1 2000-08-23 Juergen Vigna <jug@sad.it>
3 * src/BufferView_pimpl.C (tripleClick): disable this when in a
6 * src/insets/insettabular.C (pasteSelection): delete the insets
7 LyXText as it is not valid anymore.
8 (copySelection): new function.
9 (pasteSelection): new function.
10 (cutSelection): new function.
11 (LocalDispatch): implemented cut/copy/paste of cell selections.
13 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
16 * src/LyXAction.C (init): a NEW_TABULAR define too much.
18 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
21 2000-08-22 Juergen Vigna <jug@sad.it>
23 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
24 ifdef form_table out if NEW_TABULAR.
26 2000-08-21 Juergen Vigna <jug@sad.it>
28 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
29 (draw): fixed draw position so that the cursor is positioned in the
31 (InsetMotionNotify): hide/show cursor so the position is updated.
32 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
33 using cellstart() function where it should be used.
35 * src/insets/insettext.C (draw): ditto.
37 * src/tabular.C: fixed initialization of some missing variables and
38 made BoxType into an enum.
40 2000-08-22 Marko Vendelin <markov@ioc.ee>
41 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
42 stock menu item using action numerical value, not its string
46 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
48 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
49 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
51 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
53 * src/frontends/xforms/GUIRunTime.C: new file
55 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
56 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
58 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
60 * src/frontends/kde/GUIRunTime.C: new file
62 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
63 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
65 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
67 * src/frontends/gnome/GUIRunTime.C: new file
69 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
72 * src/frontends/GUIRunTime.h: removed constructor and destructor,
73 small change to documetentation.
75 * src/frontends/GUIRunTime.C: removed file
77 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
79 * src/lyxparagraph.h: enable NEW_TABULAR as default
81 * src/lyxfunc.C (processKeySym): remove some commented code
83 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
84 NEW_TABULAR around the fd_form_table_options.
86 * src/lyx_gui.C (runTime): call the static member function as
87 GUIRunTime::runTime().
89 2000-08-21 Allan Rae <rae@lyx.org>
91 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
94 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
96 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
98 2000-08-21 Allan Rae <rae@lyx.org>
100 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
102 * src/frontends/xforms/FormPreferences.C (build): use setOK
103 * src/frontends/xforms/FormDocument.C (build): use setOK
104 (FormDocument): use the appropriate policy.
106 2000-08-21 Allan Rae <rae@lyx.org>
108 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
109 automatic [de]activation of arbitrary objects when in a read-only state.
111 * src/frontends/ButtonPolicies.h: More documentation
112 (isReadOnly): added to support the above.
114 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
116 2000-08-18 Juergen Vigna <jug@sad.it>
118 * src/insets/insettabular.C (getStatus): changed to return func_status.
120 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
121 display toggle menu entries if they are.
123 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
124 new document layout now.
126 * src/lyxfunc.C: ditto
128 * src/lyx_gui_misc.C: ditto
130 * src/lyx_gui.C: ditto
132 * lib/ui/default.ui: removed paper and quotes layout as they are now
133 all in the document layout tabbed folder.
135 * src/frontends/xforms/forms/form_document.fd: added Restore
136 button and callbacks for all inputs for Allan's ButtonPolicy.
138 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
139 (CheckChoiceClass): added missing params setting on class change.
140 (UpdateLayoutDocument): added for updating the layout on params.
141 (build): forgot to RETURN_ALWAYS input_doc_spacing.
142 (FormDocument): Implemented Allan's ButtonPolicy with the
145 2000-08-17 Allan Rae <rae@lyx.org>
147 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
148 so we can at least see the credits again.
150 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
151 controller calls for the appropriate callbacks. Note that since Ok
152 calls apply followed by cancel, and apply isn't a valid input for the
153 APPLIED state, the bc_ calls have to be made in the static callback not
154 within each of the real callbacks.
156 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
157 (setOk): renamed from setOkay()
159 2000-08-17 Juergen Vigna <jug@sad.it>
161 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
162 in the implementation part.
163 (composeUIInfo): don't show optional menu-items.
165 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
167 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
169 * src/bufferview_funcs.C (CurrentState): fixed to show also the
170 text-state when in a text-inset.
172 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
174 2000-08-17 Marko Vendelin <markov@ioc.ee>
175 * src/frontends/gnome/FormIndex.C
176 * src/frontends/gnome/FormIndex.h
177 * src/frontends/gnome/FormToc.C
178 * src/frontends/gnome/FormToc.h
179 * src/frontends/gnome/dialogs
180 * src/frontends/gnome/diatoc_callbacks.c
181 * src/frontends/gnome/diatoc_callbacks.h
182 * src/frontends/gnome/diainsertindex_callbacks.h
183 * src/frontends/gnome/diainsertindex_callbacks.c
184 * src/frontends/gnome/diainsertindex_interface.c
185 * src/frontends/gnome/diainsertindex_interface.h
186 * src/frontends/gnome/diatoc_interface.h
187 * src/frontends/gnome/diatoc_interface.c
188 * src/frontends/gnome/Makefile.am: Table of Contents and
189 Insert Index dialogs implementation for Gnome frontend
191 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
193 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
195 * src/frontends/gnome/diainserturl_interface.c: make the dialog
198 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
200 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
201 destructor. Don't definde if you don't need it
202 (processEvents): made static, non-blocking events processing for
204 (runTime): static method. event loop for xforms
205 * similar as above for kde and gnome.
207 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
209 (runTime): new method calss the real frontends runtime func.
211 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
213 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
215 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
217 2000-08-16 Juergen Vigna <jug@sad.it>
219 * src/lyx_gui.C (runTime): added GUII RunTime support.
221 * src/frontends/Makefile.am:
222 * src/frontends/GUIRunTime.[Ch]:
223 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
224 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
225 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
227 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
229 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
230 as this is already set in ${FRONTEND_INCLUDE} if needed.
232 * configure.in (CPPFLAGS): setting the include dir for the frontend
233 directory and don't set FRONTEND=xforms for now as this is executed
236 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
238 * src/frontends/kde/Makefile.am:
239 * src/frontends/kde/FormUrl.C:
240 * src/frontends/kde/FormUrl.h:
241 * src/frontends/kde/formurldialog.h:
242 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
244 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
246 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
248 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
250 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
253 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
255 * src/WorkArea.C (work_area_handler): more work to get te
256 FL_KEYBOARD to work with xforms 0.88 too, please test.
258 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
260 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
262 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
265 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
267 * src/Timeout.h: remove Qt::emit hack.
269 * several files: changes to allo doc++ compilation
271 * src/lyxfunc.C (processKeySym): new method
272 (processKeyEvent): comment out if FL_REVISION < 89
274 * src/WorkArea.C: change some debugging levels.
275 (WorkArea): set wantkey to FL_KEY_ALL
276 (work_area_handler): enable the FL_KEYBOARD clause, this enables
277 clearer code and the use of compose with XForms 0.89. Change to
278 use signals instead of calling methods in bufferview directly.
280 * src/Painter.C: change some debugging levels.
282 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
285 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
286 (workAreaKeyPress): new method
288 2000-08-14 Juergen Vigna <jug@sad.it>
290 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
292 * config/kde.m4: addes some features
294 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
295 include missing xforms dialogs.
297 * src/Timeout.h: a hack to be able to compile with qt/kde.
299 * sigc++/.cvsignore: added acinclude.m4
301 * lib/.cvsignore: added listerros
303 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
304 xforms tree as objects are needed for other frontends.
306 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
307 linking with not yet implemented xforms objects.
309 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
311 2000-08-14 Baruch Even <baruch.even@writeme.com>
313 * src/frontends/xforms/FormGraphics.h:
314 * src/frontends/xforms/FormGraphics.C:
315 * src/frontends/xforms/RadioButtonGroup.h:
316 * src/frontends/xforms/RadioButtonGroup.C:
317 * src/insets/insetgraphics.h:
318 * src/insets/insetgraphics.C:
319 * src/insets/insetgraphicsParams.h:
320 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
321 instead of spaces, and various other indentation issues to make the
322 sources more consistent.
324 2000-08-14 Marko Vendelin <markov@ioc.ee>
326 * src/frontends/gnome/dialogs/diaprint.glade
327 * src/frontends/gnome/FormPrint.C
328 * src/frontends/gnome/FormPrint.h
329 * src/frontends/gnome/diaprint_callbacks.c
330 * src/frontends/gnome/diaprint_callbacks.h
331 * src/frontends/gnome/diaprint_interface.c
332 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
335 * src/frontends/gnome/dialogs/diainserturl.glade
336 * src/frontends/gnome/FormUrl.C
337 * src/frontends/gnome/FormUrl.h
338 * src/frontends/gnome/diainserturl_callbacks.c
339 * src/frontends/gnome/diainserturl_callbacks.h
340 * src/frontends/gnome/diainserturl_interface.c
341 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
344 * src/frontends/gnome/Dialogs.C
345 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
346 all other dialogs. Copy all unimplemented dialogs from Xforms
349 * src/frontends/gnome/support.c
350 * src/frontends/gnome/support.h: support files generated by Glade
354 * config/gnome.m4: Gnome configuration scripts
356 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
357 configure --help message
359 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
360 only if there are no events pendling in Gnome/Gtk. This enhances
361 the performance of menus.
364 2000-08-14 Allan Rae <rae@lyx.org>
366 * lib/Makefile.am: listerrors cleaning
368 * lib/listerrors: removed -- generated file
369 * acinclude.m4: ditto
370 * sigc++/acinclude.m4: ditto
372 * src/frontends/xforms/forms/form_citation.fd:
373 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
376 * src/frontends/xforms/forms/makefile: I renamed the `install` target
377 `updatesrc` and now we have a `test` target that does what `updatesrc`
378 used to do. I didn't like having an install target that wasn't related
381 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
382 on all except FormGraphics. This may yet happen. Followed by a major
383 cleanup including using FL_TRANSIENT for most of the dialogs. More
384 changes to come when the ButtonController below is introduced.
386 * src/frontends/xforms/ButtonController.h: New file for managing up to
387 four buttons on a dialog according to an externally defined policy.
388 * src/frontends/xforms/Makefile.am: added above
390 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
391 Apply and Cancel/Close buttons and everything in between and beyond.
392 * src/frontends/Makefile.am: added above.
394 * src/frontends/xforms/forms/form_preferences.fd:
395 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
396 and removed variable 'status' as a result. Fixed the set_minsize thing.
397 Use the new screen-font-update after checking screen fonts were changed
398 Added a "Restore" button to restore the original lyxrc values while
399 editing. This restores everything not just the last input changed.
400 That's still a tricky one. As is the "LyX: this shouldn't happen..."
402 * src/LyXAction.C: screen-font-update added for updating buffers after
403 screen font settings have been changed.
404 * src/commandtags.h: ditto
405 * src/lyxfunc.C: ditto
407 * forms/lyx.fd: removed screen fonts dialog.
408 * src/lyx_gui.C: ditto
409 * src/menus.[Ch]: ditto
410 * src/lyx.[Ch]: ditto
411 * src/lyx_cb.C: ditto + code from here moved to make
412 screen-font-update. And people wonder why progress on GUII is
413 slow. Look at how scattered this stuff was! It takes forever
416 * forms/fdfix.sh: Fixup the spacing after commas.
417 * forms/makefile: Remove date from generated files. Fewer clashes now.
418 * forms/bullet_forms.C.patch: included someones handwritten changes
420 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
421 once I've discovered why LyXRC was made noncopyable.
422 * src/lyx_main.C: ditto
424 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
426 * src/frontends/xforms/forms/fdfix.sh:
427 * src/frontends/xforms/forms/fdfixh.sed:
428 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
429 * src/frontends/xforms/Form*.[hC]:
430 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
431 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
432 provide a destructor for the struct FD_form_xxxx. Another version of
433 the set_[max|min]size workaround and a few other cleanups. Actually,
434 Angus' patch from 20000809.
436 2000-08-13 Baruch Even <baruch.even@writeme.com>
438 * src/insets/insetgraphics.C (Clone): Added several fields that needed
441 2000-08-11 Juergen Vigna <jug@sad.it>
443 * src/insets/insetgraphics.C (InsetGraphics): changing init
444 order because of warnings.
446 * src/frontends/xforms/forms/makefile: adding patching .C with
449 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
450 from .C.patch to .c.patch
452 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
453 order because of warning.
455 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
457 * src/frontends/Liason.C (setMinibuffer): new helper function
459 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
461 * src/lyxfunc.C (Dispatch): calling new Document-Layout
463 * lib/ui/default.ui: commented out PaperLayout entry
465 * src/frontends/xforms/form_document.[Ch]: new added files
467 * src/frontends/xforms/FormDocument.[Ch]: ditto
469 * src/frontends/xforms/forms/form_document.fd: ditto
471 * src/frontends/xforms/forms/form_document.C.patch: ditto
473 2000-08-10 Juergen Vigna <jug@sad.it>
475 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
476 (InsetGraphics): initialized cacheHandle to 0.
477 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
479 2000-08-10 Baruch Even <baruch.even@writeme.com>
481 * src/graphics/GraphicsCache.h:
482 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
483 correctly as a cache.
485 * src/graphics/GraphicsCacheItem.h:
486 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
489 * src/graphics/GraphicsCacheItem_pimpl.h:
490 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
493 * src/insets/insetgraphics.h:
494 * src/insets/insetgraphics.C: Changed from using a signal notification
495 to polling when image is not loaded.
497 2000-08-10 Allan Rae <rae@lyx.org>
499 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
500 that there are two functions that have to been taken out of line by
501 hand and aren't taken care of in the script. (Just a reminder note)
503 * sigc++/macros/*.h.m4: Updated as above.
505 2000-08-09 Juergen Vigna <jug@sad.it>
507 * src/insets/insettext.C (draw): small fix for clearing rectangle.
509 * src/insets/insettabular.C: make drawing of single cell smarter.
511 2000-08-09 Marko Vendelin <markov@ioc.ee>
512 * src/frontends/gnome/Menubar_pimpl.C
513 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
514 implementation: new files
516 * src/frontends/gnome/mainapp.C
517 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
520 * src/main.C: create Gnome main window
522 * src/frontends/xforms/Menubar_pimpl.h
523 * src/frontends/Menubar.C
524 * src/frontends/Menubar.h: added method Menubar::update that calls
525 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
527 * src/LyXView.C: calls Menubar::update to update the state
530 * src/frontends/gnome/Makefile.am: added new files
532 * src/frontends/Makefile.am: added frontend compiler options
534 2000-08-08 Juergen Vigna <jug@sad.it>
536 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
538 * src/bufferlist.C (close):
539 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
540 documents if exiting without saving.
542 * src/buffer.C (save): use removeAutosaveFile()
544 * src/support/filetools.C (removeAutosaveFile): new function.
546 * src/lyx_cb.C (MenuWrite): returns a bool now.
547 (MenuWriteAs): check if file could really be saved and revert to the
549 (MenuWriteAs): removing old autosavefile if existant.
551 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
552 before Goto toggle declaration, because of compiler warning.
554 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
556 * src/lyxfunc.C (MenuNew): small fix.
558 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
560 * src/bufferlist.C (newFile):
561 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
563 * src/lyxrc.C: added new_ask_filename tag
565 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
567 * src/lyx.fd: removed code pertaining to form_ref
568 * src/lyx.[Ch]: ditto
569 * src/lyx_cb.C: ditto
570 * src/lyx_gui.C: ditto
571 * src/lyx_gui_misc.C: ditto
573 * src/BufferView_pimpl.C (restorePosition): update buffer only
576 * src/commandtags.h (LFUN_REFTOGGLE): removed
577 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
578 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
579 (LFUN_REFBACK): renamed LFUN_REF_BACK
581 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
583 * src/lyxfunc.C (Dispatch): ditto.
584 InsertRef dialog is now GUI-independent.
586 * src/texrow.C: added using std::endl;
588 * src/insets/insetref.[Ch]: strip out large amounts of code.
589 The inset is now a container and this functionality is now
590 managed by a new FormRef dialog
592 * src/frontends/Dialogs.h (showRef, createRef): new signals
594 * src/frontends/xforms/FormIndex.[Ch],
595 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
596 when setting dialog's min/max size
597 * src/frontends/xforms/FormIndex.[Ch]: ditto
599 * src/frontends/xforms/FormRef.[Ch],
600 src/frontends/xforms/forms/form_ref.fd: new xforms
601 implementation of an InsetRef dialog
603 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
606 * src/graphics/XPM_Renderer.C (isImageFormatOK):
607 ios::nocreate is not part of the standard. Removed.
609 2000-08-07 Baruch Even <baruch.even@writeme.com>
611 * src/graphics/Renderer.h:
612 * src/graphics/Renderer.C: Added base class for rendering of different
613 image formats into Pixmaps.
615 * src/graphics/XPM_Renderer.h:
616 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
617 in a different class.
619 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
620 easily add support for other formats.
622 * src/insets/figinset.C: plugged a leak of an X resource.
624 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
626 * src/CutAndPaste.[Ch]: make all metods static.
628 * development/Code_rules/Rules: more work, added section on
629 Exceptions, and a References section.
631 * a lot of header files: work to make doc++ able to generate the
632 source documentation, some workarounds of doc++ problems. Doc++ is
633 now able to generate the documentation.
635 2000-08-07 Juergen Vigna <jug@sad.it>
637 * src/insets/insettabular.C (recomputeTextInsets): removed function
639 * src/tabular.C (SetWidthOfMulticolCell):
641 (calculate_width_of_column_NMC): fixed return value so that it really
642 only returns true if the column-width has changed (there where
643 problems with muliticolumn-cells in this column).
645 2000-08-04 Juergen Vigna <jug@sad.it>
647 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
648 also on the scrollstatus of the inset.
649 (workAreaMotionNotify): ditto.
651 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
653 2000-08-01 Juergen Vigna <jug@sad.it>
655 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
658 * src/LyXAction.C (init):
659 * src/insets/inset.C (LocalDispatch): added support for
662 * src/insets/inset.C (scroll): new functions.
664 * src/insets/insettext.C (removeNewlines): new function.
665 (SetAutoBreakRows): removes forced newlines in the text of the
666 paragraph if autoBreakRows is set to false.
668 * src/tabular.C (Latex): generates a parbox around the cell contents
671 * src/frontends/xforms/FormTabular.C (local_update): removed
672 the radio_useparbox button.
674 * src/tabular.C (UseParbox): new function
676 2000-08-06 Baruch Even <baruch.even@writeme.com>
678 * src/graphics/GraphicsCache.h:
679 * src/graphics/GraphicsCache.C:
680 * src/graphics/GraphicsCacheItem.h:
681 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
684 * src/insets/insetgraphics.h:
685 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
686 drawing of the inline image.
688 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
689 into the wrong position.
691 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
694 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
696 * src/support/translator.h: move all typedefs to public section
698 * src/support/filetools.C (MakeLatexName): return string const
701 (FileOpenSearch): ditto
703 (LibFileSearch): ditto
704 (i18nLibFileSearch): ditto
707 (CreateTmpDir): ditto
708 (CreateBufferTmpDir): ditto
709 (CreateLyXTmpDir): ditto
714 (OnlyFilename): ditto
716 (NormalizePath): ditto
718 (GetFileContents): ditto
719 (ReplaceEnvironmentPath): ditto
722 (ChangeExtension): ditto
723 (MakeDisplayPath): ditto
724 (do_popen): return cmdret const
725 (findtexfile): return string const
727 * src/support/DebugStream.h: add some /// to please doc++
729 * src/frontends/DialogBase.h (endif): add some /// to please doc++
731 * src/texrow.C (same_rownumber): functor to use with find_if
732 (getIdFromRow): rewritten to use find_if and to not update the
733 positions. return true if row is found
734 (increasePos): new method, use to update positions
736 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
738 * src/lyxlex_pimpl.C (verifyTable): new method
741 (GetString): return string const
742 (pushTable): rewrite to use std::stack
744 (setFile): better check
747 * src/lyxlex.h: make LyXLex noncopyable
749 * src/lyxlex.C (text): return char const * const
750 (GetString): return string const
751 (getLongString): return string const
753 * src/lyx_gui_misc.C (askForText): return pair<...> const
755 * src/lastfiles.[Ch] (operator): return string const
757 * src/buffer.C (parseSingleLyXformat2Token): pass string to
758 istringstream not char const *.
759 move token.end() out of loop.
760 (readFile): move initializaton of token
762 * src/BufferView2.C (insertErrors): run texrow.increasePos if
763 getIdFromRow is successful.
765 * lib/bind/emacs.bind: don't include menus bind
767 * development/Code_rules/Rules: the beginnings of making this
768 better and covering more of the unwritten rules that we have.
770 * development/Code_rules/Recommendations: a couple of wording
773 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
775 * src/support/strerror.c: remove C++ comment.
777 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
779 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
780 LFUN_INDEX_INSERT_LAST
782 * src/texrow.C (getIdFromRow): changed from const_iterator to
783 iterator, allowing code to compile with DEC cxx
785 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
786 stores part of the class, as suggested by Allan. Will allow
788 (apply): test to apply uses InsetCommandParams operator!=
790 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
791 (apply): test to apply uses InsetCommandParams operator!=
793 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
794 stores part of the class.
795 (update): removed limits on min/max size.
797 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
798 (apply): test to apply uses InsetCommandParams operator!=
800 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
801 (Read, Write, scanCommand, getCommand): moved functionality
802 into InsetCommandParams.
804 (getScreenLabel): made pure virtual
805 new InsetCommandParams operators== and !=
807 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
808 c-tors based on InsetCommandParams. Removed others.
809 * src/insets/insetinclude.[Ch]: ditto
810 * src/insets/insetlabel.[Ch]: ditto
811 * src/insets/insetparent.[Ch]: ditto
812 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
814 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
815 insets derived from InsetCommand created using similar c-tors
816 based on InsetCommandParams
817 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
818 * src/menus.C (ShowRefsMenu): ditto
819 * src/paragraph.C (Clone): ditto
820 * src/text2.C (SetCounter): ditto
821 * src/lyxfunc.C (Dispatch) ditto
822 Also recreated old InsetIndex behaviour exactly. Can now
823 index-insert at the start of a paragraph and index-insert-last
824 without launching the pop-up.
826 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
828 * lib/lyxrc.example: mark te pdf options as non functional.
830 * src/support/lstrings.C (strToInt): move initalization of tmpstr
831 (isStrDbl): move tmpstr.end() out of loop.
832 (strToDbl): move intialization of tmpstr
833 (lowercase): return string const and move tmp.end() out of loop.
834 (uppercase): return string const and move tmp.edn() out of loop.
835 (prefixIs): add assertion
840 (containsOnly): ditto
841 (containsOnly): ditto
842 (containsOnly): ditto
843 (countChar): make last arg char not char const
844 (token): return string const
845 (subst): return string const, move tmp.end() out of loop.
846 (subst): return string const, add assertion
847 (strip): return string const
848 (frontStrip): return string const, add assertion
849 (frontStrip): return string const
854 * src/support/lstrings.C: add inclde "LAssert.h"
855 (isStrInt): move tmpstr.end() out of loop.
857 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
858 toollist.end() out of loop.
859 (deactivate): move toollist.end() out of loop.
860 (update): move toollist.end() out of loop.
861 (updateLayoutList): move tc.end() out of loop.
862 (add): move toollist.end() out of loop.
864 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
865 md.end() out of loop.
867 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
869 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
872 * src/paragraph.C (Erase): move fontlist.end() out of loop.
873 (Erase): move insetlist.end() out of loop.
875 * src/lyx_sendfax_main.C: make show_logfile static and to take a
876 ref to const string as first arg. Move initialization of some
877 variables, whitespace changes.
879 * src/kbmap.C (defkey): move table.end() out of loop.
880 (kb_keymap): move table.end() out of loop.
881 (findbinding): move table.end() out of loop.
883 * src/MenuBackend.C (hasMenu): move end() out of loop.
884 (getMenu): move end() out of loop.
885 (getMenu): move menulist_.end() out of loop.
887 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
889 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
892 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
893 (getFromLyXName): move infotab.end() out of loop.
895 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
896 -fvtable-thunks -ffunction-sections -fdata-sections
898 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
900 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
903 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
905 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
907 * src/frontends/xforms/FormCitation.[Ch],
908 src/frontends/xforms/FormIndex.[Ch],
909 src/frontends/xforms/FormToc.[Ch],
910 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
912 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
914 * src/commandtags.h: renamed, created some flags for citation
917 * src/lyx_gui_misc.C: stripped out old FD_index_form code
919 * src/lyxfunc.C (dispatch): use signals to insert index entry
921 * src/frontends/Dialogs.h: new signal createIndex
923 * src/frontends/xforms/FormCommand.[Ch],
924 src/frontends/xforms/FormCitation.[Ch],
925 src/frontends/xforms/FormToc.[Ch],
926 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
928 * src/insets/insetindex.[Ch]: GUI-independent
930 * src/frontends/xforms/FormIndex.[Ch],
931 * src/frontends/xforms/forms/form_index.fd: xforms implementation
934 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
936 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
937 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
939 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
941 * src/insets/insetref.C (Latex): rewrite so that there is now
942 question that a initialization is requested.
944 * src/insets/insetcommand.h: reenable the hide signal
946 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
948 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
949 fix handling of shortcuts (many bugs :)
950 (add_lastfiles): ditto.
952 * lib/ui/default.ui: fix a few shortcuts.
954 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
956 * Makefile.am: Fix ``rpmdist'' target to return the exit
957 status of the ``rpm'' command, instead of the last command in
958 the chain (the ``rm lyx.xpm'' command, which always returns
961 2000-08-02 Allan Rae <rae@lyx.org>
963 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
964 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
965 * src/frontends/xforms/FormToc.C (FormToc): ditto
967 * src/frontends/xforms/Makefile.am: A few forgotten files
969 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
970 Signals-not-copyable-problem Lars' started commenting out.
972 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
974 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
976 * src/insets/insetcommand.h: Signals is not copyable so anoter
977 scheme for automatic hiding of forms must be used.
979 * src/frontends/xforms/FormCitation.h: don't inerit from
980 noncopyable, FormCommand already does that.
981 * src/frontends/xforms/FormToc.h: ditto
982 * src/frontends/xforms/FormUrl.h: ditto
984 * src/frontends/xforms/FormCitation.C: add include <algorithm>
986 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
988 * src/insets/insetcommand.h (hide): new SigC::Signal0
989 (d-tor) new virtual destructor emits hide signal
991 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
992 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
994 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
995 LOF and LOT. Inset is now GUI-independent
997 * src/insets/insetloa.[Ch]: redundant
998 * src/insets/insetlof.[Ch]: ditto
999 * src/insets/insetlot.[Ch]: ditto
1001 * src/frontends/xforms/forms/form_url.fd: tweaked!
