1 2000-08-14 Allan Rae <rae@lyx.org>
3 * lib/Makefile.am: listerrors cleaning
5 * lib/listerrors: removed -- generated file
7 * sigc++/acinclude.m4: ditto
9 * src/frontends/xforms/forms/form_citation.fd:
10 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
13 * src/frontends/xforms/forms/makefile: I renamed the `install` target
14 `updatesrc` and now we have a `test` target that does what `updatesrc`
15 used to do. I didn't like having an install target that wasn't related
18 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
19 on all except FormGraphics. This may yet happen. Followed by a major
20 cleanup including using FL_TRANSIENT for most of the dialogs. More
21 changes to come when the ButtonController below is introduced.
23 * src/frontends/xforms/ButtonController.h: New file for managing up to
24 four buttons on a dialog according to an externally defined policy.
25 * src/frontends/xforms/Makefile.am: added above
27 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
28 Apply and Cancel/Close buttons and everything in between and beyond.
29 * src/frontends/Makefile.am: added above.
31 * src/frontends/xforms/forms/form_preferences.fd:
32 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
33 and removed variable 'status' as a result. Fixed the set_minsize thing.
34 Use the new screen-font-update after checking screen fonts were changed
35 Added a "Restore" button to restore the original lyxrc values while
36 editing. This restores everything not just the last input changed.
37 That's still a tricky one. As is the "LyX: this shouldn't happen..."
39 * src/LyXAction.C: screen-font-update added for updating buffers after
40 screen font settings have been changed.
41 * src/commandtags.h: ditto
42 * src/lyxfunc.C: ditto
44 * forms/lyx.fd: removed screen fonts dialog.
45 * src/lyx_gui.C: ditto
46 * src/menus.[Ch]: ditto
48 * src/lyx_cb.C: ditto + code from here moved to make screen-font-update.
49 And people wonder why progress on GUII is slow. Look at how scattered
50 this stuff was! It takes forever just find it all.
52 * forms/fdfix.sh: Fixup the spacing after commas.
53 * forms/makefile: Remove date from generated files. Fewer clashes now.
54 * forms/bullet_forms.C.patch: included someones handwritten changes
56 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
57 once I've discovered why LyXRC was made noncopyable.
58 * src/lyx_main.C: ditto
60 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
62 * src/frontends/xforms/forms/fdfix.sh:
63 * src/frontends/xforms/forms/fdfixh.sed:
64 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
65 * src/frontends/xforms/Form*.[hC]:
66 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
67 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
68 provide a destructor for the struct FD_form_xxxx. Another version of
69 the set_[max|min]size workaround and a few other cleanups. Actually,
70 Angus' patch from 20000809.
72 2000-08-13 Baruch Even <baruch.even@writeme.com>
74 * src/insets/insetgraphics.C (Clone): Added several fields that needed
77 2000-08-11 Juergen Vigna <jug@sad.it>
79 * src/insets/insetgraphics.C (InsetGraphics): changing init
80 order because of warnings.
82 * src/frontends/xforms/forms/makefile: adding patching .C with
85 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
86 from .C.patch to .c.patch
88 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
89 order because of warning.
91 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
93 * src/frontends/Liason.C (setMinibuffer): new helper function
95 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
97 * src/lyxfunc.C (Dispatch): calling new Document-Layout
99 * lib/ui/default.ui: commented out PaperLayout entry
101 * src/frontends/xforms/form_document.[Ch]: new added files
103 * src/frontends/xforms/FormDocument.[Ch]: ditto
105 * src/frontends/xforms/forms/form_document.fd: ditto
107 * src/frontends/xforms/forms/form_document.C.patch: ditto
109 2000-08-10 Juergen Vigna <jug@sad.it>
111 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
112 (InsetGraphics): initialized cacheHandle to 0.
113 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
115 2000-08-10 Baruch Even <baruch.even@writeme.com>
117 * src/graphics/GraphicsCache.h:
118 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
119 correctly as a cache.
121 * src/graphics/GraphicsCacheItem.h:
122 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
125 * src/graphics/GraphicsCacheItem_pimpl.h:
126 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
129 * src/insets/insetgraphics.h:
130 * src/insets/insetgraphics.C: Changed from using a signal notification
131 to polling when image is not loaded.
133 2000-08-10 Allan Rae <rae@lyx.org>
135 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
136 that there are two functions that have to been taken out of line by
137 hand and aren't taken care of in the script. (Just a reminder note)
139 * sigc++/macros/*.h.m4: Updated as above.
141 2000-08-09 Juergen Vigna <jug@sad.it>
143 * src/insets/insettext.C (draw): small fix for clearing rectangle.
145 * src/insets/insettabular.C: make drawing of single cell smarter.
147 2000-08-09 Marko Vendelin <markov@ioc.ee>
148 * src/frontends/gnome/Menubar_pimpl.C
149 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
150 implementation: new files
152 * src/frontends/gnome/mainapp.C
153 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
156 * src/main.C: create Gnome main window
158 * src/frontends/xforms/Menubar_pimpl.h
159 * src/frontends/Menubar.C
160 * src/frontends/Menubar.h: added method Menubar::update that calls
161 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
163 * src/LyXView.C: calls Menubar::update to update the state
166 * src/frontends/gnome/Makefile.am: added new files
168 * src/frontends/Makefile.am: added frontend compiler options
170 2000-08-08 Juergen Vigna <jug@sad.it>
172 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
174 * src/bufferlist.C (close):
175 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
176 documents if exiting without saving.
178 * src/buffer.C (save): use removeAutosaveFile()
180 * src/support/filetools.C (removeAutosaveFile): new function.
182 * src/lyx_cb.C (MenuWrite): returns a bool now.
183 (MenuWriteAs): check if file could really be saved and revert to the
185 (MenuWriteAs): removing old autosavefile if existant.
187 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
188 before Goto toggle declaration, because of compiler warning.
190 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
192 * src/lyxfunc.C (MenuNew): small fix.
194 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
196 * src/bufferlist.C (newFile):
197 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
199 * src/lyxrc.C: added new_ask_filename tag
201 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
203 * src/lyx.fd: removed code pertaining to form_ref
204 * src/lyx.[Ch]: ditto
205 * src/lyx_cb.C: ditto
206 * src/lyx_gui.C: ditto
207 * src/lyx_gui_misc.C: ditto
209 * src/BufferView_pimpl.C (restorePosition): update buffer only
212 * src/commandtags.h (LFUN_REFTOGGLE): removed
213 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
214 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
215 (LFUN_REFBACK): renamed LFUN_REF_BACK
217 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
219 * src/lyxfunc.C (Dispatch): ditto.
220 InsertRef dialog is now GUI-independent.
222 * src/texrow.C: added using std::endl;
224 * src/insets/insetref.[Ch]: strip out large amounts of code.
225 The inset is now a container and this functionality is now
226 managed by a new FormRef dialog
228 * src/frontends/Dialogs.h (showRef, createRef): new signals
230 * src/frontends/xforms/FormIndex.[Ch],
231 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
232 when setting dialog's min/max size
233 * src/frontends/xforms/FormIndex.[Ch]: ditto
235 * src/frontends/xforms/FormRef.[Ch],
236 src/frontends/xforms/forms/form_ref.fd: new xforms
237 implementation of an InsetRef dialog
239 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
242 * src/graphics/XPM_Renderer.C (isImageFormatOK):
243 ios::nocreate is not part of the standard. Removed.
245 2000-08-07 Baruch Even <baruch.even@writeme.com>
247 * src/graphics/Renderer.h:
248 * src/graphics/Renderer.C: Added base class for rendering of different
249 image formats into Pixmaps.
251 * src/graphics/XPM_Renderer.h:
252 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
253 in a different class.
255 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
256 easily add support for other formats.
258 * src/insets/figinset.C: plugged a leak of an X resource.
260 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
262 * src/CutAndPaste.[Ch]: make all metods static.
264 * development/Code_rules/Rules: more work, added section on
265 Exceptions, and a References section.
267 * a lot of header files: work to make doc++ able to generate the
268 source documentation, some workarounds of doc++ problems. Doc++ is
269 now able to generate the documentation.
271 2000-08-07 Juergen Vigna <jug@sad.it>
273 * src/insets/insettabular.C (recomputeTextInsets): removed function
275 * src/tabular.C (SetWidthOfMulticolCell):
277 (calculate_width_of_column_NMC): fixed return value so that it really
278 only returns true if the column-width has changed (there where
279 problems with muliticolumn-cells in this column).
281 2000-08-04 Juergen Vigna <jug@sad.it>
283 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
284 also on the scrollstatus of the inset.
285 (workAreaMotionNotify): ditto.
287 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
289 2000-08-01 Juergen Vigna <jug@sad.it>
291 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
294 * src/LyXAction.C (init):
295 * src/insets/inset.C (LocalDispatch): added support for
298 * src/insets/inset.C (scroll): new functions.
300 * src/insets/insettext.C (removeNewlines): new function.
301 (SetAutoBreakRows): removes forced newlines in the text of the
302 paragraph if autoBreakRows is set to false.
304 * src/tabular.C (Latex): generates a parbox around the cell contents
307 * src/frontends/xforms/FormTabular.C (local_update): removed
308 the radio_useparbox button.
310 * src/tabular.C (UseParbox): new function
312 2000-08-06 Baruch Even <baruch.even@writeme.com>
314 * src/graphics/GraphicsCache.h:
315 * src/graphics/GraphicsCache.C:
316 * src/graphics/GraphicsCacheItem.h:
317 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
320 * src/insets/insetgraphics.h:
321 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
322 drawing of the inline image.
324 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
325 into the wrong position.
327 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
330 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
332 * src/support/translator.h: move all typedefs to public section
334 * src/support/filetools.C (MakeLatexName): return string const
337 (FileOpenSearch): ditto
339 (LibFileSearch): ditto
340 (i18nLibFileSearch): ditto
343 (CreateTmpDir): ditto
344 (CreateBufferTmpDir): ditto
345 (CreateLyXTmpDir): ditto
350 (OnlyFilename): ditto
352 (NormalizePath): ditto
354 (GetFileContents): ditto
355 (ReplaceEnvironmentPath): ditto
358 (ChangeExtension): ditto
359 (MakeDisplayPath): ditto
360 (do_popen): return cmdret const
361 (findtexfile): return string const
363 * src/support/DebugStream.h: add some /// to please doc++
365 * src/frontends/DialogBase.h (endif): add some /// to please doc++
367 * src/texrow.C (same_rownumber): functor to use with find_if
368 (getIdFromRow): rewritten to use find_if and to not update the
369 positions. return true if row is found
370 (increasePos): new method, use to update positions
372 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
374 * src/lyxlex_pimpl.C (verifyTable): new method
377 (GetString): return string const
378 (pushTable): rewrite to use std::stack
380 (setFile): better check
383 * src/lyxlex.h: make LyXLex noncopyable
385 * src/lyxlex.C (text): return char const * const
386 (GetString): return string const
387 (getLongString): return string const
389 * src/lyx_gui_misc.C (askForText): return pair<...> const
391 * src/lastfiles.[Ch] (operator): return string const
393 * src/buffer.C (parseSingleLyXformat2Token): pass string to
394 istringstream not char const *.
395 move token.end() out of loop.
396 (readFile): move initializaton of token
398 * src/BufferView2.C (insertErrors): run texrow.increasePos if
399 getIdFromRow is successful.
401 * lib/bind/emacs.bind: don't include menus bind
403 * development/Code_rules/Rules: the beginnings of making this
404 better and covering more of the unwritten rules that we have.
406 * development/Code_rules/Recommendations: a couple of wording
409 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
411 * src/support/strerror.c: remove C++ comment.
413 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
415 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
416 LFUN_INDEX_INSERT_LAST
418 * src/texrow.C (getIdFromRow): changed from const_iterator to
419 iterator, allowing code to compile with DEC cxx
421 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
422 stores part of the class, as suggested by Allan. Will allow
424 (apply): test to apply uses InsetCommandParams operator!=
426 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
427 (apply): test to apply uses InsetCommandParams operator!=
429 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
430 stores part of the class.
431 (update): removed limits on min/max size.
433 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
434 (apply): test to apply uses InsetCommandParams operator!=
436 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
437 (Read, Write, scanCommand, getCommand): moved functionality
438 into InsetCommandParams.
440 (getScreenLabel): made pure virtual
441 new InsetCommandParams operators== and !=
443 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
444 c-tors based on InsetCommandParams. Removed others.
445 * src/insets/insetinclude.[Ch]: ditto
446 * src/insets/insetlabel.[Ch]: ditto
447 * src/insets/insetparent.[Ch]: ditto
448 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
450 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
451 insets derived from InsetCommand created using similar c-tors
452 based on InsetCommandParams
453 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
454 * src/menus.C (ShowRefsMenu): ditto
455 * src/paragraph.C (Clone): ditto
456 * src/text2.C (SetCounter): ditto
457 * src/lyxfunc.C (Dispatch) ditto
458 Also recreated old InsetIndex behaviour exactly. Can now
459 index-insert at the start of a paragraph and index-insert-last
460 without launching the pop-up.
462 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
464 * lib/lyxrc.example: mark te pdf options as non functional.
466 * src/support/lstrings.C (strToInt): move initalization of tmpstr
467 (isStrDbl): move tmpstr.end() out of loop.
468 (strToDbl): move intialization of tmpstr
469 (lowercase): return string const and move tmp.end() out of loop.
470 (uppercase): return string const and move tmp.edn() out of loop.
471 (prefixIs): add assertion
476 (containsOnly): ditto
477 (containsOnly): ditto
478 (containsOnly): ditto
479 (countChar): make last arg char not char const
480 (token): return string const
481 (subst): return string const, move tmp.end() out of loop.
482 (subst): return string const, add assertion
483 (strip): return string const
484 (frontStrip): return string const, add assertion
485 (frontStrip): return string const
490 * src/support/lstrings.C: add inclde "LAssert.h"
491 (isStrInt): move tmpstr.end() out of loop.
493 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
494 toollist.end() out of loop.
495 (deactivate): move toollist.end() out of loop.
496 (update): move toollist.end() out of loop.
497 (updateLayoutList): move tc.end() out of loop.
498 (add): move toollist.end() out of loop.
500 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
501 md.end() out of loop.
503 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
505 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
508 * src/paragraph.C (Erase): move fontlist.end() out of loop.
509 (Erase): move insetlist.end() out of loop.
511 * src/lyx_sendfax_main.C: make show_logfile static and to take a
512 ref to const string as first arg. Move initialization of some
513 variables, whitespace changes.
515 * src/kbmap.C (defkey): move table.end() out of loop.
516 (kb_keymap): move table.end() out of loop.
517 (findbinding): move table.end() out of loop.
519 * src/MenuBackend.C (hasMenu): move end() out of loop.
520 (getMenu): move end() out of loop.
521 (getMenu): move menulist_.end() out of loop.
523 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
525 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
528 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
529 (getFromLyXName): move infotab.end() out of loop.
531 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
532 -fvtable-thunks -ffunction-sections -fdata-sections
534 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
536 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
539 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
541 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
543 * src/frontends/xforms/FormCitation.[Ch],
544 src/frontends/xforms/FormIndex.[Ch],
545 src/frontends/xforms/FormToc.[Ch],
546 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
548 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
550 * src/commandtags.h: renamed, created some flags for citation
553 * src/lyx_gui_misc.C: stripped out old FD_index_form code
555 * src/lyxfunc.C (dispatch): use signals to insert index entry
557 * src/frontends/Dialogs.h: new signal createIndex
559 * src/frontends/xforms/FormCommand.[Ch],
560 src/frontends/xforms/FormCitation.[Ch],
561 src/frontends/xforms/FormToc.[Ch],
562 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
564 * src/insets/insetindex.[Ch]: GUI-independent
566 * src/frontends/xforms/FormIndex.[Ch],
567 * src/frontends/xforms/forms/form_index.fd: xforms implementation
570 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
572 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
573 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
575 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
577 * src/insets/insetref.C (Latex): rewrite so that there is now
578 question that a initialization is requested.
580 * src/insets/insetcommand.h: reenable the hide signal
582 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
584 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
585 fix handling of shortcuts (many bugs :)
586 (add_lastfiles): ditto.
588 * lib/ui/default.ui: fix a few shortcuts.
590 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
592 * Makefile.am: Fix ``rpmdist'' target to return the exit
593 status of the ``rpm'' command, instead of the last command in
594 the chain (the ``rm lyx.xpm'' command, which always returns
597 2000-08-02 Allan Rae <rae@lyx.org>
599 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
600 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
601 * src/frontends/xforms/FormToc.C (FormToc): ditto
603 * src/frontends/xforms/Makefile.am: A few forgotten files
605 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
606 Signals-not-copyable-problem Lars' started commenting out.
608 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
610 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
612 * src/insets/insetcommand.h: Signals is not copyable so anoter
613 scheme for automatic hiding of forms must be used.
615 * src/frontends/xforms/FormCitation.h: don't inerit from
616 noncopyable, FormCommand already does that.
617 * src/frontends/xforms/FormToc.h: ditto
618 * src/frontends/xforms/FormUrl.h: ditto
620 * src/frontends/xforms/FormCitation.C: add include <algorithm>
622 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
624 * src/insets/insetcommand.h (hide): new SigC::Signal0
625 (d-tor) new virtual destructor emits hide signal
627 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
628 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
630 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
631 LOF and LOT. Inset is now GUI-independent
633 * src/insets/insetloa.[Ch]: redundant
634 * src/insets/insetlof.[Ch]: ditto
635 * src/insets/insetlot.[Ch]: ditto
637 * src/frontends/xforms/forms/form_url.fd: tweaked!
638 * src/frontends/xforms/forms/form_citation.fd: ditto
640 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
641 dialogs dealing with InsetCommand insets
643 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
644 FormCommand base class
645 * src/frontends/xforms/FormUrl.[Ch]: ditto
647 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
649 * src/frontends/xforms/FormToc.[Ch]: ditto
651 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
652 passed a generic InsetCommand pointer
653 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
655 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
656 and modified InsetTOC class
657 * src/buffer.C: ditto
659 * forms/lyx.fd: strip out old FD_form_toc code
660 * src/lyx_gui_misc.C: ditto
661 * src/lyx_gui.C: ditto
662 * src/lyx_cb.C: ditto
663 * src/lyx.[Ch]: ditto
665 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
667 * src/support/utility.hpp: tr -d '\r'
669 2000-08-01 Juergen Vigna <jug@sad.it>
671 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
674 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
675 LFUN_TABULAR_FEATURES.
677 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
680 * src/insets/insettabular.C (getStatus): implemented helper function.
682 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
684 2000-07-31 Juergen Vigna <jug@sad.it>
686 * src/text.C (draw): fixed screen update problem for text-insets.
688 * src/text2.C (SetParagrpah): call an update of the inset-owner when
689 something changed probably this has to be added in various other
692 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
694 2000-07-31 Baruch Even <baruch.even@writeme.com>
696 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
697 templates to satisfy compaq cxx.
700 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
702 * src/support/translator.h (equal_1st_in_pair::operator()): take
703 const ref pair_type as arg.
704 (equal_2nd_in_pair::operator()): ditto
705 (Translator::~Translator): remove empty d-tor.
707 * src/graphics/GraphicsCache.C: move include config.h to top, also
708 put initialization of GraphicsCache::singleton here.
709 (~GraphicsCache): move here
710 (addFile): take const ref as arg
713 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
715 * src/BufferView2.C (insertLyXFile): change te with/without header
718 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
720 * src/frontends/xforms/FormGraphics.C (apply): add some
721 static_cast. Not very nice, but required by compaq cxx.
723 * src/frontends/xforms/RadioButtonGroup.h: include header
724 <utility> instead of <pair.h>
726 * src/insets/insetgraphicsParams.C: add using directive.
727 (readResize): change return type to void.
730 * src/lyxfunc.C (getStatus): add missing break for build-program
731 function; add test for Literate for export functions.
733 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
734 entries in Options menu.
736 2000-07-31 Baruch Even <baruch.even@writeme.com>
738 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
739 protect against auto-allocation; release icon when needed.
741 2000-07-31 Matej Cepl <CeplM@seznam.cz>
743 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
746 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
747 earlier czech.kmap), useful only for programming.
749 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
751 * src/frontends/xforms/FormCitation.h: fix conditioning around
754 2000-07-31 Juergen Vigna <jug@sad.it>
756 * src/frontends/xforms/FormTabular.C (local_update): changed
757 radio_linebreaks to radio_useparbox and added radio_useminipage.
759 * src/tabular.C: made support for using minipages/parboxes.
761 * src/bufferlist.C (QwriteAll): small fix for asking for save.
763 * src/insets/insetgraphics.C (draw): just draw the inset so that the
765 (descent): so the cursor is in the middle.
766 (width): bit smaller box.
768 * src/insets/insetgraphics.h: added display() function.
770 2000-07-31 Baruch Even <baruch.even@writeme.com>
772 * src/frontends/Dialogs.h: Added showGraphics signals.
774 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
775 xforms form definition of the graphics dialog.
777 * src/frontends/xforms/FormGraphics.h:
778 * src/frontends/xforms/FormGraphics.C: Added files, the
779 GUIndependent code of InsetGraphics
781 * src/insets/insetgraphics.h:
782 * src/insets/insetgraphics.C: Major writing to make it work.
784 * src/insets/insetgraphicsParams.h:
785 * src/insets/insetgraphicsParams.C: Added files, parameter passing
786 struct between InsetGraphics and GUI.
788 * src/LaTeXFeatures.h:
789 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
790 support for graphicx package.
792 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
793 for the graphics inset.
795 * src/support/translator.h: Added file, used in
796 InsetGraphicsParams. this is a template to translate between two
799 * src/frontends/xforms/RadioButtonGroup.h:
800 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
801 way to easily control a radio button group.
803 2000-07-28 Juergen Vigna <jug@sad.it>
805 * src/insets/insettabular.C (LocalDispatch):
806 (TabularFeatures): added support for lyx-functions of tabular features.
807 (cellstart): refixed this function after someone wrongly changed it.
810 * src/LyXAction.C (init): added support for tabular-features
812 2000-07-28 Allan Rae <rae@lyx.org>
814 * src/frontends/xforms/FormPreferences.C (build): Setup input return
815 checking. NOTE: It seems that pressing ESC to cancel the dialog also
816 triggers the callback for input checking. As a result we sometimes get
817 "LyX: This shouldn't happen..." printed to cerr.
818 (input): Started using status variable since I only free() on
819 destruction. Some input checking for paths and font sizes.
821 * src/frontends/xforms/FormPreferences.h: Use status to control
822 activation of Ok and Apply
824 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
825 callback. Also resized to stop segfaults with 0.88. The problem is
826 that xforms-0.88 requires the folder to be wide enough to fit all the
827 tabs. If it isn't it causes all sorts of problems.
829 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
831 * src/frontends/xforms/forms/README: Reflect reality.
833 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
834 * src/frontends/xforms/forms/makefile: ditto.
836 * src/commandtags.h: Get access to new Preferences dialog
837 * src/LyXAction.C: ditto
838 * src/lyxfunc.C: ditto
839 * lib/ui/default.ui: ditto
841 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
843 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
845 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
848 * src/frontends/xforms/form_url.[Ch]: added.
850 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
852 * src/insets/insetbib.h: fixed bug in previous commit
854 * src/frontends/xforms/FormUrl.h: ditto
856 * src/frontends/xforms/FormPrint.h: ditto
858 * src/frontends/xforms/FormPreferences.h: ditto
860 * src/frontends/xforms/FormCopyright.h: ditto
862 * src/frontends/xforms/FormCitation.C: ditto
864 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
865 private copyconstructor and private default contructor
867 * src/support/Makefile.am: add utility.hpp
869 * src/support/utility.hpp: new file from boost
871 * src/insets/insetbib.h: set owner in clone
873 * src/frontends/xforms/FormCitation.C: added missing include
876 * src/insets/form_url.[Ch]: removed
878 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
880 * development/lyx.spec.in
881 * Makefile.am: Fix buglet for LyX RPM generation resulting from
882 file/directory re-organization.
884 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
886 * src/insets/insetcommand.[Ch]: moved the string data and
887 associated manipulation methods into a new stand-alone class
888 InsetCommandParams. This class has two additional methods
889 getAsString() and setFromString() allowing the contents to be
890 moved around as a single string.
891 (addContents) method removed.
892 (setContents) method no longer virtual.
894 * src/buffer.C (readInset): made use of new InsetCitation,
895 InsetUrl constructors based on InsetCommandParams.
897 * src/commandtags.h: add LFUN_INSERT_URL
899 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
900 independent InsetUrl and use InsetCommandParams to extract
901 string info and create new Insets.
903 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
905 * src/frontends/xforms/FormCitation.C (apply): uses
908 * src/frontends/xforms/form_url.C
909 * src/frontends/xforms/form_url.h
910 * src/frontends/xforms/FormUrl.h
911 * src/frontends/xforms/FormUrl.C
912 * src/frontends/xforms/forms/form_url.fd: new files
914 * src/insets/insetcite.[Ch]: removed unused constructors.
916 * src/insets/insetinclude.[Ch]: no longer store filename
918 * src/insets/inseturl.[Ch]: GUI-independent.
920 2000-07-26 Juergen Vigna <jug@sad.it>
921 * renamed frontend from gtk to gnome as it is that what is realized
922 and did the necessary changes in the files.
924 2000-07-26 Marko Vendelin <markov@ioc.ee>
926 * configure.in: cleaning up gnome configuration scripts
928 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
930 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
931 shortcuts syndrom by redrawing them explicitely (a better solution
932 would be appreciated).
934 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
936 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
939 * src/lyx_cb.C (MenuExport): change html export to do the right
940 thing depending of the document type (instead of having
941 html-linuxdoc and html-docbook).
942 * src/lyxfunc.C (getStatus): update for html
943 * lib/ui/default.ui: simplify due to the above change.
944 * src/menus.C (ShowFileMenu): update too (in case we need it).
946 * src/MenuBackend.C (read): if a menu is defined twice, add the
947 new entries to the exiting one.
949 2000-07-26 Juergen Vigna <jug@sad.it>
951 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
953 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
954 and return a bool if it did actual save the file.
955 (AutoSave): don't autosave a unnamed doc.
957 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
958 check if this is an UNNAMED new file and react to it.
