1 2000-08-07 Baruch Even <baruch.even@writeme.com>
3 * src/graphics/Renderer.h:
4 * src/graphics/Renderer.C: Added base class for rendering of different
5 image formats into Pixmaps.
7 * src/graphics/XPM_Renderer.h:
8 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
11 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
12 easily add support for other formats.
14 * src/insets/figinset.C: plugged a leak of an X resource.
16 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
18 * src/CutAndPaste.[Ch]: make all metods static.
20 * development/Code_rules/Rules: more work, added section on
21 Exceptions, and a References section.
23 * a lot of header files: work to make doc++ able to generate the
24 source documentation, some workarounds of doc++ problems. Doc++ is
25 now able to generate the documentation.
27 2000-08-07 Juergen Vigna <jug@sad.it>
29 * src/insets/insettabular.C (recomputeTextInsets): removed function
31 * src/tabular.C (SetWidthOfMulticolCell):
33 (calculate_width_of_column_NMC): fixed return value so that it really
34 only returns true if the column-width has changed (there where
35 problems with muliticolumn-cells in this column).
37 2000-08-04 Juergen Vigna <jug@sad.it>
39 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
40 also on the scrollstatus of the inset.
41 (workAreaMotionNotify): ditto.
43 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
45 2000-08-01 Juergen Vigna <jug@sad.it>
47 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
50 * src/LyXAction.C (init):
51 * src/insets/inset.C (LocalDispatch): added support for
54 * src/insets/inset.C (scroll): new functions.
56 * src/insets/insettext.C (removeNewlines): new function.
57 (SetAutoBreakRows): removes forced newlines in the text of the
58 paragraph if autoBreakRows is set to false.
60 * src/tabular.C (Latex): generates a parbox around the cell contents
63 * src/frontends/xforms/FormTabular.C (local_update): removed
64 the radio_useparbox button.
66 * src/tabular.C (UseParbox): new function
68 2000-08-06 Baruch Even <baruch.even@writeme.com>
70 * src/graphics/GraphicsCache.h:
71 * src/graphics/GraphicsCache.C:
72 * src/graphics/GraphicsCacheItem.h:
73 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
76 * src/insets/insetgraphics.h:
77 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
78 drawing of the inline image.
80 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
81 into the wrong position.
83 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
86 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
88 * src/support/translator.h: move all typedefs to public section
90 * src/support/filetools.C (MakeLatexName): return string const
93 (FileOpenSearch): ditto
95 (LibFileSearch): ditto
96 (i18nLibFileSearch): ditto
100 (CreateBufferTmpDir): ditto
101 (CreateLyXTmpDir): ditto
106 (OnlyFilename): ditto
108 (NormalizePath): ditto
110 (GetFileContents): ditto
111 (ReplaceEnvironmentPath): ditto
114 (ChangeExtension): ditto
115 (MakeDisplayPath): ditto
116 (do_popen): return cmdret const
117 (findtexfile): return string const
119 * src/support/DebugStream.h: add some /// to please doc++
121 * src/frontends/DialogBase.h (endif): add some /// to please doc++
123 * src/texrow.C (same_rownumber): functor to use with find_if
124 (getIdFromRow): rewritten to use find_if and to not update the
125 positions. return true if row is found
126 (increasePos): new method, use to update positions
128 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
130 * src/lyxlex_pimpl.C (verifyTable): new method
133 (GetString): return string const
134 (pushTable): rewrite to use std::stack
136 (setFile): better check
139 * src/lyxlex.h: make LyXLex noncopyable
141 * src/lyxlex.C (text): return char const * const
142 (GetString): return string const
143 (getLongString): return string const
145 * src/lyx_gui_misc.C (askForText): return pair<...> const
147 * src/lastfiles.[Ch] (operator): return string const
149 * src/buffer.C (parseSingleLyXformat2Token): pass string to
150 istringstream not char const *.
151 move token.end() out of loop.
152 (readFile): move initializaton of token
154 * src/BufferView2.C (insertErrors): run texrow.increasePos if
155 getIdFromRow is successful.
157 * lib/bind/emacs.bind: don't include menus bind
159 * development/Code_rules/Rules: the beginnings of making this
160 better and covering more of the unwritten rules that we have.
162 * development/Code_rules/Recommendations: a couple of wording
165 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
167 * src/support/strerror.c: remove C++ comment.
169 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
171 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
172 LFUN_INDEX_INSERT_LAST
174 * src/texrow.C (getIdFromRow): changed from const_iterator to
175 iterator, allowing code to compile with DEC cxx
177 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
178 stores part of the class, as suggested by Allan. Will allow
180 (apply): test to apply uses InsetCommandParams operator!=
182 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
183 (apply): test to apply uses InsetCommandParams operator!=
185 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
186 stores part of the class.
187 (update): removed limits on min/max size.
189 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
190 (apply): test to apply uses InsetCommandParams operator!=
192 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
193 (Read, Write, scanCommand, getCommand): moved functionality
194 into InsetCommandParams.
196 (getScreenLabel): made pure virtual
197 new InsetCommandParams operators== and !=
199 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
200 c-tors based on InsetCommandParams. Removed others.
201 * src/insets/insetinclude.[Ch]: ditto
202 * src/insets/insetlabel.[Ch]: ditto
203 * src/insets/insetparent.[Ch]: ditto
204 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
206 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
207 insets derived from InsetCommand created using similar c-tors
208 based on InsetCommandParams
209 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
210 * src/menus.C (ShowRefsMenu): ditto
211 * src/paragraph.C (Clone): ditto
212 * src/text2.C (SetCounter): ditto
213 * src/lyxfunc.C (Dispatch) ditto
214 Also recreated old InsetIndex behaviour exactly. Can now
215 index-insert at the start of a paragraph and index-insert-last
216 without launching the pop-up.
218 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
220 * lib/lyxrc.example: mark te pdf options as non functional.
222 * src/support/lstrings.C (strToInt): move initalization of tmpstr
223 (isStrDbl): move tmpstr.end() out of loop.
224 (strToDbl): move intialization of tmpstr
225 (lowercase): return string const and move tmp.end() out of loop.
226 (uppercase): return string const and move tmp.edn() out of loop.
227 (prefixIs): add assertion
232 (containsOnly): ditto
233 (containsOnly): ditto
234 (containsOnly): ditto
235 (countChar): make last arg char not char const
236 (token): return string const
237 (subst): return string const, move tmp.end() out of loop.
238 (subst): return string const, add assertion
239 (strip): return string const
240 (frontStrip): return string const, add assertion
241 (frontStrip): return string const
246 * src/support/lstrings.C: add inclde "LAssert.h"
247 (isStrInt): move tmpstr.end() out of loop.
249 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
250 toollist.end() out of loop.
251 (deactivate): move toollist.end() out of loop.
252 (update): move toollist.end() out of loop.
253 (updateLayoutList): move tc.end() out of loop.
254 (add): move toollist.end() out of loop.
256 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
257 md.end() out of loop.
259 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
261 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
264 * src/paragraph.C (Erase): move fontlist.end() out of loop.
265 (Erase): move insetlist.end() out of loop.
267 * src/lyx_sendfax_main.C: make show_logfile static and to take a
268 ref to const string as first arg. Move initialization of some
269 variables, whitespace changes.
271 * src/kbmap.C (defkey): move table.end() out of loop.
272 (kb_keymap): move table.end() out of loop.
273 (findbinding): move table.end() out of loop.
275 * src/MenuBackend.C (hasMenu): move end() out of loop.
276 (getMenu): move end() out of loop.
277 (getMenu): move menulist_.end() out of loop.
279 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
281 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
284 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
285 (getFromLyXName): move infotab.end() out of loop.
287 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
288 -fvtable-thunks -ffunction-sections -fdata-sections
290 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
292 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
295 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
297 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
299 * src/frontends/xforms/FormCitation.[Ch],
300 src/frontends/xforms/FormIndex.[Ch],
301 src/frontends/xforms/FormToc.[Ch],
302 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
304 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
306 * src/commandtags.h: renamed, created some flags for citation
309 * src/lyx_gui_misc.C: stripped out old FD_index_form code
311 * src/lyxfunc.C (dispatch): use signals to insert index entry
313 * src/frontends/Dialogs.h: new signal createIndex
315 * src/frontends/xforms/FormCommand.[Ch],
316 src/frontends/xforms/FormCitation.[Ch],
317 src/frontends/xforms/FormToc.[Ch],
318 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
320 * src/insets/insetindex.[Ch]: GUI-independent
322 * src/frontends/xforms/FormIndex.[Ch],
323 * src/frontends/xforms/forms/form_index.fd: xforms implementation
326 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
328 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
329 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
331 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
333 * src/insets/insetref.C (Latex): rewrite so that there is now
334 question that a initialization is requested.
336 * src/insets/insetcommand.h: reenable the hide signal
338 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
340 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
341 fix handling of shortcuts (many bugs :)
342 (add_lastfiles): ditto.
344 * lib/ui/default.ui: fix a few shortcuts.
346 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
348 * Makefile.am: Fix ``rpmdist'' target to return the exit
349 status of the ``rpm'' command, instead of the last command in
350 the chain (the ``rm lyx.xpm'' command, which always returns
353 2000-08-02 Allan Rae <rae@lyx.org>
355 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
356 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
357 * src/frontends/xforms/FormToc.C (FormToc): ditto
359 * src/frontends/xforms/Makefile.am: A few forgotten files
361 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
362 Signals-not-copyable-problem Lars' started commenting out.
364 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
366 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
368 * src/insets/insetcommand.h: Signals is not copyable so anoter
369 scheme for automatic hiding of forms must be used.
371 * src/frontends/xforms/FormCitation.h: don't inerit from
372 noncopyable, FormCommand already does that.
373 * src/frontends/xforms/FormToc.h: ditto
374 * src/frontends/xforms/FormUrl.h: ditto
376 * src/frontends/xforms/FormCitation.C: add include <algorithm>
378 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
380 * src/insets/insetcommand.h (hide): new SigC::Signal0
381 (d-tor) new virtual destructor emits hide signal
383 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
384 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
386 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
387 LOF and LOT. Inset is now GUI-independent
389 * src/insets/insetloa.[Ch]: redundant
390 * src/insets/insetlof.[Ch]: ditto
391 * src/insets/insetlot.[Ch]: ditto
393 * src/frontends/xforms/forms/form_url.fd: tweaked!
394 * src/frontends/xforms/forms/form_citation.fd: ditto
396 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
397 dialogs dealing with InsetCommand insets
399 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
400 FormCommand base class
401 * src/frontends/xforms/FormUrl.[Ch]: ditto
403 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
405 * src/frontends/xforms/FormToc.[Ch]: ditto
407 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
408 passed a generic InsetCommand pointer
409 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
411 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
412 and modified InsetTOC class
413 * src/buffer.C: ditto
415 * forms/lyx.fd: strip out old FD_form_toc code
416 * src/lyx_gui_misc.C: ditto
417 * src/lyx_gui.C: ditto
418 * src/lyx_cb.C: ditto
419 * src/lyx.[Ch]: ditto
421 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
423 * src/support/utility.hpp: tr -d '\r'
425 2000-08-01 Juergen Vigna <jug@sad.it>
427 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
430 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
431 LFUN_TABULAR_FEATURES.
433 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
436 * src/insets/insettabular.C (getStatus): implemented helper function.
438 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
440 2000-07-31 Juergen Vigna <jug@sad.it>
442 * src/text.C (draw): fixed screen update problem for text-insets.
444 * src/text2.C (SetParagrpah): call an update of the inset-owner when
445 something changed probably this has to be added in various other
448 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
450 2000-07-31 Baruch Even <baruch.even@writeme.com>
452 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
453 templates to satisfy compaq cxx.
456 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
458 * src/support/translator.h (equal_1st_in_pair::operator()): take
459 const ref pair_type as arg.
460 (equal_2nd_in_pair::operator()): ditto
461 (Translator::~Translator): remove empty d-tor.
463 * src/graphics/GraphicsCache.C: move include config.h to top, also
464 put initialization of GraphicsCache::singleton here.
465 (~GraphicsCache): move here
466 (addFile): take const ref as arg
469 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
471 * src/BufferView2.C (insertLyXFile): change te with/without header
474 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
476 * src/frontends/xforms/FormGraphics.C (apply): add some
477 static_cast. Not very nice, but required by compaq cxx.
479 * src/frontends/xforms/RadioButtonGroup.h: include header
480 <utility> instead of <pair.h>
482 * src/insets/insetgraphicsParams.C: add using directive.
483 (readResize): change return type to void.
486 * src/lyxfunc.C (getStatus): add missing break for build-program
487 function; add test for Literate for export functions.
489 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
490 entries in Options menu.
492 2000-07-31 Baruch Even <baruch.even@writeme.com>
494 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
495 protect against auto-allocation; release icon when needed.
497 2000-07-31 Matej Cepl <CeplM@seznam.cz>
499 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
502 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
503 earlier czech.kmap), useful only for programming.
505 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
507 * src/frontends/xforms/FormCitation.h: fix conditioning around
510 2000-07-31 Juergen Vigna <jug@sad.it>
512 * src/frontends/xforms/FormTabular.C (local_update): changed
513 radio_linebreaks to radio_useparbox and added radio_useminipage.
515 * src/tabular.C: made support for using minipages/parboxes.
517 * src/bufferlist.C (QwriteAll): small fix for asking for save.
519 * src/insets/insetgraphics.C (draw): just draw the inset so that the
521 (descent): so the cursor is in the middle.
522 (width): bit smaller box.
524 * src/insets/insetgraphics.h: added display() function.
526 2000-07-31 Baruch Even <baruch.even@writeme.com>
528 * src/frontends/Dialogs.h: Added showGraphics signals.
530 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
531 xforms form definition of the graphics dialog.
533 * src/frontends/xforms/FormGraphics.h:
534 * src/frontends/xforms/FormGraphics.C: Added files, the
535 GUIndependent code of InsetGraphics
537 * src/insets/insetgraphics.h:
538 * src/insets/insetgraphics.C: Major writing to make it work.
540 * src/insets/insetgraphicsParams.h:
541 * src/insets/insetgraphicsParams.C: Added files, parameter passing
542 struct between InsetGraphics and GUI.
544 * src/LaTeXFeatures.h:
545 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
546 support for graphicx package.
548 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
549 for the graphics inset.
551 * src/support/translator.h: Added file, used in
552 InsetGraphicsParams. this is a template to translate between two
555 * src/frontends/xforms/RadioButtonGroup.h:
556 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
557 way to easily control a radio button group.
559 2000-07-28 Juergen Vigna <jug@sad.it>
561 * src/insets/insettabular.C (LocalDispatch):
562 (TabularFeatures): added support for lyx-functions of tabular features.
563 (cellstart): refixed this function after someone wrongly changed it.
566 * src/LyXAction.C (init): added support for tabular-features
568 2000-07-28 Allan Rae <rae@lyx.org>
570 * src/frontends/xforms/FormPreferences.C (build): Setup input return
571 checking. NOTE: It seems that pressing ESC to cancel the dialog also
572 triggers the callback for input checking. As a result we sometimes get
573 "LyX: This shouldn't happen..." printed to cerr.
574 (input): Started using status variable since I only free() on
575 destruction. Some input checking for paths and font sizes.
577 * src/frontends/xforms/FormPreferences.h: Use status to control
578 activation of Ok and Apply
580 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
581 callback. Also resized to stop segfaults with 0.88. The problem is
582 that xforms-0.88 requires the folder to be wide enough to fit all the
583 tabs. If it isn't it causes all sorts of problems.
585 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
587 * src/frontends/xforms/forms/README: Reflect reality.
589 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
590 * src/frontends/xforms/forms/makefile: ditto.
592 * src/commandtags.h: Get access to new Preferences dialog
593 * src/LyXAction.C: ditto
594 * src/lyxfunc.C: ditto
595 * lib/ui/default.ui: ditto
597 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
599 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
601 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
604 * src/frontends/xforms/form_url.[Ch]: added.
606 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
608 * src/insets/insetbib.h: fixed bug in previous commit
610 * src/frontends/xforms/FormUrl.h: ditto
612 * src/frontends/xforms/FormPrint.h: ditto
614 * src/frontends/xforms/FormPreferences.h: ditto
616 * src/frontends/xforms/FormCopyright.h: ditto
618 * src/frontends/xforms/FormCitation.C: ditto
620 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
621 private copyconstructor and private default contructor
623 * src/support/Makefile.am: add utility.hpp
625 * src/support/utility.hpp: new file from boost
627 * src/insets/insetbib.h: set owner in clone
629 * src/frontends/xforms/FormCitation.C: added missing include
632 * src/insets/form_url.[Ch]: removed
634 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
636 * development/lyx.spec.in
637 * Makefile.am: Fix buglet for LyX RPM generation resulting from
638 file/directory re-organization.
640 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
642 * src/insets/insetcommand.[Ch]: moved the string data and
643 associated manipulation methods into a new stand-alone class
644 InsetCommandParams. This class has two additional methods
645 getAsString() and setFromString() allowing the contents to be
646 moved around as a single string.
647 (addContents) method removed.
648 (setContents) method no longer virtual.
650 * src/buffer.C (readInset): made use of new InsetCitation,
651 InsetUrl constructors based on InsetCommandParams.
653 * src/commandtags.h: add LFUN_INSERT_URL
655 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
656 independent InsetUrl and use InsetCommandParams to extract
657 string info and create new Insets.
659 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
661 * src/frontends/xforms/FormCitation.C (apply): uses
664 * src/frontends/xforms/form_url.C
665 * src/frontends/xforms/form_url.h
666 * src/frontends/xforms/FormUrl.h
667 * src/frontends/xforms/FormUrl.C
668 * src/frontends/xforms/forms/form_url.fd: new files
670 * src/insets/insetcite.[Ch]: removed unused constructors.
672 * src/insets/insetinclude.[Ch]: no longer store filename
674 * src/insets/inseturl.[Ch]: GUI-independent.
676 2000-07-26 Juergen Vigna <jug@sad.it>
677 * renamed frontend from gtk to gnome as it is that what is realized
678 and did the necessary changes in the files.
680 2000-07-26 Marko Vendelin <markov@ioc.ee>
682 * configure.in: cleaning up gnome configuration scripts
684 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
686 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
687 shortcuts syndrom by redrawing them explicitely (a better solution
688 would be appreciated).
690 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
692 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
695 * src/lyx_cb.C (MenuExport): change html export to do the right
696 thing depending of the document type (instead of having
697 html-linuxdoc and html-docbook).
698 * src/lyxfunc.C (getStatus): update for html
699 * lib/ui/default.ui: simplify due to the above change.
700 * src/menus.C (ShowFileMenu): update too (in case we need it).
702 * src/MenuBackend.C (read): if a menu is defined twice, add the
703 new entries to the exiting one.
705 2000-07-26 Juergen Vigna <jug@sad.it>
707 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
709 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
710 and return a bool if it did actual save the file.
711 (AutoSave): don't autosave a unnamed doc.
713 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
714 check if this is an UNNAMED new file and react to it.
715 (newFile): set buffer to unnamed and change to not mark a new
716 buffer dirty if I didn't do anything with it.
718 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
720 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
722 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
723 friend as per Angus's patch posted to lyx-devel.
725 * src/ext_l10n.h: updated
727 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
728 gettext on the style string right before inserting them into the
731 * autogen.sh: add code to extract style strings form layout files,
734 * src/frontends/gtk/.cvsignore: add MAKEFILE
736 * src/MenuBackend.C (read): run the label strings through gettext
737 before storing them in the containers.
739 * src/ext_l10n.h: new file
741 * autogen.sh : generate the ext_l10n.h file here
743 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
745 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
748 * lib/ui/default.ui: fix a couple of typos.
750 * config/gnome/gtk.m4: added (and added to the list of files in
753 * src/insets/insetinclude.C (unique_id): fix when we are using
754 lyxstring instead of basic_string<>.
755 * src/insets/insettext.C (LocalDispatch): ditto.
756 * src/support/filetools.C: ditto.
758 * lib/configure.m4: create the ui/ directory if necessary.
760 * src/LyXView.[Ch] (updateToolbar): new method.
762 * src/BufferView_pimpl.C (buffer): update the toolbar when
763 opening/closing buffer.
765 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
767 * src/LyXAction.C (getActionName): enhance to return also the name
768 and options of pseudo-actions.
769 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
771 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
772 as an example of what is possible). Used in File->Build too (more
773 useful) and in the import/export menus (to mimick the complicated
774 handling of linuxdoc and friends). Try to update all the entries.
776 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
779 * src/MenuBackend.C (read): Parse the new OptItem tag.
781 * src/MenuBackend.h: Add a new optional_ data member (used if the
782 entry should be omitted when the lyxfunc is disabled).
784 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
785 function, used as a shortcut.
786 (create_submenu): align correctly the shortcuts on the widest
789 * src/MenuBackend.h: MenuItem.label() only returns the label of
790 the menu without shortcut; new method shortcut().
792 2000-07-14 Marko Vendelin <markov@ioc.ee>
794 * src/frontends/gtk/Dialogs.C:
795 * src/frontends/gtk/FormCopyright.C:
796 * src/frontends/gtk/FormCopyright.h:
797 * src/frontends/gtk/Makefile.am: added these source-files for the
798 Gtk/Gnome support of the Copyright-Dialog.
800 * src/main.C: added Gnome::Main initialization if using
801 Gtk/Gnome frontend-GUI.
803 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
805 * config/gnome/aclocal-include.m4
806 * config/gnome/compiler-flags.m4
807 * config/gnome/curses.m4
808 * config/gnome/gnome--.m4
809 * config/gnome/gnome-bonobo-check.m4
810 * config/gnome/gnome-common.m4
811 * config/gnome/gnome-fileutils.m4
812 * config/gnome/gnome-ghttp-check.m4
813 * config/gnome/gnome-gnorba-check.m4
814 * config/gnome/gnome-guile-checks.m4
815 * config/gnome/gnome-libgtop-check.m4
816 * config/gnome/gnome-objc-checks.m4
817 * config/gnome/gnome-orbit-check.m4
818 * config/gnome/gnome-print-check.m4
819 * config/gnome/gnome-pthread-check.m4
820 * config/gnome/gnome-support.m4
821 * config/gnome/gnome-undelfs.m4
822 * config/gnome/gnome-vfs.m4
823 * config/gnome/gnome-x-checks.m4
824 * config/gnome/gnome-xml-check.m4
825 * config/gnome/gnome.m4
826 * config/gnome/gperf-check.m4
827 * config/gnome/gtk--.m4
828 * config/gnome/linger.m4
829 * config/gnome/need-declaration.m4: added configuration scripts
830 for Gtk/Gnome frontend-GUI
832 * configure.in: added support for the --with-frontend=gtk option
834 * autogen.sh: added config/gnome/* to list of config-files
836 * acconfig.h: added define for GTKGUI-support
838 * config/lyxinclude.m4: added --with-frontend[=value] option value
839 for Gtk/Gnome frontend-GUI support.
841 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
843 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
847 * src/paragraph.C (GetChar): remove non-const version
849 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
852 * src/lyx_main.C (init): if "preferences" exist, read that instead
854 (ReadRcFile): return bool if the file could be read ok.
855 (ReadUIFile): add a check to see if lex file is set ok.
857 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
858 bastring can be used instead of lyxstring (still uses the old code
859 if std::string is good enough or if lyxstring is used.)
861 * src/encoding.C: make the arrays static, move ininle functions
863 * src/encoding.h: from here.
865 * src/buffer.C: have last_isnet_read as a file scope variable for now.
866 (parseSingleLyXformat2Token): move inset parsing to separate method
867 (readInset): new private method
869 * src/Variables.h: remove virtual from get().
871 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
872 access to NEW_INSETS and NEW_TABULAR
874 * src/MenuBackend.h: remove superfluous forward declaration of
875 MenuItem. Add documentations tags "///", remove empty MenuItem
876 destructor, remove private default contructor.
878 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
880 (read): more string mlabel and mname to where they are used
881 (read): remove unused variables mlabel and mname
882 (defaults): unconditional clear, make menusetup take advantage of
883 add returning Menu &.
885 * src/LyXView.h: define NEW_MENUBAR as default
887 * src/LyXAction.C: include lyxparagraph.h temporary to get access
888 to NEW_INSETS and NEW_TABULAR.
889 (init): commetn out some funcs that is obsolete when NEW_INSETS is
890 defined. Change some of the "xxxx-inset-insert" functions names to
893 * several files: more enahncements to NEW_INSETS and the resulting
896 * lib/lyxrc.example (\date_insert_format): move to misc section
898 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
899 bastring and use AC_CACHE_CHECK.
900 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
901 the system have the newest methods. uses AC_CACHE_CHECK
902 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
903 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
904 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
906 * configure.in: add LYX_CXX_GOOD_STD_STRING
908 * acinclude.m4: recreated
910 2000-07-24 Amir Karger
912 * README: add Hebrew, Arabic kmaps
915 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
917 * src/buffer.C (writeFileAscii): Define actcell as an int instead
920 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
922 * Lot of files: add pragma interface/implementation.
924 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
926 * lib/ui/default.ui: new file (ans new directory). Contains the
927 default menu and toolbar.
929 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
930 global space. Toolbars are now read (as menus) in ui files.
932 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
934 * src/lyxfunc.C (getStatus): do not exit immediately if a command
935 is disabled because the document is read-only. We want to have the
936 toggle state of the function anyway.
937 (getStatus): add code for LFUN_VC* functions (mimicking what is
938 done in old-style menus)
940 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
941 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
943 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
944 * src/BufferView_pimpl.C: ditto.
945 * src/lyxfunc.C: ditto.
947 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
948 default). This replaces old-style menus by new ones.
950 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
951 MenuItem. Contain the data structure of a menu.
953 * src/insets/insettext.C: use LyXView::setLayout instead of
954 accessing directly the toolbar combox.
