1 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
6 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8 * src/Timeout.h: remove Qt::emit hack.
10 * several files: changes to allo doc++ compilation
12 * src/lyxfunc.C (processKeySym): new method
13 (processKeyEvent): comment out if FL_REVISION < 89
15 * src/WorkArea.C: change some debugging levels.
16 (WorkArea): set wantkey to FL_KEY_ALL
17 (work_area_handler): enable the FL_KEYBOARD clause, this enables
18 clearer code and the use of compose with XForms 0.89. Change to
19 use signals instead of calling methods in bufferview directly.
21 * src/Painter.C: change some debugging levels.
23 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
26 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
27 (workAreaKeyPress): new method
29 2000-08-14 Juergen Vigna <jug@sad.it>
31 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
33 * config/kde.m4: addes some features
35 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
36 include missing xforms dialogs.
38 * src/Timeout.h: a hack to be able to compile with qt/kde.
40 * sigc++/.cvsignore: added acinclude.m4
42 * lib/.cvsignore: added listerros
44 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
45 xforms tree as objects are needed for other frontends.
47 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
48 linking with not yet implemented xforms objects.
50 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
52 2000-08-14 Baruch Even <baruch.even@writeme.com>
54 * src/frontends/xforms/FormGraphics.h:
55 * src/frontends/xforms/FormGraphics.C:
56 * src/frontends/xforms/RadioButtonGroup.h:
57 * src/frontends/xforms/RadioButtonGroup.C:
58 * src/insets/insetgraphics.h:
59 * src/insets/insetgraphics.C:
60 * src/insets/insetgraphicsParams.h:
61 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
62 instead of spaces, and various other indentation issues to make the
63 sources more consistent.
65 2000-08-14 Marko Vendelin <markov@ioc.ee>
67 * src/frontends/gnome/dialogs/diaprint.glade
68 * src/frontends/gnome/FormPrint.C
69 * src/frontends/gnome/FormPrint.h
70 * src/frontends/gnome/diaprint_callbacks.c
71 * src/frontends/gnome/diaprint_callbacks.h
72 * src/frontends/gnome/diaprint_interface.c
73 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
76 * src/frontends/gnome/dialogs/diainserturl.glade
77 * src/frontends/gnome/FormUrl.C
78 * src/frontends/gnome/FormUrl.h
79 * src/frontends/gnome/diainserturl_callbacks.c
80 * src/frontends/gnome/diainserturl_callbacks.h
81 * src/frontends/gnome/diainserturl_interface.c
82 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
85 * src/frontends/gnome/Dialogs.C
86 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
87 all other dialogs. Copy all unimplemented dialogs from Xforms
90 * src/frontends/gnome/support.c
91 * src/frontends/gnome/support.h: support files generated by Glade
95 * config/gnome.m4: Gnome configuration scripts
97 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
98 configure --help message
100 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
101 only if there are no events pendling in Gnome/Gtk. This enhances
102 the performance of menus.
105 2000-08-14 Allan Rae <rae@lyx.org>
107 * lib/Makefile.am: listerrors cleaning
109 * lib/listerrors: removed -- generated file
110 * acinclude.m4: ditto
111 * sigc++/acinclude.m4: ditto
113 * src/frontends/xforms/forms/form_citation.fd:
114 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
117 * src/frontends/xforms/forms/makefile: I renamed the `install` target
118 `updatesrc` and now we have a `test` target that does what `updatesrc`
119 used to do. I didn't like having an install target that wasn't related
122 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
123 on all except FormGraphics. This may yet happen. Followed by a major
124 cleanup including using FL_TRANSIENT for most of the dialogs. More
125 changes to come when the ButtonController below is introduced.
127 * src/frontends/xforms/ButtonController.h: New file for managing up to
128 four buttons on a dialog according to an externally defined policy.
129 * src/frontends/xforms/Makefile.am: added above
131 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
132 Apply and Cancel/Close buttons and everything in between and beyond.
133 * src/frontends/Makefile.am: added above.
135 * src/frontends/xforms/forms/form_preferences.fd:
136 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
137 and removed variable 'status' as a result. Fixed the set_minsize thing.
138 Use the new screen-font-update after checking screen fonts were changed
139 Added a "Restore" button to restore the original lyxrc values while
140 editing. This restores everything not just the last input changed.
141 That's still a tricky one. As is the "LyX: this shouldn't happen..."
143 * src/LyXAction.C: screen-font-update added for updating buffers after
144 screen font settings have been changed.
145 * src/commandtags.h: ditto
146 * src/lyxfunc.C: ditto
148 * forms/lyx.fd: removed screen fonts dialog.
149 * src/lyx_gui.C: ditto
150 * src/menus.[Ch]: ditto
151 * src/lyx.[Ch]: ditto
152 * src/lyx_cb.C: ditto + code from here moved to make
153 screen-font-update. And people wonder why progress on GUII is
154 slow. Look at how scattered this stuff was! It takes forever
157 * forms/fdfix.sh: Fixup the spacing after commas.
158 * forms/makefile: Remove date from generated files. Fewer clashes now.
159 * forms/bullet_forms.C.patch: included someones handwritten changes
161 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
162 once I've discovered why LyXRC was made noncopyable.
163 * src/lyx_main.C: ditto
165 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
167 * src/frontends/xforms/forms/fdfix.sh:
168 * src/frontends/xforms/forms/fdfixh.sed:
169 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
170 * src/frontends/xforms/Form*.[hC]:
171 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
172 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
173 provide a destructor for the struct FD_form_xxxx. Another version of
174 the set_[max|min]size workaround and a few other cleanups. Actually,
175 Angus' patch from 20000809.
177 2000-08-13 Baruch Even <baruch.even@writeme.com>
179 * src/insets/insetgraphics.C (Clone): Added several fields that needed
182 2000-08-11 Juergen Vigna <jug@sad.it>
184 * src/insets/insetgraphics.C (InsetGraphics): changing init
185 order because of warnings.
187 * src/frontends/xforms/forms/makefile: adding patching .C with
190 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
191 from .C.patch to .c.patch
193 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
194 order because of warning.
196 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
198 * src/frontends/Liason.C (setMinibuffer): new helper function
200 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
202 * src/lyxfunc.C (Dispatch): calling new Document-Layout
204 * lib/ui/default.ui: commented out PaperLayout entry
206 * src/frontends/xforms/form_document.[Ch]: new added files
208 * src/frontends/xforms/FormDocument.[Ch]: ditto
210 * src/frontends/xforms/forms/form_document.fd: ditto
212 * src/frontends/xforms/forms/form_document.C.patch: ditto
214 2000-08-10 Juergen Vigna <jug@sad.it>
216 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
217 (InsetGraphics): initialized cacheHandle to 0.
218 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
220 2000-08-10 Baruch Even <baruch.even@writeme.com>
222 * src/graphics/GraphicsCache.h:
223 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
224 correctly as a cache.
226 * src/graphics/GraphicsCacheItem.h:
227 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
230 * src/graphics/GraphicsCacheItem_pimpl.h:
231 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
234 * src/insets/insetgraphics.h:
235 * src/insets/insetgraphics.C: Changed from using a signal notification
236 to polling when image is not loaded.
238 2000-08-10 Allan Rae <rae@lyx.org>
240 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
241 that there are two functions that have to been taken out of line by
242 hand and aren't taken care of in the script. (Just a reminder note)
244 * sigc++/macros/*.h.m4: Updated as above.
246 2000-08-09 Juergen Vigna <jug@sad.it>
248 * src/insets/insettext.C (draw): small fix for clearing rectangle.
250 * src/insets/insettabular.C: make drawing of single cell smarter.
252 2000-08-09 Marko Vendelin <markov@ioc.ee>
253 * src/frontends/gnome/Menubar_pimpl.C
254 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
255 implementation: new files
257 * src/frontends/gnome/mainapp.C
258 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
261 * src/main.C: create Gnome main window
263 * src/frontends/xforms/Menubar_pimpl.h
264 * src/frontends/Menubar.C
265 * src/frontends/Menubar.h: added method Menubar::update that calls
266 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
268 * src/LyXView.C: calls Menubar::update to update the state
271 * src/frontends/gnome/Makefile.am: added new files
273 * src/frontends/Makefile.am: added frontend compiler options
275 2000-08-08 Juergen Vigna <jug@sad.it>
277 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
279 * src/bufferlist.C (close):
280 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
281 documents if exiting without saving.
283 * src/buffer.C (save): use removeAutosaveFile()
285 * src/support/filetools.C (removeAutosaveFile): new function.
287 * src/lyx_cb.C (MenuWrite): returns a bool now.
288 (MenuWriteAs): check if file could really be saved and revert to the
290 (MenuWriteAs): removing old autosavefile if existant.
292 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
293 before Goto toggle declaration, because of compiler warning.
295 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
297 * src/lyxfunc.C (MenuNew): small fix.
299 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
301 * src/bufferlist.C (newFile):
302 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
304 * src/lyxrc.C: added new_ask_filename tag
306 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
308 * src/lyx.fd: removed code pertaining to form_ref
309 * src/lyx.[Ch]: ditto
310 * src/lyx_cb.C: ditto
311 * src/lyx_gui.C: ditto
312 * src/lyx_gui_misc.C: ditto
314 * src/BufferView_pimpl.C (restorePosition): update buffer only
317 * src/commandtags.h (LFUN_REFTOGGLE): removed
318 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
319 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
320 (LFUN_REFBACK): renamed LFUN_REF_BACK
322 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
324 * src/lyxfunc.C (Dispatch): ditto.
325 InsertRef dialog is now GUI-independent.
327 * src/texrow.C: added using std::endl;
329 * src/insets/insetref.[Ch]: strip out large amounts of code.
330 The inset is now a container and this functionality is now
331 managed by a new FormRef dialog
333 * src/frontends/Dialogs.h (showRef, createRef): new signals
335 * src/frontends/xforms/FormIndex.[Ch],
336 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
337 when setting dialog's min/max size
338 * src/frontends/xforms/FormIndex.[Ch]: ditto
340 * src/frontends/xforms/FormRef.[Ch],
341 src/frontends/xforms/forms/form_ref.fd: new xforms
342 implementation of an InsetRef dialog
344 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
347 * src/graphics/XPM_Renderer.C (isImageFormatOK):
348 ios::nocreate is not part of the standard. Removed.
350 2000-08-07 Baruch Even <baruch.even@writeme.com>
352 * src/graphics/Renderer.h:
353 * src/graphics/Renderer.C: Added base class for rendering of different
354 image formats into Pixmaps.
356 * src/graphics/XPM_Renderer.h:
357 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
358 in a different class.
360 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
361 easily add support for other formats.
363 * src/insets/figinset.C: plugged a leak of an X resource.
365 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
367 * src/CutAndPaste.[Ch]: make all metods static.
369 * development/Code_rules/Rules: more work, added section on
370 Exceptions, and a References section.
372 * a lot of header files: work to make doc++ able to generate the
373 source documentation, some workarounds of doc++ problems. Doc++ is
374 now able to generate the documentation.
376 2000-08-07 Juergen Vigna <jug@sad.it>
378 * src/insets/insettabular.C (recomputeTextInsets): removed function
380 * src/tabular.C (SetWidthOfMulticolCell):
382 (calculate_width_of_column_NMC): fixed return value so that it really
383 only returns true if the column-width has changed (there where
384 problems with muliticolumn-cells in this column).
386 2000-08-04 Juergen Vigna <jug@sad.it>
388 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
389 also on the scrollstatus of the inset.
390 (workAreaMotionNotify): ditto.
392 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
394 2000-08-01 Juergen Vigna <jug@sad.it>
396 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
399 * src/LyXAction.C (init):
400 * src/insets/inset.C (LocalDispatch): added support for
403 * src/insets/inset.C (scroll): new functions.
405 * src/insets/insettext.C (removeNewlines): new function.
406 (SetAutoBreakRows): removes forced newlines in the text of the
407 paragraph if autoBreakRows is set to false.
409 * src/tabular.C (Latex): generates a parbox around the cell contents
412 * src/frontends/xforms/FormTabular.C (local_update): removed
413 the radio_useparbox button.
415 * src/tabular.C (UseParbox): new function
417 2000-08-06 Baruch Even <baruch.even@writeme.com>
419 * src/graphics/GraphicsCache.h:
420 * src/graphics/GraphicsCache.C:
421 * src/graphics/GraphicsCacheItem.h:
422 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
425 * src/insets/insetgraphics.h:
426 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
427 drawing of the inline image.
429 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
430 into the wrong position.
432 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
435 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
437 * src/support/translator.h: move all typedefs to public section
439 * src/support/filetools.C (MakeLatexName): return string const
442 (FileOpenSearch): ditto
444 (LibFileSearch): ditto
445 (i18nLibFileSearch): ditto
448 (CreateTmpDir): ditto
449 (CreateBufferTmpDir): ditto
450 (CreateLyXTmpDir): ditto
455 (OnlyFilename): ditto
457 (NormalizePath): ditto
459 (GetFileContents): ditto
460 (ReplaceEnvironmentPath): ditto
463 (ChangeExtension): ditto
464 (MakeDisplayPath): ditto
465 (do_popen): return cmdret const
466 (findtexfile): return string const
468 * src/support/DebugStream.h: add some /// to please doc++
470 * src/frontends/DialogBase.h (endif): add some /// to please doc++
472 * src/texrow.C (same_rownumber): functor to use with find_if
473 (getIdFromRow): rewritten to use find_if and to not update the
474 positions. return true if row is found
475 (increasePos): new method, use to update positions
477 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
479 * src/lyxlex_pimpl.C (verifyTable): new method
482 (GetString): return string const
483 (pushTable): rewrite to use std::stack
485 (setFile): better check
488 * src/lyxlex.h: make LyXLex noncopyable
490 * src/lyxlex.C (text): return char const * const
491 (GetString): return string const
492 (getLongString): return string const
494 * src/lyx_gui_misc.C (askForText): return pair<...> const
496 * src/lastfiles.[Ch] (operator): return string const
498 * src/buffer.C (parseSingleLyXformat2Token): pass string to
499 istringstream not char const *.
500 move token.end() out of loop.
501 (readFile): move initializaton of token
503 * src/BufferView2.C (insertErrors): run texrow.increasePos if
504 getIdFromRow is successful.
506 * lib/bind/emacs.bind: don't include menus bind
508 * development/Code_rules/Rules: the beginnings of making this
509 better and covering more of the unwritten rules that we have.
511 * development/Code_rules/Recommendations: a couple of wording
514 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
516 * src/support/strerror.c: remove C++ comment.
518 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
520 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
521 LFUN_INDEX_INSERT_LAST
523 * src/texrow.C (getIdFromRow): changed from const_iterator to
524 iterator, allowing code to compile with DEC cxx
526 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
527 stores part of the class, as suggested by Allan. Will allow
529 (apply): test to apply uses InsetCommandParams operator!=
531 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
532 (apply): test to apply uses InsetCommandParams operator!=
534 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
535 stores part of the class.
536 (update): removed limits on min/max size.
538 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
539 (apply): test to apply uses InsetCommandParams operator!=
541 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
542 (Read, Write, scanCommand, getCommand): moved functionality
543 into InsetCommandParams.
545 (getScreenLabel): made pure virtual
546 new InsetCommandParams operators== and !=
548 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
549 c-tors based on InsetCommandParams. Removed others.
550 * src/insets/insetinclude.[Ch]: ditto
551 * src/insets/insetlabel.[Ch]: ditto
552 * src/insets/insetparent.[Ch]: ditto
553 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
555 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
556 insets derived from InsetCommand created using similar c-tors
557 based on InsetCommandParams
558 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
559 * src/menus.C (ShowRefsMenu): ditto
560 * src/paragraph.C (Clone): ditto
561 * src/text2.C (SetCounter): ditto
562 * src/lyxfunc.C (Dispatch) ditto
563 Also recreated old InsetIndex behaviour exactly. Can now
564 index-insert at the start of a paragraph and index-insert-last
565 without launching the pop-up.
567 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
569 * lib/lyxrc.example: mark te pdf options as non functional.
571 * src/support/lstrings.C (strToInt): move initalization of tmpstr
572 (isStrDbl): move tmpstr.end() out of loop.
573 (strToDbl): move intialization of tmpstr
574 (lowercase): return string const and move tmp.end() out of loop.
575 (uppercase): return string const and move tmp.edn() out of loop.
576 (prefixIs): add assertion
581 (containsOnly): ditto
582 (containsOnly): ditto
583 (containsOnly): ditto
584 (countChar): make last arg char not char const
585 (token): return string const
586 (subst): return string const, move tmp.end() out of loop.
587 (subst): return string const, add assertion
588 (strip): return string const
589 (frontStrip): return string const, add assertion
590 (frontStrip): return string const
595 * src/support/lstrings.C: add inclde "LAssert.h"
596 (isStrInt): move tmpstr.end() out of loop.
598 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
599 toollist.end() out of loop.
600 (deactivate): move toollist.end() out of loop.
601 (update): move toollist.end() out of loop.
602 (updateLayoutList): move tc.end() out of loop.
603 (add): move toollist.end() out of loop.
605 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
606 md.end() out of loop.
608 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
610 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
613 * src/paragraph.C (Erase): move fontlist.end() out of loop.
614 (Erase): move insetlist.end() out of loop.
616 * src/lyx_sendfax_main.C: make show_logfile static and to take a
617 ref to const string as first arg. Move initialization of some
618 variables, whitespace changes.
620 * src/kbmap.C (defkey): move table.end() out of loop.
621 (kb_keymap): move table.end() out of loop.
622 (findbinding): move table.end() out of loop.
624 * src/MenuBackend.C (hasMenu): move end() out of loop.
625 (getMenu): move end() out of loop.
626 (getMenu): move menulist_.end() out of loop.
628 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
630 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
633 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
634 (getFromLyXName): move infotab.end() out of loop.
636 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
637 -fvtable-thunks -ffunction-sections -fdata-sections
639 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
641 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
644 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
646 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
648 * src/frontends/xforms/FormCitation.[Ch],
649 src/frontends/xforms/FormIndex.[Ch],
650 src/frontends/xforms/FormToc.[Ch],
651 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
653 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
655 * src/commandtags.h: renamed, created some flags for citation
658 * src/lyx_gui_misc.C: stripped out old FD_index_form code
660 * src/lyxfunc.C (dispatch): use signals to insert index entry
662 * src/frontends/Dialogs.h: new signal createIndex
664 * src/frontends/xforms/FormCommand.[Ch],
665 src/frontends/xforms/FormCitation.[Ch],
666 src/frontends/xforms/FormToc.[Ch],
667 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
669 * src/insets/insetindex.[Ch]: GUI-independent
671 * src/frontends/xforms/FormIndex.[Ch],
672 * src/frontends/xforms/forms/form_index.fd: xforms implementation
675 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
677 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
678 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
680 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
682 * src/insets/insetref.C (Latex): rewrite so that there is now
683 question that a initialization is requested.
685 * src/insets/insetcommand.h: reenable the hide signal
687 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
689 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
690 fix handling of shortcuts (many bugs :)
691 (add_lastfiles): ditto.
693 * lib/ui/default.ui: fix a few shortcuts.
695 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
697 * Makefile.am: Fix ``rpmdist'' target to return the exit
698 status of the ``rpm'' command, instead of the last command in
699 the chain (the ``rm lyx.xpm'' command, which always returns
702 2000-08-02 Allan Rae <rae@lyx.org>
704 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
705 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
706 * src/frontends/xforms/FormToc.C (FormToc): ditto
708 * src/frontends/xforms/Makefile.am: A few forgotten files
710 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
711 Signals-not-copyable-problem Lars' started commenting out.
713 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
715 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
717 * src/insets/insetcommand.h: Signals is not copyable so anoter
718 scheme for automatic hiding of forms must be used.
720 * src/frontends/xforms/FormCitation.h: don't inerit from
721 noncopyable, FormCommand already does that.
722 * src/frontends/xforms/FormToc.h: ditto
723 * src/frontends/xforms/FormUrl.h: ditto
725 * src/frontends/xforms/FormCitation.C: add include <algorithm>
727 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
729 * src/insets/insetcommand.h (hide): new SigC::Signal0
730 (d-tor) new virtual destructor emits hide signal
732 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
733 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
735 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
736 LOF and LOT. Inset is now GUI-independent
738 * src/insets/insetloa.[Ch]: redundant
739 * src/insets/insetlof.[Ch]: ditto
740 * src/insets/insetlot.[Ch]: ditto
742 * src/frontends/xforms/forms/form_url.fd: tweaked!
743 * src/frontends/xforms/forms/form_citation.fd: ditto
745 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
746 dialogs dealing with InsetCommand insets
748 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
749 FormCommand base class
750 * src/frontends/xforms/FormUrl.[Ch]: ditto
752 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
754 * src/frontends/xforms/FormToc.[Ch]: ditto
756 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
757 passed a generic InsetCommand pointer
758 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
760 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
761 and modified InsetTOC class
762 * src/buffer.C: ditto
764 * forms/lyx.fd: strip out old FD_form_toc code
765 * src/lyx_gui_misc.C: ditto
766 * src/lyx_gui.C: ditto
767 * src/lyx_cb.C: ditto
768 * src/lyx.[Ch]: ditto
770 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
772 * src/support/utility.hpp: tr -d '\r'
774 2000-08-01 Juergen Vigna <jug@sad.it>
776 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
779 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
780 LFUN_TABULAR_FEATURES.
782 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
785 * src/insets/insettabular.C (getStatus): implemented helper function.
787 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
789 2000-07-31 Juergen Vigna <jug@sad.it>
791 * src/text.C (draw): fixed screen update problem for text-insets.
793 * src/text2.C (SetParagrpah): call an update of the inset-owner when
794 something changed probably this has to be added in various other
797 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
799 2000-07-31 Baruch Even <baruch.even@writeme.com>
801 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
802 templates to satisfy compaq cxx.
805 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
807 * src/support/translator.h (equal_1st_in_pair::operator()): take
808 const ref pair_type as arg.
809 (equal_2nd_in_pair::operator()): ditto
810 (Translator::~Translator): remove empty d-tor.
812 * src/graphics/GraphicsCache.C: move include config.h to top, also
813 put initialization of GraphicsCache::singleton here.
814 (~GraphicsCache): move here
815 (addFile): take const ref as arg
818 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
820 * src/BufferView2.C (insertLyXFile): change te with/without header
823 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
825 * src/frontends/xforms/FormGraphics.C (apply): add some
826 static_cast. Not very nice, but required by compaq cxx.
828 * src/frontends/xforms/RadioButtonGroup.h: include header
829 <utility> instead of <pair.h>
831 * src/insets/insetgraphicsParams.C: add using directive.
832 (readResize): change return type to void.
835 * src/lyxfunc.C (getStatus): add missing break for build-program
836 function; add test for Literate for export functions.
838 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
839 entries in Options menu.
841 2000-07-31 Baruch Even <baruch.even@writeme.com>
843 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
844 protect against auto-allocation; release icon when needed.
846 2000-07-31 Matej Cepl <CeplM@seznam.cz>
848 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
851 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
852 earlier czech.kmap), useful only for programming.
854 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
856 * src/frontends/xforms/FormCitation.h: fix conditioning around
859 2000-07-31 Juergen Vigna <jug@sad.it>
861 * src/frontends/xforms/FormTabular.C (local_update): changed
862 radio_linebreaks to radio_useparbox and added radio_useminipage.
864 * src/tabular.C: made support for using minipages/parboxes.
866 * src/bufferlist.C (QwriteAll): small fix for asking for save.
868 * src/insets/insetgraphics.C (draw): just draw the inset so that the
870 (descent): so the cursor is in the middle.
871 (width): bit smaller box.
873 * src/insets/insetgraphics.h: added display() function.
875 2000-07-31 Baruch Even <baruch.even@writeme.com>
877 * src/frontends/Dialogs.h: Added showGraphics signals.
879 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
880 xforms form definition of the graphics dialog.
882 * src/frontends/xforms/FormGraphics.h:
883 * src/frontends/xforms/FormGraphics.C: Added files, the
884 GUIndependent code of InsetGraphics
886 * src/insets/insetgraphics.h:
887 * src/insets/insetgraphics.C: Major writing to make it work.
889 * src/insets/insetgraphicsParams.h:
890 * src/insets/insetgraphicsParams.C: Added files, parameter passing
891 struct between InsetGraphics and GUI.
893 * src/LaTeXFeatures.h:
894 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
895 support for graphicx package.
897 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
898 for the graphics inset.
900 * src/support/translator.h: Added file, used in
901 InsetGraphicsParams. this is a template to translate between two
904 * src/frontends/xforms/RadioButtonGroup.h:
905 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
906 way to easily control a radio button group.
908 2000-07-28 Juergen Vigna <jug@sad.it>
910 * src/insets/insettabular.C (LocalDispatch):
911 (TabularFeatures): added support for lyx-functions of tabular features.
912 (cellstart): refixed this function after someone wrongly changed it.
915 * src/LyXAction.C (init): added support for tabular-features
917 2000-07-28 Allan Rae <rae@lyx.org>
919 * src/frontends/xforms/FormPreferences.C (build): Setup input return
920 checking. NOTE: It seems that pressing ESC to cancel the dialog also
921 triggers the callback for input checking. As a result we sometimes get
922 "LyX: This shouldn't happen..." printed to cerr.
923 (input): Started using status variable since I only free() on
924 destruction. Some input checking for paths and font sizes.
926 * src/frontends/xforms/FormPreferences.h: Use status to control
927 activation of Ok and Apply
929 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
930 callback. Also resized to stop segfaults with 0.88. The problem is
931 that xforms-0.88 requires the folder to be wide enough to fit all the
932 tabs. If it isn't it causes all sorts of problems.
934 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
936 * src/frontends/xforms/forms/README: Reflect reality.
938 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
939 * src/frontends/xforms/forms/makefile: ditto.
941 * src/commandtags.h: Get access to new Preferences dialog
942 * src/LyXAction.C: ditto
943 * src/lyxfunc.C: ditto
944 * lib/ui/default.ui: ditto
946 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
948 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
950 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
953 * src/frontends/xforms/form_url.[Ch]: added.
