the
5522 insetname for the type now!
5524 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5526 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5529 * src/frontends/Dialogs.h: removed hideCitation signal
5531 * src/insets/insetcite.h: added hide signal
5533 * src/insets/insetcite.C (~InsetCitation): emits new signal
5534 (getScreenLabel): "intelligent" label should now fit on the screen!
5536 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5538 * src/frontends/xforms/FormCitation.C (showInset): connects
5539 hide() to the inset's hide signal
5540 (show): modified to use fl_set_object_position rather than
5541 fl_set_object_geometry wherever possible
5543 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5545 * src/insets/lyxinset.h: add caption code
5547 * src/insets/insetfloat.C (type): new method
5549 * src/insets/insetcaption.C (Write): new method
5551 (LyxCode): new method
5553 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5554 to get it right together with using the FloatList.
5556 * src/commandtags.h: add LFUN_INSET_CAPTION
5557 * src/lyxfunc.C (Dispatch): handle it
5559 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5562 * src/Variables.[Ch]: make expand take a const reference, remove
5563 the destructor, some whitespace changes.
5565 * src/LyXAction.C (init): add caption-inset-insert
5567 * src/FloatList.C (FloatList): update the default floats a bit.
5569 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5571 * src/Variables.[Ch]: new files. Intended to be used for language
5572 specific strings (like \chaptername) and filename substitution in
5575 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5577 * lib/kbd/american.kmap: update
5579 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5581 * src/bufferparams.[Ch]: remove member allowAccents.
5583 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5585 * src/LaTeXLog.C: use the log_form.h header.
5586 * src/lyx_gui.C: ditto.
5587 * src/lyx_gui_misc.C: ditto.
5588 * src/lyxvc.h: ditto.
5590 * forms/log_form.fd: new file, created from latexoptions.fd. I
5591 kept the log popup and nuked the options form.
5593 * src/{la,}texoptions.[Ch]: removed.
5594 * src/lyx_cb.C (LaTeXOptions): ditto
5596 * src/lyx_gui.C (create_forms): do not handle the
5597 fd_latex_options form.
5599 2000-07-18 Juergen Vigna <jug@sad.it>
5601 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5602 name of the inset so that it can be requested outside (text2.C).
5604 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5607 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5609 * src/mathed/formula.h (ConvertFont): constify
5611 * src/mathed/formula.C (Read): add warning if \end_inset is not
5612 found on expected place.
5614 * src/insets/lyxinset.h (ConvertFont): consify
5616 * src/insets/insetquotes.C (ConvertFont): constify
5617 * src/insets/insetquotes.h: ditto
5619 * src/insets/insetinfo.h: add labelfont
5621 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5622 (ascent): use labelfont
5626 (Write): make .lyx file a bit nicer
5628 * src/insets/insetfloat.C (Write): simplify somewhat...
5629 (Read): add warning if arg is not found
5631 * src/insets/insetcollapsable.C: add using std::max
5632 (Read): move string token and add warning in arg is not found
5633 (draw): use std::max to get the right ty
5634 (getMaxWidth): simplify by using std::max
5636 * src/insets/insetsection.h: new file
5637 * src/insets/insetsection.C: new file
5638 * src/insets/insetcaption.h: new file
5639 * src/insets/insetcaption.C: new file
5641 * src/insets/inset.C (ConvertFont): constify signature
5643 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5644 insetcaption.[Ch] and insetsection.[Ch]
5646 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5647 uses to use LABEL_COUNTER_CHAPTER instead.
5648 * src/text2.C (SetCounter): here
5650 * src/counters.h: new file
5651 * src/counters.C: new file
5652 * src/Sectioning.h: new file
5653 * src/Sectioning.C: new file
5655 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5657 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5659 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5662 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5665 2000-07-17 Juergen Vigna <jug@sad.it>
5667 * src/tabular.C (Validate): check if array-package is needed.
5668 (SetVAlignment): added support for vertical alignment.
5669 (SetLTFoot): better support for longtable header/footers
5670 (Latex): modified to support added features.
5672 * src/LaTeXFeatures.[Ch]: added array-package.
5674 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5676 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5679 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5681 * configure.in: do not forget to put a space after -isystem.
5683 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5685 * lib/kbd/arabic.kmap: a few fixes.
5687 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5689 * some whitespace chagnes to a number of files.
5691 * src/support/DebugStream.h: change to make it easier for
5692 doc++ to parse correctly.
5693 * src/support/lyxstring.h: ditto
5695 * src/mathed/math_utils.C (compara): change to have only one
5697 (MathedLookupBOP): change because of the above.
5699 * src/mathed/math_delim.C (math_deco_compare): change to have only
5701 (search_deco): change becasue of the above.
5703 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5704 instead of manually coded one.
5706 * src/insets/insetquotes.C (Read): read the \end_inset too
5708 * src/insets/insetlatex.h: remove file
5709 * src/insets/insetlatex.C: remove file
5711 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5713 (InsetPrintIndex): remove destructor
5715 * src/insets/insetinclude.h: remove default constructor
5717 * src/insets/insetfloat.C: work to make it work better
5719 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5721 * src/insets/insetcite.h (InsetCitation): remove default constructor
5723 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5725 * src/text.C (GetColumnNearX): comment out some currently unused code.
5727 * src/paragraph.C (writeFile): move some initializations closer to
5729 (CutIntoMinibuffer): small change to use new matchIT operator
5733 (InsertInset): ditto
5736 (InsetIterator): ditto
5737 (Erase): small change to use new matchFT operator
5739 (GetFontSettings): ditto
5740 (HighestFontInRange): ditto
5743 * src/lyxparagraph.h: some chars changed to value_type
5744 (matchIT): because of some stronger checking (perhaps too strong)
5745 in SGI STL, the two operator() unified to one.
5748 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5750 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5751 the last inset read added
5752 (parseSingleLyXformat2Token): some more (future) compability code added
5753 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5754 (parseSingleLyXformat2Token): set last_inset_read
5755 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5756 (parseSingleLyXformat2Token): don't double intializw string next_token
5758 * src/TextCache.C (text_fits::operator()): add const's to the signature
5759 (has_buffer::operator()): ditto
5761 * src/Floating.h: add some comments on the class
5763 * src/FloatList.[Ch] (typeExist): new method
5766 * src/BackStack.h: added default constructor, wanted by Gcc.
5768 2000-07-14 Juergen Vigna <jug@sad.it>
5770 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5772 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5774 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5775 do a redraw when the window is resized!
5776 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5778 * src/insets/insettext.C (resizeLyXText): added function to correctly
5779 being able to resize the LyXWindow.
5781 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5783 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5785 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5786 crashes when closing dialog to a deleted inset.
5788 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5789 method! Now similar to other insets.
5791 2000-07-13 Juergen Vigna <jug@sad.it>
5793 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5795 * lib/examples/Literate.lyx: small patch!
5797 * src/insets/insetbib.C (Read): added this function because of wrong
5798 Write (without [begin|end]_inset).
5800 2000-07-11 Juergen Vigna <jug@sad.it>
5802 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5803 as the insertInset could not be good!
5805 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5806 the bool param should not be last.
5808 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5810 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5811 did submit that to Karl).
5813 * configure.in: use -isystem instead of -I for X headers. This
5814 fixes a problem on solaris with a recent gcc;
5815 put the front-end code after the X detection code;
5816 configure in sigc++ before lib/
5818 * src/lyx_main.C (commandLineHelp): remove -display from command
5821 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5823 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5824 Also put in Makefile rules for building the ``listerrors''
5825 program for parsing errors from literate programs written in LyX.
5827 * lib/build-listerrors: Added small shell script as part of compile
5828 process. This builds a working ``listerrors'' binary if noweb is
5829 installed and either 1) the VNC X server is installed on the machine,
5830 or 2) the user is compiling from within a GUI. The existence of a GUI
5831 is necessary to use the ``lyx --export'' feature for now. This
5832 hack can be removed once ``lyx --export'' no longer requires a GUI to
5835 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5837 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5838 now passed back correctly from gcc and placed "under" error
5839 buttons in a Literate LyX source.
5841 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5843 * src/text.C (GetColumnNearX): Better behavior when a RTL
5844 paragraph is ended by LTR text.
5846 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5849 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5851 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5852 true when clipboard is empty.
5854 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5856 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5857 row of the paragraph.
5858 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5859 to prevent calculation of bidi tables
5861 2000-07-07 Juergen Vigna <jug@sad.it>
5863 * src/screen.C (ToggleSelection): added y_offset and x_offset
5866 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5869 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5871 * src/insets/insettext.C: fixed Layout-Display!
5873 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5875 * configure.in: add check for strings.h header.
5877 * src/spellchecker.C: include <strings.h> in order to have a
5878 definition for bzero().
5880 2000-07-07 Juergen Vigna <jug@sad.it>
5882 * src/insets/insettext.C (draw): set the status of the bv->text to
5883 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5885 * src/screen.C (DrawOneRow):
5886 (DrawFromTo): redraw the actual row if something has changed in it
5889 * src/text.C (draw): call an update of the toplevel-inset if something
5890 has changed inside while drawing.
5892 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5894 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5896 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5897 processing inside class.
5899 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5900 processing inside class.
5902 * src/insets/insetindex.h new struct Holder, consistent with other
5905 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5906 citation dialog from main code and placed it in src/frontends/xforms.
5907 Dialog launched through signals instead of callbacks
5909 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5911 * lyx.man: update the options description.
5913 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5915 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5916 handle neg values, set min width to 590, add doc about -display
5918 2000-07-05 Juergen Vigna <jug@sad.it>
5920 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5921 calls to BufferView *.
5923 * src/insets/insettext.C (checkAndActivateInset): small fix non
5924 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5926 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5927 their \end_inset token!
5929 2000-07-04 edscott <edscott@imp.mx>
5931 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5932 lib/lyxrc.example: added option \wheel_jump
5934 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5936 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5937 remove support for -width,-height,-xpos and -ypos.
5939 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5941 * src/encoding.[Ch]: New files.
5943 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5944 (text): Call to the underline() method only when needed.
5946 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5948 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5949 encoding(s) for the document.
5951 * src/bufferparams.C (BufferParams): Changed default value of
5954 * src/language.C (newLang): Removed.
5955 (items[]): Added encoding information for all defined languages.
5957 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5958 encoding choice button.
5960 * src/lyxrc.h (font_norm_type): New member variable.
5961 (set_font_norm_type): New method.
5963 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5964 paragraphs with different encodings.
5966 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5967 (TransformChar): Changed to work correctly with Arabic points.
5968 (draw): Added support for drawing Arabic points.
5969 (draw): Removed code for drawing underbars (this is done by
5972 * src/support/textutils.h (IsPrintableNonspace): New function.
5974 * src/BufferView_pimpl.h: Added "using SigC::Object".
5975 * src/LyXView.h: ditto.
5977 * src/insets/insetinclude.h (include_label): Changed to mutable.
5979 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5981 * src/mathed/math_iter.h: remove empty destructor
5983 * src/mathed/math_cursor.h: remove empty destructor
5985 * src/insets/lyxinset.h: add THEOREM_CODE
5987 * src/insets/insettheorem.[Ch]: new files
5989 * src/insets/insetminipage.C: (InsertInset): remove
5991 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5993 (InsertInset): remove
5995 * src/insets/insetlist.C: (InsertList): remove
5997 * src/insets/insetfootlike.[Ch]: new files
5999 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6002 (InsertInset): ditto
6004 * src/insets/insetert.C: remove include Painter.h, reindent
6005 (InsertInset): move to header
6007 * src/insets/insetcollapsable.h: remove explicit from default
6008 contructor, remove empty destructor, add InsertInset
6010 * src/insets/insetcollapsable.C (InsertInset): new func
6012 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6014 * src/vspace.h: add explicit to constructor
6016 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6017 \textcompwordmark, please test this.
6019 * src/lyxrc.C: set ascii_linelen to 65 by default
6021 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6023 * src/commandtags.h: add LFUN_INSET_THEOREM
6025 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6026 (makeLinuxDocFile): remove _some_ of the nice logic
6027 (makeDocBookFile): ditto
6029 * src/Painter.[Ch]: (~Painter): removed
6031 * src/LyXAction.C (init): entry for insettheorem added
6033 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6035 (deplog): code to detect files generated by LaTeX, needs testing
6038 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6040 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6042 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6044 * src/LaTeX.C (deplog): Add a check for files that are going to be
6045 created by the first latex run, part of the project to remove the
6048 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6049 contents to the extension list.
6051 2000-07-04 Juergen Vigna <jug@sad.it>
6053 * src/text.C (NextBreakPoint): added support for needFullRow()
6055 * src/insets/lyxinset.h: added needFullRow()
6057 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6060 * src/insets/insettext.C: lots of changes for update!
6062 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6064 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6066 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6068 * src/insets/insetinclude.C (InsetInclude): fixed
6069 initialization of include_label.
6070 (unique_id): now returns a string.
6072 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6074 * src/LaTeXFeatures.h: new member IncludedFiles, for
6075 a map of key, included file name.
6077 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6078 with the included files for inclusion in SGML preamble,
6079 i. e., linuxdoc and docbook.
6082 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6083 nice (is the generated linuxdoc code to be exported?), that
6084 allows to remove column, and only_body that will be true for
6085 slave documents. Insets are allowed inside SGML font type.
6086 New handling of the SGML preamble for included files.
6087 (makeDocBookFile): the same for docbook.
6089 * src/insets/insetinclude.h:
6090 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6092 (DocBook): new export methods.
6094 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6095 and makeDocBookFile.
6097 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6098 formats to export with command line argument -x.
6100 2000-06-29 Juergen Vigna <jug@sad.it>
6102 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6103 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6105 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6106 region could already been cleared by an inset!
6108 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6110 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6113 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6115 (cursorToggle): remove special handling of lyx focus.
6117 2000-06-28 Juergen Vigna <jug@sad.it>
6119 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6122 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6124 * src/insets/insetindex.C (Edit): add a callback when popup is
6127 * src/insets/insettext.C (LocalDispatch):
6128 * src/insets/insetmarginal.h:
6129 * src/insets/insetlist.h:
6130 * src/insets/insetfoot.h:
6131 * src/insets/insetfloat.h:
6132 * src/insets/insetert.h: add a missing std:: qualifier.
6134 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6136 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6139 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6141 * src/insets/insettext.C (Read): remove tmptok unused variable
6142 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6143 (InsertInset): change for new InsetInset code
6145 * src/insets/insettext.h: add TEXT inline method
6147 * src/insets/insettext.C: remove TEXT macro
6149 * src/insets/insetmarginal.C (Write): new method
6150 (Latex): change output slightly
6152 * src/insets/insetfoot.C (Write): new method
6153 (Latex): change output slightly (don't use endl when no need)
6155 * src/insets/insetert.C (Write): new method
6157 * src/insets/insetcollapsable.h: make button_length, button_top_y
6158 and button_bottm_y protected.
6160 * src/insets/insetcollapsable.C (Write): simplify code by using
6161 tostr. Also do not output the float name, the children class
6162 should to that to get control over own arguments
6164 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6165 src/insets/insetminipage.[Ch]:
6168 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6170 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6172 * src/Makefile.am (lyx_SOURCES): add the new files
6174 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6175 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6176 * src/commandtags.h: ditto
6178 * src/LaTeXFeatures.h: add a std::set of used floattypes
6180 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6182 * src/FloatList.[Ch] src/Floating.h: new files
6184 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6186 * src/lyx_cb.C (TableApplyCB): ditto
6188 * src/text2.C: ditto
6189 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6190 (parseSingleLyXformat2Token): ditto + add code for
6191 backwards compability for old float styles + add code for new insets
6193 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6195 (InsertInset(size_type, Inset *, LyXFont)): new method
6196 (InsetChar(size_type, char)): changed to use the other InsetChar
6197 with a LyXFont(ALL_INHERIT).
6198 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6199 insert the META_INSET.
6201 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6203 * sigc++/thread.h (Threads): from here
6205 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6206 definition out of line
6207 * sigc++/scope.h: from here
6209 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6211 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6212 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6214 * Makefile.am (bindist): new target.
6216 * INSTALL: add instructions for doing a binary distribution.
6218 * development/tools/README.bin.example: update a bit.
6220 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6223 * lib/lyxrc.example: new lyxrc tag \set_color.
6225 * src/lyxfunc.C (Dispatch):
6226 * src/commandtags.h:
6227 * src/LyXAction.C: new lyxfunc "set-color".
6229 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6230 and an x11name given as strings.
6232 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6233 cache when a color is changed.
6235 2000-06-26 Juergen Vigna <jug@sad.it>
6237 * src/lyxrow.C (width): added this functions and variable.
6239 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6242 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6244 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6246 * images/undo_bw.xpm: new icon.
6247 * images/redo_bw.xpm: ditto.
6249 * configure.in (INSTALL_SCRIPT): change value to
6250 ${INSTALL} to avoid failures of install-script target.
6251 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6253 * src/BufferView.h: add a magic "friend" declaration to please
6256 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6258 * forms/cite.fd: modified to allow resizing without messing
6261 * src/insetcite.C: Uses code from cite.fd almost without
6263 User can now resize dialog in the x-direction.
6264 Resizing the dialog in the y-direction is prevented, as the
6265 code does this intelligently already.
6267 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6269 * INSTALL: remove obsolete entry in "problems" section.
6271 * lib/examples/sl_*.lyx: update of the slovenian examples.
6273 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6275 2000-06-23 Juergen Vigna <jug@sad.it>
6277 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6279 * src/buffer.C (resize): delete the LyXText of textinsets.
6281 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6283 * src/insets/lyxinset.h: added another parameter 'cleared' to
6284 the draw() function.
6286 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6287 unlocking inset in inset.
6289 2000-06-22 Juergen Vigna <jug@sad.it>
6291 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6292 of insets and moved first to LyXText.
6294 * src/mathed/formulamacro.[Ch]:
6295 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6297 2000-06-21 Juergen Vigna <jug@sad.it>
6299 * src/text.C (GetVisibleRow): look if I should clear the area or not
6300 using Inset::doClearArea() function.
6302 * src/insets/lyxinset.h: added doClearArea() function and
6303 modified draw(Painter &, ...) to draw(BufferView *, ...)
6305 * src/text2.C (UpdateInset): return bool insted of int
6307 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6309 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6310 combox in the character popup
6312 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6313 BufferParams const & params
6315 2000-06-20 Juergen Vigna <jug@sad.it>
6317 * src/insets/insettext.C (SetParagraphData): set insetowner on
6320 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6322 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6323 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6325 (form_main_): remove
6327 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6328 (create_form_form_main): remove FD_form_main stuff, connect to
6329 autosave_timeout signal
6331 * src/LyXView.[Ch] (getMainForm): remove
6332 (UpdateTimerCB): remove
6333 * src/BufferView_pimpl.h: inherit from SigC::Object
6335 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6336 signal instead of callback
6338 * src/BufferView.[Ch] (cursorToggleCB): remove
6340 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6342 * src/BufferView_pimpl.C: changes because of the one below
6344 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6345 instead of storing a pointer to a LyXText.
6347 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6349 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6351 * src/lyxparagraph.h
6353 * src/paragraph.C: Changed fontlist to a sorted vector.
6355 2000-06-19 Juergen Vigna <jug@sad.it>
6357 * src/BufferView.h: added screen() function.
6359 * src/insets/insettext.C (LocalDispatch): some selection code
6362 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6364 * src/insets/insettext.C (SetParagraphData):
6366 (InsetText): fixes for multiple paragraphs.
6368 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6370 * development/lyx.spec.in: Call configure with ``--without-warnings''
6371 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6372 This should be fine, however, since we generally don't want to be
6373 verbose when making an RPM.
6375 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6377 * lib/scripts/fig2pstex.py: New file
6379 2000-06-16 Juergen Vigna <jug@sad.it>
6381 * src/insets/insettabular.C (UpdateLocal):
6382 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6383 (LocalDispatch): Changed all functions to use LyXText.
6385 2000-06-15 Juergen Vigna <jug@sad.it>
6387 * src/text.C (SetHeightOfRow): call inset::update before requesting
6390 * src/insets/insettext.C (update):
6391 * src/insets/insettabular.C (update): added implementation
6393 * src/insets/lyxinset.h: added update function
6395 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6397 * src/text.C (SelectNextWord): protect against null pointers with
6398 old-style string streams. (fix from Paul Theo Gonciari
6401 * src/cite.[Ch]: remove erroneous files.
6403 * lib/configure.m4: update the list of created directories.
6405 * src/lyxrow.C: include <config.h>
6406 * src/lyxcursor.C: ditto.
6408 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6410 * lib/examples/decimal.lyx: new example file from Mike.
6412 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6413 to find template definitions (from Dekel)
6415 * src/frontends/.cvsignore: add a few things.
6417 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6419 * src/Timeout.C (TimeOut): remove default argument.
6421 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6424 * src/insets/ExternalTemplate.C: add a "using" directive.
6426 * src/lyx_main.h: remove the act_ struct, which seems unused
6429 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6431 * LyX Developers Meeting: All files changed, due to random C++ (by
6432 coincidence) code generator script.
6434 - external inset (cool!)
