1 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
3 * BufferView2.C (open_new_inset): Added 2nd argument.
4 (getParentText, getParentLanguage): New methods.
6 * src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and
7 LFUN_INSET_TABULAR for RTL text.
9 * src/tabular.C (Latex): Put \R{} around RTL cells.
11 * src/text2.C (InsertInset): Change cursor position for highly
14 * src/frontends/xforms/FormTabularCreate.C (apply): Create the
15 tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...)
17 * src/insets/insettabular.C (LocalDispatch): When dispatching
18 LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
19 locked, then the insettext of the new cell will be locked.
20 (moveLeft, moveRight): Fixed for RTL tabulars.
21 (moveNextCell, movePrevCell): Ditto.
22 (isRightToLeft): New method.
24 * src/insets/insettext.C (LocalDispatch): Fixed handling of
25 non-dispatched function in the locking inset.
26 (Edit): If the inset is empty set the language of the current font
27 to the language to the surronding text (this code was moved from
28 LocalDispatch to allow the user to change the languaeg before
30 (moveRight, moveLeft): Fixed for RTL text.
31 (checkAndActivateInset): Fixed.
33 * src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
35 2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
37 * src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate
41 * src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL
42 around some ispell code.
44 * src/lyxcursor.[Ch]: add proper constructor, to avoid tons of
45 Unitialized Memory Read in purify.
47 * lib/examples/nl_splash.lyx: update from Tino Meinen.
49 2001-01-04 Dekel Tsur <dekelts@tau.ac.il>
51 * src/frontends/xforms/FormDocument.C (FormDocument::build):
52 Disable class_->choice_doc_class and language_->choice_language to
53 allow using the class/language combox with keyboard.
55 2001-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
57 * src/support/snprintf.c (va_copy): only define va_copy if undefined
59 2001-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
61 * src/lyxvc.C (showLog): give the tempfile a mask
63 * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
66 * src/support/filetools.C (IsDirWriteable): give the tempfile a
67 mask and unlink the tempfile after use.
69 2001-01-04 Juergen Vigna <jug@sad.it>
71 * src/insets/insettabular.C (resetPos): an extra scroll, but we
72 really should redo all this scrolling code!
73 (TabularFeatures): unlock the_locking_inset before add/del rows/colums.
75 * src/text.C (GetVisibleRow): check that y/h values are good otherwise
78 * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
79 (pasteSelection): pay attention to multicolumn cells.
80 (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
82 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
84 * src/mathed/math_panel.C (deco_cb): check the decoration index is
87 * src/frontends/xforms/FormPreferences.C (feedback): apply
88 formatting to the translated string, not to the original one.
89 (printWarning): ditto.
91 * src/gettext.C (_): translate empty string with empty string.
93 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
98 * UPGRADING: mention that tabular format has been changed.
100 2001-01-03 Juergen Vigna <jug@sad.it>
102 * src/insets/insettabular.C (InsetButtonPress): look for button==2
103 and do Clipboard Paste!
105 * src/insets/insettext.C (SetText): added function.
107 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
108 new LFUN_PASTESELECTION.
110 * src/insets/insettext.C (draw): don't clear if top_x changes.
112 * src/insets/insettabular.C (draw): clear only if the inset didn't
113 change in the draw routine.
115 * src/insets/insettext.C (width): make the width dependant on the
118 * src/text.C (draw): comment out the UpdateInset call.
120 * src/screen.C (DrawOneRow):
121 (DrawFromTo): check for bv->text->status not text->status.
123 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
124 dimensions of ascent-descent for the whole row.
126 * src/insets/insettext.C (draw): check also for need_update == INIT.
128 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
130 * Makefile.am (EXTRA_DIST): add autogen.sh
132 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
134 * development/OS2/quick_fix.patch:
135 * lib/configure.cmd: update OS/2 support files.
137 2001-01-02 Juergen Vigna <jug@sad.it>
139 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
141 * src/tabular.C (TeXTopHLine):
142 (TeXBottomHLine): fixed Lars new code.
144 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
146 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
147 from this function and added a BufferView * parameter.
149 * src/mathed/math_symbols.C (math_insert_symbol): ditto
151 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
153 * src/version.h: set to pre3
155 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
157 * src/Makefile.am (lyx_SOURCES): added Floating.C
159 * src/Floating.h: moved all the inlines to Floating.C
161 * src/Floating.C: new file
163 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
165 * src/frontends/xforms/FormPreferences.C (feedback): fix
166 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
168 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
170 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
173 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
175 * src/mathed/math_inset.h: move LString.h to be included first
177 * src/insets/insetfloat.C: adjust for change in private variable names
179 * src/frontends/xforms/xform_helpers.h : don't include config.h
181 * src/frontends/xforms/xform_helpers.C: adjust the order of
182 includes, some whitespace changes.
184 * src/trans.C (Load): constify filename and res
186 * src/text2.C (SetCounter): call Floating::name()
188 * src/screen.C: change to not use owner from WorkArea, but from
191 * src/lyxfunc.C: adjust because of changes in Intl.
193 * src/intl.h: make trans a object instead of pointer, inlucd
194 trans_mgr.h in this file.
195 (getTrans): return a reference to TransManager
197 * src/intl.C: don't include trans_mgr.h here
198 modify calls to trans to work on object instead of on pointer
200 * src/WorkArea.h: add using for Signal1
201 comment out forward decl of BufferView.
203 remove class variable owner_ and getter method for this.
205 * src/WorkArea.C: don't include BufferView.h
206 (WorkArea): change to not take a BufferView.h, use signals
208 (scroll_cb): emit signal
210 * src/LaTeXFeatures.C: include Floatlist.h
211 (getPackages): only load float.sty when needed
212 (getMacros): prepare for outputting the correct code to preamble.
214 * src/Floating.h: make all variables private + rename to var_.
215 (Floating): default ctor
216 (Floating): complex ctor to set a complete Floating
222 * src/FloatList.C (FloatList): use Floating's constructor
225 (newFloat): call type()
226 (defaultPlacement): call placement()
227 (operator): new operator
229 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
230 (scrollUp): call pimpl's scrollCB
232 (pasteClipboard): constify clip
234 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
235 (insertErrors): constify desctext, errortext, msgtxt and errorrow
236 (open_new_inset): delete some commented code.
238 * src/BufferView.[Ch] (enterView): comment out
241 (workAreaMotionNotify): ditto
242 (workAreaButtonPress): ditto
245 (workAreaButtonRelease): ditto
246 (workAreaExpose): ditto
248 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
249 to compile with cvs gcc (2.97).
251 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
253 * lib/ui/default.ui: menu structure cleanup.
255 * lib/languages: add description of entries.
257 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
259 * src/insets/ExternalTemplate.C (readTemplates): change debug
261 (readTemplate): use lyxlex.printError to report read errors.
264 * src/insets/insetexternal.C (Read): suppress debug message when
267 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
269 * src/insets/insetinclude.C (Ascii): New method. Currently
270 supports only verbatim input.
272 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
274 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
276 2000-12-22 Juergen Vigna <jug@sad.it>
278 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
279 have a selection and button == 3.
280 (UpdateLocal): if what == INIT clear selection if existent!
281 (InsetButtonPress): don't activate the cell inset on button==3
283 (LocalDispatch): move curor up/down if exiting an inset which this
286 2000-12-20 Juergen Vigna <jug@sad.it>
288 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
289 calling for the math-panel (do not unlock the math-inset if locked)!
291 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
292 text-insets (with x-offset).
294 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
295 alignment of multicolumn-cells.
297 2000-12-19 Juergen Vigna <jug@sad.it>
299 * src/lyxfunc.C (Dispatch):
300 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
303 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
305 * src/WorkArea.C (work_area_handler): simplify the key/keysym
306 handling for XForms 0.89, this might have rendered some cases
307 unusable. I have at least deadkeys, accent-xxx and KP_x working.
308 Please report proplems.
310 * src/lyxfunc.C (processKeySym): make the self-insert handling
313 2000-12-18 Baruch Even <baruch.even@writeme.com>
315 * src/LaTeX.C (deplog): fix spelling errors
316 * src/text2.C (CutSelection): ditto
317 * src/lyxfunc.C (Dispatch): ditto
319 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
321 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
323 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
324 and h_align in default init.
325 adjust calls to MathedRowSt
327 * src/mathed/math_iter.C: adjust calls to MathedRowSt
328 * src/mathed/math_iter.h (getAD): ditto
330 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
331 methods setBaseline, ascent, descent
332 (class MathMatrixInset): remove method GetAlign, change h_align
335 * src/lyxfunc.C (processKeySym): discover the correct argument if
336 the action is LFUN_SELFINSERT
338 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
340 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
343 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
345 * src/support/copy.C: don't include filetools.h
347 * lib/images: revert to old banner, drop the cucumber.
349 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
351 * src/converter.C (Formats::View): Change the current directory to
352 the directory of the file.
354 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
356 * src/kbsequence.C (addkey): also clear sequence and modifiers if
359 * src/BufferView2.C (theLockingInset): return 0 if text is 0
361 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
363 * Many files: Fix RTL support for insettext.
365 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
367 * README: add mention of broken ghostscript versions, remove
368 reference to non-existent BUGS file
370 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
372 * src/support/lstrings.C (compare_no_case): small fix. When passed
373 length, should use it in the size comparison.
375 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
377 * src/insets/insetexternal.C (getScreenLabel): Return a default
378 value if the template label is empty.
380 * src/lyxlookup.C: do not condition on FL_REVISION.
383 * src/sp_form.C: fix the font size of some text entries
385 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
386 after TOC when there is no TOC.
388 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
389 bind file if it has not been done yet.
390 (read): remove local bindFile variable. Try to fix the handling of
391 RC_BIND and RC_BINDFILE.
393 * src/lyx_main.C (init): use readBindFileIfNeeded().
395 * lib/languages: Change description of german to "German (new
398 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
400 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
401 "Apply" buttons if arg is non-zero.
403 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
404 launching the popup if sufficient info is passed to
405 LFUN_CITATION_CREATE.
407 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
409 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
410 labels (disabled in 1.1.6).
412 * src/lyxrc.[Ch]: New variable label_init_length
414 * mathed/formula.C (LocalDispatch): Preserve the label when
415 changing from display math to eqnarray (however, the label
416 do not appear at the first line, as one might expects, but at the
418 (LocalDispatch): When inserting a label to a formula which already
419 have a label, the old label is used as default value.
420 Also, if the label is changed, then all references to the label
423 * src/mathed/math_iter.C (setLabel): Allow to set the label
424 even if it is empty. This is needed to allow deletion of a label
427 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
428 refernces only if the old label appears once in the document.
430 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
432 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
433 <gehlert@Rcs1.urz.tu-dresden.de>
435 * src/frontends/xforms/FormBase.C: comment out debug.h
437 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
438 code in xform_helpers instead.
439 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
441 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
442 Use N_(), rather than _() when creating strings to pass to browseFile()
443 because browseFile calls gettext() itself now.
445 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
446 display the filename correctly.
448 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
450 * src/converter.C (Move): New method. Used to move file or files
451 from temp dir to the output dir. (this fixes the bug that
452 exporting linuxdoc/docbook document to html would not move all
453 html file from temp directory).
455 * src/support/filetools.C (DirList): Fixed.
457 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
459 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
461 * src/converter.C (Add): Remove $$i when setting latex_command.
463 * src/text.C (IsBoundary): Return false when pos = 0.
465 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
467 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
469 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
471 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
472 need to empty the fields to turn off use of the geometry package!
474 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
476 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
477 (Buffer const &), not a (BufferParams const &) and so fix a crash
478 caused by using current_view before it had been initialised. Not
479 the best way to do this, but much easier than changing
480 Inset::Clone(Buffer const &) to Inset::Clone().
483 * src/tabular.C: changed call to CopyIntoMinibuffer().
485 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
487 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
489 * src/lyxfunc.C (getStatus): disable insertion of floats in a
492 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
494 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
495 changed filter for screen fonts input filter from int to float
497 * src/frontends/xforms/input_validators.c: removed.
498 * src/frontends/xforms/input_validators.C: new file. Can now call C++
499 functions from within the filter functions.
501 * src/frontends/xforms/input_validators.[Ch]
502 (fl_unsigned_float_filter): new filter function.
504 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
505 confused now! And if you think I'm going to do this in
506 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
508 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
510 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
512 * src/WorkArea.C (work_area_handler): don't handle button requests
513 if xbutton.button == 0
515 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
517 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
518 It creates a lot of interesting problems.
520 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
522 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
523 the menu exists in the current menubar before opening it.
525 * src/MenuBackend.C (hasSubmenu): new method.
527 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
528 action value by offsetting actions by a large constant (so that
529 bogs choice result will be less than this constant).
531 * lib/bind/fi_menus.bind: more cleanup to menus.
532 * lib/bind/sciword.bind: ditto.
533 * lib/bind/xemacs.bind: ditto.
534 * lib/bind/emacs.bind: ditto.
535 * lib/bind/pt_menus.bind: ditto.
536 * lib/bind/hu_menus.bind: ditto.
538 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
540 * INSTALL: update PROBLEMS section.
542 * src/lyxlookup.h: remove condition on xforms version, since we
543 should not include it if not appropriate.
545 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
547 * src/LColor.C: "latex text" -> "latex inset" (from
550 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
552 * src/frontends/kde/FormTabularCreate.C:
553 * src/frontends/kde/citationdlg.C:
554 * src/frontends/kde/copyrightdlg.C:
555 * src/frontends/kde/paradlg.C:
556 * src/frontends/kde/paraextradlg.C:
557 * src/frontends/kde/parageneraldlg.C:
558 * src/frontends/kde/printdlg.C:
559 * src/frontends/kde/refdlg.C:
560 * src/frontends/kde/tabcreatedlg.C:
561 * src/frontends/kde/tocdlg.C:
562 * src/frontends/kde/urldlg.C: add necessary headers
565 * src/frontends/kde/dlg/emptytable.C:
566 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
567 default parameters (from Angus Leeming)
569 * src/frontends/kde/dlg/moc/.cvsignore:
570 * src/frontends/kde/dlg/.cvsignore:
571 * src/frontends/kde/moc/.cvsignore: fix the library name
574 * src/frontends/kde/paradlg.C:
575 * src/frontends/kde/parageneraldlg.C:
576 * src/frontends/kde/dlg/para.dlg:
577 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
579 * src/frontends/kde/dlg/README: clarified qtarch version
581 * src/frontends/kde/dlg/Makefile.am: removed the
582 dlg rules as they created spontaneous rebuilds
583 (not a good idea as it requires qtarch)
585 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
587 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
588 fixlevel along with xforms version.
590 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
591 xforms version is strictly less than 0.89.5.
592 * src/lyx_gui.C (LyXGUI): ditto.
593 * src/LyXView.C (show): ditto.
595 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
597 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
598 movement in inset in RTL text.
599 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
600 (workAreaButtonRelease): Do not open a float when there is a selection.
602 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
604 * src/spellchecker.C (RunSpellChecker): Open all floats before
607 * src/text.C (InsertChar): Consider "," as a part of a number
608 (for LTR numbers in RTL text code).
609 (IsBoundary): Fixed (and simplified).
610 (InsertChar): Recalculate cursor boundary.
613 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
615 * src/spellchecker.C: fix figures with pspell enabled
617 * src/insets/figinset.C: workaround for gs hang xforms bug
619 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
621 * lib/bind/??_menus.bind: comment out the entries corresponding to
622 real menus. They should be eventually removed, but I'll let the
623 language maintainers do that.
625 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
627 * src/frontends/kde/parageneraldlg.C:
628 * src/frontends/kde/parageneraldlg.h: don't use
629 a derived class for SpaceAbove/Below
631 * src/frontends/kde/dlg/README: add some info
633 * src/frontends/kde/dlg/*: update data files, update
636 * src/frontends/kde/dlg/moc/Makefile.am: add
639 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
641 * configure.in: add new KDE Makefiles
642 * src/vspace.h: return GlueLength not a normal one
643 * src/support/lstrings.h:
644 * src/support/lstrings.C: add isStrUnsignedInt(),
647 * src/frontends/kde/*: big reorganisation, update
648 FormParagraph, add FormTabCreate
650 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
652 * lib/ui/default.ui: small grammatical change.
654 * src/frontends/xforms/xform_macros.h: removed.
656 * src/frontends/xforms/FormBase.C:
657 * src/frontends/xforms/FormPreferences.C:
658 * src/frontends/xforms/Makefile.am: changes associated with removing
659 xform_macros.h. Should make Lars' debugging a little easier.
661 * src/frontends/xforms/FormPreferences.C:
662 * src/frontends/xforms/FormPreferences.h:
663 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
664 longer use X11 color name database. HSV and RGB dials/sliders.
665 Please let this be the end of this!
667 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
669 * Several files: Allow compilation when the compiler doesn't
672 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
675 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
676 command line options.
678 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
680 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
681 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
684 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
686 * src/frontends/xforms/FormRef.C (updateBrowser):
687 * src/frontends/xforms/forms/form_ref.fd: try clicking on
688 different insets with the sort key active. Now apply this patch!
690 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
692 * src/frontends/xforms/FormPrint.C: set to valid()
693 when we update from the passed parameters.
695 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
697 * src/LColor.C (getFromGUIName): internationalise the comparison.
699 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
700 FormPreferences choice.
702 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
705 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
707 * src/lyxrc.C: more detail for the printer program config
710 * src/LColor.C: ert->latex text. LColor needs a big revamp
711 but will have to wait till after 1.1.6
713 * src/buffer.C: bring up a dialog if we load a document
714 with an un-installed text class, rather than just complain
717 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
719 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
720 the browser form for a combox in a tabbed folder. Bug fix courtesy of
721 Steve Lamont <spl@ncmir.ucsd.edu>.
723 * src/frontends/xforms/FormDocument.C (build):
724 * src/frontends/xforms/FormPreferences.C (Language::build):
725 pass tabfolders to Combox::add() in order to use this work around.
727 * src/frontends/xforms/FormCitation.C (connect): remove max size
729 (update): sort list of bibliography keys.
731 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
733 No max size limitation. Same popup for new and existing insets. Fixes
734 bugs reported by Rob Lahaye.
736 * src/frontends/xforms/FormCitation.C (c-tor):
737 * src/frontends/xforms/FormCopyright.C (c-tor):
738 * src/frontends/xforms/FormError.C (c-tor):
739 * src/frontends/xforms/FormGraphics.C (c-tor):
740 * src/frontends/xforms/FormIndex.C (c-tor):
741 * src/frontends/xforms/FormRef.C (c-tor):
742 * src/frontends/xforms/FormToc.C (c-tor):
743 * src/frontends/xforms/FormUrl.C (c-tor):
744 use correct policy for ButtonController.
746 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
748 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
751 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
753 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
754 Some resizing changes.
756 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
758 * configure.in: fix typo
760 * lib/languages: add ukraninian and change no to no_NO
762 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
764 * src/bufferview_funcs.C (FontSize): use setLyXSize
766 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
768 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
769 to check for systems where mkstemp() is available but not declared
770 in headers. The new autoconf macro lyx_CHECK_DECL can be used
771 to check for declarations in headers.
773 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
775 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
777 * forms/makefile: added bibforms.fd, include_form.fd.
778 Removed lyx_sendfax.fd.
780 * src/LaTeXLog.C (ShowLatexLog):
781 * src/LyXAction.C (init):
782 * src/bufferparams.C (readLanguage): altered messages as suggested by
785 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
788 * src/credits.C: made fd_form_credits non-static, so that it can be
789 redrawn should the xforms colors be re-mapped.
790 * src/spellchecker.C ditto fd_form_spell_options.
792 * src/filedlg.[Ch] (redraw):
793 * src/intl.[Ch] (redraw):
794 * src/lyxfr0.[Ch] (redraw):
795 * src/insets/figinset.[Ch] (redraw):
796 * src/insets/insetexternal.[Ch] (redraw):
797 new methods, connected to Dialogs::redrawGUI.
799 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
800 to be connected to Dialogs::redrawGUI.
802 * src/frontends/xforms/FormCitation.C (build):
803 * src/frontends/xforms/FormCopyright.C (build):
804 * src/frontends/xforms/FormError.C (build):
805 * src/frontends/xforms/FormGraphics.C (build):
806 * src/frontends/xforms/FormIndex.C (build):
807 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
808 * src/frontends/xforms/FormToc.C (build):
809 * src/frontends/xforms/FormUrl.C (build):
810 use the ButtonController correctly.
812 * src/frontends/xforms/FormCopyright.C (build):
813 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
814 the .fd file and into build().
816 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
818 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
820 * src/frontends/xforms/forms/form_citation.fd:
821 * src/frontends/xforms/forms/form_copyright.fd:
822 * src/frontends/xforms/forms/form_error.fd:
823 * src/frontends/xforms/forms/form_graphics.fd:
824 * src/frontends/xforms/forms/form_index.fd:
825 * src/frontends/xforms/forms/form_toc.fd:
826 * src/frontends/xforms/forms/form_url.fd:
827 renamed some of the objects. Named others explicitly for the first time.
828 Added Restore and Apply buttons where appropriate.
830 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
833 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
835 * src/version.h: try the pre2 again
837 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
839 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
841 * src/frontends/kde/FormParagraph.C: added using directive.
843 * src/frontends/kde/paradlg.C: added config.h and using directive.
845 * src/frontends/kde/paradlg.h: added std::qualifier.
847 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
849 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
851 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
853 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
855 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
857 * src/version.h: set back to 1.1.6cvs
859 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
861 * src/version.h: set to 1.1.6pre2
863 2000-11-20 Marko Vendelin <markov@ioc.ee>
865 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
867 * src/frontends/gnome/Makefile.am: updated list of XForms object files
869 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
871 * src/LColor.C (init):
872 * src/lyxrc.C (getDescription): changed some comments as suggested by
875 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
876 disconnect the redrawGUI signal in best-practice fashion.
878 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
879 long_opts_tab to reflect the change in name of this tabfolder, as
880 suggested by John Levon.
881 (connect, disconnect): new methods. Don't do much at present other than
882 ensuring that we can't resize the dialog. This just makes xforms go
884 (lots of methods in Colors): made void rather than bool. The idea is
885 to have an isOk() function that keeps track of whether any input is
886 genuinely invalid and should therefore block Save, Apply.
887 Easier to manipulate the counters rapidly.
888 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
889 compiler will like this code. Much cleaner way of doing things.
891 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
893 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
894 rather than simple counters, following suggestion by John Levon.
896 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
897 than engraved frame + text.
899 * src/frontends/xforms/forms/makefile: removed spurious command.
901 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
903 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
905 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
908 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
910 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
911 see what Lars has changed and what is just white space!
912 Now used X directly to ascertain the RGB color associated with the
914 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
916 Added some sort capability.
917 The X11 color name database input is only displayed if the database
918 isn't found in the standard place.
919 Got rid of struct compare_converter; it wasn't used.
920 Probably some other stuff that I've forgotten.
922 * src/frontends/xforms/FormPreferences.h: changed the names of some
923 methods in the Colors struct. Added a couple of structs to help sort
924 colors by name and by RGBColor.
926 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
927 functions into a new class RWInfo.
929 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
930 The dialog is now almost navigable using the keyboard. Unfortunately,
931 the cursor has to be inside a browser for it to be activated. There is
932 no visual feedback for the key shortcuts to the arrow keys (use
933 Alt-appropriate arrow key, Alt-x).
935 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
938 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
939 xform_helpers.[Ch]. See above.
941 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
943 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
945 * src/screen.C (setCursorColor): new method. Sets the color of the
947 (ShowManualCursor): call it.
948 Constify some local variables.
950 * src/LColor.[Ch] (LColor): add entry for cursor
951 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
954 2000-11-19 Juergen Vigna <jug@sad.it>
956 * src/insets/insettabular.C (draw): fixed text border redraw problem.
957 (calculate_dimensions_of_cells): try to boost up when inserting chars.
959 2000-11-15 Rob Lahaye <lahaye@postech.edu>
961 * lib/ui/default.ui: OptItem used for Fax entry
963 2000-11-17 Matej Cepl <cepl@bigfoot.com>
965 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
967 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
969 * src/vspace.C (nextToken): fix so it can handle length phrases like
970 "10mm+-20mm", "40inplus16mmminus10cm" etc.
972 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
974 * src/frontends/xforms/FormPreferences.C: constify several variables
975 (BrowserLyX): rewrite to not need the choice variable
976 (Modify): rewrite to not need the choide variable
977 (compare_converter): make operator const
979 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
980 correct the writing of \set_color
981 (getDescription): return a const string
983 * src/kbsequence.[Ch] (addkey): remove dead code
985 * src/Painter.C (text): remove some commented code
987 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
989 * src/ColorHandler.[Ch]: removed some header files from .h file.
990 Included LColor.h in .C file.
992 * src/LColor.[Ch]: made class copyable so that I could create a
993 system_lcolor instance.
995 * src/Painter.h: removed LColor.h.
997 * src/lyx_gui.C (create_forms): used AddName.
999 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
1000 of user preferences/lyxrc file.
1002 * src/lyxrc.C (output): output changes to lcolor.
1004 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
1006 Moved class xformColor to files xform_helpers.[Ch]. These files,
1007 Color.[Ch], could now be moved into src if they would be useful to
1010 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
1011 Also moved FormPreferences::browseFile here as it can be used by any
1012 xform dialog with a "Browse" button. FormGraphics is a perfect example.
1014 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
1015 ReadableFile): changed the FormPreferences methods a little and moved
1016 them here as they'll be useful elsewhere also.
1018 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
1019 Removed some header files and used forward declarations instead.
1021 Removed some methods as they'll be useful elsewhere (see above).
1023 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
1024 Can also now modify the LyX LColors. However, for reasons that I don't
1025 yet understand, it appears that we can use
1026 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
1027 present. The problem appears to lie in ColorHandler, because I can
1028 change the color using LColor.SetColor(). Similarly, when reading in a
1029 preferences file with some set_color instances, I'll get a warning
1030 like: Color sea green is undefined or may not be redefined
1031 Bad lyxrc set_color for sea green
1033 Once the buffer is loaded, however, I can happily change to this color.
1035 Finally, it appears that I have to set the color of "inset frame"
1036 explicitly, or it oscillates from "black" to "indian red" with each
1039 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1041 * ANNOUNCE: corrected a spelling mistake.
1043 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
1046 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1048 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
1050 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
1053 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
1054 match the requirements from the standard better. This is required
1055 to work with gnu libstdc++-v3
1057 * src/frontends/xforms/FormPreferences.C: add explict pair
1058 arguments to browse calls. include support/lyxmanip.h remvoe
1059 extern fmt. whitespace changes. reorder variables in
1060 FormPreferences.h, to match initalizaton order.
1062 * several files: constify more local variables.
1064 * src/buffer.C: remove some commented functions.
1066 * src/DepTable.C (remove_files_with_extension): temporary
1067 work around for gcc 2.97
1068 * src/filedlg.C (find): ditto
1069 * src/Variables.C (set): ditto
1070 * src/LyXAction.C (searchActionArg): ditto
1071 (retrieveActionArg): ditto
1073 * configure.in: check for mktemp too
1075 * UPGRADING: prepare for 1.1.6
1077 * Makefile.am (lgbtags): add backup tags for when etags are
1078 different than usual.
1080 * ANNOUNCE: prepare for 1.1.6
1082 * src/support/tempname.C (make_tempfile): new function, wrapper
1083 around mkstemp and mktemp. Only mkstemp has been tested.
1084 (tempName): call it.
1086 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1088 * default.ui: capitalized some menu items to improve shortcuts.
1090 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1092 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1094 * src/frontends/xforms/Dialogs.C: add "using" directive.
1096 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1098 * src/filedlg.C (Select): highlight suggested file in browser, if
1101 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1102 each tab folder is encapsulated in its own class.
1103 The Language keymaps are now chosen using a text input and a
1104 browser button, rather than a Combox.
1105 All the browser buttons are now functional, although LyXFileDlg
1106 still needs to be modified to make it straighhtforward to return a
1107 directory if that is what is desired.
1109 * src/frontends/xforms/forms/form_preferences.fd: use text input
1110 and browse button to input the Language keymaps. Add a few
1111 callbacks for the browse buttons.
1113 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1115 * src/support/tempname.C (tempName): small changes to make it
1116 safer. remove the '.' before XXXXXX
1118 * src/support/filetools.C (TmpFileName): remove func
1121 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1122 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1123 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1124 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1126 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1127 (FormCommand): ditto
1129 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1132 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1133 for bp (this fixes a reproducible hard crash)
1135 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1138 * src/frontends/xforms/FormBase.h: make bp_ private
1139 (FormBaseBI): remove default for bp
1142 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1145 * src/frontends/xforms/Color.C (RGBColor): made several vars
1146 const, changed initialization of j to allow it to be const
1149 * several files: added const to local variables.
1151 * src/lyx_cb.C: removed several function prototypes and moved them
1155 (UpdateLayoutPreamble):
1157 (MenuInsertLabel): add BufferView as arguemnt
1158 (LayoutsCB): make tmp const
1160 * src/layout_forms.h: regenerated
1162 * src/debug.C: add Debug::FILES
1163 (showLevel) (showTags): translate the desc
1165 * src/debug.h: add FILES as debug target
1167 * src/bufferlist.C: use current_view as an interim measure becuase
1168 of added arguments to MenuWrite and MenuWriteAs
1170 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1172 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1174 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1175 libstdc++ is compiled with.
1177 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1179 * lib/layouts/docbook-book.layout
1180 * lib/layouts/docbook.layout
1181 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1182 those paragraphs are expresse as SGML comments <!-- -->.
1184 * src/LaTeXFeatures.h
1185 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1186 parameter, this allows to express all the include files as relative
1187 paths to the master buffer. The verbatim insert works as the other
1190 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1192 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1194 (MakeDocBookFile): top_element is always written. Some clean up, as
1195 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1197 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1198 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1199 a reference is written instead of the name.
1200 (Validate): use the relative path for the filename.
1202 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1205 * src/support/filetools.h
1206 * src/support/filetools.C (IsSGMLFilename): added.
1209 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1211 * development/OS2/quick_fix.patch:
1212 * lib/configure.cmd:
1213 * README.OS2: quick update to the OS/2 port.
1215 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1217 * src/converter.C: add "using" directive.
1219 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1220 (compare_converter): add "int" as return type.
1222 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1225 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1227 * src/lyx_gui.C (create_forms): map the xform colours, should a
1228 mapping exist. Ie, call XformColor::read().
1230 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1231 and struct HSV as HSVColor.
1232 (XformColor::read, XformColor::write) : new methods that
1233 input/output any changes to the cform GUI colors.
1235 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1238 * src/frontends/xforms/FormPreferences.C Lots of little changes
1239 associated with the changed name of the RGB and HSV structs. Can
1240 now save changes to xforms GUI to file. Commented out
1241 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1242 used currently anyway.
1244 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1246 * src/converter.C: A lot of changes:
1247 - It is no longer possible to choose between two or more ways to
1248 export to some format (the new code uses only the shortest path).
1249 However, it is still possible to choose between pdflatex/ps2pdf
1250 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1251 - Added several methods that makes the FormPreferences code simpler.
1252 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1254 * src/exporter.C (Export): lyxrc.use_pdf is set before
1255 makeLaTeXFile is called. This works but not very nice.
1257 * src/frontends/xforms/FormPreferences.C: The formats/converters
1258 tabs are now fully functional.
1260 * src/buffer.C (getTocList): Add numbers to the captions.
1262 * lib/lyxrc.example: Removed fax section
1264 * src/support/rename.C (rename): Delete the old file if lyx::copy
1267 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1269 * lib/ui/default.ui: minor polishing.
1271 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1273 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1276 * lib/Makefile.am (DOCINST): do not install everything in the
1277 documentation directory.
1279 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1281 * src/bufferlist.C (newFile): set the filename to the constructed
1284 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1285 constructed "newfileXX.lyx" name to the dialog
1287 * src/frontends/DialogBase.h: make update() non-abstract so
1288 KDE doesn't need to implement two update methods for every form
1290 * src/frontends/kde/Makefile.am: add missing xforms objects
1293 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1295 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1297 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1298 structs RGB and HSV. May not be the best place for these files.
1299 Perhaps move them into src ?
1301 * src/frontends/xforms/Makefile.am: added new files.
1303 * src/frontends/xforms/forms/form_preferences.fd:
1304 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1305 replaced all instances of "colour" with "color"!
1307 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1310 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1311 tab. Can now alter the colors of the xform's GUI on the fly. With
1312 the aid of a single static Signal (see below), can "Apply" these
1313 changes to all currently open dialogs. (Well, to all of the NEW
1314 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1315 subsequently opened dialogs will, of course, also have the new
1316 color scheme. Cannot yet save (or load) the choices to file, so
1317 they are lost when exiting LyX.
1319 * src/frontends/Dialogs.h:
1320 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1321 Used to trigger a redraw of any dialogs connected to it because,
1322 for example, the GUI colours have been re-mapped.
1324 * src/frontends/xforms/FormBase.[Ch]:
1325 * src/frontends/xforms/FormDocument.[Ch]:
1326 * src/frontends/xforms/FormParagraph.[Ch]:
1327 * src/frontends/xforms/FormPreferences.[Ch]:
1328 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1329 method, to be connected to Dialogs::redrawGUI. Method must be
1330 virtual, because dialogs with tabbed folders need to redraw the
1331 forms of each tab folder.
1333 * src/LyXView.C (d-tor):
1334 * src/frontends/xforms/FormBase.C (d-tor): connected
1335 Dialogs::redrawGUI signal to redraw().
1337 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1338 removed Assert, because it is identical to that in FormBase.
1340 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1342 * lib/ui/default.ui: minor polishing.
1344 2000-11-10 Juergen Vigna <jug@sad.it>
1346 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1347 (deleteLyXText): ditto
1349 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1350 selection on mouse-button-3.
1352 * src/insets/insettabular.h: new function clearSelection(), use this
1353 functions inside insettabular.C.
1355 * src/insets/insettabular.C (TabularFeatures): clear the selection
1356 on remove_row/column.
1358 * src/insets/inset.C (scroll): fixed some scroll stuff.
1360 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1362 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1364 * lib/CREDITS: add Yves Bastide
1366 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1368 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1369 check whether C library functions are in the global namespace.
1371 * configure.in: calls it.
1373 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1374 #ifndef __GLIBCPP__.
1376 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1378 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1379 iterators to prevent crash.
1381 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1383 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1385 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1386 shortcut for xforms CB to the preemptive or post-handler function.
1388 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1389 removed the HIDDEN_TIMER as it's no longer used.
1390 Various other small changes.
1392 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1393 preemptive handler to obtain feedback, rather than the post-handler.
1394 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1396 Formats tab is now complete. Converters tab is nearly so.
1398 2000-11-09 Juergen Vigna <jug@sad.it>
1400 * src/insets/insettext.C (~InsetText):
1403 (SetParagraphData): set cache.second to 0 after deleting it!
1404 (getLyXText): check if cache.second is not 0 if finding it.
1406 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1408 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1409 lyxlex to parse the rgb.txt file.
1412 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1413 replace the default '#' comment character.
1415 * src/support/tempname.C: add "using" directive
1416 * src/frontends/ButtonPolicies.C: ditto.
1418 * src/support/filetools.C (DirList): add an explicit cast to avoid
1419 a compile error (probably not the right fix)
1421 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1423 * src/support/filetools.C (DirList): implement using system functions
1425 * src/support/tempname.C: new file
1427 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1429 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1431 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1434 * src/frontends/xforms/ButtonController.C: new file
1436 * src/os2_defines.h: remove getcwd define
1438 * src/lyxvc.C: include support/lyxlib.h
1439 (showLog): use lyx::tempName
1441 * src/lyx_cb.C: comment out includes that we don't need
1442 (AutoSave): use lyx::tempName
1444 * src/filedlg.C: include support/lyxlib.h
1445 (Reread): use lyx::getcwd
1447 * src/converter.C: include support/filetools.h
1448 (add_options): change to static inline, make tail const
1449 (Add): make old_viewer const
1450 (GetAllFormats): make it a const method, use const_iterator
1451 (enable): make static inline
1452 (SplitFormat): make using_format const
1454 * src/LaTeX.C (run): use lyx::getcwd
1456 * configure.in: check for mkstemp as well
1458 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1460 * src/converter.[Ch] (GetAllCommands): new method.
1462 * src/support/filetools.[Ch] (DirList): new method.
1464 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1465 functionality to the converters tab.
1466 The formats tab is now nearly complete.
1467 The kbmap choices in Languages tab now display the contents of
1468 system_lyxdir/kbd/*.kmap in readable form.
1470 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1471 Moved some variables into the class.
1473 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1474 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1475 colour of active folder to lighter grey instead. Any takers?
1476 (form_colours): added an "Apply" button.
1477 (form_converters): added a "Flags" input field.
1478 (form_formats): added a "Shortcut" input field. Note that we can't use
1479 names such as "input_shortcut" as this buggers up the sed script stuff.
1481 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1489 * src/lyx_sendfax_main.C:
1492 * src/spellchecker.C:
1493 * src/insets/figinset.C:
1494 * src/insets/insetbib.C:
1495 * src/insets/insetexternal.C:
1496 * src/insets/insetinclude.C:
1497 * src/insets/insetinfo.C:
1498 * src/mathed/math_panel.C:
1499 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1500 all "daughter" dialogs now have identical "feel".
1502 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1504 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1505 used (and was only used in one place prior to this patch. Incorrectly!)
1507 * src/frontends/xforms/FormDocument.C: changed some instances of
1508 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1509 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1510 for options_->input_float_placement. This fixes a bug reported by
1513 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1514 functionality into d-tor.
1516 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1517 input of numerals also.
1519 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1520 fl_set_form_atclose(). Can now close dialog from window manager,
1521 fixing a bug reported by Rob Lahaye.
1523 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1525 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1526 are no longer dark. Haven't yet worked out how to lighten the colour of
1527 the active tabfolder. Any ideas anybody?
1528 Adjusted Colours tab a little.
1529 Added Shortcut field to converters tab. Note that we can't create an
1530 fdesign label like "input_shortcut" as this buggers up the sed-script
1533 * src/frontends/xforms/FormPreferences.[Ch]:
1534 (feedback): fixed crash due to to ob=0.
1535 (LanguagesXXX): the kbmap choices now contain the files
1536 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1537 be replaced by an input with a file browse button, but since the browse
1538 buttons don'y yet work, this'll do for the moment.
1539 (FormatsXXX): think that this is now nearly fully functional.
1540 Some points/questions though:
1541 1. Does "Apply" remove formats if no longer present?
1542 2. I think that the browser should list the GUI names rather than the
1544 3. Must ensure that we can't delete Formats used by an existing
1547 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1548 if this is the best way to do this.
1550 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1552 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1554 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1555 for variable assignment.
1557 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1559 * src/lib/ui/default.ui: added sub/superscripts to menu as
1560 Insert->Special characters and cleaned-up the file a bit
1562 2000-11-07 Allan Rae <rae@lyx.org>
1564 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1565 ob isn't 0 before using it. See comments in function.
1567 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1569 * src/frontends/xforms/form_*.C: regenerated
1571 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1573 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1575 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1576 compiling with gcc-2.96
1578 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1580 * src/support/lyxstring.C: add a couple "using" directives.
1582 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1583 a .c_str() here too for good measure.
1584 * src/Spacing.C (set): ditto.
1585 * src/lyxfunc.C (Dispatch): ditto.
1587 * src/insets/insettabular.C (copySelection): change .str() to
1588 .str().c_str() to fix problems with lyxstring.
1589 * src/support/filetools.C (GetFileContents): ditto.
1590 * src/buffer.C (asciiParagraph): ditto.
1591 * src/paragraph.C (String): ditto.
1593 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1594 * lib/bind/sciword.bind: ditto.
1596 * src/LyXAction.C (init): remove "symbol-insert" function, which
1597 shared LFUN_INSERT_MATH with "math-insert".
1599 * lib/configure.m4: == is not a valid operator for command test.
1601 * src/lyxrc.C: add using directive.
1603 * src/converter.h: add std:: qualifier.
1605 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1607 * src/converter.[Ch] and other files: Change the Format class to a
1608 real class, and create two instances: formats and system_format.
1610 * src/lyxrc.C (output): Output the difference between formats and
1613 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1614 (buildFormats): Insert formats into browser.
1615 (inputFormats): Made the browser and add button functional.
1616 (applyFormats): Update formats from format_vec.
1618 * src/converter.C: Changed all (*it). to it->
1619 (Format::dummy): New method.
1620 (Format::importer): New format flag.
1621 (Formats::GetAllFormats): New method.
1622 (Formats::Add): Delete format from the map if prettyname is empty.
1623 (Converter::Convert): Print an error message if moving the file fails.
1624 (Converter::GetReachableTo): New method
1626 * src/MenuBackend.[Ch]: Add support for importformats tag.
1628 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1630 * lib/configure.m4: Add word->tex and ps->fax converters.
1632 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1633 Return fax to file menu.
1637 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1639 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1642 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1645 * src/lyxfunc.C (processKeyEvent): removed
1647 * src/bufferlist.C (emergencyWrite): removed the out commented
1648 emergency write code.
1650 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1652 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1654 * many files: change formatting to be a bit more uniform for
1655 if,while,for,switch statements, remove some parantesis not needed.
1658 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1660 * config/kde.m4: make config more robust when KDEDIR is set
1662 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1664 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1665 not returned a pixmap for "math-insert".
1667 * src/LyXAction.C (init): sort the entries a bit.
1669 2000-11-03 Juergen Vigna <jug@sad.it>
1671 * src/insets/insettabular.h: added fixed number to update codes so
1672 that update is only in one direction.
1674 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1677 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1678 before call to edit because of redraw.
1680 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1682 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1684 * lib/ui/default.ui: Populate "edit_float" menu
1686 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1688 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1689 "floats-operate". The name is ugly (and the func also), but this
1690 is just a band-aid until we switch to new insets.