959 (newFile): set buffer to unnamed and change to not mark a new
960 buffer dirty if I didn't do anything with it.
962 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
964 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
966 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
967 friend as per Angus's patch posted to lyx-devel.
969 * src/ext_l10n.h: updated
971 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
972 gettext on the style string right before inserting them into the
975 * autogen.sh: add code to extract style strings form layout files,
978 * src/frontends/gtk/.cvsignore: add MAKEFILE
980 * src/MenuBackend.C (read): run the label strings through gettext
981 before storing them in the containers.
983 * src/ext_l10n.h: new file
985 * autogen.sh : generate the ext_l10n.h file here
987 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
989 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
992 * lib/ui/default.ui: fix a couple of typos.
994 * config/gnome/gtk.m4: added (and added to the list of files in
997 * src/insets/insetinclude.C (unique_id): fix when we are using
998 lyxstring instead of basic_string<>.
999 * src/insets/insettext.C (LocalDispatch): ditto.
1000 * src/support/filetools.C: ditto.
1002 * lib/configure.m4: create the ui/ directory if necessary.
1004 * src/LyXView.[Ch] (updateToolbar): new method.
1006 * src/BufferView_pimpl.C (buffer): update the toolbar when
1007 opening/closing buffer.
1009 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1011 * src/LyXAction.C (getActionName): enhance to return also the name
1012 and options of pseudo-actions.
1013 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1015 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1016 as an example of what is possible). Used in File->Build too (more
1017 useful) and in the import/export menus (to mimick the complicated
1018 handling of linuxdoc and friends). Try to update all the entries.
1020 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1023 * src/MenuBackend.C (read): Parse the new OptItem tag.
1025 * src/MenuBackend.h: Add a new optional_ data member (used if the
1026 entry should be omitted when the lyxfunc is disabled).
1028 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1029 function, used as a shortcut.
1030 (create_submenu): align correctly the shortcuts on the widest
1033 * src/MenuBackend.h: MenuItem.label() only returns the label of
1034 the menu without shortcut; new method shortcut().
1036 2000-07-14 Marko Vendelin <markov@ioc.ee>
1038 * src/frontends/gtk/Dialogs.C:
1039 * src/frontends/gtk/FormCopyright.C:
1040 * src/frontends/gtk/FormCopyright.h:
1041 * src/frontends/gtk/Makefile.am: added these source-files for the
1042 Gtk/Gnome support of the Copyright-Dialog.
1044 * src/main.C: added Gnome::Main initialization if using
1045 Gtk/Gnome frontend-GUI.
1047 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1049 * config/gnome/aclocal-include.m4
1050 * config/gnome/compiler-flags.m4
1051 * config/gnome/curses.m4
1052 * config/gnome/gnome--.m4
1053 * config/gnome/gnome-bonobo-check.m4
1054 * config/gnome/gnome-common.m4
1055 * config/gnome/gnome-fileutils.m4
1056 * config/gnome/gnome-ghttp-check.m4
1057 * config/gnome/gnome-gnorba-check.m4
1058 * config/gnome/gnome-guile-checks.m4
1059 * config/gnome/gnome-libgtop-check.m4
1060 * config/gnome/gnome-objc-checks.m4
1061 * config/gnome/gnome-orbit-check.m4
1062 * config/gnome/gnome-print-check.m4
1063 * config/gnome/gnome-pthread-check.m4
1064 * config/gnome/gnome-support.m4
1065 * config/gnome/gnome-undelfs.m4
1066 * config/gnome/gnome-vfs.m4
1067 * config/gnome/gnome-x-checks.m4
1068 * config/gnome/gnome-xml-check.m4
1069 * config/gnome/gnome.m4
1070 * config/gnome/gperf-check.m4
1071 * config/gnome/gtk--.m4
1072 * config/gnome/linger.m4
1073 * config/gnome/need-declaration.m4: added configuration scripts
1074 for Gtk/Gnome frontend-GUI
1076 * configure.in: added support for the --with-frontend=gtk option
1078 * autogen.sh: added config/gnome/* to list of config-files
1080 * acconfig.h: added define for GTKGUI-support
1082 * config/lyxinclude.m4: added --with-frontend[=value] option value
1083 for Gtk/Gnome frontend-GUI support.
1085 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1087 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1091 * src/paragraph.C (GetChar): remove non-const version
1093 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1094 (search_kw): use it.
1096 * src/lyx_main.C (init): if "preferences" exist, read that instead
1098 (ReadRcFile): return bool if the file could be read ok.
1099 (ReadUIFile): add a check to see if lex file is set ok.
1101 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1102 bastring can be used instead of lyxstring (still uses the old code
1103 if std::string is good enough or if lyxstring is used.)
1105 * src/encoding.C: make the arrays static, move ininle functions
1107 * src/encoding.h: from here.
1109 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1110 (parseSingleLyXformat2Token): move inset parsing to separate method
1111 (readInset): new private method
1113 * src/Variables.h: remove virtual from get().
1115 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1116 access to NEW_INSETS and NEW_TABULAR
1118 * src/MenuBackend.h: remove superfluous forward declaration of
1119 MenuItem. Add documentations tags "///", remove empty MenuItem
1120 destructor, remove private default contructor.
1122 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1124 (read): more string mlabel and mname to where they are used
1125 (read): remove unused variables mlabel and mname
1126 (defaults): unconditional clear, make menusetup take advantage of
1127 add returning Menu &.
1129 * src/LyXView.h: define NEW_MENUBAR as default
1131 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1132 to NEW_INSETS and NEW_TABULAR.
1133 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1134 defined. Change some of the "xxxx-inset-insert" functions names to
1137 * several files: more enahncements to NEW_INSETS and the resulting
1140 * lib/lyxrc.example (\date_insert_format): move to misc section
1142 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1143 bastring and use AC_CACHE_CHECK.
1144 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1145 the system have the newest methods. uses AC_CACHE_CHECK
1146 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1147 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1148 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1150 * configure.in: add LYX_CXX_GOOD_STD_STRING
1152 * acinclude.m4: recreated
1154 2000-07-24 Amir Karger
1156 * README: add Hebrew, Arabic kmaps
1159 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1161 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1164 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1166 * Lot of files: add pragma interface/implementation.
1168 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1170 * lib/ui/default.ui: new file (ans new directory). Contains the
1171 default menu and toolbar.
1173 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1174 global space. Toolbars are now read (as menus) in ui files.
1176 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1178 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1179 is disabled because the document is read-only. We want to have the
1180 toggle state of the function anyway.
1181 (getStatus): add code for LFUN_VC* functions (mimicking what is
1182 done in old-style menus)
1184 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1185 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1187 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1188 * src/BufferView_pimpl.C: ditto.
1189 * src/lyxfunc.C: ditto.
1191 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1192 default). This replaces old-style menus by new ones.
1194 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1195 MenuItem. Contain the data structure of a menu.
1197 * src/insets/insettext.C: use LyXView::setLayout instead of
1198 accessing directly the toolbar combox.
1199 * src/lyxfunc.C (Dispatch): ditto.
1201 * src/LyXView.C (setLayout): new method, which just calls
1202 Toolbar::setLayout().
1203 (updateLayoutChoice): move part of this method in Toolbar.
1205 * src/toolbar.[Ch]: removed.
1207 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1208 implementation the toolbar.
1210 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1211 the toolbar. It might make sense to merge it with ToolbarDefaults
1213 (setLayout): new function.
1214 (updateLayoutList): ditto.
1215 (openLayoutList): ditto.
1217 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1218 xforms implementation of the toolbar.
1219 (get_toolbar_func): comment out, since I do not
1220 know what it is good for.
1222 * src/ToolbarDefaults.h: Add the ItemType enum.
1224 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1225 for a list of allocated C strings. Used in Menubar xforms
1226 implementation to avoid memory leaks.
1228 * src/support/lstrings.[Ch] (uppercase): new version taking and
1232 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1233 * lib/bind/emacs.bind: ditto.
1235 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1237 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1238 forward decl of LyXView.
1240 * src/toolbar.C (toolbarItem): moved from toolbar.h
1241 (toolbarItem::clean): ditto
1242 (toolbarItem::~toolbarItem): ditto
1243 (toolbarItem::operator): ditto
1245 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1247 * src/paragraph.h: control the NEW_TABULAR define from here
1249 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1250 USE_TABULAR_INSETS to NEW_TABULAR
1252 * src/ToolbarDefaults.C: add include "lyxlex.h"
1254 * files using the old table/tabular: use NEW_TABULAR to control
1255 compilation of old tabular stuff.
1257 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1260 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1261 planemet in reading of old style floats, fix the \end_deeper
1262 problem when reading old style floats.
1264 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1266 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1268 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1270 * lib/bind/sciword.bind: updated.
1272 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1274 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1275 layout write problem
1277 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1279 * src/Makefile.am (INCLUDES): remove image directory from include
1282 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1283 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1285 * src/LyXView.C (create_form_form_main): read the application icon
1288 * lib/images/*.xpm: change the icons to use transparent color for
1291 * src/toolbar.C (update): change the color of the button when it
1294 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1296 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1297 setting explicitely the minibuffer.
1298 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1300 * src/LyXView.C (showState): new function. Shows font information
1301 in minibuffer and update toolbar state.
1302 (LyXView): call Toolbar::update after creating the
1305 * src/toolbar.C: change toollist to be a vector instead of a
1307 (BubbleTimerCB): get help string directly from the callback
1308 argument of the corresponding icon (which is the action)
1309 (set): remove unnecessary ugliness.
1310 (update): new function. update the icons (depressed, disabled)
1311 depending of the status of the corresponding action.
1313 * src/toolbar.h: remove help in toolbarItem
1315 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1317 * src/Painter.C (text): Added code for using symbol glyphs from
1318 iso10646 fonts. Currently diabled.
1320 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1323 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1324 magyar,turkish and usorbian.
1326 * src/paragraph.C (isMultiLingual): Made more efficient.
1328 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1331 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1332 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1333 Also changed the prototype to "bool math_insert_greek(char)".
1335 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1337 * lots of files: apply the NEW_INSETS on all code that will not be
1338 needed when we move to use the new insets. Enable the define in
1339 lyxparagrah.h to try it.
1341 * src/insets/insettabular.C (cellstart): change to be a static
1343 (InsetTabular): initialize buffer in the initializer list.
1345 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1347 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1348 form_print.h out of the header file. Replaced with forward
1349 declarations of the relevant struct.
1351 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1354 * src/commandtags.h: do not include "debug.h" which does not
1355 belong there. #include it in some other places because of this
1358 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1360 * src/insets/insetcaption.C: add a couple "using" directives.
1362 * src/toolbar.C (add): get the help text directly from lyxaction.
1364 (setPixmap): new function. Loads from disk and sets a pixmap on a
1365 botton; the name of the pixmap file is derived from the command
1368 * src/toolbar.h: remove members isBitmap and pixmap from
1371 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1372 * lib/images/: move many files from images/banner.xpm.
1374 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1376 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1377 * src/toolbar.C: ditto.
1378 * configure.in: ditto.
1379 * INSTALL: document.
1381 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1382 the spellchecker popup is closed from the WM.
1384 2000-07-19 Juergen Vigna <jug@sad.it>
1386 * src/insets/insetfloat.C (Write): small fix because we use the
1387 insetname for the type now!
1389 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1391 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1394 * src/frontends/Dialogs.h: removed hideCitation signal
1396 * src/insets/insetcite.h: added hide signal
1398 * src/insets/insetcite.C (~InsetCitation): emits new signal
1399 (getScreenLabel): "intelligent" label should now fit on the screen!
1401 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1403 * src/frontends/xforms/FormCitation.C (showInset): connects
1404 hide() to the inset's hide signal
1405 (show): modified to use fl_set_object_position rather than
1406 fl_set_object_geometry wherever possible
1408 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1410 * src/insets/lyxinset.h: add caption code
1412 * src/insets/insetfloat.C (type): new method
1414 * src/insets/insetcaption.C (Write): new method
1416 (LyxCode): new method
1418 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1419 to get it right together with using the FloatList.
1421 * src/commandtags.h: add LFUN_INSET_CAPTION
1422 * src/lyxfunc.C (Dispatch): handle it
1424 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1427 * src/Variables.[Ch]: make expand take a const reference, remove
1428 the destructor, some whitespace changes.
1430 * src/LyXAction.C (init): add caption-inset-insert
1432 * src/FloatList.C (FloatList): update the default floats a bit.
1434 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1436 * src/Variables.[Ch]: new files. Intended to be used for language
1437 specific strings (like \chaptername) and filename substitution in
1440 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1442 * lib/kbd/american.kmap: update
1444 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1446 * src/bufferparams.[Ch]: remove member allowAccents.
1448 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1450 * src/LaTeXLog.C: use the log_form.h header.
1451 * src/lyx_gui.C: ditto.
1452 * src/lyx_gui_misc.C: ditto.
1453 * src/lyxvc.h: ditto.
1455 * forms/log_form.fd: new file, created from latexoptions.fd. I
1456 kept the log popup and nuked the options form.
1458 * src/{la,}texoptions.[Ch]: removed.
1459 * src/lyx_cb.C (LaTeXOptions): ditto
1461 * src/lyx_gui.C (create_forms): do not handle the
1462 fd_latex_options form.
1464 2000-07-18 Juergen Vigna <jug@sad.it>
1466 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1467 name of the inset so that it can be requested outside (text2.C).
1469 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1472 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1474 * src/mathed/formula.h (ConvertFont): constify
1476 * src/mathed/formula.C (Read): add warning if \end_inset is not
1477 found on expected place.
1479 * src/insets/lyxinset.h (ConvertFont): consify
1481 * src/insets/insetquotes.C (ConvertFont): constify
1482 * src/insets/insetquotes.h: ditto
1484 * src/insets/insetinfo.h: add labelfont
1486 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1487 (ascent): use labelfont
1491 (Write): make .lyx file a bit nicer
1493 * src/insets/insetfloat.C (Write): simplify somewhat...
1494 (Read): add warning if arg is not found
1496 * src/insets/insetcollapsable.C: add using std::max
1497 (Read): move string token and add warning in arg is not found
1498 (draw): use std::max to get the right ty
1499 (getMaxWidth): simplify by using std::max
1501 * src/insets/insetsection.h: new file
1502 * src/insets/insetsection.C: new file
1503 * src/insets/insetcaption.h: new file
1504 * src/insets/insetcaption.C: new file
1506 * src/insets/inset.C (ConvertFont): constify signature
1508 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1509 insetcaption.[Ch] and insetsection.[Ch]
1511 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1512 uses to use LABEL_COUNTER_CHAPTER instead.
1513 * src/text2.C (SetCounter): here
1515 * src/counters.h: new file
1516 * src/counters.C: new file
1517 * src/Sectioning.h: new file
1518 * src/Sectioning.C: new file
1520 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1522 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1524 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1527 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1530 2000-07-17 Juergen Vigna <jug@sad.it>
1532 * src/tabular.C (Validate): check if array-package is needed.
1533 (SetVAlignment): added support for vertical alignment.
1534 (SetLTFoot): better support for longtable header/footers
1535 (Latex): modified to support added features.
1537 * src/LaTeXFeatures.[Ch]: added array-package.
1539 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1541 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1544 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1546 * configure.in: do not forget to put a space after -isystem.
1548 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1550 * lib/kbd/arabic.kmap: a few fixes.
1552 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1554 * some whitespace chagnes to a number of files.
1556 * src/support/DebugStream.h: change to make it easier for
1557 doc++ to parse correctly.
1558 * src/support/lyxstring.h: ditto
1560 * src/mathed/math_utils.C (compara): change to have only one
1562 (MathedLookupBOP): change because of the above.
1564 * src/mathed/math_delim.C (math_deco_compare): change to have only
1566 (search_deco): change becasue of the above.
1568 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1569 instead of manually coded one.
1571 * src/insets/insetquotes.C (Read): read the \end_inset too
1573 * src/insets/insetlatex.h: remove file
1574 * src/insets/insetlatex.C: remove file
1576 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1578 (InsetPrintIndex): remove destructor
1580 * src/insets/insetinclude.h: remove default constructor
1582 * src/insets/insetfloat.C: work to make it work better
1584 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1586 * src/insets/insetcite.h (InsetCitation): remove default constructor
1588 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1590 * src/text.C (GetColumnNearX): comment out some currently unused code.
1592 * src/paragraph.C (writeFile): move some initializations closer to
1594 (CutIntoMinibuffer): small change to use new matchIT operator
1598 (InsertInset): ditto
1601 (InsetIterator): ditto
1602 (Erase): small change to use new matchFT operator
1604 (GetFontSettings): ditto
1605 (HighestFontInRange): ditto
1608 * src/lyxparagraph.h: some chars changed to value_type
1609 (matchIT): because of some stronger checking (perhaps too strong)
1610 in SGI STL, the two operator() unified to one.
1613 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1615 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1616 the last inset read added
1617 (parseSingleLyXformat2Token): some more (future) compability code added
1618 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1619 (parseSingleLyXformat2Token): set last_inset_read
1620 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1621 (parseSingleLyXformat2Token): don't double intializw string next_token
1623 * src/TextCache.C (text_fits::operator()): add const's to the signature
1624 (has_buffer::operator()): ditto
1626 * src/Floating.h: add some comments on the class
1628 * src/FloatList.[Ch] (typeExist): new method
1631 * src/BackStack.h: added default constructor, wanted by Gcc.
1633 2000-07-14 Juergen Vigna <jug@sad.it>
1635 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1637 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1639 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1640 do a redraw when the window is resized!
1641 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1643 * src/insets/insettext.C (resizeLyXText): added function to correctly
1644 being able to resize the LyXWindow.
1646 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1648 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1650 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1651 crashes when closing dialog to a deleted inset.
1653 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1654 method! Now similar to other insets.
1656 2000-07-13 Juergen Vigna <jug@sad.it>
1658 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1660 * lib/examples/Literate.lyx: small patch!
1662 * src/insets/insetbib.C (Read): added this function because of wrong
1663 Write (without [begin|end]_inset).
1665 2000-07-11 Juergen Vigna <jug@sad.it>
1667 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1668 as the insertInset could not be good!
1670 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1671 the bool param should not be last.
1673 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1675 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1676 did submit that to Karl).
1678 * configure.in: use -isystem instead of -I for X headers. This
1679 fixes a problem on solaris with a recent gcc;
1680 put the front-end code after the X detection code;
1681 configure in sigc++ before lib/
1683 * src/lyx_main.C (commandLineHelp): remove -display from command
1686 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
1688 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
1689 Also put in Makefile rules for building the ``listerrors''
1690 program for parsing errors from literate programs written in LyX.
1692 * lib/build-listerrors: Added small shell script as part of compile
1693 process. This builds a working ``listerrors'' binary if noweb is
1694 installed and either 1) the VNC X server is installed on the machine,
1695 or 2) the user is compiling from within a GUI. The existence of a GUI
1696 is necessary to use the ``lyx --export'' feature for now. This
1697 hack can be removed once ``lyx --export'' no longer requires a GUI to
1700 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
1702 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
1703 now passed back correctly from gcc and placed "under" error
1704 buttons in a Literate LyX source.
1706 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1708 * src/text.C (GetColumnNearX): Better behavior when a RTL
1709 paragraph is ended by LTR text.
1711 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
1714 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1716 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
1717 true when clipboard is empty.
1719 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1721 * text.C (Backspace): Prevent rebreaking of a row if it is the last
1722 row of the paragraph.
1723 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
1724 to prevent calculation of bidi tables
1726 2000-07-07 Juergen Vigna <jug@sad.it>
1728 * src/screen.C (ToggleSelection): added y_offset and x_offset
1731 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
1734 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
1736 * src/insets/insettext.C: fixed Layout-Display!
1738 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1740 * configure.in: add check for strings.h header.
1742 * src/spellchecker.C: include <strings.h> in order to have a
1743 definition for bzero().
1745 2000-07-07 Juergen Vigna <jug@sad.it>
1747 * src/insets/insettext.C (draw): set the status of the bv->text to
1748 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
1750 * src/screen.C (DrawOneRow):
1751 (DrawFromTo): redraw the actual row if something has changed in it
1754 * src/text.C (draw): call an update of the toplevel-inset if something
1755 has changed inside while drawing.
1757 * src/lyxtext.h: added CHANGED_IN_DRAW status.
1759 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
1761 * src/insets/insetbib.[Ch] (callback) new method, moving callback
1762 processing inside class.
1764 * src/insets/insetindex.[Ch] (callback) new method, moving callback
1765 processing inside class.
1767 * src/insets/insetindex.h new struct Holder, consistent with other
1770 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
1771 citation dialog from main code and placed it in src/frontends/xforms.
1772 Dialog launched through signals instead of callbacks
1774 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
1776 * lyx.man: update the options description.
1778 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
1780 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
1781 handle neg values, set min width to 590, add doc about -display
1783 2000-07-05 Juergen Vigna <jug@sad.it>
1785 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
1786 calls to BufferView *.
1788 * src/insets/insettext.C (checkAndActivateInset): small fix non
1789 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
1791 * src/insets/insetcommand.C (Read): Fixed as insets should read till
1792 their \end_inset token!
1794 2000-07-04 edscott <edscott@imp.mx>
1796 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
1797 lib/lyxrc.example: added option \wheel_jump
1799 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
1801 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
1802 remove support for -width,-height,-xpos and -ypos.
1804 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
1806 * src/encoding.[Ch]: New files.
1808 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
1809 (text): Call to the underline() method only when needed.
1811 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
1813 * src/buffer.C (makeLaTeXFile): Compute automatically the input
1814 encoding(s) for the document.
1816 * src/bufferparams.C (BufferParams): Changed default value of
1819 * src/language.C (newLang): Removed.
1820 (items[]): Added encoding information for all defined languages.
1822 * src/lyx_gui.C (create_forms): Added "auto" option to the input
1823 encoding choice button.
1825 * src/lyxrc.h (font_norm_type): New member variable.
1826 (set_font_norm_type): New method.
1828 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
1829 paragraphs with different encodings.
1831 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
1832 (TransformChar): Changed to work correctly with Arabic points.
1833 (draw): Added support for drawing Arabic points.
1834 (draw): Removed code for drawing underbars (this is done by
1837 * src/support/textutils.h (IsPrintableNonspace): New function.
1839 * src/BufferView_pimpl.h: Added "using SigC::Object".
1840 * src/LyXView.h: ditto.
1842 * src/insets/insetinclude.h (include_label): Changed to mutable.
1844 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1846 * src/mathed/math_iter.h: remove empty destructor
1848 * src/mathed/math_cursor.h: remove empty destructor
1850 * src/insets/lyxinset.h: add THEOREM_CODE
1852 * src/insets/insettheorem.[Ch]: new files
1854 * src/insets/insetminipage.C: (InsertInset): remove
1856 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
1858 (InsertInset): remove
1860 * src/insets/insetlist.C: (InsertList): remove
1862 * src/insets/insetfootlike.[Ch]: new files
1864 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
1867 (InsertInset): ditto
1869 * src/insets/insetert.C: remove include Painter.h, reindent
1870 (InsertInset): move to header
1872 * src/insets/insetcollapsable.h: remove explicit from default
1873 contructor, remove empty destructor, add InsertInset
1875 * src/insets/insetcollapsable.C (InsertInset): new func
1877 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
1879 * src/vspace.h: add explicit to constructor
1881 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
1882 \textcompwordmark, please test this.
1884 * src/lyxrc.C: set ascii_linelen to 65 by default
1886 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
1888 * src/commandtags.h: add LFUN_INSET_THEOREM
1890 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
1891 (makeLinuxDocFile): remove _some_ of the nice logic
1892 (makeDocBookFile): ditto
1894 * src/Painter.[Ch]: (~Painter): removed
1896 * src/LyXAction.C (init): entry for insettheorem added
1898 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
1900 (deplog): code to detect files generated by LaTeX, needs testing
1903 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1905 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
1907 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1909 * src/LaTeX.C (deplog): Add a check for files that are going to be
1910 created by the first latex run, part of the project to remove the
1913 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
1914 contents to the extension list.
1916 2000-07-04 Juergen Vigna <jug@sad.it>
1918 * src/text.C (NextBreakPoint): added support for needFullRow()
1920 * src/insets/lyxinset.h: added needFullRow()
1922 * src/insets/insetcollapsable.C: redone now this uses a text-inset
1925 * src/insets/insettext.C: lots of changes for update!
1927 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
1929 * src/LaTeXFeatures.h: add a missing std:: qualifier.
1931 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
1933 * src/insets/insetinclude.C (InsetInclude): fixed
1934 initialization of include_label.
1935 (unique_id): now returns a string.
1937 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
1939 * src/LaTeXFeatures.h: new member IncludedFiles, for
1940 a map of key, included file name.
1942 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
1943 with the included files for inclusion in SGML preamble,
1944 i. e., linuxdoc and docbook.
1947 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
1948 nice (is the generated linuxdoc code to be exported?), that
1949 allows to remove column, and only_body that will be true for
1950 slave documents. Insets are allowed inside SGML font type.
1951 New handling of the SGML preamble for included files.
1952 (makeDocBookFile): the same for docbook.
1954 * src/insets/insetinclude.h:
1955 * src/insets/insetinclude.C (Validate): keeps a list of included files.
1957 (DocBook): new export methods.
1959 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
1960 and makeDocBookFile.
1962 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
1963 formats to export with command line argument -x.
1965 2000-06-29 Juergen Vigna <jug@sad.it>
1967 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
1968 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
1970 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
1971 region could already been cleared by an inset!
1973 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
1975 * src/BufferView_pimpl.h: remove member variables lyx_focus and
1978 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
1980 (cursorToggle): remove special handling of lyx focus.
1982 2000-06-28 Juergen Vigna <jug@sad.it>
1984 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
1987 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1989 * src/insets/insetindex.C (Edit): add a callback when popup is
1992 * src/insets/insettext.C (LocalDispatch):
1993 * src/insets/insetmarginal.h:
1994 * src/insets/insetlist.h:
1995 * src/insets/insetfoot.h:
1996 * src/insets/insetfloat.h:
1997 * src/insets/insetert.h: add a missing std:: qualifier.