6435 - initial online editing of preferences
6436 - insettabular breaks insettext(s contents)
6438 - some DocBook fixes
6439 - example files update
6440 - other cool stuff, create a diff and look for yourself.
6442 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6444 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6445 -1 this is a non-line-breaking textinset.
6447 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6448 if there is no width set.
6450 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6452 * Lots of files: Merged the dialogbase branch.
6454 2000-06-09 Allan Rae <rae@lyx.org>
6456 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6457 and the Dispatch methods that used it.
6459 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6460 access to functions formerly kept in Dispatch.
6462 2000-05-19 Allan Rae <rae@lyx.org>
6464 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6465 made to_page and count_copies integers again. from_page remains a
6466 string however because I want to allow entry of a print range like
6467 "1,4,22-25" using this field.
6469 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6470 and printer-params-get. These aren't useful from the minibuffer but
6471 could be used by a script/LyXServer app provided it passes a suitable
6472 auto_mem_buffer. I guess I should take a look at how the LyXServer
6473 works and make it support xtl buffers.
6475 * sigc++/: updated to libsigc++-1.0.1
6477 * src/xtl/: updated to xtl-1.3.pl.11
6479 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6480 those changes done to the files in src/ are actually recreated when
6481 they get regenerated. Please don't ever accept a patch that changes a
6482 dialog unless that patch includes the changes to the corresponding *.fd
6485 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6486 stringOnlyContains, renamed it and generalised it.
6488 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6489 branch. Removed the remaining old form_print code.
6491 2000-04-26 Allan Rae <rae@lyx.org>
6493 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6494 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6496 2000-04-25 Allan Rae <rae@lyx.org>
6498 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6499 against a base of xtl-1.3.pl.4
6501 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6502 filter the Id: entries so they still show the xtl version number
6505 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6506 into the src/xtl code. Patch still pending with José (XTL)
6508 2000-04-24 Allan Rae <rae@lyx.org>
6510 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6511 both more generic and much safer. Use the new template functions.
6512 * src/buffer.[Ch] (Dispatch): ditto.
6514 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6515 and mem buffer more intelligently. Also a little general cleanup.
6518 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6519 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6520 * src/xtl/Makefile.am: ditto.
6521 * src/xtl/.cvsignore: ditto.
6522 * src/Makefile.am: ditto.
6524 * src/PrinterParams.h: Removed the macros member functions. Added a
6525 testInvariant member function. A bit of tidying up and commenting.
6526 Included Angus's idea for fixing operation with egcs-1.1.2.
6528 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6529 cool expansion of XTL's mem_buffer to support automatic memory
6530 management within the buffer itself. Removed the various macros and
6531 replaced them with template functions that use either auto_mem_buffer
6532 or mem_buffer depending on a #define. The mem_buffer support will
6533 disappear as soon as the auto_mem_buffer is confirmed to be good on
6534 other platforms/compilers. That is, it's there so you've got something
6537 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6538 effectively forked XTL. However I expect José will include my code
6539 into the next major release. Also fixed a memory leak.
6540 * src/xtl/text.h: ditto.
6541 * src/xtl/xdr.h: ditto.
6542 * src/xtl/giop.h: ditto.
6544 2000-04-16 Allan Rae <rae@lyx.org>
6546 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6547 by autogen.sh and removed by maintainer-clean anyway.
6548 * .cvsignore, sigc++/.cvsignore: Support the above.
6550 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6552 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6554 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6555 macros, renamed static callback-target member functions to suit new
6556 scheme and made them public.
6557 * src/frontends/xforms/forms/form_print.fd: ditto.
6558 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6560 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6563 * src/xtl/: New directory containing a minimal distribution of XTL.
6564 This is XTL-1.3.pl.4.
6566 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6568 2000-04-15 Allan Rae <rae@lyx.org>
6570 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6572 * sigc++/: Updated to libsigc++-1.0.0
6574 2000-04-14 Allan Rae <rae@lyx.org>
6576 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6577 use the generic ones in future. I'll modify my conversion script.
6579 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6581 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6582 (CloseAllBufferRelatedDialogs): Renamed.
6583 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6585 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6586 of the generic ones. These are the same ones my conversion script
6589 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6590 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6591 * src/buffer.C (Dispatch): ditto
6593 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6594 functions for updating and hiding buffer dependent dialogs.
6595 * src/BufferView.C (buffer): ditto
6596 * src/buffer.C (setReadonly): ditto
6597 * src/lyxfunc.C (CloseBuffer): ditto
6599 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6600 Dialogs.h, and hence all the SigC stuff, into every file that includes
6601 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6603 * src/BufferView2.C: reduce the number of headers included by buffer.h
6605 2000-04-11 Allan Rae <rae@lyx.org>
6607 * src/frontends/xforms/xform_macros.h: A small collection of macros
6608 for building C callbacks.
6610 * src/frontends/xforms/Makefile.am: Added above file.
6612 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6613 scheme again. This time it should work for JMarc. If this is
6614 successful I'll revise my conversion script to automate some of this.
6615 The static member functions in the class also have to be public for
6616 this scheme will work. If the scheme works (it's almost identical to
6617 the way BufferView::cursorToggleCB is handled so it should work) then
6618 FormCopyright and FormPrint will be ready for inclusion into the main
6619 trunk immediately after 1.1.5 is released -- provided we're prepared
6620 for complaints about lame compilers not handling XTL.
6622 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6624 2000-04-07 Allan Rae <rae@lyx.org>
6626 * config/lyxinclude.m4: A bit more tidying up (Angus)
6628 * src/LString.h: JMarc's <string> header fix
6630 * src/PrinterParams.h: Used string for most data to remove some
6631 ugly code in the Print dialog and avoid even uglier code when
6632 appending the ints to a string for output.
6634 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6635 and moved "default:" back to the end of switch statement. Cleaned
6636 up the printing so it uses the right function calls and so the
6637 "print to file" option actually puts the file in the right directory.
6639 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6641 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6642 and Ok+Apply button control into a separate method: input (Angus).
6643 (input) Cleaned it up and improved it to be very thorough now.
6644 (All CB) static_cast used instead of C style cast (Angus). This will
6645 probably change again once we've worked out how to keep gcc-2.8.1 happy
6646 with real C callbacks.
6647 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6648 ignore some of the bool settings and has random numbers instead. Needs
6649 some more investigation. Added other input length checks and checking
6650 of file and printer names.
6652 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6653 would link (Angus). Seems the old code doesn't compile with the pragma
6654 statement either. Separated callback entries from internal methods.
6656 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6658 2000-03-17 Allan Rae <rae@lyx.org>
6660 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6661 need it? Maybe it could go in Dialogs instead? I could make it a
6662 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6663 values to get the bool return value.
6664 (Dispatch): New overloaded method for xtl support.
6666 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6667 extern "C" callback instead of static member functions. Hopefully,
6668 JMarc will be able to compile this. I haven't changed
6669 forms/form_copyright.fd yet. Breaking one of my own rules already.
6671 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6672 because they aren't useful from the minibuffer. Maybe a LyXServer
6673 might want a help message though?
6675 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6677 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6678 xtl which needs both rtti and exceptions.
6680 * src/support/Makefile.am:
6681 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6683 * src/frontends/xforms/input_validators.[ch]: input filters and
6684 validators. These conrol what keys are valid in input boxes.
6685 Use them and write some more. Much better idea than waiting till
6686 after the user has pressed Ok to say that the input fields don't make
6689 * src/frontends/xforms/Makefile.am:
6690 * src/frontends/xforms/forms/form_print.fd:
6691 * src/frontends/xforms/forms/makefile:
6692 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6693 new scheme. Still have to make sure I haven't missed anything from
6694 the current implementation.
6696 * src/Makefile.am, src/PrinterParams.h: New data store.
6698 * other files: Added a couple of copyright notices.
6700 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6702 * src/insets/insetbib.h: move Holder struct in public space.
6704 * src/frontends/include/DialogBase.h: use SigC:: only when
6705 SIGC_CXX_NAMESPACES is defined.
6706 * src/frontends/include/Dialogs.h: ditto.
6708 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6710 * src/frontends/xforms/FormCopyright.[Ch]: do not
6711 mention SigC:: explicitely.
6713 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6715 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6716 deals with testing KDE in main configure.in
6717 * configure.in: ditto.
6719 2000-02-22 Allan Rae <rae@lyx.org>
6721 * Lots of files: Merged from HEAD
6723 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6724 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6726 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6728 * sigc++/: new minidist.
6730 2000-02-14 Allan Rae <rae@lyx.org>
6732 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6734 2000-02-08 Juergen Vigna <jug@sad.it>
6736 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6737 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6739 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6740 for this port and so it is much easier for other people to port
6741 dialogs in a common development environment.
6743 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6744 the QT/KDE implementation.
6746 * src/frontends/kde/Dialogs.C:
6747 * src/frontends/kde/FormCopyright.C:
6748 * src/frontends/kde/FormCopyright.h:
6749 * src/frontends/kde/Makefile.am:
6750 * src/frontends/kde/formcopyrightdialog.C:
6751 * src/frontends/kde/formcopyrightdialog.h:
6752 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6753 for the kde support of the Copyright-Dialog.
6755 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6756 subdir-substitution instead of hardcoded 'xforms' as we now have also
6759 * src/frontends/include/DialogBase.h (Object): just commented the
6760 label after #endif (nasty warning and I don't like warnings ;)
6762 * src/main.C (main): added KApplication initialization if using
6765 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6766 For now only the KDE event-loop is added if frontend==kde.
6768 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6770 * configure.in: added support for the --with-frontend[=value] option
6772 * autogen.sh: added kde.m4 file to list of config-files
6774 * acconfig.h: added define for KDEGUI-support
6776 * config/kde.m4: added configuration functions for KDE-port
6778 * config/lyxinclude.m4: added --with-frontend[=value] option with
6779 support for xforms and KDE.
6781 2000-02-08 Allan Rae <rae@lyx.org>
6783 * all Makefile.am: Fixed up so the make targets dist, distclean,
6784 install and uninstall all work even if builddir != srcdir. Still
6785 have a new sigc++ minidist update to come.
6787 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6789 2000-02-01 Allan Rae <rae@lyx.org>
6791 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6792 Many mods to get builddir != srcdir working.
6794 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6795 for building on NT and so we can do the builddir != srcdir stuff.
6797 2000-01-30 Allan Rae <rae@lyx.org>
6799 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6800 This will stay in "rae" branch. We probably don't really need it in
6801 the main trunk as anyone who wants to help programming it should get
6802 a full library installed also. So they can check both included and
6803 system supplied library compilation.
6805 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6806 Added a 'mini' distribution of libsigc++. If you feel the urge to
6807 change something in these directories - Resist it. If you can't
6808 resist the urge then you should modify the following script and rebuild
6809 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6810 all happen. Still uses a hacked version of libsigc++'s configure.in.
6811 I'm quite happy with the results. I'm not sure the extra work to turn
6812 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6813 worth the trouble and would probably lead to extra maintenance
6815 I haven't tested the following important make targets: install, dist.
6816 Not ready for prime time but very close. Maybe 1.1.5.
6818 * development/tools/makeLyXsigc.sh: A shell script to automatically
6819 generate our mini-dist of libsigc++. It can only be used with a CVS
6820 checkout of libsigc++ not a tarball distribution. It's well commented.
6821 This will end up as part of the libsigc++ distribution so other apps
6822 can easily have an included mini-dist. If someone makes mods to the
6823 sigc++ subpackage without modifying this script to generate those
6824 changes I'll be very upset!
6826 * src/frontends/: Started the gui/system indep structure.
6828 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6829 to access the gui-indep dialogs are in this class. Much improved
6830 design compared to previous revision. Lars, please refrain from
6831 moving this header into src/ like you did with Popups.h last time.
6833 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6835 * src/frontends/xforms/: Started the gui-indep system with a single
6836 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6839 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6840 Here you'll find a very useful makefile and automated fdfix.sh that
6841 makes updating dailogs a no-brainer -- provided you follow the rules
6842 set out in the README. I'm thinking about adding another script to
6843 automatically generate skeleton code for a new dialog given just the
6846 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6847 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6848 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6850 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6852 * src/support/LSubstring.C (operator): simplify
6854 * src/lyxtext.h: removed bparams, use buffer_->params instead
6856 * src/lyxrow.h: make Row a real class, move all variables to
6857 private and use accessors.
6859 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6861 (isRightToLeftPar): ditto
6862 (ChangeLanguage): ditto
6863 (isMultiLingual): ditto
6866 (SimpleTeXOnePar): ditto
6867 (TeXEnvironment): ditto
6868 (GetEndLabel): ditto
6870 (SetOnlyLayout): ditto
6871 (BreakParagraph): ditto
6872 (BreakParagraphConservative): ditto
6873 (GetFontSettings): ditto
6875 (CopyIntoMinibuffer): ditto
6876 (CutIntoMinibuffer): ditto
6877 (PasteParagraph): ditto
6878 (SetPExtraType): ditto
6879 (UnsetPExtraType): ditto
6880 (DocBookContTableRows): ditto
6881 (SimpleDocBookOneTablePar): ditto
6883 (TeXFootnote): ditto
6884 (SimpleTeXOneTablePar): ditto
6885 (TeXContTableRows): ditto
6886 (SimpleTeXSpecialChars): ditto
6889 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6890 to private and use accessors.
6892 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6893 this, we did not use it anymore and has not been for ages. Just a
6894 waste of cpu cycles.
6896 * src/language.h: make Language a real class, move all variables
6897 to private and use accessors.
6899 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6900 (create_view): remove
6901 (update): some changes for new timer
6902 (cursorToggle): use new timer
6903 (beforeChange): change for new timer
6905 * src/BufferView.h (cursorToggleCB): removed last paramter because
6908 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6909 (cursorToggleCB): change because of new timer code
6911 * lib/CREDITS: updated own mailaddress
6913 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6915 * src/support/filetools.C (PutEnv): fix the code in case neither
6916 putenv() nor setenv() have been found.
6918 * INSTALL: mention the install-strip Makefile target.
6920 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6921 read-only documents.
6923 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6925 * lib/reLyX/configure.in (VERSION): avoid using a previously
6926 generated reLyX wrapper to find out $prefix.
6928 * lib/examples/eu_adibide_lyx-atua.lyx:
6929 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6930 translation of the Tutorial (Dooteo)
6932 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6934 * forms/cite.fd: new citation dialog
6936 * src/insetcite.[Ch]: the new citation dialog is moved into
6939 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6942 * src/insets/insetcommand.h: data members made private.
6944 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6946 * LyX 1.1.5 released
6948 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6950 * src/version.h (LYX_RELEASE): to 1.1.5
6952 * src/spellchecker.C (RunSpellChecker): return false if the
6953 spellchecker dies upon creation.
6955 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6957 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6958 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6962 * lib/CREDITS: update entry for Martin Vermeer.
6964 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6966 * src/text.C (draw): Draw foreign language bars at the bottom of
6967 the row instead of at the baseline.
6969 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6971 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6973 * lib/bind/de_menus.bind: updated
6975 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6977 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6979 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6981 * src/menus.C (Limit_string_length): New function
6982 (ShowTocMenu): Limit the number of items/length of items in the
6985 * src/paragraph.C (String): Correct result for a paragraph inside
6988 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6990 * src/bufferlist.C (close): test of buf->getuser() == NULL
6992 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6994 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6995 Do not call to SetCursor when the paragraph is a closed footnote!
6997 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6999 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7002 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7004 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7007 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7008 reference popup, that activates the reference-back action
7010 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7012 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7013 the menus. Also fixed a bug.
7015 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7016 the math panels when switching buffers (unless new buffer is readonly).
7018 * src/BufferView.C (NoSavedPositions)
7019 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7021 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7023 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7024 less of dvi dirty or not.
7026 * src/trans_mgr.[Ch] (insert): change first parameter to string
7029 * src/chset.[Ch] (encodeString): add const to first parameter
7031 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7033 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7037 * src/LaTeX.C (deplog): better searching for dependency files in
7038 the latex log. Uses now regexps.
7040 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7041 instead of the box hack or \hfill.
7043 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7045 * src/lyxfunc.C (doImportHelper): do not create the file before
7046 doing the actual import.
7047 (doImportASCIIasLines): create a new file before doing the insert.
7048 (doImportASCIIasParagraphs): ditto.
7050 * lib/lyxrc.example: remove mention of non-existing commands
7052 * lyx.man: remove mention of color-related switches.
7054 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7056 * src/lyx_gui.C: remove all the color-related ressources, which
7057 are not used anymore.
7059 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7062 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7064 * src/lyxrc.C (read): Add a missing break in the switch
7066 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7068 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7070 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7073 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7075 * src/text.C (draw): draw bars under foreign language words.
7077 * src/LColor.[Ch]: add LColor::language
7079 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7081 * src/lyxcursor.h (boundary): New member variable
7083 * src/text.C (IsBoundary): New methods
7085 * src/text.C: Use the above for currect cursor movement when there
7086 is both RTL & LTR text.
7088 * src/text2.C: ditto
7090 * src/bufferview_funcs.C (ToggleAndShow): ditto
7092 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7094 * src/text.C (DeleteLineForward): set selection to true to avoid
7095 that DeleteEmptyParagraphMechanism does some magic. This is how it
7096 is done in all other functions, and seems reasonable.
7097 (DeleteWordForward): do not jump over non-word stuff, since
7098 CursorRightOneWord() already does it.
7100 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7101 DeleteWordBackward, since they seem safe to me (since selection is
7102 set to "true") DeleteEmptyParagraphMechanism does nothing.
7104 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7106 * src/lyx_main.C (easyParse): simplify the code by factoring the
7107 part that removes parameters from the command line.
7108 (LyX): check wether wrong command line options have been given.
7110 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7112 * src/lyx_main.C : add support for specifying user LyX
7113 directory via command line option -userdir.
7115 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7117 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7118 the number of items per popup.
7119 (Add_to_refs_menu): Ditto.
7121 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7123 * src/lyxparagraph.h: renamed ClearParagraph() to
7124 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7125 textclass as parameter, and do nothing if free_spacing is
7126 true. This fixes part of the line-delete-forward problems.
7128 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7129 (pasteSelection): ditto.
7130 (SwitchLayoutsBetweenClasses): more translatable strings.
7132 * src/text2.C (CutSelection): use StripLeadingSpaces.
7133 (PasteSelection): ditto.
7134 (DeleteEmptyParagraphMechanism): ditto.
7136 2000-05-26 Juergen Vigna <jug@sad.it>
7138 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7139 is not needed in tabular insets.
7141 * src/insets/insettabular.C (TabularFeatures): added missing features.
7143 * src/tabular.C (DeleteColumn):
7145 (AppendRow): implemented this functions
7146 (cellsturct::operator=): clone the inset too;
7148 2000-05-23 Juergen Vigna <jug@sad.it>
7150 * src/insets/insettabular.C (LocalDispatch): better selection support
7151 when having multicolumn-cells.
7153 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7155 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7157 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7159 * src/ColorHandler.C (getGCForeground): put more test into _()
7161 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7164 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7167 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7169 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7170 there are no labels, or when buffer is readonly.
7172 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7173 there are no labels, buffer is SGML, or when buffer is readonly.
7175 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7177 * src/LColor.C (LColor): change a couple of grey40 to grey60
7178 (LColor): rewore initalization to make compiles go some magnitude
7180 (getGUIName): don't use gettext until we need the string.
7182 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7184 * src/Bullet.[Ch]: Fixed a small bug.
7186 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7188 * src/paragraph.C (String): Several fixes/improvements
7190 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7192 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7194 * src/paragraph.C (String): give more correct output.
7196 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7198 * src/lyxfont.C (stateText) Do not output the language if it is
7199 eqaul to the language of the document.
7201 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7202 between two paragraphs with the same language.
7204 * src/paragraph.C (getParLanguage) Return a correct answer for an
7205 empty dummy paragraph.
7207 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7210 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7213 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7214 the menus/popup, if requested fonts are unavailable.
7216 2000-05-22 Juergen Vigna <jug@sad.it>
7218 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7219 movement support (Up/Down/Tab/Shift-Tab).
7220 (LocalDispatch): added also preliminari cursor-selection.
7222 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7224 * src/paragraph.C (PasteParagraph): Hopefully now right!
7226 2000-05-22 Garst R. Reese <reese@isn.net>
7228 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7229 of list, change all references to Environment to Command
7230 * tex/hollywood.cls : rewrite environments as commands, add
7231 \uppercase to interiorshot and exteriorshot to force uppecase.
7232 * tex/broadway.cls : rewrite environments as commands. Tweak
7235 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7237 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7238 size of items: use a constant intead of the hardcoded 40, and more
7239 importantly do not remove the %m and %x tags added at the end.
7240 (Add_to_refs_menu): use vector::size_type instead of
7241 unsigned int as basic types for the variables. _Please_ do not
7242 assume that size_t is equal to unsigned int. On an alpha, this is
7243 unsigned long, which is _not_ the same.
7245 * src/language.C (initL): remove language "hungarian", since it
7246 seems that "magyar" is better.
7248 2000-05-22 Juergen Vigna <jug@sad.it>
7250 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7252 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7255 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7256 next was deleted but not set to 0.
7258 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7260 * src/language.C (initL): change the initialization of languages
7261 so that compiles goes _fast_.