1692 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1694 * lib/ui/default.ui: update again the menu layout (fix some
1697 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1699 * src/MenuBackend.h (fulllabel): new method.
1701 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1702 the menu shortcuts of a menu are unique and whether they
1703 correspond to a letter of the label.
1704 (expand): call checkShortcuts when debugging.
1706 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1708 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1710 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1712 * lib/examples/*.lyx : '\language default' => '\language english'
1714 * lib/examples/it_splash.lyx : except where it should be italian
1716 * lib/templates/*.lyx : the same
1718 * doc/*.lyx* : the same
1720 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1722 * lib/bind/menus.bind: remove the Layout menu entries, which I
1723 somehow forgot earlier.
1725 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1727 * lib/ui/old-default.ui: keep the old one here for reference (to
1730 * lib/ui/default.ui: update the menu layout
1732 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1734 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1735 Can now Apply to different insets without closing the dialog.
1737 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1738 Can't actually DO anything with them yet, but I'd like a little
1741 * src/frontends/xforms/input_validators.[ch]
1742 (fl_lowercase_filter): new.
1744 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1746 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1747 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1749 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1751 2000-11-02 Juergen Vigna <jug@sad.it>
1753 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1754 on char insertion as it has already be updated by bv->updateInset().
1756 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1757 if an inset inside was updated.
1759 * lib/configure.cmd: commented out fax-search code
1761 2000-11-01 Yves Bastide <stid@acm.org>
1763 * src/tabular.C (OldFormatRead): set tabular language to the
1766 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1768 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1769 class names with non-letter characters (from Yves Bastide).
1771 * lib/ui/default.ui: change Item to OptItem in import menu.
1772 Comment out fax stuff.
1774 * lib/configure.m4: comment out fax-related stuff.
1776 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1778 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1779 useful xforms helper functions. At present contains only formatted().
1780 Input a string and it returns it with line breaks so that in fits
1783 * src/frontends/xforms/Makefile.am: add new files.
1785 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1786 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1789 * src/frontends/xforms/FormPreferences.[Ch]:
1790 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1791 but lots of little clean ups. Removed enum State. Make use of
1792 formatted(). Constify lots of methods. Perhaps best of all: removed
1793 requirement for that horrible reinterpret_cast from pointer to long in
1796 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1798 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1799 conditionalize build on xforms < 0.89
1801 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1803 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1805 * src/LyXAction.C (init): comment out fax
1807 * src/lyxrc.h: comment out the fax enums
1808 comment out the fax variables
1810 * src/commandtags.h: comment out LFUN_FAX
1812 * src/lyxrc.C: disable fax variables.
1813 (read): disable parsing of fax variables
1814 (output): disable writing of fax variables
1815 (getFeedback): now description for fax variables
1817 * src/lyxfunc.C: comment out MenuFax
1818 (Dispatch): disable LFUN_FAX
1820 * src/lyx_cb.C (MenuFax): comment out
1822 * src/WorkArea.C: add <cctype>
1823 (work_area_handler): better key handling, should be ok now.
1824 for accented chars + etc
1826 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1827 lyx_sendfax.h and lyx_sendfax_man.C
1829 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1830 (show): don't call InitLyXLookup when using xforms 0.89
1832 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1834 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1836 * src/support/filetools.C (GetFileContents): close to dummy change
1838 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1840 * src/trans.C (AddDeadkey): workaround stupid compilers.
1842 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1844 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1845 of two-sided document.
1847 2000-10-31 Juergen Vigna <jug@sad.it>
1849 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1851 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1852 xposition to the Edit call.
1854 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1856 * src/trans.C (AddDeadkey): cast explicitly to char.
1858 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1860 * src/tabular.C (AsciiBottomHLine): simplify?
1861 (AsciiTopHLine): simplify?
1862 (print_n_chars): simplify
1863 (DocBook): remove most of the << endl; we should flush the stream
1864 as seldom as possible.
1866 (TeXBottomHLine): ditto
1867 (TeXTopHLine): ditto
1869 (write_attribute): try a templified version.
1870 (set_row_column_number_info): lesson scope of variables
1872 * src/support/lstrings.h (tostr): new specialization of tostr
1874 * src/trans.C (AddDeadkey): slightly cleaner fix.
1876 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1878 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1879 '%%' in Toc menu labels.
1882 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1883 font_norm is iso10646-1.
1885 * src/font.C (ascent): Fixed for 16bit fonts
1886 (descent,lbearing,rbearing): ditto
1888 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1890 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1891 (getFeedback): new static method.
1893 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1894 Now use combox rather than choice to display languages.
1895 Feedback is now output using a new timer callback mechanism, identical
1896 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1898 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1900 * src/minibuffer.C: fix for older compilers
1902 2000-10-30 Juergen Vigna <jug@sad.it>
1904 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1905 has to be Left of the inset otherwise LyXText won't find it!
1907 * src/BufferView2.C (open_new_inset): delete the inset if it can
1910 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1912 * lyx.man: fix typo.
1914 2000-10-29 Marko Vendelin <markov@ioc.ee>
1915 * src/frontends/gnome/FormCitation.C
1916 * src/frontends/gnome/FormCitation.h
1917 * src/frontends/gnome/FormCopyright.C
1918 * src/frontends/gnome/FormCopyright.h
1919 * src/frontends/gnome/FormError.C
1920 * src/frontends/gnome/FormError.h
1921 * src/frontends/gnome/FormIndex.C
1922 * src/frontends/gnome/FormIndex.h
1923 * src/frontends/gnome/FormPrint.C
1924 * src/frontends/gnome/FormPrint.h
1925 * src/frontends/gnome/FormRef.C
1926 * src/frontends/gnome/FormRef.h
1927 * src/frontends/gnome/FormToc.C
1928 * src/frontends/gnome/FormToc.h
1929 * src/frontends/gnome/FormUrl.C
1930 * src/frontends/gnome/FormUrl.h
1931 * src/frontends/gnome/Menubar_pimpl.C
1932 * src/frontends/gnome/mainapp.C
1933 * src/frontends/gnome/mainapp.h
1934 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1935 changing update() to updateSlot() where appropriate
1937 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1939 * src/frontends/xforms/FormPreferences.[Ch]:
1940 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1943 2000-10-28 Juergen Vigna <jug@sad.it>
1945 * src/insets/insettabular.C (draw): fixed drawing bug.
1947 * src/insets/insettext.C (clear):
1949 (SetParagraphData): clearing the TEXT buffers when deleting the
1950 paragraphs used by it.
1952 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1954 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1956 2000-10-27 Juergen Vigna <jug@sad.it>
1958 * src/tabular.C (~LyXTabular): removed not needed anymore.
1960 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1963 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1965 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1968 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1971 * src/frontends/xforms/FormPreferences.[Ch]:
1972 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1973 Reorganised as modules based on tabs. Much easier to follow the
1974 flow and to add new tabs. Added warning and feedback messages.
1977 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1979 * src/tabular.h (DocBook): add std:: qualifier.
1981 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1983 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1984 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1987 * insettabular.C (DocBook): uses the tabular methods to export
1990 * src/insets/insettext.h
1991 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1993 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1995 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1998 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1999 moved misplaced AllowInput two lines up.
2001 * src/buffer.C (readFile): compare float with float, not with int
2003 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2005 * src/minibuffer.C: add "using SigC::slot" statement.
2007 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
2009 * src/frontends/xforms/forms/README: updated section about make.
2011 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
2012 Tidied some forms up, made two of form_tabular's tabs more
2013 self-consistent, fixed Jean-Marc's size problem in form_preferences,
2014 fixed translation problem with "Column".
2016 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2018 * src/minibuffer.h: use Timeout instead of the xforms timer
2020 (setTimer) rewrite for the Timeout, change to unsigned arg
2021 (set): change to unsigned timer arg
2024 * src/minibuffer.C (TimerCB): removed func
2025 (C_MiniBuffer_TimerCB): removed func
2026 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
2027 (peek_event): use a switch statement
2028 (add): don't use fl_add_timer.
2029 (Set): rewrite to use the Timeout
2032 * src/Timeout.[Ch] (setType): return a Timeout &
2033 (setTimeout): ditto, change to unsigned arg for timeout
2035 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
2037 * src/mathed/formula.C (mathed_string_width): Use string instead
2038 of a constant size char array.
2040 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2042 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
2043 the two recently added operator<< for SMInput and State.
2045 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
2047 (OkCancelPolicy): ditto
2048 (OkCancelReadOnlyPolicy): ditto
2049 (NoRepeatedApplyReadOnlyPolicy): ditto
2050 (OkApplyCancelReadOnlyPolicy): ditto
2051 (OkApplyCancelPolicy): ditto
2052 (NoRepeatedApplyPolicy): ditto
2054 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2056 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
2057 add the usual std:: qualifiers.
2059 2000-10-25 Juergen Vigna <jug@sad.it>
2061 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
2063 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2065 * src/support/filetools.C (MakeRelPath): change some types to
2068 * src/frontends/ButtonPolicies.h (operator<<): new operator for
2069 ButtonPolicy::SMInput and ButtonPolicy::State.
2071 * src/FontLoader.C (reset): small cleanup
2072 (unload): small cleanup
2074 * src/FontInfo.C (getFontname): initialize error to 10000.0
2076 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2078 * src/frontends/xforms/FormPreferences.[Ch]:
2079 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
2080 TeX encoding and default paper size sections.
2082 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2084 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2087 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2088 make the message_ empty.
2089 (FormError): don't initialize message_ in initializer list.
2091 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2093 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2095 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2097 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2099 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2101 * src/frontends/kde/*data.[Ch]: _("") is not
2104 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2106 * src/buffer.C: removed redundant using directive.
2108 * src/frontends/DialogBase.h: revert to original definition of
2111 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2112 stuff into two classes, one for each dialog, requires a new
2113 element in the dialogs vector, FormTabularCreate.
2115 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2118 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2119 method. Continues Allan's idea, but means that derived classes
2120 don't need to worry about "update or hide?".
2122 * src/frontends/xforms/FormError.C (showInset): add connection
2125 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2126 one for each dialog. FormTabular now contains main tabular dialog
2129 * src/frontends/xforms/FormTabularCreate.[Ch]:
2130 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2133 * src/frontends/xforms/FormGraphics.[Ch]:
2134 * src/frontends/xforms/forms/form_graphics.fd
2135 * src/frontends/xforms/FormTabular.[Ch]:
2136 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2137 classes of FormInset.
2139 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2140 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2142 * src/frontends/xforms/Makefile.am:
2143 * src/frontends/xforms/forms/makefile: added new files.
2145 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2146 variable. added Signal0 hide signal, in keeping with other GUI-I
2149 * src/support/lstrings.h: removed redundant std:: qualifier as
2150 it's already declared in Lsstream.h.
2152 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2154 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2158 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2160 * src/tabular.C (Ascii): minimize scope of cell.
2162 * src/BufferView2.C (nextWord): return string() instead of 0;
2164 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2166 * src/converter.h: add a std:: qualifier
2168 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2170 * src/importer.[Ch]: New files. Used for importing files into LyX.
2172 * src/lyxfunc.C (doImport): Use the new Importer class.
2174 * src/converter.h: Add shortcut member to the Format class.
2175 Used for holding the menu shortcut.
2177 * src/converter.C and other files: Made a distinction between
2178 format name and format extension. New formats can be defined using
2179 the \format lyxrc tag.
2180 Added two new converter flags: latex and disable.
2182 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2184 * src/support/lyxlib.h: unify namespace/struct implementation.
2185 Remove extra declarations.
2187 * src/support/chdir.C (chdir): remove version taking char const *
2189 * src/support/rename.C: ditto.
2190 * src/support/lyxsum.C: ditto.
2192 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2194 * src/frontends/xforms/FormBase.[Ch]:
2195 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2196 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2197 work only for the next call to fl_show_form(). The correct place to set
2198 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2199 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2200 from FormBase have the minimum size set; no more stupid crashes with
2203 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2205 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2207 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2209 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2211 * src/support/lyxlib.h: changed second argument of mkdir to
2212 unsigned long int (unsigned int would probably have been enough,
2213 but...). Removed <sys/types.h> header.
2214 * src/support/mkdir.C (mkdir): ditto.
2218 2000-10-19 Juergen Vigna <jug@sad.it>
2220 * src/lyxfunc.C (MenuNew): small fix (form John)
2222 * src/screen.C (Update): removed unneeded code.
2224 * src/tabular.C (Ascii): refixed int != uint bug!
2226 * src/support/lyxlib.h: added sys/types.h include for now permits
2227 compiling, but I don't like this!
2229 2000-10-18 Juergen Vigna <jug@sad.it>
2231 * src/text2.C (ClearSelection): if we clear the selection we need
2232 more refresh so set the status apropriately
2234 * src/insets/insettext.C (draw): hopefully finally fixed draw
2237 2000-10-12 Juergen Vigna <jug@sad.it>
2239 * src/insets/insettext.C (draw): another small fix and make a block
2240 so that variables are localized.
2242 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2244 * src/support/lstrings.C (lowercase, uppercase):
2245 use explicit casts to remove compiler warnings.
2247 * src/support/LRegex.C (Impl):
2248 * src/support/StrPool.C (add):
2249 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2250 (AddPath, MakeDisplayPath):
2251 * src/support/lstrings.C (prefixIs, subst):
2252 use correct type to remove compiler warnings.
2254 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2256 * src/support/lyxlib.h:
2257 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2258 portability and to remove compiler warning with DEC cxx.
2260 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2262 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2264 * src/minibuffer.C (peek_event): retun 1 when there has been a
2265 mouseclick in the minibuffer.
2269 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2271 * src/frontends/xforms/FormParagraph.C: more space above/below
2274 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2276 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2277 a char only if real_current_font was changed.
2279 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2281 * NEWS: update somewhat for 1.1.6
2283 * lib/ui/default.ui: clean up.
2285 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2287 * lib/CREDITS: clean up
2289 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2291 * src/combox.[Ch] (select): changed argument back to int
2292 * src/combox.C (peek_event): removed num_bytes as it is declared but
2295 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2296 modified calls to Combox::select() to remove warnings about type
2299 * src/insets/insetbutton.C (width): explicit cast to remove warning
2300 about type conversion.
2302 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2305 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2306 sel_pos_end, refering to cursor position are changed to
2307 LyXParagraph::size_type.
2309 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2310 consistent with LyXCursor::pos().
2311 (inset_pos): changed to LyXParagraph::size_type for same reason.
2313 * src/insets/insettext.C (resizeLyXText): changed some temporary
2314 variables refing to cursor position to LyXParagraph::size_type.
2316 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2318 * src/frontends/kde/<various>: The Great Renaming,
2321 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2323 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2325 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2327 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2328 0 when there are no arguments.
2330 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2332 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2333 to segfaults when pressing Ok in InsetBibtex dialog.
2335 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2337 * forms/layout_forms.fd:
2338 * src/layout_forms.C (create_form_form_character): small change to use
2339 labelframe rather than engraved frame + text
2341 * src/lyx_gui.C (create_forms): initialise choice_language with some
2342 arbitrary value to prevent segfault when dialog is shown.
2344 2000-10-16 Baruch Even <baruch.even@writeme.com>
2346 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2347 is no resulting file. This pertains only to LaTeX output.
2349 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2351 * src/text.C (Backspace): Make sure that the row of the cursor is
2354 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2357 * src/lyx_gui.C (init): Prevent a crash when only one font from
2358 menu/popup fonts is not found.
2360 * lib/lyxrc.example: Add an example for binding a key for language
2363 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2365 * src/converter.C (GetReachable): Changed the returned type to
2367 (IsReachable): New method
2369 * src/MenuBackend.C (expand): Handle formats that appear more
2372 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2374 * src/frontends/support/Makefile.am
2375 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2378 * lib/CREDITS: add Garst Reese.
2380 * src/support/snprintf.h: add extern "C" {} around the definitions.
2382 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2384 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2387 * src/frontends/xforms/FormDocument.C:
2388 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2389 compile without "conversion to integral type of smaller size"
2392 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2394 * src/text.C (GetColumnNearX): Fixed disabled code.
2396 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2398 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2401 * src/support/snprintf.[ch]: new files
2403 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2405 * src/frontends/kde/formprintdialog.C: add
2406 file browser for selecting postscript output
2408 * src/frontends/kde/formprintdialogdata.C:
2409 * src/frontends/kde/formprintdialogdata.h: re-generate
2412 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2414 * src/frontends/gnome/Makefile.am:
2415 * src/frontends/kde/Makefile.am: FormCommand.C
2416 disappeared from xforms
2418 * src/frontends/kde/FormCitation.C:
2419 * src/frontends/kde/FormIndex.C: read-only
2422 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2424 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2427 * src/bufferlist.C: add using directive.
2429 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2431 * src/support/lyxfunctional.h: version of class_fun for void
2432 returns added, const versions of back_inseter_fun and compare_fun
2435 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2437 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2439 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2441 * ChangeLog: cleanup.
2443 * lib/CREDITS: update to add all the contributors we've forgotten.
2444 I have obviously missed some, so tell me whether there were
2447 2000-10-13 Marko Vendelin <markov@ioc.ee>
2449 * src/frontends/gnome/FormCitation.C
2450 * src/frontends/gnome/FormCitation.h
2451 * src/frontends/gnome/FormError.C
2452 * src/frontends/gnome/FormIndex.C
2453 * src/frontends/gnome/FormRef.C
2454 * src/frontends/gnome/FormRef.h
2455 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2457 * src/frontends/gnome/FormCitation.C
2458 * src/frontends/gnome/FormCopyright.C
2459 * src/frontends/gnome/FormError.C
2460 * src/frontends/gnome/FormIndex.C
2461 * src/frontends/gnome/FormRef.C
2462 * src/frontends/gnome/FormToc.C
2463 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2466 * src/frontends/gnome/Menubar_pimpl.C
2467 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2470 2000-10-11 Baruch Even <baruch.even@writeme.com>
2473 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2474 to convey its real action.
2476 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2477 clear the minibuffer and prepare to enter a command.
2479 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2480 the rename from ExecCommand to PrepareForCommand.
2481 * src/lyxfunc.C (Dispatch): ditto.
2483 2000-10-11 Baruch Even <baruch.even@writeme.com>
2485 * src/buffer.C (writeFile): Added test for errors on writing, this
2486 catches all errors and not only file system full errors as intended.
2488 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2490 * src/lyx_gui.C (create_forms): better fix for crash with
2491 translated interface.
2493 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2495 * src/frontends/kde/Makefile.am:
2496 * src/frontends/kde/FormCopyright.C:
2497 * src/frontends/kde/formcopyrightdialog.C:
2498 * src/frontends/kde/formcopyrightdialog.h:
2499 * src/frontends/kde/formcopyrightdialogdata.C:
2500 * src/frontends/kde/formcopyrightdialogdata.h:
2501 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2502 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2503 copyright to use qtarch
2505 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2507 * src/encoding.C (read): Fixed bug that caused an error message at
2508 the end of the file.
2510 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2512 * lib/lyxrc.example: Fixed hebrew example.
2514 2000-10-13 Allan Rae <rae@lyx.org>
2516 * src/frontends/xforms/FormPreferences.C (input): reworking the
2518 (build, update, apply): New inputs in various tabfolders
2520 * src/frontends/xforms/FormToc.C: use new button policy.
2521 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2522 dialogs that either can't use any existing policy or where it just
2525 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2528 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2529 added a bool parameter which is ignored.
2531 * src/buffer.C (setReadonly):
2532 * src/BufferView_pimpl.C (buffer):
2533 * src/frontends/kde/FormCopyright.h (update):
2534 * src/frontends/kde/FormCitation.[Ch] (update):
2535 * src/frontends/kde/FormIndex.[Ch] (update):
2536 * src/frontends/kde/FormPrint.[Ch] (update):
2537 * src/frontends/kde/FormRef.[Ch] (update):
2538 * src/frontends/kde/FormToc.[Ch] (update):
2539 * src/frontends/kde/FormUrl.[Ch] (update):
2540 * src/frontends/gnome/FormCopyright.h (update):
2541 * src/frontends/gnome/FormCitation.[Ch] (update):
2542 * src/frontends/gnome/FormError.[Ch] (update):
2543 * src/frontends/gnome/FormIndex.[Ch] (update):
2544 * src/frontends/gnome/FormPrint.[Ch] (update):
2545 * src/frontends/gnome/FormRef.h (update):
2546 * src/frontends/gnome/FormToc.[Ch] (update):
2547 * src/frontends/gnome/FormUrl.[Ch] (update):
2548 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2549 to updateBufferDependent and DialogBase
2551 * src/frontends/xforms/FormCitation.[hC]:
2552 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2553 * src/frontends/xforms/FormError.[Ch]:
2554 * src/frontends/xforms/FormGraphics.[Ch]:
2555 * src/frontends/xforms/FormIndex.[Ch]:
2556 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2557 and fixed readOnly handling.
2558 * src/frontends/xforms/FormPrint.[Ch]:
2559 * src/frontends/xforms/FormRef.[Ch]:
2560 * src/frontends/xforms/FormTabular.[Ch]:
2561 * src/frontends/xforms/FormToc.[Ch]:
2562 * src/frontends/xforms/FormUrl.[Ch]:
2563 * src/frontends/xforms/FormInset.[Ch]:
2564 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2565 form of updateBufferDependent.
2567 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2568 if form()->visible just in case someone does stuff to the form in a
2571 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2572 the buttoncontroller for everything the enum used to be used for.
2573 (update) It would seem we need to force all dialogs to use a bool
2574 parameter or have two update functions. I chose to go with one.
2575 I did try removing update() from here and FormBase and defining the
2576 appropriate update signatures in FormBaseB[DI] but then ran into the
2577 problem of the update() call in FormBase::show(). Whatever I did
2578 to get around that would require another function and that just
2579 got more confusing. Hence the decision to make everyone have an
2580 update(bool). An alternative might have been to override show() in
2581 FormBaseB[DI] and that would allow the different and appropriate
2584 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2585 true == buffer change occurred. I decided against using a default
2586 template parameter since not all compilers support that at present.
2588 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2590 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2591 army knife" by removing functionality.
2592 (clearStore): removed. All such housekeeping on hide()ing the dialog
2593 is to be carried out by overloaded disconnect() methods.
2594 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2595 superceded by Baruch's neat test (FormGraphics) to update an existing
2596 dialog if a new signal is recieved rather than block all new signals
2598 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2599 only to Inset dialogs.
2600 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2601 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2603 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2605 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2606 as a base class to all inset dialogs. Used solely to connect/disconnect
2607 the Inset::hide signal and to define what action to take on receipt of
2608 a UpdateBufferDependent signal.
2609 (FormCommand): now derived from FormInset.
2611 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2614 * src/frontends/xforms/FormCopyright.[Ch]:
2615 * src/frontends/xforms/FormPreferences.[Ch]:
2616 now derived from FormBaseBI.
2618 * src/frontends/xforms/FormDocument.[Ch]:
2619 * src/frontends/xforms/FormParagraph.[Ch]:
2620 * src/frontends/xforms/FormPrint.[Ch]:
2621 now derived from FormBaseBD.
2623 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2625 * src/frontends/xforms/FormCitation.[Ch]:
2626 * src/frontends/xforms/FormError.[Ch]:
2627 * src/frontends/xforms/FormRef.[Ch]:
2628 * src/frontends/xforms/FormToc.[Ch]:
2629 (clearStore): reworked as disconnect().
2631 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2634 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2636 * src/converter.C (runLaTeX): constify buffer argument
2639 * src/frontends/support/Makefile.am (INCLUDES): fix.
2641 * src/buffer.h: add std:: qualifier
2642 * src/insets/figinset.C (addpidwait): ditto
2643 * src/MenuBackend.C: ditto
2644 * src/buffer.C: ditto
2645 * src/bufferlist.C: ditto
2646 * src/layout.C: ditto
2647 * src/lyxfunc.C: ditto
2649 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2651 * src/lyxtext.h (bidi_level): change return type to
2652 LyXParagraph::size_type.
2654 * src/lyxparagraph.h: change size_type to
2655 TextContainer::difference_type. This should really be
2656 TextContainer::size_type, but we need currently to support signed
2659 2000-10-11 Marko Vendelin <markov@ioc.ee>
2660 * src/frontends/gnome/FormError.h
2661 * src/frontends/gnome/FormRef.C
2662 * src/frontends/gnome/FormRef.h
2663 * src/frontends/gnome/FormError.C
2664 * src/frontends/gnome/Makefile.am
2665 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2666 to Gnome frontend. Both dialogs use "action" area.
2668 2000-10-12 Baruch Even <baruch.even@writeme.com>
2670 * src/graphics/GraphicsCacheItem_pimpl.C:
2671 * src/graphics/Renderer.C:
2672 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2675 2000-10-12 Juergen Vigna <jug@sad.it>
2677 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2678 visible when selecting).
2680 * development/Code_rules/Rules: fixed some typos.
2682 2000-10-09 Baruch Even <baruch.even@writeme.com>
2684 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2685 compiling on egcs 1.1.2 possible.
2687 * src/filedlg.C (comp_direntry::operator() ): ditto.
2689 2000-08-31 Baruch Even <baruch.even@writeme.com>
2691 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2694 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2695 transient it now only gets freed when the object is destructed.
2697 2000-08-24 Baruch Even <baruch.even@writeme.com>
2699 * src/frontends/FormGraphics.h:
2700 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2703 2000-08-20 Baruch Even <baruch.even@writeme.com>
2705 * src/insets/insetgraphics.C:
2706 (draw): Added messages to the drawn rectangle to report status.
2707 (updateInset): Disabled the use of the inline graphics,
2710 2000-08-17 Baruch Even <baruch.even@writeme.com>
2712 * src/frontends/support: Directory added for the support of GUII LyX.
2714 * src/frontends/support/LyXImage.h:
2715 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2718 * src/frontends/support/LyXImage_X.h:
2719 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2720 version of LyXImage, this uses the Xlib Pixmap.
2722 * src/PainterBase.h:
2723 * src/PainterBase.C:
2725 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2726 replacement to Pixmap.
2728 * src/insets/insetgraphics.h:
2729 * src/insets/insetgraphics.C:
2730 * src/graphics/GraphicsCacheItem.h:
2731 * src/graphics/GraphicsCacheItem.C:
2732 * src/graphics/GraphicsCacheItem_pimpl.h:
2733 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2736 * src/graphics/GraphicsCacheItem.h:
2737 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2738 another copy of the object.
2740 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2741 of cacheHandle, this fixed a bug that sent LyX crashing.
2743 * src/graphics/XPM_Renderer.h:
2744 * src/graphics/XPM_Renderer.C:
2745 * src/graphics/EPS_Renderer.h:
2746 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2748 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2750 * src/lyxfunc.C (processKeySym): only handle the
2751 lockinginset/inset stuff if we have a buffer and text loaded...
2753 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2755 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2757 * src/support/lyxfunctional.h: add operator= that takes a reference
2759 * src/lyxserver.C (mkfifo): make first arg const
2761 * src/layout.h: renamed name(...) to setName(...) to work around
2764 * src/buffer.C (setFileName): had to change name of function to
2765 work around bugs in egcs. (renamed from fileName)
2767 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2769 * src/support/translator.h: move helper template classes to
2770 lyxfunctional.h, include "support/lyxfunctional.h"
2772 * src/support/lyxmanip.h: add delaration of fmt
2774 * src/support/lyxfunctional.h: new file
2775 (class_fun_t): new template class
2776 (class_fun): helper template function
2777 (back_insert_fun_iterator): new template class
2778 (back_inserter_fun): helper template function
2779 (compare_memfun_t): new template class
2780 (compare_memfun): helper template function
2781 (equal_1st_in_pair): moved here from translator
2782 (equal_2nd_in_pair): moved here from translator
2784 * src/support/fmt.C: new file
2785 (fmt): new func, can be used for a printf substitute when still
2786 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2788 * src/support/StrPool.C: add some comments
2790 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2793 * src/insets/figinset.C (addpidwait): use std::copy with
2794 ostream_iterator to fill the pidwaitlist
2796 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2798 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2801 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2804 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2806 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2807 (class_update): ditto
2808 (BulletPanel): ditto
2809 (CheckChoiceClass): move initialization of tc and tct
2811 * src/tabular.C: remove current_view
2812 (OldFormatRead): similar to right below [istream::ignore]
2814 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2815 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2816 unused [istream::ignore]
2818 * src/lyxfunc.C: include "support/lyxfunctional.h"
2819 (getInsetByCode): use std::find_if and compare_memfun
2821 * src/lyxfont.C (stateText): remove c_str()
2823 * src/lyx_main.C (setDebuggingLevel): make static
2824 (commandLineHelp): make static
2826 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2827 Screen* together with fl_get_display() and fl_screen
2829 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2830 togheter with fl_get_display() and fl_screen
2831 (create_forms): remove c_str()
2833 * src/layout.C: include "support/lyxfunctional.h"
2834 (hasLayout): use std::find_if and compare_memfun
2835 (GetLayout): use std::find_if and comapre_memfun
2836 (delete_layout): use std::remove_if and compare_memfun
2837 (NumberOfClass): use std:.find_if and compare_memfun
2839 * src/gettext.h: change for the new functions
2841 * src/gettext.C: new file, make _(char const * str) and _(string
2842 const & str) real functions.
2844 * src/font.C (width): rewrite slightly to avoid one extra variable
2846 * src/debug.C: initialize Debug::ANY here
2848 * src/commandtags.h: update number comments
2850 * src/combox.h (get): make const func
2852 (getline): make const
2854 * src/combox.C (input_cb): handle case where fl_get_input can
2857 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2858 "support/lyxfunctional.h", remove current_view variable.
2859 (resize): use std::for_each with std::mem_fun
2860 (getFileNames): use std::copy with back_inserter_fun
2861 (getBuffer): change arg type to unsigned int
2862 (emergencyWriteAll): call emergencyWrite with std::for_each and
2864 (emergencyWrite): new method, the for loop in emergencyWriteAll
2866 (exists): use std::find_if with compare_memfun
2867 (getBuffer): use std::find_if and compare_memfun
2869 * src/buffer.h: add typedefs for iterator_category, value_type
2870 difference_type, pointer and reference for inset_iterator
2871 add postfix ++ for inset_iterator
2872 make inset_iterator::getPos() const
2874 * src/buffer.C: added support/lyxmanip.h
2875 (readFile): use lyxerr << fmt instead of printf
2876 (makeLaTeXFile): use std::copy to write out encodings
2878 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2880 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2881 free and the char * temp.
2882 (hasMenu): use std::find_if and compare_memfun
2885 * src/Makefile.am (lyx_SOURCES): added gettext.C
2887 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2888 string::insert small change to avoid temporary
2890 * src/LColor.C (getGUIName): remove c_str()
2892 * several files: change all occurrences of fl_display to
2895 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2896 that -pedantic is not used for gcc 2.97 (cvs gcc)
2898 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2900 2000-10-11 Allan Rae <rae@lyx.org>
2902 * src/frontends/xforms/FormPreferences.C (input): template path must be
2903 a readable directory. It doesn't need to be writeable.
2904 (build, delete, update, apply): New inputs in the various tabfolders
2906 * src/frontends/xforms/forms/form_preferences.fd:
2907 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2908 several new entries to existing folders. Shuffled some existing stuff
2911 * src/frontends/xforms/forms/form_print.fd:
2912 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2913 Should probably rework PrinterParams as well. Note that the switch to
2914 collated is effectively the same as !unsorted so changing PrinterParams
2915 will require a lot of fiddly changes to reverse the existing logic.
2917 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2919 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2921 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2923 2000-10-10 Allan Rae <rae@lyx.org>
2926 * src/lyxfunc.C (Dispatch):
2928 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2931 * src/lyxrc.C (output): Only write the differences between system lyxrc
2932 and the users settings.
2935 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2937 I'll rewrite this later, after 1.1.6 probably, to keep a single
2938 LyXRC but two instances of a LyXRCStruct.
2940 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2942 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2944 * src/tabular.h: add a few std:: qualifiers.
2946 * src/encoding.C: add using directive.
2947 * src/language.C: ditto.
2949 * src/insets/insetquotes.C (Validate): use languages->lang()
2950 instead of only language.
2952 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2954 * lib/languages: New file.
2956 * lib/encodings: New file.
2958 * src/language.C (Languages): New class.
2959 (read): New method. Reads the languages from the 'languages' file.
2961 * src/encoding.C (Encodings): New class.
2962 (read): New method. Reads the encodings from the 'encodings' file.
2964 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2967 * src/bufferparams.h and a lot of files: Deleted the member language,
2968 and renamed language_info to language
2970 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2971 * src/lyxfont.C (latexWriteStartChanges): ditto.
2972 * src/paragraph.C (validate,TeXOnePar): ditto.
2974 * src/lyxfont.C (update): Restored deleted code.
2976 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2978 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2980 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2982 * src/insets/figinset.[Ch]:
2983 * src/insets/insetinclude.[Ch]:
2984 * src/insets/insetinclude.[Ch]:
2985 * src/insets/insetparent.[Ch]:
2986 * src/insets/insetref.[Ch]:
2987 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2989 * src/insets/*.[Ch]:
2990 * src/mathed/formula.[Ch]:
2991 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2993 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2994 * src/lyx_cb.C (FigureApplyCB):
2995 * src/lyxfunc.C (getStatus, Dispatch):
2996 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2999 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
3001 * src/converter.[Ch] (Formats::View):
3002 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
3004 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
3005 *current_view->buffer(). This will change later, but this patch is way
3008 2000-10-09 Juergen Vigna <jug@sad.it>
3010 * src/text.C (GetRow): small fix.
3012 * src/BufferView_pimpl.C (cursorPrevious):
3013 (cursorNext): added LyXText parameter to function.
3015 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
3016 keypress depending on cursor position.
3018 2000-10-06 Juergen Vigna <jug@sad.it>
3020 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
3021 (copySelection): redone this function and also copy ascii representa-
3024 * src/tabular.C (Ascii):
3028 (print_n_chars): new functions to realize the ascii export of tabulars.
3030 2000-10-05 Juergen Vigna <jug@sad.it>
3032 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
3033 if we don't have a buffer.
3035 2000-10-10 Allan Rae <rae@lyx.org>
3037 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
3038 with closing dialog. It seems that nested tabfolders require hiding
3039 of inner tabfolders before hiding the dialog itself. Actually all I
3040 did was hide the active outer folder.
3042 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
3043 unless there really is a buffer. hideBufferDependent is called
3046 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
3047 POTFILES.in stays in $(srcdir).
3049 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
3051 * lib/lyxrc.example: Few changes.
3053 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
3055 * src/BufferView_pimpl.C (buffer): only need one the
3056 updateBufferDependent signal to be emitted once! Moved to the end of
3057 the method to allow bv_->text to be updated first.
3059 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
3060 and hSignal_ with Dialogs * and BufferDependency variables.
3061 New Buffer * parent_, initialised when the dialog is launched. Used to
3062 check whether to update() or hide() dialog in the new, private
3063 updateOrHide() method that is connected to the updateBufferDependent
3064 signal. Daughter classes dictate what to do using the
3065 ChangedBufferAction enum, passed to the c-tor.
3067 * src/frontends/xforms/FormCitation.C:
3068 * src/frontends/xforms/FormCommand.C:
3069 * src/frontends/xforms/FormCopyright.C:
3070 * src/frontends/xforms/FormDocument.C:
3071 * src/frontends/xforms/FormError.C:
3072 * src/frontends/xforms/FormIndex.C:
3073 * src/frontends/xforms/FormPreferences.C:
3074 * src/frontends/xforms/FormPrint.C:
3075 * src/frontends/xforms/FormRef.C:
3076 * src/frontends/xforms/FormToc.C:
3077 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
3080 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3081 ChangedBufferAction enum.
3083 * src/frontends/xforms/FormParagraph.[Ch]
3084 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3087 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3089 * lib/bind/cua.bind: fix a bit.
3090 * lib/bind/emacs.bind: ditto.
3092 * lib/bind/menus.bind: remove real menu entries from there.
3094 * src/spellchecker.C: make sure we only include strings.h when
3097 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3099 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3100 function. It enlarges the maximum number of pup when needed.
3101 (add_toc2): Open a new menu if maximum number of items per menu has
3104 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3106 * src/frontends/kde/FormPrint.C: fix error reporting
3108 * src/frontends/xforms/FormDocument.C: fix compiler
3111 * lib/.cvsignore: add Literate.nw
3113 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3116 * bufferview_funcs.[Ch]
3119 * text2.C: Add support for numbers in RTL text.
3121 2000-10-06 Allan Rae <rae@lyx.org>
3123 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3124 to be gettext.m4 friendly again. ext_l10n.h is now
3125 generated into $top_srcdir instead of $top_builddir
3126 so that lyx.pot will be built correctly -- without
3127 duplicate parsing of ext_l10n.h.
3129 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3131 * src/frontends/kde/FormCitation.C: make the dialog
3132 behave more sensibly
3134 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3136 * config/kde.m4: fix consecutive ./configure runs,
3137 look for qtarch, fix library order
3139 * src/frontends/kde/Makefile.am: tidy up,
3140 add Print dialog, add .dlg dependencies
3142 * src/frontends/kde/FormPrint.C:
3143 * src/frontends/kde/FormPrint.h:
3144 * src/frontends/kde/formprintdialog.C:
3145 * src/frontends/kde/formprintdialog.h:
3146 * src/frontends/kde/formprintdialogdata.C:
3147 * src/frontends/kde/formprintdialogdata.h:
3148 * src/frontends/kde/dlg/formprintdialog.dlg: add
3151 * src/frontends/kde/dlg/README: Added explanatory readme
3153 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3154 script to double-check qtarch's output
3156 * src/frontends/kde/formindexdialog.C:
3157 * src/frontends/kde/formindexdialogdata.C:
3158 * src/frontends/kde/formindexdialogdata.h:
3159 * src/frontends/kde/dlg/formindexdialog.dlg: update
3160 for qtarch, minor fixes
3162 2000-10-05 Allan Rae <rae@lyx.org>
3164 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3165 dialogs when switching buffers update them instead. It's up to each
3166 dialog to decide if it should still be visible or not.
3167 update() should return a bool to control visiblity within show().
3168 Or perhaps better to set a member variable and use that to control
3171 * lib/build-listerrors: create an empty "listerrors" file just to stop
3172 make trying to regenerate it all the time if you don't have noweb
3175 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3177 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3178 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3179 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3180 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3181 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3183 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3185 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3187 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3188 deleting buffer. Closes all buffer-dependent dialogs.
3190 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3192 * src/frontends/xforms/FormCitation.[Ch]:
3193 * src/frontends/xforms/FormPreferences.[Ch]:
3194 * src/frontends/xforms/FormPrint.[Ch]:
3195 * src/frontends/xforms/FormRef.[Ch]:
3196 * src/frontends/xforms/FormUrl.[Ch]: ditto
3198 * src/frontends/xforms/FormDocument.[Ch]:
3199 * src/frontends/xforms/forms/form_document.C.patch:
3200 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3201 pass through a single input() function.
3203 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3205 * lib/build-listerrors: return status as OK
3207 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3209 * lib/lyxrc.example: Updated to new export code
3211 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3213 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3216 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3219 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3220 LyX-Code is defined.
3221 * lib/layouts/amsbook.layout: ditto.
3223 * boost/Makefile.am: fix typo.
3225 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3227 (add_lastfiles): removed.
3228 (add_documents): removed.
3229 (add_formats): removed.
3231 * src/frontends/Menubar.C: remove useless "using" directive.
3233 * src/MenuBackend.h: add a new MenuItem constructor.
3235 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3238 2000-10-04 Allan Rae <rae@lyx.org>
3240 * lib/Makefile.am (listerrors):
3241 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3242 I haven't got notangle installed so Kayvan please test. The output
3243 should end up in $builddir. This also allows people who don't have
3244 noweb installed to complete the make process without error.
3246 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3247 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3248 by JMarc's picky compiler.
3250 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3253 * src/insets/insettabular.C (setPos): change for loop to not use
3254 sequencing operator. Please check this Jürgen.
3256 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3258 * src/insets/insetcite.C (getScreenLabel): ditto
3259 * src/support/filetools.C (QuoteName): ditto
3260 (ChangeExtension): ditto
3262 * src/BufferView_pimpl.C (scrollCB): make heigt int
3264 * src/BufferView2.C (insertInset): comment out unused arg
3266 * boost/Makefile.am (EXTRADIST): new variable
3268 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3270 * src/exporter.C (IsExportable): Fixed
3272 * lib/configure.m4: Small fix
3274 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3276 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3277 * src/insets/insetbib.C (bibitemWidest): ditto.
3278 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3280 2000-10-03 Juergen Vigna <jug@sad.it>
3282 * src/BufferView2.C (theLockingInset): removed const because of
3283 Agnus's compile problems.
3285 * src/insets/insettext.C (LocalDispatch): set the language of the
3286 surronding paragraph on inserting the first character.
3288 * various files: changed use of BufferView::the_locking_inset.
3290 * src/BufferView2.C (theLockingInset):
3291 (theLockingInset): new functions.
3293 * src/BufferView.h: removed the_locking_inset.
3295 * src/lyxtext.h: added the_locking_inset
3297 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3299 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3301 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3303 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3304 * src/mathed/math_cursor.C (IsAlpha): ditto.
3305 * src/mathed/math_inset.C (strnew): ditto.
3306 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3307 (IMetrics): cxp set but never used; removed.
3308 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3309 that the variable in question has been removed also!
3312 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3313 using the Buffer * passed to Latex(), using the BufferView * passed to
3314 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3316 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3317 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3319 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3320 * src/buffer.C (readInset): used new InsetBibtex c-tor
3321 * (getBibkeyList): used new InsetBibtex::getKeys
3323 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3326 * lib/build-listerrors
3328 * src/exporter.C: Add literate programming support to the export code
3331 * src/lyx_cb.C: Remove old literate code.