1999 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2001 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2004 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2006 * src/insets/insettext.C (Read): remove tmptok unused variable
2007 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2008 (InsertInset): change for new InsetInset code
2010 * src/insets/insettext.h: add TEXT inline method
2012 * src/insets/insettext.C: remove TEXT macro
2014 * src/insets/insetmarginal.C (Write): new method
2015 (Latex): change output slightly
2017 * src/insets/insetfoot.C (Write): new method
2018 (Latex): change output slightly (don't use endl when no need)
2020 * src/insets/insetert.C (Write): new method
2022 * src/insets/insetcollapsable.h: make button_length, button_top_y
2023 and button_bottm_y protected.
2025 * src/insets/insetcollapsable.C (Write): simplify code by using
2026 tostr. Also do not output the float name, the children class
2027 should to that to get control over own arguments
2029 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2030 src/insets/insetminipage.[Ch]:
2033 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2035 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2037 * src/Makefile.am (lyx_SOURCES): add the new files
2039 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2040 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2041 * src/commandtags.h: ditto
2043 * src/LaTeXFeatures.h: add a std::set of used floattypes
2045 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2047 * src/FloatList.[Ch] src/Floating.h: new files
2049 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2051 * src/lyx_cb.C (TableApplyCB): ditto
2053 * src/text2.C: ditto
2054 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2055 (parseSingleLyXformat2Token): ditto + add code for
2056 backwards compability for old float styles + add code for new insets
2058 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2060 (InsertInset(size_type, Inset *, LyXFont)): new method
2061 (InsetChar(size_type, char)): changed to use the other InsetChar
2062 with a LyXFont(ALL_INHERIT).
2063 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2064 insert the META_INSET.
2066 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2068 * sigc++/thread.h (Threads): from here
2070 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2071 definition out of line
2072 * sigc++/scope.h: from here
2074 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2076 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2077 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2079 * Makefile.am (bindist): new target.
2081 * INSTALL: add instructions for doing a binary distribution.
2083 * development/tools/README.bin.example: update a bit.
2085 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2088 * lib/lyxrc.example: new lyxrc tag \set_color.
2090 * src/lyxfunc.C (Dispatch):
2091 * src/commandtags.h:
2092 * src/LyXAction.C: new lyxfunc "set-color".
2094 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2095 and an x11name given as strings.
2097 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2098 cache when a color is changed.
2100 2000-06-26 Juergen Vigna <jug@sad.it>
2102 * src/lyxrow.C (width): added this functions and variable.
2104 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2107 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2109 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2111 * images/undo_bw.xpm: new icon.
2112 * images/redo_bw.xpm: ditto.
2114 * configure.in (INSTALL_SCRIPT): change value to
2115 ${INSTALL} to avoid failures of install-script target.
2116 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2118 * src/BufferView.h: add a magic "friend" declaration to please
2121 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2123 * forms/cite.fd: modified to allow resizing without messing
2126 * src/insetcite.C: Uses code from cite.fd almost without
2128 User can now resize dialog in the x-direction.
2129 Resizing the dialog in the y-direction is prevented, as the
2130 code does this intelligently already.
2132 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2134 * INSTALL: remove obsolete entry in "problems" section.
2136 * lib/examples/sl_*.lyx: update of the slovenian examples.
2138 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2140 2000-06-23 Juergen Vigna <jug@sad.it>
2142 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2144 * src/buffer.C (resize): delete the LyXText of textinsets.
2146 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2148 * src/insets/lyxinset.h: added another parameter 'cleared' to
2149 the draw() function.
2151 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2152 unlocking inset in inset.
2154 2000-06-22 Juergen Vigna <jug@sad.it>
2156 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2157 of insets and moved first to LyXText.
2159 * src/mathed/formulamacro.[Ch]:
2160 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2162 2000-06-21 Juergen Vigna <jug@sad.it>
2164 * src/text.C (GetVisibleRow): look if I should clear the area or not
2165 using Inset::doClearArea() function.
2167 * src/insets/lyxinset.h: added doClearArea() function and
2168 modified draw(Painter &, ...) to draw(BufferView *, ...)
2170 * src/text2.C (UpdateInset): return bool insted of int
2172 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2174 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2175 combox in the character popup
2177 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2178 BufferParams const & params
2180 2000-06-20 Juergen Vigna <jug@sad.it>
2182 * src/insets/insettext.C (SetParagraphData): set insetowner on
2185 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2187 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2188 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2190 (form_main_): remove
2192 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2193 (create_form_form_main): remove FD_form_main stuff, connect to
2194 autosave_timeout signal
2196 * src/LyXView.[Ch] (getMainForm): remove
2197 (UpdateTimerCB): remove
2198 * src/BufferView_pimpl.h: inherit from SigC::Object
2200 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2201 signal instead of callback
2203 * src/BufferView.[Ch] (cursorToggleCB): remove
2205 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2207 * src/BufferView_pimpl.C: changes because of the one below
2209 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2210 instead of storing a pointer to a LyXText.
2212 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2214 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2216 * src/lyxparagraph.h
2218 * src/paragraph.C: Changed fontlist to a sorted vector.
2220 2000-06-19 Juergen Vigna <jug@sad.it>
2222 * src/BufferView.h: added screen() function.
2224 * src/insets/insettext.C (LocalDispatch): some selection code
2227 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2229 * src/insets/insettext.C (SetParagraphData):
2231 (InsetText): fixes for multiple paragraphs.
2233 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2235 * development/lyx.spec.in: Call configure with ``--without-warnings''
2236 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2237 This should be fine, however, since we generally don't want to be
2238 verbose when making an RPM.
2240 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2242 * lib/scripts/fig2pstex.py: New file
2244 2000-06-16 Juergen Vigna <jug@sad.it>
2246 * src/insets/insettabular.C (UpdateLocal):
2247 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2248 (LocalDispatch): Changed all functions to use LyXText.
2250 2000-06-15 Juergen Vigna <jug@sad.it>
2252 * src/text.C (SetHeightOfRow): call inset::update before requesting
2255 * src/insets/insettext.C (update):
2256 * src/insets/insettabular.C (update): added implementation
2258 * src/insets/lyxinset.h: added update function
2260 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2262 * src/text.C (SelectNextWord): protect against null pointers with
2263 old-style string streams. (fix from Paul Theo Gonciari
2266 * src/cite.[Ch]: remove erroneous files.
2268 * lib/configure.m4: update the list of created directories.
2270 * src/lyxrow.C: include <config.h>
2271 * src/lyxcursor.C: ditto.
2273 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2275 * lib/examples/decimal.lyx: new example file from Mike.
2277 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2278 to find template definitions (from Dekel)
2280 * src/frontends/.cvsignore: add a few things.
2282 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2284 * src/Timeout.C (TimeOut): remove default argument.
2286 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2289 * src/insets/ExternalTemplate.C: add a "using" directive.
2291 * src/lyx_main.h: remove the act_ struct, which seems unused
2294 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2296 * LyX Developers Meeting: All files changed, due to random C++ (by
2297 coincidence) code generator script.
2299 - external inset (cool!)
2300 - initial online editing of preferences
2301 - insettabular breaks insettext(s contents)
2303 - some DocBook fixes
2304 - example files update
2305 - other cool stuff, create a diff and look for yourself.
2307 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2309 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2310 -1 this is a non-line-breaking textinset.
2312 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2313 if there is no width set.
2315 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2317 * Lots of files: Merged the dialogbase branch.
2319 2000-06-09 Allan Rae <rae@lyx.org>
2321 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2322 and the Dispatch methods that used it.
2324 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2325 access to functions formerly kept in Dispatch.
2327 2000-05-19 Allan Rae <rae@lyx.org>
2329 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2330 made to_page and count_copies integers again. from_page remains a
2331 string however because I want to allow entry of a print range like
2332 "1,4,22-25" using this field.
2334 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2335 and printer-params-get. These aren't useful from the minibuffer but
2336 could be used by a script/LyXServer app provided it passes a suitable
2337 auto_mem_buffer. I guess I should take a look at how the LyXServer
2338 works and make it support xtl buffers.
2340 * sigc++/: updated to libsigc++-1.0.1
2342 * src/xtl/: updated to xtl-1.3.pl.11
2344 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2345 those changes done to the files in src/ are actually recreated when
2346 they get regenerated. Please don't ever accept a patch that changes a
2347 dialog unless that patch includes the changes to the corresponding *.fd
2350 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2351 stringOnlyContains, renamed it and generalised it.
2353 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2354 branch. Removed the remaining old form_print code.
2356 2000-04-26 Allan Rae <rae@lyx.org>
2358 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2359 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2361 2000-04-25 Allan Rae <rae@lyx.org>
2363 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2364 against a base of xtl-1.3.pl.4
2366 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2367 filter the Id: entries so they still show the xtl version number
2370 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2371 into the src/xtl code. Patch still pending with José (XTL)
2373 2000-04-24 Allan Rae <rae@lyx.org>
2375 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2376 both more generic and much safer. Use the new template functions.
2377 * src/buffer.[Ch] (Dispatch): ditto.
2379 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2380 and mem buffer more intelligently. Also a little general cleanup.
2383 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2384 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2385 * src/xtl/Makefile.am: ditto.
2386 * src/xtl/.cvsignore: ditto.
2387 * src/Makefile.am: ditto.
2389 * src/PrinterParams.h: Removed the macros member functions. Added a
2390 testInvariant member function. A bit of tidying up and commenting.
2391 Included Angus's idea for fixing operation with egcs-1.1.2.
2393 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2394 cool expansion of XTL's mem_buffer to support automatic memory
2395 management within the buffer itself. Removed the various macros and
2396 replaced them with template functions that use either auto_mem_buffer
2397 or mem_buffer depending on a #define. The mem_buffer support will
2398 disappear as soon as the auto_mem_buffer is confirmed to be good on
2399 other platforms/compilers. That is, it's there so you've got something
2402 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2403 effectively forked XTL. However I expect José will include my code
2404 into the next major release. Also fixed a memory leak.
2405 * src/xtl/text.h: ditto.
2406 * src/xtl/xdr.h: ditto.
2407 * src/xtl/giop.h: ditto.
2409 2000-04-16 Allan Rae <rae@lyx.org>
2411 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2412 by autogen.sh and removed by maintainer-clean anyway.
2413 * .cvsignore, sigc++/.cvsignore: Support the above.
2415 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2417 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2419 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2420 macros, renamed static callback-target member functions to suit new
2421 scheme and made them public.
2422 * src/frontends/xforms/forms/form_print.fd: ditto.
2423 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2425 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2428 * src/xtl/: New directory containing a minimal distribution of XTL.
2429 This is XTL-1.3.pl.4.
2431 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2433 2000-04-15 Allan Rae <rae@lyx.org>
2435 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2437 * sigc++/: Updated to libsigc++-1.0.0
2439 2000-04-14 Allan Rae <rae@lyx.org>
2441 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2442 use the generic ones in future. I'll modify my conversion script.
2444 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2446 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2447 (CloseAllBufferRelatedDialogs): Renamed.
2448 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2450 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2451 of the generic ones. These are the same ones my conversion script
2454 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2455 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2456 * src/buffer.C (Dispatch): ditto
2458 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2459 functions for updating and hiding buffer dependent dialogs.
2460 * src/BufferView.C (buffer): ditto
2461 * src/buffer.C (setReadonly): ditto
2462 * src/lyxfunc.C (CloseBuffer): ditto
2464 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2465 Dialogs.h, and hence all the SigC stuff, into every file that includes
2466 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2468 * src/BufferView2.C: reduce the number of headers included by buffer.h
2470 2000-04-11 Allan Rae <rae@lyx.org>
2472 * src/frontends/xforms/xform_macros.h: A small collection of macros
2473 for building C callbacks.
2475 * src/frontends/xforms/Makefile.am: Added above file.
2477 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2478 scheme again. This time it should work for JMarc. If this is
2479 successful I'll revise my conversion script to automate some of this.
2480 The static member functions in the class also have to be public for
2481 this scheme will work. If the scheme works (it's almost identical to
2482 the way BufferView::cursorToggleCB is handled so it should work) then
2483 FormCopyright and FormPrint will be ready for inclusion into the main
2484 trunk immediately after 1.1.5 is released -- provided we're prepared
2485 for complaints about lame compilers not handling XTL.
2487 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2489 2000-04-07 Allan Rae <rae@lyx.org>
2491 * config/lyxinclude.m4: A bit more tidying up (Angus)
2493 * src/LString.h: JMarc's <string> header fix
2495 * src/PrinterParams.h: Used string for most data to remove some
2496 ugly code in the Print dialog and avoid even uglier code when
2497 appending the ints to a string for output.
2499 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2500 and moved "default:" back to the end of switch statement. Cleaned
2501 up the printing so it uses the right function calls and so the
2502 "print to file" option actually puts the file in the right directory.
2504 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2506 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2507 and Ok+Apply button control into a separate method: input (Angus).
2508 (input) Cleaned it up and improved it to be very thorough now.
2509 (All CB) static_cast used instead of C style cast (Angus). This will
2510 probably change again once we've worked out how to keep gcc-2.8.1 happy
2511 with real C callbacks.
2512 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2513 ignore some of the bool settings and has random numbers instead. Needs
2514 some more investigation. Added other input length checks and checking
2515 of file and printer names.
2517 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2518 would link (Angus). Seems the old code doesn't compile with the pragma
2519 statement either. Separated callback entries from internal methods.
2521 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2523 2000-03-17 Allan Rae <rae@lyx.org>
2525 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2526 need it? Maybe it could go in Dialogs instead? I could make it a
2527 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2528 values to get the bool return value.
2529 (Dispatch): New overloaded method for xtl support.
2531 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2532 extern "C" callback instead of static member functions. Hopefully,
2533 JMarc will be able to compile this. I haven't changed
2534 forms/form_copyright.fd yet. Breaking one of my own rules already.
2536 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2537 because they aren't useful from the minibuffer. Maybe a LyXServer
2538 might want a help message though?
2540 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2542 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2543 xtl which needs both rtti and exceptions.
2545 * src/support/Makefile.am:
2546 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2548 * src/frontends/xforms/input_validators.[ch]: input filters and
2549 validators. These conrol what keys are valid in input boxes.
2550 Use them and write some more. Much better idea than waiting till
2551 after the user has pressed Ok to say that the input fields don't make
2554 * src/frontends/xforms/Makefile.am:
2555 * src/frontends/xforms/forms/form_print.fd:
2556 * src/frontends/xforms/forms/makefile:
2557 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2558 new scheme. Still have to make sure I haven't missed anything from
2559 the current implementation.
2561 * src/Makefile.am, src/PrinterParams.h: New data store.
2563 * other files: Added a couple of copyright notices.
2565 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2567 * src/insets/insetbib.h: move Holder struct in public space.
2569 * src/frontends/include/DialogBase.h: use SigC:: only when
2570 SIGC_CXX_NAMESPACES is defined.
2571 * src/frontends/include/Dialogs.h: ditto.
2573 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2575 * src/frontends/xforms/FormCopyright.[Ch]: do not
2576 mention SigC:: explicitely.
2578 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2580 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2581 deals with testing KDE in main configure.in
2582 * configure.in: ditto.
2584 2000-02-22 Allan Rae <rae@lyx.org>
2586 * Lots of files: Merged from HEAD
2588 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2589 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2591 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2593 * sigc++/: new minidist.
2595 2000-02-14 Allan Rae <rae@lyx.org>
2597 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2599 2000-02-08 Juergen Vigna <jug@sad.it>
2601 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2602 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2604 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2605 for this port and so it is much easier for other people to port
2606 dialogs in a common development environment.
2608 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2609 the QT/KDE implementation.
2611 * src/frontends/kde/Dialogs.C:
2612 * src/frontends/kde/FormCopyright.C:
2613 * src/frontends/kde/FormCopyright.h:
2614 * src/frontends/kde/Makefile.am:
2615 * src/frontends/kde/formcopyrightdialog.C:
2616 * src/frontends/kde/formcopyrightdialog.h:
2617 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2618 for the kde support of the Copyright-Dialog.
2620 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2621 subdir-substitution instead of hardcoded 'xforms' as we now have also
2624 * src/frontends/include/DialogBase.h (Object): just commented the
2625 label after #endif (nasty warning and I don't like warnings ;)
2627 * src/main.C (main): added KApplication initialization if using
2630 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2631 For now only the KDE event-loop is added if frontend==kde.
2633 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2635 * configure.in: added support for the --with-frontend[=value] option
2637 * autogen.sh: added kde.m4 file to list of config-files
2639 * acconfig.h: added define for KDEGUI-support
2641 * config/kde.m4: added configuration functions for KDE-port
2643 * config/lyxinclude.m4: added --with-frontend[=value] option with
2644 support for xforms and KDE.
2646 2000-02-08 Allan Rae <rae@lyx.org>
2648 * all Makefile.am: Fixed up so the make targets dist, distclean,
2649 install and uninstall all work even if builddir != srcdir. Still
2650 have a new sigc++ minidist update to come.
2652 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2654 2000-02-01 Allan Rae <rae@lyx.org>
2656 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2657 Many mods to get builddir != srcdir working.
2659 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2660 for building on NT and so we can do the builddir != srcdir stuff.
2662 2000-01-30 Allan Rae <rae@lyx.org>
2664 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2665 This will stay in "rae" branch. We probably don't really need it in
2666 the main trunk as anyone who wants to help programming it should get
2667 a full library installed also. So they can check both included and
2668 system supplied library compilation.
2670 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2671 Added a 'mini' distribution of libsigc++. If you feel the urge to
2672 change something in these directories - Resist it. If you can't
2673 resist the urge then you should modify the following script and rebuild
2674 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2675 all happen. Still uses a hacked version of libsigc++'s configure.in.
2676 I'm quite happy with the results. I'm not sure the extra work to turn
2677 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2678 worth the trouble and would probably lead to extra maintenance
2680 I haven't tested the following important make targets: install, dist.
2681 Not ready for prime time but very close. Maybe 1.1.5.
2683 * development/tools/makeLyXsigc.sh: A shell script to automatically
2684 generate our mini-dist of libsigc++. It can only be used with a CVS
2685 checkout of libsigc++ not a tarball distribution. It's well commented.
2686 This will end up as part of the libsigc++ distribution so other apps
2687 can easily have an included mini-dist. If someone makes mods to the
2688 sigc++ subpackage without modifying this script to generate those
2689 changes I'll be very upset!
2691 * src/frontends/: Started the gui/system indep structure.
2693 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
2694 to access the gui-indep dialogs are in this class. Much improved
2695 design compared to previous revision. Lars, please refrain from
2696 moving this header into src/ like you did with Popups.h last time.
2698 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
2700 * src/frontends/xforms/: Started the gui-indep system with a single
2701 dialog: FormCopyright. Initial testing of use of libsigc++ was very
2704 * src/frontends/xforms/forms: Repository for the xforms .fd files.
2705 Here you'll find a very useful makefile and automated fdfix.sh that
2706 makes updating dailogs a no-brainer -- provided you follow the rules
2707 set out in the README. I'm thinking about adding another script to
2708 automatically generate skeleton code for a new dialog given just the
2711 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
2712 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
2713 Made FormCopyright gui-indep and added a lyxfunc to get to it.
2715 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
2717 * src/support/LSubstring.C (operator): simplify
2719 * src/lyxtext.h: removed bparams, use buffer_->params instead
2721 * src/lyxrow.h: make Row a real class, move all variables to
2722 private and use accessors.
2724 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
2726 (isRightToLeftPar): ditto
2727 (ChangeLanguage): ditto
2728 (isMultiLingual): ditto
2731 (SimpleTeXOnePar): ditto
2732 (TeXEnvironment): ditto
2733 (GetEndLabel): ditto
2735 (SetOnlyLayout): ditto
2736 (BreakParagraph): ditto
2737 (BreakParagraphConservative): ditto
2738 (GetFontSettings): ditto
2740 (CopyIntoMinibuffer): ditto
2741 (CutIntoMinibuffer): ditto
2742 (PasteParagraph): ditto
2743 (SetPExtraType): ditto
2744 (UnsetPExtraType): ditto
2745 (DocBookContTableRows): ditto
2746 (SimpleDocBookOneTablePar): ditto
2748 (TeXFootnote): ditto
2749 (SimpleTeXOneTablePar): ditto
2750 (TeXContTableRows): ditto
2751 (SimpleTeXSpecialChars): ditto
2754 * src/lyxcursor.h: make LyXCursor a real class, move all variables
2755 to private and use accessors.
2757 * src/lyx_cb.C: remove char updatetimer, and all code that uses
2758 this, we did not use it anymore and has not been for ages. Just a
2759 waste of cpu cycles.
2761 * src/language.h: make Language a real class, move all variables
2762 to private and use accessors.
2764 * src/BufferView_pimpl.C (Pimpl): use new timer code.
2765 (create_view): remove
2766 (update): some changes for new timer
2767 (cursorToggle): use new timer
2768 (beforeChange): change for new timer
2770 * src/BufferView.h (cursorToggleCB): removed last paramter because
2773 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
2774 (cursorToggleCB): change because of new timer code
2776 * lib/CREDITS: updated own mailaddress
2778 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2780 * src/support/filetools.C (PutEnv): fix the code in case neither
2781 putenv() nor setenv() have been found.
2783 * INSTALL: mention the install-strip Makefile target.
2785 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
2786 read-only documents.
2788 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2790 * lib/reLyX/configure.in (VERSION): avoid using a previously
2791 generated reLyX wrapper to find out $prefix.
2793 * lib/examples/eu_adibide_lyx-atua.lyx:
2794 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
2795 translation of the Tutorial (Dooteo)
2797 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
2799 * forms/cite.fd: new citation dialog
2801 * src/insetcite.[Ch]: the new citation dialog is moved into
2804 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
2807 * src/insets/insetcommand.h: data members made private.
2809 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2811 * LyX 1.1.5 released
2813 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2815 * src/version.h (LYX_RELEASE): to 1.1.5
2817 * src/spellchecker.C (RunSpellChecker): return false if the
2818 spellchecker dies upon creation.
2820 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2822 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
2823 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
2827 * lib/CREDITS: update entry for Martin Vermeer.
2829 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
2831 * src/text.C (draw): Draw foreign language bars at the bottom of
2832 the row instead of at the baseline.
2834 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
2836 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2838 * lib/bind/de_menus.bind: updated
2840 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2842 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
2844 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2846 * src/menus.C (Limit_string_length): New function
2847 (ShowTocMenu): Limit the number of items/length of items in the
2850 * src/paragraph.C (String): Correct result for a paragraph inside
2853 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2855 * src/bufferlist.C (close): test of buf->getuser() == NULL
2857 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
2859 * src/BufferView2.C (removeAutoInsets): Fix a bug:
2860 Do not call to SetCursor when the paragraph is a closed footnote!
2862 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
2864 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
2867 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
2869 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2872 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
2873 reference popup, that activates the reference-back action
2875 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
2877 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
2878 the menus. Also fixed a bug.
2880 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
2881 the math panels when switching buffers (unless new buffer is readonly).
2883 * src/BufferView.C (NoSavedPositions)
2884 * src/BufferView_pimpl.C (NoSavedPositions): New methods
2886 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2888 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
2889 less of dvi dirty or not.
2891 * src/trans_mgr.[Ch] (insert): change first parameter to string
2894 * src/chset.[Ch] (encodeString): add const to first parameter
2896 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2898 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
2902 * src/LaTeX.C (deplog): better searching for dependency files in
2903 the latex log. Uses now regexps.
2905 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
2906 instead of the box hack or \hfill.
2908 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2910 * src/lyxfunc.C (doImportHelper): do not create the file before
2911 doing the actual import.
2912 (doImportASCIIasLines): create a new file before doing the insert.
2913 (doImportASCIIasParagraphs): ditto.
2915 * lib/lyxrc.example: remove mention of non-existing commands
2917 * lyx.man: remove mention of color-related switches.
2919 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
2921 * src/lyx_gui.C: remove all the color-related ressources, which
2922 are not used anymore.
2924 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
2927 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2929 * src/lyxrc.C (read): Add a missing break in the switch
2931 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
2933 * src/text2.C (InsertStringA): Fix a bug with insertion into table
2935 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
2938 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
2940 * src/text.C (draw): draw bars under foreign language words.
2942 * src/LColor.[Ch]: add LColor::language
2944 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
2946 * src/lyxcursor.h (boundary): New member variable
2948 * src/text.C (IsBoundary): New methods
2950 * src/text.C: Use the above for currect cursor movement when there
2951 is both RTL & LTR text.
2953 * src/text2.C: ditto
2955 * src/bufferview_funcs.C (ToggleAndShow): ditto
2957 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2959 * src/text.C (DeleteLineForward): set selection to true to avoid
2960 that DeleteEmptyParagraphMechanism does some magic. This is how it
2961 is done in all other functions, and seems reasonable.
2962 (DeleteWordForward): do not jump over non-word stuff, since
2963 CursorRightOneWord() already does it.
2965 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
2966 DeleteWordBackward, since they seem safe to me (since selection is
2967 set to "true") DeleteEmptyParagraphMechanism does nothing.
2969 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2971 * src/lyx_main.C (easyParse): simplify the code by factoring the
2972 part that removes parameters from the command line.
2973 (LyX): check wether wrong command line options have been given.
2975 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
2977 * src/lyx_main.C : add support for specifying user LyX
2978 directory via command line option -userdir.
2980 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
2982 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
2983 the number of items per popup.
2984 (Add_to_refs_menu): Ditto.
2986 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2988 * src/lyxparagraph.h: renamed ClearParagraph() to
2989 StripLeadingSpaces() and moved it to paragraph.C. We pass the
2990 textclass as parameter, and do nothing if free_spacing is
2991 true. This fixes part of the line-delete-forward problems.
2993 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
2994 (pasteSelection): ditto.
2995 (SwitchLayoutsBetweenClasses): more translatable strings.
2997 * src/text2.C (CutSelection): use StripLeadingSpaces.
2998 (PasteSelection): ditto.
2999 (DeleteEmptyParagraphMechanism): ditto.
3001 2000-05-26 Juergen Vigna <jug@sad.it>
3003 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3004 is not needed in tabular insets.
3006 * src/insets/insettabular.C (TabularFeatures): added missing features.
3008 * src/tabular.C (DeleteColumn):
3010 (AppendRow): implemented this functions
3011 (cellsturct::operator=): clone the inset too;
3013 2000-05-23 Juergen Vigna <jug@sad.it>
3015 * src/insets/insettabular.C (LocalDispatch): better selection support
3016 when having multicolumn-cells.
