1 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix
4 class switching; do not do anything if class has not been changed.
6 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
8 * lib/build-listerrors: Exit if literate-article doesn't appear in
11 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13 * src/combox.h (getline): small fix for sun CC 6.0
14 * src/combox.C (input_cb): ditto.
15 * src/spellchecker.C (sigchldhandler): ditto.
17 * src/lyx_main.C (init): do not query for creation of user
18 directory when running without a GUI.
20 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
22 * src/mathed/formula.C (LocalDispatch): Toggle font properties.
24 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
26 * BufferView2.C (open_new_inset): Added 2nd argument.
27 (getParentText, getParentLanguage): New methods.
29 * src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and
30 LFUN_INSET_TABULAR for RTL text.
32 * src/tabular.C (Latex): Put \R{} around RTL cells.
34 * src/text2.C (InsertInset): Change cursor position for highly
37 * src/frontends/xforms/FormTabularCreate.C (apply): Create the
38 tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...)
40 * src/insets/insettabular.C (LocalDispatch): When dispatching
41 LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
42 locked, then the insettext of the new cell will be locked.
43 (moveLeft, moveRight): Fixed for RTL tabulars.
44 (moveNextCell, movePrevCell): Ditto.
45 (isRightToLeft): New method.
47 * src/insets/insettext.C (LocalDispatch): Fixed handling of
48 non-dispatched function in the locking inset.
49 (Edit): If the inset is empty set the language of the current font
50 to the language to the surronding text (this code was moved from
51 LocalDispatch to allow the user to change the languaeg before
53 (moveRight, moveLeft): Fixed for RTL text.
54 (checkAndActivateInset): Fixed.
56 * src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
58 2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
60 * src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate
64 * src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL
65 around some ispell code.
67 * src/lyxcursor.[Ch]: add proper constructor, to avoid tons of
68 Unitialized Memory Read in purify.
70 * lib/examples/nl_splash.lyx: update from Tino Meinen.
72 2001-01-04 Dekel Tsur <dekelts@tau.ac.il>
74 * src/frontends/xforms/FormDocument.C (FormDocument::build):
75 Disable class_->choice_doc_class and language_->choice_language to
76 allow using the class/language combox with keyboard.
78 2001-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
80 * src/support/snprintf.c (va_copy): only define va_copy if undefined
82 2001-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
84 * src/lyxvc.C (showLog): give the tempfile a mask
86 * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
89 * src/support/filetools.C (IsDirWriteable): give the tempfile a
90 mask and unlink the tempfile after use.
92 2001-01-04 Juergen Vigna <jug@sad.it>
94 * src/insets/insettabular.C (resetPos): an extra scroll, but we
95 really should redo all this scrolling code!
96 (TabularFeatures): unlock the_locking_inset before add/del rows/colums.
98 * src/text.C (GetVisibleRow): check that y/h values are good otherwise
101 * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
102 (pasteSelection): pay attention to multicolumn cells.
103 (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
105 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
107 * src/mathed/math_panel.C (deco_cb): check the decoration index is
110 * src/frontends/xforms/FormPreferences.C (feedback): apply
111 formatting to the translated string, not to the original one.
112 (printWarning): ditto.
114 * src/gettext.C (_): translate empty string with empty string.
116 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
121 * UPGRADING: mention that tabular format has been changed.
123 2001-01-03 Juergen Vigna <jug@sad.it>
125 * src/insets/insettabular.C (InsetButtonPress): look for button==2
126 and do Clipboard Paste!
128 * src/insets/insettext.C (SetText): added function.
130 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
131 new LFUN_PASTESELECTION.
133 * src/insets/insettext.C (draw): don't clear if top_x changes.
135 * src/insets/insettabular.C (draw): clear only if the inset didn't
136 change in the draw routine.
138 * src/insets/insettext.C (width): make the width dependant on the
141 * src/text.C (draw): comment out the UpdateInset call.
143 * src/screen.C (DrawOneRow):
144 (DrawFromTo): check for bv->text->status not text->status.
146 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
147 dimensions of ascent-descent for the whole row.
149 * src/insets/insettext.C (draw): check also for need_update == INIT.
151 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
153 * Makefile.am (EXTRA_DIST): add autogen.sh
155 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
157 * development/OS2/quick_fix.patch:
158 * lib/configure.cmd: update OS/2 support files.
160 2001-01-02 Juergen Vigna <jug@sad.it>
162 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
164 * src/tabular.C (TeXTopHLine):
165 (TeXBottomHLine): fixed Lars new code.
167 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
169 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
170 from this function and added a BufferView * parameter.
172 * src/mathed/math_symbols.C (math_insert_symbol): ditto
174 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
176 * src/version.h: set to pre3
178 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
180 * src/Makefile.am (lyx_SOURCES): added Floating.C
182 * src/Floating.h: moved all the inlines to Floating.C
184 * src/Floating.C: new file
186 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
188 * src/frontends/xforms/FormPreferences.C (feedback): fix
189 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
191 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
193 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
196 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
198 * src/mathed/math_inset.h: move LString.h to be included first
200 * src/insets/insetfloat.C: adjust for change in private variable names
202 * src/frontends/xforms/xform_helpers.h : don't include config.h
204 * src/frontends/xforms/xform_helpers.C: adjust the order of
205 includes, some whitespace changes.
207 * src/trans.C (Load): constify filename and res
209 * src/text2.C (SetCounter): call Floating::name()
211 * src/screen.C: change to not use owner from WorkArea, but from
214 * src/lyxfunc.C: adjust because of changes in Intl.
216 * src/intl.h: make trans a object instead of pointer, inlucd
217 trans_mgr.h in this file.
218 (getTrans): return a reference to TransManager
220 * src/intl.C: don't include trans_mgr.h here
221 modify calls to trans to work on object instead of on pointer
223 * src/WorkArea.h: add using for Signal1
224 comment out forward decl of BufferView.
226 remove class variable owner_ and getter method for this.
228 * src/WorkArea.C: don't include BufferView.h
229 (WorkArea): change to not take a BufferView.h, use signals
231 (scroll_cb): emit signal
233 * src/LaTeXFeatures.C: include Floatlist.h
234 (getPackages): only load float.sty when needed
235 (getMacros): prepare for outputting the correct code to preamble.
237 * src/Floating.h: make all variables private + rename to var_.
238 (Floating): default ctor
239 (Floating): complex ctor to set a complete Floating
245 * src/FloatList.C (FloatList): use Floating's constructor
248 (newFloat): call type()
249 (defaultPlacement): call placement()
250 (operator): new operator
252 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
253 (scrollUp): call pimpl's scrollCB
255 (pasteClipboard): constify clip
257 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
258 (insertErrors): constify desctext, errortext, msgtxt and errorrow
259 (open_new_inset): delete some commented code.
261 * src/BufferView.[Ch] (enterView): comment out
264 (workAreaMotionNotify): ditto
265 (workAreaButtonPress): ditto
268 (workAreaButtonRelease): ditto
269 (workAreaExpose): ditto
271 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
272 to compile with cvs gcc (2.97).
274 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
276 * lib/ui/default.ui: menu structure cleanup.
278 * lib/languages: add description of entries.
280 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
282 * src/insets/ExternalTemplate.C (readTemplates): change debug
284 (readTemplate): use lyxlex.printError to report read errors.
287 * src/insets/insetexternal.C (Read): suppress debug message when
290 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
292 * src/insets/insetinclude.C (Ascii): New method. Currently
293 supports only verbatim input.
295 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
297 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
299 2000-12-22 Juergen Vigna <jug@sad.it>
301 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
302 have a selection and button == 3.
303 (UpdateLocal): if what == INIT clear selection if existent!
304 (InsetButtonPress): don't activate the cell inset on button==3
306 (LocalDispatch): move curor up/down if exiting an inset which this
309 2000-12-20 Juergen Vigna <jug@sad.it>
311 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
312 calling for the math-panel (do not unlock the math-inset if locked)!
314 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
315 text-insets (with x-offset).
317 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
318 alignment of multicolumn-cells.
320 2000-12-19 Juergen Vigna <jug@sad.it>
322 * src/lyxfunc.C (Dispatch):
323 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
326 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
328 * src/WorkArea.C (work_area_handler): simplify the key/keysym
329 handling for XForms 0.89, this might have rendered some cases
330 unusable. I have at least deadkeys, accent-xxx and KP_x working.
331 Please report proplems.
333 * src/lyxfunc.C (processKeySym): make the self-insert handling
336 2000-12-18 Baruch Even <baruch.even@writeme.com>
338 * src/LaTeX.C (deplog): fix spelling errors
339 * src/text2.C (CutSelection): ditto
340 * src/lyxfunc.C (Dispatch): ditto
342 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
344 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
346 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
347 and h_align in default init.
348 adjust calls to MathedRowSt
350 * src/mathed/math_iter.C: adjust calls to MathedRowSt
351 * src/mathed/math_iter.h (getAD): ditto
353 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
354 methods setBaseline, ascent, descent
355 (class MathMatrixInset): remove method GetAlign, change h_align
358 * src/lyxfunc.C (processKeySym): discover the correct argument if
359 the action is LFUN_SELFINSERT
361 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
363 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
366 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
368 * src/support/copy.C: don't include filetools.h
370 * lib/images: revert to old banner, drop the cucumber.
372 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
374 * src/converter.C (Formats::View): Change the current directory to
375 the directory of the file.
377 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
379 * src/kbsequence.C (addkey): also clear sequence and modifiers if
382 * src/BufferView2.C (theLockingInset): return 0 if text is 0
384 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
386 * Many files: Fix RTL support for insettext.
388 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
390 * README: add mention of broken ghostscript versions, remove
391 reference to non-existent BUGS file
393 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
395 * src/support/lstrings.C (compare_no_case): small fix. When passed
396 length, should use it in the size comparison.
398 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
400 * src/insets/insetexternal.C (getScreenLabel): Return a default
401 value if the template label is empty.
403 * src/lyxlookup.C: do not condition on FL_REVISION.
406 * src/sp_form.C: fix the font size of some text entries
408 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
409 after TOC when there is no TOC.
411 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
412 bind file if it has not been done yet.
413 (read): remove local bindFile variable. Try to fix the handling of
414 RC_BIND and RC_BINDFILE.
416 * src/lyx_main.C (init): use readBindFileIfNeeded().
418 * lib/languages: Change description of german to "German (new
421 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
423 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
424 "Apply" buttons if arg is non-zero.
426 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
427 launching the popup if sufficient info is passed to
428 LFUN_CITATION_CREATE.
430 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
432 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
433 labels (disabled in 1.1.6).
435 * src/lyxrc.[Ch]: New variable label_init_length
437 * mathed/formula.C (LocalDispatch): Preserve the label when
438 changing from display math to eqnarray (however, the label
439 do not appear at the first line, as one might expects, but at the
441 (LocalDispatch): When inserting a label to a formula which already
442 have a label, the old label is used as default value.
443 Also, if the label is changed, then all references to the label
446 * src/mathed/math_iter.C (setLabel): Allow to set the label
447 even if it is empty. This is needed to allow deletion of a label
450 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
451 refernces only if the old label appears once in the document.
453 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
455 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
456 <gehlert@Rcs1.urz.tu-dresden.de>
458 * src/frontends/xforms/FormBase.C: comment out debug.h
460 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
461 code in xform_helpers instead.
462 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
464 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
465 Use N_(), rather than _() when creating strings to pass to browseFile()
466 because browseFile calls gettext() itself now.
468 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
469 display the filename correctly.
471 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
473 * src/converter.C (Move): New method. Used to move file or files
474 from temp dir to the output dir. (this fixes the bug that
475 exporting linuxdoc/docbook document to html would not move all
476 html file from temp directory).
478 * src/support/filetools.C (DirList): Fixed.
480 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
482 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
484 * src/converter.C (Add): Remove $$i when setting latex_command.
486 * src/text.C (IsBoundary): Return false when pos = 0.
488 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
490 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
492 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
494 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
495 need to empty the fields to turn off use of the geometry package!
497 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
499 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
500 (Buffer const &), not a (BufferParams const &) and so fix a crash
501 caused by using current_view before it had been initialised. Not
502 the best way to do this, but much easier than changing
503 Inset::Clone(Buffer const &) to Inset::Clone().
506 * src/tabular.C: changed call to CopyIntoMinibuffer().
508 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
510 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
512 * src/lyxfunc.C (getStatus): disable insertion of floats in a
515 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
517 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
518 changed filter for screen fonts input filter from int to float
520 * src/frontends/xforms/input_validators.c: removed.
521 * src/frontends/xforms/input_validators.C: new file. Can now call C++
522 functions from within the filter functions.
524 * src/frontends/xforms/input_validators.[Ch]
525 (fl_unsigned_float_filter): new filter function.
527 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
528 confused now! And if you think I'm going to do this in
529 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
531 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
533 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
535 * src/WorkArea.C (work_area_handler): don't handle button requests
536 if xbutton.button == 0
538 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
540 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
541 It creates a lot of interesting problems.
543 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
545 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
546 the menu exists in the current menubar before opening it.
548 * src/MenuBackend.C (hasSubmenu): new method.
550 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
551 action value by offsetting actions by a large constant (so that
552 bogs choice result will be less than this constant).
554 * lib/bind/fi_menus.bind: more cleanup to menus.
555 * lib/bind/sciword.bind: ditto.
556 * lib/bind/xemacs.bind: ditto.
557 * lib/bind/emacs.bind: ditto.
558 * lib/bind/pt_menus.bind: ditto.
559 * lib/bind/hu_menus.bind: ditto.
561 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
563 * INSTALL: update PROBLEMS section.
565 * src/lyxlookup.h: remove condition on xforms version, since we
566 should not include it if not appropriate.
568 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
570 * src/LColor.C: "latex text" -> "latex inset" (from
573 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
575 * src/frontends/kde/FormTabularCreate.C:
576 * src/frontends/kde/citationdlg.C:
577 * src/frontends/kde/copyrightdlg.C:
578 * src/frontends/kde/paradlg.C:
579 * src/frontends/kde/paraextradlg.C:
580 * src/frontends/kde/parageneraldlg.C:
581 * src/frontends/kde/printdlg.C:
582 * src/frontends/kde/refdlg.C:
583 * src/frontends/kde/tabcreatedlg.C:
584 * src/frontends/kde/tocdlg.C:
585 * src/frontends/kde/urldlg.C: add necessary headers
588 * src/frontends/kde/dlg/emptytable.C:
589 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
590 default parameters (from Angus Leeming)
592 * src/frontends/kde/dlg/moc/.cvsignore:
593 * src/frontends/kde/dlg/.cvsignore:
594 * src/frontends/kde/moc/.cvsignore: fix the library name
597 * src/frontends/kde/paradlg.C:
598 * src/frontends/kde/parageneraldlg.C:
599 * src/frontends/kde/dlg/para.dlg:
600 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
602 * src/frontends/kde/dlg/README: clarified qtarch version
604 * src/frontends/kde/dlg/Makefile.am: removed the
605 dlg rules as they created spontaneous rebuilds
606 (not a good idea as it requires qtarch)
608 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
610 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
611 fixlevel along with xforms version.
613 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
614 xforms version is strictly less than 0.89.5.
615 * src/lyx_gui.C (LyXGUI): ditto.
616 * src/LyXView.C (show): ditto.
618 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
620 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
621 movement in inset in RTL text.
622 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
623 (workAreaButtonRelease): Do not open a float when there is a selection.
625 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
627 * src/spellchecker.C (RunSpellChecker): Open all floats before
630 * src/text.C (InsertChar): Consider "," as a part of a number
631 (for LTR numbers in RTL text code).
632 (IsBoundary): Fixed (and simplified).
633 (InsertChar): Recalculate cursor boundary.
636 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
638 * src/spellchecker.C: fix figures with pspell enabled
640 * src/insets/figinset.C: workaround for gs hang xforms bug
642 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
644 * lib/bind/??_menus.bind: comment out the entries corresponding to
645 real menus. They should be eventually removed, but I'll let the
646 language maintainers do that.
648 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
650 * src/frontends/kde/parageneraldlg.C:
651 * src/frontends/kde/parageneraldlg.h: don't use
652 a derived class for SpaceAbove/Below
654 * src/frontends/kde/dlg/README: add some info
656 * src/frontends/kde/dlg/*: update data files, update
659 * src/frontends/kde/dlg/moc/Makefile.am: add
662 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
664 * configure.in: add new KDE Makefiles
665 * src/vspace.h: return GlueLength not a normal one
666 * src/support/lstrings.h:
667 * src/support/lstrings.C: add isStrUnsignedInt(),
670 * src/frontends/kde/*: big reorganisation, update
671 FormParagraph, add FormTabCreate
673 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
675 * lib/ui/default.ui: small grammatical change.
677 * src/frontends/xforms/xform_macros.h: removed.
679 * src/frontends/xforms/FormBase.C:
680 * src/frontends/xforms/FormPreferences.C:
681 * src/frontends/xforms/Makefile.am: changes associated with removing
682 xform_macros.h. Should make Lars' debugging a little easier.
684 * src/frontends/xforms/FormPreferences.C:
685 * src/frontends/xforms/FormPreferences.h:
686 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
687 longer use X11 color name database. HSV and RGB dials/sliders.
688 Please let this be the end of this!
690 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
692 * Several files: Allow compilation when the compiler doesn't
695 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
698 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
699 command line options.
701 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
703 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
704 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
707 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
709 * src/frontends/xforms/FormRef.C (updateBrowser):
710 * src/frontends/xforms/forms/form_ref.fd: try clicking on
711 different insets with the sort key active. Now apply this patch!
713 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
715 * src/frontends/xforms/FormPrint.C: set to valid()
716 when we update from the passed parameters.
718 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
720 * src/LColor.C (getFromGUIName): internationalise the comparison.
722 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
723 FormPreferences choice.
725 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
728 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
730 * src/lyxrc.C: more detail for the printer program config
733 * src/LColor.C: ert->latex text. LColor needs a big revamp
734 but will have to wait till after 1.1.6
736 * src/buffer.C: bring up a dialog if we load a document
737 with an un-installed text class, rather than just complain
740 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
742 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
743 the browser form for a combox in a tabbed folder. Bug fix courtesy of
744 Steve Lamont <spl@ncmir.ucsd.edu>.
746 * src/frontends/xforms/FormDocument.C (build):
747 * src/frontends/xforms/FormPreferences.C (Language::build):
748 pass tabfolders to Combox::add() in order to use this work around.
750 * src/frontends/xforms/FormCitation.C (connect): remove max size
752 (update): sort list of bibliography keys.
754 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
756 No max size limitation. Same popup for new and existing insets. Fixes
757 bugs reported by Rob Lahaye.
759 * src/frontends/xforms/FormCitation.C (c-tor):
760 * src/frontends/xforms/FormCopyright.C (c-tor):
761 * src/frontends/xforms/FormError.C (c-tor):
762 * src/frontends/xforms/FormGraphics.C (c-tor):
763 * src/frontends/xforms/FormIndex.C (c-tor):
764 * src/frontends/xforms/FormRef.C (c-tor):
765 * src/frontends/xforms/FormToc.C (c-tor):
766 * src/frontends/xforms/FormUrl.C (c-tor):
767 use correct policy for ButtonController.
769 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
771 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
774 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
776 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
777 Some resizing changes.
779 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
781 * configure.in: fix typo
783 * lib/languages: add ukraninian and change no to no_NO
785 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
787 * src/bufferview_funcs.C (FontSize): use setLyXSize
789 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
791 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
792 to check for systems where mkstemp() is available but not declared
793 in headers. The new autoconf macro lyx_CHECK_DECL can be used
794 to check for declarations in headers.
796 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
798 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
800 * forms/makefile: added bibforms.fd, include_form.fd.
801 Removed lyx_sendfax.fd.
803 * src/LaTeXLog.C (ShowLatexLog):
804 * src/LyXAction.C (init):
805 * src/bufferparams.C (readLanguage): altered messages as suggested by
808 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
811 * src/credits.C: made fd_form_credits non-static, so that it can be
812 redrawn should the xforms colors be re-mapped.
813 * src/spellchecker.C ditto fd_form_spell_options.
815 * src/filedlg.[Ch] (redraw):
816 * src/intl.[Ch] (redraw):
817 * src/lyxfr0.[Ch] (redraw):
818 * src/insets/figinset.[Ch] (redraw):
819 * src/insets/insetexternal.[Ch] (redraw):
820 new methods, connected to Dialogs::redrawGUI.
822 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
823 to be connected to Dialogs::redrawGUI.
825 * src/frontends/xforms/FormCitation.C (build):
826 * src/frontends/xforms/FormCopyright.C (build):
827 * src/frontends/xforms/FormError.C (build):
828 * src/frontends/xforms/FormGraphics.C (build):
829 * src/frontends/xforms/FormIndex.C (build):
830 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
831 * src/frontends/xforms/FormToc.C (build):
832 * src/frontends/xforms/FormUrl.C (build):
833 use the ButtonController correctly.
835 * src/frontends/xforms/FormCopyright.C (build):
836 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
837 the .fd file and into build().
839 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
841 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
843 * src/frontends/xforms/forms/form_citation.fd:
844 * src/frontends/xforms/forms/form_copyright.fd:
845 * src/frontends/xforms/forms/form_error.fd:
846 * src/frontends/xforms/forms/form_graphics.fd:
847 * src/frontends/xforms/forms/form_index.fd:
848 * src/frontends/xforms/forms/form_toc.fd:
849 * src/frontends/xforms/forms/form_url.fd:
850 renamed some of the objects. Named others explicitly for the first time.
851 Added Restore and Apply buttons where appropriate.
853 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
856 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
858 * src/version.h: try the pre2 again
860 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
862 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
864 * src/frontends/kde/FormParagraph.C: added using directive.
866 * src/frontends/kde/paradlg.C: added config.h and using directive.
868 * src/frontends/kde/paradlg.h: added std::qualifier.
870 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
872 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
874 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
876 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
878 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
880 * src/version.h: set back to 1.1.6cvs
882 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
884 * src/version.h: set to 1.1.6pre2
886 2000-11-20 Marko Vendelin <markov@ioc.ee>
888 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
890 * src/frontends/gnome/Makefile.am: updated list of XForms object files
892 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
894 * src/LColor.C (init):
895 * src/lyxrc.C (getDescription): changed some comments as suggested by
898 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
899 disconnect the redrawGUI signal in best-practice fashion.
901 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
902 long_opts_tab to reflect the change in name of this tabfolder, as
903 suggested by John Levon.
904 (connect, disconnect): new methods. Don't do much at present other than
905 ensuring that we can't resize the dialog. This just makes xforms go
907 (lots of methods in Colors): made void rather than bool. The idea is
908 to have an isOk() function that keeps track of whether any input is
909 genuinely invalid and should therefore block Save, Apply.
910 Easier to manipulate the counters rapidly.
911 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
912 compiler will like this code. Much cleaner way of doing things.
914 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
916 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
917 rather than simple counters, following suggestion by John Levon.
919 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
920 than engraved frame + text.
922 * src/frontends/xforms/forms/makefile: removed spurious command.
924 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
926 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
928 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
931 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
933 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
934 see what Lars has changed and what is just white space!
935 Now used X directly to ascertain the RGB color associated with the
937 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
939 Added some sort capability.
940 The X11 color name database input is only displayed if the database
941 isn't found in the standard place.
942 Got rid of struct compare_converter; it wasn't used.
943 Probably some other stuff that I've forgotten.
945 * src/frontends/xforms/FormPreferences.h: changed the names of some
946 methods in the Colors struct. Added a couple of structs to help sort
947 colors by name and by RGBColor.
949 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
950 functions into a new class RWInfo.
952 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
953 The dialog is now almost navigable using the keyboard. Unfortunately,
954 the cursor has to be inside a browser for it to be activated. There is
955 no visual feedback for the key shortcuts to the arrow keys (use
956 Alt-appropriate arrow key, Alt-x).
958 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
961 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
962 xform_helpers.[Ch]. See above.
964 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
966 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
968 * src/screen.C (setCursorColor): new method. Sets the color of the
970 (ShowManualCursor): call it.
971 Constify some local variables.
973 * src/LColor.[Ch] (LColor): add entry for cursor
974 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
977 2000-11-19 Juergen Vigna <jug@sad.it>
979 * src/insets/insettabular.C (draw): fixed text border redraw problem.
980 (calculate_dimensions_of_cells): try to boost up when inserting chars.
982 2000-11-15 Rob Lahaye <lahaye@postech.edu>
984 * lib/ui/default.ui: OptItem used for Fax entry
986 2000-11-17 Matej Cepl <cepl@bigfoot.com>
988 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
990 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
992 * src/vspace.C (nextToken): fix so it can handle length phrases like
993 "10mm+-20mm", "40inplus16mmminus10cm" etc.
995 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
997 * src/frontends/xforms/FormPreferences.C: constify several variables
998 (BrowserLyX): rewrite to not need the choice variable
999 (Modify): rewrite to not need the choide variable
1000 (compare_converter): make operator const
1002 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
1003 correct the writing of \set_color
1004 (getDescription): return a const string
1006 * src/kbsequence.[Ch] (addkey): remove dead code
1008 * src/Painter.C (text): remove some commented code
1010 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1012 * src/ColorHandler.[Ch]: removed some header files from .h file.
1013 Included LColor.h in .C file.
1015 * src/LColor.[Ch]: made class copyable so that I could create a
1016 system_lcolor instance.
1018 * src/Painter.h: removed LColor.h.
1020 * src/lyx_gui.C (create_forms): used AddName.
1022 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
1023 of user preferences/lyxrc file.
1025 * src/lyxrc.C (output): output changes to lcolor.
1027 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
1029 Moved class xformColor to files xform_helpers.[Ch]. These files,
1030 Color.[Ch], could now be moved into src if they would be useful to
1033 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
1034 Also moved FormPreferences::browseFile here as it can be used by any
1035 xform dialog with a "Browse" button. FormGraphics is a perfect example.
1037 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
1038 ReadableFile): changed the FormPreferences methods a little and moved
1039 them here as they'll be useful elsewhere also.
1041 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
1042 Removed some header files and used forward declarations instead.
1044 Removed some methods as they'll be useful elsewhere (see above).
1046 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
1047 Can also now modify the LyX LColors. However, for reasons that I don't
1048 yet understand, it appears that we can use
1049 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
1050 present. The problem appears to lie in ColorHandler, because I can
1051 change the color using LColor.SetColor(). Similarly, when reading in a
1052 preferences file with some set_color instances, I'll get a warning
1053 like: Color sea green is undefined or may not be redefined
1054 Bad lyxrc set_color for sea green
1056 Once the buffer is loaded, however, I can happily change to this color.
1058 Finally, it appears that I have to set the color of "inset frame"
1059 explicitly, or it oscillates from "black" to "indian red" with each
1062 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1064 * ANNOUNCE: corrected a spelling mistake.
1066 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
1069 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1071 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
1073 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
1076 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
1077 match the requirements from the standard better. This is required
1078 to work with gnu libstdc++-v3
1080 * src/frontends/xforms/FormPreferences.C: add explict pair
1081 arguments to browse calls. include support/lyxmanip.h remvoe
1082 extern fmt. whitespace changes. reorder variables in
1083 FormPreferences.h, to match initalizaton order.
1085 * several files: constify more local variables.
1087 * src/buffer.C: remove some commented functions.
1089 * src/DepTable.C (remove_files_with_extension): temporary
1090 work around for gcc 2.97
1091 * src/filedlg.C (find): ditto
1092 * src/Variables.C (set): ditto
1093 * src/LyXAction.C (searchActionArg): ditto
1094 (retrieveActionArg): ditto
1096 * configure.in: check for mktemp too
1098 * UPGRADING: prepare for 1.1.6
1100 * Makefile.am (lgbtags): add backup tags for when etags are
1101 different than usual.
1103 * ANNOUNCE: prepare for 1.1.6
1105 * src/support/tempname.C (make_tempfile): new function, wrapper
1106 around mkstemp and mktemp. Only mkstemp has been tested.
1107 (tempName): call it.
1109 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1111 * default.ui: capitalized some menu items to improve shortcuts.
1113 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1115 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1117 * src/frontends/xforms/Dialogs.C: add "using" directive.
1119 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1121 * src/filedlg.C (Select): highlight suggested file in browser, if
1124 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1125 each tab folder is encapsulated in its own class.
1126 The Language keymaps are now chosen using a text input and a
1127 browser button, rather than a Combox.
1128 All the browser buttons are now functional, although LyXFileDlg
1129 still needs to be modified to make it straighhtforward to return a
1130 directory if that is what is desired.
1132 * src/frontends/xforms/forms/form_preferences.fd: use text input
1133 and browse button to input the Language keymaps. Add a few
1134 callbacks for the browse buttons.
1136 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1138 * src/support/tempname.C (tempName): small changes to make it
1139 safer. remove the '.' before XXXXXX
1141 * src/support/filetools.C (TmpFileName): remove func
1144 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1145 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1146 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1147 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1149 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1150 (FormCommand): ditto
1152 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1155 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1156 for bp (this fixes a reproducible hard crash)
1158 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1161 * src/frontends/xforms/FormBase.h: make bp_ private
1162 (FormBaseBI): remove default for bp
1165 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1168 * src/frontends/xforms/Color.C (RGBColor): made several vars
1169 const, changed initialization of j to allow it to be const
1172 * several files: added const to local variables.
1174 * src/lyx_cb.C: removed several function prototypes and moved them
1178 (UpdateLayoutPreamble):
1180 (MenuInsertLabel): add BufferView as arguemnt
1181 (LayoutsCB): make tmp const
1183 * src/layout_forms.h: regenerated
1185 * src/debug.C: add Debug::FILES
1186 (showLevel) (showTags): translate the desc
1188 * src/debug.h: add FILES as debug target
1190 * src/bufferlist.C: use current_view as an interim measure becuase
1191 of added arguments to MenuWrite and MenuWriteAs
1193 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1195 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1197 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1198 libstdc++ is compiled with.
1200 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1202 * lib/layouts/docbook-book.layout
1203 * lib/layouts/docbook.layout
1204 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1205 those paragraphs are expresse as SGML comments <!-- -->.
1207 * src/LaTeXFeatures.h
1208 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1209 parameter, this allows to express all the include files as relative
1210 paths to the master buffer. The verbatim insert works as the other
1213 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1215 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1217 (MakeDocBookFile): top_element is always written. Some clean up, as
1218 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1220 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1221 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1222 a reference is written instead of the name.
1223 (Validate): use the relative path for the filename.
1225 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1228 * src/support/filetools.h
1229 * src/support/filetools.C (IsSGMLFilename): added.
1232 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1234 * development/OS2/quick_fix.patch:
1235 * lib/configure.cmd:
1236 * README.OS2: quick update to the OS/2 port.
1238 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1240 * src/converter.C: add "using" directive.
1242 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1243 (compare_converter): add "int" as return type.
1245 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1248 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1250 * src/lyx_gui.C (create_forms): map the xform colours, should a
1251 mapping exist. Ie, call XformColor::read().
1253 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1254 and struct HSV as HSVColor.
1255 (XformColor::read, XformColor::write) : new methods that
1256 input/output any changes to the cform GUI colors.
1258 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1261 * src/frontends/xforms/FormPreferences.C Lots of little changes
1262 associated with the changed name of the RGB and HSV structs. Can
1263 now save changes to xforms GUI to file. Commented out
1264 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1265 used currently anyway.
1267 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1269 * src/converter.C: A lot of changes:
1270 - It is no longer possible to choose between two or more ways to
1271 export to some format (the new code uses only the shortest path).
1272 However, it is still possible to choose between pdflatex/ps2pdf
1273 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1274 - Added several methods that makes the FormPreferences code simpler.
1275 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1277 * src/exporter.C (Export): lyxrc.use_pdf is set before
1278 makeLaTeXFile is called. This works but not very nice.
1280 * src/frontends/xforms/FormPreferences.C: The formats/converters
1281 tabs are now fully functional.
1283 * src/buffer.C (getTocList): Add numbers to the captions.
1285 * lib/lyxrc.example: Removed fax section
1287 * src/support/rename.C (rename): Delete the old file if lyx::copy
1290 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1292 * lib/ui/default.ui: minor polishing.
1294 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1296 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1299 * lib/Makefile.am (DOCINST): do not install everything in the
1300 documentation directory.
1302 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1304 * src/bufferlist.C (newFile): set the filename to the constructed
1307 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1308 constructed "newfileXX.lyx" name to the dialog
1310 * src/frontends/DialogBase.h: make update() non-abstract so
1311 KDE doesn't need to implement two update methods for every form
1313 * src/frontends/kde/Makefile.am: add missing xforms objects
1316 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1318 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1320 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1321 structs RGB and HSV. May not be the best place for these files.
1322 Perhaps move them into src ?
1324 * src/frontends/xforms/Makefile.am: added new files.
1326 * src/frontends/xforms/forms/form_preferences.fd:
1327 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1328 replaced all instances of "colour" with "color"!
1330 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1333 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1334 tab. Can now alter the colors of the xform's GUI on the fly. With
1335 the aid of a single static Signal (see below), can "Apply" these
1336 changes to all currently open dialogs. (Well, to all of the NEW
1337 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1338 subsequently opened dialogs will, of course, also have the new
1339 color scheme. Cannot yet save (or load) the choices to file, so
1340 they are lost when exiting LyX.
1342 * src/frontends/Dialogs.h:
1343 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1344 Used to trigger a redraw of any dialogs connected to it because,
1345 for example, the GUI colours have been re-mapped.
1347 * src/frontends/xforms/FormBase.[Ch]:
1348 * src/frontends/xforms/FormDocument.[Ch]:
1349 * src/frontends/xforms/FormParagraph.[Ch]:
1350 * src/frontends/xforms/FormPreferences.[Ch]:
1351 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1352 method, to be connected to Dialogs::redrawGUI. Method must be
1353 virtual, because dialogs with tabbed folders need to redraw the
1354 forms of each tab folder.
1356 * src/LyXView.C (d-tor):
1357 * src/frontends/xforms/FormBase.C (d-tor): connected
1358 Dialogs::redrawGUI signal to redraw().
1360 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1361 removed Assert, because it is identical to that in FormBase.
1363 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1365 * lib/ui/default.ui: minor polishing.
1367 2000-11-10 Juergen Vigna <jug@sad.it>
1369 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1370 (deleteLyXText): ditto
1372 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1373 selection on mouse-button-3.
1375 * src/insets/insettabular.h: new function clearSelection(), use this
1376 functions inside insettabular.C.
1378 * src/insets/insettabular.C (TabularFeatures): clear the selection
1379 on remove_row/column.
1381 * src/insets/inset.C (scroll): fixed some scroll stuff.
1383 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1385 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1387 * lib/CREDITS: add Yves Bastide
1389 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1391 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1392 check whether C library functions are in the global namespace.
1394 * configure.in: calls it.
1396 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1397 #ifndef __GLIBCPP__.
1399 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1401 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1402 iterators to prevent crash.
1404 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1406 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1408 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1409 shortcut for xforms CB to the preemptive or post-handler function.
1411 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1412 removed the HIDDEN_TIMER as it's no longer used.
1413 Various other small changes.
1415 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1416 preemptive handler to obtain feedback, rather than the post-handler.
1417 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1419 Formats tab is now complete. Converters tab is nearly so.
1421 2000-11-09 Juergen Vigna <jug@sad.it>
1423 * src/insets/insettext.C (~InsetText):
1426 (SetParagraphData): set cache.second to 0 after deleting it!
1427 (getLyXText): check if cache.second is not 0 if finding it.
1429 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1431 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1432 lyxlex to parse the rgb.txt file.
1435 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1436 replace the default '#' comment character.
1438 * src/support/tempname.C: add "using" directive
1439 * src/frontends/ButtonPolicies.C: ditto.
1441 * src/support/filetools.C (DirList): add an explicit cast to avoid
1442 a compile error (probably not the right fix)
1444 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1446 * src/support/filetools.C (DirList): implement using system functions
1448 * src/support/tempname.C: new file
1450 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1452 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1454 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1457 * src/frontends/xforms/ButtonController.C: new file
1459 * src/os2_defines.h: remove getcwd define
1461 * src/lyxvc.C: include support/lyxlib.h
1462 (showLog): use lyx::tempName
1464 * src/lyx_cb.C: comment out includes that we don't need
1465 (AutoSave): use lyx::tempName
1467 * src/filedlg.C: include support/lyxlib.h
1468 (Reread): use lyx::getcwd
1470 * src/converter.C: include support/filetools.h
1471 (add_options): change to static inline, make tail const
1472 (Add): make old_viewer const
1473 (GetAllFormats): make it a const method, use const_iterator
1474 (enable): make static inline
1475 (SplitFormat): make using_format const
1477 * src/LaTeX.C (run): use lyx::getcwd
1479 * configure.in: check for mkstemp as well
1481 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1483 * src/converter.[Ch] (GetAllCommands): new method.
1485 * src/support/filetools.[Ch] (DirList): new method.
1487 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1488 functionality to the converters tab.
1489 The formats tab is now nearly complete.
1490 The kbmap choices in Languages tab now display the contents of
1491 system_lyxdir/kbd/*.kmap in readable form.
1493 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1494 Moved some variables into the class.
1496 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1497 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1498 colour of active folder to lighter grey instead. Any takers?
1499 (form_colours): added an "Apply" button.
1500 (form_converters): added a "Flags" input field.
1501 (form_formats): added a "Shortcut" input field. Note that we can't use
1502 names such as "input_shortcut" as this buggers up the sed script stuff.
1504 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1512 * src/lyx_sendfax_main.C:
1515 * src/spellchecker.C:
1516 * src/insets/figinset.C:
1517 * src/insets/insetbib.C:
1518 * src/insets/insetexternal.C:
1519 * src/insets/insetinclude.C:
1520 * src/insets/insetinfo.C:
1521 * src/mathed/math_panel.C:
1522 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1523 all "daughter" dialogs now have identical "feel".
1525 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1527 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1528 used (and was only used in one place prior to this patch. Incorrectly!)
1530 * src/frontends/xforms/FormDocument.C: changed some instances of
1531 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1532 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1533 for options_->input_float_placement. This fixes a bug reported by
1536 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1537 functionality into d-tor.
1539 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1540 input of numerals also.
1542 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1543 fl_set_form_atclose(). Can now close dialog from window manager,
1544 fixing a bug reported by Rob Lahaye.
1546 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1548 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1549 are no longer dark. Haven't yet worked out how to lighten the colour of
1550 the active tabfolder. Any ideas anybody?
1551 Adjusted Colours tab a little.
1552 Added Shortcut field to converters tab. Note that we can't create an
1553 fdesign label like "input_shortcut" as this buggers up the sed-script
1556 * src/frontends/xforms/FormPreferences.[Ch]:
1557 (feedback): fixed crash due to to ob=0.
1558 (LanguagesXXX): the kbmap choices now contain the files
1559 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1560 be replaced by an input with a file browse button, but since the browse
1561 buttons don'y yet work, this'll do for the moment.
1562 (FormatsXXX): think that this is now nearly fully functional.
1563 Some points/questions though:
1564 1. Does "Apply" remove formats if no longer present?
1565 2. I think that the browser should list the GUI names rather than the
1567 3. Must ensure that we can't delete Formats used by an existing
1570 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1571 if this is the best way to do this.
1573 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1575 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1577 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1578 for variable assignment.
1580 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1582 * src/lib/ui/default.ui: added sub/superscripts to menu as
1583 Insert->Special characters and cleaned-up the file a bit
1585 2000-11-07 Allan Rae <rae@lyx.org>
1587 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1588 ob isn't 0 before using it. See comments in function.
1590 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1592 * src/frontends/xforms/form_*.C: regenerated
1594 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1596 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1598 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1599 compiling with gcc-2.96
1601 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1603 * src/support/lyxstring.C: add a couple "using" directives.
1605 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1606 a .c_str() here too for good measure.
1607 * src/Spacing.C (set): ditto.
1608 * src/lyxfunc.C (Dispatch): ditto.
1610 * src/insets/insettabular.C (copySelection): change .str() to
1611 .str().c_str() to fix problems with lyxstring.
1612 * src/support/filetools.C (GetFileContents): ditto.
1613 * src/buffer.C (asciiParagraph): ditto.
1614 * src/paragraph.C (String): ditto.
1616 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1617 * lib/bind/sciword.bind: ditto.
1619 * src/LyXAction.C (init): remove "symbol-insert" function, which
1620 shared LFUN_INSERT_MATH with "math-insert".
1622 * lib/configure.m4: == is not a valid operator for command test.
1624 * src/lyxrc.C: add using directive.
1626 * src/converter.h: add std:: qualifier.
1628 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1630 * src/converter.[Ch] and other files: Change the Format class to a
1631 real class, and create two instances: formats and system_format.
1633 * src/lyxrc.C (output): Output the difference between formats and
1636 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1637 (buildFormats): Insert formats into browser.
1638 (inputFormats): Made the browser and add button functional.
1639 (applyFormats): Update formats from format_vec.
1641 * src/converter.C: Changed all (*it). to it->
1642 (Format::dummy): New method.
1643 (Format::importer): New format flag.
1644 (Formats::GetAllFormats): New method.
1645 (Formats::Add): Delete format from the map if prettyname is empty.
1646 (Converter::Convert): Print an error message if moving the file fails.
1647 (Converter::GetReachableTo): New method
1649 * src/MenuBackend.[Ch]: Add support for importformats tag.
1651 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1653 * lib/configure.m4: Add word->tex and ps->fax converters.
1655 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1656 Return fax to file menu.
1660 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1662 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1665 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1668 * src/lyxfunc.C (processKeyEvent): removed
1670 * src/bufferlist.C (emergencyWrite): removed the out commented
1671 emergency write code.
1673 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1675 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1677 * many files: change formatting to be a bit more uniform for
1678 if,while,for,switch statements, remove some parantesis not needed.
1681 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1683 * config/kde.m4: make config more robust when KDEDIR is set
1685 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1687 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1688 not returned a pixmap for "math-insert".