3333 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3336 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3337 * src/converter.C (View, Convert): Use QuoteName.
3339 * src/insets/figinset.C (Preview): Use Formats::View.
3341 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3343 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3345 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3346 the top of the function, because compaq cxx complains that the
3347 "goto exit_with_message" when the function is disabled bypasses
3349 (MenuNew): try a better fix for the generation of new file names.
3350 This time, I used AddName() instead of AddPath(), hoping Juergen
3353 2000-10-03 Allan Rae <rae@lyx.org>
3355 * src/frontends/xforms/forms/form_preferences.fd:
3356 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3357 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3358 "Look and Feel"->"General" but will need to be split up further into
3359 general output and general input tabs. Current plan is for four outer
3360 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3361 stuff; "Inputs" for input and import configuration; "Outputs" for
3362 output and export configuration; and one more whatever is left over
3363 called "General". The leftovers at present look like being which
3364 viewers to use, spellchecker, language support and might be better
3365 named "Support". I've put "Paths" in "Inputs" for the moment as this
3366 seems reasonable for now at least.
3367 One problem remains: X error kills LyX when you close Preferences.
3369 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3371 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3372 qualifier from form()
3373 * src/frontends/xforms/FormCitation.[Ch]:
3374 * src/frontends/xforms/FormCopyright.[Ch]:
3375 * src/frontends/xforms/FormDocument.[Ch]:
3376 * src/frontends/xforms/FormError.[Ch]:
3377 * src/frontends/xforms/FormIndex.[Ch]:
3378 * src/frontends/xforms/FormPreferences.[Ch]:
3379 * src/frontends/xforms/FormPrint.[Ch]:
3380 * src/frontends/xforms/FormRef.[Ch]:
3381 * src/frontends/xforms/FormToc.[Ch]:
3382 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3384 * src/frontends/xforms/FormCitation.[Ch]:
3385 * src/frontends/xforms/FormIndex.[Ch]:
3386 * src/frontends/xforms/FormRef.[Ch]:
3387 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3388 with Allan's naming policy
3390 * src/frontends/xforms/FormCitation.C: some static casts to remove
3393 2000-10-02 Juergen Vigna <jug@sad.it>
3395 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3396 now you can type or do stuff inside the table-cell also when in dummy
3397 position, fixed visible cursor.
3399 * src/insets/insettext.C (Edit): fixing cursor-view position.
3401 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3402 be used for equal functions in lyxfunc and insettext.
3404 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3406 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3408 * src/frontends/gnome/FormCitation.h:
3409 * src/frontends/gnome/FormCopyright.h:
3410 * src/frontends/gnome/FormIndex.h:
3411 * src/frontends/gnome/FormPrint.h:
3412 * src/frontends/gnome/FormToc.h:
3413 * src/frontends/gnome/FormUrl.h:
3414 * src/frontends/kde/FormCitation.h:
3415 * src/frontends/kde/FormCopyright.h:
3416 * src/frontends/kde/FormIndex.h:
3417 * src/frontends/kde/FormRef.h:
3418 * src/frontends/kde/FormToc.h:
3419 * src/frontends/kde/FormUrl.h: fix remaining users of
3422 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3424 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3425 from depth argument.
3426 (DocBookHandleCaption): ditto.
3427 (DocBookHandleFootnote): ditto.
3428 (SimpleDocBookOnePar): ditto.
3430 * src/frontends/xforms/FormDocument.h (form): remove extra
3431 FormDocument:: qualifier.
3433 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3435 * sigc++/handle.h: ditto.
3437 * src/lyx_gui_misc.C: add "using" directive.
3439 * src/cheaders/cstddef: new file, needed by the boost library (for
3442 2000-10-02 Juergen Vigna <jug@sad.it>
3444 * src/insets/insettext.C (SetFont): better support.
3446 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3448 * src/screen.C (DrawOneRow): some uint refixes!
3450 2000-10-02 Allan Rae <rae@lyx.org>
3452 * boost/.cvsignore: ignore Makefile as well
3454 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3455 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3457 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3458 Left this one out by accident.
3460 * src/frontends/xforms/FormBase.h (restore): default to calling
3461 update() since that will restore the original/currently-applied values.
3462 Any input() triggered error messages will require the derived classes
3463 to redefine restore().
3465 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3466 avoid a segfault. combo_doc_class is the main concern.
3468 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3470 * Simplify build-listerrors in view of GUI-less export ability!
3472 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3474 * src/lyx_main.C (easyParse): Disable gui when exporting
3476 * src/insets/figinset.C:
3479 * src/lyx_gui_misc.C
3480 * src/tabular.C: Changes to allow no-gui.
3482 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3484 * src/support/utility.hpp: removed file
3485 * src/support/block.h: removed file
3487 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3490 * src/mathed/formula.C: add support/lyxlib.h
3491 * src/mathed/formulamacro.C: ditto
3493 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3494 * src/lyxparagraph.h: ditto
3496 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3497 * src/frontends/Makefile.am (INCLUDES): ditto
3498 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3499 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3500 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3501 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3502 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3503 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3505 * src/BufferView.h: use boost/utility.hpp
3506 * src/LColor.h: ditto
3507 * src/LaTeX.h: ditto
3508 * src/LyXAction.h: ditto
3509 * src/LyXView.h: ditto
3510 * src/bufferlist.h: ditto
3511 * src/lastfiles.h: ditto
3512 * src/layout.h: ditto
3513 * src/lyx_gui.h: ditto
3514 * src/lyx_main.h: ditto
3515 * src/lyxlex.h: ditto
3516 * src/lyxrc.h: ditto
3517 * src/frontends/ButtonPolicies.h: ditto
3518 * src/frontends/Dialogs.h: ditto
3519 * src/frontends/xforms/FormBase.h: ditto
3520 * src/frontends/xforms/FormGraphics.h: ditto
3521 * src/frontends/xforms/FormParagraph.h: ditto
3522 * src/frontends/xforms/FormTabular.h: ditto
3523 * src/graphics/GraphicsCache.h: ditto
3524 * src/graphics/Renderer.h: ditto
3525 * src/insets/ExternalTemplate.h: ditto
3526 * src/insets/insetcommand.h: ditto
3527 * src/support/path.h: ditto
3529 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3530 and introduce clause for 2.97.
3532 * boost/libs/README: new file
3534 * boost/boost/utility.hpp: new file
3536 * boost/boost/config.hpp: new file
3538 * boost/boost/array.hpp: new file
3540 * boost/Makefile.am: new file
3542 * boost/.cvsignore: new file
3544 * configure.in (AC_OUTPUT): add boost/Makefile
3546 * Makefile.am (SUBDIRS): add boost
3548 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3550 * src/support/lstrings.C (suffixIs): Fixed.
3552 2000-10-01 Allan Rae <rae@lyx.org>
3554 * src/PrinterParams.h: moved things around to avoid the "can't
3555 inline call" warning.
3557 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3558 into doc++ documentation.
3560 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3562 * src/frontends/xforms/FormRef.C: make use of button controller
3563 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3564 cleaned up button controller usage.
3565 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3566 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3567 use the button controller
3569 * src/frontends/xforms/forms/*.fd: and associated generated files
3570 updated to reflect changes to FormBase. Some other FormXxxx files
3571 also got minor updates to reflect changes to FormBase.
3573 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3574 (hide): made virtual.
3575 (input): return a bool. true == valid input
3576 (RestoreCB, restore): new
3577 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3578 Changes to allow derived dialogs to use a ButtonController and
3579 make sense when doing so: OK button calls ok() and so on.
3581 * src/frontends/xforms/ButtonController.h (class ButtonController):
3582 Switch from template implementation to taking Policy parameter.
3583 Allows FormBase to provide a ButtonController for any dialog.
3585 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3586 Probably should rename connect and disconnect.
3587 (apply): use the radio button groups
3588 (form): needed by FormBase
3589 (build): setup the radio button groups
3591 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3593 * several files: type changes to reduce the number of warnings and
3594 to unify type hangling a bit. Still much to do.
3596 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3598 * lib/images/*: rename a bunch of icons to match Dekel converter
3601 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3604 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3606 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3608 * sigc++/handle.h: ditto for class Handle.
3610 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3612 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3614 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3616 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3617 removal of the "default" language.
3619 * src/combox.h (getline): Check that sel > 0
3621 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3623 * lib/examples/docbook_example.lyx
3624 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3626 * lib/layouts/docbook-book.layout: new docbook book layout.
3628 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3630 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3632 * src/insets/figinset.C (DocBook):fixed small typo.
3634 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3636 * src/insets/insetinclude.h: string include_label doesn't need to be
3639 2000-09-29 Allan Rae <rae@lyx.org>
3641 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3642 Allow derived type to control connection and disconnection from signals
3643 of its choice if desired.
3645 2000-09-28 Juergen Vigna <jug@sad.it>
3647 * src/insets/insettabular.C (update): fixed cursor setting when
3648 the_locking_inset changed.
3649 (draw): made this a bit cleaner.
3650 (InsetButtonPress): fixed!
3652 * various files: added LyXText Parameter to fitCursor call.
3654 * src/BufferView.C (fitCursor): added LyXText parameter.
3656 * src/insets/insettabular.C (draw): small draw fix.
3658 * src/tabular.C: right setting of left/right celllines.
3660 * src/tabular.[Ch]: fixed various types in funcions and structures.
3661 * src/insets/insettabular.C: ditto
3662 * src/frontends/xforms/FormTabular.C: ditto
3664 2000-09-28 Allan Rae <rae@lyx.org>
3666 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3667 that the #ifdef's had been applied to part of what should have been
3668 a complete condition. It's possible there are other tests that
3669 were specific to tables that are also wrong now that InsetTabular is
3670 being used. Now we need to fix the output of '\n' after a table in a
3671 float for the same reason as the original condition:
3672 "don't insert this if we would be adding it before or after a table
3673 in a float. This little trick is needed in order to allow use of
3674 tables in \subfigures or \subtables."
3675 Juergen can you check this?
3677 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3679 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3680 output to the ostream.
3682 * several files: fixed types based on warnings from cxx
3684 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3686 * src/frontends/kde/Makefile.am: fix rule for
3687 formindexdialogdata_moc.C
3689 * src/.cvsignore: add ext_l10n.h to ignore
3691 * acconfig.h: stop messing with __STRICT_ANSI__
3692 * config/gnome.m4: remove option to set -ansi
3693 * config/kde.m4: remove option to set -ansi
3694 * config/lyxinclude.m4: don't set -ansi
3696 2000-09-27 Juergen Vigna <jug@sad.it>
3698 * various files: remove "default" language check.
3700 * src/insets/insetquotes.C: removed use of current_view.
3702 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3703 the one should have red ears by now!
3705 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3706 in more then one paragraph. Fixed cursor-movement/selection.
3708 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3709 paragraphs inside a text inset.
3711 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3712 text-inset if this owner is an inset.
3714 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3716 * src/Bullet.h: changed type of font, character and size to int
3718 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3720 * src/insets/inseturl.[Ch]:
3721 * src/insets/insetref.[Ch]:
3722 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3724 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3726 * src/buffer.C (readFile): block-if statement rearranged to minimise
3727 bloat. Patch does not reverse Jean-Marc's change ;-)
3729 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3730 Class rewritten to store pointers to hide/update signals directly,
3731 rather than Dialogs *. Also defined an enum to ease use. All xforms
3732 forms can now be derived from this class.
3734 * src/frontends/xforms/FormCommand.[Ch]
3735 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3737 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3740 * src/frontends/xforms/forms/form_citation.fd
3741 * src/frontends/xforms/forms/form_copyright.fd
3742 * src/frontends/xforms/forms/form_error.fd
3743 * src/frontends/xforms/forms/form_index.fd
3744 * src/frontends/xforms/forms/form_ref.fd
3745 * src/frontends/xforms/forms/form_toc.fd
3746 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3748 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3750 * src/insets/insetfoot.C: removed redundent using directive.
3752 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3754 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3755 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3757 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3758 created in the constructors in different groups. Then set() just
3759 have to show the groups as needed. This fixes the redraw problems
3760 (and is how the old menu code worked).
3762 * src/support/lyxlib.h: declare the methods as static when we do
3763 not have namespaces.
3765 2000-09-26 Juergen Vigna <jug@sad.it>
3767 * src/buffer.C (asciiParagraph): new function.
3768 (writeFileAscii): new function with parameter ostream.
3769 (writeFileAscii): use now asciiParagraph.
3771 * various inset files: added the linelen parameter to the Ascii-func.
3773 * src/tabular.C (Write): fixed error in writing file introduced by
3774 the last changes from Lars.
3776 * lib/bind/menus.bind: removed not supported functions.
3778 * src/insets/insettext.C (Ascii): implemented this function.
3780 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3782 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3783 (Write): use of the write_attribute functions.
3785 * src/bufferlist.C (close): fixed reasking question!
3787 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3789 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3790 new files use the everwhere possible.
3793 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3794 src/log_form.C src/lyx.C:
3797 * src/buffer.C (runLaTeX): remove func
3799 * src/PaperLayout.C: removed file
3800 * src/ParagraphExtra.C: likewise
3801 * src/bullet_forms.C: likewise
3802 * src/bullet_forms.h: likewise
3803 * src/bullet_forms_cb.C: likewise
3805 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3806 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3809 * several files: remove all traces of the old fd_form_paragraph,
3810 and functions belonging to that.
3812 * several files: remove all traces of the old fd_form_document,
3813 and functions belonging to that.
3815 * several files: constify local variables were possible.
3817 * several files: remove all code that was dead when NEW_EXPORT was
3820 * several files: removed string::c_str in as many places as
3823 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3824 (e): be a bit more outspoken when patching
3825 (updatesrc): only move files if changed.
3827 * forms/layout_forms.h.patch: regenerated
3829 * forms/layout_forms.fd: remove form_document and form_paragraph
3830 and form_quotes and form_paper and form_table_options and
3831 form_paragraph_extra
3833 * forms/form1.fd: remove form_table
3835 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3836 the fdui->... rewrite. Update some comments to xforms 0.88
3838 * forms/bullet_forms.C.patch: removed file
3839 * forms/bullet_forms.fd: likewise
3840 * forms/bullet_forms.h.patch: likewise
3842 * development/Code_rules/Rules: added a section on switch
3843 statements. Updated some comment to xforms 0.88.
3845 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3847 * src/buffer.C (readFile): make sure that the whole version number
3848 is read after \lyxformat (even when it contains a comma)
3850 * lib/ui/default.ui: change shortcut of math menu to M-a.
3852 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3854 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3857 * src/LyXView.C (updateWindowTitle): show the full files name in
3858 window title, limited to 30 characters.
3860 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3861 When a number of characters has been given, we should not assume
3862 that the string is 0-terminated.
3864 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3865 calls (fixes some memory leaks)
3867 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3868 trans member on exit.
3870 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3872 * src/converter.C (GetReachable): fix typo.
3874 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3875 understand ',' instead of '.'.
3876 (GetInteger): rewrite to use strToInt().
3878 2000-09-26 Juergen Vigna <jug@sad.it>
3880 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3881 better visibility and error-message on wrong VSpace input.
3883 * src/language.C (initL): added english again.
3885 2000-09-25 Juergen Vigna <jug@sad.it>
3887 * src/frontends/kde/Dialogs.C (Dialogs):
3888 * src/frontends/gnome/Dialogs.C (Dialogs):
3889 * src/frontends/kde/Makefile.am:
3890 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3892 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3894 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3896 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3898 * src/frontends/xforms/FormParagraph.C:
3899 * src/frontends/xforms/FormParagraph.h:
3900 * src/frontends/xforms/form_paragraph.C:
3901 * src/frontends/xforms/form_paragraph.h:
3902 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3905 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3907 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3908 Paragraph-Data after use.
3910 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3911 non breakable paragraphs.
3913 2000-09-25 Garst R. Reese <reese@isn.net>
3915 * src/language.C (initL): added missing language_country codes.
3917 2000-09-25 Juergen Vigna <jug@sad.it>
3919 * src/insets/insettext.C (InsetText):
3920 (deleteLyXText): remove the not released LyXText structure!
3922 2000-09-24 Marko Vendelin <markov@ioc.ee>
3924 * src/frontends/gnome/mainapp.C
3925 * src/frontends/gnome/mainapp.h: added support for keyboard
3928 * src/frontends/gnome/FormCitation.C
3929 * src/frontends/gnome/FormCitation.h
3930 * src/frontends/gnome/Makefile.am
3931 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3932 FormCitation to use "action area" in mainapp window
3934 * src/frontends/gnome/Menubar_pimpl.C
3935 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3938 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3940 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3941 width/descent/ascent values if name is empty.
3942 (mathed_string_height): Use std::max.
3944 2000-09-25 Allan Rae <rae@lyx.org>
3946 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3947 segfault. This will be completely redesigned soon.
3949 * sigc++: updated libsigc++. Fixes struct timespec bug.
3951 * development/tools/makeLyXsigc.sh: .cvsignore addition
3953 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3955 * several files: removed almost all traces of the old table
3958 * src/TableLayout.C: removed file
3960 2000-09-22 Juergen Vigna <jug@sad.it>
3962 * src/frontends/kde/Dialogs.C: added credits forms.
3964 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3966 * src/frontends/gnome/Dialogs.C: added some forms.
3968 * src/spellchecker.C (init_spell_checker): set language in pspell code
3969 (RunSpellChecker): some modifications for setting language string.
3971 * src/language.[Ch]: added language_country code.
3973 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3975 * src/frontends/Dialogs.h: added new signal showError.
3976 Rearranged existing signals in some sort of alphabetical order.
3978 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3979 FormError.[Ch], form_error.[Ch]
3980 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3981 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3983 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3984 dialogs. I think that this can be used as the base to all these
3987 * src/frontends/xforms/FormError.[Ch]
3988 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3989 implementation of InsetError dialog.
3991 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3993 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3994 * src/frontends/kde/Makefile.am: ditto
3996 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3998 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3999 macrobf. This fixes a bug of invisible text.
4001 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4003 * lib/doc/LaTeXConfig.lyx.in: updated.
4005 * src/language.C (initL): remove language "francais" and change a
4006 bit the names of the two other french variations.
4008 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
4009 string that may not be 0-terminated.
4011 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4013 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
4015 2000-09-20 Marko Vendelin <markov@ioc.ee>
4017 * src/frontends/gnome/FormCitation.C
4018 * src/frontends/gnome/FormIndex.C
4019 * src/frontends/gnome/FormToc.C
4020 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
4021 the variable initialization to shut up the warnings
4023 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4025 * src/table.[Ch]: deleted files
4027 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
4030 2000-09-18 Juergen Vigna <jug@sad.it>
4032 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
4033 problems with selection. Inserted new LFUN_PASTESELECTION.
4034 (InsetButtonPress): inserted handling of middle mouse-button paste.
4036 * src/spellchecker.C: changed word to word.c_str().
4038 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
4040 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
4041 included in the ``make dist'' tarball.
4043 2000-09-15 Juergen Vigna <jug@sad.it>
4045 * src/CutAndPaste.C (cutSelection): small fix return the right
4046 end position after cut inside one paragraph only.
4048 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
4049 we are locked as otherwise we don't have a valid cursor position!
4051 * src/insets/figinset.C (draw): small bugfix but why is this needed???
4053 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
4055 * src/frontends/kde/FormRef.C: added using directive.
4056 * src/frontends/kde/FormToc.C: ditto
4058 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
4060 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
4062 2000-09-19 Marko Vendelin <markov@ioc.ee>
4064 * src/frontends/gnome/Menubar_pimpl.C
4065 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
4066 Toc, ViewFormats, UpdateFormats, and ExportFormats.
4068 * src/frontends/gnome/mainapp.C
4069 * src/frontends/gnome/mainapp.h: support for menu update used
4072 * src/frontends/gnome/mainapp.C
4073 * src/frontends/gnome/mainapp.h: support for "action" area in the
4074 main window. This area is used by small simple dialogs, such as
4077 * src/frontends/gnome/FormIndex.C
4078 * src/frontends/gnome/FormIndex.h
4079 * src/frontends/gnome/FormUrl.C
4080 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4083 * src/frontends/gnome/FormCitation.C
4084 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4085 action area. Only "Insert new citation" is implemented.
4087 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4089 * src/buffer.C (Dispatch): fix call to Dispatch
4090 * src/insets/insetref.C (Edit): likewise
4091 * src/insets/insetparent.C (Edit): likewise
4092 * src/insets/insetinclude.C (include_cb): likewise
4093 * src/frontends/xforms/FormUrl.C (apply): likewise
4094 * src/frontends/xforms/FormToc.C (apply): likewise
4095 * src/frontends/xforms/FormRef.C (apply): likewise
4096 * src/frontends/xforms/FormIndex.C (apply): likewise
4097 * src/frontends/xforms/FormCitation.C (apply): likewise
4098 * src/lyxserver.C (callback): likewise
4099 * src/lyxfunc.C (processKeySym): likewise
4100 (Dispatch): likewise
4101 (Dispatch): likewise
4102 * src/lyx_cb.C (LayoutsCB): likewise
4104 * Makefile.am (sourcedoc): small change
4106 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4108 * src/main.C (main): Don't make an empty GUIRunTime object. all
4109 methods are static. constify a bit remove unneded using + headers.
4111 * src/tabular.C: some more const to local vars move some loop vars
4113 * src/spellchecker.C: added some c_str after some word for pspell
4115 * src/frontends/GUIRunTime.h: add new static method setDefaults
4116 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4117 * src/frontends/kde/GUIRunTime.C (setDefaults):
4118 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4120 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4121 with strnew in arg, use correct emptystring when calling SetName.
4123 * several files: remove all commented code with relation to
4124 HAVE_SSTREAM beeing false. We now only support stringstream and
4127 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4129 * src/lyxfunc.C: construct correctly the automatic new file
4132 * src/text2.C (IsStringInText): change type of variable i to shut
4135 * src/support/sstream.h: do not use namespaces if the compiler
4136 does not support them.
4138 2000-09-15 Marko Vendelin <markov@ioc.ee>
4139 * src/frontends/gnome/FormCitation.C
4140 * src/frontends/gnome/FormCitation.h
4141 * src/frontends/gnome/diainsertcitation_interface.c
4142 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4143 regexp support to FormCitation [Gnome].
4145 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4148 * configure.in: remove unused KDE/GTKGUI define
4150 * src/frontends/kde/FormRef.C
4151 * src/frontends/kde/FormRef.h
4152 * src/frontends/kde/formrefdialog.C
4153 * src/frontends/kde/formrefdialog.h: double click will
4154 go to reference, now it is possible to change a cross-ref
4157 * src/frontends/kde/FormToc.C
4158 * src/frontends/kde/FormToc.h
4159 * src/frontends/kde/formtocdialog.C
4160 * src/frontends/kde/formtocdialog.h: add a depth
4163 * src/frontends/kde/Makefile.am: add QtLyXView.h
4166 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4168 * src/frontends/kde/FormCitation.h: added some using directives.
4170 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4172 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4175 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4178 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4180 * src/buffer.C (pop_tag): revert for the second time a change by
4181 Lars, who seems to really hate having non-local loop variables :)
4183 * src/Lsstream.h: add "using" statements.
4185 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4186 * src/buffer.C (writeFile): ditto
4188 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4190 * src/buffer.C (writeFile): try to fix the locale modified format
4191 number to always be as we want it.
4193 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4194 in XForms 0.89. C-space is now working again.
4196 * src/Lsstream.h src/support/sstream.h: new files.
4198 * also commented out all cases where strstream were used.
4200 * src/Bullet.h (c_str): remove method.
4202 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4204 * a lot of files: get rid of "char const *" and "char *" is as
4205 many places as possible. We only want to use them in interaction
4206 with system of other libraries, not inside lyx.
4208 * a lot of files: return const object is not of pod type. This
4209 helps ensure that temporary objects is not modified. And fits well
4210 with "programming by contract".
4212 * configure.in: check for the locale header too
4214 * Makefile.am (sourcedoc): new tag for generation of doc++
4217 2000-09-14 Juergen Vigna <jug@sad.it>
4219 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4220 callback to check which combo called it and do the right action.
4222 * src/combox.C (combo_cb): added combo * to the callbacks.
4223 (Hide): moved call of callback after Ungrab of the pointer.
4225 * src/intl.h: removed LCombo2 function.
4227 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4228 function as this can now be handled in one function.
4230 * src/combox.h: added Combox * to callback prototype.
4232 * src/frontends/xforms/Toolbar_pimpl.C:
4233 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4235 2000-09-14 Garst Reese <reese@isn.net>
4237 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4238 moved usepackage{xxx}'s to beginning of file. Changed left margin
4239 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4240 underlining from title. Thanks to John Culleton for useful suggestions.
4242 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4244 * src/lyxlex_pimpl.C (setFile): change error message to debug
4247 2000-09-13 Juergen Vigna <jug@sad.it>
4249 * src/frontends/xforms/FormDocument.C: implemented choice_class
4250 as combox and give callback to combo_language so OK/Apply is activated
4253 * src/bufferlist.C (newFile): small fix so already named files
4254 (via an open call) are not requested to be named again on the
4257 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4259 * src/frontends/kde/Makefile.am
4260 * src/frontends/kde/FormRef.C
4261 * src/frontends/kde/FormRef.h
4262 * src/frontends/kde/formrefdialog.C
4263 * src/frontends/kde/formrefdialog.h: implement
4266 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4268 * src/frontends/kde/formtocdialog.C
4269 * src/frontends/kde/formtocdialog.h
4270 * src/frontends/kde/FormToc.C
4271 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4273 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4275 * src/frontends/kde/FormCitation.C: fix thinko
4276 where we didn't always display the reference text
4279 * src/frontends/kde/formurldialog.C
4280 * src/frontends/kde/formurldialog.h
4281 * src/frontends/kde/FormUrl.C
4282 * src/frontends/kde/FormUrl.h: minor cleanups
4284 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4286 * src/frontends/kde/Makefile.am
4287 * src/frontends/kde/FormToc.C
4288 * src/frontends/kde/FormToc.h
4289 * src/frontends/kde/FormCitation.C
4290 * src/frontends/kde/FormCitation.h
4291 * src/frontends/kde/FormIndex.C
4292 * src/frontends/kde/FormIndex.h
4293 * src/frontends/kde/formtocdialog.C
4294 * src/frontends/kde/formtocdialog.h
4295 * src/frontends/kde/formcitationdialog.C
4296 * src/frontends/kde/formcitationdialog.h
4297 * src/frontends/kde/formindexdialog.C
4298 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4300 2000-09-12 Juergen Vigna <jug@sad.it>
4302 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4305 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4307 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4310 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4312 * src/converter.C (Add, Convert): Added support for converter flags:
4313 needaux, resultdir, resultfile.
4314 (Convert): Added new parameter view_file.
4315 (dvips_options): Fixed letter paper option.
4317 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4318 (Export, GetExportableFormats, GetViewableFormats): Added support
4321 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4323 (easyParse): Fixed to work with new export code.
4325 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4328 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4330 * lib/bind/*.bind: Replaced
4331 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4332 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4334 2000-09-11 Juergen Vigna <jug@sad.it>
4336 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4338 * src/main.C (main): now GUII defines global guiruntime!
4340 * src/frontends/gnome/GUIRunTime.C (initApplication):
4341 * src/frontends/kde/GUIRunTime.C (initApplication):
4342 * src/frontends/xforms/GUIRunTime.C (initApplication):
4343 * src/frontends/GUIRunTime.h: added new function initApplication.
4345 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4347 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4349 2000-09-08 Juergen Vigna <jug@sad.it>
4351 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4352 we have already "Reset".
4354 * src/language.C (initL): inserted "default" language and made this
4355 THE default language (and not american!)
4357 * src/paragraph.C: inserted handling of "default" language!
4359 * src/lyxfont.C: ditto
4363 * src/paragraph.C: output the \\par only if we have a following
4364 paragraph otherwise it's not needed.
4366 2000-09-05 Juergen Vigna <jug@sad.it>
4368 * config/pspell.m4: added entry to lyx-flags
4370 * src/spellchecker.C: modified version from Kevin for using pspell
4372 2000-09-01 Marko Vendelin <markov@ioc.ee>
4373 * src/frontends/gnome/Makefile.am
4374 * src/frontends/gnome/FormCitation.C
4375 * src/frontends/gnome/FormCitation.h
4376 * src/frontends/gnome/diainsertcitation_callbacks.c
4377 * src/frontends/gnome/diainsertcitation_callbacks.h
4378 * src/frontends/gnome/diainsertcitation_interface.c
4379 * src/frontends/gnome/diainsertcitation_interface.h
4380 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4381 dialog for Gnome frontend
4383 * src/main.C: Gnome libraries require keeping application name
4384 and its version as strings
4386 * src/frontends/gnome/mainapp.C: Change the name of the main window
4387 from GnomeLyX to PACKAGE
4389 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4391 * src/frontends/Liason.C: add "using: declaration.
4393 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4395 * src/mathed/math_macro.C (Metrics): Set the size of the template
4397 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4399 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4401 * src/converter.C (add_options): New function.
4402 (SetViewer): Change $$FName into '$$FName'.
4403 (View): Add options when running xdvi
4404 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4405 (Convert): The 3rd parameter is now the desired filename. Converts
4406 calls to lyx::rename if necessary.
4407 Add options when running dvips.
4408 (dvi_papersize,dvips_options): New methods.
4410 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4412 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4413 using a call to Converter::dvips_options.
4414 Fixed to work with nex export code.
4416 * src/support/copy.C
4417 * src/support/rename.C: New files
4419 * src/support/syscall.h
4420 * src/support/syscall.C: Added Starttype SystemDontWait.
4422 * lib/ui/default.ui: Changed to work with new export code
4424 * lib/configure.m4: Changed to work with new export code
4426 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4428 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4430 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4431 so that code compiles with DEC cxx.
4433 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4434 to work correctly! Also now supports the additional elements
4437 2000-09-01 Allan Rae <rae@lyx.org>
4439 * src/frontends/ButtonPolicies.C: renamed all the references to
4440 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4442 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4443 since it's a const not a type.
4445 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4447 2000-08-31 Juergen Vigna <jug@sad.it>
4449 * src/insets/figinset.C: Various changes to look if the filename has
4450 an extension and if not add it for inline previewing.
4452 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4454 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4455 make buttonStatus and isReadOnly be const methods. (also reflect
4456 this in derived classes.)
4458 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4459 (nextState): change to be static inline, pass the StateMachine as
4461 (PreferencesPolicy): remove casts
4462 (OkCancelPolicy): remvoe casts
4463 (OkCancelReadOnlyPolicy): remove casts
4464 (NoRepeatedApplyReadOnlyPolicy): remove casts
4465 (OkApplyCancelReadOnlyPolicy): remove casts
4466 (OkApplyCancelPolicy): remove casts
4467 (NoRepeatedApplyPolicy): remove casts
4469 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4471 * src/converter.C: added some using directives
4473 * src/frontends/ButtonPolicies.C: changes to overcome
4474 "need lvalue" error with DEC c++
4476 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4477 to WMHideCB for DEC c++
4479 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4481 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4482 to BulletBMTableCB for DEC c++
4484 2000-08-31 Allan Rae <rae@lyx.org>
4486 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4487 character dialog separately from old document dialogs combo_language.
4490 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4492 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4493 Removed LFUN_REF_CREATE.
4495 * src/MenuBackend.C: Added new tags: toc and references
4497 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4498 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4500 (add_toc, add_references): New methods.
4501 (create_submenu): Handle correctly the case when there is a
4502 seperator after optional menu items.
4504 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4505 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4506 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4508 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4510 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4512 * src/converter.[Ch]: New file for converting between different
4515 * src/export.[Ch]: New file for exporting a LyX file to different
4518 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4519 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4520 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4521 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4522 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4523 RunDocBook, MenuExport.
4525 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4526 Exporter::Preview methods if NEW_EXPORT is defined.
4528 * src/buffer.C (Dispatch): Use Exporter::Export.
4530 * src/lyxrc.C: Added new tags: \converter and \viewer.
4533 * src/LyXAction.C: Define new lyx-function: buffer-update.
4534 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4535 when NEW_EXPORT is defined.
4537 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4539 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4541 * lib/ui/default.ui: Added submenus "view" and "update" to the
4544 * src/filetools.C (GetExtension): New function.
4546 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4548 2000-08-29 Allan Rae <rae@lyx.org>
4550 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4552 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4553 (EnableDocumentLayout): removed
4554 (DisableDocumentLayout): removed
4555 (build): make use of ButtonController's read-only handling to
4556 de/activate various objects. Replaces both of the above functions.
4558 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4559 (readOnly): was read_only
4560 (refresh): fixed dumb mistakes with read_only_ handling
4562 * src/frontends/xforms/forms/form_document.fd:
4563 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4564 tabbed dialogs so the tabs look more like tabs and so its easier to
4565 work out which is the current tab.
4567 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4568 segfault with form_table
4570 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4572 2000-08-28 Juergen Vigna <jug@sad.it>
4574 * acconfig.h: added USE_PSPELL.
4576 * src/config.h.in: added USE_PSPELL.
4578 * autogen.sh: added pspell.m4
4580 * config/pspell.m4: new file.
4582 * src/spellchecker.C: implemented support for pspell libary.
4584 2000-08-25 Juergen Vigna <jug@sad.it>
4586 * src/LyXAction.C (init): renamed LFUN_TABLE to
4587 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4589 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4591 * src/lyxscreen.h: add force_clear variable and fuction to force
4592 a clear area when redrawing in LyXText.
4594 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4596 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4598 * some whitespace and comment changes.
4600 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4602 * src/buffer.C: up te LYX_FORMAT to 2.17
4604 2000-08-23 Juergen Vigna <jug@sad.it>
4606 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4609 * src/insets/insettabular.C (pasteSelection): delete the insets
4610 LyXText as it is not valid anymore.
4611 (copySelection): new function.
4612 (pasteSelection): new function.
4613 (cutSelection): new function.
4614 (LocalDispatch): implemented cut/copy/paste of cell selections.
4616 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4617 don't have a LyXText.
4619 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4621 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4624 2000-08-22 Juergen Vigna <jug@sad.it>
4626 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4627 ifdef form_table out if NEW_TABULAR.
4629 2000-08-21 Juergen Vigna <jug@sad.it>
4631 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4632 (draw): fixed draw position so that the cursor is positioned in the
4634 (InsetMotionNotify): hide/show cursor so the position is updated.
4635 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4636 using cellstart() function where it should be used.
4638 * src/insets/insettext.C (draw): ditto.
4640 * src/tabular.C: fixed initialization of some missing variables and
4641 made BoxType into an enum.
4643 2000-08-22 Marko Vendelin <markov@ioc.ee>
4644 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4645 stock menu item using action numerical value, not its string
4649 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4651 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4652 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4654 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4656 * src/frontends/xforms/GUIRunTime.C: new file
4658 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4659 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4661 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4663 * src/frontends/kde/GUIRunTime.C: new file
4665 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4666 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4668 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4670 * src/frontends/gnome/GUIRunTime.C: new file
4672 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4675 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4676 small change to documetentation.
4678 * src/frontends/GUIRunTime.C: removed file
4680 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4682 * src/lyxparagraph.h: enable NEW_TABULAR as default
4684 * src/lyxfunc.C (processKeySym): remove some commented code
4686 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4687 NEW_TABULAR around the fd_form_table_options.
4689 * src/lyx_gui.C (runTime): call the static member function as
4690 GUIRunTime::runTime().
4692 2000-08-21 Allan Rae <rae@lyx.org>
4694 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4697 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4699 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4701 2000-08-21 Allan Rae <rae@lyx.org>
4703 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4704 keep Garst happy ;-)
4705 * src/frontends/xforms/FormPreferences.C (build): use setOK
4706 * src/frontends/xforms/FormDocument.C (build): use setOK
4707 (FormDocument): use the appropriate policy.
4709 2000-08-21 Allan Rae <rae@lyx.org>
4711 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4712 automatic [de]activation of arbitrary objects when in a read-only state.
4714 * src/frontends/ButtonPolicies.h: More documentation
4715 (isReadOnly): added to support the above.
4717 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4719 2000-08-18 Juergen Vigna <jug@sad.it>
4721 * src/insets/insettabular.C (getStatus): changed to return func_status.
4723 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4724 display toggle menu entries if they are.
4726 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4727 new document layout now.
4729 * src/lyxfunc.C: ditto
4731 * src/lyx_gui_misc.C: ditto
4733 * src/lyx_gui.C: ditto
4735 * lib/ui/default.ui: removed paper and quotes layout as they are now
4736 all in the document layout tabbed folder.
4738 * src/frontends/xforms/forms/form_document.fd: added Restore
4739 button and callbacks for all inputs for Allan's ButtonPolicy.
4741 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4742 (CheckChoiceClass): added missing params setting on class change.
4743 (UpdateLayoutDocument): added for updating the layout on params.
4744 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4745 (FormDocument): Implemented Allan's ButtonPolicy with the
4748 2000-08-17 Allan Rae <rae@lyx.org>
4750 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4751 so we can at least see the credits again.
4753 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4754 controller calls for the appropriate callbacks. Note that since Ok
4755 calls apply followed by cancel, and apply isn't a valid input for the
4756 APPLIED state, the bc_ calls have to be made in the static callback not
4757 within each of the real callbacks.
4759 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4760 (setOk): renamed from setOkay()
4762 2000-08-17 Juergen Vigna <jug@sad.it>
4764 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4765 in the implementation part.
4766 (composeUIInfo): don't show optional menu-items.
4768 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4770 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4772 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4773 text-state when in a text-inset.
4775 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4777 2000-08-17 Marko Vendelin <markov@ioc.ee>
4778 * src/frontends/gnome/FormIndex.C
4779 * src/frontends/gnome/FormIndex.h
4780 * src/frontends/gnome/FormToc.C
4781 * src/frontends/gnome/FormToc.h
4782 * src/frontends/gnome/dialogs
4783 * src/frontends/gnome/diatoc_callbacks.c
4784 * src/frontends/gnome/diatoc_callbacks.h
4785 * src/frontends/gnome/diainsertindex_callbacks.h
4786 * src/frontends/gnome/diainsertindex_callbacks.c
4787 * src/frontends/gnome/diainsertindex_interface.c
4788 * src/frontends/gnome/diainsertindex_interface.h
4789 * src/frontends/gnome/diatoc_interface.h
4790 * src/frontends/gnome/diatoc_interface.c
4791 * src/frontends/gnome/Makefile.am: Table of Contents and
4792 Insert Index dialogs implementation for Gnome frontend
4794 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4796 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4798 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4801 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4803 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4804 destructor. Don't definde if you don't need it
4805 (processEvents): made static, non-blocking events processing for
4807 (runTime): static method. event loop for xforms
4808 * similar as above for kde and gnome.
4810 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4811 new Pimpl is correct
4812 (runTime): new method calss the real frontends runtime func.
4814 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4816 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4818 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4820 2000-08-16 Juergen Vigna <jug@sad.it>
4822 * src/lyx_gui.C (runTime): added GUII RunTime support.
4824 * src/frontends/Makefile.am:
4825 * src/frontends/GUIRunTime.[Ch]:
4826 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4827 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4828 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4830 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4832 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4833 as this is already set in ${FRONTEND_INCLUDE} if needed.
4835 * configure.in (CPPFLAGS): setting the include dir for the frontend
4836 directory and don't set FRONTEND=xforms for now as this is executed
4839 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4841 * src/frontends/kde/Makefile.am:
4842 * src/frontends/kde/FormUrl.C:
4843 * src/frontends/kde/FormUrl.h:
4844 * src/frontends/kde/formurldialog.h:
4845 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4847 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4849 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4851 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4853 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4856 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4858 * src/WorkArea.C (work_area_handler): more work to get te
4859 FL_KEYBOARD to work with xforms 0.88 too, please test.
4861 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4863 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4865 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4868 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4870 * src/Timeout.h: remove Qt::emit hack.
4872 * several files: changes to allo doc++ compilation
4874 * src/lyxfunc.C (processKeySym): new method
4875 (processKeyEvent): comment out if FL_REVISION < 89
4877 * src/WorkArea.C: change some debugging levels.
4878 (WorkArea): set wantkey to FL_KEY_ALL
4879 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4880 clearer code and the use of compose with XForms 0.89. Change to
4881 use signals instead of calling methods in bufferview directly.
4883 * src/Painter.C: change some debugging levels.
4885 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4888 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4889 (workAreaKeyPress): new method
4891 2000-08-14 Juergen Vigna <jug@sad.it>
4893 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4895 * config/kde.m4: addes some features
4897 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4898 include missing xforms dialogs.
4900 * src/Timeout.h: a hack to be able to compile with qt/kde.
4902 * sigc++/.cvsignore: added acinclude.m4
4904 * lib/.cvsignore: added listerros
4906 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4907 xforms tree as objects are needed for other frontends.
4909 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4910 linking with not yet implemented xforms objects.
4912 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4914 2000-08-14 Baruch Even <baruch.even@writeme.com>
4916 * src/frontends/xforms/FormGraphics.h:
4917 * src/frontends/xforms/FormGraphics.C:
4918 * src/frontends/xforms/RadioButtonGroup.h:
4919 * src/frontends/xforms/RadioButtonGroup.C:
4920 * src/insets/insetgraphics.h:
4921 * src/insets/insetgraphics.C:
4922 * src/insets/insetgraphicsParams.h:
4923 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4924 instead of spaces, and various other indentation issues to make the
4925 sources more consistent.