3018 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3020 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3022 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3024 * src/ColorHandler.C (getGCForeground): put more test into _()
3026 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3029 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3032 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3034 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3035 there are no labels, or when buffer is readonly.
3037 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3038 there are no labels, buffer is SGML, or when buffer is readonly.
3040 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3042 * src/LColor.C (LColor): change a couple of grey40 to grey60
3043 (LColor): rewore initalization to make compiles go some magnitude
3045 (getGUIName): don't use gettext until we need the string.
3047 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3049 * src/Bullet.[Ch]: Fixed a small bug.
3051 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3053 * src/paragraph.C (String): Several fixes/improvements
3055 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3057 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3059 * src/paragraph.C (String): give more correct output.
3061 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3063 * src/lyxfont.C (stateText) Do not output the language if it is
3064 eqaul to the language of the document.
3066 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3067 between two paragraphs with the same language.
3069 * src/paragraph.C (getParLanguage) Return a correct answer for an
3070 empty dummy paragraph.
3072 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3075 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3078 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3079 the menus/popup, if requested fonts are unavailable.
3081 2000-05-22 Juergen Vigna <jug@sad.it>
3083 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3084 movement support (Up/Down/Tab/Shift-Tab).
3085 (LocalDispatch): added also preliminari cursor-selection.
3087 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3089 * src/paragraph.C (PasteParagraph): Hopefully now right!
3091 2000-05-22 Garst R. Reese <reese@isn.net>
3093 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3094 of list, change all references to Environment to Command
3095 * tex/hollywood.cls : rewrite environments as commands, add
3096 \uppercase to interiorshot and exteriorshot to force uppecase.
3097 * tex/broadway.cls : rewrite environments as commands. Tweak
3100 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3102 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3103 size of items: use a constant intead of the hardcoded 40, and more
3104 importantly do not remove the %m and %x tags added at the end.
3105 (Add_to_refs_menu): use vector::size_type instead of
3106 unsigned int as basic types for the variables. _Please_ do not
3107 assume that size_t is equal to unsigned int. On an alpha, this is
3108 unsigned long, which is _not_ the same.
3110 * src/language.C (initL): remove language "hungarian", since it
3111 seems that "magyar" is better.
3113 2000-05-22 Juergen Vigna <jug@sad.it>
3115 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3117 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3120 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3121 next was deleted but not set to 0.
3123 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3125 * src/language.C (initL): change the initialization of languages
3126 so that compiles goes _fast_.
3128 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3131 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3133 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3137 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3139 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3141 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3145 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3148 * src/insets/insetlo*.[Ch]: Made editable
3150 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3152 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3153 the current selection.
3155 * src/BufferView_pimpl.C (stuffClipboard): new method
3157 * src/BufferView.C (stuffClipboard): new method
3159 * src/paragraph.C (String): new method
3161 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3162 LColor::ignore when lyxname is not found.
3164 * src/BufferView.C (pasteSelection): new method
3166 * src/BufferView_pimpl.C (pasteSelection): new method
3168 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3170 * src/WorkArea.C (request_clipboard_cb): new static function
3171 (getClipboard): new method
3172 (putClipboard): new method
3174 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3176 * LyX 1.1.5pre2 released
3178 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3180 * src/vspace.C (operator=): removed
3181 (operator=): removed
3183 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3185 * src/layout.C (NumberOfClass): manually set the type in make_pair
3186 (NumberOfLayout): ditto
3188 * src/language.C: use the Language constructor for ignore_lang
3190 * src/language.h: add constructors to struct Language
3192 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3194 * src/text2.C (SetCursorIntern): comment out #warning
3196 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3198 * src/mathed/math_iter.h: initialize sx and sw to 0
3200 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3202 * forms/lyx.fd: Redesign of form_ref
3204 * src/LaTeXFeatures.[Ch]
3208 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3211 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3212 and Buffer::inset_iterator.
3214 * src/menus.C: Added new menus: TOC and Refs.
3216 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3218 * src/buffer.C (getTocList): New method.
3220 * src/BufferView2.C (ChangeRefs): New method.
3222 * src/buffer.C (getLabelList): New method. It replaces the old
3223 getReferenceList. The return type is vector<string> instead of
3226 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3227 the old getLabel() and GetNumberOfLabels() methods.
3228 * src/insets/insetlabel.C (getLabelList): ditto
3229 * src/mathed/formula.C (getLabelList): ditto
3231 * src/paragraph.C (String): New method.
3233 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3234 Uses the new getTocList() method.
3235 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3236 which automatically updates the contents of the browser.
3237 (RefUpdateCB): Use the new getLabelList method.
3239 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3241 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3243 * src/spellchecker.C: Added using std::reverse;
3245 2000-05-19 Juergen Vigna <jug@sad.it>
3247 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3249 * src/insets/insettext.C (computeTextRows): small fix for display of
3250 1 character after a newline.
3252 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3255 2000-05-18 Juergen Vigna <jug@sad.it>
3257 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3258 when changing width of column.
3260 * src/tabular.C (set_row_column_number_info): setting of
3261 autobreak rows if necessary.
3263 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3265 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3267 * src/vc-backend.*: renamed stat() to status() and vcstat to
3268 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3269 compilation broke. The new name seems more relevant, anyway.
3271 2000-05-17 Juergen Vigna <jug@sad.it>
3273 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3274 which was wrong if the removing caused removing of rows!
3276 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3277 (pushToken): new function.
3279 * src/text2.C (CutSelection): fix problem discovered with purify
3281 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3283 * src/debug.C (showTags): enlarge the first column, now that we
3284 have 6-digits debug codes.
3286 * lib/layouts/hollywood.layout:
3287 * lib/tex/hollywood.cls:
3288 * lib/tex/brodway.cls:
3289 * lib/layouts/brodway.layout: more commands and fewer
3290 environments. Preambles moved in the .cls files. Broadway now has
3291 more options on scene numbering and less whitespace (from Garst)
3293 * src/insets/insetbib.C (getKeys): make sure that we are in the
3294 document directory, in case the bib file is there.
3296 * src/insets/insetbib.C (Latex): revert bogus change.
3298 2000-05-16 Juergen Vigna <jug@sad.it>
3300 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3301 the TabularLayout on cursor move.
3303 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3305 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3308 (draw): fixed cursor position and drawing so that the cursor is
3309 visible when before the tabular-inset.
3311 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3312 when creating from old insettext.
3314 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3316 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3318 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3319 * lib/tex/brodway.cls: ditto
3321 * lib/layouts/brodway.layout: change alignment of parenthical
3324 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3326 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3327 versions 0.88 and 0.89 are supported.
3329 2000-05-15 Juergen Vigna <jug@sad.it>
3331 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3334 * src/insets/insettext.C (computeTextRows): redone completely this
3335 function in a much cleaner way, because of problems when having a
3337 (draw): added a frame border when the inset is locked.
3338 (SetDrawLockedFrame): this sets if we draw the border or not.
3339 (SetFrameColor): this sets the frame color (default=insetframe).
3341 * src/insets/lyxinset.h: added x() and y() functions which return
3342 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3343 function which is needed to see if we have a locking inset of some
3344 type in this inset (needed for now in insettabular).
3346 * src/vspace.C (inPixels): the same function also without a BufferView
3347 parameter as so it is easier to use it in some ocasions.
3349 * src/lyxfunc.C: changed all places where insertInset was used so
3350 that now if it couldn't be inserted it is deleted!
3352 * src/TabularLayout.C:
3353 * src/TableLayout.C: added support for new tabular-inset!
3355 * src/BufferView2.C (insertInset): this now returns a bool if the
3356 inset was really inserted!!!
3358 * src/tabular.C (GetLastCellInRow):
3359 (GetFirstCellInRow): new helper functions.
3360 (Latex): implemented for new tabular class.
3364 (TeXTopHLine): new Latex() helper functions.
3366 2000-05-12 Juergen Vigna <jug@sad.it>
3368 * src/mathed/formulamacro.C (Read):
3369 * src/mathed/formula.C (Read): read also the \end_inset here!
3371 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3373 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3374 crush when saving formulae with unbalanced parenthesis.
3376 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3378 * src/layout.C: Add new keyword "endlabelstring" to layout file
3380 * src/text.C (GetVisibleRow): Draw endlabel string.
3382 * lib/layouts/broadway.layout
3383 * lib/layouts/hollywood.layout: Added endlabel for the
3384 Parenthetical layout.
3386 * lib/layouts/heb-article.layout: Do not use slanted font shape
3387 for Theorem like environments.
3389 * src/buffer.C (makeLaTeXFile): Always add "american" to
3390 the UsedLanguages list if document language is RTL.
3392 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3394 * add addendum to README.OS2 and small patch (from SMiyata)
3396 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3398 * many files: correct the calls to ChangeExtension().
3400 * src/support/filetools.C (ChangeExtension): remove the no_path
3401 argument, which does not belong there. Use OnlyFileName() instead.
3403 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3404 files when LaTeXing a non-nice latex file.
3406 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3407 a chain of "if". Return false when deadkeys are not handled.
3409 * src/lyx_main.C (LyX): adapted the code for default bindings.
3411 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3412 bindings for basic functionality (except deadkeys).
3413 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3415 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3416 several methods: handle override_x_deadkeys.
3418 * src/lyxrc.h: remove the "bindings" map, which did not make much
3419 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3421 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3423 * src/lyxfont.C (stateText): use a saner method to determine
3424 whether the font is "default". Seems to fix the crash with DEC
3427 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3429 2000-05-08 Juergen Vigna <jug@sad.it>
3431 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3432 TabularLayoutMenu with mouse-button-3
3433 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3435 * src/TabularLayout.C: added this file for having a Layout for
3438 2000-05-05 Juergen Vigna <jug@sad.it>
3440 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3441 recalculating inset-widths.
3442 (TabularFeatures): activated this function so that I can change
3443 tabular-features via menu.
3445 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3446 that I can test some functions with the Table menu.
3448 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3450 * src/lyxfont.C (stateText): guard against stupid c++libs.
3452 * src/tabular.C: add using std::vector
3453 some whitespace changes, + removed som autogenerated code.
3455 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3457 2000-05-05 Juergen Vigna <jug@sad.it>
3459 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3460 row, columns and cellstructures.
3462 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3464 * lib/lyxrc.example: remove obsolete entries.
3466 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3467 reading of protected_separator for free_spacing.
3469 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3471 * src/text.C (draw): do not display an exclamation mark in the
3472 margin for margin notes. This is confusing, ugly and
3475 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3476 AMS math' is checked.
3478 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3479 name to see whether including the amsmath package is needed.
3481 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3483 * src/paragraph.C (validate): Compute UsedLanguages correctly
3484 (don't insert the american language if it doesn't appear in the
3487 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3488 The argument of \thanks{} command is considered moving argument
3490 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3493 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3495 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3496 for appendix/minipage/depth. The lines can be now both in the footnote
3497 frame, and outside the frame.
3499 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3502 2000-05-05 Juergen Vigna <jug@sad.it>
3504 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3505 neede only in tabular.[Ch].
3507 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3509 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3511 (Write): write '~' for PROTECTED_SEPARATOR
3513 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3515 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3518 * src/mathed/formula.C (drawStr): rename size to siz.
3520 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3521 possibly fix a bug by not changing the pflags = flags to piflags =
3524 2000-05-05 Juergen Vigna <jug@sad.it>
3526 * src/insets/insetbib.C: moved using directive
3528 * src/ImportNoweb.C: small fix for being able to compile (missing
3531 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3533 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3534 to use clear, since we don't depend on this in the code. Add test
3537 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3539 * (various *.C files): add using std::foo directives to please dec
3542 * replace calls to string::clear() to string::erase() (Angus)
3544 * src/cheaders/cmath: modified to provide std::abs.
3546 2000-05-04 Juergen Vigna <jug@sad.it>
3548 * src/insets/insettext.C: Prepared all for inserting of multiple
3549 paragraphs. Still display stuff to do (alignment and other things),
3550 but I would like to use LyXText to do this when we cleaned out the
3551 table-support stuff.
3553 * src/insets/insettabular.C: Changed lot of stuff and added lots
3554 of functionality still a lot to do.
3556 * src/tabular.C: Various functions changed name and moved to be
3557 const functions. Added new Read and Write functions and changed
3558 lots of things so it works good with tabular-insets (also removed
3559 some stuff which is not needed anymore * hacks *).
3561 * src/lyxcursor.h: added operators == and != which just look if
3562 par and pos are (not) equal.
3564 * src/buffer.C (latexParagraphs): inserted this function to latex
3565 all paragraphs form par to endpar as then I can use this too for
3568 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3569 so that I can call this to from text insets with their own cursor.
3571 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3572 output off all paragraphs (because of the fix below)!
3574 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3575 the very last paragraph (this could be also the last paragraph of an
3578 * src/texrow.h: added rows() call which returns the count-variable.
3580 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3582 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3584 * lib/configure.m4: better autodetection of DocBook tools.
3586 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3588 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3590 * src/lyx_cb.C: add using std::reverse;
3592 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3595 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3596 selected files. Should fix repeated errors from generated files.
3598 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3600 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3602 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3603 the spellchecker popup.
3605 * lib/lyxrc.example: Removed the \number_inset section
3607 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3609 * src/insets/figinset.C (various): Use IsFileReadable() to make
3610 sure that the file actually exist. Relying on ghostscripts errors
3611 is a bad idea since they can lead to X server crashes.
3613 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3615 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3618 * lib/lyxrc.example: smallish typo in description of
3619 \view_dvi_paper_option
3621 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3624 * src/lyxfunc.C: doImportHelper to factor out common code of the
3625 various import methods. New functions doImportASCIIasLines,
3626 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3627 doImportLinuxDoc for the format specific parts.
3630 * buffer.C: Dispatch returns now a bool to indicate success
3633 * lyx_gui.C: Add getLyXView() for member access
3635 * lyx_main.C: Change logic for batch commands: First try
3636 Buffer::Dispatch (possibly without GUI), if that fails, use
3639 * lyx_main.C: Add support for --import command line switch.
3640 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3641 Available Formats: Everything accepted by 'buffer-import <format>'
3643 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3645 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3648 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3649 documents will be reformatted upon reentry.
3651 2000-04-27 Juergen Vigna <jug@sad.it>
3653 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3654 correctly only last pos this was a bug.
3656 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3658 * release of lyx-1.1.5pre1
3660 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3662 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3664 * src/menus.C: revert the change of naming (Figure->Graphic...)
3665 from 2000-04-11. It was incomplete and bad.
3667 * src/LColor.[Ch]: add LColor::depthbar.
3668 * src/text.C (GetVisibleRow): use it.
3670 * README: update the languages list.
3672 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3674 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3677 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3679 * README: remove sections that were just wrong.
3681 * src/text2.C (GetRowNearY): remove currentrow code
3683 * src/text.C (GetRow): remove currentrow code
3685 * src/screen.C (Update): rewritten a bit.
3686 (SmallUpdate): removed func
3688 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
3690 (FullRebreak): return bool
3691 (currentrow): remove var
3692 (currentrow_y): ditto
3694 * src/lyxscreen.h (Draw): change arg to unsigned long
3695 (FitCursor): return bool
3696 (FitManualCursor): ditto
3697 (Smallpdate): remove func
3698 (first): change to unsigned long
3699 (DrawOneRow): change second arg to long (from long &)
3700 (screen_refresh_y): remove var
3701 (scree_refresh_row): ditto
3703 * src/lyxrow.h: change baseline to usigned int from unsigned
3704 short, this brings some implicit/unsigned issues out in the open.
3706 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
3708 (Dispatch): don't call updateScrollbar after fitCursor. Use update
3709 instead of smallUpdate.
3711 * src/lyxcursor.h: change y to unsigned long
3713 * src/buffer.h: don't call updateScrollbar after fitcursor
3715 * src/buffer.C (parseSingleLyXformat2Token): move variables to
3716 where they are used. Removed "\\direction", this was not present
3717 in 1.1.4 and is already obsolete. Commented out some code that I
3718 believe to never be called.
3719 (runLiterate): don't call updateScrollbar after fitCursor
3721 (buildProgram): ditto
3724 * src/WorkArea.h (workWidth): change return val to unsigned
3727 (redraw): remove the button redraws
3728 (setScrollbarValue): change for scrollbar
3729 (getScrollbarValue): change for scrollbar
3730 (getScrollbarBounds): change for scrollbar
3732 * src/WorkArea.C (C_WorkArea_up_cb): removed func
3733 (C_WorkArea_down_cb): removed func
3734 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
3735 (resize): change for scrollbar
3736 (setScrollbar): ditto
3737 (setScrollbarBounds): ditto
3738 (setScrollbarIncrements): ditto
3739 (up_cb): removed func
3740 (down_cb): removed func
3741 (scroll_cb): change for scrollbar
3742 (work_area_handler): ditto
3744 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
3745 when FitCursor did something.
3746 (updateScrollbar): some unsigned changes
3747 (downCB): removed func
3748 (scrollUpOnePage): removed func
3749 (scrollDownOnePage): remvoed func
3750 (workAreaMotionNotify): don't call screen->FitCursor but use
3751 fitCursor instead. and bool return val
3752 (workAreaButtonPress): ditto
3753 (workAreaButtonRelease): some unsigned changes
3754 (checkInsetHit): ditto
3755 (workAreaExpose): ditto
3756 (update): parts rewritten, comments about the signed char arg added
3757 (smallUpdate): removed func
3758 (cursorPrevious): call needed updateScrollbar
3761 * src/BufferView2.C (allFloats): don't call updateScrollbar after
3764 * src/BufferView.[Ch] (upCB): removed func
3765 (downCB): removed func
3766 (smallUpdate): removed func
3768 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3770 * src/lyxtext.h src/text.C src/text2.C: removed support for the
3771 currentrow, currentrow_y optimization. This did not help a lot and
3772 if we want to do this kind of optimization we should rather use
3773 cursor.row instead of the currentrow.
3775 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
3776 buffer spacing and klyx spacing support.
3778 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3780 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
3783 2000-04-26 Juergen Vigna <jug@sad.it>
3785 * src/insets/figinset.C: fixes to Lars sstream changes!
3787 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
3789 * A lot of files: Added Ascii(ostream &) methods to all inset
3790 classes. Used when exporting to ASCII.
3792 * src/buffer.C (writeFileAscii,RoffAsciiTable)
3793 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
3796 * src/text2.C (ToggleFree): Disabled implicit word selection when
3797 there is a change in the language
3799 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
3800 no output was generated for end-of-sentence inset.
3802 * src/insets/lyxinset.h
3805 * src/paragraph.C: Removed the insetnumber code
3807 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
3809 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3811 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
3812 no_babel and no_epsfig completely from the file.
3813 (parseSingleLyXformat2Token): add handling for per-paragraph
3814 spacing as written by klyx.
3816 * src/insets/figinset.C: applied patch by Andre. Made it work with
3819 2000-04-20 Juergen Vigna <jug@sad.it>
3821 * src/insets/insettext.C (cutSelection):
3822 (copySelection): Fixed with selection from right to left.
3823 (draw): now the rows are not recalculated at every draw.
3824 (computeTextRows): for now reset the inset-owner here (this is
3825 important for an undo or copy where the inset-owner is not set
3828 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
3829 motion to the_locking_inset screen->first was forgotten, this was
3830 not important till we got multiline insets.
3832 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3834 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
3835 code seems to be alright (it is code changed by Dekel, and the
3836 intent is indeed that all macros should be defined \protect'ed)
3838 * NEWS: a bit of reorganisation of the new user-visible features.
3840 2000-04-19 Juergen Vigna <jug@sad.it>
3842 * src/insets/insettext.C (init): using a LyXCursor now for cursor
3843 position. Set the inset_owner of the used paragraph so that it knows
3844 that it is inside an inset. Fixed cursor handling with mouse and
3845 cursor keys. Fixed wrong timed inset redraws and lots of other changes
3846 and cleanups to make TextInsets work better.
3848 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
3849 Changed parameters of various functions and added LockInsetInInset().
3851 * src/insets/insettext.C:
3853 * src/insets/insetcollapsable.h:
3854 * src/insets/insetcollapsable.C:
3855 * src/insets/insetfoot.h:
3856 * src/insets/insetfoot.C:
3857 * src/insets/insetert.h:
3858 * src/insets/insetert.C: cleaned up the code so that it works now
3859 correctly with insettext.
3861 * src/insets/inset.C:
3862 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
3863 that insets in insets are supported right.
3866 * src/table.C: lots of changes for use with inset tabular (and cleanup)
3868 * src/paragraph.C: some small fixes
3870 * src/debug.h: inserted INSETS debug info
3872 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
3873 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
3875 * src/commandtags.h:
3876 * src/LyXAction.C: insert code for InsetTabular.
3878 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
3879 not Button1MotionMask.
3880 (workAreaButtonRelease): send always a InsetButtonRelease event to
3882 (checkInsetHit): some setCursor fixes (always with insets).
3884 * src/BufferView2.C (lockInset): returns a bool now and extended for
3885 locking insets inside insets.
3886 (showLockedInsetCursor): it is important to have the cursor always
3887 before the locked inset.
3888 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
3890 * src/BufferView.h: made lockInset return a bool.
3892 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
3894 * src/text2.C (SetCursor): This now has a version with a LyXCursor
3895 that is used also internally but can be called as public to have back
3896 a cursor pos which is not set internally.
3897 (SetCursorIntern): Changed to use above function.
3899 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
3901 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3906 * NEWS: updated for prerelease of 1.1.5. Please comment and send
3907 patches for things that should be in or should be changed.
3909 * src/* [insetfiles]: change "usigned char fragile" to bool
3910 fragile. There was only one point that could that be questioned
3911 and that is commented in formulamacro.C. Grep for "CHECK".
3913 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
3914 (DeleteBuffer): take it out of CutAndPaste and make it static.
3916 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3918 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
3919 output the spacing envir commands. Also the new commands used in
3920 the LaTeX output makes the result better.
3922 * src/Spacing.C (writeEnvirBegin): new method
3923 (writeEnvirEnd): new method
3925 2000-04-18 Juergen Vigna <jug@sad.it>
3927 * src/CutAndPaste.C: made textclass a static member of the class
3928 as otherwise it is not accesed right!!!
3930 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
3932 * forms/layout_forms.fd
3933 * src/layout_forms.h
3934 * src/layout_forms.C (create_form_form_character)
3935 * src/lyx_cb.C (UserFreeFont)
3936 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
3937 documents (in the layout->character popup).
3939 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3941 * src/spellchecker.C (create_ispell_pipe): fix a bug where
3942 \spell_command was in fact not honored (from Kevin Atkinson).
3944 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
3947 * src/lyx_gui.h: make lyxViews private (Angus)
3949 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
3951 * src/mathed/math_write.C
3952 (MathMatrixInset::Write) Put \protect before \begin{array} and
3953 \end{array} if fragile
3954 (MathParInset::Write): Put \protect before \\ if fragile
3956 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3958 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
3959 initialization if the LyXColorHandler must be done after the
3960 connections to the XServer has been established.
3962 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
3963 get the background pixel from the lyxColorhandler so that the
3964 figures are rendered with the correct background color.
3965 (NextToken): removed functions.
3966 (GetPSSizes): use ifs >> string instead of NextToken.
3968 * src/Painter.[Ch]: the color cache moved out of this file.
3970 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
3973 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3975 * src/WorkArea.C (work_area_handler): call BufferView::enterView
3976 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
3978 * src/BufferView.C (enterView): new func
3979 (leaveView): new func
3981 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
3983 (leaveView): new func, undefines xterm cursor when approp.
3985 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
3986 (AllowInput): delete the Workarea cursor handling from this func.
3988 * src/Painter.C (underline): draw a slimer underline in most cases.
3990 * src/lyx_main.C (error_handler): use extern "C"
3992 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3994 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
3995 sent directly to me.
3997 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
3998 to the list by Dekel.
4000 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4003 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4004 methods from lyx_cb.here.
4006 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4009 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4011 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4012 instead of using current_view directly.
4014 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4016 * src/LyXAction.C (init): add the paragraph-spacing command.
4018 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4020 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4022 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4023 different from the documents.
4025 * src/text.C (SetHeightOfRow): take paragraph spacing into
4026 account, paragraph spacing takes precedence over buffer spacing
4027 (GetVisibleRow): ditto
4029 * src/paragraph.C (writeFile): output the spacing parameter too.
4030 (validate): set the correct features if spacing is used in the
4032 (Clear): set spacing to default
4033 (MakeSameLayout): spacing too
4034 (HasSameLayout): spacing too
4035 (SetLayout): spacing too
4036 (TeXOnePar): output the spacing commands
4038 * src/lyxparagraph.h: added a spacing variable for use with
4039 per-paragraph spacing.
4041 * src/Spacing.h: add a Default spacing and a method to check if
4042 the current spacing is default. also added an operator==
4044 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4047 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4049 * src/lyxserver.C (callback): fix dispatch of functions
4051 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4052 printf() into lyxerr call.
4054 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4057 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4058 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4059 the "Float" from each of the subitems.
4060 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4062 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4063 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4064 documented the change so that the workaround can be nuked later.
4066 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4069 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4071 * src/buffer.C (getLatexName): ditto
4072 (setReadonly): ditto
4074 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4076 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4077 avoid some uses of current_view. Added also a bufferParams()
4078 method to get at this.
4080 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4082 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4084 * src/lyxparagraph.[Ch]: removed
4085 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4086 with operators used by lower_bound and
4087 upper_bound in InsetTable's
4088 Make struct InsetTable private again. Used matchpos.
4090 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4092 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4093 document, the language of existing text is changed (unless the
4094 document is multi-lingual)
4096 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4098 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4100 * A lot of files: A rewrite of the Right-to-Left support.
4102 2000-04-10 Juergen Vigna <jug@sad.it>
4104 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4105 misplaced cursor when inset in inset is locked.
4107 * src/insets/insettext.C (LocalDispatch): small fix so that a
4108 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4110 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4111 footnote font should be decreased in size twice when displaying.
4113 * src/insets/insettext.C (GetDrawFont): inserted this function as
4114 the drawing-font may differ from the real paragraph font.
4116 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4117 insets (inset in inset!).
4119 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4120 function here because we don't want footnotes inside footnotes.
4122 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4124 (init): now set the inset_owner in paragraph.C
4125 (LocalDispatch): added some resetPos() in the right position
4128 (pasteSelection): changed to use the new CutAndPaste-Class.