1002 * src/frontends/xforms/forms/form_citation.fd: ditto
1004 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1005 dialogs dealing with InsetCommand insets
1007 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1008 FormCommand base class
1009 * src/frontends/xforms/FormUrl.[Ch]: ditto
1011 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1013 * src/frontends/xforms/FormToc.[Ch]: ditto
1015 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1016 passed a generic InsetCommand pointer
1017 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1019 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1020 and modified InsetTOC class
1021 * src/buffer.C: ditto
1023 * forms/lyx.fd: strip out old FD_form_toc code
1024 * src/lyx_gui_misc.C: ditto
1025 * src/lyx_gui.C: ditto
1026 * src/lyx_cb.C: ditto
1027 * src/lyx.[Ch]: ditto
1029 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1031 * src/support/utility.hpp: tr -d '\r'
1033 2000-08-01 Juergen Vigna <jug@sad.it>
1035 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1037 * src/commandtags.h:
1038 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1039 LFUN_TABULAR_FEATURES.
1041 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1042 LFUN_LAYOUT_TABULAR.
1044 * src/insets/insettabular.C (getStatus): implemented helper function.
1046 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1048 2000-07-31 Juergen Vigna <jug@sad.it>
1050 * src/text.C (draw): fixed screen update problem for text-insets.
1052 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1053 something changed probably this has to be added in various other
1056 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1058 2000-07-31 Baruch Even <baruch.even@writeme.com>
1060 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1061 templates to satisfy compaq cxx.
1064 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1066 * src/support/translator.h (equal_1st_in_pair::operator()): take
1067 const ref pair_type as arg.
1068 (equal_2nd_in_pair::operator()): ditto
1069 (Translator::~Translator): remove empty d-tor.
1071 * src/graphics/GraphicsCache.C: move include config.h to top, also
1072 put initialization of GraphicsCache::singleton here.
1073 (~GraphicsCache): move here
1074 (addFile): take const ref as arg
1077 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1079 * src/BufferView2.C (insertLyXFile): change te with/without header
1082 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1084 * src/frontends/xforms/FormGraphics.C (apply): add some
1085 static_cast. Not very nice, but required by compaq cxx.
1087 * src/frontends/xforms/RadioButtonGroup.h: include header
1088 <utility> instead of <pair.h>
1090 * src/insets/insetgraphicsParams.C: add using directive.
1091 (readResize): change return type to void.
1092 (readOrigin): ditto.
1094 * src/lyxfunc.C (getStatus): add missing break for build-program
1095 function; add test for Literate for export functions.
1097 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1098 entries in Options menu.
1100 2000-07-31 Baruch Even <baruch.even@writeme.com>
1102 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1103 protect against auto-allocation; release icon when needed.
1105 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1107 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1108 on usual typewriter.
1110 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1111 earlier czech.kmap), useful only for programming.
1113 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1115 * src/frontends/xforms/FormCitation.h: fix conditioning around
1118 2000-07-31 Juergen Vigna <jug@sad.it>
1120 * src/frontends/xforms/FormTabular.C (local_update): changed
1121 radio_linebreaks to radio_useparbox and added radio_useminipage.
1123 * src/tabular.C: made support for using minipages/parboxes.
1125 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1127 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1129 (descent): so the cursor is in the middle.
1130 (width): bit smaller box.
1132 * src/insets/insetgraphics.h: added display() function.
1134 2000-07-31 Baruch Even <baruch.even@writeme.com>
1136 * src/frontends/Dialogs.h: Added showGraphics signals.
1138 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1139 xforms form definition of the graphics dialog.
1141 * src/frontends/xforms/FormGraphics.h:
1142 * src/frontends/xforms/FormGraphics.C: Added files, the
1143 GUIndependent code of InsetGraphics
1145 * src/insets/insetgraphics.h:
1146 * src/insets/insetgraphics.C: Major writing to make it work.
1148 * src/insets/insetgraphicsParams.h:
1149 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1150 struct between InsetGraphics and GUI.
1152 * src/LaTeXFeatures.h:
1153 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1154 support for graphicx package.
1156 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1157 for the graphics inset.
1159 * src/support/translator.h: Added file, used in
1160 InsetGraphicsParams. this is a template to translate between two
1163 * src/frontends/xforms/RadioButtonGroup.h:
1164 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1165 way to easily control a radio button group.
1167 2000-07-28 Juergen Vigna <jug@sad.it>
1169 * src/insets/insettabular.C (LocalDispatch):
1170 (TabularFeatures): added support for lyx-functions of tabular features.
1171 (cellstart): refixed this function after someone wrongly changed it.
1173 * src/commandtags.h:
1174 * src/LyXAction.C (init): added support for tabular-features
1176 2000-07-28 Allan Rae <rae@lyx.org>
1178 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1179 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1180 triggers the callback for input checking. As a result we sometimes get
1181 "LyX: This shouldn't happen..." printed to cerr.
1182 (input): Started using status variable since I only free() on
1183 destruction. Some input checking for paths and font sizes.
1185 * src/frontends/xforms/FormPreferences.h: Use status to control
1186 activation of Ok and Apply
1188 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1189 callback. Also resized to stop segfaults with 0.88. The problem is
1190 that xforms-0.88 requires the folder to be wide enough to fit all the
1191 tabs. If it isn't it causes all sorts of problems.
1193 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1195 * src/frontends/xforms/forms/README: Reflect reality.
1197 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1198 * src/frontends/xforms/forms/makefile: ditto.
1200 * src/commandtags.h: Get access to new Preferences dialog
1201 * src/LyXAction.C: ditto
1202 * src/lyxfunc.C: ditto
1203 * lib/ui/default.ui: ditto
1205 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1207 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1209 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1212 * src/frontends/xforms/form_url.[Ch]: added.
1214 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1216 * src/insets/insetbib.h: fixed bug in previous commit
1218 * src/frontends/xforms/FormUrl.h: ditto
1220 * src/frontends/xforms/FormPrint.h: ditto
1222 * src/frontends/xforms/FormPreferences.h: ditto
1224 * src/frontends/xforms/FormCopyright.h: ditto
1226 * src/frontends/xforms/FormCitation.C: ditto
1228 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1229 private copyconstructor and private default contructor
1231 * src/support/Makefile.am: add utility.hpp
1233 * src/support/utility.hpp: new file from boost
1235 * src/insets/insetbib.h: set owner in clone
1237 * src/frontends/xforms/FormCitation.C: added missing include
1240 * src/insets/form_url.[Ch]: removed
1242 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1244 * development/lyx.spec.in
1245 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1246 file/directory re-organization.
1248 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1250 * src/insets/insetcommand.[Ch]: moved the string data and
1251 associated manipulation methods into a new stand-alone class
1252 InsetCommandParams. This class has two additional methods
1253 getAsString() and setFromString() allowing the contents to be
1254 moved around as a single string.
1255 (addContents) method removed.
1256 (setContents) method no longer virtual.
1258 * src/buffer.C (readInset): made use of new InsetCitation,
1259 InsetUrl constructors based on InsetCommandParams.
1261 * src/commandtags.h: add LFUN_INSERT_URL
1263 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1264 independent InsetUrl and use InsetCommandParams to extract
1265 string info and create new Insets.
1267 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1269 * src/frontends/xforms/FormCitation.C (apply): uses
1272 * src/frontends/xforms/form_url.C
1273 * src/frontends/xforms/form_url.h
1274 * src/frontends/xforms/FormUrl.h
1275 * src/frontends/xforms/FormUrl.C
1276 * src/frontends/xforms/forms/form_url.fd: new files
1278 * src/insets/insetcite.[Ch]: removed unused constructors.
1280 * src/insets/insetinclude.[Ch]: no longer store filename
1282 * src/insets/inseturl.[Ch]: GUI-independent.
1284 2000-07-26 Juergen Vigna <jug@sad.it>
1285 * renamed frontend from gtk to gnome as it is that what is realized
1286 and did the necessary changes in the files.
1288 2000-07-26 Marko Vendelin <markov@ioc.ee>
1290 * configure.in: cleaning up gnome configuration scripts
1292 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1294 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1295 shortcuts syndrom by redrawing them explicitely (a better solution
1296 would be appreciated).
1298 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1300 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1303 * src/lyx_cb.C (MenuExport): change html export to do the right
1304 thing depending of the document type (instead of having
1305 html-linuxdoc and html-docbook).
1306 * src/lyxfunc.C (getStatus): update for html
1307 * lib/ui/default.ui: simplify due to the above change.
1308 * src/menus.C (ShowFileMenu): update too (in case we need it).
1310 * src/MenuBackend.C (read): if a menu is defined twice, add the
1311 new entries to the exiting one.
1313 2000-07-26 Juergen Vigna <jug@sad.it>
1315 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1317 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1318 and return a bool if it did actual save the file.
1319 (AutoSave): don't autosave a unnamed doc.
1321 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1322 check if this is an UNNAMED new file and react to it.
1323 (newFile): set buffer to unnamed and change to not mark a new
1324 buffer dirty if I didn't do anything with it.
1326 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1328 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1330 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1331 friend as per Angus's patch posted to lyx-devel.
1333 * src/ext_l10n.h: updated
1335 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1336 gettext on the style string right before inserting them into the
1339 * autogen.sh: add code to extract style strings form layout files,
1340 not good enough yet.
1342 * src/frontends/gtk/.cvsignore: add MAKEFILE
1344 * src/MenuBackend.C (read): run the label strings through gettext
1345 before storing them in the containers.
1347 * src/ext_l10n.h: new file
1349 * autogen.sh : generate the ext_l10n.h file here
1351 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1353 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1356 * lib/ui/default.ui: fix a couple of typos.
1358 * config/gnome/gtk.m4: added (and added to the list of files in
1361 * src/insets/insetinclude.C (unique_id): fix when we are using
1362 lyxstring instead of basic_string<>.
1363 * src/insets/insettext.C (LocalDispatch): ditto.
1364 * src/support/filetools.C: ditto.
1366 * lib/configure.m4: create the ui/ directory if necessary.
1368 * src/LyXView.[Ch] (updateToolbar): new method.
1370 * src/BufferView_pimpl.C (buffer): update the toolbar when
1371 opening/closing buffer.
1373 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1375 * src/LyXAction.C (getActionName): enhance to return also the name
1376 and options of pseudo-actions.
1377 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1379 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1380 as an example of what is possible). Used in File->Build too (more
1381 useful) and in the import/export menus (to mimick the complicated
1382 handling of linuxdoc and friends). Try to update all the entries.
1384 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1387 * src/MenuBackend.C (read): Parse the new OptItem tag.
1389 * src/MenuBackend.h: Add a new optional_ data member (used if the
1390 entry should be omitted when the lyxfunc is disabled).
1392 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1393 function, used as a shortcut.
1394 (create_submenu): align correctly the shortcuts on the widest
1397 * src/MenuBackend.h: MenuItem.label() only returns the label of
1398 the menu without shortcut; new method shortcut().
1400 2000-07-14 Marko Vendelin <markov@ioc.ee>
1402 * src/frontends/gtk/Dialogs.C:
1403 * src/frontends/gtk/FormCopyright.C:
1404 * src/frontends/gtk/FormCopyright.h:
1405 * src/frontends/gtk/Makefile.am: added these source-files for the
1406 Gtk/Gnome support of the Copyright-Dialog.
1408 * src/main.C: added Gnome::Main initialization if using
1409 Gtk/Gnome frontend-GUI.
1411 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1413 * config/gnome/aclocal-include.m4
1414 * config/gnome/compiler-flags.m4
1415 * config/gnome/curses.m4
1416 * config/gnome/gnome--.m4
1417 * config/gnome/gnome-bonobo-check.m4
1418 * config/gnome/gnome-common.m4
1419 * config/gnome/gnome-fileutils.m4
1420 * config/gnome/gnome-ghttp-check.m4
1421 * config/gnome/gnome-gnorba-check.m4
1422 * config/gnome/gnome-guile-checks.m4
1423 * config/gnome/gnome-libgtop-check.m4
1424 * config/gnome/gnome-objc-checks.m4
1425 * config/gnome/gnome-orbit-check.m4
1426 * config/gnome/gnome-print-check.m4
1427 * config/gnome/gnome-pthread-check.m4
1428 * config/gnome/gnome-support.m4
1429 * config/gnome/gnome-undelfs.m4
1430 * config/gnome/gnome-vfs.m4
1431 * config/gnome/gnome-x-checks.m4
1432 * config/gnome/gnome-xml-check.m4
1433 * config/gnome/gnome.m4
1434 * config/gnome/gperf-check.m4
1435 * config/gnome/gtk--.m4
1436 * config/gnome/linger.m4
1437 * config/gnome/need-declaration.m4: added configuration scripts
1438 for Gtk/Gnome frontend-GUI
1440 * configure.in: added support for the --with-frontend=gtk option
1442 * autogen.sh: added config/gnome/* to list of config-files
1444 * acconfig.h: added define for GTKGUI-support
1446 * config/lyxinclude.m4: added --with-frontend[=value] option value
1447 for Gtk/Gnome frontend-GUI support.
1449 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1451 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1455 * src/paragraph.C (GetChar): remove non-const version
1457 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1458 (search_kw): use it.
1460 * src/lyx_main.C (init): if "preferences" exist, read that instead
1462 (ReadRcFile): return bool if the file could be read ok.
1463 (ReadUIFile): add a check to see if lex file is set ok.
1465 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1466 bastring can be used instead of lyxstring (still uses the old code
1467 if std::string is good enough or if lyxstring is used.)
1469 * src/encoding.C: make the arrays static, move ininle functions
1471 * src/encoding.h: from here.
1473 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1474 (parseSingleLyXformat2Token): move inset parsing to separate method
1475 (readInset): new private method
1477 * src/Variables.h: remove virtual from get().
1479 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1480 access to NEW_INSETS and NEW_TABULAR
1482 * src/MenuBackend.h: remove superfluous forward declaration of
1483 MenuItem. Add documentations tags "///", remove empty MenuItem
1484 destructor, remove private default contructor.
1486 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1488 (read): more string mlabel and mname to where they are used
1489 (read): remove unused variables mlabel and mname
1490 (defaults): unconditional clear, make menusetup take advantage of
1491 add returning Menu &.
1493 * src/LyXView.h: define NEW_MENUBAR as default
1495 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1496 to NEW_INSETS and NEW_TABULAR.
1497 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1498 defined. Change some of the "xxxx-inset-insert" functions names to
1501 * several files: more enahncements to NEW_INSETS and the resulting
1504 * lib/lyxrc.example (\date_insert_format): move to misc section
1506 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1507 bastring and use AC_CACHE_CHECK.
1508 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1509 the system have the newest methods. uses AC_CACHE_CHECK
1510 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1511 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1512 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1514 * configure.in: add LYX_CXX_GOOD_STD_STRING
1516 * acinclude.m4: recreated
1518 2000-07-24 Amir Karger
1520 * README: add Hebrew, Arabic kmaps
1523 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1525 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1528 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1530 * Lot of files: add pragma interface/implementation.
1532 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1534 * lib/ui/default.ui: new file (ans new directory). Contains the
1535 default menu and toolbar.
1537 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1538 global space. Toolbars are now read (as menus) in ui files.
1540 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1542 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1543 is disabled because the document is read-only. We want to have the
1544 toggle state of the function anyway.
1545 (getStatus): add code for LFUN_VC* functions (mimicking what is
1546 done in old-style menus)
1548 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1549 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1551 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1552 * src/BufferView_pimpl.C: ditto.
1553 * src/lyxfunc.C: ditto.
1555 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1556 default). This replaces old-style menus by new ones.
1558 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1559 MenuItem. Contain the data structure of a menu.
1561 * src/insets/insettext.C: use LyXView::setLayout instead of
1562 accessing directly the toolbar combox.
1563 * src/lyxfunc.C (Dispatch): ditto.
1565 * src/LyXView.C (setLayout): new method, which just calls
1566 Toolbar::setLayout().
1567 (updateLayoutChoice): move part of this method in Toolbar.
1569 * src/toolbar.[Ch]: removed.
1571 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1572 implementation the toolbar.
1574 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1575 the toolbar. It might make sense to merge it with ToolbarDefaults
1577 (setLayout): new function.
1578 (updateLayoutList): ditto.
1579 (openLayoutList): ditto.
1581 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1582 xforms implementation of the toolbar.
1583 (get_toolbar_func): comment out, since I do not
1584 know what it is good for.
1586 * src/ToolbarDefaults.h: Add the ItemType enum.
1588 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1589 for a list of allocated C strings. Used in Menubar xforms
1590 implementation to avoid memory leaks.
1592 * src/support/lstrings.[Ch] (uppercase): new version taking and
1596 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1597 * lib/bind/emacs.bind: ditto.
1599 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1601 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1602 forward decl of LyXView.
1604 * src/toolbar.C (toolbarItem): moved from toolbar.h
1605 (toolbarItem::clean): ditto
1606 (toolbarItem::~toolbarItem): ditto
1607 (toolbarItem::operator): ditto
1609 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1611 * src/paragraph.h: control the NEW_TABULAR define from here
1613 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1614 USE_TABULAR_INSETS to NEW_TABULAR
1616 * src/ToolbarDefaults.C: add include "lyxlex.h"
1618 * files using the old table/tabular: use NEW_TABULAR to control
1619 compilation of old tabular stuff.
1621 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1624 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1625 planemet in reading of old style floats, fix the \end_deeper
1626 problem when reading old style floats.
1628 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1630 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1632 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1634 * lib/bind/sciword.bind: updated.
1636 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1638 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1639 layout write problem
1641 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1643 * src/Makefile.am (INCLUDES): remove image directory from include
1646 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1647 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1649 * src/LyXView.C (create_form_form_main): read the application icon
1652 * lib/images/*.xpm: change the icons to use transparent color for
1655 * src/toolbar.C (update): change the color of the button when it
1658 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1660 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1661 setting explicitely the minibuffer.
1662 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1664 * src/LyXView.C (showState): new function. Shows font information
1665 in minibuffer and update toolbar state.
1666 (LyXView): call Toolbar::update after creating the
1669 * src/toolbar.C: change toollist to be a vector instead of a
1671 (BubbleTimerCB): get help string directly from the callback
1672 argument of the corresponding icon (which is the action)
1673 (set): remove unnecessary ugliness.
1674 (update): new function. update the icons (depressed, disabled)
1675 depending of the status of the corresponding action.
1677 * src/toolbar.h: remove help in toolbarItem
1679 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1681 * src/Painter.C (text): Added code for using symbol glyphs from
1682 iso10646 fonts. Currently diabled.
1684 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1687 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1688 magyar,turkish and usorbian.
1690 * src/paragraph.C (isMultiLingual): Made more efficient.
1692 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1695 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1696 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1697 Also changed the prototype to "bool math_insert_greek(char)".
1699 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1701 * lots of files: apply the NEW_INSETS on all code that will not be
1702 needed when we move to use the new insets. Enable the define in
1703 lyxparagrah.h to try it.
1705 * src/insets/insettabular.C (cellstart): change to be a static
1707 (InsetTabular): initialize buffer in the initializer list.
1709 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1711 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1712 form_print.h out of the header file. Replaced with forward
1713 declarations of the relevant struct.
1715 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1718 * src/commandtags.h: do not include "debug.h" which does not
1719 belong there. #include it in some other places because of this
1722 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1724 * src/insets/insetcaption.C: add a couple "using" directives.
1726 * src/toolbar.C (add): get the help text directly from lyxaction.
1728 (setPixmap): new function. Loads from disk and sets a pixmap on a
1729 botton; the name of the pixmap file is derived from the command
1732 * src/toolbar.h: remove members isBitmap and pixmap from
1735 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1736 * lib/images/: move many files from images/banner.xpm.
1738 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1740 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1741 * src/toolbar.C: ditto.
1742 * configure.in: ditto.
1743 * INSTALL: document.
1745 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1746 the spellchecker popup is closed from the WM.
1748 2000-07-19 Juergen Vigna <jug@sad.it>
1750 * src/insets/insetfloat.C (Write): small fix because we use the
1751 insetname for the type now!
1753 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1755 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1758 * src/frontends/Dialogs.h: removed hideCitation signal
1760 * src/insets/insetcite.h: added hide signal
1762 * src/insets/insetcite.C (~InsetCitation): emits new signal
1763 (getScreenLabel): "intelligent" label should now fit on the screen!
1765 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1767 * src/frontends/xforms/FormCitation.C (showInset): connects
1768 hide() to the inset's hide signal
1769 (show): modified to use fl_set_object_position rather than
1770 fl_set_object_geometry wherever possible
1772 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1774 * src/insets/lyxinset.h: add caption code
1776 * src/insets/insetfloat.C (type): new method
1778 * src/insets/insetcaption.C (Write): new method
1780 (LyxCode): new method
1782 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1783 to get it right together with using the FloatList.
1785 * src/commandtags.h: add LFUN_INSET_CAPTION
1786 * src/lyxfunc.C (Dispatch): handle it
1788 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1791 * src/Variables.[Ch]: make expand take a const reference, remove
1792 the destructor, some whitespace changes.
1794 * src/LyXAction.C (init): add caption-inset-insert
1796 * src/FloatList.C (FloatList): update the default floats a bit.
1798 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1800 * src/Variables.[Ch]: new files. Intended to be used for language
1801 specific strings (like \chaptername) and filename substitution in
1804 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1806 * lib/kbd/american.kmap: update
1808 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1810 * src/bufferparams.[Ch]: remove member allowAccents.
1812 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1814 * src/LaTeXLog.C: use the log_form.h header.
1815 * src/lyx_gui.C: ditto.
1816 * src/lyx_gui_misc.C: ditto.
1817 * src/lyxvc.h: ditto.
1819 * forms/log_form.fd: new file, created from latexoptions.fd. I
1820 kept the log popup and nuked the options form.
1822 * src/{la,}texoptions.[Ch]: removed.
1823 * src/lyx_cb.C (LaTeXOptions): ditto
1825 * src/lyx_gui.C (create_forms): do not handle the
1826 fd_latex_options form.
1828 2000-07-18 Juergen Vigna <jug@sad.it>
1830 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1831 name of the inset so that it can be requested outside (text2.C).
1833 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1836 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1838 * src/mathed/formula.h (ConvertFont): constify
1840 * src/mathed/formula.C (Read): add warning if \end_inset is not
1841 found on expected place.
1843 * src/insets/lyxinset.h (ConvertFont): consify
1845 * src/insets/insetquotes.C (ConvertFont): constify
1846 * src/insets/insetquotes.h: ditto
1848 * src/insets/insetinfo.h: add labelfont
1850 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1851 (ascent): use labelfont
1855 (Write): make .lyx file a bit nicer
1857 * src/insets/insetfloat.C (Write): simplify somewhat...
1858 (Read): add warning if arg is not found
1860 * src/insets/insetcollapsable.C: add using std::max
1861 (Read): move string token and add warning in arg is not found
1862 (draw): use std::max to get the right ty
1863 (getMaxWidth): simplify by using std::max
1865 * src/insets/insetsection.h: new file
1866 * src/insets/insetsection.C: new file
1867 * src/insets/insetcaption.h: new file
1868 * src/insets/insetcaption.C: new file
1870 * src/insets/inset.C (ConvertFont): constify signature
1872 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1873 insetcaption.[Ch] and insetsection.[Ch]
1875 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1876 uses to use LABEL_COUNTER_CHAPTER instead.
1877 * src/text2.C (SetCounter): here
1879 * src/counters.h: new file
1880 * src/counters.C: new file
1881 * src/Sectioning.h: new file
1882 * src/Sectioning.C: new file
1884 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1886 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1888 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1891 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1894 2000-07-17 Juergen Vigna <jug@sad.it>
1896 * src/tabular.C (Validate): check if array-package is needed.
1897 (SetVAlignment): added support for vertical alignment.
1898 (SetLTFoot): better support for longtable header/footers
1899 (Latex): modified to support added features.
1901 * src/LaTeXFeatures.[Ch]: added array-package.
1903 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1905 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1908 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1910 * configure.in: do not forget to put a space after -isystem.
1912 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1914 * lib/kbd/arabic.kmap: a few fixes.
1916 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1918 * some whitespace chagnes to a number of files.
1920 * src/support/DebugStream.h: change to make it easier for
1921 doc++ to parse correctly.
1922 * src/support/lyxstring.h: ditto
1924 * src/mathed/math_utils.C (compara): change to have only one
1926 (MathedLookupBOP): change because of the above.
1928 * src/mathed/math_delim.C (math_deco_compare): change to have only
1930 (search_deco): change becasue of the above.
1932 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1933 instead of manually coded one.
1935 * src/insets/insetquotes.C (Read): read the \end_inset too
1937 * src/insets/insetlatex.h: remove file
1938 * src/insets/insetlatex.C: remove file
1940 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1942 (InsetPrintIndex): remove destructor
1944 * src/insets/insetinclude.h: remove default constructor
1946 * src/insets/insetfloat.C: work to make it work better
1948 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1950 * src/insets/insetcite.h (InsetCitation): remove default constructor
1952 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1954 * src/text.C (GetColumnNearX): comment out some currently unused code.
1956 * src/paragraph.C (writeFile): move some initializations closer to
1958 (CutIntoMinibuffer): small change to use new matchIT operator
1962 (InsertInset): ditto
1965 (InsetIterator): ditto
1966 (Erase): small change to use new matchFT operator
1968 (GetFontSettings): ditto
1969 (HighestFontInRange): ditto
1972 * src/lyxparagraph.h: some chars changed to value_type
1973 (matchIT): because of some stronger checking (perhaps too strong)
1974 in SGI STL, the two operator() unified to one.
1977 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1979 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1980 the last inset read added
1981 (parseSingleLyXformat2Token): some more (future) compability code added
1982 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1983 (parseSingleLyXformat2Token): set last_inset_read
1984 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1985 (parseSingleLyXformat2Token): don't double intializw string next_token
1987 * src/TextCache.C (text_fits::operator()): add const's to the signature
1988 (has_buffer::operator()): ditto
1990 * src/Floating.h: add some comments on the class
1992 * src/FloatList.[Ch] (typeExist): new method
1995 * src/BackStack.h: added default constructor, wanted by Gcc.
1997 2000-07-14 Juergen Vigna <jug@sad.it>
1999 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2001 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2003 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2004 do a redraw when the window is resized!
2005 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2007 * src/insets/insettext.C (resizeLyXText): added function to correctly
2008 being able to resize the LyXWindow.
2010 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2012 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2014 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2015 crashes when closing dialog to a deleted inset.
2017 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2018 method! Now similar to other insets.
2020 2000-07-13 Juergen Vigna <jug@sad.it>
2022 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2024 * lib/examples/Literate.lyx: small patch!
2026 * src/insets/insetbib.C (Read): added this function because of wrong
2027 Write (without [begin|end]_inset).
2029 2000-07-11 Juergen Vigna <jug@sad.it>
2031 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2032 as the insertInset could not be good!
2034 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2035 the bool param should not be last.
2037 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2039 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2040 did submit that to Karl).