4927 2000-08-14 Marko Vendelin <markov@ioc.ee>
4929 * src/frontends/gnome/dialogs/diaprint.glade
4930 * src/frontends/gnome/FormPrint.C
4931 * src/frontends/gnome/FormPrint.h
4932 * src/frontends/gnome/diaprint_callbacks.c
4933 * src/frontends/gnome/diaprint_callbacks.h
4934 * src/frontends/gnome/diaprint_interface.c
4935 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4938 * src/frontends/gnome/dialogs/diainserturl.glade
4939 * src/frontends/gnome/FormUrl.C
4940 * src/frontends/gnome/FormUrl.h
4941 * src/frontends/gnome/diainserturl_callbacks.c
4942 * src/frontends/gnome/diainserturl_callbacks.h
4943 * src/frontends/gnome/diainserturl_interface.c
4944 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4945 Gnome implementation
4947 * src/frontends/gnome/Dialogs.C
4948 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4949 all other dialogs. Copy all unimplemented dialogs from Xforms
4952 * src/frontends/gnome/support.c
4953 * src/frontends/gnome/support.h: support files generated by Glade
4957 * config/gnome.m4: Gnome configuration scripts
4959 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4960 configure --help message
4962 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4963 only if there are no events pendling in Gnome/Gtk. This enhances
4964 the performance of menus.
4967 2000-08-14 Allan Rae <rae@lyx.org>
4969 * lib/Makefile.am: listerrors cleaning
4971 * lib/listerrors: removed -- generated file
4972 * acinclude.m4: ditto
4973 * sigc++/acinclude.m4: ditto
4975 * src/frontends/xforms/forms/form_citation.fd:
4976 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4979 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4980 `updatesrc` and now we have a `test` target that does what `updatesrc`
4981 used to do. I didn't like having an install target that wasn't related
4984 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4985 on all except FormGraphics. This may yet happen. Followed by a major
4986 cleanup including using FL_TRANSIENT for most of the dialogs. More
4987 changes to come when the ButtonController below is introduced.
4989 * src/frontends/xforms/ButtonController.h: New file for managing up to
4990 four buttons on a dialog according to an externally defined policy.
4991 * src/frontends/xforms/Makefile.am: added above
4993 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4994 Apply and Cancel/Close buttons and everything in between and beyond.
4995 * src/frontends/Makefile.am: added above.
4997 * src/frontends/xforms/forms/form_preferences.fd:
4998 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4999 and removed variable 'status' as a result. Fixed the set_minsize thing.
5000 Use the new screen-font-update after checking screen fonts were changed
5001 Added a "Restore" button to restore the original lyxrc values while
5002 editing. This restores everything not just the last input changed.
5003 That's still a tricky one. As is the "LyX: this shouldn't happen..."
5005 * src/LyXAction.C: screen-font-update added for updating buffers after
5006 screen font settings have been changed.
5007 * src/commandtags.h: ditto
5008 * src/lyxfunc.C: ditto
5010 * forms/lyx.fd: removed screen fonts dialog.
5011 * src/lyx_gui.C: ditto
5012 * src/menus.[Ch]: ditto
5013 * src/lyx.[Ch]: ditto
5014 * src/lyx_cb.C: ditto + code from here moved to make
5015 screen-font-update. And people wonder why progress on GUII is
5016 slow. Look at how scattered this stuff was! It takes forever
5019 * forms/fdfix.sh: Fixup the spacing after commas.
5020 * forms/makefile: Remove date from generated files. Fewer clashes now.
5021 * forms/bullet_forms.C.patch: included someones handwritten changes
5023 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
5024 once I've discovered why LyXRC was made noncopyable.
5025 * src/lyx_main.C: ditto
5027 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
5029 * src/frontends/xforms/forms/fdfix.sh:
5030 * src/frontends/xforms/forms/fdfixh.sed:
5031 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
5032 * src/frontends/xforms/Form*.[hC]:
5033 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
5034 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
5035 provide a destructor for the struct FD_form_xxxx. Another version of
5036 the set_[max|min]size workaround and a few other cleanups. Actually,
5037 Angus' patch from 20000809.
5039 2000-08-13 Baruch Even <baruch.even@writeme.com>
5041 * src/insets/insetgraphics.C (Clone): Added several fields that needed
5044 2000-08-11 Juergen Vigna <jug@sad.it>
5046 * src/insets/insetgraphics.C (InsetGraphics): changing init
5047 order because of warnings.
5049 * src/frontends/xforms/forms/makefile: adding patching .C with
5052 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
5053 from .C.patch to .c.patch
5055 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
5056 order because of warning.
5058 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
5060 * src/frontends/Liason.C (setMinibuffer): new helper function
5062 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
5064 * src/lyxfunc.C (Dispatch): calling new Document-Layout
5066 * lib/ui/default.ui: commented out PaperLayout entry
5068 * src/frontends/xforms/form_document.[Ch]: new added files
5070 * src/frontends/xforms/FormDocument.[Ch]: ditto
5072 * src/frontends/xforms/forms/form_document.fd: ditto
5074 * src/frontends/xforms/forms/form_document.C.patch: ditto
5076 2000-08-10 Juergen Vigna <jug@sad.it>
5078 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
5079 (InsetGraphics): initialized cacheHandle to 0.
5080 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5082 2000-08-10 Baruch Even <baruch.even@writeme.com>
5084 * src/graphics/GraphicsCache.h:
5085 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5086 correctly as a cache.
5088 * src/graphics/GraphicsCacheItem.h:
5089 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5092 * src/graphics/GraphicsCacheItem_pimpl.h:
5093 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5096 * src/insets/insetgraphics.h:
5097 * src/insets/insetgraphics.C: Changed from using a signal notification
5098 to polling when image is not loaded.
5100 2000-08-10 Allan Rae <rae@lyx.org>
5102 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5103 that there are two functions that have to been taken out of line by
5104 hand and aren't taken care of in the script. (Just a reminder note)
5106 * sigc++/macros/*.h.m4: Updated as above.
5108 2000-08-09 Juergen Vigna <jug@sad.it>
5110 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5112 * src/insets/insettabular.C: make drawing of single cell smarter.
5114 2000-08-09 Marko Vendelin <markov@ioc.ee>
5115 * src/frontends/gnome/Menubar_pimpl.C
5116 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5117 implementation: new files
5119 * src/frontends/gnome/mainapp.C
5120 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5123 * src/main.C: create Gnome main window
5125 * src/frontends/xforms/Menubar_pimpl.h
5126 * src/frontends/Menubar.C
5127 * src/frontends/Menubar.h: added method Menubar::update that calls
5128 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5130 * src/LyXView.C: calls Menubar::update to update the state
5133 * src/frontends/gnome/Makefile.am: added new files
5135 * src/frontends/Makefile.am: added frontend compiler options
5137 2000-08-08 Juergen Vigna <jug@sad.it>
5139 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5141 * src/bufferlist.C (close):
5142 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5143 documents if exiting without saving.
5145 * src/buffer.C (save): use removeAutosaveFile()
5147 * src/support/filetools.C (removeAutosaveFile): new function.
5149 * src/lyx_cb.C (MenuWrite): returns a bool now.
5150 (MenuWriteAs): check if file could really be saved and revert to the
5152 (MenuWriteAs): removing old autosavefile if existant.
5154 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5155 before Goto toggle declaration, because of compiler warning.
5157 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5159 * src/lyxfunc.C (MenuNew): small fix.
5161 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5163 * src/bufferlist.C (newFile):
5164 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5166 * src/lyxrc.C: added new_ask_filename tag
5168 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5170 * src/lyx.fd: removed code pertaining to form_ref
5171 * src/lyx.[Ch]: ditto
5172 * src/lyx_cb.C: ditto
5173 * src/lyx_gui.C: ditto
5174 * src/lyx_gui_misc.C: ditto
5176 * src/BufferView_pimpl.C (restorePosition): update buffer only
5179 * src/commandtags.h (LFUN_REFTOGGLE): removed
5180 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5181 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5182 (LFUN_REFBACK): renamed LFUN_REF_BACK
5184 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5185 * src/menus.C: ditto
5186 * src/lyxfunc.C (Dispatch): ditto.
5187 InsertRef dialog is now GUI-independent.
5189 * src/texrow.C: added using std::endl;
5191 * src/insets/insetref.[Ch]: strip out large amounts of code.
5192 The inset is now a container and this functionality is now
5193 managed by a new FormRef dialog
5195 * src/frontends/Dialogs.h (showRef, createRef): new signals
5197 * src/frontends/xforms/FormIndex.[Ch],
5198 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5199 when setting dialog's min/max size
5200 * src/frontends/xforms/FormIndex.[Ch]: ditto
5202 * src/frontends/xforms/FormRef.[Ch],
5203 src/frontends/xforms/forms/form_ref.fd: new xforms
5204 implementation of an InsetRef dialog
5206 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5209 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5210 ios::nocreate is not part of the standard. Removed.
5212 2000-08-07 Baruch Even <baruch.even@writeme.com>
5214 * src/graphics/Renderer.h:
5215 * src/graphics/Renderer.C: Added base class for rendering of different
5216 image formats into Pixmaps.
5218 * src/graphics/XPM_Renderer.h:
5219 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5220 in a different class.
5222 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5223 easily add support for other formats.
5225 * src/insets/figinset.C: plugged a leak of an X resource.
5227 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5229 * src/CutAndPaste.[Ch]: make all metods static.
5231 * development/Code_rules/Rules: more work, added section on
5232 Exceptions, and a References section.
5234 * a lot of header files: work to make doc++ able to generate the
5235 source documentation, some workarounds of doc++ problems. Doc++ is
5236 now able to generate the documentation.
5238 2000-08-07 Juergen Vigna <jug@sad.it>
5240 * src/insets/insettabular.C (recomputeTextInsets): removed function
5242 * src/tabular.C (SetWidthOfMulticolCell):
5244 (calculate_width_of_column_NMC): fixed return value so that it really
5245 only returns true if the column-width has changed (there where
5246 problems with muliticolumn-cells in this column).
5248 2000-08-04 Juergen Vigna <jug@sad.it>
5250 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5251 also on the scrollstatus of the inset.
5252 (workAreaMotionNotify): ditto.
5254 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5256 2000-08-01 Juergen Vigna <jug@sad.it>
5258 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5260 * src/commandtags.h:
5261 * src/LyXAction.C (init):
5262 * src/insets/inset.C (LocalDispatch): added support for
5265 * src/insets/inset.C (scroll): new functions.
5267 * src/insets/insettext.C (removeNewlines): new function.
5268 (SetAutoBreakRows): removes forced newlines in the text of the
5269 paragraph if autoBreakRows is set to false.
5271 * src/tabular.C (Latex): generates a parbox around the cell contents
5274 * src/frontends/xforms/FormTabular.C (local_update): removed
5275 the radio_useparbox button.
5277 * src/tabular.C (UseParbox): new function
5279 2000-08-06 Baruch Even <baruch.even@writeme.com>
5281 * src/graphics/GraphicsCache.h:
5282 * src/graphics/GraphicsCache.C:
5283 * src/graphics/GraphicsCacheItem.h:
5284 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5287 * src/insets/insetgraphics.h:
5288 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5289 and the drawing of the inline image.
5291 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5292 loaded into the wrong position.
5294 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5297 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5299 * src/support/translator.h: move all typedefs to public section
5301 * src/support/filetools.C (MakeLatexName): return string const
5303 (TmpFileName): ditto
5304 (FileOpenSearch): ditto
5306 (LibFileSearch): ditto
5307 (i18nLibFileSearch): ditto
5310 (CreateTmpDir): ditto
5311 (CreateBufferTmpDir): ditto
5312 (CreateLyXTmpDir): ditto
5315 (MakeAbsPath): ditto
5317 (OnlyFilename): ditto
5319 (NormalizePath): ditto
5320 (CleanupPath): ditto
5321 (GetFileContents): ditto
5322 (ReplaceEnvironmentPath): ditto
5323 (MakeRelPath): ditto
5325 (ChangeExtension): ditto
5326 (MakeDisplayPath): ditto
5327 (do_popen): return cmdret const
5328 (findtexfile): return string const
5330 * src/support/DebugStream.h: add some /// to please doc++
5332 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5334 * src/texrow.C (same_rownumber): functor to use with find_if
5335 (getIdFromRow): rewritten to use find_if and to not update the
5336 positions. return true if row is found
5337 (increasePos): new method, use to update positions
5339 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5341 * src/lyxlex_pimpl.C (verifyTable): new method
5344 (GetString): return string const
5345 (pushTable): rewrite to use std::stack
5347 (setFile): better check
5350 * src/lyxlex.h: make LyXLex noncopyable
5352 * src/lyxlex.C (text): return char const * const
5353 (GetString): return string const
5354 (getLongString): return string const
5356 * src/lyx_gui_misc.C (askForText): return pair<...> const
5358 * src/lastfiles.[Ch] (operator): return string const
5360 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5361 istringstream not char const *.
5362 move token.end() out of loop.
5363 (readFile): move initializaton of token
5365 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5366 getIdFromRow is successful.
5368 * lib/bind/emacs.bind: don't include menus bind
5370 * development/Code_rules/Rules: the beginnings of making this
5371 better and covering more of the unwritten rules that we have.
5373 * development/Code_rules/Recommendations: a couple of wording
5376 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5378 * src/support/strerror.c: remove C++ comment.
5380 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5382 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5383 LFUN_INDEX_INSERT_LAST
5385 * src/texrow.C (getIdFromRow): changed from const_iterator to
5386 iterator, allowing code to compile with DEC cxx
5388 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5389 stores part of the class, as suggested by Allan. Will allow
5391 (apply): test to apply uses InsetCommandParams operator!=
5393 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5394 (apply): test to apply uses InsetCommandParams operator!=
5396 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5397 stores part of the class.
5398 (update): removed limits on min/max size.
5400 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5401 (apply): test to apply uses InsetCommandParams operator!=
5403 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5404 (Read, Write, scanCommand, getCommand): moved functionality
5405 into InsetCommandParams.
5407 (getScreenLabel): made pure virtual
5408 new InsetCommandParams operators== and !=
5410 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5411 c-tors based on InsetCommandParams. Removed others.
5412 * src/insets/insetinclude.[Ch]: ditto
5413 * src/insets/insetlabel.[Ch]: ditto
5414 * src/insets/insetparent.[Ch]: ditto
5415 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5417 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5418 insets derived from InsetCommand created using similar c-tors
5419 based on InsetCommandParams
5420 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5421 * src/menus.C (ShowRefsMenu): ditto
5422 * src/paragraph.C (Clone): ditto
5423 * src/text2.C (SetCounter): ditto
5424 * src/lyxfunc.C (Dispatch) ditto
5425 Also recreated old InsetIndex behaviour exactly. Can now
5426 index-insert at the start of a paragraph and index-insert-last
5427 without launching the pop-up.
5429 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5431 * lib/lyxrc.example: mark te pdf options as non functional.
5433 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5434 (isStrDbl): move tmpstr.end() out of loop.
5435 (strToDbl): move intialization of tmpstr
5436 (lowercase): return string const and move tmp.end() out of loop.
5437 (uppercase): return string const and move tmp.edn() out of loop.
5438 (prefixIs): add assertion
5443 (containsOnly): ditto
5444 (containsOnly): ditto
5445 (containsOnly): ditto
5446 (countChar): make last arg char not char const
5447 (token): return string const
5448 (subst): return string const, move tmp.end() out of loop.
5449 (subst): return string const, add assertion
5450 (strip): return string const
5451 (frontStrip): return string const, add assertion
5452 (frontStrip): return string const
5457 * src/support/lstrings.C: add inclde "LAssert.h"
5458 (isStrInt): move tmpstr.end() out of loop.
5460 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5461 toollist.end() out of loop.
5462 (deactivate): move toollist.end() out of loop.
5463 (update): move toollist.end() out of loop.
5464 (updateLayoutList): move tc.end() out of loop.
5465 (add): move toollist.end() out of loop.
5467 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5468 md.end() out of loop.
5470 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5472 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5475 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5476 (Erase): move insetlist.end() out of loop.
5478 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5479 ref to const string as first arg. Move initialization of some
5480 variables, whitespace changes.
5482 * src/kbmap.C (defkey): move table.end() out of loop.
5483 (kb_keymap): move table.end() out of loop.
5484 (findbinding): move table.end() out of loop.
5486 * src/MenuBackend.C (hasMenu): move end() out of loop.
5487 (getMenu): move end() out of loop.
5488 (getMenu): move menulist_.end() out of loop.
5490 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5492 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5495 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5496 (getFromLyXName): move infotab.end() out of loop.
5498 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5499 -fvtable-thunks -ffunction-sections -fdata-sections
5501 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5503 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5506 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5508 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5510 * src/frontends/xforms/FormCitation.[Ch],
5511 src/frontends/xforms/FormIndex.[Ch],
5512 src/frontends/xforms/FormToc.[Ch],
5513 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5515 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5517 * src/commandtags.h: renamed, created some flags for citation
5520 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5522 * src/lyxfunc.C (dispatch): use signals to insert index entry
5524 * src/frontends/Dialogs.h: new signal createIndex
5526 * src/frontends/xforms/FormCommand.[Ch],
5527 src/frontends/xforms/FormCitation.[Ch],
5528 src/frontends/xforms/FormToc.[Ch],
5529 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5531 * src/insets/insetindex.[Ch]: GUI-independent
5533 * src/frontends/xforms/FormIndex.[Ch],
5534 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5537 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5539 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5540 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5542 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5544 * src/insets/insetref.C (Latex): rewrite so that there is now
5545 question that a initialization is requested.
5547 * src/insets/insetcommand.h: reenable the hide signal
5549 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5551 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5552 fix handling of shortcuts (many bugs :)
5553 (add_lastfiles): ditto.
5555 * lib/ui/default.ui: fix a few shortcuts.
5557 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5559 * Makefile.am: Fix ``rpmdist'' target to return the exit
5560 status of the ``rpm'' command, instead of the last command in
5561 the chain (the ``rm lyx.xpm'' command, which always returns
5564 2000-08-02 Allan Rae <rae@lyx.org>
5566 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5567 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5568 * src/frontends/xforms/FormToc.C (FormToc): ditto
5570 * src/frontends/xforms/Makefile.am: A few forgotten files
5572 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5573 Signals-not-copyable-problem Lars' started commenting out.
5575 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5577 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5579 * src/insets/insetcommand.h: Signals is not copyable so anoter
5580 scheme for automatic hiding of forms must be used.
5582 * src/frontends/xforms/FormCitation.h: don't inerit from
5583 noncopyable, FormCommand already does that.
5584 * src/frontends/xforms/FormToc.h: ditto
5585 * src/frontends/xforms/FormUrl.h: ditto
5587 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5589 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5591 * src/insets/insetcommand.h (hide): new SigC::Signal0
5592 (d-tor) new virtual destructor emits hide signal
5594 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5595 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5597 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5598 LOF and LOT. Inset is now GUI-independent
5600 * src/insets/insetloa.[Ch]: redundant
5601 * src/insets/insetlof.[Ch]: ditto
5602 * src/insets/insetlot.[Ch]: ditto
5604 * src/frontends/xforms/forms/form_url.fd: tweaked!
5605 * src/frontends/xforms/forms/form_citation.fd: ditto
5607 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5608 dialogs dealing with InsetCommand insets
5610 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5611 FormCommand base class
5612 * src/frontends/xforms/FormUrl.[Ch]: ditto
5614 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5616 * src/frontends/xforms/FormToc.[Ch]: ditto
5618 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5619 passed a generic InsetCommand pointer
5620 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5622 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5623 and modified InsetTOC class
5624 * src/buffer.C: ditto
5626 * forms/lyx.fd: strip out old FD_form_toc code
5627 * src/lyx_gui_misc.C: ditto
5628 * src/lyx_gui.C: ditto
5629 * src/lyx_cb.C: ditto
5630 * src/lyx.[Ch]: ditto
5632 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5634 * src/support/utility.hpp: tr -d '\r'
5636 2000-08-01 Juergen Vigna <jug@sad.it>
5638 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5640 * src/commandtags.h:
5641 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5642 LFUN_TABULAR_FEATURES.
5644 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5645 LFUN_LAYOUT_TABULAR.
5647 * src/insets/insettabular.C (getStatus): implemented helper function.
5649 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5651 2000-07-31 Juergen Vigna <jug@sad.it>
5653 * src/text.C (draw): fixed screen update problem for text-insets.
5655 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5656 something changed probably this has to be added in various other
5659 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5661 2000-07-31 Baruch Even <baruch.even@writeme.com>
5663 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5664 templates to satisfy compaq cxx.
5667 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5669 * src/support/translator.h (equal_1st_in_pair::operator()): take
5670 const ref pair_type as arg.
5671 (equal_2nd_in_pair::operator()): ditto
5672 (Translator::~Translator): remove empty d-tor.
5674 * src/graphics/GraphicsCache.C: move include config.h to top, also
5675 put initialization of GraphicsCache::singleton here.
5676 (~GraphicsCache): move here
5677 (addFile): take const ref as arg
5680 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5682 * src/BufferView2.C (insertLyXFile): change te with/without header
5685 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5687 * src/frontends/xforms/FormGraphics.C (apply): add some
5688 static_cast. Not very nice, but required by compaq cxx.
5690 * src/frontends/xforms/RadioButtonGroup.h: include header
5691 <utility> instead of <pair.h>
5693 * src/insets/insetgraphicsParams.C: add using directive.
5694 (readResize): change return type to void.
5695 (readOrigin): ditto.
5697 * src/lyxfunc.C (getStatus): add missing break for build-program
5698 function; add test for Literate for export functions.
5700 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5701 entries in Options menu.
5703 2000-07-31 Baruch Even <baruch.even@writeme.com>
5705 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5706 protect against auto-allocation; release icon when needed.
5708 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5710 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5711 on usual typewriter.
5713 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5714 earlier czech.kmap), useful only for programming.
5716 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5718 * src/frontends/xforms/FormCitation.h: fix conditioning around
5721 2000-07-31 Juergen Vigna <jug@sad.it>
5723 * src/frontends/xforms/FormTabular.C (local_update): changed
5724 radio_linebreaks to radio_useparbox and added radio_useminipage.
5726 * src/tabular.C: made support for using minipages/parboxes.
5728 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5730 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5732 (descent): so the cursor is in the middle.
5733 (width): bit smaller box.
5735 * src/insets/insetgraphics.h: added display() function.
5737 2000-07-31 Baruch Even <baruch.even@writeme.com>
5739 * src/frontends/Dialogs.h: Added showGraphics signals.
5741 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5742 xforms form definition of the graphics dialog.
5744 * src/frontends/xforms/FormGraphics.h:
5745 * src/frontends/xforms/FormGraphics.C: Added files, the
5746 GUIndependent code of InsetGraphics
5748 * src/insets/insetgraphics.h:
5749 * src/insets/insetgraphics.C: Major writing to make it work.
5751 * src/insets/insetgraphicsParams.h:
5752 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5753 struct between InsetGraphics and GUI.
5755 * src/LaTeXFeatures.h:
5756 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5757 support for graphicx package.
5759 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5760 for the graphics inset.
5762 * src/support/translator.h: Added file, used in
5763 InsetGraphicsParams. this is a template to translate between two
5766 * src/frontends/xforms/RadioButtonGroup.h:
5767 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5768 way to easily control a radio button group.
5770 2000-07-28 Juergen Vigna <jug@sad.it>
5772 * src/insets/insettabular.C (LocalDispatch):
5773 (TabularFeatures): added support for lyx-functions of tabular features.
5774 (cellstart): refixed this function after someone wrongly changed it.
5776 * src/commandtags.h:
5777 * src/LyXAction.C (init): added support for tabular-features
5779 2000-07-28 Allan Rae <rae@lyx.org>
5781 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5782 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5783 triggers the callback for input checking. As a result we sometimes get
5784 "LyX: This shouldn't happen..." printed to cerr.
5785 (input): Started using status variable since I only free() on
5786 destruction. Some input checking for paths and font sizes.
5788 * src/frontends/xforms/FormPreferences.h: Use status to control
5789 activation of Ok and Apply
5791 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5792 callback. Also resized to stop segfaults with 0.88. The problem is
5793 that xforms-0.88 requires the folder to be wide enough to fit all the
5794 tabs. If it isn't it causes all sorts of problems.
5796 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5798 * src/frontends/xforms/forms/README: Reflect reality.
5800 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5801 * src/frontends/xforms/forms/makefile: ditto.
5803 * src/commandtags.h: Get access to new Preferences dialog
5804 * src/LyXAction.C: ditto
5805 * src/lyxfunc.C: ditto
5806 * lib/ui/default.ui: ditto
5808 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5810 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5812 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5815 * src/frontends/xforms/form_url.[Ch]: added.
5817 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5819 * src/insets/insetbib.h: fixed bug in previous commit
5821 * src/frontends/xforms/FormUrl.h: ditto
5823 * src/frontends/xforms/FormPrint.h: ditto
5825 * src/frontends/xforms/FormPreferences.h: ditto
5827 * src/frontends/xforms/FormCopyright.h: ditto
5829 * src/frontends/xforms/FormCitation.C: ditto
5831 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5832 private copyconstructor and private default contructor
5834 * src/support/Makefile.am: add utility.hpp
5836 * src/support/utility.hpp: new file from boost
5838 * src/insets/insetbib.h: set owner in clone
5840 * src/frontends/xforms/FormCitation.C: added missing include
5843 * src/insets/form_url.[Ch]: removed
5845 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5847 * development/lyx.spec.in
5848 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5849 file/directory re-organization.
5851 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5853 * src/insets/insetcommand.[Ch]: moved the string data and
5854 associated manipulation methods into a new stand-alone class
5855 InsetCommandParams. This class has two additional methods
5856 getAsString() and setFromString() allowing the contents to be
5857 moved around as a single string.
5858 (addContents) method removed.
5859 (setContents) method no longer virtual.
5861 * src/buffer.C (readInset): made use of new InsetCitation,
5862 InsetUrl constructors based on InsetCommandParams.
5864 * src/commandtags.h: add LFUN_INSERT_URL
5866 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5867 independent InsetUrl and use InsetCommandParams to extract
5868 string info and create new Insets.
5870 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5872 * src/frontends/xforms/FormCitation.C (apply): uses
5875 * src/frontends/xforms/form_url.C
5876 * src/frontends/xforms/form_url.h
5877 * src/frontends/xforms/FormUrl.h
5878 * src/frontends/xforms/FormUrl.C
5879 * src/frontends/xforms/forms/form_url.fd: new files
5881 * src/insets/insetcite.[Ch]: removed unused constructors.
5883 * src/insets/insetinclude.[Ch]: no longer store filename
5885 * src/insets/inseturl.[Ch]: GUI-independent.
5887 2000-07-26 Juergen Vigna <jug@sad.it>
5888 * renamed frontend from gtk to gnome as it is that what is realized
5889 and did the necessary changes in the files.
5891 2000-07-26 Marko Vendelin <markov@ioc.ee>
5893 * configure.in: cleaning up gnome configuration scripts
5895 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5897 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5898 shortcuts syndrom by redrawing them explicitely (a better solution
5899 would be appreciated).
5901 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5903 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5906 * src/lyx_cb.C (MenuExport): change html export to do the right
5907 thing depending of the document type (instead of having
5908 html-linuxdoc and html-docbook).
5909 * src/lyxfunc.C (getStatus): update for html
5910 * lib/ui/default.ui: simplify due to the above change.
5911 * src/menus.C (ShowFileMenu): update too (in case we need it).
5913 * src/MenuBackend.C (read): if a menu is defined twice, add the
5914 new entries to the exiting one.
5916 2000-07-26 Juergen Vigna <jug@sad.it>
5918 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5920 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5921 and return a bool if it did actual save the file.
5922 (AutoSave): don't autosave a unnamed doc.
5924 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5925 check if this is an UNNAMED new file and react to it.
5926 (newFile): set buffer to unnamed and change to not mark a new
5927 buffer dirty if I didn't do anything with it.
5929 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5931 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5933 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5934 friend as per Angus's patch posted to lyx-devel.
5936 * src/ext_l10n.h: updated
5938 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5939 gettext on the style string right before inserting them into the
5942 * autogen.sh: add code to extract style strings form layout files,
5943 not good enough yet.
5945 * src/frontends/gtk/.cvsignore: add MAKEFILE
5947 * src/MenuBackend.C (read): run the label strings through gettext
5948 before storing them in the containers.
5950 * src/ext_l10n.h: new file
5952 * autogen.sh : generate the ext_l10n.h file here
5954 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5956 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5959 * lib/ui/default.ui: fix a couple of typos.
5961 * config/gnome/gtk.m4: added (and added to the list of files in
5964 * src/insets/insetinclude.C (unique_id): fix when we are using
5965 lyxstring instead of basic_string<>.
5966 * src/insets/insettext.C (LocalDispatch): ditto.
5967 * src/support/filetools.C: ditto.
5969 * lib/configure.m4: create the ui/ directory if necessary.
5971 * src/LyXView.[Ch] (updateToolbar): new method.
5973 * src/BufferView_pimpl.C (buffer): update the toolbar when
5974 opening/closing buffer.
5976 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5978 * src/LyXAction.C (getActionName): enhance to return also the name
5979 and options of pseudo-actions.
5980 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5982 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5983 as an example of what is possible). Used in File->Build too (more
5984 useful) and in the import/export menus (to mimick the complicated
5985 handling of linuxdoc and friends). Try to update all the entries.
5987 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5990 * src/MenuBackend.C (read): Parse the new OptItem tag.
5992 * src/MenuBackend.h: Add a new optional_ data member (used if the
5993 entry should be omitted when the lyxfunc is disabled).
5995 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5996 function, used as a shortcut.
5997 (create_submenu): align correctly the shortcuts on the widest
6000 * src/MenuBackend.h: MenuItem.label() only returns the label of
6001 the menu without shortcut; new method shortcut().
6003 2000-07-14 Marko Vendelin <markov@ioc.ee>
6005 * src/frontends/gtk/Dialogs.C:
6006 * src/frontends/gtk/FormCopyright.C:
6007 * src/frontends/gtk/FormCopyright.h:
6008 * src/frontends/gtk/Makefile.am: added these source-files for the
6009 Gtk/Gnome support of the Copyright-Dialog.
6011 * src/main.C: added Gnome::Main initialization if using
6012 Gtk/Gnome frontend-GUI.
6014 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
6016 * config/gnome/aclocal-include.m4
6017 * config/gnome/compiler-flags.m4
6018 * config/gnome/curses.m4
6019 * config/gnome/gnome--.m4
6020 * config/gnome/gnome-bonobo-check.m4
6021 * config/gnome/gnome-common.m4
6022 * config/gnome/gnome-fileutils.m4
6023 * config/gnome/gnome-ghttp-check.m4
6024 * config/gnome/gnome-gnorba-check.m4
6025 * config/gnome/gnome-guile-checks.m4
6026 * config/gnome/gnome-libgtop-check.m4
6027 * config/gnome/gnome-objc-checks.m4
6028 * config/gnome/gnome-orbit-check.m4
6029 * config/gnome/gnome-print-check.m4
6030 * config/gnome/gnome-pthread-check.m4
6031 * config/gnome/gnome-support.m4
6032 * config/gnome/gnome-undelfs.m4
6033 * config/gnome/gnome-vfs.m4
6034 * config/gnome/gnome-x-checks.m4
6035 * config/gnome/gnome-xml-check.m4
6036 * config/gnome/gnome.m4
6037 * config/gnome/gperf-check.m4
6038 * config/gnome/gtk--.m4
6039 * config/gnome/linger.m4
6040 * config/gnome/need-declaration.m4: added configuration scripts
6041 for Gtk/Gnome frontend-GUI
6043 * configure.in: added support for the --with-frontend=gtk option
6045 * autogen.sh: added config/gnome/* to list of config-files
6047 * acconfig.h: added define for GTKGUI-support
6049 * config/lyxinclude.m4: added --with-frontend[=value] option value
6050 for Gtk/Gnome frontend-GUI support.
6052 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6054 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
6058 * src/paragraph.C (GetChar): remove non-const version
6060 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
6061 (search_kw): use it.
6063 * src/lyx_main.C (init): if "preferences" exist, read that instead
6065 (ReadRcFile): return bool if the file could be read ok.
6066 (ReadUIFile): add a check to see if lex file is set ok.
6068 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
6069 bastring can be used instead of lyxstring (still uses the old code
6070 if std::string is good enough or if lyxstring is used.)
6072 * src/encoding.C: make the arrays static, move ininle functions
6074 * src/encoding.h: from here.
6076 * src/buffer.C: have last_isnet_read as a file scope variable for now.
6077 (parseSingleLyXformat2Token): move inset parsing to separate method
6078 (readInset): new private method
6080 * src/Variables.h: remove virtual from get().
6082 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6083 access to NEW_INSETS and NEW_TABULAR
6085 * src/MenuBackend.h: remove superfluous forward declaration of
6086 MenuItem. Add documentations tags "///", remove empty MenuItem
6087 destructor, remove private default contructor.
6089 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6091 (read): more string mlabel and mname to where they are used
6092 (read): remove unused variables mlabel and mname
6093 (defaults): unconditional clear, make menusetup take advantage of
6094 add returning Menu &.
6096 * src/LyXView.h: define NEW_MENUBAR as default
6098 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6099 to NEW_INSETS and NEW_TABULAR.
6100 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6101 defined. Change some of the "xxxx-inset-insert" functions names to
6104 * several files: more enahncements to NEW_INSETS and the resulting
6107 * lib/lyxrc.example (\date_insert_format): move to misc section
6109 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6110 bastring and use AC_CACHE_CHECK.
6111 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6112 the system have the newest methods. uses AC_CACHE_CHECK
6113 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6114 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6115 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6117 * configure.in: add LYX_CXX_GOOD_STD_STRING
6119 * acinclude.m4: recreated
6121 2000-07-24 Amir Karger <karger@lyx.org>
6123 * README: add Hebrew, Arabic kmaps
6126 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6128 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6131 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6133 * Lot of files: add pragma interface/implementation.
6135 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6137 * lib/ui/default.ui: new file (ans new directory). Contains the
6138 default menu and toolbar.
6140 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6141 global space. Toolbars are now read (as menus) in ui files.
6143 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6145 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6146 is disabled because the document is read-only. We want to have the
6147 toggle state of the function anyway.
6148 (getStatus): add code for LFUN_VC* functions (mimicking what is
6149 done in old-style menus)
6151 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6152 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6154 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6155 * src/BufferView_pimpl.C: ditto.
6156 * src/lyxfunc.C: ditto.
6158 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6159 default). This replaces old-style menus by new ones.
6161 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6162 MenuItem. Contain the data structure of a menu.
6164 * src/insets/insettext.C: use LyXView::setLayout instead of
6165 accessing directly the toolbar combox.
6166 * src/lyxfunc.C (Dispatch): ditto.
6168 * src/LyXView.C (setLayout): new method, which just calls
6169 Toolbar::setLayout().
6170 (updateLayoutChoice): move part of this method in Toolbar.
6172 * src/toolbar.[Ch]: removed.
6174 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6175 implementation the toolbar.
6177 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6178 the toolbar. It might make sense to merge it with ToolbarDefaults
6180 (setLayout): new function.
6181 (updateLayoutList): ditto.
6182 (openLayoutList): ditto.
6184 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6185 xforms implementation of the toolbar.
6186 (get_toolbar_func): comment out, since I do not
6187 know what it is good for.
6189 * src/ToolbarDefaults.h: Add the ItemType enum.
6191 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6192 for a list of allocated C strings. Used in Menubar xforms
6193 implementation to avoid memory leaks.
6195 * src/support/lstrings.[Ch] (uppercase): new version taking and
6199 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6200 * lib/bind/emacs.bind: ditto.
6202 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6204 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6205 forward decl of LyXView.
6207 * src/toolbar.C (toolbarItem): moved from toolbar.h
6208 (toolbarItem::clean): ditto
6209 (toolbarItem::~toolbarItem): ditto
6210 (toolbarItem::operator): ditto
6212 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6214 * src/paragraph.h: control the NEW_TABULAR define from here
6216 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6217 USE_TABULAR_INSETS to NEW_TABULAR
6219 * src/ToolbarDefaults.C: add include "lyxlex.h"
6221 * files using the old table/tabular: use NEW_TABULAR to control
6222 compilation of old tabular stuff.
6224 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6227 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6228 planemet in reading of old style floats, fix the \end_deeper
6229 problem when reading old style floats.
6231 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6233 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6235 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6237 * lib/bind/sciword.bind: updated.
6239 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6241 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6242 layout write problem
6244 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6246 * src/Makefile.am (INCLUDES): remove image directory from include
6249 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6250 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6252 * src/LyXView.C (create_form_form_main): read the application icon
6255 * lib/images/*.xpm: change the icons to use transparent color for
6258 * src/toolbar.C (update): change the color of the button when it
6261 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6263 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6264 setting explicitely the minibuffer.
6265 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6267 * src/LyXView.C (showState): new function. Shows font information
6268 in minibuffer and update toolbar state.
6269 (LyXView): call Toolbar::update after creating the
6272 * src/toolbar.C: change toollist to be a vector instead of a
6274 (BubbleTimerCB): get help string directly from the callback
6275 argument of the corresponding icon (which is the action)
6276 (set): remove unnecessary ugliness.
6277 (update): new function. update the icons (depressed, disabled)
6278 depending of the status of the corresponding action.
6280 * src/toolbar.h: remove help in toolbarItem
6282 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6284 * src/Painter.C (text): Added code for using symbol glyphs from
6285 iso10646 fonts. Currently diabled.
6287 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6290 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6291 magyar,turkish and usorbian.
6293 * src/paragraph.C (isMultiLingual): Made more efficient.
6295 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6298 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6299 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6300 Also changed the prototype to "bool math_insert_greek(char)".
6302 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6304 * lots of files: apply the NEW_INSETS on all code that will not be
6305 needed when we move to use the new insets. Enable the define in
6306 lyxparagrah.h to try it.
6308 * src/insets/insettabular.C (cellstart): change to be a static
6310 (InsetTabular): initialize buffer in the initializer list.
6312 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6314 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6315 form_print.h out of the header file. Replaced with forward
6316 declarations of the relevant struct.
6318 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6321 * src/commandtags.h: do not include "debug.h" which does not
6322 belong there. #include it in some other places because of this
6325 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6327 * src/insets/insetcaption.C: add a couple "using" directives.
6329 * src/toolbar.C (add): get the help text directly from lyxaction.
6331 (setPixmap): new function. Loads from disk and sets a pixmap on a
6332 botton; the name of the pixmap file is derived from the command
6335 * src/toolbar.h: remove members isBitmap and pixmap from
6338 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6339 * lib/images/: move many files from images/banner.xpm.
6341 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6343 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6344 * src/toolbar.C: ditto.
6345 * configure.in: ditto.
6346 * INSTALL: document.
6348 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6349 the spellchecker popup is closed from the WM.
6351 2000-07-19 Juergen Vigna <jug@sad.it>
6353 * src/insets/insetfloat.C (Write): small fix because we use the
6354 insetname for the type now!
6356 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6358 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6361 * src/frontends/Dialogs.h: removed hideCitation signal
6363 * src/insets/insetcite.h: added hide signal
6365 * src/insets/insetcite.C (~InsetCitation): emits new signal
6366 (getScreenLabel): "intelligent" label should now fit on the screen!
6368 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6370 * src/frontends/xforms/FormCitation.C (showInset): connects
6371 hide() to the inset's hide signal
6372 (show): modified to use fl_set_object_position rather than
6373 fl_set_object_geometry wherever possible
6375 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6377 * src/insets/lyxinset.h: add caption code
6379 * src/insets/insetfloat.C (type): new method
6381 * src/insets/insetcaption.C (Write): new method
6383 (LyxCode): new method
6385 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6386 to get it right together with using the FloatList.
6388 * src/commandtags.h: add LFUN_INSET_CAPTION
6389 * src/lyxfunc.C (Dispatch): handle it
6391 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6394 * src/Variables.[Ch]: make expand take a const reference, remove
6395 the destructor, some whitespace changes.
6397 * src/LyXAction.C (init): add caption-inset-insert
6399 * src/FloatList.C (FloatList): update the default floats a bit.
6401 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6403 * src/Variables.[Ch]: new files. Intended to be used for language
6404 specific strings (like \chaptername) and filename substitution in
6407 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6409 * lib/kbd/american.kmap: update
6411 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6413 * src/bufferparams.[Ch]: remove member allowAccents.
6415 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6417 * src/LaTeXLog.C: use the log_form.h header.
6418 * src/lyx_gui.C: ditto.
6419 * src/lyx_gui_misc.C: ditto.
6420 * src/lyxvc.h: ditto.
6422 * forms/log_form.fd: new file, created from latexoptions.fd. I
6423 kept the log popup and nuked the options form.
6425 * src/{la,}texoptions.[Ch]: removed.
6426 * src/lyx_cb.C (LaTeXOptions): ditto
6428 * src/lyx_gui.C (create_forms): do not handle the
6429 fd_latex_options form.
6431 2000-07-18 Juergen Vigna <jug@sad.it>
6433 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6434 name of the inset so that it can be requested outside (text2.C).
6436 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6439 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6441 * src/mathed/formula.h (ConvertFont): constify
6443 * src/mathed/formula.C (Read): add warning if \end_inset is not
6444 found on expected place.
6446 * src/insets/lyxinset.h (ConvertFont): consify
6448 * src/insets/insetquotes.C (ConvertFont): constify
6449 * src/insets/insetquotes.h: ditto
6451 * src/insets/insetinfo.h: add labelfont
6453 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6454 (ascent): use labelfont
6458 (Write): make .lyx file a bit nicer
6460 * src/insets/insetfloat.C (Write): simplify somewhat...
6461 (Read): add warning if arg is not found
6463 * src/insets/insetcollapsable.C: add using std::max
6464 (Read): move string token and add warning in arg is not found
6465 (draw): use std::max to get the right ty
6466 (getMaxWidth): simplify by using std::max
6468 * src/insets/insetsection.h: new file
6469 * src/insets/insetsection.C: new file
6470 * src/insets/insetcaption.h: new file
6471 * src/insets/insetcaption.C: new file
6473 * src/insets/inset.C (ConvertFont): constify signature
6475 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6476 insetcaption.[Ch] and insetsection.[Ch]
6478 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6479 uses to use LABEL_COUNTER_CHAPTER instead.
