1 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
3 * lib/ui/default.ui: menu structure cleanup.
5 * lib/languages: add description of entries.
7 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9 * src/insets/ExternalTemplate.C (readTemplates): change debug
11 (readTemplate): use lyxlex.printError to report read errors.
14 * src/insets/insetexternal.C (Read): suppress debug message when
17 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
19 * src/insets/insetinclude.C (Ascii): New method. Currently
20 supports only verbatim input.
22 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
24 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
26 2000-12-22 Juergen Vigna <jug@sad.it>
28 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
29 have a selection and button == 3.
30 (UpdateLocal): if what == INIT clear selection if existent!
31 (InsetButtonPress): don't activate the cell inset on button==3
33 (LocalDispatch): move curor up/down if exiting an inset which this
36 2000-12-20 Juergen Vigna <jug@sad.it>
38 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
39 calling for the math-panel (do not unlock the math-inset if locked)!
41 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
42 text-insets (with x-offset).
44 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
45 alignment of multicolumn-cells.
47 2000-12-19 Juergen Vigna <jug@sad.it>
49 * src/lyxfunc.C (Dispatch):
50 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
53 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
55 * src/WorkArea.C (work_area_handler): simplify the key/keysym
56 handling for XForms 0.89, this might have rendered some cases
57 unusable. I have at least deadkeys, accent-xxx and KP_x working.
58 Please report proplems.
60 * src/lyxfunc.C (processKeySym): make the self-insert handling
63 2000-12-18 Baruch Even <baruch.even@writeme.com>
65 * src/LaTeX.C (deplog): fix spelling errors
66 * src/text2.C (CutSelection): ditto
67 * src/lyxfunc.C (Dispatch): ditto
69 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
71 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
73 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
74 and h_align in default init.
75 adjust calls to MathedRowSt
77 * src/mathed/math_iter.C: adjust calls to MathedRowSt
78 * src/mathed/math_iter.h (getAD): ditto
80 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
81 methods setBaseline, ascent, descent
82 (class MathMatrixInset): remove method GetAlign, change h_align
85 * src/lyxfunc.C (processKeySym): discover the correct argument if
86 the action is LFUN_SELFINSERT
88 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
90 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
93 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
95 * src/support/copy.C: don't include filetools.h
97 * lib/images: revert to old banner, drop the cucumber.
99 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
101 * src/converter.C (Formats::View): Change the current directory to
102 the directory of the file.
104 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
106 * src/kbsequence.C (addkey): also clear sequence and modifiers if
109 * src/BufferView2.C (theLockingInset): return 0 if text is 0
111 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
113 * Many files: Fix RTL support for insettext.
115 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
117 * README: add mention of broken ghostscript versions, remove
118 reference to non-existent BUGS file
120 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
122 * src/support/lstrings.C (compare_no_case): small fix. When passed
123 length, should use it in the size comparison.
125 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
127 * src/insets/insetexternal.C (getScreenLabel): Return a default
128 value if the template label is empty.
130 * src/lyxlookup.C: do not condition on FL_REVISION.
133 * src/sp_form.C: fix the font size of some text entries
135 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
136 after TOC when there is no TOC.
138 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
139 bind file if it has not been done yet.
140 (read): remove local bindFile variable. Try to fix the handling of
141 RC_BIND and RC_BINDFILE.
143 * src/lyx_main.C (init): use readBindFileIfNeeded().
145 * lib/languages: Change description of german to "German (new
148 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
150 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
151 "Apply" buttons if arg is non-zero.
153 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
154 launching the popup if sufficient info is passed to
155 LFUN_CITATION_CREATE.
157 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
159 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
160 labels (disabled in 1.1.6).
162 * src/lyxrc.[Ch]: New variable label_init_length
164 * mathed/formula.C (LocalDispatch): Preserve the label when
165 changing from display math to eqnarray (however, the label
166 do not appear at the first line, as one might expects, but at the
168 (LocalDispatch): When inserting a label to a formula which already
169 have a label, the old label is used as default value.
170 Also, if the label is changed, then all references to the label
173 * src/mathed/math_iter.C (setLabel): Allow to set the label
174 even if it is empty. This is needed to allow deletion of a label
177 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
178 refernces only if the old label appears once in the document.
180 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
182 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
183 <gehlert@Rcs1.urz.tu-dresden.de>
185 * src/frontends/xforms/FormBase.C: comment out debug.h
187 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
188 code in xform_helpers instead.
189 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
191 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
192 Use N_(), rather than _() when creating strings to pass to browseFile()
193 because browseFile calls gettext() itself now.
195 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
196 display the filename correctly.
198 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
200 * src/converter.C (Move): New method. Used to move file or files
201 from temp dir to the output dir. (this fixes the bug that
202 exporting linuxdoc/docbook document to html would not move all
203 html file from temp directory).
205 * src/support/filetools.C (DirList): Fixed.
207 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
209 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
211 * src/converter.C (Add): Remove $$i when setting latex_command.
213 * src/text.C (IsBoundary): Return false when pos = 0.
215 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
217 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
219 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
221 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
222 need to empty the fields to turn off use of the geometry package!
224 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
226 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
227 (Buffer const &), not a (BufferParams const &) and so fix a crash
228 caused by using current_view before it had been initialised. Not
229 the best way to do this, but much easier than changing
230 Inset::Clone(Buffer const &) to Inset::Clone().
233 * src/tabular.C: changed call to CopyIntoMinibuffer().
235 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
237 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
239 * src/lyxfunc.C (getStatus): disable insertion of floats in a
242 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
244 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
245 changed filter for screen fonts input filter from int to float
247 * src/frontends/xforms/input_validators.c: removed.
248 * src/frontends/xforms/input_validators.C: new file. Can now call C++
249 functions from within the filter functions.
251 * src/frontends/xforms/input_validators.[Ch]
252 (fl_unsigned_float_filter): new filter function.
254 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
255 confused now! And if you think I'm going to do this in
256 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
258 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
260 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
262 * src/WorkArea.C (work_area_handler): don't handle button requests
263 if xbutton.button == 0
265 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
267 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
268 It creates a lot of interesting problems.
270 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
272 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
273 the menu exists in the current menubar before opening it.
275 * src/MenuBackend.C (hasSubmenu): new method.
277 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
278 action value by offsetting actions by a large constant (so that
279 bogs choice result will be less than this constant).
281 * lib/bind/fi_menus.bind: more cleanup to menus.
282 * lib/bind/sciword.bind: ditto.
283 * lib/bind/xemacs.bind: ditto.
284 * lib/bind/emacs.bind: ditto.
285 * lib/bind/pt_menus.bind: ditto.
286 * lib/bind/hu_menus.bind: ditto.
288 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
290 * INSTALL: update PROBLEMS section.
292 * src/lyxlookup.h: remove condition on xforms version, since we
293 should not include it if not appropriate.
295 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
297 * src/LColor.C: "latex text" -> "latex inset" (from
300 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
302 * src/frontends/kde/FormTabularCreate.C:
303 * src/frontends/kde/citationdlg.C:
304 * src/frontends/kde/copyrightdlg.C:
305 * src/frontends/kde/paradlg.C:
306 * src/frontends/kde/paraextradlg.C:
307 * src/frontends/kde/parageneraldlg.C:
308 * src/frontends/kde/printdlg.C:
309 * src/frontends/kde/refdlg.C:
310 * src/frontends/kde/tabcreatedlg.C:
311 * src/frontends/kde/tocdlg.C:
312 * src/frontends/kde/urldlg.C: add necessary headers
315 * src/frontends/kde/dlg/emptytable.C:
316 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
317 default parameters (from Angus Leeming)
319 * src/frontends/kde/dlg/moc/.cvsignore:
320 * src/frontends/kde/dlg/.cvsignore:
321 * src/frontends/kde/moc/.cvsignore: fix the library name
324 * src/frontends/kde/paradlg.C:
325 * src/frontends/kde/parageneraldlg.C:
326 * src/frontends/kde/dlg/para.dlg:
327 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
329 * src/frontends/kde/dlg/README: clarified qtarch version
331 * src/frontends/kde/dlg/Makefile.am: removed the
332 dlg rules as they created spontaneous rebuilds
333 (not a good idea as it requires qtarch)
335 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
337 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
338 fixlevel along with xforms version.
340 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
341 xforms version is strictly less than 0.89.5.
342 * src/lyx_gui.C (LyXGUI): ditto.
343 * src/LyXView.C (show): ditto.
345 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
347 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
348 movement in inset in RTL text.
349 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
350 (workAreaButtonRelease): Do not open a float when there is a selection.
352 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
354 * src/spellchecker.C (RunSpellChecker): Open all floats before
357 * src/text.C (InsertChar): Consider "," as a part of a number
358 (for LTR numbers in RTL text code).
359 (IsBoundary): Fixed (and simplified).
360 (InsertChar): Recalculate cursor boundary.
363 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
365 * src/spellchecker.C: fix figures with pspell enabled
367 * src/insets/figinset.C: workaround for gs hang xforms bug
369 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
371 * lib/bind/??_menus.bind: comment out the entries corresponding to
372 real menus. They should be eventually removed, but I'll let the
373 language maintainers do that.
375 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
377 * src/frontends/kde/parageneraldlg.C:
378 * src/frontends/kde/parageneraldlg.h: don't use
379 a derived class for SpaceAbove/Below
381 * src/frontends/kde/dlg/README: add some info
383 * src/frontends/kde/dlg/*: update data files, update
386 * src/frontends/kde/dlg/moc/Makefile.am: add
389 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
391 * configure.in: add new KDE Makefiles
392 * src/vspace.h: return GlueLength not a normal one
393 * src/support/lstrings.h:
394 * src/support/lstrings.C: add isStrUnsignedInt(),
397 * src/frontends/kde/*: big reorganisation, update
398 FormParagraph, add FormTabCreate
400 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
402 * lib/ui/default.ui: small grammatical change.
404 * src/frontends/xforms/xform_macros.h: removed.
406 * src/frontends/xforms/FormBase.C:
407 * src/frontends/xforms/FormPreferences.C:
408 * src/frontends/xforms/Makefile.am: changes associated with removing
409 xform_macros.h. Should make Lars' debugging a little easier.
411 * src/frontends/xforms/FormPreferences.C:
412 * src/frontends/xforms/FormPreferences.h:
413 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
414 longer use X11 color name database. HSV and RGB dials/sliders.
415 Please let this be the end of this!
417 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
419 * Several files: Allow compilation when the compiler doesn't
422 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
425 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
426 command line options.