2042 * configure.in: use -isystem instead of -I for X headers. This
2043 fixes a problem on solaris with a recent gcc;
2044 put the front-end code after the X detection code;
2045 configure in sigc++ before lib/
2047 * src/lyx_main.C (commandLineHelp): remove -display from command
2050 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2052 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2053 Also put in Makefile rules for building the ``listerrors''
2054 program for parsing errors from literate programs written in LyX.
2056 * lib/build-listerrors: Added small shell script as part of compile
2057 process. This builds a working ``listerrors'' binary if noweb is
2058 installed and either 1) the VNC X server is installed on the machine,
2059 or 2) the user is compiling from within a GUI. The existence of a GUI
2060 is necessary to use the ``lyx --export'' feature for now. This
2061 hack can be removed once ``lyx --export'' no longer requires a GUI to
2064 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2066 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2067 now passed back correctly from gcc and placed "under" error
2068 buttons in a Literate LyX source.
2070 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2072 * src/text.C (GetColumnNearX): Better behavior when a RTL
2073 paragraph is ended by LTR text.
2075 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2078 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2080 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2081 true when clipboard is empty.
2083 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2085 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2086 row of the paragraph.
2087 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2088 to prevent calculation of bidi tables
2090 2000-07-07 Juergen Vigna <jug@sad.it>
2092 * src/screen.C (ToggleSelection): added y_offset and x_offset
2095 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2098 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2100 * src/insets/insettext.C: fixed Layout-Display!
2102 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2104 * configure.in: add check for strings.h header.
2106 * src/spellchecker.C: include <strings.h> in order to have a
2107 definition for bzero().
2109 2000-07-07 Juergen Vigna <jug@sad.it>
2111 * src/insets/insettext.C (draw): set the status of the bv->text to
2112 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2114 * src/screen.C (DrawOneRow):
2115 (DrawFromTo): redraw the actual row if something has changed in it
2118 * src/text.C (draw): call an update of the toplevel-inset if something
2119 has changed inside while drawing.
2121 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2123 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2125 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2126 processing inside class.
2128 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2129 processing inside class.
2131 * src/insets/insetindex.h new struct Holder, consistent with other
2134 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2135 citation dialog from main code and placed it in src/frontends/xforms.
2136 Dialog launched through signals instead of callbacks
2138 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2140 * lyx.man: update the options description.
2142 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2144 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2145 handle neg values, set min width to 590, add doc about -display
2147 2000-07-05 Juergen Vigna <jug@sad.it>
2149 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2150 calls to BufferView *.
2152 * src/insets/insettext.C (checkAndActivateInset): small fix non
2153 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2155 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2156 their \end_inset token!
2158 2000-07-04 edscott <edscott@imp.mx>
2160 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2161 lib/lyxrc.example: added option \wheel_jump
2163 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2165 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2166 remove support for -width,-height,-xpos and -ypos.
2168 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2170 * src/encoding.[Ch]: New files.
2172 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2173 (text): Call to the underline() method only when needed.
2175 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2177 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2178 encoding(s) for the document.
2180 * src/bufferparams.C (BufferParams): Changed default value of
2183 * src/language.C (newLang): Removed.
2184 (items[]): Added encoding information for all defined languages.
2186 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2187 encoding choice button.
2189 * src/lyxrc.h (font_norm_type): New member variable.
2190 (set_font_norm_type): New method.
2192 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2193 paragraphs with different encodings.
2195 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2196 (TransformChar): Changed to work correctly with Arabic points.
2197 (draw): Added support for drawing Arabic points.
2198 (draw): Removed code for drawing underbars (this is done by
2201 * src/support/textutils.h (IsPrintableNonspace): New function.
2203 * src/BufferView_pimpl.h: Added "using SigC::Object".
2204 * src/LyXView.h: ditto.
2206 * src/insets/insetinclude.h (include_label): Changed to mutable.
2208 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2210 * src/mathed/math_iter.h: remove empty destructor
2212 * src/mathed/math_cursor.h: remove empty destructor
2214 * src/insets/lyxinset.h: add THEOREM_CODE
2216 * src/insets/insettheorem.[Ch]: new files
2218 * src/insets/insetminipage.C: (InsertInset): remove
2220 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2222 (InsertInset): remove
2224 * src/insets/insetlist.C: (InsertList): remove
2226 * src/insets/insetfootlike.[Ch]: new files
2228 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2231 (InsertInset): ditto
2233 * src/insets/insetert.C: remove include Painter.h, reindent
2234 (InsertInset): move to header
2236 * src/insets/insetcollapsable.h: remove explicit from default
2237 contructor, remove empty destructor, add InsertInset
2239 * src/insets/insetcollapsable.C (InsertInset): new func
2241 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2243 * src/vspace.h: add explicit to constructor
2245 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2246 \textcompwordmark, please test this.
2248 * src/lyxrc.C: set ascii_linelen to 65 by default
2250 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2252 * src/commandtags.h: add LFUN_INSET_THEOREM
2254 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2255 (makeLinuxDocFile): remove _some_ of the nice logic
2256 (makeDocBookFile): ditto
2258 * src/Painter.[Ch]: (~Painter): removed
2260 * src/LyXAction.C (init): entry for insettheorem added
2262 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2264 (deplog): code to detect files generated by LaTeX, needs testing
2267 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2269 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2271 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2273 * src/LaTeX.C (deplog): Add a check for files that are going to be
2274 created by the first latex run, part of the project to remove the
2277 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2278 contents to the extension list.
2280 2000-07-04 Juergen Vigna <jug@sad.it>
2282 * src/text.C (NextBreakPoint): added support for needFullRow()
2284 * src/insets/lyxinset.h: added needFullRow()
2286 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2289 * src/insets/insettext.C: lots of changes for update!
2291 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2293 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2295 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2297 * src/insets/insetinclude.C (InsetInclude): fixed
2298 initialization of include_label.
2299 (unique_id): now returns a string.
2301 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2303 * src/LaTeXFeatures.h: new member IncludedFiles, for
2304 a map of key, included file name.
2306 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2307 with the included files for inclusion in SGML preamble,
2308 i. e., linuxdoc and docbook.
2311 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2312 nice (is the generated linuxdoc code to be exported?), that
2313 allows to remove column, and only_body that will be true for
2314 slave documents. Insets are allowed inside SGML font type.
2315 New handling of the SGML preamble for included files.
2316 (makeDocBookFile): the same for docbook.
2318 * src/insets/insetinclude.h:
2319 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2321 (DocBook): new export methods.
2323 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2324 and makeDocBookFile.
2326 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2327 formats to export with command line argument -x.
2329 2000-06-29 Juergen Vigna <jug@sad.it>
2331 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2332 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2334 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2335 region could already been cleared by an inset!
2337 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2339 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2342 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2344 (cursorToggle): remove special handling of lyx focus.
2346 2000-06-28 Juergen Vigna <jug@sad.it>
2348 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2351 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2353 * src/insets/insetindex.C (Edit): add a callback when popup is
2356 * src/insets/insettext.C (LocalDispatch):
2357 * src/insets/insetmarginal.h:
2358 * src/insets/insetlist.h:
2359 * src/insets/insetfoot.h:
2360 * src/insets/insetfloat.h:
2361 * src/insets/insetert.h: add a missing std:: qualifier.
2363 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2365 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2368 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2370 * src/insets/insettext.C (Read): remove tmptok unused variable
2371 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2372 (InsertInset): change for new InsetInset code
2374 * src/insets/insettext.h: add TEXT inline method
2376 * src/insets/insettext.C: remove TEXT macro
2378 * src/insets/insetmarginal.C (Write): new method
2379 (Latex): change output slightly
2381 * src/insets/insetfoot.C (Write): new method
2382 (Latex): change output slightly (don't use endl when no need)
2384 * src/insets/insetert.C (Write): new method
2386 * src/insets/insetcollapsable.h: make button_length, button_top_y
2387 and button_bottm_y protected.
2389 * src/insets/insetcollapsable.C (Write): simplify code by using
2390 tostr. Also do not output the float name, the children class
2391 should to that to get control over own arguments
2393 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2394 src/insets/insetminipage.[Ch]:
2397 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2399 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2401 * src/Makefile.am (lyx_SOURCES): add the new files
2403 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2404 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2405 * src/commandtags.h: ditto
2407 * src/LaTeXFeatures.h: add a std::set of used floattypes
2409 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2411 * src/FloatList.[Ch] src/Floating.h: new files
2413 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2415 * src/lyx_cb.C (TableApplyCB): ditto
2417 * src/text2.C: ditto
2418 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2419 (parseSingleLyXformat2Token): ditto + add code for
2420 backwards compability for old float styles + add code for new insets
2422 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2424 (InsertInset(size_type, Inset *, LyXFont)): new method
2425 (InsetChar(size_type, char)): changed to use the other InsetChar
2426 with a LyXFont(ALL_INHERIT).
2427 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2428 insert the META_INSET.
2430 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2432 * sigc++/thread.h (Threads): from here
2434 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2435 definition out of line
2436 * sigc++/scope.h: from here
2438 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2440 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2441 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2443 * Makefile.am (bindist): new target.
2445 * INSTALL: add instructions for doing a binary distribution.
2447 * development/tools/README.bin.example: update a bit.
2449 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2452 * lib/lyxrc.example: new lyxrc tag \set_color.
2454 * src/lyxfunc.C (Dispatch):
2455 * src/commandtags.h:
2456 * src/LyXAction.C: new lyxfunc "set-color".
2458 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2459 and an x11name given as strings.
2461 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2462 cache when a color is changed.
2464 2000-06-26 Juergen Vigna <jug@sad.it>
2466 * src/lyxrow.C (width): added this functions and variable.
2468 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2471 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2473 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2475 * images/undo_bw.xpm: new icon.
2476 * images/redo_bw.xpm: ditto.
2478 * configure.in (INSTALL_SCRIPT): change value to
2479 ${INSTALL} to avoid failures of install-script target.
2480 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2482 * src/BufferView.h: add a magic "friend" declaration to please
2485 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2487 * forms/cite.fd: modified to allow resizing without messing
2490 * src/insetcite.C: Uses code from cite.fd almost without
2492 User can now resize dialog in the x-direction.
2493 Resizing the dialog in the y-direction is prevented, as the
2494 code does this intelligently already.
2496 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2498 * INSTALL: remove obsolete entry in "problems" section.
2500 * lib/examples/sl_*.lyx: update of the slovenian examples.
2502 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2504 2000-06-23 Juergen Vigna <jug@sad.it>
2506 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2508 * src/buffer.C (resize): delete the LyXText of textinsets.
2510 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2512 * src/insets/lyxinset.h: added another parameter 'cleared' to
2513 the draw() function.
2515 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2516 unlocking inset in inset.
2518 2000-06-22 Juergen Vigna <jug@sad.it>
2520 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2521 of insets and moved first to LyXText.
2523 * src/mathed/formulamacro.[Ch]:
2524 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2526 2000-06-21 Juergen Vigna <jug@sad.it>
2528 * src/text.C (GetVisibleRow): look if I should clear the area or not
2529 using Inset::doClearArea() function.
2531 * src/insets/lyxinset.h: added doClearArea() function and
2532 modified draw(Painter &, ...) to draw(BufferView *, ...)
2534 * src/text2.C (UpdateInset): return bool insted of int
2536 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2538 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2539 combox in the character popup
2541 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2542 BufferParams const & params
2544 2000-06-20 Juergen Vigna <jug@sad.it>
2546 * src/insets/insettext.C (SetParagraphData): set insetowner on
2549 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2551 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2552 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2554 (form_main_): remove
2556 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2557 (create_form_form_main): remove FD_form_main stuff, connect to
2558 autosave_timeout signal
2560 * src/LyXView.[Ch] (getMainForm): remove
2561 (UpdateTimerCB): remove
2562 * src/BufferView_pimpl.h: inherit from SigC::Object
2564 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2565 signal instead of callback
2567 * src/BufferView.[Ch] (cursorToggleCB): remove
2569 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2571 * src/BufferView_pimpl.C: changes because of the one below
2573 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2574 instead of storing a pointer to a LyXText.
2576 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2578 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2580 * src/lyxparagraph.h
2582 * src/paragraph.C: Changed fontlist to a sorted vector.
2584 2000-06-19 Juergen Vigna <jug@sad.it>
2586 * src/BufferView.h: added screen() function.
2588 * src/insets/insettext.C (LocalDispatch): some selection code
2591 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2593 * src/insets/insettext.C (SetParagraphData):
2595 (InsetText): fixes for multiple paragraphs.
2597 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2599 * development/lyx.spec.in: Call configure with ``--without-warnings''
2600 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2601 This should be fine, however, since we generally don't want to be
2602 verbose when making an RPM.
2604 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2606 * lib/scripts/fig2pstex.py: New file
2608 2000-06-16 Juergen Vigna <jug@sad.it>
2610 * src/insets/insettabular.C (UpdateLocal):
2611 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2612 (LocalDispatch): Changed all functions to use LyXText.
2614 2000-06-15 Juergen Vigna <jug@sad.it>
2616 * src/text.C (SetHeightOfRow): call inset::update before requesting
2619 * src/insets/insettext.C (update):
2620 * src/insets/insettabular.C (update): added implementation
2622 * src/insets/lyxinset.h: added update function
2624 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2626 * src/text.C (SelectNextWord): protect against null pointers with
2627 old-style string streams. (fix from Paul Theo Gonciari
2630 * src/cite.[Ch]: remove erroneous files.
2632 * lib/configure.m4: update the list of created directories.
2634 * src/lyxrow.C: include <config.h>
2635 * src/lyxcursor.C: ditto.
2637 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2639 * lib/examples/decimal.lyx: new example file from Mike.
2641 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2642 to find template definitions (from Dekel)
2644 * src/frontends/.cvsignore: add a few things.
2646 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2648 * src/Timeout.C (TimeOut): remove default argument.
2650 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2653 * src/insets/ExternalTemplate.C: add a "using" directive.
2655 * src/lyx_main.h: remove the act_ struct, which seems unused
2658 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2660 * LyX Developers Meeting: All files changed, due to random C++ (by
2661 coincidence) code generator script.
2663 - external inset (cool!)
2664 - initial online editing of preferences
2665 - insettabular breaks insettext(s contents)
2667 - some DocBook fixes
2668 - example files update
2669 - other cool stuff, create a diff and look for yourself.
2671 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2673 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2674 -1 this is a non-line-breaking textinset.
2676 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2677 if there is no width set.
2679 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2681 * Lots of files: Merged the dialogbase branch.
2683 2000-06-09 Allan Rae <rae@lyx.org>
2685 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2686 and the Dispatch methods that used it.
2688 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2689 access to functions formerly kept in Dispatch.
2691 2000-05-19 Allan Rae <rae@lyx.org>
2693 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2694 made to_page and count_copies integers again. from_page remains a
2695 string however because I want to allow entry of a print range like
2696 "1,4,22-25" using this field.
2698 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2699 and printer-params-get. These aren't useful from the minibuffer but
2700 could be used by a script/LyXServer app provided it passes a suitable
2701 auto_mem_buffer. I guess I should take a look at how the LyXServer
2702 works and make it support xtl buffers.
2704 * sigc++/: updated to libsigc++-1.0.1
2706 * src/xtl/: updated to xtl-1.3.pl.11
2708 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2709 those changes done to the files in src/ are actually recreated when
2710 they get regenerated. Please don't ever accept a patch that changes a
2711 dialog unless that patch includes the changes to the corresponding *.fd
2714 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2715 stringOnlyContains, renamed it and generalised it.
2717 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2718 branch. Removed the remaining old form_print code.
2720 2000-04-26 Allan Rae <rae@lyx.org>
2722 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2723 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2725 2000-04-25 Allan Rae <rae@lyx.org>
2727 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2728 against a base of xtl-1.3.pl.4
2730 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2731 filter the Id: entries so they still show the xtl version number
2734 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2735 into the src/xtl code. Patch still pending with José (XTL)
2737 2000-04-24 Allan Rae <rae@lyx.org>
2739 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2740 both more generic and much safer. Use the new template functions.
2741 * src/buffer.[Ch] (Dispatch): ditto.
2743 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2744 and mem buffer more intelligently. Also a little general cleanup.
2747 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2748 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2749 * src/xtl/Makefile.am: ditto.
2750 * src/xtl/.cvsignore: ditto.
2751 * src/Makefile.am: ditto.
2753 * src/PrinterParams.h: Removed the macros member functions. Added a
2754 testInvariant member function. A bit of tidying up and commenting.
2755 Included Angus's idea for fixing operation with egcs-1.1.2.
2757 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2758 cool expansion of XTL's mem_buffer to support automatic memory
2759 management within the buffer itself. Removed the various macros and
2760 replaced them with template functions that use either auto_mem_buffer
2761 or mem_buffer depending on a #define. The mem_buffer support will
2762 disappear as soon as the auto_mem_buffer is confirmed to be good on
2763 other platforms/compilers. That is, it's there so you've got something
2766 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2767 effectively forked XTL. However I expect José will include my code
2768 into the next major release. Also fixed a memory leak.
2769 * src/xtl/text.h: ditto.
2770 * src/xtl/xdr.h: ditto.
2771 * src/xtl/giop.h: ditto.
2773 2000-04-16 Allan Rae <rae@lyx.org>
2775 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2776 by autogen.sh and removed by maintainer-clean anyway.
2777 * .cvsignore, sigc++/.cvsignore: Support the above.
2779 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2781 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2783 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2784 macros, renamed static callback-target member functions to suit new
2785 scheme and made them public.
2786 * src/frontends/xforms/forms/form_print.fd: ditto.
2787 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2789 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2792 * src/xtl/: New directory containing a minimal distribution of XTL.
2793 This is XTL-1.3.pl.4.
2795 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2797 2000-04-15 Allan Rae <rae@lyx.org>
2799 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2801 * sigc++/: Updated to libsigc++-1.0.0
2803 2000-04-14 Allan Rae <rae@lyx.org>
2805 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2806 use the generic ones in future. I'll modify my conversion script.
2808 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2810 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2811 (CloseAllBufferRelatedDialogs): Renamed.
2812 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2814 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2815 of the generic ones. These are the same ones my conversion script
2818 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2819 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2820 * src/buffer.C (Dispatch): ditto
2822 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2823 functions for updating and hiding buffer dependent dialogs.
2824 * src/BufferView.C (buffer): ditto
2825 * src/buffer.C (setReadonly): ditto
2826 * src/lyxfunc.C (CloseBuffer): ditto
2828 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2829 Dialogs.h, and hence all the SigC stuff, into every file that includes
2830 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2832 * src/BufferView2.C: reduce the number of headers included by buffer.h
2834 2000-04-11 Allan Rae <rae@lyx.org>
2836 * src/frontends/xforms/xform_macros.h: A small collection of macros
2837 for building C callbacks.
2839 * src/frontends/xforms/Makefile.am: Added above file.
2841 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2842 scheme again. This time it should work for JMarc. If this is
2843 successful I'll revise my conversion script to automate some of this.
2844 The static member functions in the class also have to be public for
2845 this scheme will work. If the scheme works (it's almost identical to
2846 the way BufferView::cursorToggleCB is handled so it should work) then
2847 FormCopyright and FormPrint will be ready for inclusion into the main
2848 trunk immediately after 1.1.5 is released -- provided we're prepared
2849 for complaints about lame compilers not handling XTL.
2851 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2853 2000-04-07 Allan Rae <rae@lyx.org>
2855 * config/lyxinclude.m4: A bit more tidying up (Angus)
2857 * src/LString.h: JMarc's <string> header fix
2859 * src/PrinterParams.h: Used string for most data to remove some
2860 ugly code in the Print dialog and avoid even uglier code when
2861 appending the ints to a string for output.
2863 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2864 and moved "default:" back to the end of switch statement. Cleaned
2865 up the printing so it uses the right function calls and so the
2866 "print to file" option actually puts the file in the right directory.
2868 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2870 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2871 and Ok+Apply button control into a separate method: input (Angus).
2872 (input) Cleaned it up and improved it to be very thorough now.
2873 (All CB) static_cast used instead of C style cast (Angus). This will
2874 probably change again once we've worked out how to keep gcc-2.8.1 happy
2875 with real C callbacks.
2876 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2877 ignore some of the bool settings and has random numbers instead. Needs
2878 some more investigation. Added other input length checks and checking
2879 of file and printer names.
2881 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2882 would link (Angus). Seems the old code doesn't compile with the pragma
2883 statement either. Separated callback entries from internal methods.
2885 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2887 2000-03-17 Allan Rae <rae@lyx.org>
2889 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2890 need it? Maybe it could go in Dialogs instead? I could make it a
2891 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2892 values to get the bool return value.
2893 (Dispatch): New overloaded method for xtl support.
2895 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2896 extern "C" callback instead of static member functions. Hopefully,
2897 JMarc will be able to compile this. I haven't changed
2898 forms/form_copyright.fd yet. Breaking one of my own rules already.
2900 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2901 because they aren't useful from the minibuffer. Maybe a LyXServer
2902 might want a help message though?
2904 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2906 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2907 xtl which needs both rtti and exceptions.
2909 * src/support/Makefile.am:
2910 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2912 * src/frontends/xforms/input_validators.[ch]: input filters and
2913 validators. These conrol what keys are valid in input boxes.
2914 Use them and write some more. Much better idea than waiting till
2915 after the user has pressed Ok to say that the input fields don't make
2918 * src/frontends/xforms/Makefile.am:
2919 * src/frontends/xforms/forms/form_print.fd:
2920 * src/frontends/xforms/forms/makefile:
2921 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2922 new scheme. Still have to make sure I haven't missed anything from
2923 the current implementation.
2925 * src/Makefile.am, src/PrinterParams.h: New data store.
2927 * other files: Added a couple of copyright notices.
2929 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2931 * src/insets/insetbib.h: move Holder struct in public space.
2933 * src/frontends/include/DialogBase.h: use SigC:: only when
2934 SIGC_CXX_NAMESPACES is defined.
2935 * src/frontends/include/Dialogs.h: ditto.
2937 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2939 * src/frontends/xforms/FormCopyright.[Ch]: do not
2940 mention SigC:: explicitely.
2942 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2944 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2945 deals with testing KDE in main configure.in
2946 * configure.in: ditto.
2948 2000-02-22 Allan Rae <rae@lyx.org>
2950 * Lots of files: Merged from HEAD
2952 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2953 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2955 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2957 * sigc++/: new minidist.
2959 2000-02-14 Allan Rae <rae@lyx.org>
2961 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2963 2000-02-08 Juergen Vigna <jug@sad.it>
2965 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2966 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2968 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2969 for this port and so it is much easier for other people to port
2970 dialogs in a common development environment.
2972 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2973 the QT/KDE implementation.
2975 * src/frontends/kde/Dialogs.C:
2976 * src/frontends/kde/FormCopyright.C:
2977 * src/frontends/kde/FormCopyright.h:
2978 * src/frontends/kde/Makefile.am:
2979 * src/frontends/kde/formcopyrightdialog.C:
2980 * src/frontends/kde/formcopyrightdialog.h:
2981 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2982 for the kde support of the Copyright-Dialog.
2984 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2985 subdir-substitution instead of hardcoded 'xforms' as we now have also
2988 * src/frontends/include/DialogBase.h (Object): just commented the
2989 label after #endif (nasty warning and I don't like warnings ;)
2991 * src/main.C (main): added KApplication initialization if using
2994 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2995 For now only the KDE event-loop is added if frontend==kde.
2997 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2999 * configure.in: added support for the --with-frontend[=value] option
3001 * autogen.sh: added kde.m4 file to list of config-files
3003 * acconfig.h: added define for KDEGUI-support
3005 * config/kde.m4: added configuration functions for KDE-port
3007 * config/lyxinclude.m4: added --with-frontend[=value] option with
3008 support for xforms and KDE.
3010 2000-02-08 Allan Rae <rae@lyx.org>
3012 * all Makefile.am: Fixed up so the make targets dist, distclean,
3013 install and uninstall all work even if builddir != srcdir. Still
3014 have a new sigc++ minidist update to come.
3016 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3018 2000-02-01 Allan Rae <rae@lyx.org>
3020 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3021 Many mods to get builddir != srcdir working.
3023 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3024 for building on NT and so we can do the builddir != srcdir stuff.
3026 2000-01-30 Allan Rae <rae@lyx.org>
3028 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3029 This will stay in "rae" branch. We probably don't really need it in
3030 the main trunk as anyone who wants to help programming it should get
3031 a full library installed also. So they can check both included and
3032 system supplied library compilation.
3034 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3035 Added a 'mini' distribution of libsigc++. If you feel the urge to
3036 change something in these directories - Resist it. If you can't
3037 resist the urge then you should modify the following script and rebuild
3038 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3039 all happen. Still uses a hacked version of libsigc++'s configure.in.
3040 I'm quite happy with the results. I'm not sure the extra work to turn
3041 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3042 worth the trouble and would probably lead to extra maintenance
3044 I haven't tested the following important make targets: install, dist.
3045 Not ready for prime time but very close. Maybe 1.1.5.
3047 * development/tools/makeLyXsigc.sh: A shell script to automatically
3048 generate our mini-dist of libsigc++. It can only be used with a CVS
3049 checkout of libsigc++ not a tarball distribution. It's well commented.
3050 This will end up as part of the libsigc++ distribution so other apps
3051 can easily have an included mini-dist. If someone makes mods to the
3052 sigc++ subpackage without modifying this script to generate those
3053 changes I'll be very upset!
3055 * src/frontends/: Started the gui/system indep structure.
3057 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3058 to access the gui-indep dialogs are in this class. Much improved
3059 design compared to previous revision. Lars, please refrain from
3060 moving this header into src/ like you did with Popups.h last time.
3062 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3064 * src/frontends/xforms/: Started the gui-indep system with a single
3065 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3068 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3069 Here you'll find a very useful makefile and automated fdfix.sh that
3070 makes updating dailogs a no-brainer -- provided you follow the rules
3071 set out in the README. I'm thinking about adding another script to
3072 automatically generate skeleton code for a new dialog given just the
3075 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3076 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3077 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3079 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3081 * src/support/LSubstring.C (operator): simplify
3083 * src/lyxtext.h: removed bparams, use buffer_->params instead
3085 * src/lyxrow.h: make Row a real class, move all variables to
3086 private and use accessors.
3088 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3090 (isRightToLeftPar): ditto
3091 (ChangeLanguage): ditto
3092 (isMultiLingual): ditto
3095 (SimpleTeXOnePar): ditto
3096 (TeXEnvironment): ditto
3097 (GetEndLabel): ditto
3099 (SetOnlyLayout): ditto
3100 (BreakParagraph): ditto
3101 (BreakParagraphConservative): ditto
3102 (GetFontSettings): ditto
3104 (CopyIntoMinibuffer): ditto
3105 (CutIntoMinibuffer): ditto
3106 (PasteParagraph): ditto
3107 (SetPExtraType): ditto
3108 (UnsetPExtraType): ditto
3109 (DocBookContTableRows): ditto
3110 (SimpleDocBookOneTablePar): ditto
3112 (TeXFootnote): ditto
3113 (SimpleTeXOneTablePar): ditto
3114 (TeXContTableRows): ditto
3115 (SimpleTeXSpecialChars): ditto
3118 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3119 to private and use accessors.