1690 * src/LyXAction.C (init): sort the entries a bit.
1692 2000-11-03 Juergen Vigna <jug@sad.it>
1694 * src/insets/insettabular.h: added fixed number to update codes so
1695 that update is only in one direction.
1697 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1700 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1701 before call to edit because of redraw.
1703 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1705 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1707 * lib/ui/default.ui: Populate "edit_float" menu
1709 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1711 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1712 "floats-operate". The name is ugly (and the func also), but this
1713 is just a band-aid until we switch to new insets.
1715 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1717 * lib/ui/default.ui: update again the menu layout (fix some
1720 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1722 * src/MenuBackend.h (fulllabel): new method.
1724 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1725 the menu shortcuts of a menu are unique and whether they
1726 correspond to a letter of the label.
1727 (expand): call checkShortcuts when debugging.
1729 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1731 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1733 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1735 * lib/examples/*.lyx : '\language default' => '\language english'
1737 * lib/examples/it_splash.lyx : except where it should be italian
1739 * lib/templates/*.lyx : the same
1741 * doc/*.lyx* : the same
1743 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1745 * lib/bind/menus.bind: remove the Layout menu entries, which I
1746 somehow forgot earlier.
1748 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1750 * lib/ui/old-default.ui: keep the old one here for reference (to
1753 * lib/ui/default.ui: update the menu layout
1755 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1757 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1758 Can now Apply to different insets without closing the dialog.
1760 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1761 Can't actually DO anything with them yet, but I'd like a little
1764 * src/frontends/xforms/input_validators.[ch]
1765 (fl_lowercase_filter): new.
1767 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1769 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1770 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1772 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1774 2000-11-02 Juergen Vigna <jug@sad.it>
1776 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1777 on char insertion as it has already be updated by bv->updateInset().
1779 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1780 if an inset inside was updated.
1782 * lib/configure.cmd: commented out fax-search code
1784 2000-11-01 Yves Bastide <stid@acm.org>
1786 * src/tabular.C (OldFormatRead): set tabular language to the
1789 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1791 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1792 class names with non-letter characters (from Yves Bastide).
1794 * lib/ui/default.ui: change Item to OptItem in import menu.
1795 Comment out fax stuff.
1797 * lib/configure.m4: comment out fax-related stuff.
1799 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1801 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1802 useful xforms helper functions. At present contains only formatted().
1803 Input a string and it returns it with line breaks so that in fits
1806 * src/frontends/xforms/Makefile.am: add new files.
1808 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1809 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1812 * src/frontends/xforms/FormPreferences.[Ch]:
1813 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1814 but lots of little clean ups. Removed enum State. Make use of
1815 formatted(). Constify lots of methods. Perhaps best of all: removed
1816 requirement for that horrible reinterpret_cast from pointer to long in
1819 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1821 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1822 conditionalize build on xforms < 0.89
1824 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1826 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1828 * src/LyXAction.C (init): comment out fax
1830 * src/lyxrc.h: comment out the fax enums
1831 comment out the fax variables
1833 * src/commandtags.h: comment out LFUN_FAX
1835 * src/lyxrc.C: disable fax variables.
1836 (read): disable parsing of fax variables
1837 (output): disable writing of fax variables
1838 (getFeedback): now description for fax variables
1840 * src/lyxfunc.C: comment out MenuFax
1841 (Dispatch): disable LFUN_FAX
1843 * src/lyx_cb.C (MenuFax): comment out
1845 * src/WorkArea.C: add <cctype>
1846 (work_area_handler): better key handling, should be ok now.
1847 for accented chars + etc
1849 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1850 lyx_sendfax.h and lyx_sendfax_man.C
1852 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1853 (show): don't call InitLyXLookup when using xforms 0.89
1855 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1857 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1859 * src/support/filetools.C (GetFileContents): close to dummy change
1861 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1863 * src/trans.C (AddDeadkey): workaround stupid compilers.
1865 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1867 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1868 of two-sided document.
1870 2000-10-31 Juergen Vigna <jug@sad.it>
1872 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1874 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1875 xposition to the Edit call.
1877 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1879 * src/trans.C (AddDeadkey): cast explicitly to char.
1881 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1883 * src/tabular.C (AsciiBottomHLine): simplify?
1884 (AsciiTopHLine): simplify?
1885 (print_n_chars): simplify
1886 (DocBook): remove most of the << endl; we should flush the stream
1887 as seldom as possible.
1889 (TeXBottomHLine): ditto
1890 (TeXTopHLine): ditto
1892 (write_attribute): try a templified version.
1893 (set_row_column_number_info): lesson scope of variables
1895 * src/support/lstrings.h (tostr): new specialization of tostr
1897 * src/trans.C (AddDeadkey): slightly cleaner fix.
1899 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1901 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1902 '%%' in Toc menu labels.
1905 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1906 font_norm is iso10646-1.
1908 * src/font.C (ascent): Fixed for 16bit fonts
1909 (descent,lbearing,rbearing): ditto
1911 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1913 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1914 (getFeedback): new static method.
1916 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1917 Now use combox rather than choice to display languages.
1918 Feedback is now output using a new timer callback mechanism, identical
1919 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1921 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1923 * src/minibuffer.C: fix for older compilers
1925 2000-10-30 Juergen Vigna <jug@sad.it>
1927 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1928 has to be Left of the inset otherwise LyXText won't find it!
1930 * src/BufferView2.C (open_new_inset): delete the inset if it can
1933 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1935 * lyx.man: fix typo.
1937 2000-10-29 Marko Vendelin <markov@ioc.ee>
1938 * src/frontends/gnome/FormCitation.C
1939 * src/frontends/gnome/FormCitation.h
1940 * src/frontends/gnome/FormCopyright.C
1941 * src/frontends/gnome/FormCopyright.h
1942 * src/frontends/gnome/FormError.C
1943 * src/frontends/gnome/FormError.h
1944 * src/frontends/gnome/FormIndex.C
1945 * src/frontends/gnome/FormIndex.h
1946 * src/frontends/gnome/FormPrint.C
1947 * src/frontends/gnome/FormPrint.h
1948 * src/frontends/gnome/FormRef.C
1949 * src/frontends/gnome/FormRef.h
1950 * src/frontends/gnome/FormToc.C
1951 * src/frontends/gnome/FormToc.h
1952 * src/frontends/gnome/FormUrl.C
1953 * src/frontends/gnome/FormUrl.h
1954 * src/frontends/gnome/Menubar_pimpl.C
1955 * src/frontends/gnome/mainapp.C
1956 * src/frontends/gnome/mainapp.h
1957 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1958 changing update() to updateSlot() where appropriate
1960 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1962 * src/frontends/xforms/FormPreferences.[Ch]:
1963 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1966 2000-10-28 Juergen Vigna <jug@sad.it>
1968 * src/insets/insettabular.C (draw): fixed drawing bug.
1970 * src/insets/insettext.C (clear):
1972 (SetParagraphData): clearing the TEXT buffers when deleting the
1973 paragraphs used by it.
1975 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1977 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1979 2000-10-27 Juergen Vigna <jug@sad.it>
1981 * src/tabular.C (~LyXTabular): removed not needed anymore.
1983 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1986 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1988 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1991 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1994 * src/frontends/xforms/FormPreferences.[Ch]:
1995 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1996 Reorganised as modules based on tabs. Much easier to follow the
1997 flow and to add new tabs. Added warning and feedback messages.
2000 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2002 * src/tabular.h (DocBook): add std:: qualifier.
2004 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
2006 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
2007 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
2010 * insettabular.C (DocBook): uses the tabular methods to export
2013 * src/insets/insettext.h
2014 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
2016 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2018 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
2021 * src/lyxfunc.C (MenuNew): lessen the scope of fname
2022 moved misplaced AllowInput two lines up.
2024 * src/buffer.C (readFile): compare float with float, not with int
2026 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2028 * src/minibuffer.C: add "using SigC::slot" statement.
2030 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
2032 * src/frontends/xforms/forms/README: updated section about make.
2034 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
2035 Tidied some forms up, made two of form_tabular's tabs more
2036 self-consistent, fixed Jean-Marc's size problem in form_preferences,
2037 fixed translation problem with "Column".
2039 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2041 * src/minibuffer.h: use Timeout instead of the xforms timer
2043 (setTimer) rewrite for the Timeout, change to unsigned arg
2044 (set): change to unsigned timer arg
2047 * src/minibuffer.C (TimerCB): removed func
2048 (C_MiniBuffer_TimerCB): removed func
2049 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
2050 (peek_event): use a switch statement
2051 (add): don't use fl_add_timer.
2052 (Set): rewrite to use the Timeout
2055 * src/Timeout.[Ch] (setType): return a Timeout &
2056 (setTimeout): ditto, change to unsigned arg for timeout
2058 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
2060 * src/mathed/formula.C (mathed_string_width): Use string instead
2061 of a constant size char array.
2063 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2065 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
2066 the two recently added operator<< for SMInput and State.
2068 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
2070 (OkCancelPolicy): ditto
2071 (OkCancelReadOnlyPolicy): ditto
2072 (NoRepeatedApplyReadOnlyPolicy): ditto
2073 (OkApplyCancelReadOnlyPolicy): ditto
2074 (OkApplyCancelPolicy): ditto
2075 (NoRepeatedApplyPolicy): ditto
2077 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2079 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
2080 add the usual std:: qualifiers.
2082 2000-10-25 Juergen Vigna <jug@sad.it>
2084 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
2086 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2088 * src/support/filetools.C (MakeRelPath): change some types to
2091 * src/frontends/ButtonPolicies.h (operator<<): new operator for
2092 ButtonPolicy::SMInput and ButtonPolicy::State.
2094 * src/FontLoader.C (reset): small cleanup
2095 (unload): small cleanup
2097 * src/FontInfo.C (getFontname): initialize error to 10000.0
2099 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2101 * src/frontends/xforms/FormPreferences.[Ch]:
2102 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
2103 TeX encoding and default paper size sections.
2105 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2107 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2110 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2111 make the message_ empty.
2112 (FormError): don't initialize message_ in initializer list.
2114 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2116 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2118 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2120 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2122 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2124 * src/frontends/kde/*data.[Ch]: _("") is not
2127 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2129 * src/buffer.C: removed redundant using directive.
2131 * src/frontends/DialogBase.h: revert to original definition of
2134 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2135 stuff into two classes, one for each dialog, requires a new
2136 element in the dialogs vector, FormTabularCreate.
2138 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2141 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2142 method. Continues Allan's idea, but means that derived classes
2143 don't need to worry about "update or hide?".
2145 * src/frontends/xforms/FormError.C (showInset): add connection
2148 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2149 one for each dialog. FormTabular now contains main tabular dialog
2152 * src/frontends/xforms/FormTabularCreate.[Ch]:
2153 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2156 * src/frontends/xforms/FormGraphics.[Ch]:
2157 * src/frontends/xforms/forms/form_graphics.fd
2158 * src/frontends/xforms/FormTabular.[Ch]:
2159 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2160 classes of FormInset.
2162 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2163 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2165 * src/frontends/xforms/Makefile.am:
2166 * src/frontends/xforms/forms/makefile: added new files.
2168 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2169 variable. added Signal0 hide signal, in keeping with other GUI-I
2172 * src/support/lstrings.h: removed redundant std:: qualifier as
2173 it's already declared in Lsstream.h.
2175 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2177 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2181 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2183 * src/tabular.C (Ascii): minimize scope of cell.
2185 * src/BufferView2.C (nextWord): return string() instead of 0;
2187 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2189 * src/converter.h: add a std:: qualifier
2191 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2193 * src/importer.[Ch]: New files. Used for importing files into LyX.
2195 * src/lyxfunc.C (doImport): Use the new Importer class.
2197 * src/converter.h: Add shortcut member to the Format class.
2198 Used for holding the menu shortcut.
2200 * src/converter.C and other files: Made a distinction between
2201 format name and format extension. New formats can be defined using
2202 the \format lyxrc tag.
2203 Added two new converter flags: latex and disable.
2205 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2207 * src/support/lyxlib.h: unify namespace/struct implementation.
2208 Remove extra declarations.
2210 * src/support/chdir.C (chdir): remove version taking char const *
2212 * src/support/rename.C: ditto.
2213 * src/support/lyxsum.C: ditto.
2215 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2217 * src/frontends/xforms/FormBase.[Ch]:
2218 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2219 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2220 work only for the next call to fl_show_form(). The correct place to set
2221 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2222 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2223 from FormBase have the minimum size set; no more stupid crashes with
2226 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2228 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2230 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2232 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2234 * src/support/lyxlib.h: changed second argument of mkdir to
2235 unsigned long int (unsigned int would probably have been enough,
2236 but...). Removed <sys/types.h> header.
2237 * src/support/mkdir.C (mkdir): ditto.
2241 2000-10-19 Juergen Vigna <jug@sad.it>
2243 * src/lyxfunc.C (MenuNew): small fix (form John)
2245 * src/screen.C (Update): removed unneeded code.
2247 * src/tabular.C (Ascii): refixed int != uint bug!
2249 * src/support/lyxlib.h: added sys/types.h include for now permits
2250 compiling, but I don't like this!
2252 2000-10-18 Juergen Vigna <jug@sad.it>
2254 * src/text2.C (ClearSelection): if we clear the selection we need
2255 more refresh so set the status apropriately
2257 * src/insets/insettext.C (draw): hopefully finally fixed draw
2260 2000-10-12 Juergen Vigna <jug@sad.it>
2262 * src/insets/insettext.C (draw): another small fix and make a block
2263 so that variables are localized.
2265 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2267 * src/support/lstrings.C (lowercase, uppercase):
2268 use explicit casts to remove compiler warnings.
2270 * src/support/LRegex.C (Impl):
2271 * src/support/StrPool.C (add):
2272 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2273 (AddPath, MakeDisplayPath):
2274 * src/support/lstrings.C (prefixIs, subst):
2275 use correct type to remove compiler warnings.
2277 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2279 * src/support/lyxlib.h:
2280 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2281 portability and to remove compiler warning with DEC cxx.
2283 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2285 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2287 * src/minibuffer.C (peek_event): retun 1 when there has been a
2288 mouseclick in the minibuffer.
2292 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2294 * src/frontends/xforms/FormParagraph.C: more space above/below
2297 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2299 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2300 a char only if real_current_font was changed.
2302 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2304 * NEWS: update somewhat for 1.1.6
2306 * lib/ui/default.ui: clean up.
2308 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2310 * lib/CREDITS: clean up
2312 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2314 * src/combox.[Ch] (select): changed argument back to int
2315 * src/combox.C (peek_event): removed num_bytes as it is declared but
2318 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2319 modified calls to Combox::select() to remove warnings about type
2322 * src/insets/insetbutton.C (width): explicit cast to remove warning
2323 about type conversion.
2325 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2328 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2329 sel_pos_end, refering to cursor position are changed to
2330 LyXParagraph::size_type.
2332 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2333 consistent with LyXCursor::pos().
2334 (inset_pos): changed to LyXParagraph::size_type for same reason.
2336 * src/insets/insettext.C (resizeLyXText): changed some temporary
2337 variables refing to cursor position to LyXParagraph::size_type.
2339 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2341 * src/frontends/kde/<various>: The Great Renaming,
2344 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2346 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2348 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2350 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2351 0 when there are no arguments.
2353 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2355 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2356 to segfaults when pressing Ok in InsetBibtex dialog.
2358 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2360 * forms/layout_forms.fd:
2361 * src/layout_forms.C (create_form_form_character): small change to use
2362 labelframe rather than engraved frame + text
2364 * src/lyx_gui.C (create_forms): initialise choice_language with some
2365 arbitrary value to prevent segfault when dialog is shown.
2367 2000-10-16 Baruch Even <baruch.even@writeme.com>
2369 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2370 is no resulting file. This pertains only to LaTeX output.
2372 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2374 * src/text.C (Backspace): Make sure that the row of the cursor is
2377 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2380 * src/lyx_gui.C (init): Prevent a crash when only one font from
2381 menu/popup fonts is not found.
2383 * lib/lyxrc.example: Add an example for binding a key for language
2386 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2388 * src/converter.C (GetReachable): Changed the returned type to
2390 (IsReachable): New method
2392 * src/MenuBackend.C (expand): Handle formats that appear more
2395 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2397 * src/frontends/support/Makefile.am
2398 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2401 * lib/CREDITS: add Garst Reese.
2403 * src/support/snprintf.h: add extern "C" {} around the definitions.
2405 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2407 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2410 * src/frontends/xforms/FormDocument.C:
2411 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2412 compile without "conversion to integral type of smaller size"
2415 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2417 * src/text.C (GetColumnNearX): Fixed disabled code.
2419 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2421 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2424 * src/support/snprintf.[ch]: new files
2426 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2428 * src/frontends/kde/formprintdialog.C: add
2429 file browser for selecting postscript output
2431 * src/frontends/kde/formprintdialogdata.C:
2432 * src/frontends/kde/formprintdialogdata.h: re-generate
2435 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2437 * src/frontends/gnome/Makefile.am:
2438 * src/frontends/kde/Makefile.am: FormCommand.C
2439 disappeared from xforms
2441 * src/frontends/kde/FormCitation.C:
2442 * src/frontends/kde/FormIndex.C: read-only
2445 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2447 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2450 * src/bufferlist.C: add using directive.
2452 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2454 * src/support/lyxfunctional.h: version of class_fun for void
2455 returns added, const versions of back_inseter_fun and compare_fun
2458 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2460 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2462 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2464 * ChangeLog: cleanup.
2466 * lib/CREDITS: update to add all the contributors we've forgotten.
2467 I have obviously missed some, so tell me whether there were
2470 2000-10-13 Marko Vendelin <markov@ioc.ee>
2472 * src/frontends/gnome/FormCitation.C
2473 * src/frontends/gnome/FormCitation.h
2474 * src/frontends/gnome/FormError.C
2475 * src/frontends/gnome/FormIndex.C
2476 * src/frontends/gnome/FormRef.C
2477 * src/frontends/gnome/FormRef.h
2478 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2480 * src/frontends/gnome/FormCitation.C
2481 * src/frontends/gnome/FormCopyright.C
2482 * src/frontends/gnome/FormError.C
2483 * src/frontends/gnome/FormIndex.C
2484 * src/frontends/gnome/FormRef.C
2485 * src/frontends/gnome/FormToc.C
2486 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2489 * src/frontends/gnome/Menubar_pimpl.C
2490 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2493 2000-10-11 Baruch Even <baruch.even@writeme.com>
2496 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2497 to convey its real action.
2499 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2500 clear the minibuffer and prepare to enter a command.
2502 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2503 the rename from ExecCommand to PrepareForCommand.
2504 * src/lyxfunc.C (Dispatch): ditto.
2506 2000-10-11 Baruch Even <baruch.even@writeme.com>
2508 * src/buffer.C (writeFile): Added test for errors on writing, this
2509 catches all errors and not only file system full errors as intended.
2511 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2513 * src/lyx_gui.C (create_forms): better fix for crash with
2514 translated interface.
2516 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2518 * src/frontends/kde/Makefile.am:
2519 * src/frontends/kde/FormCopyright.C:
2520 * src/frontends/kde/formcopyrightdialog.C:
2521 * src/frontends/kde/formcopyrightdialog.h:
2522 * src/frontends/kde/formcopyrightdialogdata.C:
2523 * src/frontends/kde/formcopyrightdialogdata.h:
2524 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2525 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2526 copyright to use qtarch
2528 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2530 * src/encoding.C (read): Fixed bug that caused an error message at
2531 the end of the file.
2533 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2535 * lib/lyxrc.example: Fixed hebrew example.
2537 2000-10-13 Allan Rae <rae@lyx.org>
2539 * src/frontends/xforms/FormPreferences.C (input): reworking the
2541 (build, update, apply): New inputs in various tabfolders
2543 * src/frontends/xforms/FormToc.C: use new button policy.
2544 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2545 dialogs that either can't use any existing policy or where it just
2548 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2551 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2552 added a bool parameter which is ignored.
2554 * src/buffer.C (setReadonly):
2555 * src/BufferView_pimpl.C (buffer):
2556 * src/frontends/kde/FormCopyright.h (update):
2557 * src/frontends/kde/FormCitation.[Ch] (update):
2558 * src/frontends/kde/FormIndex.[Ch] (update):
2559 * src/frontends/kde/FormPrint.[Ch] (update):
2560 * src/frontends/kde/FormRef.[Ch] (update):
2561 * src/frontends/kde/FormToc.[Ch] (update):
2562 * src/frontends/kde/FormUrl.[Ch] (update):
2563 * src/frontends/gnome/FormCopyright.h (update):
2564 * src/frontends/gnome/FormCitation.[Ch] (update):
2565 * src/frontends/gnome/FormError.[Ch] (update):
2566 * src/frontends/gnome/FormIndex.[Ch] (update):
2567 * src/frontends/gnome/FormPrint.[Ch] (update):
2568 * src/frontends/gnome/FormRef.h (update):
2569 * src/frontends/gnome/FormToc.[Ch] (update):
2570 * src/frontends/gnome/FormUrl.[Ch] (update):
2571 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2572 to updateBufferDependent and DialogBase
2574 * src/frontends/xforms/FormCitation.[hC]:
2575 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2576 * src/frontends/xforms/FormError.[Ch]:
2577 * src/frontends/xforms/FormGraphics.[Ch]:
2578 * src/frontends/xforms/FormIndex.[Ch]:
2579 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2580 and fixed readOnly handling.
2581 * src/frontends/xforms/FormPrint.[Ch]:
2582 * src/frontends/xforms/FormRef.[Ch]:
2583 * src/frontends/xforms/FormTabular.[Ch]:
2584 * src/frontends/xforms/FormToc.[Ch]:
2585 * src/frontends/xforms/FormUrl.[Ch]:
2586 * src/frontends/xforms/FormInset.[Ch]:
2587 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2588 form of updateBufferDependent.
2590 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2591 if form()->visible just in case someone does stuff to the form in a
2594 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2595 the buttoncontroller for everything the enum used to be used for.
2596 (update) It would seem we need to force all dialogs to use a bool
2597 parameter or have two update functions. I chose to go with one.
2598 I did try removing update() from here and FormBase and defining the
2599 appropriate update signatures in FormBaseB[DI] but then ran into the
2600 problem of the update() call in FormBase::show(). Whatever I did
2601 to get around that would require another function and that just
2602 got more confusing. Hence the decision to make everyone have an
2603 update(bool). An alternative might have been to override show() in
2604 FormBaseB[DI] and that would allow the different and appropriate
2607 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2608 true == buffer change occurred. I decided against using a default
2609 template parameter since not all compilers support that at present.
2611 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2613 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2614 army knife" by removing functionality.
2615 (clearStore): removed. All such housekeeping on hide()ing the dialog
2616 is to be carried out by overloaded disconnect() methods.
2617 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2618 superceded by Baruch's neat test (FormGraphics) to update an existing
2619 dialog if a new signal is recieved rather than block all new signals
2621 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2622 only to Inset dialogs.
2623 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2624 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2626 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2628 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2629 as a base class to all inset dialogs. Used solely to connect/disconnect
2630 the Inset::hide signal and to define what action to take on receipt of
2631 a UpdateBufferDependent signal.
2632 (FormCommand): now derived from FormInset.
2634 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2637 * src/frontends/xforms/FormCopyright.[Ch]:
2638 * src/frontends/xforms/FormPreferences.[Ch]:
2639 now derived from FormBaseBI.
2641 * src/frontends/xforms/FormDocument.[Ch]:
2642 * src/frontends/xforms/FormParagraph.[Ch]:
2643 * src/frontends/xforms/FormPrint.[Ch]:
2644 now derived from FormBaseBD.
2646 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2648 * src/frontends/xforms/FormCitation.[Ch]:
2649 * src/frontends/xforms/FormError.[Ch]:
2650 * src/frontends/xforms/FormRef.[Ch]:
2651 * src/frontends/xforms/FormToc.[Ch]:
2652 (clearStore): reworked as disconnect().
2654 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2657 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2659 * src/converter.C (runLaTeX): constify buffer argument
2662 * src/frontends/support/Makefile.am (INCLUDES): fix.
2664 * src/buffer.h: add std:: qualifier
2665 * src/insets/figinset.C (addpidwait): ditto
2666 * src/MenuBackend.C: ditto
2667 * src/buffer.C: ditto
2668 * src/bufferlist.C: ditto
2669 * src/layout.C: ditto
2670 * src/lyxfunc.C: ditto
2672 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2674 * src/lyxtext.h (bidi_level): change return type to
2675 LyXParagraph::size_type.
2677 * src/lyxparagraph.h: change size_type to
2678 TextContainer::difference_type. This should really be
2679 TextContainer::size_type, but we need currently to support signed
2682 2000-10-11 Marko Vendelin <markov@ioc.ee>
2683 * src/frontends/gnome/FormError.h
2684 * src/frontends/gnome/FormRef.C
2685 * src/frontends/gnome/FormRef.h
2686 * src/frontends/gnome/FormError.C
2687 * src/frontends/gnome/Makefile.am
2688 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2689 to Gnome frontend. Both dialogs use "action" area.
2691 2000-10-12 Baruch Even <baruch.even@writeme.com>
2693 * src/graphics/GraphicsCacheItem_pimpl.C:
2694 * src/graphics/Renderer.C:
2695 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2698 2000-10-12 Juergen Vigna <jug@sad.it>
2700 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2701 visible when selecting).
2703 * development/Code_rules/Rules: fixed some typos.
2705 2000-10-09 Baruch Even <baruch.even@writeme.com>
2707 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2708 compiling on egcs 1.1.2 possible.
2710 * src/filedlg.C (comp_direntry::operator() ): ditto.
2712 2000-08-31 Baruch Even <baruch.even@writeme.com>
2714 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2717 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2718 transient it now only gets freed when the object is destructed.
2720 2000-08-24 Baruch Even <baruch.even@writeme.com>
2722 * src/frontends/FormGraphics.h:
2723 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2726 2000-08-20 Baruch Even <baruch.even@writeme.com>
2728 * src/insets/insetgraphics.C:
2729 (draw): Added messages to the drawn rectangle to report status.
2730 (updateInset): Disabled the use of the inline graphics,
2733 2000-08-17 Baruch Even <baruch.even@writeme.com>
2735 * src/frontends/support: Directory added for the support of GUII LyX.
2737 * src/frontends/support/LyXImage.h:
2738 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2741 * src/frontends/support/LyXImage_X.h:
2742 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2743 version of LyXImage, this uses the Xlib Pixmap.
2745 * src/PainterBase.h:
2746 * src/PainterBase.C:
2748 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2749 replacement to Pixmap.
2751 * src/insets/insetgraphics.h:
2752 * src/insets/insetgraphics.C:
2753 * src/graphics/GraphicsCacheItem.h:
2754 * src/graphics/GraphicsCacheItem.C:
2755 * src/graphics/GraphicsCacheItem_pimpl.h:
2756 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2759 * src/graphics/GraphicsCacheItem.h:
2760 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2761 another copy of the object.
2763 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2764 of cacheHandle, this fixed a bug that sent LyX crashing.
2766 * src/graphics/XPM_Renderer.h:
2767 * src/graphics/XPM_Renderer.C:
2768 * src/graphics/EPS_Renderer.h:
2769 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2771 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2773 * src/lyxfunc.C (processKeySym): only handle the
2774 lockinginset/inset stuff if we have a buffer and text loaded...
2776 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2778 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2780 * src/support/lyxfunctional.h: add operator= that takes a reference
2782 * src/lyxserver.C (mkfifo): make first arg const
2784 * src/layout.h: renamed name(...) to setName(...) to work around
2787 * src/buffer.C (setFileName): had to change name of function to
2788 work around bugs in egcs. (renamed from fileName)
2790 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2792 * src/support/translator.h: move helper template classes to
2793 lyxfunctional.h, include "support/lyxfunctional.h"
2795 * src/support/lyxmanip.h: add delaration of fmt
2797 * src/support/lyxfunctional.h: new file
2798 (class_fun_t): new template class
2799 (class_fun): helper template function
2800 (back_insert_fun_iterator): new template class
2801 (back_inserter_fun): helper template function
2802 (compare_memfun_t): new template class
2803 (compare_memfun): helper template function
2804 (equal_1st_in_pair): moved here from translator
2805 (equal_2nd_in_pair): moved here from translator
2807 * src/support/fmt.C: new file
2808 (fmt): new func, can be used for a printf substitute when still
2809 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2811 * src/support/StrPool.C: add some comments
2813 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2816 * src/insets/figinset.C (addpidwait): use std::copy with
2817 ostream_iterator to fill the pidwaitlist
2819 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2821 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2824 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2827 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2829 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2830 (class_update): ditto
2831 (BulletPanel): ditto
2832 (CheckChoiceClass): move initialization of tc and tct
2834 * src/tabular.C: remove current_view
2835 (OldFormatRead): similar to right below [istream::ignore]
2837 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2838 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2839 unused [istream::ignore]
2841 * src/lyxfunc.C: include "support/lyxfunctional.h"
2842 (getInsetByCode): use std::find_if and compare_memfun
2844 * src/lyxfont.C (stateText): remove c_str()
2846 * src/lyx_main.C (setDebuggingLevel): make static
2847 (commandLineHelp): make static
2849 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2850 Screen* together with fl_get_display() and fl_screen
2852 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2853 togheter with fl_get_display() and fl_screen
2854 (create_forms): remove c_str()
2856 * src/layout.C: include "support/lyxfunctional.h"
2857 (hasLayout): use std::find_if and compare_memfun
2858 (GetLayout): use std::find_if and comapre_memfun
2859 (delete_layout): use std::remove_if and compare_memfun
2860 (NumberOfClass): use std:.find_if and compare_memfun
2862 * src/gettext.h: change for the new functions
2864 * src/gettext.C: new file, make _(char const * str) and _(string
2865 const & str) real functions.
2867 * src/font.C (width): rewrite slightly to avoid one extra variable
2869 * src/debug.C: initialize Debug::ANY here
2871 * src/commandtags.h: update number comments
2873 * src/combox.h (get): make const func
2875 (getline): make const
2877 * src/combox.C (input_cb): handle case where fl_get_input can
2880 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2881 "support/lyxfunctional.h", remove current_view variable.
2882 (resize): use std::for_each with std::mem_fun
2883 (getFileNames): use std::copy with back_inserter_fun
2884 (getBuffer): change arg type to unsigned int
2885 (emergencyWriteAll): call emergencyWrite with std::for_each and
2887 (emergencyWrite): new method, the for loop in emergencyWriteAll
2889 (exists): use std::find_if with compare_memfun
2890 (getBuffer): use std::find_if and compare_memfun
2892 * src/buffer.h: add typedefs for iterator_category, value_type
2893 difference_type, pointer and reference for inset_iterator
2894 add postfix ++ for inset_iterator
2895 make inset_iterator::getPos() const
2897 * src/buffer.C: added support/lyxmanip.h
2898 (readFile): use lyxerr << fmt instead of printf
2899 (makeLaTeXFile): use std::copy to write out encodings
2901 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2903 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2904 free and the char * temp.
2905 (hasMenu): use std::find_if and compare_memfun
2908 * src/Makefile.am (lyx_SOURCES): added gettext.C
2910 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2911 string::insert small change to avoid temporary
2913 * src/LColor.C (getGUIName): remove c_str()
2915 * several files: change all occurrences of fl_display to
2918 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2919 that -pedantic is not used for gcc 2.97 (cvs gcc)
2921 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2923 2000-10-11 Allan Rae <rae@lyx.org>
2925 * src/frontends/xforms/FormPreferences.C (input): template path must be
2926 a readable directory. It doesn't need to be writeable.
2927 (build, delete, update, apply): New inputs in the various tabfolders
2929 * src/frontends/xforms/forms/form_preferences.fd:
2930 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2931 several new entries to existing folders. Shuffled some existing stuff
2934 * src/frontends/xforms/forms/form_print.fd:
2935 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2936 Should probably rework PrinterParams as well. Note that the switch to
2937 collated is effectively the same as !unsorted so changing PrinterParams
2938 will require a lot of fiddly changes to reverse the existing logic.
2940 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2942 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2944 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2946 2000-10-10 Allan Rae <rae@lyx.org>
2949 * src/lyxfunc.C (Dispatch):
2951 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2954 * src/lyxrc.C (output): Only write the differences between system lyxrc
2955 and the users settings.
2958 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2960 I'll rewrite this later, after 1.1.6 probably, to keep a single
2961 LyXRC but two instances of a LyXRCStruct.
2963 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2965 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2967 * src/tabular.h: add a few std:: qualifiers.
2969 * src/encoding.C: add using directive.
2970 * src/language.C: ditto.
2972 * src/insets/insetquotes.C (Validate): use languages->lang()
2973 instead of only language.
2975 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2977 * lib/languages: New file.
2979 * lib/encodings: New file.
2981 * src/language.C (Languages): New class.
2982 (read): New method. Reads the languages from the 'languages' file.
2984 * src/encoding.C (Encodings): New class.
2985 (read): New method. Reads the encodings from the 'encodings' file.
2987 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2990 * src/bufferparams.h and a lot of files: Deleted the member language,
2991 and renamed language_info to language
2993 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2994 * src/lyxfont.C (latexWriteStartChanges): ditto.
2995 * src/paragraph.C (validate,TeXOnePar): ditto.
2997 * src/lyxfont.C (update): Restored deleted code.
2999 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
3001 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
3003 * src/BufferView_pimpl.C (buffer): cleaned up a little.
3005 * src/insets/figinset.[Ch]:
3006 * src/insets/insetinclude.[Ch]:
3007 * src/insets/insetinclude.[Ch]:
3008 * src/insets/insetparent.[Ch]:
3009 * src/insets/insetref.[Ch]:
3010 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
3012 * src/insets/*.[Ch]:
3013 * src/mathed/formula.[Ch]:
3014 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
3016 * src/buffer.C (parseSingleLyXformat2Token, readInset):
3017 * src/lyx_cb.C (FigureApplyCB):
3018 * src/lyxfunc.C (getStatus, Dispatch):
3019 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
3022 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
3024 * src/converter.[Ch] (Formats::View):
3025 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
3027 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
3028 *current_view->buffer(). This will change later, but this patch is way
3031 2000-10-09 Juergen Vigna <jug@sad.it>
3033 * src/text.C (GetRow): small fix.
3035 * src/BufferView_pimpl.C (cursorPrevious):
3036 (cursorNext): added LyXText parameter to function.
3038 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
3039 keypress depending on cursor position.
3041 2000-10-06 Juergen Vigna <jug@sad.it>
3043 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
3044 (copySelection): redone this function and also copy ascii representa-
3047 * src/tabular.C (Ascii):
3051 (print_n_chars): new functions to realize the ascii export of tabulars.
3053 2000-10-05 Juergen Vigna <jug@sad.it>
3055 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
3056 if we don't have a buffer.
3058 2000-10-10 Allan Rae <rae@lyx.org>
3060 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
3061 with closing dialog. It seems that nested tabfolders require hiding
3062 of inner tabfolders before hiding the dialog itself. Actually all I
3063 did was hide the active outer folder.
3065 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
3066 unless there really is a buffer. hideBufferDependent is called
3069 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
3070 POTFILES.in stays in $(srcdir).
3072 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
3074 * lib/lyxrc.example: Few changes.
3076 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
3078 * src/BufferView_pimpl.C (buffer): only need one the
3079 updateBufferDependent signal to be emitted once! Moved to the end of
3080 the method to allow bv_->text to be updated first.
3082 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
3083 and hSignal_ with Dialogs * and BufferDependency variables.
3084 New Buffer * parent_, initialised when the dialog is launched. Used to
3085 check whether to update() or hide() dialog in the new, private
3086 updateOrHide() method that is connected to the updateBufferDependent
3087 signal. Daughter classes dictate what to do using the
3088 ChangedBufferAction enum, passed to the c-tor.
3090 * src/frontends/xforms/FormCitation.C:
3091 * src/frontends/xforms/FormCommand.C:
3092 * src/frontends/xforms/FormCopyright.C:
3093 * src/frontends/xforms/FormDocument.C:
3094 * src/frontends/xforms/FormError.C:
3095 * src/frontends/xforms/FormIndex.C:
3096 * src/frontends/xforms/FormPreferences.C:
3097 * src/frontends/xforms/FormPrint.C:
3098 * src/frontends/xforms/FormRef.C:
3099 * src/frontends/xforms/FormToc.C:
3100 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
3103 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3104 ChangedBufferAction enum.
3106 * src/frontends/xforms/FormParagraph.[Ch]
3107 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3110 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3112 * lib/bind/cua.bind: fix a bit.
3113 * lib/bind/emacs.bind: ditto.
3115 * lib/bind/menus.bind: remove real menu entries from there.
3117 * src/spellchecker.C: make sure we only include strings.h when
3120 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3122 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3123 function. It enlarges the maximum number of pup when needed.
3124 (add_toc2): Open a new menu if maximum number of items per menu has
3127 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3129 * src/frontends/kde/FormPrint.C: fix error reporting
3131 * src/frontends/xforms/FormDocument.C: fix compiler
3134 * lib/.cvsignore: add Literate.nw
3136 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3139 * bufferview_funcs.[Ch]
3142 * text2.C: Add support for numbers in RTL text.
3144 2000-10-06 Allan Rae <rae@lyx.org>
3146 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3147 to be gettext.m4 friendly again. ext_l10n.h is now
3148 generated into $top_srcdir instead of $top_builddir
3149 so that lyx.pot will be built correctly -- without
3150 duplicate parsing of ext_l10n.h.
3152 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3154 * src/frontends/kde/FormCitation.C: make the dialog
3155 behave more sensibly
3157 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3159 * config/kde.m4: fix consecutive ./configure runs,
3160 look for qtarch, fix library order
3162 * src/frontends/kde/Makefile.am: tidy up,
3163 add Print dialog, add .dlg dependencies
3165 * src/frontends/kde/FormPrint.C:
3166 * src/frontends/kde/FormPrint.h:
3167 * src/frontends/kde/formprintdialog.C:
3168 * src/frontends/kde/formprintdialog.h:
3169 * src/frontends/kde/formprintdialogdata.C:
3170 * src/frontends/kde/formprintdialogdata.h:
3171 * src/frontends/kde/dlg/formprintdialog.dlg: add
3174 * src/frontends/kde/dlg/README: Added explanatory readme
3176 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3177 script to double-check qtarch's output
3179 * src/frontends/kde/formindexdialog.C:
3180 * src/frontends/kde/formindexdialogdata.C:
3181 * src/frontends/kde/formindexdialogdata.h:
3182 * src/frontends/kde/dlg/formindexdialog.dlg: update
3183 for qtarch, minor fixes
3185 2000-10-05 Allan Rae <rae@lyx.org>
3187 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3188 dialogs when switching buffers update them instead. It's up to each
3189 dialog to decide if it should still be visible or not.
3190 update() should return a bool to control visiblity within show().
3191 Or perhaps better to set a member variable and use that to control
3194 * lib/build-listerrors: create an empty "listerrors" file just to stop
3195 make trying to regenerate it all the time if you don't have noweb
3198 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3200 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3201 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3202 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3203 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3204 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3206 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3208 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3210 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3211 deleting buffer. Closes all buffer-dependent dialogs.
3213 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3215 * src/frontends/xforms/FormCitation.[Ch]:
3216 * src/frontends/xforms/FormPreferences.[Ch]:
3217 * src/frontends/xforms/FormPrint.[Ch]:
3218 * src/frontends/xforms/FormRef.[Ch]:
3219 * src/frontends/xforms/FormUrl.[Ch]: ditto
3221 * src/frontends/xforms/FormDocument.[Ch]:
3222 * src/frontends/xforms/forms/form_document.C.patch:
3223 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3224 pass through a single input() function.
3226 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3228 * lib/build-listerrors: return status as OK
3230 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3232 * lib/lyxrc.example: Updated to new export code
3234 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3236 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3239 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3242 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3243 LyX-Code is defined.
3244 * lib/layouts/amsbook.layout: ditto.
3246 * boost/Makefile.am: fix typo.
3248 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3250 (add_lastfiles): removed.
3251 (add_documents): removed.
3252 (add_formats): removed.
3254 * src/frontends/Menubar.C: remove useless "using" directive.
3256 * src/MenuBackend.h: add a new MenuItem constructor.
3258 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3261 2000-10-04 Allan Rae <rae@lyx.org>
3263 * lib/Makefile.am (listerrors):
3264 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3265 I haven't got notangle installed so Kayvan please test. The output
3266 should end up in $builddir. This also allows people who don't have
3267 noweb installed to complete the make process without error.
3269 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3270 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3271 by JMarc's picky compiler.
3273 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3276 * src/insets/insettabular.C (setPos): change for loop to not use
3277 sequencing operator. Please check this Jürgen.
3279 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3281 * src/insets/insetcite.C (getScreenLabel): ditto
3282 * src/support/filetools.C (QuoteName): ditto
3283 (ChangeExtension): ditto
3285 * src/BufferView_pimpl.C (scrollCB): make heigt int
3287 * src/BufferView2.C (insertInset): comment out unused arg
3289 * boost/Makefile.am (EXTRADIST): new variable
3291 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3293 * src/exporter.C (IsExportable): Fixed
3295 * lib/configure.m4: Small fix
3297 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3299 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3300 * src/insets/insetbib.C (bibitemWidest): ditto.
3301 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3303 2000-10-03 Juergen Vigna <jug@sad.it>
3305 * src/BufferView2.C (theLockingInset): removed const because of
3306 Agnus's compile problems.
3308 * src/insets/insettext.C (LocalDispatch): set the language of the
3309 surronding paragraph on inserting the first character.
3311 * various files: changed use of BufferView::the_locking_inset.
3313 * src/BufferView2.C (theLockingInset):
3314 (theLockingInset): new functions.
3316 * src/BufferView.h: removed the_locking_inset.
3318 * src/lyxtext.h: added the_locking_inset
3320 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3322 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3324 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3326 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3327 * src/mathed/math_cursor.C (IsAlpha): ditto.
3328 * src/mathed/math_inset.C (strnew): ditto.