4130 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4131 which tells if it is allowed to insert another inset inside this one.
4133 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4134 SwitchLayoutsBetweenClasses.
4136 * src/text2.C (InsertInset): checking of the new paragraph-function
4138 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4139 is not needed anymore here!
4142 (PasteSelection): redone (also with #ifdef) so that now this uses
4143 the CutAndPaste-Class.
4144 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4147 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4148 from/to text/insets.
4150 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4151 so that the paragraph knows if it is inside an (text)-inset.
4152 (InsertFromMinibuffer): changed return-value to bool as now it
4153 may happen that an inset is not inserted in the paragraph.
4154 (InsertInsetAllowed): this checks if it is allowed to insert an
4155 inset in this paragraph.
4157 (BreakParagraphConservative):
4158 (BreakParagraph) : small change for the above change of the return
4159 value of InsertFromMinibuffer.
4161 * src/lyxparagraph.h: added inset_owner and the functions to handle
4162 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4164 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4166 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4167 functions from BufferView to BufferView::Pimpl to ease maintence.
4169 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4170 correctly. Also use SetCursorIntern instead of SetCursor.
4172 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4175 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4177 * src/WorkArea.C (belowMouse): manually implement below mouse.
4179 * src/*: Add "explicit" on several constructors, I added probably
4180 some unneeded ones. A couple of changes to code because of this.
4182 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4183 implementation and private parts from the users of BufferView. Not
4186 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4187 implementation and private parts from the users of LyXLex. Not
4190 * src/BufferView_pimpl.[Ch]: new files
4192 * src/lyxlex_pimpl.[Ch]: new files
4194 * src/LyXView.[Ch]: some inline functions move out-of-line
4196 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4198 * src/lyxparagraph.h: make struct InsetTable public.
4200 * src/support/lyxstring.h: change lyxstring::difference_type to be
4201 ptrdiff_t. Add std:: modifiers to streams.
4203 * src/font.C: include the <cctype> header, for islower() and
4206 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4208 * src/font.[Ch]: new files. Contains the metric functions for
4209 fonts, takes a LyXFont as parameter. Better separation of concepts.
4211 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4212 changes because of this.
4214 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4216 * src/*: compile with -Winline and move functions that don't
4219 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4222 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4224 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4225 (various files changed because of this)
4227 * src/Painter.C (text): fixed the drawing of smallcaps.
4229 * src/lyxfont.[Ch] (drawText): removed unused member func.
4232 * src/*.C: added needed "using" statements and "std::" qualifiers.
4234 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4236 * src/*.h: removed all use of "using" from header files use
4237 qualifier std:: instead.
4239 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4241 * src/text.C (Backspace): some additional cleanups (we already
4242 know whether cursor.pos is 0 or not).
4244 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4245 automake does not provide one).
4247 * src/bmtable.h: replace C++ comments with C comments.
4249 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4251 * src/screen.C (ShowCursor): Change the shape of the cursor if
4252 the current language is not equal to the language of the document.
4253 (If the cursor change its shape unexpectedly, then you've found a bug)
4255 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4258 * src/insets/insetnumber.[Ch]: New files.
4260 * src/LyXAction.C (init)
4261 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4264 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4266 * src/lyxparagraph.h
4267 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4268 (the vector is kept sorted).
4270 * src/text.C (GetVisibleRow): Draw selection correctly when there
4271 is both LTR and RTL text.
4273 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4274 which is much faster.
4276 * src/text.C (GetVisibleRow and other): Do not draw the last space
4277 in a row if the direction of the last letter is not equal to the
4278 direction of the paragraph.
4280 * src/lyxfont.C (latexWriteStartChanges):
4281 Check that font language is not equal to basefont language.
4282 (latexWriteEndChanges): ditto
4284 * src/lyx_cb.C (StyleReset): Don't change the language while using
4285 the font-default command.
4287 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4288 empty paragraph before a footnote.
4290 * src/insets/insetcommand.C (draw): Increase x correctly.
4292 * src/screen.C (ShowCursor): Change cursor shape if
4293 current language != document language.
4295 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4297 2000-03-31 Juergen Vigna <jug@sad.it>
4299 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4300 (Clone): changed mode how the paragraph-data is copied to the
4301 new clone-paragraph.
4303 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4304 GetInset(pos) with no inset anymore there (in inset UNDO)
4306 * src/insets/insetcommand.C (draw): small fix as here x is
4307 incremented not as much as width() returns (2 before, 2 behind = 4)
4309 2000-03-30 Juergen Vigna <jug@sad.it>
4311 * src/insets/insettext.C (InsetText): small fix in initialize
4312 widthOffset (should not be done in the init() function)
4314 2000-03-29 Amir Karger <karger@lyx.org>
4316 * lib/examples/it_ItemizeBullets.lyx: translation by
4319 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4321 2000-03-29 Juergen Vigna <jug@sad.it>
4323 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4325 * src/insets/insetfoot.C (Clone): small change as for the below
4326 new init function in the text-inset
4328 * src/insets/insettext.C (init): new function as I've seen that
4329 clone did not copy the Paragraph-Data!
4330 (LocalDispatch): Added code so that now we have some sort of Undo
4331 functionality (well actually we HAVE Undo ;)
4333 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4335 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4337 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4340 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4342 * src/main.C: added a runtime check that verifies that the xforms
4343 header used when building LyX and the library used when running
4344 LyX match. Exit with a message if they don't match. This is a
4345 version number check only.
4347 * src/buffer.C (save): Don't allocate memory on the heap for
4348 struct utimbuf times.
4350 * *: some using changes, use iosfwd instead of the real headers.
4352 * src/lyxfont.C use char const * instead of string for the static
4353 strings. Rewrite some functions to use sstream.
4355 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4357 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4360 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4362 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4363 of Geodesy (from Martin Vermeer)
4365 * lib/layouts/svjour.inc: include file for the Springer svjour
4366 class. It can be used to support journals other than JoG.
4368 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4369 Miskiewicz <misiek@pld.org.pl>)
4370 * lib/reLyX/Makefile.am: ditto.
4372 2000-03-27 Juergen Vigna <jug@sad.it>
4374 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4375 also some modifications with operations on selected text.
4377 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4378 problems with clicking on insets (last famous words ;)
4380 * src/insets/insetcommand.C (draw):
4381 (width): Changed to have a bit of space before and after the inset so
4382 that the blinking cursor can be seen (otherwise it was hidden)
4384 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4386 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4387 would not be added to the link list when an installed gettext (not
4388 part of libc) is found.
4390 2000-03-24 Juergen Vigna <jug@sad.it>
4392 * src/insets/insetcollapsable.C (Edit):
4393 * src/mathed/formula.C (InsetButtonRelease):
4394 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4397 * src/BufferView.C (workAreaButtonPress):
4398 (workAreaButtonRelease):
4399 (checkInsetHit): Finally fixed the clicking on insets be handled
4402 * src/insets/insetert.C (Edit): inserted this call so that ERT
4403 insets work always with LaTeX-font
4405 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4407 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4408 caused lyx to startup with no GUI in place, causing in a crash
4409 upon startup when called with arguments.
4411 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4413 * src/FontLoader.C: better initialization of dummyXFontStruct.
4415 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4417 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4418 for linuxdoc and docbook import and export format options.
4420 * lib/lyxrc.example Example of default values for the previous flags.
4422 * src/lyx_cb.C Use those flags instead of the hardwired values for
4423 linuxdoc and docbook export.
4425 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4428 * src/menus.C Added menus entries for the new import/exports formats.
4430 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4432 * src/lyxrc.*: Added support for running without Gui
4435 * src/FontLoader.C: sensible defaults if no fonts are needed
4437 * src/lyx_cb.C: New function ShowMessage (writes either to the
4438 minibuffer or cout in case of no gui
4439 New function AskOverwrite for common stuff
4440 Consequently various changes to call these functions
4442 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4443 wild guess at sensible screen resolution when having no gui
4445 * src/lyxfont.C: no gui, no fonts... set some defaults
4447 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4449 * src/LColor.C: made the command inset background a bit lighter.
4451 2000-03-20 Hartmut Goebel <goebel@noris.net>
4453 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4454 stdstruct.inc. Koma-Script added some title elements which
4455 otherwise have been listed below "bibliography". This split allows
4456 adding title elements to where they belong.
4458 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4459 define the additional tilte elements and then include
4462 * many other layout files: changed to include stdtitle.inc just
4463 before stdstruct.inc.
4465 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4467 * src/buffer.C: (save) Added the option to store all backup files
4468 in a single directory
4470 * src/lyxrc.[Ch]: Added variable \backupdir_path
4472 * lib/lyxrc.example: Added descriptions of recently added variables
4474 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4475 bibtex inset, not closing the bibtex popup when deleting the inset)
4477 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4479 * src/lyx_cb.C: add a couple using directives.
4481 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4482 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4483 import based on the filename.
4485 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4486 file would be imported at start, if the filename where of a sgml file.
4488 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4490 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4492 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4493 * src/lyxfont.h Replaced the member variable bits.direction by the
4494 member variable lang. Made many changes in other files.
4495 This allows having a multi-lingual document
4497 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4498 that change the current language to <l>.
4499 Removed the command "font-rtl"
4501 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4502 format for Hebrew documents)
4504 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4505 When auto_mathmode is "true", pressing a digit key in normal mode
4506 will cause entering into mathmode.
4507 If auto_mathmode is "rtl" then this behavior will be active only
4508 when writing right-to-left text.
4510 * src/text2.C (InsertStringA) The string is inserted using the
4513 * src/paragraph.C (GetEndLabel) Gives a correct result for
4514 footnote paragraphs.
4516 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4518 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4520 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4521 front of PasteParagraph. Never insert a ' '. This should at least
4522 fix some cause for the segfaults that we have been experiencing,
4523 it also fixes backspace behaviour slightly. (Phu!)
4525 * src/support/lstrings.C (compare_no_case): some change to make it
4526 compile with gcc 2.95.2 and stdlibc++-v3
4528 * src/text2.C (MeltFootnoteEnvironment): change type o
4529 first_footnote_par_is_not_empty to bool.
4531 * src/lyxparagraph.h: make text private. Changes in other files
4533 (fitToSize): new function
4534 (setContentsFromPar): new function
4535 (clearContents): new function
4536 (SetChar): new function
4538 * src/paragraph.C (readSimpleWholeFile): deleted.
4540 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4541 the file, just use a simple string instead. Also read the file in
4542 a more maintainable manner.
4544 * src/text2.C (InsertStringA): deleted.
4545 (InsertStringB): deleted.
4547 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4549 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4550 RedoParagraphs from the doublespace handling part, just set status
4551 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4552 done, but perhaps not like this.)
4554 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4556 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4557 character when inserting an inset.
4559 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4561 * src/bufferparams.C (readLanguage): now takes "default" into
4564 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4565 also initialize the toplevel_keymap with the default bindings from
4568 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4570 * all files using lyxrc: have lyxrc as a real variable and not a
4571 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4574 * src/lyxrc.C: remove double call to defaultKeyBindings
4576 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4577 toolbar defauls using lyxlex. Remove enums, structs, functions
4580 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4581 toolbar defaults. Also store default keybindings in a map.
4583 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4584 storing the toolbar defaults without any xforms dependencies.
4586 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4587 applied. Changed to use iterators.
4589 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4591 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4592 systems that don't have LINGUAS set to begin with.
4594 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4596 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4597 the list by Dekel Tsur.
4599 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4601 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4602 * src/insets/form_graphics.C: ditto.
4604 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4606 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4608 * src/bufferparams.C (readLanguage): use the new language map
4610 * src/intl.C (InitKeyMapper): use the new language map
4612 * src/lyx_gui.C (create_forms): use the new language map
4614 * src/language.[Ch]: New files. Used for holding the information
4615 about each language. Now! Use this new language map enhance it and
4616 make it really usable for our needs.
4618 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4620 * screen.C (ShowCursor): Removed duplicate code.
4621 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4622 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4624 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4627 * src/text.C Added TransformChar method. Used for rendering Arabic
4628 text correctly (change the glyphs of the letter according to the
4629 position in the word)
4634 * src/lyxrc.C Added lyxrc command {language_command_begin,
4635 language_command_end,language_command_ltr,language_command_rtl,
4636 language_package} which allows the use of either arabtex or Omega
4639 * src/lyx_gui.C (init)
4641 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4642 to use encoding for menu fonts which is different than the encoding
4645 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4646 do not load the babel package.
4647 To write an English document with Hebrew/Arabic, change the document
4648 language to "english".
4650 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4651 (alphaCounter): changed to return char
4652 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4654 * lib/lyxrc.example Added examples for Hebrew/Arabic
4657 * src/layout.C Added layout command endlabeltype
4659 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4661 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4663 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4665 * src/mathed/math_delim.C (search_deco): return a
4666 math_deco_struct* instead of index.
4668 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4670 * All files with a USE_OSTREAM_ONLY within: removed all code that
4671 was unused when USE_OSTREAM_ONLY is defined.
4673 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4674 of any less. Removed header and using.
4676 * src/text.C (GetVisibleRow): draw the string "Page Break
4677 (top/bottom)" on screen when drawing a pagebreak line.
4679 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4681 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
4683 * src/mathed/math_macro.C (draw): do some cast magic.
4686 * src/mathed/math_defs.h: change byte* argument to byte const*.
4688 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
4690 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
4691 know it is right to return InsetFoot* too, but cxx does not like
4694 * src/insets/insetcollapsable.[Ch] (Clone): make const.
4696 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
4698 * src/mathed/math_delim.C: change == to proper assignment.
4700 2000-03-09 Juergen Vigna <jug@sad.it>
4702 * src/insets/insettext.C (setPos): fixed various cursor positioning
4703 problems (via mouse and cursor-keys)
4704 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
4705 inset (still a small display problem but it works ;)
4707 * src/insets/insetcollapsable.C (draw): added button_top_y and
4708 button_bottom_y to have correct values for clicking on the inset.
4710 * src/support/lyxalgo.h: commented out 'using std::less'
4712 2000-03-08 Juergen Vigna <jug@sad.it>
4714 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
4715 Button-Release event closes as it is alos the Release-Event
4718 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
4720 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4722 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
4723 can add multiple spaces in Scrap (literate programming) styles...
4724 which, by the way, is how I got hooked on LyX to begin with.
4726 * src/mathed/formula.C (Write): Added dummy variable to an
4727 inset::Latex() call.
4728 (Latex): Add free_spacing boolean to inset::Latex()
4730 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
4732 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
4733 virtual function to include the free_spacing boolean from
4734 the containing paragraph's style.
4736 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
4737 Added free_spacing boolean arg to match inset.h
4739 * src/insets/insettext.C, src/insets/insettext.h (Latex):
4740 Added free_spacing boolean arg to match inset.h
4742 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
4743 Added free_spacing boolean and made sure that if in a free_spacing
4744 paragraph, that we output normal space if there is a protected space.
4746 * src/insets/insetref.C, src/insets/insetref.h (Latex):
4747 Added free_spacing boolean arg to match inset.h
4749 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
4750 Added free_spacing boolean arg to match inset.h
4752 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
4753 Added free_spacing boolean arg to match inset.h
4755 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
4756 Added free_spacing boolean arg to match inset.h
4758 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
4759 Added free_spacing boolean arg to match inset.h
4761 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
4762 free_spacing boolean arg to match inset.h
4764 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
4765 Added free_spacing boolean arg to match inset.h
4767 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
4768 Added free_spacing boolean arg to match inset.h
4770 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
4771 Added free_spacing boolean arg to match inset.h
4773 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
4774 Added free_spacing boolean arg to match inset.h
4776 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
4777 Added free_spacing boolean arg to match inset.h
4779 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
4780 free_spacing boolean arg to match inset.h
4782 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
4783 free_spacing boolean arg to match inset.h
4785 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
4786 ignore free_spacing paragraphs. The user's spaces are left
4789 * src/text.C (InsertChar): Fixed the free_spacing layout
4790 attribute behavior. Now, if free_spacing is set, you can
4791 add multiple spaces in a paragraph with impunity (and they
4792 get output verbatim).
4793 (SelectSelectedWord): Added dummy argument to inset::Latex()
4796 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
4799 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
4800 paragraph layouts now only input a simple space instead.
4801 Special character insets don't make any sense in free-spacing
4804 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
4805 hard-spaces in the *input* file to simple spaces if the layout
4806 is free-spacing. This converts old files which had to have
4807 hard-spaces in free-spacing layouts where a simple space was
4809 (writeFileAscii): Added free_spacing check to pass to the newly
4810 reworked inset::Latex(...) methods. The inset::Latex() code
4811 ensures that hard-spaces in free-spacing paragraphs get output
4812 as spaces (rather than "~").
4814 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4816 * src/mathed/math_delim.C (draw): draw the empty placeholder
4817 delims with a onoffdash line.
4818 (struct math_deco_compare): struct that holds the "functors" used
4819 for the sort and the binary search in math_deco_table.
4820 (class init_deco_table): class used for initial sort of the
4822 (search_deco): use lower_bound to do a binary search in the
4825 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4827 * src/lyxrc.C: a small secret thingie...
4829 * src/lyxlex.C (printTable): changed to take a ostream as paramter
4830 and to not flush the stream as often as it used to.
4832 * src/support/lyxalgo.h: new file
4833 (sorted): template function used for checking if a sequence is
4834 sorted or not. Two versions with and without user supplied
4835 compare. Uses same compare as std::sort.
4837 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
4838 it and give warning on lyxerr.
4840 (struct compare_tags): struct with function operators used for
4841 checking if sorted, sorting and lower_bound.
4842 (search_kw): use lower_bound instead of manually implemented
4845 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4847 * src/insets/insetcollapsable.h: fix Clone() declaration.
4848 * src/insets/insetfoot.h: ditto.
4850 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
4852 2000-03-08 Juergen Vigna <jug@sad.it>
4854 * src/insets/lyxinset.h: added owner call which tells us if
4855 this inset is inside another inset. Changed also the return-type
4856 of Editable to an enum so it tells clearer what the return-value is.
4858 * src/insets/insettext.C (computeTextRows): fixed computing of
4859 textinsets which split automatically on more rows.
4861 * src/insets/insetert.[Ch]: changed this to be of BaseType
4864 * src/insets/insetfoot.[Ch]: added footnote inset
4866 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
4867 collapsable insets (like footnote, ert, ...)
4869 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4871 * src/lyxdraw.h: remvoe file
4873 * src/lyxdraw.C: remove file
4875 * src/insets/insettext.C: added <algorithm>.
4877 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4879 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
4880 (matrix_cb): case MM_OK use string stream
4882 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
4885 * src/mathed/math_macro.C (draw): use string stream
4886 (Metrics): use string stream
4888 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
4889 directly to the ostream.
4891 * src/vspace.C (asString): use string stream.
4892 (asString): use string stream
4893 (asLatexString): use string stream
4895 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
4896 setting Spacing::Other.
4898 * src/LaTeXFeatures.C (getPackages): use string stream instead of
4899 sprintf when creating the stretch vale.
4901 * src/text2.C (alphaCounter): changed to return a string and to
4902 not use a static variable internally. Also fixed a one-off bug.
4903 (SetCounter): changed the drawing of the labels to use string
4904 streams instead of sprintf.
4906 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
4907 manipulator to use a scheme that does not require library support.
4908 This is also the way it is done in the new GNU libstdc++. Should
4909 work with DEC cxx now.
4911 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4913 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
4914 end. This fixes a bug.
4916 * src/mathed (all files concerned with file writing): apply the
4917 USE_OSTREAM_ONLY changes to mathed too.
4919 * src/support/DebugStream.h: make the constructor explicit.
4921 * src/lyxfont.C (latexWriteStartChanges): small bug related to
4922 count and ostream squashed.
4924 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4926 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
4928 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
4929 ostringstream uses STL strings, and we might not.
4931 * src/insets/insetspecialchar.C: add using directive.
4932 * src/insets/insettext.C: ditto.
4934 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4936 * lib/layouts/seminar.layout: feeble attempt at a layout for
4937 seminar.cls, far from completet and could really use some looking
4938 at from people used to write layout files.
4940 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
4941 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
4942 a lot nicer and works nicely with ostreams.
4944 * src/mathed/formula.C (draw): a slightly different solution that
4945 the one posted to the list, but I think this one works too. (font
4946 size wrong in headers.)
4948 * src/insets/insettext.C (computeTextRows): some fiddling on
4949 Jürgens turf, added some comments that he should read.
4951 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
4952 used and it gave compiler warnings.
4953 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
4956 * src/lyx_gui.C (create_forms): do the right thing when
4957 show_banner is true/false.
4959 * src/lyx_cb.C (TimerCB): no need to close or do anything if
4960 show_banner is false.
4962 * most file writing files: Now use iostreams to do almost all of
4963 the writing. Also instead of passing string &, we now use
4964 stringstreams. mathed output is still not adapted to iostreams.
4965 This change can be turned off by commenting out all the occurences
4966 of the "#define USE_OSTREAM_ONLY 1" lines.
4968 * src/WorkArea.C (createPixmap): don't output debug messages.
4969 (WorkArea): don't output debug messages.
4971 * lib/lyxrc.example: added a comment about the new variable
4974 * development/Code_rules/Rules: Added some more commente about how
4975 to build class interfaces and on how better encapsulation can be
4978 2000-03-03 Juergen Vigna <jug@sad.it>
4980 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
4981 automatically with the width of the LyX-Window
4983 * src/insets/insettext.C (computeTextRows): fixed update bug in
4984 displaying text-insets (scrollvalues where not initialized!)
4986 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4988 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
4989 id in the check of the result from lower_bound is not enough since
4990 lower_bound can return last too, and then res->id will not be a
4993 * all insets and some code that use them: I have conditionalized
4994 removed the Latex(string & out, ...) this means that only the
4995 Latex(ostream &, ...) will be used. This is a work in progress to
4996 move towards using streams for all output of files.
4998 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5001 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5003 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5004 routine (this fixes bug where greek letters were surrounded by too
5007 * src/support/filetools.C (findtexfile): change a bit the search
5008 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5009 no longer passed to kpsewhich, we may have to change that later.
5011 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5012 warning options to avoid problems with X header files (from Angus
5014 * acinclude.m4: regenerated.
5016 2000-03-02 Juergen Vigna <jug@sad.it>
5018 * src/insets/insettext.C (WriteParagraphData): Using the
5019 par->writeFile() function for writing paragraph-data.
5020 (Read): Using buffer->parseSingleLyXformat2Token()-function
5021 for parsing paragraph data!
5023 * src/buffer.C (readLyXformat2): removed all parse data and using
5024 the new parseSingleLyXformat2Token()-function.
5025 (parseSingleLyXformat2Token): added this function to parse (read)
5026 lyx-file-format (this is called also from text-insets now!)
5028 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5030 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5033 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5034 directly instead of going through a func. One very bad thing: a
5035 static LyXFindReplace, but I don't know where to place it.
5037 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5038 string instead of char[]. Also changed to static.
5039 (GetSelectionOrWordAtCursor): changed to static inline
5040 (SetSelectionOverLenChars): ditto.
5042 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5043 current_view and global variables. both classes has changed names
5044 and LyXFindReplace is not inherited from SearchForm.
5046 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5047 fl_form_search form.
5049 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5051 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5053 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5054 bound (from Kayvan).
5056 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5058 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5060 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5062 * some things that I should comment but the local pub says head to
5065 * comment out all code that belongs to the Roff code for Ascii
5066 export of tables. (this is unused)
5068 * src/LyXView.C: use correct type for global variable
5069 current_layout. (LyXTextClass::size_type)
5071 * some code to get the new insetgraphics closer to working I'd be
5072 grateful for any help.
5074 * src/BufferView2.C (insertInset): use the return type of
5075 NumberOfLayout properly. (also changes in other files)
5077 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5078 this as a test. I want to know what breaks because of this.
5080 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5082 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5084 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5085 to use a \makebox in the label, this allows proper justification
5086 with out using protected spaces or multiple hfills. Now it is
5087 "label" for left justified, "\hfill label\hfill" for center, and
5088 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5089 should be changed accordingly.
5091 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5093 * src/lyxtext.h: change SetLayout() to take a
5094 LyXTextClass::size_type instead of a char (when there is more than
5095 127 layouts in a class); also change type of copylayouttype.
5096 * src/text2.C (SetLayout): ditto.
5097 * src/LyXView.C (updateLayoutChoice): ditto.
5099 * src/LaTeX.C (scanLogFile): errors where the line number was not
5100 given just after the '!'-line were ignored (from Dekel Tsur).
5102 * lib/lyxrc.example: fix description of \date_insert_format
5104 * lib/layouts/llncs.layout: new layout, contributed by Martin
5107 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5109 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5110 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5111 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5112 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5113 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5114 paragraph.C, text.C, text2.C)
5116 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5118 * src/insets/insettext.C (LocalDispatch): remove extra break
5121 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5122 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5124 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5125 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5127 * src/insets/insetbib.h: move InsetBibkey::Holder and
5128 InsetCitation::Holder in public space.
5130 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5132 * src/insets/insettext.h: small change to get the new files from
5133 Juergen to compile (use "string", not "class string").
5135 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5136 const & as parameter to LocalDispatch, use LyXFont const & as
5137 paramter to some other func. This also had impacto on lyxinsets.h
5138 and the two mathed insets.
5140 2000-02-24 Juergen Vigna <jug@sad.it>
5143 * src/commandtags.h:
5145 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5149 * src/BufferView2.C: added/updated code for various inset-functions
5151 * src/insets/insetert.[Ch]: added implementation of InsetERT
5153 * src/insets/insettext.[Ch]: added implementation of InsetText
5155 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5156 (draw): added preliminary code for inset scrolling not finshed yet
5158 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5159 as it is in lyxfunc.C now
5161 * src/insets/lyxinset.h: Added functions for text-insets
5163 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5165 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5166 BufferView and reimplement the list as a queue put inside its own
5169 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5171 * several files: use the new interface to the "updateinsetlist"
5173 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5175 (work_area_handler): call BufferView::trippleClick on trippleclick.
5177 * src/BufferView.C (doubleClick): new function, selects word on
5179 (trippleClick): new function, selects line on trippleclick.