955 * src/lyxfunc.C (Dispatch): ditto.
957 * src/LyXView.C (setLayout): new method, which just calls
958 Toolbar::setLayout().
959 (updateLayoutChoice): move part of this method in Toolbar.
961 * src/toolbar.[Ch]: removed.
963 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
964 implementation the toolbar.
966 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
967 the toolbar. It might make sense to merge it with ToolbarDefaults
969 (setLayout): new function.
970 (updateLayoutList): ditto.
971 (openLayoutList): ditto.
973 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
974 xforms implementation of the toolbar.
975 (get_toolbar_func): comment out, since I do not
976 know what it is good for.
978 * src/ToolbarDefaults.h: Add the ItemType enum.
980 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
981 for a list of allocated C strings. Used in Menubar xforms
982 implementation to avoid memory leaks.
984 * src/support/lstrings.[Ch] (uppercase): new version taking and
988 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
989 * lib/bind/emacs.bind: ditto.
991 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
993 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
994 forward decl of LyXView.
996 * src/toolbar.C (toolbarItem): moved from toolbar.h
997 (toolbarItem::clean): ditto
998 (toolbarItem::~toolbarItem): ditto
999 (toolbarItem::operator): ditto
1001 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1003 * src/paragraph.h: control the NEW_TABULAR define from here
1005 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1006 USE_TABULAR_INSETS to NEW_TABULAR
1008 * src/ToolbarDefaults.C: add include "lyxlex.h"
1010 * files using the old table/tabular: use NEW_TABULAR to control
1011 compilation of old tabular stuff.
1013 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1016 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1017 planemet in reading of old style floats, fix the \end_deeper
1018 problem when reading old style floats.
1020 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1022 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1024 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1026 * lib/bind/sciword.bind: updated.
1028 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1030 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1031 layout write problem
1033 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1035 * src/Makefile.am (INCLUDES): remove image directory from include
1038 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1039 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1041 * src/LyXView.C (create_form_form_main): read the application icon
1044 * lib/images/*.xpm: change the icons to use transparent color for
1047 * src/toolbar.C (update): change the color of the button when it
1050 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1052 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1053 setting explicitely the minibuffer.
1054 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1056 * src/LyXView.C (showState): new function. Shows font information
1057 in minibuffer and update toolbar state.
1058 (LyXView): call Toolbar::update after creating the
1061 * src/toolbar.C: change toollist to be a vector instead of a
1063 (BubbleTimerCB): get help string directly from the callback
1064 argument of the corresponding icon (which is the action)
1065 (set): remove unnecessary ugliness.
1066 (update): new function. update the icons (depressed, disabled)
1067 depending of the status of the corresponding action.
1069 * src/toolbar.h: remove help in toolbarItem
1071 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1073 * src/Painter.C (text): Added code for using symbol glyphs from
1074 iso10646 fonts. Currently diabled.
1076 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1079 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1080 magyar,turkish and usorbian.
1082 * src/paragraph.C (isMultiLingual): Made more efficient.
1084 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1087 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1088 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1089 Also changed the prototype to "bool math_insert_greek(char)".
1091 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1093 * lots of files: apply the NEW_INSETS on all code that will not be
1094 needed when we move to use the new insets. Enable the define in
1095 lyxparagrah.h to try it.
1097 * src/insets/insettabular.C (cellstart): change to be a static
1099 (InsetTabular): initialize buffer in the initializer list.
1101 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1103 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1104 form_print.h out of the header file. Replaced with forward
1105 declarations of the relevant struct.
1107 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1110 * src/commandtags.h: do not include "debug.h" which does not
1111 belong there. #include it in some other places because of this
1114 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1116 * src/insets/insetcaption.C: add a couple "using" directives.
1118 * src/toolbar.C (add): get the help text directly from lyxaction.
1120 (setPixmap): new function. Loads from disk and sets a pixmap on a
1121 botton; the name of the pixmap file is derived from the command
1124 * src/toolbar.h: remove members isBitmap and pixmap from
1127 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1128 * lib/images/: move many files from images/banner.xpm.
1130 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1132 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1133 * src/toolbar.C: ditto.
1134 * configure.in: ditto.
1135 * INSTALL: document.
1137 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1138 the spellchecker popup is closed from the WM.
1140 2000-07-19 Juergen Vigna <jug@sad.it>
1142 * src/insets/insetfloat.C (Write): small fix because we use the
1143 insetname for the type now!
1145 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1147 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1150 * src/frontends/Dialogs.h: removed hideCitation signal
1152 * src/insets/insetcite.h: added hide signal
1154 * src/insets/insetcite.C (~InsetCitation): emits new signal
1155 (getScreenLabel): "intelligent" label should now fit on the screen!
1157 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1159 * src/frontends/xforms/FormCitation.C (showInset): connects
1160 hide() to the inset's hide signal
1161 (show): modified to use fl_set_object_position rather than
1162 fl_set_object_geometry wherever possible
1164 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1166 * src/insets/lyxinset.h: add caption code
1168 * src/insets/insetfloat.C (type): new method
1170 * src/insets/insetcaption.C (Write): new method
1172 (LyxCode): new method
1174 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1175 to get it right together with using the FloatList.
1177 * src/commandtags.h: add LFUN_INSET_CAPTION
1178 * src/lyxfunc.C (Dispatch): handle it
1180 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1183 * src/Variables.[Ch]: make expand take a const reference, remove
1184 the destructor, some whitespace changes.
1186 * src/LyXAction.C (init): add caption-inset-insert
1188 * src/FloatList.C (FloatList): update the default floats a bit.
1190 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1192 * src/Variables.[Ch]: new files. Intended to be used for language
1193 specific strings (like \chaptername) and filename substitution in
1196 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1198 * lib/kbd/american.kmap: update
1200 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1202 * src/bufferparams.[Ch]: remove member allowAccents.
1204 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1206 * src/LaTeXLog.C: use the log_form.h header.
1207 * src/lyx_gui.C: ditto.
1208 * src/lyx_gui_misc.C: ditto.
1209 * src/lyxvc.h: ditto.
1211 * forms/log_form.fd: new file, created from latexoptions.fd. I
1212 kept the log popup and nuked the options form.
1214 * src/{la,}texoptions.[Ch]: removed.
1215 * src/lyx_cb.C (LaTeXOptions): ditto
1217 * src/lyx_gui.C (create_forms): do not handle the
1218 fd_latex_options form.
1220 2000-07-18 Juergen Vigna <jug@sad.it>
1222 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1223 name of the inset so that it can be requested outside (text2.C).
1225 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1228 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1230 * src/mathed/formula.h (ConvertFont): constify
1232 * src/mathed/formula.C (Read): add warning if \end_inset is not
1233 found on expected place.
1235 * src/insets/lyxinset.h (ConvertFont): consify
1237 * src/insets/insetquotes.C (ConvertFont): constify
1238 * src/insets/insetquotes.h: ditto
1240 * src/insets/insetinfo.h: add labelfont
1242 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1243 (ascent): use labelfont
1247 (Write): make .lyx file a bit nicer
1249 * src/insets/insetfloat.C (Write): simplify somewhat...
1250 (Read): add warning if arg is not found
1252 * src/insets/insetcollapsable.C: add using std::max
1253 (Read): move string token and add warning in arg is not found
1254 (draw): use std::max to get the right ty
1255 (getMaxWidth): simplify by using std::max
1257 * src/insets/insetsection.h: new file
1258 * src/insets/insetsection.C: new file
1259 * src/insets/insetcaption.h: new file
1260 * src/insets/insetcaption.C: new file
1262 * src/insets/inset.C (ConvertFont): constify signature
1264 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1265 insetcaption.[Ch] and insetsection.[Ch]
1267 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1268 uses to use LABEL_COUNTER_CHAPTER instead.
1269 * src/text2.C (SetCounter): here
1271 * src/counters.h: new file
1272 * src/counters.C: new file
1273 * src/Sectioning.h: new file
1274 * src/Sectioning.C: new file
1276 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1278 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1280 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1283 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1286 2000-07-17 Juergen Vigna <jug@sad.it>
1288 * src/tabular.C (Validate): check if array-package is needed.
1289 (SetVAlignment): added support for vertical alignment.
1290 (SetLTFoot): better support for longtable header/footers
1291 (Latex): modified to support added features.
1293 * src/LaTeXFeatures.[Ch]: added array-package.
1295 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1297 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1300 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1302 * configure.in: do not forget to put a space after -isystem.
1304 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1306 * lib/kbd/arabic.kmap: a few fixes.
1308 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1310 * some whitespace chagnes to a number of files.
1312 * src/support/DebugStream.h: change to make it easier for
1313 doc++ to parse correctly.
1314 * src/support/lyxstring.h: ditto
1316 * src/mathed/math_utils.C (compara): change to have only one
1318 (MathedLookupBOP): change because of the above.
1320 * src/mathed/math_delim.C (math_deco_compare): change to have only
1322 (search_deco): change becasue of the above.
1324 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1325 instead of manually coded one.
1327 * src/insets/insetquotes.C (Read): read the \end_inset too
1329 * src/insets/insetlatex.h: remove file
1330 * src/insets/insetlatex.C: remove file
1332 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1334 (InsetPrintIndex): remove destructor
1336 * src/insets/insetinclude.h: remove default constructor
1338 * src/insets/insetfloat.C: work to make it work better
1340 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1342 * src/insets/insetcite.h (InsetCitation): remove default constructor
1344 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1346 * src/text.C (GetColumnNearX): comment out some currently unused code.
1348 * src/paragraph.C (writeFile): move some initializations closer to
1350 (CutIntoMinibuffer): small change to use new matchIT operator
1354 (InsertInset): ditto
1357 (InsetIterator): ditto
1358 (Erase): small change to use new matchFT operator
1360 (GetFontSettings): ditto
1361 (HighestFontInRange): ditto
1364 * src/lyxparagraph.h: some chars changed to value_type
1365 (matchIT): because of some stronger checking (perhaps too strong)
1366 in SGI STL, the two operator() unified to one.
1369 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1371 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1372 the last inset read added
1373 (parseSingleLyXformat2Token): some more (future) compability code added
1374 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1375 (parseSingleLyXformat2Token): set last_inset_read
1376 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1377 (parseSingleLyXformat2Token): don't double intializw string next_token
1379 * src/TextCache.C (text_fits::operator()): add const's to the signature
1380 (has_buffer::operator()): ditto
1382 * src/Floating.h: add some comments on the class
1384 * src/FloatList.[Ch] (typeExist): new method
1387 * src/BackStack.h: added default constructor, wanted by Gcc.
1389 2000-07-14 Juergen Vigna <jug@sad.it>
1391 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1393 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1395 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1396 do a redraw when the window is resized!
1397 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1399 * src/insets/insettext.C (resizeLyXText): added function to correctly
1400 being able to resize the LyXWindow.
1402 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1404 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1406 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1407 crashes when closing dialog to a deleted inset.
1409 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1410 method! Now similar to other insets.
1412 2000-07-13 Juergen Vigna <jug@sad.it>
1414 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1416 * lib/examples/Literate.lyx: small patch!
1418 * src/insets/insetbib.C (Read): added this function because of wrong
1419 Write (without [begin|end]_inset).
1421 2000-07-11 Juergen Vigna <jug@sad.it>
1423 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1424 as the insertInset could not be good!
1426 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1427 the bool param should not be last.
1429 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1431 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1432 did submit that to Karl).
1434 * configure.in: use -isystem instead of -I for X headers. This
1435 fixes a problem on solaris with a recent gcc;
1436 put the front-end code after the X detection code;
1437 configure in sigc++ before lib/
1439 * src/lyx_main.C (commandLineHelp): remove -display from command
1442 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
1444 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
1445 Also put in Makefile rules for building the ``listerrors''
1446 program for parsing errors from literate programs written in LyX.
1448 * lib/build-listerrors: Added small shell script as part of compile
1449 process. This builds a working ``listerrors'' binary if noweb is
1450 installed and either 1) the VNC X server is installed on the machine,
1451 or 2) the user is compiling from within a GUI. The existence of a GUI
1452 is necessary to use the ``lyx --export'' feature for now. This
1453 hack can be removed once ``lyx --export'' no longer requires a GUI to
1456 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
1458 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
1459 now passed back correctly from gcc and placed "under" error
1460 buttons in a Literate LyX source.
1462 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1464 * src/text.C (GetColumnNearX): Better behavior when a RTL
1465 paragraph is ended by LTR text.
1467 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
1470 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1472 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
1473 true when clipboard is empty.
1475 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1477 * text.C (Backspace): Prevent rebreaking of a row if it is the last
1478 row of the paragraph.
1479 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
1480 to prevent calculation of bidi tables
1482 2000-07-07 Juergen Vigna <jug@sad.it>
1484 * src/screen.C (ToggleSelection): added y_offset and x_offset
1487 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
1490 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
1492 * src/insets/insettext.C: fixed Layout-Display!
1494 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1496 * configure.in: add check for strings.h header.
1498 * src/spellchecker.C: include <strings.h> in order to have a
1499 definition for bzero().
1501 2000-07-07 Juergen Vigna <jug@sad.it>
1503 * src/insets/insettext.C (draw): set the status of the bv->text to
1504 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
1506 * src/screen.C (DrawOneRow):
1507 (DrawFromTo): redraw the actual row if something has changed in it
1510 * src/text.C (draw): call an update of the toplevel-inset if something
1511 has changed inside while drawing.
1513 * src/lyxtext.h: added CHANGED_IN_DRAW status.
1515 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
1517 * src/insets/insetbib.[Ch] (callback) new method, moving callback
1518 processing inside class.
1520 * src/insets/insetindex.[Ch] (callback) new method, moving callback
1521 processing inside class.
1523 * src/insets/insetindex.h new struct Holder, consistent with other
1526 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
1527 citation dialog from main code and placed it in src/frontends/xforms.
1528 Dialog launched through signals instead of callbacks
1530 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
1532 * lyx.man: update the options description.
1534 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
1536 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
1537 handle neg values, set min width to 590, add doc about -display
1539 2000-07-05 Juergen Vigna <jug@sad.it>
1541 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
1542 calls to BufferView *.
1544 * src/insets/insettext.C (checkAndActivateInset): small fix non
1545 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
1547 * src/insets/insetcommand.C (Read): Fixed as insets should read till
1548 their \end_inset token!
1550 2000-07-04 edscott <edscott@imp.mx>
1552 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
1553 lib/lyxrc.example: added option \wheel_jump
1555 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
1557 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
1558 remove support for -width,-height,-xpos and -ypos.
1560 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
1562 * src/encoding.[Ch]: New files.
1564 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
1565 (text): Call to the underline() method only when needed.
1567 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
1569 * src/buffer.C (makeLaTeXFile): Compute automatically the input
1570 encoding(s) for the document.
1572 * src/bufferparams.C (BufferParams): Changed default value of
1575 * src/language.C (newLang): Removed.
1576 (items[]): Added encoding information for all defined languages.
1578 * src/lyx_gui.C (create_forms): Added "auto" option to the input
1579 encoding choice button.
1581 * src/lyxrc.h (font_norm_type): New member variable.
1582 (set_font_norm_type): New method.
1584 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
1585 paragraphs with different encodings.
1587 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
1588 (TransformChar): Changed to work correctly with Arabic points.
1589 (draw): Added support for drawing Arabic points.
1590 (draw): Removed code for drawing underbars (this is done by
1593 * src/support/textutils.h (IsPrintableNonspace): New function.
1595 * src/BufferView_pimpl.h: Added "using SigC::Object".
1596 * src/LyXView.h: ditto.
1598 * src/insets/insetinclude.h (include_label): Changed to mutable.
1600 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1602 * src/mathed/math_iter.h: remove empty destructor
1604 * src/mathed/math_cursor.h: remove empty destructor
1606 * src/insets/lyxinset.h: add THEOREM_CODE
1608 * src/insets/insettheorem.[Ch]: new files
1610 * src/insets/insetminipage.C: (InsertInset): remove
1612 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
1614 (InsertInset): remove
1616 * src/insets/insetlist.C: (InsertList): remove
1618 * src/insets/insetfootlike.[Ch]: new files
1620 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
1623 (InsertInset): ditto
1625 * src/insets/insetert.C: remove include Painter.h, reindent
1626 (InsertInset): move to header
1628 * src/insets/insetcollapsable.h: remove explicit from default
1629 contructor, remove empty destructor, add InsertInset
1631 * src/insets/insetcollapsable.C (InsertInset): new func
1633 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
1635 * src/vspace.h: add explicit to constructor
1637 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
1638 \textcompwordmark, please test this.
1640 * src/lyxrc.C: set ascii_linelen to 65 by default
1642 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
1644 * src/commandtags.h: add LFUN_INSET_THEOREM
1646 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
1647 (makeLinuxDocFile): remove _some_ of the nice logic
1648 (makeDocBookFile): ditto
1650 * src/Painter.[Ch]: (~Painter): removed
1652 * src/LyXAction.C (init): entry for insettheorem added
1654 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
1656 (deplog): code to detect files generated by LaTeX, needs testing
1659 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1661 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
1663 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1665 * src/LaTeX.C (deplog): Add a check for files that are going to be
1666 created by the first latex run, part of the project to remove the
1669 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
1670 contents to the extension list.
1672 2000-07-04 Juergen Vigna <jug@sad.it>
1674 * src/text.C (NextBreakPoint): added support for needFullRow()
1676 * src/insets/lyxinset.h: added needFullRow()
1678 * src/insets/insetcollapsable.C: redone now this uses a text-inset
1681 * src/insets/insettext.C: lots of changes for update!
1683 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
1685 * src/LaTeXFeatures.h: add a missing std:: qualifier.
1687 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
1689 * src/insets/insetinclude.C (InsetInclude): fixed
1690 initialization of include_label.
1691 (unique_id): now returns a string.
1693 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
1695 * src/LaTeXFeatures.h: new member IncludedFiles, for
1696 a map of key, included file name.
1698 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
1699 with the included files for inclusion in SGML preamble,
1700 i. e., linuxdoc and docbook.
1703 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
1704 nice (is the generated linuxdoc code to be exported?), that
1705 allows to remove column, and only_body that will be true for
1706 slave documents. Insets are allowed inside SGML font type.
1707 New handling of the SGML preamble for included files.
1708 (makeDocBookFile): the same for docbook.
1710 * src/insets/insetinclude.h:
1711 * src/insets/insetinclude.C (Validate): keeps a list of included files.
1713 (DocBook): new export methods.
1715 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
1716 and makeDocBookFile.
1718 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
1719 formats to export with command line argument -x.
1721 2000-06-29 Juergen Vigna <jug@sad.it>
1723 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
1724 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
1726 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
1727 region could already been cleared by an inset!
1729 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
1731 * src/BufferView_pimpl.h: remove member variables lyx_focus and
1734 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
1736 (cursorToggle): remove special handling of lyx focus.
1738 2000-06-28 Juergen Vigna <jug@sad.it>
1740 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
1743 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1745 * src/insets/insetindex.C (Edit): add a callback when popup is
1748 * src/insets/insettext.C (LocalDispatch):
1749 * src/insets/insetmarginal.h:
1750 * src/insets/insetlist.h:
1751 * src/insets/insetfoot.h:
1752 * src/insets/insetfloat.h:
1753 * src/insets/insetert.h: add a missing std:: qualifier.
1755 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
1757 * src/support/lyxsum.C (sum): '\0' teminate file read when using
1760 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
1762 * src/insets/insettext.C (Read): remove tmptok unused variable
1763 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
1764 (InsertInset): change for new InsetInset code
1766 * src/insets/insettext.h: add TEXT inline method
1768 * src/insets/insettext.C: remove TEXT macro
1770 * src/insets/insetmarginal.C (Write): new method
1771 (Latex): change output slightly
1773 * src/insets/insetfoot.C (Write): new method
1774 (Latex): change output slightly (don't use endl when no need)
1776 * src/insets/insetert.C (Write): new method
1778 * src/insets/insetcollapsable.h: make button_length, button_top_y
1779 and button_bottm_y protected.
1781 * src/insets/insetcollapsable.C (Write): simplify code by using
1782 tostr. Also do not output the float name, the children class
1783 should to that to get control over own arguments
1785 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
1786 src/insets/insetminipage.[Ch]:
1789 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
1791 * src/lyxfunc.C (Dispatch): cases for new insets/commands
1793 * src/Makefile.am (lyx_SOURCES): add the new files
1795 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
1796 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
1797 * src/commandtags.h: ditto
1799 * src/LaTeXFeatures.h: add a std::set of used floattypes
1801 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
1803 * src/FloatList.[Ch] src/Floating.h: new files
1805 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
1807 * src/lyx_cb.C (TableApplyCB): ditto
1809 * src/text2.C: ditto
1810 * src/buffer.C (SimpleLinuxDocOnePar): ditto
1811 (parseSingleLyXformat2Token): ditto + add code for
1812 backwards compability for old float styles + add code for new insets
1814 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
1816 (InsertInset(size_type, Inset *, LyXFont)): new method
1817 (InsetChar(size_type, char)): changed to use the other InsetChar
1818 with a LyXFont(ALL_INHERIT).
1819 (InsetInset(size_type, Inset*)): changed to use InsetChar to
1820 insert the META_INSET.
1822 * sigc++/thread.cc (Privete<int>::operator int&): move definition
1824 * sigc++/thread.h (Threads): from here
1826 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
1827 definition out of line
1828 * sigc++/scope.h: from here
1830 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1832 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
1833 is specified (adapted from a patch from edscott <edscott@imp.mx>).
1835 * Makefile.am (bindist): new target.
1837 * INSTALL: add instructions for doing a binary distribution.
1839 * development/tools/README.bin.example: update a bit.
1841 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
1844 * lib/lyxrc.example: new lyxrc tag \set_color.
1846 * src/lyxfunc.C (Dispatch):
1847 * src/commandtags.h:
1848 * src/LyXAction.C: new lyxfunc "set-color".
1850 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
1851 and an x11name given as strings.
1853 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
1854 cache when a color is changed.
1856 2000-06-26 Juergen Vigna <jug@sad.it>
1858 * src/lyxrow.C (width): added this functions and variable.
1860 * src/insets/insetcite.C (create_form_citation_form): some Gravity
1863 * src/text.C (SetHeightOfRow): fixed calcualting of width.
1865 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1867 * images/undo_bw.xpm: new icon.
1868 * images/redo_bw.xpm: ditto.
1870 * configure.in (INSTALL_SCRIPT): change value to
1871 ${INSTALL} to avoid failures of install-script target.
1872 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
1874 * src/BufferView.h: add a magic "friend" declaration to please
1877 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
1879 * forms/cite.fd: modified to allow resizing without messing
1882 * src/insetcite.C: Uses code from cite.fd almost without
1884 User can now resize dialog in the x-direction.
1885 Resizing the dialog in the y-direction is prevented, as the
1886 code does this intelligently already.
1888 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1890 * INSTALL: remove obsolete entry in "problems" section.
1892 * lib/examples/sl_*.lyx: update of the slovenian examples.
1894 * src/support/FileInfo.[Ch] (getBlockSize): remove.
1896 2000-06-23 Juergen Vigna <jug@sad.it>
1898 * src/lyxtext.h: added a 'cleared' flag to draw() function.
1900 * src/buffer.C (resize): delete the LyXText of textinsets.
1902 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
1904 * src/insets/lyxinset.h: added another parameter 'cleared' to
1905 the draw() function.
1907 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
1908 unlocking inset in inset.
1910 2000-06-22 Juergen Vigna <jug@sad.it>
1912 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
1913 of insets and moved first to LyXText.
1915 * src/mathed/formulamacro.[Ch]:
1916 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
1918 2000-06-21 Juergen Vigna <jug@sad.it>
1920 * src/text.C (GetVisibleRow): look if I should clear the area or not
1921 using Inset::doClearArea() function.
1923 * src/insets/lyxinset.h: added doClearArea() function and
1924 modified draw(Painter &, ...) to draw(BufferView *, ...)
1926 * src/text2.C (UpdateInset): return bool insted of int
1928 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
1930 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
1931 combox in the character popup
1933 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
1934 BufferParams const & params
1936 2000-06-20 Juergen Vigna <jug@sad.it>
1938 * src/insets/insettext.C (SetParagraphData): set insetowner on
1941 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1943 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
1944 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
1946 (form_main_): remove
1948 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
1949 (create_form_form_main): remove FD_form_main stuff, connect to
1950 autosave_timeout signal
1952 * src/LyXView.[Ch] (getMainForm): remove
1953 (UpdateTimerCB): remove
1954 * src/BufferView_pimpl.h: inherit from SigC::Object
1956 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
1957 signal instead of callback
1959 * src/BufferView.[Ch] (cursorToggleCB): remove
1961 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1963 * src/BufferView_pimpl.C: changes because of the one below
1965 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
1966 instead of storing a pointer to a LyXText.
1968 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
1970 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
1972 * src/lyxparagraph.h
1974 * src/paragraph.C: Changed fontlist to a sorted vector.
1976 2000-06-19 Juergen Vigna <jug@sad.it>
1978 * src/BufferView.h: added screen() function.
1980 * src/insets/insettext.C (LocalDispatch): some selection code
1983 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
1985 * src/insets/insettext.C (SetParagraphData):
1987 (InsetText): fixes for multiple paragraphs.
1989 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
1991 * development/lyx.spec.in: Call configure with ``--without-warnings''
1992 to work around a bug with the Makefiles when doing ``make lyxrpm''.
1993 This should be fine, however, since we generally don't want to be
1994 verbose when making an RPM.
1996 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
1998 * lib/scripts/fig2pstex.py: New file
2000 2000-06-16 Juergen Vigna <jug@sad.it>
2002 * src/insets/insettabular.C (UpdateLocal):
2003 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2004 (LocalDispatch): Changed all functions to use LyXText.