6480 * src/text2.C (SetCounter): here
6482 * src/counters.h: new file
6483 * src/counters.C: new file
6484 * src/Sectioning.h: new file
6485 * src/Sectioning.C: new file
6487 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6489 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6491 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6494 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6497 2000-07-17 Juergen Vigna <jug@sad.it>
6499 * src/tabular.C (Validate): check if array-package is needed.
6500 (SetVAlignment): added support for vertical alignment.
6501 (SetLTFoot): better support for longtable header/footers
6502 (Latex): modified to support added features.
6504 * src/LaTeXFeatures.[Ch]: added array-package.
6506 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6508 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6511 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6513 * configure.in: do not forget to put a space after -isystem.
6515 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6517 * lib/kbd/arabic.kmap: a few fixes.
6519 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6521 * some whitespace chagnes to a number of files.
6523 * src/support/DebugStream.h: change to make it easier for
6524 doc++ to parse correctly.
6525 * src/support/lyxstring.h: ditto
6527 * src/mathed/math_utils.C (compara): change to have only one
6529 (MathedLookupBOP): change because of the above.
6531 * src/mathed/math_delim.C (math_deco_compare): change to have only
6533 (search_deco): change becasue of the above.
6535 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6536 instead of manually coded one.
6538 * src/insets/insetquotes.C (Read): read the \end_inset too
6540 * src/insets/insetlatex.h: remove file
6541 * src/insets/insetlatex.C: remove file
6543 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6545 (InsetPrintIndex): remove destructor
6547 * src/insets/insetinclude.h: remove default constructor
6549 * src/insets/insetfloat.C: work to make it work better
6551 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6553 * src/insets/insetcite.h (InsetCitation): remove default constructor
6555 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6557 * src/text.C (GetColumnNearX): comment out some currently unused code.
6559 * src/paragraph.C (writeFile): move some initializations closer to
6561 (CutIntoMinibuffer): small change to use new matchIT operator
6565 (InsertInset): ditto
6568 (InsetIterator): ditto
6569 (Erase): small change to use new matchFT operator
6571 (GetFontSettings): ditto
6572 (HighestFontInRange): ditto
6575 * src/lyxparagraph.h: some chars changed to value_type
6576 (matchIT): because of some stronger checking (perhaps too strong)
6577 in SGI STL, the two operator() unified to one.
6580 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6582 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6583 the last inset read added
6584 (parseSingleLyXformat2Token): some more (future) compability code added
6585 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6586 (parseSingleLyXformat2Token): set last_inset_read
6587 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6588 (parseSingleLyXformat2Token): don't double intializw string next_token
6590 * src/TextCache.C (text_fits::operator()): add const's to the signature
6591 (has_buffer::operator()): ditto
6593 * src/Floating.h: add some comments on the class
6595 * src/FloatList.[Ch] (typeExist): new method
6598 * src/BackStack.h: added default constructor, wanted by Gcc.
6600 2000-07-14 Juergen Vigna <jug@sad.it>
6602 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6604 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6606 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6607 do a redraw when the window is resized!
6608 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6610 * src/insets/insettext.C (resizeLyXText): added function to correctly
6611 being able to resize the LyXWindow.
6613 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6615 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6617 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6618 crashes when closing dialog to a deleted inset.
6620 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6621 method! Now similar to other insets.
6623 2000-07-13 Juergen Vigna <jug@sad.it>
6625 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6627 * lib/examples/Literate.lyx: small patch!
6629 * src/insets/insetbib.C (Read): added this function because of wrong
6630 Write (without [begin|end]_inset).
6632 2000-07-11 Juergen Vigna <jug@sad.it>
6634 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6635 as the insertInset could not be good!
6637 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6638 the bool param should not be last.
6640 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6642 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6643 did submit that to Karl).
6645 * configure.in: use -isystem instead of -I for X headers. This
6646 fixes a problem on solaris with a recent gcc;
6647 put the front-end code after the X detection code;
6648 configure in sigc++ before lib/
6650 * src/lyx_main.C (commandLineHelp): remove -display from command
6653 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6655 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6656 Also put in Makefile rules for building the ``listerrors''
6657 program for parsing errors from literate programs written in LyX.
6659 * lib/build-listerrors: Added small shell script as part of compile
6660 process. This builds a working ``listerrors'' binary if noweb is
6661 installed and either 1) the VNC X server is installed on the machine,
6662 or 2) the user is compiling from within a GUI. The existence of a GUI
6663 is necessary to use the ``lyx --export'' feature for now. This
6664 hack can be removed once ``lyx --export'' no longer requires a GUI to
6667 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6669 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6670 now passed back correctly from gcc and placed "under" error
6671 buttons in a Literate LyX source.
6673 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6675 * src/text.C (GetColumnNearX): Better behavior when a RTL
6676 paragraph is ended by LTR text.
6678 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6681 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6683 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6684 true when clipboard is empty.
6686 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6688 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6689 row of the paragraph.
6690 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6691 to prevent calculation of bidi tables
6693 2000-07-07 Juergen Vigna <jug@sad.it>
6695 * src/screen.C (ToggleSelection): added y_offset and x_offset
6698 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6701 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6703 * src/insets/insettext.C: fixed Layout-Display!
6705 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6707 * configure.in: add check for strings.h header.
6709 * src/spellchecker.C: include <strings.h> in order to have a
6710 definition for bzero().
6712 2000-07-07 Juergen Vigna <jug@sad.it>
6714 * src/insets/insettext.C (draw): set the status of the bv->text to
6715 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6717 * src/screen.C (DrawOneRow):
6718 (DrawFromTo): redraw the actual row if something has changed in it
6721 * src/text.C (draw): call an update of the toplevel-inset if something
6722 has changed inside while drawing.
6724 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6726 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6728 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6729 processing inside class.
6731 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6732 processing inside class.
6734 * src/insets/insetindex.h new struct Holder, consistent with other
6737 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6738 citation dialog from main code and placed it in src/frontends/xforms.
6739 Dialog launched through signals instead of callbacks
6741 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6743 * lyx.man: update the options description.
6745 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6747 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6748 handle neg values, set min width to 590, add doc about -display
6750 2000-07-05 Juergen Vigna <jug@sad.it>
6752 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6753 calls to BufferView *.
6755 * src/insets/insettext.C (checkAndActivateInset): small fix non
6756 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6758 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6759 their \end_inset token!
6761 2000-07-04 edscott <edscott@imp.mx>
6763 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6764 lib/lyxrc.example: added option \wheel_jump
6766 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6768 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6769 remove support for -width,-height,-xpos and -ypos.
6771 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6773 * src/encoding.[Ch]: New files.
6775 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6776 (text): Call to the underline() method only when needed.
6778 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6780 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6781 encoding(s) for the document.
6783 * src/bufferparams.C (BufferParams): Changed default value of
6786 * src/language.C (newLang): Removed.
6787 (items[]): Added encoding information for all defined languages.
6789 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6790 encoding choice button.
6792 * src/lyxrc.h (font_norm_type): New member variable.
6793 (set_font_norm_type): New method.
6795 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6796 paragraphs with different encodings.
6798 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6799 (TransformChar): Changed to work correctly with Arabic points.
6800 (draw): Added support for drawing Arabic points.
6801 (draw): Removed code for drawing underbars (this is done by
6804 * src/support/textutils.h (IsPrintableNonspace): New function.
6806 * src/BufferView_pimpl.h: Added "using SigC::Object".
6807 * src/LyXView.h: ditto.
6809 * src/insets/insetinclude.h (include_label): Changed to mutable.
6811 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6813 * src/mathed/math_iter.h: remove empty destructor
6815 * src/mathed/math_cursor.h: remove empty destructor
6817 * src/insets/lyxinset.h: add THEOREM_CODE
6819 * src/insets/insettheorem.[Ch]: new files
6821 * src/insets/insetminipage.C: (InsertInset): remove
6823 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6825 (InsertInset): remove
6827 * src/insets/insetlist.C: (InsertList): remove
6829 * src/insets/insetfootlike.[Ch]: new files
6831 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6834 (InsertInset): ditto
6836 * src/insets/insetert.C: remove include Painter.h, reindent
6837 (InsertInset): move to header
6839 * src/insets/insetcollapsable.h: remove explicit from default
6840 contructor, remove empty destructor, add InsertInset
6842 * src/insets/insetcollapsable.C (InsertInset): new func
6844 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6846 * src/vspace.h: add explicit to constructor
6848 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6849 \textcompwordmark, please test this.
6851 * src/lyxrc.C: set ascii_linelen to 65 by default
6853 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6855 * src/commandtags.h: add LFUN_INSET_THEOREM
6857 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6858 (makeLinuxDocFile): remove _some_ of the nice logic
6859 (makeDocBookFile): ditto
6861 * src/Painter.[Ch]: (~Painter): removed
6863 * src/LyXAction.C (init): entry for insettheorem added
6865 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6867 (deplog): code to detect files generated by LaTeX, needs testing
6870 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6872 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6874 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6876 * src/LaTeX.C (deplog): Add a check for files that are going to be
6877 created by the first latex run, part of the project to remove the
6880 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6881 contents to the extension list.
6883 2000-07-04 Juergen Vigna <jug@sad.it>
6885 * src/text.C (NextBreakPoint): added support for needFullRow()
6887 * src/insets/lyxinset.h: added needFullRow()
6889 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6892 * src/insets/insettext.C: lots of changes for update!
6894 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6896 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6898 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6900 * src/insets/insetinclude.C (InsetInclude): fixed
6901 initialization of include_label.
6902 (unique_id): now returns a string.
6904 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6906 * src/LaTeXFeatures.h: new member IncludedFiles, for
6907 a map of key, included file name.
6909 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6910 with the included files for inclusion in SGML preamble,
6911 i. e., linuxdoc and docbook.
6914 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6915 nice (is the generated linuxdoc code to be exported?), that
6916 allows to remove column, and only_body that will be true for
6917 slave documents. Insets are allowed inside SGML font type.
6918 New handling of the SGML preamble for included files.
6919 (makeDocBookFile): the same for docbook.
6921 * src/insets/insetinclude.h:
6922 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6924 (DocBook): new export methods.
6926 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6927 and makeDocBookFile.
6929 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6930 formats to export with command line argument -x.
6932 2000-06-29 Juergen Vigna <jug@sad.it>
6934 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6935 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6937 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6938 region could already been cleared by an inset!
6940 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6942 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6945 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6947 (cursorToggle): remove special handling of lyx focus.
6949 2000-06-28 Juergen Vigna <jug@sad.it>
6951 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6954 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6956 * src/insets/insetindex.C (Edit): add a callback when popup is
6959 * src/insets/insettext.C (LocalDispatch):
6960 * src/insets/insetmarginal.h:
6961 * src/insets/insetlist.h:
6962 * src/insets/insetfoot.h:
6963 * src/insets/insetfloat.h:
6964 * src/insets/insetert.h: add a missing std:: qualifier.
6966 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6968 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6971 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6973 * src/insets/insettext.C (Read): remove tmptok unused variable
6974 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6975 (InsertInset): change for new InsetInset code
6977 * src/insets/insettext.h: add TEXT inline method
6979 * src/insets/insettext.C: remove TEXT macro
6981 * src/insets/insetmarginal.C (Write): new method
6982 (Latex): change output slightly
6984 * src/insets/insetfoot.C (Write): new method
6985 (Latex): change output slightly (don't use endl when no need)
6987 * src/insets/insetert.C (Write): new method
6989 * src/insets/insetcollapsable.h: make button_length, button_top_y
6990 and button_bottm_y protected.
6992 * src/insets/insetcollapsable.C (Write): simplify code by using
6993 tostr. Also do not output the float name, the children class
6994 should to that to get control over own arguments
6996 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6997 src/insets/insetminipage.[Ch]:
7000 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
7002 * src/lyxfunc.C (Dispatch): cases for new insets/commands
7004 * src/Makefile.am (lyx_SOURCES): add the new files
7006 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
7007 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
7008 * src/commandtags.h: ditto
7010 * src/LaTeXFeatures.h: add a std::set of used floattypes
7012 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
7014 * src/FloatList.[Ch] src/Floating.h: new files
7016 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
7018 * src/lyx_cb.C (TableApplyCB): ditto
7020 * src/text2.C: ditto
7021 * src/buffer.C (SimpleLinuxDocOnePar): ditto
7022 (parseSingleLyXformat2Token): ditto + add code for
7023 backwards compability for old float styles + add code for new insets
7025 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
7027 (InsertInset(size_type, Inset *, LyXFont)): new method
7028 (InsetChar(size_type, char)): changed to use the other InsetChar
7029 with a LyXFont(ALL_INHERIT).
7030 (InsetInset(size_type, Inset*)): changed to use InsetChar to
7031 insert the META_INSET.
7033 * sigc++/thread.cc (Privete<int>::operator int&): move definition
7035 * sigc++/thread.h (Threads): from here
7037 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
7038 definition out of line
7039 * sigc++/scope.h: from here
7041 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7043 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
7044 is specified (adapted from a patch from edscott <edscott@imp.mx>).
7046 * Makefile.am (bindist): new target.
7048 * INSTALL: add instructions for doing a binary distribution.
7050 * development/tools/README.bin.example: update a bit.
7052 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
7055 * lib/lyxrc.example: new lyxrc tag \set_color.
7057 * src/lyxfunc.C (Dispatch):
7058 * src/commandtags.h:
7059 * src/LyXAction.C: new lyxfunc "set-color".
7061 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
7062 and an x11name given as strings.
7064 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
7065 cache when a color is changed.
7067 2000-06-26 Juergen Vigna <jug@sad.it>
7069 * src/lyxrow.C (width): added this functions and variable.
7071 * src/insets/insetcite.C (create_form_citation_form): some Gravity
7074 * src/text.C (SetHeightOfRow): fixed calcualting of width.
7076 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7078 * images/undo_bw.xpm: new icon.
7079 * images/redo_bw.xpm: ditto.
7081 * configure.in (INSTALL_SCRIPT): change value to
7082 ${INSTALL} to avoid failures of install-script target.
7083 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7085 * src/BufferView.h: add a magic "friend" declaration to please
7088 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7090 * forms/cite.fd: modified to allow resizing without messing
7093 * src/insetcite.C: Uses code from cite.fd almost without
7095 User can now resize dialog in the x-direction.
7096 Resizing the dialog in the y-direction is prevented, as the
7097 code does this intelligently already.
7099 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7101 * INSTALL: remove obsolete entry in "problems" section.
7103 * lib/examples/sl_*.lyx: update of the slovenian examples.
7105 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7107 2000-06-23 Juergen Vigna <jug@sad.it>
7109 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7111 * src/buffer.C (resize): delete the LyXText of textinsets.
7113 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7115 * src/insets/lyxinset.h: added another parameter 'cleared' to
7116 the draw() function.
7118 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7119 unlocking inset in inset.
7121 2000-06-22 Juergen Vigna <jug@sad.it>
7123 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7124 of insets and moved first to LyXText.
7126 * src/mathed/formulamacro.[Ch]:
7127 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7129 2000-06-21 Juergen Vigna <jug@sad.it>
7131 * src/text.C (GetVisibleRow): look if I should clear the area or not
7132 using Inset::doClearArea() function.
7134 * src/insets/lyxinset.h: added doClearArea() function and
7135 modified draw(Painter &, ...) to draw(BufferView *, ...)
7137 * src/text2.C (UpdateInset): return bool insted of int
7139 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7141 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7142 combox in the character popup
7144 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7145 BufferParams const & params
7147 2000-06-20 Juergen Vigna <jug@sad.it>
7149 * src/insets/insettext.C (SetParagraphData): set insetowner on
7152 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7154 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7155 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7157 (form_main_): remove
7159 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7160 (create_form_form_main): remove FD_form_main stuff, connect to
7161 autosave_timeout signal
7163 * src/LyXView.[Ch] (getMainForm): remove
7164 (UpdateTimerCB): remove
7165 * src/BufferView_pimpl.h: inherit from SigC::Object
7167 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7168 signal instead of callback
7170 * src/BufferView.[Ch] (cursorToggleCB): remove
7172 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7174 * src/BufferView_pimpl.C: changes because of the one below
7176 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7177 instead of storing a pointer to a LyXText.
7179 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7181 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7183 * src/lyxparagraph.h
7185 * src/paragraph.C: Changed fontlist to a sorted vector.
7187 2000-06-19 Juergen Vigna <jug@sad.it>
7189 * src/BufferView.h: added screen() function.
7191 * src/insets/insettext.C (LocalDispatch): some selection code
7194 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7196 * src/insets/insettext.C (SetParagraphData):
7198 (InsetText): fixes for multiple paragraphs.
7200 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7202 * development/lyx.spec.in: Call configure with ``--without-warnings''
7203 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7204 This should be fine, however, since we generally don't want to be
7205 verbose when making an RPM.
7207 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7209 * lib/scripts/fig2pstex.py: New file
7211 2000-06-16 Juergen Vigna <jug@sad.it>
7213 * src/insets/insettabular.C (UpdateLocal):
7214 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7215 (LocalDispatch): Changed all functions to use LyXText.
7217 2000-06-15 Juergen Vigna <jug@sad.it>
7219 * src/text.C (SetHeightOfRow): call inset::update before requesting
7222 * src/insets/insettext.C (update):
7223 * src/insets/insettabular.C (update): added implementation
7225 * src/insets/lyxinset.h: added update function
7227 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7229 * src/text.C (SelectNextWord): protect against null pointers with
7230 old-style string streams. (fix from Paul Theo Gonciari
7233 * src/cite.[Ch]: remove erroneous files.
7235 * lib/configure.m4: update the list of created directories.
7237 * src/lyxrow.C: include <config.h>
7238 * src/lyxcursor.C: ditto.
7240 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7242 * lib/examples/decimal.lyx: new example file from Mike.
7244 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7245 to find template definitions (from Dekel)
7247 * src/frontends/.cvsignore: add a few things.
7249 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7251 * src/Timeout.C (TimeOut): remove default argument.
7253 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7256 * src/insets/ExternalTemplate.C: add a "using" directive.
7258 * src/lyx_main.h: remove the act_ struct, which seems unused
7261 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7263 * LyX Developers Meeting: All files changed, due to random C++ (by
7264 coincidence) code generator script.
7266 - external inset (cool!)
7267 - initial online editing of preferences
7268 - insettabular breaks insettext(s contents)
7270 - some DocBook fixes
7271 - example files update
7272 - other cool stuff, create a diff and look for yourself.
7274 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7276 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7277 -1 this is a non-line-breaking textinset.
7279 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7280 if there is no width set.
7282 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7284 * Lots of files: Merged the dialogbase branch.
7286 2000-06-09 Allan Rae <rae@lyx.org>
7288 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7289 and the Dispatch methods that used it.
7291 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7292 access to functions formerly kept in Dispatch.
7294 2000-05-19 Allan Rae <rae@lyx.org>
7296 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7297 made to_page and count_copies integers again. from_page remains a
7298 string however because I want to allow entry of a print range like
7299 "1,4,22-25" using this field.
7301 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7302 and printer-params-get. These aren't useful from the minibuffer but
7303 could be used by a script/LyXServer app provided it passes a suitable
7304 auto_mem_buffer. I guess I should take a look at how the LyXServer
7305 works and make it support xtl buffers.
7307 * sigc++/: updated to libsigc++-1.0.1
7309 * src/xtl/: updated to xtl-1.3.pl.11
7311 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7312 those changes done to the files in src/ are actually recreated when
7313 they get regenerated. Please don't ever accept a patch that changes a
7314 dialog unless that patch includes the changes to the corresponding *.fd
7317 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7318 stringOnlyContains, renamed it and generalised it.
7320 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7321 branch. Removed the remaining old form_print code.
7323 2000-04-26 Allan Rae <rae@lyx.org>
7325 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7326 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7328 2000-04-25 Allan Rae <rae@lyx.org>
7330 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7331 against a base of xtl-1.3.pl.4
7333 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7334 filter the Id: entries so they still show the xtl version number
7337 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7338 into the src/xtl code. Patch still pending with José (XTL)
7340 2000-04-24 Allan Rae <rae@lyx.org>
7342 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7343 both more generic and much safer. Use the new template functions.
7344 * src/buffer.[Ch] (Dispatch): ditto.
7346 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7347 and mem buffer more intelligently. Also a little general cleanup.
7350 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7351 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7352 * src/xtl/Makefile.am: ditto.
7353 * src/xtl/.cvsignore: ditto.
7354 * src/Makefile.am: ditto.
7356 * src/PrinterParams.h: Removed the macros member functions. Added a
7357 testInvariant member function. A bit of tidying up and commenting.
7358 Included Angus's idea for fixing operation with egcs-1.1.2.
7360 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7361 cool expansion of XTL's mem_buffer to support automatic memory
7362 management within the buffer itself. Removed the various macros and
7363 replaced them with template functions that use either auto_mem_buffer
7364 or mem_buffer depending on a #define. The mem_buffer support will
7365 disappear as soon as the auto_mem_buffer is confirmed to be good on
7366 other platforms/compilers. That is, it's there so you've got something
7369 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7370 effectively forked XTL. However I expect José will include my code
7371 into the next major release. Also fixed a memory leak.
7372 * src/xtl/text.h: ditto.
7373 * src/xtl/xdr.h: ditto.
7374 * src/xtl/giop.h: ditto.
7376 2000-04-16 Allan Rae <rae@lyx.org>
7378 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7379 by autogen.sh and removed by maintainer-clean anyway.
7380 * .cvsignore, sigc++/.cvsignore: Support the above.
7382 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7384 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7386 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7387 macros, renamed static callback-target member functions to suit new
7388 scheme and made them public.
7389 * src/frontends/xforms/forms/form_print.fd: ditto.
7390 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7392 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7395 * src/xtl/: New directory containing a minimal distribution of XTL.
7396 This is XTL-1.3.pl.4.
7398 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7400 2000-04-15 Allan Rae <rae@lyx.org>
7402 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7404 * sigc++/: Updated to libsigc++-1.0.0
7406 2000-04-14 Allan Rae <rae@lyx.org>
7408 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7409 use the generic ones in future. I'll modify my conversion script.
7411 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7413 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7414 (CloseAllBufferRelatedDialogs): Renamed.
7415 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7417 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7418 of the generic ones. These are the same ones my conversion script
7421 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7422 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7423 * src/buffer.C (Dispatch): ditto
7425 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7426 functions for updating and hiding buffer dependent dialogs.
7427 * src/BufferView.C (buffer): ditto
7428 * src/buffer.C (setReadonly): ditto
7429 * src/lyxfunc.C (CloseBuffer): ditto
7431 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7432 Dialogs.h, and hence all the SigC stuff, into every file that includes
7433 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7435 * src/BufferView2.C: reduce the number of headers included by buffer.h
7437 2000-04-11 Allan Rae <rae@lyx.org>
7439 * src/frontends/xforms/xform_macros.h: A small collection of macros
7440 for building C callbacks.
7442 * src/frontends/xforms/Makefile.am: Added above file.
7444 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7445 scheme again. This time it should work for JMarc. If this is
7446 successful I'll revise my conversion script to automate some of this.
7447 The static member functions in the class also have to be public for
7448 this scheme will work. If the scheme works (it's almost identical to
7449 the way BufferView::cursorToggleCB is handled so it should work) then
7450 FormCopyright and FormPrint will be ready for inclusion into the main
7451 trunk immediately after 1.1.5 is released -- provided we're prepared
7452 for complaints about lame compilers not handling XTL.
7454 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7456 2000-04-07 Allan Rae <rae@lyx.org>
7458 * config/lyxinclude.m4: A bit more tidying up (Angus)
7460 * src/LString.h: JMarc's <string> header fix
7462 * src/PrinterParams.h: Used string for most data to remove some
7463 ugly code in the Print dialog and avoid even uglier code when
7464 appending the ints to a string for output.
7466 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7467 and moved "default:" back to the end of switch statement. Cleaned
7468 up the printing so it uses the right function calls and so the
7469 "print to file" option actually puts the file in the right directory.
7471 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7473 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7474 and Ok+Apply button control into a separate method: input (Angus).
7475 (input) Cleaned it up and improved it to be very thorough now.
7476 (All CB) static_cast used instead of C style cast (Angus). This will
7477 probably change again once we've worked out how to keep gcc-2.8.1 happy
7478 with real C callbacks.
7479 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7480 ignore some of the bool settings and has random numbers instead. Needs
7481 some more investigation. Added other input length checks and checking
7482 of file and printer names.
7484 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7485 would link (Angus). Seems the old code doesn't compile with the pragma
7486 statement either. Separated callback entries from internal methods.
7488 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7490 2000-03-17 Allan Rae <rae@lyx.org>
7492 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7493 need it? Maybe it could go in Dialogs instead? I could make it a
7494 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7495 values to get the bool return value.
7496 (Dispatch): New overloaded method for xtl support.
7498 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7499 extern "C" callback instead of static member functions. Hopefully,
7500 JMarc will be able to compile this. I haven't changed
7501 forms/form_copyright.fd yet. Breaking one of my own rules already.
7503 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7504 because they aren't useful from the minibuffer. Maybe a LyXServer
7505 might want a help message though?
7507 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7509 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7510 xtl which needs both rtti and exceptions.
7512 * src/support/Makefile.am:
7513 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7515 * src/frontends/xforms/input_validators.[ch]: input filters and
7516 validators. These conrol what keys are valid in input boxes.
7517 Use them and write some more. Much better idea than waiting till
7518 after the user has pressed Ok to say that the input fields don't make
7521 * src/frontends/xforms/Makefile.am:
7522 * src/frontends/xforms/forms/form_print.fd:
7523 * src/frontends/xforms/forms/makefile:
7524 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7525 new scheme. Still have to make sure I haven't missed anything from
7526 the current implementation.
7528 * src/Makefile.am, src/PrinterParams.h: New data store.
7530 * other files: Added a couple of copyright notices.
7532 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7534 * src/insets/insetbib.h: move Holder struct in public space.
7536 * src/frontends/include/DialogBase.h: use SigC:: only when
7537 SIGC_CXX_NAMESPACES is defined.
7538 * src/frontends/include/Dialogs.h: ditto.
7540 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7542 * src/frontends/xforms/FormCopyright.[Ch]: do not
7543 mention SigC:: explicitely.
7545 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7547 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7548 deals with testing KDE in main configure.in
7549 * configure.in: ditto.
7551 2000-02-22 Allan Rae <rae@lyx.org>
7553 * Lots of files: Merged from HEAD
7555 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7556 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7558 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7560 * sigc++/: new minidist.
7562 2000-02-14 Allan Rae <rae@lyx.org>
7564 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7566 2000-02-08 Juergen Vigna <jug@sad.it>
7568 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7569 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7571 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7572 for this port and so it is much easier for other people to port
7573 dialogs in a common development environment.
7575 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7576 the QT/KDE implementation.
7578 * src/frontends/kde/Dialogs.C:
7579 * src/frontends/kde/FormCopyright.C:
7580 * src/frontends/kde/FormCopyright.h:
7581 * src/frontends/kde/Makefile.am:
7582 * src/frontends/kde/formcopyrightdialog.C:
7583 * src/frontends/kde/formcopyrightdialog.h:
7584 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7585 for the kde support of the Copyright-Dialog.
7587 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7588 subdir-substitution instead of hardcoded 'xforms' as we now have also
7591 * src/frontends/include/DialogBase.h (Object): just commented the
7592 label after #endif (nasty warning and I don't like warnings ;)
7594 * src/main.C (main): added KApplication initialization if using
7597 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7598 For now only the KDE event-loop is added if frontend==kde.
7600 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7602 * configure.in: added support for the --with-frontend[=value] option
7604 * autogen.sh: added kde.m4 file to list of config-files
7606 * acconfig.h: added define for KDEGUI-support
7608 * config/kde.m4: added configuration functions for KDE-port
7610 * config/lyxinclude.m4: added --with-frontend[=value] option with
7611 support for xforms and KDE.
7613 2000-02-08 Allan Rae <rae@lyx.org>
7615 * all Makefile.am: Fixed up so the make targets dist, distclean,
7616 install and uninstall all work even if builddir != srcdir. Still
7617 have a new sigc++ minidist update to come.
7619 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7621 2000-02-01 Allan Rae <rae@lyx.org>
7623 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7624 Many mods to get builddir != srcdir working.
7626 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7627 for building on NT and so we can do the builddir != srcdir stuff.
7629 2000-01-30 Allan Rae <rae@lyx.org>
7631 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7632 This will stay in "rae" branch. We probably don't really need it in
7633 the main trunk as anyone who wants to help programming it should get
7634 a full library installed also. So they can check both included and
7635 system supplied library compilation.
7637 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7638 Added a 'mini' distribution of libsigc++. If you feel the urge to
7639 change something in these directories - Resist it. If you can't
7640 resist the urge then you should modify the following script and rebuild
7641 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7642 all happen. Still uses a hacked version of libsigc++'s configure.in.
7643 I'm quite happy with the results. I'm not sure the extra work to turn
7644 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7645 worth the trouble and would probably lead to extra maintenance
7647 I haven't tested the following important make targets: install, dist.
7648 Not ready for prime time but very close. Maybe 1.1.5.
7650 * development/tools/makeLyXsigc.sh: A shell script to automatically
7651 generate our mini-dist of libsigc++. It can only be used with a CVS
7652 checkout of libsigc++ not a tarball distribution. It's well commented.
7653 This will end up as part of the libsigc++ distribution so other apps
7654 can easily have an included mini-dist. If someone makes mods to the
7655 sigc++ subpackage without modifying this script to generate those
7656 changes I'll be very upset!
7658 * src/frontends/: Started the gui/system indep structure.
7660 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7661 to access the gui-indep dialogs are in this class. Much improved
7662 design compared to previous revision. Lars, please refrain from
7663 moving this header into src/ like you did with Popups.h last time.
7665 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7667 * src/frontends/xforms/: Started the gui-indep system with a single
7668 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7671 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7672 Here you'll find a very useful makefile and automated fdfix.sh that
7673 makes updating dailogs a no-brainer -- provided you follow the rules
7674 set out in the README. I'm thinking about adding another script to
7675 automatically generate skeleton code for a new dialog given just the
7678 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7679 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7680 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7682 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7684 * src/support/LSubstring.C (operator): simplify
7686 * src/lyxtext.h: removed bparams, use buffer_->params instead
7688 * src/lyxrow.h: make Row a real class, move all variables to
7689 private and use accessors.
7691 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7693 (isRightToLeftPar): ditto
7694 (ChangeLanguage): ditto
7695 (isMultiLingual): ditto
7698 (SimpleTeXOnePar): ditto
7699 (TeXEnvironment): ditto
7700 (GetEndLabel): ditto
7702 (SetOnlyLayout): ditto
7703 (BreakParagraph): ditto
7704 (BreakParagraphConservative): ditto
7705 (GetFontSettings): ditto
7707 (CopyIntoMinibuffer): ditto
7708 (CutIntoMinibuffer): ditto
7709 (PasteParagraph): ditto
7710 (SetPExtraType): ditto
7711 (UnsetPExtraType): ditto
7712 (DocBookContTableRows): ditto
7713 (SimpleDocBookOneTablePar): ditto
7715 (TeXFootnote): ditto
7716 (SimpleTeXOneTablePar): ditto
7717 (TeXContTableRows): ditto
7718 (SimpleTeXSpecialChars): ditto
7721 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7722 to private and use accessors.
7724 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7725 this, we did not use it anymore and has not been for ages. Just a
7726 waste of cpu cycles.
7728 * src/language.h: make Language a real class, move all variables
7729 to private and use accessors.
7731 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7732 (create_view): remove
7733 (update): some changes for new timer
7734 (cursorToggle): use new timer
7735 (beforeChange): change for new timer
7737 * src/BufferView.h (cursorToggleCB): removed last paramter because
7740 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7741 (cursorToggleCB): change because of new timer code
7743 * lib/CREDITS: updated own mailaddress
7745 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7747 * src/support/filetools.C (PutEnv): fix the code in case neither
7748 putenv() nor setenv() have been found.
7750 * INSTALL: mention the install-strip Makefile target.
7752 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7753 read-only documents.
7755 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7757 * lib/reLyX/configure.in (VERSION): avoid using a previously
7758 generated reLyX wrapper to find out $prefix.
7760 * lib/examples/eu_adibide_lyx-atua.lyx:
7761 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7762 translation of the Tutorial (Dooteo)
7764 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7766 * forms/cite.fd: new citation dialog
7768 * src/insetcite.[Ch]: the new citation dialog is moved into
7771 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7774 * src/insets/insetcommand.h: data members made private.
7776 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7778 * LyX 1.1.5 released
7780 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7782 * src/version.h (LYX_RELEASE): to 1.1.5
7784 * src/spellchecker.C (RunSpellChecker): return false if the
7785 spellchecker dies upon creation.
7787 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7789 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7790 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7794 * lib/CREDITS: update entry for Martin Vermeer.
7796 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7798 * src/text.C (draw): Draw foreign language bars at the bottom of
7799 the row instead of at the baseline.
7801 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7803 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7805 * lib/bind/de_menus.bind: updated
7807 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7809 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7811 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7813 * src/menus.C (Limit_string_length): New function
7814 (ShowTocMenu): Limit the number of items/length of items in the
7817 * src/paragraph.C (String): Correct result for a paragraph inside
7820 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7822 * src/bufferlist.C (close): test of buf->getuser() == NULL
7824 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7826 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7827 Do not call to SetCursor when the paragraph is a closed footnote!
7829 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7831 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7834 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7836 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7839 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7840 reference popup, that activates the reference-back action
7842 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7844 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7845 the menus. Also fixed a bug.
7847 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7848 the math panels when switching buffers (unless new buffer is readonly).
7850 * src/BufferView.C (NoSavedPositions)
7851 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7853 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7855 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7856 less of dvi dirty or not.
7858 * src/trans_mgr.[Ch] (insert): change first parameter to string
7861 * src/chset.[Ch] (encodeString): add const to first parameter
7863 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7865 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7869 * src/LaTeX.C (deplog): better searching for dependency files in
7870 the latex log. Uses now regexps.
7872 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7873 instead of the box hack or \hfill.
7875 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7877 * src/lyxfunc.C (doImportHelper): do not create the file before
7878 doing the actual import.
7879 (doImportASCIIasLines): create a new file before doing the insert.
7880 (doImportASCIIasParagraphs): ditto.
7882 * lib/lyxrc.example: remove mention of non-existing commands
7884 * lyx.man: remove mention of color-related switches.
7886 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7888 * src/lyx_gui.C: remove all the color-related ressources, which
7889 are not used anymore.
7891 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7894 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7896 * src/lyxrc.C (read): Add a missing break in the switch
7898 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7900 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7902 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7905 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7907 * src/text.C (draw): draw bars under foreign language words.
7909 * src/LColor.[Ch]: add LColor::language
7911 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7913 * src/lyxcursor.h (boundary): New member variable
7915 * src/text.C (IsBoundary): New methods
7917 * src/text.C: Use the above for currect cursor movement when there
7918 is both RTL & LTR text.
7920 * src/text2.C: ditto
7922 * src/bufferview_funcs.C (ToggleAndShow): ditto
7924 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7926 * src/text.C (DeleteLineForward): set selection to true to avoid
7927 that DeleteEmptyParagraphMechanism does some magic. This is how it
7928 is done in all other functions, and seems reasonable.
7929 (DeleteWordForward): do not jump over non-word stuff, since
7930 CursorRightOneWord() already does it.
7932 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7933 DeleteWordBackward, since they seem safe to me (since selection is
7934 set to "true") DeleteEmptyParagraphMechanism does nothing.
7936 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7938 * src/lyx_main.C (easyParse): simplify the code by factoring the
7939 part that removes parameters from the command line.
7940 (LyX): check wether wrong command line options have been given.
7942 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7944 * src/lyx_main.C : add support for specifying user LyX
7945 directory via command line option -userdir.
7947 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7949 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7950 the number of items per popup.
7951 (Add_to_refs_menu): Ditto.
7953 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7955 * src/lyxparagraph.h: renamed ClearParagraph() to
7956 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7957 textclass as parameter, and do nothing if free_spacing is
7958 true. This fixes part of the line-delete-forward problems.
7960 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7961 (pasteSelection): ditto.
7962 (SwitchLayoutsBetweenClasses): more translatable strings.
7964 * src/text2.C (CutSelection): use StripLeadingSpaces.
7965 (PasteSelection): ditto.
7966 (DeleteEmptyParagraphMechanism): ditto.
7968 2000-05-26 Juergen Vigna <jug@sad.it>
7970 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7971 is not needed in tabular insets.
7973 * src/insets/insettabular.C (TabularFeatures): added missing features.
7975 * src/tabular.C (DeleteColumn):
7977 (AppendRow): implemented this functions
7978 (cellsturct::operator=): clone the inset too;
7980 2000-05-23 Juergen Vigna <jug@sad.it>
7982 * src/insets/insettabular.C (LocalDispatch): better selection support
7983 when having multicolumn-cells.
7985 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7987 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7989 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7991 * src/ColorHandler.C (getGCForeground): put more test into _()
7993 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7996 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7999 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
8001 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
8002 there are no labels, or when buffer is readonly.
8004 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
8005 there are no labels, buffer is SGML, or when buffer is readonly.
8007 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8009 * src/LColor.C (LColor): change a couple of grey40 to grey60
8010 (LColor): rewore initalization to make compiles go some magnitude
8012 (getGUIName): don't use gettext until we need the string.
8014 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
8016 * src/Bullet.[Ch]: Fixed a small bug.
8018 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
8020 * src/paragraph.C (String): Several fixes/improvements
8022 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
8024 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8026 * src/paragraph.C (String): give more correct output.
8028 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
8030 * src/lyxfont.C (stateText) Do not output the language if it is
8031 eqaul to the language of the document.
8033 * src/paragraph.C (TeXOnePar): Do not put language switch commands
8034 between two paragraphs with the same language.
8036 * src/paragraph.C (getParLanguage) Return a correct answer for an
8037 empty dummy paragraph.
8039 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
8042 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
8045 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
8046 the menus/popup, if requested fonts are unavailable.
8048 2000-05-22 Juergen Vigna <jug@sad.it>
8050 * src/insets/insettabular.C (LocalDispatch): added some more cursor
8051 movement support (Up/Down/Tab/Shift-Tab).
8052 (LocalDispatch): added also preliminari cursor-selection.
8054 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
8056 * src/paragraph.C (PasteParagraph): Hopefully now right!
8058 2000-05-22 Garst R. Reese <reese@isn.net>
8060 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
8061 of list, change all references to Environment to Command
8062 * tex/hollywood.cls : rewrite environments as commands, add
8063 \uppercase to interiorshot and exteriorshot to force uppecase.
8064 * tex/broadway.cls : rewrite environments as commands. Tweak
8067 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8069 * src/menus.C (Add_to_toc_menu): fix the code which limits the
8070 size of items: use a constant intead of the hardcoded 40, and more
8071 importantly do not remove the %m and %x tags added at the end.
8072 (Add_to_refs_menu): use vector::size_type instead of
8073 unsigned int as basic types for the variables. _Please_ do not
8074 assume that size_t is equal to unsigned int. On an alpha, this is
8075 unsigned long, which is _not_ the same.
8077 * src/language.C (initL): remove language "hungarian", since it
8078 seems that "magyar" is better.
8080 2000-05-22 Juergen Vigna <jug@sad.it>
8082 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8084 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8087 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8088 next was deleted but not set to 0.
8090 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8092 * src/language.C (initL): change the initialization of languages
8093 so that compiles goes _fast_.
8095 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8098 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8100 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8104 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8106 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8108 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8112 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8115 * src/insets/insetlo*.[Ch]: Made editable
8117 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8119 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8120 the current selection.
8122 * src/BufferView_pimpl.C (stuffClipboard): new method
8124 * src/BufferView.C (stuffClipboard): new method
8126 * src/paragraph.C (String): new method
8128 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8129 LColor::ignore when lyxname is not found.
8131 * src/BufferView.C (pasteSelection): new method
8133 * src/BufferView_pimpl.C (pasteSelection): new method
8135 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8137 * src/WorkArea.C (request_clipboard_cb): new static function
8138 (getClipboard): new method
8139 (putClipboard): new method
8141 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8143 * LyX 1.1.5pre2 released
8145 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8147 * src/vspace.C (operator=): removed
8148 (operator=): removed
8150 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8152 * src/layout.C (NumberOfClass): manually set the type in make_pair
8153 (NumberOfLayout): ditto
8155 * src/language.C: use the Language constructor for ignore_lang
8157 * src/language.h: add constructors to struct Language
8159 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8161 * src/text2.C (SetCursorIntern): comment out #warning
8163 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8165 * src/mathed/math_iter.h: initialize sx and sw to 0
8167 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8169 * forms/lyx.fd: Redesign of form_ref
8171 * src/LaTeXFeatures.[Ch]
8175 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8178 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8179 and Buffer::inset_iterator.
8181 * src/menus.C: Added new menus: TOC and Refs.
8183 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8185 * src/buffer.C (getTocList): New method.
8187 * src/BufferView2.C (ChangeRefs): New method.
8189 * src/buffer.C (getLabelList): New method. It replaces the old
8190 getReferenceList. The return type is vector<string> instead of
8193 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8194 the old getLabel() and GetNumberOfLabels() methods.
8195 * src/insets/insetlabel.C (getLabelList): ditto
8196 * src/mathed/formula.C (getLabelList): ditto
8198 * src/paragraph.C (String): New method.
8200 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8201 Uses the new getTocList() method.
8202 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8203 which automatically updates the contents of the browser.