5181 2000-02-22 Allan Rae <rae@lyx.org>
5183 * lib/bind/xemacs.bind: buffer-previous not supported
5185 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5187 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5190 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5192 * src/bufferlist.C: get rid of current_view from this file
5194 * src/spellchecker.C: get rid of current_view from this file
5196 * src/vspace.C: get rid of current_view from this file
5197 (inPixels): added BufferView parameter for this func
5198 (asLatexCommand): added a BufferParams for this func
5200 * src/text.C src/text2.C: get rid of current_view from these
5203 * src/lyxfont.C (getFontDirection): move this function here from
5206 * src/bufferparams.C (getDocumentDirection): move this function
5209 * src/paragraph.C (getParDirection): move this function here from
5211 (getLetterDirection): ditto
5213 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5215 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5216 resize due to wrong pixmap beeing used. Also took the opurtunity
5217 to make the LyXScreen stateless on regard to WorkArea and some
5218 general cleanup in the same files.
5220 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5222 * src/Makefile.am: add missing direction.h
5224 * src/PainterBase.h: made the width functions const.
5226 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5229 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5231 * src/insets/insetlatexaccent.C (draw): make the accents draw
5232 better, at present this will only work well with iso8859-1.
5234 * several files: remove the old drawing code, now we use the new
5237 * several files: remove support for mono_video, reverse_video and
5240 2000-02-17 Juergen Vigna <jug@sad.it>
5242 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5243 int ** as we have to return the pointer, otherwise we have only
5244 NULL pointers in the returning function.
5246 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5248 * src/LaTeX.C (operator()): quote file name when running latex.
5250 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5252 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5253 (bubble tip), this removes our special handling of this.
5255 * Remove all code that is unused now that we have the new
5256 workarea. (Code that are not active when NEW_WA is defined.)
5258 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5260 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5262 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5263 nonexisting layout; correctly redirect obsoleted layouts.
5265 * lib/lyxrc.example: document \view_dvi_paper_option
5267 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5270 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5271 (PreviewDVI): handle the view_dvi_paper_option variable.
5272 [Both from Roland Krause]
5274 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5276 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5277 char const *, int, LyXFont)
5278 (text(int, int, string, LyXFont)): ditto
5280 * src/text.C (InsertCharInTable): attempt to fix the double-space
5281 feature in tables too.
5282 (BackspaceInTable): ditto.
5283 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5285 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5287 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5289 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5290 newly found text in textcache to this.
5291 (buffer): set the owner of the text put into the textcache to 0
5293 * src/insets/figinset.C (draw): fixed the drawing of figures with
5296 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5297 drawing of mathframe, hfills, protected space, table lines. I have
5298 now no outstanding drawing problems with the new Painter code.
5300 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5302 * src/PainterBase.C (ellipse, circle): do not specify the default
5305 * src/LColor.h: add using directive.
5307 * src/Painter.[Ch]: change return type of methods from Painter& to
5308 PainterBase&. Add a using directive.
5310 * src/WorkArea.C: wrap xforms callbacks in C functions
5313 * lib/layouts/foils.layout: font fix and simplifications from Carl
5316 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5318 * a lot of files: The Painter, LColor and WorkArea from the old
5319 devel branch has been ported to lyx-devel. Some new files and a
5320 lot of #ifdeffed code. The new workarea is enabled by default, but
5321 if you want to test the new Painter and LColor you have to compile
5322 with USE_PAINTER defined (do this in config.h f.ex.) There are
5323 still some rought edges, and I'd like some help to clear those
5324 out. It looks stable (loads and displays the Userguide very well).
5327 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5329 * src/buffer.C (pop_tag): revert to the previous implementation
5330 (use a global variable for both loops).
5332 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5334 * src/lyxrc.C (LyXRC): change slightly default date format.
5336 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5337 there is an English text with a footnote that starts with a Hebrew
5338 paragraph, or vice versa.
5339 (TeXFootnote): ditto.
5341 * src/text.C (LeftMargin): allow for negative values for
5342 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5345 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5346 for input encoding (cyrillic)
5348 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5350 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5353 * src/toolbar.C (set): ditto
5354 * src/insets/insetbib.C (create_form_citation_form): ditto
5356 * lib/CREDITS: added Dekel Tsur.
5358 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5359 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5360 hebrew supports files from Dekel Tsur.
5362 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5363 <tzafrir@technion.ac.il>
5365 * src/lyxrc.C: put \date_insert_format at the right place.
5367 * src/buffer.C (makeLaTeXFile): fix the handling of
5368 BufferParams::sides when writing out latex files.
5370 * src/BufferView2.C: add a "using" directive.
5372 * src/support/lyxsum.C (sum): when we use lyxstring,
5373 ostringstream::str needs an additional .c_str().
5375 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5377 * src/support/filetools.C (ChangeExtension): patch from Etienne
5380 * src/TextCache.C (show): remove const_cast and make second
5381 parameter non-const LyXText *.
5383 * src/TextCache.h: use non const LyXText in show.
5385 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5388 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5390 * src/support/lyxsum.C: rework to be more flexible.
5392 * several places: don't check if a pointer is 0 if you are going
5395 * src/text.C: remove some dead code.
5397 * src/insets/figinset.C: remove some dead code
5399 * src/buffer.C: move the BufferView funcs to BufferView2.C
5400 remove all support for insetlatexdel
5401 remove support for oldpapersize stuff
5402 made some member funcs const
5404 * src/kbmap.C: use a std::list to store the bindings in.
5406 * src/BufferView2.C: new file
5408 * src/kbsequence.[Ch]: new files
5410 * src/LyXAction.C + others: remove all trace of buffer-previous
5412 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5413 only have one copy in the binary of this table.
5415 * hebrew patch: moved some functions from LyXText to more
5416 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5418 * several files: remove support for XForms older than 0.88
5420 remove some #if 0 #endif code
5422 * src/TextCache.[Ch]: new file. Holds the textcache.
5424 * src/BufferView.C: changes to use the new TextCache interface.
5425 (waitForX): remove the now unused code.
5427 * src/BackStack.h: remove some commented code
5429 * lib/bind/emacs.bind: remove binding for buffer-previous
5431 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5433 * applied the hebrew patch.
5435 * src/lyxrow.h: make sure that all Row variables are initialized.
5437 * src/text2.C (TextHandleUndo): comment out a delete, this might
5438 introduce a memory leak, but should also help us to not try to
5439 read freed memory. We need to look at this one.
5441 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5442 (LyXParagraph): initalize footnotekind.
5444 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5445 forgot this when applying the patch. Please heed the warnings.
5447 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5448 (aka. reformat problem)
5450 * src/bufferlist.C (exists): made const, and use const_iterator
5451 (isLoaded): new func.
5452 (release): use std::find to find the correct buffer.
5454 * src/bufferlist.h: made getState a const func.
5455 made empty a const func.
5456 made exists a const func.
5459 2000-02-01 Juergen Vigna <jug@sad.it>
5461 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5463 * po/it.po: updated a bit the italian po file and also changed the
5464 'file nuovo' for newfile to 'filenuovo' without a space, this did
5467 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5468 for the new insert_date command.
5470 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5471 from jdblair, to insert a date into the current text conforming to
5472 a strftime format (for now only considering the locale-set and not
5473 the document-language).
5475 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5477 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5478 Bounds Read error seen by purify. The problem was that islower is
5479 a macros which takes an unsigned char and uses it as an index for
5480 in array of characters properties (and is thus subject to the
5484 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5485 correctly the paper sides radio buttons.
5486 (UpdateDocumentButtons): ditto.
5488 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5490 * src/kbmap.C (getsym + others): change to return unsigned int,
5491 returning a long can give problems on 64 bit systems. (I assume
5492 that int is 32bit on 64bit systems)
5494 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5496 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5497 LyXLookupString to be zero-terminated. Really fixes problems seen
5500 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5502 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5503 write a (char*)0 to the lyxerr stream.
5505 * src/lastfiles.C: move algorithm before the using statemets.
5507 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5509 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5510 complains otherwise).
5511 * src/table.C: ditto
5513 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5516 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5517 that I removed earlier... It is really needed.
5519 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5521 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5523 * INSTALL: update xforms home page URL.
5525 * lib/configure.m4: fix a bug with unreadable layout files.
5527 * src/table.C (calculate_width_of_column): add "using std::max"
5530 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5532 * several files: marked several lines with "DEL LINE", this is
5533 lines that can be deleted without changing anything.
5534 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5535 checks this anyway */
5538 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5540 * src/DepTable.C (update): add a "+" at the end when the checksum
5541 is different. (debugging string only)
5543 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5544 the next inset to not be displayed. This should also fix the list
5545 of labels in the "Insert Crossreference" dialog.
5547 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5549 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5550 when regex was not found.
5552 * src/support/lstrings.C (lowercase): use handcoded transform always.
5555 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5556 old_cursor.par->prev could be 0.
5558 * several files: changed post inc/dec to pre inc/dec
5560 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5561 write the lastfiles to file.
5563 * src/BufferView.C (buffer): only show TextCache info when debugging
5565 (resizeCurrentBuffer): ditto
5566 (workAreaExpose): ditto
5568 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5570 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5572 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5573 a bit better by removing the special case for \i and \j.
5575 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5577 * src/lyx_main.C (easyParse): remove test for bad comand line
5578 options, since this broke all xforms-related parsing.
5580 * src/kbmap.C (getsym): set return type to unsigned long, as
5581 declared in header. On an alpha, long is _not_ the same as int.
5583 * src/support/LOstream.h: add a "using std::flush;"
5585 * src/insets/figinset.C: ditto.
5587 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5589 * src/bufferlist.C (write): use blinding fast file copy instead of
5590 "a char at a time", now we are doing it the C++ way.
5592 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5593 std::list<int> instead.
5594 (addpidwait): reflect move to std::list<int>
5595 (sigchldchecker): ditto
5597 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5600 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5601 that obviously was wrong...
5603 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5604 c, this avoids warnings with purify and islower.
5606 * src/insets/figinset.C: rename struct queue to struct
5607 queue_element and rewrite to use a std::queue. gsqueue is now a
5608 std::queue<queue_element>
5609 (runqueue): reflect move to std::queue
5612 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5613 we would get "1" "0" instead of "true" "false. Also make the tostr
5616 2000-01-21 Juergen Vigna <jug@sad.it>
5618 * src/buffer.C (writeFileAscii): Disabled code for special groff
5619 handling of tabulars till I fix this in table.C
5621 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5623 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5625 * src/support/lyxlib.h: ditto.
5627 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5629 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5630 and 'j' look better. This might fix the "macron" bug that has been
5633 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5634 functions as one template function. Delete the old versions.
5636 * src/support/lyxsum.C: move using std::ifstream inside
5639 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5642 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5644 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5646 * src/insets/figinset.C (InitFigures): use new instead of malloc
5647 to allocate memory for figures and bitmaps.
5648 (DoneFigures): use delete[] instead of free to deallocate memory
5649 for figures and bitmaps.
5650 (runqueue): use new to allocate
5651 (getfigdata): use new/delete[] instead of malloc/free
5652 (RegisterFigure): ditto
5654 * some files: moved some declarations closer to first use, small
5655 whitespace changes use preincrement instead of postincrement where
5656 it does not make a difference.
5658 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5659 step on the way to use stl::containers for key maps.
5661 * src/bufferlist.h: add a typedef for const_iterator and const
5662 versions of begin and end.
5664 * src/bufferlist.[Ch]: change name of member variable _state to
5665 state_. (avoid reserved names)
5667 (getFileNames): returns the filenames of the buffers in a vector.
5669 * configure.in (ALL_LINGUAS): added ro
5671 * src/support/putenv.C: new file
5673 * src/support/mkdir.C: new file
5675 2000-01-20 Allan Rae <rae@lyx.org>
5677 * lib/layouts/IEEEtran.layout: Added several theorem environments
5679 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5680 couple of minor additions.
5682 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
5683 (except for those in footnotes of course)
5685 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5687 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
5689 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
5690 std::sort and std::lower_bound instead of qsort and handwritten
5692 (struct compara): struct that holds the functors used by std::sort
5693 and std::lower_bound in MathedLookupBOP.
5695 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5697 * src/support/LAssert.h: do not do partial specialization. We do
5700 * src/support/lyxlib.h: note that lyx::getUserName() and
5701 lyx::date() are not in use right now. Should these be suppressed?
5703 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
5704 (makeLinuxDocFile): do not put date and user name in linuxdoc
5707 * src/support/lyxlib.h (kill): change first argument to long int,
5708 since that's what solaris uses.
5710 * src/support/kill.C (kill): fix declaration to match prototype.
5712 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
5713 actually check whether namespaces are supported. This is not what
5716 * src/support/lyxsum.C: add a using directive.
5718 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5720 * src/support/kill.C: if we have namespace support we don't have
5721 to include lyxlib.h.
5723 * src/support/lyxlib.h: use namespace lyx if supported.
5725 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5727 * src/support/date.C: new file
5729 * src/support/chdir.C: new file
5731 * src/support/getUserName.C: new file
5733 * src/support/getcwd.C: new file
5735 * src/support/abort.C: new file
5737 * src/support/kill.C: new file
5739 * src/support/lyxlib.h: moved all the functions in this file
5740 insede struct lyx. Added also kill and abort to this struct. This
5741 is a way to avoid the "kill is not defined in <csignal>", we make
5742 C++ wrappers for functions that are not ANSI C or ANSI C++.
5744 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
5745 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
5746 lyx it has been renamed to sum.
5748 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5750 * src/text.C: add using directives for std::min and std::max.
5752 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5754 * src/texrow.C (getIdFromRow): actually return something useful in
5755 id and pos. Hopefully fixes the bug with positionning of errorbox
5758 * src/lyx_main.C (easyParse): output an error and exit if an
5759 incorrect command line option has been given.
5761 * src/spellchecker.C (ispell_check_word): document a memory leak.
5763 * src/bufferlist.C (write): fix mismatched allocation/deletion,
5764 where a "struct utimbuf" is allocated with "new" and deleted with
5767 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
5769 * src/text2.C (CutSelection): don't delete double spaces.
5770 (PasteSelection): ditto
5771 (CopySelection): ditto
5773 * src/text.C (Backspace): don't delete double spaces.
5775 * src/lyxlex.C (next): fix a bug that were only present with
5776 conformant std::istream::get to read comment lines, use
5777 std::istream::getline instead. This seems to fix the problem.
5779 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5781 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
5782 allowed to insert space before space" editing problem. Please read
5783 commends at the beginning of the function. Comments about usage
5786 * src/text.C (InsertChar): fix for the "not allowed to insert
5787 space before space" editing problem.
5789 * src/text2.C (DeleteEmptyParagraphMechanism): when
5790 IsEmptyTableRow can only return false this last "else if" will
5791 always be a no-op. Commented out.
5793 * src/text.C (RedoParagraph): As far as I can understand tmp
5794 cursor is not really needed.
5796 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
5797 present it could only return false anyway.
5798 (several functions): Did something not so smart...added a const
5799 specifier on a lot of methods.
5801 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
5802 and add a tmp->text.resize. The LyXParagraph constructor does the
5804 (BreakParagraphConservative): ditto
5806 * src/support/path.h (Path): add a define so that the wrong usage
5807 "Path("/tmp") will be flagged as a compilation error:
5808 "`unnamed_Path' undeclared (first use this function)"
5810 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5812 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
5813 which was bogus for several reasons.
5815 * src/LaTeX.C (scanAux): fix the regular expression used to scan
5819 * autogen.sh: do not use "type -path" (what's that anyway?).
5821 * src/support/filetools.C (findtexfile): remove extraneous space
5822 which caused a kpsewhich warning (at least with kpathsea version
5825 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5827 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
5829 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
5831 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
5833 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5835 * src/paragraph.C (BreakParagraph): do not reserve space on text
5836 if we don't need to (otherwise, if pos_end < pos, we end up
5837 reserving huge amounts of memory due to bad unsigned karma).
5838 (BreakParagraphConservative): ditto, although I have not seen
5839 evidence the bug can happen here.
5841 * src/lyxparagraph.h: add a using std::list.
5843 2000-01-11 Juergen Vigna <jug@sad.it>
5845 * src/menus.C (MenuDocu): output an Alert if the documentation-file
5848 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5850 * src/vc-backend.C (doVCCommand): change to be static and take one
5851 more parameter: the path to chdir too be fore executing the command.
5852 (retrive): new function equiv to "co -r"
5854 * src/bufferlist.C (loadLyXFile): implement the missing parts if
5855 file_not_found_hook is true.
5857 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
5859 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
5860 if a file is readwrite,readonly...anything else.
5862 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5864 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
5865 (CreatePostscript): name change from MenuRunDVIPS (or something)
5866 (PreviewPostscript): name change from MenuPreviewPS
5867 (PreviewDVI): name change from MenuPreviewDVI
5869 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
5870 \view_pdf_command., \pdf_to_ps_command
5872 * lib/configure.m4: added search for PDF viewer, and search for
5873 PDF to PS converter.
5874 (lyxrc.defaults output): add \pdflatex_command,
5875 \view_pdf_command and \pdf_to_ps_command.
5877 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
5879 * src/bufferlist.C (write): we don't use blocksize for anything so
5882 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5884 * src/support/block.h: disable operator T* (), since it causes
5885 problems with both compilers I tried. See comments in the file.
5887 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
5890 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
5891 variable LYX_DIR_10x to LYX_DIR_11x.
5893 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
5895 * INSTALL: document --with-lyxname.
5898 * configure.in: new configure flag --with-lyxname which allows to
5899 choose the name under which lyx is installed. Default is "lyx", of
5900 course. It used to be possible to do this with --program-suffix,
5901 but the later has in fact a different meaning for autoconf.
5903 * src/support/lstrings.h (lstrchr): reformat a bit.
5905 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
5906 * src/mathed/math_defs.h: ditto.
5908 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5910 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
5911 true, decides if we create a backup file or not when saving. New
5912 tag and variable \pdf_mode, defaults to false. New tag and
5913 variable \pdflatex_command, defaults to pdflatex. New tag and
5914 variable \view_pdf_command, defaults to xpdf. New tag and variable
5915 \pdf_to_ps_command, defaults to pdf2ps.
5917 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5919 * src/bufferlist.C (close): don't call insetUnlock if the buffer
5920 does not have a BufferView.
5921 (unlockInset): ditto + don't access the_locking_inset if the
5922 buffer does not have a BufferView.
5924 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
5925 certain circumstances so that we don't continue a keyboard
5926 operation long after the key was released. Try f.ex. to load a
5927 large document, press PageDown for some seconds and then release
5928 it. Before this change the document would contine to scroll for
5929 some time, with this change it stops imidiatly.
5931 * src/support/block.h: don't allocate more space than needed. As
5932 long as we don't try to write to the arr[x] in a array_type arr[x]
5933 it is perfectly ok. (if you write to it you might segfault).
5934 added operator value_type*() so that is possible to pass the array
5935 to functions expecting a C-pointer.
5937 * lib/Makefile.am (dist-hook): don't fail completely if unable to
5940 * intl/*: updated to gettext 0.10.35, tried to add our own
5941 required modifications. Please verify.
5943 * po/*: updated to gettext 0.10.35, tried to add our own required
5944 modifications. Please verify.
5946 * src/support/lstrings.C (tostr): go at fixing the problem with
5947 cxx and stringstream. When stringstream is used return
5948 oss.str().c_str() so that problems with lyxstring and basic_string
5949 are avoided. Note that the best solution would be for cxx to use
5950 basic_string all the way, but it is not conformant yet. (it seems)
5952 * src/lyx_cb.C + other files: moved several global functions to
5953 class BufferView, some have been moved to BufferView.[Ch] others
5954 are still located in lyx_cb.C. Code changes because of this. (part
5955 of "get rid of current_view project".)
5957 * src/buffer.C + other files: moved several Buffer functions to
5958 class BufferView, the functions are still present in buffer.C.
5959 Code changes because of this.
5961 * config/lcmessage.m4: updated to most recent. used when creating
5964 * config/progtest.m4: updated to most recent. used when creating
5967 * config/gettext.m4: updated to most recent. applied patch for
5970 * config/gettext.m4.patch: new file that shows what changes we
5971 have done to the local copy of gettext.m4.
5973 * config/libtool.m4: new file, used in creation of acinclude.m4
5975 * config/lyxinclude.m4: new file, this is the lyx created m4
5976 macros, used in making acinclude.m4.
5978 * autogen.sh: GNU m4 discovered as a separate task not as part of
5979 the lib/configure creation.
5980 Generate acinlucde from files in config. Actually cat
5981 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
5982 easier to upgrade .m4 files that really are external.
5984 * src/Spacing.h: moved using std::istringstream to right after
5985 <sstream>. This should fix the problem seen with some compilers.
5987 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5989 * src/lyx_cb.C: began some work to remove the dependency a lot of
5990 functions have on BufferView::text, even if not really needed.
5991 (GetCurrentTextClass): removed this func, it only hid the
5994 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
5995 forgot this in last commit.
5997 * src/Bullet.C (bulletEntry): use static char const *[] for the
5998 tables, becuase of this the return arg had to change to string.
6000 (~Bullet): removed unneeded destructor
6002 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6003 (insetSleep): moved from Buffer
6004 (insetWakeup): moved from Buffer
6005 (insetUnlock): moved from Buffer
6007 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6008 from Buffer to BufferView.
6010 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6012 * config/ltmain.sh: updated to version 1.3.4 of libtool
6014 * config/ltconfig: updated to version 1.3.4 of libtool
6016 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6019 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6020 Did I get that right?
6022 * src/lyxlex.h: add a "using" directive or two.
6023 * src/Spacing.h: ditto.
6024 * src/insets/figinset.C: ditto.
6025 * src/support/filetools.C: ditto.
6026 * src/support/lstrings.C: ditto.
6027 * src/BufferView.C: ditto.
6028 * src/bufferlist.C: ditto.
6029 * src/lyx_cb.C: ditto.
6030 * src/lyxlex.C: ditto.
6032 * NEWS: add some changes for 1.1.4.
6034 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6036 * src/BufferView.C: first go at a TextCache to speed up switching
6039 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6041 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6042 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6043 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6044 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6047 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6048 members of the struct are correctly initialized to 0 (detected by
6050 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6051 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6053 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6054 pidwait, since it was allocated with "new". This was potentially
6055 very bad. Thanks to Michael Schmitt for running purify for us.
6058 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6060 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6062 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6064 1999-12-30 Allan Rae <rae@lyx.org>
6066 * lib/templates/IEEEtran.lyx: minor change
6068 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6069 src/mathed/formula.C (LocalDispatch): askForText changes
6071 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6072 know when a user has cancelled input. Fixes annoying problems with
6073 inserting labels and version control.
6075 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6077 * src/support/lstrings.C (tostr): rewritten to use strstream and
6080 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6082 * src/support/filetools.C (IsFileWriteable): use fstream to check
6083 (IsDirWriteable): use fileinfo to check
6085 * src/support/filetools.h (FilePtr): whole class deleted
6087 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6089 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6091 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6093 * src/bufferlist.C (write): use ifstream and ofstream instead of
6096 * src/Spacing.h: use istrstream instead of sscanf
6098 * src/mathed/math_defs.h: change first arg to istream from FILE*
6100 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6102 * src/mathed/math_parser.C: have yyis to be an istream
6103 (LexGetArg): use istream (yyis)
6105 (mathed_parse): ditto
6106 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6108 * src/mathed/formula.C (Read): rewritten to use istream
6110 * src/mathed/formulamacro.C (Read): rewritten to use istream
6112 * src/lyxlex.h (~LyXLex): deleted desturctor
6113 (getStream): new function, returns an istream
6114 (getFile): deleted funtion
6115 (IsOK): return is.good();
6117 * src/lyxlex.C (LyXLex): delete file and owns_file
6118 (setFile): open an filebuf and assign that to a istream instead of
6120 (setStream): new function, takes an istream as arg.
6121 (setFile): deleted function
6122 (EatLine): rewritten us use istream instead of FILE*
6126 * src/table.C (LyXTable): use istream instead of FILE*
6127 (Read): rewritten to take an istream instead of FILE*
6129 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6131 * src/buffer.C (Dispatch): remove an extraneous break statement.
6133 * src/support/filetools.C (QuoteName): change to do simple
6134 'quoting'. More work is necessary. Also changed to do nothing
6135 under emx (needs fix too).
6136 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6138 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6139 config.h.in to the AC_DEFINE_UNQUOTED() call.
6140 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6141 needs char * as argument (because Solaris 7 declares it like
6144 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6145 remove definition of BZERO.
6147 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6149 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6150 defined, "lyxregex.h" if not.
6152 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6154 (REGEX): new variable that is set to regex.c lyxregex.h when
6155 AM_CONDITIONAL USE_REGEX is set.
6156 (libsupport_la_SOURCES): add $(REGEX)
6158 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6161 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6164 * configure.in: add call to LYX_REGEX
6166 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6167 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6169 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6171 * lib/bind/fi_menus.bind: new file, from
6172 pauli.virtanen@saunalahti.fi.
6174 * src/buffer.C (getBibkeyList): pass the parameter delim to
6175 InsetInclude::getKeys and InsetBibtex::getKeys.
6177 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6178 is passed to Buffer::getBibkeyList
6180 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6181 instead of the hardcoded comma.
6183 * src/insets/insetbib.C (getKeys): make sure that there are not
6184 leading blanks in bibtex keys. Normal latex does not care, but
6185 harvard.sty seems to dislike blanks at the beginning of citation
6186 keys. In particular, the retturn value of the function is
6188 * INSTALL: make it clear that libstdc++ is needed and that gcc
6189 2.7.x probably does not work.
6191 * src/support/filetools.C (findtexfile): make debug message go to
6193 * src/insets/insetbib.C (getKeys): ditto
6195 * src/debug.C (showTags): make sure that the output is correctly
6198 * configure.in: add a comment for TWO_COLOR_ICON define.
6200 * acconfig.h: remove all the entries that already defined in
6201 configure.in or acinclude.m4.
6203 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6204 to avoid user name, date and copyright.
6206 1999-12-21 Juergen Vigna <jug@sad.it>
6208 * src/table.C (Read): Now read bogus row format informations
6209 if the format is < 5 so that afterwards the table can
6210 be read by lyx but without any format-info. Fixed the
6211 crash we experienced when not doing this.