428 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
430 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
431 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
434 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
436 * src/frontends/xforms/FormRef.C (updateBrowser):
437 * src/frontends/xforms/forms/form_ref.fd: try clicking on
438 different insets with the sort key active. Now apply this patch!
440 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
442 * src/frontends/xforms/FormPrint.C: set to valid()
443 when we update from the passed parameters.
445 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
447 * src/LColor.C (getFromGUIName): internationalise the comparison.
449 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
450 FormPreferences choice.
452 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
455 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
457 * src/lyxrc.C: more detail for the printer program config
460 * src/LColor.C: ert->latex text. LColor needs a big revamp
461 but will have to wait till after 1.1.6
463 * src/buffer.C: bring up a dialog if we load a document
464 with an un-installed text class, rather than just complain
467 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
469 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
470 the browser form for a combox in a tabbed folder. Bug fix courtesy of
471 Steve Lamont <spl@ncmir.ucsd.edu>.
473 * src/frontends/xforms/FormDocument.C (build):
474 * src/frontends/xforms/FormPreferences.C (Language::build):
475 pass tabfolders to Combox::add() in order to use this work around.
477 * src/frontends/xforms/FormCitation.C (connect): remove max size
479 (update): sort list of bibliography keys.
481 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
483 No max size limitation. Same popup for new and existing insets. Fixes
484 bugs reported by Rob Lahaye.
486 * src/frontends/xforms/FormCitation.C (c-tor):
487 * src/frontends/xforms/FormCopyright.C (c-tor):
488 * src/frontends/xforms/FormError.C (c-tor):
489 * src/frontends/xforms/FormGraphics.C (c-tor):
490 * src/frontends/xforms/FormIndex.C (c-tor):
491 * src/frontends/xforms/FormRef.C (c-tor):
492 * src/frontends/xforms/FormToc.C (c-tor):
493 * src/frontends/xforms/FormUrl.C (c-tor):
494 use correct policy for ButtonController.
496 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
498 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
501 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
503 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
504 Some resizing changes.
506 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
508 * configure.in: fix typo
510 * lib/languages: add ukraninian and change no to no_NO
512 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
514 * src/bufferview_funcs.C (FontSize): use setLyXSize
516 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
518 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
519 to check for systems where mkstemp() is available but not declared
520 in headers. The new autoconf macro lyx_CHECK_DECL can be used
521 to check for declarations in headers.
523 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
525 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
527 * forms/makefile: added bibforms.fd, include_form.fd.
528 Removed lyx_sendfax.fd.
530 * src/LaTeXLog.C (ShowLatexLog):
531 * src/LyXAction.C (init):
532 * src/bufferparams.C (readLanguage): altered messages as suggested by
535 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
538 * src/credits.C: made fd_form_credits non-static, so that it can be
539 redrawn should the xforms colors be re-mapped.
540 * src/spellchecker.C ditto fd_form_spell_options.
542 * src/filedlg.[Ch] (redraw):
543 * src/intl.[Ch] (redraw):
544 * src/lyxfr0.[Ch] (redraw):
545 * src/insets/figinset.[Ch] (redraw):
546 * src/insets/insetexternal.[Ch] (redraw):
547 new methods, connected to Dialogs::redrawGUI.
549 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
550 to be connected to Dialogs::redrawGUI.
552 * src/frontends/xforms/FormCitation.C (build):
553 * src/frontends/xforms/FormCopyright.C (build):
554 * src/frontends/xforms/FormError.C (build):
555 * src/frontends/xforms/FormGraphics.C (build):
556 * src/frontends/xforms/FormIndex.C (build):
557 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
558 * src/frontends/xforms/FormToc.C (build):
559 * src/frontends/xforms/FormUrl.C (build):
560 use the ButtonController correctly.
562 * src/frontends/xforms/FormCopyright.C (build):
563 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
564 the .fd file and into build().
566 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
568 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
570 * src/frontends/xforms/forms/form_citation.fd:
571 * src/frontends/xforms/forms/form_copyright.fd:
572 * src/frontends/xforms/forms/form_error.fd:
573 * src/frontends/xforms/forms/form_graphics.fd:
574 * src/frontends/xforms/forms/form_index.fd:
575 * src/frontends/xforms/forms/form_toc.fd:
576 * src/frontends/xforms/forms/form_url.fd:
577 renamed some of the objects. Named others explicitly for the first time.
578 Added Restore and Apply buttons where appropriate.
580 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
583 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
585 * src/version.h: try the pre2 again
587 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
589 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
591 * src/frontends/kde/FormParagraph.C: added using directive.
593 * src/frontends/kde/paradlg.C: added config.h and using directive.
595 * src/frontends/kde/paradlg.h: added std::qualifier.
597 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
599 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
601 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
603 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
605 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
607 * src/version.h: set back to 1.1.6cvs
609 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
611 * src/version.h: set to 1.1.6pre2
613 2000-11-20 Marko Vendelin <markov@ioc.ee>
615 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
617 * src/frontends/gnome/Makefile.am: updated list of XForms object files
619 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
621 * src/LColor.C (init):
622 * src/lyxrc.C (getDescription): changed some comments as suggested by
625 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
626 disconnect the redrawGUI signal in best-practice fashion.
628 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
629 long_opts_tab to reflect the change in name of this tabfolder, as
630 suggested by John Levon.
631 (connect, disconnect): new methods. Don't do much at present other than
632 ensuring that we can't resize the dialog. This just makes xforms go
634 (lots of methods in Colors): made void rather than bool. The idea is
635 to have an isOk() function that keeps track of whether any input is
636 genuinely invalid and should therefore block Save, Apply.
637 Easier to manipulate the counters rapidly.
638 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
639 compiler will like this code. Much cleaner way of doing things.
641 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
643 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
644 rather than simple counters, following suggestion by John Levon.
646 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
647 than engraved frame + text.
649 * src/frontends/xforms/forms/makefile: removed spurious command.
651 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
653 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
655 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
658 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
660 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
661 see what Lars has changed and what is just white space!
662 Now used X directly to ascertain the RGB color associated with the
664 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
666 Added some sort capability.
667 The X11 color name database input is only displayed if the database
668 isn't found in the standard place.
669 Got rid of struct compare_converter; it wasn't used.
670 Probably some other stuff that I've forgotten.
672 * src/frontends/xforms/FormPreferences.h: changed the names of some
673 methods in the Colors struct. Added a couple of structs to help sort
674 colors by name and by RGBColor.
676 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
677 functions into a new class RWInfo.
679 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
680 The dialog is now almost navigable using the keyboard. Unfortunately,
681 the cursor has to be inside a browser for it to be activated. There is
682 no visual feedback for the key shortcuts to the arrow keys (use
683 Alt-appropriate arrow key, Alt-x).
685 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
688 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
689 xform_helpers.[Ch]. See above.
691 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
693 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
695 * src/screen.C (setCursorColor): new method. Sets the color of the
697 (ShowManualCursor): call it.
698 Constify some local variables.
700 * src/LColor.[Ch] (LColor): add entry for cursor
701 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
704 2000-11-19 Juergen Vigna <jug@sad.it>
706 * src/insets/insettabular.C (draw): fixed text border redraw problem.
707 (calculate_dimensions_of_cells): try to boost up when inserting chars.
709 2000-11-15 Rob Lahaye <lahaye@postech.edu>
711 * lib/ui/default.ui: OptItem used for Fax entry
713 2000-11-17 Matej Cepl <cepl@bigfoot.com>
715 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
717 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
719 * src/vspace.C (nextToken): fix so it can handle length phrases like
720 "10mm+-20mm", "40inplus16mmminus10cm" etc.
722 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
724 * src/frontends/xforms/FormPreferences.C: constify several variables
725 (BrowserLyX): rewrite to not need the choice variable
726 (Modify): rewrite to not need the choide variable
727 (compare_converter): make operator const
729 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
730 correct the writing of \set_color
731 (getDescription): return a const string
733 * src/kbsequence.[Ch] (addkey): remove dead code
735 * src/Painter.C (text): remove some commented code
737 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
739 * src/ColorHandler.[Ch]: removed some header files from .h file.
740 Included LColor.h in .C file.
742 * src/LColor.[Ch]: made class copyable so that I could create a
743 system_lcolor instance.
745 * src/Painter.h: removed LColor.h.
747 * src/lyx_gui.C (create_forms): used AddName.
749 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
750 of user preferences/lyxrc file.
752 * src/lyxrc.C (output): output changes to lcolor.
754 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
756 Moved class xformColor to files xform_helpers.[Ch]. These files,
757 Color.[Ch], could now be moved into src if they would be useful to
760 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
761 Also moved FormPreferences::browseFile here as it can be used by any
762 xform dialog with a "Browse" button. FormGraphics is a perfect example.
764 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
765 ReadableFile): changed the FormPreferences methods a little and moved
766 them here as they'll be useful elsewhere also.
768 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
769 Removed some header files and used forward declarations instead.
771 Removed some methods as they'll be useful elsewhere (see above).
773 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
774 Can also now modify the LyX LColors. However, for reasons that I don't
775 yet understand, it appears that we can use
776 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
777 present. The problem appears to lie in ColorHandler, because I can
778 change the color using LColor.SetColor(). Similarly, when reading in a
779 preferences file with some set_color instances, I'll get a warning
780 like: Color sea green is undefined or may not be redefined
781 Bad lyxrc set_color for sea green
783 Once the buffer is loaded, however, I can happily change to this color.
785 Finally, it appears that I have to set the color of "inset frame"
786 explicitly, or it oscillates from "black" to "indian red" with each
789 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
791 * ANNOUNCE: corrected a spelling mistake.
793 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
796 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
798 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
800 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
803 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
804 match the requirements from the standard better. This is required
805 to work with gnu libstdc++-v3
807 * src/frontends/xforms/FormPreferences.C: add explict pair
808 arguments to browse calls. include support/lyxmanip.h remvoe
809 extern fmt. whitespace changes. reorder variables in
810 FormPreferences.h, to match initalizaton order.
812 * several files: constify more local variables.
814 * src/buffer.C: remove some commented functions.
816 * src/DepTable.C (remove_files_with_extension): temporary
817 work around for gcc 2.97
818 * src/filedlg.C (find): ditto
819 * src/Variables.C (set): ditto
820 * src/LyXAction.C (searchActionArg): ditto
821 (retrieveActionArg): ditto
823 * configure.in: check for mktemp too
825 * UPGRADING: prepare for 1.1.6
827 * Makefile.am (lgbtags): add backup tags for when etags are
828 different than usual.
830 * ANNOUNCE: prepare for 1.1.6
832 * src/support/tempname.C (make_tempfile): new function, wrapper
833 around mkstemp and mktemp. Only mkstemp has been tested.