3121 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3122 this, we did not use it anymore and has not been for ages. Just a
3123 waste of cpu cycles.
3125 * src/language.h: make Language a real class, move all variables
3126 to private and use accessors.
3128 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3129 (create_view): remove
3130 (update): some changes for new timer
3131 (cursorToggle): use new timer
3132 (beforeChange): change for new timer
3134 * src/BufferView.h (cursorToggleCB): removed last paramter because
3137 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3138 (cursorToggleCB): change because of new timer code
3140 * lib/CREDITS: updated own mailaddress
3142 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3144 * src/support/filetools.C (PutEnv): fix the code in case neither
3145 putenv() nor setenv() have been found.
3147 * INSTALL: mention the install-strip Makefile target.
3149 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3150 read-only documents.
3152 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3154 * lib/reLyX/configure.in (VERSION): avoid using a previously
3155 generated reLyX wrapper to find out $prefix.
3157 * lib/examples/eu_adibide_lyx-atua.lyx:
3158 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3159 translation of the Tutorial (Dooteo)
3161 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3163 * forms/cite.fd: new citation dialog
3165 * src/insetcite.[Ch]: the new citation dialog is moved into
3168 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3171 * src/insets/insetcommand.h: data members made private.
3173 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3175 * LyX 1.1.5 released
3177 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3179 * src/version.h (LYX_RELEASE): to 1.1.5
3181 * src/spellchecker.C (RunSpellChecker): return false if the
3182 spellchecker dies upon creation.
3184 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3186 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3187 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3191 * lib/CREDITS: update entry for Martin Vermeer.
3193 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3195 * src/text.C (draw): Draw foreign language bars at the bottom of
3196 the row instead of at the baseline.
3198 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3200 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3202 * lib/bind/de_menus.bind: updated
3204 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3206 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3208 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3210 * src/menus.C (Limit_string_length): New function
3211 (ShowTocMenu): Limit the number of items/length of items in the
3214 * src/paragraph.C (String): Correct result for a paragraph inside
3217 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3219 * src/bufferlist.C (close): test of buf->getuser() == NULL
3221 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3223 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3224 Do not call to SetCursor when the paragraph is a closed footnote!
3226 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3228 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3231 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3233 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3236 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3237 reference popup, that activates the reference-back action
3239 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3241 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3242 the menus. Also fixed a bug.
3244 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3245 the math panels when switching buffers (unless new buffer is readonly).
3247 * src/BufferView.C (NoSavedPositions)
3248 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3250 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3252 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3253 less of dvi dirty or not.
3255 * src/trans_mgr.[Ch] (insert): change first parameter to string
3258 * src/chset.[Ch] (encodeString): add const to first parameter
3260 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3262 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3266 * src/LaTeX.C (deplog): better searching for dependency files in
3267 the latex log. Uses now regexps.
3269 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3270 instead of the box hack or \hfill.
3272 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3274 * src/lyxfunc.C (doImportHelper): do not create the file before
3275 doing the actual import.
3276 (doImportASCIIasLines): create a new file before doing the insert.
3277 (doImportASCIIasParagraphs): ditto.
3279 * lib/lyxrc.example: remove mention of non-existing commands
3281 * lyx.man: remove mention of color-related switches.
3283 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3285 * src/lyx_gui.C: remove all the color-related ressources, which
3286 are not used anymore.
3288 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3291 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3293 * src/lyxrc.C (read): Add a missing break in the switch
3295 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3297 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3299 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3302 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3304 * src/text.C (draw): draw bars under foreign language words.
3306 * src/LColor.[Ch]: add LColor::language
3308 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3310 * src/lyxcursor.h (boundary): New member variable
3312 * src/text.C (IsBoundary): New methods
3314 * src/text.C: Use the above for currect cursor movement when there
3315 is both RTL & LTR text.
3317 * src/text2.C: ditto
3319 * src/bufferview_funcs.C (ToggleAndShow): ditto
3321 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3323 * src/text.C (DeleteLineForward): set selection to true to avoid
3324 that DeleteEmptyParagraphMechanism does some magic. This is how it
3325 is done in all other functions, and seems reasonable.
3326 (DeleteWordForward): do not jump over non-word stuff, since
3327 CursorRightOneWord() already does it.
3329 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3330 DeleteWordBackward, since they seem safe to me (since selection is
3331 set to "true") DeleteEmptyParagraphMechanism does nothing.
3333 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3335 * src/lyx_main.C (easyParse): simplify the code by factoring the
3336 part that removes parameters from the command line.
3337 (LyX): check wether wrong command line options have been given.
3339 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3341 * src/lyx_main.C : add support for specifying user LyX
3342 directory via command line option -userdir.
3344 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3346 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3347 the number of items per popup.
3348 (Add_to_refs_menu): Ditto.
3350 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3352 * src/lyxparagraph.h: renamed ClearParagraph() to
3353 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3354 textclass as parameter, and do nothing if free_spacing is
3355 true. This fixes part of the line-delete-forward problems.
3357 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3358 (pasteSelection): ditto.
3359 (SwitchLayoutsBetweenClasses): more translatable strings.
3361 * src/text2.C (CutSelection): use StripLeadingSpaces.
3362 (PasteSelection): ditto.
3363 (DeleteEmptyParagraphMechanism): ditto.
3365 2000-05-26 Juergen Vigna <jug@sad.it>
3367 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3368 is not needed in tabular insets.
3370 * src/insets/insettabular.C (TabularFeatures): added missing features.
3372 * src/tabular.C (DeleteColumn):
3374 (AppendRow): implemented this functions
3375 (cellsturct::operator=): clone the inset too;
3377 2000-05-23 Juergen Vigna <jug@sad.it>
3379 * src/insets/insettabular.C (LocalDispatch): better selection support
3380 when having multicolumn-cells.
3382 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3384 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3386 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3388 * src/ColorHandler.C (getGCForeground): put more test into _()
3390 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3393 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3396 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3398 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3399 there are no labels, or when buffer is readonly.
3401 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3402 there are no labels, buffer is SGML, or when buffer is readonly.
3404 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3406 * src/LColor.C (LColor): change a couple of grey40 to grey60
3407 (LColor): rewore initalization to make compiles go some magnitude
3409 (getGUIName): don't use gettext until we need the string.
3411 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3413 * src/Bullet.[Ch]: Fixed a small bug.
3415 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3417 * src/paragraph.C (String): Several fixes/improvements
3419 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3421 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3423 * src/paragraph.C (String): give more correct output.
3425 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3427 * src/lyxfont.C (stateText) Do not output the language if it is
3428 eqaul to the language of the document.
3430 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3431 between two paragraphs with the same language.
3433 * src/paragraph.C (getParLanguage) Return a correct answer for an
3434 empty dummy paragraph.
3436 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3439 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3442 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3443 the menus/popup, if requested fonts are unavailable.
3445 2000-05-22 Juergen Vigna <jug@sad.it>
3447 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3448 movement support (Up/Down/Tab/Shift-Tab).
3449 (LocalDispatch): added also preliminari cursor-selection.
3451 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3453 * src/paragraph.C (PasteParagraph): Hopefully now right!
3455 2000-05-22 Garst R. Reese <reese@isn.net>
3457 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3458 of list, change all references to Environment to Command
3459 * tex/hollywood.cls : rewrite environments as commands, add
3460 \uppercase to interiorshot and exteriorshot to force uppecase.
3461 * tex/broadway.cls : rewrite environments as commands. Tweak
3464 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3466 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3467 size of items: use a constant intead of the hardcoded 40, and more
3468 importantly do not remove the %m and %x tags added at the end.
3469 (Add_to_refs_menu): use vector::size_type instead of
3470 unsigned int as basic types for the variables. _Please_ do not
3471 assume that size_t is equal to unsigned int. On an alpha, this is
3472 unsigned long, which is _not_ the same.
3474 * src/language.C (initL): remove language "hungarian", since it
3475 seems that "magyar" is better.
3477 2000-05-22 Juergen Vigna <jug@sad.it>
3479 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3481 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3484 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3485 next was deleted but not set to 0.
3487 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3489 * src/language.C (initL): change the initialization of languages
3490 so that compiles goes _fast_.
3492 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3495 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3497 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3501 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3503 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3505 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3509 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3512 * src/insets/insetlo*.[Ch]: Made editable
3514 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3516 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3517 the current selection.
3519 * src/BufferView_pimpl.C (stuffClipboard): new method
3521 * src/BufferView.C (stuffClipboard): new method
3523 * src/paragraph.C (String): new method
3525 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3526 LColor::ignore when lyxname is not found.
3528 * src/BufferView.C (pasteSelection): new method
3530 * src/BufferView_pimpl.C (pasteSelection): new method
3532 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3534 * src/WorkArea.C (request_clipboard_cb): new static function
3535 (getClipboard): new method
3536 (putClipboard): new method
3538 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3540 * LyX 1.1.5pre2 released
3542 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3544 * src/vspace.C (operator=): removed
3545 (operator=): removed
3547 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3549 * src/layout.C (NumberOfClass): manually set the type in make_pair
3550 (NumberOfLayout): ditto
3552 * src/language.C: use the Language constructor for ignore_lang
3554 * src/language.h: add constructors to struct Language
3556 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3558 * src/text2.C (SetCursorIntern): comment out #warning
3560 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3562 * src/mathed/math_iter.h: initialize sx and sw to 0
3564 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3566 * forms/lyx.fd: Redesign of form_ref
3568 * src/LaTeXFeatures.[Ch]
3572 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3575 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3576 and Buffer::inset_iterator.
3578 * src/menus.C: Added new menus: TOC and Refs.
3580 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3582 * src/buffer.C (getTocList): New method.
3584 * src/BufferView2.C (ChangeRefs): New method.
3586 * src/buffer.C (getLabelList): New method. It replaces the old
3587 getReferenceList. The return type is vector<string> instead of
3590 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3591 the old getLabel() and GetNumberOfLabels() methods.
3592 * src/insets/insetlabel.C (getLabelList): ditto
3593 * src/mathed/formula.C (getLabelList): ditto
3595 * src/paragraph.C (String): New method.
3597 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3598 Uses the new getTocList() method.
3599 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3600 which automatically updates the contents of the browser.
3601 (RefUpdateCB): Use the new getLabelList method.
3603 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3605 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3607 * src/spellchecker.C: Added using std::reverse;
3609 2000-05-19 Juergen Vigna <jug@sad.it>
3611 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3613 * src/insets/insettext.C (computeTextRows): small fix for display of
3614 1 character after a newline.
3616 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3619 2000-05-18 Juergen Vigna <jug@sad.it>
3621 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3622 when changing width of column.
3624 * src/tabular.C (set_row_column_number_info): setting of
3625 autobreak rows if necessary.
3627 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3629 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3631 * src/vc-backend.*: renamed stat() to status() and vcstat to
3632 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3633 compilation broke. The new name seems more relevant, anyway.
3635 2000-05-17 Juergen Vigna <jug@sad.it>
3637 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3638 which was wrong if the removing caused removing of rows!
3640 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3641 (pushToken): new function.
3643 * src/text2.C (CutSelection): fix problem discovered with purify
3645 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3647 * src/debug.C (showTags): enlarge the first column, now that we
3648 have 6-digits debug codes.
3650 * lib/layouts/hollywood.layout:
3651 * lib/tex/hollywood.cls:
3652 * lib/tex/brodway.cls:
3653 * lib/layouts/brodway.layout: more commands and fewer
3654 environments. Preambles moved in the .cls files. Broadway now has
3655 more options on scene numbering and less whitespace (from Garst)
3657 * src/insets/insetbib.C (getKeys): make sure that we are in the
3658 document directory, in case the bib file is there.
3660 * src/insets/insetbib.C (Latex): revert bogus change.
3662 2000-05-16 Juergen Vigna <jug@sad.it>
3664 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3665 the TabularLayout on cursor move.
3667 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3669 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3672 (draw): fixed cursor position and drawing so that the cursor is
3673 visible when before the tabular-inset.
3675 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3676 when creating from old insettext.
3678 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3680 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3682 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3683 * lib/tex/brodway.cls: ditto
3685 * lib/layouts/brodway.layout: change alignment of parenthical
3688 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3690 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3691 versions 0.88 and 0.89 are supported.
3693 2000-05-15 Juergen Vigna <jug@sad.it>
3695 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3698 * src/insets/insettext.C (computeTextRows): redone completely this
3699 function in a much cleaner way, because of problems when having a
3701 (draw): added a frame border when the inset is locked.
3702 (SetDrawLockedFrame): this sets if we draw the border or not.
3703 (SetFrameColor): this sets the frame color (default=insetframe).
3705 * src/insets/lyxinset.h: added x() and y() functions which return
3706 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3707 function which is needed to see if we have a locking inset of some
3708 type in this inset (needed for now in insettabular).
3710 * src/vspace.C (inPixels): the same function also without a BufferView
3711 parameter as so it is easier to use it in some ocasions.
3713 * src/lyxfunc.C: changed all places where insertInset was used so
3714 that now if it couldn't be inserted it is deleted!
3716 * src/TabularLayout.C:
3717 * src/TableLayout.C: added support for new tabular-inset!
3719 * src/BufferView2.C (insertInset): this now returns a bool if the
3720 inset was really inserted!!!
3722 * src/tabular.C (GetLastCellInRow):
3723 (GetFirstCellInRow): new helper functions.
3724 (Latex): implemented for new tabular class.
3728 (TeXTopHLine): new Latex() helper functions.
3730 2000-05-12 Juergen Vigna <jug@sad.it>
3732 * src/mathed/formulamacro.C (Read):
3733 * src/mathed/formula.C (Read): read also the \end_inset here!
3735 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3737 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3738 crush when saving formulae with unbalanced parenthesis.
3740 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3742 * src/layout.C: Add new keyword "endlabelstring" to layout file
3744 * src/text.C (GetVisibleRow): Draw endlabel string.
3746 * lib/layouts/broadway.layout
3747 * lib/layouts/hollywood.layout: Added endlabel for the
3748 Parenthetical layout.
3750 * lib/layouts/heb-article.layout: Do not use slanted font shape
3751 for Theorem like environments.
3753 * src/buffer.C (makeLaTeXFile): Always add "american" to
3754 the UsedLanguages list if document language is RTL.
3756 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3758 * add addendum to README.OS2 and small patch (from SMiyata)
3760 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3762 * many files: correct the calls to ChangeExtension().
3764 * src/support/filetools.C (ChangeExtension): remove the no_path
3765 argument, which does not belong there. Use OnlyFileName() instead.
3767 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3768 files when LaTeXing a non-nice latex file.
3770 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3771 a chain of "if". Return false when deadkeys are not handled.
3773 * src/lyx_main.C (LyX): adapted the code for default bindings.
3775 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3776 bindings for basic functionality (except deadkeys).
3777 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3779 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3780 several methods: handle override_x_deadkeys.
3782 * src/lyxrc.h: remove the "bindings" map, which did not make much
3783 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3785 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3787 * src/lyxfont.C (stateText): use a saner method to determine
3788 whether the font is "default". Seems to fix the crash with DEC
3791 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3793 2000-05-08 Juergen Vigna <jug@sad.it>
3795 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3796 TabularLayoutMenu with mouse-button-3
3797 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3799 * src/TabularLayout.C: added this file for having a Layout for
3802 2000-05-05 Juergen Vigna <jug@sad.it>
3804 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3805 recalculating inset-widths.
3806 (TabularFeatures): activated this function so that I can change
3807 tabular-features via menu.
3809 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3810 that I can test some functions with the Table menu.
3812 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3814 * src/lyxfont.C (stateText): guard against stupid c++libs.
3816 * src/tabular.C: add using std::vector
3817 some whitespace changes, + removed som autogenerated code.
3819 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3821 2000-05-05 Juergen Vigna <jug@sad.it>
3823 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3824 row, columns and cellstructures.
3826 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3828 * lib/lyxrc.example: remove obsolete entries.
3830 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3831 reading of protected_separator for free_spacing.
3833 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3835 * src/text.C (draw): do not display an exclamation mark in the
3836 margin for margin notes. This is confusing, ugly and
3839 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3840 AMS math' is checked.
3842 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3843 name to see whether including the amsmath package is needed.
3845 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3847 * src/paragraph.C (validate): Compute UsedLanguages correctly
3848 (don't insert the american language if it doesn't appear in the
3851 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3852 The argument of \thanks{} command is considered moving argument
3854 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3857 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3859 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3860 for appendix/minipage/depth. The lines can be now both in the footnote
3861 frame, and outside the frame.
3863 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3866 2000-05-05 Juergen Vigna <jug@sad.it>
3868 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3869 neede only in tabular.[Ch].
3871 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3873 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3875 (Write): write '~' for PROTECTED_SEPARATOR
3877 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3879 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3882 * src/mathed/formula.C (drawStr): rename size to siz.
3884 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3885 possibly fix a bug by not changing the pflags = flags to piflags =
3888 2000-05-05 Juergen Vigna <jug@sad.it>
3890 * src/insets/insetbib.C: moved using directive
3892 * src/ImportNoweb.C: small fix for being able to compile (missing
3895 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3897 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3898 to use clear, since we don't depend on this in the code. Add test
3901 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3903 * (various *.C files): add using std::foo directives to please dec
3906 * replace calls to string::clear() to string::erase() (Angus)
3908 * src/cheaders/cmath: modified to provide std::abs.
3910 2000-05-04 Juergen Vigna <jug@sad.it>
3912 * src/insets/insettext.C: Prepared all for inserting of multiple
3913 paragraphs. Still display stuff to do (alignment and other things),
3914 but I would like to use LyXText to do this when we cleaned out the
3915 table-support stuff.
3917 * src/insets/insettabular.C: Changed lot of stuff and added lots
3918 of functionality still a lot to do.
3920 * src/tabular.C: Various functions changed name and moved to be
3921 const functions. Added new Read and Write functions and changed
3922 lots of things so it works good with tabular-insets (also removed
3923 some stuff which is not needed anymore * hacks *).
3925 * src/lyxcursor.h: added operators == and != which just look if
3926 par and pos are (not) equal.
3928 * src/buffer.C (latexParagraphs): inserted this function to latex
3929 all paragraphs form par to endpar as then I can use this too for
3932 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3933 so that I can call this to from text insets with their own cursor.
3935 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3936 output off all paragraphs (because of the fix below)!
3938 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3939 the very last paragraph (this could be also the last paragraph of an
3942 * src/texrow.h: added rows() call which returns the count-variable.
3944 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3946 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3948 * lib/configure.m4: better autodetection of DocBook tools.
3950 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3952 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3954 * src/lyx_cb.C: add using std::reverse;
3956 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3959 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3960 selected files. Should fix repeated errors from generated files.
3962 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3964 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3966 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3967 the spellchecker popup.
3969 * lib/lyxrc.example: Removed the \number_inset section
3971 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3973 * src/insets/figinset.C (various): Use IsFileReadable() to make
3974 sure that the file actually exist. Relying on ghostscripts errors
3975 is a bad idea since they can lead to X server crashes.
3977 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3979 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3982 * lib/lyxrc.example: smallish typo in description of
3983 \view_dvi_paper_option
3985 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3988 * src/lyxfunc.C: doImportHelper to factor out common code of the
3989 various import methods. New functions doImportASCIIasLines,
3990 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3991 doImportLinuxDoc for the format specific parts.
3994 * buffer.C: Dispatch returns now a bool to indicate success
3997 * lyx_gui.C: Add getLyXView() for member access
3999 * lyx_main.C: Change logic for batch commands: First try
4000 Buffer::Dispatch (possibly without GUI), if that fails, use
4003 * lyx_main.C: Add support for --import command line switch.
4004 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4005 Available Formats: Everything accepted by 'buffer-import <format>'
4007 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4009 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4012 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4013 documents will be reformatted upon reentry.
4015 2000-04-27 Juergen Vigna <jug@sad.it>
4017 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4018 correctly only last pos this was a bug.
4020 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4022 * release of lyx-1.1.5pre1
4024 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4026 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4028 * src/menus.C: revert the change of naming (Figure->Graphic...)
4029 from 2000-04-11. It was incomplete and bad.
4031 * src/LColor.[Ch]: add LColor::depthbar.
4032 * src/text.C (GetVisibleRow): use it.
4034 * README: update the languages list.
4036 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4038 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4041 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4043 * README: remove sections that were just wrong.
4045 * src/text2.C (GetRowNearY): remove currentrow code
4047 * src/text.C (GetRow): remove currentrow code
4049 * src/screen.C (Update): rewritten a bit.
4050 (SmallUpdate): removed func
4052 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4054 (FullRebreak): return bool
4055 (currentrow): remove var
4056 (currentrow_y): ditto
4058 * src/lyxscreen.h (Draw): change arg to unsigned long
4059 (FitCursor): return bool
4060 (FitManualCursor): ditto
4061 (Smallpdate): remove func
4062 (first): change to unsigned long
4063 (DrawOneRow): change second arg to long (from long &)
4064 (screen_refresh_y): remove var
4065 (scree_refresh_row): ditto
4067 * src/lyxrow.h: change baseline to usigned int from unsigned
4068 short, this brings some implicit/unsigned issues out in the open.
4070 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4072 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4073 instead of smallUpdate.
4075 * src/lyxcursor.h: change y to unsigned long
4077 * src/buffer.h: don't call updateScrollbar after fitcursor
4079 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4080 where they are used. Removed "\\direction", this was not present
4081 in 1.1.4 and is already obsolete. Commented out some code that I
4082 believe to never be called.
4083 (runLiterate): don't call updateScrollbar after fitCursor
4085 (buildProgram): ditto
4088 * src/WorkArea.h (workWidth): change return val to unsigned
4091 (redraw): remove the button redraws
4092 (setScrollbarValue): change for scrollbar
4093 (getScrollbarValue): change for scrollbar
4094 (getScrollbarBounds): change for scrollbar
4096 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4097 (C_WorkArea_down_cb): removed func
4098 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4099 (resize): change for scrollbar
4100 (setScrollbar): ditto
4101 (setScrollbarBounds): ditto
4102 (setScrollbarIncrements): ditto
4103 (up_cb): removed func
4104 (down_cb): removed func
4105 (scroll_cb): change for scrollbar
4106 (work_area_handler): ditto
4108 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4109 when FitCursor did something.
4110 (updateScrollbar): some unsigned changes
4111 (downCB): removed func
4112 (scrollUpOnePage): removed func
4113 (scrollDownOnePage): remvoed func
4114 (workAreaMotionNotify): don't call screen->FitCursor but use
4115 fitCursor instead. and bool return val
4116 (workAreaButtonPress): ditto
4117 (workAreaButtonRelease): some unsigned changes
4118 (checkInsetHit): ditto
4119 (workAreaExpose): ditto
4120 (update): parts rewritten, comments about the signed char arg added
4121 (smallUpdate): removed func
4122 (cursorPrevious): call needed updateScrollbar
4125 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4128 * src/BufferView.[Ch] (upCB): removed func
4129 (downCB): removed func
4130 (smallUpdate): removed func
4132 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4134 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4135 currentrow, currentrow_y optimization. This did not help a lot and
4136 if we want to do this kind of optimization we should rather use
4137 cursor.row instead of the currentrow.
4139 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4140 buffer spacing and klyx spacing support.
4142 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4144 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4147 2000-04-26 Juergen Vigna <jug@sad.it>
4149 * src/insets/figinset.C: fixes to Lars sstream changes!
4151 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4153 * A lot of files: Added Ascii(ostream &) methods to all inset
4154 classes. Used when exporting to ASCII.
4156 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4157 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4160 * src/text2.C (ToggleFree): Disabled implicit word selection when
4161 there is a change in the language
4163 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4164 no output was generated for end-of-sentence inset.
4166 * src/insets/lyxinset.h
4169 * src/paragraph.C: Removed the insetnumber code
4171 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4173 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4175 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4176 no_babel and no_epsfig completely from the file.
4177 (parseSingleLyXformat2Token): add handling for per-paragraph
4178 spacing as written by klyx.
4180 * src/insets/figinset.C: applied patch by Andre. Made it work with
4183 2000-04-20 Juergen Vigna <jug@sad.it>
4185 * src/insets/insettext.C (cutSelection):
4186 (copySelection): Fixed with selection from right to left.
4187 (draw): now the rows are not recalculated at every draw.
4188 (computeTextRows): for now reset the inset-owner here (this is
4189 important for an undo or copy where the inset-owner is not set
4192 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4193 motion to the_locking_inset screen->first was forgotten, this was
4194 not important till we got multiline insets.
4196 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4198 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4199 code seems to be alright (it is code changed by Dekel, and the
4200 intent is indeed that all macros should be defined \protect'ed)
4202 * NEWS: a bit of reorganisation of the new user-visible features.
4204 2000-04-19 Juergen Vigna <jug@sad.it>
4206 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4207 position. Set the inset_owner of the used paragraph so that it knows
4208 that it is inside an inset. Fixed cursor handling with mouse and
4209 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4210 and cleanups to make TextInsets work better.
4212 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4213 Changed parameters of various functions and added LockInsetInInset().
4215 * src/insets/insettext.C:
4217 * src/insets/insetcollapsable.h:
4218 * src/insets/insetcollapsable.C:
4219 * src/insets/insetfoot.h:
4220 * src/insets/insetfoot.C:
4221 * src/insets/insetert.h:
4222 * src/insets/insetert.C: cleaned up the code so that it works now
4223 correctly with insettext.
4225 * src/insets/inset.C:
4226 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4227 that insets in insets are supported right.
4230 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4232 * src/paragraph.C: some small fixes
4234 * src/debug.h: inserted INSETS debug info
4236 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4237 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4239 * src/commandtags.h:
4240 * src/LyXAction.C: insert code for InsetTabular.
4242 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4243 not Button1MotionMask.
4244 (workAreaButtonRelease): send always a InsetButtonRelease event to
4246 (checkInsetHit): some setCursor fixes (always with insets).
4248 * src/BufferView2.C (lockInset): returns a bool now and extended for
4249 locking insets inside insets.
4250 (showLockedInsetCursor): it is important to have the cursor always
4251 before the locked inset.
4252 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4254 * src/BufferView.h: made lockInset return a bool.
4256 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4258 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4259 that is used also internally but can be called as public to have back
4260 a cursor pos which is not set internally.
4261 (SetCursorIntern): Changed to use above function.
4263 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4265 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4270 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4271 patches for things that should be in or should be changed.
4273 * src/* [insetfiles]: change "usigned char fragile" to bool
4274 fragile. There was only one point that could that be questioned
4275 and that is commented in formulamacro.C. Grep for "CHECK".
4277 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4278 (DeleteBuffer): take it out of CutAndPaste and make it static.