7263 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7266 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7268 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7272 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7274 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7276 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7280 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7283 * src/insets/insetlo*.[Ch]: Made editable
7285 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7287 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7288 the current selection.
7290 * src/BufferView_pimpl.C (stuffClipboard): new method
7292 * src/BufferView.C (stuffClipboard): new method
7294 * src/paragraph.C (String): new method
7296 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7297 LColor::ignore when lyxname is not found.
7299 * src/BufferView.C (pasteSelection): new method
7301 * src/BufferView_pimpl.C (pasteSelection): new method
7303 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7305 * src/WorkArea.C (request_clipboard_cb): new static function
7306 (getClipboard): new method
7307 (putClipboard): new method
7309 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7311 * LyX 1.1.5pre2 released
7313 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7315 * src/vspace.C (operator=): removed
7316 (operator=): removed
7318 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7320 * src/layout.C (NumberOfClass): manually set the type in make_pair
7321 (NumberOfLayout): ditto
7323 * src/language.C: use the Language constructor for ignore_lang
7325 * src/language.h: add constructors to struct Language
7327 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7329 * src/text2.C (SetCursorIntern): comment out #warning
7331 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7333 * src/mathed/math_iter.h: initialize sx and sw to 0
7335 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7337 * forms/lyx.fd: Redesign of form_ref
7339 * src/LaTeXFeatures.[Ch]
7343 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7346 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7347 and Buffer::inset_iterator.
7349 * src/menus.C: Added new menus: TOC and Refs.
7351 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7353 * src/buffer.C (getTocList): New method.
7355 * src/BufferView2.C (ChangeRefs): New method.
7357 * src/buffer.C (getLabelList): New method. It replaces the old
7358 getReferenceList. The return type is vector<string> instead of
7361 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7362 the old getLabel() and GetNumberOfLabels() methods.
7363 * src/insets/insetlabel.C (getLabelList): ditto
7364 * src/mathed/formula.C (getLabelList): ditto
7366 * src/paragraph.C (String): New method.
7368 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7369 Uses the new getTocList() method.
7370 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7371 which automatically updates the contents of the browser.
7372 (RefUpdateCB): Use the new getLabelList method.
7374 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7376 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7378 * src/spellchecker.C: Added using std::reverse;
7380 2000-05-19 Juergen Vigna <jug@sad.it>
7382 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7384 * src/insets/insettext.C (computeTextRows): small fix for display of
7385 1 character after a newline.
7387 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7390 2000-05-18 Juergen Vigna <jug@sad.it>
7392 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7393 when changing width of column.
7395 * src/tabular.C (set_row_column_number_info): setting of
7396 autobreak rows if necessary.
7398 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7400 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7402 * src/vc-backend.*: renamed stat() to status() and vcstat to
7403 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7404 compilation broke. The new name seems more relevant, anyway.
7406 2000-05-17 Juergen Vigna <jug@sad.it>
7408 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7409 which was wrong if the removing caused removing of rows!
7411 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7412 (pushToken): new function.
7414 * src/text2.C (CutSelection): fix problem discovered with purify
7416 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7418 * src/debug.C (showTags): enlarge the first column, now that we
7419 have 6-digits debug codes.
7421 * lib/layouts/hollywood.layout:
7422 * lib/tex/hollywood.cls:
7423 * lib/tex/brodway.cls:
7424 * lib/layouts/brodway.layout: more commands and fewer
7425 environments. Preambles moved in the .cls files. Broadway now has
7426 more options on scene numbering and less whitespace (from Garst)
7428 * src/insets/insetbib.C (getKeys): make sure that we are in the
7429 document directory, in case the bib file is there.
7431 * src/insets/insetbib.C (Latex): revert bogus change.
7433 2000-05-16 Juergen Vigna <jug@sad.it>
7435 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7436 the TabularLayout on cursor move.
7438 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7440 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7443 (draw): fixed cursor position and drawing so that the cursor is
7444 visible when before the tabular-inset.
7446 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7447 when creating from old insettext.
7449 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7451 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7453 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7454 * lib/tex/brodway.cls: ditto
7456 * lib/layouts/brodway.layout: change alignment of parenthical
7459 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7461 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7462 versions 0.88 and 0.89 are supported.
7464 2000-05-15 Juergen Vigna <jug@sad.it>
7466 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7469 * src/insets/insettext.C (computeTextRows): redone completely this
7470 function in a much cleaner way, because of problems when having a
7472 (draw): added a frame border when the inset is locked.
7473 (SetDrawLockedFrame): this sets if we draw the border or not.
7474 (SetFrameColor): this sets the frame color (default=insetframe).
7476 * src/insets/lyxinset.h: added x() and y() functions which return
7477 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7478 function which is needed to see if we have a locking inset of some
7479 type in this inset (needed for now in insettabular).
7481 * src/vspace.C (inPixels): the same function also without a BufferView
7482 parameter as so it is easier to use it in some ocasions.
7484 * src/lyxfunc.C: changed all places where insertInset was used so
7485 that now if it couldn't be inserted it is deleted!
7487 * src/TabularLayout.C:
7488 * src/TableLayout.C: added support for new tabular-inset!
7490 * src/BufferView2.C (insertInset): this now returns a bool if the
7491 inset was really inserted!!!
7493 * src/tabular.C (GetLastCellInRow):
7494 (GetFirstCellInRow): new helper functions.
7495 (Latex): implemented for new tabular class.
7499 (TeXTopHLine): new Latex() helper functions.
7501 2000-05-12 Juergen Vigna <jug@sad.it>
7503 * src/mathed/formulamacro.C (Read):
7504 * src/mathed/formula.C (Read): read also the \end_inset here!
7506 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7508 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7509 crush when saving formulae with unbalanced parenthesis.
7511 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7513 * src/layout.C: Add new keyword "endlabelstring" to layout file
7515 * src/text.C (GetVisibleRow): Draw endlabel string.
7517 * lib/layouts/broadway.layout
7518 * lib/layouts/hollywood.layout: Added endlabel for the
7519 Parenthetical layout.
7521 * lib/layouts/heb-article.layout: Do not use slanted font shape
7522 for Theorem like environments.
7524 * src/buffer.C (makeLaTeXFile): Always add "american" to
7525 the UsedLanguages list if document language is RTL.
7527 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7529 * add addendum to README.OS2 and small patch (from SMiyata)
7531 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7533 * many files: correct the calls to ChangeExtension().
7535 * src/support/filetools.C (ChangeExtension): remove the no_path
7536 argument, which does not belong there. Use OnlyFileName() instead.
7538 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7539 files when LaTeXing a non-nice latex file.
7541 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7542 a chain of "if". Return false when deadkeys are not handled.
7544 * src/lyx_main.C (LyX): adapted the code for default bindings.
7546 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7547 bindings for basic functionality (except deadkeys).
7548 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7550 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7551 several methods: handle override_x_deadkeys.
7553 * src/lyxrc.h: remove the "bindings" map, which did not make much
7554 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7556 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7558 * src/lyxfont.C (stateText): use a saner method to determine
7559 whether the font is "default". Seems to fix the crash with DEC
7562 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7564 2000-05-08 Juergen Vigna <jug@sad.it>
7566 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7567 TabularLayoutMenu with mouse-button-3
7568 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7570 * src/TabularLayout.C: added this file for having a Layout for
7573 2000-05-05 Juergen Vigna <jug@sad.it>
7575 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7576 recalculating inset-widths.
7577 (TabularFeatures): activated this function so that I can change
7578 tabular-features via menu.
7580 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7581 that I can test some functions with the Table menu.
7583 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7585 * src/lyxfont.C (stateText): guard against stupid c++libs.
7587 * src/tabular.C: add using std::vector
7588 some whitespace changes, + removed som autogenerated code.
7590 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7592 2000-05-05 Juergen Vigna <jug@sad.it>
7594 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7595 row, columns and cellstructures.
7597 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7599 * lib/lyxrc.example: remove obsolete entries.
7601 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7602 reading of protected_separator for free_spacing.
7604 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7606 * src/text.C (draw): do not display an exclamation mark in the
7607 margin for margin notes. This is confusing, ugly and
7610 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7611 AMS math' is checked.
7613 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7614 name to see whether including the amsmath package is needed.
7616 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7618 * src/paragraph.C (validate): Compute UsedLanguages correctly
7619 (don't insert the american language if it doesn't appear in the
7622 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7623 The argument of \thanks{} command is considered moving argument
7625 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7628 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7630 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7631 for appendix/minipage/depth. The lines can be now both in the footnote
7632 frame, and outside the frame.
7634 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7637 2000-05-05 Juergen Vigna <jug@sad.it>
7639 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7640 neede only in tabular.[Ch].
7642 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7644 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7646 (Write): write '~' for PROTECTED_SEPARATOR
7648 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7650 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7653 * src/mathed/formula.C (drawStr): rename size to siz.
7655 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7656 possibly fix a bug by not changing the pflags = flags to piflags =
7659 2000-05-05 Juergen Vigna <jug@sad.it>
7661 * src/insets/insetbib.C: moved using directive
7663 * src/ImportNoweb.C: small fix for being able to compile (missing
7666 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7668 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7669 to use clear, since we don't depend on this in the code. Add test
7672 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7674 * (various *.C files): add using std::foo directives to please dec
7677 * replace calls to string::clear() to string::erase() (Angus)
7679 * src/cheaders/cmath: modified to provide std::abs.
7681 2000-05-04 Juergen Vigna <jug@sad.it>
7683 * src/insets/insettext.C: Prepared all for inserting of multiple
7684 paragraphs. Still display stuff to do (alignment and other things),
7685 but I would like to use LyXText to do this when we cleaned out the
7686 table-support stuff.
7688 * src/insets/insettabular.C: Changed lot of stuff and added lots
7689 of functionality still a lot to do.
7691 * src/tabular.C: Various functions changed name and moved to be
7692 const functions. Added new Read and Write functions and changed
7693 lots of things so it works good with tabular-insets (also removed
7694 some stuff which is not needed anymore * hacks *).
7696 * src/lyxcursor.h: added operators == and != which just look if
7697 par and pos are (not) equal.
7699 * src/buffer.C (latexParagraphs): inserted this function to latex
7700 all paragraphs form par to endpar as then I can use this too for
7703 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7704 so that I can call this to from text insets with their own cursor.
7706 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7707 output off all paragraphs (because of the fix below)!
7709 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7710 the very last paragraph (this could be also the last paragraph of an
7713 * src/texrow.h: added rows() call which returns the count-variable.
7715 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7717 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7719 * lib/configure.m4: better autodetection of DocBook tools.
7721 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7723 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7725 * src/lyx_cb.C: add using std::reverse;
7727 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7730 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7731 selected files. Should fix repeated errors from generated files.
7733 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7735 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7737 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7738 the spellchecker popup.
7740 * lib/lyxrc.example: Removed the \number_inset section
7742 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7744 * src/insets/figinset.C (various): Use IsFileReadable() to make
7745 sure that the file actually exist. Relying on ghostscripts errors
7746 is a bad idea since they can lead to X server crashes.
7748 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7750 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7753 * lib/lyxrc.example: smallish typo in description of
7754 \view_dvi_paper_option
7756 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7759 * src/lyxfunc.C: doImportHelper to factor out common code of the
7760 various import methods. New functions doImportASCIIasLines,
7761 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7762 doImportLinuxDoc for the format specific parts.
7765 * buffer.C: Dispatch returns now a bool to indicate success
7768 * lyx_gui.C: Add getLyXView() for member access
7770 * lyx_main.C: Change logic for batch commands: First try
7771 Buffer::Dispatch (possibly without GUI), if that fails, use
7774 * lyx_main.C: Add support for --import command line switch.
7775 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7776 Available Formats: Everything accepted by 'buffer-import <format>'
7778 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7780 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7783 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7784 documents will be reformatted upon reentry.
7786 2000-04-27 Juergen Vigna <jug@sad.it>
7788 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7789 correctly only last pos this was a bug.
7791 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7793 * release of lyx-1.1.5pre1
7795 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7797 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7799 * src/menus.C: revert the change of naming (Figure->Graphic...)
7800 from 2000-04-11. It was incomplete and bad.
7802 * src/LColor.[Ch]: add LColor::depthbar.
7803 * src/text.C (GetVisibleRow): use it.
7805 * README: update the languages list.
7807 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7809 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7812 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7814 * README: remove sections that were just wrong.
7816 * src/text2.C (GetRowNearY): remove currentrow code
7818 * src/text.C (GetRow): remove currentrow code
7820 * src/screen.C (Update): rewritten a bit.
7821 (SmallUpdate): removed func
7823 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7825 (FullRebreak): return bool
7826 (currentrow): remove var
7827 (currentrow_y): ditto
7829 * src/lyxscreen.h (Draw): change arg to unsigned long
7830 (FitCursor): return bool
7831 (FitManualCursor): ditto
7832 (Smallpdate): remove func
7833 (first): change to unsigned long
7834 (DrawOneRow): change second arg to long (from long &)
7835 (screen_refresh_y): remove var
7836 (scree_refresh_row): ditto
7838 * src/lyxrow.h: change baseline to usigned int from unsigned
7839 short, this brings some implicit/unsigned issues out in the open.
7841 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7843 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7844 instead of smallUpdate.
7846 * src/lyxcursor.h: change y to unsigned long
7848 * src/buffer.h: don't call updateScrollbar after fitcursor
7850 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7851 where they are used. Removed "\\direction", this was not present
7852 in 1.1.4 and is already obsolete. Commented out some code that I
7853 believe to never be called.
7854 (runLiterate): don't call updateScrollbar after fitCursor
7856 (buildProgram): ditto
7859 * src/WorkArea.h (workWidth): change return val to unsigned
7862 (redraw): remove the button redraws
7863 (setScrollbarValue): change for scrollbar
7864 (getScrollbarValue): change for scrollbar
7865 (getScrollbarBounds): change for scrollbar
7867 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7868 (C_WorkArea_down_cb): removed func
7869 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7870 (resize): change for scrollbar
7871 (setScrollbar): ditto
7872 (setScrollbarBounds): ditto
7873 (setScrollbarIncrements): ditto
7874 (up_cb): removed func
7875 (down_cb): removed func
7876 (scroll_cb): change for scrollbar
7877 (work_area_handler): ditto
7879 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7880 when FitCursor did something.
7881 (updateScrollbar): some unsigned changes
7882 (downCB): removed func
7883 (scrollUpOnePage): removed func
7884 (scrollDownOnePage): remvoed func
7885 (workAreaMotionNotify): don't call screen->FitCursor but use
7886 fitCursor instead. and bool return val
7887 (workAreaButtonPress): ditto
7888 (workAreaButtonRelease): some unsigned changes
7889 (checkInsetHit): ditto
7890 (workAreaExpose): ditto
7891 (update): parts rewritten, comments about the signed char arg added
7892 (smallUpdate): removed func
7893 (cursorPrevious): call needed updateScrollbar
7896 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7899 * src/BufferView.[Ch] (upCB): removed func
7900 (downCB): removed func
7901 (smallUpdate): removed func
7903 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7905 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7906 currentrow, currentrow_y optimization. This did not help a lot and
7907 if we want to do this kind of optimization we should rather use
7908 cursor.row instead of the currentrow.
7910 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7911 buffer spacing and klyx spacing support.
7913 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7915 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7918 2000-04-26 Juergen Vigna <jug@sad.it>
7920 * src/insets/figinset.C: fixes to Lars sstream changes!
7922 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7924 * A lot of files: Added Ascii(ostream &) methods to all inset
7925 classes. Used when exporting to ASCII.
7927 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7928 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7931 * src/text2.C (ToggleFree): Disabled implicit word selection when
7932 there is a change in the language
7934 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7935 no output was generated for end-of-sentence inset.
7937 * src/insets/lyxinset.h
7940 * src/paragraph.C: Removed the insetnumber code
7942 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7944 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7946 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7947 no_babel and no_epsfig completely from the file.
7948 (parseSingleLyXformat2Token): add handling for per-paragraph
7949 spacing as written by klyx.
7951 * src/insets/figinset.C: applied patch by Andre. Made it work with
7954 2000-04-20 Juergen Vigna <jug@sad.it>
7956 * src/insets/insettext.C (cutSelection):
7957 (copySelection): Fixed with selection from right to left.
7958 (draw): now the rows are not recalculated at every draw.
7959 (computeTextRows): for now reset the inset-owner here (this is
7960 important for an undo or copy where the inset-owner is not set
7963 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7964 motion to the_locking_inset screen->first was forgotten, this was
7965 not important till we got multiline insets.
7967 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7969 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7970 code seems to be alright (it is code changed by Dekel, and the
7971 intent is indeed that all macros should be defined \protect'ed)
7973 * NEWS: a bit of reorganisation of the new user-visible features.
7975 2000-04-19 Juergen Vigna <jug@sad.it>
7977 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7978 position. Set the inset_owner of the used paragraph so that it knows
7979 that it is inside an inset. Fixed cursor handling with mouse and
7980 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7981 and cleanups to make TextInsets work better.
7983 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7984 Changed parameters of various functions and added LockInsetInInset().
7986 * src/insets/insettext.C:
7988 * src/insets/insetcollapsable.h:
7989 * src/insets/insetcollapsable.C:
7990 * src/insets/insetfoot.h:
7991 * src/insets/insetfoot.C:
7992 * src/insets/insetert.h:
7993 * src/insets/insetert.C: cleaned up the code so that it works now
7994 correctly with insettext.
7996 * src/insets/inset.C:
7997 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7998 that insets in insets are supported right.
8001 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8003 * src/paragraph.C: some small fixes
8005 * src/debug.h: inserted INSETS debug info
8007 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8008 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8010 * src/commandtags.h:
8011 * src/LyXAction.C: insert code for InsetTabular.
8013 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8014 not Button1MotionMask.
8015 (workAreaButtonRelease): send always a InsetButtonRelease event to
8017 (checkInsetHit): some setCursor fixes (always with insets).
8019 * src/BufferView2.C (lockInset): returns a bool now and extended for
8020 locking insets inside insets.
8021 (showLockedInsetCursor): it is important to have the cursor always
8022 before the locked inset.
8023 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8025 * src/BufferView.h: made lockInset return a bool.
8027 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8029 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8030 that is used also internally but can be called as public to have back
8031 a cursor pos which is not set internally.
8032 (SetCursorIntern): Changed to use above function.
8034 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8036 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8041 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8042 patches for things that should be in or should be changed.
8044 * src/* [insetfiles]: change "usigned char fragile" to bool
8045 fragile. There was only one point that could that be questioned
8046 and that is commented in formulamacro.C. Grep for "CHECK".
8048 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8049 (DeleteBuffer): take it out of CutAndPaste and make it static.
8051 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8053 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8054 output the spacing envir commands. Also the new commands used in
8055 the LaTeX output makes the result better.
8057 * src/Spacing.C (writeEnvirBegin): new method
8058 (writeEnvirEnd): new method
8060 2000-04-18 Juergen Vigna <jug@sad.it>
8062 * src/CutAndPaste.C: made textclass a static member of the class
8063 as otherwise it is not accesed right!!!
8065 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8067 * forms/layout_forms.fd
8068 * src/layout_forms.h
8069 * src/layout_forms.C (create_form_form_character)
8070 * src/lyx_cb.C (UserFreeFont)
8071 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8072 documents (in the layout->character popup).
8074 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8076 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8077 \spell_command was in fact not honored (from Kevin Atkinson).
8079 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8082 * src/lyx_gui.h: make lyxViews private (Angus)
8084 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8086 * src/mathed/math_write.C
8087 (MathMatrixInset::Write) Put \protect before \begin{array} and
8088 \end{array} if fragile
8089 (MathParInset::Write): Put \protect before \\ if fragile
8091 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8093 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8094 initialization if the LyXColorHandler must be done after the
8095 connections to the XServer has been established.
8097 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8098 get the background pixel from the lyxColorhandler so that the
8099 figures are rendered with the correct background color.
8100 (NextToken): removed functions.
8101 (GetPSSizes): use ifs >> string instead of NextToken.
8103 * src/Painter.[Ch]: the color cache moved out of this file.
8105 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8108 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8110 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8111 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8113 * src/BufferView.C (enterView): new func
8114 (leaveView): new func
8116 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8118 (leaveView): new func, undefines xterm cursor when approp.
8120 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8121 (AllowInput): delete the Workarea cursor handling from this func.
8123 * src/Painter.C (underline): draw a slimer underline in most cases.
8125 * src/lyx_main.C (error_handler): use extern "C"
8127 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8129 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8130 sent directly to me.
8132 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8133 to the list by Dekel.
8135 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8138 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8139 methods from lyx_cb.here.
8141 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8144 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8146 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8147 instead of using current_view directly.
8149 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8151 * src/LyXAction.C (init): add the paragraph-spacing command.
8153 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8155 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8157 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8158 different from the documents.
8160 * src/text.C (SetHeightOfRow): take paragraph spacing into
8161 account, paragraph spacing takes precedence over buffer spacing
8162 (GetVisibleRow): ditto
8164 * src/paragraph.C (writeFile): output the spacing parameter too.