836 2000-11-14 Rob Lahaye <lahaye@postech.edu>
838 * default.ui: capitalized some menu items to improve shortcuts.
840 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
842 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
844 * src/frontends/xforms/Dialogs.C: add "using" directive.
846 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
848 * src/filedlg.C (Select): highlight suggested file in browser, if
851 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
852 each tab folder is encapsulated in its own class.
853 The Language keymaps are now chosen using a text input and a
854 browser button, rather than a Combox.
855 All the browser buttons are now functional, although LyXFileDlg
856 still needs to be modified to make it straighhtforward to return a
857 directory if that is what is desired.
859 * src/frontends/xforms/forms/form_preferences.fd: use text input
860 and browse button to input the Language keymaps. Add a few
861 callbacks for the browse buttons.
863 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
865 * src/support/tempname.C (tempName): small changes to make it
866 safer. remove the '.' before XXXXXX
868 * src/support/filetools.C (TmpFileName): remove func
871 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
872 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
873 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
874 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
876 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
879 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
882 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
883 for bp (this fixes a reproducible hard crash)
885 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
888 * src/frontends/xforms/FormBase.h: make bp_ private
889 (FormBaseBI): remove default for bp
892 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
895 * src/frontends/xforms/Color.C (RGBColor): made several vars
896 const, changed initialization of j to allow it to be const
899 * several files: added const to local variables.
901 * src/lyx_cb.C: removed several function prototypes and moved them
905 (UpdateLayoutPreamble):
907 (MenuInsertLabel): add BufferView as arguemnt
908 (LayoutsCB): make tmp const
910 * src/layout_forms.h: regenerated
912 * src/debug.C: add Debug::FILES
913 (showLevel) (showTags): translate the desc
915 * src/debug.h: add FILES as debug target
917 * src/bufferlist.C: use current_view as an interim measure becuase
918 of added arguments to MenuWrite and MenuWriteAs
920 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
922 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
924 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
925 libstdc++ is compiled with.
927 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
929 * lib/layouts/docbook-book.layout
930 * lib/layouts/docbook.layout
931 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
932 those paragraphs are expresse as SGML comments <!-- -->.
934 * src/LaTeXFeatures.h
935 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
936 parameter, this allows to express all the include files as relative
937 paths to the master buffer. The verbatim insert works as the other
940 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
942 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
944 (MakeDocBookFile): top_element is always written. Some clean up, as
945 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
947 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
948 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
949 a reference is written instead of the name.
950 (Validate): use the relative path for the filename.
952 * src/insets/insetlabel.C (DocBook): write end tag, for XML
955 * src/support/filetools.h
956 * src/support/filetools.C (IsSGMLFilename): added.
959 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
961 * development/OS2/quick_fix.patch:
963 * README.OS2: quick update to the OS/2 port.
965 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
967 * src/converter.C: add "using" directive.
969 * src/frontends/xforms/FormPreferences.C: add "using" directive.
970 (compare_converter): add "int" as return type.
972 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
975 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
977 * src/lyx_gui.C (create_forms): map the xform colours, should a
978 mapping exist. Ie, call XformColor::read().
980 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
981 and struct HSV as HSVColor.
982 (XformColor::read, XformColor::write) : new methods that
983 input/output any changes to the cform GUI colors.
985 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
988 * src/frontends/xforms/FormPreferences.C Lots of little changes
989 associated with the changed name of the RGB and HSV structs. Can
990 now save changes to xforms GUI to file. Commented out
991 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
992 used currently anyway.
994 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
996 * src/converter.C: A lot of changes:
997 - It is no longer possible to choose between two or more ways to
998 export to some format (the new code uses only the shortest path).
999 However, it is still possible to choose between pdflatex/ps2pdf
1000 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1001 - Added several methods that makes the FormPreferences code simpler.
1002 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1004 * src/exporter.C (Export): lyxrc.use_pdf is set before
1005 makeLaTeXFile is called. This works but not very nice.
1007 * src/frontends/xforms/FormPreferences.C: The formats/converters
1008 tabs are now fully functional.
1010 * src/buffer.C (getTocList): Add numbers to the captions.
1012 * lib/lyxrc.example: Removed fax section
1014 * src/support/rename.C (rename): Delete the old file if lyx::copy
1017 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1019 * lib/ui/default.ui: minor polishing.
1021 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1023 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1026 * lib/Makefile.am (DOCINST): do not install everything in the
1027 documentation directory.
1029 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1031 * src/bufferlist.C (newFile): set the filename to the constructed
1034 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1035 constructed "newfileXX.lyx" name to the dialog
1037 * src/frontends/DialogBase.h: make update() non-abstract so
1038 KDE doesn't need to implement two update methods for every form
1040 * src/frontends/kde/Makefile.am: add missing xforms objects
1043 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1045 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1047 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1048 structs RGB and HSV. May not be the best place for these files.
1049 Perhaps move them into src ?
1051 * src/frontends/xforms/Makefile.am: added new files.
1053 * src/frontends/xforms/forms/form_preferences.fd:
1054 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1055 replaced all instances of "colour" with "color"!
1057 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1060 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1061 tab. Can now alter the colors of the xform's GUI on the fly. With
1062 the aid of a single static Signal (see below), can "Apply" these
1063 changes to all currently open dialogs. (Well, to all of the NEW
1064 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1065 subsequently opened dialogs will, of course, also have the new
1066 color scheme. Cannot yet save (or load) the choices to file, so
1067 they are lost when exiting LyX.
1069 * src/frontends/Dialogs.h:
1070 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1071 Used to trigger a redraw of any dialogs connected to it because,
1072 for example, the GUI colours have been re-mapped.
1074 * src/frontends/xforms/FormBase.[Ch]:
1075 * src/frontends/xforms/FormDocument.[Ch]:
1076 * src/frontends/xforms/FormParagraph.[Ch]:
1077 * src/frontends/xforms/FormPreferences.[Ch]:
1078 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1079 method, to be connected to Dialogs::redrawGUI. Method must be
1080 virtual, because dialogs with tabbed folders need to redraw the
1081 forms of each tab folder.
1083 * src/LyXView.C (d-tor):
1084 * src/frontends/xforms/FormBase.C (d-tor): connected
1085 Dialogs::redrawGUI signal to redraw().
1087 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1088 removed Assert, because it is identical to that in FormBase.
1090 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1092 * lib/ui/default.ui: minor polishing.
1094 2000-11-10 Juergen Vigna <jug@sad.it>
1096 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1097 (deleteLyXText): ditto
1099 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1100 selection on mouse-button-3.
1102 * src/insets/insettabular.h: new function clearSelection(), use this
1103 functions inside insettabular.C.
1105 * src/insets/insettabular.C (TabularFeatures): clear the selection
1106 on remove_row/column.
1108 * src/insets/inset.C (scroll): fixed some scroll stuff.
1110 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1112 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1114 * lib/CREDITS: add Yves Bastide
1116 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1118 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1119 check whether C library functions are in the global namespace.
1121 * configure.in: calls it.
1123 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1124 #ifndef __GLIBCPP__.
1126 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1128 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1129 iterators to prevent crash.
1131 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1133 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1135 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1136 shortcut for xforms CB to the preemptive or post-handler function.
1138 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1139 removed the HIDDEN_TIMER as it's no longer used.
1140 Various other small changes.
1142 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1143 preemptive handler to obtain feedback, rather than the post-handler.
1144 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1146 Formats tab is now complete. Converters tab is nearly so.
1148 2000-11-09 Juergen Vigna <jug@sad.it>
1150 * src/insets/insettext.C (~InsetText):
1153 (SetParagraphData): set cache.second to 0 after deleting it!
1154 (getLyXText): check if cache.second is not 0 if finding it.
1156 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1158 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1159 lyxlex to parse the rgb.txt file.
1162 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1163 replace the default '#' comment character.
1165 * src/support/tempname.C: add "using" directive
1166 * src/frontends/ButtonPolicies.C: ditto.
1168 * src/support/filetools.C (DirList): add an explicit cast to avoid
1169 a compile error (probably not the right fix)
1171 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1173 * src/support/filetools.C (DirList): implement using system functions
1175 * src/support/tempname.C: new file
1177 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1179 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1181 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1184 * src/frontends/xforms/ButtonController.C: new file
1186 * src/os2_defines.h: remove getcwd define
1188 * src/lyxvc.C: include support/lyxlib.h
1189 (showLog): use lyx::tempName
1191 * src/lyx_cb.C: comment out includes that we don't need
1192 (AutoSave): use lyx::tempName
1194 * src/filedlg.C: include support/lyxlib.h
1195 (Reread): use lyx::getcwd
1197 * src/converter.C: include support/filetools.h
1198 (add_options): change to static inline, make tail const
1199 (Add): make old_viewer const
1200 (GetAllFormats): make it a const method, use const_iterator
1201 (enable): make static inline
1202 (SplitFormat): make using_format const
1204 * src/LaTeX.C (run): use lyx::getcwd
1206 * configure.in: check for mkstemp as well
1208 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1210 * src/converter.[Ch] (GetAllCommands): new method.
1212 * src/support/filetools.[Ch] (DirList): new method.
1214 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1215 functionality to the converters tab.
1216 The formats tab is now nearly complete.
1217 The kbmap choices in Languages tab now display the contents of
1218 system_lyxdir/kbd/*.kmap in readable form.
1220 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1221 Moved some variables into the class.
1223 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1224 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1225 colour of active folder to lighter grey instead. Any takers?
1226 (form_colours): added an "Apply" button.
1227 (form_converters): added a "Flags" input field.
1228 (form_formats): added a "Shortcut" input field. Note that we can't use
1229 names such as "input_shortcut" as this buggers up the sed script stuff.
1231 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1239 * src/lyx_sendfax_main.C:
1242 * src/spellchecker.C:
1243 * src/insets/figinset.C:
1244 * src/insets/insetbib.C:
1245 * src/insets/insetexternal.C:
1246 * src/insets/insetinclude.C:
1247 * src/insets/insetinfo.C:
1248 * src/mathed/math_panel.C:
1249 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1250 all "daughter" dialogs now have identical "feel".
1252 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1254 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1255 used (and was only used in one place prior to this patch. Incorrectly!)
1257 * src/frontends/xforms/FormDocument.C: changed some instances of
1258 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1259 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1260 for options_->input_float_placement. This fixes a bug reported by
1263 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1264 functionality into d-tor.
1266 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1267 input of numerals also.
1269 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1270 fl_set_form_atclose(). Can now close dialog from window manager,
1271 fixing a bug reported by Rob Lahaye.