2006 2000-06-15 Juergen Vigna <jug@sad.it>
2008 * src/text.C (SetHeightOfRow): call inset::update before requesting
2011 * src/insets/insettext.C (update):
2012 * src/insets/insettabular.C (update): added implementation
2014 * src/insets/lyxinset.h: added update function
2016 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2018 * src/text.C (SelectNextWord): protect against null pointers with
2019 old-style string streams. (fix from Paul Theo Gonciari
2022 * src/cite.[Ch]: remove erroneous files.
2024 * lib/configure.m4: update the list of created directories.
2026 * src/lyxrow.C: include <config.h>
2027 * src/lyxcursor.C: ditto.
2029 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2031 * lib/examples/decimal.lyx: new example file from Mike.
2033 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2034 to find template definitions (from Dekel)
2036 * src/frontends/.cvsignore: add a few things.
2038 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2040 * src/Timeout.C (TimeOut): remove default argument.
2042 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2045 * src/insets/ExternalTemplate.C: add a "using" directive.
2047 * src/lyx_main.h: remove the act_ struct, which seems unused
2050 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2052 * LyX Developers Meeting: All files changed, due to random C++ (by
2053 coincidence) code generator script.
2055 - external inset (cool!)
2056 - initial online editing of preferences
2057 - insettabular breaks insettext(s contents)
2059 - some DocBook fixes
2060 - example files update
2061 - other cool stuff, create a diff and look for yourself.
2063 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2065 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2066 -1 this is a non-line-breaking textinset.
2068 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2069 if there is no width set.
2071 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2073 * Lots of files: Merged the dialogbase branch.
2075 2000-06-09 Allan Rae <rae@lyx.org>
2077 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2078 and the Dispatch methods that used it.
2080 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2081 access to functions formerly kept in Dispatch.
2083 2000-05-19 Allan Rae <rae@lyx.org>
2085 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2086 made to_page and count_copies integers again. from_page remains a
2087 string however because I want to allow entry of a print range like
2088 "1,4,22-25" using this field.
2090 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2091 and printer-params-get. These aren't useful from the minibuffer but
2092 could be used by a script/LyXServer app provided it passes a suitable
2093 auto_mem_buffer. I guess I should take a look at how the LyXServer
2094 works and make it support xtl buffers.
2096 * sigc++/: updated to libsigc++-1.0.1
2098 * src/xtl/: updated to xtl-1.3.pl.11
2100 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2101 those changes done to the files in src/ are actually recreated when
2102 they get regenerated. Please don't ever accept a patch that changes a
2103 dialog unless that patch includes the changes to the corresponding *.fd
2106 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2107 stringOnlyContains, renamed it and generalised it.
2109 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2110 branch. Removed the remaining old form_print code.
2112 2000-04-26 Allan Rae <rae@lyx.org>
2114 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2115 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2117 2000-04-25 Allan Rae <rae@lyx.org>
2119 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2120 against a base of xtl-1.3.pl.4
2122 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2123 filter the Id: entries so they still show the xtl version number
2126 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2127 into the src/xtl code. Patch still pending with José (XTL)
2129 2000-04-24 Allan Rae <rae@lyx.org>
2131 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2132 both more generic and much safer. Use the new template functions.
2133 * src/buffer.[Ch] (Dispatch): ditto.
2135 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2136 and mem buffer more intelligently. Also a little general cleanup.
2139 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2140 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2141 * src/xtl/Makefile.am: ditto.
2142 * src/xtl/.cvsignore: ditto.
2143 * src/Makefile.am: ditto.
2145 * src/PrinterParams.h: Removed the macros member functions. Added a
2146 testInvariant member function. A bit of tidying up and commenting.
2147 Included Angus's idea for fixing operation with egcs-1.1.2.
2149 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2150 cool expansion of XTL's mem_buffer to support automatic memory
2151 management within the buffer itself. Removed the various macros and
2152 replaced them with template functions that use either auto_mem_buffer
2153 or mem_buffer depending on a #define. The mem_buffer support will
2154 disappear as soon as the auto_mem_buffer is confirmed to be good on
2155 other platforms/compilers. That is, it's there so you've got something
2158 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2159 effectively forked XTL. However I expect José will include my code
2160 into the next major release. Also fixed a memory leak.
2161 * src/xtl/text.h: ditto.
2162 * src/xtl/xdr.h: ditto.
2163 * src/xtl/giop.h: ditto.
2165 2000-04-16 Allan Rae <rae@lyx.org>
2167 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2168 by autogen.sh and removed by maintainer-clean anyway.
2169 * .cvsignore, sigc++/.cvsignore: Support the above.
2171 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2173 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2175 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2176 macros, renamed static callback-target member functions to suit new
2177 scheme and made them public.
2178 * src/frontends/xforms/forms/form_print.fd: ditto.
2179 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2181 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2184 * src/xtl/: New directory containing a minimal distribution of XTL.
2185 This is XTL-1.3.pl.4.
2187 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2189 2000-04-15 Allan Rae <rae@lyx.org>
2191 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2193 * sigc++/: Updated to libsigc++-1.0.0
2195 2000-04-14 Allan Rae <rae@lyx.org>
2197 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2198 use the generic ones in future. I'll modify my conversion script.
2200 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2202 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2203 (CloseAllBufferRelatedDialogs): Renamed.
2204 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2206 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2207 of the generic ones. These are the same ones my conversion script
2210 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2211 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2212 * src/buffer.C (Dispatch): ditto
2214 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2215 functions for updating and hiding buffer dependent dialogs.
2216 * src/BufferView.C (buffer): ditto
2217 * src/buffer.C (setReadonly): ditto
2218 * src/lyxfunc.C (CloseBuffer): ditto
2220 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2221 Dialogs.h, and hence all the SigC stuff, into every file that includes
2222 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2224 * src/BufferView2.C: reduce the number of headers included by buffer.h
2226 2000-04-11 Allan Rae <rae@lyx.org>
2228 * src/frontends/xforms/xform_macros.h: A small collection of macros
2229 for building C callbacks.
2231 * src/frontends/xforms/Makefile.am: Added above file.
2233 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2234 scheme again. This time it should work for JMarc. If this is
2235 successful I'll revise my conversion script to automate some of this.
2236 The static member functions in the class also have to be public for
2237 this scheme will work. If the scheme works (it's almost identical to
2238 the way BufferView::cursorToggleCB is handled so it should work) then
2239 FormCopyright and FormPrint will be ready for inclusion into the main
2240 trunk immediately after 1.1.5 is released -- provided we're prepared
2241 for complaints about lame compilers not handling XTL.
2243 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2245 2000-04-07 Allan Rae <rae@lyx.org>
2247 * config/lyxinclude.m4: A bit more tidying up (Angus)
2249 * src/LString.h: JMarc's <string> header fix
2251 * src/PrinterParams.h: Used string for most data to remove some
2252 ugly code in the Print dialog and avoid even uglier code when
2253 appending the ints to a string for output.
2255 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2256 and moved "default:" back to the end of switch statement. Cleaned
2257 up the printing so it uses the right function calls and so the
2258 "print to file" option actually puts the file in the right directory.
2260 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2262 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2263 and Ok+Apply button control into a separate method: input (Angus).
2264 (input) Cleaned it up and improved it to be very thorough now.
2265 (All CB) static_cast used instead of C style cast (Angus). This will
2266 probably change again once we've worked out how to keep gcc-2.8.1 happy
2267 with real C callbacks.
2268 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2269 ignore some of the bool settings and has random numbers instead. Needs
2270 some more investigation. Added other input length checks and checking
2271 of file and printer names.
2273 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2274 would link (Angus). Seems the old code doesn't compile with the pragma
2275 statement either. Separated callback entries from internal methods.
2277 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2279 2000-03-17 Allan Rae <rae@lyx.org>
2281 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2282 need it? Maybe it could go in Dialogs instead? I could make it a
2283 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2284 values to get the bool return value.
2285 (Dispatch): New overloaded method for xtl support.
2287 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2288 extern "C" callback instead of static member functions. Hopefully,
2289 JMarc will be able to compile this. I haven't changed
2290 forms/form_copyright.fd yet. Breaking one of my own rules already.
2292 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2293 because they aren't useful from the minibuffer. Maybe a LyXServer
2294 might want a help message though?
2296 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2298 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2299 xtl which needs both rtti and exceptions.
2301 * src/support/Makefile.am:
2302 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2304 * src/frontends/xforms/input_validators.[ch]: input filters and
2305 validators. These conrol what keys are valid in input boxes.
2306 Use them and write some more. Much better idea than waiting till
2307 after the user has pressed Ok to say that the input fields don't make
2310 * src/frontends/xforms/Makefile.am:
2311 * src/frontends/xforms/forms/form_print.fd:
2312 * src/frontends/xforms/forms/makefile:
2313 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2314 new scheme. Still have to make sure I haven't missed anything from
2315 the current implementation.
2317 * src/Makefile.am, src/PrinterParams.h: New data store.
2319 * other files: Added a couple of copyright notices.
2321 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2323 * src/insets/insetbib.h: move Holder struct in public space.
2325 * src/frontends/include/DialogBase.h: use SigC:: only when
2326 SIGC_CXX_NAMESPACES is defined.
2327 * src/frontends/include/Dialogs.h: ditto.
2329 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2331 * src/frontends/xforms/FormCopyright.[Ch]: do not
2332 mention SigC:: explicitely.
2334 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2336 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2337 deals with testing KDE in main configure.in
2338 * configure.in: ditto.
2340 2000-02-22 Allan Rae <rae@lyx.org>
2342 * Lots of files: Merged from HEAD
2344 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2345 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2347 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2349 * sigc++/: new minidist.
2351 2000-02-14 Allan Rae <rae@lyx.org>
2353 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2355 2000-02-08 Juergen Vigna <jug@sad.it>
2357 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2358 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2360 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2361 for this port and so it is much easier for other people to port
2362 dialogs in a common development environment.
2364 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2365 the QT/KDE implementation.
2367 * src/frontends/kde/Dialogs.C:
2368 * src/frontends/kde/FormCopyright.C:
2369 * src/frontends/kde/FormCopyright.h:
2370 * src/frontends/kde/Makefile.am:
2371 * src/frontends/kde/formcopyrightdialog.C:
2372 * src/frontends/kde/formcopyrightdialog.h:
2373 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2374 for the kde support of the Copyright-Dialog.
2376 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2377 subdir-substitution instead of hardcoded 'xforms' as we now have also
2380 * src/frontends/include/DialogBase.h (Object): just commented the
2381 label after #endif (nasty warning and I don't like warnings ;)
2383 * src/main.C (main): added KApplication initialization if using
2386 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2387 For now only the KDE event-loop is added if frontend==kde.
2389 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2391 * configure.in: added support for the --with-frontend[=value] option
2393 * autogen.sh: added kde.m4 file to list of config-files
2395 * acconfig.h: added define for KDEGUI-support
2397 * config/kde.m4: added configuration functions for KDE-port
2399 * config/lyxinclude.m4: added --with-frontend[=value] option with
2400 support for xforms and KDE.
2402 2000-02-08 Allan Rae <rae@lyx.org>
2404 * all Makefile.am: Fixed up so the make targets dist, distclean,
2405 install and uninstall all work even if builddir != srcdir. Still
2406 have a new sigc++ minidist update to come.
2408 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2410 2000-02-01 Allan Rae <rae@lyx.org>
2412 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2413 Many mods to get builddir != srcdir working.
2415 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2416 for building on NT and so we can do the builddir != srcdir stuff.
2418 2000-01-30 Allan Rae <rae@lyx.org>
2420 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2421 This will stay in "rae" branch. We probably don't really need it in
2422 the main trunk as anyone who wants to help programming it should get
2423 a full library installed also. So they can check both included and
2424 system supplied library compilation.
2426 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2427 Added a 'mini' distribution of libsigc++. If you feel the urge to
2428 change something in these directories - Resist it. If you can't
2429 resist the urge then you should modify the following script and rebuild
2430 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2431 all happen. Still uses a hacked version of libsigc++'s configure.in.
2432 I'm quite happy with the results. I'm not sure the extra work to turn
2433 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2434 worth the trouble and would probably lead to extra maintenance
2436 I haven't tested the following important make targets: install, dist.
2437 Not ready for prime time but very close. Maybe 1.1.5.
2439 * development/tools/makeLyXsigc.sh: A shell script to automatically
2440 generate our mini-dist of libsigc++. It can only be used with a CVS
2441 checkout of libsigc++ not a tarball distribution. It's well commented.
2442 This will end up as part of the libsigc++ distribution so other apps
2443 can easily have an included mini-dist. If someone makes mods to the
2444 sigc++ subpackage without modifying this script to generate those
2445 changes I'll be very upset!
2447 * src/frontends/: Started the gui/system indep structure.
2449 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
2450 to access the gui-indep dialogs are in this class. Much improved
2451 design compared to previous revision. Lars, please refrain from
2452 moving this header into src/ like you did with Popups.h last time.
2454 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
2456 * src/frontends/xforms/: Started the gui-indep system with a single
2457 dialog: FormCopyright. Initial testing of use of libsigc++ was very
2460 * src/frontends/xforms/forms: Repository for the xforms .fd files.
2461 Here you'll find a very useful makefile and automated fdfix.sh that
2462 makes updating dailogs a no-brainer -- provided you follow the rules
2463 set out in the README. I'm thinking about adding another script to
2464 automatically generate skeleton code for a new dialog given just the
2467 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
2468 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
2469 Made FormCopyright gui-indep and added a lyxfunc to get to it.
2471 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
2473 * src/support/LSubstring.C (operator): simplify
2475 * src/lyxtext.h: removed bparams, use buffer_->params instead
2477 * src/lyxrow.h: make Row a real class, move all variables to
2478 private and use accessors.
2480 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
2482 (isRightToLeftPar): ditto
2483 (ChangeLanguage): ditto
2484 (isMultiLingual): ditto
2487 (SimpleTeXOnePar): ditto
2488 (TeXEnvironment): ditto
2489 (GetEndLabel): ditto
2491 (SetOnlyLayout): ditto
2492 (BreakParagraph): ditto
2493 (BreakParagraphConservative): ditto
2494 (GetFontSettings): ditto
2496 (CopyIntoMinibuffer): ditto
2497 (CutIntoMinibuffer): ditto
2498 (PasteParagraph): ditto
2499 (SetPExtraType): ditto
2500 (UnsetPExtraType): ditto
2501 (DocBookContTableRows): ditto
2502 (SimpleDocBookOneTablePar): ditto
2504 (TeXFootnote): ditto
2505 (SimpleTeXOneTablePar): ditto
2506 (TeXContTableRows): ditto
2507 (SimpleTeXSpecialChars): ditto
2510 * src/lyxcursor.h: make LyXCursor a real class, move all variables
2511 to private and use accessors.
2513 * src/lyx_cb.C: remove char updatetimer, and all code that uses
2514 this, we did not use it anymore and has not been for ages. Just a
2515 waste of cpu cycles.
2517 * src/language.h: make Language a real class, move all variables
2518 to private and use accessors.
2520 * src/BufferView_pimpl.C (Pimpl): use new timer code.
2521 (create_view): remove
2522 (update): some changes for new timer
2523 (cursorToggle): use new timer
2524 (beforeChange): change for new timer
2526 * src/BufferView.h (cursorToggleCB): removed last paramter because
2529 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
2530 (cursorToggleCB): change because of new timer code
2532 * lib/CREDITS: updated own mailaddress
2534 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2536 * src/support/filetools.C (PutEnv): fix the code in case neither
2537 putenv() nor setenv() have been found.
2539 * INSTALL: mention the install-strip Makefile target.
2541 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
2542 read-only documents.
2544 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2546 * lib/reLyX/configure.in (VERSION): avoid using a previously
2547 generated reLyX wrapper to find out $prefix.
2549 * lib/examples/eu_adibide_lyx-atua.lyx:
2550 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
2551 translation of the Tutorial (Dooteo)
2553 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
2555 * forms/cite.fd: new citation dialog
2557 * src/insetcite.[Ch]: the new citation dialog is moved into
2560 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
2563 * src/insets/insetcommand.h: data members made private.
2565 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2567 * LyX 1.1.5 released
2569 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2571 * src/version.h (LYX_RELEASE): to 1.1.5
2573 * src/spellchecker.C (RunSpellChecker): return false if the
2574 spellchecker dies upon creation.
2576 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2578 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
2579 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
2583 * lib/CREDITS: update entry for Martin Vermeer.
2585 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
2587 * src/text.C (draw): Draw foreign language bars at the bottom of
2588 the row instead of at the baseline.
2590 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
2592 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2594 * lib/bind/de_menus.bind: updated
2596 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2598 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
2600 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2602 * src/menus.C (Limit_string_length): New function
2603 (ShowTocMenu): Limit the number of items/length of items in the
2606 * src/paragraph.C (String): Correct result for a paragraph inside
2609 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2611 * src/bufferlist.C (close): test of buf->getuser() == NULL
2613 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
2615 * src/BufferView2.C (removeAutoInsets): Fix a bug:
2616 Do not call to SetCursor when the paragraph is a closed footnote!
2618 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
2620 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
2623 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
2625 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2628 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
2629 reference popup, that activates the reference-back action
2631 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
2633 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
2634 the menus. Also fixed a bug.
2636 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
2637 the math panels when switching buffers (unless new buffer is readonly).
2639 * src/BufferView.C (NoSavedPositions)
2640 * src/BufferView_pimpl.C (NoSavedPositions): New methods
2642 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2644 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
2645 less of dvi dirty or not.
2647 * src/trans_mgr.[Ch] (insert): change first parameter to string
2650 * src/chset.[Ch] (encodeString): add const to first parameter
2652 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2654 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
2658 * src/LaTeX.C (deplog): better searching for dependency files in
2659 the latex log. Uses now regexps.
2661 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
2662 instead of the box hack or \hfill.
2664 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2666 * src/lyxfunc.C (doImportHelper): do not create the file before
2667 doing the actual import.
2668 (doImportASCIIasLines): create a new file before doing the insert.
2669 (doImportASCIIasParagraphs): ditto.
2671 * lib/lyxrc.example: remove mention of non-existing commands
2673 * lyx.man: remove mention of color-related switches.
2675 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
2677 * src/lyx_gui.C: remove all the color-related ressources, which
2678 are not used anymore.
2680 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
2683 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2685 * src/lyxrc.C (read): Add a missing break in the switch
2687 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
2689 * src/text2.C (InsertStringA): Fix a bug with insertion into table
2691 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
2694 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
2696 * src/text.C (draw): draw bars under foreign language words.
2698 * src/LColor.[Ch]: add LColor::language
2700 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
2702 * src/lyxcursor.h (boundary): New member variable
2704 * src/text.C (IsBoundary): New methods
2706 * src/text.C: Use the above for currect cursor movement when there
2707 is both RTL & LTR text.
2709 * src/text2.C: ditto
2711 * src/bufferview_funcs.C (ToggleAndShow): ditto
2713 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2715 * src/text.C (DeleteLineForward): set selection to true to avoid
2716 that DeleteEmptyParagraphMechanism does some magic. This is how it
2717 is done in all other functions, and seems reasonable.
2718 (DeleteWordForward): do not jump over non-word stuff, since
2719 CursorRightOneWord() already does it.
2721 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
2722 DeleteWordBackward, since they seem safe to me (since selection is
2723 set to "true") DeleteEmptyParagraphMechanism does nothing.
2725 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2727 * src/lyx_main.C (easyParse): simplify the code by factoring the
2728 part that removes parameters from the command line.
2729 (LyX): check wether wrong command line options have been given.
2731 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
2733 * src/lyx_main.C : add support for specifying user LyX
2734 directory via command line option -userdir.
2736 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
2738 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
2739 the number of items per popup.
2740 (Add_to_refs_menu): Ditto.
2742 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2744 * src/lyxparagraph.h: renamed ClearParagraph() to
2745 StripLeadingSpaces() and moved it to paragraph.C. We pass the
2746 textclass as parameter, and do nothing if free_spacing is
2747 true. This fixes part of the line-delete-forward problems.
2749 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
2750 (pasteSelection): ditto.
2751 (SwitchLayoutsBetweenClasses): more translatable strings.
2753 * src/text2.C (CutSelection): use StripLeadingSpaces.
2754 (PasteSelection): ditto.
2755 (DeleteEmptyParagraphMechanism): ditto.
2757 2000-05-26 Juergen Vigna <jug@sad.it>
2759 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
2760 is not needed in tabular insets.
2762 * src/insets/insettabular.C (TabularFeatures): added missing features.
2764 * src/tabular.C (DeleteColumn):
2766 (AppendRow): implemented this functions
2767 (cellsturct::operator=): clone the inset too;
2769 2000-05-23 Juergen Vigna <jug@sad.it>
2771 * src/insets/insettabular.C (LocalDispatch): better selection support
2772 when having multicolumn-cells.
2774 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
2776 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
2778 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2780 * src/ColorHandler.C (getGCForeground): put more test into _()
2782 * lib/examples/eu_splash.lyx: new file (Basque translation) from
2785 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
2788 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
2790 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
2791 there are no labels, or when buffer is readonly.
2793 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
2794 there are no labels, buffer is SGML, or when buffer is readonly.
2796 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2798 * src/LColor.C (LColor): change a couple of grey40 to grey60
2799 (LColor): rewore initalization to make compiles go some magnitude
2801 (getGUIName): don't use gettext until we need the string.
2803 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
2805 * src/Bullet.[Ch]: Fixed a small bug.
2807 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
2809 * src/paragraph.C (String): Several fixes/improvements
2811 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
2813 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2815 * src/paragraph.C (String): give more correct output.
2817 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
2819 * src/lyxfont.C (stateText) Do not output the language if it is
2820 eqaul to the language of the document.
2822 * src/paragraph.C (TeXOnePar): Do not put language switch commands
2823 between two paragraphs with the same language.
2825 * src/paragraph.C (getParLanguage) Return a correct answer for an
2826 empty dummy paragraph.
2828 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
2831 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
2834 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
2835 the menus/popup, if requested fonts are unavailable.
2837 2000-05-22 Juergen Vigna <jug@sad.it>
2839 * src/insets/insettabular.C (LocalDispatch): added some more cursor
2840 movement support (Up/Down/Tab/Shift-Tab).
2841 (LocalDispatch): added also preliminari cursor-selection.
2843 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
2845 * src/paragraph.C (PasteParagraph): Hopefully now right!
2847 2000-05-22 Garst R. Reese <reese@isn.net>
2849 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
2850 of list, change all references to Environment to Command
2851 * tex/hollywood.cls : rewrite environments as commands, add
2852 \uppercase to interiorshot and exteriorshot to force uppecase.
2853 * tex/broadway.cls : rewrite environments as commands. Tweak
2856 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2858 * src/menus.C (Add_to_toc_menu): fix the code which limits the
2859 size of items: use a constant intead of the hardcoded 40, and more
2860 importantly do not remove the %m and %x tags added at the end.
2861 (Add_to_refs_menu): use vector::size_type instead of
2862 unsigned int as basic types for the variables. _Please_ do not
2863 assume that size_t is equal to unsigned int. On an alpha, this is
2864 unsigned long, which is _not_ the same.
2866 * src/language.C (initL): remove language "hungarian", since it
2867 seems that "magyar" is better.
2869 2000-05-22 Juergen Vigna <jug@sad.it>
2871 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
2873 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
2876 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
2877 next was deleted but not set to 0.
2879 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2881 * src/language.C (initL): change the initialization of languages
2882 so that compiles goes _fast_.
2884 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
2887 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
2889 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2893 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2895 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
2897 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
2901 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
2904 * src/insets/insetlo*.[Ch]: Made editable
2906 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2908 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
2909 the current selection.
2911 * src/BufferView_pimpl.C (stuffClipboard): new method
2913 * src/BufferView.C (stuffClipboard): new method
2915 * src/paragraph.C (String): new method
2917 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
2918 LColor::ignore when lyxname is not found.
2920 * src/BufferView.C (pasteSelection): new method
2922 * src/BufferView_pimpl.C (pasteSelection): new method
2924 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
2926 * src/WorkArea.C (request_clipboard_cb): new static function
2927 (getClipboard): new method
2928 (putClipboard): new method
2930 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2932 * LyX 1.1.5pre2 released
2934 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2936 * src/vspace.C (operator=): removed
2937 (operator=): removed
2939 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
2941 * src/layout.C (NumberOfClass): manually set the type in make_pair
2942 (NumberOfLayout): ditto
2944 * src/language.C: use the Language constructor for ignore_lang
2946 * src/language.h: add constructors to struct Language
2948 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
2950 * src/text2.C (SetCursorIntern): comment out #warning
2952 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
2954 * src/mathed/math_iter.h: initialize sx and sw to 0
2956 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
2958 * forms/lyx.fd: Redesign of form_ref
2960 * src/LaTeXFeatures.[Ch]
2964 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
2967 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
2968 and Buffer::inset_iterator.
2970 * src/menus.C: Added new menus: TOC and Refs.
2972 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
2974 * src/buffer.C (getTocList): New method.
2976 * src/BufferView2.C (ChangeRefs): New method.
2978 * src/buffer.C (getLabelList): New method. It replaces the old
2979 getReferenceList. The return type is vector<string> instead of
2982 * src/insets/insetinclude.C (getLabelList): New method. Replaces
2983 the old getLabel() and GetNumberOfLabels() methods.
2984 * src/insets/insetlabel.C (getLabelList): ditto
2985 * src/mathed/formula.C (getLabelList): ditto
2987 * src/paragraph.C (String): New method.
2989 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
2990 Uses the new getTocList() method.
2991 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
2992 which automatically updates the contents of the browser.
2993 (RefUpdateCB): Use the new getLabelList method.
2995 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
2997 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
2999 * src/spellchecker.C: Added using std::reverse;
3001 2000-05-19 Juergen Vigna <jug@sad.it>
3003 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3005 * src/insets/insettext.C (computeTextRows): small fix for display of
3006 1 character after a newline.