955 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
957 * src/insets/insetbib.h: fixed bug in previous commit
959 * src/frontends/xforms/FormUrl.h: ditto
961 * src/frontends/xforms/FormPrint.h: ditto
963 * src/frontends/xforms/FormPreferences.h: ditto
965 * src/frontends/xforms/FormCopyright.h: ditto
967 * src/frontends/xforms/FormCitation.C: ditto
969 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
970 private copyconstructor and private default contructor
972 * src/support/Makefile.am: add utility.hpp
974 * src/support/utility.hpp: new file from boost
976 * src/insets/insetbib.h: set owner in clone
978 * src/frontends/xforms/FormCitation.C: added missing include
981 * src/insets/form_url.[Ch]: removed
983 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
985 * development/lyx.spec.in
986 * Makefile.am: Fix buglet for LyX RPM generation resulting from
987 file/directory re-organization.
989 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
991 * src/insets/insetcommand.[Ch]: moved the string data and
992 associated manipulation methods into a new stand-alone class
993 InsetCommandParams. This class has two additional methods
994 getAsString() and setFromString() allowing the contents to be
995 moved around as a single string.
996 (addContents) method removed.
997 (setContents) method no longer virtual.
999 * src/buffer.C (readInset): made use of new InsetCitation,
1000 InsetUrl constructors based on InsetCommandParams.
1002 * src/commandtags.h: add LFUN_INSERT_URL
1004 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1005 independent InsetUrl and use InsetCommandParams to extract
1006 string info and create new Insets.
1008 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1010 * src/frontends/xforms/FormCitation.C (apply): uses
1013 * src/frontends/xforms/form_url.C
1014 * src/frontends/xforms/form_url.h
1015 * src/frontends/xforms/FormUrl.h
1016 * src/frontends/xforms/FormUrl.C
1017 * src/frontends/xforms/forms/form_url.fd: new files
1019 * src/insets/insetcite.[Ch]: removed unused constructors.
1021 * src/insets/insetinclude.[Ch]: no longer store filename
1023 * src/insets/inseturl.[Ch]: GUI-independent.
1025 2000-07-26 Juergen Vigna <jug@sad.it>
1026 * renamed frontend from gtk to gnome as it is that what is realized
1027 and did the necessary changes in the files.
1029 2000-07-26 Marko Vendelin <markov@ioc.ee>
1031 * configure.in: cleaning up gnome configuration scripts
1033 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1035 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1036 shortcuts syndrom by redrawing them explicitely (a better solution
1037 would be appreciated).
1039 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1041 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1044 * src/lyx_cb.C (MenuExport): change html export to do the right
1045 thing depending of the document type (instead of having
1046 html-linuxdoc and html-docbook).
1047 * src/lyxfunc.C (getStatus): update for html
1048 * lib/ui/default.ui: simplify due to the above change.
1049 * src/menus.C (ShowFileMenu): update too (in case we need it).
1051 * src/MenuBackend.C (read): if a menu is defined twice, add the
1052 new entries to the exiting one.
1054 2000-07-26 Juergen Vigna <jug@sad.it>
1056 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1058 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1059 and return a bool if it did actual save the file.
1060 (AutoSave): don't autosave a unnamed doc.
1062 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1063 check if this is an UNNAMED new file and react to it.
1064 (newFile): set buffer to unnamed and change to not mark a new
1065 buffer dirty if I didn't do anything with it.
1067 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1069 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1071 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1072 friend as per Angus's patch posted to lyx-devel.
1074 * src/ext_l10n.h: updated
1076 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1077 gettext on the style string right before inserting them into the
1080 * autogen.sh: add code to extract style strings form layout files,
1081 not good enough yet.
1083 * src/frontends/gtk/.cvsignore: add MAKEFILE
1085 * src/MenuBackend.C (read): run the label strings through gettext
1086 before storing them in the containers.
1088 * src/ext_l10n.h: new file
1090 * autogen.sh : generate the ext_l10n.h file here
1092 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1094 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1097 * lib/ui/default.ui: fix a couple of typos.
1099 * config/gnome/gtk.m4: added (and added to the list of files in
1102 * src/insets/insetinclude.C (unique_id): fix when we are using
1103 lyxstring instead of basic_string<>.
1104 * src/insets/insettext.C (LocalDispatch): ditto.
1105 * src/support/filetools.C: ditto.
1107 * lib/configure.m4: create the ui/ directory if necessary.
1109 * src/LyXView.[Ch] (updateToolbar): new method.
1111 * src/BufferView_pimpl.C (buffer): update the toolbar when
1112 opening/closing buffer.
1114 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1116 * src/LyXAction.C (getActionName): enhance to return also the name
1117 and options of pseudo-actions.
1118 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1120 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1121 as an example of what is possible). Used in File->Build too (more
1122 useful) and in the import/export menus (to mimick the complicated
1123 handling of linuxdoc and friends). Try to update all the entries.
1125 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1128 * src/MenuBackend.C (read): Parse the new OptItem tag.
1130 * src/MenuBackend.h: Add a new optional_ data member (used if the
1131 entry should be omitted when the lyxfunc is disabled).
1133 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1134 function, used as a shortcut.
1135 (create_submenu): align correctly the shortcuts on the widest
1138 * src/MenuBackend.h: MenuItem.label() only returns the label of
1139 the menu without shortcut; new method shortcut().
1141 2000-07-14 Marko Vendelin <markov@ioc.ee>
1143 * src/frontends/gtk/Dialogs.C:
1144 * src/frontends/gtk/FormCopyright.C:
1145 * src/frontends/gtk/FormCopyright.h:
1146 * src/frontends/gtk/Makefile.am: added these source-files for the
1147 Gtk/Gnome support of the Copyright-Dialog.
1149 * src/main.C: added Gnome::Main initialization if using
1150 Gtk/Gnome frontend-GUI.
1152 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1154 * config/gnome/aclocal-include.m4
1155 * config/gnome/compiler-flags.m4
1156 * config/gnome/curses.m4
1157 * config/gnome/gnome--.m4
1158 * config/gnome/gnome-bonobo-check.m4
1159 * config/gnome/gnome-common.m4
1160 * config/gnome/gnome-fileutils.m4
1161 * config/gnome/gnome-ghttp-check.m4
1162 * config/gnome/gnome-gnorba-check.m4
1163 * config/gnome/gnome-guile-checks.m4
1164 * config/gnome/gnome-libgtop-check.m4
1165 * config/gnome/gnome-objc-checks.m4
1166 * config/gnome/gnome-orbit-check.m4
1167 * config/gnome/gnome-print-check.m4
1168 * config/gnome/gnome-pthread-check.m4
1169 * config/gnome/gnome-support.m4
1170 * config/gnome/gnome-undelfs.m4
1171 * config/gnome/gnome-vfs.m4
1172 * config/gnome/gnome-x-checks.m4
1173 * config/gnome/gnome-xml-check.m4
1174 * config/gnome/gnome.m4
1175 * config/gnome/gperf-check.m4
1176 * config/gnome/gtk--.m4
1177 * config/gnome/linger.m4
1178 * config/gnome/need-declaration.m4: added configuration scripts
1179 for Gtk/Gnome frontend-GUI
1181 * configure.in: added support for the --with-frontend=gtk option
1183 * autogen.sh: added config/gnome/* to list of config-files
1185 * acconfig.h: added define for GTKGUI-support
1187 * config/lyxinclude.m4: added --with-frontend[=value] option value
1188 for Gtk/Gnome frontend-GUI support.
1190 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1192 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1196 * src/paragraph.C (GetChar): remove non-const version
1198 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1199 (search_kw): use it.
1201 * src/lyx_main.C (init): if "preferences" exist, read that instead
1203 (ReadRcFile): return bool if the file could be read ok.
1204 (ReadUIFile): add a check to see if lex file is set ok.
1206 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1207 bastring can be used instead of lyxstring (still uses the old code
1208 if std::string is good enough or if lyxstring is used.)
1210 * src/encoding.C: make the arrays static, move ininle functions
1212 * src/encoding.h: from here.
1214 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1215 (parseSingleLyXformat2Token): move inset parsing to separate method
1216 (readInset): new private method
1218 * src/Variables.h: remove virtual from get().
1220 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1221 access to NEW_INSETS and NEW_TABULAR
1223 * src/MenuBackend.h: remove superfluous forward declaration of
1224 MenuItem. Add documentations tags "///", remove empty MenuItem
1225 destructor, remove private default contructor.
1227 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1229 (read): more string mlabel and mname to where they are used
1230 (read): remove unused variables mlabel and mname
1231 (defaults): unconditional clear, make menusetup take advantage of
1232 add returning Menu &.
1234 * src/LyXView.h: define NEW_MENUBAR as default
1236 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1237 to NEW_INSETS and NEW_TABULAR.
1238 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1239 defined. Change some of the "xxxx-inset-insert" functions names to
1242 * several files: more enahncements to NEW_INSETS and the resulting
1245 * lib/lyxrc.example (\date_insert_format): move to misc section
1247 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1248 bastring and use AC_CACHE_CHECK.
1249 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1250 the system have the newest methods. uses AC_CACHE_CHECK
1251 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1252 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1253 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1255 * configure.in: add LYX_CXX_GOOD_STD_STRING
1257 * acinclude.m4: recreated
1259 2000-07-24 Amir Karger
1261 * README: add Hebrew, Arabic kmaps
1264 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1266 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1269 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1271 * Lot of files: add pragma interface/implementation.
1273 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1275 * lib/ui/default.ui: new file (ans new directory). Contains the
1276 default menu and toolbar.
1278 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1279 global space. Toolbars are now read (as menus) in ui files.
1281 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1283 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1284 is disabled because the document is read-only. We want to have the
1285 toggle state of the function anyway.
1286 (getStatus): add code for LFUN_VC* functions (mimicking what is
1287 done in old-style menus)
1289 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1290 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1292 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1293 * src/BufferView_pimpl.C: ditto.
1294 * src/lyxfunc.C: ditto.
1296 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1297 default). This replaces old-style menus by new ones.
1299 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1300 MenuItem. Contain the data structure of a menu.
1302 * src/insets/insettext.C: use LyXView::setLayout instead of
1303 accessing directly the toolbar combox.
1304 * src/lyxfunc.C (Dispatch): ditto.
1306 * src/LyXView.C (setLayout): new method, which just calls
1307 Toolbar::setLayout().
1308 (updateLayoutChoice): move part of this method in Toolbar.
1310 * src/toolbar.[Ch]: removed.
1312 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1313 implementation the toolbar.
1315 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1316 the toolbar. It might make sense to merge it with ToolbarDefaults
1318 (setLayout): new function.
1319 (updateLayoutList): ditto.
1320 (openLayoutList): ditto.
1322 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1323 xforms implementation of the toolbar.
1324 (get_toolbar_func): comment out, since I do not
1325 know what it is good for.
1327 * src/ToolbarDefaults.h: Add the ItemType enum.
1329 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1330 for a list of allocated C strings. Used in Menubar xforms
1331 implementation to avoid memory leaks.
1333 * src/support/lstrings.[Ch] (uppercase): new version taking and
1337 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1338 * lib/bind/emacs.bind: ditto.
1340 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1342 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1343 forward decl of LyXView.
1345 * src/toolbar.C (toolbarItem): moved from toolbar.h
1346 (toolbarItem::clean): ditto
1347 (toolbarItem::~toolbarItem): ditto
1348 (toolbarItem::operator): ditto
1350 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1352 * src/paragraph.h: control the NEW_TABULAR define from here
1354 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1355 USE_TABULAR_INSETS to NEW_TABULAR
1357 * src/ToolbarDefaults.C: add include "lyxlex.h"
1359 * files using the old table/tabular: use NEW_TABULAR to control
1360 compilation of old tabular stuff.
1362 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1365 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1366 planemet in reading of old style floats, fix the \end_deeper
1367 problem when reading old style floats.
1369 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1371 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1373 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1375 * lib/bind/sciword.bind: updated.
1377 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1379 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1380 layout write problem
1382 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1384 * src/Makefile.am (INCLUDES): remove image directory from include
1387 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1388 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1390 * src/LyXView.C (create_form_form_main): read the application icon
1393 * lib/images/*.xpm: change the icons to use transparent color for
1396 * src/toolbar.C (update): change the color of the button when it
1399 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1401 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1402 setting explicitely the minibuffer.
1403 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1405 * src/LyXView.C (showState): new function. Shows font information
1406 in minibuffer and update toolbar state.
1407 (LyXView): call Toolbar::update after creating the
1410 * src/toolbar.C: change toollist to be a vector instead of a
1412 (BubbleTimerCB): get help string directly from the callback
1413 argument of the corresponding icon (which is the action)
1414 (set): remove unnecessary ugliness.
1415 (update): new function. update the icons (depressed, disabled)
1416 depending of the status of the corresponding action.
1418 * src/toolbar.h: remove help in toolbarItem
1420 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1422 * src/Painter.C (text): Added code for using symbol glyphs from
1423 iso10646 fonts. Currently diabled.
1425 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1428 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1429 magyar,turkish and usorbian.
1431 * src/paragraph.C (isMultiLingual): Made more efficient.
1433 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1436 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1437 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1438 Also changed the prototype to "bool math_insert_greek(char)".
1440 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1442 * lots of files: apply the NEW_INSETS on all code that will not be
1443 needed when we move to use the new insets. Enable the define in
1444 lyxparagrah.h to try it.
1446 * src/insets/insettabular.C (cellstart): change to be a static
1448 (InsetTabular): initialize buffer in the initializer list.
1450 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1452 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1453 form_print.h out of the header file. Replaced with forward
1454 declarations of the relevant struct.
1456 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1459 * src/commandtags.h: do not include "debug.h" which does not
1460 belong there. #include it in some other places because of this
1463 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1465 * src/insets/insetcaption.C: add a couple "using" directives.
1467 * src/toolbar.C (add): get the help text directly from lyxaction.
1469 (setPixmap): new function. Loads from disk and sets a pixmap on a
1470 botton; the name of the pixmap file is derived from the command
1473 * src/toolbar.h: remove members isBitmap and pixmap from
1476 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1477 * lib/images/: move many files from images/banner.xpm.
1479 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1481 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1482 * src/toolbar.C: ditto.
1483 * configure.in: ditto.
1484 * INSTALL: document.
1486 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1487 the spellchecker popup is closed from the WM.
1489 2000-07-19 Juergen Vigna <jug@sad.it>
1491 * src/insets/insetfloat.C (Write): small fix because we use the
1492 insetname for the type now!
1494 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1496 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1499 * src/frontends/Dialogs.h: removed hideCitation signal
1501 * src/insets/insetcite.h: added hide signal
1503 * src/insets/insetcite.C (~InsetCitation): emits new signal
1504 (getScreenLabel): "intelligent" label should now fit on the screen!
1506 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1508 * src/frontends/xforms/FormCitation.C (showInset): connects
1509 hide() to the inset's hide signal
1510 (show): modified to use fl_set_object_position rather than
1511 fl_set_object_geometry wherever possible
1513 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1515 * src/insets/lyxinset.h: add caption code
1517 * src/insets/insetfloat.C (type): new method
1519 * src/insets/insetcaption.C (Write): new method
1521 (LyxCode): new method
1523 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1524 to get it right together with using the FloatList.
1526 * src/commandtags.h: add LFUN_INSET_CAPTION
1527 * src/lyxfunc.C (Dispatch): handle it
1529 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1532 * src/Variables.[Ch]: make expand take a const reference, remove
1533 the destructor, some whitespace changes.
1535 * src/LyXAction.C (init): add caption-inset-insert
1537 * src/FloatList.C (FloatList): update the default floats a bit.
1539 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1541 * src/Variables.[Ch]: new files. Intended to be used for language
1542 specific strings (like \chaptername) and filename substitution in
1545 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1547 * lib/kbd/american.kmap: update
1549 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1551 * src/bufferparams.[Ch]: remove member allowAccents.
1553 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1555 * src/LaTeXLog.C: use the log_form.h header.
1556 * src/lyx_gui.C: ditto.
1557 * src/lyx_gui_misc.C: ditto.
1558 * src/lyxvc.h: ditto.
1560 * forms/log_form.fd: new file, created from latexoptions.fd. I
1561 kept the log popup and nuked the options form.
1563 * src/{la,}texoptions.[Ch]: removed.
1564 * src/lyx_cb.C (LaTeXOptions): ditto
1566 * src/lyx_gui.C (create_forms): do not handle the
1567 fd_latex_options form.
1569 2000-07-18 Juergen Vigna <jug@sad.it>
1571 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1572 name of the inset so that it can be requested outside (text2.C).
1574 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1577 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1579 * src/mathed/formula.h (ConvertFont): constify
1581 * src/mathed/formula.C (Read): add warning if \end_inset is not
1582 found on expected place.
1584 * src/insets/lyxinset.h (ConvertFont): consify
1586 * src/insets/insetquotes.C (ConvertFont): constify
1587 * src/insets/insetquotes.h: ditto
1589 * src/insets/insetinfo.h: add labelfont
1591 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1592 (ascent): use labelfont
1596 (Write): make .lyx file a bit nicer
1598 * src/insets/insetfloat.C (Write): simplify somewhat...
1599 (Read): add warning if arg is not found
1601 * src/insets/insetcollapsable.C: add using std::max
1602 (Read): move string token and add warning in arg is not found
1603 (draw): use std::max to get the right ty
1604 (getMaxWidth): simplify by using std::max
1606 * src/insets/insetsection.h: new file
1607 * src/insets/insetsection.C: new file
1608 * src/insets/insetcaption.h: new file
1609 * src/insets/insetcaption.C: new file
1611 * src/insets/inset.C (ConvertFont): constify signature
1613 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1614 insetcaption.[Ch] and insetsection.[Ch]
1616 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1617 uses to use LABEL_COUNTER_CHAPTER instead.
1618 * src/text2.C (SetCounter): here
1620 * src/counters.h: new file
1621 * src/counters.C: new file
1622 * src/Sectioning.h: new file
1623 * src/Sectioning.C: new file
1625 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1627 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1629 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1632 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1635 2000-07-17 Juergen Vigna <jug@sad.it>
1637 * src/tabular.C (Validate): check if array-package is needed.
1638 (SetVAlignment): added support for vertical alignment.
1639 (SetLTFoot): better support for longtable header/footers
1640 (Latex): modified to support added features.
1642 * src/LaTeXFeatures.[Ch]: added array-package.
1644 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1646 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1649 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1651 * configure.in: do not forget to put a space after -isystem.
1653 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1655 * lib/kbd/arabic.kmap: a few fixes.
1657 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1659 * some whitespace chagnes to a number of files.
1661 * src/support/DebugStream.h: change to make it easier for
1662 doc++ to parse correctly.
1663 * src/support/lyxstring.h: ditto
1665 * src/mathed/math_utils.C (compara): change to have only one
1667 (MathedLookupBOP): change because of the above.
1669 * src/mathed/math_delim.C (math_deco_compare): change to have only
1671 (search_deco): change becasue of the above.
1673 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1674 instead of manually coded one.
1676 * src/insets/insetquotes.C (Read): read the \end_inset too
1678 * src/insets/insetlatex.h: remove file
1679 * src/insets/insetlatex.C: remove file
1681 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1683 (InsetPrintIndex): remove destructor
1685 * src/insets/insetinclude.h: remove default constructor
1687 * src/insets/insetfloat.C: work to make it work better
1689 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1691 * src/insets/insetcite.h (InsetCitation): remove default constructor
1693 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1695 * src/text.C (GetColumnNearX): comment out some currently unused code.
1697 * src/paragraph.C (writeFile): move some initializations closer to
1699 (CutIntoMinibuffer): small change to use new matchIT operator
1703 (InsertInset): ditto
1706 (InsetIterator): ditto
1707 (Erase): small change to use new matchFT operator
1709 (GetFontSettings): ditto
1710 (HighestFontInRange): ditto
1713 * src/lyxparagraph.h: some chars changed to value_type
1714 (matchIT): because of some stronger checking (perhaps too strong)
1715 in SGI STL, the two operator() unified to one.
1718 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1720 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1721 the last inset read added
1722 (parseSingleLyXformat2Token): some more (future) compability code added
1723 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1724 (parseSingleLyXformat2Token): set last_inset_read
1725 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1726 (parseSingleLyXformat2Token): don't double intializw string next_token
1728 * src/TextCache.C (text_fits::operator()): add const's to the signature
1729 (has_buffer::operator()): ditto
1731 * src/Floating.h: add some comments on the class
1733 * src/FloatList.[Ch] (typeExist): new method
1736 * src/BackStack.h: added default constructor, wanted by Gcc.
1738 2000-07-14 Juergen Vigna <jug@sad.it>
1740 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1742 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1744 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1745 do a redraw when the window is resized!
1746 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1748 * src/insets/insettext.C (resizeLyXText): added function to correctly
1749 being able to resize the LyXWindow.
1751 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1753 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1755 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1756 crashes when closing dialog to a deleted inset.
1758 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1759 method! Now similar to other insets.
1761 2000-07-13 Juergen Vigna <jug@sad.it>
1763 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1765 * lib/examples/Literate.lyx: small patch!
1767 * src/insets/insetbib.C (Read): added this function because of wrong
1768 Write (without [begin|end]_inset).
1770 2000-07-11 Juergen Vigna <jug@sad.it>
1772 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1773 as the insertInset could not be good!
1775 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1776 the bool param should not be last.
1778 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1780 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1781 did submit that to Karl).
1783 * configure.in: use -isystem instead of -I for X headers. This
1784 fixes a problem on solaris with a recent gcc;
1785 put the front-end code after the X detection code;
1786 configure in sigc++ before lib/
1788 * src/lyx_main.C (commandLineHelp): remove -display from command
1791 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
1793 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
1794 Also put in Makefile rules for building the ``listerrors''
1795 program for parsing errors from literate programs written in LyX.
1797 * lib/build-listerrors: Added small shell script as part of compile
1798 process. This builds a working ``listerrors'' binary if noweb is
1799 installed and either 1) the VNC X server is installed on the machine,
1800 or 2) the user is compiling from within a GUI. The existence of a GUI
1801 is necessary to use the ``lyx --export'' feature for now. This
1802 hack can be removed once ``lyx --export'' no longer requires a GUI to
1805 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
1807 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
1808 now passed back correctly from gcc and placed "under" error
1809 buttons in a Literate LyX source.
1811 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1813 * src/text.C (GetColumnNearX): Better behavior when a RTL
1814 paragraph is ended by LTR text.
1816 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
1819 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1821 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
1822 true when clipboard is empty.
1824 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1826 * text.C (Backspace): Prevent rebreaking of a row if it is the last
1827 row of the paragraph.
1828 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
1829 to prevent calculation of bidi tables
1831 2000-07-07 Juergen Vigna <jug@sad.it>
1833 * src/screen.C (ToggleSelection): added y_offset and x_offset
1836 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
1839 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
1841 * src/insets/insettext.C: fixed Layout-Display!
1843 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1845 * configure.in: add check for strings.h header.
1847 * src/spellchecker.C: include <strings.h> in order to have a
1848 definition for bzero().
1850 2000-07-07 Juergen Vigna <jug@sad.it>
1852 * src/insets/insettext.C (draw): set the status of the bv->text to
1853 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
1855 * src/screen.C (DrawOneRow):
1856 (DrawFromTo): redraw the actual row if something has changed in it
1859 * src/text.C (draw): call an update of the toplevel-inset if something
1860 has changed inside while drawing.
1862 * src/lyxtext.h: added CHANGED_IN_DRAW status.
1864 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
1866 * src/insets/insetbib.[Ch] (callback) new method, moving callback
1867 processing inside class.
1869 * src/insets/insetindex.[Ch] (callback) new method, moving callback
1870 processing inside class.
1872 * src/insets/insetindex.h new struct Holder, consistent with other
1875 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
1876 citation dialog from main code and placed it in src/frontends/xforms.
1877 Dialog launched through signals instead of callbacks
1879 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
1881 * lyx.man: update the options description.
1883 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
1885 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
1886 handle neg values, set min width to 590, add doc about -display
1888 2000-07-05 Juergen Vigna <jug@sad.it>
1890 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
1891 calls to BufferView *.
1893 * src/insets/insettext.C (checkAndActivateInset): small fix non
1894 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
1896 * src/insets/insetcommand.C (Read): Fixed as insets should read till
1897 their \end_inset token!
1899 2000-07-04 edscott <edscott@imp.mx>
1901 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
1902 lib/lyxrc.example: added option \wheel_jump
1904 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
1906 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
1907 remove support for -width,-height,-xpos and -ypos.
1909 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
1911 * src/encoding.[Ch]: New files.
1913 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
1914 (text): Call to the underline() method only when needed.
1916 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
1918 * src/buffer.C (makeLaTeXFile): Compute automatically the input
1919 encoding(s) for the document.
1921 * src/bufferparams.C (BufferParams): Changed default value of
1924 * src/language.C (newLang): Removed.
1925 (items[]): Added encoding information for all defined languages.
1927 * src/lyx_gui.C (create_forms): Added "auto" option to the input
1928 encoding choice button.
1930 * src/lyxrc.h (font_norm_type): New member variable.
1931 (set_font_norm_type): New method.
1933 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
1934 paragraphs with different encodings.
1936 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
1937 (TransformChar): Changed to work correctly with Arabic points.
1938 (draw): Added support for drawing Arabic points.
1939 (draw): Removed code for drawing underbars (this is done by
1942 * src/support/textutils.h (IsPrintableNonspace): New function.
1944 * src/BufferView_pimpl.h: Added "using SigC::Object".
1945 * src/LyXView.h: ditto.
1947 * src/insets/insetinclude.h (include_label): Changed to mutable.
1949 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1951 * src/mathed/math_iter.h: remove empty destructor
1953 * src/mathed/math_cursor.h: remove empty destructor
1955 * src/insets/lyxinset.h: add THEOREM_CODE
1957 * src/insets/insettheorem.[Ch]: new files
1959 * src/insets/insetminipage.C: (InsertInset): remove
1961 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
1963 (InsertInset): remove
1965 * src/insets/insetlist.C: (InsertList): remove
1967 * src/insets/insetfootlike.[Ch]: new files
1969 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
1972 (InsertInset): ditto
1974 * src/insets/insetert.C: remove include Painter.h, reindent
1975 (InsertInset): move to header
1977 * src/insets/insetcollapsable.h: remove explicit from default
1978 contructor, remove empty destructor, add InsertInset
1980 * src/insets/insetcollapsable.C (InsertInset): new func
1982 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
1984 * src/vspace.h: add explicit to constructor
1986 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
1987 \textcompwordmark, please test this.
1989 * src/lyxrc.C: set ascii_linelen to 65 by default
1991 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
1993 * src/commandtags.h: add LFUN_INSET_THEOREM
1995 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
1996 (makeLinuxDocFile): remove _some_ of the nice logic
1997 (makeDocBookFile): ditto
1999 * src/Painter.[Ch]: (~Painter): removed
2001 * src/LyXAction.C (init): entry for insettheorem added
2003 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2005 (deplog): code to detect files generated by LaTeX, needs testing
2008 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2010 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2012 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2014 * src/LaTeX.C (deplog): Add a check for files that are going to be
2015 created by the first latex run, part of the project to remove the
2018 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2019 contents to the extension list.