4280 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4282 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4283 output the spacing envir commands. Also the new commands used in
4284 the LaTeX output makes the result better.
4286 * src/Spacing.C (writeEnvirBegin): new method
4287 (writeEnvirEnd): new method
4289 2000-04-18 Juergen Vigna <jug@sad.it>
4291 * src/CutAndPaste.C: made textclass a static member of the class
4292 as otherwise it is not accesed right!!!
4294 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4296 * forms/layout_forms.fd
4297 * src/layout_forms.h
4298 * src/layout_forms.C (create_form_form_character)
4299 * src/lyx_cb.C (UserFreeFont)
4300 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4301 documents (in the layout->character popup).
4303 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4305 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4306 \spell_command was in fact not honored (from Kevin Atkinson).
4308 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4311 * src/lyx_gui.h: make lyxViews private (Angus)
4313 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4315 * src/mathed/math_write.C
4316 (MathMatrixInset::Write) Put \protect before \begin{array} and
4317 \end{array} if fragile
4318 (MathParInset::Write): Put \protect before \\ if fragile
4320 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4322 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4323 initialization if the LyXColorHandler must be done after the
4324 connections to the XServer has been established.
4326 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4327 get the background pixel from the lyxColorhandler so that the
4328 figures are rendered with the correct background color.
4329 (NextToken): removed functions.
4330 (GetPSSizes): use ifs >> string instead of NextToken.
4332 * src/Painter.[Ch]: the color cache moved out of this file.
4334 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4337 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4339 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4340 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4342 * src/BufferView.C (enterView): new func
4343 (leaveView): new func
4345 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4347 (leaveView): new func, undefines xterm cursor when approp.
4349 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4350 (AllowInput): delete the Workarea cursor handling from this func.
4352 * src/Painter.C (underline): draw a slimer underline in most cases.
4354 * src/lyx_main.C (error_handler): use extern "C"
4356 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4358 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4359 sent directly to me.
4361 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4362 to the list by Dekel.
4364 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4367 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4368 methods from lyx_cb.here.
4370 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4373 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4375 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4376 instead of using current_view directly.
4378 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4380 * src/LyXAction.C (init): add the paragraph-spacing command.
4382 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4384 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4386 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4387 different from the documents.
4389 * src/text.C (SetHeightOfRow): take paragraph spacing into
4390 account, paragraph spacing takes precedence over buffer spacing
4391 (GetVisibleRow): ditto
4393 * src/paragraph.C (writeFile): output the spacing parameter too.
4394 (validate): set the correct features if spacing is used in the
4396 (Clear): set spacing to default
4397 (MakeSameLayout): spacing too
4398 (HasSameLayout): spacing too
4399 (SetLayout): spacing too
4400 (TeXOnePar): output the spacing commands
4402 * src/lyxparagraph.h: added a spacing variable for use with
4403 per-paragraph spacing.
4405 * src/Spacing.h: add a Default spacing and a method to check if
4406 the current spacing is default. also added an operator==
4408 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4411 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4413 * src/lyxserver.C (callback): fix dispatch of functions
4415 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4416 printf() into lyxerr call.
4418 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4421 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4422 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4423 the "Float" from each of the subitems.
4424 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4426 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4427 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4428 documented the change so that the workaround can be nuked later.
4430 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4433 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4435 * src/buffer.C (getLatexName): ditto
4436 (setReadonly): ditto
4438 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4440 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4441 avoid some uses of current_view. Added also a bufferParams()
4442 method to get at this.
4444 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4446 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4448 * src/lyxparagraph.[Ch]: removed
4449 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4450 with operators used by lower_bound and
4451 upper_bound in InsetTable's
4452 Make struct InsetTable private again. Used matchpos.
4454 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4456 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4457 document, the language of existing text is changed (unless the
4458 document is multi-lingual)
4460 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4462 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4464 * A lot of files: A rewrite of the Right-to-Left support.
4466 2000-04-10 Juergen Vigna <jug@sad.it>
4468 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4469 misplaced cursor when inset in inset is locked.
4471 * src/insets/insettext.C (LocalDispatch): small fix so that a
4472 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4474 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4475 footnote font should be decreased in size twice when displaying.
4477 * src/insets/insettext.C (GetDrawFont): inserted this function as
4478 the drawing-font may differ from the real paragraph font.
4480 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4481 insets (inset in inset!).
4483 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4484 function here because we don't want footnotes inside footnotes.
4486 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4488 (init): now set the inset_owner in paragraph.C
4489 (LocalDispatch): added some resetPos() in the right position
4492 (pasteSelection): changed to use the new CutAndPaste-Class.
4494 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4495 which tells if it is allowed to insert another inset inside this one.
4497 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4498 SwitchLayoutsBetweenClasses.
4500 * src/text2.C (InsertInset): checking of the new paragraph-function
4502 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4503 is not needed anymore here!
4506 (PasteSelection): redone (also with #ifdef) so that now this uses
4507 the CutAndPaste-Class.
4508 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4511 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4512 from/to text/insets.
4514 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4515 so that the paragraph knows if it is inside an (text)-inset.
4516 (InsertFromMinibuffer): changed return-value to bool as now it
4517 may happen that an inset is not inserted in the paragraph.
4518 (InsertInsetAllowed): this checks if it is allowed to insert an
4519 inset in this paragraph.
4521 (BreakParagraphConservative):
4522 (BreakParagraph) : small change for the above change of the return
4523 value of InsertFromMinibuffer.
4525 * src/lyxparagraph.h: added inset_owner and the functions to handle
4526 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4528 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4530 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4531 functions from BufferView to BufferView::Pimpl to ease maintence.
4533 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4534 correctly. Also use SetCursorIntern instead of SetCursor.
4536 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4539 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4541 * src/WorkArea.C (belowMouse): manually implement below mouse.
4543 * src/*: Add "explicit" on several constructors, I added probably
4544 some unneeded ones. A couple of changes to code because of this.
4546 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4547 implementation and private parts from the users of BufferView. Not
4550 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4551 implementation and private parts from the users of LyXLex. Not
4554 * src/BufferView_pimpl.[Ch]: new files
4556 * src/lyxlex_pimpl.[Ch]: new files
4558 * src/LyXView.[Ch]: some inline functions move out-of-line
4560 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4562 * src/lyxparagraph.h: make struct InsetTable public.
4564 * src/support/lyxstring.h: change lyxstring::difference_type to be
4565 ptrdiff_t. Add std:: modifiers to streams.
4567 * src/font.C: include the <cctype> header, for islower() and
4570 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4572 * src/font.[Ch]: new files. Contains the metric functions for
4573 fonts, takes a LyXFont as parameter. Better separation of concepts.
4575 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4576 changes because of this.
4578 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4580 * src/*: compile with -Winline and move functions that don't
4583 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4586 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4588 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4589 (various files changed because of this)
4591 * src/Painter.C (text): fixed the drawing of smallcaps.
4593 * src/lyxfont.[Ch] (drawText): removed unused member func.
4596 * src/*.C: added needed "using" statements and "std::" qualifiers.
4598 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4600 * src/*.h: removed all use of "using" from header files use
4601 qualifier std:: instead.
4603 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4605 * src/text.C (Backspace): some additional cleanups (we already
4606 know whether cursor.pos is 0 or not).
4608 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4609 automake does not provide one).
4611 * src/bmtable.h: replace C++ comments with C comments.
4613 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4615 * src/screen.C (ShowCursor): Change the shape of the cursor if
4616 the current language is not equal to the language of the document.
4617 (If the cursor change its shape unexpectedly, then you've found a bug)
4619 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4622 * src/insets/insetnumber.[Ch]: New files.
4624 * src/LyXAction.C (init)
4625 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4628 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4630 * src/lyxparagraph.h
4631 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4632 (the vector is kept sorted).
4634 * src/text.C (GetVisibleRow): Draw selection correctly when there
4635 is both LTR and RTL text.
4637 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4638 which is much faster.
4640 * src/text.C (GetVisibleRow and other): Do not draw the last space
4641 in a row if the direction of the last letter is not equal to the
4642 direction of the paragraph.
4644 * src/lyxfont.C (latexWriteStartChanges):
4645 Check that font language is not equal to basefont language.
4646 (latexWriteEndChanges): ditto
4648 * src/lyx_cb.C (StyleReset): Don't change the language while using
4649 the font-default command.
4651 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4652 empty paragraph before a footnote.
4654 * src/insets/insetcommand.C (draw): Increase x correctly.
4656 * src/screen.C (ShowCursor): Change cursor shape if
4657 current language != document language.
4659 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4661 2000-03-31 Juergen Vigna <jug@sad.it>
4663 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4664 (Clone): changed mode how the paragraph-data is copied to the
4665 new clone-paragraph.
4667 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4668 GetInset(pos) with no inset anymore there (in inset UNDO)
4670 * src/insets/insetcommand.C (draw): small fix as here x is
4671 incremented not as much as width() returns (2 before, 2 behind = 4)
4673 2000-03-30 Juergen Vigna <jug@sad.it>
4675 * src/insets/insettext.C (InsetText): small fix in initialize
4676 widthOffset (should not be done in the init() function)
4678 2000-03-29 Amir Karger <karger@lyx.org>
4680 * lib/examples/it_ItemizeBullets.lyx: translation by
4683 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4685 2000-03-29 Juergen Vigna <jug@sad.it>
4687 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4689 * src/insets/insetfoot.C (Clone): small change as for the below
4690 new init function in the text-inset
4692 * src/insets/insettext.C (init): new function as I've seen that
4693 clone did not copy the Paragraph-Data!
4694 (LocalDispatch): Added code so that now we have some sort of Undo
4695 functionality (well actually we HAVE Undo ;)
4697 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4699 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4701 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4704 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4706 * src/main.C: added a runtime check that verifies that the xforms
4707 header used when building LyX and the library used when running
4708 LyX match. Exit with a message if they don't match. This is a
4709 version number check only.
4711 * src/buffer.C (save): Don't allocate memory on the heap for
4712 struct utimbuf times.
4714 * *: some using changes, use iosfwd instead of the real headers.
4716 * src/lyxfont.C use char const * instead of string for the static
4717 strings. Rewrite some functions to use sstream.
4719 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4721 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4724 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4726 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4727 of Geodesy (from Martin Vermeer)
4729 * lib/layouts/svjour.inc: include file for the Springer svjour
4730 class. It can be used to support journals other than JoG.
4732 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4733 Miskiewicz <misiek@pld.org.pl>)
4734 * lib/reLyX/Makefile.am: ditto.
4736 2000-03-27 Juergen Vigna <jug@sad.it>
4738 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4739 also some modifications with operations on selected text.
4741 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4742 problems with clicking on insets (last famous words ;)
4744 * src/insets/insetcommand.C (draw):
4745 (width): Changed to have a bit of space before and after the inset so
4746 that the blinking cursor can be seen (otherwise it was hidden)
4748 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4750 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4751 would not be added to the link list when an installed gettext (not
4752 part of libc) is found.
4754 2000-03-24 Juergen Vigna <jug@sad.it>
4756 * src/insets/insetcollapsable.C (Edit):
4757 * src/mathed/formula.C (InsetButtonRelease):
4758 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4761 * src/BufferView.C (workAreaButtonPress):
4762 (workAreaButtonRelease):
4763 (checkInsetHit): Finally fixed the clicking on insets be handled
4766 * src/insets/insetert.C (Edit): inserted this call so that ERT
4767 insets work always with LaTeX-font
4769 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4771 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4772 caused lyx to startup with no GUI in place, causing in a crash
4773 upon startup when called with arguments.
4775 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4777 * src/FontLoader.C: better initialization of dummyXFontStruct.
4779 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4781 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4782 for linuxdoc and docbook import and export format options.
4784 * lib/lyxrc.example Example of default values for the previous flags.
4786 * src/lyx_cb.C Use those flags instead of the hardwired values for
4787 linuxdoc and docbook export.
4789 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4792 * src/menus.C Added menus entries for the new import/exports formats.
4794 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4796 * src/lyxrc.*: Added support for running without Gui
4799 * src/FontLoader.C: sensible defaults if no fonts are needed
4801 * src/lyx_cb.C: New function ShowMessage (writes either to the
4802 minibuffer or cout in case of no gui
4803 New function AskOverwrite for common stuff
4804 Consequently various changes to call these functions
4806 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4807 wild guess at sensible screen resolution when having no gui
4809 * src/lyxfont.C: no gui, no fonts... set some defaults
4811 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4813 * src/LColor.C: made the command inset background a bit lighter.
4815 2000-03-20 Hartmut Goebel <goebel@noris.net>
4817 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4818 stdstruct.inc. Koma-Script added some title elements which
4819 otherwise have been listed below "bibliography". This split allows
4820 adding title elements to where they belong.
4822 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4823 define the additional tilte elements and then include
4826 * many other layout files: changed to include stdtitle.inc just
4827 before stdstruct.inc.
4829 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4831 * src/buffer.C: (save) Added the option to store all backup files
4832 in a single directory
4834 * src/lyxrc.[Ch]: Added variable \backupdir_path
4836 * lib/lyxrc.example: Added descriptions of recently added variables
4838 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4839 bibtex inset, not closing the bibtex popup when deleting the inset)
4841 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4843 * src/lyx_cb.C: add a couple using directives.
4845 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4846 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4847 import based on the filename.
4849 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4850 file would be imported at start, if the filename where of a sgml file.
4852 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4854 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4856 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4857 * src/lyxfont.h Replaced the member variable bits.direction by the
4858 member variable lang. Made many changes in other files.
4859 This allows having a multi-lingual document
4861 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4862 that change the current language to <l>.
4863 Removed the command "font-rtl"
4865 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4866 format for Hebrew documents)
4868 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4869 When auto_mathmode is "true", pressing a digit key in normal mode
4870 will cause entering into mathmode.
4871 If auto_mathmode is "rtl" then this behavior will be active only
4872 when writing right-to-left text.
4874 * src/text2.C (InsertStringA) The string is inserted using the
4877 * src/paragraph.C (GetEndLabel) Gives a correct result for
4878 footnote paragraphs.
4880 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4882 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4884 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4885 front of PasteParagraph. Never insert a ' '. This should at least
4886 fix some cause for the segfaults that we have been experiencing,
4887 it also fixes backspace behaviour slightly. (Phu!)
4889 * src/support/lstrings.C (compare_no_case): some change to make it
4890 compile with gcc 2.95.2 and stdlibc++-v3
4892 * src/text2.C (MeltFootnoteEnvironment): change type o
4893 first_footnote_par_is_not_empty to bool.
4895 * src/lyxparagraph.h: make text private. Changes in other files
4897 (fitToSize): new function
4898 (setContentsFromPar): new function
4899 (clearContents): new function
4900 (SetChar): new function
4902 * src/paragraph.C (readSimpleWholeFile): deleted.
4904 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4905 the file, just use a simple string instead. Also read the file in
4906 a more maintainable manner.
4908 * src/text2.C (InsertStringA): deleted.
4909 (InsertStringB): deleted.
4911 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4913 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4914 RedoParagraphs from the doublespace handling part, just set status
4915 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4916 done, but perhaps not like this.)
4918 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4920 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4921 character when inserting an inset.
4923 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4925 * src/bufferparams.C (readLanguage): now takes "default" into
4928 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4929 also initialize the toplevel_keymap with the default bindings from
4932 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4934 * all files using lyxrc: have lyxrc as a real variable and not a
4935 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4938 * src/lyxrc.C: remove double call to defaultKeyBindings
4940 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4941 toolbar defauls using lyxlex. Remove enums, structs, functions
4944 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4945 toolbar defaults. Also store default keybindings in a map.
4947 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4948 storing the toolbar defaults without any xforms dependencies.
4950 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4951 applied. Changed to use iterators.
4953 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4955 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4956 systems that don't have LINGUAS set to begin with.
4958 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4960 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4961 the list by Dekel Tsur.
4963 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4965 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4966 * src/insets/form_graphics.C: ditto.
4968 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4970 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4972 * src/bufferparams.C (readLanguage): use the new language map
4974 * src/intl.C (InitKeyMapper): use the new language map
4976 * src/lyx_gui.C (create_forms): use the new language map
4978 * src/language.[Ch]: New files. Used for holding the information
4979 about each language. Now! Use this new language map enhance it and
4980 make it really usable for our needs.
4982 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4984 * screen.C (ShowCursor): Removed duplicate code.
4985 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4986 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4988 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4991 * src/text.C Added TransformChar method. Used for rendering Arabic
4992 text correctly (change the glyphs of the letter according to the
4993 position in the word)
4998 * src/lyxrc.C Added lyxrc command {language_command_begin,
4999 language_command_end,language_command_ltr,language_command_rtl,
5000 language_package} which allows the use of either arabtex or Omega
5003 * src/lyx_gui.C (init)
5005 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5006 to use encoding for menu fonts which is different than the encoding
5009 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5010 do not load the babel package.
5011 To write an English document with Hebrew/Arabic, change the document
5012 language to "english".
5014 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5015 (alphaCounter): changed to return char
5016 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5018 * lib/lyxrc.example Added examples for Hebrew/Arabic
5021 * src/layout.C Added layout command endlabeltype
5023 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5025 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5027 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5029 * src/mathed/math_delim.C (search_deco): return a
5030 math_deco_struct* instead of index.
5032 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5034 * All files with a USE_OSTREAM_ONLY within: removed all code that
5035 was unused when USE_OSTREAM_ONLY is defined.
5037 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5038 of any less. Removed header and using.
5040 * src/text.C (GetVisibleRow): draw the string "Page Break
5041 (top/bottom)" on screen when drawing a pagebreak line.
5043 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5045 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5047 * src/mathed/math_macro.C (draw): do some cast magic.
5050 * src/mathed/math_defs.h: change byte* argument to byte const*.
5052 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5054 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5055 know it is right to return InsetFoot* too, but cxx does not like
5058 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5060 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5062 * src/mathed/math_delim.C: change == to proper assignment.
5064 2000-03-09 Juergen Vigna <jug@sad.it>
5066 * src/insets/insettext.C (setPos): fixed various cursor positioning
5067 problems (via mouse and cursor-keys)
5068 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5069 inset (still a small display problem but it works ;)
5071 * src/insets/insetcollapsable.C (draw): added button_top_y and
5072 button_bottom_y to have correct values for clicking on the inset.
5074 * src/support/lyxalgo.h: commented out 'using std::less'
5076 2000-03-08 Juergen Vigna <jug@sad.it>
5078 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5079 Button-Release event closes as it is alos the Release-Event
5082 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5084 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5086 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5087 can add multiple spaces in Scrap (literate programming) styles...
5088 which, by the way, is how I got hooked on LyX to begin with.
5090 * src/mathed/formula.C (Write): Added dummy variable to an
5091 inset::Latex() call.
5092 (Latex): Add free_spacing boolean to inset::Latex()
5094 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5096 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5097 virtual function to include the free_spacing boolean from
5098 the containing paragraph's style.
5100 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5101 Added free_spacing boolean arg to match inset.h
5103 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5104 Added free_spacing boolean arg to match inset.h
5106 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5107 Added free_spacing boolean and made sure that if in a free_spacing
5108 paragraph, that we output normal space if there is a protected space.
5110 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5111 Added free_spacing boolean arg to match inset.h
5113 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5114 Added free_spacing boolean arg to match inset.h
5116 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5117 Added free_spacing boolean arg to match inset.h
5119 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5120 Added free_spacing boolean arg to match inset.h
5122 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5123 Added free_spacing boolean arg to match inset.h
5125 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5126 free_spacing boolean arg to match inset.h
5128 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5129 Added free_spacing boolean arg to match inset.h
5131 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5132 Added free_spacing boolean arg to match inset.h
5134 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5135 Added free_spacing boolean arg to match inset.h
5137 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5138 Added free_spacing boolean arg to match inset.h
5140 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5141 Added free_spacing boolean arg to match inset.h
5143 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5144 free_spacing boolean arg to match inset.h
5146 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5147 free_spacing boolean arg to match inset.h
5149 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5150 ignore free_spacing paragraphs. The user's spaces are left
5153 * src/text.C (InsertChar): Fixed the free_spacing layout
5154 attribute behavior. Now, if free_spacing is set, you can
5155 add multiple spaces in a paragraph with impunity (and they
5156 get output verbatim).
5157 (SelectSelectedWord): Added dummy argument to inset::Latex()
5160 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5163 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5164 paragraph layouts now only input a simple space instead.
5165 Special character insets don't make any sense in free-spacing
5168 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5169 hard-spaces in the *input* file to simple spaces if the layout
5170 is free-spacing. This converts old files which had to have
5171 hard-spaces in free-spacing layouts where a simple space was
5173 (writeFileAscii): Added free_spacing check to pass to the newly
5174 reworked inset::Latex(...) methods. The inset::Latex() code
5175 ensures that hard-spaces in free-spacing paragraphs get output
5176 as spaces (rather than "~").
5178 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5180 * src/mathed/math_delim.C (draw): draw the empty placeholder
5181 delims with a onoffdash line.
5182 (struct math_deco_compare): struct that holds the "functors" used
5183 for the sort and the binary search in math_deco_table.
5184 (class init_deco_table): class used for initial sort of the
5186 (search_deco): use lower_bound to do a binary search in the
5189 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5191 * src/lyxrc.C: a small secret thingie...
5193 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5194 and to not flush the stream as often as it used to.
5196 * src/support/lyxalgo.h: new file
5197 (sorted): template function used for checking if a sequence is
5198 sorted or not. Two versions with and without user supplied
5199 compare. Uses same compare as std::sort.
5201 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5202 it and give warning on lyxerr.
5204 (struct compare_tags): struct with function operators used for
5205 checking if sorted, sorting and lower_bound.
5206 (search_kw): use lower_bound instead of manually implemented
5209 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5211 * src/insets/insetcollapsable.h: fix Clone() declaration.
5212 * src/insets/insetfoot.h: ditto.
5214 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5216 2000-03-08 Juergen Vigna <jug@sad.it>
5218 * src/insets/lyxinset.h: added owner call which tells us if
5219 this inset is inside another inset. Changed also the return-type
5220 of Editable to an enum so it tells clearer what the return-value is.
5222 * src/insets/insettext.C (computeTextRows): fixed computing of
5223 textinsets which split automatically on more rows.
5225 * src/insets/insetert.[Ch]: changed this to be of BaseType
5228 * src/insets/insetfoot.[Ch]: added footnote inset
5230 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5231 collapsable insets (like footnote, ert, ...)
5233 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5235 * src/lyxdraw.h: remvoe file
5237 * src/lyxdraw.C: remove file
5239 * src/insets/insettext.C: added <algorithm>.
5241 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5243 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5244 (matrix_cb): case MM_OK use string stream
5246 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5249 * src/mathed/math_macro.C (draw): use string stream
5250 (Metrics): use string stream
5252 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5253 directly to the ostream.
5255 * src/vspace.C (asString): use string stream.
5256 (asString): use string stream
5257 (asLatexString): use string stream
5259 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5260 setting Spacing::Other.
5262 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5263 sprintf when creating the stretch vale.
5265 * src/text2.C (alphaCounter): changed to return a string and to
5266 not use a static variable internally. Also fixed a one-off bug.
5267 (SetCounter): changed the drawing of the labels to use string
5268 streams instead of sprintf.
5270 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5271 manipulator to use a scheme that does not require library support.
5272 This is also the way it is done in the new GNU libstdc++. Should
5273 work with DEC cxx now.
5275 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5277 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5278 end. This fixes a bug.
5280 * src/mathed (all files concerned with file writing): apply the
5281 USE_OSTREAM_ONLY changes to mathed too.
5283 * src/support/DebugStream.h: make the constructor explicit.
5285 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5286 count and ostream squashed.
5288 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5290 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5292 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5293 ostringstream uses STL strings, and we might not.
5295 * src/insets/insetspecialchar.C: add using directive.
5296 * src/insets/insettext.C: ditto.
5298 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5300 * lib/layouts/seminar.layout: feeble attempt at a layout for
5301 seminar.cls, far from completet and could really use some looking
5302 at from people used to write layout files.
5304 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5305 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5306 a lot nicer and works nicely with ostreams.
5308 * src/mathed/formula.C (draw): a slightly different solution that
5309 the one posted to the list, but I think this one works too. (font
5310 size wrong in headers.)
5312 * src/insets/insettext.C (computeTextRows): some fiddling on
5313 Jürgens turf, added some comments that he should read.
5315 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5316 used and it gave compiler warnings.
5317 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5320 * src/lyx_gui.C (create_forms): do the right thing when
5321 show_banner is true/false.
5323 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5324 show_banner is false.
5326 * most file writing files: Now use iostreams to do almost all of
5327 the writing. Also instead of passing string &, we now use
5328 stringstreams. mathed output is still not adapted to iostreams.
5329 This change can be turned off by commenting out all the occurences
5330 of the "#define USE_OSTREAM_ONLY 1" lines.
5332 * src/WorkArea.C (createPixmap): don't output debug messages.
5333 (WorkArea): don't output debug messages.
5335 * lib/lyxrc.example: added a comment about the new variable
5338 * development/Code_rules/Rules: Added some more commente about how
5339 to build class interfaces and on how better encapsulation can be
5342 2000-03-03 Juergen Vigna <jug@sad.it>
5344 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5345 automatically with the width of the LyX-Window
5347 * src/insets/insettext.C (computeTextRows): fixed update bug in
5348 displaying text-insets (scrollvalues where not initialized!)
5350 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5352 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5353 id in the check of the result from lower_bound is not enough since
5354 lower_bound can return last too, and then res->id will not be a
5357 * all insets and some code that use them: I have conditionalized
5358 removed the Latex(string & out, ...) this means that only the
5359 Latex(ostream &, ...) will be used. This is a work in progress to
5360 move towards using streams for all output of files.
5362 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5365 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5367 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5368 routine (this fixes bug where greek letters were surrounded by too
5371 * src/support/filetools.C (findtexfile): change a bit the search
5372 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5373 no longer passed to kpsewhich, we may have to change that later.
5375 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5376 warning options to avoid problems with X header files (from Angus
5378 * acinclude.m4: regenerated.
5380 2000-03-02 Juergen Vigna <jug@sad.it>
5382 * src/insets/insettext.C (WriteParagraphData): Using the
5383 par->writeFile() function for writing paragraph-data.
5384 (Read): Using buffer->parseSingleLyXformat2Token()-function
5385 for parsing paragraph data!
5387 * src/buffer.C (readLyXformat2): removed all parse data and using
5388 the new parseSingleLyXformat2Token()-function.
5389 (parseSingleLyXformat2Token): added this function to parse (read)
5390 lyx-file-format (this is called also from text-insets now!)
5392 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5394 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5397 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5398 directly instead of going through a func. One very bad thing: a
5399 static LyXFindReplace, but I don't know where to place it.
5401 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5402 string instead of char[]. Also changed to static.
5403 (GetSelectionOrWordAtCursor): changed to static inline
5404 (SetSelectionOverLenChars): ditto.