3329 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3330 (IMetrics): cxp set but never used; removed.
3331 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3332 that the variable in question has been removed also!
3335 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3336 using the Buffer * passed to Latex(), using the BufferView * passed to
3337 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3339 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3340 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3342 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3343 * src/buffer.C (readInset): used new InsetBibtex c-tor
3344 * (getBibkeyList): used new InsetBibtex::getKeys
3346 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3349 * lib/build-listerrors
3351 * src/exporter.C: Add literate programming support to the export code
3354 * src/lyx_cb.C: Remove old literate code.
3356 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3359 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3360 * src/converter.C (View, Convert): Use QuoteName.
3362 * src/insets/figinset.C (Preview): Use Formats::View.
3364 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3366 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3368 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3369 the top of the function, because compaq cxx complains that the
3370 "goto exit_with_message" when the function is disabled bypasses
3372 (MenuNew): try a better fix for the generation of new file names.
3373 This time, I used AddName() instead of AddPath(), hoping Juergen
3376 2000-10-03 Allan Rae <rae@lyx.org>
3378 * src/frontends/xforms/forms/form_preferences.fd:
3379 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3380 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3381 "Look and Feel"->"General" but will need to be split up further into
3382 general output and general input tabs. Current plan is for four outer
3383 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3384 stuff; "Inputs" for input and import configuration; "Outputs" for
3385 output and export configuration; and one more whatever is left over
3386 called "General". The leftovers at present look like being which
3387 viewers to use, spellchecker, language support and might be better
3388 named "Support". I've put "Paths" in "Inputs" for the moment as this
3389 seems reasonable for now at least.
3390 One problem remains: X error kills LyX when you close Preferences.
3392 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3394 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3395 qualifier from form()
3396 * src/frontends/xforms/FormCitation.[Ch]:
3397 * src/frontends/xforms/FormCopyright.[Ch]:
3398 * src/frontends/xforms/FormDocument.[Ch]:
3399 * src/frontends/xforms/FormError.[Ch]:
3400 * src/frontends/xforms/FormIndex.[Ch]:
3401 * src/frontends/xforms/FormPreferences.[Ch]:
3402 * src/frontends/xforms/FormPrint.[Ch]:
3403 * src/frontends/xforms/FormRef.[Ch]:
3404 * src/frontends/xforms/FormToc.[Ch]:
3405 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3407 * src/frontends/xforms/FormCitation.[Ch]:
3408 * src/frontends/xforms/FormIndex.[Ch]:
3409 * src/frontends/xforms/FormRef.[Ch]:
3410 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3411 with Allan's naming policy
3413 * src/frontends/xforms/FormCitation.C: some static casts to remove
3416 2000-10-02 Juergen Vigna <jug@sad.it>
3418 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3419 now you can type or do stuff inside the table-cell also when in dummy
3420 position, fixed visible cursor.
3422 * src/insets/insettext.C (Edit): fixing cursor-view position.
3424 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3425 be used for equal functions in lyxfunc and insettext.
3427 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3429 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3431 * src/frontends/gnome/FormCitation.h:
3432 * src/frontends/gnome/FormCopyright.h:
3433 * src/frontends/gnome/FormIndex.h:
3434 * src/frontends/gnome/FormPrint.h:
3435 * src/frontends/gnome/FormToc.h:
3436 * src/frontends/gnome/FormUrl.h:
3437 * src/frontends/kde/FormCitation.h:
3438 * src/frontends/kde/FormCopyright.h:
3439 * src/frontends/kde/FormIndex.h:
3440 * src/frontends/kde/FormRef.h:
3441 * src/frontends/kde/FormToc.h:
3442 * src/frontends/kde/FormUrl.h: fix remaining users of
3445 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3447 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3448 from depth argument.
3449 (DocBookHandleCaption): ditto.
3450 (DocBookHandleFootnote): ditto.
3451 (SimpleDocBookOnePar): ditto.
3453 * src/frontends/xforms/FormDocument.h (form): remove extra
3454 FormDocument:: qualifier.
3456 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3458 * sigc++/handle.h: ditto.
3460 * src/lyx_gui_misc.C: add "using" directive.
3462 * src/cheaders/cstddef: new file, needed by the boost library (for
3465 2000-10-02 Juergen Vigna <jug@sad.it>
3467 * src/insets/insettext.C (SetFont): better support.
3469 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3471 * src/screen.C (DrawOneRow): some uint refixes!
3473 2000-10-02 Allan Rae <rae@lyx.org>
3475 * boost/.cvsignore: ignore Makefile as well
3477 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3478 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3480 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3481 Left this one out by accident.
3483 * src/frontends/xforms/FormBase.h (restore): default to calling
3484 update() since that will restore the original/currently-applied values.
3485 Any input() triggered error messages will require the derived classes
3486 to redefine restore().
3488 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3489 avoid a segfault. combo_doc_class is the main concern.
3491 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3493 * Simplify build-listerrors in view of GUI-less export ability!
3495 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3497 * src/lyx_main.C (easyParse): Disable gui when exporting
3499 * src/insets/figinset.C:
3502 * src/lyx_gui_misc.C
3503 * src/tabular.C: Changes to allow no-gui.
3505 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3507 * src/support/utility.hpp: removed file
3508 * src/support/block.h: removed file
3510 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3513 * src/mathed/formula.C: add support/lyxlib.h
3514 * src/mathed/formulamacro.C: ditto
3516 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3517 * src/lyxparagraph.h: ditto
3519 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3520 * src/frontends/Makefile.am (INCLUDES): ditto
3521 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3522 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3523 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3524 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3525 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3526 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3528 * src/BufferView.h: use boost/utility.hpp
3529 * src/LColor.h: ditto
3530 * src/LaTeX.h: ditto
3531 * src/LyXAction.h: ditto
3532 * src/LyXView.h: ditto
3533 * src/bufferlist.h: ditto
3534 * src/lastfiles.h: ditto
3535 * src/layout.h: ditto
3536 * src/lyx_gui.h: ditto
3537 * src/lyx_main.h: ditto
3538 * src/lyxlex.h: ditto
3539 * src/lyxrc.h: ditto
3540 * src/frontends/ButtonPolicies.h: ditto
3541 * src/frontends/Dialogs.h: ditto
3542 * src/frontends/xforms/FormBase.h: ditto
3543 * src/frontends/xforms/FormGraphics.h: ditto
3544 * src/frontends/xforms/FormParagraph.h: ditto
3545 * src/frontends/xforms/FormTabular.h: ditto
3546 * src/graphics/GraphicsCache.h: ditto
3547 * src/graphics/Renderer.h: ditto
3548 * src/insets/ExternalTemplate.h: ditto
3549 * src/insets/insetcommand.h: ditto
3550 * src/support/path.h: ditto
3552 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3553 and introduce clause for 2.97.
3555 * boost/libs/README: new file
3557 * boost/boost/utility.hpp: new file
3559 * boost/boost/config.hpp: new file
3561 * boost/boost/array.hpp: new file
3563 * boost/Makefile.am: new file
3565 * boost/.cvsignore: new file
3567 * configure.in (AC_OUTPUT): add boost/Makefile
3569 * Makefile.am (SUBDIRS): add boost
3571 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3573 * src/support/lstrings.C (suffixIs): Fixed.
3575 2000-10-01 Allan Rae <rae@lyx.org>
3577 * src/PrinterParams.h: moved things around to avoid the "can't
3578 inline call" warning.
3580 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3581 into doc++ documentation.
3583 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3585 * src/frontends/xforms/FormRef.C: make use of button controller
3586 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3587 cleaned up button controller usage.
3588 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3589 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3590 use the button controller
3592 * src/frontends/xforms/forms/*.fd: and associated generated files
3593 updated to reflect changes to FormBase. Some other FormXxxx files
3594 also got minor updates to reflect changes to FormBase.
3596 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3597 (hide): made virtual.
3598 (input): return a bool. true == valid input
3599 (RestoreCB, restore): new
3600 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3601 Changes to allow derived dialogs to use a ButtonController and
3602 make sense when doing so: OK button calls ok() and so on.
3604 * src/frontends/xforms/ButtonController.h (class ButtonController):
3605 Switch from template implementation to taking Policy parameter.
3606 Allows FormBase to provide a ButtonController for any dialog.
3608 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3609 Probably should rename connect and disconnect.
3610 (apply): use the radio button groups
3611 (form): needed by FormBase
3612 (build): setup the radio button groups
3614 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3616 * several files: type changes to reduce the number of warnings and
3617 to unify type hangling a bit. Still much to do.
3619 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3621 * lib/images/*: rename a bunch of icons to match Dekel converter
3624 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3627 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3629 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3631 * sigc++/handle.h: ditto for class Handle.
3633 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3635 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3637 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3639 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3640 removal of the "default" language.
3642 * src/combox.h (getline): Check that sel > 0
3644 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3646 * lib/examples/docbook_example.lyx
3647 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3649 * lib/layouts/docbook-book.layout: new docbook book layout.
3651 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3653 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3655 * src/insets/figinset.C (DocBook):fixed small typo.
3657 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3659 * src/insets/insetinclude.h: string include_label doesn't need to be
3662 2000-09-29 Allan Rae <rae@lyx.org>
3664 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3665 Allow derived type to control connection and disconnection from signals
3666 of its choice if desired.
3668 2000-09-28 Juergen Vigna <jug@sad.it>
3670 * src/insets/insettabular.C (update): fixed cursor setting when
3671 the_locking_inset changed.
3672 (draw): made this a bit cleaner.
3673 (InsetButtonPress): fixed!
3675 * various files: added LyXText Parameter to fitCursor call.
3677 * src/BufferView.C (fitCursor): added LyXText parameter.
3679 * src/insets/insettabular.C (draw): small draw fix.
3681 * src/tabular.C: right setting of left/right celllines.
3683 * src/tabular.[Ch]: fixed various types in funcions and structures.
3684 * src/insets/insettabular.C: ditto
3685 * src/frontends/xforms/FormTabular.C: ditto
3687 2000-09-28 Allan Rae <rae@lyx.org>
3689 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3690 that the #ifdef's had been applied to part of what should have been
3691 a complete condition. It's possible there are other tests that
3692 were specific to tables that are also wrong now that InsetTabular is
3693 being used. Now we need to fix the output of '\n' after a table in a
3694 float for the same reason as the original condition:
3695 "don't insert this if we would be adding it before or after a table
3696 in a float. This little trick is needed in order to allow use of
3697 tables in \subfigures or \subtables."
3698 Juergen can you check this?
3700 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3702 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3703 output to the ostream.
3705 * several files: fixed types based on warnings from cxx
3707 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3709 * src/frontends/kde/Makefile.am: fix rule for
3710 formindexdialogdata_moc.C
3712 * src/.cvsignore: add ext_l10n.h to ignore
3714 * acconfig.h: stop messing with __STRICT_ANSI__
3715 * config/gnome.m4: remove option to set -ansi
3716 * config/kde.m4: remove option to set -ansi
3717 * config/lyxinclude.m4: don't set -ansi
3719 2000-09-27 Juergen Vigna <jug@sad.it>
3721 * various files: remove "default" language check.
3723 * src/insets/insetquotes.C: removed use of current_view.
3725 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3726 the one should have red ears by now!
3728 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3729 in more then one paragraph. Fixed cursor-movement/selection.
3731 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3732 paragraphs inside a text inset.
3734 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3735 text-inset if this owner is an inset.
3737 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3739 * src/Bullet.h: changed type of font, character and size to int
3741 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3743 * src/insets/inseturl.[Ch]:
3744 * src/insets/insetref.[Ch]:
3745 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3747 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3749 * src/buffer.C (readFile): block-if statement rearranged to minimise
3750 bloat. Patch does not reverse Jean-Marc's change ;-)
3752 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3753 Class rewritten to store pointers to hide/update signals directly,
3754 rather than Dialogs *. Also defined an enum to ease use. All xforms
3755 forms can now be derived from this class.
3757 * src/frontends/xforms/FormCommand.[Ch]
3758 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3760 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3763 * src/frontends/xforms/forms/form_citation.fd
3764 * src/frontends/xforms/forms/form_copyright.fd
3765 * src/frontends/xforms/forms/form_error.fd
3766 * src/frontends/xforms/forms/form_index.fd
3767 * src/frontends/xforms/forms/form_ref.fd
3768 * src/frontends/xforms/forms/form_toc.fd
3769 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3771 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3773 * src/insets/insetfoot.C: removed redundent using directive.
3775 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3777 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3778 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3780 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3781 created in the constructors in different groups. Then set() just
3782 have to show the groups as needed. This fixes the redraw problems
3783 (and is how the old menu code worked).
3785 * src/support/lyxlib.h: declare the methods as static when we do
3786 not have namespaces.
3788 2000-09-26 Juergen Vigna <jug@sad.it>
3790 * src/buffer.C (asciiParagraph): new function.
3791 (writeFileAscii): new function with parameter ostream.
3792 (writeFileAscii): use now asciiParagraph.
3794 * various inset files: added the linelen parameter to the Ascii-func.
3796 * src/tabular.C (Write): fixed error in writing file introduced by
3797 the last changes from Lars.
3799 * lib/bind/menus.bind: removed not supported functions.
3801 * src/insets/insettext.C (Ascii): implemented this function.
3803 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3805 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3806 (Write): use of the write_attribute functions.
3808 * src/bufferlist.C (close): fixed reasking question!
3810 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3812 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3813 new files use the everwhere possible.
3816 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3817 src/log_form.C src/lyx.C:
3820 * src/buffer.C (runLaTeX): remove func
3822 * src/PaperLayout.C: removed file
3823 * src/ParagraphExtra.C: likewise
3824 * src/bullet_forms.C: likewise
3825 * src/bullet_forms.h: likewise
3826 * src/bullet_forms_cb.C: likewise
3828 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3829 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3832 * several files: remove all traces of the old fd_form_paragraph,
3833 and functions belonging to that.
3835 * several files: remove all traces of the old fd_form_document,
3836 and functions belonging to that.
3838 * several files: constify local variables were possible.
3840 * several files: remove all code that was dead when NEW_EXPORT was
3843 * several files: removed string::c_str in as many places as
3846 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3847 (e): be a bit more outspoken when patching
3848 (updatesrc): only move files if changed.
3850 * forms/layout_forms.h.patch: regenerated
3852 * forms/layout_forms.fd: remove form_document and form_paragraph
3853 and form_quotes and form_paper and form_table_options and
3854 form_paragraph_extra
3856 * forms/form1.fd: remove form_table
3858 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3859 the fdui->... rewrite. Update some comments to xforms 0.88
3861 * forms/bullet_forms.C.patch: removed file
3862 * forms/bullet_forms.fd: likewise
3863 * forms/bullet_forms.h.patch: likewise
3865 * development/Code_rules/Rules: added a section on switch
3866 statements. Updated some comment to xforms 0.88.
3868 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3870 * src/buffer.C (readFile): make sure that the whole version number
3871 is read after \lyxformat (even when it contains a comma)
3873 * lib/ui/default.ui: change shortcut of math menu to M-a.
3875 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3877 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3880 * src/LyXView.C (updateWindowTitle): show the full files name in
3881 window title, limited to 30 characters.
3883 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3884 When a number of characters has been given, we should not assume
3885 that the string is 0-terminated.
3887 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3888 calls (fixes some memory leaks)
3890 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3891 trans member on exit.
3893 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3895 * src/converter.C (GetReachable): fix typo.
3897 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3898 understand ',' instead of '.'.
3899 (GetInteger): rewrite to use strToInt().
3901 2000-09-26 Juergen Vigna <jug@sad.it>
3903 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3904 better visibility and error-message on wrong VSpace input.
3906 * src/language.C (initL): added english again.
3908 2000-09-25 Juergen Vigna <jug@sad.it>
3910 * src/frontends/kde/Dialogs.C (Dialogs):
3911 * src/frontends/gnome/Dialogs.C (Dialogs):
3912 * src/frontends/kde/Makefile.am:
3913 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3915 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3917 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3919 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3921 * src/frontends/xforms/FormParagraph.C:
3922 * src/frontends/xforms/FormParagraph.h:
3923 * src/frontends/xforms/form_paragraph.C:
3924 * src/frontends/xforms/form_paragraph.h:
3925 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3928 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3930 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3931 Paragraph-Data after use.
3933 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3934 non breakable paragraphs.
3936 2000-09-25 Garst R. Reese <reese@isn.net>
3938 * src/language.C (initL): added missing language_country codes.
3940 2000-09-25 Juergen Vigna <jug@sad.it>
3942 * src/insets/insettext.C (InsetText):
3943 (deleteLyXText): remove the not released LyXText structure!
3945 2000-09-24 Marko Vendelin <markov@ioc.ee>
3947 * src/frontends/gnome/mainapp.C
3948 * src/frontends/gnome/mainapp.h: added support for keyboard
3951 * src/frontends/gnome/FormCitation.C
3952 * src/frontends/gnome/FormCitation.h
3953 * src/frontends/gnome/Makefile.am
3954 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3955 FormCitation to use "action area" in mainapp window
3957 * src/frontends/gnome/Menubar_pimpl.C
3958 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3961 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3963 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3964 width/descent/ascent values if name is empty.
3965 (mathed_string_height): Use std::max.
3967 2000-09-25 Allan Rae <rae@lyx.org>
3969 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3970 segfault. This will be completely redesigned soon.
3972 * sigc++: updated libsigc++. Fixes struct timespec bug.
3974 * development/tools/makeLyXsigc.sh: .cvsignore addition
3976 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3978 * several files: removed almost all traces of the old table
3981 * src/TableLayout.C: removed file
3983 2000-09-22 Juergen Vigna <jug@sad.it>
3985 * src/frontends/kde/Dialogs.C: added credits forms.
3987 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3989 * src/frontends/gnome/Dialogs.C: added some forms.
3991 * src/spellchecker.C (init_spell_checker): set language in pspell code
3992 (RunSpellChecker): some modifications for setting language string.
3994 * src/language.[Ch]: added language_country code.
3996 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3998 * src/frontends/Dialogs.h: added new signal showError.
3999 Rearranged existing signals in some sort of alphabetical order.
4001 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
4002 FormError.[Ch], form_error.[Ch]
4003 * src/frontends/xforms/forms/makefile: added new file form_error.fd
4004 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
4006 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
4007 dialogs. I think that this can be used as the base to all these
4010 * src/frontends/xforms/FormError.[Ch]
4011 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
4012 implementation of InsetError dialog.
4014 * src/insets/inseterror.[Ch]: rendered GUI-independent.
4016 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
4017 * src/frontends/kde/Makefile.am: ditto
4019 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
4021 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
4022 macrobf. This fixes a bug of invisible text.
4024 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4026 * lib/doc/LaTeXConfig.lyx.in: updated.
4028 * src/language.C (initL): remove language "francais" and change a
4029 bit the names of the two other french variations.
4031 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
4032 string that may not be 0-terminated.
4034 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4036 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
4038 2000-09-20 Marko Vendelin <markov@ioc.ee>
4040 * src/frontends/gnome/FormCitation.C
4041 * src/frontends/gnome/FormIndex.C
4042 * src/frontends/gnome/FormToc.C
4043 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
4044 the variable initialization to shut up the warnings
4046 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4048 * src/table.[Ch]: deleted files
4050 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
4053 2000-09-18 Juergen Vigna <jug@sad.it>
4055 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
4056 problems with selection. Inserted new LFUN_PASTESELECTION.
4057 (InsetButtonPress): inserted handling of middle mouse-button paste.
4059 * src/spellchecker.C: changed word to word.c_str().
4061 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
4063 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
4064 included in the ``make dist'' tarball.
4066 2000-09-15 Juergen Vigna <jug@sad.it>
4068 * src/CutAndPaste.C (cutSelection): small fix return the right
4069 end position after cut inside one paragraph only.
4071 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
4072 we are locked as otherwise we don't have a valid cursor position!
4074 * src/insets/figinset.C (draw): small bugfix but why is this needed???
4076 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
4078 * src/frontends/kde/FormRef.C: added using directive.
4079 * src/frontends/kde/FormToc.C: ditto
4081 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
4083 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
4085 2000-09-19 Marko Vendelin <markov@ioc.ee>
4087 * src/frontends/gnome/Menubar_pimpl.C
4088 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
4089 Toc, ViewFormats, UpdateFormats, and ExportFormats.
4091 * src/frontends/gnome/mainapp.C
4092 * src/frontends/gnome/mainapp.h: support for menu update used
4095 * src/frontends/gnome/mainapp.C
4096 * src/frontends/gnome/mainapp.h: support for "action" area in the
4097 main window. This area is used by small simple dialogs, such as
4100 * src/frontends/gnome/FormIndex.C
4101 * src/frontends/gnome/FormIndex.h
4102 * src/frontends/gnome/FormUrl.C
4103 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4106 * src/frontends/gnome/FormCitation.C
4107 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4108 action area. Only "Insert new citation" is implemented.
4110 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4112 * src/buffer.C (Dispatch): fix call to Dispatch
4113 * src/insets/insetref.C (Edit): likewise
4114 * src/insets/insetparent.C (Edit): likewise
4115 * src/insets/insetinclude.C (include_cb): likewise
4116 * src/frontends/xforms/FormUrl.C (apply): likewise
4117 * src/frontends/xforms/FormToc.C (apply): likewise
4118 * src/frontends/xforms/FormRef.C (apply): likewise
4119 * src/frontends/xforms/FormIndex.C (apply): likewise
4120 * src/frontends/xforms/FormCitation.C (apply): likewise
4121 * src/lyxserver.C (callback): likewise
4122 * src/lyxfunc.C (processKeySym): likewise
4123 (Dispatch): likewise
4124 (Dispatch): likewise
4125 * src/lyx_cb.C (LayoutsCB): likewise
4127 * Makefile.am (sourcedoc): small change
4129 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4131 * src/main.C (main): Don't make an empty GUIRunTime object. all
4132 methods are static. constify a bit remove unneded using + headers.
4134 * src/tabular.C: some more const to local vars move some loop vars
4136 * src/spellchecker.C: added some c_str after some word for pspell
4138 * src/frontends/GUIRunTime.h: add new static method setDefaults
4139 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4140 * src/frontends/kde/GUIRunTime.C (setDefaults):
4141 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4143 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4144 with strnew in arg, use correct emptystring when calling SetName.
4146 * several files: remove all commented code with relation to
4147 HAVE_SSTREAM beeing false. We now only support stringstream and
4150 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4152 * src/lyxfunc.C: construct correctly the automatic new file
4155 * src/text2.C (IsStringInText): change type of variable i to shut
4158 * src/support/sstream.h: do not use namespaces if the compiler
4159 does not support them.
4161 2000-09-15 Marko Vendelin <markov@ioc.ee>
4162 * src/frontends/gnome/FormCitation.C
4163 * src/frontends/gnome/FormCitation.h
4164 * src/frontends/gnome/diainsertcitation_interface.c
4165 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4166 regexp support to FormCitation [Gnome].
4168 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4171 * configure.in: remove unused KDE/GTKGUI define
4173 * src/frontends/kde/FormRef.C
4174 * src/frontends/kde/FormRef.h
4175 * src/frontends/kde/formrefdialog.C
4176 * src/frontends/kde/formrefdialog.h: double click will
4177 go to reference, now it is possible to change a cross-ref
4180 * src/frontends/kde/FormToc.C
4181 * src/frontends/kde/FormToc.h
4182 * src/frontends/kde/formtocdialog.C
4183 * src/frontends/kde/formtocdialog.h: add a depth
4186 * src/frontends/kde/Makefile.am: add QtLyXView.h
4189 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4191 * src/frontends/kde/FormCitation.h: added some using directives.
4193 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4195 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4198 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4201 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4203 * src/buffer.C (pop_tag): revert for the second time a change by
4204 Lars, who seems to really hate having non-local loop variables :)
4206 * src/Lsstream.h: add "using" statements.
4208 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4209 * src/buffer.C (writeFile): ditto
4211 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4213 * src/buffer.C (writeFile): try to fix the locale modified format
4214 number to always be as we want it.
4216 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4217 in XForms 0.89. C-space is now working again.
4219 * src/Lsstream.h src/support/sstream.h: new files.
4221 * also commented out all cases where strstream were used.
4223 * src/Bullet.h (c_str): remove method.
4225 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4227 * a lot of files: get rid of "char const *" and "char *" is as
4228 many places as possible. We only want to use them in interaction
4229 with system of other libraries, not inside lyx.
4231 * a lot of files: return const object is not of pod type. This
4232 helps ensure that temporary objects is not modified. And fits well
4233 with "programming by contract".
4235 * configure.in: check for the locale header too
4237 * Makefile.am (sourcedoc): new tag for generation of doc++
4240 2000-09-14 Juergen Vigna <jug@sad.it>
4242 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4243 callback to check which combo called it and do the right action.
4245 * src/combox.C (combo_cb): added combo * to the callbacks.
4246 (Hide): moved call of callback after Ungrab of the pointer.
4248 * src/intl.h: removed LCombo2 function.
4250 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4251 function as this can now be handled in one function.
4253 * src/combox.h: added Combox * to callback prototype.
4255 * src/frontends/xforms/Toolbar_pimpl.C:
4256 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4258 2000-09-14 Garst Reese <reese@isn.net>
4260 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4261 moved usepackage{xxx}'s to beginning of file. Changed left margin
4262 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4263 underlining from title. Thanks to John Culleton for useful suggestions.
4265 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4267 * src/lyxlex_pimpl.C (setFile): change error message to debug
4270 2000-09-13 Juergen Vigna <jug@sad.it>
4272 * src/frontends/xforms/FormDocument.C: implemented choice_class
4273 as combox and give callback to combo_language so OK/Apply is activated
4276 * src/bufferlist.C (newFile): small fix so already named files
4277 (via an open call) are not requested to be named again on the
4280 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4282 * src/frontends/kde/Makefile.am
4283 * src/frontends/kde/FormRef.C
4284 * src/frontends/kde/FormRef.h
4285 * src/frontends/kde/formrefdialog.C
4286 * src/frontends/kde/formrefdialog.h: implement
4289 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4291 * src/frontends/kde/formtocdialog.C
4292 * src/frontends/kde/formtocdialog.h
4293 * src/frontends/kde/FormToc.C
4294 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4296 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4298 * src/frontends/kde/FormCitation.C: fix thinko
4299 where we didn't always display the reference text
4302 * src/frontends/kde/formurldialog.C
4303 * src/frontends/kde/formurldialog.h
4304 * src/frontends/kde/FormUrl.C
4305 * src/frontends/kde/FormUrl.h: minor cleanups
4307 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4309 * src/frontends/kde/Makefile.am
4310 * src/frontends/kde/FormToc.C
4311 * src/frontends/kde/FormToc.h
4312 * src/frontends/kde/FormCitation.C
4313 * src/frontends/kde/FormCitation.h
4314 * src/frontends/kde/FormIndex.C
4315 * src/frontends/kde/FormIndex.h
4316 * src/frontends/kde/formtocdialog.C
4317 * src/frontends/kde/formtocdialog.h
4318 * src/frontends/kde/formcitationdialog.C
4319 * src/frontends/kde/formcitationdialog.h
4320 * src/frontends/kde/formindexdialog.C
4321 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4323 2000-09-12 Juergen Vigna <jug@sad.it>
4325 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4328 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4330 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4333 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4335 * src/converter.C (Add, Convert): Added support for converter flags:
4336 needaux, resultdir, resultfile.
4337 (Convert): Added new parameter view_file.
4338 (dvips_options): Fixed letter paper option.
4340 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4341 (Export, GetExportableFormats, GetViewableFormats): Added support
4344 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4346 (easyParse): Fixed to work with new export code.
4348 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4351 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4353 * lib/bind/*.bind: Replaced
4354 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4355 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4357 2000-09-11 Juergen Vigna <jug@sad.it>
4359 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4361 * src/main.C (main): now GUII defines global guiruntime!
4363 * src/frontends/gnome/GUIRunTime.C (initApplication):
4364 * src/frontends/kde/GUIRunTime.C (initApplication):
4365 * src/frontends/xforms/GUIRunTime.C (initApplication):
4366 * src/frontends/GUIRunTime.h: added new function initApplication.
4368 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4370 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4372 2000-09-08 Juergen Vigna <jug@sad.it>
4374 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4375 we have already "Reset".
4377 * src/language.C (initL): inserted "default" language and made this
4378 THE default language (and not american!)
4380 * src/paragraph.C: inserted handling of "default" language!
4382 * src/lyxfont.C: ditto
4386 * src/paragraph.C: output the \\par only if we have a following
4387 paragraph otherwise it's not needed.
4389 2000-09-05 Juergen Vigna <jug@sad.it>
4391 * config/pspell.m4: added entry to lyx-flags
4393 * src/spellchecker.C: modified version from Kevin for using pspell
4395 2000-09-01 Marko Vendelin <markov@ioc.ee>
4396 * src/frontends/gnome/Makefile.am
4397 * src/frontends/gnome/FormCitation.C
4398 * src/frontends/gnome/FormCitation.h
4399 * src/frontends/gnome/diainsertcitation_callbacks.c
4400 * src/frontends/gnome/diainsertcitation_callbacks.h
4401 * src/frontends/gnome/diainsertcitation_interface.c
4402 * src/frontends/gnome/diainsertcitation_interface.h
4403 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4404 dialog for Gnome frontend
4406 * src/main.C: Gnome libraries require keeping application name
4407 and its version as strings
4409 * src/frontends/gnome/mainapp.C: Change the name of the main window
4410 from GnomeLyX to PACKAGE
4412 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4414 * src/frontends/Liason.C: add "using: declaration.
4416 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4418 * src/mathed/math_macro.C (Metrics): Set the size of the template
4420 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4422 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4424 * src/converter.C (add_options): New function.
4425 (SetViewer): Change $$FName into '$$FName'.
4426 (View): Add options when running xdvi
4427 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4428 (Convert): The 3rd parameter is now the desired filename. Converts
4429 calls to lyx::rename if necessary.
4430 Add options when running dvips.
4431 (dvi_papersize,dvips_options): New methods.
4433 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4435 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4436 using a call to Converter::dvips_options.
4437 Fixed to work with nex export code.
4439 * src/support/copy.C
4440 * src/support/rename.C: New files
4442 * src/support/syscall.h
4443 * src/support/syscall.C: Added Starttype SystemDontWait.
4445 * lib/ui/default.ui: Changed to work with new export code
4447 * lib/configure.m4: Changed to work with new export code
4449 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4451 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4453 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4454 so that code compiles with DEC cxx.
4456 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4457 to work correctly! Also now supports the additional elements
4460 2000-09-01 Allan Rae <rae@lyx.org>
4462 * src/frontends/ButtonPolicies.C: renamed all the references to
4463 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4465 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4466 since it's a const not a type.
4468 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4470 2000-08-31 Juergen Vigna <jug@sad.it>
4472 * src/insets/figinset.C: Various changes to look if the filename has
4473 an extension and if not add it for inline previewing.
4475 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4477 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4478 make buttonStatus and isReadOnly be const methods. (also reflect
4479 this in derived classes.)
4481 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4482 (nextState): change to be static inline, pass the StateMachine as
4484 (PreferencesPolicy): remove casts
4485 (OkCancelPolicy): remvoe casts
4486 (OkCancelReadOnlyPolicy): remove casts
4487 (NoRepeatedApplyReadOnlyPolicy): remove casts
4488 (OkApplyCancelReadOnlyPolicy): remove casts
4489 (OkApplyCancelPolicy): remove casts
4490 (NoRepeatedApplyPolicy): remove casts
4492 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4494 * src/converter.C: added some using directives
4496 * src/frontends/ButtonPolicies.C: changes to overcome
4497 "need lvalue" error with DEC c++
4499 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4500 to WMHideCB for DEC c++
4502 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4504 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4505 to BulletBMTableCB for DEC c++
4507 2000-08-31 Allan Rae <rae@lyx.org>
4509 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4510 character dialog separately from old document dialogs combo_language.
4513 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4515 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4516 Removed LFUN_REF_CREATE.
4518 * src/MenuBackend.C: Added new tags: toc and references
4520 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4521 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4523 (add_toc, add_references): New methods.
4524 (create_submenu): Handle correctly the case when there is a
4525 seperator after optional menu items.
4527 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4528 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4529 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4531 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4533 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4535 * src/converter.[Ch]: New file for converting between different
4538 * src/export.[Ch]: New file for exporting a LyX file to different
4541 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4542 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4543 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4544 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4545 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4546 RunDocBook, MenuExport.
4548 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4549 Exporter::Preview methods if NEW_EXPORT is defined.
4551 * src/buffer.C (Dispatch): Use Exporter::Export.
4553 * src/lyxrc.C: Added new tags: \converter and \viewer.
4556 * src/LyXAction.C: Define new lyx-function: buffer-update.
4557 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4558 when NEW_EXPORT is defined.
4560 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4562 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4564 * lib/ui/default.ui: Added submenus "view" and "update" to the
4567 * src/filetools.C (GetExtension): New function.
4569 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4571 2000-08-29 Allan Rae <rae@lyx.org>
4573 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4575 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4576 (EnableDocumentLayout): removed
4577 (DisableDocumentLayout): removed
4578 (build): make use of ButtonController's read-only handling to
4579 de/activate various objects. Replaces both of the above functions.
4581 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4582 (readOnly): was read_only
4583 (refresh): fixed dumb mistakes with read_only_ handling
4585 * src/frontends/xforms/forms/form_document.fd:
4586 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4587 tabbed dialogs so the tabs look more like tabs and so its easier to
4588 work out which is the current tab.
4590 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4591 segfault with form_table
4593 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4595 2000-08-28 Juergen Vigna <jug@sad.it>
4597 * acconfig.h: added USE_PSPELL.
4599 * src/config.h.in: added USE_PSPELL.
4601 * autogen.sh: added pspell.m4
4603 * config/pspell.m4: new file.
4605 * src/spellchecker.C: implemented support for pspell libary.
4607 2000-08-25 Juergen Vigna <jug@sad.it>
4609 * src/LyXAction.C (init): renamed LFUN_TABLE to
4610 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4612 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4614 * src/lyxscreen.h: add force_clear variable and fuction to force
4615 a clear area when redrawing in LyXText.
4617 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4619 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4621 * some whitespace and comment changes.
4623 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4625 * src/buffer.C: up te LYX_FORMAT to 2.17
4627 2000-08-23 Juergen Vigna <jug@sad.it>
4629 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4632 * src/insets/insettabular.C (pasteSelection): delete the insets
4633 LyXText as it is not valid anymore.
4634 (copySelection): new function.
4635 (pasteSelection): new function.
4636 (cutSelection): new function.
4637 (LocalDispatch): implemented cut/copy/paste of cell selections.
4639 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4640 don't have a LyXText.
4642 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4644 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4647 2000-08-22 Juergen Vigna <jug@sad.it>
4649 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4650 ifdef form_table out if NEW_TABULAR.
4652 2000-08-21 Juergen Vigna <jug@sad.it>
4654 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4655 (draw): fixed draw position so that the cursor is positioned in the
4657 (InsetMotionNotify): hide/show cursor so the position is updated.
4658 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4659 using cellstart() function where it should be used.
4661 * src/insets/insettext.C (draw): ditto.
4663 * src/tabular.C: fixed initialization of some missing variables and
4664 made BoxType into an enum.
4666 2000-08-22 Marko Vendelin <markov@ioc.ee>
4667 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4668 stock menu item using action numerical value, not its string
4672 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4674 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4675 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4677 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4679 * src/frontends/xforms/GUIRunTime.C: new file
4681 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4682 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4684 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4686 * src/frontends/kde/GUIRunTime.C: new file
4688 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4689 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4691 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4693 * src/frontends/gnome/GUIRunTime.C: new file
4695 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4698 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4699 small change to documetentation.
4701 * src/frontends/GUIRunTime.C: removed file
4703 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4705 * src/lyxparagraph.h: enable NEW_TABULAR as default
4707 * src/lyxfunc.C (processKeySym): remove some commented code
4709 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4710 NEW_TABULAR around the fd_form_table_options.
4712 * src/lyx_gui.C (runTime): call the static member function as
4713 GUIRunTime::runTime().
4715 2000-08-21 Allan Rae <rae@lyx.org>
4717 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4720 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4722 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4724 2000-08-21 Allan Rae <rae@lyx.org>
4726 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4727 keep Garst happy ;-)
4728 * src/frontends/xforms/FormPreferences.C (build): use setOK
4729 * src/frontends/xforms/FormDocument.C (build): use setOK
4730 (FormDocument): use the appropriate policy.
4732 2000-08-21 Allan Rae <rae@lyx.org>
4734 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4735 automatic [de]activation of arbitrary objects when in a read-only state.
4737 * src/frontends/ButtonPolicies.h: More documentation
4738 (isReadOnly): added to support the above.
4740 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4742 2000-08-18 Juergen Vigna <jug@sad.it>
4744 * src/insets/insettabular.C (getStatus): changed to return func_status.
4746 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4747 display toggle menu entries if they are.
4749 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4750 new document layout now.
4752 * src/lyxfunc.C: ditto
4754 * src/lyx_gui_misc.C: ditto
4756 * src/lyx_gui.C: ditto
4758 * lib/ui/default.ui: removed paper and quotes layout as they are now
4759 all in the document layout tabbed folder.
4761 * src/frontends/xforms/forms/form_document.fd: added Restore
4762 button and callbacks for all inputs for Allan's ButtonPolicy.
4764 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4765 (CheckChoiceClass): added missing params setting on class change.
4766 (UpdateLayoutDocument): added for updating the layout on params.
4767 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4768 (FormDocument): Implemented Allan's ButtonPolicy with the
4771 2000-08-17 Allan Rae <rae@lyx.org>
4773 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4774 so we can at least see the credits again.
4776 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4777 controller calls for the appropriate callbacks. Note that since Ok
4778 calls apply followed by cancel, and apply isn't a valid input for the
4779 APPLIED state, the bc_ calls have to be made in the static callback not
4780 within each of the real callbacks.
4782 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4783 (setOk): renamed from setOkay()
4785 2000-08-17 Juergen Vigna <jug@sad.it>
4787 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4788 in the implementation part.
4789 (composeUIInfo): don't show optional menu-items.
4791 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4793 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4795 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4796 text-state when in a text-inset.
4798 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4800 2000-08-17 Marko Vendelin <markov@ioc.ee>
4801 * src/frontends/gnome/FormIndex.C
4802 * src/frontends/gnome/FormIndex.h
4803 * src/frontends/gnome/FormToc.C
4804 * src/frontends/gnome/FormToc.h
4805 * src/frontends/gnome/dialogs
4806 * src/frontends/gnome/diatoc_callbacks.c
4807 * src/frontends/gnome/diatoc_callbacks.h
4808 * src/frontends/gnome/diainsertindex_callbacks.h
4809 * src/frontends/gnome/diainsertindex_callbacks.c
4810 * src/frontends/gnome/diainsertindex_interface.c
4811 * src/frontends/gnome/diainsertindex_interface.h
4812 * src/frontends/gnome/diatoc_interface.h
4813 * src/frontends/gnome/diatoc_interface.c
4814 * src/frontends/gnome/Makefile.am: Table of Contents and
4815 Insert Index dialogs implementation for Gnome frontend
4817 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4819 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4821 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4824 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4826 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4827 destructor. Don't definde if you don't need it
4828 (processEvents): made static, non-blocking events processing for
4830 (runTime): static method. event loop for xforms
4831 * similar as above for kde and gnome.
4833 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4834 new Pimpl is correct
4835 (runTime): new method calss the real frontends runtime func.
4837 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4839 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4841 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4843 2000-08-16 Juergen Vigna <jug@sad.it>
4845 * src/lyx_gui.C (runTime): added GUII RunTime support.
4847 * src/frontends/Makefile.am:
4848 * src/frontends/GUIRunTime.[Ch]:
4849 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4850 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4851 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4853 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4855 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4856 as this is already set in ${FRONTEND_INCLUDE} if needed.
4858 * configure.in (CPPFLAGS): setting the include dir for the frontend
4859 directory and don't set FRONTEND=xforms for now as this is executed
4862 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4864 * src/frontends/kde/Makefile.am:
4865 * src/frontends/kde/FormUrl.C:
4866 * src/frontends/kde/FormUrl.h:
4867 * src/frontends/kde/formurldialog.h:
4868 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4870 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4872 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4874 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4876 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4879 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4881 * src/WorkArea.C (work_area_handler): more work to get te
4882 FL_KEYBOARD to work with xforms 0.88 too, please test.
4884 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4886 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4888 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4891 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4893 * src/Timeout.h: remove Qt::emit hack.
4895 * several files: changes to allo doc++ compilation
4897 * src/lyxfunc.C (processKeySym): new method
4898 (processKeyEvent): comment out if FL_REVISION < 89
4900 * src/WorkArea.C: change some debugging levels.
4901 (WorkArea): set wantkey to FL_KEY_ALL
4902 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4903 clearer code and the use of compose with XForms 0.89. Change to
4904 use signals instead of calling methods in bufferview directly.
4906 * src/Painter.C: change some debugging levels.
4908 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4911 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4912 (workAreaKeyPress): new method
4914 2000-08-14 Juergen Vigna <jug@sad.it>
4916 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4918 * config/kde.m4: addes some features
4920 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4921 include missing xforms dialogs.
4923 * src/Timeout.h: a hack to be able to compile with qt/kde.
4925 * sigc++/.cvsignore: added acinclude.m4
4927 * lib/.cvsignore: added listerros
4929 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4930 xforms tree as objects are needed for other frontends.
4932 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4933 linking with not yet implemented xforms objects.
4935 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4937 2000-08-14 Baruch Even <baruch.even@writeme.com>
4939 * src/frontends/xforms/FormGraphics.h:
4940 * src/frontends/xforms/FormGraphics.C:
4941 * src/frontends/xforms/RadioButtonGroup.h:
4942 * src/frontends/xforms/RadioButtonGroup.C:
4943 * src/insets/insetgraphics.h:
4944 * src/insets/insetgraphics.C:
4945 * src/insets/insetgraphicsParams.h:
4946 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4947 instead of spaces, and various other indentation issues to make the
4948 sources more consistent.