3008 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3011 2000-05-18 Juergen Vigna <jug@sad.it>
3013 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3014 when changing width of column.
3016 * src/tabular.C (set_row_column_number_info): setting of
3017 autobreak rows if necessary.
3019 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3021 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3023 * src/vc-backend.*: renamed stat() to status() and vcstat to
3024 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3025 compilation broke. The new name seems more relevant, anyway.
3027 2000-05-17 Juergen Vigna <jug@sad.it>
3029 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3030 which was wrong if the removing caused removing of rows!
3032 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3033 (pushToken): new function.
3035 * src/text2.C (CutSelection): fix problem discovered with purify
3037 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3039 * src/debug.C (showTags): enlarge the first column, now that we
3040 have 6-digits debug codes.
3042 * lib/layouts/hollywood.layout:
3043 * lib/tex/hollywood.cls:
3044 * lib/tex/brodway.cls:
3045 * lib/layouts/brodway.layout: more commands and fewer
3046 environments. Preambles moved in the .cls files. Broadway now has
3047 more options on scene numbering and less whitespace (from Garst)
3049 * src/insets/insetbib.C (getKeys): make sure that we are in the
3050 document directory, in case the bib file is there.
3052 * src/insets/insetbib.C (Latex): revert bogus change.
3054 2000-05-16 Juergen Vigna <jug@sad.it>
3056 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3057 the TabularLayout on cursor move.
3059 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3061 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3064 (draw): fixed cursor position and drawing so that the cursor is
3065 visible when before the tabular-inset.
3067 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3068 when creating from old insettext.
3070 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3072 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3074 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3075 * lib/tex/brodway.cls: ditto
3077 * lib/layouts/brodway.layout: change alignment of parenthical
3080 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3082 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3083 versions 0.88 and 0.89 are supported.
3085 2000-05-15 Juergen Vigna <jug@sad.it>
3087 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3090 * src/insets/insettext.C (computeTextRows): redone completely this
3091 function in a much cleaner way, because of problems when having a
3093 (draw): added a frame border when the inset is locked.
3094 (SetDrawLockedFrame): this sets if we draw the border or not.
3095 (SetFrameColor): this sets the frame color (default=insetframe).
3097 * src/insets/lyxinset.h: added x() and y() functions which return
3098 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3099 function which is needed to see if we have a locking inset of some
3100 type in this inset (needed for now in insettabular).
3102 * src/vspace.C (inPixels): the same function also without a BufferView
3103 parameter as so it is easier to use it in some ocasions.
3105 * src/lyxfunc.C: changed all places where insertInset was used so
3106 that now if it couldn't be inserted it is deleted!
3108 * src/TabularLayout.C:
3109 * src/TableLayout.C: added support for new tabular-inset!
3111 * src/BufferView2.C (insertInset): this now returns a bool if the
3112 inset was really inserted!!!
3114 * src/tabular.C (GetLastCellInRow):
3115 (GetFirstCellInRow): new helper functions.
3116 (Latex): implemented for new tabular class.
3120 (TeXTopHLine): new Latex() helper functions.
3122 2000-05-12 Juergen Vigna <jug@sad.it>
3124 * src/mathed/formulamacro.C (Read):
3125 * src/mathed/formula.C (Read): read also the \end_inset here!
3127 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3129 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3130 crush when saving formulae with unbalanced parenthesis.
3132 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3134 * src/layout.C: Add new keyword "endlabelstring" to layout file
3136 * src/text.C (GetVisibleRow): Draw endlabel string.
3138 * lib/layouts/broadway.layout
3139 * lib/layouts/hollywood.layout: Added endlabel for the
3140 Parenthetical layout.
3142 * lib/layouts/heb-article.layout: Do not use slanted font shape
3143 for Theorem like environments.
3145 * src/buffer.C (makeLaTeXFile): Always add "american" to
3146 the UsedLanguages list if document language is RTL.
3148 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3150 * add addendum to README.OS2 and small patch (from SMiyata)
3152 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3154 * many files: correct the calls to ChangeExtension().
3156 * src/support/filetools.C (ChangeExtension): remove the no_path
3157 argument, which does not belong there. Use OnlyFileName() instead.
3159 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3160 files when LaTeXing a non-nice latex file.
3162 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3163 a chain of "if". Return false when deadkeys are not handled.
3165 * src/lyx_main.C (LyX): adapted the code for default bindings.
3167 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3168 bindings for basic functionality (except deadkeys).
3169 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3171 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3172 several methods: handle override_x_deadkeys.
3174 * src/lyxrc.h: remove the "bindings" map, which did not make much
3175 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3177 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3179 * src/lyxfont.C (stateText): use a saner method to determine
3180 whether the font is "default". Seems to fix the crash with DEC
3183 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3185 2000-05-08 Juergen Vigna <jug@sad.it>
3187 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3188 TabularLayoutMenu with mouse-button-3
3189 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3191 * src/TabularLayout.C: added this file for having a Layout for
3194 2000-05-05 Juergen Vigna <jug@sad.it>
3196 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3197 recalculating inset-widths.
3198 (TabularFeatures): activated this function so that I can change
3199 tabular-features via menu.
3201 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3202 that I can test some functions with the Table menu.
3204 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3206 * src/lyxfont.C (stateText): guard against stupid c++libs.
3208 * src/tabular.C: add using std::vector
3209 some whitespace changes, + removed som autogenerated code.
3211 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3213 2000-05-05 Juergen Vigna <jug@sad.it>
3215 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3216 row, columns and cellstructures.
3218 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3220 * lib/lyxrc.example: remove obsolete entries.
3222 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3223 reading of protected_separator for free_spacing.
3225 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3227 * src/text.C (draw): do not display an exclamation mark in the
3228 margin for margin notes. This is confusing, ugly and
3231 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3232 AMS math' is checked.
3234 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3235 name to see whether including the amsmath package is needed.
3237 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3239 * src/paragraph.C (validate): Compute UsedLanguages correctly
3240 (don't insert the american language if it doesn't appear in the
3243 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3244 The argument of \thanks{} command is considered moving argument
3246 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3249 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3251 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3252 for appendix/minipage/depth. The lines can be now both in the footnote
3253 frame, and outside the frame.
3255 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3258 2000-05-05 Juergen Vigna <jug@sad.it>
3260 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3261 neede only in tabular.[Ch].
3263 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3265 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3267 (Write): write '~' for PROTECTED_SEPARATOR
3269 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3271 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3274 * src/mathed/formula.C (drawStr): rename size to siz.
3276 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3277 possibly fix a bug by not changing the pflags = flags to piflags =
3280 2000-05-05 Juergen Vigna <jug@sad.it>
3282 * src/insets/insetbib.C: moved using directive
3284 * src/ImportNoweb.C: small fix for being able to compile (missing
3287 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3289 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3290 to use clear, since we don't depend on this in the code. Add test
3293 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3295 * (various *.C files): add using std::foo directives to please dec
3298 * replace calls to string::clear() to string::erase() (Angus)
3300 * src/cheaders/cmath: modified to provide std::abs.
3302 2000-05-04 Juergen Vigna <jug@sad.it>
3304 * src/insets/insettext.C: Prepared all for inserting of multiple
3305 paragraphs. Still display stuff to do (alignment and other things),
3306 but I would like to use LyXText to do this when we cleaned out the
3307 table-support stuff.
3309 * src/insets/insettabular.C: Changed lot of stuff and added lots
3310 of functionality still a lot to do.
3312 * src/tabular.C: Various functions changed name and moved to be
3313 const functions. Added new Read and Write functions and changed
3314 lots of things so it works good with tabular-insets (also removed
3315 some stuff which is not needed anymore * hacks *).
3317 * src/lyxcursor.h: added operators == and != which just look if
3318 par and pos are (not) equal.
3320 * src/buffer.C (latexParagraphs): inserted this function to latex
3321 all paragraphs form par to endpar as then I can use this too for
3324 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3325 so that I can call this to from text insets with their own cursor.
3327 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3328 output off all paragraphs (because of the fix below)!
3330 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3331 the very last paragraph (this could be also the last paragraph of an
3334 * src/texrow.h: added rows() call which returns the count-variable.
3336 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3338 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3340 * lib/configure.m4: better autodetection of DocBook tools.
3342 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3344 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3346 * src/lyx_cb.C: add using std::reverse;
3348 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3351 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3352 selected files. Should fix repeated errors from generated files.
3354 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3356 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3358 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3359 the spellchecker popup.
3361 * lib/lyxrc.example: Removed the \number_inset section
3363 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3365 * src/insets/figinset.C (various): Use IsFileReadable() to make
3366 sure that the file actually exist. Relying on ghostscripts errors
3367 is a bad idea since they can lead to X server crashes.
3369 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3371 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3374 * lib/lyxrc.example: smallish typo in description of
3375 \view_dvi_paper_option
3377 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3380 * src/lyxfunc.C: doImportHelper to factor out common code of the
3381 various import methods. New functions doImportASCIIasLines,
3382 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3383 doImportLinuxDoc for the format specific parts.
3386 * buffer.C: Dispatch returns now a bool to indicate success
3389 * lyx_gui.C: Add getLyXView() for member access
3391 * lyx_main.C: Change logic for batch commands: First try
3392 Buffer::Dispatch (possibly without GUI), if that fails, use
3395 * lyx_main.C: Add support for --import command line switch.
3396 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3397 Available Formats: Everything accepted by 'buffer-import <format>'
3399 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3401 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3404 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3405 documents will be reformatted upon reentry.
3407 2000-04-27 Juergen Vigna <jug@sad.it>
3409 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3410 correctly only last pos this was a bug.
3412 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3414 * release of lyx-1.1.5pre1
3416 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3418 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3420 * src/menus.C: revert the change of naming (Figure->Graphic...)
3421 from 2000-04-11. It was incomplete and bad.
3423 * src/LColor.[Ch]: add LColor::depthbar.
3424 * src/text.C (GetVisibleRow): use it.
3426 * README: update the languages list.
3428 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3430 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3433 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3435 * README: remove sections that were just wrong.
3437 * src/text2.C (GetRowNearY): remove currentrow code
3439 * src/text.C (GetRow): remove currentrow code
3441 * src/screen.C (Update): rewritten a bit.
3442 (SmallUpdate): removed func
3444 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
3446 (FullRebreak): return bool
3447 (currentrow): remove var
3448 (currentrow_y): ditto
3450 * src/lyxscreen.h (Draw): change arg to unsigned long
3451 (FitCursor): return bool
3452 (FitManualCursor): ditto
3453 (Smallpdate): remove func
3454 (first): change to unsigned long
3455 (DrawOneRow): change second arg to long (from long &)
3456 (screen_refresh_y): remove var
3457 (scree_refresh_row): ditto
3459 * src/lyxrow.h: change baseline to usigned int from unsigned
3460 short, this brings some implicit/unsigned issues out in the open.
3462 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
3464 (Dispatch): don't call updateScrollbar after fitCursor. Use update
3465 instead of smallUpdate.
3467 * src/lyxcursor.h: change y to unsigned long
3469 * src/buffer.h: don't call updateScrollbar after fitcursor
3471 * src/buffer.C (parseSingleLyXformat2Token): move variables to
3472 where they are used. Removed "\\direction", this was not present
3473 in 1.1.4 and is already obsolete. Commented out some code that I
3474 believe to never be called.
3475 (runLiterate): don't call updateScrollbar after fitCursor
3477 (buildProgram): ditto
3480 * src/WorkArea.h (workWidth): change return val to unsigned
3483 (redraw): remove the button redraws
3484 (setScrollbarValue): change for scrollbar
3485 (getScrollbarValue): change for scrollbar
3486 (getScrollbarBounds): change for scrollbar
3488 * src/WorkArea.C (C_WorkArea_up_cb): removed func
3489 (C_WorkArea_down_cb): removed func
3490 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
3491 (resize): change for scrollbar
3492 (setScrollbar): ditto
3493 (setScrollbarBounds): ditto
3494 (setScrollbarIncrements): ditto
3495 (up_cb): removed func
3496 (down_cb): removed func
3497 (scroll_cb): change for scrollbar
3498 (work_area_handler): ditto
3500 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
3501 when FitCursor did something.
3502 (updateScrollbar): some unsigned changes
3503 (downCB): removed func
3504 (scrollUpOnePage): removed func
3505 (scrollDownOnePage): remvoed func
3506 (workAreaMotionNotify): don't call screen->FitCursor but use
3507 fitCursor instead. and bool return val
3508 (workAreaButtonPress): ditto
3509 (workAreaButtonRelease): some unsigned changes
3510 (checkInsetHit): ditto
3511 (workAreaExpose): ditto
3512 (update): parts rewritten, comments about the signed char arg added
3513 (smallUpdate): removed func
3514 (cursorPrevious): call needed updateScrollbar
3517 * src/BufferView2.C (allFloats): don't call updateScrollbar after
3520 * src/BufferView.[Ch] (upCB): removed func
3521 (downCB): removed func
3522 (smallUpdate): removed func
3524 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3526 * src/lyxtext.h src/text.C src/text2.C: removed support for the
3527 currentrow, currentrow_y optimization. This did not help a lot and
3528 if we want to do this kind of optimization we should rather use
3529 cursor.row instead of the currentrow.
3531 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
3532 buffer spacing and klyx spacing support.
3534 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3536 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
3539 2000-04-26 Juergen Vigna <jug@sad.it>
3541 * src/insets/figinset.C: fixes to Lars sstream changes!
3543 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
3545 * A lot of files: Added Ascii(ostream &) methods to all inset
3546 classes. Used when exporting to ASCII.
3548 * src/buffer.C (writeFileAscii,RoffAsciiTable)
3549 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
3552 * src/text2.C (ToggleFree): Disabled implicit word selection when
3553 there is a change in the language
3555 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
3556 no output was generated for end-of-sentence inset.
3558 * src/insets/lyxinset.h
3561 * src/paragraph.C: Removed the insetnumber code
3563 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
3565 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3567 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
3568 no_babel and no_epsfig completely from the file.
3569 (parseSingleLyXformat2Token): add handling for per-paragraph
3570 spacing as written by klyx.
3572 * src/insets/figinset.C: applied patch by Andre. Made it work with
3575 2000-04-20 Juergen Vigna <jug@sad.it>
3577 * src/insets/insettext.C (cutSelection):
3578 (copySelection): Fixed with selection from right to left.
3579 (draw): now the rows are not recalculated at every draw.
3580 (computeTextRows): for now reset the inset-owner here (this is
3581 important for an undo or copy where the inset-owner is not set
3584 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
3585 motion to the_locking_inset screen->first was forgotten, this was
3586 not important till we got multiline insets.
3588 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3590 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
3591 code seems to be alright (it is code changed by Dekel, and the
3592 intent is indeed that all macros should be defined \protect'ed)
3594 * NEWS: a bit of reorganisation of the new user-visible features.
3596 2000-04-19 Juergen Vigna <jug@sad.it>
3598 * src/insets/insettext.C (init): using a LyXCursor now for cursor
3599 position. Set the inset_owner of the used paragraph so that it knows
3600 that it is inside an inset. Fixed cursor handling with mouse and
3601 cursor keys. Fixed wrong timed inset redraws and lots of other changes
3602 and cleanups to make TextInsets work better.
3604 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
3605 Changed parameters of various functions and added LockInsetInInset().
3607 * src/insets/insettext.C:
3609 * src/insets/insetcollapsable.h:
3610 * src/insets/insetcollapsable.C:
3611 * src/insets/insetfoot.h:
3612 * src/insets/insetfoot.C:
3613 * src/insets/insetert.h:
3614 * src/insets/insetert.C: cleaned up the code so that it works now
3615 correctly with insettext.
3617 * src/insets/inset.C:
3618 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
3619 that insets in insets are supported right.
3622 * src/table.C: lots of changes for use with inset tabular (and cleanup)
3624 * src/paragraph.C: some small fixes
3626 * src/debug.h: inserted INSETS debug info
3628 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
3629 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
3631 * src/commandtags.h:
3632 * src/LyXAction.C: insert code for InsetTabular.
3634 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
3635 not Button1MotionMask.
3636 (workAreaButtonRelease): send always a InsetButtonRelease event to
3638 (checkInsetHit): some setCursor fixes (always with insets).
3640 * src/BufferView2.C (lockInset): returns a bool now and extended for
3641 locking insets inside insets.
3642 (showLockedInsetCursor): it is important to have the cursor always
3643 before the locked inset.
3644 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
3646 * src/BufferView.h: made lockInset return a bool.
3648 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
3650 * src/text2.C (SetCursor): This now has a version with a LyXCursor
3651 that is used also internally but can be called as public to have back
3652 a cursor pos which is not set internally.
3653 (SetCursorIntern): Changed to use above function.
3655 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
3657 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3662 * NEWS: updated for prerelease of 1.1.5. Please comment and send
3663 patches for things that should be in or should be changed.
3665 * src/* [insetfiles]: change "usigned char fragile" to bool
3666 fragile. There was only one point that could that be questioned
3667 and that is commented in formulamacro.C. Grep for "CHECK".
3669 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
3670 (DeleteBuffer): take it out of CutAndPaste and make it static.
3672 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3674 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
3675 output the spacing envir commands. Also the new commands used in
3676 the LaTeX output makes the result better.
3678 * src/Spacing.C (writeEnvirBegin): new method
3679 (writeEnvirEnd): new method
3681 2000-04-18 Juergen Vigna <jug@sad.it>
3683 * src/CutAndPaste.C: made textclass a static member of the class
3684 as otherwise it is not accesed right!!!
3686 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
3688 * forms/layout_forms.fd
3689 * src/layout_forms.h
3690 * src/layout_forms.C (create_form_form_character)
3691 * src/lyx_cb.C (UserFreeFont)
3692 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
3693 documents (in the layout->character popup).
3695 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3697 * src/spellchecker.C (create_ispell_pipe): fix a bug where
3698 \spell_command was in fact not honored (from Kevin Atkinson).
3700 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
3703 * src/lyx_gui.h: make lyxViews private (Angus)
3705 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
3707 * src/mathed/math_write.C
3708 (MathMatrixInset::Write) Put \protect before \begin{array} and
3709 \end{array} if fragile
3710 (MathParInset::Write): Put \protect before \\ if fragile
3712 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3714 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
3715 initialization if the LyXColorHandler must be done after the
3716 connections to the XServer has been established.
3718 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
3719 get the background pixel from the lyxColorhandler so that the
3720 figures are rendered with the correct background color.
3721 (NextToken): removed functions.
3722 (GetPSSizes): use ifs >> string instead of NextToken.
3724 * src/Painter.[Ch]: the color cache moved out of this file.
3726 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
3729 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3731 * src/WorkArea.C (work_area_handler): call BufferView::enterView
3732 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
3734 * src/BufferView.C (enterView): new func
3735 (leaveView): new func
3737 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
3739 (leaveView): new func, undefines xterm cursor when approp.
3741 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
3742 (AllowInput): delete the Workarea cursor handling from this func.
3744 * src/Painter.C (underline): draw a slimer underline in most cases.
3746 * src/lyx_main.C (error_handler): use extern "C"
3748 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3750 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
3751 sent directly to me.
3753 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
3754 to the list by Dekel.
3756 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
3759 * src/bufferview_funcs.[Ch]: two new files, moved several of the
3760 methods from lyx_cb.here.
3762 * src/lyx_cb.C: in addition to the above; removed input_prohibited
3765 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
3767 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
3768 instead of using current_view directly.
3770 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
3772 * src/LyXAction.C (init): add the paragraph-spacing command.
3774 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
3776 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
3778 * src/lyx_cb.C (CurrentState): output a string when the spacing is
3779 different from the documents.
3781 * src/text.C (SetHeightOfRow): take paragraph spacing into
3782 account, paragraph spacing takes precedence over buffer spacing
3783 (GetVisibleRow): ditto
3785 * src/paragraph.C (writeFile): output the spacing parameter too.
3786 (validate): set the correct features if spacing is used in the
3788 (Clear): set spacing to default
3789 (MakeSameLayout): spacing too
3790 (HasSameLayout): spacing too
3791 (SetLayout): spacing too
3792 (TeXOnePar): output the spacing commands
3794 * src/lyxparagraph.h: added a spacing variable for use with
3795 per-paragraph spacing.
3797 * src/Spacing.h: add a Default spacing and a method to check if
3798 the current spacing is default. also added an operator==
3800 * src/text2.C (DeleteEmptyParagraphMechanism): added a
3803 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3805 * src/lyxserver.C (callback): fix dispatch of functions
3807 * src/insets/insetlatexaccent.C (checkContents): turn bogus
3808 printf() into lyxerr call.
3810 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
3813 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
3814 "Table" to "Table Box", "Float" to "Floating Material"; deletes
3815 the "Float" from each of the subitems.
3816 (ShowHelpMenu): add entry for "FAQ" and "TOC".
3818 * src/support/DebugStream.h: add an #ifdef to work around a gcc
3819 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
3820 documented the change so that the workaround can be nuked later.
3822 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
3825 * src/lyxlex_pimpl.C (next): do not re-declare the default value
3827 * src/buffer.C (getLatexName): ditto
3828 (setReadonly): ditto
3830 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
3832 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
3833 avoid some uses of current_view. Added also a bufferParams()
3834 method to get at this.
3836 * src/lyxtext.h: changed params->buffer and paramters->bparams.
3838 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3840 * src/lyxparagraph.[Ch]: removed
3841 operator<(LyXParagraph::InsetTable..., added a struct matchIT
3842 with operators used by lower_bound and
3843 upper_bound in InsetTable's
3844 Make struct InsetTable private again. Used matchpos.
3846 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
3848 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
3849 document, the language of existing text is changed (unless the
3850 document is multi-lingual)
3852 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
3854 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
3856 * A lot of files: A rewrite of the Right-to-Left support.
3858 2000-04-10 Juergen Vigna <jug@sad.it>
3860 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
3861 misplaced cursor when inset in inset is locked.
3863 * src/insets/insettext.C (LocalDispatch): small fix so that a
3864 BREAKLINE is not inserted if we don't permit it with autBreakRows.
3866 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
3867 footnote font should be decreased in size twice when displaying.
3869 * src/insets/insettext.C (GetDrawFont): inserted this function as
3870 the drawing-font may differ from the real paragraph font.
3872 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
3873 insets (inset in inset!).
3875 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
3876 function here because we don't want footnotes inside footnotes.
3878 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
3880 (init): now set the inset_owner in paragraph.C
3881 (LocalDispatch): added some resetPos() in the right position
3884 (pasteSelection): changed to use the new CutAndPaste-Class.
3886 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
3887 which tells if it is allowed to insert another inset inside this one.
3889 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
3890 SwitchLayoutsBetweenClasses.
3892 * src/text2.C (InsertInset): checking of the new paragraph-function
3894 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
3895 is not needed anymore here!
3898 (PasteSelection): redone (also with #ifdef) so that now this uses
3899 the CutAndPaste-Class.
3900 (SwitchLayoutsBetweenClasses): removed here and implemented in the
3903 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
3904 from/to text/insets.
3906 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
3907 so that the paragraph knows if it is inside an (text)-inset.
3908 (InsertFromMinibuffer): changed return-value to bool as now it
3909 may happen that an inset is not inserted in the paragraph.
3910 (InsertInsetAllowed): this checks if it is allowed to insert an
3911 inset in this paragraph.
3913 (BreakParagraphConservative):
3914 (BreakParagraph) : small change for the above change of the return
3915 value of InsertFromMinibuffer.
3917 * src/lyxparagraph.h: added inset_owner and the functions to handle
3918 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
3920 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3922 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
3923 functions from BufferView to BufferView::Pimpl to ease maintence.
3925 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
3926 correctly. Also use SetCursorIntern instead of SetCursor.
3928 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
3931 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
3933 * src/WorkArea.C (belowMouse): manually implement below mouse.
3935 * src/*: Add "explicit" on several constructors, I added probably
3936 some unneeded ones. A couple of changes to code because of this.
3938 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
3939 implementation and private parts from the users of BufferView. Not
3942 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
3943 implementation and private parts from the users of LyXLex. Not
3946 * src/BufferView_pimpl.[Ch]: new files
3948 * src/lyxlex_pimpl.[Ch]: new files
3950 * src/LyXView.[Ch]: some inline functions move out-of-line
3952 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3954 * src/lyxparagraph.h: make struct InsetTable public.
3956 * src/support/lyxstring.h: change lyxstring::difference_type to be
3957 ptrdiff_t. Add std:: modifiers to streams.
3959 * src/font.C: include the <cctype> header, for islower() and
3962 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3964 * src/font.[Ch]: new files. Contains the metric functions for
3965 fonts, takes a LyXFont as parameter. Better separation of concepts.
3967 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
3968 changes because of this.
3970 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
3972 * src/*: compile with -Winline and move functions that don't
3975 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
3978 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3980 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
3981 (various files changed because of this)
3983 * src/Painter.C (text): fixed the drawing of smallcaps.
3985 * src/lyxfont.[Ch] (drawText): removed unused member func.
3988 * src/*.C: added needed "using" statements and "std::" qualifiers.
3990 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3992 * src/*.h: removed all use of "using" from header files use
3993 qualifier std:: instead.
3995 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3997 * src/text.C (Backspace): some additional cleanups (we already
3998 know whether cursor.pos is 0 or not).
4000 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4001 automake does not provide one).
4003 * src/bmtable.h: replace C++ comments with C comments.
4005 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4007 * src/screen.C (ShowCursor): Change the shape of the cursor if
4008 the current language is not equal to the language of the document.
4009 (If the cursor change its shape unexpectedly, then you've found a bug)
4011 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4014 * src/insets/insetnumber.[Ch]: New files.
4016 * src/LyXAction.C (init)
4017 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4020 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4022 * src/lyxparagraph.h
4023 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4024 (the vector is kept sorted).
4026 * src/text.C (GetVisibleRow): Draw selection correctly when there
4027 is both LTR and RTL text.
4029 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4030 which is much faster.