8204 (RefUpdateCB): Use the new getLabelList method.
8206 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8208 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8210 * src/spellchecker.C: Added using std::reverse;
8212 2000-05-19 Juergen Vigna <jug@sad.it>
8214 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8216 * src/insets/insettext.C (computeTextRows): small fix for display of
8217 1 character after a newline.
8219 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8222 2000-05-18 Juergen Vigna <jug@sad.it>
8224 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8225 when changing width of column.
8227 * src/tabular.C (set_row_column_number_info): setting of
8228 autobreak rows if necessary.
8230 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8232 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8234 * src/vc-backend.*: renamed stat() to status() and vcstat to
8235 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8236 compilation broke. The new name seems more relevant, anyway.
8238 2000-05-17 Juergen Vigna <jug@sad.it>
8240 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8241 which was wrong if the removing caused removing of rows!
8243 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8244 (pushToken): new function.
8246 * src/text2.C (CutSelection): fix problem discovered with purify
8248 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8250 * src/debug.C (showTags): enlarge the first column, now that we
8251 have 6-digits debug codes.
8253 * lib/layouts/hollywood.layout:
8254 * lib/tex/hollywood.cls:
8255 * lib/tex/brodway.cls:
8256 * lib/layouts/brodway.layout: more commands and fewer
8257 environments. Preambles moved in the .cls files. Broadway now has
8258 more options on scene numbering and less whitespace (from Garst)
8260 * src/insets/insetbib.C (getKeys): make sure that we are in the
8261 document directory, in case the bib file is there.
8263 * src/insets/insetbib.C (Latex): revert bogus change.
8265 2000-05-16 Juergen Vigna <jug@sad.it>
8267 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8268 the TabularLayout on cursor move.
8270 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8272 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8275 (draw): fixed cursor position and drawing so that the cursor is
8276 visible when before the tabular-inset.
8278 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8279 when creating from old insettext.
8281 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8283 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8285 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8286 * lib/tex/brodway.cls: ditto
8288 * lib/layouts/brodway.layout: change alignment of parenthical
8291 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8293 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8294 versions 0.88 and 0.89 are supported.
8296 2000-05-15 Juergen Vigna <jug@sad.it>
8298 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8301 * src/insets/insettext.C (computeTextRows): redone completely this
8302 function in a much cleaner way, because of problems when having a
8304 (draw): added a frame border when the inset is locked.
8305 (SetDrawLockedFrame): this sets if we draw the border or not.
8306 (SetFrameColor): this sets the frame color (default=insetframe).
8308 * src/insets/lyxinset.h: added x() and y() functions which return
8309 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8310 function which is needed to see if we have a locking inset of some
8311 type in this inset (needed for now in insettabular).
8313 * src/vspace.C (inPixels): the same function also without a BufferView
8314 parameter as so it is easier to use it in some ocasions.
8316 * src/lyxfunc.C: changed all places where insertInset was used so
8317 that now if it couldn't be inserted it is deleted!
8319 * src/TabularLayout.C:
8320 * src/TableLayout.C: added support for new tabular-inset!
8322 * src/BufferView2.C (insertInset): this now returns a bool if the
8323 inset was really inserted!!!
8325 * src/tabular.C (GetLastCellInRow):
8326 (GetFirstCellInRow): new helper functions.
8327 (Latex): implemented for new tabular class.
8331 (TeXTopHLine): new Latex() helper functions.
8333 2000-05-12 Juergen Vigna <jug@sad.it>
8335 * src/mathed/formulamacro.C (Read):
8336 * src/mathed/formula.C (Read): read also the \end_inset here!
8338 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8340 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8341 crush when saving formulae with unbalanced parenthesis.
8343 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8345 * src/layout.C: Add new keyword "endlabelstring" to layout file
8347 * src/text.C (GetVisibleRow): Draw endlabel string.
8349 * lib/layouts/broadway.layout
8350 * lib/layouts/hollywood.layout: Added endlabel for the
8351 Parenthetical layout.
8353 * lib/layouts/heb-article.layout: Do not use slanted font shape
8354 for Theorem like environments.
8356 * src/buffer.C (makeLaTeXFile): Always add "american" to
8357 the UsedLanguages list if document language is RTL.
8359 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8361 * add addendum to README.OS2 and small patch (from SMiyata)
8363 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8365 * many files: correct the calls to ChangeExtension().
8367 * src/support/filetools.C (ChangeExtension): remove the no_path
8368 argument, which does not belong there. Use OnlyFileName() instead.
8370 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8371 files when LaTeXing a non-nice latex file.
8373 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8374 a chain of "if". Return false when deadkeys are not handled.
8376 * src/lyx_main.C (LyX): adapted the code for default bindings.
8378 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8379 bindings for basic functionality (except deadkeys).
8380 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8382 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8383 several methods: handle override_x_deadkeys.
8385 * src/lyxrc.h: remove the "bindings" map, which did not make much
8386 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8388 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8390 * src/lyxfont.C (stateText): use a saner method to determine
8391 whether the font is "default". Seems to fix the crash with DEC
8394 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8396 2000-05-08 Juergen Vigna <jug@sad.it>
8398 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8399 TabularLayoutMenu with mouse-button-3
8400 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8402 * src/TabularLayout.C: added this file for having a Layout for
8405 2000-05-05 Juergen Vigna <jug@sad.it>
8407 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8408 recalculating inset-widths.
8409 (TabularFeatures): activated this function so that I can change
8410 tabular-features via menu.
8412 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8413 that I can test some functions with the Table menu.
8415 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8417 * src/lyxfont.C (stateText): guard against stupid c++libs.
8419 * src/tabular.C: add using std::vector
8420 some whitespace changes, + removed som autogenerated code.
8422 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8424 2000-05-05 Juergen Vigna <jug@sad.it>
8426 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8427 row, columns and cellstructures.
8429 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8431 * lib/lyxrc.example: remove obsolete entries.
8433 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8434 reading of protected_separator for free_spacing.
8436 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8438 * src/text.C (draw): do not display an exclamation mark in the
8439 margin for margin notes. This is confusing, ugly and
8442 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8443 AMS math' is checked.
8445 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8446 name to see whether including the amsmath package is needed.
8448 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8450 * src/paragraph.C (validate): Compute UsedLanguages correctly
8451 (don't insert the american language if it doesn't appear in the
8454 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8455 The argument of \thanks{} command is considered moving argument
8457 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8460 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8462 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8463 for appendix/minipage/depth. The lines can be now both in the footnote
8464 frame, and outside the frame.
8466 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8469 2000-05-05 Juergen Vigna <jug@sad.it>
8471 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8472 neede only in tabular.[Ch].
8474 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8476 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8478 (Write): write '~' for PROTECTED_SEPARATOR
8480 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8482 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8485 * src/mathed/formula.C (drawStr): rename size to siz.
8487 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8488 possibly fix a bug by not changing the pflags = flags to piflags =
8491 2000-05-05 Juergen Vigna <jug@sad.it>
8493 * src/insets/insetbib.C: moved using directive
8495 * src/ImportNoweb.C: small fix for being able to compile (missing
8498 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8500 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8501 to use clear, since we don't depend on this in the code. Add test
8504 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8506 * (various *.C files): add using std::foo directives to please dec
8509 * replace calls to string::clear() to string::erase() (Angus)
8511 * src/cheaders/cmath: modified to provide std::abs.
8513 2000-05-04 Juergen Vigna <jug@sad.it>
8515 * src/insets/insettext.C: Prepared all for inserting of multiple
8516 paragraphs. Still display stuff to do (alignment and other things),
8517 but I would like to use LyXText to do this when we cleaned out the
8518 table-support stuff.
8520 * src/insets/insettabular.C: Changed lot of stuff and added lots
8521 of functionality still a lot to do.
8523 * src/tabular.C: Various functions changed name and moved to be
8524 const functions. Added new Read and Write functions and changed
8525 lots of things so it works good with tabular-insets (also removed
8526 some stuff which is not needed anymore * hacks *).
8528 * src/lyxcursor.h: added operators == and != which just look if
8529 par and pos are (not) equal.
8531 * src/buffer.C (latexParagraphs): inserted this function to latex
8532 all paragraphs form par to endpar as then I can use this too for
8535 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8536 so that I can call this to from text insets with their own cursor.
8538 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8539 output off all paragraphs (because of the fix below)!
8541 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8542 the very last paragraph (this could be also the last paragraph of an
8545 * src/texrow.h: added rows() call which returns the count-variable.
8547 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8549 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8551 * lib/configure.m4: better autodetection of DocBook tools.
8553 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8555 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8557 * src/lyx_cb.C: add using std::reverse;
8559 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8562 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8563 selected files. Should fix repeated errors from generated files.
8565 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8567 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8569 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8570 the spellchecker popup.
8572 * lib/lyxrc.example: Removed the \number_inset section
8574 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8576 * src/insets/figinset.C (various): Use IsFileReadable() to make
8577 sure that the file actually exist. Relying on ghostscripts errors
8578 is a bad idea since they can lead to X server crashes.
8580 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8582 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8585 * lib/lyxrc.example: smallish typo in description of
8586 \view_dvi_paper_option
8588 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8591 * src/lyxfunc.C: doImportHelper to factor out common code of the
8592 various import methods. New functions doImportASCIIasLines,
8593 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8594 doImportLinuxDoc for the format specific parts.
8597 * buffer.C: Dispatch returns now a bool to indicate success
8600 * lyx_gui.C: Add getLyXView() for member access
8602 * lyx_main.C: Change logic for batch commands: First try
8603 Buffer::Dispatch (possibly without GUI), if that fails, use
8606 * lyx_main.C: Add support for --import command line switch.
8607 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8608 Available Formats: Everything accepted by 'buffer-import <format>'
8610 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8612 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8615 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8616 documents will be reformatted upon reentry.
8618 2000-04-27 Juergen Vigna <jug@sad.it>
8620 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8621 correctly only last pos this was a bug.
8623 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8625 * release of lyx-1.1.5pre1
8627 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8629 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8631 * src/menus.C: revert the change of naming (Figure->Graphic...)
8632 from 2000-04-11. It was incomplete and bad.
8634 * src/LColor.[Ch]: add LColor::depthbar.
8635 * src/text.C (GetVisibleRow): use it.
8637 * README: update the languages list.
8639 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8641 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8644 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8646 * README: remove sections that were just wrong.
8648 * src/text2.C (GetRowNearY): remove currentrow code
8650 * src/text.C (GetRow): remove currentrow code
8652 * src/screen.C (Update): rewritten a bit.
8653 (SmallUpdate): removed func
8655 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8657 (FullRebreak): return bool
8658 (currentrow): remove var
8659 (currentrow_y): ditto
8661 * src/lyxscreen.h (Draw): change arg to unsigned long
8662 (FitCursor): return bool
8663 (FitManualCursor): ditto
8664 (Smallpdate): remove func
8665 (first): change to unsigned long
8666 (DrawOneRow): change second arg to long (from long &)
8667 (screen_refresh_y): remove var
8668 (scree_refresh_row): ditto
8670 * src/lyxrow.h: change baseline to usigned int from unsigned
8671 short, this brings some implicit/unsigned issues out in the open.
8673 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8675 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8676 instead of smallUpdate.
8678 * src/lyxcursor.h: change y to unsigned long
8680 * src/buffer.h: don't call updateScrollbar after fitcursor
8682 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8683 where they are used. Removed "\\direction", this was not present
8684 in 1.1.4 and is already obsolete. Commented out some code that I
8685 believe to never be called.
8686 (runLiterate): don't call updateScrollbar after fitCursor
8688 (buildProgram): ditto
8691 * src/WorkArea.h (workWidth): change return val to unsigned
8694 (redraw): remove the button redraws
8695 (setScrollbarValue): change for scrollbar
8696 (getScrollbarValue): change for scrollbar
8697 (getScrollbarBounds): change for scrollbar
8699 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8700 (C_WorkArea_down_cb): removed func
8701 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8702 (resize): change for scrollbar
8703 (setScrollbar): ditto
8704 (setScrollbarBounds): ditto
8705 (setScrollbarIncrements): ditto
8706 (up_cb): removed func
8707 (down_cb): removed func
8708 (scroll_cb): change for scrollbar
8709 (work_area_handler): ditto
8711 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8712 when FitCursor did something.
8713 (updateScrollbar): some unsigned changes
8714 (downCB): removed func
8715 (scrollUpOnePage): removed func
8716 (scrollDownOnePage): remvoed func
8717 (workAreaMotionNotify): don't call screen->FitCursor but use
8718 fitCursor instead. and bool return val
8719 (workAreaButtonPress): ditto
8720 (workAreaButtonRelease): some unsigned changes
8721 (checkInsetHit): ditto
8722 (workAreaExpose): ditto
8723 (update): parts rewritten, comments about the signed char arg added
8724 (smallUpdate): removed func
8725 (cursorPrevious): call needed updateScrollbar
8728 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8731 * src/BufferView.[Ch] (upCB): removed func
8732 (downCB): removed func
8733 (smallUpdate): removed func
8735 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8737 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8738 currentrow, currentrow_y optimization. This did not help a lot and
8739 if we want to do this kind of optimization we should rather use
8740 cursor.row instead of the currentrow.
8742 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8743 buffer spacing and klyx spacing support.
8745 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8747 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8750 2000-04-26 Juergen Vigna <jug@sad.it>
8752 * src/insets/figinset.C: fixes to Lars sstream changes!
8754 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8756 * A lot of files: Added Ascii(ostream &) methods to all inset
8757 classes. Used when exporting to ASCII.
8759 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8760 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8763 * src/text2.C (ToggleFree): Disabled implicit word selection when
8764 there is a change in the language
8766 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8767 no output was generated for end-of-sentence inset.
8769 * src/insets/lyxinset.h
8772 * src/paragraph.C: Removed the insetnumber code
8774 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8776 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8778 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8779 no_babel and no_epsfig completely from the file.
8780 (parseSingleLyXformat2Token): add handling for per-paragraph
8781 spacing as written by klyx.
8783 * src/insets/figinset.C: applied patch by Andre. Made it work with
8786 2000-04-20 Juergen Vigna <jug@sad.it>
8788 * src/insets/insettext.C (cutSelection):
8789 (copySelection): Fixed with selection from right to left.
8790 (draw): now the rows are not recalculated at every draw.
8791 (computeTextRows): for now reset the inset-owner here (this is
8792 important for an undo or copy where the inset-owner is not set
8795 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8796 motion to the_locking_inset screen->first was forgotten, this was
8797 not important till we got multiline insets.
8799 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8801 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8802 code seems to be alright (it is code changed by Dekel, and the
8803 intent is indeed that all macros should be defined \protect'ed)
8805 * NEWS: a bit of reorganisation of the new user-visible features.
8807 2000-04-19 Juergen Vigna <jug@sad.it>
8809 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8810 position. Set the inset_owner of the used paragraph so that it knows
8811 that it is inside an inset. Fixed cursor handling with mouse and
8812 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8813 and cleanups to make TextInsets work better.
8815 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8816 Changed parameters of various functions and added LockInsetInInset().
8818 * src/insets/insettext.C:
8820 * src/insets/insetcollapsable.h:
8821 * src/insets/insetcollapsable.C:
8822 * src/insets/insetfoot.h:
8823 * src/insets/insetfoot.C:
8824 * src/insets/insetert.h:
8825 * src/insets/insetert.C: cleaned up the code so that it works now
8826 correctly with insettext.
8828 * src/insets/inset.C:
8829 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8830 that insets in insets are supported right.
8833 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8835 * src/paragraph.C: some small fixes
8837 * src/debug.h: inserted INSETS debug info
8839 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8840 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8842 * src/commandtags.h:
8843 * src/LyXAction.C: insert code for InsetTabular.
8845 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8846 not Button1MotionMask.
8847 (workAreaButtonRelease): send always a InsetButtonRelease event to
8849 (checkInsetHit): some setCursor fixes (always with insets).
8851 * src/BufferView2.C (lockInset): returns a bool now and extended for
8852 locking insets inside insets.
8853 (showLockedInsetCursor): it is important to have the cursor always
8854 before the locked inset.
8855 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8857 * src/BufferView.h: made lockInset return a bool.
8859 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8861 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8862 that is used also internally but can be called as public to have back
8863 a cursor pos which is not set internally.
8864 (SetCursorIntern): Changed to use above function.
8866 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8868 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8873 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8874 patches for things that should be in or should be changed.
8876 * src/* [insetfiles]: change "usigned char fragile" to bool
8877 fragile. There was only one point that could that be questioned
8878 and that is commented in formulamacro.C. Grep for "CHECK".
8880 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8881 (DeleteBuffer): take it out of CutAndPaste and make it static.
8883 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8885 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8886 output the spacing envir commands. Also the new commands used in
8887 the LaTeX output makes the result better.
8889 * src/Spacing.C (writeEnvirBegin): new method
8890 (writeEnvirEnd): new method
8892 2000-04-18 Juergen Vigna <jug@sad.it>
8894 * src/CutAndPaste.C: made textclass a static member of the class
8895 as otherwise it is not accesed right!!!
8897 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8899 * forms/layout_forms.fd
8900 * src/layout_forms.h
8901 * src/layout_forms.C (create_form_form_character)
8902 * src/lyx_cb.C (UserFreeFont)
8903 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8904 documents (in the layout->character popup).
8906 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8908 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8909 \spell_command was in fact not honored (from Kevin Atkinson).
8911 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8914 * src/lyx_gui.h: make lyxViews private (Angus)
8916 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8918 * src/mathed/math_write.C
8919 (MathMatrixInset::Write) Put \protect before \begin{array} and
8920 \end{array} if fragile
8921 (MathParInset::Write): Put \protect before \\ if fragile
8923 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8925 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8926 initialization if the LyXColorHandler must be done after the
8927 connections to the XServer has been established.
8929 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8930 get the background pixel from the lyxColorhandler so that the
8931 figures are rendered with the correct background color.
8932 (NextToken): removed functions.
8933 (GetPSSizes): use ifs >> string instead of NextToken.
8935 * src/Painter.[Ch]: the color cache moved out of this file.
8937 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8940 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8942 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8943 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8945 * src/BufferView.C (enterView): new func
8946 (leaveView): new func
8948 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8950 (leaveView): new func, undefines xterm cursor when approp.
8952 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8953 (AllowInput): delete the Workarea cursor handling from this func.
8955 * src/Painter.C (underline): draw a slimer underline in most cases.
8957 * src/lyx_main.C (error_handler): use extern "C"
8959 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8961 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8962 sent directly to me.
8964 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8965 to the list by Dekel.
8967 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8970 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8971 methods from lyx_cb.here.
8973 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8976 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8978 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8979 instead of using current_view directly.
8981 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8983 * src/LyXAction.C (init): add the paragraph-spacing command.
8985 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8987 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8989 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8990 different from the documents.
8992 * src/text.C (SetHeightOfRow): take paragraph spacing into
8993 account, paragraph spacing takes precedence over buffer spacing
8994 (GetVisibleRow): ditto
8996 * src/paragraph.C (writeFile): output the spacing parameter too.
8997 (validate): set the correct features if spacing is used in the
8999 (Clear): set spacing to default
9000 (MakeSameLayout): spacing too
9001 (HasSameLayout): spacing too
9002 (SetLayout): spacing too
9003 (TeXOnePar): output the spacing commands
9005 * src/lyxparagraph.h: added a spacing variable for use with
9006 per-paragraph spacing.
9008 * src/Spacing.h: add a Default spacing and a method to check if
9009 the current spacing is default. also added an operator==
9011 * src/text2.C (DeleteEmptyParagraphMechanism): added a
9014 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9016 * src/lyxserver.C (callback): fix dispatch of functions
9018 * src/insets/insetlatexaccent.C (checkContents): turn bogus
9019 printf() into lyxerr call.
9021 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
9024 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
9025 "Table" to "Table Box", "Float" to "Floating Material"; deletes
9026 the "Float" from each of the subitems.
9027 (ShowHelpMenu): add entry for "FAQ" and "TOC".
9029 * src/support/DebugStream.h: add an #ifdef to work around a gcc
9030 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
9031 documented the change so that the workaround can be nuked later.
9033 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
9036 * src/lyxlex_pimpl.C (next): do not re-declare the default value
9038 * src/buffer.C (getLatexName): ditto
9039 (setReadonly): ditto
9041 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9043 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
9044 avoid some uses of current_view. Added also a bufferParams()
9045 method to get at this.
9047 * src/lyxtext.h: changed params->buffer and paramters->bparams.
9049 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9051 * src/lyxparagraph.[Ch]: removed
9052 operator<(LyXParagraph::InsetTable..., added a struct matchIT
9053 with operators used by lower_bound and
9054 upper_bound in InsetTable's
9055 Make struct InsetTable private again. Used matchpos.
9057 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
9059 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
9060 document, the language of existing text is changed (unless the
9061 document is multi-lingual)
9063 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
9065 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
9067 * A lot of files: A rewrite of the Right-to-Left support.
9069 2000-04-10 Juergen Vigna <jug@sad.it>
9071 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
9072 misplaced cursor when inset in inset is locked.
9074 * src/insets/insettext.C (LocalDispatch): small fix so that a
9075 BREAKLINE is not inserted if we don't permit it with autBreakRows.
9077 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
9078 footnote font should be decreased in size twice when displaying.
9080 * src/insets/insettext.C (GetDrawFont): inserted this function as
9081 the drawing-font may differ from the real paragraph font.
9083 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9084 insets (inset in inset!).
9086 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9087 function here because we don't want footnotes inside footnotes.
9089 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9091 (init): now set the inset_owner in paragraph.C
9092 (LocalDispatch): added some resetPos() in the right position
9095 (pasteSelection): changed to use the new CutAndPaste-Class.
9097 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9098 which tells if it is allowed to insert another inset inside this one.
9100 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9101 SwitchLayoutsBetweenClasses.
9103 * src/text2.C (InsertInset): checking of the new paragraph-function
9105 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9106 is not needed anymore here!
9109 (PasteSelection): redone (also with #ifdef) so that now this uses
9110 the CutAndPaste-Class.
9111 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9114 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9115 from/to text/insets.
9117 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9118 so that the paragraph knows if it is inside an (text)-inset.
9119 (InsertFromMinibuffer): changed return-value to bool as now it
9120 may happen that an inset is not inserted in the paragraph.
9121 (InsertInsetAllowed): this checks if it is allowed to insert an
9122 inset in this paragraph.
9124 (BreakParagraphConservative):
9125 (BreakParagraph) : small change for the above change of the return
9126 value of InsertFromMinibuffer.
9128 * src/lyxparagraph.h: added inset_owner and the functions to handle
9129 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9131 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9133 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9134 functions from BufferView to BufferView::Pimpl to ease maintence.
9136 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9137 correctly. Also use SetCursorIntern instead of SetCursor.
9139 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9142 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9144 * src/WorkArea.C (belowMouse): manually implement below mouse.
9146 * src/*: Add "explicit" on several constructors, I added probably
9147 some unneeded ones. A couple of changes to code because of this.
9149 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9150 implementation and private parts from the users of BufferView. Not
9153 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9154 implementation and private parts from the users of LyXLex. Not
9157 * src/BufferView_pimpl.[Ch]: new files
9159 * src/lyxlex_pimpl.[Ch]: new files
9161 * src/LyXView.[Ch]: some inline functions move out-of-line
9163 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9165 * src/lyxparagraph.h: make struct InsetTable public.
9167 * src/support/lyxstring.h: change lyxstring::difference_type to be
9168 ptrdiff_t. Add std:: modifiers to streams.
9170 * src/font.C: include the <cctype> header, for islower() and
9173 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9175 * src/font.[Ch]: new files. Contains the metric functions for
9176 fonts, takes a LyXFont as parameter. Better separation of concepts.
9178 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9179 changes because of this.
9181 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9183 * src/*: compile with -Winline and move functions that don't
9186 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9189 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9191 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9192 (various files changed because of this)
9194 * src/Painter.C (text): fixed the drawing of smallcaps.
9196 * src/lyxfont.[Ch] (drawText): removed unused member func.
9199 * src/*.C: added needed "using" statements and "std::" qualifiers.
9201 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9203 * src/*.h: removed all use of "using" from header files use
9204 qualifier std:: instead.
9206 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9208 * src/text.C (Backspace): some additional cleanups (we already
9209 know whether cursor.pos is 0 or not).
9211 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9212 automake does not provide one).
9214 * src/bmtable.h: replace C++ comments with C comments.
9216 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9218 * src/screen.C (ShowCursor): Change the shape of the cursor if
9219 the current language is not equal to the language of the document.
9220 (If the cursor change its shape unexpectedly, then you've found a bug)
9222 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9225 * src/insets/insetnumber.[Ch]: New files.
9227 * src/LyXAction.C (init)
9228 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9231 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9233 * src/lyxparagraph.h
9234 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9235 (the vector is kept sorted).
9237 * src/text.C (GetVisibleRow): Draw selection correctly when there
9238 is both LTR and RTL text.
9240 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9241 which is much faster.
9243 * src/text.C (GetVisibleRow and other): Do not draw the last space
9244 in a row if the direction of the last letter is not equal to the
9245 direction of the paragraph.
9247 * src/lyxfont.C (latexWriteStartChanges):
9248 Check that font language is not equal to basefont language.
9249 (latexWriteEndChanges): ditto
9251 * src/lyx_cb.C (StyleReset): Don't change the language while using
9252 the font-default command.
9254 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9255 empty paragraph before a footnote.
9257 * src/insets/insetcommand.C (draw): Increase x correctly.
9259 * src/screen.C (ShowCursor): Change cursor shape if
9260 current language != document language.
9262 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9264 2000-03-31 Juergen Vigna <jug@sad.it>
9266 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9267 (Clone): changed mode how the paragraph-data is copied to the
9268 new clone-paragraph.
9270 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9271 GetInset(pos) with no inset anymore there (in inset UNDO)
9273 * src/insets/insetcommand.C (draw): small fix as here x is
9274 incremented not as much as width() returns (2 before, 2 behind = 4)
9276 2000-03-30 Juergen Vigna <jug@sad.it>
9278 * src/insets/insettext.C (InsetText): small fix in initialize
9279 widthOffset (should not be done in the init() function)
9281 2000-03-29 Amir Karger <karger@lyx.org>
9283 * lib/examples/it_ItemizeBullets.lyx: translation by
9286 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9288 2000-03-29 Juergen Vigna <jug@sad.it>
9290 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9292 * src/insets/insetfoot.C (Clone): small change as for the below
9293 new init function in the text-inset
9295 * src/insets/insettext.C (init): new function as I've seen that
9296 clone did not copy the Paragraph-Data!
9297 (LocalDispatch): Added code so that now we have some sort of Undo
9298 functionality (well actually we HAVE Undo ;)
9300 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9302 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9304 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9307 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9309 * src/main.C: added a runtime check that verifies that the xforms
9310 header used when building LyX and the library used when running
9311 LyX match. Exit with a message if they don't match. This is a
9312 version number check only.
9314 * src/buffer.C (save): Don't allocate memory on the heap for
9315 struct utimbuf times.
9317 * *: some using changes, use iosfwd instead of the real headers.
9319 * src/lyxfont.C use char const * instead of string for the static
9320 strings. Rewrite some functions to use sstream.
9322 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9324 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9327 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9329 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9330 of Geodesy (from Martin Vermeer)
9332 * lib/layouts/svjour.inc: include file for the Springer svjour
9333 class. It can be used to support journals other than JoG.
9335 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9336 Miskiewicz <misiek@pld.org.pl>)
9337 * lib/reLyX/Makefile.am: ditto.
9339 2000-03-27 Juergen Vigna <jug@sad.it>
9341 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9342 also some modifications with operations on selected text.
9344 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9345 problems with clicking on insets (last famous words ;)
9347 * src/insets/insetcommand.C (draw):
9348 (width): Changed to have a bit of space before and after the inset so
9349 that the blinking cursor can be seen (otherwise it was hidden)
9351 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9353 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9354 would not be added to the link list when an installed gettext (not
9355 part of libc) is found.
9357 2000-03-24 Juergen Vigna <jug@sad.it>
9359 * src/insets/insetcollapsable.C (Edit):
9360 * src/mathed/formula.C (InsetButtonRelease):
9361 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9364 * src/BufferView.C (workAreaButtonPress):
9365 (workAreaButtonRelease):
9366 (checkInsetHit): Finally fixed the clicking on insets be handled
9369 * src/insets/insetert.C (Edit): inserted this call so that ERT
9370 insets work always with LaTeX-font
9372 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9374 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9375 caused lyx to startup with no GUI in place, causing in a crash
9376 upon startup when called with arguments.
9378 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9380 * src/FontLoader.C: better initialization of dummyXFontStruct.
9382 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9384 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9385 for linuxdoc and docbook import and export format options.
9387 * lib/lyxrc.example Example of default values for the previous flags.
9389 * src/lyx_cb.C Use those flags instead of the hardwired values for
9390 linuxdoc and docbook export.
9392 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9395 * src/menus.C Added menus entries for the new import/exports formats.
9397 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9399 * src/lyxrc.*: Added support for running without Gui
9402 * src/FontLoader.C: sensible defaults if no fonts are needed
9404 * src/lyx_cb.C: New function ShowMessage (writes either to the
9405 minibuffer or cout in case of no gui
9406 New function AskOverwrite for common stuff
9407 Consequently various changes to call these functions
9409 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9410 wild guess at sensible screen resolution when having no gui
9412 * src/lyxfont.C: no gui, no fonts... set some defaults
9414 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9416 * src/LColor.C: made the command inset background a bit lighter.
9418 2000-03-20 Hartmut Goebel <goebel@noris.net>
9420 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9421 stdstruct.inc. Koma-Script added some title elements which
9422 otherwise have been listed below "bibliography". This split allows
9423 adding title elements to where they belong.
9425 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9426 define the additional title elements and then include
9429 * many other layout files: changed to include stdtitle.inc just
9430 before stdstruct.inc.
9432 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9434 * src/buffer.C: (save) Added the option to store all backup files
9435 in a single directory
9437 * src/lyxrc.[Ch]: Added variable \backupdir_path
9439 * lib/lyxrc.example: Added descriptions of recently added variables
9441 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9442 bibtex inset, not closing the bibtex popup when deleting the inset)
9444 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9446 * src/lyx_cb.C: add a couple using directives.
9448 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9449 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9450 import based on the filename.
9452 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9453 file would be imported at start, if the filename where of a sgml file.
9455 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9457 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9459 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9460 * src/lyxfont.h Replaced the member variable bits.direction by the
9461 member variable lang. Made many changes in other files.
9462 This allows having a multi-lingual document
9464 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9465 that change the current language to <l>.
9466 Removed the command "font-rtl"
9468 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9469 format for Hebrew documents)
9471 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9472 When auto_mathmode is "true", pressing a digit key in normal mode
9473 will cause entering into mathmode.
9474 If auto_mathmode is "rtl" then this behavior will be active only
9475 when writing right-to-left text.
9477 * src/text2.C (InsertStringA) The string is inserted using the
9480 * src/paragraph.C (GetEndLabel) Gives a correct result for
9481 footnote paragraphs.
9483 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9485 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9487 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9488 front of PasteParagraph. Never insert a ' '. This should at least
9489 fix some cause for the segfaults that we have been experiencing,
9490 it also fixes backspace behaviour slightly. (Phu!)
9492 * src/support/lstrings.C (compare_no_case): some change to make it
9493 compile with gcc 2.95.2 and stdlibc++-v3
9495 * src/text2.C (MeltFootnoteEnvironment): change type o
9496 first_footnote_par_is_not_empty to bool.
9498 * src/lyxparagraph.h: make text private. Changes in other files
9500 (fitToSize): new function
9501 (setContentsFromPar): new function
9502 (clearContents): new function
9503 (SetChar): new function
9505 * src/paragraph.C (readSimpleWholeFile): deleted.
9507 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9508 the file, just use a simple string instead. Also read the file in
9509 a more maintainable manner.
9511 * src/text2.C (InsertStringA): deleted.
9512 (InsertStringB): deleted.
9514 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9516 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9517 RedoParagraphs from the doublespace handling part, just set status
9518 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9519 done, but perhaps not like this.)
9521 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9523 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9524 character when inserting an inset.
9526 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9528 * src/bufferparams.C (readLanguage): now takes "default" into
9531 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9532 also initialize the toplevel_keymap with the default bindings from
9535 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9537 * all files using lyxrc: have lyxrc as a real variable and not a
9538 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9541 * src/lyxrc.C: remove double call to defaultKeyBindings
9543 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9544 toolbar defauls using lyxlex. Remove enums, structs, functions
9547 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9548 toolbar defaults. Also store default keybindings in a map.
9550 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9551 storing the toolbar defaults without any xforms dependencies.
9553 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9554 applied. Changed to use iterators.
9556 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9558 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9559 systems that don't have LINGUAS set to begin with.
9561 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9563 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9564 the list by Dekel Tsur.
9566 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9568 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9569 * src/insets/form_graphics.C: ditto.
9571 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9573 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9575 * src/bufferparams.C (readLanguage): use the new language map
9577 * src/intl.C (InitKeyMapper): use the new language map
9579 * src/lyx_gui.C (create_forms): use the new language map
9581 * src/language.[Ch]: New files. Used for holding the information
9582 about each language. Now! Use this new language map enhance it and
9583 make it really usable for our needs.
9585 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9587 * screen.C (ShowCursor): Removed duplicate code.
9588 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9589 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9591 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9594 * src/text.C Added TransformChar method. Used for rendering Arabic
9595 text correctly (change the glyphs of the letter according to the
9596 position in the word)
9601 * src/lyxrc.C Added lyxrc command {language_command_begin,
9602 language_command_end,language_command_ltr,language_command_rtl,
9603 language_package} which allows the use of either arabtex or Omega
9606 * src/lyx_gui.C (init)
9608 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9609 to use encoding for menu fonts which is different than the encoding
9612 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9613 do not load the babel package.
9614 To write an English document with Hebrew/Arabic, change the document
9615 language to "english".
9617 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9618 (alphaCounter): changed to return char
9619 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9621 * lib/lyxrc.example Added examples for Hebrew/Arabic
9624 * src/layout.C Added layout command endlabeltype
9626 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9628 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9630 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9632 * src/mathed/math_delim.C (search_deco): return a
9633 math_deco_struct* instead of index.
9635 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9637 * All files with a USE_OSTREAM_ONLY within: removed all code that
9638 was unused when USE_OSTREAM_ONLY is defined.
9640 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9641 of any less. Removed header and using.
9643 * src/text.C (GetVisibleRow): draw the string "Page Break
9644 (top/bottom)" on screen when drawing a pagebreak line.
9646 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9648 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9650 * src/mathed/math_macro.C (draw): do some cast magic.
9653 * src/mathed/math_defs.h: change byte* argument to byte const*.
9655 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9657 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9658 know it is right to return InsetFoot* too, but cxx does not like
9661 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9663 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9665 * src/mathed/math_delim.C: change == to proper assignment.
9667 2000-03-09 Juergen Vigna <jug@sad.it>
9669 * src/insets/insettext.C (setPos): fixed various cursor positioning
9670 problems (via mouse and cursor-keys)
9671 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9672 inset (still a small display problem but it works ;)
9674 * src/insets/insetcollapsable.C (draw): added button_top_y and
9675 button_bottom_y to have correct values for clicking on the inset.
9677 * src/support/lyxalgo.h: commented out 'using std::less'
9679 2000-03-08 Juergen Vigna <jug@sad.it>
9681 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9682 Button-Release event closes as it is alos the Release-Event
9685 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9687 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9689 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9690 can add multiple spaces in Scrap (literate programming) styles...
9691 which, by the way, is how I got hooked on LyX to begin with.
9693 * src/mathed/formula.C (Write): Added dummy variable to an
9694 inset::Latex() call.
9695 (Latex): Add free_spacing boolean to inset::Latex()
9697 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9699 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9700 virtual function to include the free_spacing boolean from
9701 the containing paragraph's style.
9703 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9704 Added free_spacing boolean arg to match inset.h
9706 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9707 Added free_spacing boolean arg to match inset.h
9709 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9710 Added free_spacing boolean and made sure that if in a free_spacing
9711 paragraph, that we output normal space if there is a protected space.
9713 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9714 Added free_spacing boolean arg to match inset.h
9716 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9717 Added free_spacing boolean arg to match inset.h
9719 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9720 Added free_spacing boolean arg to match inset.h
9722 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9723 Added free_spacing boolean arg to match inset.h
9725 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9726 Added free_spacing boolean arg to match inset.h
9728 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9729 free_spacing boolean arg to match inset.h
9731 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9732 Added free_spacing boolean arg to match inset.h
9734 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9735 Added free_spacing boolean arg to match inset.h
9737 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9738 Added free_spacing boolean arg to match inset.h
9740 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9741 Added free_spacing boolean arg to match inset.h
9743 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9744 Added free_spacing boolean arg to match inset.h
9746 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9747 free_spacing boolean arg to match inset.h
9749 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9750 free_spacing boolean arg to match inset.h
9752 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9753 ignore free_spacing paragraphs. The user's spaces are left
9756 * src/text.C (InsertChar): Fixed the free_spacing layout
9757 attribute behavior. Now, if free_spacing is set, you can
9758 add multiple spaces in a paragraph with impunity (and they
9759 get output verbatim).
9760 (SelectSelectedWord): Added dummy argument to inset::Latex()
9763 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9766 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9767 paragraph layouts now only input a simple space instead.
9768 Special character insets don't make any sense in free-spacing
9771 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9772 hard-spaces in the *input* file to simple spaces if the layout
9773 is free-spacing. This converts old files which had to have
9774 hard-spaces in free-spacing layouts where a simple space was
9776 (writeFileAscii): Added free_spacing check to pass to the newly
9777 reworked inset::Latex(...) methods. The inset::Latex() code
9778 ensures that hard-spaces in free-spacing paragraphs get output
9779 as spaces (rather than "~").
9781 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9783 * src/mathed/math_delim.C (draw): draw the empty placeholder
9784 delims with a onoffdash line.
9785 (struct math_deco_compare): struct that holds the "functors" used
9786 for the sort and the binary search in math_deco_table.
9787 (class init_deco_table): class used for initial sort of the
9789 (search_deco): use lower_bound to do a binary search in the
9792 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9794 * src/lyxrc.C: a small secret thingie...
9796 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9797 and to not flush the stream as often as it used to.
9799 * src/support/lyxalgo.h: new file
9800 (sorted): template function used for checking if a sequence is
9801 sorted or not. Two versions with and without user supplied
9802 compare. Uses same compare as std::sort.
9804 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9805 it and give warning on lyxerr.
9807 (struct compare_tags): struct with function operators used for
9808 checking if sorted, sorting and lower_bound.
9809 (search_kw): use lower_bound instead of manually implemented
9812 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9814 * src/insets/insetcollapsable.h: fix Clone() declaration.
9815 * src/insets/insetfoot.h: ditto.
9817 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9819 2000-03-08 Juergen Vigna <jug@sad.it>
9821 * src/insets/lyxinset.h: added owner call which tells us if
9822 this inset is inside another inset. Changed also the return-type
9823 of Editable to an enum so it tells clearer what the return-value is.
9825 * src/insets/insettext.C (computeTextRows): fixed computing of
9826 textinsets which split automatically on more rows.
9828 * src/insets/insetert.[Ch]: changed this to be of BaseType
9831 * src/insets/insetfoot.[Ch]: added footnote inset
9833 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9834 collapsable insets (like footnote, ert, ...)
9836 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9838 * src/lyxdraw.h: remvoe file
9840 * src/lyxdraw.C: remove file
9842 * src/insets/insettext.C: added <algorithm>.
9844 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9846 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9847 (matrix_cb): case MM_OK use string stream
9849 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9852 * src/mathed/math_macro.C (draw): use string stream
9853 (Metrics): use string stream
9855 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9856 directly to the ostream.
9858 * src/vspace.C (asString): use string stream.
9859 (asString): use string stream
9860 (asLatexString): use string stream
9862 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9863 setting Spacing::Other.
9865 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9866 sprintf when creating the stretch vale.
9868 * src/text2.C (alphaCounter): changed to return a string and to
9869 not use a static variable internally. Also fixed a one-off bug.
9870 (SetCounter): changed the drawing of the labels to use string
9871 streams instead of sprintf.
9873 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9874 manipulator to use a scheme that does not require library support.
9875 This is also the way it is done in the new GNU libstdc++. Should
9876 work with DEC cxx now.
9878 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9880 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9881 end. This fixes a bug.
9883 * src/mathed (all files concerned with file writing): apply the
9884 USE_OSTREAM_ONLY changes to mathed too.
9886 * src/support/DebugStream.h: make the constructor explicit.
9888 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9889 count and ostream squashed.
9891 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9893 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9895 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9896 ostringstream uses STL strings, and we might not.
9898 * src/insets/insetspecialchar.C: add using directive.
9899 * src/insets/insettext.C: ditto.
9901 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9903 * lib/layouts/seminar.layout: feeble attempt at a layout for
9904 seminar.cls, far from completet and could really use some looking
9905 at from people used to write layout files.
9907 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9908 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9909 a lot nicer and works nicely with ostreams.
9911 * src/mathed/formula.C (draw): a slightly different solution that
9912 the one posted to the list, but I think this one works too. (font
9913 size wrong in headers.)
9915 * src/insets/insettext.C (computeTextRows): some fiddling on
9916 Jürgens turf, added some comments that he should read.
9918 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9919 used and it gave compiler warnings.
9920 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9923 * src/lyx_gui.C (create_forms): do the right thing when
9924 show_banner is true/false.
9926 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9927 show_banner is false.
9929 * most file writing files: Now use iostreams to do almost all of
9930 the writing. Also instead of passing string &, we now use
9931 stringstreams. mathed output is still not adapted to iostreams.
9932 This change can be turned off by commenting out all the occurences
9933 of the "#define USE_OSTREAM_ONLY 1" lines.