8165 (validate): set the correct features if spacing is used in the
8167 (Clear): set spacing to default
8168 (MakeSameLayout): spacing too
8169 (HasSameLayout): spacing too
8170 (SetLayout): spacing too
8171 (TeXOnePar): output the spacing commands
8173 * src/lyxparagraph.h: added a spacing variable for use with
8174 per-paragraph spacing.
8176 * src/Spacing.h: add a Default spacing and a method to check if
8177 the current spacing is default. also added an operator==
8179 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8182 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8184 * src/lyxserver.C (callback): fix dispatch of functions
8186 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8187 printf() into lyxerr call.
8189 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8192 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8193 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8194 the "Float" from each of the subitems.
8195 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8197 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8198 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8199 documented the change so that the workaround can be nuked later.
8201 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8204 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8206 * src/buffer.C (getLatexName): ditto
8207 (setReadonly): ditto
8209 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8211 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8212 avoid some uses of current_view. Added also a bufferParams()
8213 method to get at this.
8215 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8217 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8219 * src/lyxparagraph.[Ch]: removed
8220 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8221 with operators used by lower_bound and
8222 upper_bound in InsetTable's
8223 Make struct InsetTable private again. Used matchpos.
8225 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8227 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8228 document, the language of existing text is changed (unless the
8229 document is multi-lingual)
8231 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8233 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8235 * A lot of files: A rewrite of the Right-to-Left support.
8237 2000-04-10 Juergen Vigna <jug@sad.it>
8239 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8240 misplaced cursor when inset in inset is locked.
8242 * src/insets/insettext.C (LocalDispatch): small fix so that a
8243 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8245 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8246 footnote font should be decreased in size twice when displaying.
8248 * src/insets/insettext.C (GetDrawFont): inserted this function as
8249 the drawing-font may differ from the real paragraph font.
8251 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8252 insets (inset in inset!).
8254 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8255 function here because we don't want footnotes inside footnotes.
8257 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8259 (init): now set the inset_owner in paragraph.C
8260 (LocalDispatch): added some resetPos() in the right position
8263 (pasteSelection): changed to use the new CutAndPaste-Class.
8265 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8266 which tells if it is allowed to insert another inset inside this one.
8268 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8269 SwitchLayoutsBetweenClasses.
8271 * src/text2.C (InsertInset): checking of the new paragraph-function
8273 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8274 is not needed anymore here!
8277 (PasteSelection): redone (also with #ifdef) so that now this uses
8278 the CutAndPaste-Class.
8279 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8282 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8283 from/to text/insets.
8285 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8286 so that the paragraph knows if it is inside an (text)-inset.
8287 (InsertFromMinibuffer): changed return-value to bool as now it
8288 may happen that an inset is not inserted in the paragraph.
8289 (InsertInsetAllowed): this checks if it is allowed to insert an
8290 inset in this paragraph.
8292 (BreakParagraphConservative):
8293 (BreakParagraph) : small change for the above change of the return
8294 value of InsertFromMinibuffer.
8296 * src/lyxparagraph.h: added inset_owner and the functions to handle
8297 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8299 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8301 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8302 functions from BufferView to BufferView::Pimpl to ease maintence.
8304 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8305 correctly. Also use SetCursorIntern instead of SetCursor.
8307 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8310 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8312 * src/WorkArea.C (belowMouse): manually implement below mouse.
8314 * src/*: Add "explicit" on several constructors, I added probably
8315 some unneeded ones. A couple of changes to code because of this.
8317 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8318 implementation and private parts from the users of BufferView. Not
8321 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8322 implementation and private parts from the users of LyXLex. Not
8325 * src/BufferView_pimpl.[Ch]: new files
8327 * src/lyxlex_pimpl.[Ch]: new files
8329 * src/LyXView.[Ch]: some inline functions move out-of-line
8331 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8333 * src/lyxparagraph.h: make struct InsetTable public.
8335 * src/support/lyxstring.h: change lyxstring::difference_type to be
8336 ptrdiff_t. Add std:: modifiers to streams.
8338 * src/font.C: include the <cctype> header, for islower() and
8341 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8343 * src/font.[Ch]: new files. Contains the metric functions for
8344 fonts, takes a LyXFont as parameter. Better separation of concepts.
8346 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8347 changes because of this.
8349 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8351 * src/*: compile with -Winline and move functions that don't
8354 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8357 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8359 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8360 (various files changed because of this)
8362 * src/Painter.C (text): fixed the drawing of smallcaps.
8364 * src/lyxfont.[Ch] (drawText): removed unused member func.
8367 * src/*.C: added needed "using" statements and "std::" qualifiers.
8369 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8371 * src/*.h: removed all use of "using" from header files use
8372 qualifier std:: instead.
8374 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8376 * src/text.C (Backspace): some additional cleanups (we already
8377 know whether cursor.pos is 0 or not).
8379 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8380 automake does not provide one).
8382 * src/bmtable.h: replace C++ comments with C comments.
8384 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8386 * src/screen.C (ShowCursor): Change the shape of the cursor if
8387 the current language is not equal to the language of the document.
8388 (If the cursor change its shape unexpectedly, then you've found a bug)
8390 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8393 * src/insets/insetnumber.[Ch]: New files.
8395 * src/LyXAction.C (init)
8396 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8399 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8401 * src/lyxparagraph.h
8402 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8403 (the vector is kept sorted).
8405 * src/text.C (GetVisibleRow): Draw selection correctly when there
8406 is both LTR and RTL text.
8408 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8409 which is much faster.
8411 * src/text.C (GetVisibleRow and other): Do not draw the last space
8412 in a row if the direction of the last letter is not equal to the
8413 direction of the paragraph.
8415 * src/lyxfont.C (latexWriteStartChanges):
8416 Check that font language is not equal to basefont language.
8417 (latexWriteEndChanges): ditto
8419 * src/lyx_cb.C (StyleReset): Don't change the language while using
8420 the font-default command.
8422 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8423 empty paragraph before a footnote.
8425 * src/insets/insetcommand.C (draw): Increase x correctly.
8427 * src/screen.C (ShowCursor): Change cursor shape if
8428 current language != document language.
8430 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8432 2000-03-31 Juergen Vigna <jug@sad.it>
8434 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8435 (Clone): changed mode how the paragraph-data is copied to the
8436 new clone-paragraph.
8438 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8439 GetInset(pos) with no inset anymore there (in inset UNDO)
8441 * src/insets/insetcommand.C (draw): small fix as here x is
8442 incremented not as much as width() returns (2 before, 2 behind = 4)
8444 2000-03-30 Juergen Vigna <jug@sad.it>
8446 * src/insets/insettext.C (InsetText): small fix in initialize
8447 widthOffset (should not be done in the init() function)
8449 2000-03-29 Amir Karger <karger@lyx.org>
8451 * lib/examples/it_ItemizeBullets.lyx: translation by
8454 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8456 2000-03-29 Juergen Vigna <jug@sad.it>
8458 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8460 * src/insets/insetfoot.C (Clone): small change as for the below
8461 new init function in the text-inset
8463 * src/insets/insettext.C (init): new function as I've seen that
8464 clone did not copy the Paragraph-Data!
8465 (LocalDispatch): Added code so that now we have some sort of Undo
8466 functionality (well actually we HAVE Undo ;)
8468 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8470 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8472 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8475 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8477 * src/main.C: added a runtime check that verifies that the xforms
8478 header used when building LyX and the library used when running
8479 LyX match. Exit with a message if they don't match. This is a
8480 version number check only.
8482 * src/buffer.C (save): Don't allocate memory on the heap for
8483 struct utimbuf times.
8485 * *: some using changes, use iosfwd instead of the real headers.
8487 * src/lyxfont.C use char const * instead of string for the static
8488 strings. Rewrite some functions to use sstream.
8490 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8492 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8495 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8497 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8498 of Geodesy (from Martin Vermeer)
8500 * lib/layouts/svjour.inc: include file for the Springer svjour
8501 class. It can be used to support journals other than JoG.
8503 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8504 Miskiewicz <misiek@pld.org.pl>)
8505 * lib/reLyX/Makefile.am: ditto.
8507 2000-03-27 Juergen Vigna <jug@sad.it>
8509 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8510 also some modifications with operations on selected text.
8512 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8513 problems with clicking on insets (last famous words ;)
8515 * src/insets/insetcommand.C (draw):
8516 (width): Changed to have a bit of space before and after the inset so
8517 that the blinking cursor can be seen (otherwise it was hidden)
8519 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8521 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8522 would not be added to the link list when an installed gettext (not
8523 part of libc) is found.
8525 2000-03-24 Juergen Vigna <jug@sad.it>
8527 * src/insets/insetcollapsable.C (Edit):
8528 * src/mathed/formula.C (InsetButtonRelease):
8529 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8532 * src/BufferView.C (workAreaButtonPress):
8533 (workAreaButtonRelease):
8534 (checkInsetHit): Finally fixed the clicking on insets be handled
8537 * src/insets/insetert.C (Edit): inserted this call so that ERT
8538 insets work always with LaTeX-font
8540 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8542 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8543 caused lyx to startup with no GUI in place, causing in a crash
8544 upon startup when called with arguments.
8546 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8548 * src/FontLoader.C: better initialization of dummyXFontStruct.
8550 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8552 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8553 for linuxdoc and docbook import and export format options.
8555 * lib/lyxrc.example Example of default values for the previous flags.
8557 * src/lyx_cb.C Use those flags instead of the hardwired values for
8558 linuxdoc and docbook export.
8560 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8563 * src/menus.C Added menus entries for the new import/exports formats.
8565 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8567 * src/lyxrc.*: Added support for running without Gui
8570 * src/FontLoader.C: sensible defaults if no fonts are needed
8572 * src/lyx_cb.C: New function ShowMessage (writes either to the
8573 minibuffer or cout in case of no gui
8574 New function AskOverwrite for common stuff
8575 Consequently various changes to call these functions
8577 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8578 wild guess at sensible screen resolution when having no gui
8580 * src/lyxfont.C: no gui, no fonts... set some defaults
8582 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8584 * src/LColor.C: made the command inset background a bit lighter.
8586 2000-03-20 Hartmut Goebel <goebel@noris.net>
8588 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8589 stdstruct.inc. Koma-Script added some title elements which
8590 otherwise have been listed below "bibliography". This split allows
8591 adding title elements to where they belong.
8593 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8594 define the additional title elements and then include
8597 * many other layout files: changed to include stdtitle.inc just
8598 before stdstruct.inc.
8600 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8602 * src/buffer.C: (save) Added the option to store all backup files
8603 in a single directory
8605 * src/lyxrc.[Ch]: Added variable \backupdir_path
8607 * lib/lyxrc.example: Added descriptions of recently added variables
8609 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8610 bibtex inset, not closing the bibtex popup when deleting the inset)
8612 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8614 * src/lyx_cb.C: add a couple using directives.
8616 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8617 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8618 import based on the filename.
8620 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8621 file would be imported at start, if the filename where of a sgml file.
8623 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8625 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8627 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8628 * src/lyxfont.h Replaced the member variable bits.direction by the
8629 member variable lang. Made many changes in other files.
8630 This allows having a multi-lingual document
8632 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8633 that change the current language to <l>.
8634 Removed the command "font-rtl"
8636 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8637 format for Hebrew documents)
8639 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8640 When auto_mathmode is "true", pressing a digit key in normal mode
8641 will cause entering into mathmode.
8642 If auto_mathmode is "rtl" then this behavior will be active only
8643 when writing right-to-left text.
8645 * src/text2.C (InsertStringA) The string is inserted using the
8648 * src/paragraph.C (GetEndLabel) Gives a correct result for
8649 footnote paragraphs.
8651 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8653 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8655 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8656 front of PasteParagraph. Never insert a ' '. This should at least
8657 fix some cause for the segfaults that we have been experiencing,
8658 it also fixes backspace behaviour slightly. (Phu!)
8660 * src/support/lstrings.C (compare_no_case): some change to make it
8661 compile with gcc 2.95.2 and stdlibc++-v3
8663 * src/text2.C (MeltFootnoteEnvironment): change type o
8664 first_footnote_par_is_not_empty to bool.
8666 * src/lyxparagraph.h: make text private. Changes in other files
8668 (fitToSize): new function
8669 (setContentsFromPar): new function
8670 (clearContents): new function
8671 (SetChar): new function
8673 * src/paragraph.C (readSimpleWholeFile): deleted.
8675 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8676 the file, just use a simple string instead. Also read the file in
8677 a more maintainable manner.
8679 * src/text2.C (InsertStringA): deleted.
8680 (InsertStringB): deleted.
8682 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8684 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8685 RedoParagraphs from the doublespace handling part, just set status
8686 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8687 done, but perhaps not like this.)
8689 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8691 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8692 character when inserting an inset.
8694 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8696 * src/bufferparams.C (readLanguage): now takes "default" into
8699 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8700 also initialize the toplevel_keymap with the default bindings from
8703 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8705 * all files using lyxrc: have lyxrc as a real variable and not a
8706 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8709 * src/lyxrc.C: remove double call to defaultKeyBindings
8711 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8712 toolbar defauls using lyxlex. Remove enums, structs, functions
8715 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8716 toolbar defaults. Also store default keybindings in a map.
8718 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8719 storing the toolbar defaults without any xforms dependencies.
8721 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8722 applied. Changed to use iterators.
8724 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8726 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8727 systems that don't have LINGUAS set to begin with.
8729 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8731 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8732 the list by Dekel Tsur.
8734 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8736 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8737 * src/insets/form_graphics.C: ditto.
8739 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8741 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8743 * src/bufferparams.C (readLanguage): use the new language map
8745 * src/intl.C (InitKeyMapper): use the new language map
8747 * src/lyx_gui.C (create_forms): use the new language map
8749 * src/language.[Ch]: New files. Used for holding the information
8750 about each language. Now! Use this new language map enhance it and
8751 make it really usable for our needs.
8753 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8755 * screen.C (ShowCursor): Removed duplicate code.
8756 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8757 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8759 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8762 * src/text.C Added TransformChar method. Used for rendering Arabic
8763 text correctly (change the glyphs of the letter according to the
8764 position in the word)
8769 * src/lyxrc.C Added lyxrc command {language_command_begin,
8770 language_command_end,language_command_ltr,language_command_rtl,
8771 language_package} which allows the use of either arabtex or Omega
8774 * src/lyx_gui.C (init)
8776 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8777 to use encoding for menu fonts which is different than the encoding
8780 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8781 do not load the babel package.
8782 To write an English document with Hebrew/Arabic, change the document
8783 language to "english".
8785 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8786 (alphaCounter): changed to return char
8787 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8789 * lib/lyxrc.example Added examples for Hebrew/Arabic
8792 * src/layout.C Added layout command endlabeltype
8794 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8796 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8798 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8800 * src/mathed/math_delim.C (search_deco): return a
8801 math_deco_struct* instead of index.
8803 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8805 * All files with a USE_OSTREAM_ONLY within: removed all code that
8806 was unused when USE_OSTREAM_ONLY is defined.
8808 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8809 of any less. Removed header and using.
8811 * src/text.C (GetVisibleRow): draw the string "Page Break
8812 (top/bottom)" on screen when drawing a pagebreak line.
8814 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8816 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8818 * src/mathed/math_macro.C (draw): do some cast magic.
8821 * src/mathed/math_defs.h: change byte* argument to byte const*.
8823 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8825 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8826 know it is right to return InsetFoot* too, but cxx does not like
8829 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8831 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8833 * src/mathed/math_delim.C: change == to proper assignment.
8835 2000-03-09 Juergen Vigna <jug@sad.it>
8837 * src/insets/insettext.C (setPos): fixed various cursor positioning
8838 problems (via mouse and cursor-keys)
8839 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8840 inset (still a small display problem but it works ;)
8842 * src/insets/insetcollapsable.C (draw): added button_top_y and
8843 button_bottom_y to have correct values for clicking on the inset.
8845 * src/support/lyxalgo.h: commented out 'using std::less'
8847 2000-03-08 Juergen Vigna <jug@sad.it>
8849 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8850 Button-Release event closes as it is alos the Release-Event
8853 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8855 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8857 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8858 can add multiple spaces in Scrap (literate programming) styles...
8859 which, by the way, is how I got hooked on LyX to begin with.
8861 * src/mathed/formula.C (Write): Added dummy variable to an
8862 inset::Latex() call.
8863 (Latex): Add free_spacing boolean to inset::Latex()
8865 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8867 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8868 virtual function to include the free_spacing boolean from
8869 the containing paragraph's style.
8871 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8872 Added free_spacing boolean arg to match inset.h
8874 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8875 Added free_spacing boolean arg to match inset.h
8877 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8878 Added free_spacing boolean and made sure that if in a free_spacing
8879 paragraph, that we output normal space if there is a protected space.
8881 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8882 Added free_spacing boolean arg to match inset.h
8884 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8885 Added free_spacing boolean arg to match inset.h
8887 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8888 Added free_spacing boolean arg to match inset.h
8890 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8891 Added free_spacing boolean arg to match inset.h
8893 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8894 Added free_spacing boolean arg to match inset.h
8896 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8897 free_spacing boolean arg to match inset.h
8899 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8900 Added free_spacing boolean arg to match inset.h
8902 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8903 Added free_spacing boolean arg to match inset.h
8905 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8906 Added free_spacing boolean arg to match inset.h
8908 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8909 Added free_spacing boolean arg to match inset.h
8911 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8912 Added free_spacing boolean arg to match inset.h
8914 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8915 free_spacing boolean arg to match inset.h
8917 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8918 free_spacing boolean arg to match inset.h
8920 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8921 ignore free_spacing paragraphs. The user's spaces are left
8924 * src/text.C (InsertChar): Fixed the free_spacing layout
8925 attribute behavior. Now, if free_spacing is set, you can
8926 add multiple spaces in a paragraph with impunity (and they
8927 get output verbatim).
8928 (SelectSelectedWord): Added dummy argument to inset::Latex()
8931 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8934 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8935 paragraph layouts now only input a simple space instead.
8936 Special character insets don't make any sense in free-spacing
8939 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8940 hard-spaces in the *input* file to simple spaces if the layout
8941 is free-spacing. This converts old files which had to have
8942 hard-spaces in free-spacing layouts where a simple space was
8944 (writeFileAscii): Added free_spacing check to pass to the newly
8945 reworked inset::Latex(...) methods. The inset::Latex() code
8946 ensures that hard-spaces in free-spacing paragraphs get output
8947 as spaces (rather than "~").
8949 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8951 * src/mathed/math_delim.C (draw): draw the empty placeholder
8952 delims with a onoffdash line.
8953 (struct math_deco_compare): struct that holds the "functors" used
8954 for the sort and the binary search in math_deco_table.
8955 (class init_deco_table): class used for initial sort of the
8957 (search_deco): use lower_bound to do a binary search in the
8960 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8962 * src/lyxrc.C: a small secret thingie...
8964 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8965 and to not flush the stream as often as it used to.
8967 * src/support/lyxalgo.h: new file
8968 (sorted): template function used for checking if a sequence is
8969 sorted or not. Two versions with and without user supplied
8970 compare. Uses same compare as std::sort.
8972 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8973 it and give warning on lyxerr.
8975 (struct compare_tags): struct with function operators used for
8976 checking if sorted, sorting and lower_bound.
8977 (search_kw): use lower_bound instead of manually implemented
8980 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8982 * src/insets/insetcollapsable.h: fix Clone() declaration.
8983 * src/insets/insetfoot.h: ditto.
8985 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8987 2000-03-08 Juergen Vigna <jug@sad.it>
8989 * src/insets/lyxinset.h: added owner call which tells us if
8990 this inset is inside another inset. Changed also the return-type
8991 of Editable to an enum so it tells clearer what the return-value is.
8993 * src/insets/insettext.C (computeTextRows): fixed computing of
8994 textinsets which split automatically on more rows.
8996 * src/insets/insetert.[Ch]: changed this to be of BaseType
8999 * src/insets/insetfoot.[Ch]: added footnote inset
9001 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9002 collapsable insets (like footnote, ert, ...)
9004 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9006 * src/lyxdraw.h: remvoe file
9008 * src/lyxdraw.C: remove file
9010 * src/insets/insettext.C: added <algorithm>.
9012 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9014 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9015 (matrix_cb): case MM_OK use string stream
9017 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9020 * src/mathed/math_macro.C (draw): use string stream
9021 (Metrics): use string stream
9023 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9024 directly to the ostream.
9026 * src/vspace.C (asString): use string stream.
9027 (asString): use string stream
9028 (asLatexString): use string stream
9030 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9031 setting Spacing::Other.
9033 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9034 sprintf when creating the stretch vale.
9036 * src/text2.C (alphaCounter): changed to return a string and to
9037 not use a static variable internally. Also fixed a one-off bug.
9038 (SetCounter): changed the drawing of the labels to use string
9039 streams instead of sprintf.
9041 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9042 manipulator to use a scheme that does not require library support.
9043 This is also the way it is done in the new GNU libstdc++. Should
9044 work with DEC cxx now.
9046 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9048 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9049 end. This fixes a bug.
9051 * src/mathed (all files concerned with file writing): apply the
9052 USE_OSTREAM_ONLY changes to mathed too.
9054 * src/support/DebugStream.h: make the constructor explicit.