4950 2000-08-14 Marko Vendelin <markov@ioc.ee>
4952 * src/frontends/gnome/dialogs/diaprint.glade
4953 * src/frontends/gnome/FormPrint.C
4954 * src/frontends/gnome/FormPrint.h
4955 * src/frontends/gnome/diaprint_callbacks.c
4956 * src/frontends/gnome/diaprint_callbacks.h
4957 * src/frontends/gnome/diaprint_interface.c
4958 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4961 * src/frontends/gnome/dialogs/diainserturl.glade
4962 * src/frontends/gnome/FormUrl.C
4963 * src/frontends/gnome/FormUrl.h
4964 * src/frontends/gnome/diainserturl_callbacks.c
4965 * src/frontends/gnome/diainserturl_callbacks.h
4966 * src/frontends/gnome/diainserturl_interface.c
4967 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4968 Gnome implementation
4970 * src/frontends/gnome/Dialogs.C
4971 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4972 all other dialogs. Copy all unimplemented dialogs from Xforms
4975 * src/frontends/gnome/support.c
4976 * src/frontends/gnome/support.h: support files generated by Glade
4980 * config/gnome.m4: Gnome configuration scripts
4982 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4983 configure --help message
4985 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4986 only if there are no events pendling in Gnome/Gtk. This enhances
4987 the performance of menus.
4990 2000-08-14 Allan Rae <rae@lyx.org>
4992 * lib/Makefile.am: listerrors cleaning
4994 * lib/listerrors: removed -- generated file
4995 * acinclude.m4: ditto
4996 * sigc++/acinclude.m4: ditto
4998 * src/frontends/xforms/forms/form_citation.fd:
4999 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
5002 * src/frontends/xforms/forms/makefile: I renamed the `install` target
5003 `updatesrc` and now we have a `test` target that does what `updatesrc`
5004 used to do. I didn't like having an install target that wasn't related
5007 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
5008 on all except FormGraphics. This may yet happen. Followed by a major
5009 cleanup including using FL_TRANSIENT for most of the dialogs. More
5010 changes to come when the ButtonController below is introduced.
5012 * src/frontends/xforms/ButtonController.h: New file for managing up to
5013 four buttons on a dialog according to an externally defined policy.
5014 * src/frontends/xforms/Makefile.am: added above
5016 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
5017 Apply and Cancel/Close buttons and everything in between and beyond.
5018 * src/frontends/Makefile.am: added above.
5020 * src/frontends/xforms/forms/form_preferences.fd:
5021 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
5022 and removed variable 'status' as a result. Fixed the set_minsize thing.
5023 Use the new screen-font-update after checking screen fonts were changed
5024 Added a "Restore" button to restore the original lyxrc values while
5025 editing. This restores everything not just the last input changed.
5026 That's still a tricky one. As is the "LyX: this shouldn't happen..."
5028 * src/LyXAction.C: screen-font-update added for updating buffers after
5029 screen font settings have been changed.
5030 * src/commandtags.h: ditto
5031 * src/lyxfunc.C: ditto
5033 * forms/lyx.fd: removed screen fonts dialog.
5034 * src/lyx_gui.C: ditto
5035 * src/menus.[Ch]: ditto
5036 * src/lyx.[Ch]: ditto
5037 * src/lyx_cb.C: ditto + code from here moved to make
5038 screen-font-update. And people wonder why progress on GUII is
5039 slow. Look at how scattered this stuff was! It takes forever
5042 * forms/fdfix.sh: Fixup the spacing after commas.
5043 * forms/makefile: Remove date from generated files. Fewer clashes now.
5044 * forms/bullet_forms.C.patch: included someones handwritten changes
5046 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
5047 once I've discovered why LyXRC was made noncopyable.
5048 * src/lyx_main.C: ditto
5050 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
5052 * src/frontends/xforms/forms/fdfix.sh:
5053 * src/frontends/xforms/forms/fdfixh.sed:
5054 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
5055 * src/frontends/xforms/Form*.[hC]:
5056 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
5057 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
5058 provide a destructor for the struct FD_form_xxxx. Another version of
5059 the set_[max|min]size workaround and a few other cleanups. Actually,
5060 Angus' patch from 20000809.
5062 2000-08-13 Baruch Even <baruch.even@writeme.com>
5064 * src/insets/insetgraphics.C (Clone): Added several fields that needed
5067 2000-08-11 Juergen Vigna <jug@sad.it>
5069 * src/insets/insetgraphics.C (InsetGraphics): changing init
5070 order because of warnings.
5072 * src/frontends/xforms/forms/makefile: adding patching .C with
5075 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
5076 from .C.patch to .c.patch
5078 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
5079 order because of warning.
5081 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
5083 * src/frontends/Liason.C (setMinibuffer): new helper function
5085 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
5087 * src/lyxfunc.C (Dispatch): calling new Document-Layout
5089 * lib/ui/default.ui: commented out PaperLayout entry
5091 * src/frontends/xforms/form_document.[Ch]: new added files
5093 * src/frontends/xforms/FormDocument.[Ch]: ditto
5095 * src/frontends/xforms/forms/form_document.fd: ditto
5097 * src/frontends/xforms/forms/form_document.C.patch: ditto
5099 2000-08-10 Juergen Vigna <jug@sad.it>
5101 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
5102 (InsetGraphics): initialized cacheHandle to 0.
5103 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5105 2000-08-10 Baruch Even <baruch.even@writeme.com>
5107 * src/graphics/GraphicsCache.h:
5108 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5109 correctly as a cache.
5111 * src/graphics/GraphicsCacheItem.h:
5112 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5115 * src/graphics/GraphicsCacheItem_pimpl.h:
5116 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5119 * src/insets/insetgraphics.h:
5120 * src/insets/insetgraphics.C: Changed from using a signal notification
5121 to polling when image is not loaded.
5123 2000-08-10 Allan Rae <rae@lyx.org>
5125 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5126 that there are two functions that have to been taken out of line by
5127 hand and aren't taken care of in the script. (Just a reminder note)
5129 * sigc++/macros/*.h.m4: Updated as above.
5131 2000-08-09 Juergen Vigna <jug@sad.it>
5133 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5135 * src/insets/insettabular.C: make drawing of single cell smarter.
5137 2000-08-09 Marko Vendelin <markov@ioc.ee>
5138 * src/frontends/gnome/Menubar_pimpl.C
5139 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5140 implementation: new files
5142 * src/frontends/gnome/mainapp.C
5143 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5146 * src/main.C: create Gnome main window
5148 * src/frontends/xforms/Menubar_pimpl.h
5149 * src/frontends/Menubar.C
5150 * src/frontends/Menubar.h: added method Menubar::update that calls
5151 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5153 * src/LyXView.C: calls Menubar::update to update the state
5156 * src/frontends/gnome/Makefile.am: added new files
5158 * src/frontends/Makefile.am: added frontend compiler options
5160 2000-08-08 Juergen Vigna <jug@sad.it>
5162 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5164 * src/bufferlist.C (close):
5165 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5166 documents if exiting without saving.
5168 * src/buffer.C (save): use removeAutosaveFile()
5170 * src/support/filetools.C (removeAutosaveFile): new function.
5172 * src/lyx_cb.C (MenuWrite): returns a bool now.
5173 (MenuWriteAs): check if file could really be saved and revert to the
5175 (MenuWriteAs): removing old autosavefile if existant.
5177 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5178 before Goto toggle declaration, because of compiler warning.
5180 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5182 * src/lyxfunc.C (MenuNew): small fix.
5184 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5186 * src/bufferlist.C (newFile):
5187 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5189 * src/lyxrc.C: added new_ask_filename tag
5191 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5193 * src/lyx.fd: removed code pertaining to form_ref
5194 * src/lyx.[Ch]: ditto
5195 * src/lyx_cb.C: ditto
5196 * src/lyx_gui.C: ditto
5197 * src/lyx_gui_misc.C: ditto
5199 * src/BufferView_pimpl.C (restorePosition): update buffer only
5202 * src/commandtags.h (LFUN_REFTOGGLE): removed
5203 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5204 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5205 (LFUN_REFBACK): renamed LFUN_REF_BACK
5207 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5208 * src/menus.C: ditto
5209 * src/lyxfunc.C (Dispatch): ditto.
5210 InsertRef dialog is now GUI-independent.
5212 * src/texrow.C: added using std::endl;
5214 * src/insets/insetref.[Ch]: strip out large amounts of code.
5215 The inset is now a container and this functionality is now
5216 managed by a new FormRef dialog
5218 * src/frontends/Dialogs.h (showRef, createRef): new signals
5220 * src/frontends/xforms/FormIndex.[Ch],
5221 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5222 when setting dialog's min/max size
5223 * src/frontends/xforms/FormIndex.[Ch]: ditto
5225 * src/frontends/xforms/FormRef.[Ch],
5226 src/frontends/xforms/forms/form_ref.fd: new xforms
5227 implementation of an InsetRef dialog
5229 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5232 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5233 ios::nocreate is not part of the standard. Removed.
5235 2000-08-07 Baruch Even <baruch.even@writeme.com>
5237 * src/graphics/Renderer.h:
5238 * src/graphics/Renderer.C: Added base class for rendering of different
5239 image formats into Pixmaps.
5241 * src/graphics/XPM_Renderer.h:
5242 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5243 in a different class.
5245 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5246 easily add support for other formats.
5248 * src/insets/figinset.C: plugged a leak of an X resource.
5250 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5252 * src/CutAndPaste.[Ch]: make all metods static.
5254 * development/Code_rules/Rules: more work, added section on
5255 Exceptions, and a References section.
5257 * a lot of header files: work to make doc++ able to generate the
5258 source documentation, some workarounds of doc++ problems. Doc++ is
5259 now able to generate the documentation.
5261 2000-08-07 Juergen Vigna <jug@sad.it>
5263 * src/insets/insettabular.C (recomputeTextInsets): removed function
5265 * src/tabular.C (SetWidthOfMulticolCell):
5267 (calculate_width_of_column_NMC): fixed return value so that it really
5268 only returns true if the column-width has changed (there where
5269 problems with muliticolumn-cells in this column).
5271 2000-08-04 Juergen Vigna <jug@sad.it>
5273 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5274 also on the scrollstatus of the inset.
5275 (workAreaMotionNotify): ditto.
5277 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5279 2000-08-01 Juergen Vigna <jug@sad.it>
5281 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5283 * src/commandtags.h:
5284 * src/LyXAction.C (init):
5285 * src/insets/inset.C (LocalDispatch): added support for
5288 * src/insets/inset.C (scroll): new functions.
5290 * src/insets/insettext.C (removeNewlines): new function.
5291 (SetAutoBreakRows): removes forced newlines in the text of the
5292 paragraph if autoBreakRows is set to false.
5294 * src/tabular.C (Latex): generates a parbox around the cell contents
5297 * src/frontends/xforms/FormTabular.C (local_update): removed
5298 the radio_useparbox button.
5300 * src/tabular.C (UseParbox): new function
5302 2000-08-06 Baruch Even <baruch.even@writeme.com>
5304 * src/graphics/GraphicsCache.h:
5305 * src/graphics/GraphicsCache.C:
5306 * src/graphics/GraphicsCacheItem.h:
5307 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5310 * src/insets/insetgraphics.h:
5311 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5312 and the drawing of the inline image.
5314 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5315 loaded into the wrong position.
5317 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5320 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5322 * src/support/translator.h: move all typedefs to public section
5324 * src/support/filetools.C (MakeLatexName): return string const
5326 (TmpFileName): ditto
5327 (FileOpenSearch): ditto
5329 (LibFileSearch): ditto
5330 (i18nLibFileSearch): ditto
5333 (CreateTmpDir): ditto
5334 (CreateBufferTmpDir): ditto
5335 (CreateLyXTmpDir): ditto
5338 (MakeAbsPath): ditto
5340 (OnlyFilename): ditto
5342 (NormalizePath): ditto
5343 (CleanupPath): ditto
5344 (GetFileContents): ditto
5345 (ReplaceEnvironmentPath): ditto
5346 (MakeRelPath): ditto
5348 (ChangeExtension): ditto
5349 (MakeDisplayPath): ditto
5350 (do_popen): return cmdret const
5351 (findtexfile): return string const
5353 * src/support/DebugStream.h: add some /// to please doc++
5355 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5357 * src/texrow.C (same_rownumber): functor to use with find_if
5358 (getIdFromRow): rewritten to use find_if and to not update the
5359 positions. return true if row is found
5360 (increasePos): new method, use to update positions
5362 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5364 * src/lyxlex_pimpl.C (verifyTable): new method
5367 (GetString): return string const
5368 (pushTable): rewrite to use std::stack
5370 (setFile): better check
5373 * src/lyxlex.h: make LyXLex noncopyable
5375 * src/lyxlex.C (text): return char const * const
5376 (GetString): return string const
5377 (getLongString): return string const
5379 * src/lyx_gui_misc.C (askForText): return pair<...> const
5381 * src/lastfiles.[Ch] (operator): return string const
5383 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5384 istringstream not char const *.
5385 move token.end() out of loop.
5386 (readFile): move initializaton of token
5388 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5389 getIdFromRow is successful.
5391 * lib/bind/emacs.bind: don't include menus bind
5393 * development/Code_rules/Rules: the beginnings of making this
5394 better and covering more of the unwritten rules that we have.
5396 * development/Code_rules/Recommendations: a couple of wording
5399 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5401 * src/support/strerror.c: remove C++ comment.
5403 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5405 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5406 LFUN_INDEX_INSERT_LAST
5408 * src/texrow.C (getIdFromRow): changed from const_iterator to
5409 iterator, allowing code to compile with DEC cxx
5411 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5412 stores part of the class, as suggested by Allan. Will allow
5414 (apply): test to apply uses InsetCommandParams operator!=
5416 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5417 (apply): test to apply uses InsetCommandParams operator!=
5419 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5420 stores part of the class.
5421 (update): removed limits on min/max size.
5423 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5424 (apply): test to apply uses InsetCommandParams operator!=
5426 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5427 (Read, Write, scanCommand, getCommand): moved functionality
5428 into InsetCommandParams.
5430 (getScreenLabel): made pure virtual
5431 new InsetCommandParams operators== and !=
5433 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5434 c-tors based on InsetCommandParams. Removed others.
5435 * src/insets/insetinclude.[Ch]: ditto
5436 * src/insets/insetlabel.[Ch]: ditto
5437 * src/insets/insetparent.[Ch]: ditto
5438 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5440 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5441 insets derived from InsetCommand created using similar c-tors
5442 based on InsetCommandParams
5443 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5444 * src/menus.C (ShowRefsMenu): ditto
5445 * src/paragraph.C (Clone): ditto
5446 * src/text2.C (SetCounter): ditto
5447 * src/lyxfunc.C (Dispatch) ditto
5448 Also recreated old InsetIndex behaviour exactly. Can now
5449 index-insert at the start of a paragraph and index-insert-last
5450 without launching the pop-up.
5452 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5454 * lib/lyxrc.example: mark te pdf options as non functional.
5456 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5457 (isStrDbl): move tmpstr.end() out of loop.
5458 (strToDbl): move intialization of tmpstr
5459 (lowercase): return string const and move tmp.end() out of loop.
5460 (uppercase): return string const and move tmp.edn() out of loop.
5461 (prefixIs): add assertion
5466 (containsOnly): ditto
5467 (containsOnly): ditto
5468 (containsOnly): ditto
5469 (countChar): make last arg char not char const
5470 (token): return string const
5471 (subst): return string const, move tmp.end() out of loop.
5472 (subst): return string const, add assertion
5473 (strip): return string const
5474 (frontStrip): return string const, add assertion
5475 (frontStrip): return string const
5480 * src/support/lstrings.C: add inclde "LAssert.h"
5481 (isStrInt): move tmpstr.end() out of loop.
5483 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5484 toollist.end() out of loop.
5485 (deactivate): move toollist.end() out of loop.
5486 (update): move toollist.end() out of loop.
5487 (updateLayoutList): move tc.end() out of loop.
5488 (add): move toollist.end() out of loop.
5490 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5491 md.end() out of loop.
5493 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5495 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5498 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5499 (Erase): move insetlist.end() out of loop.
5501 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5502 ref to const string as first arg. Move initialization of some
5503 variables, whitespace changes.
5505 * src/kbmap.C (defkey): move table.end() out of loop.
5506 (kb_keymap): move table.end() out of loop.
5507 (findbinding): move table.end() out of loop.
5509 * src/MenuBackend.C (hasMenu): move end() out of loop.
5510 (getMenu): move end() out of loop.
5511 (getMenu): move menulist_.end() out of loop.
5513 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5515 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5518 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5519 (getFromLyXName): move infotab.end() out of loop.
5521 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5522 -fvtable-thunks -ffunction-sections -fdata-sections
5524 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5526 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5529 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5531 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5533 * src/frontends/xforms/FormCitation.[Ch],
5534 src/frontends/xforms/FormIndex.[Ch],
5535 src/frontends/xforms/FormToc.[Ch],
5536 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5538 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5540 * src/commandtags.h: renamed, created some flags for citation
5543 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5545 * src/lyxfunc.C (dispatch): use signals to insert index entry
5547 * src/frontends/Dialogs.h: new signal createIndex
5549 * src/frontends/xforms/FormCommand.[Ch],
5550 src/frontends/xforms/FormCitation.[Ch],
5551 src/frontends/xforms/FormToc.[Ch],
5552 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5554 * src/insets/insetindex.[Ch]: GUI-independent
5556 * src/frontends/xforms/FormIndex.[Ch],
5557 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5560 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5562 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5563 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5565 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5567 * src/insets/insetref.C (Latex): rewrite so that there is now
5568 question that a initialization is requested.
5570 * src/insets/insetcommand.h: reenable the hide signal
5572 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5574 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5575 fix handling of shortcuts (many bugs :)
5576 (add_lastfiles): ditto.
5578 * lib/ui/default.ui: fix a few shortcuts.
5580 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5582 * Makefile.am: Fix ``rpmdist'' target to return the exit
5583 status of the ``rpm'' command, instead of the last command in
5584 the chain (the ``rm lyx.xpm'' command, which always returns
5587 2000-08-02 Allan Rae <rae@lyx.org>
5589 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5590 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5591 * src/frontends/xforms/FormToc.C (FormToc): ditto
5593 * src/frontends/xforms/Makefile.am: A few forgotten files
5595 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5596 Signals-not-copyable-problem Lars' started commenting out.
5598 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5600 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5602 * src/insets/insetcommand.h: Signals is not copyable so anoter
5603 scheme for automatic hiding of forms must be used.
5605 * src/frontends/xforms/FormCitation.h: don't inerit from
5606 noncopyable, FormCommand already does that.
5607 * src/frontends/xforms/FormToc.h: ditto
5608 * src/frontends/xforms/FormUrl.h: ditto
5610 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5612 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5614 * src/insets/insetcommand.h (hide): new SigC::Signal0
5615 (d-tor) new virtual destructor emits hide signal
5617 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5618 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5620 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5621 LOF and LOT. Inset is now GUI-independent
5623 * src/insets/insetloa.[Ch]: redundant
5624 * src/insets/insetlof.[Ch]: ditto
5625 * src/insets/insetlot.[Ch]: ditto
5627 * src/frontends/xforms/forms/form_url.fd: tweaked!
5628 * src/frontends/xforms/forms/form_citation.fd: ditto
5630 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5631 dialogs dealing with InsetCommand insets
5633 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5634 FormCommand base class
5635 * src/frontends/xforms/FormUrl.[Ch]: ditto
5637 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5639 * src/frontends/xforms/FormToc.[Ch]: ditto
5641 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5642 passed a generic InsetCommand pointer
5643 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5645 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5646 and modified InsetTOC class
5647 * src/buffer.C: ditto
5649 * forms/lyx.fd: strip out old FD_form_toc code
5650 * src/lyx_gui_misc.C: ditto
5651 * src/lyx_gui.C: ditto
5652 * src/lyx_cb.C: ditto
5653 * src/lyx.[Ch]: ditto
5655 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5657 * src/support/utility.hpp: tr -d '\r'
5659 2000-08-01 Juergen Vigna <jug@sad.it>
5661 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5663 * src/commandtags.h:
5664 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5665 LFUN_TABULAR_FEATURES.
5667 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5668 LFUN_LAYOUT_TABULAR.
5670 * src/insets/insettabular.C (getStatus): implemented helper function.
5672 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5674 2000-07-31 Juergen Vigna <jug@sad.it>
5676 * src/text.C (draw): fixed screen update problem for text-insets.
5678 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5679 something changed probably this has to be added in various other
5682 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5684 2000-07-31 Baruch Even <baruch.even@writeme.com>
5686 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5687 templates to satisfy compaq cxx.
5690 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5692 * src/support/translator.h (equal_1st_in_pair::operator()): take
5693 const ref pair_type as arg.
5694 (equal_2nd_in_pair::operator()): ditto
5695 (Translator::~Translator): remove empty d-tor.
5697 * src/graphics/GraphicsCache.C: move include config.h to top, also
5698 put initialization of GraphicsCache::singleton here.
5699 (~GraphicsCache): move here
5700 (addFile): take const ref as arg
5703 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5705 * src/BufferView2.C (insertLyXFile): change te with/without header
5708 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5710 * src/frontends/xforms/FormGraphics.C (apply): add some
5711 static_cast. Not very nice, but required by compaq cxx.
5713 * src/frontends/xforms/RadioButtonGroup.h: include header
5714 <utility> instead of <pair.h>
5716 * src/insets/insetgraphicsParams.C: add using directive.
5717 (readResize): change return type to void.
5718 (readOrigin): ditto.
5720 * src/lyxfunc.C (getStatus): add missing break for build-program
5721 function; add test for Literate for export functions.
5723 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5724 entries in Options menu.
5726 2000-07-31 Baruch Even <baruch.even@writeme.com>
5728 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5729 protect against auto-allocation; release icon when needed.
5731 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5733 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5734 on usual typewriter.
5736 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5737 earlier czech.kmap), useful only for programming.
5739 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5741 * src/frontends/xforms/FormCitation.h: fix conditioning around
5744 2000-07-31 Juergen Vigna <jug@sad.it>
5746 * src/frontends/xforms/FormTabular.C (local_update): changed
5747 radio_linebreaks to radio_useparbox and added radio_useminipage.
5749 * src/tabular.C: made support for using minipages/parboxes.
5751 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5753 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5755 (descent): so the cursor is in the middle.
5756 (width): bit smaller box.
5758 * src/insets/insetgraphics.h: added display() function.
5760 2000-07-31 Baruch Even <baruch.even@writeme.com>
5762 * src/frontends/Dialogs.h: Added showGraphics signals.
5764 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5765 xforms form definition of the graphics dialog.
5767 * src/frontends/xforms/FormGraphics.h:
5768 * src/frontends/xforms/FormGraphics.C: Added files, the
5769 GUIndependent code of InsetGraphics
5771 * src/insets/insetgraphics.h:
5772 * src/insets/insetgraphics.C: Major writing to make it work.
5774 * src/insets/insetgraphicsParams.h:
5775 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5776 struct between InsetGraphics and GUI.
5778 * src/LaTeXFeatures.h:
5779 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5780 support for graphicx package.
5782 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5783 for the graphics inset.
5785 * src/support/translator.h: Added file, used in
5786 InsetGraphicsParams. this is a template to translate between two
5789 * src/frontends/xforms/RadioButtonGroup.h:
5790 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5791 way to easily control a radio button group.
5793 2000-07-28 Juergen Vigna <jug@sad.it>
5795 * src/insets/insettabular.C (LocalDispatch):
5796 (TabularFeatures): added support for lyx-functions of tabular features.
5797 (cellstart): refixed this function after someone wrongly changed it.
5799 * src/commandtags.h:
5800 * src/LyXAction.C (init): added support for tabular-features
5802 2000-07-28 Allan Rae <rae@lyx.org>
5804 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5805 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5806 triggers the callback for input checking. As a result we sometimes get
5807 "LyX: This shouldn't happen..." printed to cerr.
5808 (input): Started using status variable since I only free() on
5809 destruction. Some input checking for paths and font sizes.
5811 * src/frontends/xforms/FormPreferences.h: Use status to control
5812 activation of Ok and Apply
5814 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5815 callback. Also resized to stop segfaults with 0.88. The problem is
5816 that xforms-0.88 requires the folder to be wide enough to fit all the
5817 tabs. If it isn't it causes all sorts of problems.
5819 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5821 * src/frontends/xforms/forms/README: Reflect reality.
5823 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5824 * src/frontends/xforms/forms/makefile: ditto.
5826 * src/commandtags.h: Get access to new Preferences dialog
5827 * src/LyXAction.C: ditto
5828 * src/lyxfunc.C: ditto
5829 * lib/ui/default.ui: ditto
5831 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5833 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5835 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5838 * src/frontends/xforms/form_url.[Ch]: added.
5840 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5842 * src/insets/insetbib.h: fixed bug in previous commit
5844 * src/frontends/xforms/FormUrl.h: ditto
5846 * src/frontends/xforms/FormPrint.h: ditto
5848 * src/frontends/xforms/FormPreferences.h: ditto
5850 * src/frontends/xforms/FormCopyright.h: ditto
5852 * src/frontends/xforms/FormCitation.C: ditto
5854 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5855 private copyconstructor and private default contructor
5857 * src/support/Makefile.am: add utility.hpp
5859 * src/support/utility.hpp: new file from boost
5861 * src/insets/insetbib.h: set owner in clone
5863 * src/frontends/xforms/FormCitation.C: added missing include
5866 * src/insets/form_url.[Ch]: removed
5868 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5870 * development/lyx.spec.in
5871 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5872 file/directory re-organization.
5874 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5876 * src/insets/insetcommand.[Ch]: moved the string data and
5877 associated manipulation methods into a new stand-alone class
5878 InsetCommandParams. This class has two additional methods
5879 getAsString() and setFromString() allowing the contents to be
5880 moved around as a single string.
5881 (addContents) method removed.
5882 (setContents) method no longer virtual.
5884 * src/buffer.C (readInset): made use of new InsetCitation,
5885 InsetUrl constructors based on InsetCommandParams.
5887 * src/commandtags.h: add LFUN_INSERT_URL
5889 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5890 independent InsetUrl and use InsetCommandParams to extract
5891 string info and create new Insets.
5893 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5895 * src/frontends/xforms/FormCitation.C (apply): uses
5898 * src/frontends/xforms/form_url.C
5899 * src/frontends/xforms/form_url.h
5900 * src/frontends/xforms/FormUrl.h
5901 * src/frontends/xforms/FormUrl.C
5902 * src/frontends/xforms/forms/form_url.fd: new files
5904 * src/insets/insetcite.[Ch]: removed unused constructors.
5906 * src/insets/insetinclude.[Ch]: no longer store filename
5908 * src/insets/inseturl.[Ch]: GUI-independent.
5910 2000-07-26 Juergen Vigna <jug@sad.it>
5911 * renamed frontend from gtk to gnome as it is that what is realized
5912 and did the necessary changes in the files.
5914 2000-07-26 Marko Vendelin <markov@ioc.ee>
5916 * configure.in: cleaning up gnome configuration scripts
5918 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5920 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5921 shortcuts syndrom by redrawing them explicitely (a better solution
5922 would be appreciated).
5924 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5926 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5929 * src/lyx_cb.C (MenuExport): change html export to do the right
5930 thing depending of the document type (instead of having
5931 html-linuxdoc and html-docbook).
5932 * src/lyxfunc.C (getStatus): update for html
5933 * lib/ui/default.ui: simplify due to the above change.
5934 * src/menus.C (ShowFileMenu): update too (in case we need it).
5936 * src/MenuBackend.C (read): if a menu is defined twice, add the
5937 new entries to the exiting one.
5939 2000-07-26 Juergen Vigna <jug@sad.it>
5941 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5943 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5944 and return a bool if it did actual save the file.
5945 (AutoSave): don't autosave a unnamed doc.
5947 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5948 check if this is an UNNAMED new file and react to it.
5949 (newFile): set buffer to unnamed and change to not mark a new
5950 buffer dirty if I didn't do anything with it.
5952 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5954 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5956 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5957 friend as per Angus's patch posted to lyx-devel.
5959 * src/ext_l10n.h: updated
5961 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5962 gettext on the style string right before inserting them into the
5965 * autogen.sh: add code to extract style strings form layout files,
5966 not good enough yet.
5968 * src/frontends/gtk/.cvsignore: add MAKEFILE
5970 * src/MenuBackend.C (read): run the label strings through gettext
5971 before storing them in the containers.
5973 * src/ext_l10n.h: new file
5975 * autogen.sh : generate the ext_l10n.h file here
5977 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5979 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5982 * lib/ui/default.ui: fix a couple of typos.
5984 * config/gnome/gtk.m4: added (and added to the list of files in
5987 * src/insets/insetinclude.C (unique_id): fix when we are using
5988 lyxstring instead of basic_string<>.
5989 * src/insets/insettext.C (LocalDispatch): ditto.
5990 * src/support/filetools.C: ditto.
5992 * lib/configure.m4: create the ui/ directory if necessary.
5994 * src/LyXView.[Ch] (updateToolbar): new method.
5996 * src/BufferView_pimpl.C (buffer): update the toolbar when
5997 opening/closing buffer.
5999 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6001 * src/LyXAction.C (getActionName): enhance to return also the name
6002 and options of pseudo-actions.
6003 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
6005 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
6006 as an example of what is possible). Used in File->Build too (more
6007 useful) and in the import/export menus (to mimick the complicated
6008 handling of linuxdoc and friends). Try to update all the entries.
6010 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
6013 * src/MenuBackend.C (read): Parse the new OptItem tag.
6015 * src/MenuBackend.h: Add a new optional_ data member (used if the
6016 entry should be omitted when the lyxfunc is disabled).
6018 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
6019 function, used as a shortcut.
6020 (create_submenu): align correctly the shortcuts on the widest
6023 * src/MenuBackend.h: MenuItem.label() only returns the label of
6024 the menu without shortcut; new method shortcut().
6026 2000-07-14 Marko Vendelin <markov@ioc.ee>
6028 * src/frontends/gtk/Dialogs.C:
6029 * src/frontends/gtk/FormCopyright.C:
6030 * src/frontends/gtk/FormCopyright.h:
6031 * src/frontends/gtk/Makefile.am: added these source-files for the
6032 Gtk/Gnome support of the Copyright-Dialog.
6034 * src/main.C: added Gnome::Main initialization if using
6035 Gtk/Gnome frontend-GUI.
6037 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
6039 * config/gnome/aclocal-include.m4
6040 * config/gnome/compiler-flags.m4
6041 * config/gnome/curses.m4
6042 * config/gnome/gnome--.m4
6043 * config/gnome/gnome-bonobo-check.m4
6044 * config/gnome/gnome-common.m4
6045 * config/gnome/gnome-fileutils.m4
6046 * config/gnome/gnome-ghttp-check.m4
6047 * config/gnome/gnome-gnorba-check.m4
6048 * config/gnome/gnome-guile-checks.m4
6049 * config/gnome/gnome-libgtop-check.m4
6050 * config/gnome/gnome-objc-checks.m4
6051 * config/gnome/gnome-orbit-check.m4
6052 * config/gnome/gnome-print-check.m4
6053 * config/gnome/gnome-pthread-check.m4
6054 * config/gnome/gnome-support.m4
6055 * config/gnome/gnome-undelfs.m4
6056 * config/gnome/gnome-vfs.m4
6057 * config/gnome/gnome-x-checks.m4
6058 * config/gnome/gnome-xml-check.m4
6059 * config/gnome/gnome.m4
6060 * config/gnome/gperf-check.m4
6061 * config/gnome/gtk--.m4
6062 * config/gnome/linger.m4
6063 * config/gnome/need-declaration.m4: added configuration scripts
6064 for Gtk/Gnome frontend-GUI
6066 * configure.in: added support for the --with-frontend=gtk option
6068 * autogen.sh: added config/gnome/* to list of config-files
6070 * acconfig.h: added define for GTKGUI-support
6072 * config/lyxinclude.m4: added --with-frontend[=value] option value
6073 for Gtk/Gnome frontend-GUI support.
6075 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6077 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
6081 * src/paragraph.C (GetChar): remove non-const version
6083 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
6084 (search_kw): use it.
6086 * src/lyx_main.C (init): if "preferences" exist, read that instead
6088 (ReadRcFile): return bool if the file could be read ok.
6089 (ReadUIFile): add a check to see if lex file is set ok.
6091 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
6092 bastring can be used instead of lyxstring (still uses the old code
6093 if std::string is good enough or if lyxstring is used.)
6095 * src/encoding.C: make the arrays static, move ininle functions
6097 * src/encoding.h: from here.
6099 * src/buffer.C: have last_isnet_read as a file scope variable for now.
6100 (parseSingleLyXformat2Token): move inset parsing to separate method
6101 (readInset): new private method
6103 * src/Variables.h: remove virtual from get().
6105 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6106 access to NEW_INSETS and NEW_TABULAR
6108 * src/MenuBackend.h: remove superfluous forward declaration of
6109 MenuItem. Add documentations tags "///", remove empty MenuItem
6110 destructor, remove private default contructor.
6112 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6114 (read): more string mlabel and mname to where they are used
6115 (read): remove unused variables mlabel and mname
6116 (defaults): unconditional clear, make menusetup take advantage of
6117 add returning Menu &.
6119 * src/LyXView.h: define NEW_MENUBAR as default
6121 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6122 to NEW_INSETS and NEW_TABULAR.
6123 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6124 defined. Change some of the "xxxx-inset-insert" functions names to
6127 * several files: more enahncements to NEW_INSETS and the resulting
6130 * lib/lyxrc.example (\date_insert_format): move to misc section
6132 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6133 bastring and use AC_CACHE_CHECK.
6134 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6135 the system have the newest methods. uses AC_CACHE_CHECK
6136 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6137 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6138 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6140 * configure.in: add LYX_CXX_GOOD_STD_STRING
6142 * acinclude.m4: recreated
6144 2000-07-24 Amir Karger <karger@lyx.org>
6146 * README: add Hebrew, Arabic kmaps
6149 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6151 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6154 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6156 * Lot of files: add pragma interface/implementation.
6158 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6160 * lib/ui/default.ui: new file (ans new directory). Contains the
6161 default menu and toolbar.
6163 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6164 global space. Toolbars are now read (as menus) in ui files.
6166 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6168 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6169 is disabled because the document is read-only. We want to have the
6170 toggle state of the function anyway.
6171 (getStatus): add code for LFUN_VC* functions (mimicking what is
6172 done in old-style menus)
6174 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6175 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6177 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6178 * src/BufferView_pimpl.C: ditto.
6179 * src/lyxfunc.C: ditto.
6181 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6182 default). This replaces old-style menus by new ones.
6184 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6185 MenuItem. Contain the data structure of a menu.
6187 * src/insets/insettext.C: use LyXView::setLayout instead of
6188 accessing directly the toolbar combox.
6189 * src/lyxfunc.C (Dispatch): ditto.
6191 * src/LyXView.C (setLayout): new method, which just calls
6192 Toolbar::setLayout().
6193 (updateLayoutChoice): move part of this method in Toolbar.
6195 * src/toolbar.[Ch]: removed.
6197 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6198 implementation the toolbar.
6200 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6201 the toolbar. It might make sense to merge it with ToolbarDefaults
6203 (setLayout): new function.
6204 (updateLayoutList): ditto.
6205 (openLayoutList): ditto.
6207 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6208 xforms implementation of the toolbar.
6209 (get_toolbar_func): comment out, since I do not
6210 know what it is good for.
6212 * src/ToolbarDefaults.h: Add the ItemType enum.
6214 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6215 for a list of allocated C strings. Used in Menubar xforms
6216 implementation to avoid memory leaks.
6218 * src/support/lstrings.[Ch] (uppercase): new version taking and
6222 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6223 * lib/bind/emacs.bind: ditto.
6225 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6227 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6228 forward decl of LyXView.
6230 * src/toolbar.C (toolbarItem): moved from toolbar.h
6231 (toolbarItem::clean): ditto
6232 (toolbarItem::~toolbarItem): ditto
6233 (toolbarItem::operator): ditto
6235 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6237 * src/paragraph.h: control the NEW_TABULAR define from here
6239 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6240 USE_TABULAR_INSETS to NEW_TABULAR
6242 * src/ToolbarDefaults.C: add include "lyxlex.h"
6244 * files using the old table/tabular: use NEW_TABULAR to control
6245 compilation of old tabular stuff.
6247 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6250 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6251 planemet in reading of old style floats, fix the \end_deeper
6252 problem when reading old style floats.
6254 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6256 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6258 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6260 * lib/bind/sciword.bind: updated.
6262 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6264 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6265 layout write problem
6267 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6269 * src/Makefile.am (INCLUDES): remove image directory from include
6272 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6273 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6275 * src/LyXView.C (create_form_form_main): read the application icon
6278 * lib/images/*.xpm: change the icons to use transparent color for
6281 * src/toolbar.C (update): change the color of the button when it
6284 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6286 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6287 setting explicitely the minibuffer.
6288 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6290 * src/LyXView.C (showState): new function. Shows font information
6291 in minibuffer and update toolbar state.
6292 (LyXView): call Toolbar::update after creating the
6295 * src/toolbar.C: change toollist to be a vector instead of a
6297 (BubbleTimerCB): get help string directly from the callback
6298 argument of the corresponding icon (which is the action)
6299 (set): remove unnecessary ugliness.
6300 (update): new function. update the icons (depressed, disabled)
6301 depending of the status of the corresponding action.
6303 * src/toolbar.h: remove help in toolbarItem
6305 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6307 * src/Painter.C (text): Added code for using symbol glyphs from
6308 iso10646 fonts. Currently diabled.
6310 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6313 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6314 magyar,turkish and usorbian.
6316 * src/paragraph.C (isMultiLingual): Made more efficient.
6318 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6321 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6322 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6323 Also changed the prototype to "bool math_insert_greek(char)".
6325 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6327 * lots of files: apply the NEW_INSETS on all code that will not be
6328 needed when we move to use the new insets. Enable the define in
6329 lyxparagrah.h to try it.
6331 * src/insets/insettabular.C (cellstart): change to be a static
6333 (InsetTabular): initialize buffer in the initializer list.
6335 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6337 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6338 form_print.h out of the header file. Replaced with forward
6339 declarations of the relevant struct.
6341 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6344 * src/commandtags.h: do not include "debug.h" which does not
6345 belong there. #include it in some other places because of this
6348 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6350 * src/insets/insetcaption.C: add a couple "using" directives.
6352 * src/toolbar.C (add): get the help text directly from lyxaction.
6354 (setPixmap): new function. Loads from disk and sets a pixmap on a
6355 botton; the name of the pixmap file is derived from the command
6358 * src/toolbar.h: remove members isBitmap and pixmap from
6361 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6362 * lib/images/: move many files from images/banner.xpm.
6364 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6366 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6367 * src/toolbar.C: ditto.
6368 * configure.in: ditto.
6369 * INSTALL: document.
6371 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6372 the spellchecker popup is closed from the WM.
6374 2000-07-19 Juergen Vigna <jug@sad.it>
6376 * src/insets/insetfloat.C (Write): small fix because we use the
6377 insetname for the type now!
6379 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6381 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6384 * src/frontends/Dialogs.h: removed hideCitation signal
6386 * src/insets/insetcite.h: added hide signal
6388 * src/insets/insetcite.C (~InsetCitation): emits new signal
6389 (getScreenLabel): "intelligent" label should now fit on the screen!
6391 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6393 * src/frontends/xforms/FormCitation.C (showInset): connects
6394 hide() to the inset's hide signal
6395 (show): modified to use fl_set_object_position rather than
6396 fl_set_object_geometry wherever possible
6398 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6400 * src/insets/lyxinset.h: add caption code
6402 * src/insets/insetfloat.C (type): new method
6404 * src/insets/insetcaption.C (Write): new method
6406 (LyxCode): new method
6408 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6409 to get it right together with using the FloatList.
6411 * src/commandtags.h: add LFUN_INSET_CAPTION
6412 * src/lyxfunc.C (Dispatch): handle it
6414 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6417 * src/Variables.[Ch]: make expand take a const reference, remove
6418 the destructor, some whitespace changes.
6420 * src/LyXAction.C (init): add caption-inset-insert
6422 * src/FloatList.C (FloatList): update the default floats a bit.
6424 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6426 * src/Variables.[Ch]: new files. Intended to be used for language
6427 specific strings (like \chaptername) and filename substitution in
6430 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6432 * lib/kbd/american.kmap: update
6434 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6436 * src/bufferparams.[Ch]: remove member allowAccents.
6438 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6440 * src/LaTeXLog.C: use the log_form.h header.
6441 * src/lyx_gui.C: ditto.
6442 * src/lyx_gui_misc.C: ditto.
6443 * src/lyxvc.h: ditto.
6445 * forms/log_form.fd: new file, created from latexoptions.fd. I
6446 kept the log popup and nuked the options form.
6448 * src/{la,}texoptions.[Ch]: removed.
6449 * src/lyx_cb.C (LaTeXOptions): ditto
6451 * src/lyx_gui.C (create_forms): do not handle the
6452 fd_latex_options form.
6454 2000-07-18 Juergen Vigna <jug@sad.it>
6456 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6457 name of the inset so that it can be requested outside (text2.C).
6459 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6462 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6464 * src/mathed/formula.h (ConvertFont): constify
6466 * src/mathed/formula.C (Read): add warning if \end_inset is not
6467 found on expected place.
6469 * src/insets/lyxinset.h (ConvertFont): consify
6471 * src/insets/insetquotes.C (ConvertFont): constify
6472 * src/insets/insetquotes.h: ditto
6474 * src/insets/insetinfo.h: add labelfont
6476 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6477 (ascent): use labelfont
6481 (Write): make .lyx file a bit nicer
6483 * src/insets/insetfloat.C (Write): simplify somewhat...