6213 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6215 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6216 (RedoDrawingOfParagraph): ditto
6217 (RedoParagraphs): ditto
6218 (RemoveTableRow): ditto
6220 * src/text.C (Fill): rename arg paperwidth -> paper_width
6222 * src/buffer.C (insertLyXFile): rename var filename -> fname
6223 (writeFile): rename arg filename -> fname
6224 (writeFileAscii): ditto
6225 (makeLaTeXFile): ditto
6226 (makeLinuxDocFile): ditto
6227 (makeDocBookFile): ditto
6229 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6232 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6234 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6237 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6238 compiled by a C compiler not C++.
6240 * src/layout.h (LyXTextClass): added typedef for const_iterator
6241 (LyXTextClassList): added typedef for const_iterator + member
6242 functions begin and end.
6244 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6245 iterators to fill the choice_class.
6246 (updateLayoutChoice): rewritten to use iterators to fill the
6247 layoutlist in the toolbar.
6249 * src/BufferView.h (BufferView::work_area_width): removed unused
6252 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6254 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6255 (sgmlCloseTag): ditto
6257 * src/support/lstrings.h: return type of countChar changed to
6260 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6261 what version of this func to use. Also made to return unsigned int.
6263 * configure.in: call LYX_STD_COUNT
6265 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6266 conforming std::count.
6268 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6270 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6271 and a subscript would give bad display (patch from Dekel Tsur
6272 <dekel@math.tau.ac.il>).
6274 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6276 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6279 * src/chset.h: add a few 'using' directives
6281 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6282 triggered when no buffer is active
6284 * src/layout.C: removed `break' after `return' in switch(), since
6287 * src/lyx_main.C (init): make sure LyX can be ran in place even
6288 when libtool has done its magic with shared libraries. Fix the
6289 test for the case when the system directory has not been found.
6291 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6292 name for the latex file.
6293 (MenuMakeHTML): ditto
6295 * src/buffer.h: add an optional boolean argument, which is passed
6298 1999-12-20 Allan Rae <rae@lyx.org>
6300 * lib/templates/IEEEtran.lyx: small correction and update.
6302 * configure.in: Attempted to use LYX_PATH_HEADER
6304 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6306 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6307 input from JMarc. Now use preprocessor to find the header.
6308 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6309 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6310 LYX_STL_STRING_FWD. See comments in file.
6312 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6314 * The global MiniBuffer * minibuffer variable is dead.
6316 * The global FD_form_main * fd_form_main variable is dead.
6318 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6320 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6322 * src/table.h: add the LOstream.h header
6323 * src/debug.h: ditto
6325 * src/LyXAction.h: change the explaination of the ReadOnly
6326 attribute: is indicates that the function _can_ be used.
6328 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6331 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6333 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6339 * src/paragraph.C (GetWord): assert on pos>=0
6342 * src/support/lyxstring.C: condition the use of an invariant on
6344 * src/support/lyxstring.h: ditto
6346 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6347 Use LAssert.h instead of plain assert().
6349 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6351 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6352 * src/support/filetools.C: ditto
6354 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6357 * INSTALL: document the new configure flags
6359 * configure.in: suppress --with-debug; add --enable-assertions
6361 * acinclude.m4: various changes in alignment of help strings.
6363 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6365 * src/kbmap.C: commented out the use of the hash map in kb_map,
6366 beginning of movement to a stl::container.
6368 * several files: removed code that was not in effect when
6369 MOVE_TEXT was defined.
6371 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6372 for escaping should not be used. We can discuss if the string
6373 should be enclosed in f.ex. [] instead of "".
6375 * src/trans_mgr.C (insert): use the new returned value from
6376 encodeString to get deadkeys and keymaps done correctly.
6378 * src/chset.C (encodeString): changed to return a pair, to tell
6379 what to use if we know the string.
6381 * src/lyxscreen.h (fillArc): new function.
6383 * src/FontInfo.C (resize): rewritten to use more std::string like
6384 structore, especially string::replace.
6386 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6389 * configure.in (chmod +x some scripts): remove config/gcc-hack
6391 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6393 * src/buffer.C (writeFile): change once again the top comment in a
6394 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6395 instead of an hardcoded version number.
6396 (makeDocBookFile): ditto
6398 * src/version.h: add new define LYX_DOCVERSION
6400 * po/de.po: update from Pit Sütterlin
6401 * lib/bind/de_menus.bind: ditto.
6403 * src/lyxfunc.C (Dispatch): call MenuExport()
6404 * src/buffer.C (Dispatch): ditto
6406 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6407 LyXFunc::Dispatch().
6408 (MenuExport): new function, moved from
6409 LyXFunc::Dispatch().
6411 * src/trans_mgr.C (insert): small cleanup
6412 * src/chset.C (loadFile): ditto
6414 * lib/kbd/iso8859-1.cdef: add missing backslashes
6416 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6418 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6419 help with placing the manually drawn accents better.
6421 (Draw): x2 and hg changed to float to minimize rounding errors and
6422 help place the accents better.
6424 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6425 unsigned short to char is just wrong...cast the char to unsigned
6426 char instead so that the two values can compare sanely. This
6427 should also make the display of insetlatexaccents better and
6428 perhaps also some other insets.
6430 (lbearing): new function
6433 1999-12-15 Allan Rae <rae@lyx.org>
6435 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6436 header that provides a wrapper around the very annoying SGI STL header
6439 * src/support/lyxstring.C, src/LString.h:
6440 removed old SGI-STL-compatability attempts.
6442 * configure.in: Use LYX_STL_STRING_FWD.
6444 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6445 stl_string_fwd.h is around and try to determine it's location.
6446 Major improvement over previous SGI STL 3.2 compatability.
6447 Three small problems remain with this function due to my zero
6448 knowledge of autoconf. JMarc and lgb see the comments in the code.
6450 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6452 * src/broken_const.h, config/hack-gcc, config/README: removed
6454 * configure.in: remove --with-gcc-hack option; do not call
6457 * INSTALL: remove documentation of --with-broken-const and
6460 * acconfig.h: remove all trace of BROKEN_CONST define
6462 * src/buffer.C (makeDocBookFile): update version number in output
6464 (SimpleDocBookOnePar): fix an assert when trying to a character
6465 access beyond string length
6468 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6470 * po/de.po: fix the Export menu
6472 * lyx.man: update the description of -dbg
6474 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6475 (commandLineHelp): updated
6476 (easyParse): show list of available debug levels if -dbg is passed
6479 * src/Makefile.am: add debug.C
6481 * src/debug.h: moved some code to debug.C
6483 * src/debug.C: new file. Contains code to set and show debug
6486 * src/layout.C: remove 'break' after 'continue' in switch
6487 statements, since these cannot be reached.
6489 1999-12-13 Allan Rae <rae@lyx.org>
6491 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6492 (in_word_set): hash() -> math_hash()
6494 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6496 * acconfig.h: Added a test for whether we are using exceptions in the
6497 current compilation run. If so USING_EXCEPTIONS is defined.
6499 * config.in: Check for existance of stl_string_fwd.h
6500 * src/LString.h: If compiling --with-included-string and SGI's
6501 STL version 3.2 is present (see above test) we need to block their
6502 forward declaration of string and supply a __get_c_string().
6503 However, it turns out this is only necessary if compiling with
6504 exceptions enabled so I've a bit more to add yet.
6506 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6507 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6508 src/support/LRegex.h, src/undo.h:
6509 Shuffle the order of the included files a little to ensure that
6510 LString.h gets included before anything that includes stl_string_fwd.h
6512 * src/support/lyxstring.C: We need to #include LString.h instead of
6513 lyxstring.h to get the necessary definition of __get_c_string.
6514 (__get_c_string): New function. This is defined static just like SGI's
6515 although why they need to do this I'm not sure. Perhaps it should be
6516 in lstrings.C instead.
6518 * lib/templates/IEEEtran.lyx: New template file.
6520 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6522 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6523 * intl/Makefile.in (MKINSTALLDIRS): ditto
6525 * src/LyXAction.C (init): changed to hold the LFUN data in a
6526 automatic array in stead of in callso to newFunc, this speeds up
6527 compilation a lot. Also all the memory used by the array is
6528 returned when the init is completed.
6530 * a lot of files: compiled with -Wold-style-cast, changed most of
6531 the reported offenders to C++ style casts. Did not change the
6532 offenders in C files.
6534 * src/trans.h (Match): change argument type to unsigned int.
6536 * src/support/DebugStream.C: fix some types on the streambufs so
6537 that it works on a conforming implementation.
6539 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6541 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6543 * src/support/lyxstring.C: remove the inline added earlier since
6544 they cause a bunch of unsatisfied symbols when linking with dec
6545 cxx. Cxx likes to have the body of inlines at the place where they
6548 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6549 accessing negative bounds in array. This fixes the crash when
6550 inserting accented characters.
6551 * src/trans.h (Match): ditto
6553 * src/buffer.C (Dispatch): since this is a void, it should not try
6554 to return anything...
6556 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6558 * src/buffer.h: removed the two friends from Buffer. Some changes
6559 because of this. Buffer::getFileName and Buffer::setFileName
6560 renamed to Buffer::fileName() and Buffer::fileName(...).
6562 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6564 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6565 and Buffer::update(short) to BufferView. This move is currently
6566 controlled by a define MOVE_TEXT, this will be removed when all
6567 shows to be ok. This move paves the way for better separation
6568 between buffer contents and buffer view. One side effect is that
6569 the BufferView needs a rebreak when swiching buffers, if we want
6570 to avoid this we can add a cache that holds pointers to LyXText's
6571 that is not currently in use.
6573 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6576 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6578 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6580 * lyx_main.C: new command line option -x (or --execute) and
6581 -e (or --export). Now direct conversion from .lyx to .tex
6582 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6583 Unfortunately, X is still needed and the GUI pops up during the
6586 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6588 * src/Spacing.C: add a using directive to bring stream stuff into
6590 * src/paragraph.C: ditto
6591 * src/buffer.C: ditto
6593 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6594 from Lars' announcement).
6596 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6597 example files from Tino Meinen.
6599 1999-12-06 Allan Rae <rae@lyx.org>
6601 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6603 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6605 * src/support/lyxstring.C: added a lot of inline for no good
6608 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6609 latexWriteEndChanges, they were not used.
6611 * src/layout.h (operator<<): output operator for PageSides
6613 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6615 * some example files: loaded in LyX 1.0.4 and saved again to update
6616 certain constructs (table format)
6618 * a lot of files: did the change to use fstream/iostream for all
6619 writing of files. Done with a close look at Andre Poenitz's patch.
6621 * some files: whitespace changes.
6623 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6625 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6626 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6627 architecture, we provide our own. It is used unconditionnally, but
6628 I do not think this is a performance problem. Thanks to Angus
6629 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6630 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6632 (GetInset): use my_memcpy.
6636 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6637 it is easier to understand, but it uses less TeX-only constructs now.
6639 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6640 elements contain spaces
6642 * lib/configure: regenerated
6644 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6645 elements contain spaces; display the list of programs that are
6648 * autogen.sh: make sure lib/configure is executable
6650 * lib/examples/*: rename the tutorial examples to begin with the
6651 two-letters language code.
6653 * src/lyxfunc.C (getStatus): do not query current font if no
6656 * src/lyx_cb.C (RunScript): use QuoteName
6657 (MenuRunDvips): ditto
6658 (PrintApplyCB): ditto
6660 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6661 around argument, so that it works well with the current shell.
6662 Does not work properly with OS/2 shells currently.
6664 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6665 * src/LyXSendto.C (SendtoApplyCB): ditto
6666 * src/lyxfunc.C (Dispatch): ditto
6667 * src/buffer.C (runLaTeX): ditto
6668 (runLiterate): ditto
6669 (buildProgram): ditto
6671 * src/lyx_cb.C (RunScript): ditto
6672 (MenuMakeLaTeX): ditto
6674 * src/buffer.h (getLatexName): new method
6676 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6678 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6680 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
6681 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
6682 (create_math_panel): ditto
6684 * src/lyxfunc.C (getStatus): re-activate the code which gets
6685 current font and cursor; add test for export to html.
6687 * src/lyxrc.C (read): remove unreachable break statements; add a
6690 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
6692 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6694 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
6695 introduced by faulty regex.
6696 * src/buffer.C: ditto
6697 * src/lastfiles.C: ditto
6698 * src/paragraph.C: ditto
6699 * src/table.C: ditto
6700 * src/vspace.C: ditto
6701 * src/insets/figinset.C: ditto
6702 Note: most of these is absolutely harmless, except the one in
6703 src/mathed formula.C.
6705 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6707 * src/ImportNoweb.C (documentclass): fixed bounds for substr
6708 operation, yielding correct results for the reLyX command.
6710 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6712 * src/support/filetools.C (ExpandPath): removed an over eager
6714 (ReplaceEnvironmentPath): ditto
6716 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
6717 shows that we are doing something fishy in our code...
6721 * src/lyxrc.C (read): use a double switch trick to get more help
6722 from the compiler. (the same trick is used in layout.C)
6723 (write): new function. opens a ofstream and pass that to output
6724 (output): new function, takes a ostream and writes the lyxrc
6725 elemts to it. uses a dummy switch to make sure no elements are
6728 * src/lyxlex.h: added a struct pushpophelper for use in functions
6729 with more than one exit point.
6731 * src/lyxlex.[Ch] (GetInteger): made it const
6735 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
6737 * src/layout.[hC] : LayoutTags splitted into several enums, new
6738 methods created, better error handling cleaner use of lyxlex. Read
6741 * src/bmtable.[Ch]: change some member prototypes because of the
6742 image const changes.
6744 * commandtags.h, src/LyXAction.C (init): new function:
6745 "preferences-save", saves the lyxrc entries into .lyx/preferences.
6746 This file is not read automatically but you can add \input
6747 preferences to your lyxrc if you want to. We need to discuss how
6750 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
6751 in .aux, also remove .bib and .bst files from dependencies when
6754 * src/BufferView.C, src/LyXView.C: add const_cast several places
6755 because of changes to images.
6757 * lib/images/*: same change as for images/*
6759 * lib/lyxrc.example: Default for accept_compound is false not no.
6761 * images/*: changed to be const, however I have som misgivings
6762 about this change so it might be changed back.
6764 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6766 * lib/configure, po/POTFILES.in: regenerated
6768 * autogen.sh: autogenerate lib/configure from lib/configure.m4
6770 * config/lib_configure.m4: removed
6772 * lib/configure.m4: new file (was config/lib_configure.m4)
6774 * configure.in: do not test for rtti, since we do not use it.
6776 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6778 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
6779 doubling of allocated space scheme. This makes it faster for large
6780 strings end to use less memory for small strings. xtra rememoved.
6782 * src/insets/figinset.C (waitalarm): commented out.
6783 (GhostscriptMsg): use static_cast
6784 (GhostscriptMsg): use new instead of malloc to allocate memory for
6785 cmap. also delete the memory after use.
6787 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
6789 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
6790 for changes in bibtex database or style.
6791 (runBibTeX): remove all .bib and .bst files from dep before we
6793 (run): use scanAuc in when dep file already exist.
6795 * src/DepTable.C (remove_files_with_extension): new method
6798 * src/DepTable.[Ch]: made many of the methods const.
6800 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6802 * src/bufferparams.C: make sure that the default textclass is
6803 "article". It used to be the first one by description order, but
6804 now the first one is "docbook".
6806 * src/lyx_main.C (setDebuggingLevel): change type of argument to
6807 string; call Debug::value.
6808 (easyParse): pass complete argument to setDebuggingLevel().
6810 * src/debug.h (value): fix the code that parses debug levels.
6812 * src/debug.h: add new debug type ACTION, reserved for LyXAction
6815 * src/LyXAction.C: use Debug::ACTION as debug channel.
6817 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
6819 * NEWS: updated for the future 1.1.3 release.
6821 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
6822 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
6823 it should. This is of course a controversial change (since many
6824 people will find that their lyx workscreen is suddenly full of
6825 red), but done for the sake of correctness.
6827 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
6828 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
6830 * src/insets/inseterror.h, src/insets/inseturl.h,
6831 src/insets/insetinfo.h, src/insets/figinset.h,
6832 src/mathed/formulamacro.h, src/mathed/math_macro.h
6833 (EditMessage): add a missing const and add _() to make sure that
6836 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
6837 src/insets/insetbib.C, src/support/filetools.C: add `using'
6840 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
6841 doing 'Insert index of last word' at the beginning of a paragraph.
6843 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6845 * several files: white-space changes.
6847 * src/mathed/formula.C: removed IsAlpha and IsDigit
6849 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
6850 .bib file. use a ifstream instead of FilePtr when parsing the .bib
6853 * src/insets/figinset.C (GetPSSizes): don't break when
6854 "EndComments" is seen. But break when a boundingbox is read.
6856 * all classes inherited from Inset: return value of Clone
6857 changed back to Inset *.
6859 * all classes inherited form MathInset: return value of Clone
6860 changed back to MathedInset *.
6862 * src/insets/figinset.C (runqueue): use a ofstream to output the
6863 gs/ps file. Might need some setpresicion or setw. However I can
6864 see no problem with the current code.
6865 (runqueue): use sleep instead of the alarm/signal code. I just
6866 can't see the difference.
6868 * src/paragraph.C (LyXParagraph): reserve space in the new
6869 paragraph and resize the inserted paragraph to just fit.
6871 * src/lyxfunc.h (operator|=): added operator for func_status.
6873 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
6874 check for readable file.
6876 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
6877 check for readable file.
6878 (MenuMakeLinuxDoc): ditto
6879 (MenuMakeDocBook): ditto
6880 (MenuMakeAscii): ditto
6881 (InsertAsciiFile): split the test for openable and readable
6883 * src/bmtable.C (draw_bitmaptable): use
6884 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
6886 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
6887 findtexfile from LaTeX to filetools.
6889 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
6890 instead of FilePtr. Needs to be verified by a literate user.
6892 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6894 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
6895 (EditMessage): likewise.
6897 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
6898 respectively as \textasciitilde and \textasciicircum.
6900 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6902 * src/support/lyxstring.h: made the methods that take iterators
6905 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
6906 (regexMatch): made is use the real regex class.
6908 * src/support/Makefile.am: changed to use libtool
6910 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
6912 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
6914 (MathIsInset ++): changed several macros to be inline functions
6917 * src/mathed/Makefile.am: changed to use libtool
6919 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
6921 * src/insets/inset* : Clone changed to const and return type is
6922 the true insettype not just Inset*.
6924 * src/insets/Makefile.am: changed to use libtool
6926 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
6928 * src/undo.[Ch] : added empty() and changed some of the method
6931 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
6933 * src/lyxparagraph.h: use id() and id(...) instead of getID and
6934 setID use block<> for the bullets array, added const several places.
6936 * src/lyxfunc.C (getStatus): new function
6938 * src/lyxfunc.[Ch] : small changes to take advantage of the new
6939 LyXAction, added const to several funtions.
6941 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
6942 a std::map, and to store the dir items in a vector.
6944 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
6947 * src/LyXView.[Ch] + other files : changed currentView to view.
6949 * src/LyXAction.[Ch] : ported from the old devel branch.
6951 * src/.cvsignore: added .libs and a.out
6953 * configure.in : changes to use libtool.
6955 * acinclude.m4 : inserted libtool.m4
6957 * .cvsignore: added libtool
6959 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6961 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
6962 file name in insets and mathed directories (otherwise the
6963 dependency is not taken in account under cygwin).
6965 * src/text2.C (InsertString[AB]): make sure that we do not try to
6966 read characters past the string length.
6968 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6970 * lib/doc/LaTeXConfig.lyx.in,
6971 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
6973 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
6974 file saying who created them and when this heppened; this is
6975 useless and annoys tools like cvs.
6977 * lib/layouts/g-brief-{en,de}.layout,
6978 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
6979 from Thomas Hartkens <thomas@hartkens.de>.
6981 * src/{insets,mathed}/Makefile.am: do not declare an empty
6982 LDFLAGS, so that it can be set at configure time (useful on Irix
6985 * lib/reLyX/configure.in: make sure that the prefix is set
6986 correctly in LYX_DIR.
6988 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6990 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
6991 be used by 'command-sequence' this allows to bind a key to a
6992 sequence of LyX-commands
6993 (Example: 'command-sequence math-insert alpha; math-insert beta;")
6995 * src/LyXAction.C: add "command-sequence"
6997 * src/LyXFunction.C: handling of "command-sequence"
6999 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7000 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7002 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7004 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7006 * src/buffer.C (writeFile): Do not output a comment giving user
7007 and date at the beginning of a .lyx file. This is useless and
7008 annoys cvs anyway; update version number to 1.1.
7010 * src/Makefile.am (LYX_DIR): add this definition, so that a
7011 default path is hardcoded in LyX.
7013 * configure.in: Use LYX_GNU_GETTEXT.
7015 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7016 AM_GNU_GETTEXT with a bug fixed.
7018 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7020 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7022 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7023 which is used to point to LyX data is now LYX_DIR_11x.
7025 * lyx.man: convert to a unix text file; small updates.
7027 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7029 * src/support/LSubstring.[Ch]: made the second arg of most of the
7030 constructors be a const reference.
7032 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7035 * src/support/lyxstring.[Ch] (swap): added missing member function
7036 and specialization of swap(str, str);
7038 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7040 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7041 trace of the old one.
7043 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7044 put the member definitions in undo.C.
7046 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7047 NEW_TEXT and have now only code that was included when this was
7050 * src/intl.C (LCombo): use static_cast
7052 (DispatchCallback): ditto
7054 * src/definitions.h: removed whole file
7056 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7058 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7059 parsing and stores in a std:map. a regex defines the file format.
7060 removed unneeded members.
7062 * src/bufferparams.h: added several enums from definitions.h here.
7063 Removed unsused destructor. Changed some types to use proper enum
7064 types. use block to have the temp_bullets and user_defined_bullets
7065 and to make the whole class assignable.
7067 * src/bufferparams.C (Copy): removed this functions, use a default
7070 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7073 * src/buffer.C (readLyXformat2): commend out all that have with
7074 oldpapersize to do. also comment out all that hve to do with
7075 insetlatex and insetlatexdel.
7076 (setOldPaperStuff): commented out
7078 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7080 * src/LyXAction.C: remove use of inset-latex-insert
7082 * src/mathed/math_panel.C (button_cb): use static_cast
7084 * src/insets/Makefile.am (insets_o_SOURCES): removed
7087 * src/support/lyxstring.C (helper): use the unsigned long
7088 specifier, UL, instead of a static_cast.
7090 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7092 * src/support/block.h: new file. to be used as a c-style array in
7093 classes, so that the class can be assignable.
7095 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7097 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7098 NULL, make sure to return an empty string (it is not possible to
7099 set a string to NULL).
7101 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7103 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7105 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7107 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7108 link line, so that Irix users (for example) can set it explicitely to
7111 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7112 it can be overidden at make time (static or dynamic link, for
7115 * src/vc-backend.C, src/LaTeXFeatures.h,
7116 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7117 statements to bring templates to global namespace.
7119 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7121 * src/support/lyxstring.C (operator[] const): make it standard
7124 * src/minibuffer.C (Init): changed to reflect that more
7125 information is given from the lyxvc and need not be provided here.
7127 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7129 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7131 * src/LyXView.C (UpdateTimerCB): use static_cast
7132 (KeyPressMask_raw_callback): ditto
7134 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7135 buffer_, a lot of changes because of this. currentBuffer() ->
7136 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7137 also changes to other files because of this.
7139 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7141 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7142 have no support for RCS and partial support for CVS, will be
7145 * src/insets/ several files: changes because of function name
7146 changes in Bufferview and LyXView.
7148 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7150 * src/support/LSubstring.[Ch]: new files. These implement a
7151 Substring that can be very convenient to use. i.e. is this
7153 string a = "Mary had a little sheep";
7154 Substring(a, "sheep") = "lamb";
7155 a is now "Mary has a little lamb".
7157 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7158 out patterns and subpatterns of strings. It is used by LSubstring
7159 and also by vc-backend.C
7161 * src/support/lyxstring.C: went over all the assertions used and
7162 tried to correct the wrong ones and flag which of them is required
7163 by the standard. some bugs found because of this. Also removed a
7164 couple of assertions.
7166 * src/support/Makefile.am (libsupport_a_SOURCES): added
7167 LSubstring.[Ch] and LRegex.[Ch]
7169 * src/support/FileInfo.h: have struct stat buf as an object and
7170 not a pointer to one, some changes because of this.
7172 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7173 information in layout when adding the layouts preamble to the
7176 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7179 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7180 because of bug in OS/2.
7182 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7184 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7185 \verbatim@font instead of \ttfamily, so that it can be redefined.
7187 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7188 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7189 src/layout.h, src/text2.C: add 'using' directive to bring the
7190 STL templates we need from the std:: namespace to the global one.
7191 Needed by DEC cxx in strict ansi mode.
7193 * src/support/LIstream.h,src/support/LOstream.h,
7194 src/support/lyxstring.h,src/table.h,
7195 src/lyxlookup.h: do not include <config.h> in header
7196 files. This should be done in the .C files only.
7198 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7202 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7204 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7205 from Kayvan to fix the tth invokation.
7207 * development/lyx.spec.in: updates from Kayvan to reflect the
7208 changes of file names.
7210 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7212 * src/text2.C (InsertStringB): use std::copy
7213 (InsertStringA): use std::copy
7215 * src/bufferlist.C: use a vector to store the buffers in. This is
7216 an internal change and should not affect any other thing.
7218 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7221 * src/text.C (Fill): fix potential bug, one off bug.
7223 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7225 * src/Makefile.am (lyx_main.o): add more files it depends on.
7227 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7229 * src/support/lyxstring.C: use size_t for the reference count,
7230 size, reserved memory and xtra.
7231 (internal_compare): new private member function. Now the compare
7232 functions should work for std::strings that have embedded '\0'
7234 (compare): all compare functions rewritten to use
7237 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7239 * src/support/lyxstring.C (compare): pass c_str()
7240 (compare): pass c_str
7241 (compare): pass c_str
7243 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7245 * src/support/DebugStream.C: <config.h> was not included correctly.
7247 * lib/configure: forgot to re-generate it :( I'll make this file
7248 auto generated soon.
7250 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7252 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7255 * src/support/lyxstring.C: some changes from length() to rep->sz.
7256 avoids a function call.
7258 * src/support/filetools.C (SpaceLess): yet another version of the
7259 algorithm...now per Jean-Marc's suggestions.