9056 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9057 count and ostream squashed.
9059 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9061 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9063 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9064 ostringstream uses STL strings, and we might not.
9066 * src/insets/insetspecialchar.C: add using directive.
9067 * src/insets/insettext.C: ditto.
9069 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9071 * lib/layouts/seminar.layout: feeble attempt at a layout for
9072 seminar.cls, far from completet and could really use some looking
9073 at from people used to write layout files.
9075 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9076 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9077 a lot nicer and works nicely with ostreams.
9079 * src/mathed/formula.C (draw): a slightly different solution that
9080 the one posted to the list, but I think this one works too. (font
9081 size wrong in headers.)
9083 * src/insets/insettext.C (computeTextRows): some fiddling on
9084 Jürgens turf, added some comments that he should read.
9086 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9087 used and it gave compiler warnings.
9088 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9091 * src/lyx_gui.C (create_forms): do the right thing when
9092 show_banner is true/false.
9094 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9095 show_banner is false.
9097 * most file writing files: Now use iostreams to do almost all of
9098 the writing. Also instead of passing string &, we now use
9099 stringstreams. mathed output is still not adapted to iostreams.
9100 This change can be turned off by commenting out all the occurences
9101 of the "#define USE_OSTREAM_ONLY 1" lines.
9103 * src/WorkArea.C (createPixmap): don't output debug messages.
9104 (WorkArea): don't output debug messages.
9106 * lib/lyxrc.example: added a comment about the new variable
9109 * development/Code_rules/Rules: Added some more commente about how
9110 to build class interfaces and on how better encapsulation can be
9113 2000-03-03 Juergen Vigna <jug@sad.it>
9115 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9116 automatically with the width of the LyX-Window
9118 * src/insets/insettext.C (computeTextRows): fixed update bug in
9119 displaying text-insets (scrollvalues where not initialized!)
9121 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9123 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9124 id in the check of the result from lower_bound is not enough since
9125 lower_bound can return last too, and then res->id will not be a
9128 * all insets and some code that use them: I have conditionalized
9129 removed the Latex(string & out, ...) this means that only the
9130 Latex(ostream &, ...) will be used. This is a work in progress to
9131 move towards using streams for all output of files.
9133 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9136 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9138 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9139 routine (this fixes bug where greek letters were surrounded by too
9142 * src/support/filetools.C (findtexfile): change a bit the search
9143 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9144 no longer passed to kpsewhich, we may have to change that later.
9146 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9147 warning options to avoid problems with X header files (from Angus
9149 * acinclude.m4: regenerated.
9151 2000-03-02 Juergen Vigna <jug@sad.it>
9153 * src/insets/insettext.C (WriteParagraphData): Using the
9154 par->writeFile() function for writing paragraph-data.
9155 (Read): Using buffer->parseSingleLyXformat2Token()-function
9156 for parsing paragraph data!
9158 * src/buffer.C (readLyXformat2): removed all parse data and using
9159 the new parseSingleLyXformat2Token()-function.
9160 (parseSingleLyXformat2Token): added this function to parse (read)
9161 lyx-file-format (this is called also from text-insets now!)
9163 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9165 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9168 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9169 directly instead of going through a func. One very bad thing: a
9170 static LyXFindReplace, but I don't know where to place it.
9172 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9173 string instead of char[]. Also changed to static.
9174 (GetSelectionOrWordAtCursor): changed to static inline
9175 (SetSelectionOverLenChars): ditto.
9177 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9178 current_view and global variables. both classes has changed names
9179 and LyXFindReplace is not inherited from SearchForm.
9181 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9182 fl_form_search form.
9184 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9186 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9188 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9189 bound (from Kayvan).
9191 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9193 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9195 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9197 * some things that I should comment but the local pub says head to
9200 * comment out all code that belongs to the Roff code for Ascii
9201 export of tables. (this is unused)
9203 * src/LyXView.C: use correct type for global variable
9204 current_layout. (LyXTextClass::size_type)
9206 * some code to get the new insetgraphics closer to working I'd be
9207 grateful for any help.
9209 * src/BufferView2.C (insertInset): use the return type of
9210 NumberOfLayout properly. (also changes in other files)
9212 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9213 this as a test. I want to know what breaks because of this.
9215 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9217 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9219 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9220 to use a \makebox in the label, this allows proper justification
9221 with out using protected spaces or multiple hfills. Now it is
9222 "label" for left justified, "\hfill label\hfill" for center, and
9223 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9224 should be changed accordingly.
9226 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9228 * src/lyxtext.h: change SetLayout() to take a
9229 LyXTextClass::size_type instead of a char (when there is more than
9230 127 layouts in a class); also change type of copylayouttype.
9231 * src/text2.C (SetLayout): ditto.
9232 * src/LyXView.C (updateLayoutChoice): ditto.
9234 * src/LaTeX.C (scanLogFile): errors where the line number was not
9235 given just after the '!'-line were ignored (from Dekel Tsur).
9237 * lib/lyxrc.example: fix description of \date_insert_format
9239 * lib/layouts/llncs.layout: new layout, contributed by Martin
9242 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9244 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9245 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9246 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9247 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9248 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9249 paragraph.C, text.C, text2.C)
9251 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9253 * src/insets/insettext.C (LocalDispatch): remove extra break
9256 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9257 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9259 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9260 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9262 * src/insets/insetbib.h: move InsetBibkey::Holder and
9263 InsetCitation::Holder in public space.
9265 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9267 * src/insets/insettext.h: small change to get the new files from
9268 Juergen to compile (use "string", not "class string").
9270 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9271 const & as parameter to LocalDispatch, use LyXFont const & as
9272 paramter to some other func. This also had impacto on lyxinsets.h
9273 and the two mathed insets.
9275 2000-02-24 Juergen Vigna <jug@sad.it>
9278 * src/commandtags.h:
9280 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9284 * src/BufferView2.C: added/updated code for various inset-functions
9286 * src/insets/insetert.[Ch]: added implementation of InsetERT
9288 * src/insets/insettext.[Ch]: added implementation of InsetText
9290 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9291 (draw): added preliminary code for inset scrolling not finshed yet
9293 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9294 as it is in lyxfunc.C now
9296 * src/insets/lyxinset.h: Added functions for text-insets
9298 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9300 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9301 BufferView and reimplement the list as a queue put inside its own
9304 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9306 * several files: use the new interface to the "updateinsetlist"
9308 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9310 (work_area_handler): call BufferView::trippleClick on trippleclick.
9312 * src/BufferView.C (doubleClick): new function, selects word on
9314 (trippleClick): new function, selects line on trippleclick.
9316 2000-02-22 Allan Rae <rae@lyx.org>
9318 * lib/bind/xemacs.bind: buffer-previous not supported
9320 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9322 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9325 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9327 * src/bufferlist.C: get rid of current_view from this file
9329 * src/spellchecker.C: get rid of current_view from this file
9331 * src/vspace.C: get rid of current_view from this file
9332 (inPixels): added BufferView parameter for this func
9333 (asLatexCommand): added a BufferParams for this func
9335 * src/text.C src/text2.C: get rid of current_view from these
9338 * src/lyxfont.C (getFontDirection): move this function here from
9341 * src/bufferparams.C (getDocumentDirection): move this function
9344 * src/paragraph.C (getParDirection): move this function here from
9346 (getLetterDirection): ditto
9348 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9350 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9351 resize due to wrong pixmap beeing used. Also took the opurtunity
9352 to make the LyXScreen stateless on regard to WorkArea and some
9353 general cleanup in the same files.
9355 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9357 * src/Makefile.am: add missing direction.h
9359 * src/PainterBase.h: made the width functions const.
9361 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9364 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9366 * src/insets/insetlatexaccent.C (draw): make the accents draw
9367 better, at present this will only work well with iso8859-1.
9369 * several files: remove the old drawing code, now we use the new
9372 * several files: remove support for mono_video, reverse_video and
9375 2000-02-17 Juergen Vigna <jug@sad.it>
9377 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9378 int ** as we have to return the pointer, otherwise we have only
9379 NULL pointers in the returning function.
9381 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9383 * src/LaTeX.C (operator()): quote file name when running latex.
9385 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9387 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9388 (bubble tip), this removes our special handling of this.
9390 * Remove all code that is unused now that we have the new
9391 workarea. (Code that are not active when NEW_WA is defined.)
9393 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9395 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9397 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9398 nonexisting layout; correctly redirect obsoleted layouts.
9400 * lib/lyxrc.example: document \view_dvi_paper_option
9402 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9405 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9406 (PreviewDVI): handle the view_dvi_paper_option variable.
9407 [Both from Roland Krause]
9409 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9411 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9412 char const *, int, LyXFont)
9413 (text(int, int, string, LyXFont)): ditto
9415 * src/text.C (InsertCharInTable): attempt to fix the double-space
9416 feature in tables too.
9417 (BackspaceInTable): ditto.
9418 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9420 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9422 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9424 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9425 newly found text in textcache to this.
9426 (buffer): set the owner of the text put into the textcache to 0
9428 * src/insets/figinset.C (draw): fixed the drawing of figures with
9431 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9432 drawing of mathframe, hfills, protected space, table lines. I have
9433 now no outstanding drawing problems with the new Painter code.
9435 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9437 * src/PainterBase.C (ellipse, circle): do not specify the default
9440 * src/LColor.h: add using directive.
9442 * src/Painter.[Ch]: change return type of methods from Painter& to
9443 PainterBase&. Add a using directive.
9445 * src/WorkArea.C: wrap xforms callbacks in C functions
9448 * lib/layouts/foils.layout: font fix and simplifications from Carl
9451 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9453 * a lot of files: The Painter, LColor and WorkArea from the old
9454 devel branch has been ported to lyx-devel. Some new files and a
9455 lot of #ifdeffed code. The new workarea is enabled by default, but
9456 if you want to test the new Painter and LColor you have to compile
9457 with USE_PAINTER defined (do this in config.h f.ex.) There are
9458 still some rought edges, and I'd like some help to clear those
9459 out. It looks stable (loads and displays the Userguide very well).
9462 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9464 * src/buffer.C (pop_tag): revert to the previous implementation
9465 (use a global variable for both loops).
9467 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9469 * src/lyxrc.C (LyXRC): change slightly default date format.
9471 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9472 there is an English text with a footnote that starts with a Hebrew
9473 paragraph, or vice versa.
9474 (TeXFootnote): ditto.
9476 * src/text.C (LeftMargin): allow for negative values for
9477 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9480 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9481 for input encoding (cyrillic)
9483 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9485 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9488 * src/toolbar.C (set): ditto
9489 * src/insets/insetbib.C (create_form_citation_form): ditto
9491 * lib/CREDITS: added Dekel Tsur.
9493 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9494 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9495 hebrew supports files from Dekel Tsur.
9497 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9498 <tzafrir@technion.ac.il>
9500 * src/lyxrc.C: put \date_insert_format at the right place.
9502 * src/buffer.C (makeLaTeXFile): fix the handling of
9503 BufferParams::sides when writing out latex files.
9505 * src/BufferView2.C: add a "using" directive.
9507 * src/support/lyxsum.C (sum): when we use lyxstring,
9508 ostringstream::str needs an additional .c_str().
9510 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9512 * src/support/filetools.C (ChangeExtension): patch from Etienne
9515 * src/TextCache.C (show): remove const_cast and make second
9516 parameter non-const LyXText *.
9518 * src/TextCache.h: use non const LyXText in show.
9520 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9523 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9525 * src/support/lyxsum.C: rework to be more flexible.
9527 * several places: don't check if a pointer is 0 if you are going
9530 * src/text.C: remove some dead code.
9532 * src/insets/figinset.C: remove some dead code
9534 * src/buffer.C: move the BufferView funcs to BufferView2.C
9535 remove all support for insetlatexdel
9536 remove support for oldpapersize stuff
9537 made some member funcs const
9539 * src/kbmap.C: use a std::list to store the bindings in.
9541 * src/BufferView2.C: new file
9543 * src/kbsequence.[Ch]: new files
9545 * src/LyXAction.C + others: remove all trace of buffer-previous
9547 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9548 only have one copy in the binary of this table.
9550 * hebrew patch: moved some functions from LyXText to more
9551 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9553 * several files: remove support for XForms older than 0.88
9555 remove some #if 0 #endif code
9557 * src/TextCache.[Ch]: new file. Holds the textcache.
9559 * src/BufferView.C: changes to use the new TextCache interface.
9560 (waitForX): remove the now unused code.
9562 * src/BackStack.h: remove some commented code
9564 * lib/bind/emacs.bind: remove binding for buffer-previous
9566 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9568 * applied the hebrew patch.
9570 * src/lyxrow.h: make sure that all Row variables are initialized.
9572 * src/text2.C (TextHandleUndo): comment out a delete, this might
9573 introduce a memory leak, but should also help us to not try to
9574 read freed memory. We need to look at this one.
9576 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9577 (LyXParagraph): initalize footnotekind.
9579 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9580 forgot this when applying the patch. Please heed the warnings.
9582 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9583 (aka. reformat problem)
9585 * src/bufferlist.C (exists): made const, and use const_iterator
9586 (isLoaded): new func.
9587 (release): use std::find to find the correct buffer.
9589 * src/bufferlist.h: made getState a const func.
9590 made empty a const func.
9591 made exists a const func.
9594 2000-02-01 Juergen Vigna <jug@sad.it>
9596 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9598 * po/it.po: updated a bit the italian po file and also changed the
9599 'file nuovo' for newfile to 'filenuovo' without a space, this did
9602 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9603 for the new insert_date command.
9605 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9606 from jdblair, to insert a date into the current text conforming to
9607 a strftime format (for now only considering the locale-set and not
9608 the document-language).
9610 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9612 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9613 Bounds Read error seen by purify. The problem was that islower is
9614 a macros which takes an unsigned char and uses it as an index for
9615 in array of characters properties (and is thus subject to the
9619 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9620 correctly the paper sides radio buttons.
9621 (UpdateDocumentButtons): ditto.
9623 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9625 * src/kbmap.C (getsym + others): change to return unsigned int,
9626 returning a long can give problems on 64 bit systems. (I assume
9627 that int is 32bit on 64bit systems)
9629 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9631 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9632 LyXLookupString to be zero-terminated. Really fixes problems seen
9635 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9637 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9638 write a (char*)0 to the lyxerr stream.
9640 * src/lastfiles.C: move algorithm before the using statemets.
9642 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9644 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9645 complains otherwise).
9646 * src/table.C: ditto
9648 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9651 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9652 that I removed earlier... It is really needed.
9654 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9656 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9658 * INSTALL: update xforms home page URL.
9660 * lib/configure.m4: fix a bug with unreadable layout files.
9662 * src/table.C (calculate_width_of_column): add "using std::max"
9665 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9667 * several files: marked several lines with "DEL LINE", this is
9668 lines that can be deleted without changing anything.
9669 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9670 checks this anyway */
9673 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9675 * src/DepTable.C (update): add a "+" at the end when the checksum
9676 is different. (debugging string only)
9678 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9679 the next inset to not be displayed. This should also fix the list
9680 of labels in the "Insert Crossreference" dialog.
9682 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9684 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9685 when regex was not found.
9687 * src/support/lstrings.C (lowercase): use handcoded transform always.
9690 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9691 old_cursor.par->prev could be 0.
9693 * several files: changed post inc/dec to pre inc/dec
9695 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9696 write the lastfiles to file.
9698 * src/BufferView.C (buffer): only show TextCache info when debugging
9700 (resizeCurrentBuffer): ditto
9701 (workAreaExpose): ditto
9703 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9705 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9707 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9708 a bit better by removing the special case for \i and \j.
9710 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9712 * src/lyx_main.C (easyParse): remove test for bad comand line
9713 options, since this broke all xforms-related parsing.
9715 * src/kbmap.C (getsym): set return type to unsigned long, as
9716 declared in header. On an alpha, long is _not_ the same as int.
9718 * src/support/LOstream.h: add a "using std::flush;"
9720 * src/insets/figinset.C: ditto.
9722 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9724 * src/bufferlist.C (write): use blinding fast file copy instead of
9725 "a char at a time", now we are doing it the C++ way.
9727 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9728 std::list<int> instead.
9729 (addpidwait): reflect move to std::list<int>
9730 (sigchldchecker): ditto
9732 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9735 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9736 that obviously was wrong...
9738 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9739 c, this avoids warnings with purify and islower.
9741 * src/insets/figinset.C: rename struct queue to struct
9742 queue_element and rewrite to use a std::queue. gsqueue is now a
9743 std::queue<queue_element>
9744 (runqueue): reflect move to std::queue
9747 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9748 we would get "1" "0" instead of "true" "false. Also make the tostr
9751 2000-01-21 Juergen Vigna <jug@sad.it>
9753 * src/buffer.C (writeFileAscii): Disabled code for special groff
9754 handling of tabulars till I fix this in table.C
9756 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9758 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9760 * src/support/lyxlib.h: ditto.
9762 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9764 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9765 and 'j' look better. This might fix the "macron" bug that has been
9768 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9769 functions as one template function. Delete the old versions.
9771 * src/support/lyxsum.C: move using std::ifstream inside
9774 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9777 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9779 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9781 * src/insets/figinset.C (InitFigures): use new instead of malloc
9782 to allocate memory for figures and bitmaps.
9783 (DoneFigures): use delete[] instead of free to deallocate memory
9784 for figures and bitmaps.
9785 (runqueue): use new to allocate
9786 (getfigdata): use new/delete[] instead of malloc/free
9787 (RegisterFigure): ditto
9789 * some files: moved some declarations closer to first use, small
9790 whitespace changes use preincrement instead of postincrement where
9791 it does not make a difference.
9793 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9794 step on the way to use stl::containers for key maps.
9796 * src/bufferlist.h: add a typedef for const_iterator and const
9797 versions of begin and end.
9799 * src/bufferlist.[Ch]: change name of member variable _state to
9800 state_. (avoid reserved names)
9802 (getFileNames): returns the filenames of the buffers in a vector.
9804 * configure.in (ALL_LINGUAS): added ro
9806 * src/support/putenv.C: new file
9808 * src/support/mkdir.C: new file
9810 2000-01-20 Allan Rae <rae@lyx.org>
9812 * lib/layouts/IEEEtran.layout: Added several theorem environments
9814 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9815 couple of minor additions.
9817 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9818 (except for those in footnotes of course)
9820 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9822 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9824 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9825 std::sort and std::lower_bound instead of qsort and handwritten
9827 (struct compara): struct that holds the functors used by std::sort
9828 and std::lower_bound in MathedLookupBOP.
9830 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9832 * src/support/LAssert.h: do not do partial specialization. We do
9835 * src/support/lyxlib.h: note that lyx::getUserName() and
9836 lyx::date() are not in use right now. Should these be suppressed?
9838 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9839 (makeLinuxDocFile): do not put date and user name in linuxdoc
9842 * src/support/lyxlib.h (kill): change first argument to long int,
9843 since that's what solaris uses.
9845 * src/support/kill.C (kill): fix declaration to match prototype.
9847 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9848 actually check whether namespaces are supported. This is not what
9851 * src/support/lyxsum.C: add a using directive.
9853 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9855 * src/support/kill.C: if we have namespace support we don't have
9856 to include lyxlib.h.
9858 * src/support/lyxlib.h: use namespace lyx if supported.
9860 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9862 * src/support/date.C: new file
9864 * src/support/chdir.C: new file
9866 * src/support/getUserName.C: new file
9868 * src/support/getcwd.C: new file
9870 * src/support/abort.C: new file
9872 * src/support/kill.C: new file
9874 * src/support/lyxlib.h: moved all the functions in this file
9875 insede struct lyx. Added also kill and abort to this struct. This
9876 is a way to avoid the "kill is not defined in <csignal>", we make
9877 C++ wrappers for functions that are not ANSI C or ANSI C++.
9879 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9880 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9881 lyx it has been renamed to sum.
9883 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9885 * src/text.C: add using directives for std::min and std::max.
9887 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9889 * src/texrow.C (getIdFromRow): actually return something useful in
9890 id and pos. Hopefully fixes the bug with positionning of errorbox
9893 * src/lyx_main.C (easyParse): output an error and exit if an
9894 incorrect command line option has been given.
9896 * src/spellchecker.C (ispell_check_word): document a memory leak.
9898 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9899 where a "struct utimbuf" is allocated with "new" and deleted with
9902 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9904 * src/text2.C (CutSelection): don't delete double spaces.
9905 (PasteSelection): ditto
9906 (CopySelection): ditto
9908 * src/text.C (Backspace): don't delete double spaces.
9910 * src/lyxlex.C (next): fix a bug that were only present with
9911 conformant std::istream::get to read comment lines, use
9912 std::istream::getline instead. This seems to fix the problem.
9914 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9916 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9917 allowed to insert space before space" editing problem. Please read
9918 commends at the beginning of the function. Comments about usage
9921 * src/text.C (InsertChar): fix for the "not allowed to insert
9922 space before space" editing problem.
9924 * src/text2.C (DeleteEmptyParagraphMechanism): when
9925 IsEmptyTableRow can only return false this last "else if" will
9926 always be a no-op. Commented out.
9928 * src/text.C (RedoParagraph): As far as I can understand tmp
9929 cursor is not really needed.