5406 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5407 current_view and global variables. both classes has changed names
5408 and LyXFindReplace is not inherited from SearchForm.
5410 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5411 fl_form_search form.
5413 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5415 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5417 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5418 bound (from Kayvan).
5420 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5422 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5424 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5426 * some things that I should comment but the local pub says head to
5429 * comment out all code that belongs to the Roff code for Ascii
5430 export of tables. (this is unused)
5432 * src/LyXView.C: use correct type for global variable
5433 current_layout. (LyXTextClass::size_type)
5435 * some code to get the new insetgraphics closer to working I'd be
5436 grateful for any help.
5438 * src/BufferView2.C (insertInset): use the return type of
5439 NumberOfLayout properly. (also changes in other files)
5441 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5442 this as a test. I want to know what breaks because of this.
5444 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5446 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5448 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5449 to use a \makebox in the label, this allows proper justification
5450 with out using protected spaces or multiple hfills. Now it is
5451 "label" for left justified, "\hfill label\hfill" for center, and
5452 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5453 should be changed accordingly.
5455 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5457 * src/lyxtext.h: change SetLayout() to take a
5458 LyXTextClass::size_type instead of a char (when there is more than
5459 127 layouts in a class); also change type of copylayouttype.
5460 * src/text2.C (SetLayout): ditto.
5461 * src/LyXView.C (updateLayoutChoice): ditto.
5463 * src/LaTeX.C (scanLogFile): errors where the line number was not
5464 given just after the '!'-line were ignored (from Dekel Tsur).
5466 * lib/lyxrc.example: fix description of \date_insert_format
5468 * lib/layouts/llncs.layout: new layout, contributed by Martin
5471 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5473 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5474 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5475 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5476 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5477 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5478 paragraph.C, text.C, text2.C)
5480 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5482 * src/insets/insettext.C (LocalDispatch): remove extra break
5485 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5486 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5488 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5489 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5491 * src/insets/insetbib.h: move InsetBibkey::Holder and
5492 InsetCitation::Holder in public space.
5494 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5496 * src/insets/insettext.h: small change to get the new files from
5497 Juergen to compile (use "string", not "class string").
5499 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5500 const & as parameter to LocalDispatch, use LyXFont const & as
5501 paramter to some other func. This also had impacto on lyxinsets.h
5502 and the two mathed insets.
5504 2000-02-24 Juergen Vigna <jug@sad.it>
5507 * src/commandtags.h:
5509 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5513 * src/BufferView2.C: added/updated code for various inset-functions
5515 * src/insets/insetert.[Ch]: added implementation of InsetERT
5517 * src/insets/insettext.[Ch]: added implementation of InsetText
5519 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5520 (draw): added preliminary code for inset scrolling not finshed yet
5522 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5523 as it is in lyxfunc.C now
5525 * src/insets/lyxinset.h: Added functions for text-insets
5527 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5529 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5530 BufferView and reimplement the list as a queue put inside its own
5533 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5535 * several files: use the new interface to the "updateinsetlist"
5537 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5539 (work_area_handler): call BufferView::trippleClick on trippleclick.
5541 * src/BufferView.C (doubleClick): new function, selects word on
5543 (trippleClick): new function, selects line on trippleclick.
5545 2000-02-22 Allan Rae <rae@lyx.org>
5547 * lib/bind/xemacs.bind: buffer-previous not supported
5549 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5551 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5554 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5556 * src/bufferlist.C: get rid of current_view from this file
5558 * src/spellchecker.C: get rid of current_view from this file
5560 * src/vspace.C: get rid of current_view from this file
5561 (inPixels): added BufferView parameter for this func
5562 (asLatexCommand): added a BufferParams for this func
5564 * src/text.C src/text2.C: get rid of current_view from these
5567 * src/lyxfont.C (getFontDirection): move this function here from
5570 * src/bufferparams.C (getDocumentDirection): move this function
5573 * src/paragraph.C (getParDirection): move this function here from
5575 (getLetterDirection): ditto
5577 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5579 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5580 resize due to wrong pixmap beeing used. Also took the opurtunity
5581 to make the LyXScreen stateless on regard to WorkArea and some
5582 general cleanup in the same files.
5584 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5586 * src/Makefile.am: add missing direction.h
5588 * src/PainterBase.h: made the width functions const.
5590 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5593 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5595 * src/insets/insetlatexaccent.C (draw): make the accents draw
5596 better, at present this will only work well with iso8859-1.
5598 * several files: remove the old drawing code, now we use the new
5601 * several files: remove support for mono_video, reverse_video and
5604 2000-02-17 Juergen Vigna <jug@sad.it>
5606 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5607 int ** as we have to return the pointer, otherwise we have only
5608 NULL pointers in the returning function.
5610 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5612 * src/LaTeX.C (operator()): quote file name when running latex.
5614 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5616 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5617 (bubble tip), this removes our special handling of this.
5619 * Remove all code that is unused now that we have the new
5620 workarea. (Code that are not active when NEW_WA is defined.)
5622 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5624 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5626 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5627 nonexisting layout; correctly redirect obsoleted layouts.
5629 * lib/lyxrc.example: document \view_dvi_paper_option
5631 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5634 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5635 (PreviewDVI): handle the view_dvi_paper_option variable.
5636 [Both from Roland Krause]
5638 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5640 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5641 char const *, int, LyXFont)
5642 (text(int, int, string, LyXFont)): ditto
5644 * src/text.C (InsertCharInTable): attempt to fix the double-space
5645 feature in tables too.
5646 (BackspaceInTable): ditto.
5647 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5649 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5651 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5653 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5654 newly found text in textcache to this.
5655 (buffer): set the owner of the text put into the textcache to 0
5657 * src/insets/figinset.C (draw): fixed the drawing of figures with
5660 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5661 drawing of mathframe, hfills, protected space, table lines. I have
5662 now no outstanding drawing problems with the new Painter code.
5664 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5666 * src/PainterBase.C (ellipse, circle): do not specify the default
5669 * src/LColor.h: add using directive.
5671 * src/Painter.[Ch]: change return type of methods from Painter& to
5672 PainterBase&. Add a using directive.
5674 * src/WorkArea.C: wrap xforms callbacks in C functions
5677 * lib/layouts/foils.layout: font fix and simplifications from Carl
5680 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5682 * a lot of files: The Painter, LColor and WorkArea from the old
5683 devel branch has been ported to lyx-devel. Some new files and a
5684 lot of #ifdeffed code. The new workarea is enabled by default, but
5685 if you want to test the new Painter and LColor you have to compile
5686 with USE_PAINTER defined (do this in config.h f.ex.) There are
5687 still some rought edges, and I'd like some help to clear those
5688 out. It looks stable (loads and displays the Userguide very well).
5691 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5693 * src/buffer.C (pop_tag): revert to the previous implementation
5694 (use a global variable for both loops).
5696 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5698 * src/lyxrc.C (LyXRC): change slightly default date format.
5700 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5701 there is an English text with a footnote that starts with a Hebrew
5702 paragraph, or vice versa.
5703 (TeXFootnote): ditto.
5705 * src/text.C (LeftMargin): allow for negative values for
5706 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5709 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5710 for input encoding (cyrillic)
5712 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5714 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5717 * src/toolbar.C (set): ditto
5718 * src/insets/insetbib.C (create_form_citation_form): ditto
5720 * lib/CREDITS: added Dekel Tsur.
5722 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5723 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5724 hebrew supports files from Dekel Tsur.
5726 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5727 <tzafrir@technion.ac.il>
5729 * src/lyxrc.C: put \date_insert_format at the right place.
5731 * src/buffer.C (makeLaTeXFile): fix the handling of
5732 BufferParams::sides when writing out latex files.
5734 * src/BufferView2.C: add a "using" directive.
5736 * src/support/lyxsum.C (sum): when we use lyxstring,
5737 ostringstream::str needs an additional .c_str().
5739 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5741 * src/support/filetools.C (ChangeExtension): patch from Etienne
5744 * src/TextCache.C (show): remove const_cast and make second
5745 parameter non-const LyXText *.
5747 * src/TextCache.h: use non const LyXText in show.
5749 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5752 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5754 * src/support/lyxsum.C: rework to be more flexible.
5756 * several places: don't check if a pointer is 0 if you are going
5759 * src/text.C: remove some dead code.
5761 * src/insets/figinset.C: remove some dead code
5763 * src/buffer.C: move the BufferView funcs to BufferView2.C
5764 remove all support for insetlatexdel
5765 remove support for oldpapersize stuff
5766 made some member funcs const
5768 * src/kbmap.C: use a std::list to store the bindings in.
5770 * src/BufferView2.C: new file
5772 * src/kbsequence.[Ch]: new files
5774 * src/LyXAction.C + others: remove all trace of buffer-previous
5776 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5777 only have one copy in the binary of this table.
5779 * hebrew patch: moved some functions from LyXText to more
5780 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5782 * several files: remove support for XForms older than 0.88
5784 remove some #if 0 #endif code
5786 * src/TextCache.[Ch]: new file. Holds the textcache.
5788 * src/BufferView.C: changes to use the new TextCache interface.
5789 (waitForX): remove the now unused code.
5791 * src/BackStack.h: remove some commented code
5793 * lib/bind/emacs.bind: remove binding for buffer-previous
5795 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5797 * applied the hebrew patch.
5799 * src/lyxrow.h: make sure that all Row variables are initialized.
5801 * src/text2.C (TextHandleUndo): comment out a delete, this might
5802 introduce a memory leak, but should also help us to not try to
5803 read freed memory. We need to look at this one.
5805 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5806 (LyXParagraph): initalize footnotekind.
5808 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5809 forgot this when applying the patch. Please heed the warnings.
5811 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5812 (aka. reformat problem)
5814 * src/bufferlist.C (exists): made const, and use const_iterator
5815 (isLoaded): new func.
5816 (release): use std::find to find the correct buffer.
5818 * src/bufferlist.h: made getState a const func.
5819 made empty a const func.
5820 made exists a const func.
5823 2000-02-01 Juergen Vigna <jug@sad.it>
5825 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5827 * po/it.po: updated a bit the italian po file and also changed the
5828 'file nuovo' for newfile to 'filenuovo' without a space, this did
5831 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5832 for the new insert_date command.
5834 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5835 from jdblair, to insert a date into the current text conforming to
5836 a strftime format (for now only considering the locale-set and not
5837 the document-language).
5839 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5841 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5842 Bounds Read error seen by purify. The problem was that islower is
5843 a macros which takes an unsigned char and uses it as an index for
5844 in array of characters properties (and is thus subject to the
5848 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5849 correctly the paper sides radio buttons.
5850 (UpdateDocumentButtons): ditto.
5852 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5854 * src/kbmap.C (getsym + others): change to return unsigned int,
5855 returning a long can give problems on 64 bit systems. (I assume
5856 that int is 32bit on 64bit systems)
5858 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5860 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5861 LyXLookupString to be zero-terminated. Really fixes problems seen
5864 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5866 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5867 write a (char*)0 to the lyxerr stream.
5869 * src/lastfiles.C: move algorithm before the using statemets.
5871 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5873 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5874 complains otherwise).
5875 * src/table.C: ditto
5877 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5880 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5881 that I removed earlier... It is really needed.
5883 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5885 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5887 * INSTALL: update xforms home page URL.
5889 * lib/configure.m4: fix a bug with unreadable layout files.
5891 * src/table.C (calculate_width_of_column): add "using std::max"
5894 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5896 * several files: marked several lines with "DEL LINE", this is
5897 lines that can be deleted without changing anything.
5898 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5899 checks this anyway */
5902 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5904 * src/DepTable.C (update): add a "+" at the end when the checksum
5905 is different. (debugging string only)
5907 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5908 the next inset to not be displayed. This should also fix the list
5909 of labels in the "Insert Crossreference" dialog.
5911 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5913 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5914 when regex was not found.
5916 * src/support/lstrings.C (lowercase): use handcoded transform always.
5919 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5920 old_cursor.par->prev could be 0.
5922 * several files: changed post inc/dec to pre inc/dec
5924 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5925 write the lastfiles to file.
5927 * src/BufferView.C (buffer): only show TextCache info when debugging
5929 (resizeCurrentBuffer): ditto
5930 (workAreaExpose): ditto
5932 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5934 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5936 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5937 a bit better by removing the special case for \i and \j.
5939 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5941 * src/lyx_main.C (easyParse): remove test for bad comand line
5942 options, since this broke all xforms-related parsing.
5944 * src/kbmap.C (getsym): set return type to unsigned long, as
5945 declared in header. On an alpha, long is _not_ the same as int.
5947 * src/support/LOstream.h: add a "using std::flush;"
5949 * src/insets/figinset.C: ditto.
5951 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5953 * src/bufferlist.C (write): use blinding fast file copy instead of
5954 "a char at a time", now we are doing it the C++ way.
5956 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5957 std::list<int> instead.
5958 (addpidwait): reflect move to std::list<int>
5959 (sigchldchecker): ditto
5961 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5964 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5965 that obviously was wrong...
5967 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5968 c, this avoids warnings with purify and islower.
5970 * src/insets/figinset.C: rename struct queue to struct
5971 queue_element and rewrite to use a std::queue. gsqueue is now a
5972 std::queue<queue_element>
5973 (runqueue): reflect move to std::queue
5976 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5977 we would get "1" "0" instead of "true" "false. Also make the tostr
5980 2000-01-21 Juergen Vigna <jug@sad.it>
5982 * src/buffer.C (writeFileAscii): Disabled code for special groff
5983 handling of tabulars till I fix this in table.C
5985 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5987 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5989 * src/support/lyxlib.h: ditto.
5991 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5993 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5994 and 'j' look better. This might fix the "macron" bug that has been
5997 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5998 functions as one template function. Delete the old versions.
6000 * src/support/lyxsum.C: move using std::ifstream inside
6003 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6006 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6008 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6010 * src/insets/figinset.C (InitFigures): use new instead of malloc
6011 to allocate memory for figures and bitmaps.
6012 (DoneFigures): use delete[] instead of free to deallocate memory
6013 for figures and bitmaps.
6014 (runqueue): use new to allocate
6015 (getfigdata): use new/delete[] instead of malloc/free
6016 (RegisterFigure): ditto
6018 * some files: moved some declarations closer to first use, small
6019 whitespace changes use preincrement instead of postincrement where
6020 it does not make a difference.
6022 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6023 step on the way to use stl::containers for key maps.
6025 * src/bufferlist.h: add a typedef for const_iterator and const
6026 versions of begin and end.
6028 * src/bufferlist.[Ch]: change name of member variable _state to
6029 state_. (avoid reserved names)
6031 (getFileNames): returns the filenames of the buffers in a vector.
6033 * configure.in (ALL_LINGUAS): added ro
6035 * src/support/putenv.C: new file
6037 * src/support/mkdir.C: new file
6039 2000-01-20 Allan Rae <rae@lyx.org>
6041 * lib/layouts/IEEEtran.layout: Added several theorem environments
6043 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6044 couple of minor additions.
6046 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6047 (except for those in footnotes of course)
6049 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6051 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6053 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6054 std::sort and std::lower_bound instead of qsort and handwritten
6056 (struct compara): struct that holds the functors used by std::sort
6057 and std::lower_bound in MathedLookupBOP.
6059 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6061 * src/support/LAssert.h: do not do partial specialization. We do
6064 * src/support/lyxlib.h: note that lyx::getUserName() and
6065 lyx::date() are not in use right now. Should these be suppressed?
6067 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6068 (makeLinuxDocFile): do not put date and user name in linuxdoc
6071 * src/support/lyxlib.h (kill): change first argument to long int,
6072 since that's what solaris uses.
6074 * src/support/kill.C (kill): fix declaration to match prototype.
6076 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6077 actually check whether namespaces are supported. This is not what
6080 * src/support/lyxsum.C: add a using directive.
6082 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6084 * src/support/kill.C: if we have namespace support we don't have
6085 to include lyxlib.h.
6087 * src/support/lyxlib.h: use namespace lyx if supported.
6089 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6091 * src/support/date.C: new file
6093 * src/support/chdir.C: new file
6095 * src/support/getUserName.C: new file
6097 * src/support/getcwd.C: new file
6099 * src/support/abort.C: new file
6101 * src/support/kill.C: new file
6103 * src/support/lyxlib.h: moved all the functions in this file
6104 insede struct lyx. Added also kill and abort to this struct. This
6105 is a way to avoid the "kill is not defined in <csignal>", we make
6106 C++ wrappers for functions that are not ANSI C or ANSI C++.
6108 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6109 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6110 lyx it has been renamed to sum.
6112 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6114 * src/text.C: add using directives for std::min and std::max.
6116 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6118 * src/texrow.C (getIdFromRow): actually return something useful in
6119 id and pos. Hopefully fixes the bug with positionning of errorbox
6122 * src/lyx_main.C (easyParse): output an error and exit if an
6123 incorrect command line option has been given.
6125 * src/spellchecker.C (ispell_check_word): document a memory leak.
6127 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6128 where a "struct utimbuf" is allocated with "new" and deleted with
6131 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6133 * src/text2.C (CutSelection): don't delete double spaces.
6134 (PasteSelection): ditto
6135 (CopySelection): ditto
6137 * src/text.C (Backspace): don't delete double spaces.
6139 * src/lyxlex.C (next): fix a bug that were only present with
6140 conformant std::istream::get to read comment lines, use
6141 std::istream::getline instead. This seems to fix the problem.
6143 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6145 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6146 allowed to insert space before space" editing problem. Please read
6147 commends at the beginning of the function. Comments about usage
6150 * src/text.C (InsertChar): fix for the "not allowed to insert
6151 space before space" editing problem.
6153 * src/text2.C (DeleteEmptyParagraphMechanism): when
6154 IsEmptyTableRow can only return false this last "else if" will
6155 always be a no-op. Commented out.
6157 * src/text.C (RedoParagraph): As far as I can understand tmp
6158 cursor is not really needed.
6160 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6161 present it could only return false anyway.
6162 (several functions): Did something not so smart...added a const
6163 specifier on a lot of methods.
6165 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6166 and add a tmp->text.resize. The LyXParagraph constructor does the
6168 (BreakParagraphConservative): ditto
6170 * src/support/path.h (Path): add a define so that the wrong usage
6171 "Path("/tmp") will be flagged as a compilation error:
6172 "`unnamed_Path' undeclared (first use this function)"
6174 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6176 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6177 which was bogus for several reasons.
6179 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6183 * autogen.sh: do not use "type -path" (what's that anyway?).
6185 * src/support/filetools.C (findtexfile): remove extraneous space
6186 which caused a kpsewhich warning (at least with kpathsea version
6189 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6191 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6193 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6195 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6197 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6199 * src/paragraph.C (BreakParagraph): do not reserve space on text
6200 if we don't need to (otherwise, if pos_end < pos, we end up
6201 reserving huge amounts of memory due to bad unsigned karma).
6202 (BreakParagraphConservative): ditto, although I have not seen
6203 evidence the bug can happen here.
6205 * src/lyxparagraph.h: add a using std::list.
6207 2000-01-11 Juergen Vigna <jug@sad.it>
6209 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6212 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6214 * src/vc-backend.C (doVCCommand): change to be static and take one
6215 more parameter: the path to chdir too be fore executing the command.
6216 (retrive): new function equiv to "co -r"
6218 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6219 file_not_found_hook is true.
6221 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6223 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6224 if a file is readwrite,readonly...anything else.
6226 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6228 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6229 (CreatePostscript): name change from MenuRunDVIPS (or something)
6230 (PreviewPostscript): name change from MenuPreviewPS
6231 (PreviewDVI): name change from MenuPreviewDVI
6233 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6234 \view_pdf_command., \pdf_to_ps_command
6236 * lib/configure.m4: added search for PDF viewer, and search for
6237 PDF to PS converter.
6238 (lyxrc.defaults output): add \pdflatex_command,
6239 \view_pdf_command and \pdf_to_ps_command.
6241 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6243 * src/bufferlist.C (write): we don't use blocksize for anything so
6246 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6248 * src/support/block.h: disable operator T* (), since it causes
6249 problems with both compilers I tried. See comments in the file.
6251 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6254 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6255 variable LYX_DIR_10x to LYX_DIR_11x.
6257 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6259 * INSTALL: document --with-lyxname.
6262 * configure.in: new configure flag --with-lyxname which allows to
6263 choose the name under which lyx is installed. Default is "lyx", of
6264 course. It used to be possible to do this with --program-suffix,
6265 but the later has in fact a different meaning for autoconf.
6267 * src/support/lstrings.h (lstrchr): reformat a bit.
6269 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6270 * src/mathed/math_defs.h: ditto.
6272 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6274 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6275 true, decides if we create a backup file or not when saving. New
6276 tag and variable \pdf_mode, defaults to false. New tag and
6277 variable \pdflatex_command, defaults to pdflatex. New tag and
6278 variable \view_pdf_command, defaults to xpdf. New tag and variable
6279 \pdf_to_ps_command, defaults to pdf2ps.
6281 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6283 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6284 does not have a BufferView.
6285 (unlockInset): ditto + don't access the_locking_inset if the
6286 buffer does not have a BufferView.
6288 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6289 certain circumstances so that we don't continue a keyboard
6290 operation long after the key was released. Try f.ex. to load a
6291 large document, press PageDown for some seconds and then release
6292 it. Before this change the document would contine to scroll for
6293 some time, with this change it stops imidiatly.
6295 * src/support/block.h: don't allocate more space than needed. As
6296 long as we don't try to write to the arr[x] in a array_type arr[x]
6297 it is perfectly ok. (if you write to it you might segfault).
6298 added operator value_type*() so that is possible to pass the array
6299 to functions expecting a C-pointer.
6301 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6304 * intl/*: updated to gettext 0.10.35, tried to add our own
6305 required modifications. Please verify.
6307 * po/*: updated to gettext 0.10.35, tried to add our own required
6308 modifications. Please verify.
6310 * src/support/lstrings.C (tostr): go at fixing the problem with
6311 cxx and stringstream. When stringstream is used return
6312 oss.str().c_str() so that problems with lyxstring and basic_string
6313 are avoided. Note that the best solution would be for cxx to use
6314 basic_string all the way, but it is not conformant yet. (it seems)
6316 * src/lyx_cb.C + other files: moved several global functions to
6317 class BufferView, some have been moved to BufferView.[Ch] others
6318 are still located in lyx_cb.C. Code changes because of this. (part
6319 of "get rid of current_view project".)
6321 * src/buffer.C + other files: moved several Buffer functions to
6322 class BufferView, the functions are still present in buffer.C.
6323 Code changes because of this.
6325 * config/lcmessage.m4: updated to most recent. used when creating
6328 * config/progtest.m4: updated to most recent. used when creating
6331 * config/gettext.m4: updated to most recent. applied patch for
6334 * config/gettext.m4.patch: new file that shows what changes we
6335 have done to the local copy of gettext.m4.
6337 * config/libtool.m4: new file, used in creation of acinclude.m4
6339 * config/lyxinclude.m4: new file, this is the lyx created m4
6340 macros, used in making acinclude.m4.
6342 * autogen.sh: GNU m4 discovered as a separate task not as part of
6343 the lib/configure creation.
6344 Generate acinlucde from files in config. Actually cat
6345 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6346 easier to upgrade .m4 files that really are external.
6348 * src/Spacing.h: moved using std::istringstream to right after
6349 <sstream>. This should fix the problem seen with some compilers.
6351 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6353 * src/lyx_cb.C: began some work to remove the dependency a lot of
6354 functions have on BufferView::text, even if not really needed.
6355 (GetCurrentTextClass): removed this func, it only hid the
6358 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6359 forgot this in last commit.
6361 * src/Bullet.C (bulletEntry): use static char const *[] for the
6362 tables, becuase of this the return arg had to change to string.
6364 (~Bullet): removed unneeded destructor
6366 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6367 (insetSleep): moved from Buffer
6368 (insetWakeup): moved from Buffer
6369 (insetUnlock): moved from Buffer
6371 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6372 from Buffer to BufferView.
6374 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6376 * config/ltmain.sh: updated to version 1.3.4 of libtool
6378 * config/ltconfig: updated to version 1.3.4 of libtool
6380 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6383 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6384 Did I get that right?
6386 * src/lyxlex.h: add a "using" directive or two.
6387 * src/Spacing.h: ditto.
6388 * src/insets/figinset.C: ditto.
6389 * src/support/filetools.C: ditto.
6390 * src/support/lstrings.C: ditto.
6391 * src/BufferView.C: ditto.
6392 * src/bufferlist.C: ditto.
6393 * src/lyx_cb.C: ditto.
6394 * src/lyxlex.C: ditto.
6396 * NEWS: add some changes for 1.1.4.
6398 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6400 * src/BufferView.C: first go at a TextCache to speed up switching
6403 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6405 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6406 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6407 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6408 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6411 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6412 members of the struct are correctly initialized to 0 (detected by
6414 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6415 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6417 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6418 pidwait, since it was allocated with "new". This was potentially
6419 very bad. Thanks to Michael Schmitt for running purify for us.
6422 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6424 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6426 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6428 1999-12-30 Allan Rae <rae@lyx.org>
6430 * lib/templates/IEEEtran.lyx: minor change
6432 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6433 src/mathed/formula.C (LocalDispatch): askForText changes
6435 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6436 know when a user has cancelled input. Fixes annoying problems with
6437 inserting labels and version control.
6439 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6441 * src/support/lstrings.C (tostr): rewritten to use strstream and
6444 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6446 * src/support/filetools.C (IsFileWriteable): use fstream to check
6447 (IsDirWriteable): use fileinfo to check
6449 * src/support/filetools.h (FilePtr): whole class deleted
6451 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6453 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6455 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6457 * src/bufferlist.C (write): use ifstream and ofstream instead of
6460 * src/Spacing.h: use istrstream instead of sscanf
6462 * src/mathed/math_defs.h: change first arg to istream from FILE*
6464 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6466 * src/mathed/math_parser.C: have yyis to be an istream
6467 (LexGetArg): use istream (yyis)
6469 (mathed_parse): ditto
6470 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6472 * src/mathed/formula.C (Read): rewritten to use istream
6474 * src/mathed/formulamacro.C (Read): rewritten to use istream
6476 * src/lyxlex.h (~LyXLex): deleted desturctor
6477 (getStream): new function, returns an istream
6478 (getFile): deleted funtion
6479 (IsOK): return is.good();
6481 * src/lyxlex.C (LyXLex): delete file and owns_file
6482 (setFile): open an filebuf and assign that to a istream instead of
6484 (setStream): new function, takes an istream as arg.
6485 (setFile): deleted function
6486 (EatLine): rewritten us use istream instead of FILE*
6490 * src/table.C (LyXTable): use istream instead of FILE*
6491 (Read): rewritten to take an istream instead of FILE*
6493 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6495 * src/buffer.C (Dispatch): remove an extraneous break statement.