4032 * src/text.C (GetVisibleRow and other): Do not draw the last space
4033 in a row if the direction of the last letter is not equal to the
4034 direction of the paragraph.
4036 * src/lyxfont.C (latexWriteStartChanges):
4037 Check that font language is not equal to basefont language.
4038 (latexWriteEndChanges): ditto
4040 * src/lyx_cb.C (StyleReset): Don't change the language while using
4041 the font-default command.
4043 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4044 empty paragraph before a footnote.
4046 * src/insets/insetcommand.C (draw): Increase x correctly.
4048 * src/screen.C (ShowCursor): Change cursor shape if
4049 current language != document language.
4051 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4053 2000-03-31 Juergen Vigna <jug@sad.it>
4055 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4056 (Clone): changed mode how the paragraph-data is copied to the
4057 new clone-paragraph.
4059 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4060 GetInset(pos) with no inset anymore there (in inset UNDO)
4062 * src/insets/insetcommand.C (draw): small fix as here x is
4063 incremented not as much as width() returns (2 before, 2 behind = 4)
4065 2000-03-30 Juergen Vigna <jug@sad.it>
4067 * src/insets/insettext.C (InsetText): small fix in initialize
4068 widthOffset (should not be done in the init() function)
4070 2000-03-29 Amir Karger <karger@lyx.org>
4072 * lib/examples/it_ItemizeBullets.lyx: translation by
4075 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4077 2000-03-29 Juergen Vigna <jug@sad.it>
4079 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4081 * src/insets/insetfoot.C (Clone): small change as for the below
4082 new init function in the text-inset
4084 * src/insets/insettext.C (init): new function as I've seen that
4085 clone did not copy the Paragraph-Data!
4086 (LocalDispatch): Added code so that now we have some sort of Undo
4087 functionality (well actually we HAVE Undo ;)
4089 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4091 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4093 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4096 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4098 * src/main.C: added a runtime check that verifies that the xforms
4099 header used when building LyX and the library used when running
4100 LyX match. Exit with a message if they don't match. This is a
4101 version number check only.
4103 * src/buffer.C (save): Don't allocate memory on the heap for
4104 struct utimbuf times.
4106 * *: some using changes, use iosfwd instead of the real headers.
4108 * src/lyxfont.C use char const * instead of string for the static
4109 strings. Rewrite some functions to use sstream.
4111 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4113 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4116 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4118 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4119 of Geodesy (from Martin Vermeer)
4121 * lib/layouts/svjour.inc: include file for the Springer svjour
4122 class. It can be used to support journals other than JoG.
4124 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4125 Miskiewicz <misiek@pld.org.pl>)
4126 * lib/reLyX/Makefile.am: ditto.
4128 2000-03-27 Juergen Vigna <jug@sad.it>
4130 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4131 also some modifications with operations on selected text.
4133 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4134 problems with clicking on insets (last famous words ;)
4136 * src/insets/insetcommand.C (draw):
4137 (width): Changed to have a bit of space before and after the inset so
4138 that the blinking cursor can be seen (otherwise it was hidden)
4140 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4142 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4143 would not be added to the link list when an installed gettext (not
4144 part of libc) is found.
4146 2000-03-24 Juergen Vigna <jug@sad.it>
4148 * src/insets/insetcollapsable.C (Edit):
4149 * src/mathed/formula.C (InsetButtonRelease):
4150 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4153 * src/BufferView.C (workAreaButtonPress):
4154 (workAreaButtonRelease):
4155 (checkInsetHit): Finally fixed the clicking on insets be handled
4158 * src/insets/insetert.C (Edit): inserted this call so that ERT
4159 insets work always with LaTeX-font
4161 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4163 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4164 caused lyx to startup with no GUI in place, causing in a crash
4165 upon startup when called with arguments.
4167 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4169 * src/FontLoader.C: better initialization of dummyXFontStruct.
4171 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4173 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4174 for linuxdoc and docbook import and export format options.
4176 * lib/lyxrc.example Example of default values for the previous flags.
4178 * src/lyx_cb.C Use those flags instead of the hardwired values for
4179 linuxdoc and docbook export.
4181 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4184 * src/menus.C Added menus entries for the new import/exports formats.
4186 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4188 * src/lyxrc.*: Added support for running without Gui
4191 * src/FontLoader.C: sensible defaults if no fonts are needed
4193 * src/lyx_cb.C: New function ShowMessage (writes either to the
4194 minibuffer or cout in case of no gui
4195 New function AskOverwrite for common stuff
4196 Consequently various changes to call these functions
4198 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4199 wild guess at sensible screen resolution when having no gui
4201 * src/lyxfont.C: no gui, no fonts... set some defaults
4203 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4205 * src/LColor.C: made the command inset background a bit lighter.
4207 2000-03-20 Hartmut Goebel <goebel@noris.net>
4209 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4210 stdstruct.inc. Koma-Script added some title elements which
4211 otherwise have been listed below "bibliography". This split allows
4212 adding title elements to where they belong.
4214 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4215 define the additional tilte elements and then include
4218 * many other layout files: changed to include stdtitle.inc just
4219 before stdstruct.inc.
4221 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4223 * src/buffer.C: (save) Added the option to store all backup files
4224 in a single directory
4226 * src/lyxrc.[Ch]: Added variable \backupdir_path
4228 * lib/lyxrc.example: Added descriptions of recently added variables
4230 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4231 bibtex inset, not closing the bibtex popup when deleting the inset)
4233 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4235 * src/lyx_cb.C: add a couple using directives.
4237 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4238 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4239 import based on the filename.
4241 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4242 file would be imported at start, if the filename where of a sgml file.
4244 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4246 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4248 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4249 * src/lyxfont.h Replaced the member variable bits.direction by the
4250 member variable lang. Made many changes in other files.
4251 This allows having a multi-lingual document
4253 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4254 that change the current language to <l>.
4255 Removed the command "font-rtl"
4257 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4258 format for Hebrew documents)
4260 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4261 When auto_mathmode is "true", pressing a digit key in normal mode
4262 will cause entering into mathmode.
4263 If auto_mathmode is "rtl" then this behavior will be active only
4264 when writing right-to-left text.
4266 * src/text2.C (InsertStringA) The string is inserted using the
4269 * src/paragraph.C (GetEndLabel) Gives a correct result for
4270 footnote paragraphs.
4272 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4274 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4276 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4277 front of PasteParagraph. Never insert a ' '. This should at least
4278 fix some cause for the segfaults that we have been experiencing,
4279 it also fixes backspace behaviour slightly. (Phu!)
4281 * src/support/lstrings.C (compare_no_case): some change to make it
4282 compile with gcc 2.95.2 and stdlibc++-v3
4284 * src/text2.C (MeltFootnoteEnvironment): change type o
4285 first_footnote_par_is_not_empty to bool.
4287 * src/lyxparagraph.h: make text private. Changes in other files
4289 (fitToSize): new function
4290 (setContentsFromPar): new function
4291 (clearContents): new function
4292 (SetChar): new function
4294 * src/paragraph.C (readSimpleWholeFile): deleted.
4296 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4297 the file, just use a simple string instead. Also read the file in
4298 a more maintainable manner.
4300 * src/text2.C (InsertStringA): deleted.
4301 (InsertStringB): deleted.
4303 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4305 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4306 RedoParagraphs from the doublespace handling part, just set status
4307 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4308 done, but perhaps not like this.)
4310 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4312 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4313 character when inserting an inset.
4315 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4317 * src/bufferparams.C (readLanguage): now takes "default" into
4320 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4321 also initialize the toplevel_keymap with the default bindings from
4324 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4326 * all files using lyxrc: have lyxrc as a real variable and not a
4327 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4330 * src/lyxrc.C: remove double call to defaultKeyBindings
4332 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4333 toolbar defauls using lyxlex. Remove enums, structs, functions
4336 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4337 toolbar defaults. Also store default keybindings in a map.
4339 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4340 storing the toolbar defaults without any xforms dependencies.
4342 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4343 applied. Changed to use iterators.
4345 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4347 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4348 systems that don't have LINGUAS set to begin with.
4350 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4352 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4353 the list by Dekel Tsur.
4355 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4357 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4358 * src/insets/form_graphics.C: ditto.
4360 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4362 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4364 * src/bufferparams.C (readLanguage): use the new language map
4366 * src/intl.C (InitKeyMapper): use the new language map
4368 * src/lyx_gui.C (create_forms): use the new language map
4370 * src/language.[Ch]: New files. Used for holding the information
4371 about each language. Now! Use this new language map enhance it and
4372 make it really usable for our needs.
4374 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4376 * screen.C (ShowCursor): Removed duplicate code.
4377 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4378 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4380 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4383 * src/text.C Added TransformChar method. Used for rendering Arabic
4384 text correctly (change the glyphs of the letter according to the
4385 position in the word)
4390 * src/lyxrc.C Added lyxrc command {language_command_begin,
4391 language_command_end,language_command_ltr,language_command_rtl,
4392 language_package} which allows the use of either arabtex or Omega
4395 * src/lyx_gui.C (init)
4397 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4398 to use encoding for menu fonts which is different than the encoding
4401 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4402 do not load the babel package.
4403 To write an English document with Hebrew/Arabic, change the document
4404 language to "english".
4406 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4407 (alphaCounter): changed to return char
4408 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4410 * lib/lyxrc.example Added examples for Hebrew/Arabic
4413 * src/layout.C Added layout command endlabeltype
4415 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4417 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4419 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4421 * src/mathed/math_delim.C (search_deco): return a
4422 math_deco_struct* instead of index.
4424 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4426 * All files with a USE_OSTREAM_ONLY within: removed all code that
4427 was unused when USE_OSTREAM_ONLY is defined.
4429 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4430 of any less. Removed header and using.
4432 * src/text.C (GetVisibleRow): draw the string "Page Break
4433 (top/bottom)" on screen when drawing a pagebreak line.
4435 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4437 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
4439 * src/mathed/math_macro.C (draw): do some cast magic.
4442 * src/mathed/math_defs.h: change byte* argument to byte const*.
4444 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
4446 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
4447 know it is right to return InsetFoot* too, but cxx does not like
4450 * src/insets/insetcollapsable.[Ch] (Clone): make const.
4452 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
4454 * src/mathed/math_delim.C: change == to proper assignment.
4456 2000-03-09 Juergen Vigna <jug@sad.it>
4458 * src/insets/insettext.C (setPos): fixed various cursor positioning
4459 problems (via mouse and cursor-keys)
4460 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
4461 inset (still a small display problem but it works ;)
4463 * src/insets/insetcollapsable.C (draw): added button_top_y and
4464 button_bottom_y to have correct values for clicking on the inset.
4466 * src/support/lyxalgo.h: commented out 'using std::less'
4468 2000-03-08 Juergen Vigna <jug@sad.it>
4470 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
4471 Button-Release event closes as it is alos the Release-Event
4474 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
4476 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4478 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
4479 can add multiple spaces in Scrap (literate programming) styles...
4480 which, by the way, is how I got hooked on LyX to begin with.
4482 * src/mathed/formula.C (Write): Added dummy variable to an
4483 inset::Latex() call.
4484 (Latex): Add free_spacing boolean to inset::Latex()
4486 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
4488 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
4489 virtual function to include the free_spacing boolean from
4490 the containing paragraph's style.
4492 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
4493 Added free_spacing boolean arg to match inset.h
4495 * src/insets/insettext.C, src/insets/insettext.h (Latex):
4496 Added free_spacing boolean arg to match inset.h
4498 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
4499 Added free_spacing boolean and made sure that if in a free_spacing
4500 paragraph, that we output normal space if there is a protected space.
4502 * src/insets/insetref.C, src/insets/insetref.h (Latex):
4503 Added free_spacing boolean arg to match inset.h
4505 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
4506 Added free_spacing boolean arg to match inset.h
4508 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
4509 Added free_spacing boolean arg to match inset.h
4511 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
4512 Added free_spacing boolean arg to match inset.h
4514 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
4515 Added free_spacing boolean arg to match inset.h
4517 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
4518 free_spacing boolean arg to match inset.h
4520 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
4521 Added free_spacing boolean arg to match inset.h
4523 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
4524 Added free_spacing boolean arg to match inset.h
4526 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
4527 Added free_spacing boolean arg to match inset.h
4529 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
4530 Added free_spacing boolean arg to match inset.h
4532 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
4533 Added free_spacing boolean arg to match inset.h
4535 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
4536 free_spacing boolean arg to match inset.h
4538 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
4539 free_spacing boolean arg to match inset.h
4541 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
4542 ignore free_spacing paragraphs. The user's spaces are left
4545 * src/text.C (InsertChar): Fixed the free_spacing layout
4546 attribute behavior. Now, if free_spacing is set, you can
4547 add multiple spaces in a paragraph with impunity (and they
4548 get output verbatim).
4549 (SelectSelectedWord): Added dummy argument to inset::Latex()
4552 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
4555 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
4556 paragraph layouts now only input a simple space instead.
4557 Special character insets don't make any sense in free-spacing
4560 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
4561 hard-spaces in the *input* file to simple spaces if the layout
4562 is free-spacing. This converts old files which had to have
4563 hard-spaces in free-spacing layouts where a simple space was
4565 (writeFileAscii): Added free_spacing check to pass to the newly
4566 reworked inset::Latex(...) methods. The inset::Latex() code
4567 ensures that hard-spaces in free-spacing paragraphs get output
4568 as spaces (rather than "~").
4570 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4572 * src/mathed/math_delim.C (draw): draw the empty placeholder
4573 delims with a onoffdash line.
4574 (struct math_deco_compare): struct that holds the "functors" used
4575 for the sort and the binary search in math_deco_table.
4576 (class init_deco_table): class used for initial sort of the
4578 (search_deco): use lower_bound to do a binary search in the
4581 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4583 * src/lyxrc.C: a small secret thingie...
4585 * src/lyxlex.C (printTable): changed to take a ostream as paramter
4586 and to not flush the stream as often as it used to.
4588 * src/support/lyxalgo.h: new file
4589 (sorted): template function used for checking if a sequence is
4590 sorted or not. Two versions with and without user supplied
4591 compare. Uses same compare as std::sort.
4593 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
4594 it and give warning on lyxerr.
4596 (struct compare_tags): struct with function operators used for
4597 checking if sorted, sorting and lower_bound.
4598 (search_kw): use lower_bound instead of manually implemented
4601 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4603 * src/insets/insetcollapsable.h: fix Clone() declaration.
4604 * src/insets/insetfoot.h: ditto.
4606 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
4608 2000-03-08 Juergen Vigna <jug@sad.it>
4610 * src/insets/lyxinset.h: added owner call which tells us if
4611 this inset is inside another inset. Changed also the return-type
4612 of Editable to an enum so it tells clearer what the return-value is.
4614 * src/insets/insettext.C (computeTextRows): fixed computing of
4615 textinsets which split automatically on more rows.
4617 * src/insets/insetert.[Ch]: changed this to be of BaseType
4620 * src/insets/insetfoot.[Ch]: added footnote inset
4622 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
4623 collapsable insets (like footnote, ert, ...)
4625 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4627 * src/lyxdraw.h: remvoe file
4629 * src/lyxdraw.C: remove file
4631 * src/insets/insettext.C: added <algorithm>.
4633 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4635 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
4636 (matrix_cb): case MM_OK use string stream
4638 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
4641 * src/mathed/math_macro.C (draw): use string stream
4642 (Metrics): use string stream
4644 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
4645 directly to the ostream.
4647 * src/vspace.C (asString): use string stream.
4648 (asString): use string stream
4649 (asLatexString): use string stream
4651 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
4652 setting Spacing::Other.
4654 * src/LaTeXFeatures.C (getPackages): use string stream instead of
4655 sprintf when creating the stretch vale.
4657 * src/text2.C (alphaCounter): changed to return a string and to
4658 not use a static variable internally. Also fixed a one-off bug.
4659 (SetCounter): changed the drawing of the labels to use string
4660 streams instead of sprintf.
4662 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
4663 manipulator to use a scheme that does not require library support.
4664 This is also the way it is done in the new GNU libstdc++. Should
4665 work with DEC cxx now.
4667 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4669 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
4670 end. This fixes a bug.
4672 * src/mathed (all files concerned with file writing): apply the
4673 USE_OSTREAM_ONLY changes to mathed too.
4675 * src/support/DebugStream.h: make the constructor explicit.
4677 * src/lyxfont.C (latexWriteStartChanges): small bug related to
4678 count and ostream squashed.
4680 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4682 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
4684 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
4685 ostringstream uses STL strings, and we might not.
4687 * src/insets/insetspecialchar.C: add using directive.
4688 * src/insets/insettext.C: ditto.
4690 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4692 * lib/layouts/seminar.layout: feeble attempt at a layout for
4693 seminar.cls, far from completet and could really use some looking
4694 at from people used to write layout files.
4696 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
4697 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
4698 a lot nicer and works nicely with ostreams.
4700 * src/mathed/formula.C (draw): a slightly different solution that
4701 the one posted to the list, but I think this one works too. (font
4702 size wrong in headers.)
4704 * src/insets/insettext.C (computeTextRows): some fiddling on
4705 Jürgens turf, added some comments that he should read.
4707 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
4708 used and it gave compiler warnings.
4709 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
4712 * src/lyx_gui.C (create_forms): do the right thing when
4713 show_banner is true/false.
4715 * src/lyx_cb.C (TimerCB): no need to close or do anything if
4716 show_banner is false.
4718 * most file writing files: Now use iostreams to do almost all of
4719 the writing. Also instead of passing string &, we now use
4720 stringstreams. mathed output is still not adapted to iostreams.
4721 This change can be turned off by commenting out all the occurences
4722 of the "#define USE_OSTREAM_ONLY 1" lines.
4724 * src/WorkArea.C (createPixmap): don't output debug messages.
4725 (WorkArea): don't output debug messages.
4727 * lib/lyxrc.example: added a comment about the new variable
4730 * development/Code_rules/Rules: Added some more commente about how
4731 to build class interfaces and on how better encapsulation can be
4734 2000-03-03 Juergen Vigna <jug@sad.it>
4736 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
4737 automatically with the width of the LyX-Window
4739 * src/insets/insettext.C (computeTextRows): fixed update bug in
4740 displaying text-insets (scrollvalues where not initialized!)
4742 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4744 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
4745 id in the check of the result from lower_bound is not enough since
4746 lower_bound can return last too, and then res->id will not be a
4749 * all insets and some code that use them: I have conditionalized
4750 removed the Latex(string & out, ...) this means that only the
4751 Latex(ostream &, ...) will be used. This is a work in progress to
4752 move towards using streams for all output of files.
4754 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
4757 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4759 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
4760 routine (this fixes bug where greek letters were surrounded by too
4763 * src/support/filetools.C (findtexfile): change a bit the search
4764 algorithm, to fix bug introduced in 1.1.4. Note that --format is
4765 no longer passed to kpsewhich, we may have to change that later.
4767 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
4768 warning options to avoid problems with X header files (from Angus
4770 * acinclude.m4: regenerated.
4772 2000-03-02 Juergen Vigna <jug@sad.it>
4774 * src/insets/insettext.C (WriteParagraphData): Using the
4775 par->writeFile() function for writing paragraph-data.
4776 (Read): Using buffer->parseSingleLyXformat2Token()-function
4777 for parsing paragraph data!
4779 * src/buffer.C (readLyXformat2): removed all parse data and using
4780 the new parseSingleLyXformat2Token()-function.
4781 (parseSingleLyXformat2Token): added this function to parse (read)
4782 lyx-file-format (this is called also from text-insets now!)
4784 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4786 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
4789 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
4790 directly instead of going through a func. One very bad thing: a
4791 static LyXFindReplace, but I don't know where to place it.
4793 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
4794 string instead of char[]. Also changed to static.
4795 (GetSelectionOrWordAtCursor): changed to static inline
4796 (SetSelectionOverLenChars): ditto.
4798 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
4799 current_view and global variables. both classes has changed names
4800 and LyXFindReplace is not inherited from SearchForm.
4802 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
4803 fl_form_search form.
4805 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
4807 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4809 * lib/bind/*.bind: make sure 'buffer-previous' function is not
4810 bound (from Kayvan).
4812 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
4814 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
4816 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4818 * some things that I should comment but the local pub says head to
4821 * comment out all code that belongs to the Roff code for Ascii
4822 export of tables. (this is unused)
4824 * src/LyXView.C: use correct type for global variable
4825 current_layout. (LyXTextClass::size_type)
4827 * some code to get the new insetgraphics closer to working I'd be
4828 grateful for any help.
4830 * src/BufferView2.C (insertInset): use the return type of
4831 NumberOfLayout properly. (also changes in other files)
4833 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
4834 this as a test. I want to know what breaks because of this.
4836 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
4838 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
4840 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
4841 to use a \makebox in the label, this allows proper justification
4842 with out using protected spaces or multiple hfills. Now it is
4843 "label" for left justified, "\hfill label\hfill" for center, and
4844 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
4845 should be changed accordingly.
4847 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4849 * src/lyxtext.h: change SetLayout() to take a
4850 LyXTextClass::size_type instead of a char (when there is more than
4851 127 layouts in a class); also change type of copylayouttype.
4852 * src/text2.C (SetLayout): ditto.
4853 * src/LyXView.C (updateLayoutChoice): ditto.
4855 * src/LaTeX.C (scanLogFile): errors where the line number was not
4856 given just after the '!'-line were ignored (from Dekel Tsur).
4858 * lib/lyxrc.example: fix description of \date_insert_format
4860 * lib/layouts/llncs.layout: new layout, contributed by Martin
4863 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4865 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
4866 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
4867 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
4868 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
4869 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
4870 paragraph.C, text.C, text2.C)
4872 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4874 * src/insets/insettext.C (LocalDispatch): remove extra break
4877 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
4878 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
4880 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
4881 * src/insets/insettext.[Ch] (GetCursorPos): ditto
4883 * src/insets/insetbib.h: move InsetBibkey::Holder and
4884 InsetCitation::Holder in public space.
4886 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4888 * src/insets/insettext.h: small change to get the new files from
4889 Juergen to compile (use "string", not "class string").
4891 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
4892 const & as parameter to LocalDispatch, use LyXFont const & as
4893 paramter to some other func. This also had impacto on lyxinsets.h
4894 and the two mathed insets.
4896 2000-02-24 Juergen Vigna <jug@sad.it>
4899 * src/commandtags.h:
4901 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
4905 * src/BufferView2.C: added/updated code for various inset-functions
4907 * src/insets/insetert.[Ch]: added implementation of InsetERT
4909 * src/insets/insettext.[Ch]: added implementation of InsetText
4911 * src/insets/inset.C (Edit): added "unsigned int button" parameter
4912 (draw): added preliminary code for inset scrolling not finshed yet
4914 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
4915 as it is in lyxfunc.C now
4917 * src/insets/lyxinset.h: Added functions for text-insets
4919 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4921 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
4922 BufferView and reimplement the list as a queue put inside its own
4925 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
4927 * several files: use the new interface to the "updateinsetlist"
4929 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
4931 (work_area_handler): call BufferView::trippleClick on trippleclick.
4933 * src/BufferView.C (doubleClick): new function, selects word on
4935 (trippleClick): new function, selects line on trippleclick.
4937 2000-02-22 Allan Rae <rae@lyx.org>
4939 * lib/bind/xemacs.bind: buffer-previous not supported
4941 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4943 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
4946 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4948 * src/bufferlist.C: get rid of current_view from this file
4950 * src/spellchecker.C: get rid of current_view from this file
4952 * src/vspace.C: get rid of current_view from this file
4953 (inPixels): added BufferView parameter for this func
4954 (asLatexCommand): added a BufferParams for this func
4956 * src/text.C src/text2.C: get rid of current_view from these
4959 * src/lyxfont.C (getFontDirection): move this function here from
4962 * src/bufferparams.C (getDocumentDirection): move this function
4965 * src/paragraph.C (getParDirection): move this function here from
4967 (getLetterDirection): ditto
4969 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4971 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
4972 resize due to wrong pixmap beeing used. Also took the opurtunity
4973 to make the LyXScreen stateless on regard to WorkArea and some
4974 general cleanup in the same files.
4976 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4978 * src/Makefile.am: add missing direction.h
4980 * src/PainterBase.h: made the width functions const.
4982 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
4985 * src/insets/insetcommand.C (draw): draw Editable as buttons.
4987 * src/insets/insetlatexaccent.C (draw): make the accents draw
4988 better, at present this will only work well with iso8859-1.
4990 * several files: remove the old drawing code, now we use the new
4993 * several files: remove support for mono_video, reverse_video and
4996 2000-02-17 Juergen Vigna <jug@sad.it>
4998 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
4999 int ** as we have to return the pointer, otherwise we have only
5000 NULL pointers in the returning function.
5002 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5004 * src/LaTeX.C (operator()): quote file name when running latex.
5006 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5008 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5009 (bubble tip), this removes our special handling of this.
5011 * Remove all code that is unused now that we have the new
5012 workarea. (Code that are not active when NEW_WA is defined.)
5014 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5016 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5018 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5019 nonexisting layout; correctly redirect obsoleted layouts.
5021 * lib/lyxrc.example: document \view_dvi_paper_option
5023 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5026 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5027 (PreviewDVI): handle the view_dvi_paper_option variable.
5028 [Both from Roland Krause]
5030 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5032 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5033 char const *, int, LyXFont)
5034 (text(int, int, string, LyXFont)): ditto
5036 * src/text.C (InsertCharInTable): attempt to fix the double-space
5037 feature in tables too.
5038 (BackspaceInTable): ditto.
5039 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5041 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5043 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5045 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5046 newly found text in textcache to this.
5047 (buffer): set the owner of the text put into the textcache to 0
5049 * src/insets/figinset.C (draw): fixed the drawing of figures with
5052 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5053 drawing of mathframe, hfills, protected space, table lines. I have
5054 now no outstanding drawing problems with the new Painter code.