9931 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9932 present it could only return false anyway.
9933 (several functions): Did something not so smart...added a const
9934 specifier on a lot of methods.
9936 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9937 and add a tmp->text.resize. The LyXParagraph constructor does the
9939 (BreakParagraphConservative): ditto
9941 * src/support/path.h (Path): add a define so that the wrong usage
9942 "Path("/tmp") will be flagged as a compilation error:
9943 "`unnamed_Path' undeclared (first use this function)"
9945 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9947 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9948 which was bogus for several reasons.
9950 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9954 * autogen.sh: do not use "type -path" (what's that anyway?).
9956 * src/support/filetools.C (findtexfile): remove extraneous space
9957 which caused a kpsewhich warning (at least with kpathsea version
9960 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9962 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9964 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9966 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9968 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9970 * src/paragraph.C (BreakParagraph): do not reserve space on text
9971 if we don't need to (otherwise, if pos_end < pos, we end up
9972 reserving huge amounts of memory due to bad unsigned karma).
9973 (BreakParagraphConservative): ditto, although I have not seen
9974 evidence the bug can happen here.
9976 * src/lyxparagraph.h: add a using std::list.
9978 2000-01-11 Juergen Vigna <jug@sad.it>
9980 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9983 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9985 * src/vc-backend.C (doVCCommand): change to be static and take one
9986 more parameter: the path to chdir too be fore executing the command.
9987 (retrive): new function equiv to "co -r"
9989 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9990 file_not_found_hook is true.
9992 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9994 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9995 if a file is readwrite,readonly...anything else.
9997 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9999 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10000 (CreatePostscript): name change from MenuRunDVIPS (or something)
10001 (PreviewPostscript): name change from MenuPreviewPS
10002 (PreviewDVI): name change from MenuPreviewDVI
10004 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10005 \view_pdf_command., \pdf_to_ps_command
10007 * lib/configure.m4: added search for PDF viewer, and search for
10008 PDF to PS converter.
10009 (lyxrc.defaults output): add \pdflatex_command,
10010 \view_pdf_command and \pdf_to_ps_command.
10012 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10014 * src/bufferlist.C (write): we don't use blocksize for anything so
10017 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10019 * src/support/block.h: disable operator T* (), since it causes
10020 problems with both compilers I tried. See comments in the file.
10022 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10025 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10026 variable LYX_DIR_10x to LYX_DIR_11x.
10028 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10030 * INSTALL: document --with-lyxname.
10033 * configure.in: new configure flag --with-lyxname which allows to
10034 choose the name under which lyx is installed. Default is "lyx", of
10035 course. It used to be possible to do this with --program-suffix,
10036 but the later has in fact a different meaning for autoconf.
10038 * src/support/lstrings.h (lstrchr): reformat a bit.
10040 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10041 * src/mathed/math_defs.h: ditto.
10043 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10045 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10046 true, decides if we create a backup file or not when saving. New
10047 tag and variable \pdf_mode, defaults to false. New tag and
10048 variable \pdflatex_command, defaults to pdflatex. New tag and
10049 variable \view_pdf_command, defaults to xpdf. New tag and variable
10050 \pdf_to_ps_command, defaults to pdf2ps.
10052 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10054 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10055 does not have a BufferView.
10056 (unlockInset): ditto + don't access the_locking_inset if the
10057 buffer does not have a BufferView.
10059 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10060 certain circumstances so that we don't continue a keyboard
10061 operation long after the key was released. Try f.ex. to load a
10062 large document, press PageDown for some seconds and then release
10063 it. Before this change the document would contine to scroll for
10064 some time, with this change it stops imidiatly.
10066 * src/support/block.h: don't allocate more space than needed. As
10067 long as we don't try to write to the arr[x] in a array_type arr[x]
10068 it is perfectly ok. (if you write to it you might segfault).
10069 added operator value_type*() so that is possible to pass the array
10070 to functions expecting a C-pointer.
10072 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10075 * intl/*: updated to gettext 0.10.35, tried to add our own
10076 required modifications. Please verify.
10078 * po/*: updated to gettext 0.10.35, tried to add our own required
10079 modifications. Please verify.
10081 * src/support/lstrings.C (tostr): go at fixing the problem with
10082 cxx and stringstream. When stringstream is used return
10083 oss.str().c_str() so that problems with lyxstring and basic_string
10084 are avoided. Note that the best solution would be for cxx to use
10085 basic_string all the way, but it is not conformant yet. (it seems)
10087 * src/lyx_cb.C + other files: moved several global functions to
10088 class BufferView, some have been moved to BufferView.[Ch] others
10089 are still located in lyx_cb.C. Code changes because of this. (part
10090 of "get rid of current_view project".)
10092 * src/buffer.C + other files: moved several Buffer functions to
10093 class BufferView, the functions are still present in buffer.C.
10094 Code changes because of this.
10096 * config/lcmessage.m4: updated to most recent. used when creating
10099 * config/progtest.m4: updated to most recent. used when creating
10102 * config/gettext.m4: updated to most recent. applied patch for
10105 * config/gettext.m4.patch: new file that shows what changes we
10106 have done to the local copy of gettext.m4.
10108 * config/libtool.m4: new file, used in creation of acinclude.m4
10110 * config/lyxinclude.m4: new file, this is the lyx created m4
10111 macros, used in making acinclude.m4.
10113 * autogen.sh: GNU m4 discovered as a separate task not as part of
10114 the lib/configure creation.
10115 Generate acinlucde from files in config. Actually cat
10116 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10117 easier to upgrade .m4 files that really are external.
10119 * src/Spacing.h: moved using std::istringstream to right after
10120 <sstream>. This should fix the problem seen with some compilers.
10122 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10124 * src/lyx_cb.C: began some work to remove the dependency a lot of
10125 functions have on BufferView::text, even if not really needed.
10126 (GetCurrentTextClass): removed this func, it only hid the
10129 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10130 forgot this in last commit.
10132 * src/Bullet.C (bulletEntry): use static char const *[] for the
10133 tables, becuase of this the return arg had to change to string.
10134 (bulletSize): ditto
10135 (~Bullet): removed unneeded destructor
10137 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10138 (insetSleep): moved from Buffer
10139 (insetWakeup): moved from Buffer
10140 (insetUnlock): moved from Buffer
10142 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10143 from Buffer to BufferView.
10145 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10147 * config/ltmain.sh: updated to version 1.3.4 of libtool
10149 * config/ltconfig: updated to version 1.3.4 of libtool
10151 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10154 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10155 Did I get that right?
10157 * src/lyxlex.h: add a "using" directive or two.
10158 * src/Spacing.h: ditto.
10159 * src/insets/figinset.C: ditto.
10160 * src/support/filetools.C: ditto.
10161 * src/support/lstrings.C: ditto.
10162 * src/BufferView.C: ditto.
10163 * src/bufferlist.C: ditto.
10164 * src/lyx_cb.C: ditto.
10165 * src/lyxlex.C: ditto.
10167 * NEWS: add some changes for 1.1.4.
10169 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10171 * src/BufferView.C: first go at a TextCache to speed up switching
10174 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10176 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10177 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10178 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10179 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10182 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10183 members of the struct are correctly initialized to 0 (detected by
10185 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10186 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10188 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10189 pidwait, since it was allocated with "new". This was potentially
10190 very bad. Thanks to Michael Schmitt for running purify for us.
10193 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10195 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10197 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10199 1999-12-30 Allan Rae <rae@lyx.org>
10201 * lib/templates/IEEEtran.lyx: minor change
10203 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10204 src/mathed/formula.C (LocalDispatch): askForText changes
10206 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10207 know when a user has cancelled input. Fixes annoying problems with
10208 inserting labels and version control.
10210 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10212 * src/support/lstrings.C (tostr): rewritten to use strstream and
10215 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10217 * src/support/filetools.C (IsFileWriteable): use fstream to check
10218 (IsDirWriteable): use fileinfo to check
10220 * src/support/filetools.h (FilePtr): whole class deleted
10222 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10224 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10226 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10228 * src/bufferlist.C (write): use ifstream and ofstream instead of
10231 * src/Spacing.h: use istrstream instead of sscanf
10233 * src/mathed/math_defs.h: change first arg to istream from FILE*
10235 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10237 * src/mathed/math_parser.C: have yyis to be an istream
10238 (LexGetArg): use istream (yyis)
10240 (mathed_parse): ditto
10241 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10243 * src/mathed/formula.C (Read): rewritten to use istream
10245 * src/mathed/formulamacro.C (Read): rewritten to use istream
10247 * src/lyxlex.h (~LyXLex): deleted desturctor
10248 (getStream): new function, returns an istream
10249 (getFile): deleted funtion
10250 (IsOK): return is.good();
10252 * src/lyxlex.C (LyXLex): delete file and owns_file
10253 (setFile): open an filebuf and assign that to a istream instead of
10255 (setStream): new function, takes an istream as arg.
10256 (setFile): deleted function
10257 (EatLine): rewritten us use istream instead of FILE*
10261 * src/table.C (LyXTable): use istream instead of FILE*
10262 (Read): rewritten to take an istream instead of FILE*
10264 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10266 * src/buffer.C (Dispatch): remove an extraneous break statement.
10268 * src/support/filetools.C (QuoteName): change to do simple
10269 'quoting'. More work is necessary. Also changed to do nothing
10270 under emx (needs fix too).
10271 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10273 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10274 config.h.in to the AC_DEFINE_UNQUOTED() call.
10275 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10276 needs char * as argument (because Solaris 7 declares it like
10279 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10280 remove definition of BZERO.
10282 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10284 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10285 defined, "lyxregex.h" if not.
10287 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10289 (REGEX): new variable that is set to regex.c lyxregex.h when
10290 AM_CONDITIONAL USE_REGEX is set.
10291 (libsupport_la_SOURCES): add $(REGEX)
10293 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10296 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10299 * configure.in: add call to LYX_REGEX
10301 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10302 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10304 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10306 * lib/bind/fi_menus.bind: new file, from
10307 pauli.virtanen@saunalahti.fi.
10309 * src/buffer.C (getBibkeyList): pass the parameter delim to
10310 InsetInclude::getKeys and InsetBibtex::getKeys.
10312 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10313 is passed to Buffer::getBibkeyList
10315 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10316 instead of the hardcoded comma.
10318 * src/insets/insetbib.C (getKeys): make sure that there are not
10319 leading blanks in bibtex keys. Normal latex does not care, but
10320 harvard.sty seems to dislike blanks at the beginning of citation
10321 keys. In particular, the retturn value of the function is
10323 * INSTALL: make it clear that libstdc++ is needed and that gcc
10324 2.7.x probably does not work.
10326 * src/support/filetools.C (findtexfile): make debug message go to
10328 * src/insets/insetbib.C (getKeys): ditto
10330 * src/debug.C (showTags): make sure that the output is correctly
10333 * configure.in: add a comment for TWO_COLOR_ICON define.
10335 * acconfig.h: remove all the entries that already defined in
10336 configure.in or acinclude.m4.
10338 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10339 to avoid user name, date and copyright.
10341 1999-12-21 Juergen Vigna <jug@sad.it>
10343 * src/table.C (Read): Now read bogus row format informations
10344 if the format is < 5 so that afterwards the table can
10345 be read by lyx but without any format-info. Fixed the
10346 crash we experienced when not doing this.
10348 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10350 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10351 (RedoDrawingOfParagraph): ditto
10352 (RedoParagraphs): ditto
10353 (RemoveTableRow): ditto
10355 * src/text.C (Fill): rename arg paperwidth -> paper_width
10357 * src/buffer.C (insertLyXFile): rename var filename -> fname
10358 (writeFile): rename arg filename -> fname
10359 (writeFileAscii): ditto
10360 (makeLaTeXFile): ditto
10361 (makeLinuxDocFile): ditto
10362 (makeDocBookFile): ditto
10364 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10367 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10369 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10372 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10373 compiled by a C compiler not C++.
10375 * src/layout.h (LyXTextClass): added typedef for const_iterator
10376 (LyXTextClassList): added typedef for const_iterator + member
10377 functions begin and end.
10379 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10380 iterators to fill the choice_class.
10381 (updateLayoutChoice): rewritten to use iterators to fill the
10382 layoutlist in the toolbar.
10384 * src/BufferView.h (BufferView::work_area_width): removed unused
10387 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10389 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10390 (sgmlCloseTag): ditto
10392 * src/support/lstrings.h: return type of countChar changed to
10395 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10396 what version of this func to use. Also made to return unsigned int.
10398 * configure.in: call LYX_STD_COUNT
10400 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10401 conforming std::count.
10403 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10405 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10406 and a subscript would give bad display (patch from Dekel Tsur
10407 <dekel@math.tau.ac.il>).
10409 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10411 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10414 * src/chset.h: add a few 'using' directives
10416 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10417 triggered when no buffer is active
10419 * src/layout.C: removed `break' after `return' in switch(), since
10422 * src/lyx_main.C (init): make sure LyX can be ran in place even
10423 when libtool has done its magic with shared libraries. Fix the
10424 test for the case when the system directory has not been found.
10426 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10427 name for the latex file.
10428 (MenuMakeHTML): ditto
10430 * src/buffer.h: add an optional boolean argument, which is passed
10431 to ChangeExtension.
10433 1999-12-20 Allan Rae <rae@lyx.org>
10435 * lib/templates/IEEEtran.lyx: small correction and update.
10437 * configure.in: Attempted to use LYX_PATH_HEADER
10439 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10441 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10442 input from JMarc. Now use preprocessor to find the header.
10443 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10444 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10445 LYX_STL_STRING_FWD. See comments in file.
10447 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10449 * The global MiniBuffer * minibuffer variable is dead.
10451 * The global FD_form_main * fd_form_main variable is dead.
10453 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10455 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10457 * src/table.h: add the LOstream.h header
10458 * src/debug.h: ditto
10460 * src/LyXAction.h: change the explaination of the ReadOnly
10461 attribute: is indicates that the function _can_ be used.
10463 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10466 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10468 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10474 * src/paragraph.C (GetWord): assert on pos>=0
10477 * src/support/lyxstring.C: condition the use of an invariant on
10479 * src/support/lyxstring.h: ditto
10481 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10482 Use LAssert.h instead of plain assert().
10484 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10486 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10487 * src/support/filetools.C: ditto
10489 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10492 * INSTALL: document the new configure flags
10494 * configure.in: suppress --with-debug; add --enable-assertions
10496 * acinclude.m4: various changes in alignment of help strings.
10498 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10500 * src/kbmap.C: commented out the use of the hash map in kb_map,
10501 beginning of movement to a stl::container.
10503 * several files: removed code that was not in effect when
10504 MOVE_TEXT was defined.
10506 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10507 for escaping should not be used. We can discuss if the string
10508 should be enclosed in f.ex. [] instead of "".
10510 * src/trans_mgr.C (insert): use the new returned value from
10511 encodeString to get deadkeys and keymaps done correctly.
10513 * src/chset.C (encodeString): changed to return a pair, to tell
10514 what to use if we know the string.
10516 * src/lyxscreen.h (fillArc): new function.
10518 * src/FontInfo.C (resize): rewritten to use more std::string like
10519 structore, especially string::replace.
10521 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10524 * configure.in (chmod +x some scripts): remove config/gcc-hack
10526 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10528 * src/buffer.C (writeFile): change once again the top comment in a
10529 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10530 instead of an hardcoded version number.
10531 (makeDocBookFile): ditto
10533 * src/version.h: add new define LYX_DOCVERSION
10535 * po/de.po: update from Pit Sütterlin
10536 * lib/bind/de_menus.bind: ditto.
10538 * src/lyxfunc.C (Dispatch): call MenuExport()
10539 * src/buffer.C (Dispatch): ditto
10541 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10542 LyXFunc::Dispatch().
10543 (MenuExport): new function, moved from
10544 LyXFunc::Dispatch().
10546 * src/trans_mgr.C (insert): small cleanup
10547 * src/chset.C (loadFile): ditto
10549 * lib/kbd/iso8859-1.cdef: add missing backslashes
10551 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10553 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10554 help with placing the manually drawn accents better.
10556 (Draw): x2 and hg changed to float to minimize rounding errors and
10557 help place the accents better.
10559 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10560 unsigned short to char is just wrong...cast the char to unsigned
10561 char instead so that the two values can compare sanely. This
10562 should also make the display of insetlatexaccents better and
10563 perhaps also some other insets.
10565 (lbearing): new function
10568 1999-12-15 Allan Rae <rae@lyx.org>
10570 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10571 header that provides a wrapper around the very annoying SGI STL header
10574 * src/support/lyxstring.C, src/LString.h:
10575 removed old SGI-STL-compatability attempts.
10577 * configure.in: Use LYX_STL_STRING_FWD.
10579 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10580 stl_string_fwd.h is around and try to determine it's location.
10581 Major improvement over previous SGI STL 3.2 compatability.
10582 Three small problems remain with this function due to my zero
10583 knowledge of autoconf. JMarc and lgb see the comments in the code.
10585 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10587 * src/broken_const.h, config/hack-gcc, config/README: removed
10589 * configure.in: remove --with-gcc-hack option; do not call
10592 * INSTALL: remove documentation of --with-broken-const and
10595 * acconfig.h: remove all trace of BROKEN_CONST define
10597 * src/buffer.C (makeDocBookFile): update version number in output
10599 (SimpleDocBookOnePar): fix an assert when trying to a character
10600 access beyond string length
10603 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10605 * po/de.po: fix the Export menu
10607 * lyx.man: update the description of -dbg
10609 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10610 (commandLineHelp): updated
10611 (easyParse): show list of available debug levels if -dbg is passed
10614 * src/Makefile.am: add debug.C
10616 * src/debug.h: moved some code to debug.C
10618 * src/debug.C: new file. Contains code to set and show debug
10621 * src/layout.C: remove 'break' after 'continue' in switch
10622 statements, since these cannot be reached.
10624 1999-12-13 Allan Rae <rae@lyx.org>
10626 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10627 (in_word_set): hash() -> math_hash()
10629 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10631 * acconfig.h: Added a test for whether we are using exceptions in the
10632 current compilation run. If so USING_EXCEPTIONS is defined.
10634 * config.in: Check for existance of stl_string_fwd.h
10635 * src/LString.h: If compiling --with-included-string and SGI's
10636 STL version 3.2 is present (see above test) we need to block their
10637 forward declaration of string and supply a __get_c_string().
10638 However, it turns out this is only necessary if compiling with
10639 exceptions enabled so I've a bit more to add yet.
10641 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10642 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10643 src/support/LRegex.h, src/undo.h:
10644 Shuffle the order of the included files a little to ensure that
10645 LString.h gets included before anything that includes stl_string_fwd.h
10647 * src/support/lyxstring.C: We need to #include LString.h instead of
10648 lyxstring.h to get the necessary definition of __get_c_string.
10649 (__get_c_string): New function. This is defined static just like SGI's
10650 although why they need to do this I'm not sure. Perhaps it should be
10651 in lstrings.C instead.
10653 * lib/templates/IEEEtran.lyx: New template file.
10655 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10657 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10658 * intl/Makefile.in (MKINSTALLDIRS): ditto
10660 * src/LyXAction.C (init): changed to hold the LFUN data in a
10661 automatic array in stead of in callso to newFunc, this speeds up
10662 compilation a lot. Also all the memory used by the array is
10663 returned when the init is completed.
10665 * a lot of files: compiled with -Wold-style-cast, changed most of
10666 the reported offenders to C++ style casts. Did not change the
10667 offenders in C files.
10669 * src/trans.h (Match): change argument type to unsigned int.
10671 * src/support/DebugStream.C: fix some types on the streambufs so
10672 that it works on a conforming implementation.
10674 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10676 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10678 * src/support/lyxstring.C: remove the inline added earlier since
10679 they cause a bunch of unsatisfied symbols when linking with dec
10680 cxx. Cxx likes to have the body of inlines at the place where they
10683 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10684 accessing negative bounds in array. This fixes the crash when
10685 inserting accented characters.
10686 * src/trans.h (Match): ditto
10688 * src/buffer.C (Dispatch): since this is a void, it should not try
10689 to return anything...
10691 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10693 * src/buffer.h: removed the two friends from Buffer. Some changes
10694 because of this. Buffer::getFileName and Buffer::setFileName
10695 renamed to Buffer::fileName() and Buffer::fileName(...).
10697 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10699 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10700 and Buffer::update(short) to BufferView. This move is currently
10701 controlled by a define MOVE_TEXT, this will be removed when all
10702 shows to be ok. This move paves the way for better separation
10703 between buffer contents and buffer view. One side effect is that
10704 the BufferView needs a rebreak when swiching buffers, if we want
10705 to avoid this we can add a cache that holds pointers to LyXText's
10706 that is not currently in use.
10708 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10711 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10713 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10715 * lyx_main.C: new command line option -x (or --execute) and
10716 -e (or --export). Now direct conversion from .lyx to .tex
10717 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10718 Unfortunately, X is still needed and the GUI pops up during the
10721 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10723 * src/Spacing.C: add a using directive to bring stream stuff into
10725 * src/paragraph.C: ditto
10726 * src/buffer.C: ditto
10728 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10729 from Lars' announcement).
10731 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10732 example files from Tino Meinen.