6497 * src/support/filetools.C (QuoteName): change to do simple
6498 'quoting'. More work is necessary. Also changed to do nothing
6499 under emx (needs fix too).
6500 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6502 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6503 config.h.in to the AC_DEFINE_UNQUOTED() call.
6504 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6505 needs char * as argument (because Solaris 7 declares it like
6508 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6509 remove definition of BZERO.
6511 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6513 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6514 defined, "lyxregex.h" if not.
6516 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6518 (REGEX): new variable that is set to regex.c lyxregex.h when
6519 AM_CONDITIONAL USE_REGEX is set.
6520 (libsupport_la_SOURCES): add $(REGEX)
6522 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6525 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6528 * configure.in: add call to LYX_REGEX
6530 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6531 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6533 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6535 * lib/bind/fi_menus.bind: new file, from
6536 pauli.virtanen@saunalahti.fi.
6538 * src/buffer.C (getBibkeyList): pass the parameter delim to
6539 InsetInclude::getKeys and InsetBibtex::getKeys.
6541 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6542 is passed to Buffer::getBibkeyList
6544 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6545 instead of the hardcoded comma.
6547 * src/insets/insetbib.C (getKeys): make sure that there are not
6548 leading blanks in bibtex keys. Normal latex does not care, but
6549 harvard.sty seems to dislike blanks at the beginning of citation
6550 keys. In particular, the retturn value of the function is
6552 * INSTALL: make it clear that libstdc++ is needed and that gcc
6553 2.7.x probably does not work.
6555 * src/support/filetools.C (findtexfile): make debug message go to
6557 * src/insets/insetbib.C (getKeys): ditto
6559 * src/debug.C (showTags): make sure that the output is correctly
6562 * configure.in: add a comment for TWO_COLOR_ICON define.
6564 * acconfig.h: remove all the entries that already defined in
6565 configure.in or acinclude.m4.
6567 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6568 to avoid user name, date and copyright.
6570 1999-12-21 Juergen Vigna <jug@sad.it>
6572 * src/table.C (Read): Now read bogus row format informations
6573 if the format is < 5 so that afterwards the table can
6574 be read by lyx but without any format-info. Fixed the
6575 crash we experienced when not doing this.
6577 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6579 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6580 (RedoDrawingOfParagraph): ditto
6581 (RedoParagraphs): ditto
6582 (RemoveTableRow): ditto
6584 * src/text.C (Fill): rename arg paperwidth -> paper_width
6586 * src/buffer.C (insertLyXFile): rename var filename -> fname
6587 (writeFile): rename arg filename -> fname
6588 (writeFileAscii): ditto
6589 (makeLaTeXFile): ditto
6590 (makeLinuxDocFile): ditto
6591 (makeDocBookFile): ditto
6593 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6596 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6598 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6601 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6602 compiled by a C compiler not C++.
6604 * src/layout.h (LyXTextClass): added typedef for const_iterator
6605 (LyXTextClassList): added typedef for const_iterator + member
6606 functions begin and end.
6608 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6609 iterators to fill the choice_class.
6610 (updateLayoutChoice): rewritten to use iterators to fill the
6611 layoutlist in the toolbar.
6613 * src/BufferView.h (BufferView::work_area_width): removed unused
6616 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6618 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6619 (sgmlCloseTag): ditto
6621 * src/support/lstrings.h: return type of countChar changed to
6624 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6625 what version of this func to use. Also made to return unsigned int.
6627 * configure.in: call LYX_STD_COUNT
6629 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6630 conforming std::count.
6632 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6634 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6635 and a subscript would give bad display (patch from Dekel Tsur
6636 <dekel@math.tau.ac.il>).
6638 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6640 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6643 * src/chset.h: add a few 'using' directives
6645 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6646 triggered when no buffer is active
6648 * src/layout.C: removed `break' after `return' in switch(), since
6651 * src/lyx_main.C (init): make sure LyX can be ran in place even
6652 when libtool has done its magic with shared libraries. Fix the
6653 test for the case when the system directory has not been found.
6655 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6656 name for the latex file.
6657 (MenuMakeHTML): ditto
6659 * src/buffer.h: add an optional boolean argument, which is passed
6662 1999-12-20 Allan Rae <rae@lyx.org>
6664 * lib/templates/IEEEtran.lyx: small correction and update.
6666 * configure.in: Attempted to use LYX_PATH_HEADER
6668 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6670 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6671 input from JMarc. Now use preprocessor to find the header.
6672 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6673 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6674 LYX_STL_STRING_FWD. See comments in file.
6676 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6678 * The global MiniBuffer * minibuffer variable is dead.
6680 * The global FD_form_main * fd_form_main variable is dead.
6682 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6684 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6686 * src/table.h: add the LOstream.h header
6687 * src/debug.h: ditto
6689 * src/LyXAction.h: change the explaination of the ReadOnly
6690 attribute: is indicates that the function _can_ be used.
6692 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6695 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6697 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6703 * src/paragraph.C (GetWord): assert on pos>=0
6706 * src/support/lyxstring.C: condition the use of an invariant on
6708 * src/support/lyxstring.h: ditto
6710 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6711 Use LAssert.h instead of plain assert().
6713 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6715 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6716 * src/support/filetools.C: ditto
6718 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6721 * INSTALL: document the new configure flags
6723 * configure.in: suppress --with-debug; add --enable-assertions
6725 * acinclude.m4: various changes in alignment of help strings.
6727 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6729 * src/kbmap.C: commented out the use of the hash map in kb_map,
6730 beginning of movement to a stl::container.
6732 * several files: removed code that was not in effect when
6733 MOVE_TEXT was defined.
6735 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6736 for escaping should not be used. We can discuss if the string
6737 should be enclosed in f.ex. [] instead of "".
6739 * src/trans_mgr.C (insert): use the new returned value from
6740 encodeString to get deadkeys and keymaps done correctly.
6742 * src/chset.C (encodeString): changed to return a pair, to tell
6743 what to use if we know the string.
6745 * src/lyxscreen.h (fillArc): new function.
6747 * src/FontInfo.C (resize): rewritten to use more std::string like
6748 structore, especially string::replace.
6750 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6753 * configure.in (chmod +x some scripts): remove config/gcc-hack
6755 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6757 * src/buffer.C (writeFile): change once again the top comment in a
6758 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6759 instead of an hardcoded version number.
6760 (makeDocBookFile): ditto
6762 * src/version.h: add new define LYX_DOCVERSION
6764 * po/de.po: update from Pit Sütterlin
6765 * lib/bind/de_menus.bind: ditto.
6767 * src/lyxfunc.C (Dispatch): call MenuExport()
6768 * src/buffer.C (Dispatch): ditto
6770 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6771 LyXFunc::Dispatch().
6772 (MenuExport): new function, moved from
6773 LyXFunc::Dispatch().
6775 * src/trans_mgr.C (insert): small cleanup
6776 * src/chset.C (loadFile): ditto
6778 * lib/kbd/iso8859-1.cdef: add missing backslashes
6780 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6782 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6783 help with placing the manually drawn accents better.
6785 (Draw): x2 and hg changed to float to minimize rounding errors and
6786 help place the accents better.
6788 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6789 unsigned short to char is just wrong...cast the char to unsigned
6790 char instead so that the two values can compare sanely. This
6791 should also make the display of insetlatexaccents better and
6792 perhaps also some other insets.
6794 (lbearing): new function
6797 1999-12-15 Allan Rae <rae@lyx.org>
6799 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6800 header that provides a wrapper around the very annoying SGI STL header
6803 * src/support/lyxstring.C, src/LString.h:
6804 removed old SGI-STL-compatability attempts.
6806 * configure.in: Use LYX_STL_STRING_FWD.
6808 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6809 stl_string_fwd.h is around and try to determine it's location.
6810 Major improvement over previous SGI STL 3.2 compatability.
6811 Three small problems remain with this function due to my zero
6812 knowledge of autoconf. JMarc and lgb see the comments in the code.
6814 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6816 * src/broken_const.h, config/hack-gcc, config/README: removed
6818 * configure.in: remove --with-gcc-hack option; do not call
6821 * INSTALL: remove documentation of --with-broken-const and
6824 * acconfig.h: remove all trace of BROKEN_CONST define
6826 * src/buffer.C (makeDocBookFile): update version number in output
6828 (SimpleDocBookOnePar): fix an assert when trying to a character
6829 access beyond string length
6832 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6834 * po/de.po: fix the Export menu
6836 * lyx.man: update the description of -dbg
6838 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6839 (commandLineHelp): updated
6840 (easyParse): show list of available debug levels if -dbg is passed
6843 * src/Makefile.am: add debug.C
6845 * src/debug.h: moved some code to debug.C
6847 * src/debug.C: new file. Contains code to set and show debug
6850 * src/layout.C: remove 'break' after 'continue' in switch
6851 statements, since these cannot be reached.
6853 1999-12-13 Allan Rae <rae@lyx.org>
6855 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6856 (in_word_set): hash() -> math_hash()
6858 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6860 * acconfig.h: Added a test for whether we are using exceptions in the
6861 current compilation run. If so USING_EXCEPTIONS is defined.
6863 * config.in: Check for existance of stl_string_fwd.h
6864 * src/LString.h: If compiling --with-included-string and SGI's
6865 STL version 3.2 is present (see above test) we need to block their
6866 forward declaration of string and supply a __get_c_string().
6867 However, it turns out this is only necessary if compiling with
6868 exceptions enabled so I've a bit more to add yet.
6870 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6871 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6872 src/support/LRegex.h, src/undo.h:
6873 Shuffle the order of the included files a little to ensure that
6874 LString.h gets included before anything that includes stl_string_fwd.h
6876 * src/support/lyxstring.C: We need to #include LString.h instead of
6877 lyxstring.h to get the necessary definition of __get_c_string.
6878 (__get_c_string): New function. This is defined static just like SGI's
6879 although why they need to do this I'm not sure. Perhaps it should be
6880 in lstrings.C instead.
6882 * lib/templates/IEEEtran.lyx: New template file.
6884 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6886 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6887 * intl/Makefile.in (MKINSTALLDIRS): ditto
6889 * src/LyXAction.C (init): changed to hold the LFUN data in a
6890 automatic array in stead of in callso to newFunc, this speeds up
6891 compilation a lot. Also all the memory used by the array is
6892 returned when the init is completed.
6894 * a lot of files: compiled with -Wold-style-cast, changed most of
6895 the reported offenders to C++ style casts. Did not change the
6896 offenders in C files.
6898 * src/trans.h (Match): change argument type to unsigned int.
6900 * src/support/DebugStream.C: fix some types on the streambufs so
6901 that it works on a conforming implementation.
6903 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6905 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6907 * src/support/lyxstring.C: remove the inline added earlier since
6908 they cause a bunch of unsatisfied symbols when linking with dec
6909 cxx. Cxx likes to have the body of inlines at the place where they
6912 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6913 accessing negative bounds in array. This fixes the crash when
6914 inserting accented characters.
6915 * src/trans.h (Match): ditto
6917 * src/buffer.C (Dispatch): since this is a void, it should not try
6918 to return anything...
6920 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6922 * src/buffer.h: removed the two friends from Buffer. Some changes
6923 because of this. Buffer::getFileName and Buffer::setFileName
6924 renamed to Buffer::fileName() and Buffer::fileName(...).
6926 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6928 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6929 and Buffer::update(short) to BufferView. This move is currently
6930 controlled by a define MOVE_TEXT, this will be removed when all
6931 shows to be ok. This move paves the way for better separation
6932 between buffer contents and buffer view. One side effect is that
6933 the BufferView needs a rebreak when swiching buffers, if we want
6934 to avoid this we can add a cache that holds pointers to LyXText's
6935 that is not currently in use.
6937 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6940 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6942 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6944 * lyx_main.C: new command line option -x (or --execute) and
6945 -e (or --export). Now direct conversion from .lyx to .tex
6946 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6947 Unfortunately, X is still needed and the GUI pops up during the
6950 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6952 * src/Spacing.C: add a using directive to bring stream stuff into
6954 * src/paragraph.C: ditto
6955 * src/buffer.C: ditto
6957 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6958 from Lars' announcement).
6960 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6961 example files from Tino Meinen.
6963 1999-12-06 Allan Rae <rae@lyx.org>
6965 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6967 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6969 * src/support/lyxstring.C: added a lot of inline for no good
6972 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6973 latexWriteEndChanges, they were not used.
6975 * src/layout.h (operator<<): output operator for PageSides
6977 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6979 * some example files: loaded in LyX 1.0.4 and saved again to update
6980 certain constructs (table format)
6982 * a lot of files: did the change to use fstream/iostream for all
6983 writing of files. Done with a close look at Andre Poenitz's patch.
6985 * some files: whitespace changes.
6987 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6989 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6990 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6991 architecture, we provide our own. It is used unconditionnally, but
6992 I do not think this is a performance problem. Thanks to Angus
6993 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6994 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6996 (GetInset): use my_memcpy.
7000 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7001 it is easier to understand, but it uses less TeX-only constructs now.
7003 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7004 elements contain spaces
7006 * lib/configure: regenerated
7008 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7009 elements contain spaces; display the list of programs that are
7012 * autogen.sh: make sure lib/configure is executable
7014 * lib/examples/*: rename the tutorial examples to begin with the
7015 two-letters language code.
7017 * src/lyxfunc.C (getStatus): do not query current font if no
7020 * src/lyx_cb.C (RunScript): use QuoteName
7021 (MenuRunDvips): ditto
7022 (PrintApplyCB): ditto
7024 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7025 around argument, so that it works well with the current shell.
7026 Does not work properly with OS/2 shells currently.
7028 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7029 * src/LyXSendto.C (SendtoApplyCB): ditto
7030 * src/lyxfunc.C (Dispatch): ditto
7031 * src/buffer.C (runLaTeX): ditto
7032 (runLiterate): ditto
7033 (buildProgram): ditto
7035 * src/lyx_cb.C (RunScript): ditto
7036 (MenuMakeLaTeX): ditto
7038 * src/buffer.h (getLatexName): new method
7040 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7042 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7044 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7045 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7046 (create_math_panel): ditto
7048 * src/lyxfunc.C (getStatus): re-activate the code which gets
7049 current font and cursor; add test for export to html.
7051 * src/lyxrc.C (read): remove unreachable break statements; add a
7054 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7056 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7058 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7059 introduced by faulty regex.
7060 * src/buffer.C: ditto
7061 * src/lastfiles.C: ditto
7062 * src/paragraph.C: ditto
7063 * src/table.C: ditto
7064 * src/vspace.C: ditto
7065 * src/insets/figinset.C: ditto
7066 Note: most of these is absolutely harmless, except the one in
7067 src/mathed formula.C.
7069 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7071 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7072 operation, yielding correct results for the reLyX command.
7074 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7076 * src/support/filetools.C (ExpandPath): removed an over eager
7078 (ReplaceEnvironmentPath): ditto
7080 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7081 shows that we are doing something fishy in our code...
7085 * src/lyxrc.C (read): use a double switch trick to get more help
7086 from the compiler. (the same trick is used in layout.C)
7087 (write): new function. opens a ofstream and pass that to output
7088 (output): new function, takes a ostream and writes the lyxrc
7089 elemts to it. uses a dummy switch to make sure no elements are
7092 * src/lyxlex.h: added a struct pushpophelper for use in functions
7093 with more than one exit point.
7095 * src/lyxlex.[Ch] (GetInteger): made it const
7099 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7101 * src/layout.[hC] : LayoutTags splitted into several enums, new
7102 methods created, better error handling cleaner use of lyxlex. Read
7105 * src/bmtable.[Ch]: change some member prototypes because of the
7106 image const changes.
7108 * commandtags.h, src/LyXAction.C (init): new function:
7109 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7110 This file is not read automatically but you can add \input
7111 preferences to your lyxrc if you want to. We need to discuss how
7114 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7115 in .aux, also remove .bib and .bst files from dependencies when
7118 * src/BufferView.C, src/LyXView.C: add const_cast several places
7119 because of changes to images.
7121 * lib/images/*: same change as for images/*
7123 * lib/lyxrc.example: Default for accept_compound is false not no.
7125 * images/*: changed to be const, however I have som misgivings
7126 about this change so it might be changed back.
7128 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7130 * lib/configure, po/POTFILES.in: regenerated
7132 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7134 * config/lib_configure.m4: removed
7136 * lib/configure.m4: new file (was config/lib_configure.m4)
7138 * configure.in: do not test for rtti, since we do not use it.
7140 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7142 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7143 doubling of allocated space scheme. This makes it faster for large
7144 strings end to use less memory for small strings. xtra rememoved.
7146 * src/insets/figinset.C (waitalarm): commented out.
7147 (GhostscriptMsg): use static_cast
7148 (GhostscriptMsg): use new instead of malloc to allocate memory for
7149 cmap. also delete the memory after use.
7151 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7153 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7154 for changes in bibtex database or style.
7155 (runBibTeX): remove all .bib and .bst files from dep before we
7157 (run): use scanAuc in when dep file already exist.
7159 * src/DepTable.C (remove_files_with_extension): new method
7162 * src/DepTable.[Ch]: made many of the methods const.
7164 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7166 * src/bufferparams.C: make sure that the default textclass is
7167 "article". It used to be the first one by description order, but
7168 now the first one is "docbook".
7170 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7171 string; call Debug::value.
7172 (easyParse): pass complete argument to setDebuggingLevel().
7174 * src/debug.h (value): fix the code that parses debug levels.
7176 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7179 * src/LyXAction.C: use Debug::ACTION as debug channel.
7181 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7183 * NEWS: updated for the future 1.1.3 release.
7185 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7186 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7187 it should. This is of course a controversial change (since many
7188 people will find that their lyx workscreen is suddenly full of
7189 red), but done for the sake of correctness.
7191 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7192 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7194 * src/insets/inseterror.h, src/insets/inseturl.h,
7195 src/insets/insetinfo.h, src/insets/figinset.h,
7196 src/mathed/formulamacro.h, src/mathed/math_macro.h
7197 (EditMessage): add a missing const and add _() to make sure that
7200 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7201 src/insets/insetbib.C, src/support/filetools.C: add `using'
7204 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7205 doing 'Insert index of last word' at the beginning of a paragraph.
7207 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7209 * several files: white-space changes.
7211 * src/mathed/formula.C: removed IsAlpha and IsDigit
7213 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7214 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7217 * src/insets/figinset.C (GetPSSizes): don't break when
7218 "EndComments" is seen. But break when a boundingbox is read.
7220 * all classes inherited from Inset: return value of Clone
7221 changed back to Inset *.
7223 * all classes inherited form MathInset: return value of Clone
7224 changed back to MathedInset *.
7226 * src/insets/figinset.C (runqueue): use a ofstream to output the
7227 gs/ps file. Might need some setpresicion or setw. However I can
7228 see no problem with the current code.
7229 (runqueue): use sleep instead of the alarm/signal code. I just
7230 can't see the difference.
7232 * src/paragraph.C (LyXParagraph): reserve space in the new
7233 paragraph and resize the inserted paragraph to just fit.
7235 * src/lyxfunc.h (operator|=): added operator for func_status.
7237 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7238 check for readable file.
7240 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7241 check for readable file.
7242 (MenuMakeLinuxDoc): ditto
7243 (MenuMakeDocBook): ditto
7244 (MenuMakeAscii): ditto
7245 (InsertAsciiFile): split the test for openable and readable
7247 * src/bmtable.C (draw_bitmaptable): use
7248 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7250 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7251 findtexfile from LaTeX to filetools.
7253 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7254 instead of FilePtr. Needs to be verified by a literate user.
7256 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7258 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7259 (EditMessage): likewise.
7261 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7262 respectively as \textasciitilde and \textasciicircum.
7264 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7266 * src/support/lyxstring.h: made the methods that take iterators
7269 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7270 (regexMatch): made is use the real regex class.
7272 * src/support/Makefile.am: changed to use libtool
7274 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7276 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7278 (MathIsInset ++): changed several macros to be inline functions
7281 * src/mathed/Makefile.am: changed to use libtool
7283 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7285 * src/insets/inset* : Clone changed to const and return type is
7286 the true insettype not just Inset*.
7288 * src/insets/Makefile.am: changed to use libtool
7290 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7292 * src/undo.[Ch] : added empty() and changed some of the method
7295 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7297 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7298 setID use block<> for the bullets array, added const several places.
7300 * src/lyxfunc.C (getStatus): new function
7302 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7303 LyXAction, added const to several funtions.
7305 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7306 a std::map, and to store the dir items in a vector.
7308 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7311 * src/LyXView.[Ch] + other files : changed currentView to view.
7313 * src/LyXAction.[Ch] : ported from the old devel branch.
7315 * src/.cvsignore: added .libs and a.out
7317 * configure.in : changes to use libtool.
7319 * acinclude.m4 : inserted libtool.m4
7321 * .cvsignore: added libtool
7323 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7325 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7326 file name in insets and mathed directories (otherwise the
7327 dependency is not taken in account under cygwin).
7329 * src/text2.C (InsertString[AB]): make sure that we do not try to
7330 read characters past the string length.
7332 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7334 * lib/doc/LaTeXConfig.lyx.in,
7335 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7337 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7338 file saying who created them and when this heppened; this is
7339 useless and annoys tools like cvs.
7341 * lib/layouts/g-brief-{en,de}.layout,
7342 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7343 from Thomas Hartkens <thomas@hartkens.de>.
7345 * src/{insets,mathed}/Makefile.am: do not declare an empty
7346 LDFLAGS, so that it can be set at configure time (useful on Irix
7349 * lib/reLyX/configure.in: make sure that the prefix is set
7350 correctly in LYX_DIR.
7352 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7354 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7355 be used by 'command-sequence' this allows to bind a key to a
7356 sequence of LyX-commands
7357 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7359 * src/LyXAction.C: add "command-sequence"
7361 * src/LyXFunction.C: handling of "command-sequence"
7363 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7364 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7366 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7368 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7370 * src/buffer.C (writeFile): Do not output a comment giving user
7371 and date at the beginning of a .lyx file. This is useless and
7372 annoys cvs anyway; update version number to 1.1.
7374 * src/Makefile.am (LYX_DIR): add this definition, so that a
7375 default path is hardcoded in LyX.
7377 * configure.in: Use LYX_GNU_GETTEXT.
7379 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7380 AM_GNU_GETTEXT with a bug fixed.
7382 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7384 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7386 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7387 which is used to point to LyX data is now LYX_DIR_11x.
7389 * lyx.man: convert to a unix text file; small updates.
7391 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7393 * src/support/LSubstring.[Ch]: made the second arg of most of the
7394 constructors be a const reference.
7396 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7399 * src/support/lyxstring.[Ch] (swap): added missing member function
7400 and specialization of swap(str, str);
7402 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7404 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7405 trace of the old one.
7407 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7408 put the member definitions in undo.C.
7410 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7411 NEW_TEXT and have now only code that was included when this was
7414 * src/intl.C (LCombo): use static_cast
7416 (DispatchCallback): ditto
7418 * src/definitions.h: removed whole file
7420 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7422 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7423 parsing and stores in a std:map. a regex defines the file format.
7424 removed unneeded members.
7426 * src/bufferparams.h: added several enums from definitions.h here.
7427 Removed unsused destructor. Changed some types to use proper enum
7428 types. use block to have the temp_bullets and user_defined_bullets
7429 and to make the whole class assignable.
7431 * src/bufferparams.C (Copy): removed this functions, use a default
7434 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7437 * src/buffer.C (readLyXformat2): commend out all that have with
7438 oldpapersize to do. also comment out all that hve to do with
7439 insetlatex and insetlatexdel.
7440 (setOldPaperStuff): commented out
7442 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7444 * src/LyXAction.C: remove use of inset-latex-insert
7446 * src/mathed/math_panel.C (button_cb): use static_cast
7448 * src/insets/Makefile.am (insets_o_SOURCES): removed
7451 * src/support/lyxstring.C (helper): use the unsigned long
7452 specifier, UL, instead of a static_cast.
7454 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7456 * src/support/block.h: new file. to be used as a c-style array in
7457 classes, so that the class can be assignable.
7459 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7461 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7462 NULL, make sure to return an empty string (it is not possible to
7463 set a string to NULL).
7465 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7467 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7469 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7471 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7472 link line, so that Irix users (for example) can set it explicitely to
7475 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7476 it can be overidden at make time (static or dynamic link, for
7479 * src/vc-backend.C, src/LaTeXFeatures.h,
7480 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7481 statements to bring templates to global namespace.
7483 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7485 * src/support/lyxstring.C (operator[] const): make it standard
7488 * src/minibuffer.C (Init): changed to reflect that more
7489 information is given from the lyxvc and need not be provided here.
7491 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7493 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7495 * src/LyXView.C (UpdateTimerCB): use static_cast
7496 (KeyPressMask_raw_callback): ditto
7498 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7499 buffer_, a lot of changes because of this. currentBuffer() ->
7500 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7501 also changes to other files because of this.
7503 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7505 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7506 have no support for RCS and partial support for CVS, will be
7509 * src/insets/ several files: changes because of function name
7510 changes in Bufferview and LyXView.
7512 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7514 * src/support/LSubstring.[Ch]: new files. These implement a
7515 Substring that can be very convenient to use. i.e. is this
7517 string a = "Mary had a little sheep";
7518 Substring(a, "sheep") = "lamb";
7519 a is now "Mary has a little lamb".
7521 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7522 out patterns and subpatterns of strings. It is used by LSubstring
7523 and also by vc-backend.C
7525 * src/support/lyxstring.C: went over all the assertions used and
7526 tried to correct the wrong ones and flag which of them is required
7527 by the standard. some bugs found because of this. Also removed a
7528 couple of assertions.
7530 * src/support/Makefile.am (libsupport_a_SOURCES): added
7531 LSubstring.[Ch] and LRegex.[Ch]
7533 * src/support/FileInfo.h: have struct stat buf as an object and
7534 not a pointer to one, some changes because of this.
7536 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7537 information in layout when adding the layouts preamble to the
7540 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7543 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7544 because of bug in OS/2.
7546 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7548 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7549 \verbatim@font instead of \ttfamily, so that it can be redefined.
7551 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7552 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7553 src/layout.h, src/text2.C: add 'using' directive to bring the
7554 STL templates we need from the std:: namespace to the global one.
7555 Needed by DEC cxx in strict ansi mode.
7557 * src/support/LIstream.h,src/support/LOstream.h,
7558 src/support/lyxstring.h,src/table.h,
7559 src/lyxlookup.h: do not include <config.h> in header
7560 files. This should be done in the .C files only.
7562 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7566 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7568 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7569 from Kayvan to fix the tth invokation.
7571 * development/lyx.spec.in: updates from Kayvan to reflect the
7572 changes of file names.
7574 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7576 * src/text2.C (InsertStringB): use std::copy
7577 (InsertStringA): use std::copy
7579 * src/bufferlist.C: use a vector to store the buffers in. This is
7580 an internal change and should not affect any other thing.
7582 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7585 * src/text.C (Fill): fix potential bug, one off bug.