5056 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5058 * src/PainterBase.C (ellipse, circle): do not specify the default
5061 * src/LColor.h: add using directive.
5063 * src/Painter.[Ch]: change return type of methods from Painter& to
5064 PainterBase&. Add a using directive.
5066 * src/WorkArea.C: wrap xforms callbacks in C functions
5069 * lib/layouts/foils.layout: font fix and simplifications from Carl
5072 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5074 * a lot of files: The Painter, LColor and WorkArea from the old
5075 devel branch has been ported to lyx-devel. Some new files and a
5076 lot of #ifdeffed code. The new workarea is enabled by default, but
5077 if you want to test the new Painter and LColor you have to compile
5078 with USE_PAINTER defined (do this in config.h f.ex.) There are
5079 still some rought edges, and I'd like some help to clear those
5080 out. It looks stable (loads and displays the Userguide very well).
5083 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5085 * src/buffer.C (pop_tag): revert to the previous implementation
5086 (use a global variable for both loops).
5088 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5090 * src/lyxrc.C (LyXRC): change slightly default date format.
5092 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5093 there is an English text with a footnote that starts with a Hebrew
5094 paragraph, or vice versa.
5095 (TeXFootnote): ditto.
5097 * src/text.C (LeftMargin): allow for negative values for
5098 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5101 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5102 for input encoding (cyrillic)
5104 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5106 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5109 * src/toolbar.C (set): ditto
5110 * src/insets/insetbib.C (create_form_citation_form): ditto
5112 * lib/CREDITS: added Dekel Tsur.
5114 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5115 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5116 hebrew supports files from Dekel Tsur.
5118 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5119 <tzafrir@technion.ac.il>
5121 * src/lyxrc.C: put \date_insert_format at the right place.
5123 * src/buffer.C (makeLaTeXFile): fix the handling of
5124 BufferParams::sides when writing out latex files.
5126 * src/BufferView2.C: add a "using" directive.
5128 * src/support/lyxsum.C (sum): when we use lyxstring,
5129 ostringstream::str needs an additional .c_str().
5131 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5133 * src/support/filetools.C (ChangeExtension): patch from Etienne
5136 * src/TextCache.C (show): remove const_cast and make second
5137 parameter non-const LyXText *.
5139 * src/TextCache.h: use non const LyXText in show.
5141 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5144 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5146 * src/support/lyxsum.C: rework to be more flexible.
5148 * several places: don't check if a pointer is 0 if you are going
5151 * src/text.C: remove some dead code.
5153 * src/insets/figinset.C: remove some dead code
5155 * src/buffer.C: move the BufferView funcs to BufferView2.C
5156 remove all support for insetlatexdel
5157 remove support for oldpapersize stuff
5158 made some member funcs const
5160 * src/kbmap.C: use a std::list to store the bindings in.
5162 * src/BufferView2.C: new file
5164 * src/kbsequence.[Ch]: new files
5166 * src/LyXAction.C + others: remove all trace of buffer-previous
5168 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5169 only have one copy in the binary of this table.
5171 * hebrew patch: moved some functions from LyXText to more
5172 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5174 * several files: remove support for XForms older than 0.88
5176 remove some #if 0 #endif code
5178 * src/TextCache.[Ch]: new file. Holds the textcache.
5180 * src/BufferView.C: changes to use the new TextCache interface.
5181 (waitForX): remove the now unused code.
5183 * src/BackStack.h: remove some commented code
5185 * lib/bind/emacs.bind: remove binding for buffer-previous
5187 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5189 * applied the hebrew patch.
5191 * src/lyxrow.h: make sure that all Row variables are initialized.
5193 * src/text2.C (TextHandleUndo): comment out a delete, this might
5194 introduce a memory leak, but should also help us to not try to
5195 read freed memory. We need to look at this one.
5197 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5198 (LyXParagraph): initalize footnotekind.
5200 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5201 forgot this when applying the patch. Please heed the warnings.
5203 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5204 (aka. reformat problem)
5206 * src/bufferlist.C (exists): made const, and use const_iterator
5207 (isLoaded): new func.
5208 (release): use std::find to find the correct buffer.
5210 * src/bufferlist.h: made getState a const func.
5211 made empty a const func.
5212 made exists a const func.
5215 2000-02-01 Juergen Vigna <jug@sad.it>
5217 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5219 * po/it.po: updated a bit the italian po file and also changed the
5220 'file nuovo' for newfile to 'filenuovo' without a space, this did
5223 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5224 for the new insert_date command.
5226 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5227 from jdblair, to insert a date into the current text conforming to
5228 a strftime format (for now only considering the locale-set and not
5229 the document-language).
5231 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5233 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5234 Bounds Read error seen by purify. The problem was that islower is
5235 a macros which takes an unsigned char and uses it as an index for
5236 in array of characters properties (and is thus subject to the
5240 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5241 correctly the paper sides radio buttons.
5242 (UpdateDocumentButtons): ditto.
5244 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5246 * src/kbmap.C (getsym + others): change to return unsigned int,
5247 returning a long can give problems on 64 bit systems. (I assume
5248 that int is 32bit on 64bit systems)
5250 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5252 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5253 LyXLookupString to be zero-terminated. Really fixes problems seen
5256 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5258 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5259 write a (char*)0 to the lyxerr stream.
5261 * src/lastfiles.C: move algorithm before the using statemets.
5263 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5265 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5266 complains otherwise).
5267 * src/table.C: ditto
5269 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5272 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5273 that I removed earlier... It is really needed.
5275 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5277 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5279 * INSTALL: update xforms home page URL.
5281 * lib/configure.m4: fix a bug with unreadable layout files.
5283 * src/table.C (calculate_width_of_column): add "using std::max"
5286 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5288 * several files: marked several lines with "DEL LINE", this is
5289 lines that can be deleted without changing anything.
5290 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5291 checks this anyway */
5294 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5296 * src/DepTable.C (update): add a "+" at the end when the checksum
5297 is different. (debugging string only)
5299 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5300 the next inset to not be displayed. This should also fix the list
5301 of labels in the "Insert Crossreference" dialog.
5303 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5305 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5306 when regex was not found.
5308 * src/support/lstrings.C (lowercase): use handcoded transform always.
5311 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5312 old_cursor.par->prev could be 0.
5314 * several files: changed post inc/dec to pre inc/dec
5316 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5317 write the lastfiles to file.
5319 * src/BufferView.C (buffer): only show TextCache info when debugging
5321 (resizeCurrentBuffer): ditto
5322 (workAreaExpose): ditto
5324 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5326 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5328 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5329 a bit better by removing the special case for \i and \j.
5331 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5333 * src/lyx_main.C (easyParse): remove test for bad comand line
5334 options, since this broke all xforms-related parsing.
5336 * src/kbmap.C (getsym): set return type to unsigned long, as
5337 declared in header. On an alpha, long is _not_ the same as int.
5339 * src/support/LOstream.h: add a "using std::flush;"
5341 * src/insets/figinset.C: ditto.
5343 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5345 * src/bufferlist.C (write): use blinding fast file copy instead of
5346 "a char at a time", now we are doing it the C++ way.
5348 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5349 std::list<int> instead.
5350 (addpidwait): reflect move to std::list<int>
5351 (sigchldchecker): ditto
5353 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5356 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5357 that obviously was wrong...
5359 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5360 c, this avoids warnings with purify and islower.
5362 * src/insets/figinset.C: rename struct queue to struct
5363 queue_element and rewrite to use a std::queue. gsqueue is now a
5364 std::queue<queue_element>
5365 (runqueue): reflect move to std::queue
5368 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5369 we would get "1" "0" instead of "true" "false. Also make the tostr
5372 2000-01-21 Juergen Vigna <jug@sad.it>
5374 * src/buffer.C (writeFileAscii): Disabled code for special groff
5375 handling of tabulars till I fix this in table.C
5377 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5379 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5381 * src/support/lyxlib.h: ditto.
5383 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5385 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5386 and 'j' look better. This might fix the "macron" bug that has been
5389 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5390 functions as one template function. Delete the old versions.
5392 * src/support/lyxsum.C: move using std::ifstream inside
5395 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5398 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5400 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5402 * src/insets/figinset.C (InitFigures): use new instead of malloc
5403 to allocate memory for figures and bitmaps.
5404 (DoneFigures): use delete[] instead of free to deallocate memory
5405 for figures and bitmaps.
5406 (runqueue): use new to allocate
5407 (getfigdata): use new/delete[] instead of malloc/free
5408 (RegisterFigure): ditto
5410 * some files: moved some declarations closer to first use, small
5411 whitespace changes use preincrement instead of postincrement where
5412 it does not make a difference.
5414 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5415 step on the way to use stl::containers for key maps.
5417 * src/bufferlist.h: add a typedef for const_iterator and const
5418 versions of begin and end.
5420 * src/bufferlist.[Ch]: change name of member variable _state to
5421 state_. (avoid reserved names)
5423 (getFileNames): returns the filenames of the buffers in a vector.
5425 * configure.in (ALL_LINGUAS): added ro
5427 * src/support/putenv.C: new file
5429 * src/support/mkdir.C: new file
5431 2000-01-20 Allan Rae <rae@lyx.org>
5433 * lib/layouts/IEEEtran.layout: Added several theorem environments
5435 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5436 couple of minor additions.
5438 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
5439 (except for those in footnotes of course)
5441 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5443 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
5445 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
5446 std::sort and std::lower_bound instead of qsort and handwritten
5448 (struct compara): struct that holds the functors used by std::sort
5449 and std::lower_bound in MathedLookupBOP.
5451 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5453 * src/support/LAssert.h: do not do partial specialization. We do
5456 * src/support/lyxlib.h: note that lyx::getUserName() and
5457 lyx::date() are not in use right now. Should these be suppressed?
5459 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
5460 (makeLinuxDocFile): do not put date and user name in linuxdoc
5463 * src/support/lyxlib.h (kill): change first argument to long int,
5464 since that's what solaris uses.
5466 * src/support/kill.C (kill): fix declaration to match prototype.
5468 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
5469 actually check whether namespaces are supported. This is not what
5472 * src/support/lyxsum.C: add a using directive.
5474 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5476 * src/support/kill.C: if we have namespace support we don't have
5477 to include lyxlib.h.
5479 * src/support/lyxlib.h: use namespace lyx if supported.
5481 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5483 * src/support/date.C: new file
5485 * src/support/chdir.C: new file
5487 * src/support/getUserName.C: new file
5489 * src/support/getcwd.C: new file
5491 * src/support/abort.C: new file
5493 * src/support/kill.C: new file
5495 * src/support/lyxlib.h: moved all the functions in this file
5496 insede struct lyx. Added also kill and abort to this struct. This
5497 is a way to avoid the "kill is not defined in <csignal>", we make
5498 C++ wrappers for functions that are not ANSI C or ANSI C++.
5500 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
5501 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
5502 lyx it has been renamed to sum.
5504 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5506 * src/text.C: add using directives for std::min and std::max.
5508 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5510 * src/texrow.C (getIdFromRow): actually return something useful in
5511 id and pos. Hopefully fixes the bug with positionning of errorbox
5514 * src/lyx_main.C (easyParse): output an error and exit if an
5515 incorrect command line option has been given.
5517 * src/spellchecker.C (ispell_check_word): document a memory leak.
5519 * src/bufferlist.C (write): fix mismatched allocation/deletion,
5520 where a "struct utimbuf" is allocated with "new" and deleted with
5523 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
5525 * src/text2.C (CutSelection): don't delete double spaces.
5526 (PasteSelection): ditto
5527 (CopySelection): ditto
5529 * src/text.C (Backspace): don't delete double spaces.
5531 * src/lyxlex.C (next): fix a bug that were only present with
5532 conformant std::istream::get to read comment lines, use
5533 std::istream::getline instead. This seems to fix the problem.
5535 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5537 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
5538 allowed to insert space before space" editing problem. Please read
5539 commends at the beginning of the function. Comments about usage
5542 * src/text.C (InsertChar): fix for the "not allowed to insert
5543 space before space" editing problem.
5545 * src/text2.C (DeleteEmptyParagraphMechanism): when
5546 IsEmptyTableRow can only return false this last "else if" will
5547 always be a no-op. Commented out.
5549 * src/text.C (RedoParagraph): As far as I can understand tmp
5550 cursor is not really needed.
5552 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
5553 present it could only return false anyway.
5554 (several functions): Did something not so smart...added a const
5555 specifier on a lot of methods.
5557 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
5558 and add a tmp->text.resize. The LyXParagraph constructor does the
5560 (BreakParagraphConservative): ditto
5562 * src/support/path.h (Path): add a define so that the wrong usage
5563 "Path("/tmp") will be flagged as a compilation error:
5564 "`unnamed_Path' undeclared (first use this function)"
5566 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5568 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
5569 which was bogus for several reasons.
5571 * src/LaTeX.C (scanAux): fix the regular expression used to scan
5575 * autogen.sh: do not use "type -path" (what's that anyway?).
5577 * src/support/filetools.C (findtexfile): remove extraneous space
5578 which caused a kpsewhich warning (at least with kpathsea version
5581 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5583 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
5585 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
5587 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
5589 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5591 * src/paragraph.C (BreakParagraph): do not reserve space on text
5592 if we don't need to (otherwise, if pos_end < pos, we end up
5593 reserving huge amounts of memory due to bad unsigned karma).
5594 (BreakParagraphConservative): ditto, although I have not seen
5595 evidence the bug can happen here.
5597 * src/lyxparagraph.h: add a using std::list.
5599 2000-01-11 Juergen Vigna <jug@sad.it>
5601 * src/menus.C (MenuDocu): output an Alert if the documentation-file
5604 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5606 * src/vc-backend.C (doVCCommand): change to be static and take one
5607 more parameter: the path to chdir too be fore executing the command.
5608 (retrive): new function equiv to "co -r"
5610 * src/bufferlist.C (loadLyXFile): implement the missing parts if
5611 file_not_found_hook is true.
5613 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
5615 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
5616 if a file is readwrite,readonly...anything else.
5618 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5620 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
5621 (CreatePostscript): name change from MenuRunDVIPS (or something)
5622 (PreviewPostscript): name change from MenuPreviewPS
5623 (PreviewDVI): name change from MenuPreviewDVI
5625 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
5626 \view_pdf_command., \pdf_to_ps_command
5628 * lib/configure.m4: added search for PDF viewer, and search for
5629 PDF to PS converter.
5630 (lyxrc.defaults output): add \pdflatex_command,
5631 \view_pdf_command and \pdf_to_ps_command.
5633 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
5635 * src/bufferlist.C (write): we don't use blocksize for anything so
5638 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5640 * src/support/block.h: disable operator T* (), since it causes
5641 problems with both compilers I tried. See comments in the file.
5643 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
5646 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
5647 variable LYX_DIR_10x to LYX_DIR_11x.
5649 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
5651 * INSTALL: document --with-lyxname.
5654 * configure.in: new configure flag --with-lyxname which allows to
5655 choose the name under which lyx is installed. Default is "lyx", of
5656 course. It used to be possible to do this with --program-suffix,
5657 but the later has in fact a different meaning for autoconf.
5659 * src/support/lstrings.h (lstrchr): reformat a bit.
5661 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
5662 * src/mathed/math_defs.h: ditto.
5664 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5666 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
5667 true, decides if we create a backup file or not when saving. New
5668 tag and variable \pdf_mode, defaults to false. New tag and
5669 variable \pdflatex_command, defaults to pdflatex. New tag and
5670 variable \view_pdf_command, defaults to xpdf. New tag and variable
5671 \pdf_to_ps_command, defaults to pdf2ps.
5673 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5675 * src/bufferlist.C (close): don't call insetUnlock if the buffer
5676 does not have a BufferView.
5677 (unlockInset): ditto + don't access the_locking_inset if the
5678 buffer does not have a BufferView.
5680 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
5681 certain circumstances so that we don't continue a keyboard
5682 operation long after the key was released. Try f.ex. to load a
5683 large document, press PageDown for some seconds and then release
5684 it. Before this change the document would contine to scroll for
5685 some time, with this change it stops imidiatly.
5687 * src/support/block.h: don't allocate more space than needed. As
5688 long as we don't try to write to the arr[x] in a array_type arr[x]
5689 it is perfectly ok. (if you write to it you might segfault).
5690 added operator value_type*() so that is possible to pass the array
5691 to functions expecting a C-pointer.
5693 * lib/Makefile.am (dist-hook): don't fail completely if unable to
5696 * intl/*: updated to gettext 0.10.35, tried to add our own
5697 required modifications. Please verify.
5699 * po/*: updated to gettext 0.10.35, tried to add our own required
5700 modifications. Please verify.
5702 * src/support/lstrings.C (tostr): go at fixing the problem with
5703 cxx and stringstream. When stringstream is used return
5704 oss.str().c_str() so that problems with lyxstring and basic_string
5705 are avoided. Note that the best solution would be for cxx to use
5706 basic_string all the way, but it is not conformant yet. (it seems)
5708 * src/lyx_cb.C + other files: moved several global functions to
5709 class BufferView, some have been moved to BufferView.[Ch] others
5710 are still located in lyx_cb.C. Code changes because of this. (part
5711 of "get rid of current_view project".)
5713 * src/buffer.C + other files: moved several Buffer functions to
5714 class BufferView, the functions are still present in buffer.C.
5715 Code changes because of this.
5717 * config/lcmessage.m4: updated to most recent. used when creating
5720 * config/progtest.m4: updated to most recent. used when creating
5723 * config/gettext.m4: updated to most recent. applied patch for
5726 * config/gettext.m4.patch: new file that shows what changes we
5727 have done to the local copy of gettext.m4.
5729 * config/libtool.m4: new file, used in creation of acinclude.m4
5731 * config/lyxinclude.m4: new file, this is the lyx created m4
5732 macros, used in making acinclude.m4.
5734 * autogen.sh: GNU m4 discovered as a separate task not as part of
5735 the lib/configure creation.
5736 Generate acinlucde from files in config. Actually cat
5737 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
5738 easier to upgrade .m4 files that really are external.
5740 * src/Spacing.h: moved using std::istringstream to right after
5741 <sstream>. This should fix the problem seen with some compilers.
5743 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5745 * src/lyx_cb.C: began some work to remove the dependency a lot of
5746 functions have on BufferView::text, even if not really needed.
5747 (GetCurrentTextClass): removed this func, it only hid the
5750 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
5751 forgot this in last commit.
5753 * src/Bullet.C (bulletEntry): use static char const *[] for the
5754 tables, becuase of this the return arg had to change to string.
5756 (~Bullet): removed unneeded destructor
5758 * src/BufferView.C (beforeChange): moved from lyx_cb.C
5759 (insetSleep): moved from Buffer
5760 (insetWakeup): moved from Buffer
5761 (insetUnlock): moved from Buffer
5763 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
5764 from Buffer to BufferView.
5766 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
5768 * config/ltmain.sh: updated to version 1.3.4 of libtool
5770 * config/ltconfig: updated to version 1.3.4 of libtool
5772 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5775 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
5776 Did I get that right?
5778 * src/lyxlex.h: add a "using" directive or two.
5779 * src/Spacing.h: ditto.
5780 * src/insets/figinset.C: ditto.
5781 * src/support/filetools.C: ditto.
5782 * src/support/lstrings.C: ditto.
5783 * src/BufferView.C: ditto.
5784 * src/bufferlist.C: ditto.
5785 * src/lyx_cb.C: ditto.
5786 * src/lyxlex.C: ditto.
5788 * NEWS: add some changes for 1.1.4.
5790 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/BufferView.C: first go at a TextCache to speed up switching
5795 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5797 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
5798 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
5799 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
5800 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
5803 * src/mathed/math_defs.h (MathedRowSt): make sure that all
5804 members of the struct are correctly initialized to 0 (detected by
5806 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
5807 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
5809 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
5810 pidwait, since it was allocated with "new". This was potentially
5811 very bad. Thanks to Michael Schmitt for running purify for us.
5814 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5816 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
5818 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
5820 1999-12-30 Allan Rae <rae@lyx.org>
5822 * lib/templates/IEEEtran.lyx: minor change
5824 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
5825 src/mathed/formula.C (LocalDispatch): askForText changes
5827 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
5828 know when a user has cancelled input. Fixes annoying problems with
5829 inserting labels and version control.
5831 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5833 * src/support/lstrings.C (tostr): rewritten to use strstream and
5836 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5838 * src/support/filetools.C (IsFileWriteable): use fstream to check
5839 (IsDirWriteable): use fileinfo to check
5841 * src/support/filetools.h (FilePtr): whole class deleted
5843 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
5845 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
5847 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
5849 * src/bufferlist.C (write): use ifstream and ofstream instead of
5852 * src/Spacing.h: use istrstream instead of sscanf
5854 * src/mathed/math_defs.h: change first arg to istream from FILE*
5856 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
5858 * src/mathed/math_parser.C: have yyis to be an istream
5859 (LexGetArg): use istream (yyis)
5861 (mathed_parse): ditto
5862 (mathed_parser_file): first arg istream instead of FILE*, set yyis
5864 * src/mathed/formula.C (Read): rewritten to use istream
5866 * src/mathed/formulamacro.C (Read): rewritten to use istream
5868 * src/lyxlex.h (~LyXLex): deleted desturctor
5869 (getStream): new function, returns an istream
5870 (getFile): deleted funtion
5871 (IsOK): return is.good();
5873 * src/lyxlex.C (LyXLex): delete file and owns_file
5874 (setFile): open an filebuf and assign that to a istream instead of
5876 (setStream): new function, takes an istream as arg.
5877 (setFile): deleted function
5878 (EatLine): rewritten us use istream instead of FILE*
5882 * src/table.C (LyXTable): use istream instead of FILE*
5883 (Read): rewritten to take an istream instead of FILE*
5885 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5887 * src/buffer.C (Dispatch): remove an extraneous break statement.
5889 * src/support/filetools.C (QuoteName): change to do simple
5890 'quoting'. More work is necessary. Also changed to do nothing
5891 under emx (needs fix too).
5892 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
5894 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
5895 config.h.in to the AC_DEFINE_UNQUOTED() call.
5896 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
5897 needs char * as argument (because Solaris 7 declares it like
5900 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
5901 remove definition of BZERO.
5903 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5905 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
5906 defined, "lyxregex.h" if not.
5908 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
5910 (REGEX): new variable that is set to regex.c lyxregex.h when
5911 AM_CONDITIONAL USE_REGEX is set.
5912 (libsupport_la_SOURCES): add $(REGEX)
5914 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
5917 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
5920 * configure.in: add call to LYX_REGEX
5922 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
5923 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
5925 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5927 * lib/bind/fi_menus.bind: new file, from
5928 pauli.virtanen@saunalahti.fi.
5930 * src/buffer.C (getBibkeyList): pass the parameter delim to
5931 InsetInclude::getKeys and InsetBibtex::getKeys.
5933 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
5934 is passed to Buffer::getBibkeyList
5936 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
5937 instead of the hardcoded comma.
5939 * src/insets/insetbib.C (getKeys): make sure that there are not
5940 leading blanks in bibtex keys. Normal latex does not care, but
5941 harvard.sty seems to dislike blanks at the beginning of citation
5942 keys. In particular, the retturn value of the function is
5944 * INSTALL: make it clear that libstdc++ is needed and that gcc
5945 2.7.x probably does not work.
5947 * src/support/filetools.C (findtexfile): make debug message go to
5949 * src/insets/insetbib.C (getKeys): ditto
5951 * src/debug.C (showTags): make sure that the output is correctly
5954 * configure.in: add a comment for TWO_COLOR_ICON define.
5956 * acconfig.h: remove all the entries that already defined in
5957 configure.in or acinclude.m4.
5959 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
5960 to avoid user name, date and copyright.
5962 1999-12-21 Juergen Vigna <jug@sad.it>
5964 * src/table.C (Read): Now read bogus row format informations
5965 if the format is < 5 so that afterwards the table can
5966 be read by lyx but without any format-info. Fixed the
5967 crash we experienced when not doing this.
5969 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5971 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
5972 (RedoDrawingOfParagraph): ditto
5973 (RedoParagraphs): ditto
5974 (RemoveTableRow): ditto
5976 * src/text.C (Fill): rename arg paperwidth -> paper_width
5978 * src/buffer.C (insertLyXFile): rename var filename -> fname
5979 (writeFile): rename arg filename -> fname
5980 (writeFileAscii): ditto
5981 (makeLaTeXFile): ditto
5982 (makeLinuxDocFile): ditto
5983 (makeDocBookFile): ditto
5985 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
5988 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
5990 * src/bmtable.h: add extern "C" on this file when __cplusplus is
5993 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
5994 compiled by a C compiler not C++.
5996 * src/layout.h (LyXTextClass): added typedef for const_iterator
5997 (LyXTextClassList): added typedef for const_iterator + member
5998 functions begin and end.
6000 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6001 iterators to fill the choice_class.
6002 (updateLayoutChoice): rewritten to use iterators to fill the
6003 layoutlist in the toolbar.
6005 * src/BufferView.h (BufferView::work_area_width): removed unused
6008 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6010 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6011 (sgmlCloseTag): ditto
6013 * src/support/lstrings.h: return type of countChar changed to
6016 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6017 what version of this func to use. Also made to return unsigned int.
6019 * configure.in: call LYX_STD_COUNT
6021 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6022 conforming std::count.
6024 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6026 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6027 and a subscript would give bad display (patch from Dekel Tsur
6028 <dekel@math.tau.ac.il>).
6030 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6032 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6035 * src/chset.h: add a few 'using' directives
6037 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6038 triggered when no buffer is active
6040 * src/layout.C: removed `break' after `return' in switch(), since
6043 * src/lyx_main.C (init): make sure LyX can be ran in place even
6044 when libtool has done its magic with shared libraries. Fix the
6045 test for the case when the system directory has not been found.
6047 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6048 name for the latex file.