1273 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1275 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1276 are no longer dark. Haven't yet worked out how to lighten the colour of
1277 the active tabfolder. Any ideas anybody?
1278 Adjusted Colours tab a little.
1279 Added Shortcut field to converters tab. Note that we can't create an
1280 fdesign label like "input_shortcut" as this buggers up the sed-script
1283 * src/frontends/xforms/FormPreferences.[Ch]:
1284 (feedback): fixed crash due to to ob=0.
1285 (LanguagesXXX): the kbmap choices now contain the files
1286 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1287 be replaced by an input with a file browse button, but since the browse
1288 buttons don'y yet work, this'll do for the moment.
1289 (FormatsXXX): think that this is now nearly fully functional.
1290 Some points/questions though:
1291 1. Does "Apply" remove formats if no longer present?
1292 2. I think that the browser should list the GUI names rather than the
1294 3. Must ensure that we can't delete Formats used by an existing
1297 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1298 if this is the best way to do this.
1300 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1302 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1304 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1305 for variable assignment.
1307 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1309 * src/lib/ui/default.ui: added sub/superscripts to menu as
1310 Insert->Special characters and cleaned-up the file a bit
1312 2000-11-07 Allan Rae <rae@lyx.org>
1314 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1315 ob isn't 0 before using it. See comments in function.
1317 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1319 * src/frontends/xforms/form_*.C: regenerated
1321 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1323 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1325 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1326 compiling with gcc-2.96
1328 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1330 * src/support/lyxstring.C: add a couple "using" directives.
1332 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1333 a .c_str() here too for good measure.
1334 * src/Spacing.C (set): ditto.
1335 * src/lyxfunc.C (Dispatch): ditto.
1337 * src/insets/insettabular.C (copySelection): change .str() to
1338 .str().c_str() to fix problems with lyxstring.
1339 * src/support/filetools.C (GetFileContents): ditto.
1340 * src/buffer.C (asciiParagraph): ditto.
1341 * src/paragraph.C (String): ditto.
1343 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1344 * lib/bind/sciword.bind: ditto.
1346 * src/LyXAction.C (init): remove "symbol-insert" function, which
1347 shared LFUN_INSERT_MATH with "math-insert".
1349 * lib/configure.m4: == is not a valid operator for command test.
1351 * src/lyxrc.C: add using directive.
1353 * src/converter.h: add std:: qualifier.
1355 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1357 * src/converter.[Ch] and other files: Change the Format class to a
1358 real class, and create two instances: formats and system_format.
1360 * src/lyxrc.C (output): Output the difference between formats and
1363 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1364 (buildFormats): Insert formats into browser.
1365 (inputFormats): Made the browser and add button functional.
1366 (applyFormats): Update formats from format_vec.
1368 * src/converter.C: Changed all (*it). to it->
1369 (Format::dummy): New method.
1370 (Format::importer): New format flag.
1371 (Formats::GetAllFormats): New method.
1372 (Formats::Add): Delete format from the map if prettyname is empty.
1373 (Converter::Convert): Print an error message if moving the file fails.
1374 (Converter::GetReachableTo): New method
1376 * src/MenuBackend.[Ch]: Add support for importformats tag.
1378 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1380 * lib/configure.m4: Add word->tex and ps->fax converters.
1382 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1383 Return fax to file menu.
1387 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1389 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1392 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1395 * src/lyxfunc.C (processKeyEvent): removed
1397 * src/bufferlist.C (emergencyWrite): removed the out commented
1398 emergency write code.
1400 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1402 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1404 * many files: change formatting to be a bit more uniform for
1405 if,while,for,switch statements, remove some parantesis not needed.
1408 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1410 * config/kde.m4: make config more robust when KDEDIR is set
1412 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1414 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1415 not returned a pixmap for "math-insert".
1417 * src/LyXAction.C (init): sort the entries a bit.
1419 2000-11-03 Juergen Vigna <jug@sad.it>
1421 * src/insets/insettabular.h: added fixed number to update codes so
1422 that update is only in one direction.
1424 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1427 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1428 before call to edit because of redraw.
1430 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1432 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1434 * lib/ui/default.ui: Populate "edit_float" menu
1436 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1438 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1439 "floats-operate". The name is ugly (and the func also), but this
1440 is just a band-aid until we switch to new insets.
1442 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1444 * lib/ui/default.ui: update again the menu layout (fix some
1447 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1449 * src/MenuBackend.h (fulllabel): new method.
1451 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1452 the menu shortcuts of a menu are unique and whether they
1453 correspond to a letter of the label.
1454 (expand): call checkShortcuts when debugging.
1456 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1458 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1460 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1462 * lib/examples/*.lyx : '\language default' => '\language english'
1464 * lib/examples/it_splash.lyx : except where it should be italian
1466 * lib/templates/*.lyx : the same
1468 * doc/*.lyx* : the same
1470 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1472 * lib/bind/menus.bind: remove the Layout menu entries, which I
1473 somehow forgot earlier.
1475 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1477 * lib/ui/old-default.ui: keep the old one here for reference (to
1480 * lib/ui/default.ui: update the menu layout
1482 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1484 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1485 Can now Apply to different insets without closing the dialog.
1487 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1488 Can't actually DO anything with them yet, but I'd like a little
1491 * src/frontends/xforms/input_validators.[ch]
1492 (fl_lowercase_filter): new.
1494 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1496 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1497 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1499 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1501 2000-11-02 Juergen Vigna <jug@sad.it>
1503 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1504 on char insertion as it has already be updated by bv->updateInset().
1506 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1507 if an inset inside was updated.
1509 * lib/configure.cmd: commented out fax-search code
1511 2000-11-01 Yves Bastide <stid@acm.org>
1513 * src/tabular.C (OldFormatRead): set tabular language to the
1516 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1518 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1519 class names with non-letter characters (from Yves Bastide).
1521 * lib/ui/default.ui: change Item to OptItem in import menu.
1522 Comment out fax stuff.
1524 * lib/configure.m4: comment out fax-related stuff.
1526 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1528 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1529 useful xforms helper functions. At present contains only formatted().
1530 Input a string and it returns it with line breaks so that in fits
1533 * src/frontends/xforms/Makefile.am: add new files.
1535 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1536 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1539 * src/frontends/xforms/FormPreferences.[Ch]:
1540 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1541 but lots of little clean ups. Removed enum State. Make use of
1542 formatted(). Constify lots of methods. Perhaps best of all: removed
1543 requirement for that horrible reinterpret_cast from pointer to long in
1546 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1548 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1549 conditionalize build on xforms < 0.89
1551 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1553 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1555 * src/LyXAction.C (init): comment out fax
1557 * src/lyxrc.h: comment out the fax enums
1558 comment out the fax variables
1560 * src/commandtags.h: comment out LFUN_FAX
1562 * src/lyxrc.C: disable fax variables.
1563 (read): disable parsing of fax variables
1564 (output): disable writing of fax variables
1565 (getFeedback): now description for fax variables
1567 * src/lyxfunc.C: comment out MenuFax
1568 (Dispatch): disable LFUN_FAX
1570 * src/lyx_cb.C (MenuFax): comment out
1572 * src/WorkArea.C: add <cctype>
1573 (work_area_handler): better key handling, should be ok now.
1574 for accented chars + etc
1576 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1577 lyx_sendfax.h and lyx_sendfax_man.C
1579 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1580 (show): don't call InitLyXLookup when using xforms 0.89
1582 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1584 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1586 * src/support/filetools.C (GetFileContents): close to dummy change
1588 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1590 * src/trans.C (AddDeadkey): workaround stupid compilers.
1592 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1594 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1595 of two-sided document.
1597 2000-10-31 Juergen Vigna <jug@sad.it>
1599 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1601 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1602 xposition to the Edit call.
1604 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1606 * src/trans.C (AddDeadkey): cast explicitly to char.
1608 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1610 * src/tabular.C (AsciiBottomHLine): simplify?
1611 (AsciiTopHLine): simplify?
1612 (print_n_chars): simplify
1613 (DocBook): remove most of the << endl; we should flush the stream
1614 as seldom as possible.
1616 (TeXBottomHLine): ditto
1617 (TeXTopHLine): ditto
1619 (write_attribute): try a templified version.
1620 (set_row_column_number_info): lesson scope of variables
1622 * src/support/lstrings.h (tostr): new specialization of tostr
1624 * src/trans.C (AddDeadkey): slightly cleaner fix.
1626 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1628 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1629 '%%' in Toc menu labels.
1632 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1633 font_norm is iso10646-1.
1635 * src/font.C (ascent): Fixed for 16bit fonts
1636 (descent,lbearing,rbearing): ditto
1638 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1640 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1641 (getFeedback): new static method.
1643 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1644 Now use combox rather than choice to display languages.
1645 Feedback is now output using a new timer callback mechanism, identical
1646 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1648 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1650 * src/minibuffer.C: fix for older compilers
1652 2000-10-30 Juergen Vigna <jug@sad.it>
1654 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1655 has to be Left of the inset otherwise LyXText won't find it!
1657 * src/BufferView2.C (open_new_inset): delete the inset if it can
1660 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1662 * lyx.man: fix typo.
1664 2000-10-29 Marko Vendelin <markov@ioc.ee>
1665 * src/frontends/gnome/FormCitation.C
1666 * src/frontends/gnome/FormCitation.h
1667 * src/frontends/gnome/FormCopyright.C
1668 * src/frontends/gnome/FormCopyright.h
1669 * src/frontends/gnome/FormError.C
1670 * src/frontends/gnome/FormError.h
1671 * src/frontends/gnome/FormIndex.C
1672 * src/frontends/gnome/FormIndex.h
1673 * src/frontends/gnome/FormPrint.C
1674 * src/frontends/gnome/FormPrint.h
1675 * src/frontends/gnome/FormRef.C
1676 * src/frontends/gnome/FormRef.h
1677 * src/frontends/gnome/FormToc.C
1678 * src/frontends/gnome/FormToc.h
1679 * src/frontends/gnome/FormUrl.C
1680 * src/frontends/gnome/FormUrl.h
1681 * src/frontends/gnome/Menubar_pimpl.C
1682 * src/frontends/gnome/mainapp.C
1683 * src/frontends/gnome/mainapp.h
1684 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1685 changing update() to updateSlot() where appropriate
1687 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1689 * src/frontends/xforms/FormPreferences.[Ch]:
1690 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1693 2000-10-28 Juergen Vigna <jug@sad.it>
1695 * src/insets/insettabular.C (draw): fixed drawing bug.
1697 * src/insets/insettext.C (clear):
1699 (SetParagraphData): clearing the TEXT buffers when deleting the
1700 paragraphs used by it.