6484 (Read): add warning if arg is not found
6486 * src/insets/insetcollapsable.C: add using std::max
6487 (Read): move string token and add warning in arg is not found
6488 (draw): use std::max to get the right ty
6489 (getMaxWidth): simplify by using std::max
6491 * src/insets/insetsection.h: new file
6492 * src/insets/insetsection.C: new file
6493 * src/insets/insetcaption.h: new file
6494 * src/insets/insetcaption.C: new file
6496 * src/insets/inset.C (ConvertFont): constify signature
6498 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6499 insetcaption.[Ch] and insetsection.[Ch]
6501 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6502 uses to use LABEL_COUNTER_CHAPTER instead.
6503 * src/text2.C (SetCounter): here
6505 * src/counters.h: new file
6506 * src/counters.C: new file
6507 * src/Sectioning.h: new file
6508 * src/Sectioning.C: new file
6510 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6512 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6514 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6517 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6520 2000-07-17 Juergen Vigna <jug@sad.it>
6522 * src/tabular.C (Validate): check if array-package is needed.
6523 (SetVAlignment): added support for vertical alignment.
6524 (SetLTFoot): better support for longtable header/footers
6525 (Latex): modified to support added features.
6527 * src/LaTeXFeatures.[Ch]: added array-package.
6529 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6531 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6534 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6536 * configure.in: do not forget to put a space after -isystem.
6538 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6540 * lib/kbd/arabic.kmap: a few fixes.
6542 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6544 * some whitespace chagnes to a number of files.
6546 * src/support/DebugStream.h: change to make it easier for
6547 doc++ to parse correctly.
6548 * src/support/lyxstring.h: ditto
6550 * src/mathed/math_utils.C (compara): change to have only one
6552 (MathedLookupBOP): change because of the above.
6554 * src/mathed/math_delim.C (math_deco_compare): change to have only
6556 (search_deco): change becasue of the above.
6558 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6559 instead of manually coded one.
6561 * src/insets/insetquotes.C (Read): read the \end_inset too
6563 * src/insets/insetlatex.h: remove file
6564 * src/insets/insetlatex.C: remove file
6566 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6568 (InsetPrintIndex): remove destructor
6570 * src/insets/insetinclude.h: remove default constructor
6572 * src/insets/insetfloat.C: work to make it work better
6574 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6576 * src/insets/insetcite.h (InsetCitation): remove default constructor
6578 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6580 * src/text.C (GetColumnNearX): comment out some currently unused code.
6582 * src/paragraph.C (writeFile): move some initializations closer to
6584 (CutIntoMinibuffer): small change to use new matchIT operator
6588 (InsertInset): ditto
6591 (InsetIterator): ditto
6592 (Erase): small change to use new matchFT operator
6594 (GetFontSettings): ditto
6595 (HighestFontInRange): ditto
6598 * src/lyxparagraph.h: some chars changed to value_type
6599 (matchIT): because of some stronger checking (perhaps too strong)
6600 in SGI STL, the two operator() unified to one.
6603 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6605 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6606 the last inset read added
6607 (parseSingleLyXformat2Token): some more (future) compability code added
6608 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6609 (parseSingleLyXformat2Token): set last_inset_read
6610 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6611 (parseSingleLyXformat2Token): don't double intializw string next_token
6613 * src/TextCache.C (text_fits::operator()): add const's to the signature
6614 (has_buffer::operator()): ditto
6616 * src/Floating.h: add some comments on the class
6618 * src/FloatList.[Ch] (typeExist): new method
6621 * src/BackStack.h: added default constructor, wanted by Gcc.
6623 2000-07-14 Juergen Vigna <jug@sad.it>
6625 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6627 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6629 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6630 do a redraw when the window is resized!
6631 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6633 * src/insets/insettext.C (resizeLyXText): added function to correctly
6634 being able to resize the LyXWindow.
6636 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6638 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6640 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6641 crashes when closing dialog to a deleted inset.
6643 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6644 method! Now similar to other insets.
6646 2000-07-13 Juergen Vigna <jug@sad.it>
6648 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6650 * lib/examples/Literate.lyx: small patch!
6652 * src/insets/insetbib.C (Read): added this function because of wrong
6653 Write (without [begin|end]_inset).
6655 2000-07-11 Juergen Vigna <jug@sad.it>
6657 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6658 as the insertInset could not be good!
6660 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6661 the bool param should not be last.
6663 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6665 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6666 did submit that to Karl).
6668 * configure.in: use -isystem instead of -I for X headers. This
6669 fixes a problem on solaris with a recent gcc;
6670 put the front-end code after the X detection code;
6671 configure in sigc++ before lib/
6673 * src/lyx_main.C (commandLineHelp): remove -display from command
6676 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6678 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6679 Also put in Makefile rules for building the ``listerrors''
6680 program for parsing errors from literate programs written in LyX.
6682 * lib/build-listerrors: Added small shell script as part of compile
6683 process. This builds a working ``listerrors'' binary if noweb is
6684 installed and either 1) the VNC X server is installed on the machine,
6685 or 2) the user is compiling from within a GUI. The existence of a GUI
6686 is necessary to use the ``lyx --export'' feature for now. This
6687 hack can be removed once ``lyx --export'' no longer requires a GUI to
6690 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6692 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6693 now passed back correctly from gcc and placed "under" error
6694 buttons in a Literate LyX source.
6696 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6698 * src/text.C (GetColumnNearX): Better behavior when a RTL
6699 paragraph is ended by LTR text.
6701 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6704 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6706 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6707 true when clipboard is empty.
6709 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6711 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6712 row of the paragraph.
6713 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6714 to prevent calculation of bidi tables
6716 2000-07-07 Juergen Vigna <jug@sad.it>
6718 * src/screen.C (ToggleSelection): added y_offset and x_offset
6721 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6724 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6726 * src/insets/insettext.C: fixed Layout-Display!
6728 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6730 * configure.in: add check for strings.h header.
6732 * src/spellchecker.C: include <strings.h> in order to have a
6733 definition for bzero().
6735 2000-07-07 Juergen Vigna <jug@sad.it>
6737 * src/insets/insettext.C (draw): set the status of the bv->text to
6738 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6740 * src/screen.C (DrawOneRow):
6741 (DrawFromTo): redraw the actual row if something has changed in it
6744 * src/text.C (draw): call an update of the toplevel-inset if something
6745 has changed inside while drawing.
6747 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6749 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6751 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6752 processing inside class.
6754 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6755 processing inside class.
6757 * src/insets/insetindex.h new struct Holder, consistent with other
6760 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6761 citation dialog from main code and placed it in src/frontends/xforms.
6762 Dialog launched through signals instead of callbacks
6764 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6766 * lyx.man: update the options description.
6768 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6770 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6771 handle neg values, set min width to 590, add doc about -display
6773 2000-07-05 Juergen Vigna <jug@sad.it>
6775 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6776 calls to BufferView *.
6778 * src/insets/insettext.C (checkAndActivateInset): small fix non
6779 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6781 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6782 their \end_inset token!
6784 2000-07-04 edscott <edscott@imp.mx>
6786 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6787 lib/lyxrc.example: added option \wheel_jump
6789 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6791 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6792 remove support for -width,-height,-xpos and -ypos.
6794 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6796 * src/encoding.[Ch]: New files.
6798 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6799 (text): Call to the underline() method only when needed.
6801 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6803 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6804 encoding(s) for the document.
6806 * src/bufferparams.C (BufferParams): Changed default value of
6809 * src/language.C (newLang): Removed.
6810 (items[]): Added encoding information for all defined languages.
6812 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6813 encoding choice button.
6815 * src/lyxrc.h (font_norm_type): New member variable.
6816 (set_font_norm_type): New method.
6818 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6819 paragraphs with different encodings.
6821 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6822 (TransformChar): Changed to work correctly with Arabic points.
6823 (draw): Added support for drawing Arabic points.
6824 (draw): Removed code for drawing underbars (this is done by
6827 * src/support/textutils.h (IsPrintableNonspace): New function.
6829 * src/BufferView_pimpl.h: Added "using SigC::Object".
6830 * src/LyXView.h: ditto.
6832 * src/insets/insetinclude.h (include_label): Changed to mutable.
6834 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6836 * src/mathed/math_iter.h: remove empty destructor
6838 * src/mathed/math_cursor.h: remove empty destructor
6840 * src/insets/lyxinset.h: add THEOREM_CODE
6842 * src/insets/insettheorem.[Ch]: new files
6844 * src/insets/insetminipage.C: (InsertInset): remove
6846 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6848 (InsertInset): remove
6850 * src/insets/insetlist.C: (InsertList): remove
6852 * src/insets/insetfootlike.[Ch]: new files
6854 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6857 (InsertInset): ditto
6859 * src/insets/insetert.C: remove include Painter.h, reindent
6860 (InsertInset): move to header
6862 * src/insets/insetcollapsable.h: remove explicit from default
6863 contructor, remove empty destructor, add InsertInset
6865 * src/insets/insetcollapsable.C (InsertInset): new func
6867 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6869 * src/vspace.h: add explicit to constructor
6871 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6872 \textcompwordmark, please test this.
6874 * src/lyxrc.C: set ascii_linelen to 65 by default
6876 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6878 * src/commandtags.h: add LFUN_INSET_THEOREM
6880 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6881 (makeLinuxDocFile): remove _some_ of the nice logic
6882 (makeDocBookFile): ditto
6884 * src/Painter.[Ch]: (~Painter): removed
6886 * src/LyXAction.C (init): entry for insettheorem added
6888 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6890 (deplog): code to detect files generated by LaTeX, needs testing
6893 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6895 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6897 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6899 * src/LaTeX.C (deplog): Add a check for files that are going to be
6900 created by the first latex run, part of the project to remove the
6903 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6904 contents to the extension list.
6906 2000-07-04 Juergen Vigna <jug@sad.it>
6908 * src/text.C (NextBreakPoint): added support for needFullRow()
6910 * src/insets/lyxinset.h: added needFullRow()
6912 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6915 * src/insets/insettext.C: lots of changes for update!
6917 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6919 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6921 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6923 * src/insets/insetinclude.C (InsetInclude): fixed
6924 initialization of include_label.
6925 (unique_id): now returns a string.
6927 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6929 * src/LaTeXFeatures.h: new member IncludedFiles, for
6930 a map of key, included file name.
6932 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6933 with the included files for inclusion in SGML preamble,
6934 i. e., linuxdoc and docbook.
6937 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6938 nice (is the generated linuxdoc code to be exported?), that
6939 allows to remove column, and only_body that will be true for
6940 slave documents. Insets are allowed inside SGML font type.
6941 New handling of the SGML preamble for included files.
6942 (makeDocBookFile): the same for docbook.
6944 * src/insets/insetinclude.h:
6945 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6947 (DocBook): new export methods.
6949 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6950 and makeDocBookFile.
6952 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6953 formats to export with command line argument -x.
6955 2000-06-29 Juergen Vigna <jug@sad.it>
6957 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6958 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6960 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6961 region could already been cleared by an inset!
6963 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6965 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6968 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6970 (cursorToggle): remove special handling of lyx focus.
6972 2000-06-28 Juergen Vigna <jug@sad.it>
6974 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6977 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6979 * src/insets/insetindex.C (Edit): add a callback when popup is
6982 * src/insets/insettext.C (LocalDispatch):
6983 * src/insets/insetmarginal.h:
6984 * src/insets/insetlist.h:
6985 * src/insets/insetfoot.h:
6986 * src/insets/insetfloat.h:
6987 * src/insets/insetert.h: add a missing std:: qualifier.
6989 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6991 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6994 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6996 * src/insets/insettext.C (Read): remove tmptok unused variable
6997 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6998 (InsertInset): change for new InsetInset code
7000 * src/insets/insettext.h: add TEXT inline method
7002 * src/insets/insettext.C: remove TEXT macro
7004 * src/insets/insetmarginal.C (Write): new method
7005 (Latex): change output slightly
7007 * src/insets/insetfoot.C (Write): new method
7008 (Latex): change output slightly (don't use endl when no need)
7010 * src/insets/insetert.C (Write): new method
7012 * src/insets/insetcollapsable.h: make button_length, button_top_y
7013 and button_bottm_y protected.
7015 * src/insets/insetcollapsable.C (Write): simplify code by using
7016 tostr. Also do not output the float name, the children class
7017 should to that to get control over own arguments
7019 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
7020 src/insets/insetminipage.[Ch]:
7023 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
7025 * src/lyxfunc.C (Dispatch): cases for new insets/commands
7027 * src/Makefile.am (lyx_SOURCES): add the new files
7029 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
7030 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
7031 * src/commandtags.h: ditto
7033 * src/LaTeXFeatures.h: add a std::set of used floattypes
7035 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
7037 * src/FloatList.[Ch] src/Floating.h: new files
7039 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
7041 * src/lyx_cb.C (TableApplyCB): ditto
7043 * src/text2.C: ditto
7044 * src/buffer.C (SimpleLinuxDocOnePar): ditto
7045 (parseSingleLyXformat2Token): ditto + add code for
7046 backwards compability for old float styles + add code for new insets
7048 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
7050 (InsertInset(size_type, Inset *, LyXFont)): new method
7051 (InsetChar(size_type, char)): changed to use the other InsetChar
7052 with a LyXFont(ALL_INHERIT).
7053 (InsetInset(size_type, Inset*)): changed to use InsetChar to
7054 insert the META_INSET.
7056 * sigc++/thread.cc (Privete<int>::operator int&): move definition
7058 * sigc++/thread.h (Threads): from here
7060 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
7061 definition out of line
7062 * sigc++/scope.h: from here
7064 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7066 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
7067 is specified (adapted from a patch from edscott <edscott@imp.mx>).
7069 * Makefile.am (bindist): new target.
7071 * INSTALL: add instructions for doing a binary distribution.
7073 * development/tools/README.bin.example: update a bit.
7075 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
7078 * lib/lyxrc.example: new lyxrc tag \set_color.
7080 * src/lyxfunc.C (Dispatch):
7081 * src/commandtags.h:
7082 * src/LyXAction.C: new lyxfunc "set-color".
7084 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
7085 and an x11name given as strings.
7087 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
7088 cache when a color is changed.
7090 2000-06-26 Juergen Vigna <jug@sad.it>
7092 * src/lyxrow.C (width): added this functions and variable.
7094 * src/insets/insetcite.C (create_form_citation_form): some Gravity
7097 * src/text.C (SetHeightOfRow): fixed calcualting of width.
7099 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7101 * images/undo_bw.xpm: new icon.
7102 * images/redo_bw.xpm: ditto.
7104 * configure.in (INSTALL_SCRIPT): change value to
7105 ${INSTALL} to avoid failures of install-script target.
7106 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7108 * src/BufferView.h: add a magic "friend" declaration to please
7111 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7113 * forms/cite.fd: modified to allow resizing without messing
7116 * src/insetcite.C: Uses code from cite.fd almost without
7118 User can now resize dialog in the x-direction.
7119 Resizing the dialog in the y-direction is prevented, as the
7120 code does this intelligently already.
7122 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7124 * INSTALL: remove obsolete entry in "problems" section.
7126 * lib/examples/sl_*.lyx: update of the slovenian examples.
7128 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7130 2000-06-23 Juergen Vigna <jug@sad.it>
7132 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7134 * src/buffer.C (resize): delete the LyXText of textinsets.
7136 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7138 * src/insets/lyxinset.h: added another parameter 'cleared' to
7139 the draw() function.
7141 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7142 unlocking inset in inset.
7144 2000-06-22 Juergen Vigna <jug@sad.it>
7146 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7147 of insets and moved first to LyXText.
7149 * src/mathed/formulamacro.[Ch]:
7150 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7152 2000-06-21 Juergen Vigna <jug@sad.it>
7154 * src/text.C (GetVisibleRow): look if I should clear the area or not
7155 using Inset::doClearArea() function.
7157 * src/insets/lyxinset.h: added doClearArea() function and
7158 modified draw(Painter &, ...) to draw(BufferView *, ...)
7160 * src/text2.C (UpdateInset): return bool insted of int
7162 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7164 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7165 combox in the character popup
7167 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7168 BufferParams const & params
7170 2000-06-20 Juergen Vigna <jug@sad.it>
7172 * src/insets/insettext.C (SetParagraphData): set insetowner on
7175 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7177 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7178 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7180 (form_main_): remove
7182 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7183 (create_form_form_main): remove FD_form_main stuff, connect to
7184 autosave_timeout signal
7186 * src/LyXView.[Ch] (getMainForm): remove
7187 (UpdateTimerCB): remove
7188 * src/BufferView_pimpl.h: inherit from SigC::Object
7190 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7191 signal instead of callback
7193 * src/BufferView.[Ch] (cursorToggleCB): remove
7195 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7197 * src/BufferView_pimpl.C: changes because of the one below
7199 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7200 instead of storing a pointer to a LyXText.
7202 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7204 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7206 * src/lyxparagraph.h
7208 * src/paragraph.C: Changed fontlist to a sorted vector.
7210 2000-06-19 Juergen Vigna <jug@sad.it>
7212 * src/BufferView.h: added screen() function.
7214 * src/insets/insettext.C (LocalDispatch): some selection code
7217 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7219 * src/insets/insettext.C (SetParagraphData):
7221 (InsetText): fixes for multiple paragraphs.
7223 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7225 * development/lyx.spec.in: Call configure with ``--without-warnings''
7226 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7227 This should be fine, however, since we generally don't want to be
7228 verbose when making an RPM.
7230 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7232 * lib/scripts/fig2pstex.py: New file
7234 2000-06-16 Juergen Vigna <jug@sad.it>
7236 * src/insets/insettabular.C (UpdateLocal):
7237 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7238 (LocalDispatch): Changed all functions to use LyXText.
7240 2000-06-15 Juergen Vigna <jug@sad.it>
7242 * src/text.C (SetHeightOfRow): call inset::update before requesting
7245 * src/insets/insettext.C (update):
7246 * src/insets/insettabular.C (update): added implementation
7248 * src/insets/lyxinset.h: added update function
7250 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7252 * src/text.C (SelectNextWord): protect against null pointers with
7253 old-style string streams. (fix from Paul Theo Gonciari
7256 * src/cite.[Ch]: remove erroneous files.
7258 * lib/configure.m4: update the list of created directories.
7260 * src/lyxrow.C: include <config.h>
7261 * src/lyxcursor.C: ditto.
7263 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7265 * lib/examples/decimal.lyx: new example file from Mike.
7267 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7268 to find template definitions (from Dekel)
7270 * src/frontends/.cvsignore: add a few things.
7272 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7274 * src/Timeout.C (TimeOut): remove default argument.
7276 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7279 * src/insets/ExternalTemplate.C: add a "using" directive.
7281 * src/lyx_main.h: remove the act_ struct, which seems unused
7284 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7286 * LyX Developers Meeting: All files changed, due to random C++ (by
7287 coincidence) code generator script.
7289 - external inset (cool!)
7290 - initial online editing of preferences
7291 - insettabular breaks insettext(s contents)
7293 - some DocBook fixes
7294 - example files update
7295 - other cool stuff, create a diff and look for yourself.
7297 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7299 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7300 -1 this is a non-line-breaking textinset.
7302 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7303 if there is no width set.
7305 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7307 * Lots of files: Merged the dialogbase branch.
7309 2000-06-09 Allan Rae <rae@lyx.org>
7311 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7312 and the Dispatch methods that used it.
7314 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7315 access to functions formerly kept in Dispatch.
7317 2000-05-19 Allan Rae <rae@lyx.org>
7319 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7320 made to_page and count_copies integers again. from_page remains a
7321 string however because I want to allow entry of a print range like
7322 "1,4,22-25" using this field.
7324 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7325 and printer-params-get. These aren't useful from the minibuffer but
7326 could be used by a script/LyXServer app provided it passes a suitable
7327 auto_mem_buffer. I guess I should take a look at how the LyXServer
7328 works and make it support xtl buffers.
7330 * sigc++/: updated to libsigc++-1.0.1
7332 * src/xtl/: updated to xtl-1.3.pl.11
7334 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7335 those changes done to the files in src/ are actually recreated when
7336 they get regenerated. Please don't ever accept a patch that changes a
7337 dialog unless that patch includes the changes to the corresponding *.fd
7340 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7341 stringOnlyContains, renamed it and generalised it.
7343 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7344 branch. Removed the remaining old form_print code.
7346 2000-04-26 Allan Rae <rae@lyx.org>
7348 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7349 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7351 2000-04-25 Allan Rae <rae@lyx.org>
7353 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7354 against a base of xtl-1.3.pl.4
7356 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7357 filter the Id: entries so they still show the xtl version number
7360 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7361 into the src/xtl code. Patch still pending with José (XTL)
7363 2000-04-24 Allan Rae <rae@lyx.org>
7365 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7366 both more generic and much safer. Use the new template functions.
7367 * src/buffer.[Ch] (Dispatch): ditto.
7369 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7370 and mem buffer more intelligently. Also a little general cleanup.
7373 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7374 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7375 * src/xtl/Makefile.am: ditto.
7376 * src/xtl/.cvsignore: ditto.
7377 * src/Makefile.am: ditto.
7379 * src/PrinterParams.h: Removed the macros member functions. Added a
7380 testInvariant member function. A bit of tidying up and commenting.
7381 Included Angus's idea for fixing operation with egcs-1.1.2.
7383 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7384 cool expansion of XTL's mem_buffer to support automatic memory
7385 management within the buffer itself. Removed the various macros and
7386 replaced them with template functions that use either auto_mem_buffer
7387 or mem_buffer depending on a #define. The mem_buffer support will
7388 disappear as soon as the auto_mem_buffer is confirmed to be good on
7389 other platforms/compilers. That is, it's there so you've got something
7392 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7393 effectively forked XTL. However I expect José will include my code
7394 into the next major release. Also fixed a memory leak.
7395 * src/xtl/text.h: ditto.
7396 * src/xtl/xdr.h: ditto.
7397 * src/xtl/giop.h: ditto.
7399 2000-04-16 Allan Rae <rae@lyx.org>
7401 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7402 by autogen.sh and removed by maintainer-clean anyway.
7403 * .cvsignore, sigc++/.cvsignore: Support the above.
7405 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7407 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7409 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7410 macros, renamed static callback-target member functions to suit new
7411 scheme and made them public.
7412 * src/frontends/xforms/forms/form_print.fd: ditto.
7413 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7415 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7418 * src/xtl/: New directory containing a minimal distribution of XTL.
7419 This is XTL-1.3.pl.4.
7421 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7423 2000-04-15 Allan Rae <rae@lyx.org>
7425 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7427 * sigc++/: Updated to libsigc++-1.0.0
7429 2000-04-14 Allan Rae <rae@lyx.org>
7431 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7432 use the generic ones in future. I'll modify my conversion script.
7434 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7436 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7437 (CloseAllBufferRelatedDialogs): Renamed.
7438 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7440 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7441 of the generic ones. These are the same ones my conversion script
7444 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7445 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7446 * src/buffer.C (Dispatch): ditto
7448 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7449 functions for updating and hiding buffer dependent dialogs.
7450 * src/BufferView.C (buffer): ditto
7451 * src/buffer.C (setReadonly): ditto
7452 * src/lyxfunc.C (CloseBuffer): ditto
7454 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7455 Dialogs.h, and hence all the SigC stuff, into every file that includes
7456 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7458 * src/BufferView2.C: reduce the number of headers included by buffer.h
7460 2000-04-11 Allan Rae <rae@lyx.org>
7462 * src/frontends/xforms/xform_macros.h: A small collection of macros
7463 for building C callbacks.
7465 * src/frontends/xforms/Makefile.am: Added above file.
7467 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7468 scheme again. This time it should work for JMarc. If this is
7469 successful I'll revise my conversion script to automate some of this.
7470 The static member functions in the class also have to be public for
7471 this scheme will work. If the scheme works (it's almost identical to
7472 the way BufferView::cursorToggleCB is handled so it should work) then
7473 FormCopyright and FormPrint will be ready for inclusion into the main
7474 trunk immediately after 1.1.5 is released -- provided we're prepared
7475 for complaints about lame compilers not handling XTL.
7477 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7479 2000-04-07 Allan Rae <rae@lyx.org>
7481 * config/lyxinclude.m4: A bit more tidying up (Angus)
7483 * src/LString.h: JMarc's <string> header fix
7485 * src/PrinterParams.h: Used string for most data to remove some
7486 ugly code in the Print dialog and avoid even uglier code when
7487 appending the ints to a string for output.
7489 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7490 and moved "default:" back to the end of switch statement. Cleaned
7491 up the printing so it uses the right function calls and so the
7492 "print to file" option actually puts the file in the right directory.
7494 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7496 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7497 and Ok+Apply button control into a separate method: input (Angus).
7498 (input) Cleaned it up and improved it to be very thorough now.
7499 (All CB) static_cast used instead of C style cast (Angus). This will
7500 probably change again once we've worked out how to keep gcc-2.8.1 happy
7501 with real C callbacks.
7502 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7503 ignore some of the bool settings and has random numbers instead. Needs
7504 some more investigation. Added other input length checks and checking
7505 of file and printer names.
7507 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7508 would link (Angus). Seems the old code doesn't compile with the pragma
7509 statement either. Separated callback entries from internal methods.
7511 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7513 2000-03-17 Allan Rae <rae@lyx.org>
7515 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7516 need it? Maybe it could go in Dialogs instead? I could make it a
7517 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7518 values to get the bool return value.
7519 (Dispatch): New overloaded method for xtl support.
7521 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7522 extern "C" callback instead of static member functions. Hopefully,
7523 JMarc will be able to compile this. I haven't changed
7524 forms/form_copyright.fd yet. Breaking one of my own rules already.
7526 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7527 because they aren't useful from the minibuffer. Maybe a LyXServer
7528 might want a help message though?
7530 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7532 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7533 xtl which needs both rtti and exceptions.
7535 * src/support/Makefile.am:
7536 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7538 * src/frontends/xforms/input_validators.[ch]: input filters and
7539 validators. These conrol what keys are valid in input boxes.
7540 Use them and write some more. Much better idea than waiting till
7541 after the user has pressed Ok to say that the input fields don't make
7544 * src/frontends/xforms/Makefile.am:
7545 * src/frontends/xforms/forms/form_print.fd:
7546 * src/frontends/xforms/forms/makefile:
7547 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7548 new scheme. Still have to make sure I haven't missed anything from
7549 the current implementation.
7551 * src/Makefile.am, src/PrinterParams.h: New data store.
7553 * other files: Added a couple of copyright notices.
7555 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7557 * src/insets/insetbib.h: move Holder struct in public space.
7559 * src/frontends/include/DialogBase.h: use SigC:: only when
7560 SIGC_CXX_NAMESPACES is defined.
7561 * src/frontends/include/Dialogs.h: ditto.
7563 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7565 * src/frontends/xforms/FormCopyright.[Ch]: do not
7566 mention SigC:: explicitely.
7568 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7570 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7571 deals with testing KDE in main configure.in
7572 * configure.in: ditto.
7574 2000-02-22 Allan Rae <rae@lyx.org>
7576 * Lots of files: Merged from HEAD
7578 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7579 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7581 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7583 * sigc++/: new minidist.
7585 2000-02-14 Allan Rae <rae@lyx.org>
7587 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7589 2000-02-08 Juergen Vigna <jug@sad.it>
7591 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7592 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7594 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7595 for this port and so it is much easier for other people to port
7596 dialogs in a common development environment.
7598 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7599 the QT/KDE implementation.
7601 * src/frontends/kde/Dialogs.C:
7602 * src/frontends/kde/FormCopyright.C:
7603 * src/frontends/kde/FormCopyright.h:
7604 * src/frontends/kde/Makefile.am:
7605 * src/frontends/kde/formcopyrightdialog.C:
7606 * src/frontends/kde/formcopyrightdialog.h:
7607 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7608 for the kde support of the Copyright-Dialog.
7610 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7611 subdir-substitution instead of hardcoded 'xforms' as we now have also
7614 * src/frontends/include/DialogBase.h (Object): just commented the
7615 label after #endif (nasty warning and I don't like warnings ;)
7617 * src/main.C (main): added KApplication initialization if using
7620 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7621 For now only the KDE event-loop is added if frontend==kde.
7623 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7625 * configure.in: added support for the --with-frontend[=value] option
7627 * autogen.sh: added kde.m4 file to list of config-files
7629 * acconfig.h: added define for KDEGUI-support
7631 * config/kde.m4: added configuration functions for KDE-port
7633 * config/lyxinclude.m4: added --with-frontend[=value] option with
7634 support for xforms and KDE.
7636 2000-02-08 Allan Rae <rae@lyx.org>
7638 * all Makefile.am: Fixed up so the make targets dist, distclean,
7639 install and uninstall all work even if builddir != srcdir. Still
7640 have a new sigc++ minidist update to come.
7642 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7644 2000-02-01 Allan Rae <rae@lyx.org>
7646 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7647 Many mods to get builddir != srcdir working.
7649 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7650 for building on NT and so we can do the builddir != srcdir stuff.
7652 2000-01-30 Allan Rae <rae@lyx.org>
7654 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7655 This will stay in "rae" branch. We probably don't really need it in
7656 the main trunk as anyone who wants to help programming it should get
7657 a full library installed also. So they can check both included and
7658 system supplied library compilation.
7660 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7661 Added a 'mini' distribution of libsigc++. If you feel the urge to
7662 change something in these directories - Resist it. If you can't
7663 resist the urge then you should modify the following script and rebuild
7664 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7665 all happen. Still uses a hacked version of libsigc++'s configure.in.
7666 I'm quite happy with the results. I'm not sure the extra work to turn
7667 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7668 worth the trouble and would probably lead to extra maintenance
7670 I haven't tested the following important make targets: install, dist.
7671 Not ready for prime time but very close. Maybe 1.1.5.
7673 * development/tools/makeLyXsigc.sh: A shell script to automatically
7674 generate our mini-dist of libsigc++. It can only be used with a CVS
7675 checkout of libsigc++ not a tarball distribution. It's well commented.
7676 This will end up as part of the libsigc++ distribution so other apps
7677 can easily have an included mini-dist. If someone makes mods to the
7678 sigc++ subpackage without modifying this script to generate those
7679 changes I'll be very upset!
7681 * src/frontends/: Started the gui/system indep structure.
7683 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7684 to access the gui-indep dialogs are in this class. Much improved
7685 design compared to previous revision. Lars, please refrain from
7686 moving this header into src/ like you did with Popups.h last time.
7688 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7690 * src/frontends/xforms/: Started the gui-indep system with a single
7691 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7694 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7695 Here you'll find a very useful makefile and automated fdfix.sh that
7696 makes updating dailogs a no-brainer -- provided you follow the rules
7697 set out in the README. I'm thinking about adding another script to
7698 automatically generate skeleton code for a new dialog given just the
7701 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7702 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7703 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7705 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7707 * src/support/LSubstring.C (operator): simplify
7709 * src/lyxtext.h: removed bparams, use buffer_->params instead
7711 * src/lyxrow.h: make Row a real class, move all variables to
7712 private and use accessors.
7714 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7716 (isRightToLeftPar): ditto
7717 (ChangeLanguage): ditto
7718 (isMultiLingual): ditto
7721 (SimpleTeXOnePar): ditto
7722 (TeXEnvironment): ditto
7723 (GetEndLabel): ditto
7725 (SetOnlyLayout): ditto
7726 (BreakParagraph): ditto
7727 (BreakParagraphConservative): ditto
7728 (GetFontSettings): ditto
7730 (CopyIntoMinibuffer): ditto
7731 (CutIntoMinibuffer): ditto
7732 (PasteParagraph): ditto
7733 (SetPExtraType): ditto
7734 (UnsetPExtraType): ditto
7735 (DocBookContTableRows): ditto
7736 (SimpleDocBookOneTablePar): ditto
7738 (TeXFootnote): ditto
7739 (SimpleTeXOneTablePar): ditto
7740 (TeXContTableRows): ditto
7741 (SimpleTeXSpecialChars): ditto
7744 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7745 to private and use accessors.
7747 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7748 this, we did not use it anymore and has not been for ages. Just a
7749 waste of cpu cycles.
7751 * src/language.h: make Language a real class, move all variables
7752 to private and use accessors.
7754 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7755 (create_view): remove
7756 (update): some changes for new timer
7757 (cursorToggle): use new timer
7758 (beforeChange): change for new timer
7760 * src/BufferView.h (cursorToggleCB): removed last paramter because
7763 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7764 (cursorToggleCB): change because of new timer code
7766 * lib/CREDITS: updated own mailaddress
7768 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7770 * src/support/filetools.C (PutEnv): fix the code in case neither
7771 putenv() nor setenv() have been found.
7773 * INSTALL: mention the install-strip Makefile target.
7775 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7776 read-only documents.
7778 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7780 * lib/reLyX/configure.in (VERSION): avoid using a previously
7781 generated reLyX wrapper to find out $prefix.
7783 * lib/examples/eu_adibide_lyx-atua.lyx:
7784 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7785 translation of the Tutorial (Dooteo)
7787 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7789 * forms/cite.fd: new citation dialog
7791 * src/insetcite.[Ch]: the new citation dialog is moved into
7794 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7797 * src/insets/insetcommand.h: data members made private.
7799 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7801 * LyX 1.1.5 released
7803 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7805 * src/version.h (LYX_RELEASE): to 1.1.5
7807 * src/spellchecker.C (RunSpellChecker): return false if the
7808 spellchecker dies upon creation.
7810 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7812 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7813 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7817 * lib/CREDITS: update entry for Martin Vermeer.
7819 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7821 * src/text.C (draw): Draw foreign language bars at the bottom of
7822 the row instead of at the baseline.
7824 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7826 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7828 * lib/bind/de_menus.bind: updated
7830 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7832 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7834 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7836 * src/menus.C (Limit_string_length): New function
7837 (ShowTocMenu): Limit the number of items/length of items in the
7840 * src/paragraph.C (String): Correct result for a paragraph inside
7843 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7845 * src/bufferlist.C (close): test of buf->getuser() == NULL
7847 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7849 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7850 Do not call to SetCursor when the paragraph is a closed footnote!
7852 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7854 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7857 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7859 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7862 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7863 reference popup, that activates the reference-back action
7865 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7867 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7868 the menus. Also fixed a bug.
7870 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7871 the math panels when switching buffers (unless new buffer is readonly).
7873 * src/BufferView.C (NoSavedPositions)
7874 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7876 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7878 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7879 less of dvi dirty or not.
7881 * src/trans_mgr.[Ch] (insert): change first parameter to string
7884 * src/chset.[Ch] (encodeString): add const to first parameter
7886 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7888 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7892 * src/LaTeX.C (deplog): better searching for dependency files in
7893 the latex log. Uses now regexps.
7895 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7896 instead of the box hack or \hfill.
7898 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7900 * src/lyxfunc.C (doImportHelper): do not create the file before
7901 doing the actual import.
7902 (doImportASCIIasLines): create a new file before doing the insert.
7903 (doImportASCIIasParagraphs): ditto.
7905 * lib/lyxrc.example: remove mention of non-existing commands
7907 * lyx.man: remove mention of color-related switches.
7909 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7911 * src/lyx_gui.C: remove all the color-related ressources, which
7912 are not used anymore.
7914 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7917 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7919 * src/lyxrc.C (read): Add a missing break in the switch
7921 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7923 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7925 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7928 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7930 * src/text.C (draw): draw bars under foreign language words.
7932 * src/LColor.[Ch]: add LColor::language
7934 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7936 * src/lyxcursor.h (boundary): New member variable
7938 * src/text.C (IsBoundary): New methods
7940 * src/text.C: Use the above for currect cursor movement when there
7941 is both RTL & LTR text.
7943 * src/text2.C: ditto
7945 * src/bufferview_funcs.C (ToggleAndShow): ditto
7947 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7949 * src/text.C (DeleteLineForward): set selection to true to avoid
7950 that DeleteEmptyParagraphMechanism does some magic. This is how it
7951 is done in all other functions, and seems reasonable.
7952 (DeleteWordForward): do not jump over non-word stuff, since
7953 CursorRightOneWord() already does it.
7955 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7956 DeleteWordBackward, since they seem safe to me (since selection is
7957 set to "true") DeleteEmptyParagraphMechanism does nothing.
7959 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7961 * src/lyx_main.C (easyParse): simplify the code by factoring the
7962 part that removes parameters from the command line.
7963 (LyX): check wether wrong command line options have been given.
7965 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7967 * src/lyx_main.C : add support for specifying user LyX
7968 directory via command line option -userdir.
7970 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7972 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7973 the number of items per popup.
7974 (Add_to_refs_menu): Ditto.
7976 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7978 * src/lyxparagraph.h: renamed ClearParagraph() to
7979 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7980 textclass as parameter, and do nothing if free_spacing is
7981 true. This fixes part of the line-delete-forward problems.
7983 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7984 (pasteSelection): ditto.
7985 (SwitchLayoutsBetweenClasses): more translatable strings.
7987 * src/text2.C (CutSelection): use StripLeadingSpaces.
7988 (PasteSelection): ditto.
7989 (DeleteEmptyParagraphMechanism): ditto.
7991 2000-05-26 Juergen Vigna <jug@sad.it>
7993 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7994 is not needed in tabular insets.
7996 * src/insets/insettabular.C (TabularFeatures): added missing features.
7998 * src/tabular.C (DeleteColumn):
8000 (AppendRow): implemented this functions
8001 (cellsturct::operator=): clone the inset too;
8003 2000-05-23 Juergen Vigna <jug@sad.it>
8005 * src/insets/insettabular.C (LocalDispatch): better selection support
8006 when having multicolumn-cells.
8008 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8010 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
8012 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8014 * src/ColorHandler.C (getGCForeground): put more test into _()
8016 * lib/examples/eu_splash.lyx: new file (Basque translation) from
8019 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
8022 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
8024 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
8025 there are no labels, or when buffer is readonly.
8027 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
8028 there are no labels, buffer is SGML, or when buffer is readonly.
8030 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8032 * src/LColor.C (LColor): change a couple of grey40 to grey60
8033 (LColor): rewore initalization to make compiles go some magnitude
8035 (getGUIName): don't use gettext until we need the string.
8037 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
8039 * src/Bullet.[Ch]: Fixed a small bug.
8041 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
8043 * src/paragraph.C (String): Several fixes/improvements
8045 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
8047 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8049 * src/paragraph.C (String): give more correct output.
8051 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
8053 * src/lyxfont.C (stateText) Do not output the language if it is
8054 eqaul to the language of the document.
8056 * src/paragraph.C (TeXOnePar): Do not put language switch commands
8057 between two paragraphs with the same language.
8059 * src/paragraph.C (getParLanguage) Return a correct answer for an
8060 empty dummy paragraph.
8062 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
8065 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
8068 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
8069 the menus/popup, if requested fonts are unavailable.
8071 2000-05-22 Juergen Vigna <jug@sad.it>
8073 * src/insets/insettabular.C (LocalDispatch): added some more cursor
8074 movement support (Up/Down/Tab/Shift-Tab).
8075 (LocalDispatch): added also preliminari cursor-selection.
8077 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
8079 * src/paragraph.C (PasteParagraph): Hopefully now right!
8081 2000-05-22 Garst R. Reese <reese@isn.net>
8083 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
8084 of list, change all references to Environment to Command
8085 * tex/hollywood.cls : rewrite environments as commands, add
8086 \uppercase to interiorshot and exteriorshot to force uppecase.
8087 * tex/broadway.cls : rewrite environments as commands. Tweak
8090 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8092 * src/menus.C (Add_to_toc_menu): fix the code which limits the
8093 size of items: use a constant intead of the hardcoded 40, and more
8094 importantly do not remove the %m and %x tags added at the end.
8095 (Add_to_refs_menu): use vector::size_type instead of
8096 unsigned int as basic types for the variables. _Please_ do not
8097 assume that size_t is equal to unsigned int. On an alpha, this is
8098 unsigned long, which is _not_ the same.
8100 * src/language.C (initL): remove language "hungarian", since it
8101 seems that "magyar" is better.
8103 2000-05-22 Juergen Vigna <jug@sad.it>
8105 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8107 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8110 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8111 next was deleted but not set to 0.
8113 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8115 * src/language.C (initL): change the initialization of languages
8116 so that compiles goes _fast_.
8118 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8121 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8123 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8127 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8129 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8131 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8135 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8138 * src/insets/insetlo*.[Ch]: Made editable
8140 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8142 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8143 the current selection.
8145 * src/BufferView_pimpl.C (stuffClipboard): new method
8147 * src/BufferView.C (stuffClipboard): new method
8149 * src/paragraph.C (String): new method
8151 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8152 LColor::ignore when lyxname is not found.
8154 * src/BufferView.C (pasteSelection): new method
8156 * src/BufferView_pimpl.C (pasteSelection): new method
8158 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8160 * src/WorkArea.C (request_clipboard_cb): new static function
8161 (getClipboard): new method
8162 (putClipboard): new method
8164 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8166 * LyX 1.1.5pre2 released
8168 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8170 * src/vspace.C (operator=): removed
8171 (operator=): removed
8173 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8175 * src/layout.C (NumberOfClass): manually set the type in make_pair
8176 (NumberOfLayout): ditto
8178 * src/language.C: use the Language constructor for ignore_lang
8180 * src/language.h: add constructors to struct Language
8182 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8184 * src/text2.C (SetCursorIntern): comment out #warning
8186 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8188 * src/mathed/math_iter.h: initialize sx and sw to 0
8190 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8192 * forms/lyx.fd: Redesign of form_ref
8194 * src/LaTeXFeatures.[Ch]
8198 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8201 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8202 and Buffer::inset_iterator.
8204 * src/menus.C: Added new menus: TOC and Refs.
8206 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8208 * src/buffer.C (getTocList): New method.
8210 * src/BufferView2.C (ChangeRefs): New method.
8212 * src/buffer.C (getLabelList): New method. It replaces the old
8213 getReferenceList. The return type is vector<string> instead of
8216 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8217 the old getLabel() and GetNumberOfLabels() methods.