6049 (MenuMakeHTML): ditto
6051 * src/buffer.h: add an optional boolean argument, which is passed
6054 1999-12-20 Allan Rae <rae@lyx.org>
6056 * lib/templates/IEEEtran.lyx: small correction and update.
6058 * configure.in: Attempted to use LYX_PATH_HEADER
6060 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6062 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6063 input from JMarc. Now use preprocessor to find the header.
6064 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6065 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6066 LYX_STL_STRING_FWD. See comments in file.
6068 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6070 * The global MiniBuffer * minibuffer variable is dead.
6072 * The global FD_form_main * fd_form_main variable is dead.
6074 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6076 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6078 * src/table.h: add the LOstream.h header
6079 * src/debug.h: ditto
6081 * src/LyXAction.h: change the explaination of the ReadOnly
6082 attribute: is indicates that the function _can_ be used.
6084 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6087 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6089 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6095 * src/paragraph.C (GetWord): assert on pos>=0
6098 * src/support/lyxstring.C: condition the use of an invariant on
6100 * src/support/lyxstring.h: ditto
6102 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6103 Use LAssert.h instead of plain assert().
6105 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6107 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6108 * src/support/filetools.C: ditto
6110 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6113 * INSTALL: document the new configure flags
6115 * configure.in: suppress --with-debug; add --enable-assertions
6117 * acinclude.m4: various changes in alignment of help strings.
6119 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6121 * src/kbmap.C: commented out the use of the hash map in kb_map,
6122 beginning of movement to a stl::container.
6124 * several files: removed code that was not in effect when
6125 MOVE_TEXT was defined.
6127 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6128 for escaping should not be used. We can discuss if the string
6129 should be enclosed in f.ex. [] instead of "".
6131 * src/trans_mgr.C (insert): use the new returned value from
6132 encodeString to get deadkeys and keymaps done correctly.
6134 * src/chset.C (encodeString): changed to return a pair, to tell
6135 what to use if we know the string.
6137 * src/lyxscreen.h (fillArc): new function.
6139 * src/FontInfo.C (resize): rewritten to use more std::string like
6140 structore, especially string::replace.
6142 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6145 * configure.in (chmod +x some scripts): remove config/gcc-hack
6147 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6149 * src/buffer.C (writeFile): change once again the top comment in a
6150 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6151 instead of an hardcoded version number.
6152 (makeDocBookFile): ditto
6154 * src/version.h: add new define LYX_DOCVERSION
6156 * po/de.po: update from Pit Sütterlin
6157 * lib/bind/de_menus.bind: ditto.
6159 * src/lyxfunc.C (Dispatch): call MenuExport()
6160 * src/buffer.C (Dispatch): ditto
6162 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6163 LyXFunc::Dispatch().
6164 (MenuExport): new function, moved from
6165 LyXFunc::Dispatch().
6167 * src/trans_mgr.C (insert): small cleanup
6168 * src/chset.C (loadFile): ditto
6170 * lib/kbd/iso8859-1.cdef: add missing backslashes
6172 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6174 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6175 help with placing the manually drawn accents better.
6177 (Draw): x2 and hg changed to float to minimize rounding errors and
6178 help place the accents better.
6180 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6181 unsigned short to char is just wrong...cast the char to unsigned
6182 char instead so that the two values can compare sanely. This
6183 should also make the display of insetlatexaccents better and
6184 perhaps also some other insets.
6186 (lbearing): new function
6189 1999-12-15 Allan Rae <rae@lyx.org>
6191 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6192 header that provides a wrapper around the very annoying SGI STL header
6195 * src/support/lyxstring.C, src/LString.h:
6196 removed old SGI-STL-compatability attempts.
6198 * configure.in: Use LYX_STL_STRING_FWD.
6200 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6201 stl_string_fwd.h is around and try to determine it's location.
6202 Major improvement over previous SGI STL 3.2 compatability.
6203 Three small problems remain with this function due to my zero
6204 knowledge of autoconf. JMarc and lgb see the comments in the code.
6206 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6208 * src/broken_const.h, config/hack-gcc, config/README: removed
6210 * configure.in: remove --with-gcc-hack option; do not call
6213 * INSTALL: remove documentation of --with-broken-const and
6216 * acconfig.h: remove all trace of BROKEN_CONST define
6218 * src/buffer.C (makeDocBookFile): update version number in output
6220 (SimpleDocBookOnePar): fix an assert when trying to a character
6221 access beyond string length
6224 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6226 * po/de.po: fix the Export menu
6228 * lyx.man: update the description of -dbg
6230 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6231 (commandLineHelp): updated
6232 (easyParse): show list of available debug levels if -dbg is passed
6235 * src/Makefile.am: add debug.C
6237 * src/debug.h: moved some code to debug.C
6239 * src/debug.C: new file. Contains code to set and show debug
6242 * src/layout.C: remove 'break' after 'continue' in switch
6243 statements, since these cannot be reached.
6245 1999-12-13 Allan Rae <rae@lyx.org>
6247 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6248 (in_word_set): hash() -> math_hash()
6250 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6252 * acconfig.h: Added a test for whether we are using exceptions in the
6253 current compilation run. If so USING_EXCEPTIONS is defined.
6255 * config.in: Check for existance of stl_string_fwd.h
6256 * src/LString.h: If compiling --with-included-string and SGI's
6257 STL version 3.2 is present (see above test) we need to block their
6258 forward declaration of string and supply a __get_c_string().
6259 However, it turns out this is only necessary if compiling with
6260 exceptions enabled so I've a bit more to add yet.
6262 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6263 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6264 src/support/LRegex.h, src/undo.h:
6265 Shuffle the order of the included files a little to ensure that
6266 LString.h gets included before anything that includes stl_string_fwd.h
6268 * src/support/lyxstring.C: We need to #include LString.h instead of
6269 lyxstring.h to get the necessary definition of __get_c_string.
6270 (__get_c_string): New function. This is defined static just like SGI's
6271 although why they need to do this I'm not sure. Perhaps it should be
6272 in lstrings.C instead.
6274 * lib/templates/IEEEtran.lyx: New template file.
6276 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6278 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6279 * intl/Makefile.in (MKINSTALLDIRS): ditto
6281 * src/LyXAction.C (init): changed to hold the LFUN data in a
6282 automatic array in stead of in callso to newFunc, this speeds up
6283 compilation a lot. Also all the memory used by the array is
6284 returned when the init is completed.
6286 * a lot of files: compiled with -Wold-style-cast, changed most of
6287 the reported offenders to C++ style casts. Did not change the
6288 offenders in C files.
6290 * src/trans.h (Match): change argument type to unsigned int.
6292 * src/support/DebugStream.C: fix some types on the streambufs so
6293 that it works on a conforming implementation.
6295 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6297 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6299 * src/support/lyxstring.C: remove the inline added earlier since
6300 they cause a bunch of unsatisfied symbols when linking with dec
6301 cxx. Cxx likes to have the body of inlines at the place where they
6304 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6305 accessing negative bounds in array. This fixes the crash when
6306 inserting accented characters.
6307 * src/trans.h (Match): ditto
6309 * src/buffer.C (Dispatch): since this is a void, it should not try
6310 to return anything...
6312 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6314 * src/buffer.h: removed the two friends from Buffer. Some changes
6315 because of this. Buffer::getFileName and Buffer::setFileName
6316 renamed to Buffer::fileName() and Buffer::fileName(...).
6318 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6320 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6321 and Buffer::update(short) to BufferView. This move is currently
6322 controlled by a define MOVE_TEXT, this will be removed when all
6323 shows to be ok. This move paves the way for better separation
6324 between buffer contents and buffer view. One side effect is that
6325 the BufferView needs a rebreak when swiching buffers, if we want
6326 to avoid this we can add a cache that holds pointers to LyXText's
6327 that is not currently in use.
6329 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6332 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6334 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6336 * lyx_main.C: new command line option -x (or --execute) and
6337 -e (or --export). Now direct conversion from .lyx to .tex
6338 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6339 Unfortunately, X is still needed and the GUI pops up during the
6342 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6344 * src/Spacing.C: add a using directive to bring stream stuff into
6346 * src/paragraph.C: ditto
6347 * src/buffer.C: ditto
6349 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6350 from Lars' announcement).
6352 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6353 example files from Tino Meinen.
6355 1999-12-06 Allan Rae <rae@lyx.org>
6357 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6359 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6361 * src/support/lyxstring.C: added a lot of inline for no good
6364 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6365 latexWriteEndChanges, they were not used.
6367 * src/layout.h (operator<<): output operator for PageSides
6369 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6371 * some example files: loaded in LyX 1.0.4 and saved again to update
6372 certain constructs (table format)
6374 * a lot of files: did the change to use fstream/iostream for all
6375 writing of files. Done with a close look at Andre Poenitz's patch.
6377 * some files: whitespace changes.
6379 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6381 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6382 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6383 architecture, we provide our own. It is used unconditionnally, but
6384 I do not think this is a performance problem. Thanks to Angus
6385 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6386 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6388 (GetInset): use my_memcpy.
6392 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6393 it is easier to understand, but it uses less TeX-only constructs now.
6395 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6396 elements contain spaces
6398 * lib/configure: regenerated
6400 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6401 elements contain spaces; display the list of programs that are
6404 * autogen.sh: make sure lib/configure is executable
6406 * lib/examples/*: rename the tutorial examples to begin with the
6407 two-letters language code.
6409 * src/lyxfunc.C (getStatus): do not query current font if no
6412 * src/lyx_cb.C (RunScript): use QuoteName
6413 (MenuRunDvips): ditto
6414 (PrintApplyCB): ditto
6416 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6417 around argument, so that it works well with the current shell.
6418 Does not work properly with OS/2 shells currently.
6420 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6421 * src/LyXSendto.C (SendtoApplyCB): ditto
6422 * src/lyxfunc.C (Dispatch): ditto
6423 * src/buffer.C (runLaTeX): ditto
6424 (runLiterate): ditto
6425 (buildProgram): ditto
6427 * src/lyx_cb.C (RunScript): ditto
6428 (MenuMakeLaTeX): ditto
6430 * src/buffer.h (getLatexName): new method
6432 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6434 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6436 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
6437 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
6438 (create_math_panel): ditto
6440 * src/lyxfunc.C (getStatus): re-activate the code which gets
6441 current font and cursor; add test for export to html.
6443 * src/lyxrc.C (read): remove unreachable break statements; add a
6446 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
6448 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6450 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
6451 introduced by faulty regex.
6452 * src/buffer.C: ditto
6453 * src/lastfiles.C: ditto
6454 * src/paragraph.C: ditto
6455 * src/table.C: ditto
6456 * src/vspace.C: ditto
6457 * src/insets/figinset.C: ditto
6458 Note: most of these is absolutely harmless, except the one in
6459 src/mathed formula.C.
6461 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6463 * src/ImportNoweb.C (documentclass): fixed bounds for substr
6464 operation, yielding correct results for the reLyX command.
6466 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6468 * src/support/filetools.C (ExpandPath): removed an over eager
6470 (ReplaceEnvironmentPath): ditto
6472 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
6473 shows that we are doing something fishy in our code...
6477 * src/lyxrc.C (read): use a double switch trick to get more help
6478 from the compiler. (the same trick is used in layout.C)
6479 (write): new function. opens a ofstream and pass that to output
6480 (output): new function, takes a ostream and writes the lyxrc
6481 elemts to it. uses a dummy switch to make sure no elements are
6484 * src/lyxlex.h: added a struct pushpophelper for use in functions
6485 with more than one exit point.
6487 * src/lyxlex.[Ch] (GetInteger): made it const
6491 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
6493 * src/layout.[hC] : LayoutTags splitted into several enums, new
6494 methods created, better error handling cleaner use of lyxlex. Read
6497 * src/bmtable.[Ch]: change some member prototypes because of the
6498 image const changes.
6500 * commandtags.h, src/LyXAction.C (init): new function:
6501 "preferences-save", saves the lyxrc entries into .lyx/preferences.
6502 This file is not read automatically but you can add \input
6503 preferences to your lyxrc if you want to. We need to discuss how
6506 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
6507 in .aux, also remove .bib and .bst files from dependencies when
6510 * src/BufferView.C, src/LyXView.C: add const_cast several places
6511 because of changes to images.
6513 * lib/images/*: same change as for images/*
6515 * lib/lyxrc.example: Default for accept_compound is false not no.
6517 * images/*: changed to be const, however I have som misgivings
6518 about this change so it might be changed back.
6520 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6522 * lib/configure, po/POTFILES.in: regenerated
6524 * autogen.sh: autogenerate lib/configure from lib/configure.m4
6526 * config/lib_configure.m4: removed
6528 * lib/configure.m4: new file (was config/lib_configure.m4)
6530 * configure.in: do not test for rtti, since we do not use it.
6532 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6534 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
6535 doubling of allocated space scheme. This makes it faster for large
6536 strings end to use less memory for small strings. xtra rememoved.
6538 * src/insets/figinset.C (waitalarm): commented out.
6539 (GhostscriptMsg): use static_cast
6540 (GhostscriptMsg): use new instead of malloc to allocate memory for
6541 cmap. also delete the memory after use.
6543 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
6545 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
6546 for changes in bibtex database or style.
6547 (runBibTeX): remove all .bib and .bst files from dep before we
6549 (run): use scanAuc in when dep file already exist.
6551 * src/DepTable.C (remove_files_with_extension): new method
6554 * src/DepTable.[Ch]: made many of the methods const.
6556 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6558 * src/bufferparams.C: make sure that the default textclass is
6559 "article". It used to be the first one by description order, but
6560 now the first one is "docbook".
6562 * src/lyx_main.C (setDebuggingLevel): change type of argument to
6563 string; call Debug::value.
6564 (easyParse): pass complete argument to setDebuggingLevel().
6566 * src/debug.h (value): fix the code that parses debug levels.
6568 * src/debug.h: add new debug type ACTION, reserved for LyXAction
6571 * src/LyXAction.C: use Debug::ACTION as debug channel.
6573 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
6575 * NEWS: updated for the future 1.1.3 release.
6577 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
6578 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
6579 it should. This is of course a controversial change (since many
6580 people will find that their lyx workscreen is suddenly full of
6581 red), but done for the sake of correctness.
6583 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
6584 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
6586 * src/insets/inseterror.h, src/insets/inseturl.h,
6587 src/insets/insetinfo.h, src/insets/figinset.h,
6588 src/mathed/formulamacro.h, src/mathed/math_macro.h
6589 (EditMessage): add a missing const and add _() to make sure that
6592 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
6593 src/insets/insetbib.C, src/support/filetools.C: add `using'
6596 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
6597 doing 'Insert index of last word' at the beginning of a paragraph.
6599 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6601 * several files: white-space changes.
6603 * src/mathed/formula.C: removed IsAlpha and IsDigit
6605 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
6606 .bib file. use a ifstream instead of FilePtr when parsing the .bib
6609 * src/insets/figinset.C (GetPSSizes): don't break when
6610 "EndComments" is seen. But break when a boundingbox is read.
6612 * all classes inherited from Inset: return value of Clone
6613 changed back to Inset *.
6615 * all classes inherited form MathInset: return value of Clone
6616 changed back to MathedInset *.
6618 * src/insets/figinset.C (runqueue): use a ofstream to output the
6619 gs/ps file. Might need some setpresicion or setw. However I can
6620 see no problem with the current code.
6621 (runqueue): use sleep instead of the alarm/signal code. I just
6622 can't see the difference.
6624 * src/paragraph.C (LyXParagraph): reserve space in the new
6625 paragraph and resize the inserted paragraph to just fit.
6627 * src/lyxfunc.h (operator|=): added operator for func_status.
6629 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
6630 check for readable file.
6632 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
6633 check for readable file.
6634 (MenuMakeLinuxDoc): ditto
6635 (MenuMakeDocBook): ditto
6636 (MenuMakeAscii): ditto
6637 (InsertAsciiFile): split the test for openable and readable
6639 * src/bmtable.C (draw_bitmaptable): use
6640 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
6642 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
6643 findtexfile from LaTeX to filetools.
6645 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
6646 instead of FilePtr. Needs to be verified by a literate user.
6648 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6650 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
6651 (EditMessage): likewise.
6653 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
6654 respectively as \textasciitilde and \textasciicircum.
6656 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6658 * src/support/lyxstring.h: made the methods that take iterators
6661 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
6662 (regexMatch): made is use the real regex class.
6664 * src/support/Makefile.am: changed to use libtool
6666 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
6668 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
6670 (MathIsInset ++): changed several macros to be inline functions
6673 * src/mathed/Makefile.am: changed to use libtool
6675 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
6677 * src/insets/inset* : Clone changed to const and return type is
6678 the true insettype not just Inset*.
6680 * src/insets/Makefile.am: changed to use libtool
6682 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
6684 * src/undo.[Ch] : added empty() and changed some of the method
6687 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
6689 * src/lyxparagraph.h: use id() and id(...) instead of getID and
6690 setID use block<> for the bullets array, added const several places.
6692 * src/lyxfunc.C (getStatus): new function
6694 * src/lyxfunc.[Ch] : small changes to take advantage of the new
6695 LyXAction, added const to several funtions.
6697 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
6698 a std::map, and to store the dir items in a vector.
6700 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
6703 * src/LyXView.[Ch] + other files : changed currentView to view.
6705 * src/LyXAction.[Ch] : ported from the old devel branch.
6707 * src/.cvsignore: added .libs and a.out
6709 * configure.in : changes to use libtool.
6711 * acinclude.m4 : inserted libtool.m4
6713 * .cvsignore: added libtool
6715 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6717 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
6718 file name in insets and mathed directories (otherwise the
6719 dependency is not taken in account under cygwin).
6721 * src/text2.C (InsertString[AB]): make sure that we do not try to
6722 read characters past the string length.
6724 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6726 * lib/doc/LaTeXConfig.lyx.in,
6727 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
6729 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
6730 file saying who created them and when this heppened; this is
6731 useless and annoys tools like cvs.
6733 * lib/layouts/g-brief-{en,de}.layout,
6734 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
6735 from Thomas Hartkens <thomas@hartkens.de>.
6737 * src/{insets,mathed}/Makefile.am: do not declare an empty
6738 LDFLAGS, so that it can be set at configure time (useful on Irix
6741 * lib/reLyX/configure.in: make sure that the prefix is set
6742 correctly in LYX_DIR.
6744 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6746 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
6747 be used by 'command-sequence' this allows to bind a key to a
6748 sequence of LyX-commands
6749 (Example: 'command-sequence math-insert alpha; math-insert beta;")
6751 * src/LyXAction.C: add "command-sequence"
6753 * src/LyXFunction.C: handling of "command-sequence"
6755 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
6756 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
6758 * src/lyxserver.C, src/minibuffer.C: Use this new interface
6760 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6762 * src/buffer.C (writeFile): Do not output a comment giving user
6763 and date at the beginning of a .lyx file. This is useless and
6764 annoys cvs anyway; update version number to 1.1.
6766 * src/Makefile.am (LYX_DIR): add this definition, so that a
6767 default path is hardcoded in LyX.
6769 * configure.in: Use LYX_GNU_GETTEXT.
6771 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
6772 AM_GNU_GETTEXT with a bug fixed.
6774 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
6776 * src/chset.C: add "using std::ifstream;" to please dec cxx.
6778 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
6779 which is used to point to LyX data is now LYX_DIR_11x.
6781 * lyx.man: convert to a unix text file; small updates.
6783 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6785 * src/support/LSubstring.[Ch]: made the second arg of most of the
6786 constructors be a const reference.
6788 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
6791 * src/support/lyxstring.[Ch] (swap): added missing member function
6792 and specialization of swap(str, str);
6794 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
6796 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
6797 trace of the old one.
6799 * src/undo.[Ch]: made the undostack use std::list to store undo's in
6800 put the member definitions in undo.C.
6802 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
6803 NEW_TEXT and have now only code that was included when this was
6806 * src/intl.C (LCombo): use static_cast
6808 (DispatchCallback): ditto
6810 * src/definitions.h: removed whole file
6812 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
6814 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
6815 parsing and stores in a std:map. a regex defines the file format.
6816 removed unneeded members.
6818 * src/bufferparams.h: added several enums from definitions.h here.
6819 Removed unsused destructor. Changed some types to use proper enum
6820 types. use block to have the temp_bullets and user_defined_bullets
6821 and to make the whole class assignable.
6823 * src/bufferparams.C (Copy): removed this functions, use a default
6826 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
6829 * src/buffer.C (readLyXformat2): commend out all that have with
6830 oldpapersize to do. also comment out all that hve to do with
6831 insetlatex and insetlatexdel.
6832 (setOldPaperStuff): commented out
6834 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
6836 * src/LyXAction.C: remove use of inset-latex-insert
6838 * src/mathed/math_panel.C (button_cb): use static_cast
6840 * src/insets/Makefile.am (insets_o_SOURCES): removed
6843 * src/support/lyxstring.C (helper): use the unsigned long
6844 specifier, UL, instead of a static_cast.
6846 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
6848 * src/support/block.h: new file. to be used as a c-style array in
6849 classes, so that the class can be assignable.
6851 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6853 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
6854 NULL, make sure to return an empty string (it is not possible to
6855 set a string to NULL).
6857 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6859 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
6861 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
6863 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
6864 link line, so that Irix users (for example) can set it explicitely to
6867 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
6868 it can be overidden at make time (static or dynamic link, for
6871 * src/vc-backend.C, src/LaTeXFeatures.h,
6872 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
6873 statements to bring templates to global namespace.
6875 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6877 * src/support/lyxstring.C (operator[] const): make it standard
6880 * src/minibuffer.C (Init): changed to reflect that more
6881 information is given from the lyxvc and need not be provided here.
6883 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
6885 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
6887 * src/LyXView.C (UpdateTimerCB): use static_cast
6888 (KeyPressMask_raw_callback): ditto
6890 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
6891 buffer_, a lot of changes because of this. currentBuffer() ->
6892 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
6893 also changes to other files because of this.
6895 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6897 * src/vc-backend.[Ch]: new files. The backends for vc handling,
6898 have no support for RCS and partial support for CVS, will be
6901 * src/insets/ several files: changes because of function name
6902 changes in Bufferview and LyXView.
6904 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
6906 * src/support/LSubstring.[Ch]: new files. These implement a
6907 Substring that can be very convenient to use. i.e. is this
6909 string a = "Mary had a little sheep";
6910 Substring(a, "sheep") = "lamb";
6911 a is now "Mary has a little lamb".
6913 * src/support/LRegex.[Ch]: a regex class that can be used to pick
6914 out patterns and subpatterns of strings. It is used by LSubstring
6915 and also by vc-backend.C
6917 * src/support/lyxstring.C: went over all the assertions used and
6918 tried to correct the wrong ones and flag which of them is required
6919 by the standard. some bugs found because of this. Also removed a
6920 couple of assertions.
6922 * src/support/Makefile.am (libsupport_a_SOURCES): added
6923 LSubstring.[Ch] and LRegex.[Ch]
6925 * src/support/FileInfo.h: have struct stat buf as an object and
6926 not a pointer to one, some changes because of this.
6928 * src/LaTeXFeatures.C (getTClassPreamble): also use the
6929 information in layout when adding the layouts preamble to the
6932 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
6935 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
6936 because of bug in OS/2.
6938 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6940 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
6941 \verbatim@font instead of \ttfamily, so that it can be redefined.
6943 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
6944 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
6945 src/layout.h, src/text2.C: add 'using' directive to bring the
6946 STL templates we need from the std:: namespace to the global one.
6947 Needed by DEC cxx in strict ansi mode.
6949 * src/support/LIstream.h,src/support/LOstream.h,
6950 src/support/lyxstring.h,src/table.h,
6951 src/lyxlookup.h: do not include <config.h> in header
6952 files. This should be done in the .C files only.
6954 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
6958 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6960 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
6961 from Kayvan to fix the tth invokation.
6963 * development/lyx.spec.in: updates from Kayvan to reflect the
6964 changes of file names.
6966 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6968 * src/text2.C (InsertStringB): use std::copy
6969 (InsertStringA): use std::copy
6971 * src/bufferlist.C: use a vector to store the buffers in. This is
6972 an internal change and should not affect any other thing.
6974 * src/BufferView.C (waitForX): use XSync instead of the lengthy
6977 * src/text.C (Fill): fix potential bug, one off bug.
6979 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6981 * src/Makefile.am (lyx_main.o): add more files it depends on.
6983 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
6985 * src/support/lyxstring.C: use size_t for the reference count,
6986 size, reserved memory and xtra.
6987 (internal_compare): new private member function. Now the compare
6988 functions should work for std::strings that have embedded '\0'
6990 (compare): all compare functions rewritten to use
6993 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6995 * src/support/lyxstring.C (compare): pass c_str()
6996 (compare): pass c_str
6997 (compare): pass c_str
6999 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7001 * src/support/DebugStream.C: <config.h> was not included correctly.
7003 * lib/configure: forgot to re-generate it :( I'll make this file
7004 auto generated soon.
7006 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7008 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7011 * src/support/lyxstring.C: some changes from length() to rep->sz.
7012 avoids a function call.
7014 * src/support/filetools.C (SpaceLess): yet another version of the
7015 algorithm...now per Jean-Marc's suggestions.
7017 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7019 * src/layout.C (less_textclass_desc): functor for use in sorting
7021 (LyXTextClass::Read): sort the textclasses after reading.
7023 * src/support/filetools.C (SpaceLess): new version of the
7024 SpaceLess functions. What problems does this one give? Please
7027 * images/banner_bw.xbm: made the arrays unsigned char *
7029 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7031 * src/support/lyxstring.C (find): remove bogus assertion in the
7032 two versions of find where this has not been done yet.
7034 * src/support/lyxlib.h: add missing int return type to
7037 * src/menus.C (ShowFileMenu): disable exporting to html if no
7038 html export command is present.