1702 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1704 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1706 2000-10-27 Juergen Vigna <jug@sad.it>
1708 * src/tabular.C (~LyXTabular): removed not needed anymore.
1710 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1713 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1715 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1718 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1721 * src/frontends/xforms/FormPreferences.[Ch]:
1722 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1723 Reorganised as modules based on tabs. Much easier to follow the
1724 flow and to add new tabs. Added warning and feedback messages.
1727 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1729 * src/tabular.h (DocBook): add std:: qualifier.
1731 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1733 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1734 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1737 * insettabular.C (DocBook): uses the tabular methods to export
1740 * src/insets/insettext.h
1741 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1743 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1745 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1748 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1749 moved misplaced AllowInput two lines up.
1751 * src/buffer.C (readFile): compare float with float, not with int
1753 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1755 * src/minibuffer.C: add "using SigC::slot" statement.
1757 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1759 * src/frontends/xforms/forms/README: updated section about make.
1761 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1762 Tidied some forms up, made two of form_tabular's tabs more
1763 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1764 fixed translation problem with "Column".
1766 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1768 * src/minibuffer.h: use Timeout instead of the xforms timer
1770 (setTimer) rewrite for the Timeout, change to unsigned arg
1771 (set): change to unsigned timer arg
1774 * src/minibuffer.C (TimerCB): removed func
1775 (C_MiniBuffer_TimerCB): removed func
1776 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1777 (peek_event): use a switch statement
1778 (add): don't use fl_add_timer.
1779 (Set): rewrite to use the Timeout
1782 * src/Timeout.[Ch] (setType): return a Timeout &
1783 (setTimeout): ditto, change to unsigned arg for timeout
1785 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1787 * src/mathed/formula.C (mathed_string_width): Use string instead
1788 of a constant size char array.
1790 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1792 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1793 the two recently added operator<< for SMInput and State.
1795 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1797 (OkCancelPolicy): ditto
1798 (OkCancelReadOnlyPolicy): ditto
1799 (NoRepeatedApplyReadOnlyPolicy): ditto
1800 (OkApplyCancelReadOnlyPolicy): ditto
1801 (OkApplyCancelPolicy): ditto
1802 (NoRepeatedApplyPolicy): ditto
1804 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1806 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1807 add the usual std:: qualifiers.
1809 2000-10-25 Juergen Vigna <jug@sad.it>
1811 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1813 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1815 * src/support/filetools.C (MakeRelPath): change some types to
1818 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1819 ButtonPolicy::SMInput and ButtonPolicy::State.
1821 * src/FontLoader.C (reset): small cleanup
1822 (unload): small cleanup
1824 * src/FontInfo.C (getFontname): initialize error to 10000.0
1826 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1828 * src/frontends/xforms/FormPreferences.[Ch]:
1829 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1830 TeX encoding and default paper size sections.
1832 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1834 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1837 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1838 make the message_ empty.
1839 (FormError): don't initialize message_ in initializer list.
1841 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1843 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1845 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1847 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1849 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1851 * src/frontends/kde/*data.[Ch]: _("") is not
1854 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1856 * src/buffer.C: removed redundant using directive.
1858 * src/frontends/DialogBase.h: revert to original definition of
1861 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1862 stuff into two classes, one for each dialog, requires a new
1863 element in the dialogs vector, FormTabularCreate.
1865 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1868 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1869 method. Continues Allan's idea, but means that derived classes
1870 don't need to worry about "update or hide?".
1872 * src/frontends/xforms/FormError.C (showInset): add connection
1875 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1876 one for each dialog. FormTabular now contains main tabular dialog
1879 * src/frontends/xforms/FormTabularCreate.[Ch]:
1880 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1883 * src/frontends/xforms/FormGraphics.[Ch]:
1884 * src/frontends/xforms/forms/form_graphics.fd
1885 * src/frontends/xforms/FormTabular.[Ch]:
1886 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1887 classes of FormInset.
1889 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1890 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1892 * src/frontends/xforms/Makefile.am:
1893 * src/frontends/xforms/forms/makefile: added new files.
1895 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1896 variable. added Signal0 hide signal, in keeping with other GUI-I
1899 * src/support/lstrings.h: removed redundant std:: qualifier as
1900 it's already declared in Lsstream.h.
1902 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1904 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1908 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1910 * src/tabular.C (Ascii): minimize scope of cell.
1912 * src/BufferView2.C (nextWord): return string() instead of 0;
1914 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1916 * src/converter.h: add a std:: qualifier
1918 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1920 * src/importer.[Ch]: New files. Used for importing files into LyX.
1922 * src/lyxfunc.C (doImport): Use the new Importer class.
1924 * src/converter.h: Add shortcut member to the Format class.
1925 Used for holding the menu shortcut.
1927 * src/converter.C and other files: Made a distinction between
1928 format name and format extension. New formats can be defined using
1929 the \format lyxrc tag.
1930 Added two new converter flags: latex and disable.
1932 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1934 * src/support/lyxlib.h: unify namespace/struct implementation.
1935 Remove extra declarations.
1937 * src/support/chdir.C (chdir): remove version taking char const *
1939 * src/support/rename.C: ditto.
1940 * src/support/lyxsum.C: ditto.
1942 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1944 * src/frontends/xforms/FormBase.[Ch]:
1945 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1946 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1947 work only for the next call to fl_show_form(). The correct place to set
1948 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1949 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1950 from FormBase have the minimum size set; no more stupid crashes with
1953 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1955 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1957 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1959 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1961 * src/support/lyxlib.h: changed second argument of mkdir to
1962 unsigned long int (unsigned int would probably have been enough,
1963 but...). Removed <sys/types.h> header.
1964 * src/support/mkdir.C (mkdir): ditto.
1968 2000-10-19 Juergen Vigna <jug@sad.it>
1970 * src/lyxfunc.C (MenuNew): small fix (form John)
1972 * src/screen.C (Update): removed unneeded code.
1974 * src/tabular.C (Ascii): refixed int != uint bug!
1976 * src/support/lyxlib.h: added sys/types.h include for now permits
1977 compiling, but I don't like this!
1979 2000-10-18 Juergen Vigna <jug@sad.it>
1981 * src/text2.C (ClearSelection): if we clear the selection we need
1982 more refresh so set the status apropriately
1984 * src/insets/insettext.C (draw): hopefully finally fixed draw
1987 2000-10-12 Juergen Vigna <jug@sad.it>
1989 * src/insets/insettext.C (draw): another small fix and make a block
1990 so that variables are localized.
1992 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1994 * src/support/lstrings.C (lowercase, uppercase):
1995 use explicit casts to remove compiler warnings.
1997 * src/support/LRegex.C (Impl):
1998 * src/support/StrPool.C (add):
1999 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2000 (AddPath, MakeDisplayPath):
2001 * src/support/lstrings.C (prefixIs, subst):
2002 use correct type to remove compiler warnings.
2004 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2006 * src/support/lyxlib.h:
2007 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2008 portability and to remove compiler warning with DEC cxx.
2010 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2012 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2014 * src/minibuffer.C (peek_event): retun 1 when there has been a
2015 mouseclick in the minibuffer.
2019 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2021 * src/frontends/xforms/FormParagraph.C: more space above/below
2024 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2026 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2027 a char only if real_current_font was changed.
2029 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2031 * NEWS: update somewhat for 1.1.6
2033 * lib/ui/default.ui: clean up.
2035 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2037 * lib/CREDITS: clean up
2039 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2041 * src/combox.[Ch] (select): changed argument back to int
2042 * src/combox.C (peek_event): removed num_bytes as it is declared but
2045 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2046 modified calls to Combox::select() to remove warnings about type
2049 * src/insets/insetbutton.C (width): explicit cast to remove warning
2050 about type conversion.
2052 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2055 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2056 sel_pos_end, refering to cursor position are changed to
2057 LyXParagraph::size_type.
2059 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2060 consistent with LyXCursor::pos().
2061 (inset_pos): changed to LyXParagraph::size_type for same reason.
2063 * src/insets/insettext.C (resizeLyXText): changed some temporary
2064 variables refing to cursor position to LyXParagraph::size_type.
2066 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2068 * src/frontends/kde/<various>: The Great Renaming,
2071 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2073 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2075 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2077 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2078 0 when there are no arguments.
2080 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2082 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2083 to segfaults when pressing Ok in InsetBibtex dialog.
2085 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2087 * forms/layout_forms.fd:
2088 * src/layout_forms.C (create_form_form_character): small change to use
2089 labelframe rather than engraved frame + text
2091 * src/lyx_gui.C (create_forms): initialise choice_language with some
2092 arbitrary value to prevent segfault when dialog is shown.
2094 2000-10-16 Baruch Even <baruch.even@writeme.com>
2096 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2097 is no resulting file. This pertains only to LaTeX output.
2099 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2101 * src/text.C (Backspace): Make sure that the row of the cursor is
2104 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2107 * src/lyx_gui.C (init): Prevent a crash when only one font from
2108 menu/popup fonts is not found.
2110 * lib/lyxrc.example: Add an example for binding a key for language
2113 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2115 * src/converter.C (GetReachable): Changed the returned type to
2117 (IsReachable): New method
2119 * src/MenuBackend.C (expand): Handle formats that appear more
2122 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2124 * src/frontends/support/Makefile.am
2125 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2128 * lib/CREDITS: add Garst Reese.
2130 * src/support/snprintf.h: add extern "C" {} around the definitions.
2132 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2134 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2137 * src/frontends/xforms/FormDocument.C:
2138 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2139 compile without "conversion to integral type of smaller size"
2142 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2144 * src/text.C (GetColumnNearX): Fixed disabled code.
2146 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2148 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2151 * src/support/snprintf.[ch]: new files
2153 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2155 * src/frontends/kde/formprintdialog.C: add
2156 file browser for selecting postscript output
2158 * src/frontends/kde/formprintdialogdata.C:
2159 * src/frontends/kde/formprintdialogdata.h: re-generate
2162 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2164 * src/frontends/gnome/Makefile.am:
2165 * src/frontends/kde/Makefile.am: FormCommand.C
2166 disappeared from xforms
2168 * src/frontends/kde/FormCitation.C:
2169 * src/frontends/kde/FormIndex.C: read-only
2172 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2174 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2177 * src/bufferlist.C: add using directive.
2179 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2181 * src/support/lyxfunctional.h: version of class_fun for void
2182 returns added, const versions of back_inseter_fun and compare_fun
2185 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2187 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2189 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2191 * ChangeLog: cleanup.
2193 * lib/CREDITS: update to add all the contributors we've forgotten.