7261 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7263 * src/layout.C (less_textclass_desc): functor for use in sorting
7265 (LyXTextClass::Read): sort the textclasses after reading.
7267 * src/support/filetools.C (SpaceLess): new version of the
7268 SpaceLess functions. What problems does this one give? Please
7271 * images/banner_bw.xbm: made the arrays unsigned char *
7273 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7275 * src/support/lyxstring.C (find): remove bogus assertion in the
7276 two versions of find where this has not been done yet.
7278 * src/support/lyxlib.h: add missing int return type to
7281 * src/menus.C (ShowFileMenu): disable exporting to html if no
7282 html export command is present.
7284 * config/lib_configure.m4: add a test for an HTML converter. The
7285 programs checked for are, in this order: tth, latex2html and
7288 * lib/configure: generated from config/lib_configure.m4.
7290 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7291 html converter. The parameters are now passed through $$FName and
7292 $$OutName, instead of standard input/output.
7294 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7296 * lib/lyxrc.example: update description of \html_command.
7297 add "quotes" around \screen_font_xxx font setting examples to help
7298 people who use fonts with spaces in their names.
7300 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7302 * Distribution files: updates for v1.1.2
7304 * src/support/lyxstring.C (find): remove bogus assert and return
7305 npos for the same condition.
7307 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7309 * added patch for OS/2 from SMiyata.
7311 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7313 * src/text2.C (CutSelection): make space_wrapped a bool
7314 (CutSelection): dont declare int i until we have to.
7315 (alphaCounter): return a char const *.
7317 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7319 * src/support/syscall.C (Systemcalls::kill):
7320 src/support/filetools.C (PutEnv, PutEnvPath):
7321 src/lyx_cb.C (addNewlineAndDepth):
7322 src/FontInfo.C (FontInfo::resize): condition some #warning
7323 directives with WITH_WARNINGS.
7326 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7328 * src/layout.[Ch] + several files: access to class variables
7329 limited and made accessor functions instead a lot of code changed
7330 becuase of this. Also instead of returning pointers often a const
7331 reference is returned instead.
7333 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7335 * src/Makefile.am (dist-hook): added used to remove the CVS from
7336 cheaders upon creating a dist
7337 (EXTRA_DIST): added cheaders
7339 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7340 a character not as a small integer.
7342 * src/support/lyxstring.C (find): removed Assert and added i >=
7343 rep->sz to the first if.
7345 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7347 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7348 src/LyXView.C src/buffer.C src/bufferparams.C
7349 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7350 src/text2.C src/insets/insetinclude.C:
7351 lyxlayout renamed to textclasslist.
7353 * src/layout.C: some lyxerr changes.
7355 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7356 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7357 (LyXLayoutList): removed all traces of this class.
7358 (LyXTextClass::Read): rewrote LT_STYLE
7359 (LyXTextClass::hasLayout): new function
7360 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7361 both const and nonconst version.
7362 (LyXTextClass::delete_layout): new function.
7363 (LyXTextClassList::Style): bug fix. do the right thing if layout
7365 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7366 (LyXTextClassList::NameOfLayout): ditto
7367 (LyXTextClassList::Load): ditto
7369 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7371 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7373 * src/LyXAction.C (LookupFunc): added a workaround for sun
7374 compiler, on the other hand...we don't know if the current code
7375 compiles on sun at all...
7377 * src/support/filetools.C (CleanupPath): subst fix
7379 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7382 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7383 complained about this one?
7385 * src/insets/insetinclude.C (Latex): subst fix
7387 * src/insets/insetbib.C (getKeys): subst fix
7389 * src/LyXSendto.C (SendtoApplyCB): subst fix
7391 * src/lyx_main.C (init): subst fix
7393 * src/layout.C (Read): subst fix
7395 * src/lyx_sendfax_main.C (button_send): subst fix
7397 * src/buffer.C (RoffAsciiTable): subst fix
7399 * src/lyx_cb.C (MenuFax): subst fix
7400 (PrintApplyCB): subst fix
7402 1999-10-26 Juergen Vigna <jug@sad.it>
7404 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7406 (Read): Cleaned up this code so now we read only format vestion >= 5
7408 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7410 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7411 come nobody has complained about this one?
7413 * src/insets/insetinclude.C (Latex): subst fix
7415 * src/insets/insetbib.C (getKeys): subst fix
7417 * src/lyx_main.C (init): subst fix
7419 * src/layout.C (Read): subst fix
7421 * src/buffer.C (RoffAsciiTable): subst fix
7423 * src/lyx_cb.C (MenuFax): subst fix.
7425 * src/layout.[hC] + some other files: rewrote to use
7426 std::container to store textclasses and layouts in.
7427 Simplified, removed a lot of code. Make all classes
7428 assignable. Further simplifications and review of type
7429 use still to be one.
7431 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7432 lastfiles to create the lastfiles partr of the menu.
7434 * src/lastfiles.[Ch]: rewritten to use deque to store the
7435 lastfiles in. Uses fstream for reading and writing. Simplifies
7438 * src/support/syscall.C: remove explicit cast.
7440 * src/BufferView.C (CursorToggleCB): removed code snippets that
7442 use explicat C++ style casts instead of C style casts. also use
7443 u_vdata instea of passing pointers in longs.
7445 * src/PaperLayout.C: removed code snippets that were commented out.
7447 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7449 * src/lyx_main.C: removed code snippets that wer commented out.
7451 * src/paragraph.C: removed code snippets that were commented out.
7453 * src/lyxvc.C (logClose): use static_cast
7455 (viewLog): remove explicit cast to void*
7456 (showLog): removed old commented code
7458 * src/menus.C: use static_cast instead of C style casts. use
7459 u_vdata instead of u_ldata. remove explicit cast to (long) for
7460 pointers. Removed old code that was commented out.
7462 * src/insets/inset.C: removed old commented func
7464 * src/insets/insetref.C (InsetRef): removed old code that had been
7465 commented out for a long time.
7467 (escape): removed C style cast
7469 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7471 * src/insets/insetlatex.C (Draw): removed old commented code
7472 (Read): rewritten to use string
7474 * src/insets/insetlabel.C (escape): removed C style cast
7476 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7478 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7481 * src/insets/insetinclude.h: removed a couple of stupid bools
7483 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7484 (Clone): remove C style cast
7485 (getKeys): changed list to lst because of std::list
7487 * src/insets/inseterror.C (Draw): removed som old commented code.
7489 * src/insets/insetcommand.C (Draw): removed some old commented code.
7491 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7492 commented out forever.
7493 (bibitem_cb): use static_cast instead of C style cast
7494 use of vdata changed to u_vdata.
7496 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7498 (CloseUrlCB): use static_cast instead of C style cast.
7499 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7501 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7502 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7503 (CloseInfoCB): static_cast from ob->u_vdata instead.
7504 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7507 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7508 (C_InsetError_CloseErrorCB): forward the ob parameter
7509 (CloseErrorCB): static_cast from ob->u_vdata instead.
7511 * src/vspace.h: include LString.h since we use string in this class.
7513 * src/vspace.C (lyx_advance): changed name from advance because of
7514 nameclash with stl. And since we cannot use namespaces yet...I
7515 used a lyx_ prefix instead. Expect this to change when we begin
7518 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7520 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7521 and removed now defunct constructor and deconstructor.
7523 * src/BufferView.h: have backstack as a object not as a pointer.
7524 removed initialization from constructor. added include for BackStack
7526 * development/lyx.spec.in (%build): add CFLAGS also.
7528 * src/screen.C (drawFrame): removed another warning.
7530 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7532 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7533 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7534 README and ANNOUNCE a bit for the next release. More work is
7537 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7538 unbreakable if we are in freespacing mode (LyX-Code), but not in
7541 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7543 * src/BackStack.h: fixed initialization order in constructor
7545 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7547 * acinclude.m4 (VERSION): new rules for when a version is
7548 development, added also a variable for prerelease.
7549 (warnings): we set with_warnings=yes for prereleases
7550 (lyx_opt): prereleases compile with same optimization as development
7551 (CXXFLAGS): only use pedantic if we are a development version
7553 * src/BufferView.C (restorePosition): don't do anything if the
7556 * src/BackStack.h: added member empty, use this to test if there
7557 is anything to pop...
7559 1999-10-25 Juergen Vigna <jug@sad.it>
7562 * forms/layout_forms.fd +
7563 * forms/latexoptions.fd +
7564 * lyx.fd: changed for various form resize issues
7566 * src/mathed/math_panel.C +
7567 * src/insets/inseterror.C +
7568 * src/insets/insetinfo.C +
7569 * src/insets/inseturl.C +
7570 * src/insets/inseturl.h +
7573 * src/PaperLayout.C +
7574 * src/ParagraphExtra.C +
7575 * src/TableLayout.C +
7577 * src/layout_forms.C +
7584 * src/menus.C: fixed various resize issues. So now forms can be
7585 resized savely or not be resized at all.
7587 * forms/form_url.fd +
7588 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7591 * src/insets/Makefile.am: added files form_url.[Ch]
7593 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7595 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7596 (and presumably 6.2).
7598 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7599 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7600 remaining static member callbacks.
7602 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7605 * src/support/lyxstring.h: declare struct Srep as friend of
7606 lyxstring, since DEC cxx complains otherwise.
7608 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7610 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7612 * src/LaTeX.C (run): made run_bibtex also depend on files with
7614 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7615 are put into the dependency file.
7617 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7618 the code has shown itself to work
7619 (create_ispell_pipe): removed another warning, added a comment
7622 * src/minibuffer.C (ExecutingCB): removed code that has been
7623 commented out a long time
7625 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7626 out code + a warning.
7628 * src/support/lyxstring.h: comment out the three private
7629 operators, when compiling with string ansi conforming compilers
7632 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7634 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7635 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7638 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7641 * src/mathed/math_panel.C (create_math_panel): remove explicit
7644 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7647 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7648 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7649 to XCreatePixmapFromBitmapData
7650 (fl_set_bmtable_data): change the last argument to be unsigned
7652 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7653 and bh to be unsigned int, remove explicit casts in call to
7654 XReadBitmapFileData.
7656 * images/arrows.xbm: made the arrays unsigned char *
7657 * images/varsz.xbm: ditto
7658 * images/misc.xbm: ditto
7659 * images/greek.xbm: ditto
7660 * images/dots.xbm: ditto
7661 * images/brel.xbm: ditto
7662 * images/bop.xbm: ditto
7664 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7666 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7667 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7668 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7670 (LYX_CXX_CHEADERS): added <clocale> to the test.
7672 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7674 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7676 * src/support/lyxstring.C (append): fixed something that must be a
7677 bug, rep->assign was used instead of rep->append.
7679 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
7682 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
7683 lyx insert double chars. Fix spotted by Kayvan.
7685 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7687 * Fixed the tth support. I messed up with the Emacs patch apply feature
7688 and omitted the changes in lyxrc.C.
7690 1999-10-22 Juergen Vigna <jug@sad.it>
7692 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
7694 * src/lyx_cb.C (MenuInsertRef) +
7695 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
7696 the form cannot be resized under it limits (fixes a segfault)
7698 * src/lyx.C (create_form_form_ref) +
7699 * forms/lyx.fd: Changed Gravity on name input field so that it is
7702 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7704 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
7705 <ostream> and <istream>.
7707 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
7708 whether <fstream> provides the latest standard features, or if we
7709 have an oldstyle library (like in egcs).
7710 (LYX_CXX_STL_STRING): fix the test.
7712 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
7713 code on MODERN_STL_STREAM.
7715 * src/support/lyxstring.h: use L{I,O}stream.h.
7717 * src/support/L{I,O}stream.h: new files, designed to setup
7718 correctly streams for our use
7719 - includes the right header depending on STL capabilities
7720 - puts std::ostream and std::endl (for LOStream.h) or
7721 std::istream (LIStream.h) in toplevel namespace.
7723 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7725 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
7726 was a bib file that had been changed we ensure that bibtex is run.
7727 (runBibTeX): enhanced to extract the names of the bib files and
7728 getting their absolute path and enter them into the dep file.
7729 (findtexfile): static func that is used to look for tex-files,
7730 checks for absolute patchs and tries also with kpsewhich.
7731 Alternative ways of finding the correct files are wanted. Will
7733 (do_popen): function that runs a command using popen and returns
7734 the whole output of that command in a string. Should be moved to
7737 * src/DepTable.[Ch] (extchanged): new function that returns true if a
7738 file with extension ext has changed.
7740 * src/insets/figinset.C: added ifdef guards around the fl_free
7741 code that jug commented out. Now it is commented out when
7742 compiling with XForms == 0.89.
7744 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
7745 to lyxstring.C, and only keep a forward declaration in
7746 lyxstring.h. Simplifies the header file a bit and should help a
7747 bit on compile time too. Also changes to Srep will not mandate a
7748 recompile of code just using string.
7749 (~lyxstring): definition moved here since it uses srep.
7750 (size): definition moved here since it uses srep.
7752 * src/support/lyxstring.h: removed a couple of "inline" that should
7755 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7757 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
7760 1999-10-21 Juergen Vigna <jug@sad.it>
7762 * src/table.C (SetPWidth): Just a small fix so the alignment is not
7763 set to left if I just remove the width entry (or it is empty).
7765 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
7766 paragraph when having dummy paragraphs.
7768 1999-10-20 Juergen Vigna <jug@sad.it>
7770 * src/insets/figinset.C: just commented some fl_free_form calls
7771 and added warnings so that this calls should be activated later
7772 again. This avoids for now a segfault, but we have a memory leak!
7774 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
7775 'const char * argument' to 'string argument', this should
7776 fix some Asserts() in lyxstring.C.
7778 * src/lyxfunc.h: Removed the function argAsString(const char *)
7779 as it is not used anymore.
7781 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7783 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
7786 * src/Literate.h: some funcs moved from public to private to make
7787 interface clearer. Unneeded args removed.
7789 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
7791 (scanBuildLogFile): ditto
7793 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
7794 normal TeX Error. Still room for improvement.
7796 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
7798 * src/buffer.C (insertErrors): changes to make the error
7799 desctription show properly.
7801 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
7804 * src/support/lyxstring.C (helper): changed to use
7805 sizeof(object->rep->ref).
7806 (operator>>): changed to use a pointer instead.
7808 * src/support/lyxstring.h: changed const reference & to value_type
7809 const & lets see if that helps.
7811 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7813 * Makefile.am (rpmdist): fixed to have non static package and
7816 * src/support/lyxstring.C: removed the compilation guards
7818 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
7821 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
7822 conditional compile of lyxstring.Ch
7824 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
7825 stupid check, but it is a lot better than the bastring hack.
7826 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
7828 * several files: changed string::erase into string::clear. Not
7831 * src/chset.C (encodeString): use a char temporary instead
7833 * src/table.C (TexEndOfCell): added tostr around
7834 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
7835 (TexEndOfCell): ditto
7836 (TexEndOfCell): ditto
7837 (TexEndOfCell): ditto
7838 (DocBookEndOfCell): ditto
7839 (DocBookEndOfCell): ditto
7840 (DocBookEndOfCell): ditto
7841 (DocBookEndOfCell): ditto
7843 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
7845 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
7847 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
7848 (MenuBuildProg): added tostr around ret
7849 (MenuRunChktex): added tostr around ret
7850 (DocumentApplyCB): added tostr around ret
7852 * src/chset.C (encodeString): added tostr around t->ic
7854 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
7855 (makeLaTeXFile): added tostr around tocdepth
7856 (makeLaTeXFile): added tostr around ftcound - 1
7858 * src/insets/insetbib.C (setCounter): added tostr around counter.
7860 * src/support/lyxstring.h: added an operator+=(int) to catch more
7863 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
7864 (lyxstring): We DON'T allow NULL pointers.
7866 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7868 * src/mathed/math_macro.C (MathMacroArgument::Write,
7869 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
7870 when writing them out.
7872 * src/LString.C: remove, since it is not used anymore.
7874 * src/support/lyxstring.C: condition the content to
7875 USE_INCLUDED_STRING macro.
7877 * src/mathed/math_symbols.C, src/support/lstrings.C,
7878 src/support/lyxstring.C: add `using' directive to specify what
7879 we need in <algorithm>. I do not think that we need to
7880 conditionalize this, but any thought is appreciated.
7882 * many files: change all callback functions to "C" linkage
7883 functions to please strict C++ compilers like DEC cxx 6.1 in mode
7884 strict_ansi. Those who were static are now global.
7885 The case of callbacks which are static class members is
7886 trickier, since we have to make C wrappers around them (see
7887 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
7888 did not finish this yet, since it defeats the purpose of
7889 encapsulation, and I am not sure what the best route is.
7891 1999-10-19 Juergen Vigna <jug@sad.it>
7893 * src/support/lyxstring.C (lyxstring): we permit to have a null
7894 pointer as assignment value and just don't assign it.
7896 * src/vspace.C (nextToken): corrected this function substituting
7897 find_first(_not)_of with find_last_of.
7899 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
7900 (TableOptCloseCB) (TableSpeCloseCB):
7901 inserted fl_set_focus call for problem with fl_hide_form() in
7904 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7906 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
7909 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7911 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
7912 LyXLex::next() and not eatline() to get its argument.
7914 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
7917 instead, use fstreams for io of the depfile, removed unneeded
7918 functions and variables.
7920 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
7921 vector instead, removed all functions and variables that is not in
7924 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7926 * src/buffer.C (insertErrors): use new interface to TeXError
7928 * Makefile.am (rpmdist): added a rpmdist target
7930 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
7931 per Kayvan's instructions.
7933 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7935 * src/Makefile.am: add a definition for localedir, so that locales
7936 are found after installation (Kayvan)
7938 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7940 * development/.cvsignore: new file.
7942 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7944 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
7945 C++ compiler provides wrappers for C headers and use our alternate
7948 * configure.in: use LYX_CXX_CHEADERS.
7950 * src/cheader/: new directory, populated with cname headers from
7951 libstdc++-2.8.1. They are a bit old, but probably good enough for
7952 what we want (support compilers who lack them).
7954 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
7955 from includes. It turns out is was stupid.
7957 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7959 * lib/Makefile.am (install-data-local): forgot a ';'
7960 (install-data-local): forgot a '\'
7961 (libinstalldirs): needed after all. reintroduced.
7963 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7965 * configure.in (AC_OUTPUT): added lyx.spec
7967 * development/lyx.spec: removed file
7969 * development/lyx.spec.in: new file
7971 * po/*.po: merged with lyx.pot becuase of make distcheck
7973 * lib/Makefile.am (dist-hook): added dist-hook so that
7974 documentation files will be included when doing a make
7975 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
7976 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
7978 more: tried to make install do the right thing, exclude CVS dirs
7981 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
7982 Path would fit in more nicely.
7984 * all files that used to use pathstack: uses now Path instead.
7985 This change was a lot easier than expected.
7987 * src/support/path.h: new file
7989 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
7991 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
7993 * src/support/lyxstring.C (getline): Default arg was given for
7996 * Configure.cmd: removed file
7998 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8000 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8001 streams classes and types, add the proper 'using' statements when
8002 MODERN_STL is defined.
8004 * src/debug.h: move the << operator definition after the inclusion
8007 * src/support/filetools.C: include "LAssert.h", which is needed
8010 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8013 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8014 include "debug.h" to define a proper ostream.
8016 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8018 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8019 method to the SystemCall class which can kill a process, but it's
8020 not fully implemented yet.
8022 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8024 * src/support/FileInfo.h: Better documentation
8026 * src/lyxfunc.C: Added support for buffer-export html
8028 * src/menus.C: Added Export->As HTML...
8030 * lib/bind/*.bind: Added short-cut for buffer-export html
8032 * src/lyxrc.*: Added support for new \tth_command
8034 * lib/lyxrc.example: Added stuff for new \tth_command
8036 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8038 * lib/Makefile.am (IMAGES): removed images/README
8039 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8040 installes in correct place. Check permisions is installed
8043 * src/LaTeX.C: some no-op changes moved declaration of some
8046 * src/LaTeX.h (LATEX_H): changed include guard name
8048 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8050 * lib/reLyX/Makefile.am: install noweb2lyx.
8052 * lib/Makefile.am: install configure.
8054 * lib/reLyX/configure.in: declare a config aux dir; set package
8055 name to lyx (not sure what the best solution is); generate noweb2lyx.
8057 * lib/layouts/egs.layout: fix the bibliography layout.
8059 1999-10-08 Jürgen Vigna <jug@sad.it>
8061 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8062 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8063 it returned without continuing to search the path.
8065 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8067 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8068 also fixes a bug. It is not allowed to do tricks with std::strings
8069 like: string a("hei"); &a[e]; this will not give what you
8070 think... Any reason for the complexity in this func?
8072 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8074 * Updated README and INSTALL a bit, mostly to check that my
8075 CVS rights are correctly set up.
8077 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8079 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8080 does not allow '\0' chars but lyxstring and std::string does.
8082 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8084 * autogen.sh (AUTOCONF): let the autogen script create the
8085 POTFILES.in file too. POTFILES.in should perhaps now not be
8086 included in the cvs module.
8088 * some more files changed to use C++ includes instead of C ones.
8090 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8092 (Reread): added tostr to nlink. buggy output otherwise.
8093 (Reread): added a string() around szMode when assigning to Buffer,
8094 without this I got a log of garbled info strings.
8096 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8099 * I have added several ostream & operator<<(ostream &, some_type)
8100 functions. This has been done to avoid casting and warnings when
8101 outputting enums to lyxerr. This as thus eliminated a lot of
8102 explicit casts and has made the code clearer. Among the enums
8103 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8104 mathed enums, some font enum the Debug::type enum.
8106 * src/support/lyxstring.h (clear): missing method. equivalent of
8109 * all files that contained "stderr": rewrote constructs that used
8110 stderr to use lyxerr instead. (except bmtable)
8112 * src/support/DebugStream.h (level): and the passed t with
8113 Debug::ANY to avoid spurious bits set.
8115 * src/debug.h (Debug::type value): made it accept strings of the
8118 * configure.in (Check for programs): Added a check for kpsewhich,
8119 the latex generation will use this later to better the dicovery of
8122 * src/BufferView.C (create_view): we don't need to cast this to
8123 (void*) that is done automatically.
8124 (WorkAreaButtonPress): removed some dead code.
8126 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8128 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8129 is not overwritten when translated (David Sua'rez de Lis).
8131 * lib/CREDITS: Added David Sua'rez de Lis
8133 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8135 * src/bufferparams.C (BufferParams): default input encoding is now
8138 * acinclude.m4 (cross_compiling): comment out macro
8139 LYX_GXX_STRENGTH_REDUCE.
8141 * acconfig.h: make sure that const is not defined (to empty) when
8142 we are compiling C++. Remove commented out code using SIZEOF_xx
8145 * configure.in : move the test for const and inline as late as
8146 possible so that these C tests do not interefere with C++ ones.
8147 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8148 has not been proven.
8150 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8152 * src/table.C (getDocBookAlign): remove bad default value for
8155 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8157 (ShowFileMenu2): ditto.
8159 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8162 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8164 * Most files: finished the change from the old error code to use
8165 DebugStream for all lyxerr debugging. Only minor changes remain
8166 (e.g. the setting of debug levels using strings instead of number)
8168 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8170 * src/layout.C (Add): Changed to use compare_no_case instead of
8173 * src/FontInfo.C: changed loop variable type too string::size_type.
8175 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8177 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8178 set ETAGS_ARGS to --c++
8180 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8182 * src/table.C (DocBookEndOfCell): commented out two unused variables
8184 * src/paragraph.C: commented out four unused variables.
8186 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8187 insed a if clause with type string::size_type.
8189 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8192 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8194 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8195 variable, also changed loop to go from 0 to lenght + 1, instead of
8196 -1 to length. This should be correct.
8198 * src/LaTeX.C (scanError): use string::size_type as loop variable
8201 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8202 (l.896) since y_tmp and row was not used anyway.
8204 * src/insets/insetref.C (escape): use string::size_type as loop
8207 * src/insets/insetquotes.C (Width): use string::size_type as loop
8209 (Draw): use string::size_type as loop variable type.
8211 * src/insets/insetlatexaccent.C (checkContents): use
8212 string::size_type as loop variable type.
8214 * src/insets/insetlabel.C (escape): use string::size_type as loop
8217 * src/insets/insetinfo.C: added an extern for current_view.
8219 * src/insets/insetcommand.C (scanCommand): use string::size_type
8220 as loop variable type.
8222 * most files: removed the RCS tags. With them we had to recompile
8223 a lot of files after a simple cvs commit. Also we have never used
8224 them for anything meaningful.
8226 * most files: tags-query-replace NULL 0. As adviced several plases
8227 we now use "0" instead of "NULL" in our code.
8229 * src/support/filetools.C (SpaceLess): use string::size_type as
8232 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8234 * src/paragraph.C: fixed up some more string stuff.
8236 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8238 * src/support/filetools.h: make modestr a std::string.
8240 * src/filetools.C (GetEnv): made ch really const.
8242 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8243 made code that used these use max/min from <algorithm> instead.
8245 * changed several c library include files to their equivalent c++
8246 library include files. All is not changed yet.
8248 * created a support subdir in src, put lyxstring and lstrings
8249 there + the extra files atexit, fileblock, strerror. Created
8250 Makefile.am. edited configure.in and src/Makefile.am to use this
8251 new subdir. More files moved to support.
8253 * imported som of the functions from repository lyx, filetools
8255 * ran tags-query-replace on LString -> string, corrected the bogus
8256 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8257 is still some errors in there. This is errors where too much or
8258 too litle get deleted from strings (string::erase, string::substr,
8259 string::replace), there can also be some off by one errors, or
8260 just plain wrong use of functions from lstrings. Viewing of quotes
8263 * LyX is now running fairly well with string, but there are
8264 certainly some bugs yet (see above) also string is quite different
8265 from LString among others in that it does not allow null pointers
8266 passed in and will abort if it gets any.
8268 * Added the revtex4 files I forgot when setting up the repository.
8270 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8272 * All over: Tried to clean everything up so that only the files
8273 that we really need are included in the cvs repository.
8274 * Switched to use automake.
8275 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8276 * Install has not been checked.
8278 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8280 * po/pt.po: Three errors:
8281 l.533 and l.538 format specification error
8282 l. 402 duplicate entry, I just deleted it.