2021 2000-07-04 Juergen Vigna <jug@sad.it>
2023 * src/text.C (NextBreakPoint): added support for needFullRow()
2025 * src/insets/lyxinset.h: added needFullRow()
2027 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2030 * src/insets/insettext.C: lots of changes for update!
2032 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2034 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2036 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2038 * src/insets/insetinclude.C (InsetInclude): fixed
2039 initialization of include_label.
2040 (unique_id): now returns a string.
2042 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2044 * src/LaTeXFeatures.h: new member IncludedFiles, for
2045 a map of key, included file name.
2047 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2048 with the included files for inclusion in SGML preamble,
2049 i. e., linuxdoc and docbook.
2052 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2053 nice (is the generated linuxdoc code to be exported?), that
2054 allows to remove column, and only_body that will be true for
2055 slave documents. Insets are allowed inside SGML font type.
2056 New handling of the SGML preamble for included files.
2057 (makeDocBookFile): the same for docbook.
2059 * src/insets/insetinclude.h:
2060 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2062 (DocBook): new export methods.
2064 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2065 and makeDocBookFile.
2067 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2068 formats to export with command line argument -x.
2070 2000-06-29 Juergen Vigna <jug@sad.it>
2072 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2073 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2075 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2076 region could already been cleared by an inset!
2078 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2080 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2083 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2085 (cursorToggle): remove special handling of lyx focus.
2087 2000-06-28 Juergen Vigna <jug@sad.it>
2089 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2092 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2094 * src/insets/insetindex.C (Edit): add a callback when popup is
2097 * src/insets/insettext.C (LocalDispatch):
2098 * src/insets/insetmarginal.h:
2099 * src/insets/insetlist.h:
2100 * src/insets/insetfoot.h:
2101 * src/insets/insetfloat.h:
2102 * src/insets/insetert.h: add a missing std:: qualifier.
2104 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2106 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2109 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2111 * src/insets/insettext.C (Read): remove tmptok unused variable
2112 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2113 (InsertInset): change for new InsetInset code
2115 * src/insets/insettext.h: add TEXT inline method
2117 * src/insets/insettext.C: remove TEXT macro
2119 * src/insets/insetmarginal.C (Write): new method
2120 (Latex): change output slightly
2122 * src/insets/insetfoot.C (Write): new method
2123 (Latex): change output slightly (don't use endl when no need)
2125 * src/insets/insetert.C (Write): new method
2127 * src/insets/insetcollapsable.h: make button_length, button_top_y
2128 and button_bottm_y protected.
2130 * src/insets/insetcollapsable.C (Write): simplify code by using
2131 tostr. Also do not output the float name, the children class
2132 should to that to get control over own arguments
2134 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2135 src/insets/insetminipage.[Ch]:
2138 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2140 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2142 * src/Makefile.am (lyx_SOURCES): add the new files
2144 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2145 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2146 * src/commandtags.h: ditto
2148 * src/LaTeXFeatures.h: add a std::set of used floattypes
2150 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2152 * src/FloatList.[Ch] src/Floating.h: new files
2154 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2156 * src/lyx_cb.C (TableApplyCB): ditto
2158 * src/text2.C: ditto
2159 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2160 (parseSingleLyXformat2Token): ditto + add code for
2161 backwards compability for old float styles + add code for new insets
2163 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2165 (InsertInset(size_type, Inset *, LyXFont)): new method
2166 (InsetChar(size_type, char)): changed to use the other InsetChar
2167 with a LyXFont(ALL_INHERIT).
2168 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2169 insert the META_INSET.
2171 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2173 * sigc++/thread.h (Threads): from here
2175 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2176 definition out of line
2177 * sigc++/scope.h: from here
2179 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2181 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2182 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2184 * Makefile.am (bindist): new target.
2186 * INSTALL: add instructions for doing a binary distribution.
2188 * development/tools/README.bin.example: update a bit.
2190 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2193 * lib/lyxrc.example: new lyxrc tag \set_color.
2195 * src/lyxfunc.C (Dispatch):
2196 * src/commandtags.h:
2197 * src/LyXAction.C: new lyxfunc "set-color".
2199 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2200 and an x11name given as strings.
2202 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2203 cache when a color is changed.
2205 2000-06-26 Juergen Vigna <jug@sad.it>
2207 * src/lyxrow.C (width): added this functions and variable.
2209 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2212 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2214 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2216 * images/undo_bw.xpm: new icon.
2217 * images/redo_bw.xpm: ditto.
2219 * configure.in (INSTALL_SCRIPT): change value to
2220 ${INSTALL} to avoid failures of install-script target.
2221 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2223 * src/BufferView.h: add a magic "friend" declaration to please
2226 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2228 * forms/cite.fd: modified to allow resizing without messing
2231 * src/insetcite.C: Uses code from cite.fd almost without
2233 User can now resize dialog in the x-direction.
2234 Resizing the dialog in the y-direction is prevented, as the
2235 code does this intelligently already.
2237 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2239 * INSTALL: remove obsolete entry in "problems" section.
2241 * lib/examples/sl_*.lyx: update of the slovenian examples.
2243 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2245 2000-06-23 Juergen Vigna <jug@sad.it>
2247 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2249 * src/buffer.C (resize): delete the LyXText of textinsets.
2251 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2253 * src/insets/lyxinset.h: added another parameter 'cleared' to
2254 the draw() function.
2256 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2257 unlocking inset in inset.
2259 2000-06-22 Juergen Vigna <jug@sad.it>
2261 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2262 of insets and moved first to LyXText.
2264 * src/mathed/formulamacro.[Ch]:
2265 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2267 2000-06-21 Juergen Vigna <jug@sad.it>
2269 * src/text.C (GetVisibleRow): look if I should clear the area or not
2270 using Inset::doClearArea() function.
2272 * src/insets/lyxinset.h: added doClearArea() function and
2273 modified draw(Painter &, ...) to draw(BufferView *, ...)
2275 * src/text2.C (UpdateInset): return bool insted of int
2277 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2279 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2280 combox in the character popup
2282 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2283 BufferParams const & params
2285 2000-06-20 Juergen Vigna <jug@sad.it>
2287 * src/insets/insettext.C (SetParagraphData): set insetowner on
2290 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2292 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2293 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2295 (form_main_): remove
2297 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2298 (create_form_form_main): remove FD_form_main stuff, connect to
2299 autosave_timeout signal
2301 * src/LyXView.[Ch] (getMainForm): remove
2302 (UpdateTimerCB): remove
2303 * src/BufferView_pimpl.h: inherit from SigC::Object
2305 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2306 signal instead of callback
2308 * src/BufferView.[Ch] (cursorToggleCB): remove
2310 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2312 * src/BufferView_pimpl.C: changes because of the one below
2314 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2315 instead of storing a pointer to a LyXText.
2317 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2319 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2321 * src/lyxparagraph.h
2323 * src/paragraph.C: Changed fontlist to a sorted vector.
2325 2000-06-19 Juergen Vigna <jug@sad.it>
2327 * src/BufferView.h: added screen() function.
2329 * src/insets/insettext.C (LocalDispatch): some selection code
2332 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2334 * src/insets/insettext.C (SetParagraphData):
2336 (InsetText): fixes for multiple paragraphs.
2338 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2340 * development/lyx.spec.in: Call configure with ``--without-warnings''
2341 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2342 This should be fine, however, since we generally don't want to be
2343 verbose when making an RPM.
2345 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2347 * lib/scripts/fig2pstex.py: New file
2349 2000-06-16 Juergen Vigna <jug@sad.it>
2351 * src/insets/insettabular.C (UpdateLocal):
2352 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2353 (LocalDispatch): Changed all functions to use LyXText.
2355 2000-06-15 Juergen Vigna <jug@sad.it>
2357 * src/text.C (SetHeightOfRow): call inset::update before requesting
2360 * src/insets/insettext.C (update):
2361 * src/insets/insettabular.C (update): added implementation
2363 * src/insets/lyxinset.h: added update function
2365 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2367 * src/text.C (SelectNextWord): protect against null pointers with
2368 old-style string streams. (fix from Paul Theo Gonciari
2371 * src/cite.[Ch]: remove erroneous files.
2373 * lib/configure.m4: update the list of created directories.
2375 * src/lyxrow.C: include <config.h>
2376 * src/lyxcursor.C: ditto.
2378 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2380 * lib/examples/decimal.lyx: new example file from Mike.
2382 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2383 to find template definitions (from Dekel)
2385 * src/frontends/.cvsignore: add a few things.
2387 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2389 * src/Timeout.C (TimeOut): remove default argument.
2391 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2394 * src/insets/ExternalTemplate.C: add a "using" directive.
2396 * src/lyx_main.h: remove the act_ struct, which seems unused
2399 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2401 * LyX Developers Meeting: All files changed, due to random C++ (by
2402 coincidence) code generator script.
2404 - external inset (cool!)
2405 - initial online editing of preferences
2406 - insettabular breaks insettext(s contents)
2408 - some DocBook fixes
2409 - example files update
2410 - other cool stuff, create a diff and look for yourself.
2412 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2414 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2415 -1 this is a non-line-breaking textinset.
2417 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2418 if there is no width set.
2420 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2422 * Lots of files: Merged the dialogbase branch.
2424 2000-06-09 Allan Rae <rae@lyx.org>
2426 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2427 and the Dispatch methods that used it.
2429 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2430 access to functions formerly kept in Dispatch.
2432 2000-05-19 Allan Rae <rae@lyx.org>
2434 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2435 made to_page and count_copies integers again. from_page remains a
2436 string however because I want to allow entry of a print range like
2437 "1,4,22-25" using this field.
2439 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2440 and printer-params-get. These aren't useful from the minibuffer but
2441 could be used by a script/LyXServer app provided it passes a suitable
2442 auto_mem_buffer. I guess I should take a look at how the LyXServer
2443 works and make it support xtl buffers.
2445 * sigc++/: updated to libsigc++-1.0.1
2447 * src/xtl/: updated to xtl-1.3.pl.11
2449 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2450 those changes done to the files in src/ are actually recreated when
2451 they get regenerated. Please don't ever accept a patch that changes a
2452 dialog unless that patch includes the changes to the corresponding *.fd
2455 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2456 stringOnlyContains, renamed it and generalised it.
2458 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2459 branch. Removed the remaining old form_print code.
2461 2000-04-26 Allan Rae <rae@lyx.org>
2463 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2464 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2466 2000-04-25 Allan Rae <rae@lyx.org>
2468 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2469 against a base of xtl-1.3.pl.4
2471 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2472 filter the Id: entries so they still show the xtl version number
2475 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2476 into the src/xtl code. Patch still pending with José (XTL)
2478 2000-04-24 Allan Rae <rae@lyx.org>
2480 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2481 both more generic and much safer. Use the new template functions.
2482 * src/buffer.[Ch] (Dispatch): ditto.
2484 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2485 and mem buffer more intelligently. Also a little general cleanup.
2488 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2489 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2490 * src/xtl/Makefile.am: ditto.
2491 * src/xtl/.cvsignore: ditto.
2492 * src/Makefile.am: ditto.
2494 * src/PrinterParams.h: Removed the macros member functions. Added a
2495 testInvariant member function. A bit of tidying up and commenting.
2496 Included Angus's idea for fixing operation with egcs-1.1.2.
2498 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2499 cool expansion of XTL's mem_buffer to support automatic memory
2500 management within the buffer itself. Removed the various macros and
2501 replaced them with template functions that use either auto_mem_buffer
2502 or mem_buffer depending on a #define. The mem_buffer support will
2503 disappear as soon as the auto_mem_buffer is confirmed to be good on
2504 other platforms/compilers. That is, it's there so you've got something
2507 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2508 effectively forked XTL. However I expect José will include my code
2509 into the next major release. Also fixed a memory leak.
2510 * src/xtl/text.h: ditto.
2511 * src/xtl/xdr.h: ditto.
2512 * src/xtl/giop.h: ditto.
2514 2000-04-16 Allan Rae <rae@lyx.org>
2516 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2517 by autogen.sh and removed by maintainer-clean anyway.
2518 * .cvsignore, sigc++/.cvsignore: Support the above.
2520 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2522 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2524 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2525 macros, renamed static callback-target member functions to suit new
2526 scheme and made them public.
2527 * src/frontends/xforms/forms/form_print.fd: ditto.
2528 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2530 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2533 * src/xtl/: New directory containing a minimal distribution of XTL.
2534 This is XTL-1.3.pl.4.
2536 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2538 2000-04-15 Allan Rae <rae@lyx.org>
2540 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2542 * sigc++/: Updated to libsigc++-1.0.0
2544 2000-04-14 Allan Rae <rae@lyx.org>
2546 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2547 use the generic ones in future. I'll modify my conversion script.
2549 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2551 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2552 (CloseAllBufferRelatedDialogs): Renamed.
2553 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2555 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2556 of the generic ones. These are the same ones my conversion script
2559 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2560 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2561 * src/buffer.C (Dispatch): ditto
2563 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2564 functions for updating and hiding buffer dependent dialogs.
2565 * src/BufferView.C (buffer): ditto
2566 * src/buffer.C (setReadonly): ditto
2567 * src/lyxfunc.C (CloseBuffer): ditto
2569 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2570 Dialogs.h, and hence all the SigC stuff, into every file that includes
2571 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2573 * src/BufferView2.C: reduce the number of headers included by buffer.h
2575 2000-04-11 Allan Rae <rae@lyx.org>
2577 * src/frontends/xforms/xform_macros.h: A small collection of macros
2578 for building C callbacks.
2580 * src/frontends/xforms/Makefile.am: Added above file.
2582 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2583 scheme again. This time it should work for JMarc. If this is
2584 successful I'll revise my conversion script to automate some of this.
2585 The static member functions in the class also have to be public for
2586 this scheme will work. If the scheme works (it's almost identical to
2587 the way BufferView::cursorToggleCB is handled so it should work) then
2588 FormCopyright and FormPrint will be ready for inclusion into the main
2589 trunk immediately after 1.1.5 is released -- provided we're prepared
2590 for complaints about lame compilers not handling XTL.
2592 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2594 2000-04-07 Allan Rae <rae@lyx.org>
2596 * config/lyxinclude.m4: A bit more tidying up (Angus)
2598 * src/LString.h: JMarc's <string> header fix
2600 * src/PrinterParams.h: Used string for most data to remove some
2601 ugly code in the Print dialog and avoid even uglier code when
2602 appending the ints to a string for output.
2604 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2605 and moved "default:" back to the end of switch statement. Cleaned
2606 up the printing so it uses the right function calls and so the
2607 "print to file" option actually puts the file in the right directory.
2609 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2611 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2612 and Ok+Apply button control into a separate method: input (Angus).
2613 (input) Cleaned it up and improved it to be very thorough now.
2614 (All CB) static_cast used instead of C style cast (Angus). This will
2615 probably change again once we've worked out how to keep gcc-2.8.1 happy
2616 with real C callbacks.
2617 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2618 ignore some of the bool settings and has random numbers instead. Needs
2619 some more investigation. Added other input length checks and checking
2620 of file and printer names.
2622 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2623 would link (Angus). Seems the old code doesn't compile with the pragma
2624 statement either. Separated callback entries from internal methods.
2626 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2628 2000-03-17 Allan Rae <rae@lyx.org>
2630 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2631 need it? Maybe it could go in Dialogs instead? I could make it a
2632 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2633 values to get the bool return value.
2634 (Dispatch): New overloaded method for xtl support.
2636 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2637 extern "C" callback instead of static member functions. Hopefully,
2638 JMarc will be able to compile this. I haven't changed
2639 forms/form_copyright.fd yet. Breaking one of my own rules already.
2641 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2642 because they aren't useful from the minibuffer. Maybe a LyXServer
2643 might want a help message though?
2645 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2647 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2648 xtl which needs both rtti and exceptions.
2650 * src/support/Makefile.am:
2651 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2653 * src/frontends/xforms/input_validators.[ch]: input filters and
2654 validators. These conrol what keys are valid in input boxes.
2655 Use them and write some more. Much better idea than waiting till
2656 after the user has pressed Ok to say that the input fields don't make
2659 * src/frontends/xforms/Makefile.am:
2660 * src/frontends/xforms/forms/form_print.fd:
2661 * src/frontends/xforms/forms/makefile:
2662 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2663 new scheme. Still have to make sure I haven't missed anything from
2664 the current implementation.
2666 * src/Makefile.am, src/PrinterParams.h: New data store.
2668 * other files: Added a couple of copyright notices.
2670 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2672 * src/insets/insetbib.h: move Holder struct in public space.
2674 * src/frontends/include/DialogBase.h: use SigC:: only when
2675 SIGC_CXX_NAMESPACES is defined.
2676 * src/frontends/include/Dialogs.h: ditto.
2678 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2680 * src/frontends/xforms/FormCopyright.[Ch]: do not
2681 mention SigC:: explicitely.
2683 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2685 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2686 deals with testing KDE in main configure.in
2687 * configure.in: ditto.
2689 2000-02-22 Allan Rae <rae@lyx.org>
2691 * Lots of files: Merged from HEAD
2693 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2694 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2696 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2698 * sigc++/: new minidist.
2700 2000-02-14 Allan Rae <rae@lyx.org>
2702 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2704 2000-02-08 Juergen Vigna <jug@sad.it>
2706 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2707 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2709 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2710 for this port and so it is much easier for other people to port
2711 dialogs in a common development environment.
2713 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2714 the QT/KDE implementation.
2716 * src/frontends/kde/Dialogs.C:
2717 * src/frontends/kde/FormCopyright.C:
2718 * src/frontends/kde/FormCopyright.h:
2719 * src/frontends/kde/Makefile.am:
2720 * src/frontends/kde/formcopyrightdialog.C:
2721 * src/frontends/kde/formcopyrightdialog.h:
2722 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2723 for the kde support of the Copyright-Dialog.
2725 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2726 subdir-substitution instead of hardcoded 'xforms' as we now have also
2729 * src/frontends/include/DialogBase.h (Object): just commented the
2730 label after #endif (nasty warning and I don't like warnings ;)
2732 * src/main.C (main): added KApplication initialization if using
2735 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2736 For now only the KDE event-loop is added if frontend==kde.
2738 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2740 * configure.in: added support for the --with-frontend[=value] option
2742 * autogen.sh: added kde.m4 file to list of config-files
2744 * acconfig.h: added define for KDEGUI-support
2746 * config/kde.m4: added configuration functions for KDE-port
2748 * config/lyxinclude.m4: added --with-frontend[=value] option with
2749 support for xforms and KDE.
2751 2000-02-08 Allan Rae <rae@lyx.org>
2753 * all Makefile.am: Fixed up so the make targets dist, distclean,
2754 install and uninstall all work even if builddir != srcdir. Still
2755 have a new sigc++ minidist update to come.
2757 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2759 2000-02-01 Allan Rae <rae@lyx.org>
2761 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2762 Many mods to get builddir != srcdir working.
2764 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2765 for building on NT and so we can do the builddir != srcdir stuff.
2767 2000-01-30 Allan Rae <rae@lyx.org>
2769 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2770 This will stay in "rae" branch. We probably don't really need it in
2771 the main trunk as anyone who wants to help programming it should get
2772 a full library installed also. So they can check both included and
2773 system supplied library compilation.
2775 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2776 Added a 'mini' distribution of libsigc++. If you feel the urge to
2777 change something in these directories - Resist it. If you can't
2778 resist the urge then you should modify the following script and rebuild
2779 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2780 all happen. Still uses a hacked version of libsigc++'s configure.in.
2781 I'm quite happy with the results. I'm not sure the extra work to turn
2782 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2783 worth the trouble and would probably lead to extra maintenance
2785 I haven't tested the following important make targets: install, dist.
2786 Not ready for prime time but very close. Maybe 1.1.5.
2788 * development/tools/makeLyXsigc.sh: A shell script to automatically
2789 generate our mini-dist of libsigc++. It can only be used with a CVS
2790 checkout of libsigc++ not a tarball distribution. It's well commented.
2791 This will end up as part of the libsigc++ distribution so other apps
2792 can easily have an included mini-dist. If someone makes mods to the
2793 sigc++ subpackage without modifying this script to generate those
2794 changes I'll be very upset!
2796 * src/frontends/: Started the gui/system indep structure.
2798 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
2799 to access the gui-indep dialogs are in this class. Much improved
2800 design compared to previous revision. Lars, please refrain from
2801 moving this header into src/ like you did with Popups.h last time.
2803 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
2805 * src/frontends/xforms/: Started the gui-indep system with a single
2806 dialog: FormCopyright. Initial testing of use of libsigc++ was very
2809 * src/frontends/xforms/forms: Repository for the xforms .fd files.
2810 Here you'll find a very useful makefile and automated fdfix.sh that
2811 makes updating dailogs a no-brainer -- provided you follow the rules
2812 set out in the README. I'm thinking about adding another script to
2813 automatically generate skeleton code for a new dialog given just the
2816 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
2817 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
2818 Made FormCopyright gui-indep and added a lyxfunc to get to it.
2820 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
2822 * src/support/LSubstring.C (operator): simplify
2824 * src/lyxtext.h: removed bparams, use buffer_->params instead
2826 * src/lyxrow.h: make Row a real class, move all variables to
2827 private and use accessors.
2829 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
2831 (isRightToLeftPar): ditto
2832 (ChangeLanguage): ditto
2833 (isMultiLingual): ditto
2836 (SimpleTeXOnePar): ditto
2837 (TeXEnvironment): ditto
2838 (GetEndLabel): ditto
2840 (SetOnlyLayout): ditto
2841 (BreakParagraph): ditto
2842 (BreakParagraphConservative): ditto
2843 (GetFontSettings): ditto
2845 (CopyIntoMinibuffer): ditto
2846 (CutIntoMinibuffer): ditto
2847 (PasteParagraph): ditto
2848 (SetPExtraType): ditto
2849 (UnsetPExtraType): ditto
2850 (DocBookContTableRows): ditto
2851 (SimpleDocBookOneTablePar): ditto
2853 (TeXFootnote): ditto
2854 (SimpleTeXOneTablePar): ditto
2855 (TeXContTableRows): ditto
2856 (SimpleTeXSpecialChars): ditto
2859 * src/lyxcursor.h: make LyXCursor a real class, move all variables
2860 to private and use accessors.
2862 * src/lyx_cb.C: remove char updatetimer, and all code that uses
2863 this, we did not use it anymore and has not been for ages. Just a
2864 waste of cpu cycles.
2866 * src/language.h: make Language a real class, move all variables
2867 to private and use accessors.
2869 * src/BufferView_pimpl.C (Pimpl): use new timer code.
2870 (create_view): remove
2871 (update): some changes for new timer
2872 (cursorToggle): use new timer
2873 (beforeChange): change for new timer
2875 * src/BufferView.h (cursorToggleCB): removed last paramter because
2878 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
2879 (cursorToggleCB): change because of new timer code
2881 * lib/CREDITS: updated own mailaddress
2883 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2885 * src/support/filetools.C (PutEnv): fix the code in case neither
2886 putenv() nor setenv() have been found.
2888 * INSTALL: mention the install-strip Makefile target.
2890 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
2891 read-only documents.
2893 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2895 * lib/reLyX/configure.in (VERSION): avoid using a previously
2896 generated reLyX wrapper to find out $prefix.
2898 * lib/examples/eu_adibide_lyx-atua.lyx:
2899 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
2900 translation of the Tutorial (Dooteo)
2902 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
2904 * forms/cite.fd: new citation dialog
2906 * src/insetcite.[Ch]: the new citation dialog is moved into
2909 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
2912 * src/insets/insetcommand.h: data members made private.
2914 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2916 * LyX 1.1.5 released
2918 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2920 * src/version.h (LYX_RELEASE): to 1.1.5
2922 * src/spellchecker.C (RunSpellChecker): return false if the
2923 spellchecker dies upon creation.
2925 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2927 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
2928 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
2932 * lib/CREDITS: update entry for Martin Vermeer.
2934 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
2936 * src/text.C (draw): Draw foreign language bars at the bottom of
2937 the row instead of at the baseline.
2939 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
2941 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2943 * lib/bind/de_menus.bind: updated
2945 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2947 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
2949 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2951 * src/menus.C (Limit_string_length): New function
2952 (ShowTocMenu): Limit the number of items/length of items in the
2955 * src/paragraph.C (String): Correct result for a paragraph inside
2958 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2960 * src/bufferlist.C (close): test of buf->getuser() == NULL
2962 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
2964 * src/BufferView2.C (removeAutoInsets): Fix a bug:
2965 Do not call to SetCursor when the paragraph is a closed footnote!
2967 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
2969 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
2972 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
2974 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2977 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
2978 reference popup, that activates the reference-back action
2980 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
2982 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
2983 the menus. Also fixed a bug.
2985 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
2986 the math panels when switching buffers (unless new buffer is readonly).
2988 * src/BufferView.C (NoSavedPositions)
2989 * src/BufferView_pimpl.C (NoSavedPositions): New methods
2991 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2993 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
2994 less of dvi dirty or not.
2996 * src/trans_mgr.[Ch] (insert): change first parameter to string
2999 * src/chset.[Ch] (encodeString): add const to first parameter
3001 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3003 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3007 * src/LaTeX.C (deplog): better searching for dependency files in
3008 the latex log. Uses now regexps.
3010 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3011 instead of the box hack or \hfill.
3013 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3015 * src/lyxfunc.C (doImportHelper): do not create the file before
3016 doing the actual import.
3017 (doImportASCIIasLines): create a new file before doing the insert.
3018 (doImportASCIIasParagraphs): ditto.
3020 * lib/lyxrc.example: remove mention of non-existing commands
3022 * lyx.man: remove mention of color-related switches.
3024 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3026 * src/lyx_gui.C: remove all the color-related ressources, which
3027 are not used anymore.
3029 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3032 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3034 * src/lyxrc.C (read): Add a missing break in the switch
3036 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3038 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3040 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3043 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3045 * src/text.C (draw): draw bars under foreign language words.
3047 * src/LColor.[Ch]: add LColor::language
3049 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3051 * src/lyxcursor.h (boundary): New member variable
3053 * src/text.C (IsBoundary): New methods
3055 * src/text.C: Use the above for currect cursor movement when there
3056 is both RTL & LTR text.