2194 I have obviously missed some, so tell me whether there were
2197 2000-10-13 Marko Vendelin <markov@ioc.ee>
2199 * src/frontends/gnome/FormCitation.C
2200 * src/frontends/gnome/FormCitation.h
2201 * src/frontends/gnome/FormError.C
2202 * src/frontends/gnome/FormIndex.C
2203 * src/frontends/gnome/FormRef.C
2204 * src/frontends/gnome/FormRef.h
2205 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2207 * src/frontends/gnome/FormCitation.C
2208 * src/frontends/gnome/FormCopyright.C
2209 * src/frontends/gnome/FormError.C
2210 * src/frontends/gnome/FormIndex.C
2211 * src/frontends/gnome/FormRef.C
2212 * src/frontends/gnome/FormToc.C
2213 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2216 * src/frontends/gnome/Menubar_pimpl.C
2217 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2220 2000-10-11 Baruch Even <baruch.even@writeme.com>
2223 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2224 to convey its real action.
2226 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2227 clear the minibuffer and prepare to enter a command.
2229 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2230 the rename from ExecCommand to PrepareForCommand.
2231 * src/lyxfunc.C (Dispatch): ditto.
2233 2000-10-11 Baruch Even <baruch.even@writeme.com>
2235 * src/buffer.C (writeFile): Added test for errors on writing, this
2236 catches all errors and not only file system full errors as intended.
2238 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2240 * src/lyx_gui.C (create_forms): better fix for crash with
2241 translated interface.
2243 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2245 * src/frontends/kde/Makefile.am:
2246 * src/frontends/kde/FormCopyright.C:
2247 * src/frontends/kde/formcopyrightdialog.C:
2248 * src/frontends/kde/formcopyrightdialog.h:
2249 * src/frontends/kde/formcopyrightdialogdata.C:
2250 * src/frontends/kde/formcopyrightdialogdata.h:
2251 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2252 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2253 copyright to use qtarch
2255 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2257 * src/encoding.C (read): Fixed bug that caused an error message at
2258 the end of the file.
2260 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2262 * lib/lyxrc.example: Fixed hebrew example.
2264 2000-10-13 Allan Rae <rae@lyx.org>
2266 * src/frontends/xforms/FormPreferences.C (input): reworking the
2268 (build, update, apply): New inputs in various tabfolders
2270 * src/frontends/xforms/FormToc.C: use new button policy.
2271 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2272 dialogs that either can't use any existing policy or where it just
2275 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2278 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2279 added a bool parameter which is ignored.
2281 * src/buffer.C (setReadonly):
2282 * src/BufferView_pimpl.C (buffer):
2283 * src/frontends/kde/FormCopyright.h (update):
2284 * src/frontends/kde/FormCitation.[Ch] (update):
2285 * src/frontends/kde/FormIndex.[Ch] (update):
2286 * src/frontends/kde/FormPrint.[Ch] (update):
2287 * src/frontends/kde/FormRef.[Ch] (update):
2288 * src/frontends/kde/FormToc.[Ch] (update):
2289 * src/frontends/kde/FormUrl.[Ch] (update):
2290 * src/frontends/gnome/FormCopyright.h (update):
2291 * src/frontends/gnome/FormCitation.[Ch] (update):
2292 * src/frontends/gnome/FormError.[Ch] (update):
2293 * src/frontends/gnome/FormIndex.[Ch] (update):
2294 * src/frontends/gnome/FormPrint.[Ch] (update):
2295 * src/frontends/gnome/FormRef.h (update):
2296 * src/frontends/gnome/FormToc.[Ch] (update):
2297 * src/frontends/gnome/FormUrl.[Ch] (update):
2298 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2299 to updateBufferDependent and DialogBase
2301 * src/frontends/xforms/FormCitation.[hC]:
2302 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2303 * src/frontends/xforms/FormError.[Ch]:
2304 * src/frontends/xforms/FormGraphics.[Ch]:
2305 * src/frontends/xforms/FormIndex.[Ch]:
2306 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2307 and fixed readOnly handling.
2308 * src/frontends/xforms/FormPrint.[Ch]:
2309 * src/frontends/xforms/FormRef.[Ch]:
2310 * src/frontends/xforms/FormTabular.[Ch]:
2311 * src/frontends/xforms/FormToc.[Ch]:
2312 * src/frontends/xforms/FormUrl.[Ch]:
2313 * src/frontends/xforms/FormInset.[Ch]:
2314 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2315 form of updateBufferDependent.
2317 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2318 if form()->visible just in case someone does stuff to the form in a
2321 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2322 the buttoncontroller for everything the enum used to be used for.
2323 (update) It would seem we need to force all dialogs to use a bool
2324 parameter or have two update functions. I chose to go with one.
2325 I did try removing update() from here and FormBase and defining the
2326 appropriate update signatures in FormBaseB[DI] but then ran into the
2327 problem of the update() call in FormBase::show(). Whatever I did
2328 to get around that would require another function and that just
2329 got more confusing. Hence the decision to make everyone have an
2330 update(bool). An alternative might have been to override show() in
2331 FormBaseB[DI] and that would allow the different and appropriate
2334 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2335 true == buffer change occurred. I decided against using a default
2336 template parameter since not all compilers support that at present.
2338 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2340 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2341 army knife" by removing functionality.
2342 (clearStore): removed. All such housekeeping on hide()ing the dialog
2343 is to be carried out by overloaded disconnect() methods.
2344 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2345 superceded by Baruch's neat test (FormGraphics) to update an existing
2346 dialog if a new signal is recieved rather than block all new signals
2348 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2349 only to Inset dialogs.
2350 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2351 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2353 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2355 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2356 as a base class to all inset dialogs. Used solely to connect/disconnect
2357 the Inset::hide signal and to define what action to take on receipt of
2358 a UpdateBufferDependent signal.
2359 (FormCommand): now derived from FormInset.
2361 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2364 * src/frontends/xforms/FormCopyright.[Ch]:
2365 * src/frontends/xforms/FormPreferences.[Ch]:
2366 now derived from FormBaseBI.
2368 * src/frontends/xforms/FormDocument.[Ch]:
2369 * src/frontends/xforms/FormParagraph.[Ch]:
2370 * src/frontends/xforms/FormPrint.[Ch]:
2371 now derived from FormBaseBD.
2373 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2375 * src/frontends/xforms/FormCitation.[Ch]:
2376 * src/frontends/xforms/FormError.[Ch]:
2377 * src/frontends/xforms/FormRef.[Ch]:
2378 * src/frontends/xforms/FormToc.[Ch]:
2379 (clearStore): reworked as disconnect().
2381 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2384 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2386 * src/converter.C (runLaTeX): constify buffer argument
2389 * src/frontends/support/Makefile.am (INCLUDES): fix.
2391 * src/buffer.h: add std:: qualifier
2392 * src/insets/figinset.C (addpidwait): ditto
2393 * src/MenuBackend.C: ditto
2394 * src/buffer.C: ditto
2395 * src/bufferlist.C: ditto
2396 * src/layout.C: ditto
2397 * src/lyxfunc.C: ditto
2399 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2401 * src/lyxtext.h (bidi_level): change return type to
2402 LyXParagraph::size_type.
2404 * src/lyxparagraph.h: change size_type to
2405 TextContainer::difference_type. This should really be
2406 TextContainer::size_type, but we need currently to support signed
2409 2000-10-11 Marko Vendelin <markov@ioc.ee>
2410 * src/frontends/gnome/FormError.h
2411 * src/frontends/gnome/FormRef.C
2412 * src/frontends/gnome/FormRef.h
2413 * src/frontends/gnome/FormError.C
2414 * src/frontends/gnome/Makefile.am
2415 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2416 to Gnome frontend. Both dialogs use "action" area.
2418 2000-10-12 Baruch Even <baruch.even@writeme.com>
2420 * src/graphics/GraphicsCacheItem_pimpl.C:
2421 * src/graphics/Renderer.C:
2422 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2425 2000-10-12 Juergen Vigna <jug@sad.it>
2427 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2428 visible when selecting).
2430 * development/Code_rules/Rules: fixed some typos.
2432 2000-10-09 Baruch Even <baruch.even@writeme.com>
2434 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2435 compiling on egcs 1.1.2 possible.
2437 * src/filedlg.C (comp_direntry::operator() ): ditto.
2439 2000-08-31 Baruch Even <baruch.even@writeme.com>
2441 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2444 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2445 transient it now only gets freed when the object is destructed.
2447 2000-08-24 Baruch Even <baruch.even@writeme.com>
2449 * src/frontends/FormGraphics.h:
2450 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2453 2000-08-20 Baruch Even <baruch.even@writeme.com>
2455 * src/insets/insetgraphics.C:
2456 (draw): Added messages to the drawn rectangle to report status.
2457 (updateInset): Disabled the use of the inline graphics,
2460 2000-08-17 Baruch Even <baruch.even@writeme.com>
2462 * src/frontends/support: Directory added for the support of GUII LyX.
2464 * src/frontends/support/LyXImage.h:
2465 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2468 * src/frontends/support/LyXImage_X.h:
2469 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2470 version of LyXImage, this uses the Xlib Pixmap.
2472 * src/PainterBase.h:
2473 * src/PainterBase.C:
2475 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2476 replacement to Pixmap.
2478 * src/insets/insetgraphics.h:
2479 * src/insets/insetgraphics.C:
2480 * src/graphics/GraphicsCacheItem.h:
2481 * src/graphics/GraphicsCacheItem.C:
2482 * src/graphics/GraphicsCacheItem_pimpl.h:
2483 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2486 * src/graphics/GraphicsCacheItem.h:
2487 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2488 another copy of the object.
2490 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2491 of cacheHandle, this fixed a bug that sent LyX crashing.
2493 * src/graphics/XPM_Renderer.h:
2494 * src/graphics/XPM_Renderer.C:
2495 * src/graphics/EPS_Renderer.h:
2496 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2498 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2500 * src/lyxfunc.C (processKeySym): only handle the
2501 lockinginset/inset stuff if we have a buffer and text loaded...