9935 * src/WorkArea.C (createPixmap): don't output debug messages.
9936 (WorkArea): don't output debug messages.
9938 * lib/lyxrc.example: added a comment about the new variable
9941 * development/Code_rules/Rules: Added some more commente about how
9942 to build class interfaces and on how better encapsulation can be
9945 2000-03-03 Juergen Vigna <jug@sad.it>
9947 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9948 automatically with the width of the LyX-Window
9950 * src/insets/insettext.C (computeTextRows): fixed update bug in
9951 displaying text-insets (scrollvalues where not initialized!)
9953 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9955 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9956 id in the check of the result from lower_bound is not enough since
9957 lower_bound can return last too, and then res->id will not be a
9960 * all insets and some code that use them: I have conditionalized
9961 removed the Latex(string & out, ...) this means that only the
9962 Latex(ostream &, ...) will be used. This is a work in progress to
9963 move towards using streams for all output of files.
9965 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9968 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9970 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9971 routine (this fixes bug where greek letters were surrounded by too
9974 * src/support/filetools.C (findtexfile): change a bit the search
9975 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9976 no longer passed to kpsewhich, we may have to change that later.
9978 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9979 warning options to avoid problems with X header files (from Angus
9981 * acinclude.m4: regenerated.
9983 2000-03-02 Juergen Vigna <jug@sad.it>
9985 * src/insets/insettext.C (WriteParagraphData): Using the
9986 par->writeFile() function for writing paragraph-data.
9987 (Read): Using buffer->parseSingleLyXformat2Token()-function
9988 for parsing paragraph data!
9990 * src/buffer.C (readLyXformat2): removed all parse data and using
9991 the new parseSingleLyXformat2Token()-function.
9992 (parseSingleLyXformat2Token): added this function to parse (read)
9993 lyx-file-format (this is called also from text-insets now!)
9995 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9997 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
10000 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
10001 directly instead of going through a func. One very bad thing: a
10002 static LyXFindReplace, but I don't know where to place it.
10004 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
10005 string instead of char[]. Also changed to static.
10006 (GetSelectionOrWordAtCursor): changed to static inline
10007 (SetSelectionOverLenChars): ditto.
10009 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
10010 current_view and global variables. both classes has changed names
10011 and LyXFindReplace is not inherited from SearchForm.
10013 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
10014 fl_form_search form.
10016 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
10018 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10020 * lib/bind/*.bind: make sure 'buffer-previous' function is not
10021 bound (from Kayvan).
10023 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
10025 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
10027 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10029 * some things that I should comment but the local pub says head to
10032 * comment out all code that belongs to the Roff code for Ascii
10033 export of tables. (this is unused)
10035 * src/LyXView.C: use correct type for global variable
10036 current_layout. (LyXTextClass::size_type)
10038 * some code to get the new insetgraphics closer to working I'd be
10039 grateful for any help.
10041 * src/BufferView2.C (insertInset): use the return type of
10042 NumberOfLayout properly. (also changes in other files)
10044 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
10045 this as a test. I want to know what breaks because of this.
10047 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
10049 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10051 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
10052 to use a \makebox in the label, this allows proper justification
10053 with out using protected spaces or multiple hfills. Now it is
10054 "label" for left justified, "\hfill label\hfill" for center, and
10055 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
10056 should be changed accordingly.
10058 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10060 * src/lyxtext.h: change SetLayout() to take a
10061 LyXTextClass::size_type instead of a char (when there is more than
10062 127 layouts in a class); also change type of copylayouttype.
10063 * src/text2.C (SetLayout): ditto.
10064 * src/LyXView.C (updateLayoutChoice): ditto.
10066 * src/LaTeX.C (scanLogFile): errors where the line number was not
10067 given just after the '!'-line were ignored (from Dekel Tsur).
10069 * lib/lyxrc.example: fix description of \date_insert_format
10071 * lib/layouts/llncs.layout: new layout, contributed by Martin
10074 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10076 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
10077 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
10078 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
10079 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
10080 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10081 paragraph.C, text.C, text2.C)
10083 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10085 * src/insets/insettext.C (LocalDispatch): remove extra break
10088 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10089 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10091 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10092 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10094 * src/insets/insetbib.h: move InsetBibkey::Holder and
10095 InsetCitation::Holder in public space.
10097 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10099 * src/insets/insettext.h: small change to get the new files from
10100 Juergen to compile (use "string", not "class string").
10102 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10103 const & as parameter to LocalDispatch, use LyXFont const & as
10104 paramter to some other func. This also had impacto on lyxinsets.h
10105 and the two mathed insets.
10107 2000-02-24 Juergen Vigna <jug@sad.it>
10110 * src/commandtags.h:
10112 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10116 * src/BufferView2.C: added/updated code for various inset-functions
10118 * src/insets/insetert.[Ch]: added implementation of InsetERT
10120 * src/insets/insettext.[Ch]: added implementation of InsetText
10122 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10123 (draw): added preliminary code for inset scrolling not finshed yet
10125 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10126 as it is in lyxfunc.C now
10128 * src/insets/lyxinset.h: Added functions for text-insets
10130 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10132 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10133 BufferView and reimplement the list as a queue put inside its own
10136 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10138 * several files: use the new interface to the "updateinsetlist"
10140 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10142 (work_area_handler): call BufferView::trippleClick on trippleclick.
10144 * src/BufferView.C (doubleClick): new function, selects word on
10146 (trippleClick): new function, selects line on trippleclick.
10148 2000-02-22 Allan Rae <rae@lyx.org>
10150 * lib/bind/xemacs.bind: buffer-previous not supported
10152 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10154 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10157 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10159 * src/bufferlist.C: get rid of current_view from this file
10161 * src/spellchecker.C: get rid of current_view from this file
10163 * src/vspace.C: get rid of current_view from this file
10164 (inPixels): added BufferView parameter for this func
10165 (asLatexCommand): added a BufferParams for this func
10167 * src/text.C src/text2.C: get rid of current_view from these
10170 * src/lyxfont.C (getFontDirection): move this function here from
10173 * src/bufferparams.C (getDocumentDirection): move this function
10176 * src/paragraph.C (getParDirection): move this function here from
10178 (getLetterDirection): ditto
10180 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10182 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10183 resize due to wrong pixmap beeing used. Also took the opurtunity
10184 to make the LyXScreen stateless on regard to WorkArea and some
10185 general cleanup in the same files.
10187 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10189 * src/Makefile.am: add missing direction.h
10191 * src/PainterBase.h: made the width functions const.
10193 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10196 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10198 * src/insets/insetlatexaccent.C (draw): make the accents draw
10199 better, at present this will only work well with iso8859-1.
10201 * several files: remove the old drawing code, now we use the new
10204 * several files: remove support for mono_video, reverse_video and
10207 2000-02-17 Juergen Vigna <jug@sad.it>
10209 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10210 int ** as we have to return the pointer, otherwise we have only
10211 NULL pointers in the returning function.
10213 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10215 * src/LaTeX.C (operator()): quote file name when running latex.
10217 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10219 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10220 (bubble tip), this removes our special handling of this.
10222 * Remove all code that is unused now that we have the new
10223 workarea. (Code that are not active when NEW_WA is defined.)
10225 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10227 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10229 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10230 nonexisting layout; correctly redirect obsoleted layouts.
10232 * lib/lyxrc.example: document \view_dvi_paper_option
10234 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10237 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10238 (PreviewDVI): handle the view_dvi_paper_option variable.
10239 [Both from Roland Krause]
10241 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10243 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10244 char const *, int, LyXFont)
10245 (text(int, int, string, LyXFont)): ditto
10247 * src/text.C (InsertCharInTable): attempt to fix the double-space
10248 feature in tables too.
10249 (BackspaceInTable): ditto.
10250 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10252 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10254 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10256 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10257 newly found text in textcache to this.
10258 (buffer): set the owner of the text put into the textcache to 0
10260 * src/insets/figinset.C (draw): fixed the drawing of figures with
10263 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10264 drawing of mathframe, hfills, protected space, table lines. I have
10265 now no outstanding drawing problems with the new Painter code.
10267 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10269 * src/PainterBase.C (ellipse, circle): do not specify the default
10272 * src/LColor.h: add using directive.
10274 * src/Painter.[Ch]: change return type of methods from Painter& to
10275 PainterBase&. Add a using directive.
10277 * src/WorkArea.C: wrap xforms callbacks in C functions
10280 * lib/layouts/foils.layout: font fix and simplifications from Carl
10283 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10285 * a lot of files: The Painter, LColor and WorkArea from the old
10286 devel branch has been ported to lyx-devel. Some new files and a
10287 lot of #ifdeffed code. The new workarea is enabled by default, but
10288 if you want to test the new Painter and LColor you have to compile
10289 with USE_PAINTER defined (do this in config.h f.ex.) There are
10290 still some rought edges, and I'd like some help to clear those
10291 out. It looks stable (loads and displays the Userguide very well).
10294 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10296 * src/buffer.C (pop_tag): revert to the previous implementation
10297 (use a global variable for both loops).
10299 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10301 * src/lyxrc.C (LyXRC): change slightly default date format.
10303 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10304 there is an English text with a footnote that starts with a Hebrew
10305 paragraph, or vice versa.
10306 (TeXFootnote): ditto.
10308 * src/text.C (LeftMargin): allow for negative values for
10309 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10312 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10313 for input encoding (cyrillic)
10315 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10317 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10320 * src/toolbar.C (set): ditto
10321 * src/insets/insetbib.C (create_form_citation_form): ditto
10323 * lib/CREDITS: added Dekel Tsur.
10325 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10326 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10327 hebrew supports files from Dekel Tsur.
10329 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10330 <tzafrir@technion.ac.il>
10332 * src/lyxrc.C: put \date_insert_format at the right place.
10334 * src/buffer.C (makeLaTeXFile): fix the handling of
10335 BufferParams::sides when writing out latex files.
10337 * src/BufferView2.C: add a "using" directive.
10339 * src/support/lyxsum.C (sum): when we use lyxstring,
10340 ostringstream::str needs an additional .c_str().
10342 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10344 * src/support/filetools.C (ChangeExtension): patch from Etienne
10347 * src/TextCache.C (show): remove const_cast and make second
10348 parameter non-const LyXText *.
10350 * src/TextCache.h: use non const LyXText in show.
10352 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10355 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10357 * src/support/lyxsum.C: rework to be more flexible.
10359 * several places: don't check if a pointer is 0 if you are going
10362 * src/text.C: remove some dead code.
10364 * src/insets/figinset.C: remove some dead code
10366 * src/buffer.C: move the BufferView funcs to BufferView2.C
10367 remove all support for insetlatexdel
10368 remove support for oldpapersize stuff
10369 made some member funcs const
10371 * src/kbmap.C: use a std::list to store the bindings in.
10373 * src/BufferView2.C: new file
10375 * src/kbsequence.[Ch]: new files
10377 * src/LyXAction.C + others: remove all trace of buffer-previous
10379 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10380 only have one copy in the binary of this table.
10382 * hebrew patch: moved some functions from LyXText to more
10383 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10385 * several files: remove support for XForms older than 0.88
10386 whitespace changes.
10387 remove some #if 0 #endif code
10389 * src/TextCache.[Ch]: new file. Holds the textcache.
10391 * src/BufferView.C: changes to use the new TextCache interface.
10392 (waitForX): remove the now unused code.
10394 * src/BackStack.h: remove some commented code
10396 * lib/bind/emacs.bind: remove binding for buffer-previous
10398 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10400 * applied the hebrew patch.
10402 * src/lyxrow.h: make sure that all Row variables are initialized.
10404 * src/text2.C (TextHandleUndo): comment out a delete, this might
10405 introduce a memory leak, but should also help us to not try to
10406 read freed memory. We need to look at this one.
10408 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10409 (LyXParagraph): initalize footnotekind.
10411 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10412 forgot this when applying the patch. Please heed the warnings.
10414 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10415 (aka. reformat problem)
10417 * src/bufferlist.C (exists): made const, and use const_iterator
10418 (isLoaded): new func.
10419 (release): use std::find to find the correct buffer.
10421 * src/bufferlist.h: made getState a const func.
10422 made empty a const func.
10423 made exists a const func.
10426 2000-02-01 Juergen Vigna <jug@sad.it>
10428 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10430 * po/it.po: updated a bit the italian po file and also changed the
10431 'file nuovo' for newfile to 'filenuovo' without a space, this did
10434 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10435 for the new insert_date command.
10437 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10438 from jdblair, to insert a date into the current text conforming to
10439 a strftime format (for now only considering the locale-set and not
10440 the document-language).
10442 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10444 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10445 Bounds Read error seen by purify. The problem was that islower is
10446 a macros which takes an unsigned char and uses it as an index for
10447 in array of characters properties (and is thus subject to the
10451 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10452 correctly the paper sides radio buttons.
10453 (UpdateDocumentButtons): ditto.
10455 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10457 * src/kbmap.C (getsym + others): change to return unsigned int,
10458 returning a long can give problems on 64 bit systems. (I assume
10459 that int is 32bit on 64bit systems)
10461 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10463 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10464 LyXLookupString to be zero-terminated. Really fixes problems seen
10465 by purify, I think.
10467 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10469 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10470 write a (char*)0 to the lyxerr stream.
10472 * src/lastfiles.C: move algorithm before the using statemets.
10474 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10476 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10477 complains otherwise).
10478 * src/table.C: ditto
10480 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10483 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10484 that I removed earlier... It is really needed.
10486 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10488 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10490 * INSTALL: update xforms home page URL.
10492 * lib/configure.m4: fix a bug with unreadable layout files.
10494 * src/table.C (calculate_width_of_column): add "using std::max"
10497 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10499 * several files: marked several lines with "DEL LINE", this is
10500 lines that can be deleted without changing anything.
10501 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10502 checks this anyway */
10505 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10507 * src/DepTable.C (update): add a "+" at the end when the checksum
10508 is different. (debugging string only)
10510 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10511 the next inset to not be displayed. This should also fix the list
10512 of labels in the "Insert Crossreference" dialog.
10514 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10516 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10517 when regex was not found.
10519 * src/support/lstrings.C (lowercase): use handcoded transform always.
10522 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10523 old_cursor.par->prev could be 0.
10525 * several files: changed post inc/dec to pre inc/dec
10527 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10528 write the lastfiles to file.
10530 * src/BufferView.C (buffer): only show TextCache info when debugging
10532 (resizeCurrentBuffer): ditto
10533 (workAreaExpose): ditto
10535 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10537 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10539 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10540 a bit better by removing the special case for \i and \j.
10542 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10544 * src/lyx_main.C (easyParse): remove test for bad comand line
10545 options, since this broke all xforms-related parsing.
10547 * src/kbmap.C (getsym): set return type to unsigned long, as
10548 declared in header. On an alpha, long is _not_ the same as int.
10550 * src/support/LOstream.h: add a "using std::flush;"
10552 * src/insets/figinset.C: ditto.
10554 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10556 * src/bufferlist.C (write): use blinding fast file copy instead of
10557 "a char at a time", now we are doing it the C++ way.
10559 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10560 std::list<int> instead.
10561 (addpidwait): reflect move to std::list<int>
10562 (sigchldchecker): ditto
10564 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10567 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10568 that obviously was wrong...
10570 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10571 c, this avoids warnings with purify and islower.
10573 * src/insets/figinset.C: rename struct queue to struct
10574 queue_element and rewrite to use a std::queue. gsqueue is now a
10575 std::queue<queue_element>
10576 (runqueue): reflect move to std::queue
10579 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10580 we would get "1" "0" instead of "true" "false. Also make the tostr
10583 2000-01-21 Juergen Vigna <jug@sad.it>
10585 * src/buffer.C (writeFileAscii): Disabled code for special groff
10586 handling of tabulars till I fix this in table.C
10588 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10590 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10592 * src/support/lyxlib.h: ditto.
10594 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10596 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10597 and 'j' look better. This might fix the "macron" bug that has been
10600 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10601 functions as one template function. Delete the old versions.
10603 * src/support/lyxsum.C: move using std::ifstream inside
10606 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10609 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10611 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10613 * src/insets/figinset.C (InitFigures): use new instead of malloc
10614 to allocate memory for figures and bitmaps.
10615 (DoneFigures): use delete[] instead of free to deallocate memory
10616 for figures and bitmaps.
10617 (runqueue): use new to allocate
10618 (getfigdata): use new/delete[] instead of malloc/free
10619 (RegisterFigure): ditto
10621 * some files: moved some declarations closer to first use, small
10622 whitespace changes use preincrement instead of postincrement where
10623 it does not make a difference.
10625 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10626 step on the way to use stl::containers for key maps.
10628 * src/bufferlist.h: add a typedef for const_iterator and const
10629 versions of begin and end.
10631 * src/bufferlist.[Ch]: change name of member variable _state to
10632 state_. (avoid reserved names)
10634 (getFileNames): returns the filenames of the buffers in a vector.
10636 * configure.in (ALL_LINGUAS): added ro
10638 * src/support/putenv.C: new file
10640 * src/support/mkdir.C: new file
10642 2000-01-20 Allan Rae <rae@lyx.org>
10644 * lib/layouts/IEEEtran.layout: Added several theorem environments
10646 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10647 couple of minor additions.
10649 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10650 (except for those in footnotes of course)
10652 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10654 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10656 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10657 std::sort and std::lower_bound instead of qsort and handwritten
10659 (struct compara): struct that holds the functors used by std::sort
10660 and std::lower_bound in MathedLookupBOP.
10662 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10664 * src/support/LAssert.h: do not do partial specialization. We do
10665 not really need it.
10667 * src/support/lyxlib.h: note that lyx::getUserName() and
10668 lyx::date() are not in use right now. Should these be suppressed?
10670 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10671 (makeLinuxDocFile): do not put date and user name in linuxdoc
10674 * src/support/lyxlib.h (kill): change first argument to long int,
10675 since that's what solaris uses.
10677 * src/support/kill.C (kill): fix declaration to match prototype.
10679 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10680 actually check whether namespaces are supported. This is not what
10683 * src/support/lyxsum.C: add a using directive.
10685 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10687 * src/support/kill.C: if we have namespace support we don't have
10688 to include lyxlib.h.
10690 * src/support/lyxlib.h: use namespace lyx if supported.
10692 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10694 * src/support/date.C: new file
10696 * src/support/chdir.C: new file
10698 * src/support/getUserName.C: new file
10700 * src/support/getcwd.C: new file
10702 * src/support/abort.C: new file
10704 * src/support/kill.C: new file
10706 * src/support/lyxlib.h: moved all the functions in this file
10707 insede struct lyx. Added also kill and abort to this struct. This
10708 is a way to avoid the "kill is not defined in <csignal>", we make
10709 C++ wrappers for functions that are not ANSI C or ANSI C++.
10711 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10712 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10713 lyx it has been renamed to sum.
10715 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10717 * src/text.C: add using directives for std::min and std::max.
10719 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10721 * src/texrow.C (getIdFromRow): actually return something useful in
10722 id and pos. Hopefully fixes the bug with positionning of errorbox
10725 * src/lyx_main.C (easyParse): output an error and exit if an
10726 incorrect command line option has been given.
10728 * src/spellchecker.C (ispell_check_word): document a memory leak.
10730 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10731 where a "struct utimbuf" is allocated with "new" and deleted with
10734 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10736 * src/text2.C (CutSelection): don't delete double spaces.
10737 (PasteSelection): ditto
10738 (CopySelection): ditto
10740 * src/text.C (Backspace): don't delete double spaces.
10742 * src/lyxlex.C (next): fix a bug that were only present with
10743 conformant std::istream::get to read comment lines, use
10744 std::istream::getline instead. This seems to fix the problem.
10746 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10748 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10749 allowed to insert space before space" editing problem. Please read
10750 commends at the beginning of the function. Comments about usage
10753 * src/text.C (InsertChar): fix for the "not allowed to insert
10754 space before space" editing problem.
10756 * src/text2.C (DeleteEmptyParagraphMechanism): when
10757 IsEmptyTableRow can only return false this last "else if" will
10758 always be a no-op. Commented out.
10760 * src/text.C (RedoParagraph): As far as I can understand tmp
10761 cursor is not really needed.
10763 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10764 present it could only return false anyway.
10765 (several functions): Did something not so smart...added a const
10766 specifier on a lot of methods.
10768 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10769 and add a tmp->text.resize. The LyXParagraph constructor does the
10771 (BreakParagraphConservative): ditto
10773 * src/support/path.h (Path): add a define so that the wrong usage
10774 "Path("/tmp") will be flagged as a compilation error:
10775 "`unnamed_Path' undeclared (first use this function)"
10777 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10779 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10780 which was bogus for several reasons.
10782 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10784 (runBibTeX): ditto.
10786 * autogen.sh: do not use "type -path" (what's that anyway?).
10788 * src/support/filetools.C (findtexfile): remove extraneous space
10789 which caused a kpsewhich warning (at least with kpathsea version
10792 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10794 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10796 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10798 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10800 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10802 * src/paragraph.C (BreakParagraph): do not reserve space on text
10803 if we don't need to (otherwise, if pos_end < pos, we end up
10804 reserving huge amounts of memory due to bad unsigned karma).
10805 (BreakParagraphConservative): ditto, although I have not seen
10806 evidence the bug can happen here.
10808 * src/lyxparagraph.h: add a using std::list.
10810 2000-01-11 Juergen Vigna <jug@sad.it>
10812 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10813 could not be found.
10815 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10817 * src/vc-backend.C (doVCCommand): change to be static and take one
10818 more parameter: the path to chdir too be fore executing the command.
10819 (retrive): new function equiv to "co -r"
10821 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10822 file_not_found_hook is true.
10824 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10826 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10827 if a file is readwrite,readonly...anything else.
10829 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10831 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10832 (CreatePostscript): name change from MenuRunDVIPS (or something)
10833 (PreviewPostscript): name change from MenuPreviewPS
10834 (PreviewDVI): name change from MenuPreviewDVI
10836 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10837 \view_pdf_command., \pdf_to_ps_command
10839 * lib/configure.m4: added search for PDF viewer, and search for
10840 PDF to PS converter.
10841 (lyxrc.defaults output): add \pdflatex_command,
10842 \view_pdf_command and \pdf_to_ps_command.
10844 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10846 * src/bufferlist.C (write): we don't use blocksize for anything so
10849 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10851 * src/support/block.h: disable operator T* (), since it causes
10852 problems with both compilers I tried. See comments in the file.
10854 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10857 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10858 variable LYX_DIR_10x to LYX_DIR_11x.
10860 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10862 * INSTALL: document --with-lyxname.
10865 * configure.in: new configure flag --with-lyxname which allows to
10866 choose the name under which lyx is installed. Default is "lyx", of
10867 course. It used to be possible to do this with --program-suffix,
10868 but the later has in fact a different meaning for autoconf.
10870 * src/support/lstrings.h (lstrchr): reformat a bit.
10872 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10873 * src/mathed/math_defs.h: ditto.
10875 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10877 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10878 true, decides if we create a backup file or not when saving. New
10879 tag and variable \pdf_mode, defaults to false. New tag and
10880 variable \pdflatex_command, defaults to pdflatex. New tag and
10881 variable \view_pdf_command, defaults to xpdf. New tag and variable
10882 \pdf_to_ps_command, defaults to pdf2ps.
10884 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10886 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10887 does not have a BufferView.
10888 (unlockInset): ditto + don't access the_locking_inset if the
10889 buffer does not have a BufferView.
10891 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10892 certain circumstances so that we don't continue a keyboard
10893 operation long after the key was released. Try f.ex. to load a
10894 large document, press PageDown for some seconds and then release
10895 it. Before this change the document would contine to scroll for
10896 some time, with this change it stops imidiatly.
10898 * src/support/block.h: don't allocate more space than needed. As
10899 long as we don't try to write to the arr[x] in a array_type arr[x]
10900 it is perfectly ok. (if you write to it you might segfault).
10901 added operator value_type*() so that is possible to pass the array
10902 to functions expecting a C-pointer.
10904 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10907 * intl/*: updated to gettext 0.10.35, tried to add our own
10908 required modifications. Please verify.
10910 * po/*: updated to gettext 0.10.35, tried to add our own required
10911 modifications. Please verify.
10913 * src/support/lstrings.C (tostr): go at fixing the problem with
10914 cxx and stringstream. When stringstream is used return
10915 oss.str().c_str() so that problems with lyxstring and basic_string
10916 are avoided. Note that the best solution would be for cxx to use
10917 basic_string all the way, but it is not conformant yet. (it seems)
10919 * src/lyx_cb.C + other files: moved several global functions to
10920 class BufferView, some have been moved to BufferView.[Ch] others
10921 are still located in lyx_cb.C. Code changes because of this. (part
10922 of "get rid of current_view project".)
10924 * src/buffer.C + other files: moved several Buffer functions to
10925 class BufferView, the functions are still present in buffer.C.
10926 Code changes because of this.
10928 * config/lcmessage.m4: updated to most recent. used when creating
10931 * config/progtest.m4: updated to most recent. used when creating
10934 * config/gettext.m4: updated to most recent. applied patch for
10937 * config/gettext.m4.patch: new file that shows what changes we
10938 have done to the local copy of gettext.m4.
10940 * config/libtool.m4: new file, used in creation of acinclude.m4
10942 * config/lyxinclude.m4: new file, this is the lyx created m4
10943 macros, used in making acinclude.m4.
10945 * autogen.sh: GNU m4 discovered as a separate task not as part of
10946 the lib/configure creation.
10947 Generate acinlucde from files in config. Actually cat
10948 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10949 easier to upgrade .m4 files that really are external.
10951 * src/Spacing.h: moved using std::istringstream to right after
10952 <sstream>. This should fix the problem seen with some compilers.
10954 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10956 * src/lyx_cb.C: began some work to remove the dependency a lot of
10957 functions have on BufferView::text, even if not really needed.
10958 (GetCurrentTextClass): removed this func, it only hid the
10961 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10962 forgot this in last commit.
10964 * src/Bullet.C (bulletEntry): use static char const *[] for the
10965 tables, becuase of this the return arg had to change to string.
10966 (bulletSize): ditto
10967 (~Bullet): removed unneeded destructor
10969 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10970 (insetSleep): moved from Buffer
10971 (insetWakeup): moved from Buffer
10972 (insetUnlock): moved from Buffer
10974 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10975 from Buffer to BufferView.
10977 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10979 * config/ltmain.sh: updated to version 1.3.4 of libtool
10981 * config/ltconfig: updated to version 1.3.4 of libtool
10983 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10986 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10987 Did I get that right?
10989 * src/lyxlex.h: add a "using" directive or two.
10990 * src/Spacing.h: ditto.
10991 * src/insets/figinset.C: ditto.
10992 * src/support/filetools.C: ditto.
10993 * src/support/lstrings.C: ditto.
10994 * src/BufferView.C: ditto.
10995 * src/bufferlist.C: ditto.
10996 * src/lyx_cb.C: ditto.
10997 * src/lyxlex.C: ditto.
10999 * NEWS: add some changes for 1.1.4.
11001 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11003 * src/BufferView.C: first go at a TextCache to speed up switching
11006 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11008 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
11009 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
11010 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
11011 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
11014 * src/mathed/math_defs.h (MathedRowSt): make sure that all
11015 members of the struct are correctly initialized to 0 (detected by
11017 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
11018 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
11020 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
11021 pidwait, since it was allocated with "new". This was potentially
11022 very bad. Thanks to Michael Schmitt for running purify for us.
11025 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11027 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
11029 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
11031 1999-12-30 Allan Rae <rae@lyx.org>
11033 * lib/templates/IEEEtran.lyx: minor change
11035 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
11036 src/mathed/formula.C (LocalDispatch): askForText changes
11038 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
11039 know when a user has cancelled input. Fixes annoying problems with
11040 inserting labels and version control.
11042 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11044 * src/support/lstrings.C (tostr): rewritten to use strstream and
11047 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11049 * src/support/filetools.C (IsFileWriteable): use fstream to check
11050 (IsDirWriteable): use fileinfo to check
11052 * src/support/filetools.h (FilePtr): whole class deleted
11054 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
11056 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
11058 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
11060 * src/bufferlist.C (write): use ifstream and ofstream instead of
11063 * src/Spacing.h: use istrstream instead of sscanf
11065 * src/mathed/math_defs.h: change first arg to istream from FILE*
11067 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
11069 * src/mathed/math_parser.C: have yyis to be an istream
11070 (LexGetArg): use istream (yyis)
11072 (mathed_parse): ditto
11073 (mathed_parser_file): first arg istream instead of FILE*, set yyis
11075 * src/mathed/formula.C (Read): rewritten to use istream
11077 * src/mathed/formulamacro.C (Read): rewritten to use istream
11079 * src/lyxlex.h (~LyXLex): deleted desturctor
11080 (getStream): new function, returns an istream
11081 (getFile): deleted funtion
11082 (IsOK): return is.good();
11084 * src/lyxlex.C (LyXLex): delete file and owns_file
11085 (setFile): open an filebuf and assign that to a istream instead of
11087 (setStream): new function, takes an istream as arg.
11088 (setFile): deleted function
11089 (EatLine): rewritten us use istream instead of FILE*
11093 * src/table.C (LyXTable): use istream instead of FILE*
11094 (Read): rewritten to take an istream instead of FILE*
11096 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11098 * src/buffer.C (Dispatch): remove an extraneous break statement.
11100 * src/support/filetools.C (QuoteName): change to do simple
11101 'quoting'. More work is necessary. Also changed to do nothing
11102 under emx (needs fix too).
11103 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11105 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11106 config.h.in to the AC_DEFINE_UNQUOTED() call.
11107 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11108 needs char * as argument (because Solaris 7 declares it like
11111 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11112 remove definition of BZERO.
11114 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11116 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11117 defined, "lyxregex.h" if not.
11119 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11121 (REGEX): new variable that is set to regex.c lyxregex.h when
11122 AM_CONDITIONAL USE_REGEX is set.
11123 (libsupport_la_SOURCES): add $(REGEX)
11125 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11128 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11131 * configure.in: add call to LYX_REGEX
11133 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11134 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11136 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11138 * lib/bind/fi_menus.bind: new file, from
11139 pauli.virtanen@saunalahti.fi.
11141 * src/buffer.C (getBibkeyList): pass the parameter delim to
11142 InsetInclude::getKeys and InsetBibtex::getKeys.
11144 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11145 is passed to Buffer::getBibkeyList
11147 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11148 instead of the hardcoded comma.
11150 * src/insets/insetbib.C (getKeys): make sure that there are not
11151 leading blanks in bibtex keys. Normal latex does not care, but
11152 harvard.sty seems to dislike blanks at the beginning of citation
11153 keys. In particular, the retturn value of the function is
11155 * INSTALL: make it clear that libstdc++ is needed and that gcc
11156 2.7.x probably does not work.
11158 * src/support/filetools.C (findtexfile): make debug message go to
11160 * src/insets/insetbib.C (getKeys): ditto
11162 * src/debug.C (showTags): make sure that the output is correctly
11165 * configure.in: add a comment for TWO_COLOR_ICON define.
11167 * acconfig.h: remove all the entries that already defined in
11168 configure.in or acinclude.m4.
11170 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11171 to avoid user name, date and copyright.
11173 1999-12-21 Juergen Vigna <jug@sad.it>
11175 * src/table.C (Read): Now read bogus row format informations
11176 if the format is < 5 so that afterwards the table can
11177 be read by lyx but without any format-info. Fixed the
11178 crash we experienced when not doing this.
11180 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11182 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11183 (RedoDrawingOfParagraph): ditto
11184 (RedoParagraphs): ditto
11185 (RemoveTableRow): ditto
11187 * src/text.C (Fill): rename arg paperwidth -> paper_width
11189 * src/buffer.C (insertLyXFile): rename var filename -> fname
11190 (writeFile): rename arg filename -> fname
11191 (writeFileAscii): ditto
11192 (makeLaTeXFile): ditto
11193 (makeLinuxDocFile): ditto
11194 (makeDocBookFile): ditto
11196 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11199 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11201 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11204 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11205 compiled by a C compiler not C++.
11207 * src/layout.h (LyXTextClass): added typedef for const_iterator
11208 (LyXTextClassList): added typedef for const_iterator + member
11209 functions begin and end.
11211 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11212 iterators to fill the choice_class.
11213 (updateLayoutChoice): rewritten to use iterators to fill the
11214 layoutlist in the toolbar.
11216 * src/BufferView.h (BufferView::work_area_width): removed unused
11219 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11221 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11222 (sgmlCloseTag): ditto
11224 * src/support/lstrings.h: return type of countChar changed to
11227 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11228 what version of this func to use. Also made to return unsigned int.
11230 * configure.in: call LYX_STD_COUNT
11232 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11233 conforming std::count.
11235 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11237 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11238 and a subscript would give bad display (patch from Dekel Tsur
11239 <dekel@math.tau.ac.il>).
11241 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11243 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11246 * src/chset.h: add a few 'using' directives
11248 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11249 triggered when no buffer is active
11251 * src/layout.C: removed `break' after `return' in switch(), since
11254 * src/lyx_main.C (init): make sure LyX can be ran in place even
11255 when libtool has done its magic with shared libraries. Fix the
11256 test for the case when the system directory has not been found.
11258 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11259 name for the latex file.
11260 (MenuMakeHTML): ditto
11262 * src/buffer.h: add an optional boolean argument, which is passed
11263 to ChangeExtension.
11265 1999-12-20 Allan Rae <rae@lyx.org>
11267 * lib/templates/IEEEtran.lyx: small correction and update.
11269 * configure.in: Attempted to use LYX_PATH_HEADER
11271 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11273 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11274 input from JMarc. Now use preprocessor to find the header.
11275 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11276 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11277 LYX_STL_STRING_FWD. See comments in file.
11279 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11281 * The global MiniBuffer * minibuffer variable is dead.
11283 * The global FD_form_main * fd_form_main variable is dead.
11285 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11287 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11289 * src/table.h: add the LOstream.h header
11290 * src/debug.h: ditto
11292 * src/LyXAction.h: change the explaination of the ReadOnly
11293 attribute: is indicates that the function _can_ be used.
11295 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11298 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11300 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11306 * src/paragraph.C (GetWord): assert on pos>=0
11309 * src/support/lyxstring.C: condition the use of an invariant on
11311 * src/support/lyxstring.h: ditto
11313 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11314 Use LAssert.h instead of plain assert().
11316 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11318 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11319 * src/support/filetools.C: ditto
11321 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11324 * INSTALL: document the new configure flags
11326 * configure.in: suppress --with-debug; add --enable-assertions
11328 * acinclude.m4: various changes in alignment of help strings.
11330 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11332 * src/kbmap.C: commented out the use of the hash map in kb_map,
11333 beginning of movement to a stl::container.
11335 * several files: removed code that was not in effect when
11336 MOVE_TEXT was defined.
11338 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11339 for escaping should not be used. We can discuss if the string
11340 should be enclosed in f.ex. [] instead of "".
11342 * src/trans_mgr.C (insert): use the new returned value from
11343 encodeString to get deadkeys and keymaps done correctly.
11345 * src/chset.C (encodeString): changed to return a pair, to tell
11346 what to use if we know the string.
11348 * src/lyxscreen.h (fillArc): new function.
11350 * src/FontInfo.C (resize): rewritten to use more std::string like
11351 structore, especially string::replace.
11353 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11356 * configure.in (chmod +x some scripts): remove config/gcc-hack
11358 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11360 * src/buffer.C (writeFile): change once again the top comment in a
11361 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11362 instead of an hardcoded version number.
11363 (makeDocBookFile): ditto
11365 * src/version.h: add new define LYX_DOCVERSION
11367 * po/de.po: update from Pit Sütterlin
11368 * lib/bind/de_menus.bind: ditto.
11370 * src/lyxfunc.C (Dispatch): call MenuExport()
11371 * src/buffer.C (Dispatch): ditto
11373 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11374 LyXFunc::Dispatch().
11375 (MenuExport): new function, moved from
11376 LyXFunc::Dispatch().
11378 * src/trans_mgr.C (insert): small cleanup
11379 * src/chset.C (loadFile): ditto
11381 * lib/kbd/iso8859-1.cdef: add missing backslashes
11383 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11385 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11386 help with placing the manually drawn accents better.
11388 (Draw): x2 and hg changed to float to minimize rounding errors and
11389 help place the accents better.
11391 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11392 unsigned short to char is just wrong...cast the char to unsigned
11393 char instead so that the two values can compare sanely. This
11394 should also make the display of insetlatexaccents better and
11395 perhaps also some other insets.
11397 (lbearing): new function
11400 1999-12-15 Allan Rae <rae@lyx.org>
11402 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11403 header that provides a wrapper around the very annoying SGI STL header
11406 * src/support/lyxstring.C, src/LString.h:
11407 removed old SGI-STL-compatability attempts.
11409 * configure.in: Use LYX_STL_STRING_FWD.
11411 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11412 stl_string_fwd.h is around and try to determine it's location.
11413 Major improvement over previous SGI STL 3.2 compatability.
11414 Three small problems remain with this function due to my zero
11415 knowledge of autoconf. JMarc and lgb see the comments in the code.
11417 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11419 * src/broken_const.h, config/hack-gcc, config/README: removed
11421 * configure.in: remove --with-gcc-hack option; do not call
11424 * INSTALL: remove documentation of --with-broken-const and
11427 * acconfig.h: remove all trace of BROKEN_CONST define
11429 * src/buffer.C (makeDocBookFile): update version number in output
11431 (SimpleDocBookOnePar): fix an assert when trying to a character
11432 access beyond string length
11435 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11437 * po/de.po: fix the Export menu
11439 * lyx.man: update the description of -dbg
11441 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11442 (commandLineHelp): updated
11443 (easyParse): show list of available debug levels if -dbg is passed
11446 * src/Makefile.am: add debug.C
11448 * src/debug.h: moved some code to debug.C
11450 * src/debug.C: new file. Contains code to set and show debug
11453 * src/layout.C: remove 'break' after 'continue' in switch
11454 statements, since these cannot be reached.
11456 1999-12-13 Allan Rae <rae@lyx.org>
11458 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11459 (in_word_set): hash() -> math_hash()
11461 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11463 * acconfig.h: Added a test for whether we are using exceptions in the
11464 current compilation run. If so USING_EXCEPTIONS is defined.
11466 * config.in: Check for existance of stl_string_fwd.h
11467 * src/LString.h: If compiling --with-included-string and SGI's
11468 STL version 3.2 is present (see above test) we need to block their
11469 forward declaration of string and supply a __get_c_string().
11470 However, it turns out this is only necessary if compiling with
11471 exceptions enabled so I've a bit more to add yet.
11473 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11474 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11475 src/support/LRegex.h, src/undo.h:
11476 Shuffle the order of the included files a little to ensure that
11477 LString.h gets included before anything that includes stl_string_fwd.h
11479 * src/support/lyxstring.C: We need to #include LString.h instead of
11480 lyxstring.h to get the necessary definition of __get_c_string.
11481 (__get_c_string): New function. This is defined static just like SGI's
11482 although why they need to do this I'm not sure. Perhaps it should be
11483 in lstrings.C instead.
11485 * lib/templates/IEEEtran.lyx: New template file.
11487 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11489 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11490 * intl/Makefile.in (MKINSTALLDIRS): ditto
11492 * src/LyXAction.C (init): changed to hold the LFUN data in a
11493 automatic array in stead of in callso to newFunc, this speeds up
11494 compilation a lot. Also all the memory used by the array is
11495 returned when the init is completed.
11497 * a lot of files: compiled with -Wold-style-cast, changed most of
11498 the reported offenders to C++ style casts. Did not change the
11499 offenders in C files.
11501 * src/trans.h (Match): change argument type to unsigned int.
11503 * src/support/DebugStream.C: fix some types on the streambufs so
11504 that it works on a conforming implementation.
11506 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11508 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11510 * src/support/lyxstring.C: remove the inline added earlier since
11511 they cause a bunch of unsatisfied symbols when linking with dec
11512 cxx. Cxx likes to have the body of inlines at the place where they
11515 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11516 accessing negative bounds in array. This fixes the crash when
11517 inserting accented characters.
11518 * src/trans.h (Match): ditto
11520 * src/buffer.C (Dispatch): since this is a void, it should not try
11521 to return anything...
11523 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11525 * src/buffer.h: removed the two friends from Buffer. Some changes
11526 because of this. Buffer::getFileName and Buffer::setFileName
11527 renamed to Buffer::fileName() and Buffer::fileName(...).
11529 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11531 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11532 and Buffer::update(short) to BufferView. This move is currently
11533 controlled by a define MOVE_TEXT, this will be removed when all
11534 shows to be ok. This move paves the way for better separation
11535 between buffer contents and buffer view. One side effect is that
11536 the BufferView needs a rebreak when swiching buffers, if we want
11537 to avoid this we can add a cache that holds pointers to LyXText's
11538 that is not currently in use.
11540 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11543 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11545 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11547 * lyx_main.C: new command line option -x (or --execute) and
11548 -e (or --export). Now direct conversion from .lyx to .tex
11549 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11550 Unfortunately, X is still needed and the GUI pops up during the
11553 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11555 * src/Spacing.C: add a using directive to bring stream stuff into
11557 * src/paragraph.C: ditto
11558 * src/buffer.C: ditto
11560 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11561 from Lars' announcement).
11563 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11564 example files from Tino Meinen.
11566 1999-12-06 Allan Rae <rae@lyx.org>
11568 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11570 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11572 * src/support/lyxstring.C: added a lot of inline for no good
11575 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11576 latexWriteEndChanges, they were not used.
11578 * src/layout.h (operator<<): output operator for PageSides
11580 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11582 * some example files: loaded in LyX 1.0.4 and saved again to update
11583 certain constructs (table format)
11585 * a lot of files: did the change to use fstream/iostream for all
11586 writing of files. Done with a close look at Andre Poenitz's patch.