3058 * src/text2.C: ditto
3060 * src/bufferview_funcs.C (ToggleAndShow): ditto
3062 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3064 * src/text.C (DeleteLineForward): set selection to true to avoid
3065 that DeleteEmptyParagraphMechanism does some magic. This is how it
3066 is done in all other functions, and seems reasonable.
3067 (DeleteWordForward): do not jump over non-word stuff, since
3068 CursorRightOneWord() already does it.
3070 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3071 DeleteWordBackward, since they seem safe to me (since selection is
3072 set to "true") DeleteEmptyParagraphMechanism does nothing.
3074 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3076 * src/lyx_main.C (easyParse): simplify the code by factoring the
3077 part that removes parameters from the command line.
3078 (LyX): check wether wrong command line options have been given.
3080 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3082 * src/lyx_main.C : add support for specifying user LyX
3083 directory via command line option -userdir.
3085 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3087 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3088 the number of items per popup.
3089 (Add_to_refs_menu): Ditto.
3091 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3093 * src/lyxparagraph.h: renamed ClearParagraph() to
3094 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3095 textclass as parameter, and do nothing if free_spacing is
3096 true. This fixes part of the line-delete-forward problems.
3098 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3099 (pasteSelection): ditto.
3100 (SwitchLayoutsBetweenClasses): more translatable strings.
3102 * src/text2.C (CutSelection): use StripLeadingSpaces.
3103 (PasteSelection): ditto.
3104 (DeleteEmptyParagraphMechanism): ditto.
3106 2000-05-26 Juergen Vigna <jug@sad.it>
3108 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3109 is not needed in tabular insets.
3111 * src/insets/insettabular.C (TabularFeatures): added missing features.
3113 * src/tabular.C (DeleteColumn):
3115 (AppendRow): implemented this functions
3116 (cellsturct::operator=): clone the inset too;
3118 2000-05-23 Juergen Vigna <jug@sad.it>
3120 * src/insets/insettabular.C (LocalDispatch): better selection support
3121 when having multicolumn-cells.
3123 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3125 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3127 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3129 * src/ColorHandler.C (getGCForeground): put more test into _()
3131 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3134 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3137 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3139 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3140 there are no labels, or when buffer is readonly.
3142 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3143 there are no labels, buffer is SGML, or when buffer is readonly.
3145 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3147 * src/LColor.C (LColor): change a couple of grey40 to grey60
3148 (LColor): rewore initalization to make compiles go some magnitude
3150 (getGUIName): don't use gettext until we need the string.
3152 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3154 * src/Bullet.[Ch]: Fixed a small bug.
3156 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3158 * src/paragraph.C (String): Several fixes/improvements
3160 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3162 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3164 * src/paragraph.C (String): give more correct output.
3166 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3168 * src/lyxfont.C (stateText) Do not output the language if it is
3169 eqaul to the language of the document.
3171 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3172 between two paragraphs with the same language.
3174 * src/paragraph.C (getParLanguage) Return a correct answer for an
3175 empty dummy paragraph.
3177 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3180 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3183 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3184 the menus/popup, if requested fonts are unavailable.
3186 2000-05-22 Juergen Vigna <jug@sad.it>
3188 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3189 movement support (Up/Down/Tab/Shift-Tab).
3190 (LocalDispatch): added also preliminari cursor-selection.
3192 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3194 * src/paragraph.C (PasteParagraph): Hopefully now right!
3196 2000-05-22 Garst R. Reese <reese@isn.net>
3198 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3199 of list, change all references to Environment to Command
3200 * tex/hollywood.cls : rewrite environments as commands, add
3201 \uppercase to interiorshot and exteriorshot to force uppecase.
3202 * tex/broadway.cls : rewrite environments as commands. Tweak
3205 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3207 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3208 size of items: use a constant intead of the hardcoded 40, and more
3209 importantly do not remove the %m and %x tags added at the end.
3210 (Add_to_refs_menu): use vector::size_type instead of
3211 unsigned int as basic types for the variables. _Please_ do not
3212 assume that size_t is equal to unsigned int. On an alpha, this is
3213 unsigned long, which is _not_ the same.
3215 * src/language.C (initL): remove language "hungarian", since it
3216 seems that "magyar" is better.
3218 2000-05-22 Juergen Vigna <jug@sad.it>
3220 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3222 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3225 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3226 next was deleted but not set to 0.
3228 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3230 * src/language.C (initL): change the initialization of languages
3231 so that compiles goes _fast_.
3233 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3236 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3238 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3242 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3244 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3246 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3250 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3253 * src/insets/insetlo*.[Ch]: Made editable
3255 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3257 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3258 the current selection.
3260 * src/BufferView_pimpl.C (stuffClipboard): new method
3262 * src/BufferView.C (stuffClipboard): new method
3264 * src/paragraph.C (String): new method
3266 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3267 LColor::ignore when lyxname is not found.
3269 * src/BufferView.C (pasteSelection): new method
3271 * src/BufferView_pimpl.C (pasteSelection): new method
3273 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3275 * src/WorkArea.C (request_clipboard_cb): new static function
3276 (getClipboard): new method
3277 (putClipboard): new method
3279 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3281 * LyX 1.1.5pre2 released
3283 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3285 * src/vspace.C (operator=): removed
3286 (operator=): removed
3288 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3290 * src/layout.C (NumberOfClass): manually set the type in make_pair
3291 (NumberOfLayout): ditto
3293 * src/language.C: use the Language constructor for ignore_lang
3295 * src/language.h: add constructors to struct Language
3297 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3299 * src/text2.C (SetCursorIntern): comment out #warning
3301 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3303 * src/mathed/math_iter.h: initialize sx and sw to 0
3305 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3307 * forms/lyx.fd: Redesign of form_ref
3309 * src/LaTeXFeatures.[Ch]
3313 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3316 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3317 and Buffer::inset_iterator.
3319 * src/menus.C: Added new menus: TOC and Refs.
3321 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3323 * src/buffer.C (getTocList): New method.
3325 * src/BufferView2.C (ChangeRefs): New method.
3327 * src/buffer.C (getLabelList): New method. It replaces the old
3328 getReferenceList. The return type is vector<string> instead of
3331 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3332 the old getLabel() and GetNumberOfLabels() methods.
3333 * src/insets/insetlabel.C (getLabelList): ditto
3334 * src/mathed/formula.C (getLabelList): ditto
3336 * src/paragraph.C (String): New method.
3338 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3339 Uses the new getTocList() method.
3340 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3341 which automatically updates the contents of the browser.
3342 (RefUpdateCB): Use the new getLabelList method.
3344 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3346 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3348 * src/spellchecker.C: Added using std::reverse;
3350 2000-05-19 Juergen Vigna <jug@sad.it>
3352 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3354 * src/insets/insettext.C (computeTextRows): small fix for display of
3355 1 character after a newline.
3357 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3360 2000-05-18 Juergen Vigna <jug@sad.it>
3362 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3363 when changing width of column.
3365 * src/tabular.C (set_row_column_number_info): setting of
3366 autobreak rows if necessary.
3368 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3370 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3372 * src/vc-backend.*: renamed stat() to status() and vcstat to
3373 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3374 compilation broke. The new name seems more relevant, anyway.
3376 2000-05-17 Juergen Vigna <jug@sad.it>
3378 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3379 which was wrong if the removing caused removing of rows!
3381 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3382 (pushToken): new function.
3384 * src/text2.C (CutSelection): fix problem discovered with purify
3386 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3388 * src/debug.C (showTags): enlarge the first column, now that we
3389 have 6-digits debug codes.
3391 * lib/layouts/hollywood.layout:
3392 * lib/tex/hollywood.cls:
3393 * lib/tex/brodway.cls:
3394 * lib/layouts/brodway.layout: more commands and fewer
3395 environments. Preambles moved in the .cls files. Broadway now has
3396 more options on scene numbering and less whitespace (from Garst)
3398 * src/insets/insetbib.C (getKeys): make sure that we are in the
3399 document directory, in case the bib file is there.
3401 * src/insets/insetbib.C (Latex): revert bogus change.
3403 2000-05-16 Juergen Vigna <jug@sad.it>
3405 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3406 the TabularLayout on cursor move.
3408 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3410 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3413 (draw): fixed cursor position and drawing so that the cursor is
3414 visible when before the tabular-inset.
3416 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3417 when creating from old insettext.
3419 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3421 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3423 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3424 * lib/tex/brodway.cls: ditto
3426 * lib/layouts/brodway.layout: change alignment of parenthical
3429 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3431 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3432 versions 0.88 and 0.89 are supported.
3434 2000-05-15 Juergen Vigna <jug@sad.it>
3436 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3439 * src/insets/insettext.C (computeTextRows): redone completely this
3440 function in a much cleaner way, because of problems when having a
3442 (draw): added a frame border when the inset is locked.
3443 (SetDrawLockedFrame): this sets if we draw the border or not.
3444 (SetFrameColor): this sets the frame color (default=insetframe).
3446 * src/insets/lyxinset.h: added x() and y() functions which return
3447 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3448 function which is needed to see if we have a locking inset of some
3449 type in this inset (needed for now in insettabular).
3451 * src/vspace.C (inPixels): the same function also without a BufferView
3452 parameter as so it is easier to use it in some ocasions.
3454 * src/lyxfunc.C: changed all places where insertInset was used so
3455 that now if it couldn't be inserted it is deleted!
3457 * src/TabularLayout.C:
3458 * src/TableLayout.C: added support for new tabular-inset!
3460 * src/BufferView2.C (insertInset): this now returns a bool if the
3461 inset was really inserted!!!
3463 * src/tabular.C (GetLastCellInRow):
3464 (GetFirstCellInRow): new helper functions.
3465 (Latex): implemented for new tabular class.
3469 (TeXTopHLine): new Latex() helper functions.
3471 2000-05-12 Juergen Vigna <jug@sad.it>
3473 * src/mathed/formulamacro.C (Read):
3474 * src/mathed/formula.C (Read): read also the \end_inset here!
3476 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3478 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3479 crush when saving formulae with unbalanced parenthesis.
3481 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3483 * src/layout.C: Add new keyword "endlabelstring" to layout file
3485 * src/text.C (GetVisibleRow): Draw endlabel string.
3487 * lib/layouts/broadway.layout
3488 * lib/layouts/hollywood.layout: Added endlabel for the
3489 Parenthetical layout.
3491 * lib/layouts/heb-article.layout: Do not use slanted font shape
3492 for Theorem like environments.
3494 * src/buffer.C (makeLaTeXFile): Always add "american" to
3495 the UsedLanguages list if document language is RTL.
3497 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3499 * add addendum to README.OS2 and small patch (from SMiyata)
3501 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3503 * many files: correct the calls to ChangeExtension().
3505 * src/support/filetools.C (ChangeExtension): remove the no_path
3506 argument, which does not belong there. Use OnlyFileName() instead.
3508 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3509 files when LaTeXing a non-nice latex file.
3511 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3512 a chain of "if". Return false when deadkeys are not handled.
3514 * src/lyx_main.C (LyX): adapted the code for default bindings.
3516 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3517 bindings for basic functionality (except deadkeys).
3518 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3520 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3521 several methods: handle override_x_deadkeys.
3523 * src/lyxrc.h: remove the "bindings" map, which did not make much
3524 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3526 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3528 * src/lyxfont.C (stateText): use a saner method to determine
3529 whether the font is "default". Seems to fix the crash with DEC
3532 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3534 2000-05-08 Juergen Vigna <jug@sad.it>
3536 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3537 TabularLayoutMenu with mouse-button-3
3538 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3540 * src/TabularLayout.C: added this file for having a Layout for
3543 2000-05-05 Juergen Vigna <jug@sad.it>
3545 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3546 recalculating inset-widths.
3547 (TabularFeatures): activated this function so that I can change
3548 tabular-features via menu.
3550 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3551 that I can test some functions with the Table menu.
3553 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3555 * src/lyxfont.C (stateText): guard against stupid c++libs.
3557 * src/tabular.C: add using std::vector
3558 some whitespace changes, + removed som autogenerated code.
3560 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3562 2000-05-05 Juergen Vigna <jug@sad.it>
3564 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3565 row, columns and cellstructures.
3567 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3569 * lib/lyxrc.example: remove obsolete entries.
3571 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3572 reading of protected_separator for free_spacing.
3574 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3576 * src/text.C (draw): do not display an exclamation mark in the
3577 margin for margin notes. This is confusing, ugly and
3580 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3581 AMS math' is checked.
3583 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3584 name to see whether including the amsmath package is needed.
3586 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3588 * src/paragraph.C (validate): Compute UsedLanguages correctly
3589 (don't insert the american language if it doesn't appear in the
3592 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3593 The argument of \thanks{} command is considered moving argument
3595 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3598 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3600 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3601 for appendix/minipage/depth. The lines can be now both in the footnote
3602 frame, and outside the frame.
3604 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3607 2000-05-05 Juergen Vigna <jug@sad.it>
3609 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3610 neede only in tabular.[Ch].
3612 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3614 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3616 (Write): write '~' for PROTECTED_SEPARATOR
3618 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3620 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3623 * src/mathed/formula.C (drawStr): rename size to siz.
3625 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3626 possibly fix a bug by not changing the pflags = flags to piflags =
3629 2000-05-05 Juergen Vigna <jug@sad.it>
3631 * src/insets/insetbib.C: moved using directive
3633 * src/ImportNoweb.C: small fix for being able to compile (missing
3636 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3638 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3639 to use clear, since we don't depend on this in the code. Add test
3642 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3644 * (various *.C files): add using std::foo directives to please dec
3647 * replace calls to string::clear() to string::erase() (Angus)
3649 * src/cheaders/cmath: modified to provide std::abs.
3651 2000-05-04 Juergen Vigna <jug@sad.it>
3653 * src/insets/insettext.C: Prepared all for inserting of multiple
3654 paragraphs. Still display stuff to do (alignment and other things),
3655 but I would like to use LyXText to do this when we cleaned out the
3656 table-support stuff.
3658 * src/insets/insettabular.C: Changed lot of stuff and added lots
3659 of functionality still a lot to do.
3661 * src/tabular.C: Various functions changed name and moved to be
3662 const functions. Added new Read and Write functions and changed
3663 lots of things so it works good with tabular-insets (also removed
3664 some stuff which is not needed anymore * hacks *).
3666 * src/lyxcursor.h: added operators == and != which just look if
3667 par and pos are (not) equal.
3669 * src/buffer.C (latexParagraphs): inserted this function to latex
3670 all paragraphs form par to endpar as then I can use this too for
3673 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3674 so that I can call this to from text insets with their own cursor.
3676 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3677 output off all paragraphs (because of the fix below)!
3679 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3680 the very last paragraph (this could be also the last paragraph of an
3683 * src/texrow.h: added rows() call which returns the count-variable.
3685 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3687 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3689 * lib/configure.m4: better autodetection of DocBook tools.
3691 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3693 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3695 * src/lyx_cb.C: add using std::reverse;
3697 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3700 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3701 selected files. Should fix repeated errors from generated files.
3703 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3705 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3707 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3708 the spellchecker popup.
3710 * lib/lyxrc.example: Removed the \number_inset section
3712 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3714 * src/insets/figinset.C (various): Use IsFileReadable() to make
3715 sure that the file actually exist. Relying on ghostscripts errors
3716 is a bad idea since they can lead to X server crashes.
3718 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3720 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3723 * lib/lyxrc.example: smallish typo in description of
3724 \view_dvi_paper_option
3726 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3729 * src/lyxfunc.C: doImportHelper to factor out common code of the
3730 various import methods. New functions doImportASCIIasLines,
3731 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3732 doImportLinuxDoc for the format specific parts.
3735 * buffer.C: Dispatch returns now a bool to indicate success
3738 * lyx_gui.C: Add getLyXView() for member access
3740 * lyx_main.C: Change logic for batch commands: First try
3741 Buffer::Dispatch (possibly without GUI), if that fails, use
3744 * lyx_main.C: Add support for --import command line switch.
3745 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3746 Available Formats: Everything accepted by 'buffer-import <format>'
3748 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3750 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3753 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3754 documents will be reformatted upon reentry.
3756 2000-04-27 Juergen Vigna <jug@sad.it>
3758 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3759 correctly only last pos this was a bug.
3761 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3763 * release of lyx-1.1.5pre1
3765 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3767 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3769 * src/menus.C: revert the change of naming (Figure->Graphic...)
3770 from 2000-04-11. It was incomplete and bad.
3772 * src/LColor.[Ch]: add LColor::depthbar.
3773 * src/text.C (GetVisibleRow): use it.
3775 * README: update the languages list.
3777 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3779 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3782 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3784 * README: remove sections that were just wrong.
3786 * src/text2.C (GetRowNearY): remove currentrow code
3788 * src/text.C (GetRow): remove currentrow code
3790 * src/screen.C (Update): rewritten a bit.
3791 (SmallUpdate): removed func
3793 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
3795 (FullRebreak): return bool
3796 (currentrow): remove var
3797 (currentrow_y): ditto
3799 * src/lyxscreen.h (Draw): change arg to unsigned long
3800 (FitCursor): return bool
3801 (FitManualCursor): ditto
3802 (Smallpdate): remove func
3803 (first): change to unsigned long
3804 (DrawOneRow): change second arg to long (from long &)
3805 (screen_refresh_y): remove var
3806 (scree_refresh_row): ditto
3808 * src/lyxrow.h: change baseline to usigned int from unsigned
3809 short, this brings some implicit/unsigned issues out in the open.
3811 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
3813 (Dispatch): don't call updateScrollbar after fitCursor. Use update
3814 instead of smallUpdate.
3816 * src/lyxcursor.h: change y to unsigned long
3818 * src/buffer.h: don't call updateScrollbar after fitcursor
3820 * src/buffer.C (parseSingleLyXformat2Token): move variables to
3821 where they are used. Removed "\\direction", this was not present
3822 in 1.1.4 and is already obsolete. Commented out some code that I
3823 believe to never be called.
3824 (runLiterate): don't call updateScrollbar after fitCursor
3826 (buildProgram): ditto
3829 * src/WorkArea.h (workWidth): change return val to unsigned
3832 (redraw): remove the button redraws
3833 (setScrollbarValue): change for scrollbar
3834 (getScrollbarValue): change for scrollbar
3835 (getScrollbarBounds): change for scrollbar
3837 * src/WorkArea.C (C_WorkArea_up_cb): removed func
3838 (C_WorkArea_down_cb): removed func
3839 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
3840 (resize): change for scrollbar
3841 (setScrollbar): ditto
3842 (setScrollbarBounds): ditto
3843 (setScrollbarIncrements): ditto
3844 (up_cb): removed func
3845 (down_cb): removed func
3846 (scroll_cb): change for scrollbar
3847 (work_area_handler): ditto
3849 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
3850 when FitCursor did something.
3851 (updateScrollbar): some unsigned changes
3852 (downCB): removed func
3853 (scrollUpOnePage): removed func
3854 (scrollDownOnePage): remvoed func
3855 (workAreaMotionNotify): don't call screen->FitCursor but use
3856 fitCursor instead. and bool return val
3857 (workAreaButtonPress): ditto
3858 (workAreaButtonRelease): some unsigned changes
3859 (checkInsetHit): ditto
3860 (workAreaExpose): ditto
3861 (update): parts rewritten, comments about the signed char arg added
3862 (smallUpdate): removed func
3863 (cursorPrevious): call needed updateScrollbar
3866 * src/BufferView2.C (allFloats): don't call updateScrollbar after
3869 * src/BufferView.[Ch] (upCB): removed func
3870 (downCB): removed func
3871 (smallUpdate): removed func
3873 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3875 * src/lyxtext.h src/text.C src/text2.C: removed support for the
3876 currentrow, currentrow_y optimization. This did not help a lot and
3877 if we want to do this kind of optimization we should rather use
3878 cursor.row instead of the currentrow.
3880 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
3881 buffer spacing and klyx spacing support.
3883 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3885 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
3888 2000-04-26 Juergen Vigna <jug@sad.it>
3890 * src/insets/figinset.C: fixes to Lars sstream changes!
3892 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
3894 * A lot of files: Added Ascii(ostream &) methods to all inset
3895 classes. Used when exporting to ASCII.
3897 * src/buffer.C (writeFileAscii,RoffAsciiTable)
3898 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
3901 * src/text2.C (ToggleFree): Disabled implicit word selection when
3902 there is a change in the language
3904 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
3905 no output was generated for end-of-sentence inset.
3907 * src/insets/lyxinset.h
3910 * src/paragraph.C: Removed the insetnumber code
3912 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
3914 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3916 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
3917 no_babel and no_epsfig completely from the file.
3918 (parseSingleLyXformat2Token): add handling for per-paragraph
3919 spacing as written by klyx.
3921 * src/insets/figinset.C: applied patch by Andre. Made it work with
3924 2000-04-20 Juergen Vigna <jug@sad.it>
3926 * src/insets/insettext.C (cutSelection):
3927 (copySelection): Fixed with selection from right to left.
3928 (draw): now the rows are not recalculated at every draw.
3929 (computeTextRows): for now reset the inset-owner here (this is
3930 important for an undo or copy where the inset-owner is not set
3933 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
3934 motion to the_locking_inset screen->first was forgotten, this was
3935 not important till we got multiline insets.
3937 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3939 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
3940 code seems to be alright (it is code changed by Dekel, and the
3941 intent is indeed that all macros should be defined \protect'ed)
3943 * NEWS: a bit of reorganisation of the new user-visible features.
3945 2000-04-19 Juergen Vigna <jug@sad.it>
3947 * src/insets/insettext.C (init): using a LyXCursor now for cursor
3948 position. Set the inset_owner of the used paragraph so that it knows
3949 that it is inside an inset. Fixed cursor handling with mouse and
3950 cursor keys. Fixed wrong timed inset redraws and lots of other changes
3951 and cleanups to make TextInsets work better.
3953 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
3954 Changed parameters of various functions and added LockInsetInInset().
3956 * src/insets/insettext.C:
3958 * src/insets/insetcollapsable.h:
3959 * src/insets/insetcollapsable.C:
3960 * src/insets/insetfoot.h:
3961 * src/insets/insetfoot.C:
3962 * src/insets/insetert.h:
3963 * src/insets/insetert.C: cleaned up the code so that it works now
3964 correctly with insettext.
3966 * src/insets/inset.C:
3967 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
3968 that insets in insets are supported right.
3971 * src/table.C: lots of changes for use with inset tabular (and cleanup)
3973 * src/paragraph.C: some small fixes
3975 * src/debug.h: inserted INSETS debug info
3977 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
3978 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
3980 * src/commandtags.h:
3981 * src/LyXAction.C: insert code for InsetTabular.
3983 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
3984 not Button1MotionMask.
3985 (workAreaButtonRelease): send always a InsetButtonRelease event to
3987 (checkInsetHit): some setCursor fixes (always with insets).
3989 * src/BufferView2.C (lockInset): returns a bool now and extended for
3990 locking insets inside insets.
3991 (showLockedInsetCursor): it is important to have the cursor always
3992 before the locked inset.
3993 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
3995 * src/BufferView.h: made lockInset return a bool.
3997 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
3999 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4000 that is used also internally but can be called as public to have back
4001 a cursor pos which is not set internally.
4002 (SetCursorIntern): Changed to use above function.
4004 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4006 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4011 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4012 patches for things that should be in or should be changed.
4014 * src/* [insetfiles]: change "usigned char fragile" to bool
4015 fragile. There was only one point that could that be questioned
4016 and that is commented in formulamacro.C. Grep for "CHECK".
4018 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4019 (DeleteBuffer): take it out of CutAndPaste and make it static.
4021 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4023 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4024 output the spacing envir commands. Also the new commands used in
4025 the LaTeX output makes the result better.
4027 * src/Spacing.C (writeEnvirBegin): new method
4028 (writeEnvirEnd): new method
4030 2000-04-18 Juergen Vigna <jug@sad.it>
4032 * src/CutAndPaste.C: made textclass a static member of the class
4033 as otherwise it is not accesed right!!!
4035 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4037 * forms/layout_forms.fd
4038 * src/layout_forms.h
4039 * src/layout_forms.C (create_form_form_character)
4040 * src/lyx_cb.C (UserFreeFont)
4041 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4042 documents (in the layout->character popup).
4044 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4046 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4047 \spell_command was in fact not honored (from Kevin Atkinson).
4049 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4052 * src/lyx_gui.h: make lyxViews private (Angus)
4054 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4056 * src/mathed/math_write.C
4057 (MathMatrixInset::Write) Put \protect before \begin{array} and
4058 \end{array} if fragile
4059 (MathParInset::Write): Put \protect before \\ if fragile
4061 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4063 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4064 initialization if the LyXColorHandler must be done after the
4065 connections to the XServer has been established.
4067 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4068 get the background pixel from the lyxColorhandler so that the
4069 figures are rendered with the correct background color.
4070 (NextToken): removed functions.
4071 (GetPSSizes): use ifs >> string instead of NextToken.
4073 * src/Painter.[Ch]: the color cache moved out of this file.
4075 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4078 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4080 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4081 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4083 * src/BufferView.C (enterView): new func
4084 (leaveView): new func
4086 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4088 (leaveView): new func, undefines xterm cursor when approp.
4090 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4091 (AllowInput): delete the Workarea cursor handling from this func.
4093 * src/Painter.C (underline): draw a slimer underline in most cases.
4095 * src/lyx_main.C (error_handler): use extern "C"
4097 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4099 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4100 sent directly to me.
4102 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4103 to the list by Dekel.
4105 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4108 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4109 methods from lyx_cb.here.
4111 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4114 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4116 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4117 instead of using current_view directly.
4119 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4121 * src/LyXAction.C (init): add the paragraph-spacing command.
4123 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4125 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4127 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4128 different from the documents.
4130 * src/text.C (SetHeightOfRow): take paragraph spacing into
4131 account, paragraph spacing takes precedence over buffer spacing
4132 (GetVisibleRow): ditto
4134 * src/paragraph.C (writeFile): output the spacing parameter too.
4135 (validate): set the correct features if spacing is used in the
4137 (Clear): set spacing to default
4138 (MakeSameLayout): spacing too
4139 (HasSameLayout): spacing too
4140 (SetLayout): spacing too
4141 (TeXOnePar): output the spacing commands
4143 * src/lyxparagraph.h: added a spacing variable for use with
4144 per-paragraph spacing.
4146 * src/Spacing.h: add a Default spacing and a method to check if
4147 the current spacing is default. also added an operator==
4149 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4152 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4154 * src/lyxserver.C (callback): fix dispatch of functions
4156 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4157 printf() into lyxerr call.