10734 1999-12-06 Allan Rae <rae@lyx.org>
10736 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10738 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10740 * src/support/lyxstring.C: added a lot of inline for no good
10743 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10744 latexWriteEndChanges, they were not used.
10746 * src/layout.h (operator<<): output operator for PageSides
10748 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10750 * some example files: loaded in LyX 1.0.4 and saved again to update
10751 certain constructs (table format)
10753 * a lot of files: did the change to use fstream/iostream for all
10754 writing of files. Done with a close look at Andre Poenitz's patch.
10756 * some files: whitespace changes.
10758 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10760 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10761 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10762 architecture, we provide our own. It is used unconditionnally, but
10763 I do not think this is a performance problem. Thanks to Angus
10764 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10765 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10767 (GetInset): use my_memcpy.
10771 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10772 it is easier to understand, but it uses less TeX-only constructs now.
10774 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10775 elements contain spaces
10777 * lib/configure: regenerated
10779 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10780 elements contain spaces; display the list of programs that are
10783 * autogen.sh: make sure lib/configure is executable
10785 * lib/examples/*: rename the tutorial examples to begin with the
10786 two-letters language code.
10788 * src/lyxfunc.C (getStatus): do not query current font if no
10791 * src/lyx_cb.C (RunScript): use QuoteName
10792 (MenuRunDvips): ditto
10793 (PrintApplyCB): ditto
10795 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10796 around argument, so that it works well with the current shell.
10797 Does not work properly with OS/2 shells currently.
10799 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10800 * src/LyXSendto.C (SendtoApplyCB): ditto
10801 * src/lyxfunc.C (Dispatch): ditto
10802 * src/buffer.C (runLaTeX): ditto
10803 (runLiterate): ditto
10804 (buildProgram): ditto
10806 * src/lyx_cb.C (RunScript): ditto
10807 (MenuMakeLaTeX): ditto
10809 * src/buffer.h (getLatexName): new method
10811 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10813 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10815 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10816 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10817 (create_math_panel): ditto
10819 * src/lyxfunc.C (getStatus): re-activate the code which gets
10820 current font and cursor; add test for export to html.
10822 * src/lyxrc.C (read): remove unreachable break statements; add a
10825 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10827 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10829 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10830 introduced by faulty regex.
10831 * src/buffer.C: ditto
10832 * src/lastfiles.C: ditto
10833 * src/paragraph.C: ditto
10834 * src/table.C: ditto
10835 * src/vspace.C: ditto
10836 * src/insets/figinset.C: ditto
10837 Note: most of these is absolutely harmless, except the one in
10838 src/mathed formula.C.
10840 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10842 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10843 operation, yielding correct results for the reLyX command.
10845 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10847 * src/support/filetools.C (ExpandPath): removed an over eager
10849 (ReplaceEnvironmentPath): ditto
10851 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10852 shows that we are doing something fishy in our code...
10853 (BubblePost): ditto
10856 * src/lyxrc.C (read): use a double switch trick to get more help
10857 from the compiler. (the same trick is used in layout.C)
10858 (write): new function. opens a ofstream and pass that to output
10859 (output): new function, takes a ostream and writes the lyxrc
10860 elemts to it. uses a dummy switch to make sure no elements are
10863 * src/lyxlex.h: added a struct pushpophelper for use in functions
10864 with more than one exit point.
10866 * src/lyxlex.[Ch] (GetInteger): made it const
10870 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10872 * src/layout.[hC] : LayoutTags splitted into several enums, new
10873 methods created, better error handling cleaner use of lyxlex. Read
10876 * src/bmtable.[Ch]: change some member prototypes because of the
10877 image const changes.
10879 * commandtags.h, src/LyXAction.C (init): new function:
10880 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10881 This file is not read automatically but you can add \input
10882 preferences to your lyxrc if you want to. We need to discuss how
10885 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10886 in .aux, also remove .bib and .bst files from dependencies when
10889 * src/BufferView.C, src/LyXView.C: add const_cast several places
10890 because of changes to images.
10892 * lib/images/*: same change as for images/*
10894 * lib/lyxrc.example: Default for accept_compound is false not no.
10896 * images/*: changed to be const, however I have som misgivings
10897 about this change so it might be changed back.
10899 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10901 * lib/configure, po/POTFILES.in: regenerated
10903 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10905 * config/lib_configure.m4: removed
10907 * lib/configure.m4: new file (was config/lib_configure.m4)
10909 * configure.in: do not test for rtti, since we do not use it.
10911 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10913 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10914 doubling of allocated space scheme. This makes it faster for large
10915 strings end to use less memory for small strings. xtra rememoved.
10917 * src/insets/figinset.C (waitalarm): commented out.
10918 (GhostscriptMsg): use static_cast
10919 (GhostscriptMsg): use new instead of malloc to allocate memory for
10920 cmap. also delete the memory after use.
10922 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10924 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10925 for changes in bibtex database or style.
10926 (runBibTeX): remove all .bib and .bst files from dep before we
10928 (run): use scanAuc in when dep file already exist.
10930 * src/DepTable.C (remove_files_with_extension): new method
10931 (exist): new method
10933 * src/DepTable.[Ch]: made many of the methods const.
10935 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10937 * src/bufferparams.C: make sure that the default textclass is
10938 "article". It used to be the first one by description order, but
10939 now the first one is "docbook".
10941 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10942 string; call Debug::value.
10943 (easyParse): pass complete argument to setDebuggingLevel().
10945 * src/debug.h (value): fix the code that parses debug levels.
10947 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10950 * src/LyXAction.C: use Debug::ACTION as debug channel.
10952 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10954 * NEWS: updated for the future 1.1.3 release.
10956 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10957 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10958 it should. This is of course a controversial change (since many
10959 people will find that their lyx workscreen is suddenly full of
10960 red), but done for the sake of correctness.
10962 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10963 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10965 * src/insets/inseterror.h, src/insets/inseturl.h,
10966 src/insets/insetinfo.h, src/insets/figinset.h,
10967 src/mathed/formulamacro.h, src/mathed/math_macro.h
10968 (EditMessage): add a missing const and add _() to make sure that
10969 translation happens
10971 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10972 src/insets/insetbib.C, src/support/filetools.C: add `using'
10973 directives for cxx.
10975 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10976 doing 'Insert index of last word' at the beginning of a paragraph.
10978 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10980 * several files: white-space changes.
10982 * src/mathed/formula.C: removed IsAlpha and IsDigit
10984 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10985 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10988 * src/insets/figinset.C (GetPSSizes): don't break when
10989 "EndComments" is seen. But break when a boundingbox is read.
10991 * all classes inherited from Inset: return value of Clone
10992 changed back to Inset *.
10994 * all classes inherited form MathInset: return value of Clone
10995 changed back to MathedInset *.
10997 * src/insets/figinset.C (runqueue): use a ofstream to output the
10998 gs/ps file. Might need some setpresicion or setw. However I can
10999 see no problem with the current code.
11000 (runqueue): use sleep instead of the alarm/signal code. I just
11001 can't see the difference.
11003 * src/paragraph.C (LyXParagraph): reserve space in the new
11004 paragraph and resize the inserted paragraph to just fit.
11006 * src/lyxfunc.h (operator|=): added operator for func_status.
11008 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11009 check for readable file.
11011 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11012 check for readable file.
11013 (MenuMakeLinuxDoc): ditto
11014 (MenuMakeDocBook): ditto
11015 (MenuMakeAscii): ditto
11016 (InsertAsciiFile): split the test for openable and readable
11018 * src/bmtable.C (draw_bitmaptable): use
11019 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11021 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11022 findtexfile from LaTeX to filetools.
11024 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11025 instead of FilePtr. Needs to be verified by a literate user.
11027 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11029 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11030 (EditMessage): likewise.
11032 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11033 respectively as \textasciitilde and \textasciicircum.
11035 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11037 * src/support/lyxstring.h: made the methods that take iterators
11038 use const_iterator.
11040 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11041 (regexMatch): made is use the real regex class.
11043 * src/support/Makefile.am: changed to use libtool
11045 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11047 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11049 (MathIsInset ++): changed several macros to be inline functions
11052 * src/mathed/Makefile.am: changed to use libtool
11054 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11056 * src/insets/inset* : Clone changed to const and return type is
11057 the true insettype not just Inset*.
11059 * src/insets/Makefile.am: changed to use libtool
11061 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11063 * src/undo.[Ch] : added empty() and changed some of the method
11066 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11068 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11069 setID use block<> for the bullets array, added const several places.
11071 * src/lyxfunc.C (getStatus): new function
11073 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11074 LyXAction, added const to several funtions.
11076 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11077 a std::map, and to store the dir items in a vector.
11079 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11082 * src/LyXView.[Ch] + other files : changed currentView to view.
11084 * src/LyXAction.[Ch] : ported from the old devel branch.
11086 * src/.cvsignore: added .libs and a.out
11088 * configure.in : changes to use libtool.
11090 * acinclude.m4 : inserted libtool.m4
11092 * .cvsignore: added libtool
11094 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11096 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11097 file name in insets and mathed directories (otherwise the
11098 dependency is not taken in account under cygwin).
11100 * src/text2.C (InsertString[AB]): make sure that we do not try to
11101 read characters past the string length.
11103 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11105 * lib/doc/LaTeXConfig.lyx.in,
11106 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11108 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11109 file saying who created them and when this heppened; this is
11110 useless and annoys tools like cvs.
11112 * lib/layouts/g-brief-{en,de}.layout,
11113 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11114 from Thomas Hartkens <thomas@hartkens.de>.
11116 * src/{insets,mathed}/Makefile.am: do not declare an empty
11117 LDFLAGS, so that it can be set at configure time (useful on Irix
11120 * lib/reLyX/configure.in: make sure that the prefix is set
11121 correctly in LYX_DIR.
11123 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11125 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11126 be used by 'command-sequence' this allows to bind a key to a
11127 sequence of LyX-commands
11128 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11130 * src/LyXAction.C: add "command-sequence"
11132 * src/LyXFunction.C: handling of "command-sequence"
11134 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11135 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11137 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11139 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11141 * src/buffer.C (writeFile): Do not output a comment giving user
11142 and date at the beginning of a .lyx file. This is useless and
11143 annoys cvs anyway; update version number to 1.1.
11145 * src/Makefile.am (LYX_DIR): add this definition, so that a
11146 default path is hardcoded in LyX.
11148 * configure.in: Use LYX_GNU_GETTEXT.
11150 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11151 AM_GNU_GETTEXT with a bug fixed.
11153 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11155 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11157 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11158 which is used to point to LyX data is now LYX_DIR_11x.
11160 * lyx.man: convert to a unix text file; small updates.
11162 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11164 * src/support/LSubstring.[Ch]: made the second arg of most of the
11165 constructors be a const reference.
11167 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11170 * src/support/lyxstring.[Ch] (swap): added missing member function
11171 and specialization of swap(str, str);
11173 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11175 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11176 trace of the old one.
11178 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11179 put the member definitions in undo.C.
11181 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11182 NEW_TEXT and have now only code that was included when this was
11185 * src/intl.C (LCombo): use static_cast
11187 (DispatchCallback): ditto
11189 * src/definitions.h: removed whole file
11191 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11193 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11194 parsing and stores in a std:map. a regex defines the file format.
11195 removed unneeded members.
11197 * src/bufferparams.h: added several enums from definitions.h here.
11198 Removed unsused destructor. Changed some types to use proper enum
11199 types. use block to have the temp_bullets and user_defined_bullets
11200 and to make the whole class assignable.
11202 * src/bufferparams.C (Copy): removed this functions, use a default
11203 assignment instead.
11205 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11208 * src/buffer.C (readLyXformat2): commend out all that have with
11209 oldpapersize to do. also comment out all that hve to do with
11210 insetlatex and insetlatexdel.
11211 (setOldPaperStuff): commented out
11213 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11215 * src/LyXAction.C: remove use of inset-latex-insert
11217 * src/mathed/math_panel.C (button_cb): use static_cast
11219 * src/insets/Makefile.am (insets_o_SOURCES): removed
11222 * src/support/lyxstring.C (helper): use the unsigned long
11223 specifier, UL, instead of a static_cast.
11225 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11227 * src/support/block.h: new file. to be used as a c-style array in
11228 classes, so that the class can be assignable.
11230 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11232 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11233 NULL, make sure to return an empty string (it is not possible to
11234 set a string to NULL).
11236 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11238 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11240 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11242 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11243 link line, so that Irix users (for example) can set it explicitely to
11246 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11247 it can be overidden at make time (static or dynamic link, for
11250 * src/vc-backend.C, src/LaTeXFeatures.h,
11251 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11252 statements to bring templates to global namespace.
11254 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11256 * src/support/lyxstring.C (operator[] const): make it standard
11259 * src/minibuffer.C (Init): changed to reflect that more
11260 information is given from the lyxvc and need not be provided here.
11262 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11264 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11266 * src/LyXView.C (UpdateTimerCB): use static_cast
11267 (KeyPressMask_raw_callback): ditto
11269 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11270 buffer_, a lot of changes because of this. currentBuffer() ->
11271 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11272 also changes to other files because of this.
11274 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11276 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11277 have no support for RCS and partial support for CVS, will be
11280 * src/insets/ several files: changes because of function name
11281 changes in Bufferview and LyXView.
11283 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11285 * src/support/LSubstring.[Ch]: new files. These implement a
11286 Substring that can be very convenient to use. i.e. is this
11288 string a = "Mary had a little sheep";
11289 Substring(a, "sheep") = "lamb";
11290 a is now "Mary has a little lamb".
11292 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11293 out patterns and subpatterns of strings. It is used by LSubstring
11294 and also by vc-backend.C
11296 * src/support/lyxstring.C: went over all the assertions used and
11297 tried to correct the wrong ones and flag which of them is required
11298 by the standard. some bugs found because of this. Also removed a
11299 couple of assertions.
11301 * src/support/Makefile.am (libsupport_a_SOURCES): added
11302 LSubstring.[Ch] and LRegex.[Ch]
11304 * src/support/FileInfo.h: have struct stat buf as an object and
11305 not a pointer to one, some changes because of this.
11307 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11308 information in layout when adding the layouts preamble to the
11309 textclass preamble.
11311 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11314 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11315 because of bug in OS/2.
11317 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11319 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11320 \verbatim@font instead of \ttfamily, so that it can be redefined.
11322 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11323 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11324 src/layout.h, src/text2.C: add 'using' directive to bring the
11325 STL templates we need from the std:: namespace to the global one.
11326 Needed by DEC cxx in strict ansi mode.
11328 * src/support/LIstream.h,src/support/LOstream.h,
11329 src/support/lyxstring.h,src/table.h,
11330 src/lyxlookup.h: do not include <config.h> in header
11331 files. This should be done in the .C files only.
11333 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11337 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11339 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11340 from Kayvan to fix the tth invokation.
11342 * development/lyx.spec.in: updates from Kayvan to reflect the
11343 changes of file names.
11345 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11347 * src/text2.C (InsertStringB): use std::copy
11348 (InsertStringA): use std::copy
11350 * src/bufferlist.C: use a vector to store the buffers in. This is
11351 an internal change and should not affect any other thing.
11353 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11356 * src/text.C (Fill): fix potential bug, one off bug.
11358 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11360 * src/Makefile.am (lyx_main.o): add more files it depends on.
11362 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11364 * src/support/lyxstring.C: use size_t for the reference count,
11365 size, reserved memory and xtra.
11366 (internal_compare): new private member function. Now the compare
11367 functions should work for std::strings that have embedded '\0'
11369 (compare): all compare functions rewritten to use
11372 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11374 * src/support/lyxstring.C (compare): pass c_str()
11375 (compare): pass c_str
11376 (compare): pass c_str
11378 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11380 * src/support/DebugStream.C: <config.h> was not included correctly.
11382 * lib/configure: forgot to re-generate it :( I'll make this file
11383 auto generated soon.
11385 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11387 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11390 * src/support/lyxstring.C: some changes from length() to rep->sz.
11391 avoids a function call.
11393 * src/support/filetools.C (SpaceLess): yet another version of the
11394 algorithm...now per Jean-Marc's suggestions.
11396 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11398 * src/layout.C (less_textclass_desc): functor for use in sorting
11400 (LyXTextClass::Read): sort the textclasses after reading.
11402 * src/support/filetools.C (SpaceLess): new version of the
11403 SpaceLess functions. What problems does this one give? Please
11406 * images/banner_bw.xbm: made the arrays unsigned char *
11408 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11410 * src/support/lyxstring.C (find): remove bogus assertion in the
11411 two versions of find where this has not been done yet.
11413 * src/support/lyxlib.h: add missing int return type to
11416 * src/menus.C (ShowFileMenu): disable exporting to html if no
11417 html export command is present.
11419 * config/lib_configure.m4: add a test for an HTML converter. The
11420 programs checked for are, in this order: tth, latex2html and
11423 * lib/configure: generated from config/lib_configure.m4.
11425 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11426 html converter. The parameters are now passed through $$FName and
11427 $$OutName, instead of standard input/output.
11429 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11431 * lib/lyxrc.example: update description of \html_command.
11432 add "quotes" around \screen_font_xxx font setting examples to help
11433 people who use fonts with spaces in their names.
11435 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11437 * Distribution files: updates for v1.1.2
11439 * src/support/lyxstring.C (find): remove bogus assert and return
11440 npos for the same condition.
11442 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11444 * added patch for OS/2 from SMiyata.
11446 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11448 * src/text2.C (CutSelection): make space_wrapped a bool
11449 (CutSelection): dont declare int i until we have to.
11450 (alphaCounter): return a char const *.
11452 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11454 * src/support/syscall.C (Systemcalls::kill):
11455 src/support/filetools.C (PutEnv, PutEnvPath):
11456 src/lyx_cb.C (addNewlineAndDepth):
11457 src/FontInfo.C (FontInfo::resize): condition some #warning
11458 directives with WITH_WARNINGS.
11461 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11463 * src/layout.[Ch] + several files: access to class variables
11464 limited and made accessor functions instead a lot of code changed
11465 becuase of this. Also instead of returning pointers often a const
11466 reference is returned instead.
11468 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11470 * src/Makefile.am (dist-hook): added used to remove the CVS from
11471 cheaders upon creating a dist
11472 (EXTRA_DIST): added cheaders
11474 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11475 a character not as a small integer.
11477 * src/support/lyxstring.C (find): removed Assert and added i >=
11478 rep->sz to the first if.
11480 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11482 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11483 src/LyXView.C src/buffer.C src/bufferparams.C
11484 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11485 src/text2.C src/insets/insetinclude.C:
11486 lyxlayout renamed to textclasslist.
11488 * src/layout.C: some lyxerr changes.
11490 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11491 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11492 (LyXLayoutList): removed all traces of this class.
11493 (LyXTextClass::Read): rewrote LT_STYLE
11494 (LyXTextClass::hasLayout): new function
11495 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11496 both const and nonconst version.
11497 (LyXTextClass::delete_layout): new function.
11498 (LyXTextClassList::Style): bug fix. do the right thing if layout
11500 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11501 (LyXTextClassList::NameOfLayout): ditto
11502 (LyXTextClassList::Load): ditto
11504 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11506 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11508 * src/LyXAction.C (LookupFunc): added a workaround for sun
11509 compiler, on the other hand...we don't know if the current code
11510 compiles on sun at all...
11512 * src/support/filetools.C (CleanupPath): subst fix
11514 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11517 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11518 complained about this one?
11520 * src/insets/insetinclude.C (Latex): subst fix
11522 * src/insets/insetbib.C (getKeys): subst fix
11524 * src/LyXSendto.C (SendtoApplyCB): subst fix
11526 * src/lyx_main.C (init): subst fix
11528 * src/layout.C (Read): subst fix
11530 * src/lyx_sendfax_main.C (button_send): subst fix
11532 * src/buffer.C (RoffAsciiTable): subst fix
11534 * src/lyx_cb.C (MenuFax): subst fix
11535 (PrintApplyCB): subst fix
11537 1999-10-26 Juergen Vigna <jug@sad.it>
11539 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11541 (Read): Cleaned up this code so now we read only format vestion >= 5
11543 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11545 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11546 come nobody has complained about this one?
11548 * src/insets/insetinclude.C (Latex): subst fix
11550 * src/insets/insetbib.C (getKeys): subst fix
11552 * src/lyx_main.C (init): subst fix
11554 * src/layout.C (Read): subst fix
11556 * src/buffer.C (RoffAsciiTable): subst fix
11558 * src/lyx_cb.C (MenuFax): subst fix.
11560 * src/layout.[hC] + some other files: rewrote to use
11561 std::container to store textclasses and layouts in.
11562 Simplified, removed a lot of code. Make all classes
11563 assignable. Further simplifications and review of type
11564 use still to be one.
11566 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11567 lastfiles to create the lastfiles partr of the menu.
11569 * src/lastfiles.[Ch]: rewritten to use deque to store the
11570 lastfiles in. Uses fstream for reading and writing. Simplifies
11573 * src/support/syscall.C: remove explicit cast.
11575 * src/BufferView.C (CursorToggleCB): removed code snippets that
11576 were commented out.
11577 use explicat C++ style casts instead of C style casts. also use
11578 u_vdata instea of passing pointers in longs.