2503 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2505 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2507 * src/support/lyxfunctional.h: add operator= that takes a reference
2509 * src/lyxserver.C (mkfifo): make first arg const
2511 * src/layout.h: renamed name(...) to setName(...) to work around
2514 * src/buffer.C (setFileName): had to change name of function to
2515 work around bugs in egcs. (renamed from fileName)
2517 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2519 * src/support/translator.h: move helper template classes to
2520 lyxfunctional.h, include "support/lyxfunctional.h"
2522 * src/support/lyxmanip.h: add delaration of fmt
2524 * src/support/lyxfunctional.h: new file
2525 (class_fun_t): new template class
2526 (class_fun): helper template function
2527 (back_insert_fun_iterator): new template class
2528 (back_inserter_fun): helper template function
2529 (compare_memfun_t): new template class
2530 (compare_memfun): helper template function
2531 (equal_1st_in_pair): moved here from translator
2532 (equal_2nd_in_pair): moved here from translator
2534 * src/support/fmt.C: new file
2535 (fmt): new func, can be used for a printf substitute when still
2536 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2538 * src/support/StrPool.C: add some comments
2540 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2543 * src/insets/figinset.C (addpidwait): use std::copy with
2544 ostream_iterator to fill the pidwaitlist
2546 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2548 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2551 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2554 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2556 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2557 (class_update): ditto
2558 (BulletPanel): ditto
2559 (CheckChoiceClass): move initialization of tc and tct
2561 * src/tabular.C: remove current_view
2562 (OldFormatRead): similar to right below [istream::ignore]
2564 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2565 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2566 unused [istream::ignore]
2568 * src/lyxfunc.C: include "support/lyxfunctional.h"
2569 (getInsetByCode): use std::find_if and compare_memfun
2571 * src/lyxfont.C (stateText): remove c_str()
2573 * src/lyx_main.C (setDebuggingLevel): make static
2574 (commandLineHelp): make static
2576 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2577 Screen* together with fl_get_display() and fl_screen
2579 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2580 togheter with fl_get_display() and fl_screen
2581 (create_forms): remove c_str()
2583 * src/layout.C: include "support/lyxfunctional.h"
2584 (hasLayout): use std::find_if and compare_memfun
2585 (GetLayout): use std::find_if and comapre_memfun
2586 (delete_layout): use std::remove_if and compare_memfun
2587 (NumberOfClass): use std:.find_if and compare_memfun
2589 * src/gettext.h: change for the new functions
2591 * src/gettext.C: new file, make _(char const * str) and _(string
2592 const & str) real functions.
2594 * src/font.C (width): rewrite slightly to avoid one extra variable
2596 * src/debug.C: initialize Debug::ANY here
2598 * src/commandtags.h: update number comments
2600 * src/combox.h (get): make const func
2602 (getline): make const
2604 * src/combox.C (input_cb): handle case where fl_get_input can
2607 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2608 "support/lyxfunctional.h", remove current_view variable.
2609 (resize): use std::for_each with std::mem_fun
2610 (getFileNames): use std::copy with back_inserter_fun
2611 (getBuffer): change arg type to unsigned int
2612 (emergencyWriteAll): call emergencyWrite with std::for_each and
2614 (emergencyWrite): new method, the for loop in emergencyWriteAll
2616 (exists): use std::find_if with compare_memfun
2617 (getBuffer): use std::find_if and compare_memfun
2619 * src/buffer.h: add typedefs for iterator_category, value_type
2620 difference_type, pointer and reference for inset_iterator
2621 add postfix ++ for inset_iterator
2622 make inset_iterator::getPos() const
2624 * src/buffer.C: added support/lyxmanip.h
2625 (readFile): use lyxerr << fmt instead of printf
2626 (makeLaTeXFile): use std::copy to write out encodings
2628 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2630 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2631 free and the char * temp.
2632 (hasMenu): use std::find_if and compare_memfun
2635 * src/Makefile.am (lyx_SOURCES): added gettext.C
2637 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2638 string::insert small change to avoid temporary
2640 * src/LColor.C (getGUIName): remove c_str()
2642 * several files: change all occurrences of fl_display to
2645 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2646 that -pedantic is not used for gcc 2.97 (cvs gcc)
2648 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2650 2000-10-11 Allan Rae <rae@lyx.org>
2652 * src/frontends/xforms/FormPreferences.C (input): template path must be
2653 a readable directory. It doesn't need to be writeable.
2654 (build, delete, update, apply): New inputs in the various tabfolders
2656 * src/frontends/xforms/forms/form_preferences.fd:
2657 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2658 several new entries to existing folders. Shuffled some existing stuff
2661 * src/frontends/xforms/forms/form_print.fd:
2662 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2663 Should probably rework PrinterParams as well. Note that the switch to
2664 collated is effectively the same as !unsorted so changing PrinterParams
2665 will require a lot of fiddly changes to reverse the existing logic.
2667 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2669 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2671 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2673 2000-10-10 Allan Rae <rae@lyx.org>
2676 * src/lyxfunc.C (Dispatch):
2678 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2681 * src/lyxrc.C (output): Only write the differences between system lyxrc
2682 and the users settings.
2685 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2687 I'll rewrite this later, after 1.1.6 probably, to keep a single
2688 LyXRC but two instances of a LyXRCStruct.
2690 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2692 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2694 * src/tabular.h: add a few std:: qualifiers.
2696 * src/encoding.C: add using directive.
2697 * src/language.C: ditto.
2699 * src/insets/insetquotes.C (Validate): use languages->lang()
2700 instead of only language.
2702 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2704 * lib/languages: New file.
2706 * lib/encodings: New file.
2708 * src/language.C (Languages): New class.
2709 (read): New method. Reads the languages from the 'languages' file.
2711 * src/encoding.C (Encodings): New class.
2712 (read): New method. Reads the encodings from the 'encodings' file.
2714 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2717 * src/bufferparams.h and a lot of files: Deleted the member language,
2718 and renamed language_info to language
2720 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2721 * src/lyxfont.C (latexWriteStartChanges): ditto.
2722 * src/paragraph.C (validate,TeXOnePar): ditto.
2724 * src/lyxfont.C (update): Restored deleted code.
2726 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2728 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2730 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2732 * src/insets/figinset.[Ch]:
2733 * src/insets/insetinclude.[Ch]:
2734 * src/insets/insetinclude.[Ch]:
2735 * src/insets/insetparent.[Ch]:
2736 * src/insets/insetref.[Ch]:
2737 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2739 * src/insets/*.[Ch]:
2740 * src/mathed/formula.[Ch]:
2741 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2743 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2744 * src/lyx_cb.C (FigureApplyCB):
2745 * src/lyxfunc.C (getStatus, Dispatch):
2746 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2749 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2751 * src/converter.[Ch] (Formats::View):
2752 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2754 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2755 *current_view->buffer(). This will change later, but this patch is way
2758 2000-10-09 Juergen Vigna <jug@sad.it>
2760 * src/text.C (GetRow): small fix.
2762 * src/BufferView_pimpl.C (cursorPrevious):
2763 (cursorNext): added LyXText parameter to function.
2765 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2766 keypress depending on cursor position.
2768 2000-10-06 Juergen Vigna <jug@sad.it>
2770 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2771 (copySelection): redone this function and also copy ascii representa-
2774 * src/tabular.C (Ascii):
2778 (print_n_chars): new functions to realize the ascii export of tabulars.
2780 2000-10-05 Juergen Vigna <jug@sad.it>
2782 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2783 if we don't have a buffer.
2785 2000-10-10 Allan Rae <rae@lyx.org>
2787 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2788 with closing dialog. It seems that nested tabfolders require hiding
2789 of inner tabfolders before hiding the dialog itself. Actually all I
2790 did was hide the active outer folder.
2792 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2793 unless there really is a buffer. hideBufferDependent is called
2796 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2797 POTFILES.in stays in $(srcdir).
2799 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2801 * lib/lyxrc.example: Few changes.
2803 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2805 * src/BufferView_pimpl.C (buffer): only need one the
2806 updateBufferDependent signal to be emitted once! Moved to the end of
2807 the method to allow bv_->text to be updated first.
2809 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2810 and hSignal_ with Dialogs * and BufferDependency variables.
2811 New Buffer * parent_, initialised when the dialog is launched. Used to
2812 check whether to update() or hide() dialog in the new, private
2813 updateOrHide() method that is connected to the updateBufferDependent
2814 signal. Daughter classes dictate what to do using the
2815 ChangedBufferAction enum, passed to the c-tor.
2817 * src/frontends/xforms/FormCitation.C:
2818 * src/frontends/xforms/FormCommand.C:
2819 * src/frontends/xforms/FormCopyright.C:
2820 * src/frontends/xforms/FormDocument.C:
2821 * src/frontends/xforms/FormError.C:
2822 * src/frontends/xforms/FormIndex.C:
2823 * src/frontends/xforms/FormPreferences.C:
2824 * src/frontends/xforms/FormPrint.C:
2825 * src/frontends/xforms/FormRef.C:
2826 * src/frontends/xforms/FormToc.C:
2827 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2830 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2831 ChangedBufferAction enum.
2833 * src/frontends/xforms/FormParagraph.[Ch]
2834 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2837 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2839 * lib/bind/cua.bind: fix a bit.
2840 * lib/bind/emacs.bind: ditto.
2842 * lib/bind/menus.bind: remove real menu entries from there.
2844 * src/spellchecker.C: make sure we only include strings.h when
2847 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2849 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2850 function. It enlarges the maximum number of pup when needed.
2851 (add_toc2): Open a new menu if maximum number of items per menu has
2854 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2856 * src/frontends/kde/FormPrint.C: fix error reporting
2858 * src/frontends/xforms/FormDocument.C: fix compiler
2861 * lib/.cvsignore: add Literate.nw
2863 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2866 * bufferview_funcs.[Ch]
2869 * text2.C: Add support for numbers in RTL text.
2871 2000-10-06 Allan Rae <rae@lyx.org>
2873 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2874 to be gettext.m4 friendly again. ext_l10n.h is now
2875 generated into $top_srcdir instead of $top_builddir
2876 so that lyx.pot will be built correctly -- without
2877 duplicate parsing of ext_l10n.h.
2879 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2881 * src/frontends/kde/FormCitation.C: make the dialog
2882 behave more sensibly
2884 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2886 * config/kde.m4: fix consecutive ./configure runs,
2887 look for qtarch, fix library order
2889 * src/frontends/kde/Makefile.am: tidy up,
2890 add Print dialog, add .dlg dependencies
2892 * src/frontends/kde/FormPrint.C:
2893 * src/frontends/kde/FormPrint.h:
2894 * src/frontends/kde/formprintdialog.C:
2895 * src/frontends/kde/formprintdialog.h:
2896 * src/frontends/kde/formprintdialogdata.C:
2897 * src/frontends/kde/formprintdialogdata.h:
2898 * src/frontends/kde/dlg/formprintdialog.dlg: add
2901 * src/frontends/kde/dlg/README: Added explanatory readme
2903 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2904 script to double-check qtarch's output
2906 * src/frontends/kde/formindexdialog.C:
2907 * src/frontends/kde/formindexdialogdata.C:
2908 * src/frontends/kde/formindexdialogdata.h:
2909 * src/frontends/kde/dlg/formindexdialog.dlg: update
2910 for qtarch, minor fixes
2912 2000-10-05 Allan Rae <rae@lyx.org>
2914 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2915 dialogs when switching buffers update them instead. It's up to each
2916 dialog to decide if it should still be visible or not.