8218 * src/insets/insetlabel.C (getLabelList): ditto
8219 * src/mathed/formula.C (getLabelList): ditto
8221 * src/paragraph.C (String): New method.
8223 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8224 Uses the new getTocList() method.
8225 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8226 which automatically updates the contents of the browser.
8227 (RefUpdateCB): Use the new getLabelList method.
8229 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8231 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8233 * src/spellchecker.C: Added using std::reverse;
8235 2000-05-19 Juergen Vigna <jug@sad.it>
8237 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8239 * src/insets/insettext.C (computeTextRows): small fix for display of
8240 1 character after a newline.
8242 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8245 2000-05-18 Juergen Vigna <jug@sad.it>
8247 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8248 when changing width of column.
8250 * src/tabular.C (set_row_column_number_info): setting of
8251 autobreak rows if necessary.
8253 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8255 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8257 * src/vc-backend.*: renamed stat() to status() and vcstat to
8258 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8259 compilation broke. The new name seems more relevant, anyway.
8261 2000-05-17 Juergen Vigna <jug@sad.it>
8263 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8264 which was wrong if the removing caused removing of rows!
8266 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8267 (pushToken): new function.
8269 * src/text2.C (CutSelection): fix problem discovered with purify
8271 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8273 * src/debug.C (showTags): enlarge the first column, now that we
8274 have 6-digits debug codes.
8276 * lib/layouts/hollywood.layout:
8277 * lib/tex/hollywood.cls:
8278 * lib/tex/brodway.cls:
8279 * lib/layouts/brodway.layout: more commands and fewer
8280 environments. Preambles moved in the .cls files. Broadway now has
8281 more options on scene numbering and less whitespace (from Garst)
8283 * src/insets/insetbib.C (getKeys): make sure that we are in the
8284 document directory, in case the bib file is there.
8286 * src/insets/insetbib.C (Latex): revert bogus change.
8288 2000-05-16 Juergen Vigna <jug@sad.it>
8290 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8291 the TabularLayout on cursor move.
8293 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8295 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8298 (draw): fixed cursor position and drawing so that the cursor is
8299 visible when before the tabular-inset.
8301 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8302 when creating from old insettext.
8304 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8306 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8308 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8309 * lib/tex/brodway.cls: ditto
8311 * lib/layouts/brodway.layout: change alignment of parenthical
8314 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8316 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8317 versions 0.88 and 0.89 are supported.
8319 2000-05-15 Juergen Vigna <jug@sad.it>
8321 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8324 * src/insets/insettext.C (computeTextRows): redone completely this
8325 function in a much cleaner way, because of problems when having a
8327 (draw): added a frame border when the inset is locked.
8328 (SetDrawLockedFrame): this sets if we draw the border or not.
8329 (SetFrameColor): this sets the frame color (default=insetframe).
8331 * src/insets/lyxinset.h: added x() and y() functions which return
8332 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8333 function which is needed to see if we have a locking inset of some
8334 type in this inset (needed for now in insettabular).
8336 * src/vspace.C (inPixels): the same function also without a BufferView
8337 parameter as so it is easier to use it in some ocasions.
8339 * src/lyxfunc.C: changed all places where insertInset was used so
8340 that now if it couldn't be inserted it is deleted!
8342 * src/TabularLayout.C:
8343 * src/TableLayout.C: added support for new tabular-inset!
8345 * src/BufferView2.C (insertInset): this now returns a bool if the
8346 inset was really inserted!!!
8348 * src/tabular.C (GetLastCellInRow):
8349 (GetFirstCellInRow): new helper functions.
8350 (Latex): implemented for new tabular class.
8354 (TeXTopHLine): new Latex() helper functions.
8356 2000-05-12 Juergen Vigna <jug@sad.it>
8358 * src/mathed/formulamacro.C (Read):
8359 * src/mathed/formula.C (Read): read also the \end_inset here!
8361 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8363 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8364 crush when saving formulae with unbalanced parenthesis.
8366 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8368 * src/layout.C: Add new keyword "endlabelstring" to layout file
8370 * src/text.C (GetVisibleRow): Draw endlabel string.
8372 * lib/layouts/broadway.layout
8373 * lib/layouts/hollywood.layout: Added endlabel for the
8374 Parenthetical layout.
8376 * lib/layouts/heb-article.layout: Do not use slanted font shape
8377 for Theorem like environments.
8379 * src/buffer.C (makeLaTeXFile): Always add "american" to
8380 the UsedLanguages list if document language is RTL.
8382 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8384 * add addendum to README.OS2 and small patch (from SMiyata)
8386 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8388 * many files: correct the calls to ChangeExtension().
8390 * src/support/filetools.C (ChangeExtension): remove the no_path
8391 argument, which does not belong there. Use OnlyFileName() instead.
8393 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8394 files when LaTeXing a non-nice latex file.
8396 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8397 a chain of "if". Return false when deadkeys are not handled.
8399 * src/lyx_main.C (LyX): adapted the code for default bindings.
8401 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8402 bindings for basic functionality (except deadkeys).
8403 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8405 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8406 several methods: handle override_x_deadkeys.
8408 * src/lyxrc.h: remove the "bindings" map, which did not make much
8409 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8411 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8413 * src/lyxfont.C (stateText): use a saner method to determine
8414 whether the font is "default". Seems to fix the crash with DEC
8417 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8419 2000-05-08 Juergen Vigna <jug@sad.it>
8421 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8422 TabularLayoutMenu with mouse-button-3
8423 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8425 * src/TabularLayout.C: added this file for having a Layout for
8428 2000-05-05 Juergen Vigna <jug@sad.it>
8430 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8431 recalculating inset-widths.
8432 (TabularFeatures): activated this function so that I can change
8433 tabular-features via menu.
8435 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8436 that I can test some functions with the Table menu.
8438 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8440 * src/lyxfont.C (stateText): guard against stupid c++libs.
8442 * src/tabular.C: add using std::vector
8443 some whitespace changes, + removed som autogenerated code.
8445 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8447 2000-05-05 Juergen Vigna <jug@sad.it>
8449 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8450 row, columns and cellstructures.
8452 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8454 * lib/lyxrc.example: remove obsolete entries.
8456 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8457 reading of protected_separator for free_spacing.
8459 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8461 * src/text.C (draw): do not display an exclamation mark in the
8462 margin for margin notes. This is confusing, ugly and
8465 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8466 AMS math' is checked.
8468 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8469 name to see whether including the amsmath package is needed.
8471 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8473 * src/paragraph.C (validate): Compute UsedLanguages correctly
8474 (don't insert the american language if it doesn't appear in the
8477 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8478 The argument of \thanks{} command is considered moving argument
8480 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8483 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8485 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8486 for appendix/minipage/depth. The lines can be now both in the footnote
8487 frame, and outside the frame.
8489 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8492 2000-05-05 Juergen Vigna <jug@sad.it>
8494 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8495 neede only in tabular.[Ch].
8497 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8499 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8501 (Write): write '~' for PROTECTED_SEPARATOR
8503 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8505 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8508 * src/mathed/formula.C (drawStr): rename size to siz.
8510 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8511 possibly fix a bug by not changing the pflags = flags to piflags =
8514 2000-05-05 Juergen Vigna <jug@sad.it>
8516 * src/insets/insetbib.C: moved using directive
8518 * src/ImportNoweb.C: small fix for being able to compile (missing
8521 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8523 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8524 to use clear, since we don't depend on this in the code. Add test
8527 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8529 * (various *.C files): add using std::foo directives to please dec
8532 * replace calls to string::clear() to string::erase() (Angus)
8534 * src/cheaders/cmath: modified to provide std::abs.
8536 2000-05-04 Juergen Vigna <jug@sad.it>
8538 * src/insets/insettext.C: Prepared all for inserting of multiple
8539 paragraphs. Still display stuff to do (alignment and other things),
8540 but I would like to use LyXText to do this when we cleaned out the
8541 table-support stuff.
8543 * src/insets/insettabular.C: Changed lot of stuff and added lots
8544 of functionality still a lot to do.
8546 * src/tabular.C: Various functions changed name and moved to be
8547 const functions. Added new Read and Write functions and changed
8548 lots of things so it works good with tabular-insets (also removed
8549 some stuff which is not needed anymore * hacks *).
8551 * src/lyxcursor.h: added operators == and != which just look if
8552 par and pos are (not) equal.
8554 * src/buffer.C (latexParagraphs): inserted this function to latex
8555 all paragraphs form par to endpar as then I can use this too for
8558 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8559 so that I can call this to from text insets with their own cursor.
8561 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8562 output off all paragraphs (because of the fix below)!
8564 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8565 the very last paragraph (this could be also the last paragraph of an
8568 * src/texrow.h: added rows() call which returns the count-variable.
8570 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8572 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8574 * lib/configure.m4: better autodetection of DocBook tools.
8576 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8578 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8580 * src/lyx_cb.C: add using std::reverse;
8582 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8585 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8586 selected files. Should fix repeated errors from generated files.
8588 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8590 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8592 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8593 the spellchecker popup.
8595 * lib/lyxrc.example: Removed the \number_inset section
8597 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8599 * src/insets/figinset.C (various): Use IsFileReadable() to make
8600 sure that the file actually exist. Relying on ghostscripts errors
8601 is a bad idea since they can lead to X server crashes.
8603 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8605 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8608 * lib/lyxrc.example: smallish typo in description of
8609 \view_dvi_paper_option
8611 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8614 * src/lyxfunc.C: doImportHelper to factor out common code of the
8615 various import methods. New functions doImportASCIIasLines,
8616 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8617 doImportLinuxDoc for the format specific parts.
8620 * buffer.C: Dispatch returns now a bool to indicate success
8623 * lyx_gui.C: Add getLyXView() for member access
8625 * lyx_main.C: Change logic for batch commands: First try
8626 Buffer::Dispatch (possibly without GUI), if that fails, use
8629 * lyx_main.C: Add support for --import command line switch.
8630 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8631 Available Formats: Everything accepted by 'buffer-import <format>'
8633 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8635 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8638 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8639 documents will be reformatted upon reentry.
8641 2000-04-27 Juergen Vigna <jug@sad.it>
8643 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8644 correctly only last pos this was a bug.
8646 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8648 * release of lyx-1.1.5pre1
8650 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8652 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8654 * src/menus.C: revert the change of naming (Figure->Graphic...)
8655 from 2000-04-11. It was incomplete and bad.
8657 * src/LColor.[Ch]: add LColor::depthbar.
8658 * src/text.C (GetVisibleRow): use it.
8660 * README: update the languages list.
8662 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8664 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8667 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8669 * README: remove sections that were just wrong.
8671 * src/text2.C (GetRowNearY): remove currentrow code
8673 * src/text.C (GetRow): remove currentrow code
8675 * src/screen.C (Update): rewritten a bit.
8676 (SmallUpdate): removed func
8678 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8680 (FullRebreak): return bool
8681 (currentrow): remove var
8682 (currentrow_y): ditto
8684 * src/lyxscreen.h (Draw): change arg to unsigned long
8685 (FitCursor): return bool
8686 (FitManualCursor): ditto
8687 (Smallpdate): remove func
8688 (first): change to unsigned long
8689 (DrawOneRow): change second arg to long (from long &)
8690 (screen_refresh_y): remove var
8691 (scree_refresh_row): ditto
8693 * src/lyxrow.h: change baseline to usigned int from unsigned
8694 short, this brings some implicit/unsigned issues out in the open.
8696 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8698 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8699 instead of smallUpdate.
8701 * src/lyxcursor.h: change y to unsigned long
8703 * src/buffer.h: don't call updateScrollbar after fitcursor
8705 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8706 where they are used. Removed "\\direction", this was not present
8707 in 1.1.4 and is already obsolete. Commented out some code that I
8708 believe to never be called.
8709 (runLiterate): don't call updateScrollbar after fitCursor
8711 (buildProgram): ditto
8714 * src/WorkArea.h (workWidth): change return val to unsigned
8717 (redraw): remove the button redraws
8718 (setScrollbarValue): change for scrollbar
8719 (getScrollbarValue): change for scrollbar
8720 (getScrollbarBounds): change for scrollbar
8722 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8723 (C_WorkArea_down_cb): removed func
8724 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8725 (resize): change for scrollbar
8726 (setScrollbar): ditto
8727 (setScrollbarBounds): ditto
8728 (setScrollbarIncrements): ditto
8729 (up_cb): removed func
8730 (down_cb): removed func
8731 (scroll_cb): change for scrollbar
8732 (work_area_handler): ditto
8734 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8735 when FitCursor did something.
8736 (updateScrollbar): some unsigned changes
8737 (downCB): removed func
8738 (scrollUpOnePage): removed func
8739 (scrollDownOnePage): remvoed func
8740 (workAreaMotionNotify): don't call screen->FitCursor but use
8741 fitCursor instead. and bool return val
8742 (workAreaButtonPress): ditto
8743 (workAreaButtonRelease): some unsigned changes
8744 (checkInsetHit): ditto
8745 (workAreaExpose): ditto
8746 (update): parts rewritten, comments about the signed char arg added
8747 (smallUpdate): removed func
8748 (cursorPrevious): call needed updateScrollbar
8751 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8754 * src/BufferView.[Ch] (upCB): removed func
8755 (downCB): removed func
8756 (smallUpdate): removed func
8758 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8760 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8761 currentrow, currentrow_y optimization. This did not help a lot and
8762 if we want to do this kind of optimization we should rather use
8763 cursor.row instead of the currentrow.
8765 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8766 buffer spacing and klyx spacing support.
8768 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8770 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8773 2000-04-26 Juergen Vigna <jug@sad.it>
8775 * src/insets/figinset.C: fixes to Lars sstream changes!
8777 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8779 * A lot of files: Added Ascii(ostream &) methods to all inset
8780 classes. Used when exporting to ASCII.
8782 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8783 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8786 * src/text2.C (ToggleFree): Disabled implicit word selection when
8787 there is a change in the language
8789 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8790 no output was generated for end-of-sentence inset.
8792 * src/insets/lyxinset.h
8795 * src/paragraph.C: Removed the insetnumber code
8797 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8799 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8801 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8802 no_babel and no_epsfig completely from the file.
8803 (parseSingleLyXformat2Token): add handling for per-paragraph
8804 spacing as written by klyx.
8806 * src/insets/figinset.C: applied patch by Andre. Made it work with
8809 2000-04-20 Juergen Vigna <jug@sad.it>
8811 * src/insets/insettext.C (cutSelection):
8812 (copySelection): Fixed with selection from right to left.
8813 (draw): now the rows are not recalculated at every draw.
8814 (computeTextRows): for now reset the inset-owner here (this is
8815 important for an undo or copy where the inset-owner is not set
8818 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8819 motion to the_locking_inset screen->first was forgotten, this was
8820 not important till we got multiline insets.
8822 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8824 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8825 code seems to be alright (it is code changed by Dekel, and the
8826 intent is indeed that all macros should be defined \protect'ed)
8828 * NEWS: a bit of reorganisation of the new user-visible features.
8830 2000-04-19 Juergen Vigna <jug@sad.it>
8832 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8833 position. Set the inset_owner of the used paragraph so that it knows
8834 that it is inside an inset. Fixed cursor handling with mouse and
8835 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8836 and cleanups to make TextInsets work better.
8838 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8839 Changed parameters of various functions and added LockInsetInInset().
8841 * src/insets/insettext.C:
8843 * src/insets/insetcollapsable.h:
8844 * src/insets/insetcollapsable.C:
8845 * src/insets/insetfoot.h:
8846 * src/insets/insetfoot.C:
8847 * src/insets/insetert.h:
8848 * src/insets/insetert.C: cleaned up the code so that it works now
8849 correctly with insettext.
8851 * src/insets/inset.C:
8852 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8853 that insets in insets are supported right.
8856 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8858 * src/paragraph.C: some small fixes
8860 * src/debug.h: inserted INSETS debug info
8862 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8863 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8865 * src/commandtags.h:
8866 * src/LyXAction.C: insert code for InsetTabular.
8868 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8869 not Button1MotionMask.
8870 (workAreaButtonRelease): send always a InsetButtonRelease event to
8872 (checkInsetHit): some setCursor fixes (always with insets).
8874 * src/BufferView2.C (lockInset): returns a bool now and extended for
8875 locking insets inside insets.
8876 (showLockedInsetCursor): it is important to have the cursor always
8877 before the locked inset.
8878 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8880 * src/BufferView.h: made lockInset return a bool.
8882 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8884 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8885 that is used also internally but can be called as public to have back
8886 a cursor pos which is not set internally.
8887 (SetCursorIntern): Changed to use above function.
8889 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8891 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8896 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8897 patches for things that should be in or should be changed.
8899 * src/* [insetfiles]: change "usigned char fragile" to bool
8900 fragile. There was only one point that could that be questioned
8901 and that is commented in formulamacro.C. Grep for "CHECK".
8903 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8904 (DeleteBuffer): take it out of CutAndPaste and make it static.
8906 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8908 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8909 output the spacing envir commands. Also the new commands used in
8910 the LaTeX output makes the result better.
8912 * src/Spacing.C (writeEnvirBegin): new method
8913 (writeEnvirEnd): new method
8915 2000-04-18 Juergen Vigna <jug@sad.it>
8917 * src/CutAndPaste.C: made textclass a static member of the class
8918 as otherwise it is not accesed right!!!
8920 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8922 * forms/layout_forms.fd
8923 * src/layout_forms.h
8924 * src/layout_forms.C (create_form_form_character)
8925 * src/lyx_cb.C (UserFreeFont)
8926 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8927 documents (in the layout->character popup).
8929 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8931 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8932 \spell_command was in fact not honored (from Kevin Atkinson).
8934 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8937 * src/lyx_gui.h: make lyxViews private (Angus)
8939 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8941 * src/mathed/math_write.C
8942 (MathMatrixInset::Write) Put \protect before \begin{array} and
8943 \end{array} if fragile
8944 (MathParInset::Write): Put \protect before \\ if fragile
8946 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8948 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8949 initialization if the LyXColorHandler must be done after the
8950 connections to the XServer has been established.
8952 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8953 get the background pixel from the lyxColorhandler so that the
8954 figures are rendered with the correct background color.
8955 (NextToken): removed functions.
8956 (GetPSSizes): use ifs >> string instead of NextToken.
8958 * src/Painter.[Ch]: the color cache moved out of this file.
8960 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8963 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8965 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8966 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8968 * src/BufferView.C (enterView): new func
8969 (leaveView): new func
8971 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8973 (leaveView): new func, undefines xterm cursor when approp.
8975 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8976 (AllowInput): delete the Workarea cursor handling from this func.
8978 * src/Painter.C (underline): draw a slimer underline in most cases.
8980 * src/lyx_main.C (error_handler): use extern "C"
8982 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8984 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8985 sent directly to me.
8987 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8988 to the list by Dekel.
8990 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8993 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8994 methods from lyx_cb.here.
8996 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8999 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9001 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
9002 instead of using current_view directly.
9004 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
9006 * src/LyXAction.C (init): add the paragraph-spacing command.
9008 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
9010 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
9012 * src/lyx_cb.C (CurrentState): output a string when the spacing is
9013 different from the documents.
9015 * src/text.C (SetHeightOfRow): take paragraph spacing into
9016 account, paragraph spacing takes precedence over buffer spacing
9017 (GetVisibleRow): ditto
9019 * src/paragraph.C (writeFile): output the spacing parameter too.
9020 (validate): set the correct features if spacing is used in the
9022 (Clear): set spacing to default
9023 (MakeSameLayout): spacing too
9024 (HasSameLayout): spacing too
9025 (SetLayout): spacing too
9026 (TeXOnePar): output the spacing commands
9028 * src/lyxparagraph.h: added a spacing variable for use with
9029 per-paragraph spacing.
9031 * src/Spacing.h: add a Default spacing and a method to check if
9032 the current spacing is default. also added an operator==
9034 * src/text2.C (DeleteEmptyParagraphMechanism): added a
9037 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9039 * src/lyxserver.C (callback): fix dispatch of functions
9041 * src/insets/insetlatexaccent.C (checkContents): turn bogus
9042 printf() into lyxerr call.
9044 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
9047 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
9048 "Table" to "Table Box", "Float" to "Floating Material"; deletes
9049 the "Float" from each of the subitems.
9050 (ShowHelpMenu): add entry for "FAQ" and "TOC".
9052 * src/support/DebugStream.h: add an #ifdef to work around a gcc
9053 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
9054 documented the change so that the workaround can be nuked later.
9056 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
9059 * src/lyxlex_pimpl.C (next): do not re-declare the default value
9061 * src/buffer.C (getLatexName): ditto
9062 (setReadonly): ditto
9064 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9066 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
9067 avoid some uses of current_view. Added also a bufferParams()
9068 method to get at this.
9070 * src/lyxtext.h: changed params->buffer and paramters->bparams.
9072 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9074 * src/lyxparagraph.[Ch]: removed
9075 operator<(LyXParagraph::InsetTable..., added a struct matchIT
9076 with operators used by lower_bound and
9077 upper_bound in InsetTable's
9078 Make struct InsetTable private again. Used matchpos.
9080 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
9082 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
9083 document, the language of existing text is changed (unless the
9084 document is multi-lingual)
9086 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
9088 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
9090 * A lot of files: A rewrite of the Right-to-Left support.
9092 2000-04-10 Juergen Vigna <jug@sad.it>
9094 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
9095 misplaced cursor when inset in inset is locked.
9097 * src/insets/insettext.C (LocalDispatch): small fix so that a
9098 BREAKLINE is not inserted if we don't permit it with autBreakRows.
9100 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
9101 footnote font should be decreased in size twice when displaying.
9103 * src/insets/insettext.C (GetDrawFont): inserted this function as
9104 the drawing-font may differ from the real paragraph font.
9106 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9107 insets (inset in inset!).
9109 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9110 function here because we don't want footnotes inside footnotes.
9112 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9114 (init): now set the inset_owner in paragraph.C
9115 (LocalDispatch): added some resetPos() in the right position
9118 (pasteSelection): changed to use the new CutAndPaste-Class.
9120 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9121 which tells if it is allowed to insert another inset inside this one.
9123 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9124 SwitchLayoutsBetweenClasses.
9126 * src/text2.C (InsertInset): checking of the new paragraph-function
9128 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9129 is not needed anymore here!
9132 (PasteSelection): redone (also with #ifdef) so that now this uses
9133 the CutAndPaste-Class.
9134 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9137 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9138 from/to text/insets.
9140 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9141 so that the paragraph knows if it is inside an (text)-inset.
9142 (InsertFromMinibuffer): changed return-value to bool as now it
9143 may happen that an inset is not inserted in the paragraph.
9144 (InsertInsetAllowed): this checks if it is allowed to insert an
9145 inset in this paragraph.
9147 (BreakParagraphConservative):
9148 (BreakParagraph) : small change for the above change of the return
9149 value of InsertFromMinibuffer.
9151 * src/lyxparagraph.h: added inset_owner and the functions to handle
9152 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9154 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9156 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9157 functions from BufferView to BufferView::Pimpl to ease maintence.
9159 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9160 correctly. Also use SetCursorIntern instead of SetCursor.
9162 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9165 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9167 * src/WorkArea.C (belowMouse): manually implement below mouse.
9169 * src/*: Add "explicit" on several constructors, I added probably
9170 some unneeded ones. A couple of changes to code because of this.
9172 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9173 implementation and private parts from the users of BufferView. Not
9176 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9177 implementation and private parts from the users of LyXLex. Not
9180 * src/BufferView_pimpl.[Ch]: new files
9182 * src/lyxlex_pimpl.[Ch]: new files
9184 * src/LyXView.[Ch]: some inline functions move out-of-line
9186 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9188 * src/lyxparagraph.h: make struct InsetTable public.
9190 * src/support/lyxstring.h: change lyxstring::difference_type to be
9191 ptrdiff_t. Add std:: modifiers to streams.
9193 * src/font.C: include the <cctype> header, for islower() and
9196 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9198 * src/font.[Ch]: new files. Contains the metric functions for
9199 fonts, takes a LyXFont as parameter. Better separation of concepts.
9201 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9202 changes because of this.
9204 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9206 * src/*: compile with -Winline and move functions that don't
9209 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9212 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9214 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9215 (various files changed because of this)
9217 * src/Painter.C (text): fixed the drawing of smallcaps.
9219 * src/lyxfont.[Ch] (drawText): removed unused member func.
9222 * src/*.C: added needed "using" statements and "std::" qualifiers.
9224 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9226 * src/*.h: removed all use of "using" from header files use
9227 qualifier std:: instead.
9229 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9231 * src/text.C (Backspace): some additional cleanups (we already
9232 know whether cursor.pos is 0 or not).
9234 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9235 automake does not provide one).
9237 * src/bmtable.h: replace C++ comments with C comments.
9239 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9241 * src/screen.C (ShowCursor): Change the shape of the cursor if
9242 the current language is not equal to the language of the document.
9243 (If the cursor change its shape unexpectedly, then you've found a bug)
9245 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9248 * src/insets/insetnumber.[Ch]: New files.
9250 * src/LyXAction.C (init)
9251 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9254 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9256 * src/lyxparagraph.h
9257 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9258 (the vector is kept sorted).
9260 * src/text.C (GetVisibleRow): Draw selection correctly when there
9261 is both LTR and RTL text.
9263 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9264 which is much faster.
9266 * src/text.C (GetVisibleRow and other): Do not draw the last space
9267 in a row if the direction of the last letter is not equal to the
9268 direction of the paragraph.
9270 * src/lyxfont.C (latexWriteStartChanges):
9271 Check that font language is not equal to basefont language.
9272 (latexWriteEndChanges): ditto
9274 * src/lyx_cb.C (StyleReset): Don't change the language while using
9275 the font-default command.
9277 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9278 empty paragraph before a footnote.
9280 * src/insets/insetcommand.C (draw): Increase x correctly.
9282 * src/screen.C (ShowCursor): Change cursor shape if
9283 current language != document language.
9285 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9287 2000-03-31 Juergen Vigna <jug@sad.it>
9289 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9290 (Clone): changed mode how the paragraph-data is copied to the
9291 new clone-paragraph.
9293 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9294 GetInset(pos) with no inset anymore there (in inset UNDO)
9296 * src/insets/insetcommand.C (draw): small fix as here x is
9297 incremented not as much as width() returns (2 before, 2 behind = 4)
9299 2000-03-30 Juergen Vigna <jug@sad.it>
9301 * src/insets/insettext.C (InsetText): small fix in initialize
9302 widthOffset (should not be done in the init() function)
9304 2000-03-29 Amir Karger <karger@lyx.org>
9306 * lib/examples/it_ItemizeBullets.lyx: translation by
9309 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9311 2000-03-29 Juergen Vigna <jug@sad.it>
9313 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9315 * src/insets/insetfoot.C (Clone): small change as for the below
9316 new init function in the text-inset
9318 * src/insets/insettext.C (init): new function as I've seen that
9319 clone did not copy the Paragraph-Data!
9320 (LocalDispatch): Added code so that now we have some sort of Undo
9321 functionality (well actually we HAVE Undo ;)
9323 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9325 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9327 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9330 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9332 * src/main.C: added a runtime check that verifies that the xforms
9333 header used when building LyX and the library used when running
9334 LyX match. Exit with a message if they don't match. This is a
9335 version number check only.
9337 * src/buffer.C (save): Don't allocate memory on the heap for
9338 struct utimbuf times.
9340 * *: some using changes, use iosfwd instead of the real headers.
9342 * src/lyxfont.C use char const * instead of string for the static
9343 strings. Rewrite some functions to use sstream.
9345 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9347 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9350 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9352 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9353 of Geodesy (from Martin Vermeer)
9355 * lib/layouts/svjour.inc: include file for the Springer svjour
9356 class. It can be used to support journals other than JoG.
9358 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9359 Miskiewicz <misiek@pld.org.pl>)
9360 * lib/reLyX/Makefile.am: ditto.
9362 2000-03-27 Juergen Vigna <jug@sad.it>
9364 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9365 also some modifications with operations on selected text.
9367 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9368 problems with clicking on insets (last famous words ;)
9370 * src/insets/insetcommand.C (draw):
9371 (width): Changed to have a bit of space before and after the inset so
9372 that the blinking cursor can be seen (otherwise it was hidden)
9374 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9376 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9377 would not be added to the link list when an installed gettext (not
9378 part of libc) is found.
9380 2000-03-24 Juergen Vigna <jug@sad.it>
9382 * src/insets/insetcollapsable.C (Edit):
9383 * src/mathed/formula.C (InsetButtonRelease):
9384 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9387 * src/BufferView.C (workAreaButtonPress):
9388 (workAreaButtonRelease):
9389 (checkInsetHit): Finally fixed the clicking on insets be handled
9392 * src/insets/insetert.C (Edit): inserted this call so that ERT
9393 insets work always with LaTeX-font
9395 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9397 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9398 caused lyx to startup with no GUI in place, causing in a crash
9399 upon startup when called with arguments.
9401 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9403 * src/FontLoader.C: better initialization of dummyXFontStruct.
9405 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9407 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9408 for linuxdoc and docbook import and export format options.
9410 * lib/lyxrc.example Example of default values for the previous flags.
9412 * src/lyx_cb.C Use those flags instead of the hardwired values for
9413 linuxdoc and docbook export.
9415 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9418 * src/menus.C Added menus entries for the new import/exports formats.
9420 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9422 * src/lyxrc.*: Added support for running without Gui
9425 * src/FontLoader.C: sensible defaults if no fonts are needed
9427 * src/lyx_cb.C: New function ShowMessage (writes either to the
9428 minibuffer or cout in case of no gui
9429 New function AskOverwrite for common stuff
9430 Consequently various changes to call these functions
9432 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9433 wild guess at sensible screen resolution when having no gui
9435 * src/lyxfont.C: no gui, no fonts... set some defaults
9437 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9439 * src/LColor.C: made the command inset background a bit lighter.
9441 2000-03-20 Hartmut Goebel <goebel@noris.net>
9443 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9444 stdstruct.inc. Koma-Script added some title elements which
9445 otherwise have been listed below "bibliography". This split allows
9446 adding title elements to where they belong.
9448 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9449 define the additional title elements and then include
9452 * many other layout files: changed to include stdtitle.inc just
9453 before stdstruct.inc.
9455 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9457 * src/buffer.C: (save) Added the option to store all backup files
9458 in a single directory
9460 * src/lyxrc.[Ch]: Added variable \backupdir_path
9462 * lib/lyxrc.example: Added descriptions of recently added variables
9464 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9465 bibtex inset, not closing the bibtex popup when deleting the inset)
9467 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9469 * src/lyx_cb.C: add a couple using directives.
9471 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9472 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9473 import based on the filename.
9475 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9476 file would be imported at start, if the filename where of a sgml file.
9478 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9480 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9482 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9483 * src/lyxfont.h Replaced the member variable bits.direction by the
9484 member variable lang. Made many changes in other files.
9485 This allows having a multi-lingual document
9487 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9488 that change the current language to <l>.
9489 Removed the command "font-rtl"
9491 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9492 format for Hebrew documents)
9494 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9495 When auto_mathmode is "true", pressing a digit key in normal mode
9496 will cause entering into mathmode.
9497 If auto_mathmode is "rtl" then this behavior will be active only
9498 when writing right-to-left text.
9500 * src/text2.C (InsertStringA) The string is inserted using the
9503 * src/paragraph.C (GetEndLabel) Gives a correct result for
9504 footnote paragraphs.
9506 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9508 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9510 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9511 front of PasteParagraph. Never insert a ' '. This should at least
9512 fix some cause for the segfaults that we have been experiencing,
9513 it also fixes backspace behaviour slightly. (Phu!)
9515 * src/support/lstrings.C (compare_no_case): some change to make it
9516 compile with gcc 2.95.2 and stdlibc++-v3
9518 * src/text2.C (MeltFootnoteEnvironment): change type o
9519 first_footnote_par_is_not_empty to bool.
9521 * src/lyxparagraph.h: make text private. Changes in other files
9523 (fitToSize): new function
9524 (setContentsFromPar): new function
9525 (clearContents): new function
9526 (SetChar): new function
9528 * src/paragraph.C (readSimpleWholeFile): deleted.
9530 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9531 the file, just use a simple string instead. Also read the file in
9532 a more maintainable manner.
9534 * src/text2.C (InsertStringA): deleted.
9535 (InsertStringB): deleted.
9537 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9539 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9540 RedoParagraphs from the doublespace handling part, just set status
9541 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9542 done, but perhaps not like this.)
9544 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9546 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9547 character when inserting an inset.
9549 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9551 * src/bufferparams.C (readLanguage): now takes "default" into
9554 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9555 also initialize the toplevel_keymap with the default bindings from
9558 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9560 * all files using lyxrc: have lyxrc as a real variable and not a
9561 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9564 * src/lyxrc.C: remove double call to defaultKeyBindings
9566 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9567 toolbar defauls using lyxlex. Remove enums, structs, functions
9570 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9571 toolbar defaults. Also store default keybindings in a map.
9573 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9574 storing the toolbar defaults without any xforms dependencies.
9576 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9577 applied. Changed to use iterators.
9579 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9581 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9582 systems that don't have LINGUAS set to begin with.
9584 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9586 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9587 the list by Dekel Tsur.
9589 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9591 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9592 * src/insets/form_graphics.C: ditto.
9594 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9596 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9598 * src/bufferparams.C (readLanguage): use the new language map
9600 * src/intl.C (InitKeyMapper): use the new language map
9602 * src/lyx_gui.C (create_forms): use the new language map
9604 * src/language.[Ch]: New files. Used for holding the information
9605 about each language. Now! Use this new language map enhance it and
9606 make it really usable for our needs.
9608 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9610 * screen.C (ShowCursor): Removed duplicate code.
9611 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9612 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9614 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9617 * src/text.C Added TransformChar method. Used for rendering Arabic
9618 text correctly (change the glyphs of the letter according to the
9619 position in the word)
9624 * src/lyxrc.C Added lyxrc command {language_command_begin,
9625 language_command_end,language_command_ltr,language_command_rtl,
9626 language_package} which allows the use of either arabtex or Omega
9629 * src/lyx_gui.C (init)
9631 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9632 to use encoding for menu fonts which is different than the encoding
9635 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9636 do not load the babel package.
9637 To write an English document with Hebrew/Arabic, change the document
9638 language to "english".
9640 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9641 (alphaCounter): changed to return char
9642 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9644 * lib/lyxrc.example Added examples for Hebrew/Arabic
9647 * src/layout.C Added layout command endlabeltype
9649 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9651 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9653 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9655 * src/mathed/math_delim.C (search_deco): return a
9656 math_deco_struct* instead of index.
9658 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9660 * All files with a USE_OSTREAM_ONLY within: removed all code that
9661 was unused when USE_OSTREAM_ONLY is defined.
9663 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9664 of any less. Removed header and using.
9666 * src/text.C (GetVisibleRow): draw the string "Page Break
9667 (top/bottom)" on screen when drawing a pagebreak line.
9669 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9671 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9673 * src/mathed/math_macro.C (draw): do some cast magic.
9676 * src/mathed/math_defs.h: change byte* argument to byte const*.
9678 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9680 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9681 know it is right to return InsetFoot* too, but cxx does not like
9684 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9686 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9688 * src/mathed/math_delim.C: change == to proper assignment.
9690 2000-03-09 Juergen Vigna <jug@sad.it>
9692 * src/insets/insettext.C (setPos): fixed various cursor positioning
9693 problems (via mouse and cursor-keys)
9694 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9695 inset (still a small display problem but it works ;)
9697 * src/insets/insetcollapsable.C (draw): added button_top_y and
9698 button_bottom_y to have correct values for clicking on the inset.
9700 * src/support/lyxalgo.h: commented out 'using std::less'
9702 2000-03-08 Juergen Vigna <jug@sad.it>
9704 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9705 Button-Release event closes as it is alos the Release-Event
9708 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9710 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9712 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9713 can add multiple spaces in Scrap (literate programming) styles...
9714 which, by the way, is how I got hooked on LyX to begin with.
9716 * src/mathed/formula.C (Write): Added dummy variable to an
9717 inset::Latex() call.
9718 (Latex): Add free_spacing boolean to inset::Latex()
9720 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9722 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9723 virtual function to include the free_spacing boolean from
9724 the containing paragraph's style.
9726 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9727 Added free_spacing boolean arg to match inset.h
9729 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9730 Added free_spacing boolean arg to match inset.h
9732 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9733 Added free_spacing boolean and made sure that if in a free_spacing
9734 paragraph, that we output normal space if there is a protected space.
9736 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9737 Added free_spacing boolean arg to match inset.h
9739 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9740 Added free_spacing boolean arg to match inset.h
9742 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9743 Added free_spacing boolean arg to match inset.h
9745 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9746 Added free_spacing boolean arg to match inset.h
9748 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9749 Added free_spacing boolean arg to match inset.h
9751 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9752 free_spacing boolean arg to match inset.h
9754 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9755 Added free_spacing boolean arg to match inset.h
9757 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9758 Added free_spacing boolean arg to match inset.h
9760 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9761 Added free_spacing boolean arg to match inset.h
9763 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9764 Added free_spacing boolean arg to match inset.h
9766 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9767 Added free_spacing boolean arg to match inset.h
9769 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9770 free_spacing boolean arg to match inset.h
9772 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9773 free_spacing boolean arg to match inset.h
9775 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9776 ignore free_spacing paragraphs. The user's spaces are left
9779 * src/text.C (InsertChar): Fixed the free_spacing layout
9780 attribute behavior. Now, if free_spacing is set, you can
9781 add multiple spaces in a paragraph with impunity (and they
9782 get output verbatim).
9783 (SelectSelectedWord): Added dummy argument to inset::Latex()
9786 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9789 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9790 paragraph layouts now only input a simple space instead.
9791 Special character insets don't make any sense in free-spacing
9794 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9795 hard-spaces in the *input* file to simple spaces if the layout
9796 is free-spacing. This converts old files which had to have
9797 hard-spaces in free-spacing layouts where a simple space was
9799 (writeFileAscii): Added free_spacing check to pass to the newly
9800 reworked inset::Latex(...) methods. The inset::Latex() code
9801 ensures that hard-spaces in free-spacing paragraphs get output
9802 as spaces (rather than "~").
9804 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9806 * src/mathed/math_delim.C (draw): draw the empty placeholder
9807 delims with a onoffdash line.
9808 (struct math_deco_compare): struct that holds the "functors" used
9809 for the sort and the binary search in math_deco_table.
9810 (class init_deco_table): class used for initial sort of the
9812 (search_deco): use lower_bound to do a binary search in the
9815 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9817 * src/lyxrc.C: a small secret thingie...
9819 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9820 and to not flush the stream as often as it used to.
9822 * src/support/lyxalgo.h: new file
9823 (sorted): template function used for checking if a sequence is
9824 sorted or not. Two versions with and without user supplied
9825 compare. Uses same compare as std::sort.
9827 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9828 it and give warning on lyxerr.
9830 (struct compare_tags): struct with function operators used for
9831 checking if sorted, sorting and lower_bound.
9832 (search_kw): use lower_bound instead of manually implemented
9835 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9837 * src/insets/insetcollapsable.h: fix Clone() declaration.
9838 * src/insets/insetfoot.h: ditto.
9840 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9842 2000-03-08 Juergen Vigna <jug@sad.it>
9844 * src/insets/lyxinset.h: added owner call which tells us if
9845 this inset is inside another inset. Changed also the return-type
9846 of Editable to an enum so it tells clearer what the return-value is.
9848 * src/insets/insettext.C (computeTextRows): fixed computing of
9849 textinsets which split automatically on more rows.
9851 * src/insets/insetert.[Ch]: changed this to be of BaseType
9854 * src/insets/insetfoot.[Ch]: added footnote inset
9856 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9857 collapsable insets (like footnote, ert, ...)
9859 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9861 * src/lyxdraw.h: remvoe file
9863 * src/lyxdraw.C: remove file
9865 * src/insets/insettext.C: added <algorithm>.
9867 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9869 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9870 (matrix_cb): case MM_OK use string stream
9872 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9875 * src/mathed/math_macro.C (draw): use string stream
9876 (Metrics): use string stream
9878 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9879 directly to the ostream.
9881 * src/vspace.C (asString): use string stream.
9882 (asString): use string stream
9883 (asLatexString): use string stream
9885 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9886 setting Spacing::Other.
9888 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9889 sprintf when creating the stretch vale.
9891 * src/text2.C (alphaCounter): changed to return a string and to
9892 not use a static variable internally. Also fixed a one-off bug.
9893 (SetCounter): changed the drawing of the labels to use string
9894 streams instead of sprintf.
9896 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9897 manipulator to use a scheme that does not require library support.
9898 This is also the way it is done in the new GNU libstdc++. Should
9899 work with DEC cxx now.
9901 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9903 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9904 end. This fixes a bug.
9906 * src/mathed (all files concerned with file writing): apply the
9907 USE_OSTREAM_ONLY changes to mathed too.
9909 * src/support/DebugStream.h: make the constructor explicit.
9911 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9912 count and ostream squashed.
9914 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9916 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9918 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9919 ostringstream uses STL strings, and we might not.
9921 * src/insets/insetspecialchar.C: add using directive.
9922 * src/insets/insettext.C: ditto.
9924 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9926 * lib/layouts/seminar.layout: feeble attempt at a layout for
9927 seminar.cls, far from completet and could really use some looking
9928 at from people used to write layout files.
9930 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9931 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9932 a lot nicer and works nicely with ostreams.
9934 * src/mathed/formula.C (draw): a slightly different solution that
9935 the one posted to the list, but I think this one works too. (font
9936 size wrong in headers.)
9938 * src/insets/insettext.C (computeTextRows): some fiddling on
9939 Jürgens turf, added some comments that he should read.
9941 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9942 used and it gave compiler warnings.
9943 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9946 * src/lyx_gui.C (create_forms): do the right thing when
9947 show_banner is true/false.
9949 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9950 show_banner is false.