11580 * src/PaperLayout.C: removed code snippets that were commented out.
11582 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11584 * src/lyx_main.C: removed code snippets that wer commented out.
11586 * src/paragraph.C: removed code snippets that were commented out.
11588 * src/lyxvc.C (logClose): use static_cast
11590 (viewLog): remove explicit cast to void*
11591 (showLog): removed old commented code
11593 * src/menus.C: use static_cast instead of C style casts. use
11594 u_vdata instead of u_ldata. remove explicit cast to (long) for
11595 pointers. Removed old code that was commented out.
11597 * src/insets/inset.C: removed old commented func
11599 * src/insets/insetref.C (InsetRef): removed old code that had been
11600 commented out for a long time.
11602 (escape): removed C style cast
11604 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11606 * src/insets/insetlatex.C (Draw): removed old commented code
11607 (Read): rewritten to use string
11609 * src/insets/insetlabel.C (escape): removed C style cast
11611 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11613 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11614 old commented code.
11616 * src/insets/insetinclude.h: removed a couple of stupid bools
11618 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11619 (Clone): remove C style cast
11620 (getKeys): changed list to lst because of std::list
11622 * src/insets/inseterror.C (Draw): removed som old commented code.
11624 * src/insets/insetcommand.C (Draw): removed some old commented code.
11626 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11627 commented out forever.
11628 (bibitem_cb): use static_cast instead of C style cast
11629 use of vdata changed to u_vdata.
11631 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11633 (CloseUrlCB): use static_cast instead of C style cast.
11634 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11636 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11637 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11638 (CloseInfoCB): static_cast from ob->u_vdata instead.
11639 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11642 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11643 (C_InsetError_CloseErrorCB): forward the ob parameter
11644 (CloseErrorCB): static_cast from ob->u_vdata instead.
11646 * src/vspace.h: include LString.h since we use string in this class.
11648 * src/vspace.C (lyx_advance): changed name from advance because of
11649 nameclash with stl. And since we cannot use namespaces yet...I
11650 used a lyx_ prefix instead. Expect this to change when we begin
11653 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11655 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11656 and removed now defunct constructor and deconstructor.
11658 * src/BufferView.h: have backstack as a object not as a pointer.
11659 removed initialization from constructor. added include for BackStack
11661 * development/lyx.spec.in (%build): add CFLAGS also.
11663 * src/screen.C (drawFrame): removed another warning.
11665 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11667 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11668 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11669 README and ANNOUNCE a bit for the next release. More work is
11672 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11673 unbreakable if we are in freespacing mode (LyX-Code), but not in
11676 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11678 * src/BackStack.h: fixed initialization order in constructor
11680 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11682 * acinclude.m4 (VERSION): new rules for when a version is
11683 development, added also a variable for prerelease.
11684 (warnings): we set with_warnings=yes for prereleases
11685 (lyx_opt): prereleases compile with same optimization as development
11686 (CXXFLAGS): only use pedantic if we are a development version
11688 * src/BufferView.C (restorePosition): don't do anything if the
11689 backstack is empty.
11691 * src/BackStack.h: added member empty, use this to test if there
11692 is anything to pop...
11694 1999-10-25 Juergen Vigna <jug@sad.it>
11697 * forms/layout_forms.fd +
11698 * forms/latexoptions.fd +
11699 * lyx.fd: changed for various form resize issues
11701 * src/mathed/math_panel.C +
11702 * src/insets/inseterror.C +
11703 * src/insets/insetinfo.C +
11704 * src/insets/inseturl.C +
11705 * src/insets/inseturl.h +
11707 * src/LyXSendto.C +
11708 * src/PaperLayout.C +
11709 * src/ParagraphExtra.C +
11710 * src/TableLayout.C +
11712 * src/layout_forms.C +
11719 * src/menus.C: fixed various resize issues. So now forms can be
11720 resized savely or not be resized at all.
11722 * forms/form_url.fd +
11723 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11726 * src/insets/Makefile.am: added files form_url.[Ch]
11728 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11730 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11731 (and presumably 6.2).
11733 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11734 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11735 remaining static member callbacks.
11737 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11740 * src/support/lyxstring.h: declare struct Srep as friend of
11741 lyxstring, since DEC cxx complains otherwise.
11743 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11745 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11747 * src/LaTeX.C (run): made run_bibtex also depend on files with
11749 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11750 are put into the dependency file.
11752 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11753 the code has shown itself to work
11754 (create_ispell_pipe): removed another warning, added a comment
11757 * src/minibuffer.C (ExecutingCB): removed code that has been
11758 commented out a long time
11760 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11761 out code + a warning.
11763 * src/support/lyxstring.h: comment out the three private
11764 operators, when compiling with string ansi conforming compilers
11765 they make problems.
11767 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11769 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11770 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11773 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11776 * src/mathed/math_panel.C (create_math_panel): remove explicit
11779 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11782 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11783 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11784 to XCreatePixmapFromBitmapData
11785 (fl_set_bmtable_data): change the last argument to be unsigned
11787 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11788 and bh to be unsigned int, remove explicit casts in call to
11789 XReadBitmapFileData.
11791 * images/arrows.xbm: made the arrays unsigned char *
11792 * images/varsz.xbm: ditto
11793 * images/misc.xbm: ditto
11794 * images/greek.xbm: ditto
11795 * images/dots.xbm: ditto
11796 * images/brel.xbm: ditto
11797 * images/bop.xbm: ditto
11799 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11801 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11802 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11803 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11805 (LYX_CXX_CHEADERS): added <clocale> to the test.
11807 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11809 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11811 * src/support/lyxstring.C (append): fixed something that must be a
11812 bug, rep->assign was used instead of rep->append.
11814 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11817 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11818 lyx insert double chars. Fix spotted by Kayvan.
11820 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11822 * Fixed the tth support. I messed up with the Emacs patch apply feature
11823 and omitted the changes in lyxrc.C.
11825 1999-10-22 Juergen Vigna <jug@sad.it>
11827 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11829 * src/lyx_cb.C (MenuInsertRef) +
11830 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11831 the form cannot be resized under it limits (fixes a segfault)
11833 * src/lyx.C (create_form_form_ref) +
11834 * forms/lyx.fd: Changed Gravity on name input field so that it is
11837 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11839 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11840 <ostream> and <istream>.
11842 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11843 whether <fstream> provides the latest standard features, or if we
11844 have an oldstyle library (like in egcs).
11845 (LYX_CXX_STL_STRING): fix the test.
11847 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11848 code on MODERN_STL_STREAM.
11850 * src/support/lyxstring.h: use L{I,O}stream.h.
11852 * src/support/L{I,O}stream.h: new files, designed to setup
11853 correctly streams for our use
11854 - includes the right header depending on STL capabilities
11855 - puts std::ostream and std::endl (for LOStream.h) or
11856 std::istream (LIStream.h) in toplevel namespace.
11858 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11860 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11861 was a bib file that had been changed we ensure that bibtex is run.
11862 (runBibTeX): enhanced to extract the names of the bib files and
11863 getting their absolute path and enter them into the dep file.
11864 (findtexfile): static func that is used to look for tex-files,
11865 checks for absolute patchs and tries also with kpsewhich.
11866 Alternative ways of finding the correct files are wanted. Will
11868 (do_popen): function that runs a command using popen and returns
11869 the whole output of that command in a string. Should be moved to
11872 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11873 file with extension ext has changed.
11875 * src/insets/figinset.C: added ifdef guards around the fl_free
11876 code that jug commented out. Now it is commented out when
11877 compiling with XForms == 0.89.
11879 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11880 to lyxstring.C, and only keep a forward declaration in
11881 lyxstring.h. Simplifies the header file a bit and should help a
11882 bit on compile time too. Also changes to Srep will not mandate a
11883 recompile of code just using string.
11884 (~lyxstring): definition moved here since it uses srep.
11885 (size): definition moved here since it uses srep.
11887 * src/support/lyxstring.h: removed a couple of "inline" that should
11890 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11892 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11895 1999-10-21 Juergen Vigna <jug@sad.it>
11897 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11898 set to left if I just remove the width entry (or it is empty).
11900 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11901 paragraph when having dummy paragraphs.
11903 1999-10-20 Juergen Vigna <jug@sad.it>
11905 * src/insets/figinset.C: just commented some fl_free_form calls
11906 and added warnings so that this calls should be activated later
11907 again. This avoids for now a segfault, but we have a memory leak!
11909 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11910 'const char * argument' to 'string argument', this should
11911 fix some Asserts() in lyxstring.C.
11913 * src/lyxfunc.h: Removed the function argAsString(const char *)
11914 as it is not used anymore.
11916 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11918 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11921 * src/Literate.h: some funcs moved from public to private to make
11922 interface clearer. Unneeded args removed.
11924 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11926 (scanBuildLogFile): ditto
11928 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11929 normal TeX Error. Still room for improvement.
11931 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11933 * src/buffer.C (insertErrors): changes to make the error
11934 desctription show properly.
11936 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11939 * src/support/lyxstring.C (helper): changed to use
11940 sizeof(object->rep->ref).
11941 (operator>>): changed to use a pointer instead.
11943 * src/support/lyxstring.h: changed const reference & to value_type
11944 const & lets see if that helps.
11946 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11948 * Makefile.am (rpmdist): fixed to have non static package and
11951 * src/support/lyxstring.C: removed the compilation guards
11953 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11956 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11957 conditional compile of lyxstring.Ch
11959 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11960 stupid check, but it is a lot better than the bastring hack.
11961 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11963 * several files: changed string::erase into string::clear. Not
11966 * src/chset.C (encodeString): use a char temporary instead
11968 * src/table.C (TexEndOfCell): added tostr around
11969 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11970 (TexEndOfCell): ditto
11971 (TexEndOfCell): ditto
11972 (TexEndOfCell): ditto
11973 (DocBookEndOfCell): ditto
11974 (DocBookEndOfCell): ditto
11975 (DocBookEndOfCell): ditto
11976 (DocBookEndOfCell): ditto
11978 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11980 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11982 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11983 (MenuBuildProg): added tostr around ret
11984 (MenuRunChktex): added tostr around ret
11985 (DocumentApplyCB): added tostr around ret
11987 * src/chset.C (encodeString): added tostr around t->ic
11989 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11990 (makeLaTeXFile): added tostr around tocdepth
11991 (makeLaTeXFile): added tostr around ftcound - 1
11993 * src/insets/insetbib.C (setCounter): added tostr around counter.
11995 * src/support/lyxstring.h: added an operator+=(int) to catch more
11998 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11999 (lyxstring): We DON'T allow NULL pointers.
12001 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12003 * src/mathed/math_macro.C (MathMacroArgument::Write,
12004 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12005 when writing them out.
12007 * src/LString.C: remove, since it is not used anymore.
12009 * src/support/lyxstring.C: condition the content to
12010 USE_INCLUDED_STRING macro.
12012 * src/mathed/math_symbols.C, src/support/lstrings.C,
12013 src/support/lyxstring.C: add `using' directive to specify what
12014 we need in <algorithm>. I do not think that we need to
12015 conditionalize this, but any thought is appreciated.
12017 * many files: change all callback functions to "C" linkage
12018 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12019 strict_ansi. Those who were static are now global.
12020 The case of callbacks which are static class members is
12021 trickier, since we have to make C wrappers around them (see
12022 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12023 did not finish this yet, since it defeats the purpose of
12024 encapsulation, and I am not sure what the best route is.
12026 1999-10-19 Juergen Vigna <jug@sad.it>
12028 * src/support/lyxstring.C (lyxstring): we permit to have a null
12029 pointer as assignment value and just don't assign it.
12031 * src/vspace.C (nextToken): corrected this function substituting
12032 find_first(_not)_of with find_last_of.
12034 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12035 (TableOptCloseCB) (TableSpeCloseCB):
12036 inserted fl_set_focus call for problem with fl_hide_form() in
12039 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12041 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12044 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12046 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12047 LyXLex::next() and not eatline() to get its argument.
12049 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12051 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12052 instead, use fstreams for io of the depfile, removed unneeded
12053 functions and variables.
12055 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12056 vector instead, removed all functions and variables that is not in
12059 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12061 * src/buffer.C (insertErrors): use new interface to TeXError
12063 * Makefile.am (rpmdist): added a rpmdist target
12065 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12066 per Kayvan's instructions.
12068 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12070 * src/Makefile.am: add a definition for localedir, so that locales
12071 are found after installation (Kayvan)
12073 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12075 * development/.cvsignore: new file.
12077 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12079 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12080 C++ compiler provides wrappers for C headers and use our alternate
12083 * configure.in: use LYX_CXX_CHEADERS.
12085 * src/cheader/: new directory, populated with cname headers from
12086 libstdc++-2.8.1. They are a bit old, but probably good enough for
12087 what we want (support compilers who lack them).
12089 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12090 from includes. It turns out is was stupid.
12092 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12094 * lib/Makefile.am (install-data-local): forgot a ';'
12095 (install-data-local): forgot a '\'
12096 (libinstalldirs): needed after all. reintroduced.
12098 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12100 * configure.in (AC_OUTPUT): added lyx.spec
12102 * development/lyx.spec: removed file
12104 * development/lyx.spec.in: new file
12106 * po/*.po: merged with lyx.pot becuase of make distcheck
12108 * lib/Makefile.am (dist-hook): added dist-hook so that
12109 documentation files will be included when doing a make
12110 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12111 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12113 more: tried to make install do the right thing, exclude CVS dirs
12116 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12117 Path would fit in more nicely.
12119 * all files that used to use pathstack: uses now Path instead.
12120 This change was a lot easier than expected.
12122 * src/support/path.h: new file
12124 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12126 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12128 * src/support/lyxstring.C (getline): Default arg was given for
12131 * Configure.cmd: removed file
12133 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12135 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12136 streams classes and types, add the proper 'using' statements when
12137 MODERN_STL is defined.
12139 * src/debug.h: move the << operator definition after the inclusion
12142 * src/support/filetools.C: include "LAssert.h", which is needed
12145 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12148 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12149 include "debug.h" to define a proper ostream.
12151 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12153 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12154 method to the SystemCall class which can kill a process, but it's
12155 not fully implemented yet.
12157 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12159 * src/support/FileInfo.h: Better documentation
12161 * src/lyxfunc.C: Added support for buffer-export html
12163 * src/menus.C: Added Export->As HTML...
12165 * lib/bind/*.bind: Added short-cut for buffer-export html
12167 * src/lyxrc.*: Added support for new \tth_command
12169 * lib/lyxrc.example: Added stuff for new \tth_command
12171 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12173 * lib/Makefile.am (IMAGES): removed images/README
12174 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12175 installes in correct place. Check permisions is installed
12178 * src/LaTeX.C: some no-op changes moved declaration of some
12181 * src/LaTeX.h (LATEX_H): changed include guard name
12183 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12185 * lib/reLyX/Makefile.am: install noweb2lyx.
12187 * lib/Makefile.am: install configure.
12189 * lib/reLyX/configure.in: declare a config aux dir; set package
12190 name to lyx (not sure what the best solution is); generate noweb2lyx.
12192 * lib/layouts/egs.layout: fix the bibliography layout.
12194 1999-10-08 Jürgen Vigna <jug@sad.it>
12196 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12197 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12198 it returned without continuing to search the path.
12200 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12202 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12203 also fixes a bug. It is not allowed to do tricks with std::strings
12204 like: string a("hei"); &a[e]; this will not give what you
12205 think... Any reason for the complexity in this func?
12207 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12209 * Updated README and INSTALL a bit, mostly to check that my
12210 CVS rights are correctly set up.
12212 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12214 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12215 does not allow '\0' chars but lyxstring and std::string does.
12217 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12219 * autogen.sh (AUTOCONF): let the autogen script create the
12220 POTFILES.in file too. POTFILES.in should perhaps now not be
12221 included in the cvs module.
12223 * some more files changed to use C++ includes instead of C ones.
12225 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12227 (Reread): added tostr to nlink. buggy output otherwise.
12228 (Reread): added a string() around szMode when assigning to Buffer,
12229 without this I got a log of garbled info strings.
12231 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12234 * I have added several ostream & operator<<(ostream &, some_type)
12235 functions. This has been done to avoid casting and warnings when
12236 outputting enums to lyxerr. This as thus eliminated a lot of
12237 explicit casts and has made the code clearer. Among the enums
12238 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12239 mathed enums, some font enum the Debug::type enum.
12241 * src/support/lyxstring.h (clear): missing method. equivalent of
12244 * all files that contained "stderr": rewrote constructs that used
12245 stderr to use lyxerr instead. (except bmtable)
12247 * src/support/DebugStream.h (level): and the passed t with
12248 Debug::ANY to avoid spurious bits set.
12250 * src/debug.h (Debug::type value): made it accept strings of the
12251 type INFO,INIT,KEY.
12253 * configure.in (Check for programs): Added a check for kpsewhich,
12254 the latex generation will use this later to better the dicovery of
12257 * src/BufferView.C (create_view): we don't need to cast this to
12258 (void*) that is done automatically.
12259 (WorkAreaButtonPress): removed some dead code.
12261 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12263 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12264 is not overwritten when translated (David Sua'rez de Lis).
12266 * lib/CREDITS: Added David Sua'rez de Lis
12268 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12270 * src/bufferparams.C (BufferParams): default input encoding is now
12273 * acinclude.m4 (cross_compiling): comment out macro
12274 LYX_GXX_STRENGTH_REDUCE.
12276 * acconfig.h: make sure that const is not defined (to empty) when
12277 we are compiling C++. Remove commented out code using SIZEOF_xx
12280 * configure.in : move the test for const and inline as late as
12281 possible so that these C tests do not interefere with C++ ones.
12282 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12283 has not been proven.
12285 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12287 * src/table.C (getDocBookAlign): remove bad default value for
12288 isColumn parameter.
12290 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12292 (ShowFileMenu2): ditto.
12294 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12295 of files to ignore.
12297 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12299 * Most files: finished the change from the old error code to use
12300 DebugStream for all lyxerr debugging. Only minor changes remain
12301 (e.g. the setting of debug levels using strings instead of number)
12303 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12305 * src/layout.C (Add): Changed to use compare_no_case instead of
12308 * src/FontInfo.C: changed loop variable type too string::size_type.
12310 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12312 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12313 set ETAGS_ARGS to --c++
12315 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12317 * src/table.C (DocBookEndOfCell): commented out two unused variables
12319 * src/paragraph.C: commented out four unused variables.
12321 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12322 insed a if clause with type string::size_type.
12324 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12327 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12329 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12330 variable, also changed loop to go from 0 to lenght + 1, instead of
12331 -1 to length. This should be correct.
12333 * src/LaTeX.C (scanError): use string::size_type as loop variable
12336 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12337 (l.896) since y_tmp and row was not used anyway.
12339 * src/insets/insetref.C (escape): use string::size_type as loop
12342 * src/insets/insetquotes.C (Width): use string::size_type as loop
12344 (Draw): use string::size_type as loop variable type.
12346 * src/insets/insetlatexaccent.C (checkContents): use
12347 string::size_type as loop variable type.
12349 * src/insets/insetlabel.C (escape): use string::size_type as loop
12352 * src/insets/insetinfo.C: added an extern for current_view.
12354 * src/insets/insetcommand.C (scanCommand): use string::size_type
12355 as loop variable type.
12357 * most files: removed the RCS tags. With them we had to recompile
12358 a lot of files after a simple cvs commit. Also we have never used
12359 them for anything meaningful.
12361 * most files: tags-query-replace NULL 0. As adviced several plases
12362 we now use "0" instead of "NULL" in our code.
12364 * src/support/filetools.C (SpaceLess): use string::size_type as
12365 loop variable type.
12367 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12369 * src/paragraph.C: fixed up some more string stuff.
12371 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12373 * src/support/filetools.h: make modestr a std::string.
12375 * src/filetools.C (GetEnv): made ch really const.
12377 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12378 made code that used these use max/min from <algorithm> instead.
12380 * changed several c library include files to their equivalent c++
12381 library include files. All is not changed yet.
12383 * created a support subdir in src, put lyxstring and lstrings
12384 there + the extra files atexit, fileblock, strerror. Created
12385 Makefile.am. edited configure.in and src/Makefile.am to use this
12386 new subdir. More files moved to support.
12388 * imported som of the functions from repository lyx, filetools
12390 * ran tags-query-replace on LString -> string, corrected the bogus
12391 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12392 is still some errors in there. This is errors where too much or
12393 too litle get deleted from strings (string::erase, string::substr,
12394 string::replace), there can also be some off by one errors, or
12395 just plain wrong use of functions from lstrings. Viewing of quotes
12398 * LyX is now running fairly well with string, but there are
12399 certainly some bugs yet (see above) also string is quite different
12400 from LString among others in that it does not allow null pointers
12401 passed in and will abort if it gets any.
12403 * Added the revtex4 files I forgot when setting up the repository.
12405 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12407 * All over: Tried to clean everything up so that only the files
12408 that we really need are included in the cvs repository.
12409 * Switched to use automake.
12410 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12411 * Install has not been checked.
12413 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12415 * po/pt.po: Three errors:
12416 l.533 and l.538 format specification error
12417 l. 402 duplicate entry, I just deleted it.