4159 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4162 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4163 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4164 the "Float" from each of the subitems.
4165 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4167 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4168 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4169 documented the change so that the workaround can be nuked later.
4171 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4174 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4176 * src/buffer.C (getLatexName): ditto
4177 (setReadonly): ditto
4179 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4181 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4182 avoid some uses of current_view. Added also a bufferParams()
4183 method to get at this.
4185 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4187 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4189 * src/lyxparagraph.[Ch]: removed
4190 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4191 with operators used by lower_bound and
4192 upper_bound in InsetTable's
4193 Make struct InsetTable private again. Used matchpos.
4195 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4197 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4198 document, the language of existing text is changed (unless the
4199 document is multi-lingual)
4201 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4203 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4205 * A lot of files: A rewrite of the Right-to-Left support.
4207 2000-04-10 Juergen Vigna <jug@sad.it>
4209 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4210 misplaced cursor when inset in inset is locked.
4212 * src/insets/insettext.C (LocalDispatch): small fix so that a
4213 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4215 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4216 footnote font should be decreased in size twice when displaying.
4218 * src/insets/insettext.C (GetDrawFont): inserted this function as
4219 the drawing-font may differ from the real paragraph font.
4221 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4222 insets (inset in inset!).
4224 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4225 function here because we don't want footnotes inside footnotes.
4227 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4229 (init): now set the inset_owner in paragraph.C
4230 (LocalDispatch): added some resetPos() in the right position
4233 (pasteSelection): changed to use the new CutAndPaste-Class.
4235 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4236 which tells if it is allowed to insert another inset inside this one.
4238 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4239 SwitchLayoutsBetweenClasses.
4241 * src/text2.C (InsertInset): checking of the new paragraph-function
4243 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4244 is not needed anymore here!
4247 (PasteSelection): redone (also with #ifdef) so that now this uses
4248 the CutAndPaste-Class.
4249 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4252 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4253 from/to text/insets.
4255 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4256 so that the paragraph knows if it is inside an (text)-inset.
4257 (InsertFromMinibuffer): changed return-value to bool as now it
4258 may happen that an inset is not inserted in the paragraph.
4259 (InsertInsetAllowed): this checks if it is allowed to insert an
4260 inset in this paragraph.
4262 (BreakParagraphConservative):
4263 (BreakParagraph) : small change for the above change of the return
4264 value of InsertFromMinibuffer.
4266 * src/lyxparagraph.h: added inset_owner and the functions to handle
4267 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4269 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4271 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4272 functions from BufferView to BufferView::Pimpl to ease maintence.
4274 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4275 correctly. Also use SetCursorIntern instead of SetCursor.
4277 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4280 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4282 * src/WorkArea.C (belowMouse): manually implement below mouse.
4284 * src/*: Add "explicit" on several constructors, I added probably
4285 some unneeded ones. A couple of changes to code because of this.
4287 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4288 implementation and private parts from the users of BufferView. Not
4291 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4292 implementation and private parts from the users of LyXLex. Not
4295 * src/BufferView_pimpl.[Ch]: new files
4297 * src/lyxlex_pimpl.[Ch]: new files
4299 * src/LyXView.[Ch]: some inline functions move out-of-line
4301 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4303 * src/lyxparagraph.h: make struct InsetTable public.
4305 * src/support/lyxstring.h: change lyxstring::difference_type to be
4306 ptrdiff_t. Add std:: modifiers to streams.
4308 * src/font.C: include the <cctype> header, for islower() and
4311 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4313 * src/font.[Ch]: new files. Contains the metric functions for
4314 fonts, takes a LyXFont as parameter. Better separation of concepts.
4316 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4317 changes because of this.
4319 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4321 * src/*: compile with -Winline and move functions that don't
4324 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4327 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4329 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4330 (various files changed because of this)
4332 * src/Painter.C (text): fixed the drawing of smallcaps.
4334 * src/lyxfont.[Ch] (drawText): removed unused member func.
4337 * src/*.C: added needed "using" statements and "std::" qualifiers.
4339 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4341 * src/*.h: removed all use of "using" from header files use
4342 qualifier std:: instead.
4344 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4346 * src/text.C (Backspace): some additional cleanups (we already
4347 know whether cursor.pos is 0 or not).
4349 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4350 automake does not provide one).
4352 * src/bmtable.h: replace C++ comments with C comments.
4354 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4356 * src/screen.C (ShowCursor): Change the shape of the cursor if
4357 the current language is not equal to the language of the document.
4358 (If the cursor change its shape unexpectedly, then you've found a bug)
4360 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4363 * src/insets/insetnumber.[Ch]: New files.
4365 * src/LyXAction.C (init)
4366 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4369 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4371 * src/lyxparagraph.h
4372 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4373 (the vector is kept sorted).
4375 * src/text.C (GetVisibleRow): Draw selection correctly when there
4376 is both LTR and RTL text.
4378 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4379 which is much faster.
4381 * src/text.C (GetVisibleRow and other): Do not draw the last space
4382 in a row if the direction of the last letter is not equal to the
4383 direction of the paragraph.
4385 * src/lyxfont.C (latexWriteStartChanges):
4386 Check that font language is not equal to basefont language.
4387 (latexWriteEndChanges): ditto
4389 * src/lyx_cb.C (StyleReset): Don't change the language while using
4390 the font-default command.
4392 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4393 empty paragraph before a footnote.
4395 * src/insets/insetcommand.C (draw): Increase x correctly.
4397 * src/screen.C (ShowCursor): Change cursor shape if
4398 current language != document language.
4400 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4402 2000-03-31 Juergen Vigna <jug@sad.it>
4404 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4405 (Clone): changed mode how the paragraph-data is copied to the
4406 new clone-paragraph.
4408 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4409 GetInset(pos) with no inset anymore there (in inset UNDO)
4411 * src/insets/insetcommand.C (draw): small fix as here x is
4412 incremented not as much as width() returns (2 before, 2 behind = 4)
4414 2000-03-30 Juergen Vigna <jug@sad.it>
4416 * src/insets/insettext.C (InsetText): small fix in initialize
4417 widthOffset (should not be done in the init() function)
4419 2000-03-29 Amir Karger <karger@lyx.org>
4421 * lib/examples/it_ItemizeBullets.lyx: translation by
4424 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4426 2000-03-29 Juergen Vigna <jug@sad.it>
4428 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4430 * src/insets/insetfoot.C (Clone): small change as for the below
4431 new init function in the text-inset
4433 * src/insets/insettext.C (init): new function as I've seen that
4434 clone did not copy the Paragraph-Data!
4435 (LocalDispatch): Added code so that now we have some sort of Undo
4436 functionality (well actually we HAVE Undo ;)
4438 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4440 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4442 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4445 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4447 * src/main.C: added a runtime check that verifies that the xforms
4448 header used when building LyX and the library used when running
4449 LyX match. Exit with a message if they don't match. This is a
4450 version number check only.
4452 * src/buffer.C (save): Don't allocate memory on the heap for
4453 struct utimbuf times.
4455 * *: some using changes, use iosfwd instead of the real headers.
4457 * src/lyxfont.C use char const * instead of string for the static
4458 strings. Rewrite some functions to use sstream.
4460 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4462 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4465 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4467 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4468 of Geodesy (from Martin Vermeer)
4470 * lib/layouts/svjour.inc: include file for the Springer svjour
4471 class. It can be used to support journals other than JoG.
4473 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4474 Miskiewicz <misiek@pld.org.pl>)
4475 * lib/reLyX/Makefile.am: ditto.
4477 2000-03-27 Juergen Vigna <jug@sad.it>
4479 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4480 also some modifications with operations on selected text.
4482 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4483 problems with clicking on insets (last famous words ;)
4485 * src/insets/insetcommand.C (draw):
4486 (width): Changed to have a bit of space before and after the inset so
4487 that the blinking cursor can be seen (otherwise it was hidden)
4489 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4491 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4492 would not be added to the link list when an installed gettext (not
4493 part of libc) is found.
4495 2000-03-24 Juergen Vigna <jug@sad.it>
4497 * src/insets/insetcollapsable.C (Edit):
4498 * src/mathed/formula.C (InsetButtonRelease):
4499 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4502 * src/BufferView.C (workAreaButtonPress):
4503 (workAreaButtonRelease):
4504 (checkInsetHit): Finally fixed the clicking on insets be handled
4507 * src/insets/insetert.C (Edit): inserted this call so that ERT
4508 insets work always with LaTeX-font
4510 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4512 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4513 caused lyx to startup with no GUI in place, causing in a crash
4514 upon startup when called with arguments.
4516 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4518 * src/FontLoader.C: better initialization of dummyXFontStruct.
4520 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4522 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4523 for linuxdoc and docbook import and export format options.
4525 * lib/lyxrc.example Example of default values for the previous flags.
4527 * src/lyx_cb.C Use those flags instead of the hardwired values for
4528 linuxdoc and docbook export.
4530 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4533 * src/menus.C Added menus entries for the new import/exports formats.
4535 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4537 * src/lyxrc.*: Added support for running without Gui
4540 * src/FontLoader.C: sensible defaults if no fonts are needed
4542 * src/lyx_cb.C: New function ShowMessage (writes either to the
4543 minibuffer or cout in case of no gui
4544 New function AskOverwrite for common stuff
4545 Consequently various changes to call these functions
4547 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4548 wild guess at sensible screen resolution when having no gui
4550 * src/lyxfont.C: no gui, no fonts... set some defaults
4552 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4554 * src/LColor.C: made the command inset background a bit lighter.
4556 2000-03-20 Hartmut Goebel <goebel@noris.net>
4558 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4559 stdstruct.inc. Koma-Script added some title elements which
4560 otherwise have been listed below "bibliography". This split allows
4561 adding title elements to where they belong.
4563 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4564 define the additional tilte elements and then include
4567 * many other layout files: changed to include stdtitle.inc just
4568 before stdstruct.inc.
4570 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4572 * src/buffer.C: (save) Added the option to store all backup files
4573 in a single directory
4575 * src/lyxrc.[Ch]: Added variable \backupdir_path
4577 * lib/lyxrc.example: Added descriptions of recently added variables
4579 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4580 bibtex inset, not closing the bibtex popup when deleting the inset)
4582 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4584 * src/lyx_cb.C: add a couple using directives.
4586 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4587 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4588 import based on the filename.
4590 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4591 file would be imported at start, if the filename where of a sgml file.
4593 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4595 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4597 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4598 * src/lyxfont.h Replaced the member variable bits.direction by the
4599 member variable lang. Made many changes in other files.
4600 This allows having a multi-lingual document
4602 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4603 that change the current language to <l>.
4604 Removed the command "font-rtl"
4606 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4607 format for Hebrew documents)
4609 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4610 When auto_mathmode is "true", pressing a digit key in normal mode
4611 will cause entering into mathmode.
4612 If auto_mathmode is "rtl" then this behavior will be active only
4613 when writing right-to-left text.
4615 * src/text2.C (InsertStringA) The string is inserted using the
4618 * src/paragraph.C (GetEndLabel) Gives a correct result for
4619 footnote paragraphs.
4621 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4623 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4625 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4626 front of PasteParagraph. Never insert a ' '. This should at least
4627 fix some cause for the segfaults that we have been experiencing,
4628 it also fixes backspace behaviour slightly. (Phu!)
4630 * src/support/lstrings.C (compare_no_case): some change to make it
4631 compile with gcc 2.95.2 and stdlibc++-v3
4633 * src/text2.C (MeltFootnoteEnvironment): change type o
4634 first_footnote_par_is_not_empty to bool.
4636 * src/lyxparagraph.h: make text private. Changes in other files
4638 (fitToSize): new function
4639 (setContentsFromPar): new function
4640 (clearContents): new function
4641 (SetChar): new function
4643 * src/paragraph.C (readSimpleWholeFile): deleted.
4645 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4646 the file, just use a simple string instead. Also read the file in
4647 a more maintainable manner.
4649 * src/text2.C (InsertStringA): deleted.
4650 (InsertStringB): deleted.
4652 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4654 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4655 RedoParagraphs from the doublespace handling part, just set status
4656 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4657 done, but perhaps not like this.)
4659 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4661 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4662 character when inserting an inset.
4664 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4666 * src/bufferparams.C (readLanguage): now takes "default" into
4669 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4670 also initialize the toplevel_keymap with the default bindings from
4673 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4675 * all files using lyxrc: have lyxrc as a real variable and not a
4676 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4679 * src/lyxrc.C: remove double call to defaultKeyBindings
4681 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4682 toolbar defauls using lyxlex. Remove enums, structs, functions
4685 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4686 toolbar defaults. Also store default keybindings in a map.
4688 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4689 storing the toolbar defaults without any xforms dependencies.
4691 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4692 applied. Changed to use iterators.
4694 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4696 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4697 systems that don't have LINGUAS set to begin with.
4699 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4701 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4702 the list by Dekel Tsur.
4704 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4706 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4707 * src/insets/form_graphics.C: ditto.
4709 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4711 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4713 * src/bufferparams.C (readLanguage): use the new language map
4715 * src/intl.C (InitKeyMapper): use the new language map
4717 * src/lyx_gui.C (create_forms): use the new language map
4719 * src/language.[Ch]: New files. Used for holding the information
4720 about each language. Now! Use this new language map enhance it and
4721 make it really usable for our needs.
4723 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4725 * screen.C (ShowCursor): Removed duplicate code.
4726 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4727 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4729 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4732 * src/text.C Added TransformChar method. Used for rendering Arabic
4733 text correctly (change the glyphs of the letter according to the
4734 position in the word)
4739 * src/lyxrc.C Added lyxrc command {language_command_begin,
4740 language_command_end,language_command_ltr,language_command_rtl,
4741 language_package} which allows the use of either arabtex or Omega
4744 * src/lyx_gui.C (init)
4746 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4747 to use encoding for menu fonts which is different than the encoding
4750 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4751 do not load the babel package.
4752 To write an English document with Hebrew/Arabic, change the document
4753 language to "english".
4755 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4756 (alphaCounter): changed to return char
4757 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4759 * lib/lyxrc.example Added examples for Hebrew/Arabic
4762 * src/layout.C Added layout command endlabeltype
4764 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4766 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4768 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4770 * src/mathed/math_delim.C (search_deco): return a
4771 math_deco_struct* instead of index.
4773 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4775 * All files with a USE_OSTREAM_ONLY within: removed all code that
4776 was unused when USE_OSTREAM_ONLY is defined.
4778 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4779 of any less. Removed header and using.
4781 * src/text.C (GetVisibleRow): draw the string "Page Break
4782 (top/bottom)" on screen when drawing a pagebreak line.
4784 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4786 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
4788 * src/mathed/math_macro.C (draw): do some cast magic.
4791 * src/mathed/math_defs.h: change byte* argument to byte const*.
4793 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
4795 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
4796 know it is right to return InsetFoot* too, but cxx does not like
4799 * src/insets/insetcollapsable.[Ch] (Clone): make const.
4801 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
4803 * src/mathed/math_delim.C: change == to proper assignment.
4805 2000-03-09 Juergen Vigna <jug@sad.it>
4807 * src/insets/insettext.C (setPos): fixed various cursor positioning
4808 problems (via mouse and cursor-keys)
4809 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
4810 inset (still a small display problem but it works ;)
4812 * src/insets/insetcollapsable.C (draw): added button_top_y and
4813 button_bottom_y to have correct values for clicking on the inset.
4815 * src/support/lyxalgo.h: commented out 'using std::less'
4817 2000-03-08 Juergen Vigna <jug@sad.it>
4819 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
4820 Button-Release event closes as it is alos the Release-Event
4823 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
4825 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4827 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
4828 can add multiple spaces in Scrap (literate programming) styles...
4829 which, by the way, is how I got hooked on LyX to begin with.
4831 * src/mathed/formula.C (Write): Added dummy variable to an
4832 inset::Latex() call.
4833 (Latex): Add free_spacing boolean to inset::Latex()
4835 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
4837 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
4838 virtual function to include the free_spacing boolean from
4839 the containing paragraph's style.
4841 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
4842 Added free_spacing boolean arg to match inset.h
4844 * src/insets/insettext.C, src/insets/insettext.h (Latex):
4845 Added free_spacing boolean arg to match inset.h
4847 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
4848 Added free_spacing boolean and made sure that if in a free_spacing
4849 paragraph, that we output normal space if there is a protected space.
4851 * src/insets/insetref.C, src/insets/insetref.h (Latex):
4852 Added free_spacing boolean arg to match inset.h
4854 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
4855 Added free_spacing boolean arg to match inset.h
4857 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
4858 Added free_spacing boolean arg to match inset.h
4860 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
4861 Added free_spacing boolean arg to match inset.h
4863 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
4864 Added free_spacing boolean arg to match inset.h
4866 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
4867 free_spacing boolean arg to match inset.h
4869 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
4870 Added free_spacing boolean arg to match inset.h
4872 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
4873 Added free_spacing boolean arg to match inset.h
4875 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
4876 Added free_spacing boolean arg to match inset.h
4878 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
4879 Added free_spacing boolean arg to match inset.h
4881 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
4882 Added free_spacing boolean arg to match inset.h
4884 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
4885 free_spacing boolean arg to match inset.h
4887 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
4888 free_spacing boolean arg to match inset.h
4890 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
4891 ignore free_spacing paragraphs. The user's spaces are left
4894 * src/text.C (InsertChar): Fixed the free_spacing layout
4895 attribute behavior. Now, if free_spacing is set, you can
4896 add multiple spaces in a paragraph with impunity (and they
4897 get output verbatim).
4898 (SelectSelectedWord): Added dummy argument to inset::Latex()
4901 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
4904 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
4905 paragraph layouts now only input a simple space instead.
4906 Special character insets don't make any sense in free-spacing
4909 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
4910 hard-spaces in the *input* file to simple spaces if the layout
4911 is free-spacing. This converts old files which had to have
4912 hard-spaces in free-spacing layouts where a simple space was
4914 (writeFileAscii): Added free_spacing check to pass to the newly
4915 reworked inset::Latex(...) methods. The inset::Latex() code
4916 ensures that hard-spaces in free-spacing paragraphs get output
4917 as spaces (rather than "~").
4919 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4921 * src/mathed/math_delim.C (draw): draw the empty placeholder
4922 delims with a onoffdash line.
4923 (struct math_deco_compare): struct that holds the "functors" used
4924 for the sort and the binary search in math_deco_table.
4925 (class init_deco_table): class used for initial sort of the
4927 (search_deco): use lower_bound to do a binary search in the
4930 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4932 * src/lyxrc.C: a small secret thingie...
4934 * src/lyxlex.C (printTable): changed to take a ostream as paramter
4935 and to not flush the stream as often as it used to.
4937 * src/support/lyxalgo.h: new file
4938 (sorted): template function used for checking if a sequence is
4939 sorted or not. Two versions with and without user supplied
4940 compare. Uses same compare as std::sort.
4942 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
4943 it and give warning on lyxerr.
4945 (struct compare_tags): struct with function operators used for
4946 checking if sorted, sorting and lower_bound.
4947 (search_kw): use lower_bound instead of manually implemented
4950 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4952 * src/insets/insetcollapsable.h: fix Clone() declaration.
4953 * src/insets/insetfoot.h: ditto.
4955 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
4957 2000-03-08 Juergen Vigna <jug@sad.it>
4959 * src/insets/lyxinset.h: added owner call which tells us if
4960 this inset is inside another inset. Changed also the return-type
4961 of Editable to an enum so it tells clearer what the return-value is.
4963 * src/insets/insettext.C (computeTextRows): fixed computing of
4964 textinsets which split automatically on more rows.
4966 * src/insets/insetert.[Ch]: changed this to be of BaseType
4969 * src/insets/insetfoot.[Ch]: added footnote inset
4971 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
4972 collapsable insets (like footnote, ert, ...)
4974 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4976 * src/lyxdraw.h: remvoe file
4978 * src/lyxdraw.C: remove file
4980 * src/insets/insettext.C: added <algorithm>.
4982 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4984 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
4985 (matrix_cb): case MM_OK use string stream
4987 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
4990 * src/mathed/math_macro.C (draw): use string stream
4991 (Metrics): use string stream
4993 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
4994 directly to the ostream.
4996 * src/vspace.C (asString): use string stream.
4997 (asString): use string stream
4998 (asLatexString): use string stream
5000 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5001 setting Spacing::Other.
5003 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5004 sprintf when creating the stretch vale.
5006 * src/text2.C (alphaCounter): changed to return a string and to
5007 not use a static variable internally. Also fixed a one-off bug.
5008 (SetCounter): changed the drawing of the labels to use string
5009 streams instead of sprintf.
5011 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5012 manipulator to use a scheme that does not require library support.
5013 This is also the way it is done in the new GNU libstdc++. Should
5014 work with DEC cxx now.
5016 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5018 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5019 end. This fixes a bug.
5021 * src/mathed (all files concerned with file writing): apply the
5022 USE_OSTREAM_ONLY changes to mathed too.
5024 * src/support/DebugStream.h: make the constructor explicit.
5026 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5027 count and ostream squashed.
5029 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5031 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5033 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5034 ostringstream uses STL strings, and we might not.
5036 * src/insets/insetspecialchar.C: add using directive.
5037 * src/insets/insettext.C: ditto.
5039 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5041 * lib/layouts/seminar.layout: feeble attempt at a layout for
5042 seminar.cls, far from completet and could really use some looking
5043 at from people used to write layout files.
5045 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5046 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5047 a lot nicer and works nicely with ostreams.
5049 * src/mathed/formula.C (draw): a slightly different solution that
5050 the one posted to the list, but I think this one works too. (font
5051 size wrong in headers.)
5053 * src/insets/insettext.C (computeTextRows): some fiddling on
5054 Jürgens turf, added some comments that he should read.
5056 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5057 used and it gave compiler warnings.
5058 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5061 * src/lyx_gui.C (create_forms): do the right thing when
5062 show_banner is true/false.
5064 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5065 show_banner is false.
5067 * most file writing files: Now use iostreams to do almost all of
5068 the writing. Also instead of passing string &, we now use
5069 stringstreams. mathed output is still not adapted to iostreams.
5070 This change can be turned off by commenting out all the occurences
5071 of the "#define USE_OSTREAM_ONLY 1" lines.
5073 * src/WorkArea.C (createPixmap): don't output debug messages.
5074 (WorkArea): don't output debug messages.
5076 * lib/lyxrc.example: added a comment about the new variable
5079 * development/Code_rules/Rules: Added some more commente about how
5080 to build class interfaces and on how better encapsulation can be
5083 2000-03-03 Juergen Vigna <jug@sad.it>
5085 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5086 automatically with the width of the LyX-Window
5088 * src/insets/insettext.C (computeTextRows): fixed update bug in
5089 displaying text-insets (scrollvalues where not initialized!)
5091 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5093 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5094 id in the check of the result from lower_bound is not enough since
5095 lower_bound can return last too, and then res->id will not be a
5098 * all insets and some code that use them: I have conditionalized
5099 removed the Latex(string & out, ...) this means that only the
5100 Latex(ostream &, ...) will be used. This is a work in progress to
5101 move towards using streams for all output of files.
5103 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5106 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5108 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5109 routine (this fixes bug where greek letters were surrounded by too
5112 * src/support/filetools.C (findtexfile): change a bit the search
5113 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5114 no longer passed to kpsewhich, we may have to change that later.
5116 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5117 warning options to avoid problems with X header files (from Angus
5119 * acinclude.m4: regenerated.
5121 2000-03-02 Juergen Vigna <jug@sad.it>
5123 * src/insets/insettext.C (WriteParagraphData): Using the
5124 par->writeFile() function for writing paragraph-data.
5125 (Read): Using buffer->parseSingleLyXformat2Token()-function
5126 for parsing paragraph data!
5128 * src/buffer.C (readLyXformat2): removed all parse data and using
5129 the new parseSingleLyXformat2Token()-function.
5130 (parseSingleLyXformat2Token): added this function to parse (read)
5131 lyx-file-format (this is called also from text-insets now!)
5133 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5135 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5138 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5139 directly instead of going through a func. One very bad thing: a
5140 static LyXFindReplace, but I don't know where to place it.
5142 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5143 string instead of char[]. Also changed to static.
5144 (GetSelectionOrWordAtCursor): changed to static inline
5145 (SetSelectionOverLenChars): ditto.
5147 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5148 current_view and global variables. both classes has changed names
5149 and LyXFindReplace is not inherited from SearchForm.
5151 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5152 fl_form_search form.
5154 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5156 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5158 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5159 bound (from Kayvan).
5161 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5163 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5165 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5167 * some things that I should comment but the local pub says head to
5170 * comment out all code that belongs to the Roff code for Ascii
5171 export of tables. (this is unused)
5173 * src/LyXView.C: use correct type for global variable
5174 current_layout. (LyXTextClass::size_type)
5176 * some code to get the new insetgraphics closer to working I'd be
5177 grateful for any help.
5179 * src/BufferView2.C (insertInset): use the return type of
5180 NumberOfLayout properly. (also changes in other files)
5182 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5183 this as a test. I want to know what breaks because of this.
5185 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5187 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5189 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5190 to use a \makebox in the label, this allows proper justification
5191 with out using protected spaces or multiple hfills. Now it is
5192 "label" for left justified, "\hfill label\hfill" for center, and
5193 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5194 should be changed accordingly.
5196 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5198 * src/lyxtext.h: change SetLayout() to take a
5199 LyXTextClass::size_type instead of a char (when there is more than
5200 127 layouts in a class); also change type of copylayouttype.
5201 * src/text2.C (SetLayout): ditto.
5202 * src/LyXView.C (updateLayoutChoice): ditto.
5204 * src/LaTeX.C (scanLogFile): errors where the line number was not
5205 given just after the '!'-line were ignored (from Dekel Tsur).
5207 * lib/lyxrc.example: fix description of \date_insert_format
5209 * lib/layouts/llncs.layout: new layout, contributed by Martin
5212 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5214 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5215 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5216 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5217 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5218 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5219 paragraph.C, text.C, text2.C)
5221 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5223 * src/insets/insettext.C (LocalDispatch): remove extra break
5226 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5227 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5229 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5230 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5232 * src/insets/insetbib.h: move InsetBibkey::Holder and
5233 InsetCitation::Holder in public space.
5235 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5237 * src/insets/insettext.h: small change to get the new files from
5238 Juergen to compile (use "string", not "class string").
5240 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5241 const & as parameter to LocalDispatch, use LyXFont const & as
5242 paramter to some other func. This also had impacto on lyxinsets.h
5243 and the two mathed insets.