7587 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7589 * src/Makefile.am (lyx_main.o): add more files it depends on.
7591 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7593 * src/support/lyxstring.C: use size_t for the reference count,
7594 size, reserved memory and xtra.
7595 (internal_compare): new private member function. Now the compare
7596 functions should work for std::strings that have embedded '\0'
7598 (compare): all compare functions rewritten to use
7601 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7603 * src/support/lyxstring.C (compare): pass c_str()
7604 (compare): pass c_str
7605 (compare): pass c_str
7607 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7609 * src/support/DebugStream.C: <config.h> was not included correctly.
7611 * lib/configure: forgot to re-generate it :( I'll make this file
7612 auto generated soon.
7614 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7616 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7619 * src/support/lyxstring.C: some changes from length() to rep->sz.
7620 avoids a function call.
7622 * src/support/filetools.C (SpaceLess): yet another version of the
7623 algorithm...now per Jean-Marc's suggestions.
7625 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7627 * src/layout.C (less_textclass_desc): functor for use in sorting
7629 (LyXTextClass::Read): sort the textclasses after reading.
7631 * src/support/filetools.C (SpaceLess): new version of the
7632 SpaceLess functions. What problems does this one give? Please
7635 * images/banner_bw.xbm: made the arrays unsigned char *
7637 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7639 * src/support/lyxstring.C (find): remove bogus assertion in the
7640 two versions of find where this has not been done yet.
7642 * src/support/lyxlib.h: add missing int return type to
7645 * src/menus.C (ShowFileMenu): disable exporting to html if no
7646 html export command is present.
7648 * config/lib_configure.m4: add a test for an HTML converter. The
7649 programs checked for are, in this order: tth, latex2html and
7652 * lib/configure: generated from config/lib_configure.m4.
7654 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7655 html converter. The parameters are now passed through $$FName and
7656 $$OutName, instead of standard input/output.
7658 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7660 * lib/lyxrc.example: update description of \html_command.
7661 add "quotes" around \screen_font_xxx font setting examples to help
7662 people who use fonts with spaces in their names.
7664 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7666 * Distribution files: updates for v1.1.2
7668 * src/support/lyxstring.C (find): remove bogus assert and return
7669 npos for the same condition.
7671 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7673 * added patch for OS/2 from SMiyata.
7675 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7677 * src/text2.C (CutSelection): make space_wrapped a bool
7678 (CutSelection): dont declare int i until we have to.
7679 (alphaCounter): return a char const *.
7681 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7683 * src/support/syscall.C (Systemcalls::kill):
7684 src/support/filetools.C (PutEnv, PutEnvPath):
7685 src/lyx_cb.C (addNewlineAndDepth):
7686 src/FontInfo.C (FontInfo::resize): condition some #warning
7687 directives with WITH_WARNINGS.
7690 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7692 * src/layout.[Ch] + several files: access to class variables
7693 limited and made accessor functions instead a lot of code changed
7694 becuase of this. Also instead of returning pointers often a const
7695 reference is returned instead.
7697 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7699 * src/Makefile.am (dist-hook): added used to remove the CVS from
7700 cheaders upon creating a dist
7701 (EXTRA_DIST): added cheaders
7703 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7704 a character not as a small integer.
7706 * src/support/lyxstring.C (find): removed Assert and added i >=
7707 rep->sz to the first if.
7709 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7711 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7712 src/LyXView.C src/buffer.C src/bufferparams.C
7713 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7714 src/text2.C src/insets/insetinclude.C:
7715 lyxlayout renamed to textclasslist.
7717 * src/layout.C: some lyxerr changes.
7719 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7720 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7721 (LyXLayoutList): removed all traces of this class.
7722 (LyXTextClass::Read): rewrote LT_STYLE
7723 (LyXTextClass::hasLayout): new function
7724 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7725 both const and nonconst version.
7726 (LyXTextClass::delete_layout): new function.
7727 (LyXTextClassList::Style): bug fix. do the right thing if layout
7729 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7730 (LyXTextClassList::NameOfLayout): ditto
7731 (LyXTextClassList::Load): ditto
7733 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7735 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7737 * src/LyXAction.C (LookupFunc): added a workaround for sun
7738 compiler, on the other hand...we don't know if the current code
7739 compiles on sun at all...
7741 * src/support/filetools.C (CleanupPath): subst fix
7743 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7746 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7747 complained about this one?
7749 * src/insets/insetinclude.C (Latex): subst fix
7751 * src/insets/insetbib.C (getKeys): subst fix
7753 * src/LyXSendto.C (SendtoApplyCB): subst fix
7755 * src/lyx_main.C (init): subst fix
7757 * src/layout.C (Read): subst fix
7759 * src/lyx_sendfax_main.C (button_send): subst fix
7761 * src/buffer.C (RoffAsciiTable): subst fix
7763 * src/lyx_cb.C (MenuFax): subst fix
7764 (PrintApplyCB): subst fix
7766 1999-10-26 Juergen Vigna <jug@sad.it>
7768 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7770 (Read): Cleaned up this code so now we read only format vestion >= 5
7772 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7774 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7775 come nobody has complained about this one?
7777 * src/insets/insetinclude.C (Latex): subst fix
7779 * src/insets/insetbib.C (getKeys): subst fix
7781 * src/lyx_main.C (init): subst fix
7783 * src/layout.C (Read): subst fix
7785 * src/buffer.C (RoffAsciiTable): subst fix
7787 * src/lyx_cb.C (MenuFax): subst fix.
7789 * src/layout.[hC] + some other files: rewrote to use
7790 std::container to store textclasses and layouts in.
7791 Simplified, removed a lot of code. Make all classes
7792 assignable. Further simplifications and review of type
7793 use still to be one.
7795 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7796 lastfiles to create the lastfiles partr of the menu.
7798 * src/lastfiles.[Ch]: rewritten to use deque to store the
7799 lastfiles in. Uses fstream for reading and writing. Simplifies
7802 * src/support/syscall.C: remove explicit cast.
7804 * src/BufferView.C (CursorToggleCB): removed code snippets that
7806 use explicat C++ style casts instead of C style casts. also use
7807 u_vdata instea of passing pointers in longs.
7809 * src/PaperLayout.C: removed code snippets that were commented out.
7811 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7813 * src/lyx_main.C: removed code snippets that wer commented out.
7815 * src/paragraph.C: removed code snippets that were commented out.
7817 * src/lyxvc.C (logClose): use static_cast
7819 (viewLog): remove explicit cast to void*
7820 (showLog): removed old commented code
7822 * src/menus.C: use static_cast instead of C style casts. use
7823 u_vdata instead of u_ldata. remove explicit cast to (long) for
7824 pointers. Removed old code that was commented out.
7826 * src/insets/inset.C: removed old commented func
7828 * src/insets/insetref.C (InsetRef): removed old code that had been
7829 commented out for a long time.
7831 (escape): removed C style cast
7833 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7835 * src/insets/insetlatex.C (Draw): removed old commented code
7836 (Read): rewritten to use string
7838 * src/insets/insetlabel.C (escape): removed C style cast
7840 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7842 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7845 * src/insets/insetinclude.h: removed a couple of stupid bools
7847 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7848 (Clone): remove C style cast
7849 (getKeys): changed list to lst because of std::list
7851 * src/insets/inseterror.C (Draw): removed som old commented code.
7853 * src/insets/insetcommand.C (Draw): removed some old commented code.
7855 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7856 commented out forever.
7857 (bibitem_cb): use static_cast instead of C style cast
7858 use of vdata changed to u_vdata.
7860 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7862 (CloseUrlCB): use static_cast instead of C style cast.
7863 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7865 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7866 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7867 (CloseInfoCB): static_cast from ob->u_vdata instead.
7868 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7871 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7872 (C_InsetError_CloseErrorCB): forward the ob parameter
7873 (CloseErrorCB): static_cast from ob->u_vdata instead.
7875 * src/vspace.h: include LString.h since we use string in this class.
7877 * src/vspace.C (lyx_advance): changed name from advance because of
7878 nameclash with stl. And since we cannot use namespaces yet...I
7879 used a lyx_ prefix instead. Expect this to change when we begin
7882 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7884 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7885 and removed now defunct constructor and deconstructor.
7887 * src/BufferView.h: have backstack as a object not as a pointer.
7888 removed initialization from constructor. added include for BackStack
7890 * development/lyx.spec.in (%build): add CFLAGS also.
7892 * src/screen.C (drawFrame): removed another warning.
7894 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7896 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7897 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7898 README and ANNOUNCE a bit for the next release. More work is
7901 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7902 unbreakable if we are in freespacing mode (LyX-Code), but not in
7905 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7907 * src/BackStack.h: fixed initialization order in constructor
7909 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7911 * acinclude.m4 (VERSION): new rules for when a version is
7912 development, added also a variable for prerelease.
7913 (warnings): we set with_warnings=yes for prereleases
7914 (lyx_opt): prereleases compile with same optimization as development
7915 (CXXFLAGS): only use pedantic if we are a development version
7917 * src/BufferView.C (restorePosition): don't do anything if the
7920 * src/BackStack.h: added member empty, use this to test if there
7921 is anything to pop...
7923 1999-10-25 Juergen Vigna <jug@sad.it>
7926 * forms/layout_forms.fd +
7927 * forms/latexoptions.fd +
7928 * lyx.fd: changed for various form resize issues
7930 * src/mathed/math_panel.C +
7931 * src/insets/inseterror.C +
7932 * src/insets/insetinfo.C +
7933 * src/insets/inseturl.C +
7934 * src/insets/inseturl.h +
7937 * src/PaperLayout.C +
7938 * src/ParagraphExtra.C +
7939 * src/TableLayout.C +
7941 * src/layout_forms.C +
7948 * src/menus.C: fixed various resize issues. So now forms can be
7949 resized savely or not be resized at all.
7951 * forms/form_url.fd +
7952 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7955 * src/insets/Makefile.am: added files form_url.[Ch]
7957 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7959 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7960 (and presumably 6.2).
7962 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7963 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7964 remaining static member callbacks.
7966 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7969 * src/support/lyxstring.h: declare struct Srep as friend of
7970 lyxstring, since DEC cxx complains otherwise.
7972 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7974 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7976 * src/LaTeX.C (run): made run_bibtex also depend on files with
7978 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7979 are put into the dependency file.
7981 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7982 the code has shown itself to work
7983 (create_ispell_pipe): removed another warning, added a comment
7986 * src/minibuffer.C (ExecutingCB): removed code that has been
7987 commented out a long time
7989 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7990 out code + a warning.
7992 * src/support/lyxstring.h: comment out the three private
7993 operators, when compiling with string ansi conforming compilers
7996 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7998 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7999 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8002 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8005 * src/mathed/math_panel.C (create_math_panel): remove explicit
8008 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8011 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8012 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8013 to XCreatePixmapFromBitmapData
8014 (fl_set_bmtable_data): change the last argument to be unsigned
8016 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8017 and bh to be unsigned int, remove explicit casts in call to
8018 XReadBitmapFileData.
8020 * images/arrows.xbm: made the arrays unsigned char *
8021 * images/varsz.xbm: ditto
8022 * images/misc.xbm: ditto
8023 * images/greek.xbm: ditto
8024 * images/dots.xbm: ditto
8025 * images/brel.xbm: ditto
8026 * images/bop.xbm: ditto
8028 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8030 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8031 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8032 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8034 (LYX_CXX_CHEADERS): added <clocale> to the test.
8036 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8038 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8040 * src/support/lyxstring.C (append): fixed something that must be a
8041 bug, rep->assign was used instead of rep->append.
8043 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8046 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8047 lyx insert double chars. Fix spotted by Kayvan.
8049 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8051 * Fixed the tth support. I messed up with the Emacs patch apply feature
8052 and omitted the changes in lyxrc.C.
8054 1999-10-22 Juergen Vigna <jug@sad.it>
8056 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8058 * src/lyx_cb.C (MenuInsertRef) +
8059 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8060 the form cannot be resized under it limits (fixes a segfault)
8062 * src/lyx.C (create_form_form_ref) +
8063 * forms/lyx.fd: Changed Gravity on name input field so that it is
8066 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8068 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8069 <ostream> and <istream>.
8071 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8072 whether <fstream> provides the latest standard features, or if we
8073 have an oldstyle library (like in egcs).
8074 (LYX_CXX_STL_STRING): fix the test.
8076 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8077 code on MODERN_STL_STREAM.
8079 * src/support/lyxstring.h: use L{I,O}stream.h.
8081 * src/support/L{I,O}stream.h: new files, designed to setup
8082 correctly streams for our use
8083 - includes the right header depending on STL capabilities
8084 - puts std::ostream and std::endl (for LOStream.h) or
8085 std::istream (LIStream.h) in toplevel namespace.
8087 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8089 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8090 was a bib file that had been changed we ensure that bibtex is run.
8091 (runBibTeX): enhanced to extract the names of the bib files and
8092 getting their absolute path and enter them into the dep file.
8093 (findtexfile): static func that is used to look for tex-files,
8094 checks for absolute patchs and tries also with kpsewhich.
8095 Alternative ways of finding the correct files are wanted. Will
8097 (do_popen): function that runs a command using popen and returns
8098 the whole output of that command in a string. Should be moved to
8101 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8102 file with extension ext has changed.
8104 * src/insets/figinset.C: added ifdef guards around the fl_free
8105 code that jug commented out. Now it is commented out when
8106 compiling with XForms == 0.89.
8108 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8109 to lyxstring.C, and only keep a forward declaration in
8110 lyxstring.h. Simplifies the header file a bit and should help a
8111 bit on compile time too. Also changes to Srep will not mandate a
8112 recompile of code just using string.
8113 (~lyxstring): definition moved here since it uses srep.
8114 (size): definition moved here since it uses srep.
8116 * src/support/lyxstring.h: removed a couple of "inline" that should
8119 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8121 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8124 1999-10-21 Juergen Vigna <jug@sad.it>
8126 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8127 set to left if I just remove the width entry (or it is empty).
8129 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8130 paragraph when having dummy paragraphs.
8132 1999-10-20 Juergen Vigna <jug@sad.it>
8134 * src/insets/figinset.C: just commented some fl_free_form calls
8135 and added warnings so that this calls should be activated later
8136 again. This avoids for now a segfault, but we have a memory leak!
8138 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8139 'const char * argument' to 'string argument', this should
8140 fix some Asserts() in lyxstring.C.
8142 * src/lyxfunc.h: Removed the function argAsString(const char *)
8143 as it is not used anymore.
8145 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8147 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8150 * src/Literate.h: some funcs moved from public to private to make
8151 interface clearer. Unneeded args removed.
8153 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8155 (scanBuildLogFile): ditto
8157 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8158 normal TeX Error. Still room for improvement.
8160 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8162 * src/buffer.C (insertErrors): changes to make the error
8163 desctription show properly.
8165 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8168 * src/support/lyxstring.C (helper): changed to use
8169 sizeof(object->rep->ref).
8170 (operator>>): changed to use a pointer instead.
8172 * src/support/lyxstring.h: changed const reference & to value_type
8173 const & lets see if that helps.
8175 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8177 * Makefile.am (rpmdist): fixed to have non static package and
8180 * src/support/lyxstring.C: removed the compilation guards
8182 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8185 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8186 conditional compile of lyxstring.Ch
8188 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8189 stupid check, but it is a lot better than the bastring hack.
8190 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8192 * several files: changed string::erase into string::clear. Not
8195 * src/chset.C (encodeString): use a char temporary instead
8197 * src/table.C (TexEndOfCell): added tostr around
8198 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8199 (TexEndOfCell): ditto
8200 (TexEndOfCell): ditto
8201 (TexEndOfCell): ditto
8202 (DocBookEndOfCell): ditto
8203 (DocBookEndOfCell): ditto
8204 (DocBookEndOfCell): ditto
8205 (DocBookEndOfCell): ditto
8207 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8209 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8211 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8212 (MenuBuildProg): added tostr around ret
8213 (MenuRunChktex): added tostr around ret
8214 (DocumentApplyCB): added tostr around ret
8216 * src/chset.C (encodeString): added tostr around t->ic
8218 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8219 (makeLaTeXFile): added tostr around tocdepth
8220 (makeLaTeXFile): added tostr around ftcound - 1
8222 * src/insets/insetbib.C (setCounter): added tostr around counter.
8224 * src/support/lyxstring.h: added an operator+=(int) to catch more
8227 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8228 (lyxstring): We DON'T allow NULL pointers.
8230 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8232 * src/mathed/math_macro.C (MathMacroArgument::Write,
8233 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8234 when writing them out.
8236 * src/LString.C: remove, since it is not used anymore.
8238 * src/support/lyxstring.C: condition the content to
8239 USE_INCLUDED_STRING macro.
8241 * src/mathed/math_symbols.C, src/support/lstrings.C,
8242 src/support/lyxstring.C: add `using' directive to specify what
8243 we need in <algorithm>. I do not think that we need to
8244 conditionalize this, but any thought is appreciated.
8246 * many files: change all callback functions to "C" linkage
8247 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8248 strict_ansi. Those who were static are now global.
8249 The case of callbacks which are static class members is
8250 trickier, since we have to make C wrappers around them (see
8251 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8252 did not finish this yet, since it defeats the purpose of
8253 encapsulation, and I am not sure what the best route is.
8255 1999-10-19 Juergen Vigna <jug@sad.it>
8257 * src/support/lyxstring.C (lyxstring): we permit to have a null
8258 pointer as assignment value and just don't assign it.
8260 * src/vspace.C (nextToken): corrected this function substituting
8261 find_first(_not)_of with find_last_of.
8263 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8264 (TableOptCloseCB) (TableSpeCloseCB):
8265 inserted fl_set_focus call for problem with fl_hide_form() in
8268 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8270 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8273 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8275 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8276 LyXLex::next() and not eatline() to get its argument.
8278 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8280 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8281 instead, use fstreams for io of the depfile, removed unneeded
8282 functions and variables.
8284 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8285 vector instead, removed all functions and variables that is not in
8288 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8290 * src/buffer.C (insertErrors): use new interface to TeXError
8292 * Makefile.am (rpmdist): added a rpmdist target
8294 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8295 per Kayvan's instructions.
8297 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8299 * src/Makefile.am: add a definition for localedir, so that locales
8300 are found after installation (Kayvan)
8302 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8304 * development/.cvsignore: new file.
8306 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8308 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8309 C++ compiler provides wrappers for C headers and use our alternate
8312 * configure.in: use LYX_CXX_CHEADERS.
8314 * src/cheader/: new directory, populated with cname headers from
8315 libstdc++-2.8.1. They are a bit old, but probably good enough for
8316 what we want (support compilers who lack them).
8318 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8319 from includes. It turns out is was stupid.
8321 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8323 * lib/Makefile.am (install-data-local): forgot a ';'
8324 (install-data-local): forgot a '\'
8325 (libinstalldirs): needed after all. reintroduced.
8327 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8329 * configure.in (AC_OUTPUT): added lyx.spec
8331 * development/lyx.spec: removed file
8333 * development/lyx.spec.in: new file
8335 * po/*.po: merged with lyx.pot becuase of make distcheck
8337 * lib/Makefile.am (dist-hook): added dist-hook so that
8338 documentation files will be included when doing a make
8339 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8340 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8342 more: tried to make install do the right thing, exclude CVS dirs
8345 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8346 Path would fit in more nicely.
8348 * all files that used to use pathstack: uses now Path instead.
8349 This change was a lot easier than expected.
8351 * src/support/path.h: new file
8353 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8355 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8357 * src/support/lyxstring.C (getline): Default arg was given for
8360 * Configure.cmd: removed file
8362 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8364 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8365 streams classes and types, add the proper 'using' statements when
8366 MODERN_STL is defined.
8368 * src/debug.h: move the << operator definition after the inclusion
8371 * src/support/filetools.C: include "LAssert.h", which is needed
8374 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8377 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8378 include "debug.h" to define a proper ostream.
8380 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8382 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8383 method to the SystemCall class which can kill a process, but it's
8384 not fully implemented yet.
8386 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8388 * src/support/FileInfo.h: Better documentation
8390 * src/lyxfunc.C: Added support for buffer-export html
8392 * src/menus.C: Added Export->As HTML...
8394 * lib/bind/*.bind: Added short-cut for buffer-export html
8396 * src/lyxrc.*: Added support for new \tth_command
8398 * lib/lyxrc.example: Added stuff for new \tth_command
8400 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8402 * lib/Makefile.am (IMAGES): removed images/README
8403 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8404 installes in correct place. Check permisions is installed
8407 * src/LaTeX.C: some no-op changes moved declaration of some
8410 * src/LaTeX.h (LATEX_H): changed include guard name
8412 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8414 * lib/reLyX/Makefile.am: install noweb2lyx.
8416 * lib/Makefile.am: install configure.
8418 * lib/reLyX/configure.in: declare a config aux dir; set package
8419 name to lyx (not sure what the best solution is); generate noweb2lyx.
8421 * lib/layouts/egs.layout: fix the bibliography layout.
8423 1999-10-08 Jürgen Vigna <jug@sad.it>
8425 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8426 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8427 it returned without continuing to search the path.
8429 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8431 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8432 also fixes a bug. It is not allowed to do tricks with std::strings
8433 like: string a("hei"); &a[e]; this will not give what you
8434 think... Any reason for the complexity in this func?
8436 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8438 * Updated README and INSTALL a bit, mostly to check that my
8439 CVS rights are correctly set up.
8441 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8443 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8444 does not allow '\0' chars but lyxstring and std::string does.
8446 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8448 * autogen.sh (AUTOCONF): let the autogen script create the
8449 POTFILES.in file too. POTFILES.in should perhaps now not be
8450 included in the cvs module.
8452 * some more files changed to use C++ includes instead of C ones.
8454 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8456 (Reread): added tostr to nlink. buggy output otherwise.
8457 (Reread): added a string() around szMode when assigning to Buffer,
8458 without this I got a log of garbled info strings.
8460 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8463 * I have added several ostream & operator<<(ostream &, some_type)
8464 functions. This has been done to avoid casting and warnings when
8465 outputting enums to lyxerr. This as thus eliminated a lot of
8466 explicit casts and has made the code clearer. Among the enums
8467 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8468 mathed enums, some font enum the Debug::type enum.
8470 * src/support/lyxstring.h (clear): missing method. equivalent of
8473 * all files that contained "stderr": rewrote constructs that used
8474 stderr to use lyxerr instead. (except bmtable)
8476 * src/support/DebugStream.h (level): and the passed t with
8477 Debug::ANY to avoid spurious bits set.
8479 * src/debug.h (Debug::type value): made it accept strings of the
8482 * configure.in (Check for programs): Added a check for kpsewhich,
8483 the latex generation will use this later to better the dicovery of
8486 * src/BufferView.C (create_view): we don't need to cast this to
8487 (void*) that is done automatically.
8488 (WorkAreaButtonPress): removed some dead code.
8490 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8492 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8493 is not overwritten when translated (David Sua'rez de Lis).
8495 * lib/CREDITS: Added David Sua'rez de Lis
8497 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8499 * src/bufferparams.C (BufferParams): default input encoding is now
8502 * acinclude.m4 (cross_compiling): comment out macro
8503 LYX_GXX_STRENGTH_REDUCE.
8505 * acconfig.h: make sure that const is not defined (to empty) when
8506 we are compiling C++. Remove commented out code using SIZEOF_xx
8509 * configure.in : move the test for const and inline as late as
8510 possible so that these C tests do not interefere with C++ ones.
8511 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8512 has not been proven.
8514 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8516 * src/table.C (getDocBookAlign): remove bad default value for
8519 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8521 (ShowFileMenu2): ditto.
8523 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8526 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8528 * Most files: finished the change from the old error code to use
8529 DebugStream for all lyxerr debugging. Only minor changes remain
8530 (e.g. the setting of debug levels using strings instead of number)
8532 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8534 * src/layout.C (Add): Changed to use compare_no_case instead of
8537 * src/FontInfo.C: changed loop variable type too string::size_type.
8539 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8541 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8542 set ETAGS_ARGS to --c++
8544 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8546 * src/table.C (DocBookEndOfCell): commented out two unused variables
8548 * src/paragraph.C: commented out four unused variables.
8550 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8551 insed a if clause with type string::size_type.
8553 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8556 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8558 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8559 variable, also changed loop to go from 0 to lenght + 1, instead of
8560 -1 to length. This should be correct.
8562 * src/LaTeX.C (scanError): use string::size_type as loop variable
8565 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8566 (l.896) since y_tmp and row was not used anyway.
8568 * src/insets/insetref.C (escape): use string::size_type as loop
8571 * src/insets/insetquotes.C (Width): use string::size_type as loop
8573 (Draw): use string::size_type as loop variable type.
8575 * src/insets/insetlatexaccent.C (checkContents): use
8576 string::size_type as loop variable type.
8578 * src/insets/insetlabel.C (escape): use string::size_type as loop
8581 * src/insets/insetinfo.C: added an extern for current_view.
8583 * src/insets/insetcommand.C (scanCommand): use string::size_type
8584 as loop variable type.
8586 * most files: removed the RCS tags. With them we had to recompile
8587 a lot of files after a simple cvs commit. Also we have never used
8588 them for anything meaningful.
8590 * most files: tags-query-replace NULL 0. As adviced several plases
8591 we now use "0" instead of "NULL" in our code.
8593 * src/support/filetools.C (SpaceLess): use string::size_type as
8596 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8598 * src/paragraph.C: fixed up some more string stuff.
8600 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8602 * src/support/filetools.h: make modestr a std::string.
8604 * src/filetools.C (GetEnv): made ch really const.
8606 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8607 made code that used these use max/min from <algorithm> instead.
8609 * changed several c library include files to their equivalent c++
8610 library include files. All is not changed yet.
8612 * created a support subdir in src, put lyxstring and lstrings
8613 there + the extra files atexit, fileblock, strerror. Created
8614 Makefile.am. edited configure.in and src/Makefile.am to use this
8615 new subdir. More files moved to support.
8617 * imported som of the functions from repository lyx, filetools
8619 * ran tags-query-replace on LString -> string, corrected the bogus
8620 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8621 is still some errors in there. This is errors where too much or
8622 too litle get deleted from strings (string::erase, string::substr,
8623 string::replace), there can also be some off by one errors, or
8624 just plain wrong use of functions from lstrings. Viewing of quotes
8627 * LyX is now running fairly well with string, but there are
8628 certainly some bugs yet (see above) also string is quite different
8629 from LString among others in that it does not allow null pointers
8630 passed in and will abort if it gets any.
8632 * Added the revtex4 files I forgot when setting up the repository.
8634 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8636 * All over: Tried to clean everything up so that only the files
8637 that we really need are included in the cvs repository.
8638 * Switched to use automake.
8639 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8640 * Install has not been checked.
8642 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8644 * po/pt.po: Three errors:
8645 l.533 and l.538 format specification error
8646 l. 402 duplicate entry, I just deleted it.