9952 * most file writing files: Now use iostreams to do almost all of
9953 the writing. Also instead of passing string &, we now use
9954 stringstreams. mathed output is still not adapted to iostreams.
9955 This change can be turned off by commenting out all the occurences
9956 of the "#define USE_OSTREAM_ONLY 1" lines.
9958 * src/WorkArea.C (createPixmap): don't output debug messages.
9959 (WorkArea): don't output debug messages.
9961 * lib/lyxrc.example: added a comment about the new variable
9964 * development/Code_rules/Rules: Added some more commente about how
9965 to build class interfaces and on how better encapsulation can be
9968 2000-03-03 Juergen Vigna <jug@sad.it>
9970 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9971 automatically with the width of the LyX-Window
9973 * src/insets/insettext.C (computeTextRows): fixed update bug in
9974 displaying text-insets (scrollvalues where not initialized!)
9976 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9978 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9979 id in the check of the result from lower_bound is not enough since
9980 lower_bound can return last too, and then res->id will not be a
9983 * all insets and some code that use them: I have conditionalized
9984 removed the Latex(string & out, ...) this means that only the
9985 Latex(ostream &, ...) will be used. This is a work in progress to
9986 move towards using streams for all output of files.
9988 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9991 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9993 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9994 routine (this fixes bug where greek letters were surrounded by too
9997 * src/support/filetools.C (findtexfile): change a bit the search
9998 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9999 no longer passed to kpsewhich, we may have to change that later.
10001 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
10002 warning options to avoid problems with X header files (from Angus
10004 * acinclude.m4: regenerated.
10006 2000-03-02 Juergen Vigna <jug@sad.it>
10008 * src/insets/insettext.C (WriteParagraphData): Using the
10009 par->writeFile() function for writing paragraph-data.
10010 (Read): Using buffer->parseSingleLyXformat2Token()-function
10011 for parsing paragraph data!
10013 * src/buffer.C (readLyXformat2): removed all parse data and using
10014 the new parseSingleLyXformat2Token()-function.
10015 (parseSingleLyXformat2Token): added this function to parse (read)
10016 lyx-file-format (this is called also from text-insets now!)
10018 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10020 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
10023 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
10024 directly instead of going through a func. One very bad thing: a
10025 static LyXFindReplace, but I don't know where to place it.
10027 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
10028 string instead of char[]. Also changed to static.
10029 (GetSelectionOrWordAtCursor): changed to static inline
10030 (SetSelectionOverLenChars): ditto.
10032 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
10033 current_view and global variables. both classes has changed names
10034 and LyXFindReplace is not inherited from SearchForm.
10036 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
10037 fl_form_search form.
10039 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
10041 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10043 * lib/bind/*.bind: make sure 'buffer-previous' function is not
10044 bound (from Kayvan).
10046 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
10048 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
10050 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10052 * some things that I should comment but the local pub says head to
10055 * comment out all code that belongs to the Roff code for Ascii
10056 export of tables. (this is unused)
10058 * src/LyXView.C: use correct type for global variable
10059 current_layout. (LyXTextClass::size_type)
10061 * some code to get the new insetgraphics closer to working I'd be
10062 grateful for any help.
10064 * src/BufferView2.C (insertInset): use the return type of
10065 NumberOfLayout properly. (also changes in other files)
10067 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
10068 this as a test. I want to know what breaks because of this.
10070 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
10072 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10074 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
10075 to use a \makebox in the label, this allows proper justification
10076 with out using protected spaces or multiple hfills. Now it is
10077 "label" for left justified, "\hfill label\hfill" for center, and
10078 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
10079 should be changed accordingly.
10081 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10083 * src/lyxtext.h: change SetLayout() to take a
10084 LyXTextClass::size_type instead of a char (when there is more than
10085 127 layouts in a class); also change type of copylayouttype.
10086 * src/text2.C (SetLayout): ditto.
10087 * src/LyXView.C (updateLayoutChoice): ditto.
10089 * src/LaTeX.C (scanLogFile): errors where the line number was not
10090 given just after the '!'-line were ignored (from Dekel Tsur).
10092 * lib/lyxrc.example: fix description of \date_insert_format
10094 * lib/layouts/llncs.layout: new layout, contributed by Martin
10097 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10099 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
10100 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
10101 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
10102 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
10103 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10104 paragraph.C, text.C, text2.C)
10106 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10108 * src/insets/insettext.C (LocalDispatch): remove extra break
10111 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10112 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10114 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10115 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10117 * src/insets/insetbib.h: move InsetBibkey::Holder and
10118 InsetCitation::Holder in public space.
10120 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10122 * src/insets/insettext.h: small change to get the new files from
10123 Juergen to compile (use "string", not "class string").
10125 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10126 const & as parameter to LocalDispatch, use LyXFont const & as
10127 paramter to some other func. This also had impacto on lyxinsets.h
10128 and the two mathed insets.
10130 2000-02-24 Juergen Vigna <jug@sad.it>
10133 * src/commandtags.h:
10135 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10139 * src/BufferView2.C: added/updated code for various inset-functions
10141 * src/insets/insetert.[Ch]: added implementation of InsetERT
10143 * src/insets/insettext.[Ch]: added implementation of InsetText
10145 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10146 (draw): added preliminary code for inset scrolling not finshed yet
10148 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10149 as it is in lyxfunc.C now
10151 * src/insets/lyxinset.h: Added functions for text-insets
10153 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10155 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10156 BufferView and reimplement the list as a queue put inside its own
10159 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10161 * several files: use the new interface to the "updateinsetlist"
10163 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10165 (work_area_handler): call BufferView::trippleClick on trippleclick.
10167 * src/BufferView.C (doubleClick): new function, selects word on
10169 (trippleClick): new function, selects line on trippleclick.
10171 2000-02-22 Allan Rae <rae@lyx.org>
10173 * lib/bind/xemacs.bind: buffer-previous not supported
10175 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10177 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10180 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10182 * src/bufferlist.C: get rid of current_view from this file
10184 * src/spellchecker.C: get rid of current_view from this file
10186 * src/vspace.C: get rid of current_view from this file
10187 (inPixels): added BufferView parameter for this func
10188 (asLatexCommand): added a BufferParams for this func
10190 * src/text.C src/text2.C: get rid of current_view from these
10193 * src/lyxfont.C (getFontDirection): move this function here from
10196 * src/bufferparams.C (getDocumentDirection): move this function
10199 * src/paragraph.C (getParDirection): move this function here from
10201 (getLetterDirection): ditto
10203 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10205 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10206 resize due to wrong pixmap beeing used. Also took the opurtunity
10207 to make the LyXScreen stateless on regard to WorkArea and some
10208 general cleanup in the same files.
10210 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10212 * src/Makefile.am: add missing direction.h
10214 * src/PainterBase.h: made the width functions const.
10216 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10219 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10221 * src/insets/insetlatexaccent.C (draw): make the accents draw
10222 better, at present this will only work well with iso8859-1.
10224 * several files: remove the old drawing code, now we use the new
10227 * several files: remove support for mono_video, reverse_video and
10230 2000-02-17 Juergen Vigna <jug@sad.it>
10232 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10233 int ** as we have to return the pointer, otherwise we have only
10234 NULL pointers in the returning function.
10236 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10238 * src/LaTeX.C (operator()): quote file name when running latex.
10240 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10242 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10243 (bubble tip), this removes our special handling of this.
10245 * Remove all code that is unused now that we have the new
10246 workarea. (Code that are not active when NEW_WA is defined.)
10248 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10250 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10252 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10253 nonexisting layout; correctly redirect obsoleted layouts.
10255 * lib/lyxrc.example: document \view_dvi_paper_option
10257 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10260 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10261 (PreviewDVI): handle the view_dvi_paper_option variable.
10262 [Both from Roland Krause]
10264 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10266 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10267 char const *, int, LyXFont)
10268 (text(int, int, string, LyXFont)): ditto
10270 * src/text.C (InsertCharInTable): attempt to fix the double-space
10271 feature in tables too.
10272 (BackspaceInTable): ditto.
10273 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10275 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10277 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10279 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10280 newly found text in textcache to this.
10281 (buffer): set the owner of the text put into the textcache to 0
10283 * src/insets/figinset.C (draw): fixed the drawing of figures with
10286 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10287 drawing of mathframe, hfills, protected space, table lines. I have
10288 now no outstanding drawing problems with the new Painter code.
10290 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10292 * src/PainterBase.C (ellipse, circle): do not specify the default
10295 * src/LColor.h: add using directive.
10297 * src/Painter.[Ch]: change return type of methods from Painter& to
10298 PainterBase&. Add a using directive.
10300 * src/WorkArea.C: wrap xforms callbacks in C functions
10303 * lib/layouts/foils.layout: font fix and simplifications from Carl
10306 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10308 * a lot of files: The Painter, LColor and WorkArea from the old
10309 devel branch has been ported to lyx-devel. Some new files and a
10310 lot of #ifdeffed code. The new workarea is enabled by default, but
10311 if you want to test the new Painter and LColor you have to compile
10312 with USE_PAINTER defined (do this in config.h f.ex.) There are
10313 still some rought edges, and I'd like some help to clear those
10314 out. It looks stable (loads and displays the Userguide very well).
10317 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10319 * src/buffer.C (pop_tag): revert to the previous implementation
10320 (use a global variable for both loops).
10322 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10324 * src/lyxrc.C (LyXRC): change slightly default date format.
10326 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10327 there is an English text with a footnote that starts with a Hebrew
10328 paragraph, or vice versa.
10329 (TeXFootnote): ditto.
10331 * src/text.C (LeftMargin): allow for negative values for
10332 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10335 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10336 for input encoding (cyrillic)
10338 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10340 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10343 * src/toolbar.C (set): ditto
10344 * src/insets/insetbib.C (create_form_citation_form): ditto
10346 * lib/CREDITS: added Dekel Tsur.
10348 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10349 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10350 hebrew supports files from Dekel Tsur.
10352 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10353 <tzafrir@technion.ac.il>
10355 * src/lyxrc.C: put \date_insert_format at the right place.
10357 * src/buffer.C (makeLaTeXFile): fix the handling of
10358 BufferParams::sides when writing out latex files.
10360 * src/BufferView2.C: add a "using" directive.
10362 * src/support/lyxsum.C (sum): when we use lyxstring,
10363 ostringstream::str needs an additional .c_str().
10365 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10367 * src/support/filetools.C (ChangeExtension): patch from Etienne
10370 * src/TextCache.C (show): remove const_cast and make second
10371 parameter non-const LyXText *.
10373 * src/TextCache.h: use non const LyXText in show.
10375 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10378 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10380 * src/support/lyxsum.C: rework to be more flexible.
10382 * several places: don't check if a pointer is 0 if you are going
10385 * src/text.C: remove some dead code.
10387 * src/insets/figinset.C: remove some dead code
10389 * src/buffer.C: move the BufferView funcs to BufferView2.C
10390 remove all support for insetlatexdel
10391 remove support for oldpapersize stuff
10392 made some member funcs const
10394 * src/kbmap.C: use a std::list to store the bindings in.
10396 * src/BufferView2.C: new file
10398 * src/kbsequence.[Ch]: new files
10400 * src/LyXAction.C + others: remove all trace of buffer-previous
10402 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10403 only have one copy in the binary of this table.
10405 * hebrew patch: moved some functions from LyXText to more
10406 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10408 * several files: remove support for XForms older than 0.88
10409 whitespace changes.
10410 remove some #if 0 #endif code
10412 * src/TextCache.[Ch]: new file. Holds the textcache.
10414 * src/BufferView.C: changes to use the new TextCache interface.
10415 (waitForX): remove the now unused code.
10417 * src/BackStack.h: remove some commented code
10419 * lib/bind/emacs.bind: remove binding for buffer-previous
10421 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10423 * applied the hebrew patch.
10425 * src/lyxrow.h: make sure that all Row variables are initialized.
10427 * src/text2.C (TextHandleUndo): comment out a delete, this might
10428 introduce a memory leak, but should also help us to not try to
10429 read freed memory. We need to look at this one.
10431 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10432 (LyXParagraph): initalize footnotekind.
10434 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10435 forgot this when applying the patch. Please heed the warnings.
10437 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10438 (aka. reformat problem)
10440 * src/bufferlist.C (exists): made const, and use const_iterator
10441 (isLoaded): new func.
10442 (release): use std::find to find the correct buffer.
10444 * src/bufferlist.h: made getState a const func.
10445 made empty a const func.
10446 made exists a const func.
10449 2000-02-01 Juergen Vigna <jug@sad.it>
10451 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10453 * po/it.po: updated a bit the italian po file and also changed the
10454 'file nuovo' for newfile to 'filenuovo' without a space, this did
10457 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10458 for the new insert_date command.
10460 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10461 from jdblair, to insert a date into the current text conforming to
10462 a strftime format (for now only considering the locale-set and not
10463 the document-language).
10465 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10467 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10468 Bounds Read error seen by purify. The problem was that islower is
10469 a macros which takes an unsigned char and uses it as an index for
10470 in array of characters properties (and is thus subject to the
10474 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10475 correctly the paper sides radio buttons.
10476 (UpdateDocumentButtons): ditto.
10478 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10480 * src/kbmap.C (getsym + others): change to return unsigned int,
10481 returning a long can give problems on 64 bit systems. (I assume
10482 that int is 32bit on 64bit systems)
10484 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10486 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10487 LyXLookupString to be zero-terminated. Really fixes problems seen
10488 by purify, I think.
10490 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10492 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10493 write a (char*)0 to the lyxerr stream.
10495 * src/lastfiles.C: move algorithm before the using statemets.
10497 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10499 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10500 complains otherwise).
10501 * src/table.C: ditto
10503 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10506 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10507 that I removed earlier... It is really needed.
10509 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10511 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10513 * INSTALL: update xforms home page URL.
10515 * lib/configure.m4: fix a bug with unreadable layout files.
10517 * src/table.C (calculate_width_of_column): add "using std::max"
10520 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10522 * several files: marked several lines with "DEL LINE", this is
10523 lines that can be deleted without changing anything.
10524 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10525 checks this anyway */
10528 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10530 * src/DepTable.C (update): add a "+" at the end when the checksum
10531 is different. (debugging string only)
10533 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10534 the next inset to not be displayed. This should also fix the list
10535 of labels in the "Insert Crossreference" dialog.
10537 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10539 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10540 when regex was not found.
10542 * src/support/lstrings.C (lowercase): use handcoded transform always.
10545 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10546 old_cursor.par->prev could be 0.
10548 * several files: changed post inc/dec to pre inc/dec
10550 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10551 write the lastfiles to file.
10553 * src/BufferView.C (buffer): only show TextCache info when debugging
10555 (resizeCurrentBuffer): ditto
10556 (workAreaExpose): ditto
10558 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10560 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10562 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10563 a bit better by removing the special case for \i and \j.
10565 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10567 * src/lyx_main.C (easyParse): remove test for bad comand line
10568 options, since this broke all xforms-related parsing.
10570 * src/kbmap.C (getsym): set return type to unsigned long, as
10571 declared in header. On an alpha, long is _not_ the same as int.
10573 * src/support/LOstream.h: add a "using std::flush;"
10575 * src/insets/figinset.C: ditto.
10577 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10579 * src/bufferlist.C (write): use blinding fast file copy instead of
10580 "a char at a time", now we are doing it the C++ way.
10582 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10583 std::list<int> instead.
10584 (addpidwait): reflect move to std::list<int>
10585 (sigchldchecker): ditto
10587 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10590 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10591 that obviously was wrong...
10593 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10594 c, this avoids warnings with purify and islower.
10596 * src/insets/figinset.C: rename struct queue to struct
10597 queue_element and rewrite to use a std::queue. gsqueue is now a
10598 std::queue<queue_element>
10599 (runqueue): reflect move to std::queue
10602 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10603 we would get "1" "0" instead of "true" "false. Also make the tostr
10606 2000-01-21 Juergen Vigna <jug@sad.it>
10608 * src/buffer.C (writeFileAscii): Disabled code for special groff
10609 handling of tabulars till I fix this in table.C
10611 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10613 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10615 * src/support/lyxlib.h: ditto.
10617 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10619 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10620 and 'j' look better. This might fix the "macron" bug that has been
10623 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10624 functions as one template function. Delete the old versions.
10626 * src/support/lyxsum.C: move using std::ifstream inside
10629 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10632 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10634 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10636 * src/insets/figinset.C (InitFigures): use new instead of malloc
10637 to allocate memory for figures and bitmaps.
10638 (DoneFigures): use delete[] instead of free to deallocate memory
10639 for figures and bitmaps.
10640 (runqueue): use new to allocate
10641 (getfigdata): use new/delete[] instead of malloc/free
10642 (RegisterFigure): ditto
10644 * some files: moved some declarations closer to first use, small
10645 whitespace changes use preincrement instead of postincrement where
10646 it does not make a difference.
10648 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10649 step on the way to use stl::containers for key maps.
10651 * src/bufferlist.h: add a typedef for const_iterator and const
10652 versions of begin and end.
10654 * src/bufferlist.[Ch]: change name of member variable _state to
10655 state_. (avoid reserved names)
10657 (getFileNames): returns the filenames of the buffers in a vector.
10659 * configure.in (ALL_LINGUAS): added ro
10661 * src/support/putenv.C: new file
10663 * src/support/mkdir.C: new file
10665 2000-01-20 Allan Rae <rae@lyx.org>
10667 * lib/layouts/IEEEtran.layout: Added several theorem environments
10669 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10670 couple of minor additions.
10672 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10673 (except for those in footnotes of course)
10675 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10677 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10679 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10680 std::sort and std::lower_bound instead of qsort and handwritten
10682 (struct compara): struct that holds the functors used by std::sort
10683 and std::lower_bound in MathedLookupBOP.
10685 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10687 * src/support/LAssert.h: do not do partial specialization. We do
10688 not really need it.
10690 * src/support/lyxlib.h: note that lyx::getUserName() and
10691 lyx::date() are not in use right now. Should these be suppressed?
10693 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10694 (makeLinuxDocFile): do not put date and user name in linuxdoc
10697 * src/support/lyxlib.h (kill): change first argument to long int,
10698 since that's what solaris uses.
10700 * src/support/kill.C (kill): fix declaration to match prototype.
10702 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10703 actually check whether namespaces are supported. This is not what
10706 * src/support/lyxsum.C: add a using directive.
10708 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10710 * src/support/kill.C: if we have namespace support we don't have
10711 to include lyxlib.h.
10713 * src/support/lyxlib.h: use namespace lyx if supported.
10715 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10717 * src/support/date.C: new file
10719 * src/support/chdir.C: new file
10721 * src/support/getUserName.C: new file
10723 * src/support/getcwd.C: new file
10725 * src/support/abort.C: new file
10727 * src/support/kill.C: new file
10729 * src/support/lyxlib.h: moved all the functions in this file
10730 insede struct lyx. Added also kill and abort to this struct. This
10731 is a way to avoid the "kill is not defined in <csignal>", we make
10732 C++ wrappers for functions that are not ANSI C or ANSI C++.
10734 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10735 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10736 lyx it has been renamed to sum.
10738 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10740 * src/text.C: add using directives for std::min and std::max.
10742 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10744 * src/texrow.C (getIdFromRow): actually return something useful in
10745 id and pos. Hopefully fixes the bug with positionning of errorbox
10748 * src/lyx_main.C (easyParse): output an error and exit if an
10749 incorrect command line option has been given.
10751 * src/spellchecker.C (ispell_check_word): document a memory leak.
10753 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10754 where a "struct utimbuf" is allocated with "new" and deleted with
10757 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10759 * src/text2.C (CutSelection): don't delete double spaces.
10760 (PasteSelection): ditto
10761 (CopySelection): ditto
10763 * src/text.C (Backspace): don't delete double spaces.
10765 * src/lyxlex.C (next): fix a bug that were only present with
10766 conformant std::istream::get to read comment lines, use
10767 std::istream::getline instead. This seems to fix the problem.
10769 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10771 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10772 allowed to insert space before space" editing problem. Please read
10773 commends at the beginning of the function. Comments about usage
10776 * src/text.C (InsertChar): fix for the "not allowed to insert
10777 space before space" editing problem.
10779 * src/text2.C (DeleteEmptyParagraphMechanism): when
10780 IsEmptyTableRow can only return false this last "else if" will
10781 always be a no-op. Commented out.
10783 * src/text.C (RedoParagraph): As far as I can understand tmp
10784 cursor is not really needed.
10786 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10787 present it could only return false anyway.
10788 (several functions): Did something not so smart...added a const
10789 specifier on a lot of methods.
10791 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10792 and add a tmp->text.resize. The LyXParagraph constructor does the
10794 (BreakParagraphConservative): ditto
10796 * src/support/path.h (Path): add a define so that the wrong usage
10797 "Path("/tmp") will be flagged as a compilation error:
10798 "`unnamed_Path' undeclared (first use this function)"
10800 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10802 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10803 which was bogus for several reasons.
10805 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10807 (runBibTeX): ditto.
10809 * autogen.sh: do not use "type -path" (what's that anyway?).
10811 * src/support/filetools.C (findtexfile): remove extraneous space
10812 which caused a kpsewhich warning (at least with kpathsea version
10815 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10817 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10819 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10821 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10823 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10825 * src/paragraph.C (BreakParagraph): do not reserve space on text
10826 if we don't need to (otherwise, if pos_end < pos, we end up
10827 reserving huge amounts of memory due to bad unsigned karma).
10828 (BreakParagraphConservative): ditto, although I have not seen
10829 evidence the bug can happen here.
10831 * src/lyxparagraph.h: add a using std::list.
10833 2000-01-11 Juergen Vigna <jug@sad.it>
10835 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10836 could not be found.
10838 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10840 * src/vc-backend.C (doVCCommand): change to be static and take one
10841 more parameter: the path to chdir too be fore executing the command.
10842 (retrive): new function equiv to "co -r"
10844 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10845 file_not_found_hook is true.
10847 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10849 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10850 if a file is readwrite,readonly...anything else.
10852 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10854 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10855 (CreatePostscript): name change from MenuRunDVIPS (or something)
10856 (PreviewPostscript): name change from MenuPreviewPS
10857 (PreviewDVI): name change from MenuPreviewDVI
10859 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10860 \view_pdf_command., \pdf_to_ps_command
10862 * lib/configure.m4: added search for PDF viewer, and search for
10863 PDF to PS converter.
10864 (lyxrc.defaults output): add \pdflatex_command,
10865 \view_pdf_command and \pdf_to_ps_command.
10867 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10869 * src/bufferlist.C (write): we don't use blocksize for anything so
10872 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10874 * src/support/block.h: disable operator T* (), since it causes
10875 problems with both compilers I tried. See comments in the file.
10877 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10880 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10881 variable LYX_DIR_10x to LYX_DIR_11x.
10883 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10885 * INSTALL: document --with-lyxname.
10888 * configure.in: new configure flag --with-lyxname which allows to
10889 choose the name under which lyx is installed. Default is "lyx", of
10890 course. It used to be possible to do this with --program-suffix,
10891 but the later has in fact a different meaning for autoconf.
10893 * src/support/lstrings.h (lstrchr): reformat a bit.
10895 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10896 * src/mathed/math_defs.h: ditto.
10898 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10900 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10901 true, decides if we create a backup file or not when saving. New
10902 tag and variable \pdf_mode, defaults to false. New tag and
10903 variable \pdflatex_command, defaults to pdflatex. New tag and
10904 variable \view_pdf_command, defaults to xpdf. New tag and variable
10905 \pdf_to_ps_command, defaults to pdf2ps.
10907 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10909 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10910 does not have a BufferView.
10911 (unlockInset): ditto + don't access the_locking_inset if the
10912 buffer does not have a BufferView.
10914 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10915 certain circumstances so that we don't continue a keyboard
10916 operation long after the key was released. Try f.ex. to load a
10917 large document, press PageDown for some seconds and then release
10918 it. Before this change the document would contine to scroll for
10919 some time, with this change it stops imidiatly.
10921 * src/support/block.h: don't allocate more space than needed. As
10922 long as we don't try to write to the arr[x] in a array_type arr[x]
10923 it is perfectly ok. (if you write to it you might segfault).
10924 added operator value_type*() so that is possible to pass the array
10925 to functions expecting a C-pointer.
10927 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10930 * intl/*: updated to gettext 0.10.35, tried to add our own
10931 required modifications. Please verify.
10933 * po/*: updated to gettext 0.10.35, tried to add our own required
10934 modifications. Please verify.
10936 * src/support/lstrings.C (tostr): go at fixing the problem with
10937 cxx and stringstream. When stringstream is used return
10938 oss.str().c_str() so that problems with lyxstring and basic_string
10939 are avoided. Note that the best solution would be for cxx to use
10940 basic_string all the way, but it is not conformant yet. (it seems)
10942 * src/lyx_cb.C + other files: moved several global functions to
10943 class BufferView, some have been moved to BufferView.[Ch] others
10944 are still located in lyx_cb.C. Code changes because of this. (part
10945 of "get rid of current_view project".)
10947 * src/buffer.C + other files: moved several Buffer functions to
10948 class BufferView, the functions are still present in buffer.C.
10949 Code changes because of this.
10951 * config/lcmessage.m4: updated to most recent. used when creating
10954 * config/progtest.m4: updated to most recent. used when creating
10957 * config/gettext.m4: updated to most recent. applied patch for
10960 * config/gettext.m4.patch: new file that shows what changes we
10961 have done to the local copy of gettext.m4.
10963 * config/libtool.m4: new file, used in creation of acinclude.m4
10965 * config/lyxinclude.m4: new file, this is the lyx created m4
10966 macros, used in making acinclude.m4.
10968 * autogen.sh: GNU m4 discovered as a separate task not as part of
10969 the lib/configure creation.
10970 Generate acinlucde from files in config. Actually cat
10971 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10972 easier to upgrade .m4 files that really are external.
10974 * src/Spacing.h: moved using std::istringstream to right after
10975 <sstream>. This should fix the problem seen with some compilers.
10977 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10979 * src/lyx_cb.C: began some work to remove the dependency a lot of
10980 functions have on BufferView::text, even if not really needed.
10981 (GetCurrentTextClass): removed this func, it only hid the
10984 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10985 forgot this in last commit.
10987 * src/Bullet.C (bulletEntry): use static char const *[] for the
10988 tables, becuase of this the return arg had to change to string.
10989 (bulletSize): ditto
10990 (~Bullet): removed unneeded destructor
10992 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10993 (insetSleep): moved from Buffer
10994 (insetWakeup): moved from Buffer
10995 (insetUnlock): moved from Buffer
10997 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10998 from Buffer to BufferView.
11000 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
11002 * config/ltmain.sh: updated to version 1.3.4 of libtool
11004 * config/ltconfig: updated to version 1.3.4 of libtool
11006 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11009 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
11010 Did I get that right?
11012 * src/lyxlex.h: add a "using" directive or two.
11013 * src/Spacing.h: ditto.
11014 * src/insets/figinset.C: ditto.
11015 * src/support/filetools.C: ditto.
11016 * src/support/lstrings.C: ditto.
11017 * src/BufferView.C: ditto.
11018 * src/bufferlist.C: ditto.
11019 * src/lyx_cb.C: ditto.
11020 * src/lyxlex.C: ditto.
11022 * NEWS: add some changes for 1.1.4.
11024 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11026 * src/BufferView.C: first go at a TextCache to speed up switching
11029 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11031 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
11032 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
11033 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
11034 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
11037 * src/mathed/math_defs.h (MathedRowSt): make sure that all
11038 members of the struct are correctly initialized to 0 (detected by
11040 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
11041 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
11043 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
11044 pidwait, since it was allocated with "new". This was potentially
11045 very bad. Thanks to Michael Schmitt for running purify for us.
11048 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11050 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
11052 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
11054 1999-12-30 Allan Rae <rae@lyx.org>
11056 * lib/templates/IEEEtran.lyx: minor change
11058 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
11059 src/mathed/formula.C (LocalDispatch): askForText changes
11061 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
11062 know when a user has cancelled input. Fixes annoying problems with
11063 inserting labels and version control.
11065 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11067 * src/support/lstrings.C (tostr): rewritten to use strstream and
11070 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11072 * src/support/filetools.C (IsFileWriteable): use fstream to check
11073 (IsDirWriteable): use fileinfo to check
11075 * src/support/filetools.h (FilePtr): whole class deleted
11077 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
11079 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
11081 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
11083 * src/bufferlist.C (write): use ifstream and ofstream instead of
11086 * src/Spacing.h: use istrstream instead of sscanf
11088 * src/mathed/math_defs.h: change first arg to istream from FILE*
11090 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
11092 * src/mathed/math_parser.C: have yyis to be an istream
11093 (LexGetArg): use istream (yyis)
11095 (mathed_parse): ditto
11096 (mathed_parser_file): first arg istream instead of FILE*, set yyis
11098 * src/mathed/formula.C (Read): rewritten to use istream
11100 * src/mathed/formulamacro.C (Read): rewritten to use istream
11102 * src/lyxlex.h (~LyXLex): deleted desturctor
11103 (getStream): new function, returns an istream
11104 (getFile): deleted funtion
11105 (IsOK): return is.good();
11107 * src/lyxlex.C (LyXLex): delete file and owns_file
11108 (setFile): open an filebuf and assign that to a istream instead of
11110 (setStream): new function, takes an istream as arg.
11111 (setFile): deleted function
11112 (EatLine): rewritten us use istream instead of FILE*
11116 * src/table.C (LyXTable): use istream instead of FILE*
11117 (Read): rewritten to take an istream instead of FILE*
11119 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11121 * src/buffer.C (Dispatch): remove an extraneous break statement.
11123 * src/support/filetools.C (QuoteName): change to do simple
11124 'quoting'. More work is necessary. Also changed to do nothing
11125 under emx (needs fix too).
11126 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11128 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11129 config.h.in to the AC_DEFINE_UNQUOTED() call.
11130 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11131 needs char * as argument (because Solaris 7 declares it like
11134 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11135 remove definition of BZERO.
11137 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11139 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11140 defined, "lyxregex.h" if not.
11142 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11144 (REGEX): new variable that is set to regex.c lyxregex.h when
11145 AM_CONDITIONAL USE_REGEX is set.
11146 (libsupport_la_SOURCES): add $(REGEX)
11148 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11151 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11154 * configure.in: add call to LYX_REGEX
11156 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11157 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11159 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11161 * lib/bind/fi_menus.bind: new file, from
11162 pauli.virtanen@saunalahti.fi.
11164 * src/buffer.C (getBibkeyList): pass the parameter delim to
11165 InsetInclude::getKeys and InsetBibtex::getKeys.
11167 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11168 is passed to Buffer::getBibkeyList
11170 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11171 instead of the hardcoded comma.
11173 * src/insets/insetbib.C (getKeys): make sure that there are not
11174 leading blanks in bibtex keys. Normal latex does not care, but
11175 harvard.sty seems to dislike blanks at the beginning of citation
11176 keys. In particular, the retturn value of the function is
11178 * INSTALL: make it clear that libstdc++ is needed and that gcc
11179 2.7.x probably does not work.
11181 * src/support/filetools.C (findtexfile): make debug message go to
11183 * src/insets/insetbib.C (getKeys): ditto
11185 * src/debug.C (showTags): make sure that the output is correctly
11188 * configure.in: add a comment for TWO_COLOR_ICON define.
11190 * acconfig.h: remove all the entries that already defined in
11191 configure.in or acinclude.m4.
11193 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11194 to avoid user name, date and copyright.
11196 1999-12-21 Juergen Vigna <jug@sad.it>
11198 * src/table.C (Read): Now read bogus row format informations
11199 if the format is < 5 so that afterwards the table can
11200 be read by lyx but without any format-info. Fixed the
11201 crash we experienced when not doing this.
11203 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11205 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11206 (RedoDrawingOfParagraph): ditto
11207 (RedoParagraphs): ditto
11208 (RemoveTableRow): ditto
11210 * src/text.C (Fill): rename arg paperwidth -> paper_width
11212 * src/buffer.C (insertLyXFile): rename var filename -> fname
11213 (writeFile): rename arg filename -> fname
11214 (writeFileAscii): ditto
11215 (makeLaTeXFile): ditto
11216 (makeLinuxDocFile): ditto
11217 (makeDocBookFile): ditto
11219 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11222 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11224 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11227 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11228 compiled by a C compiler not C++.
11230 * src/layout.h (LyXTextClass): added typedef for const_iterator
11231 (LyXTextClassList): added typedef for const_iterator + member
11232 functions begin and end.
11234 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11235 iterators to fill the choice_class.
11236 (updateLayoutChoice): rewritten to use iterators to fill the
11237 layoutlist in the toolbar.
11239 * src/BufferView.h (BufferView::work_area_width): removed unused
11242 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11244 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11245 (sgmlCloseTag): ditto
11247 * src/support/lstrings.h: return type of countChar changed to
11250 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11251 what version of this func to use. Also made to return unsigned int.
11253 * configure.in: call LYX_STD_COUNT
11255 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11256 conforming std::count.
11258 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11260 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11261 and a subscript would give bad display (patch from Dekel Tsur
11262 <dekel@math.tau.ac.il>).
11264 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11266 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11269 * src/chset.h: add a few 'using' directives
11271 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11272 triggered when no buffer is active
11274 * src/layout.C: removed `break' after `return' in switch(), since
11277 * src/lyx_main.C (init): make sure LyX can be ran in place even
11278 when libtool has done its magic with shared libraries. Fix the
11279 test for the case when the system directory has not been found.
11281 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11282 name for the latex file.
11283 (MenuMakeHTML): ditto
11285 * src/buffer.h: add an optional boolean argument, which is passed
11286 to ChangeExtension.
11288 1999-12-20 Allan Rae <rae@lyx.org>
11290 * lib/templates/IEEEtran.lyx: small correction and update.
11292 * configure.in: Attempted to use LYX_PATH_HEADER
11294 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11296 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11297 input from JMarc. Now use preprocessor to find the header.
11298 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11299 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11300 LYX_STL_STRING_FWD. See comments in file.
11302 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11304 * The global MiniBuffer * minibuffer variable is dead.
11306 * The global FD_form_main * fd_form_main variable is dead.
11308 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11310 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11312 * src/table.h: add the LOstream.h header
11313 * src/debug.h: ditto
11315 * src/LyXAction.h: change the explaination of the ReadOnly
11316 attribute: is indicates that the function _can_ be used.
11318 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11321 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11323 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11329 * src/paragraph.C (GetWord): assert on pos>=0
11332 * src/support/lyxstring.C: condition the use of an invariant on
11334 * src/support/lyxstring.h: ditto
11336 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11337 Use LAssert.h instead of plain assert().
11339 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11341 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11342 * src/support/filetools.C: ditto
11344 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11347 * INSTALL: document the new configure flags
11349 * configure.in: suppress --with-debug; add --enable-assertions
11351 * acinclude.m4: various changes in alignment of help strings.
11353 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11355 * src/kbmap.C: commented out the use of the hash map in kb_map,
11356 beginning of movement to a stl::container.
11358 * several files: removed code that was not in effect when
11359 MOVE_TEXT was defined.
11361 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11362 for escaping should not be used. We can discuss if the string
11363 should be enclosed in f.ex. [] instead of "".
11365 * src/trans_mgr.C (insert): use the new returned value from
11366 encodeString to get deadkeys and keymaps done correctly.
11368 * src/chset.C (encodeString): changed to return a pair, to tell
11369 what to use if we know the string.
11371 * src/lyxscreen.h (fillArc): new function.
11373 * src/FontInfo.C (resize): rewritten to use more std::string like
11374 structore, especially string::replace.
11376 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11379 * configure.in (chmod +x some scripts): remove config/gcc-hack
11381 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11383 * src/buffer.C (writeFile): change once again the top comment in a
11384 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11385 instead of an hardcoded version number.
11386 (makeDocBookFile): ditto
11388 * src/version.h: add new define LYX_DOCVERSION
11390 * po/de.po: update from Pit Sütterlin
11391 * lib/bind/de_menus.bind: ditto.
11393 * src/lyxfunc.C (Dispatch): call MenuExport()
11394 * src/buffer.C (Dispatch): ditto
11396 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11397 LyXFunc::Dispatch().
11398 (MenuExport): new function, moved from
11399 LyXFunc::Dispatch().
11401 * src/trans_mgr.C (insert): small cleanup
11402 * src/chset.C (loadFile): ditto
11404 * lib/kbd/iso8859-1.cdef: add missing backslashes
11406 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11408 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11409 help with placing the manually drawn accents better.
11411 (Draw): x2 and hg changed to float to minimize rounding errors and
11412 help place the accents better.
11414 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11415 unsigned short to char is just wrong...cast the char to unsigned
11416 char instead so that the two values can compare sanely. This
11417 should also make the display of insetlatexaccents better and
11418 perhaps also some other insets.
11420 (lbearing): new function
11423 1999-12-15 Allan Rae <rae@lyx.org>
11425 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11426 header that provides a wrapper around the very annoying SGI STL header
11429 * src/support/lyxstring.C, src/LString.h:
11430 removed old SGI-STL-compatability attempts.
11432 * configure.in: Use LYX_STL_STRING_FWD.
11434 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11435 stl_string_fwd.h is around and try to determine it's location.
11436 Major improvement over previous SGI STL 3.2 compatability.
11437 Three small problems remain with this function due to my zero
11438 knowledge of autoconf. JMarc and lgb see the comments in the code.
11440 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11442 * src/broken_const.h, config/hack-gcc, config/README: removed
11444 * configure.in: remove --with-gcc-hack option; do not call
11447 * INSTALL: remove documentation of --with-broken-const and
11450 * acconfig.h: remove all trace of BROKEN_CONST define
11452 * src/buffer.C (makeDocBookFile): update version number in output
11454 (SimpleDocBookOnePar): fix an assert when trying to a character
11455 access beyond string length
11458 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11460 * po/de.po: fix the Export menu
11462 * lyx.man: update the description of -dbg
11464 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11465 (commandLineHelp): updated
11466 (easyParse): show list of available debug levels if -dbg is passed
11469 * src/Makefile.am: add debug.C
11471 * src/debug.h: moved some code to debug.C
11473 * src/debug.C: new file. Contains code to set and show debug
11476 * src/layout.C: remove 'break' after 'continue' in switch
11477 statements, since these cannot be reached.
11479 1999-12-13 Allan Rae <rae@lyx.org>
11481 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11482 (in_word_set): hash() -> math_hash()
11484 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11486 * acconfig.h: Added a test for whether we are using exceptions in the
11487 current compilation run. If so USING_EXCEPTIONS is defined.
11489 * config.in: Check for existance of stl_string_fwd.h
11490 * src/LString.h: If compiling --with-included-string and SGI's
11491 STL version 3.2 is present (see above test) we need to block their
11492 forward declaration of string and supply a __get_c_string().
11493 However, it turns out this is only necessary if compiling with
11494 exceptions enabled so I've a bit more to add yet.
11496 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11497 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11498 src/support/LRegex.h, src/undo.h:
11499 Shuffle the order of the included files a little to ensure that
11500 LString.h gets included before anything that includes stl_string_fwd.h
11502 * src/support/lyxstring.C: We need to #include LString.h instead of
11503 lyxstring.h to get the necessary definition of __get_c_string.
11504 (__get_c_string): New function. This is defined static just like SGI's
11505 although why they need to do this I'm not sure. Perhaps it should be
11506 in lstrings.C instead.
11508 * lib/templates/IEEEtran.lyx: New template file.
11510 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11512 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11513 * intl/Makefile.in (MKINSTALLDIRS): ditto
11515 * src/LyXAction.C (init): changed to hold the LFUN data in a
11516 automatic array in stead of in callso to newFunc, this speeds up
11517 compilation a lot. Also all the memory used by the array is
11518 returned when the init is completed.
11520 * a lot of files: compiled with -Wold-style-cast, changed most of
11521 the reported offenders to C++ style casts. Did not change the
11522 offenders in C files.
11524 * src/trans.h (Match): change argument type to unsigned int.
11526 * src/support/DebugStream.C: fix some types on the streambufs so
11527 that it works on a conforming implementation.
11529 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11531 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11533 * src/support/lyxstring.C: remove the inline added earlier since
11534 they cause a bunch of unsatisfied symbols when linking with dec
11535 cxx. Cxx likes to have the body of inlines at the place where they
11538 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11539 accessing negative bounds in array. This fixes the crash when
11540 inserting accented characters.
11541 * src/trans.h (Match): ditto
11543 * src/buffer.C (Dispatch): since this is a void, it should not try
11544 to return anything...
11546 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11548 * src/buffer.h: removed the two friends from Buffer. Some changes
11549 because of this. Buffer::getFileName and Buffer::setFileName
11550 renamed to Buffer::fileName() and Buffer::fileName(...).
11552 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11554 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11555 and Buffer::update(short) to BufferView. This move is currently
11556 controlled by a define MOVE_TEXT, this will be removed when all
11557 shows to be ok. This move paves the way for better separation
11558 between buffer contents and buffer view. One side effect is that
11559 the BufferView needs a rebreak when swiching buffers, if we want
11560 to avoid this we can add a cache that holds pointers to LyXText's
11561 that is not currently in use.
11563 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11566 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11568 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11570 * lyx_main.C: new command line option -x (or --execute) and
11571 -e (or --export). Now direct conversion from .lyx to .tex
11572 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11573 Unfortunately, X is still needed and the GUI pops up during the
11576 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11578 * src/Spacing.C: add a using directive to bring stream stuff into
11580 * src/paragraph.C: ditto
11581 * src/buffer.C: ditto
11583 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11584 from Lars' announcement).
11586 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11587 example files from Tino Meinen.
11589 1999-12-06 Allan Rae <rae@lyx.org>
11591 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11593 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11595 * src/support/lyxstring.C: added a lot of inline for no good
11598 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11599 latexWriteEndChanges, they were not used.
11601 * src/layout.h (operator<<): output operator for PageSides
11603 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11605 * some example files: loaded in LyX 1.0.4 and saved again to update
11606 certain constructs (table format)
11608 * a lot of files: did the change to use fstream/iostream for all
11609 writing of files. Done with a close look at Andre Poenitz's patch.