5245 2000-02-24 Juergen Vigna <jug@sad.it>
5248 * src/commandtags.h:
5250 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5254 * src/BufferView2.C: added/updated code for various inset-functions
5256 * src/insets/insetert.[Ch]: added implementation of InsetERT
5258 * src/insets/insettext.[Ch]: added implementation of InsetText
5260 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5261 (draw): added preliminary code for inset scrolling not finshed yet
5263 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5264 as it is in lyxfunc.C now
5266 * src/insets/lyxinset.h: Added functions for text-insets
5268 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5270 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5271 BufferView and reimplement the list as a queue put inside its own
5274 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5276 * several files: use the new interface to the "updateinsetlist"
5278 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5280 (work_area_handler): call BufferView::trippleClick on trippleclick.
5282 * src/BufferView.C (doubleClick): new function, selects word on
5284 (trippleClick): new function, selects line on trippleclick.
5286 2000-02-22 Allan Rae <rae@lyx.org>
5288 * lib/bind/xemacs.bind: buffer-previous not supported
5290 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5292 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5295 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5297 * src/bufferlist.C: get rid of current_view from this file
5299 * src/spellchecker.C: get rid of current_view from this file
5301 * src/vspace.C: get rid of current_view from this file
5302 (inPixels): added BufferView parameter for this func
5303 (asLatexCommand): added a BufferParams for this func
5305 * src/text.C src/text2.C: get rid of current_view from these
5308 * src/lyxfont.C (getFontDirection): move this function here from
5311 * src/bufferparams.C (getDocumentDirection): move this function
5314 * src/paragraph.C (getParDirection): move this function here from
5316 (getLetterDirection): ditto
5318 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5320 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5321 resize due to wrong pixmap beeing used. Also took the opurtunity
5322 to make the LyXScreen stateless on regard to WorkArea and some
5323 general cleanup in the same files.
5325 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5327 * src/Makefile.am: add missing direction.h
5329 * src/PainterBase.h: made the width functions const.
5331 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5334 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5336 * src/insets/insetlatexaccent.C (draw): make the accents draw
5337 better, at present this will only work well with iso8859-1.
5339 * several files: remove the old drawing code, now we use the new
5342 * several files: remove support for mono_video, reverse_video and
5345 2000-02-17 Juergen Vigna <jug@sad.it>
5347 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5348 int ** as we have to return the pointer, otherwise we have only
5349 NULL pointers in the returning function.
5351 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5353 * src/LaTeX.C (operator()): quote file name when running latex.
5355 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5357 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5358 (bubble tip), this removes our special handling of this.
5360 * Remove all code that is unused now that we have the new
5361 workarea. (Code that are not active when NEW_WA is defined.)
5363 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5365 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5367 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5368 nonexisting layout; correctly redirect obsoleted layouts.
5370 * lib/lyxrc.example: document \view_dvi_paper_option
5372 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5375 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5376 (PreviewDVI): handle the view_dvi_paper_option variable.
5377 [Both from Roland Krause]
5379 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5381 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5382 char const *, int, LyXFont)
5383 (text(int, int, string, LyXFont)): ditto
5385 * src/text.C (InsertCharInTable): attempt to fix the double-space
5386 feature in tables too.
5387 (BackspaceInTable): ditto.
5388 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5390 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5392 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5394 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5395 newly found text in textcache to this.
5396 (buffer): set the owner of the text put into the textcache to 0
5398 * src/insets/figinset.C (draw): fixed the drawing of figures with
5401 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5402 drawing of mathframe, hfills, protected space, table lines. I have
5403 now no outstanding drawing problems with the new Painter code.
5405 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5407 * src/PainterBase.C (ellipse, circle): do not specify the default
5410 * src/LColor.h: add using directive.
5412 * src/Painter.[Ch]: change return type of methods from Painter& to
5413 PainterBase&. Add a using directive.
5415 * src/WorkArea.C: wrap xforms callbacks in C functions
5418 * lib/layouts/foils.layout: font fix and simplifications from Carl
5421 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5423 * a lot of files: The Painter, LColor and WorkArea from the old
5424 devel branch has been ported to lyx-devel. Some new files and a
5425 lot of #ifdeffed code. The new workarea is enabled by default, but
5426 if you want to test the new Painter and LColor you have to compile
5427 with USE_PAINTER defined (do this in config.h f.ex.) There are
5428 still some rought edges, and I'd like some help to clear those
5429 out. It looks stable (loads and displays the Userguide very well).
5432 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5434 * src/buffer.C (pop_tag): revert to the previous implementation
5435 (use a global variable for both loops).
5437 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5439 * src/lyxrc.C (LyXRC): change slightly default date format.
5441 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5442 there is an English text with a footnote that starts with a Hebrew
5443 paragraph, or vice versa.
5444 (TeXFootnote): ditto.
5446 * src/text.C (LeftMargin): allow for negative values for
5447 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5450 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5451 for input encoding (cyrillic)
5453 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5455 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5458 * src/toolbar.C (set): ditto
5459 * src/insets/insetbib.C (create_form_citation_form): ditto
5461 * lib/CREDITS: added Dekel Tsur.
5463 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5464 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5465 hebrew supports files from Dekel Tsur.
5467 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5468 <tzafrir@technion.ac.il>
5470 * src/lyxrc.C: put \date_insert_format at the right place.
5472 * src/buffer.C (makeLaTeXFile): fix the handling of
5473 BufferParams::sides when writing out latex files.
5475 * src/BufferView2.C: add a "using" directive.
5477 * src/support/lyxsum.C (sum): when we use lyxstring,
5478 ostringstream::str needs an additional .c_str().
5480 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5482 * src/support/filetools.C (ChangeExtension): patch from Etienne
5485 * src/TextCache.C (show): remove const_cast and make second
5486 parameter non-const LyXText *.
5488 * src/TextCache.h: use non const LyXText in show.
5490 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5493 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5495 * src/support/lyxsum.C: rework to be more flexible.
5497 * several places: don't check if a pointer is 0 if you are going
5500 * src/text.C: remove some dead code.
5502 * src/insets/figinset.C: remove some dead code
5504 * src/buffer.C: move the BufferView funcs to BufferView2.C
5505 remove all support for insetlatexdel
5506 remove support for oldpapersize stuff
5507 made some member funcs const
5509 * src/kbmap.C: use a std::list to store the bindings in.
5511 * src/BufferView2.C: new file
5513 * src/kbsequence.[Ch]: new files
5515 * src/LyXAction.C + others: remove all trace of buffer-previous
5517 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5518 only have one copy in the binary of this table.
5520 * hebrew patch: moved some functions from LyXText to more
5521 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5523 * several files: remove support for XForms older than 0.88
5525 remove some #if 0 #endif code
5527 * src/TextCache.[Ch]: new file. Holds the textcache.
5529 * src/BufferView.C: changes to use the new TextCache interface.
5530 (waitForX): remove the now unused code.
5532 * src/BackStack.h: remove some commented code
5534 * lib/bind/emacs.bind: remove binding for buffer-previous
5536 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5538 * applied the hebrew patch.
5540 * src/lyxrow.h: make sure that all Row variables are initialized.
5542 * src/text2.C (TextHandleUndo): comment out a delete, this might
5543 introduce a memory leak, but should also help us to not try to
5544 read freed memory. We need to look at this one.
5546 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5547 (LyXParagraph): initalize footnotekind.
5549 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5550 forgot this when applying the patch. Please heed the warnings.
5552 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5553 (aka. reformat problem)
5555 * src/bufferlist.C (exists): made const, and use const_iterator
5556 (isLoaded): new func.
5557 (release): use std::find to find the correct buffer.
5559 * src/bufferlist.h: made getState a const func.
5560 made empty a const func.
5561 made exists a const func.
5564 2000-02-01 Juergen Vigna <jug@sad.it>
5566 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5568 * po/it.po: updated a bit the italian po file and also changed the
5569 'file nuovo' for newfile to 'filenuovo' without a space, this did
5572 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5573 for the new insert_date command.
5575 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5576 from jdblair, to insert a date into the current text conforming to
5577 a strftime format (for now only considering the locale-set and not
5578 the document-language).
5580 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5582 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5583 Bounds Read error seen by purify. The problem was that islower is
5584 a macros which takes an unsigned char and uses it as an index for
5585 in array of characters properties (and is thus subject to the
5589 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5590 correctly the paper sides radio buttons.
5591 (UpdateDocumentButtons): ditto.
5593 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5595 * src/kbmap.C (getsym + others): change to return unsigned int,
5596 returning a long can give problems on 64 bit systems. (I assume
5597 that int is 32bit on 64bit systems)
5599 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5601 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5602 LyXLookupString to be zero-terminated. Really fixes problems seen
5605 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5607 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5608 write a (char*)0 to the lyxerr stream.
5610 * src/lastfiles.C: move algorithm before the using statemets.
5612 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5614 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5615 complains otherwise).
5616 * src/table.C: ditto
5618 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5621 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5622 that I removed earlier... It is really needed.
5624 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5626 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5628 * INSTALL: update xforms home page URL.
5630 * lib/configure.m4: fix a bug with unreadable layout files.
5632 * src/table.C (calculate_width_of_column): add "using std::max"
5635 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5637 * several files: marked several lines with "DEL LINE", this is
5638 lines that can be deleted without changing anything.
5639 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5640 checks this anyway */
5643 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5645 * src/DepTable.C (update): add a "+" at the end when the checksum
5646 is different. (debugging string only)
5648 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5649 the next inset to not be displayed. This should also fix the list
5650 of labels in the "Insert Crossreference" dialog.
5652 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5654 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5655 when regex was not found.
5657 * src/support/lstrings.C (lowercase): use handcoded transform always.
5660 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5661 old_cursor.par->prev could be 0.
5663 * several files: changed post inc/dec to pre inc/dec
5665 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5666 write the lastfiles to file.
5668 * src/BufferView.C (buffer): only show TextCache info when debugging
5670 (resizeCurrentBuffer): ditto
5671 (workAreaExpose): ditto
5673 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5675 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5677 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5678 a bit better by removing the special case for \i and \j.
5680 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5682 * src/lyx_main.C (easyParse): remove test for bad comand line
5683 options, since this broke all xforms-related parsing.
5685 * src/kbmap.C (getsym): set return type to unsigned long, as
5686 declared in header. On an alpha, long is _not_ the same as int.
5688 * src/support/LOstream.h: add a "using std::flush;"
5690 * src/insets/figinset.C: ditto.
5692 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5694 * src/bufferlist.C (write): use blinding fast file copy instead of
5695 "a char at a time", now we are doing it the C++ way.
5697 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5698 std::list<int> instead.
5699 (addpidwait): reflect move to std::list<int>
5700 (sigchldchecker): ditto
5702 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5705 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5706 that obviously was wrong...
5708 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5709 c, this avoids warnings with purify and islower.
5711 * src/insets/figinset.C: rename struct queue to struct
5712 queue_element and rewrite to use a std::queue. gsqueue is now a
5713 std::queue<queue_element>
5714 (runqueue): reflect move to std::queue
5717 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5718 we would get "1" "0" instead of "true" "false. Also make the tostr
5721 2000-01-21 Juergen Vigna <jug@sad.it>
5723 * src/buffer.C (writeFileAscii): Disabled code for special groff
5724 handling of tabulars till I fix this in table.C
5726 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5728 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5730 * src/support/lyxlib.h: ditto.
5732 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5734 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5735 and 'j' look better. This might fix the "macron" bug that has been
5738 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5739 functions as one template function. Delete the old versions.
5741 * src/support/lyxsum.C: move using std::ifstream inside
5744 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5747 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5749 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5751 * src/insets/figinset.C (InitFigures): use new instead of malloc
5752 to allocate memory for figures and bitmaps.
5753 (DoneFigures): use delete[] instead of free to deallocate memory
5754 for figures and bitmaps.
5755 (runqueue): use new to allocate
5756 (getfigdata): use new/delete[] instead of malloc/free
5757 (RegisterFigure): ditto
5759 * some files: moved some declarations closer to first use, small
5760 whitespace changes use preincrement instead of postincrement where
5761 it does not make a difference.
5763 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5764 step on the way to use stl::containers for key maps.
5766 * src/bufferlist.h: add a typedef for const_iterator and const
5767 versions of begin and end.
5769 * src/bufferlist.[Ch]: change name of member variable _state to
5770 state_. (avoid reserved names)
5772 (getFileNames): returns the filenames of the buffers in a vector.
5774 * configure.in (ALL_LINGUAS): added ro
5776 * src/support/putenv.C: new file
5778 * src/support/mkdir.C: new file
5780 2000-01-20 Allan Rae <rae@lyx.org>
5782 * lib/layouts/IEEEtran.layout: Added several theorem environments
5784 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5785 couple of minor additions.
5787 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
5788 (except for those in footnotes of course)
5790 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
5794 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
5795 std::sort and std::lower_bound instead of qsort and handwritten
5797 (struct compara): struct that holds the functors used by std::sort
5798 and std::lower_bound in MathedLookupBOP.
5800 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5802 * src/support/LAssert.h: do not do partial specialization. We do
5805 * src/support/lyxlib.h: note that lyx::getUserName() and
5806 lyx::date() are not in use right now. Should these be suppressed?
5808 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
5809 (makeLinuxDocFile): do not put date and user name in linuxdoc
5812 * src/support/lyxlib.h (kill): change first argument to long int,
5813 since that's what solaris uses.
5815 * src/support/kill.C (kill): fix declaration to match prototype.
5817 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
5818 actually check whether namespaces are supported. This is not what
5821 * src/support/lyxsum.C: add a using directive.
5823 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5825 * src/support/kill.C: if we have namespace support we don't have
5826 to include lyxlib.h.
5828 * src/support/lyxlib.h: use namespace lyx if supported.
5830 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5832 * src/support/date.C: new file
5834 * src/support/chdir.C: new file
5836 * src/support/getUserName.C: new file
5838 * src/support/getcwd.C: new file
5840 * src/support/abort.C: new file
5842 * src/support/kill.C: new file
5844 * src/support/lyxlib.h: moved all the functions in this file
5845 insede struct lyx. Added also kill and abort to this struct. This
5846 is a way to avoid the "kill is not defined in <csignal>", we make
5847 C++ wrappers for functions that are not ANSI C or ANSI C++.
5849 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
5850 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
5851 lyx it has been renamed to sum.
5853 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5855 * src/text.C: add using directives for std::min and std::max.
5857 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5859 * src/texrow.C (getIdFromRow): actually return something useful in
5860 id and pos. Hopefully fixes the bug with positionning of errorbox
5863 * src/lyx_main.C (easyParse): output an error and exit if an
5864 incorrect command line option has been given.
5866 * src/spellchecker.C (ispell_check_word): document a memory leak.
5868 * src/bufferlist.C (write): fix mismatched allocation/deletion,
5869 where a "struct utimbuf" is allocated with "new" and deleted with
5872 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
5874 * src/text2.C (CutSelection): don't delete double spaces.
5875 (PasteSelection): ditto
5876 (CopySelection): ditto
5878 * src/text.C (Backspace): don't delete double spaces.
5880 * src/lyxlex.C (next): fix a bug that were only present with
5881 conformant std::istream::get to read comment lines, use
5882 std::istream::getline instead. This seems to fix the problem.
5884 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5886 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
5887 allowed to insert space before space" editing problem. Please read
5888 commends at the beginning of the function. Comments about usage
5891 * src/text.C (InsertChar): fix for the "not allowed to insert
5892 space before space" editing problem.
5894 * src/text2.C (DeleteEmptyParagraphMechanism): when
5895 IsEmptyTableRow can only return false this last "else if" will
5896 always be a no-op. Commented out.
5898 * src/text.C (RedoParagraph): As far as I can understand tmp
5899 cursor is not really needed.
5901 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
5902 present it could only return false anyway.
5903 (several functions): Did something not so smart...added a const
5904 specifier on a lot of methods.
5906 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
5907 and add a tmp->text.resize. The LyXParagraph constructor does the
5909 (BreakParagraphConservative): ditto
5911 * src/support/path.h (Path): add a define so that the wrong usage
5912 "Path("/tmp") will be flagged as a compilation error:
5913 "`unnamed_Path' undeclared (first use this function)"
5915 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5917 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
5918 which was bogus for several reasons.
5920 * src/LaTeX.C (scanAux): fix the regular expression used to scan
5924 * autogen.sh: do not use "type -path" (what's that anyway?).
5926 * src/support/filetools.C (findtexfile): remove extraneous space
5927 which caused a kpsewhich warning (at least with kpathsea version
5930 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5932 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
5934 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
5936 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
5938 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5940 * src/paragraph.C (BreakParagraph): do not reserve space on text
5941 if we don't need to (otherwise, if pos_end < pos, we end up
5942 reserving huge amounts of memory due to bad unsigned karma).
5943 (BreakParagraphConservative): ditto, although I have not seen
5944 evidence the bug can happen here.
5946 * src/lyxparagraph.h: add a using std::list.
5948 2000-01-11 Juergen Vigna <jug@sad.it>
5950 * src/menus.C (MenuDocu): output an Alert if the documentation-file
5953 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5955 * src/vc-backend.C (doVCCommand): change to be static and take one
5956 more parameter: the path to chdir too be fore executing the command.
5957 (retrive): new function equiv to "co -r"
5959 * src/bufferlist.C (loadLyXFile): implement the missing parts if
5960 file_not_found_hook is true.
5962 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
5964 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
5965 if a file is readwrite,readonly...anything else.
5967 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5969 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
5970 (CreatePostscript): name change from MenuRunDVIPS (or something)
5971 (PreviewPostscript): name change from MenuPreviewPS
5972 (PreviewDVI): name change from MenuPreviewDVI
5974 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
5975 \view_pdf_command., \pdf_to_ps_command
5977 * lib/configure.m4: added search for PDF viewer, and search for
5978 PDF to PS converter.
5979 (lyxrc.defaults output): add \pdflatex_command,
5980 \view_pdf_command and \pdf_to_ps_command.
5982 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
5984 * src/bufferlist.C (write): we don't use blocksize for anything so
5987 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5989 * src/support/block.h: disable operator T* (), since it causes
5990 problems with both compilers I tried. See comments in the file.
5992 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
5995 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
5996 variable LYX_DIR_10x to LYX_DIR_11x.
5998 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6000 * INSTALL: document --with-lyxname.
6003 * configure.in: new configure flag --with-lyxname which allows to
6004 choose the name under which lyx is installed. Default is "lyx", of
6005 course. It used to be possible to do this with --program-suffix,
6006 but the later has in fact a different meaning for autoconf.
6008 * src/support/lstrings.h (lstrchr): reformat a bit.
6010 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6011 * src/mathed/math_defs.h: ditto.
6013 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6015 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6016 true, decides if we create a backup file or not when saving. New
6017 tag and variable \pdf_mode, defaults to false. New tag and
6018 variable \pdflatex_command, defaults to pdflatex. New tag and
6019 variable \view_pdf_command, defaults to xpdf. New tag and variable
6020 \pdf_to_ps_command, defaults to pdf2ps.
6022 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6024 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6025 does not have a BufferView.
6026 (unlockInset): ditto + don't access the_locking_inset if the
6027 buffer does not have a BufferView.
6029 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6030 certain circumstances so that we don't continue a keyboard
6031 operation long after the key was released. Try f.ex. to load a
6032 large document, press PageDown for some seconds and then release
6033 it. Before this change the document would contine to scroll for
6034 some time, with this change it stops imidiatly.
6036 * src/support/block.h: don't allocate more space than needed. As
6037 long as we don't try to write to the arr[x] in a array_type arr[x]
6038 it is perfectly ok. (if you write to it you might segfault).
6039 added operator value_type*() so that is possible to pass the array
6040 to functions expecting a C-pointer.
6042 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6045 * intl/*: updated to gettext 0.10.35, tried to add our own
6046 required modifications. Please verify.
6048 * po/*: updated to gettext 0.10.35, tried to add our own required
6049 modifications. Please verify.
6051 * src/support/lstrings.C (tostr): go at fixing the problem with
6052 cxx and stringstream. When stringstream is used return
6053 oss.str().c_str() so that problems with lyxstring and basic_string
6054 are avoided. Note that the best solution would be for cxx to use
6055 basic_string all the way, but it is not conformant yet. (it seems)
6057 * src/lyx_cb.C + other files: moved several global functions to
6058 class BufferView, some have been moved to BufferView.[Ch] others
6059 are still located in lyx_cb.C. Code changes because of this. (part
6060 of "get rid of current_view project".)
6062 * src/buffer.C + other files: moved several Buffer functions to
6063 class BufferView, the functions are still present in buffer.C.
6064 Code changes because of this.
6066 * config/lcmessage.m4: updated to most recent. used when creating
6069 * config/progtest.m4: updated to most recent. used when creating
6072 * config/gettext.m4: updated to most recent. applied patch for
6075 * config/gettext.m4.patch: new file that shows what changes we
6076 have done to the local copy of gettext.m4.
6078 * config/libtool.m4: new file, used in creation of acinclude.m4
6080 * config/lyxinclude.m4: new file, this is the lyx created m4
6081 macros, used in making acinclude.m4.
6083 * autogen.sh: GNU m4 discovered as a separate task not as part of
6084 the lib/configure creation.
6085 Generate acinlucde from files in config. Actually cat
6086 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6087 easier to upgrade .m4 files that really are external.
6089 * src/Spacing.h: moved using std::istringstream to right after
6090 <sstream>. This should fix the problem seen with some compilers.
6092 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6094 * src/lyx_cb.C: began some work to remove the dependency a lot of
6095 functions have on BufferView::text, even if not really needed.
6096 (GetCurrentTextClass): removed this func, it only hid the
6099 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6100 forgot this in last commit.
6102 * src/Bullet.C (bulletEntry): use static char const *[] for the
6103 tables, becuase of this the return arg had to change to string.
6105 (~Bullet): removed unneeded destructor
6107 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6108 (insetSleep): moved from Buffer
6109 (insetWakeup): moved from Buffer
6110 (insetUnlock): moved from Buffer
6112 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6113 from Buffer to BufferView.
6115 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6117 * config/ltmain.sh: updated to version 1.3.4 of libtool
6119 * config/ltconfig: updated to version 1.3.4 of libtool
6121 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6124 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6125 Did I get that right?
6127 * src/lyxlex.h: add a "using" directive or two.
6128 * src/Spacing.h: ditto.
6129 * src/insets/figinset.C: ditto.
6130 * src/support/filetools.C: ditto.
6131 * src/support/lstrings.C: ditto.
6132 * src/BufferView.C: ditto.
6133 * src/bufferlist.C: ditto.
6134 * src/lyx_cb.C: ditto.
6135 * src/lyxlex.C: ditto.
6137 * NEWS: add some changes for 1.1.4.
6139 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6141 * src/BufferView.C: first go at a TextCache to speed up switching
6144 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6146 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6147 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6148 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6149 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6152 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6153 members of the struct are correctly initialized to 0 (detected by
6155 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6156 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6158 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6159 pidwait, since it was allocated with "new". This was potentially
6160 very bad. Thanks to Michael Schmitt for running purify for us.
6163 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6165 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6167 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6169 1999-12-30 Allan Rae <rae@lyx.org>
6171 * lib/templates/IEEEtran.lyx: minor change
6173 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6174 src/mathed/formula.C (LocalDispatch): askForText changes
6176 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6177 know when a user has cancelled input. Fixes annoying problems with
6178 inserting labels and version control.
6180 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6182 * src/support/lstrings.C (tostr): rewritten to use strstream and
6185 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6187 * src/support/filetools.C (IsFileWriteable): use fstream to check
6188 (IsDirWriteable): use fileinfo to check
6190 * src/support/filetools.h (FilePtr): whole class deleted
6192 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6194 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6196 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6198 * src/bufferlist.C (write): use ifstream and ofstream instead of
6201 * src/Spacing.h: use istrstream instead of sscanf
6203 * src/mathed/math_defs.h: change first arg to istream from FILE*
6205 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6207 * src/mathed/math_parser.C: have yyis to be an istream
6208 (LexGetArg): use istream (yyis)
6210 (mathed_parse): ditto
6211 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6213 * src/mathed/formula.C (Read): rewritten to use istream
6215 * src/mathed/formulamacro.C (Read): rewritten to use istream
6217 * src/lyxlex.h (~LyXLex): deleted desturctor
6218 (getStream): new function, returns an istream
6219 (getFile): deleted funtion
6220 (IsOK): return is.good();
6222 * src/lyxlex.C (LyXLex): delete file and owns_file
6223 (setFile): open an filebuf and assign that to a istream instead of
6225 (setStream): new function, takes an istream as arg.
6226 (setFile): deleted function
6227 (EatLine): rewritten us use istream instead of FILE*
6231 * src/table.C (LyXTable): use istream instead of FILE*
6232 (Read): rewritten to take an istream instead of FILE*
6234 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6236 * src/buffer.C (Dispatch): remove an extraneous break statement.
6238 * src/support/filetools.C (QuoteName): change to do simple
6239 'quoting'. More work is necessary. Also changed to do nothing
6240 under emx (needs fix too).
6241 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6243 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6244 config.h.in to the AC_DEFINE_UNQUOTED() call.
6245 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6246 needs char * as argument (because Solaris 7 declares it like
6249 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6250 remove definition of BZERO.
6252 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6254 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6255 defined, "lyxregex.h" if not.
6257 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6259 (REGEX): new variable that is set to regex.c lyxregex.h when
6260 AM_CONDITIONAL USE_REGEX is set.
6261 (libsupport_la_SOURCES): add $(REGEX)
6263 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6266 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6269 * configure.in: add call to LYX_REGEX
6271 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6272 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6274 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6276 * lib/bind/fi_menus.bind: new file, from
6277 pauli.virtanen@saunalahti.fi.
6279 * src/buffer.C (getBibkeyList): pass the parameter delim to
6280 InsetInclude::getKeys and InsetBibtex::getKeys.
6282 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6283 is passed to Buffer::getBibkeyList
6285 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6286 instead of the hardcoded comma.
6288 * src/insets/insetbib.C (getKeys): make sure that there are not
6289 leading blanks in bibtex keys. Normal latex does not care, but
6290 harvard.sty seems to dislike blanks at the beginning of citation
6291 keys. In particular, the retturn value of the function is
6293 * INSTALL: make it clear that libstdc++ is needed and that gcc
6294 2.7.x probably does not work.