11588 * some files: whitespace changes.
11590 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11592 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11593 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11594 architecture, we provide our own. It is used unconditionnally, but
11595 I do not think this is a performance problem. Thanks to Angus
11596 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11597 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11599 (GetInset): use my_memcpy.
11603 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11604 it is easier to understand, but it uses less TeX-only constructs now.
11606 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11607 elements contain spaces
11609 * lib/configure: regenerated
11611 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11612 elements contain spaces; display the list of programs that are
11615 * autogen.sh: make sure lib/configure is executable
11617 * lib/examples/*: rename the tutorial examples to begin with the
11618 two-letters language code.
11620 * src/lyxfunc.C (getStatus): do not query current font if no
11623 * src/lyx_cb.C (RunScript): use QuoteName
11624 (MenuRunDvips): ditto
11625 (PrintApplyCB): ditto
11627 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11628 around argument, so that it works well with the current shell.
11629 Does not work properly with OS/2 shells currently.
11631 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11632 * src/LyXSendto.C (SendtoApplyCB): ditto
11633 * src/lyxfunc.C (Dispatch): ditto
11634 * src/buffer.C (runLaTeX): ditto
11635 (runLiterate): ditto
11636 (buildProgram): ditto
11638 * src/lyx_cb.C (RunScript): ditto
11639 (MenuMakeLaTeX): ditto
11641 * src/buffer.h (getLatexName): new method
11643 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11645 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11647 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11648 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11649 (create_math_panel): ditto
11651 * src/lyxfunc.C (getStatus): re-activate the code which gets
11652 current font and cursor; add test for export to html.
11654 * src/lyxrc.C (read): remove unreachable break statements; add a
11657 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11659 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11661 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11662 introduced by faulty regex.
11663 * src/buffer.C: ditto
11664 * src/lastfiles.C: ditto
11665 * src/paragraph.C: ditto
11666 * src/table.C: ditto
11667 * src/vspace.C: ditto
11668 * src/insets/figinset.C: ditto
11669 Note: most of these is absolutely harmless, except the one in
11670 src/mathed formula.C.
11672 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11674 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11675 operation, yielding correct results for the reLyX command.
11677 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11679 * src/support/filetools.C (ExpandPath): removed an over eager
11681 (ReplaceEnvironmentPath): ditto
11683 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11684 shows that we are doing something fishy in our code...
11685 (BubblePost): ditto
11688 * src/lyxrc.C (read): use a double switch trick to get more help
11689 from the compiler. (the same trick is used in layout.C)
11690 (write): new function. opens a ofstream and pass that to output
11691 (output): new function, takes a ostream and writes the lyxrc
11692 elemts to it. uses a dummy switch to make sure no elements are
11695 * src/lyxlex.h: added a struct pushpophelper for use in functions
11696 with more than one exit point.
11698 * src/lyxlex.[Ch] (GetInteger): made it const
11702 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11704 * src/layout.[hC] : LayoutTags splitted into several enums, new
11705 methods created, better error handling cleaner use of lyxlex. Read
11708 * src/bmtable.[Ch]: change some member prototypes because of the
11709 image const changes.
11711 * commandtags.h, src/LyXAction.C (init): new function:
11712 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11713 This file is not read automatically but you can add \input
11714 preferences to your lyxrc if you want to. We need to discuss how
11717 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11718 in .aux, also remove .bib and .bst files from dependencies when
11721 * src/BufferView.C, src/LyXView.C: add const_cast several places
11722 because of changes to images.
11724 * lib/images/*: same change as for images/*
11726 * lib/lyxrc.example: Default for accept_compound is false not no.
11728 * images/*: changed to be const, however I have som misgivings
11729 about this change so it might be changed back.
11731 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11733 * lib/configure, po/POTFILES.in: regenerated
11735 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11737 * config/lib_configure.m4: removed
11739 * lib/configure.m4: new file (was config/lib_configure.m4)
11741 * configure.in: do not test for rtti, since we do not use it.
11743 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11745 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11746 doubling of allocated space scheme. This makes it faster for large
11747 strings end to use less memory for small strings. xtra rememoved.
11749 * src/insets/figinset.C (waitalarm): commented out.
11750 (GhostscriptMsg): use static_cast
11751 (GhostscriptMsg): use new instead of malloc to allocate memory for
11752 cmap. also delete the memory after use.
11754 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11756 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11757 for changes in bibtex database or style.
11758 (runBibTeX): remove all .bib and .bst files from dep before we
11760 (run): use scanAuc in when dep file already exist.
11762 * src/DepTable.C (remove_files_with_extension): new method
11763 (exist): new method
11765 * src/DepTable.[Ch]: made many of the methods const.
11767 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11769 * src/bufferparams.C: make sure that the default textclass is
11770 "article". It used to be the first one by description order, but
11771 now the first one is "docbook".
11773 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11774 string; call Debug::value.
11775 (easyParse): pass complete argument to setDebuggingLevel().
11777 * src/debug.h (value): fix the code that parses debug levels.
11779 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11782 * src/LyXAction.C: use Debug::ACTION as debug channel.
11784 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11786 * NEWS: updated for the future 1.1.3 release.
11788 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11789 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11790 it should. This is of course a controversial change (since many
11791 people will find that their lyx workscreen is suddenly full of
11792 red), but done for the sake of correctness.
11794 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11795 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11797 * src/insets/inseterror.h, src/insets/inseturl.h,
11798 src/insets/insetinfo.h, src/insets/figinset.h,
11799 src/mathed/formulamacro.h, src/mathed/math_macro.h
11800 (EditMessage): add a missing const and add _() to make sure that
11801 translation happens
11803 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11804 src/insets/insetbib.C, src/support/filetools.C: add `using'
11805 directives for cxx.
11807 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11808 doing 'Insert index of last word' at the beginning of a paragraph.
11810 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11812 * several files: white-space changes.
11814 * src/mathed/formula.C: removed IsAlpha and IsDigit
11816 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11817 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11820 * src/insets/figinset.C (GetPSSizes): don't break when
11821 "EndComments" is seen. But break when a boundingbox is read.
11823 * all classes inherited from Inset: return value of Clone
11824 changed back to Inset *.
11826 * all classes inherited form MathInset: return value of Clone
11827 changed back to MathedInset *.
11829 * src/insets/figinset.C (runqueue): use a ofstream to output the
11830 gs/ps file. Might need some setpresicion or setw. However I can
11831 see no problem with the current code.
11832 (runqueue): use sleep instead of the alarm/signal code. I just
11833 can't see the difference.
11835 * src/paragraph.C (LyXParagraph): reserve space in the new
11836 paragraph and resize the inserted paragraph to just fit.
11838 * src/lyxfunc.h (operator|=): added operator for func_status.
11840 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11841 check for readable file.
11843 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11844 check for readable file.
11845 (MenuMakeLinuxDoc): ditto
11846 (MenuMakeDocBook): ditto
11847 (MenuMakeAscii): ditto
11848 (InsertAsciiFile): split the test for openable and readable
11850 * src/bmtable.C (draw_bitmaptable): use
11851 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11853 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11854 findtexfile from LaTeX to filetools.
11856 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11857 instead of FilePtr. Needs to be verified by a literate user.
11859 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11861 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11862 (EditMessage): likewise.
11864 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11865 respectively as \textasciitilde and \textasciicircum.
11867 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11869 * src/support/lyxstring.h: made the methods that take iterators
11870 use const_iterator.
11872 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11873 (regexMatch): made is use the real regex class.
11875 * src/support/Makefile.am: changed to use libtool
11877 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11879 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11881 (MathIsInset ++): changed several macros to be inline functions
11884 * src/mathed/Makefile.am: changed to use libtool
11886 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11888 * src/insets/inset* : Clone changed to const and return type is
11889 the true insettype not just Inset*.
11891 * src/insets/Makefile.am: changed to use libtool
11893 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11895 * src/undo.[Ch] : added empty() and changed some of the method
11898 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11900 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11901 setID use block<> for the bullets array, added const several places.
11903 * src/lyxfunc.C (getStatus): new function
11905 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11906 LyXAction, added const to several funtions.
11908 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11909 a std::map, and to store the dir items in a vector.
11911 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11914 * src/LyXView.[Ch] + other files : changed currentView to view.
11916 * src/LyXAction.[Ch] : ported from the old devel branch.
11918 * src/.cvsignore: added .libs and a.out
11920 * configure.in : changes to use libtool.
11922 * acinclude.m4 : inserted libtool.m4
11924 * .cvsignore: added libtool
11926 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11928 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11929 file name in insets and mathed directories (otherwise the
11930 dependency is not taken in account under cygwin).
11932 * src/text2.C (InsertString[AB]): make sure that we do not try to
11933 read characters past the string length.
11935 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11937 * lib/doc/LaTeXConfig.lyx.in,
11938 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11940 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11941 file saying who created them and when this heppened; this is
11942 useless and annoys tools like cvs.
11944 * lib/layouts/g-brief-{en,de}.layout,
11945 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11946 from Thomas Hartkens <thomas@hartkens.de>.
11948 * src/{insets,mathed}/Makefile.am: do not declare an empty
11949 LDFLAGS, so that it can be set at configure time (useful on Irix
11952 * lib/reLyX/configure.in: make sure that the prefix is set
11953 correctly in LYX_DIR.
11955 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11957 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11958 be used by 'command-sequence' this allows to bind a key to a
11959 sequence of LyX-commands
11960 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11962 * src/LyXAction.C: add "command-sequence"
11964 * src/LyXFunction.C: handling of "command-sequence"
11966 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11967 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11969 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11971 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11973 * src/buffer.C (writeFile): Do not output a comment giving user
11974 and date at the beginning of a .lyx file. This is useless and
11975 annoys cvs anyway; update version number to 1.1.
11977 * src/Makefile.am (LYX_DIR): add this definition, so that a
11978 default path is hardcoded in LyX.
11980 * configure.in: Use LYX_GNU_GETTEXT.
11982 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11983 AM_GNU_GETTEXT with a bug fixed.
11985 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11987 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11989 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11990 which is used to point to LyX data is now LYX_DIR_11x.
11992 * lyx.man: convert to a unix text file; small updates.
11994 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11996 * src/support/LSubstring.[Ch]: made the second arg of most of the
11997 constructors be a const reference.
11999 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
12002 * src/support/lyxstring.[Ch] (swap): added missing member function
12003 and specialization of swap(str, str);
12005 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
12007 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
12008 trace of the old one.
12010 * src/undo.[Ch]: made the undostack use std::list to store undo's in
12011 put the member definitions in undo.C.
12013 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
12014 NEW_TEXT and have now only code that was included when this was
12017 * src/intl.C (LCombo): use static_cast
12019 (DispatchCallback): ditto
12021 * src/definitions.h: removed whole file
12023 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
12025 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
12026 parsing and stores in a std:map. a regex defines the file format.
12027 removed unneeded members.
12029 * src/bufferparams.h: added several enums from definitions.h here.
12030 Removed unsused destructor. Changed some types to use proper enum
12031 types. use block to have the temp_bullets and user_defined_bullets
12032 and to make the whole class assignable.
12034 * src/bufferparams.C (Copy): removed this functions, use a default
12035 assignment instead.
12037 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
12040 * src/buffer.C (readLyXformat2): commend out all that have with
12041 oldpapersize to do. also comment out all that hve to do with
12042 insetlatex and insetlatexdel.
12043 (setOldPaperStuff): commented out
12045 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
12047 * src/LyXAction.C: remove use of inset-latex-insert
12049 * src/mathed/math_panel.C (button_cb): use static_cast
12051 * src/insets/Makefile.am (insets_o_SOURCES): removed
12054 * src/support/lyxstring.C (helper): use the unsigned long
12055 specifier, UL, instead of a static_cast.
12057 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
12059 * src/support/block.h: new file. to be used as a c-style array in
12060 classes, so that the class can be assignable.
12062 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12064 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
12065 NULL, make sure to return an empty string (it is not possible to
12066 set a string to NULL).
12068 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12070 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
12072 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
12074 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
12075 link line, so that Irix users (for example) can set it explicitely to
12078 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
12079 it can be overidden at make time (static or dynamic link, for
12082 * src/vc-backend.C, src/LaTeXFeatures.h,
12083 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12084 statements to bring templates to global namespace.
12086 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12088 * src/support/lyxstring.C (operator[] const): make it standard
12091 * src/minibuffer.C (Init): changed to reflect that more
12092 information is given from the lyxvc and need not be provided here.
12094 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12096 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12098 * src/LyXView.C (UpdateTimerCB): use static_cast
12099 (KeyPressMask_raw_callback): ditto
12101 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12102 buffer_, a lot of changes because of this. currentBuffer() ->
12103 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12104 also changes to other files because of this.
12106 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12108 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12109 have no support for RCS and partial support for CVS, will be
12112 * src/insets/ several files: changes because of function name
12113 changes in Bufferview and LyXView.
12115 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12117 * src/support/LSubstring.[Ch]: new files. These implement a
12118 Substring that can be very convenient to use. i.e. is this
12120 string a = "Mary had a little sheep";
12121 Substring(a, "sheep") = "lamb";
12122 a is now "Mary has a little lamb".
12124 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12125 out patterns and subpatterns of strings. It is used by LSubstring
12126 and also by vc-backend.C
12128 * src/support/lyxstring.C: went over all the assertions used and
12129 tried to correct the wrong ones and flag which of them is required
12130 by the standard. some bugs found because of this. Also removed a
12131 couple of assertions.
12133 * src/support/Makefile.am (libsupport_a_SOURCES): added
12134 LSubstring.[Ch] and LRegex.[Ch]
12136 * src/support/FileInfo.h: have struct stat buf as an object and
12137 not a pointer to one, some changes because of this.
12139 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12140 information in layout when adding the layouts preamble to the
12141 textclass preamble.
12143 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12146 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12147 because of bug in OS/2.
12149 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12151 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12152 \verbatim@font instead of \ttfamily, so that it can be redefined.
12154 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12155 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12156 src/layout.h, src/text2.C: add 'using' directive to bring the
12157 STL templates we need from the std:: namespace to the global one.
12158 Needed by DEC cxx in strict ansi mode.
12160 * src/support/LIstream.h,src/support/LOstream.h,
12161 src/support/lyxstring.h,src/table.h,
12162 src/lyxlookup.h: do not include <config.h> in header
12163 files. This should be done in the .C files only.
12165 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12169 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12171 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12172 from Kayvan to fix the tth invokation.
12174 * development/lyx.spec.in: updates from Kayvan to reflect the
12175 changes of file names.
12177 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12179 * src/text2.C (InsertStringB): use std::copy
12180 (InsertStringA): use std::copy
12182 * src/bufferlist.C: use a vector to store the buffers in. This is
12183 an internal change and should not affect any other thing.
12185 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12188 * src/text.C (Fill): fix potential bug, one off bug.
12190 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12192 * src/Makefile.am (lyx_main.o): add more files it depends on.
12194 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12196 * src/support/lyxstring.C: use size_t for the reference count,
12197 size, reserved memory and xtra.
12198 (internal_compare): new private member function. Now the compare
12199 functions should work for std::strings that have embedded '\0'
12201 (compare): all compare functions rewritten to use
12204 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12206 * src/support/lyxstring.C (compare): pass c_str()
12207 (compare): pass c_str
12208 (compare): pass c_str
12210 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12212 * src/support/DebugStream.C: <config.h> was not included correctly.
12214 * lib/configure: forgot to re-generate it :( I'll make this file
12215 auto generated soon.
12217 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12219 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12222 * src/support/lyxstring.C: some changes from length() to rep->sz.
12223 avoids a function call.
12225 * src/support/filetools.C (SpaceLess): yet another version of the
12226 algorithm...now per Jean-Marc's suggestions.
12228 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12230 * src/layout.C (less_textclass_desc): functor for use in sorting
12232 (LyXTextClass::Read): sort the textclasses after reading.
12234 * src/support/filetools.C (SpaceLess): new version of the
12235 SpaceLess functions. What problems does this one give? Please
12238 * images/banner_bw.xbm: made the arrays unsigned char *
12240 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12242 * src/support/lyxstring.C (find): remove bogus assertion in the
12243 two versions of find where this has not been done yet.
12245 * src/support/lyxlib.h: add missing int return type to
12248 * src/menus.C (ShowFileMenu): disable exporting to html if no
12249 html export command is present.
12251 * config/lib_configure.m4: add a test for an HTML converter. The
12252 programs checked for are, in this order: tth, latex2html and
12255 * lib/configure: generated from config/lib_configure.m4.
12257 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12258 html converter. The parameters are now passed through $$FName and
12259 $$OutName, instead of standard input/output.
12261 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12263 * lib/lyxrc.example: update description of \html_command.
12264 add "quotes" around \screen_font_xxx font setting examples to help
12265 people who use fonts with spaces in their names.
12267 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12269 * Distribution files: updates for v1.1.2
12271 * src/support/lyxstring.C (find): remove bogus assert and return
12272 npos for the same condition.
12274 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12276 * added patch for OS/2 from SMiyata.
12278 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12280 * src/text2.C (CutSelection): make space_wrapped a bool
12281 (CutSelection): dont declare int i until we have to.
12282 (alphaCounter): return a char const *.
12284 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12286 * src/support/syscall.C (Systemcalls::kill):
12287 src/support/filetools.C (PutEnv, PutEnvPath):
12288 src/lyx_cb.C (addNewlineAndDepth):
12289 src/FontInfo.C (FontInfo::resize): condition some #warning
12290 directives with WITH_WARNINGS.
12293 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12295 * src/layout.[Ch] + several files: access to class variables
12296 limited and made accessor functions instead a lot of code changed
12297 becuase of this. Also instead of returning pointers often a const
12298 reference is returned instead.
12300 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12302 * src/Makefile.am (dist-hook): added used to remove the CVS from
12303 cheaders upon creating a dist
12304 (EXTRA_DIST): added cheaders
12306 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12307 a character not as a small integer.
12309 * src/support/lyxstring.C (find): removed Assert and added i >=
12310 rep->sz to the first if.
12312 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12314 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12315 src/LyXView.C src/buffer.C src/bufferparams.C
12316 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12317 src/text2.C src/insets/insetinclude.C:
12318 lyxlayout renamed to textclasslist.
12320 * src/layout.C: some lyxerr changes.
12322 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12323 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12324 (LyXLayoutList): removed all traces of this class.
12325 (LyXTextClass::Read): rewrote LT_STYLE
12326 (LyXTextClass::hasLayout): new function
12327 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12328 both const and nonconst version.
12329 (LyXTextClass::delete_layout): new function.
12330 (LyXTextClassList::Style): bug fix. do the right thing if layout
12332 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12333 (LyXTextClassList::NameOfLayout): ditto
12334 (LyXTextClassList::Load): ditto
12336 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12338 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12340 * src/LyXAction.C (LookupFunc): added a workaround for sun
12341 compiler, on the other hand...we don't know if the current code
12342 compiles on sun at all...
12344 * src/support/filetools.C (CleanupPath): subst fix
12346 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12349 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12350 complained about this one?
12352 * src/insets/insetinclude.C (Latex): subst fix
12354 * src/insets/insetbib.C (getKeys): subst fix
12356 * src/LyXSendto.C (SendtoApplyCB): subst fix
12358 * src/lyx_main.C (init): subst fix
12360 * src/layout.C (Read): subst fix
12362 * src/lyx_sendfax_main.C (button_send): subst fix
12364 * src/buffer.C (RoffAsciiTable): subst fix
12366 * src/lyx_cb.C (MenuFax): subst fix
12367 (PrintApplyCB): subst fix
12369 1999-10-26 Juergen Vigna <jug@sad.it>
12371 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12373 (Read): Cleaned up this code so now we read only format vestion >= 5
12375 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12377 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12378 come nobody has complained about this one?
12380 * src/insets/insetinclude.C (Latex): subst fix
12382 * src/insets/insetbib.C (getKeys): subst fix
12384 * src/lyx_main.C (init): subst fix
12386 * src/layout.C (Read): subst fix
12388 * src/buffer.C (RoffAsciiTable): subst fix
12390 * src/lyx_cb.C (MenuFax): subst fix.
12392 * src/layout.[hC] + some other files: rewrote to use
12393 std::container to store textclasses and layouts in.
12394 Simplified, removed a lot of code. Make all classes
12395 assignable. Further simplifications and review of type
12396 use still to be one.
12398 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12399 lastfiles to create the lastfiles partr of the menu.
12401 * src/lastfiles.[Ch]: rewritten to use deque to store the
12402 lastfiles in. Uses fstream for reading and writing. Simplifies
12405 * src/support/syscall.C: remove explicit cast.
12407 * src/BufferView.C (CursorToggleCB): removed code snippets that
12408 were commented out.
12409 use explicat C++ style casts instead of C style casts. also use
12410 u_vdata instea of passing pointers in longs.
12412 * src/PaperLayout.C: removed code snippets that were commented out.
12414 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12416 * src/lyx_main.C: removed code snippets that wer commented out.
12418 * src/paragraph.C: removed code snippets that were commented out.
12420 * src/lyxvc.C (logClose): use static_cast
12422 (viewLog): remove explicit cast to void*
12423 (showLog): removed old commented code
12425 * src/menus.C: use static_cast instead of C style casts. use
12426 u_vdata instead of u_ldata. remove explicit cast to (long) for
12427 pointers. Removed old code that was commented out.
12429 * src/insets/inset.C: removed old commented func
12431 * src/insets/insetref.C (InsetRef): removed old code that had been
12432 commented out for a long time.
12434 (escape): removed C style cast
12436 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12438 * src/insets/insetlatex.C (Draw): removed old commented code
12439 (Read): rewritten to use string
12441 * src/insets/insetlabel.C (escape): removed C style cast
12443 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12445 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12446 old commented code.
12448 * src/insets/insetinclude.h: removed a couple of stupid bools
12450 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12451 (Clone): remove C style cast
12452 (getKeys): changed list to lst because of std::list
12454 * src/insets/inseterror.C (Draw): removed som old commented code.
12456 * src/insets/insetcommand.C (Draw): removed some old commented code.
12458 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12459 commented out forever.
12460 (bibitem_cb): use static_cast instead of C style cast
12461 use of vdata changed to u_vdata.
12463 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12465 (CloseUrlCB): use static_cast instead of C style cast.
12466 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12468 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12469 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12470 (CloseInfoCB): static_cast from ob->u_vdata instead.
12471 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12474 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12475 (C_InsetError_CloseErrorCB): forward the ob parameter
12476 (CloseErrorCB): static_cast from ob->u_vdata instead.
12478 * src/vspace.h: include LString.h since we use string in this class.
12480 * src/vspace.C (lyx_advance): changed name from advance because of
12481 nameclash with stl. And since we cannot use namespaces yet...I
12482 used a lyx_ prefix instead. Expect this to change when we begin
12485 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12487 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12488 and removed now defunct constructor and deconstructor.
12490 * src/BufferView.h: have backstack as a object not as a pointer.
12491 removed initialization from constructor. added include for BackStack
12493 * development/lyx.spec.in (%build): add CFLAGS also.
12495 * src/screen.C (drawFrame): removed another warning.
12497 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12499 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12500 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12501 README and ANNOUNCE a bit for the next release. More work is
12504 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12505 unbreakable if we are in freespacing mode (LyX-Code), but not in
12508 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12510 * src/BackStack.h: fixed initialization order in constructor
12512 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12514 * acinclude.m4 (VERSION): new rules for when a version is
12515 development, added also a variable for prerelease.
12516 (warnings): we set with_warnings=yes for prereleases
12517 (lyx_opt): prereleases compile with same optimization as development
12518 (CXXFLAGS): only use pedantic if we are a development version
12520 * src/BufferView.C (restorePosition): don't do anything if the
12521 backstack is empty.
12523 * src/BackStack.h: added member empty, use this to test if there
12524 is anything to pop...
12526 1999-10-25 Juergen Vigna <jug@sad.it>
12529 * forms/layout_forms.fd +
12530 * forms/latexoptions.fd +
12531 * lyx.fd: changed for various form resize issues
12533 * src/mathed/math_panel.C +
12534 * src/insets/inseterror.C +
12535 * src/insets/insetinfo.C +
12536 * src/insets/inseturl.C +
12537 * src/insets/inseturl.h +
12539 * src/LyXSendto.C +
12540 * src/PaperLayout.C +
12541 * src/ParagraphExtra.C +
12542 * src/TableLayout.C +
12544 * src/layout_forms.C +
12551 * src/menus.C: fixed various resize issues. So now forms can be
12552 resized savely or not be resized at all.
12554 * forms/form_url.fd +
12555 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12558 * src/insets/Makefile.am: added files form_url.[Ch]
12560 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12562 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12563 (and presumably 6.2).
12565 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12566 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12567 remaining static member callbacks.
12569 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12572 * src/support/lyxstring.h: declare struct Srep as friend of
12573 lyxstring, since DEC cxx complains otherwise.
12575 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12577 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12579 * src/LaTeX.C (run): made run_bibtex also depend on files with
12581 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12582 are put into the dependency file.
12584 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12585 the code has shown itself to work
12586 (create_ispell_pipe): removed another warning, added a comment
12589 * src/minibuffer.C (ExecutingCB): removed code that has been
12590 commented out a long time
12592 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12593 out code + a warning.
12595 * src/support/lyxstring.h: comment out the three private
12596 operators, when compiling with string ansi conforming compilers
12597 they make problems.
12599 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12601 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12602 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12605 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12608 * src/mathed/math_panel.C (create_math_panel): remove explicit
12611 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12614 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12615 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12616 to XCreatePixmapFromBitmapData
12617 (fl_set_bmtable_data): change the last argument to be unsigned
12619 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12620 and bh to be unsigned int, remove explicit casts in call to
12621 XReadBitmapFileData.
12623 * images/arrows.xbm: made the arrays unsigned char *
12624 * images/varsz.xbm: ditto
12625 * images/misc.xbm: ditto
12626 * images/greek.xbm: ditto
12627 * images/dots.xbm: ditto
12628 * images/brel.xbm: ditto
12629 * images/bop.xbm: ditto
12631 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12633 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12634 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12635 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12637 (LYX_CXX_CHEADERS): added <clocale> to the test.
12639 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12641 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12643 * src/support/lyxstring.C (append): fixed something that must be a
12644 bug, rep->assign was used instead of rep->append.
12646 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12649 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12650 lyx insert double chars. Fix spotted by Kayvan.
12652 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12654 * Fixed the tth support. I messed up with the Emacs patch apply feature
12655 and omitted the changes in lyxrc.C.
12657 1999-10-22 Juergen Vigna <jug@sad.it>
12659 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12661 * src/lyx_cb.C (MenuInsertRef) +
12662 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12663 the form cannot be resized under it limits (fixes a segfault)
12665 * src/lyx.C (create_form_form_ref) +
12666 * forms/lyx.fd: Changed Gravity on name input field so that it is
12669 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12671 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12672 <ostream> and <istream>.
12674 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12675 whether <fstream> provides the latest standard features, or if we
12676 have an oldstyle library (like in egcs).
12677 (LYX_CXX_STL_STRING): fix the test.
12679 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12680 code on MODERN_STL_STREAM.
12682 * src/support/lyxstring.h: use L{I,O}stream.h.
12684 * src/support/L{I,O}stream.h: new files, designed to setup
12685 correctly streams for our use
12686 - includes the right header depending on STL capabilities
12687 - puts std::ostream and std::endl (for LOStream.h) or
12688 std::istream (LIStream.h) in toplevel namespace.
12690 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12692 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12693 was a bib file that had been changed we ensure that bibtex is run.
12694 (runBibTeX): enhanced to extract the names of the bib files and
12695 getting their absolute path and enter them into the dep file.
12696 (findtexfile): static func that is used to look for tex-files,
12697 checks for absolute patchs and tries also with kpsewhich.
12698 Alternative ways of finding the correct files are wanted. Will
12700 (do_popen): function that runs a command using popen and returns
12701 the whole output of that command in a string. Should be moved to
12704 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12705 file with extension ext has changed.
12707 * src/insets/figinset.C: added ifdef guards around the fl_free
12708 code that jug commented out. Now it is commented out when
12709 compiling with XForms == 0.89.
12711 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12712 to lyxstring.C, and only keep a forward declaration in
12713 lyxstring.h. Simplifies the header file a bit and should help a
12714 bit on compile time too. Also changes to Srep will not mandate a
12715 recompile of code just using string.
12716 (~lyxstring): definition moved here since it uses srep.
12717 (size): definition moved here since it uses srep.
12719 * src/support/lyxstring.h: removed a couple of "inline" that should
12722 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12724 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12727 1999-10-21 Juergen Vigna <jug@sad.it>
12729 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12730 set to left if I just remove the width entry (or it is empty).
12732 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12733 paragraph when having dummy paragraphs.
12735 1999-10-20 Juergen Vigna <jug@sad.it>
12737 * src/insets/figinset.C: just commented some fl_free_form calls
12738 and added warnings so that this calls should be activated later
12739 again. This avoids for now a segfault, but we have a memory leak!
12741 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12742 'const char * argument' to 'string argument', this should
12743 fix some Asserts() in lyxstring.C.
12745 * src/lyxfunc.h: Removed the function argAsString(const char *)
12746 as it is not used anymore.
12748 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12750 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12753 * src/Literate.h: some funcs moved from public to private to make
12754 interface clearer. Unneeded args removed.
12756 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12758 (scanBuildLogFile): ditto
12760 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12761 normal TeX Error. Still room for improvement.
12763 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12765 * src/buffer.C (insertErrors): changes to make the error
12766 desctription show properly.
12768 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12771 * src/support/lyxstring.C (helper): changed to use
12772 sizeof(object->rep->ref).
12773 (operator>>): changed to use a pointer instead.
12775 * src/support/lyxstring.h: changed const reference & to value_type
12776 const & lets see if that helps.
12778 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12780 * Makefile.am (rpmdist): fixed to have non static package and
12783 * src/support/lyxstring.C: removed the compilation guards
12785 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12788 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12789 conditional compile of lyxstring.Ch
12791 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12792 stupid check, but it is a lot better than the bastring hack.
12793 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12795 * several files: changed string::erase into string::clear. Not
12798 * src/chset.C (encodeString): use a char temporary instead
12800 * src/table.C (TexEndOfCell): added tostr around
12801 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12802 (TexEndOfCell): ditto
12803 (TexEndOfCell): ditto
12804 (TexEndOfCell): ditto
12805 (DocBookEndOfCell): ditto
12806 (DocBookEndOfCell): ditto
12807 (DocBookEndOfCell): ditto
12808 (DocBookEndOfCell): ditto
12810 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12812 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12814 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12815 (MenuBuildProg): added tostr around ret
12816 (MenuRunChktex): added tostr around ret
12817 (DocumentApplyCB): added tostr around ret
12819 * src/chset.C (encodeString): added tostr around t->ic
12821 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12822 (makeLaTeXFile): added tostr around tocdepth
12823 (makeLaTeXFile): added tostr around ftcound - 1
12825 * src/insets/insetbib.C (setCounter): added tostr around counter.
12827 * src/support/lyxstring.h: added an operator+=(int) to catch more
12830 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12831 (lyxstring): We DON'T allow NULL pointers.
12833 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12835 * src/mathed/math_macro.C (MathMacroArgument::Write,
12836 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12837 when writing them out.
12839 * src/LString.C: remove, since it is not used anymore.
12841 * src/support/lyxstring.C: condition the content to
12842 USE_INCLUDED_STRING macro.
12844 * src/mathed/math_symbols.C, src/support/lstrings.C,
12845 src/support/lyxstring.C: add `using' directive to specify what
12846 we need in <algorithm>. I do not think that we need to
12847 conditionalize this, but any thought is appreciated.
12849 * many files: change all callback functions to "C" linkage
12850 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12851 strict_ansi. Those who were static are now global.
12852 The case of callbacks which are static class members is
12853 trickier, since we have to make C wrappers around them (see
12854 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12855 did not finish this yet, since it defeats the purpose of
12856 encapsulation, and I am not sure what the best route is.
12858 1999-10-19 Juergen Vigna <jug@sad.it>
12860 * src/support/lyxstring.C (lyxstring): we permit to have a null
12861 pointer as assignment value and just don't assign it.
12863 * src/vspace.C (nextToken): corrected this function substituting
12864 find_first(_not)_of with find_last_of.
12866 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12867 (TableOptCloseCB) (TableSpeCloseCB):
12868 inserted fl_set_focus call for problem with fl_hide_form() in
12871 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12873 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12876 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12878 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12879 LyXLex::next() and not eatline() to get its argument.
12881 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12883 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12884 instead, use fstreams for io of the depfile, removed unneeded
12885 functions and variables.
12887 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12888 vector instead, removed all functions and variables that is not in
12891 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12893 * src/buffer.C (insertErrors): use new interface to TeXError
12895 * Makefile.am (rpmdist): added a rpmdist target
12897 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12898 per Kayvan's instructions.
12900 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12902 * src/Makefile.am: add a definition for localedir, so that locales
12903 are found after installation (Kayvan)
12905 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12907 * development/.cvsignore: new file.
12909 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12911 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12912 C++ compiler provides wrappers for C headers and use our alternate
12915 * configure.in: use LYX_CXX_CHEADERS.
12917 * src/cheader/: new directory, populated with cname headers from
12918 libstdc++-2.8.1. They are a bit old, but probably good enough for
12919 what we want (support compilers who lack them).
12921 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12922 from includes. It turns out is was stupid.
12924 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12926 * lib/Makefile.am (install-data-local): forgot a ';'
12927 (install-data-local): forgot a '\'
12928 (libinstalldirs): needed after all. reintroduced.
12930 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12932 * configure.in (AC_OUTPUT): added lyx.spec
12934 * development/lyx.spec: removed file
12936 * development/lyx.spec.in: new file
12938 * po/*.po: merged with lyx.pot becuase of make distcheck
12940 * lib/Makefile.am (dist-hook): added dist-hook so that
12941 documentation files will be included when doing a make
12942 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12943 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12945 more: tried to make install do the right thing, exclude CVS dirs
12948 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12949 Path would fit in more nicely.
12951 * all files that used to use pathstack: uses now Path instead.
12952 This change was a lot easier than expected.
12954 * src/support/path.h: new file
12956 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12958 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12960 * src/support/lyxstring.C (getline): Default arg was given for
12963 * Configure.cmd: removed file
12965 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12967 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12968 streams classes and types, add the proper 'using' statements when
12969 MODERN_STL is defined.
12971 * src/debug.h: move the << operator definition after the inclusion
12974 * src/support/filetools.C: include "LAssert.h", which is needed
12977 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12980 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12981 include "debug.h" to define a proper ostream.
12983 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12985 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12986 method to the SystemCall class which can kill a process, but it's
12987 not fully implemented yet.
12989 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12991 * src/support/FileInfo.h: Better documentation
12993 * src/lyxfunc.C: Added support for buffer-export html
12995 * src/menus.C: Added Export->As HTML...
12997 * lib/bind/*.bind: Added short-cut for buffer-export html
12999 * src/lyxrc.*: Added support for new \tth_command
13001 * lib/lyxrc.example: Added stuff for new \tth_command
13003 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
13005 * lib/Makefile.am (IMAGES): removed images/README
13006 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
13007 installes in correct place. Check permisions is installed
13010 * src/LaTeX.C: some no-op changes moved declaration of some
13013 * src/LaTeX.h (LATEX_H): changed include guard name
13015 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13017 * lib/reLyX/Makefile.am: install noweb2lyx.
13019 * lib/Makefile.am: install configure.
13021 * lib/reLyX/configure.in: declare a config aux dir; set package
13022 name to lyx (not sure what the best solution is); generate noweb2lyx.
13024 * lib/layouts/egs.layout: fix the bibliography layout.
13026 1999-10-08 Jürgen Vigna <jug@sad.it>
13028 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
13029 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
13030 it returned without continuing to search the path.
13032 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
13034 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
13035 also fixes a bug. It is not allowed to do tricks with std::strings
13036 like: string a("hei"); &a[e]; this will not give what you
13037 think... Any reason for the complexity in this func?
13039 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
13041 * Updated README and INSTALL a bit, mostly to check that my
13042 CVS rights are correctly set up.
13044 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
13046 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
13047 does not allow '\0' chars but lyxstring and std::string does.
13049 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
13051 * autogen.sh (AUTOCONF): let the autogen script create the
13052 POTFILES.in file too. POTFILES.in should perhaps now not be
13053 included in the cvs module.
13055 * some more files changed to use C++ includes instead of C ones.
13057 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
13059 (Reread): added tostr to nlink. buggy output otherwise.
13060 (Reread): added a string() around szMode when assigning to Buffer,
13061 without this I got a log of garbled info strings.
13063 * acconfig.h: commented out the PTR_AS_INT macros. They should not
13066 * I have added several ostream & operator<<(ostream &, some_type)
13067 functions. This has been done to avoid casting and warnings when
13068 outputting enums to lyxerr. This as thus eliminated a lot of
13069 explicit casts and has made the code clearer. Among the enums
13070 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
13071 mathed enums, some font enum the Debug::type enum.
13073 * src/support/lyxstring.h (clear): missing method. equivalent of
13076 * all files that contained "stderr": rewrote constructs that used
13077 stderr to use lyxerr instead. (except bmtable)
13079 * src/support/DebugStream.h (level): and the passed t with
13080 Debug::ANY to avoid spurious bits set.
13082 * src/debug.h (Debug::type value): made it accept strings of the
13083 type INFO,INIT,KEY.
13085 * configure.in (Check for programs): Added a check for kpsewhich,
13086 the latex generation will use this later to better the dicovery of
13089 * src/BufferView.C (create_view): we don't need to cast this to
13090 (void*) that is done automatically.
13091 (WorkAreaButtonPress): removed some dead code.
13093 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13095 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13096 is not overwritten when translated (David Sua'rez de Lis).
13098 * lib/CREDITS: Added David Sua'rez de Lis
13100 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13102 * src/bufferparams.C (BufferParams): default input encoding is now
13105 * acinclude.m4 (cross_compiling): comment out macro
13106 LYX_GXX_STRENGTH_REDUCE.
13108 * acconfig.h: make sure that const is not defined (to empty) when
13109 we are compiling C++. Remove commented out code using SIZEOF_xx
13112 * configure.in : move the test for const and inline as late as
13113 possible so that these C tests do not interefere with C++ ones.
13114 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13115 has not been proven.
13117 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13119 * src/table.C (getDocBookAlign): remove bad default value for
13120 isColumn parameter.
13122 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13124 (ShowFileMenu2): ditto.
13126 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13127 of files to ignore.
13129 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13131 * Most files: finished the change from the old error code to use
13132 DebugStream for all lyxerr debugging. Only minor changes remain
13133 (e.g. the setting of debug levels using strings instead of number)
13135 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13137 * src/layout.C (Add): Changed to use compare_no_case instead of
13140 * src/FontInfo.C: changed loop variable type too string::size_type.
13142 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13144 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13145 set ETAGS_ARGS to --c++
13147 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13149 * src/table.C (DocBookEndOfCell): commented out two unused variables
13151 * src/paragraph.C: commented out four unused variables.
13153 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13154 insed a if clause with type string::size_type.
13156 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13159 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13161 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13162 variable, also changed loop to go from 0 to lenght + 1, instead of
13163 -1 to length. This should be correct.
13165 * src/LaTeX.C (scanError): use string::size_type as loop variable
13168 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13169 (l.896) since y_tmp and row was not used anyway.
13171 * src/insets/insetref.C (escape): use string::size_type as loop
13174 * src/insets/insetquotes.C (Width): use string::size_type as loop
13176 (Draw): use string::size_type as loop variable type.
13178 * src/insets/insetlatexaccent.C (checkContents): use
13179 string::size_type as loop variable type.
13181 * src/insets/insetlabel.C (escape): use string::size_type as loop
13184 * src/insets/insetinfo.C: added an extern for current_view.
13186 * src/insets/insetcommand.C (scanCommand): use string::size_type
13187 as loop variable type.
13189 * most files: removed the RCS tags. With them we had to recompile
13190 a lot of files after a simple cvs commit. Also we have never used
13191 them for anything meaningful.
13193 * most files: tags-query-replace NULL 0. As adviced several plases
13194 we now use "0" instead of "NULL" in our code.
13196 * src/support/filetools.C (SpaceLess): use string::size_type as
13197 loop variable type.
13199 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13201 * src/paragraph.C: fixed up some more string stuff.
13203 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13205 * src/support/filetools.h: make modestr a std::string.
13207 * src/filetools.C (GetEnv): made ch really const.
13209 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13210 made code that used these use max/min from <algorithm> instead.
13212 * changed several c library include files to their equivalent c++
13213 library include files. All is not changed yet.
13215 * created a support subdir in src, put lyxstring and lstrings
13216 there + the extra files atexit, fileblock, strerror. Created
13217 Makefile.am. edited configure.in and src/Makefile.am to use this
13218 new subdir. More files moved to support.
13220 * imported som of the functions from repository lyx, filetools
13222 * ran tags-query-replace on LString -> string, corrected the bogus
13223 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13224 is still some errors in there. This is errors where too much or
13225 too litle get deleted from strings (string::erase, string::substr,
13226 string::replace), there can also be some off by one errors, or
13227 just plain wrong use of functions from lstrings. Viewing of quotes
13230 * LyX is now running fairly well with string, but there are
13231 certainly some bugs yet (see above) also string is quite different
13232 from LString among others in that it does not allow null pointers
13233 passed in and will abort if it gets any.
13235 * Added the revtex4 files I forgot when setting up the repository.
13237 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13239 * All over: Tried to clean everything up so that only the files
13240 that we really need are included in the cvs repository.
13241 * Switched to use automake.
13242 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13243 * Install has not been checked.
13245 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13247 * po/pt.po: Three errors:
13248 l.533 and l.538 format specification error
13249 l. 402 duplicate entry, I just deleted it.