11611 * some files: whitespace changes.
11613 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11615 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11616 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11617 architecture, we provide our own. It is used unconditionnally, but
11618 I do not think this is a performance problem. Thanks to Angus
11619 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11620 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11622 (GetInset): use my_memcpy.
11626 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11627 it is easier to understand, but it uses less TeX-only constructs now.
11629 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11630 elements contain spaces
11632 * lib/configure: regenerated
11634 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11635 elements contain spaces; display the list of programs that are
11638 * autogen.sh: make sure lib/configure is executable
11640 * lib/examples/*: rename the tutorial examples to begin with the
11641 two-letters language code.
11643 * src/lyxfunc.C (getStatus): do not query current font if no
11646 * src/lyx_cb.C (RunScript): use QuoteName
11647 (MenuRunDvips): ditto
11648 (PrintApplyCB): ditto
11650 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11651 around argument, so that it works well with the current shell.
11652 Does not work properly with OS/2 shells currently.
11654 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11655 * src/LyXSendto.C (SendtoApplyCB): ditto
11656 * src/lyxfunc.C (Dispatch): ditto
11657 * src/buffer.C (runLaTeX): ditto
11658 (runLiterate): ditto
11659 (buildProgram): ditto
11661 * src/lyx_cb.C (RunScript): ditto
11662 (MenuMakeLaTeX): ditto
11664 * src/buffer.h (getLatexName): new method
11666 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11668 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11670 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11671 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11672 (create_math_panel): ditto
11674 * src/lyxfunc.C (getStatus): re-activate the code which gets
11675 current font and cursor; add test for export to html.
11677 * src/lyxrc.C (read): remove unreachable break statements; add a
11680 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11682 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11684 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11685 introduced by faulty regex.
11686 * src/buffer.C: ditto
11687 * src/lastfiles.C: ditto
11688 * src/paragraph.C: ditto
11689 * src/table.C: ditto
11690 * src/vspace.C: ditto
11691 * src/insets/figinset.C: ditto
11692 Note: most of these is absolutely harmless, except the one in
11693 src/mathed formula.C.
11695 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11697 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11698 operation, yielding correct results for the reLyX command.
11700 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11702 * src/support/filetools.C (ExpandPath): removed an over eager
11704 (ReplaceEnvironmentPath): ditto
11706 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11707 shows that we are doing something fishy in our code...
11708 (BubblePost): ditto
11711 * src/lyxrc.C (read): use a double switch trick to get more help
11712 from the compiler. (the same trick is used in layout.C)
11713 (write): new function. opens a ofstream and pass that to output
11714 (output): new function, takes a ostream and writes the lyxrc
11715 elemts to it. uses a dummy switch to make sure no elements are
11718 * src/lyxlex.h: added a struct pushpophelper for use in functions
11719 with more than one exit point.
11721 * src/lyxlex.[Ch] (GetInteger): made it const
11725 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11727 * src/layout.[hC] : LayoutTags splitted into several enums, new
11728 methods created, better error handling cleaner use of lyxlex. Read
11731 * src/bmtable.[Ch]: change some member prototypes because of the
11732 image const changes.
11734 * commandtags.h, src/LyXAction.C (init): new function:
11735 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11736 This file is not read automatically but you can add \input
11737 preferences to your lyxrc if you want to. We need to discuss how
11740 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11741 in .aux, also remove .bib and .bst files from dependencies when
11744 * src/BufferView.C, src/LyXView.C: add const_cast several places
11745 because of changes to images.
11747 * lib/images/*: same change as for images/*
11749 * lib/lyxrc.example: Default for accept_compound is false not no.
11751 * images/*: changed to be const, however I have som misgivings
11752 about this change so it might be changed back.
11754 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11756 * lib/configure, po/POTFILES.in: regenerated
11758 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11760 * config/lib_configure.m4: removed
11762 * lib/configure.m4: new file (was config/lib_configure.m4)
11764 * configure.in: do not test for rtti, since we do not use it.
11766 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11768 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11769 doubling of allocated space scheme. This makes it faster for large
11770 strings end to use less memory for small strings. xtra rememoved.
11772 * src/insets/figinset.C (waitalarm): commented out.
11773 (GhostscriptMsg): use static_cast
11774 (GhostscriptMsg): use new instead of malloc to allocate memory for
11775 cmap. also delete the memory after use.
11777 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11779 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11780 for changes in bibtex database or style.
11781 (runBibTeX): remove all .bib and .bst files from dep before we
11783 (run): use scanAuc in when dep file already exist.
11785 * src/DepTable.C (remove_files_with_extension): new method
11786 (exist): new method
11788 * src/DepTable.[Ch]: made many of the methods const.
11790 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11792 * src/bufferparams.C: make sure that the default textclass is
11793 "article". It used to be the first one by description order, but
11794 now the first one is "docbook".
11796 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11797 string; call Debug::value.
11798 (easyParse): pass complete argument to setDebuggingLevel().
11800 * src/debug.h (value): fix the code that parses debug levels.
11802 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11805 * src/LyXAction.C: use Debug::ACTION as debug channel.
11807 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11809 * NEWS: updated for the future 1.1.3 release.
11811 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11812 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11813 it should. This is of course a controversial change (since many
11814 people will find that their lyx workscreen is suddenly full of
11815 red), but done for the sake of correctness.
11817 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11818 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11820 * src/insets/inseterror.h, src/insets/inseturl.h,
11821 src/insets/insetinfo.h, src/insets/figinset.h,
11822 src/mathed/formulamacro.h, src/mathed/math_macro.h
11823 (EditMessage): add a missing const and add _() to make sure that
11824 translation happens
11826 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11827 src/insets/insetbib.C, src/support/filetools.C: add `using'
11828 directives for cxx.
11830 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11831 doing 'Insert index of last word' at the beginning of a paragraph.
11833 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11835 * several files: white-space changes.
11837 * src/mathed/formula.C: removed IsAlpha and IsDigit
11839 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11840 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11843 * src/insets/figinset.C (GetPSSizes): don't break when
11844 "EndComments" is seen. But break when a boundingbox is read.
11846 * all classes inherited from Inset: return value of Clone
11847 changed back to Inset *.
11849 * all classes inherited form MathInset: return value of Clone
11850 changed back to MathedInset *.
11852 * src/insets/figinset.C (runqueue): use a ofstream to output the
11853 gs/ps file. Might need some setpresicion or setw. However I can
11854 see no problem with the current code.
11855 (runqueue): use sleep instead of the alarm/signal code. I just
11856 can't see the difference.
11858 * src/paragraph.C (LyXParagraph): reserve space in the new
11859 paragraph and resize the inserted paragraph to just fit.
11861 * src/lyxfunc.h (operator|=): added operator for func_status.
11863 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11864 check for readable file.
11866 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11867 check for readable file.
11868 (MenuMakeLinuxDoc): ditto
11869 (MenuMakeDocBook): ditto
11870 (MenuMakeAscii): ditto
11871 (InsertAsciiFile): split the test for openable and readable
11873 * src/bmtable.C (draw_bitmaptable): use
11874 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11876 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11877 findtexfile from LaTeX to filetools.
11879 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11880 instead of FilePtr. Needs to be verified by a literate user.
11882 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11884 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11885 (EditMessage): likewise.
11887 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11888 respectively as \textasciitilde and \textasciicircum.
11890 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11892 * src/support/lyxstring.h: made the methods that take iterators
11893 use const_iterator.
11895 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11896 (regexMatch): made is use the real regex class.
11898 * src/support/Makefile.am: changed to use libtool
11900 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11902 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11904 (MathIsInset ++): changed several macros to be inline functions
11907 * src/mathed/Makefile.am: changed to use libtool
11909 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11911 * src/insets/inset* : Clone changed to const and return type is
11912 the true insettype not just Inset*.
11914 * src/insets/Makefile.am: changed to use libtool
11916 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11918 * src/undo.[Ch] : added empty() and changed some of the method
11921 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11923 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11924 setID use block<> for the bullets array, added const several places.
11926 * src/lyxfunc.C (getStatus): new function
11928 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11929 LyXAction, added const to several funtions.
11931 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11932 a std::map, and to store the dir items in a vector.
11934 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11937 * src/LyXView.[Ch] + other files : changed currentView to view.
11939 * src/LyXAction.[Ch] : ported from the old devel branch.
11941 * src/.cvsignore: added .libs and a.out
11943 * configure.in : changes to use libtool.
11945 * acinclude.m4 : inserted libtool.m4
11947 * .cvsignore: added libtool
11949 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11951 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11952 file name in insets and mathed directories (otherwise the
11953 dependency is not taken in account under cygwin).
11955 * src/text2.C (InsertString[AB]): make sure that we do not try to
11956 read characters past the string length.
11958 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11960 * lib/doc/LaTeXConfig.lyx.in,
11961 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11963 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11964 file saying who created them and when this heppened; this is
11965 useless and annoys tools like cvs.
11967 * lib/layouts/g-brief-{en,de}.layout,
11968 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11969 from Thomas Hartkens <thomas@hartkens.de>.
11971 * src/{insets,mathed}/Makefile.am: do not declare an empty
11972 LDFLAGS, so that it can be set at configure time (useful on Irix
11975 * lib/reLyX/configure.in: make sure that the prefix is set
11976 correctly in LYX_DIR.
11978 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11980 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11981 be used by 'command-sequence' this allows to bind a key to a
11982 sequence of LyX-commands
11983 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11985 * src/LyXAction.C: add "command-sequence"
11987 * src/LyXFunction.C: handling of "command-sequence"
11989 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11990 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11992 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11994 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11996 * src/buffer.C (writeFile): Do not output a comment giving user
11997 and date at the beginning of a .lyx file. This is useless and
11998 annoys cvs anyway; update version number to 1.1.
12000 * src/Makefile.am (LYX_DIR): add this definition, so that a
12001 default path is hardcoded in LyX.
12003 * configure.in: Use LYX_GNU_GETTEXT.
12005 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
12006 AM_GNU_GETTEXT with a bug fixed.
12008 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
12010 * src/chset.C: add "using std::ifstream;" to please dec cxx.
12012 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
12013 which is used to point to LyX data is now LYX_DIR_11x.
12015 * lyx.man: convert to a unix text file; small updates.
12017 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
12019 * src/support/LSubstring.[Ch]: made the second arg of most of the
12020 constructors be a const reference.
12022 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
12025 * src/support/lyxstring.[Ch] (swap): added missing member function
12026 and specialization of swap(str, str);
12028 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
12030 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
12031 trace of the old one.
12033 * src/undo.[Ch]: made the undostack use std::list to store undo's in
12034 put the member definitions in undo.C.
12036 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
12037 NEW_TEXT and have now only code that was included when this was
12040 * src/intl.C (LCombo): use static_cast
12042 (DispatchCallback): ditto
12044 * src/definitions.h: removed whole file
12046 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
12048 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
12049 parsing and stores in a std:map. a regex defines the file format.
12050 removed unneeded members.
12052 * src/bufferparams.h: added several enums from definitions.h here.
12053 Removed unsused destructor. Changed some types to use proper enum
12054 types. use block to have the temp_bullets and user_defined_bullets
12055 and to make the whole class assignable.
12057 * src/bufferparams.C (Copy): removed this functions, use a default
12058 assignment instead.
12060 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
12063 * src/buffer.C (readLyXformat2): commend out all that have with
12064 oldpapersize to do. also comment out all that hve to do with
12065 insetlatex and insetlatexdel.
12066 (setOldPaperStuff): commented out
12068 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
12070 * src/LyXAction.C: remove use of inset-latex-insert
12072 * src/mathed/math_panel.C (button_cb): use static_cast
12074 * src/insets/Makefile.am (insets_o_SOURCES): removed
12077 * src/support/lyxstring.C (helper): use the unsigned long
12078 specifier, UL, instead of a static_cast.
12080 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
12082 * src/support/block.h: new file. to be used as a c-style array in
12083 classes, so that the class can be assignable.
12085 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12087 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
12088 NULL, make sure to return an empty string (it is not possible to
12089 set a string to NULL).
12091 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12093 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
12095 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
12097 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
12098 link line, so that Irix users (for example) can set it explicitely to
12101 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
12102 it can be overidden at make time (static or dynamic link, for
12105 * src/vc-backend.C, src/LaTeXFeatures.h,
12106 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12107 statements to bring templates to global namespace.
12109 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12111 * src/support/lyxstring.C (operator[] const): make it standard
12114 * src/minibuffer.C (Init): changed to reflect that more
12115 information is given from the lyxvc and need not be provided here.
12117 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12119 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12121 * src/LyXView.C (UpdateTimerCB): use static_cast
12122 (KeyPressMask_raw_callback): ditto
12124 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12125 buffer_, a lot of changes because of this. currentBuffer() ->
12126 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12127 also changes to other files because of this.
12129 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12131 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12132 have no support for RCS and partial support for CVS, will be
12135 * src/insets/ several files: changes because of function name
12136 changes in Bufferview and LyXView.
12138 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12140 * src/support/LSubstring.[Ch]: new files. These implement a
12141 Substring that can be very convenient to use. i.e. is this
12143 string a = "Mary had a little sheep";
12144 Substring(a, "sheep") = "lamb";
12145 a is now "Mary has a little lamb".
12147 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12148 out patterns and subpatterns of strings. It is used by LSubstring
12149 and also by vc-backend.C
12151 * src/support/lyxstring.C: went over all the assertions used and
12152 tried to correct the wrong ones and flag which of them is required
12153 by the standard. some bugs found because of this. Also removed a
12154 couple of assertions.
12156 * src/support/Makefile.am (libsupport_a_SOURCES): added
12157 LSubstring.[Ch] and LRegex.[Ch]
12159 * src/support/FileInfo.h: have struct stat buf as an object and
12160 not a pointer to one, some changes because of this.
12162 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12163 information in layout when adding the layouts preamble to the
12164 textclass preamble.
12166 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12169 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12170 because of bug in OS/2.
12172 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12174 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12175 \verbatim@font instead of \ttfamily, so that it can be redefined.
12177 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12178 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12179 src/layout.h, src/text2.C: add 'using' directive to bring the
12180 STL templates we need from the std:: namespace to the global one.
12181 Needed by DEC cxx in strict ansi mode.
12183 * src/support/LIstream.h,src/support/LOstream.h,
12184 src/support/lyxstring.h,src/table.h,
12185 src/lyxlookup.h: do not include <config.h> in header
12186 files. This should be done in the .C files only.
12188 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12192 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12194 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12195 from Kayvan to fix the tth invokation.
12197 * development/lyx.spec.in: updates from Kayvan to reflect the
12198 changes of file names.
12200 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12202 * src/text2.C (InsertStringB): use std::copy
12203 (InsertStringA): use std::copy
12205 * src/bufferlist.C: use a vector to store the buffers in. This is
12206 an internal change and should not affect any other thing.
12208 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12211 * src/text.C (Fill): fix potential bug, one off bug.
12213 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12215 * src/Makefile.am (lyx_main.o): add more files it depends on.
12217 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12219 * src/support/lyxstring.C: use size_t for the reference count,
12220 size, reserved memory and xtra.
12221 (internal_compare): new private member function. Now the compare
12222 functions should work for std::strings that have embedded '\0'
12224 (compare): all compare functions rewritten to use
12227 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12229 * src/support/lyxstring.C (compare): pass c_str()
12230 (compare): pass c_str
12231 (compare): pass c_str
12233 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12235 * src/support/DebugStream.C: <config.h> was not included correctly.
12237 * lib/configure: forgot to re-generate it :( I'll make this file
12238 auto generated soon.
12240 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12242 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12245 * src/support/lyxstring.C: some changes from length() to rep->sz.
12246 avoids a function call.
12248 * src/support/filetools.C (SpaceLess): yet another version of the
12249 algorithm...now per Jean-Marc's suggestions.
12251 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12253 * src/layout.C (less_textclass_desc): functor for use in sorting
12255 (LyXTextClass::Read): sort the textclasses after reading.
12257 * src/support/filetools.C (SpaceLess): new version of the
12258 SpaceLess functions. What problems does this one give? Please
12261 * images/banner_bw.xbm: made the arrays unsigned char *
12263 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12265 * src/support/lyxstring.C (find): remove bogus assertion in the
12266 two versions of find where this has not been done yet.
12268 * src/support/lyxlib.h: add missing int return type to
12271 * src/menus.C (ShowFileMenu): disable exporting to html if no
12272 html export command is present.
12274 * config/lib_configure.m4: add a test for an HTML converter. The
12275 programs checked for are, in this order: tth, latex2html and
12278 * lib/configure: generated from config/lib_configure.m4.
12280 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12281 html converter. The parameters are now passed through $$FName and
12282 $$OutName, instead of standard input/output.
12284 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12286 * lib/lyxrc.example: update description of \html_command.
12287 add "quotes" around \screen_font_xxx font setting examples to help
12288 people who use fonts with spaces in their names.
12290 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12292 * Distribution files: updates for v1.1.2
12294 * src/support/lyxstring.C (find): remove bogus assert and return
12295 npos for the same condition.
12297 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12299 * added patch for OS/2 from SMiyata.
12301 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12303 * src/text2.C (CutSelection): make space_wrapped a bool
12304 (CutSelection): dont declare int i until we have to.
12305 (alphaCounter): return a char const *.
12307 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12309 * src/support/syscall.C (Systemcalls::kill):
12310 src/support/filetools.C (PutEnv, PutEnvPath):
12311 src/lyx_cb.C (addNewlineAndDepth):
12312 src/FontInfo.C (FontInfo::resize): condition some #warning
12313 directives with WITH_WARNINGS.
12316 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12318 * src/layout.[Ch] + several files: access to class variables
12319 limited and made accessor functions instead a lot of code changed
12320 becuase of this. Also instead of returning pointers often a const
12321 reference is returned instead.
12323 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12325 * src/Makefile.am (dist-hook): added used to remove the CVS from
12326 cheaders upon creating a dist
12327 (EXTRA_DIST): added cheaders
12329 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12330 a character not as a small integer.
12332 * src/support/lyxstring.C (find): removed Assert and added i >=
12333 rep->sz to the first if.
12335 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12337 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12338 src/LyXView.C src/buffer.C src/bufferparams.C
12339 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12340 src/text2.C src/insets/insetinclude.C:
12341 lyxlayout renamed to textclasslist.
12343 * src/layout.C: some lyxerr changes.
12345 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12346 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12347 (LyXLayoutList): removed all traces of this class.
12348 (LyXTextClass::Read): rewrote LT_STYLE
12349 (LyXTextClass::hasLayout): new function
12350 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12351 both const and nonconst version.
12352 (LyXTextClass::delete_layout): new function.
12353 (LyXTextClassList::Style): bug fix. do the right thing if layout
12355 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12356 (LyXTextClassList::NameOfLayout): ditto
12357 (LyXTextClassList::Load): ditto
12359 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12361 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12363 * src/LyXAction.C (LookupFunc): added a workaround for sun
12364 compiler, on the other hand...we don't know if the current code
12365 compiles on sun at all...
12367 * src/support/filetools.C (CleanupPath): subst fix
12369 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12372 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12373 complained about this one?
12375 * src/insets/insetinclude.C (Latex): subst fix
12377 * src/insets/insetbib.C (getKeys): subst fix
12379 * src/LyXSendto.C (SendtoApplyCB): subst fix
12381 * src/lyx_main.C (init): subst fix
12383 * src/layout.C (Read): subst fix
12385 * src/lyx_sendfax_main.C (button_send): subst fix
12387 * src/buffer.C (RoffAsciiTable): subst fix
12389 * src/lyx_cb.C (MenuFax): subst fix
12390 (PrintApplyCB): subst fix
12392 1999-10-26 Juergen Vigna <jug@sad.it>
12394 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12396 (Read): Cleaned up this code so now we read only format vestion >= 5
12398 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12400 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12401 come nobody has complained about this one?
12403 * src/insets/insetinclude.C (Latex): subst fix
12405 * src/insets/insetbib.C (getKeys): subst fix
12407 * src/lyx_main.C (init): subst fix
12409 * src/layout.C (Read): subst fix
12411 * src/buffer.C (RoffAsciiTable): subst fix
12413 * src/lyx_cb.C (MenuFax): subst fix.
12415 * src/layout.[hC] + some other files: rewrote to use
12416 std::container to store textclasses and layouts in.
12417 Simplified, removed a lot of code. Make all classes
12418 assignable. Further simplifications and review of type
12419 use still to be one.
12421 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12422 lastfiles to create the lastfiles partr of the menu.
12424 * src/lastfiles.[Ch]: rewritten to use deque to store the
12425 lastfiles in. Uses fstream for reading and writing. Simplifies
12428 * src/support/syscall.C: remove explicit cast.
12430 * src/BufferView.C (CursorToggleCB): removed code snippets that
12431 were commented out.
12432 use explicat C++ style casts instead of C style casts. also use
12433 u_vdata instea of passing pointers in longs.
12435 * src/PaperLayout.C: removed code snippets that were commented out.
12437 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12439 * src/lyx_main.C: removed code snippets that wer commented out.
12441 * src/paragraph.C: removed code snippets that were commented out.
12443 * src/lyxvc.C (logClose): use static_cast
12445 (viewLog): remove explicit cast to void*
12446 (showLog): removed old commented code
12448 * src/menus.C: use static_cast instead of C style casts. use
12449 u_vdata instead of u_ldata. remove explicit cast to (long) for
12450 pointers. Removed old code that was commented out.
12452 * src/insets/inset.C: removed old commented func
12454 * src/insets/insetref.C (InsetRef): removed old code that had been
12455 commented out for a long time.
12457 (escape): removed C style cast
12459 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12461 * src/insets/insetlatex.C (Draw): removed old commented code
12462 (Read): rewritten to use string
12464 * src/insets/insetlabel.C (escape): removed C style cast
12466 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12468 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12469 old commented code.
12471 * src/insets/insetinclude.h: removed a couple of stupid bools
12473 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12474 (Clone): remove C style cast
12475 (getKeys): changed list to lst because of std::list
12477 * src/insets/inseterror.C (Draw): removed som old commented code.
12479 * src/insets/insetcommand.C (Draw): removed some old commented code.
12481 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12482 commented out forever.
12483 (bibitem_cb): use static_cast instead of C style cast
12484 use of vdata changed to u_vdata.
12486 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12488 (CloseUrlCB): use static_cast instead of C style cast.
12489 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12491 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12492 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12493 (CloseInfoCB): static_cast from ob->u_vdata instead.
12494 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12497 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12498 (C_InsetError_CloseErrorCB): forward the ob parameter
12499 (CloseErrorCB): static_cast from ob->u_vdata instead.
12501 * src/vspace.h: include LString.h since we use string in this class.
12503 * src/vspace.C (lyx_advance): changed name from advance because of
12504 nameclash with stl. And since we cannot use namespaces yet...I
12505 used a lyx_ prefix instead. Expect this to change when we begin
12508 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12510 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12511 and removed now defunct constructor and deconstructor.
12513 * src/BufferView.h: have backstack as a object not as a pointer.
12514 removed initialization from constructor. added include for BackStack
12516 * development/lyx.spec.in (%build): add CFLAGS also.
12518 * src/screen.C (drawFrame): removed another warning.
12520 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12522 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12523 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12524 README and ANNOUNCE a bit for the next release. More work is
12527 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12528 unbreakable if we are in freespacing mode (LyX-Code), but not in
12531 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12533 * src/BackStack.h: fixed initialization order in constructor
12535 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12537 * acinclude.m4 (VERSION): new rules for when a version is
12538 development, added also a variable for prerelease.
12539 (warnings): we set with_warnings=yes for prereleases
12540 (lyx_opt): prereleases compile with same optimization as development
12541 (CXXFLAGS): only use pedantic if we are a development version
12543 * src/BufferView.C (restorePosition): don't do anything if the
12544 backstack is empty.
12546 * src/BackStack.h: added member empty, use this to test if there
12547 is anything to pop...
12549 1999-10-25 Juergen Vigna <jug@sad.it>
12552 * forms/layout_forms.fd +
12553 * forms/latexoptions.fd +
12554 * lyx.fd: changed for various form resize issues
12556 * src/mathed/math_panel.C +
12557 * src/insets/inseterror.C +
12558 * src/insets/insetinfo.C +
12559 * src/insets/inseturl.C +
12560 * src/insets/inseturl.h +
12562 * src/LyXSendto.C +
12563 * src/PaperLayout.C +
12564 * src/ParagraphExtra.C +
12565 * src/TableLayout.C +
12567 * src/layout_forms.C +
12574 * src/menus.C: fixed various resize issues. So now forms can be
12575 resized savely or not be resized at all.
12577 * forms/form_url.fd +
12578 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12581 * src/insets/Makefile.am: added files form_url.[Ch]
12583 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12585 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12586 (and presumably 6.2).
12588 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12589 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12590 remaining static member callbacks.
12592 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12595 * src/support/lyxstring.h: declare struct Srep as friend of
12596 lyxstring, since DEC cxx complains otherwise.
12598 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12600 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12602 * src/LaTeX.C (run): made run_bibtex also depend on files with
12604 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12605 are put into the dependency file.
12607 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12608 the code has shown itself to work
12609 (create_ispell_pipe): removed another warning, added a comment
12612 * src/minibuffer.C (ExecutingCB): removed code that has been
12613 commented out a long time
12615 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12616 out code + a warning.
12618 * src/support/lyxstring.h: comment out the three private
12619 operators, when compiling with string ansi conforming compilers
12620 they make problems.
12622 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12624 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12625 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12628 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12631 * src/mathed/math_panel.C (create_math_panel): remove explicit
12634 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12637 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12638 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12639 to XCreatePixmapFromBitmapData
12640 (fl_set_bmtable_data): change the last argument to be unsigned
12642 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12643 and bh to be unsigned int, remove explicit casts in call to
12644 XReadBitmapFileData.
12646 * images/arrows.xbm: made the arrays unsigned char *
12647 * images/varsz.xbm: ditto
12648 * images/misc.xbm: ditto
12649 * images/greek.xbm: ditto
12650 * images/dots.xbm: ditto
12651 * images/brel.xbm: ditto
12652 * images/bop.xbm: ditto
12654 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12656 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12657 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12658 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12660 (LYX_CXX_CHEADERS): added <clocale> to the test.
12662 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12664 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12666 * src/support/lyxstring.C (append): fixed something that must be a
12667 bug, rep->assign was used instead of rep->append.
12669 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12672 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12673 lyx insert double chars. Fix spotted by Kayvan.
12675 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12677 * Fixed the tth support. I messed up with the Emacs patch apply feature
12678 and omitted the changes in lyxrc.C.
12680 1999-10-22 Juergen Vigna <jug@sad.it>
12682 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12684 * src/lyx_cb.C (MenuInsertRef) +
12685 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12686 the form cannot be resized under it limits (fixes a segfault)
12688 * src/lyx.C (create_form_form_ref) +
12689 * forms/lyx.fd: Changed Gravity on name input field so that it is
12692 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12694 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12695 <ostream> and <istream>.
12697 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12698 whether <fstream> provides the latest standard features, or if we
12699 have an oldstyle library (like in egcs).
12700 (LYX_CXX_STL_STRING): fix the test.
12702 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12703 code on MODERN_STL_STREAM.
12705 * src/support/lyxstring.h: use L{I,O}stream.h.
12707 * src/support/L{I,O}stream.h: new files, designed to setup
12708 correctly streams for our use
12709 - includes the right header depending on STL capabilities
12710 - puts std::ostream and std::endl (for LOStream.h) or
12711 std::istream (LIStream.h) in toplevel namespace.
12713 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12715 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12716 was a bib file that had been changed we ensure that bibtex is run.
12717 (runBibTeX): enhanced to extract the names of the bib files and
12718 getting their absolute path and enter them into the dep file.
12719 (findtexfile): static func that is used to look for tex-files,
12720 checks for absolute patchs and tries also with kpsewhich.
12721 Alternative ways of finding the correct files are wanted. Will
12723 (do_popen): function that runs a command using popen and returns
12724 the whole output of that command in a string. Should be moved to
12727 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12728 file with extension ext has changed.
12730 * src/insets/figinset.C: added ifdef guards around the fl_free
12731 code that jug commented out. Now it is commented out when
12732 compiling with XForms == 0.89.
12734 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12735 to lyxstring.C, and only keep a forward declaration in
12736 lyxstring.h. Simplifies the header file a bit and should help a
12737 bit on compile time too. Also changes to Srep will not mandate a
12738 recompile of code just using string.
12739 (~lyxstring): definition moved here since it uses srep.
12740 (size): definition moved here since it uses srep.
12742 * src/support/lyxstring.h: removed a couple of "inline" that should
12745 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12747 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12750 1999-10-21 Juergen Vigna <jug@sad.it>
12752 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12753 set to left if I just remove the width entry (or it is empty).
12755 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12756 paragraph when having dummy paragraphs.
12758 1999-10-20 Juergen Vigna <jug@sad.it>
12760 * src/insets/figinset.C: just commented some fl_free_form calls
12761 and added warnings so that this calls should be activated later
12762 again. This avoids for now a segfault, but we have a memory leak!
12764 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12765 'const char * argument' to 'string argument', this should
12766 fix some Asserts() in lyxstring.C.
12768 * src/lyxfunc.h: Removed the function argAsString(const char *)
12769 as it is not used anymore.
12771 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12773 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12776 * src/Literate.h: some funcs moved from public to private to make
12777 interface clearer. Unneeded args removed.
12779 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12781 (scanBuildLogFile): ditto
12783 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12784 normal TeX Error. Still room for improvement.
12786 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12788 * src/buffer.C (insertErrors): changes to make the error
12789 desctription show properly.
12791 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12794 * src/support/lyxstring.C (helper): changed to use
12795 sizeof(object->rep->ref).
12796 (operator>>): changed to use a pointer instead.
12798 * src/support/lyxstring.h: changed const reference & to value_type
12799 const & lets see if that helps.
12801 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12803 * Makefile.am (rpmdist): fixed to have non static package and
12806 * src/support/lyxstring.C: removed the compilation guards
12808 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12811 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12812 conditional compile of lyxstring.Ch
12814 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12815 stupid check, but it is a lot better than the bastring hack.
12816 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12818 * several files: changed string::erase into string::clear. Not
12821 * src/chset.C (encodeString): use a char temporary instead
12823 * src/table.C (TexEndOfCell): added tostr around
12824 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12825 (TexEndOfCell): ditto
12826 (TexEndOfCell): ditto
12827 (TexEndOfCell): ditto
12828 (DocBookEndOfCell): ditto
12829 (DocBookEndOfCell): ditto
12830 (DocBookEndOfCell): ditto
12831 (DocBookEndOfCell): ditto
12833 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12835 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12837 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12838 (MenuBuildProg): added tostr around ret
12839 (MenuRunChktex): added tostr around ret
12840 (DocumentApplyCB): added tostr around ret
12842 * src/chset.C (encodeString): added tostr around t->ic
12844 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12845 (makeLaTeXFile): added tostr around tocdepth
12846 (makeLaTeXFile): added tostr around ftcound - 1
12848 * src/insets/insetbib.C (setCounter): added tostr around counter.
12850 * src/support/lyxstring.h: added an operator+=(int) to catch more
12853 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12854 (lyxstring): We DON'T allow NULL pointers.
12856 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12858 * src/mathed/math_macro.C (MathMacroArgument::Write,
12859 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12860 when writing them out.
12862 * src/LString.C: remove, since it is not used anymore.
12864 * src/support/lyxstring.C: condition the content to
12865 USE_INCLUDED_STRING macro.
12867 * src/mathed/math_symbols.C, src/support/lstrings.C,
12868 src/support/lyxstring.C: add `using' directive to specify what
12869 we need in <algorithm>. I do not think that we need to
12870 conditionalize this, but any thought is appreciated.
12872 * many files: change all callback functions to "C" linkage
12873 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12874 strict_ansi. Those who were static are now global.
12875 The case of callbacks which are static class members is
12876 trickier, since we have to make C wrappers around them (see
12877 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12878 did not finish this yet, since it defeats the purpose of
12879 encapsulation, and I am not sure what the best route is.
12881 1999-10-19 Juergen Vigna <jug@sad.it>
12883 * src/support/lyxstring.C (lyxstring): we permit to have a null
12884 pointer as assignment value and just don't assign it.
12886 * src/vspace.C (nextToken): corrected this function substituting
12887 find_first(_not)_of with find_last_of.
12889 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12890 (TableOptCloseCB) (TableSpeCloseCB):
12891 inserted fl_set_focus call for problem with fl_hide_form() in
12894 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12896 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12899 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12901 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12902 LyXLex::next() and not eatline() to get its argument.
12904 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12906 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12907 instead, use fstreams for io of the depfile, removed unneeded
12908 functions and variables.
12910 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12911 vector instead, removed all functions and variables that is not in
12914 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12916 * src/buffer.C (insertErrors): use new interface to TeXError
12918 * Makefile.am (rpmdist): added a rpmdist target
12920 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12921 per Kayvan's instructions.
12923 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12925 * src/Makefile.am: add a definition for localedir, so that locales
12926 are found after installation (Kayvan)
12928 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12930 * development/.cvsignore: new file.
12932 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12934 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12935 C++ compiler provides wrappers for C headers and use our alternate
12938 * configure.in: use LYX_CXX_CHEADERS.
12940 * src/cheader/: new directory, populated with cname headers from
12941 libstdc++-2.8.1. They are a bit old, but probably good enough for
12942 what we want (support compilers who lack them).
12944 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12945 from includes. It turns out is was stupid.
12947 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12949 * lib/Makefile.am (install-data-local): forgot a ';'
12950 (install-data-local): forgot a '\'
12951 (libinstalldirs): needed after all. reintroduced.
12953 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12955 * configure.in (AC_OUTPUT): added lyx.spec
12957 * development/lyx.spec: removed file
12959 * development/lyx.spec.in: new file
12961 * po/*.po: merged with lyx.pot becuase of make distcheck
12963 * lib/Makefile.am (dist-hook): added dist-hook so that
12964 documentation files will be included when doing a make
12965 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12966 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12968 more: tried to make install do the right thing, exclude CVS dirs
12971 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12972 Path would fit in more nicely.
12974 * all files that used to use pathstack: uses now Path instead.
12975 This change was a lot easier than expected.
12977 * src/support/path.h: new file
12979 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12981 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12983 * src/support/lyxstring.C (getline): Default arg was given for
12986 * Configure.cmd: removed file
12988 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12990 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12991 streams classes and types, add the proper 'using' statements when
12992 MODERN_STL is defined.
12994 * src/debug.h: move the << operator definition after the inclusion
12997 * src/support/filetools.C: include "LAssert.h", which is needed
13000 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
13003 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
13004 include "debug.h" to define a proper ostream.
13006 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
13008 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
13009 method to the SystemCall class which can kill a process, but it's
13010 not fully implemented yet.
13012 * src/*.C: Changed Systemcalls::Startscript() to startscript()
13014 * src/support/FileInfo.h: Better documentation
13016 * src/lyxfunc.C: Added support for buffer-export html
13018 * src/menus.C: Added Export->As HTML...
13020 * lib/bind/*.bind: Added short-cut for buffer-export html
13022 * src/lyxrc.*: Added support for new \tth_command
13024 * lib/lyxrc.example: Added stuff for new \tth_command
13026 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
13028 * lib/Makefile.am (IMAGES): removed images/README
13029 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
13030 installes in correct place. Check permisions is installed
13033 * src/LaTeX.C: some no-op changes moved declaration of some
13036 * src/LaTeX.h (LATEX_H): changed include guard name
13038 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13040 * lib/reLyX/Makefile.am: install noweb2lyx.
13042 * lib/Makefile.am: install configure.
13044 * lib/reLyX/configure.in: declare a config aux dir; set package
13045 name to lyx (not sure what the best solution is); generate noweb2lyx.
13047 * lib/layouts/egs.layout: fix the bibliography layout.
13049 1999-10-08 Jürgen Vigna <jug@sad.it>
13051 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
13052 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
13053 it returned without continuing to search the path.
13055 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
13057 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
13058 also fixes a bug. It is not allowed to do tricks with std::strings
13059 like: string a("hei"); &a[e]; this will not give what you
13060 think... Any reason for the complexity in this func?
13062 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
13064 * Updated README and INSTALL a bit, mostly to check that my
13065 CVS rights are correctly set up.
13067 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
13069 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
13070 does not allow '\0' chars but lyxstring and std::string does.
13072 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
13074 * autogen.sh (AUTOCONF): let the autogen script create the
13075 POTFILES.in file too. POTFILES.in should perhaps now not be
13076 included in the cvs module.
13078 * some more files changed to use C++ includes instead of C ones.
13080 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
13082 (Reread): added tostr to nlink. buggy output otherwise.
13083 (Reread): added a string() around szMode when assigning to Buffer,
13084 without this I got a log of garbled info strings.
13086 * acconfig.h: commented out the PTR_AS_INT macros. They should not
13089 * I have added several ostream & operator<<(ostream &, some_type)
13090 functions. This has been done to avoid casting and warnings when
13091 outputting enums to lyxerr. This as thus eliminated a lot of
13092 explicit casts and has made the code clearer. Among the enums
13093 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
13094 mathed enums, some font enum the Debug::type enum.
13096 * src/support/lyxstring.h (clear): missing method. equivalent of
13099 * all files that contained "stderr": rewrote constructs that used
13100 stderr to use lyxerr instead. (except bmtable)
13102 * src/support/DebugStream.h (level): and the passed t with
13103 Debug::ANY to avoid spurious bits set.
13105 * src/debug.h (Debug::type value): made it accept strings of the
13106 type INFO,INIT,KEY.
13108 * configure.in (Check for programs): Added a check for kpsewhich,
13109 the latex generation will use this later to better the dicovery of
13112 * src/BufferView.C (create_view): we don't need to cast this to
13113 (void*) that is done automatically.
13114 (WorkAreaButtonPress): removed some dead code.
13116 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13118 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13119 is not overwritten when translated (David Sua'rez de Lis).
13121 * lib/CREDITS: Added David Sua'rez de Lis
13123 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13125 * src/bufferparams.C (BufferParams): default input encoding is now
13128 * acinclude.m4 (cross_compiling): comment out macro
13129 LYX_GXX_STRENGTH_REDUCE.
13131 * acconfig.h: make sure that const is not defined (to empty) when
13132 we are compiling C++. Remove commented out code using SIZEOF_xx
13135 * configure.in : move the test for const and inline as late as
13136 possible so that these C tests do not interefere with C++ ones.
13137 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13138 has not been proven.
13140 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13142 * src/table.C (getDocBookAlign): remove bad default value for
13143 isColumn parameter.
13145 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13147 (ShowFileMenu2): ditto.
13149 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13150 of files to ignore.
13152 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13154 * Most files: finished the change from the old error code to use
13155 DebugStream for all lyxerr debugging. Only minor changes remain
13156 (e.g. the setting of debug levels using strings instead of number)
13158 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13160 * src/layout.C (Add): Changed to use compare_no_case instead of
13163 * src/FontInfo.C: changed loop variable type too string::size_type.
13165 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13167 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13168 set ETAGS_ARGS to --c++
13170 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13172 * src/table.C (DocBookEndOfCell): commented out two unused variables
13174 * src/paragraph.C: commented out four unused variables.
13176 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13177 insed a if clause with type string::size_type.
13179 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13182 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13184 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13185 variable, also changed loop to go from 0 to lenght + 1, instead of
13186 -1 to length. This should be correct.
13188 * src/LaTeX.C (scanError): use string::size_type as loop variable
13191 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13192 (l.896) since y_tmp and row was not used anyway.
13194 * src/insets/insetref.C (escape): use string::size_type as loop
13197 * src/insets/insetquotes.C (Width): use string::size_type as loop
13199 (Draw): use string::size_type as loop variable type.
13201 * src/insets/insetlatexaccent.C (checkContents): use
13202 string::size_type as loop variable type.
13204 * src/insets/insetlabel.C (escape): use string::size_type as loop
13207 * src/insets/insetinfo.C: added an extern for current_view.
13209 * src/insets/insetcommand.C (scanCommand): use string::size_type
13210 as loop variable type.
13212 * most files: removed the RCS tags. With them we had to recompile
13213 a lot of files after a simple cvs commit. Also we have never used
13214 them for anything meaningful.
13216 * most files: tags-query-replace NULL 0. As adviced several plases
13217 we now use "0" instead of "NULL" in our code.
13219 * src/support/filetools.C (SpaceLess): use string::size_type as
13220 loop variable type.
13222 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13224 * src/paragraph.C: fixed up some more string stuff.
13226 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13228 * src/support/filetools.h: make modestr a std::string.
13230 * src/filetools.C (GetEnv): made ch really const.
13232 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13233 made code that used these use max/min from <algorithm> instead.
13235 * changed several c library include files to their equivalent c++
13236 library include files. All is not changed yet.
13238 * created a support subdir in src, put lyxstring and lstrings
13239 there + the extra files atexit, fileblock, strerror. Created
13240 Makefile.am. edited configure.in and src/Makefile.am to use this
13241 new subdir. More files moved to support.
13243 * imported som of the functions from repository lyx, filetools
13245 * ran tags-query-replace on LString -> string, corrected the bogus
13246 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13247 is still some errors in there. This is errors where too much or
13248 too litle get deleted from strings (string::erase, string::substr,
13249 string::replace), there can also be some off by one errors, or
13250 just plain wrong use of functions from lstrings. Viewing of quotes
13253 * LyX is now running fairly well with string, but there are
13254 certainly some bugs yet (see above) also string is quite different
13255 from LString among others in that it does not allow null pointers
13256 passed in and will abort if it gets any.
13258 * Added the revtex4 files I forgot when setting up the repository.
13260 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13262 * All over: Tried to clean everything up so that only the files
13263 that we really need are included in the cvs repository.
13264 * Switched to use automake.
13265 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13266 * Install has not been checked.
13268 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13270 * po/pt.po: Three errors:
13271 l.533 and l.538 format specification error
13272 l. 402 duplicate entry, I just deleted it.