7040 * config/lib_configure.m4: add a test for an HTML converter. The
7041 programs checked for are, in this order: tth, latex2html and
7044 * lib/configure: generated from config/lib_configure.m4.
7046 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7047 html converter. The parameters are now passed through $$FName and
7048 $$OutName, instead of standard input/output.
7050 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7052 * lib/lyxrc.example: update description of \html_command.
7053 add "quotes" around \screen_font_xxx font setting examples to help
7054 people who use fonts with spaces in their names.
7056 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7058 * Distribution files: updates for v1.1.2
7060 * src/support/lyxstring.C (find): remove bogus assert and return
7061 npos for the same condition.
7063 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7065 * added patch for OS/2 from SMiyata.
7067 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7069 * src/text2.C (CutSelection): make space_wrapped a bool
7070 (CutSelection): dont declare int i until we have to.
7071 (alphaCounter): return a char const *.
7073 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7075 * src/support/syscall.C (Systemcalls::kill):
7076 src/support/filetools.C (PutEnv, PutEnvPath):
7077 src/lyx_cb.C (addNewlineAndDepth):
7078 src/FontInfo.C (FontInfo::resize): condition some #warning
7079 directives with WITH_WARNINGS.
7082 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7084 * src/layout.[Ch] + several files: access to class variables
7085 limited and made accessor functions instead a lot of code changed
7086 becuase of this. Also instead of returning pointers often a const
7087 reference is returned instead.
7089 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7091 * src/Makefile.am (dist-hook): added used to remove the CVS from
7092 cheaders upon creating a dist
7093 (EXTRA_DIST): added cheaders
7095 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7096 a character not as a small integer.
7098 * src/support/lyxstring.C (find): removed Assert and added i >=
7099 rep->sz to the first if.
7101 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7103 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7104 src/LyXView.C src/buffer.C src/bufferparams.C
7105 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7106 src/text2.C src/insets/insetinclude.C:
7107 lyxlayout renamed to textclasslist.
7109 * src/layout.C: some lyxerr changes.
7111 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7112 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7113 (LyXLayoutList): removed all traces of this class.
7114 (LyXTextClass::Read): rewrote LT_STYLE
7115 (LyXTextClass::hasLayout): new function
7116 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7117 both const and nonconst version.
7118 (LyXTextClass::delete_layout): new function.
7119 (LyXTextClassList::Style): bug fix. do the right thing if layout
7121 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7122 (LyXTextClassList::NameOfLayout): ditto
7123 (LyXTextClassList::Load): ditto
7125 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7127 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7129 * src/LyXAction.C (LookupFunc): added a workaround for sun
7130 compiler, on the other hand...we don't know if the current code
7131 compiles on sun at all...
7133 * src/support/filetools.C (CleanupPath): subst fix
7135 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7138 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7139 complained about this one?
7141 * src/insets/insetinclude.C (Latex): subst fix
7143 * src/insets/insetbib.C (getKeys): subst fix
7145 * src/LyXSendto.C (SendtoApplyCB): subst fix
7147 * src/lyx_main.C (init): subst fix
7149 * src/layout.C (Read): subst fix
7151 * src/lyx_sendfax_main.C (button_send): subst fix
7153 * src/buffer.C (RoffAsciiTable): subst fix
7155 * src/lyx_cb.C (MenuFax): subst fix
7156 (PrintApplyCB): subst fix
7158 1999-10-26 Juergen Vigna <jug@sad.it>
7160 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7162 (Read): Cleaned up this code so now we read only format vestion >= 5
7164 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7166 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7167 come nobody has complained about this one?
7169 * src/insets/insetinclude.C (Latex): subst fix
7171 * src/insets/insetbib.C (getKeys): subst fix
7173 * src/lyx_main.C (init): subst fix
7175 * src/layout.C (Read): subst fix
7177 * src/buffer.C (RoffAsciiTable): subst fix
7179 * src/lyx_cb.C (MenuFax): subst fix.
7181 * src/layout.[hC] + some other files: rewrote to use
7182 std::container to store textclasses and layouts in.
7183 Simplified, removed a lot of code. Make all classes
7184 assignable. Further simplifications and review of type
7185 use still to be one.
7187 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7188 lastfiles to create the lastfiles partr of the menu.
7190 * src/lastfiles.[Ch]: rewritten to use deque to store the
7191 lastfiles in. Uses fstream for reading and writing. Simplifies
7194 * src/support/syscall.C: remove explicit cast.
7196 * src/BufferView.C (CursorToggleCB): removed code snippets that
7198 use explicat C++ style casts instead of C style casts. also use
7199 u_vdata instea of passing pointers in longs.
7201 * src/PaperLayout.C: removed code snippets that were commented out.
7203 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7205 * src/lyx_main.C: removed code snippets that wer commented out.
7207 * src/paragraph.C: removed code snippets that were commented out.
7209 * src/lyxvc.C (logClose): use static_cast
7211 (viewLog): remove explicit cast to void*
7212 (showLog): removed old commented code
7214 * src/menus.C: use static_cast instead of C style casts. use
7215 u_vdata instead of u_ldata. remove explicit cast to (long) for
7216 pointers. Removed old code that was commented out.
7218 * src/insets/inset.C: removed old commented func
7220 * src/insets/insetref.C (InsetRef): removed old code that had been
7221 commented out for a long time.
7223 (escape): removed C style cast
7225 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7227 * src/insets/insetlatex.C (Draw): removed old commented code
7228 (Read): rewritten to use string
7230 * src/insets/insetlabel.C (escape): removed C style cast
7232 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7234 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7237 * src/insets/insetinclude.h: removed a couple of stupid bools
7239 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7240 (Clone): remove C style cast
7241 (getKeys): changed list to lst because of std::list
7243 * src/insets/inseterror.C (Draw): removed som old commented code.
7245 * src/insets/insetcommand.C (Draw): removed some old commented code.
7247 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7248 commented out forever.
7249 (bibitem_cb): use static_cast instead of C style cast
7250 use of vdata changed to u_vdata.
7252 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7254 (CloseUrlCB): use static_cast instead of C style cast.
7255 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7257 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7258 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7259 (CloseInfoCB): static_cast from ob->u_vdata instead.
7260 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7263 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7264 (C_InsetError_CloseErrorCB): forward the ob parameter
7265 (CloseErrorCB): static_cast from ob->u_vdata instead.
7267 * src/vspace.h: include LString.h since we use string in this class.
7269 * src/vspace.C (lyx_advance): changed name from advance because of
7270 nameclash with stl. And since we cannot use namespaces yet...I
7271 used a lyx_ prefix instead. Expect this to change when we begin
7274 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7276 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7277 and removed now defunct constructor and deconstructor.
7279 * src/BufferView.h: have backstack as a object not as a pointer.
7280 removed initialization from constructor. added include for BackStack
7282 * development/lyx.spec.in (%build): add CFLAGS also.
7284 * src/screen.C (drawFrame): removed another warning.
7286 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7288 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7289 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7290 README and ANNOUNCE a bit for the next release. More work is
7293 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7294 unbreakable if we are in freespacing mode (LyX-Code), but not in
7297 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7299 * src/BackStack.h: fixed initialization order in constructor
7301 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7303 * acinclude.m4 (VERSION): new rules for when a version is
7304 development, added also a variable for prerelease.
7305 (warnings): we set with_warnings=yes for prereleases
7306 (lyx_opt): prereleases compile with same optimization as development
7307 (CXXFLAGS): only use pedantic if we are a development version
7309 * src/BufferView.C (restorePosition): don't do anything if the
7312 * src/BackStack.h: added member empty, use this to test if there
7313 is anything to pop...
7315 1999-10-25 Juergen Vigna <jug@sad.it>
7318 * forms/layout_forms.fd +
7319 * forms/latexoptions.fd +
7320 * lyx.fd: changed for various form resize issues
7322 * src/mathed/math_panel.C +
7323 * src/insets/inseterror.C +
7324 * src/insets/insetinfo.C +
7325 * src/insets/inseturl.C +
7326 * src/insets/inseturl.h +
7329 * src/PaperLayout.C +
7330 * src/ParagraphExtra.C +
7331 * src/TableLayout.C +
7333 * src/layout_forms.C +
7340 * src/menus.C: fixed various resize issues. So now forms can be
7341 resized savely or not be resized at all.
7343 * forms/form_url.fd +
7344 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7347 * src/insets/Makefile.am: added files form_url.[Ch]
7349 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7351 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7352 (and presumably 6.2).
7354 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7355 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7356 remaining static member callbacks.
7358 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7361 * src/support/lyxstring.h: declare struct Srep as friend of
7362 lyxstring, since DEC cxx complains otherwise.
7364 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7366 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7368 * src/LaTeX.C (run): made run_bibtex also depend on files with
7370 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7371 are put into the dependency file.
7373 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7374 the code has shown itself to work
7375 (create_ispell_pipe): removed another warning, added a comment
7378 * src/minibuffer.C (ExecutingCB): removed code that has been
7379 commented out a long time
7381 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7382 out code + a warning.
7384 * src/support/lyxstring.h: comment out the three private
7385 operators, when compiling with string ansi conforming compilers
7388 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7390 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7391 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7394 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7397 * src/mathed/math_panel.C (create_math_panel): remove explicit
7400 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7403 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7404 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7405 to XCreatePixmapFromBitmapData
7406 (fl_set_bmtable_data): change the last argument to be unsigned
7408 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7409 and bh to be unsigned int, remove explicit casts in call to
7410 XReadBitmapFileData.
7412 * images/arrows.xbm: made the arrays unsigned char *
7413 * images/varsz.xbm: ditto
7414 * images/misc.xbm: ditto
7415 * images/greek.xbm: ditto
7416 * images/dots.xbm: ditto
7417 * images/brel.xbm: ditto
7418 * images/bop.xbm: ditto
7420 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7422 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7423 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7424 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7426 (LYX_CXX_CHEADERS): added <clocale> to the test.
7428 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7430 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7432 * src/support/lyxstring.C (append): fixed something that must be a
7433 bug, rep->assign was used instead of rep->append.
7435 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
7438 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
7439 lyx insert double chars. Fix spotted by Kayvan.
7441 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7443 * Fixed the tth support. I messed up with the Emacs patch apply feature
7444 and omitted the changes in lyxrc.C.
7446 1999-10-22 Juergen Vigna <jug@sad.it>
7448 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
7450 * src/lyx_cb.C (MenuInsertRef) +
7451 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
7452 the form cannot be resized under it limits (fixes a segfault)
7454 * src/lyx.C (create_form_form_ref) +
7455 * forms/lyx.fd: Changed Gravity on name input field so that it is
7458 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7460 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
7461 <ostream> and <istream>.
7463 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
7464 whether <fstream> provides the latest standard features, or if we
7465 have an oldstyle library (like in egcs).
7466 (LYX_CXX_STL_STRING): fix the test.
7468 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
7469 code on MODERN_STL_STREAM.
7471 * src/support/lyxstring.h: use L{I,O}stream.h.
7473 * src/support/L{I,O}stream.h: new files, designed to setup
7474 correctly streams for our use
7475 - includes the right header depending on STL capabilities
7476 - puts std::ostream and std::endl (for LOStream.h) or
7477 std::istream (LIStream.h) in toplevel namespace.
7479 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7481 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
7482 was a bib file that had been changed we ensure that bibtex is run.
7483 (runBibTeX): enhanced to extract the names of the bib files and
7484 getting their absolute path and enter them into the dep file.
7485 (findtexfile): static func that is used to look for tex-files,
7486 checks for absolute patchs and tries also with kpsewhich.
7487 Alternative ways of finding the correct files are wanted. Will
7489 (do_popen): function that runs a command using popen and returns
7490 the whole output of that command in a string. Should be moved to
7493 * src/DepTable.[Ch] (extchanged): new function that returns true if a
7494 file with extension ext has changed.
7496 * src/insets/figinset.C: added ifdef guards around the fl_free
7497 code that jug commented out. Now it is commented out when
7498 compiling with XForms == 0.89.
7500 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
7501 to lyxstring.C, and only keep a forward declaration in
7502 lyxstring.h. Simplifies the header file a bit and should help a
7503 bit on compile time too. Also changes to Srep will not mandate a
7504 recompile of code just using string.
7505 (~lyxstring): definition moved here since it uses srep.
7506 (size): definition moved here since it uses srep.
7508 * src/support/lyxstring.h: removed a couple of "inline" that should
7511 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7513 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
7516 1999-10-21 Juergen Vigna <jug@sad.it>
7518 * src/table.C (SetPWidth): Just a small fix so the alignment is not
7519 set to left if I just remove the width entry (or it is empty).
7521 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
7522 paragraph when having dummy paragraphs.
7524 1999-10-20 Juergen Vigna <jug@sad.it>
7526 * src/insets/figinset.C: just commented some fl_free_form calls
7527 and added warnings so that this calls should be activated later
7528 again. This avoids for now a segfault, but we have a memory leak!
7530 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
7531 'const char * argument' to 'string argument', this should
7532 fix some Asserts() in lyxstring.C.
7534 * src/lyxfunc.h: Removed the function argAsString(const char *)
7535 as it is not used anymore.
7537 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7539 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
7542 * src/Literate.h: some funcs moved from public to private to make
7543 interface clearer. Unneeded args removed.
7545 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
7547 (scanBuildLogFile): ditto
7549 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
7550 normal TeX Error. Still room for improvement.
7552 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
7554 * src/buffer.C (insertErrors): changes to make the error
7555 desctription show properly.
7557 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
7560 * src/support/lyxstring.C (helper): changed to use
7561 sizeof(object->rep->ref).
7562 (operator>>): changed to use a pointer instead.
7564 * src/support/lyxstring.h: changed const reference & to value_type
7565 const & lets see if that helps.
7567 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7569 * Makefile.am (rpmdist): fixed to have non static package and
7572 * src/support/lyxstring.C: removed the compilation guards
7574 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
7577 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
7578 conditional compile of lyxstring.Ch
7580 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
7581 stupid check, but it is a lot better than the bastring hack.
7582 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
7584 * several files: changed string::erase into string::clear. Not
7587 * src/chset.C (encodeString): use a char temporary instead
7589 * src/table.C (TexEndOfCell): added tostr around
7590 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
7591 (TexEndOfCell): ditto
7592 (TexEndOfCell): ditto
7593 (TexEndOfCell): ditto
7594 (DocBookEndOfCell): ditto
7595 (DocBookEndOfCell): ditto
7596 (DocBookEndOfCell): ditto
7597 (DocBookEndOfCell): ditto
7599 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
7601 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
7603 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
7604 (MenuBuildProg): added tostr around ret
7605 (MenuRunChktex): added tostr around ret
7606 (DocumentApplyCB): added tostr around ret
7608 * src/chset.C (encodeString): added tostr around t->ic
7610 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
7611 (makeLaTeXFile): added tostr around tocdepth
7612 (makeLaTeXFile): added tostr around ftcound - 1
7614 * src/insets/insetbib.C (setCounter): added tostr around counter.
7616 * src/support/lyxstring.h: added an operator+=(int) to catch more
7619 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
7620 (lyxstring): We DON'T allow NULL pointers.
7622 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7624 * src/mathed/math_macro.C (MathMacroArgument::Write,
7625 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
7626 when writing them out.
7628 * src/LString.C: remove, since it is not used anymore.
7630 * src/support/lyxstring.C: condition the content to
7631 USE_INCLUDED_STRING macro.
7633 * src/mathed/math_symbols.C, src/support/lstrings.C,
7634 src/support/lyxstring.C: add `using' directive to specify what
7635 we need in <algorithm>. I do not think that we need to
7636 conditionalize this, but any thought is appreciated.
7638 * many files: change all callback functions to "C" linkage
7639 functions to please strict C++ compilers like DEC cxx 6.1 in mode
7640 strict_ansi. Those who were static are now global.
7641 The case of callbacks which are static class members is
7642 trickier, since we have to make C wrappers around them (see
7643 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
7644 did not finish this yet, since it defeats the purpose of
7645 encapsulation, and I am not sure what the best route is.
7647 1999-10-19 Juergen Vigna <jug@sad.it>
7649 * src/support/lyxstring.C (lyxstring): we permit to have a null
7650 pointer as assignment value and just don't assign it.
7652 * src/vspace.C (nextToken): corrected this function substituting
7653 find_first(_not)_of with find_last_of.
7655 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
7656 (TableOptCloseCB) (TableSpeCloseCB):
7657 inserted fl_set_focus call for problem with fl_hide_form() in
7660 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7662 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
7665 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7667 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
7668 LyXLex::next() and not eatline() to get its argument.
7670 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7672 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
7673 instead, use fstreams for io of the depfile, removed unneeded
7674 functions and variables.
7676 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
7677 vector instead, removed all functions and variables that is not in
7680 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7682 * src/buffer.C (insertErrors): use new interface to TeXError
7684 * Makefile.am (rpmdist): added a rpmdist target
7686 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
7687 per Kayvan's instructions.
7689 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7691 * src/Makefile.am: add a definition for localedir, so that locales
7692 are found after installation (Kayvan)
7694 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7696 * development/.cvsignore: new file.
7698 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7700 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
7701 C++ compiler provides wrappers for C headers and use our alternate
7704 * configure.in: use LYX_CXX_CHEADERS.
7706 * src/cheader/: new directory, populated with cname headers from
7707 libstdc++-2.8.1. They are a bit old, but probably good enough for
7708 what we want (support compilers who lack them).
7710 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
7711 from includes. It turns out is was stupid.
7713 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7715 * lib/Makefile.am (install-data-local): forgot a ';'
7716 (install-data-local): forgot a '\'
7717 (libinstalldirs): needed after all. reintroduced.
7719 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7721 * configure.in (AC_OUTPUT): added lyx.spec
7723 * development/lyx.spec: removed file
7725 * development/lyx.spec.in: new file
7727 * po/*.po: merged with lyx.pot becuase of make distcheck
7729 * lib/Makefile.am (dist-hook): added dist-hook so that
7730 documentation files will be included when doing a make
7731 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
7732 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
7734 more: tried to make install do the right thing, exclude CVS dirs
7737 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
7738 Path would fit in more nicely.
7740 * all files that used to use pathstack: uses now Path instead.
7741 This change was a lot easier than expected.
7743 * src/support/path.h: new file
7745 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
7747 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
7749 * src/support/lyxstring.C (getline): Default arg was given for
7752 * Configure.cmd: removed file
7754 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7756 * src/support/DebugStream.[Ch]: remove the explicit std:: before
7757 streams classes and types, add the proper 'using' statements when
7758 MODERN_STL is defined.
7760 * src/debug.h: move the << operator definition after the inclusion
7763 * src/support/filetools.C: include "LAssert.h", which is needed
7766 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
7769 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
7770 include "debug.h" to define a proper ostream.
7772 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7774 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
7775 method to the SystemCall class which can kill a process, but it's
7776 not fully implemented yet.
7778 * src/*.C: Changed Systemcalls::Startscript() to startscript()
7780 * src/support/FileInfo.h: Better documentation
7782 * src/lyxfunc.C: Added support for buffer-export html
7784 * src/menus.C: Added Export->As HTML...
7786 * lib/bind/*.bind: Added short-cut for buffer-export html
7788 * src/lyxrc.*: Added support for new \tth_command
7790 * lib/lyxrc.example: Added stuff for new \tth_command
7792 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7794 * lib/Makefile.am (IMAGES): removed images/README
7795 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
7796 installes in correct place. Check permisions is installed
7799 * src/LaTeX.C: some no-op changes moved declaration of some
7802 * src/LaTeX.h (LATEX_H): changed include guard name
7804 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7806 * lib/reLyX/Makefile.am: install noweb2lyx.
7808 * lib/Makefile.am: install configure.
7810 * lib/reLyX/configure.in: declare a config aux dir; set package
7811 name to lyx (not sure what the best solution is); generate noweb2lyx.
7813 * lib/layouts/egs.layout: fix the bibliography layout.
7815 1999-10-08 Jürgen Vigna <jug@sad.it>
7817 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
7818 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
7819 it returned without continuing to search the path.
7821 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7823 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
7824 also fixes a bug. It is not allowed to do tricks with std::strings
7825 like: string a("hei"); &a[e]; this will not give what you
7826 think... Any reason for the complexity in this func?
7828 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
7830 * Updated README and INSTALL a bit, mostly to check that my
7831 CVS rights are correctly set up.
7833 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7835 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
7836 does not allow '\0' chars but lyxstring and std::string does.
7838 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7840 * autogen.sh (AUTOCONF): let the autogen script create the
7841 POTFILES.in file too. POTFILES.in should perhaps now not be
7842 included in the cvs module.
7844 * some more files changed to use C++ includes instead of C ones.
7846 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
7848 (Reread): added tostr to nlink. buggy output otherwise.
7849 (Reread): added a string() around szMode when assigning to Buffer,
7850 without this I got a log of garbled info strings.
7852 * acconfig.h: commented out the PTR_AS_INT macros. They should not
7855 * I have added several ostream & operator<<(ostream &, some_type)
7856 functions. This has been done to avoid casting and warnings when
7857 outputting enums to lyxerr. This as thus eliminated a lot of
7858 explicit casts and has made the code clearer. Among the enums
7859 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
7860 mathed enums, some font enum the Debug::type enum.
7862 * src/support/lyxstring.h (clear): missing method. equivalent of
7865 * all files that contained "stderr": rewrote constructs that used
7866 stderr to use lyxerr instead. (except bmtable)
7868 * src/support/DebugStream.h (level): and the passed t with
7869 Debug::ANY to avoid spurious bits set.
7871 * src/debug.h (Debug::type value): made it accept strings of the
7874 * configure.in (Check for programs): Added a check for kpsewhich,
7875 the latex generation will use this later to better the dicovery of
7878 * src/BufferView.C (create_view): we don't need to cast this to
7879 (void*) that is done automatically.
7880 (WorkAreaButtonPress): removed some dead code.
7882 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7884 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
7885 is not overwritten when translated (David Sua'rez de Lis).
7887 * lib/CREDITS: Added David Sua'rez de Lis
7889 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
7891 * src/bufferparams.C (BufferParams): default input encoding is now
7894 * acinclude.m4 (cross_compiling): comment out macro
7895 LYX_GXX_STRENGTH_REDUCE.
7897 * acconfig.h: make sure that const is not defined (to empty) when
7898 we are compiling C++. Remove commented out code using SIZEOF_xx
7901 * configure.in : move the test for const and inline as late as
7902 possible so that these C tests do not interefere with C++ ones.
7903 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
7904 has not been proven.
7906 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7908 * src/table.C (getDocBookAlign): remove bad default value for
7911 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
7913 (ShowFileMenu2): ditto.
7915 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
7918 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7920 * Most files: finished the change from the old error code to use
7921 DebugStream for all lyxerr debugging. Only minor changes remain
7922 (e.g. the setting of debug levels using strings instead of number)
7924 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7926 * src/layout.C (Add): Changed to use compare_no_case instead of
7929 * src/FontInfo.C: changed loop variable type too string::size_type.
7931 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7933 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
7934 set ETAGS_ARGS to --c++
7936 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
7938 * src/table.C (DocBookEndOfCell): commented out two unused variables
7940 * src/paragraph.C: commented out four unused variables.
7942 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
7943 insed a if clause with type string::size_type.
7945 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
7948 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
7950 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
7951 variable, also changed loop to go from 0 to lenght + 1, instead of
7952 -1 to length. This should be correct.
7954 * src/LaTeX.C (scanError): use string::size_type as loop variable
7957 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
7958 (l.896) since y_tmp and row was not used anyway.
7960 * src/insets/insetref.C (escape): use string::size_type as loop
7963 * src/insets/insetquotes.C (Width): use string::size_type as loop
7965 (Draw): use string::size_type as loop variable type.
7967 * src/insets/insetlatexaccent.C (checkContents): use
7968 string::size_type as loop variable type.
7970 * src/insets/insetlabel.C (escape): use string::size_type as loop
7973 * src/insets/insetinfo.C: added an extern for current_view.
7975 * src/insets/insetcommand.C (scanCommand): use string::size_type
7976 as loop variable type.
7978 * most files: removed the RCS tags. With them we had to recompile
7979 a lot of files after a simple cvs commit. Also we have never used
7980 them for anything meaningful.
7982 * most files: tags-query-replace NULL 0. As adviced several plases
7983 we now use "0" instead of "NULL" in our code.
7985 * src/support/filetools.C (SpaceLess): use string::size_type as
7988 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7990 * src/paragraph.C: fixed up some more string stuff.
7992 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7994 * src/support/filetools.h: make modestr a std::string.
7996 * src/filetools.C (GetEnv): made ch really const.
7998 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
7999 made code that used these use max/min from <algorithm> instead.
8001 * changed several c library include files to their equivalent c++
8002 library include files. All is not changed yet.
8004 * created a support subdir in src, put lyxstring and lstrings
8005 there + the extra files atexit, fileblock, strerror. Created
8006 Makefile.am. edited configure.in and src/Makefile.am to use this
8007 new subdir. More files moved to support.
8009 * imported som of the functions from repository lyx, filetools
8011 * ran tags-query-replace on LString -> string, corrected the bogus
8012 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8013 is still some errors in there. This is errors where too much or
8014 too litle get deleted from strings (string::erase, string::substr,
8015 string::replace), there can also be some off by one errors, or
8016 just plain wrong use of functions from lstrings. Viewing of quotes
8019 * LyX is now running fairly well with string, but there are
8020 certainly some bugs yet (see above) also string is quite different
8021 from LString among others in that it does not allow null pointers
8022 passed in and will abort if it gets any.
8024 * Added the revtex4 files I forgot when setting up the repository.
8026 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8028 * All over: Tried to clean everything up so that only the files
8029 that we really need are included in the cvs repository.
8030 * Switched to use automake.
8031 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8032 * Install has not been checked.
8034 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8036 * po/pt.po: Three errors:
8037 l.533 and l.538 format specification error
8038 l. 402 duplicate entry, I just deleted it.