6296 * src/support/filetools.C (findtexfile): make debug message go to
6298 * src/insets/insetbib.C (getKeys): ditto
6300 * src/debug.C (showTags): make sure that the output is correctly
6303 * configure.in: add a comment for TWO_COLOR_ICON define.
6305 * acconfig.h: remove all the entries that already defined in
6306 configure.in or acinclude.m4.
6308 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6309 to avoid user name, date and copyright.
6311 1999-12-21 Juergen Vigna <jug@sad.it>
6313 * src/table.C (Read): Now read bogus row format informations
6314 if the format is < 5 so that afterwards the table can
6315 be read by lyx but without any format-info. Fixed the
6316 crash we experienced when not doing this.
6318 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6320 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6321 (RedoDrawingOfParagraph): ditto
6322 (RedoParagraphs): ditto
6323 (RemoveTableRow): ditto
6325 * src/text.C (Fill): rename arg paperwidth -> paper_width
6327 * src/buffer.C (insertLyXFile): rename var filename -> fname
6328 (writeFile): rename arg filename -> fname
6329 (writeFileAscii): ditto
6330 (makeLaTeXFile): ditto
6331 (makeLinuxDocFile): ditto
6332 (makeDocBookFile): ditto
6334 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6337 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6339 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6342 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6343 compiled by a C compiler not C++.
6345 * src/layout.h (LyXTextClass): added typedef for const_iterator
6346 (LyXTextClassList): added typedef for const_iterator + member
6347 functions begin and end.
6349 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6350 iterators to fill the choice_class.
6351 (updateLayoutChoice): rewritten to use iterators to fill the
6352 layoutlist in the toolbar.
6354 * src/BufferView.h (BufferView::work_area_width): removed unused
6357 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6359 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6360 (sgmlCloseTag): ditto
6362 * src/support/lstrings.h: return type of countChar changed to
6365 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6366 what version of this func to use. Also made to return unsigned int.
6368 * configure.in: call LYX_STD_COUNT
6370 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6371 conforming std::count.
6373 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6375 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6376 and a subscript would give bad display (patch from Dekel Tsur
6377 <dekel@math.tau.ac.il>).
6379 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6381 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6384 * src/chset.h: add a few 'using' directives
6386 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6387 triggered when no buffer is active
6389 * src/layout.C: removed `break' after `return' in switch(), since
6392 * src/lyx_main.C (init): make sure LyX can be ran in place even
6393 when libtool has done its magic with shared libraries. Fix the
6394 test for the case when the system directory has not been found.
6396 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6397 name for the latex file.
6398 (MenuMakeHTML): ditto
6400 * src/buffer.h: add an optional boolean argument, which is passed
6403 1999-12-20 Allan Rae <rae@lyx.org>
6405 * lib/templates/IEEEtran.lyx: small correction and update.
6407 * configure.in: Attempted to use LYX_PATH_HEADER
6409 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6411 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6412 input from JMarc. Now use preprocessor to find the header.
6413 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6414 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6415 LYX_STL_STRING_FWD. See comments in file.
6417 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6419 * The global MiniBuffer * minibuffer variable is dead.
6421 * The global FD_form_main * fd_form_main variable is dead.
6423 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6425 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6427 * src/table.h: add the LOstream.h header
6428 * src/debug.h: ditto
6430 * src/LyXAction.h: change the explaination of the ReadOnly
6431 attribute: is indicates that the function _can_ be used.
6433 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6436 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6438 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6444 * src/paragraph.C (GetWord): assert on pos>=0
6447 * src/support/lyxstring.C: condition the use of an invariant on
6449 * src/support/lyxstring.h: ditto
6451 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6452 Use LAssert.h instead of plain assert().
6454 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6456 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6457 * src/support/filetools.C: ditto
6459 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6462 * INSTALL: document the new configure flags
6464 * configure.in: suppress --with-debug; add --enable-assertions
6466 * acinclude.m4: various changes in alignment of help strings.
6468 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6470 * src/kbmap.C: commented out the use of the hash map in kb_map,
6471 beginning of movement to a stl::container.
6473 * several files: removed code that was not in effect when
6474 MOVE_TEXT was defined.
6476 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6477 for escaping should not be used. We can discuss if the string
6478 should be enclosed in f.ex. [] instead of "".
6480 * src/trans_mgr.C (insert): use the new returned value from
6481 encodeString to get deadkeys and keymaps done correctly.
6483 * src/chset.C (encodeString): changed to return a pair, to tell
6484 what to use if we know the string.
6486 * src/lyxscreen.h (fillArc): new function.
6488 * src/FontInfo.C (resize): rewritten to use more std::string like
6489 structore, especially string::replace.
6491 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6494 * configure.in (chmod +x some scripts): remove config/gcc-hack
6496 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6498 * src/buffer.C (writeFile): change once again the top comment in a
6499 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6500 instead of an hardcoded version number.
6501 (makeDocBookFile): ditto
6503 * src/version.h: add new define LYX_DOCVERSION
6505 * po/de.po: update from Pit Sütterlin
6506 * lib/bind/de_menus.bind: ditto.
6508 * src/lyxfunc.C (Dispatch): call MenuExport()
6509 * src/buffer.C (Dispatch): ditto
6511 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6512 LyXFunc::Dispatch().
6513 (MenuExport): new function, moved from
6514 LyXFunc::Dispatch().
6516 * src/trans_mgr.C (insert): small cleanup
6517 * src/chset.C (loadFile): ditto
6519 * lib/kbd/iso8859-1.cdef: add missing backslashes
6521 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6523 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6524 help with placing the manually drawn accents better.
6526 (Draw): x2 and hg changed to float to minimize rounding errors and
6527 help place the accents better.
6529 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6530 unsigned short to char is just wrong...cast the char to unsigned
6531 char instead so that the two values can compare sanely. This
6532 should also make the display of insetlatexaccents better and
6533 perhaps also some other insets.
6535 (lbearing): new function
6538 1999-12-15 Allan Rae <rae@lyx.org>
6540 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6541 header that provides a wrapper around the very annoying SGI STL header
6544 * src/support/lyxstring.C, src/LString.h:
6545 removed old SGI-STL-compatability attempts.
6547 * configure.in: Use LYX_STL_STRING_FWD.
6549 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6550 stl_string_fwd.h is around and try to determine it's location.
6551 Major improvement over previous SGI STL 3.2 compatability.
6552 Three small problems remain with this function due to my zero
6553 knowledge of autoconf. JMarc and lgb see the comments in the code.
6555 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6557 * src/broken_const.h, config/hack-gcc, config/README: removed
6559 * configure.in: remove --with-gcc-hack option; do not call
6562 * INSTALL: remove documentation of --with-broken-const and
6565 * acconfig.h: remove all trace of BROKEN_CONST define
6567 * src/buffer.C (makeDocBookFile): update version number in output
6569 (SimpleDocBookOnePar): fix an assert when trying to a character
6570 access beyond string length
6573 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6575 * po/de.po: fix the Export menu
6577 * lyx.man: update the description of -dbg
6579 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6580 (commandLineHelp): updated
6581 (easyParse): show list of available debug levels if -dbg is passed
6584 * src/Makefile.am: add debug.C
6586 * src/debug.h: moved some code to debug.C
6588 * src/debug.C: new file. Contains code to set and show debug
6591 * src/layout.C: remove 'break' after 'continue' in switch
6592 statements, since these cannot be reached.
6594 1999-12-13 Allan Rae <rae@lyx.org>
6596 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6597 (in_word_set): hash() -> math_hash()
6599 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6601 * acconfig.h: Added a test for whether we are using exceptions in the
6602 current compilation run. If so USING_EXCEPTIONS is defined.
6604 * config.in: Check for existance of stl_string_fwd.h
6605 * src/LString.h: If compiling --with-included-string and SGI's
6606 STL version 3.2 is present (see above test) we need to block their
6607 forward declaration of string and supply a __get_c_string().
6608 However, it turns out this is only necessary if compiling with
6609 exceptions enabled so I've a bit more to add yet.
6611 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6612 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6613 src/support/LRegex.h, src/undo.h:
6614 Shuffle the order of the included files a little to ensure that
6615 LString.h gets included before anything that includes stl_string_fwd.h
6617 * src/support/lyxstring.C: We need to #include LString.h instead of
6618 lyxstring.h to get the necessary definition of __get_c_string.
6619 (__get_c_string): New function. This is defined static just like SGI's
6620 although why they need to do this I'm not sure. Perhaps it should be
6621 in lstrings.C instead.
6623 * lib/templates/IEEEtran.lyx: New template file.
6625 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6627 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6628 * intl/Makefile.in (MKINSTALLDIRS): ditto
6630 * src/LyXAction.C (init): changed to hold the LFUN data in a
6631 automatic array in stead of in callso to newFunc, this speeds up
6632 compilation a lot. Also all the memory used by the array is
6633 returned when the init is completed.
6635 * a lot of files: compiled with -Wold-style-cast, changed most of
6636 the reported offenders to C++ style casts. Did not change the
6637 offenders in C files.
6639 * src/trans.h (Match): change argument type to unsigned int.
6641 * src/support/DebugStream.C: fix some types on the streambufs so
6642 that it works on a conforming implementation.
6644 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6646 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6648 * src/support/lyxstring.C: remove the inline added earlier since
6649 they cause a bunch of unsatisfied symbols when linking with dec
6650 cxx. Cxx likes to have the body of inlines at the place where they
6653 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6654 accessing negative bounds in array. This fixes the crash when
6655 inserting accented characters.
6656 * src/trans.h (Match): ditto
6658 * src/buffer.C (Dispatch): since this is a void, it should not try
6659 to return anything...
6661 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6663 * src/buffer.h: removed the two friends from Buffer. Some changes
6664 because of this. Buffer::getFileName and Buffer::setFileName
6665 renamed to Buffer::fileName() and Buffer::fileName(...).
6667 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6669 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6670 and Buffer::update(short) to BufferView. This move is currently
6671 controlled by a define MOVE_TEXT, this will be removed when all
6672 shows to be ok. This move paves the way for better separation
6673 between buffer contents and buffer view. One side effect is that
6674 the BufferView needs a rebreak when swiching buffers, if we want
6675 to avoid this we can add a cache that holds pointers to LyXText's
6676 that is not currently in use.
6678 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6681 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6683 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6685 * lyx_main.C: new command line option -x (or --execute) and
6686 -e (or --export). Now direct conversion from .lyx to .tex
6687 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6688 Unfortunately, X is still needed and the GUI pops up during the
6691 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6693 * src/Spacing.C: add a using directive to bring stream stuff into
6695 * src/paragraph.C: ditto
6696 * src/buffer.C: ditto
6698 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6699 from Lars' announcement).
6701 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6702 example files from Tino Meinen.
6704 1999-12-06 Allan Rae <rae@lyx.org>
6706 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6708 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6710 * src/support/lyxstring.C: added a lot of inline for no good
6713 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6714 latexWriteEndChanges, they were not used.
6716 * src/layout.h (operator<<): output operator for PageSides
6718 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6720 * some example files: loaded in LyX 1.0.4 and saved again to update
6721 certain constructs (table format)
6723 * a lot of files: did the change to use fstream/iostream for all
6724 writing of files. Done with a close look at Andre Poenitz's patch.
6726 * some files: whitespace changes.
6728 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6730 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6731 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6732 architecture, we provide our own. It is used unconditionnally, but
6733 I do not think this is a performance problem. Thanks to Angus
6734 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6735 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6737 (GetInset): use my_memcpy.
6741 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6742 it is easier to understand, but it uses less TeX-only constructs now.
6744 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6745 elements contain spaces
6747 * lib/configure: regenerated
6749 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6750 elements contain spaces; display the list of programs that are
6753 * autogen.sh: make sure lib/configure is executable
6755 * lib/examples/*: rename the tutorial examples to begin with the
6756 two-letters language code.
6758 * src/lyxfunc.C (getStatus): do not query current font if no
6761 * src/lyx_cb.C (RunScript): use QuoteName
6762 (MenuRunDvips): ditto
6763 (PrintApplyCB): ditto
6765 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6766 around argument, so that it works well with the current shell.
6767 Does not work properly with OS/2 shells currently.
6769 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6770 * src/LyXSendto.C (SendtoApplyCB): ditto
6771 * src/lyxfunc.C (Dispatch): ditto
6772 * src/buffer.C (runLaTeX): ditto
6773 (runLiterate): ditto
6774 (buildProgram): ditto
6776 * src/lyx_cb.C (RunScript): ditto
6777 (MenuMakeLaTeX): ditto
6779 * src/buffer.h (getLatexName): new method
6781 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6783 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6785 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
6786 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
6787 (create_math_panel): ditto
6789 * src/lyxfunc.C (getStatus): re-activate the code which gets
6790 current font and cursor; add test for export to html.
6792 * src/lyxrc.C (read): remove unreachable break statements; add a
6795 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
6797 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6799 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
6800 introduced by faulty regex.
6801 * src/buffer.C: ditto
6802 * src/lastfiles.C: ditto
6803 * src/paragraph.C: ditto
6804 * src/table.C: ditto
6805 * src/vspace.C: ditto
6806 * src/insets/figinset.C: ditto
6807 Note: most of these is absolutely harmless, except the one in
6808 src/mathed formula.C.
6810 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6812 * src/ImportNoweb.C (documentclass): fixed bounds for substr
6813 operation, yielding correct results for the reLyX command.
6815 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6817 * src/support/filetools.C (ExpandPath): removed an over eager
6819 (ReplaceEnvironmentPath): ditto
6821 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
6822 shows that we are doing something fishy in our code...
6826 * src/lyxrc.C (read): use a double switch trick to get more help
6827 from the compiler. (the same trick is used in layout.C)
6828 (write): new function. opens a ofstream and pass that to output
6829 (output): new function, takes a ostream and writes the lyxrc
6830 elemts to it. uses a dummy switch to make sure no elements are
6833 * src/lyxlex.h: added a struct pushpophelper for use in functions
6834 with more than one exit point.
6836 * src/lyxlex.[Ch] (GetInteger): made it const
6840 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
6842 * src/layout.[hC] : LayoutTags splitted into several enums, new
6843 methods created, better error handling cleaner use of lyxlex. Read
6846 * src/bmtable.[Ch]: change some member prototypes because of the
6847 image const changes.
6849 * commandtags.h, src/LyXAction.C (init): new function:
6850 "preferences-save", saves the lyxrc entries into .lyx/preferences.
6851 This file is not read automatically but you can add \input
6852 preferences to your lyxrc if you want to. We need to discuss how
6855 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
6856 in .aux, also remove .bib and .bst files from dependencies when
6859 * src/BufferView.C, src/LyXView.C: add const_cast several places
6860 because of changes to images.
6862 * lib/images/*: same change as for images/*
6864 * lib/lyxrc.example: Default for accept_compound is false not no.
6866 * images/*: changed to be const, however I have som misgivings
6867 about this change so it might be changed back.
6869 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6871 * lib/configure, po/POTFILES.in: regenerated
6873 * autogen.sh: autogenerate lib/configure from lib/configure.m4
6875 * config/lib_configure.m4: removed
6877 * lib/configure.m4: new file (was config/lib_configure.m4)
6879 * configure.in: do not test for rtti, since we do not use it.
6881 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6883 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
6884 doubling of allocated space scheme. This makes it faster for large
6885 strings end to use less memory for small strings. xtra rememoved.
6887 * src/insets/figinset.C (waitalarm): commented out.
6888 (GhostscriptMsg): use static_cast
6889 (GhostscriptMsg): use new instead of malloc to allocate memory for
6890 cmap. also delete the memory after use.
6892 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
6894 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
6895 for changes in bibtex database or style.
6896 (runBibTeX): remove all .bib and .bst files from dep before we
6898 (run): use scanAuc in when dep file already exist.
6900 * src/DepTable.C (remove_files_with_extension): new method
6903 * src/DepTable.[Ch]: made many of the methods const.
6905 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6907 * src/bufferparams.C: make sure that the default textclass is
6908 "article". It used to be the first one by description order, but
6909 now the first one is "docbook".
6911 * src/lyx_main.C (setDebuggingLevel): change type of argument to
6912 string; call Debug::value.
6913 (easyParse): pass complete argument to setDebuggingLevel().
6915 * src/debug.h (value): fix the code that parses debug levels.
6917 * src/debug.h: add new debug type ACTION, reserved for LyXAction
6920 * src/LyXAction.C: use Debug::ACTION as debug channel.
6922 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
6924 * NEWS: updated for the future 1.1.3 release.
6926 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
6927 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
6928 it should. This is of course a controversial change (since many
6929 people will find that their lyx workscreen is suddenly full of
6930 red), but done for the sake of correctness.
6932 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
6933 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
6935 * src/insets/inseterror.h, src/insets/inseturl.h,
6936 src/insets/insetinfo.h, src/insets/figinset.h,
6937 src/mathed/formulamacro.h, src/mathed/math_macro.h
6938 (EditMessage): add a missing const and add _() to make sure that
6941 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
6942 src/insets/insetbib.C, src/support/filetools.C: add `using'
6945 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
6946 doing 'Insert index of last word' at the beginning of a paragraph.
6948 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6950 * several files: white-space changes.
6952 * src/mathed/formula.C: removed IsAlpha and IsDigit
6954 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
6955 .bib file. use a ifstream instead of FilePtr when parsing the .bib
6958 * src/insets/figinset.C (GetPSSizes): don't break when
6959 "EndComments" is seen. But break when a boundingbox is read.
6961 * all classes inherited from Inset: return value of Clone
6962 changed back to Inset *.
6964 * all classes inherited form MathInset: return value of Clone
6965 changed back to MathedInset *.
6967 * src/insets/figinset.C (runqueue): use a ofstream to output the
6968 gs/ps file. Might need some setpresicion or setw. However I can
6969 see no problem with the current code.
6970 (runqueue): use sleep instead of the alarm/signal code. I just
6971 can't see the difference.
6973 * src/paragraph.C (LyXParagraph): reserve space in the new
6974 paragraph and resize the inserted paragraph to just fit.
6976 * src/lyxfunc.h (operator|=): added operator for func_status.
6978 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
6979 check for readable file.
6981 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
6982 check for readable file.
6983 (MenuMakeLinuxDoc): ditto
6984 (MenuMakeDocBook): ditto
6985 (MenuMakeAscii): ditto
6986 (InsertAsciiFile): split the test for openable and readable
6988 * src/bmtable.C (draw_bitmaptable): use
6989 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
6991 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
6992 findtexfile from LaTeX to filetools.
6994 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
6995 instead of FilePtr. Needs to be verified by a literate user.
6997 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6999 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7000 (EditMessage): likewise.
7002 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7003 respectively as \textasciitilde and \textasciicircum.
7005 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7007 * src/support/lyxstring.h: made the methods that take iterators
7010 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7011 (regexMatch): made is use the real regex class.
7013 * src/support/Makefile.am: changed to use libtool
7015 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7017 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7019 (MathIsInset ++): changed several macros to be inline functions
7022 * src/mathed/Makefile.am: changed to use libtool
7024 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7026 * src/insets/inset* : Clone changed to const and return type is
7027 the true insettype not just Inset*.
7029 * src/insets/Makefile.am: changed to use libtool
7031 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7033 * src/undo.[Ch] : added empty() and changed some of the method
7036 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7038 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7039 setID use block<> for the bullets array, added const several places.
7041 * src/lyxfunc.C (getStatus): new function
7043 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7044 LyXAction, added const to several funtions.
7046 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7047 a std::map, and to store the dir items in a vector.
7049 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7052 * src/LyXView.[Ch] + other files : changed currentView to view.
7054 * src/LyXAction.[Ch] : ported from the old devel branch.
7056 * src/.cvsignore: added .libs and a.out
7058 * configure.in : changes to use libtool.
7060 * acinclude.m4 : inserted libtool.m4
7062 * .cvsignore: added libtool
7064 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7066 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7067 file name in insets and mathed directories (otherwise the
7068 dependency is not taken in account under cygwin).
7070 * src/text2.C (InsertString[AB]): make sure that we do not try to
7071 read characters past the string length.
7073 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7075 * lib/doc/LaTeXConfig.lyx.in,
7076 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7078 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7079 file saying who created them and when this heppened; this is
7080 useless and annoys tools like cvs.
7082 * lib/layouts/g-brief-{en,de}.layout,
7083 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7084 from Thomas Hartkens <thomas@hartkens.de>.
7086 * src/{insets,mathed}/Makefile.am: do not declare an empty
7087 LDFLAGS, so that it can be set at configure time (useful on Irix
7090 * lib/reLyX/configure.in: make sure that the prefix is set
7091 correctly in LYX_DIR.
7093 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7095 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7096 be used by 'command-sequence' this allows to bind a key to a
7097 sequence of LyX-commands
7098 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7100 * src/LyXAction.C: add "command-sequence"
7102 * src/LyXFunction.C: handling of "command-sequence"
7104 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7105 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7107 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7109 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7111 * src/buffer.C (writeFile): Do not output a comment giving user
7112 and date at the beginning of a .lyx file. This is useless and
7113 annoys cvs anyway; update version number to 1.1.
7115 * src/Makefile.am (LYX_DIR): add this definition, so that a
7116 default path is hardcoded in LyX.
7118 * configure.in: Use LYX_GNU_GETTEXT.
7120 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7121 AM_GNU_GETTEXT with a bug fixed.
7123 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7125 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7127 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7128 which is used to point to LyX data is now LYX_DIR_11x.
7130 * lyx.man: convert to a unix text file; small updates.
7132 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7134 * src/support/LSubstring.[Ch]: made the second arg of most of the
7135 constructors be a const reference.
7137 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7140 * src/support/lyxstring.[Ch] (swap): added missing member function
7141 and specialization of swap(str, str);
7143 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7145 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7146 trace of the old one.
7148 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7149 put the member definitions in undo.C.
7151 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7152 NEW_TEXT and have now only code that was included when this was
7155 * src/intl.C (LCombo): use static_cast
7157 (DispatchCallback): ditto
7159 * src/definitions.h: removed whole file
7161 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7163 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7164 parsing and stores in a std:map. a regex defines the file format.
7165 removed unneeded members.
7167 * src/bufferparams.h: added several enums from definitions.h here.
7168 Removed unsused destructor. Changed some types to use proper enum
7169 types. use block to have the temp_bullets and user_defined_bullets
7170 and to make the whole class assignable.
7172 * src/bufferparams.C (Copy): removed this functions, use a default
7175 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7178 * src/buffer.C (readLyXformat2): commend out all that have with
7179 oldpapersize to do. also comment out all that hve to do with
7180 insetlatex and insetlatexdel.
7181 (setOldPaperStuff): commented out
7183 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7185 * src/LyXAction.C: remove use of inset-latex-insert
7187 * src/mathed/math_panel.C (button_cb): use static_cast
7189 * src/insets/Makefile.am (insets_o_SOURCES): removed
7192 * src/support/lyxstring.C (helper): use the unsigned long
7193 specifier, UL, instead of a static_cast.
7195 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7197 * src/support/block.h: new file. to be used as a c-style array in
7198 classes, so that the class can be assignable.
7200 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7202 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7203 NULL, make sure to return an empty string (it is not possible to
7204 set a string to NULL).
7206 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7208 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7210 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7212 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7213 link line, so that Irix users (for example) can set it explicitely to
7216 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7217 it can be overidden at make time (static or dynamic link, for
7220 * src/vc-backend.C, src/LaTeXFeatures.h,
7221 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7222 statements to bring templates to global namespace.
7224 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7226 * src/support/lyxstring.C (operator[] const): make it standard
7229 * src/minibuffer.C (Init): changed to reflect that more
7230 information is given from the lyxvc and need not be provided here.
7232 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7234 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7236 * src/LyXView.C (UpdateTimerCB): use static_cast
7237 (KeyPressMask_raw_callback): ditto
7239 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7240 buffer_, a lot of changes because of this. currentBuffer() ->
7241 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7242 also changes to other files because of this.
7244 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7246 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7247 have no support for RCS and partial support for CVS, will be
7250 * src/insets/ several files: changes because of function name
7251 changes in Bufferview and LyXView.
7253 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7255 * src/support/LSubstring.[Ch]: new files. These implement a
7256 Substring that can be very convenient to use. i.e. is this
7258 string a = "Mary had a little sheep";
7259 Substring(a, "sheep") = "lamb";
7260 a is now "Mary has a little lamb".
7262 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7263 out patterns and subpatterns of strings. It is used by LSubstring
7264 and also by vc-backend.C
7266 * src/support/lyxstring.C: went over all the assertions used and
7267 tried to correct the wrong ones and flag which of them is required
7268 by the standard. some bugs found because of this. Also removed a
7269 couple of assertions.
7271 * src/support/Makefile.am (libsupport_a_SOURCES): added
7272 LSubstring.[Ch] and LRegex.[Ch]
7274 * src/support/FileInfo.h: have struct stat buf as an object and
7275 not a pointer to one, some changes because of this.
7277 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7278 information in layout when adding the layouts preamble to the
7281 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7284 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7285 because of bug in OS/2.
7287 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7289 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7290 \verbatim@font instead of \ttfamily, so that it can be redefined.
7292 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7293 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7294 src/layout.h, src/text2.C: add 'using' directive to bring the
7295 STL templates we need from the std:: namespace to the global one.
7296 Needed by DEC cxx in strict ansi mode.
7298 * src/support/LIstream.h,src/support/LOstream.h,
7299 src/support/lyxstring.h,src/table.h,
7300 src/lyxlookup.h: do not include <config.h> in header
7301 files. This should be done in the .C files only.
7303 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7307 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7309 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7310 from Kayvan to fix the tth invokation.
7312 * development/lyx.spec.in: updates from Kayvan to reflect the
7313 changes of file names.
7315 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7317 * src/text2.C (InsertStringB): use std::copy
7318 (InsertStringA): use std::copy
7320 * src/bufferlist.C: use a vector to store the buffers in. This is
7321 an internal change and should not affect any other thing.
7323 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7326 * src/text.C (Fill): fix potential bug, one off bug.
7328 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7330 * src/Makefile.am (lyx_main.o): add more files it depends on.
7332 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7334 * src/support/lyxstring.C: use size_t for the reference count,
7335 size, reserved memory and xtra.
7336 (internal_compare): new private member function. Now the compare
7337 functions should work for std::strings that have embedded '\0'
7339 (compare): all compare functions rewritten to use
7342 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7344 * src/support/lyxstring.C (compare): pass c_str()
7345 (compare): pass c_str
7346 (compare): pass c_str
7348 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7350 * src/support/DebugStream.C: <config.h> was not included correctly.
7352 * lib/configure: forgot to re-generate it :( I'll make this file
7353 auto generated soon.
7355 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7357 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7360 * src/support/lyxstring.C: some changes from length() to rep->sz.
7361 avoids a function call.
7363 * src/support/filetools.C (SpaceLess): yet another version of the
7364 algorithm...now per Jean-Marc's suggestions.
7366 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7368 * src/layout.C (less_textclass_desc): functor for use in sorting
7370 (LyXTextClass::Read): sort the textclasses after reading.
7372 * src/support/filetools.C (SpaceLess): new version of the
7373 SpaceLess functions. What problems does this one give? Please
7376 * images/banner_bw.xbm: made the arrays unsigned char *
7378 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7380 * src/support/lyxstring.C (find): remove bogus assertion in the
7381 two versions of find where this has not been done yet.
7383 * src/support/lyxlib.h: add missing int return type to
7386 * src/menus.C (ShowFileMenu): disable exporting to html if no
7387 html export command is present.
7389 * config/lib_configure.m4: add a test for an HTML converter. The
7390 programs checked for are, in this order: tth, latex2html and
7393 * lib/configure: generated from config/lib_configure.m4.
7395 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7396 html converter. The parameters are now passed through $$FName and
7397 $$OutName, instead of standard input/output.
7399 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7401 * lib/lyxrc.example: update description of \html_command.
7402 add "quotes" around \screen_font_xxx font setting examples to help
7403 people who use fonts with spaces in their names.
7405 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7407 * Distribution files: updates for v1.1.2
7409 * src/support/lyxstring.C (find): remove bogus assert and return
7410 npos for the same condition.
7412 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7414 * added patch for OS/2 from SMiyata.
7416 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7418 * src/text2.C (CutSelection): make space_wrapped a bool
7419 (CutSelection): dont declare int i until we have to.
7420 (alphaCounter): return a char const *.
7422 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7424 * src/support/syscall.C (Systemcalls::kill):
7425 src/support/filetools.C (PutEnv, PutEnvPath):
7426 src/lyx_cb.C (addNewlineAndDepth):
7427 src/FontInfo.C (FontInfo::resize): condition some #warning
7428 directives with WITH_WARNINGS.
7431 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7433 * src/layout.[Ch] + several files: access to class variables
7434 limited and made accessor functions instead a lot of code changed
7435 becuase of this. Also instead of returning pointers often a const
7436 reference is returned instead.
7438 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7440 * src/Makefile.am (dist-hook): added used to remove the CVS from
7441 cheaders upon creating a dist
7442 (EXTRA_DIST): added cheaders
7444 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7445 a character not as a small integer.
7447 * src/support/lyxstring.C (find): removed Assert and added i >=
7448 rep->sz to the first if.
7450 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7452 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7453 src/LyXView.C src/buffer.C src/bufferparams.C
7454 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7455 src/text2.C src/insets/insetinclude.C:
7456 lyxlayout renamed to textclasslist.
7458 * src/layout.C: some lyxerr changes.
7460 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7461 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7462 (LyXLayoutList): removed all traces of this class.
7463 (LyXTextClass::Read): rewrote LT_STYLE
7464 (LyXTextClass::hasLayout): new function
7465 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7466 both const and nonconst version.
7467 (LyXTextClass::delete_layout): new function.
7468 (LyXTextClassList::Style): bug fix. do the right thing if layout
7470 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7471 (LyXTextClassList::NameOfLayout): ditto
7472 (LyXTextClassList::Load): ditto
7474 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7476 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7478 * src/LyXAction.C (LookupFunc): added a workaround for sun
7479 compiler, on the other hand...we don't know if the current code
7480 compiles on sun at all...
7482 * src/support/filetools.C (CleanupPath): subst fix
7484 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7487 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7488 complained about this one?
7490 * src/insets/insetinclude.C (Latex): subst fix
7492 * src/insets/insetbib.C (getKeys): subst fix
7494 * src/LyXSendto.C (SendtoApplyCB): subst fix
7496 * src/lyx_main.C (init): subst fix
7498 * src/layout.C (Read): subst fix
7500 * src/lyx_sendfax_main.C (button_send): subst fix
7502 * src/buffer.C (RoffAsciiTable): subst fix
7504 * src/lyx_cb.C (MenuFax): subst fix
7505 (PrintApplyCB): subst fix
7507 1999-10-26 Juergen Vigna <jug@sad.it>
7509 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7511 (Read): Cleaned up this code so now we read only format vestion >= 5
7513 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7515 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7516 come nobody has complained about this one?
7518 * src/insets/insetinclude.C (Latex): subst fix
7520 * src/insets/insetbib.C (getKeys): subst fix
7522 * src/lyx_main.C (init): subst fix
7524 * src/layout.C (Read): subst fix
7526 * src/buffer.C (RoffAsciiTable): subst fix
7528 * src/lyx_cb.C (MenuFax): subst fix.
7530 * src/layout.[hC] + some other files: rewrote to use
7531 std::container to store textclasses and layouts in.
7532 Simplified, removed a lot of code. Make all classes
7533 assignable. Further simplifications and review of type
7534 use still to be one.
7536 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7537 lastfiles to create the lastfiles partr of the menu.
7539 * src/lastfiles.[Ch]: rewritten to use deque to store the
7540 lastfiles in. Uses fstream for reading and writing. Simplifies
7543 * src/support/syscall.C: remove explicit cast.
7545 * src/BufferView.C (CursorToggleCB): removed code snippets that
7547 use explicat C++ style casts instead of C style casts. also use
7548 u_vdata instea of passing pointers in longs.
7550 * src/PaperLayout.C: removed code snippets that were commented out.
7552 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7554 * src/lyx_main.C: removed code snippets that wer commented out.
7556 * src/paragraph.C: removed code snippets that were commented out.
7558 * src/lyxvc.C (logClose): use static_cast
7560 (viewLog): remove explicit cast to void*
7561 (showLog): removed old commented code
7563 * src/menus.C: use static_cast instead of C style casts. use
7564 u_vdata instead of u_ldata. remove explicit cast to (long) for
7565 pointers. Removed old code that was commented out.
7567 * src/insets/inset.C: removed old commented func
7569 * src/insets/insetref.C (InsetRef): removed old code that had been
7570 commented out for a long time.
7572 (escape): removed C style cast
7574 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7576 * src/insets/insetlatex.C (Draw): removed old commented code
7577 (Read): rewritten to use string
7579 * src/insets/insetlabel.C (escape): removed C style cast
7581 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7583 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7586 * src/insets/insetinclude.h: removed a couple of stupid bools
7588 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7589 (Clone): remove C style cast
7590 (getKeys): changed list to lst because of std::list
7592 * src/insets/inseterror.C (Draw): removed som old commented code.
7594 * src/insets/insetcommand.C (Draw): removed some old commented code.
7596 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7597 commented out forever.
7598 (bibitem_cb): use static_cast instead of C style cast
7599 use of vdata changed to u_vdata.
7601 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7603 (CloseUrlCB): use static_cast instead of C style cast.
7604 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7606 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7607 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7608 (CloseInfoCB): static_cast from ob->u_vdata instead.
7609 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7612 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7613 (C_InsetError_CloseErrorCB): forward the ob parameter
7614 (CloseErrorCB): static_cast from ob->u_vdata instead.
7616 * src/vspace.h: include LString.h since we use string in this class.
7618 * src/vspace.C (lyx_advance): changed name from advance because of
7619 nameclash with stl. And since we cannot use namespaces yet...I
7620 used a lyx_ prefix instead. Expect this to change when we begin
7623 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7625 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7626 and removed now defunct constructor and deconstructor.
7628 * src/BufferView.h: have backstack as a object not as a pointer.
7629 removed initialization from constructor. added include for BackStack
7631 * development/lyx.spec.in (%build): add CFLAGS also.
7633 * src/screen.C (drawFrame): removed another warning.
7635 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7637 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7638 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7639 README and ANNOUNCE a bit for the next release. More work is
7642 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7643 unbreakable if we are in freespacing mode (LyX-Code), but not in
7646 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7648 * src/BackStack.h: fixed initialization order in constructor
7650 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7652 * acinclude.m4 (VERSION): new rules for when a version is
7653 development, added also a variable for prerelease.
7654 (warnings): we set with_warnings=yes for prereleases
7655 (lyx_opt): prereleases compile with same optimization as development
7656 (CXXFLAGS): only use pedantic if we are a development version
7658 * src/BufferView.C (restorePosition): don't do anything if the
7661 * src/BackStack.h: added member empty, use this to test if there
7662 is anything to pop...
7664 1999-10-25 Juergen Vigna <jug@sad.it>
7667 * forms/layout_forms.fd +
7668 * forms/latexoptions.fd +
7669 * lyx.fd: changed for various form resize issues
7671 * src/mathed/math_panel.C +
7672 * src/insets/inseterror.C +
7673 * src/insets/insetinfo.C +
7674 * src/insets/inseturl.C +
7675 * src/insets/inseturl.h +
7678 * src/PaperLayout.C +
7679 * src/ParagraphExtra.C +
7680 * src/TableLayout.C +
7682 * src/layout_forms.C +
7689 * src/menus.C: fixed various resize issues. So now forms can be
7690 resized savely or not be resized at all.
7692 * forms/form_url.fd +
7693 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7696 * src/insets/Makefile.am: added files form_url.[Ch]
7698 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7700 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7701 (and presumably 6.2).
7703 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7704 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7705 remaining static member callbacks.
7707 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7710 * src/support/lyxstring.h: declare struct Srep as friend of
7711 lyxstring, since DEC cxx complains otherwise.
7713 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7715 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7717 * src/LaTeX.C (run): made run_bibtex also depend on files with
7719 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7720 are put into the dependency file.
7722 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7723 the code has shown itself to work
7724 (create_ispell_pipe): removed another warning, added a comment
7727 * src/minibuffer.C (ExecutingCB): removed code that has been
7728 commented out a long time
7730 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7731 out code + a warning.
7733 * src/support/lyxstring.h: comment out the three private
7734 operators, when compiling with string ansi conforming compilers
7737 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7739 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7740 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7743 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7746 * src/mathed/math_panel.C (create_math_panel): remove explicit
7749 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7752 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7753 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7754 to XCreatePixmapFromBitmapData
7755 (fl_set_bmtable_data): change the last argument to be unsigned
7757 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7758 and bh to be unsigned int, remove explicit casts in call to
7759 XReadBitmapFileData.
7761 * images/arrows.xbm: made the arrays unsigned char *
7762 * images/varsz.xbm: ditto
7763 * images/misc.xbm: ditto
7764 * images/greek.xbm: ditto
7765 * images/dots.xbm: ditto
7766 * images/brel.xbm: ditto
7767 * images/bop.xbm: ditto
7769 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7771 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7772 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7773 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7775 (LYX_CXX_CHEADERS): added <clocale> to the test.
7777 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7779 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7781 * src/support/lyxstring.C (append): fixed something that must be a
7782 bug, rep->assign was used instead of rep->append.
7784 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
7787 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
7788 lyx insert double chars. Fix spotted by Kayvan.
7790 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7792 * Fixed the tth support. I messed up with the Emacs patch apply feature
7793 and omitted the changes in lyxrc.C.
7795 1999-10-22 Juergen Vigna <jug@sad.it>
7797 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
7799 * src/lyx_cb.C (MenuInsertRef) +
7800 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
7801 the form cannot be resized under it limits (fixes a segfault)
7803 * src/lyx.C (create_form_form_ref) +
7804 * forms/lyx.fd: Changed Gravity on name input field so that it is
7807 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7809 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
7810 <ostream> and <istream>.
7812 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
7813 whether <fstream> provides the latest standard features, or if we
7814 have an oldstyle library (like in egcs).
7815 (LYX_CXX_STL_STRING): fix the test.
7817 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
7818 code on MODERN_STL_STREAM.
7820 * src/support/lyxstring.h: use L{I,O}stream.h.
7822 * src/support/L{I,O}stream.h: new files, designed to setup
7823 correctly streams for our use
7824 - includes the right header depending on STL capabilities
7825 - puts std::ostream and std::endl (for LOStream.h) or
7826 std::istream (LIStream.h) in toplevel namespace.
7828 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7830 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
7831 was a bib file that had been changed we ensure that bibtex is run.
7832 (runBibTeX): enhanced to extract the names of the bib files and
7833 getting their absolute path and enter them into the dep file.
7834 (findtexfile): static func that is used to look for tex-files,
7835 checks for absolute patchs and tries also with kpsewhich.
7836 Alternative ways of finding the correct files are wanted. Will
7838 (do_popen): function that runs a command using popen and returns
7839 the whole output of that command in a string. Should be moved to
7842 * src/DepTable.[Ch] (extchanged): new function that returns true if a
7843 file with extension ext has changed.
7845 * src/insets/figinset.C: added ifdef guards around the fl_free
7846 code that jug commented out. Now it is commented out when
7847 compiling with XForms == 0.89.
7849 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
7850 to lyxstring.C, and only keep a forward declaration in
7851 lyxstring.h. Simplifies the header file a bit and should help a
7852 bit on compile time too. Also changes to Srep will not mandate a
7853 recompile of code just using string.
7854 (~lyxstring): definition moved here since it uses srep.
7855 (size): definition moved here since it uses srep.
7857 * src/support/lyxstring.h: removed a couple of "inline" that should
7860 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7862 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
7865 1999-10-21 Juergen Vigna <jug@sad.it>
7867 * src/table.C (SetPWidth): Just a small fix so the alignment is not
7868 set to left if I just remove the width entry (or it is empty).
7870 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
7871 paragraph when having dummy paragraphs.
7873 1999-10-20 Juergen Vigna <jug@sad.it>
7875 * src/insets/figinset.C: just commented some fl_free_form calls
7876 and added warnings so that this calls should be activated later
7877 again. This avoids for now a segfault, but we have a memory leak!
7879 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
7880 'const char * argument' to 'string argument', this should
7881 fix some Asserts() in lyxstring.C.
7883 * src/lyxfunc.h: Removed the function argAsString(const char *)
7884 as it is not used anymore.
7886 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7888 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
7891 * src/Literate.h: some funcs moved from public to private to make
7892 interface clearer. Unneeded args removed.
7894 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
7896 (scanBuildLogFile): ditto
7898 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
7899 normal TeX Error. Still room for improvement.
7901 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
7903 * src/buffer.C (insertErrors): changes to make the error
7904 desctription show properly.
7906 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
7909 * src/support/lyxstring.C (helper): changed to use
7910 sizeof(object->rep->ref).
7911 (operator>>): changed to use a pointer instead.
7913 * src/support/lyxstring.h: changed const reference & to value_type
7914 const & lets see if that helps.
7916 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7918 * Makefile.am (rpmdist): fixed to have non static package and
7921 * src/support/lyxstring.C: removed the compilation guards
7923 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
7926 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
7927 conditional compile of lyxstring.Ch
7929 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
7930 stupid check, but it is a lot better than the bastring hack.
7931 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
7933 * several files: changed string::erase into string::clear. Not
7936 * src/chset.C (encodeString): use a char temporary instead
7938 * src/table.C (TexEndOfCell): added tostr around
7939 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
7940 (TexEndOfCell): ditto
7941 (TexEndOfCell): ditto
7942 (TexEndOfCell): ditto
7943 (DocBookEndOfCell): ditto
7944 (DocBookEndOfCell): ditto
7945 (DocBookEndOfCell): ditto
7946 (DocBookEndOfCell): ditto
7948 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
7950 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
7952 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
7953 (MenuBuildProg): added tostr around ret
7954 (MenuRunChktex): added tostr around ret
7955 (DocumentApplyCB): added tostr around ret
7957 * src/chset.C (encodeString): added tostr around t->ic
7959 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
7960 (makeLaTeXFile): added tostr around tocdepth
7961 (makeLaTeXFile): added tostr around ftcound - 1
7963 * src/insets/insetbib.C (setCounter): added tostr around counter.
7965 * src/support/lyxstring.h: added an operator+=(int) to catch more
7968 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
7969 (lyxstring): We DON'T allow NULL pointers.
7971 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7973 * src/mathed/math_macro.C (MathMacroArgument::Write,
7974 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
7975 when writing them out.
7977 * src/LString.C: remove, since it is not used anymore.
7979 * src/support/lyxstring.C: condition the content to
7980 USE_INCLUDED_STRING macro.
7982 * src/mathed/math_symbols.C, src/support/lstrings.C,
7983 src/support/lyxstring.C: add `using' directive to specify what
7984 we need in <algorithm>. I do not think that we need to
7985 conditionalize this, but any thought is appreciated.
7987 * many files: change all callback functions to "C" linkage
7988 functions to please strict C++ compilers like DEC cxx 6.1 in mode
7989 strict_ansi. Those who were static are now global.
7990 The case of callbacks which are static class members is
7991 trickier, since we have to make C wrappers around them (see
7992 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
7993 did not finish this yet, since it defeats the purpose of
7994 encapsulation, and I am not sure what the best route is.
7996 1999-10-19 Juergen Vigna <jug@sad.it>
7998 * src/support/lyxstring.C (lyxstring): we permit to have a null
7999 pointer as assignment value and just don't assign it.
8001 * src/vspace.C (nextToken): corrected this function substituting
8002 find_first(_not)_of with find_last_of.
8004 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8005 (TableOptCloseCB) (TableSpeCloseCB):
8006 inserted fl_set_focus call for problem with fl_hide_form() in
8009 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8011 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8014 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8016 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8017 LyXLex::next() and not eatline() to get its argument.
8019 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8021 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8022 instead, use fstreams for io of the depfile, removed unneeded
8023 functions and variables.
8025 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8026 vector instead, removed all functions and variables that is not in
8029 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8031 * src/buffer.C (insertErrors): use new interface to TeXError
8033 * Makefile.am (rpmdist): added a rpmdist target
8035 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8036 per Kayvan's instructions.
8038 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8040 * src/Makefile.am: add a definition for localedir, so that locales
8041 are found after installation (Kayvan)
8043 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8045 * development/.cvsignore: new file.
8047 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8049 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8050 C++ compiler provides wrappers for C headers and use our alternate
8053 * configure.in: use LYX_CXX_CHEADERS.
8055 * src/cheader/: new directory, populated with cname headers from
8056 libstdc++-2.8.1. They are a bit old, but probably good enough for
8057 what we want (support compilers who lack them).
8059 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8060 from includes. It turns out is was stupid.
8062 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8064 * lib/Makefile.am (install-data-local): forgot a ';'
8065 (install-data-local): forgot a '\'
8066 (libinstalldirs): needed after all. reintroduced.
8068 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8070 * configure.in (AC_OUTPUT): added lyx.spec
8072 * development/lyx.spec: removed file
8074 * development/lyx.spec.in: new file
8076 * po/*.po: merged with lyx.pot becuase of make distcheck
8078 * lib/Makefile.am (dist-hook): added dist-hook so that
8079 documentation files will be included when doing a make
8080 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8081 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8083 more: tried to make install do the right thing, exclude CVS dirs
8086 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8087 Path would fit in more nicely.
8089 * all files that used to use pathstack: uses now Path instead.
8090 This change was a lot easier than expected.
8092 * src/support/path.h: new file
8094 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8096 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8098 * src/support/lyxstring.C (getline): Default arg was given for
8101 * Configure.cmd: removed file
8103 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8105 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8106 streams classes and types, add the proper 'using' statements when
8107 MODERN_STL is defined.
8109 * src/debug.h: move the << operator definition after the inclusion
8112 * src/support/filetools.C: include "LAssert.h", which is needed
8115 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8118 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8119 include "debug.h" to define a proper ostream.
8121 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8123 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8124 method to the SystemCall class which can kill a process, but it's
8125 not fully implemented yet.
8127 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8129 * src/support/FileInfo.h: Better documentation
8131 * src/lyxfunc.C: Added support for buffer-export html
8133 * src/menus.C: Added Export->As HTML...
8135 * lib/bind/*.bind: Added short-cut for buffer-export html
8137 * src/lyxrc.*: Added support for new \tth_command
8139 * lib/lyxrc.example: Added stuff for new \tth_command
8141 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8143 * lib/Makefile.am (IMAGES): removed images/README
8144 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8145 installes in correct place. Check permisions is installed
8148 * src/LaTeX.C: some no-op changes moved declaration of some
8151 * src/LaTeX.h (LATEX_H): changed include guard name
8153 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8155 * lib/reLyX/Makefile.am: install noweb2lyx.
8157 * lib/Makefile.am: install configure.
8159 * lib/reLyX/configure.in: declare a config aux dir; set package
8160 name to lyx (not sure what the best solution is); generate noweb2lyx.
8162 * lib/layouts/egs.layout: fix the bibliography layout.
8164 1999-10-08 Jürgen Vigna <jug@sad.it>
8166 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8167 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8168 it returned without continuing to search the path.
8170 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8172 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8173 also fixes a bug. It is not allowed to do tricks with std::strings
8174 like: string a("hei"); &a[e]; this will not give what you
8175 think... Any reason for the complexity in this func?
8177 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8179 * Updated README and INSTALL a bit, mostly to check that my
8180 CVS rights are correctly set up.
8182 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8184 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8185 does not allow '\0' chars but lyxstring and std::string does.
8187 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8189 * autogen.sh (AUTOCONF): let the autogen script create the
8190 POTFILES.in file too. POTFILES.in should perhaps now not be
8191 included in the cvs module.
8193 * some more files changed to use C++ includes instead of C ones.
8195 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8197 (Reread): added tostr to nlink. buggy output otherwise.
8198 (Reread): added a string() around szMode when assigning to Buffer,
8199 without this I got a log of garbled info strings.
8201 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8204 * I have added several ostream & operator<<(ostream &, some_type)
8205 functions. This has been done to avoid casting and warnings when
8206 outputting enums to lyxerr. This as thus eliminated a lot of
8207 explicit casts and has made the code clearer. Among the enums
8208 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8209 mathed enums, some font enum the Debug::type enum.
8211 * src/support/lyxstring.h (clear): missing method. equivalent of
8214 * all files that contained "stderr": rewrote constructs that used
8215 stderr to use lyxerr instead. (except bmtable)
8217 * src/support/DebugStream.h (level): and the passed t with
8218 Debug::ANY to avoid spurious bits set.
8220 * src/debug.h (Debug::type value): made it accept strings of the
8223 * configure.in (Check for programs): Added a check for kpsewhich,
8224 the latex generation will use this later to better the dicovery of
8227 * src/BufferView.C (create_view): we don't need to cast this to
8228 (void*) that is done automatically.
8229 (WorkAreaButtonPress): removed some dead code.
8231 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8233 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8234 is not overwritten when translated (David Sua'rez de Lis).
8236 * lib/CREDITS: Added David Sua'rez de Lis
8238 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8240 * src/bufferparams.C (BufferParams): default input encoding is now
8243 * acinclude.m4 (cross_compiling): comment out macro
8244 LYX_GXX_STRENGTH_REDUCE.
8246 * acconfig.h: make sure that const is not defined (to empty) when
8247 we are compiling C++. Remove commented out code using SIZEOF_xx
8250 * configure.in : move the test for const and inline as late as
8251 possible so that these C tests do not interefere with C++ ones.
8252 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8253 has not been proven.
8255 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8257 * src/table.C (getDocBookAlign): remove bad default value for
8260 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8262 (ShowFileMenu2): ditto.
8264 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8267 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8269 * Most files: finished the change from the old error code to use
8270 DebugStream for all lyxerr debugging. Only minor changes remain
8271 (e.g. the setting of debug levels using strings instead of number)
8273 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8275 * src/layout.C (Add): Changed to use compare_no_case instead of
8278 * src/FontInfo.C: changed loop variable type too string::size_type.
8280 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8282 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8283 set ETAGS_ARGS to --c++
8285 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8287 * src/table.C (DocBookEndOfCell): commented out two unused variables
8289 * src/paragraph.C: commented out four unused variables.
8291 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8292 insed a if clause with type string::size_type.
8294 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8297 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8299 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8300 variable, also changed loop to go from 0 to lenght + 1, instead of
8301 -1 to length. This should be correct.
8303 * src/LaTeX.C (scanError): use string::size_type as loop variable
8306 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8307 (l.896) since y_tmp and row was not used anyway.
8309 * src/insets/insetref.C (escape): use string::size_type as loop
8312 * src/insets/insetquotes.C (Width): use string::size_type as loop
8314 (Draw): use string::size_type as loop variable type.
8316 * src/insets/insetlatexaccent.C (checkContents): use
8317 string::size_type as loop variable type.
8319 * src/insets/insetlabel.C (escape): use string::size_type as loop
8322 * src/insets/insetinfo.C: added an extern for current_view.
8324 * src/insets/insetcommand.C (scanCommand): use string::size_type
8325 as loop variable type.
8327 * most files: removed the RCS tags. With them we had to recompile
8328 a lot of files after a simple cvs commit. Also we have never used
8329 them for anything meaningful.
8331 * most files: tags-query-replace NULL 0. As adviced several plases
8332 we now use "0" instead of "NULL" in our code.
8334 * src/support/filetools.C (SpaceLess): use string::size_type as
8337 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8339 * src/paragraph.C: fixed up some more string stuff.
8341 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8343 * src/support/filetools.h: make modestr a std::string.
8345 * src/filetools.C (GetEnv): made ch really const.
8347 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8348 made code that used these use max/min from <algorithm> instead.
8350 * changed several c library include files to their equivalent c++
8351 library include files. All is not changed yet.
8353 * created a support subdir in src, put lyxstring and lstrings
8354 there + the extra files atexit, fileblock, strerror. Created
8355 Makefile.am. edited configure.in and src/Makefile.am to use this
8356 new subdir. More files moved to support.
8358 * imported som of the functions from repository lyx, filetools
8360 * ran tags-query-replace on LString -> string, corrected the bogus
8361 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8362 is still some errors in there. This is errors where too much or
8363 too litle get deleted from strings (string::erase, string::substr,
8364 string::replace), there can also be some off by one errors, or
8365 just plain wrong use of functions from lstrings. Viewing of quotes
8368 * LyX is now running fairly well with string, but there are
8369 certainly some bugs yet (see above) also string is quite different
8370 from LString among others in that it does not allow null pointers
8371 passed in and will abort if it gets any.
8373 * Added the revtex4 files I forgot when setting up the repository.
8375 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8377 * All over: Tried to clean everything up so that only the files
8378 that we really need are included in the cvs repository.
8379 * Switched to use automake.
8380 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8381 * Install has not been checked.
8383 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8385 * po/pt.po: Three errors:
8386 l.533 and l.538 format specification error
8387 l. 402 duplicate entry, I just deleted it.