2917 update() should return a bool to control visiblity within show().
2918 Or perhaps better to set a member variable and use that to control
2921 * lib/build-listerrors: create an empty "listerrors" file just to stop
2922 make trying to regenerate it all the time if you don't have noweb
2925 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2927 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2928 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2929 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2930 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2931 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2933 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2935 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2937 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2938 deleting buffer. Closes all buffer-dependent dialogs.
2940 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2942 * src/frontends/xforms/FormCitation.[Ch]:
2943 * src/frontends/xforms/FormPreferences.[Ch]:
2944 * src/frontends/xforms/FormPrint.[Ch]:
2945 * src/frontends/xforms/FormRef.[Ch]:
2946 * src/frontends/xforms/FormUrl.[Ch]: ditto
2948 * src/frontends/xforms/FormDocument.[Ch]:
2949 * src/frontends/xforms/forms/form_document.C.patch:
2950 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2951 pass through a single input() function.
2953 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2955 * lib/build-listerrors: return status as OK
2957 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2959 * lib/lyxrc.example: Updated to new export code
2961 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2963 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2966 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2969 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2970 LyX-Code is defined.
2971 * lib/layouts/amsbook.layout: ditto.
2973 * boost/Makefile.am: fix typo.
2975 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2977 (add_lastfiles): removed.
2978 (add_documents): removed.
2979 (add_formats): removed.
2981 * src/frontends/Menubar.C: remove useless "using" directive.
2983 * src/MenuBackend.h: add a new MenuItem constructor.
2985 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2988 2000-10-04 Allan Rae <rae@lyx.org>
2990 * lib/Makefile.am (listerrors):
2991 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2992 I haven't got notangle installed so Kayvan please test. The output
2993 should end up in $builddir. This also allows people who don't have
2994 noweb installed to complete the make process without error.
2996 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2997 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2998 by JMarc's picky compiler.
3000 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3003 * src/insets/insettabular.C (setPos): change for loop to not use
3004 sequencing operator. Please check this Jürgen.
3006 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3008 * src/insets/insetcite.C (getScreenLabel): ditto
3009 * src/support/filetools.C (QuoteName): ditto
3010 (ChangeExtension): ditto
3012 * src/BufferView_pimpl.C (scrollCB): make heigt int
3014 * src/BufferView2.C (insertInset): comment out unused arg
3016 * boost/Makefile.am (EXTRADIST): new variable
3018 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3020 * src/exporter.C (IsExportable): Fixed
3022 * lib/configure.m4: Small fix
3024 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3026 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3027 * src/insets/insetbib.C (bibitemWidest): ditto.
3028 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3030 2000-10-03 Juergen Vigna <jug@sad.it>
3032 * src/BufferView2.C (theLockingInset): removed const because of
3033 Agnus's compile problems.
3035 * src/insets/insettext.C (LocalDispatch): set the language of the
3036 surronding paragraph on inserting the first character.
3038 * various files: changed use of BufferView::the_locking_inset.
3040 * src/BufferView2.C (theLockingInset):
3041 (theLockingInset): new functions.
3043 * src/BufferView.h: removed the_locking_inset.
3045 * src/lyxtext.h: added the_locking_inset
3047 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3049 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3051 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3053 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3054 * src/mathed/math_cursor.C (IsAlpha): ditto.
3055 * src/mathed/math_inset.C (strnew): ditto.
3056 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3057 (IMetrics): cxp set but never used; removed.
3058 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3059 that the variable in question has been removed also!
3062 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3063 using the Buffer * passed to Latex(), using the BufferView * passed to
3064 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3066 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3067 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3069 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3070 * src/buffer.C (readInset): used new InsetBibtex c-tor
3071 * (getBibkeyList): used new InsetBibtex::getKeys
3073 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3076 * lib/build-listerrors
3078 * src/exporter.C: Add literate programming support to the export code
3081 * src/lyx_cb.C: Remove old literate code.
3083 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3086 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3087 * src/converter.C (View, Convert): Use QuoteName.
3089 * src/insets/figinset.C (Preview): Use Formats::View.
3091 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3093 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3095 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3096 the top of the function, because compaq cxx complains that the
3097 "goto exit_with_message" when the function is disabled bypasses
3099 (MenuNew): try a better fix for the generation of new file names.
3100 This time, I used AddName() instead of AddPath(), hoping Juergen
3103 2000-10-03 Allan Rae <rae@lyx.org>
3105 * src/frontends/xforms/forms/form_preferences.fd:
3106 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3107 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3108 "Look and Feel"->"General" but will need to be split up further into
3109 general output and general input tabs. Current plan is for four outer
3110 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3111 stuff; "Inputs" for input and import configuration; "Outputs" for
3112 output and export configuration; and one more whatever is left over
3113 called "General". The leftovers at present look like being which
3114 viewers to use, spellchecker, language support and might be better
3115 named "Support". I've put "Paths" in "Inputs" for the moment as this
3116 seems reasonable for now at least.
3117 One problem remains: X error kills LyX when you close Preferences.
3119 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3121 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3122 qualifier from form()
3123 * src/frontends/xforms/FormCitation.[Ch]:
3124 * src/frontends/xforms/FormCopyright.[Ch]:
3125 * src/frontends/xforms/FormDocument.[Ch]:
3126 * src/frontends/xforms/FormError.[Ch]:
3127 * src/frontends/xforms/FormIndex.[Ch]:
3128 * src/frontends/xforms/FormPreferences.[Ch]:
3129 * src/frontends/xforms/FormPrint.[Ch]:
3130 * src/frontends/xforms/FormRef.[Ch]:
3131 * src/frontends/xforms/FormToc.[Ch]:
3132 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3134 * src/frontends/xforms/FormCitation.[Ch]:
3135 * src/frontends/xforms/FormIndex.[Ch]:
3136 * src/frontends/xforms/FormRef.[Ch]:
3137 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3138 with Allan's naming policy
3140 * src/frontends/xforms/FormCitation.C: some static casts to remove
3143 2000-10-02 Juergen Vigna <jug@sad.it>
3145 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3146 now you can type or do stuff inside the table-cell also when in dummy
3147 position, fixed visible cursor.
3149 * src/insets/insettext.C (Edit): fixing cursor-view position.
3151 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3152 be used for equal functions in lyxfunc and insettext.
3154 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3156 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3158 * src/frontends/gnome/FormCitation.h:
3159 * src/frontends/gnome/FormCopyright.h:
3160 * src/frontends/gnome/FormIndex.h:
3161 * src/frontends/gnome/FormPrint.h:
3162 * src/frontends/gnome/FormToc.h:
3163 * src/frontends/gnome/FormUrl.h:
3164 * src/frontends/kde/FormCitation.h:
3165 * src/frontends/kde/FormCopyright.h:
3166 * src/frontends/kde/FormIndex.h:
3167 * src/frontends/kde/FormRef.h:
3168 * src/frontends/kde/FormToc.h:
3169 * src/frontends/kde/FormUrl.h: fix remaining users of
3172 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3174 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3175 from depth argument.
3176 (DocBookHandleCaption): ditto.
3177 (DocBookHandleFootnote): ditto.
3178 (SimpleDocBookOnePar): ditto.
3180 * src/frontends/xforms/FormDocument.h (form): remove extra
3181 FormDocument:: qualifier.
3183 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3185 * sigc++/handle.h: ditto.
3187 * src/lyx_gui_misc.C: add "using" directive.
3189 * src/cheaders/cstddef: new file, needed by the boost library (for
3192 2000-10-02 Juergen Vigna <jug@sad.it>
3194 * src/insets/insettext.C (SetFont): better support.
3196 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3198 * src/screen.C (DrawOneRow): some uint refixes!
3200 2000-10-02 Allan Rae <rae@lyx.org>
3202 * boost/.cvsignore: ignore Makefile as well
3204 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3205 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3207 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3208 Left this one out by accident.
3210 * src/frontends/xforms/FormBase.h (restore): default to calling
3211 update() since that will restore the original/currently-applied values.
3212 Any input() triggered error messages will require the derived classes
3213 to redefine restore().
3215 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3216 avoid a segfault. combo_doc_class is the main concern.
3218 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3220 * Simplify build-listerrors in view of GUI-less export ability!
3222 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3224 * src/lyx_main.C (easyParse): Disable gui when exporting
3226 * src/insets/figinset.C:
3229 * src/lyx_gui_misc.C
3230 * src/tabular.C: Changes to allow no-gui.
3232 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3234 * src/support/utility.hpp: removed file
3235 * src/support/block.h: removed file
3237 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3240 * src/mathed/formula.C: add support/lyxlib.h
3241 * src/mathed/formulamacro.C: ditto
3243 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3244 * src/lyxparagraph.h: ditto
3246 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3247 * src/frontends/Makefile.am (INCLUDES): ditto
3248 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3249 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3250 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3251 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3252 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3253 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3255 * src/BufferView.h: use boost/utility.hpp
3256 * src/LColor.h: ditto
3257 * src/LaTeX.h: ditto
3258 * src/LyXAction.h: ditto
3259 * src/LyXView.h: ditto
3260 * src/bufferlist.h: ditto
3261 * src/lastfiles.h: ditto
3262 * src/layout.h: ditto
3263 * src/lyx_gui.h: ditto
3264 * src/lyx_main.h: ditto
3265 * src/lyxlex.h: ditto
3266 * src/lyxrc.h: ditto
3267 * src/frontends/ButtonPolicies.h: ditto
3268 * src/frontends/Dialogs.h: ditto
3269 * src/frontends/xforms/FormBase.h: ditto
3270 * src/frontends/xforms/FormGraphics.h: ditto
3271 * src/frontends/xforms/FormParagraph.h: ditto
3272 * src/frontends/xforms/FormTabular.h: ditto
3273 * src/graphics/GraphicsCache.h: ditto
3274 * src/graphics/Renderer.h: ditto
3275 * src/insets/ExternalTemplate.h: ditto
3276 * src/insets/insetcommand.h: ditto
3277 * src/support/path.h: ditto
3279 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3280 and introduce clause for 2.97.
3282 * boost/libs/README: new file
3284 * boost/boost/utility.hpp: new file
3286 * boost/boost/config.hpp: new file
3288 * boost/boost/array.hpp: new file
3290 * boost/Makefile.am: new file
3292 * boost/.cvsignore: new file
3294 * configure.in (AC_OUTPUT): add boost/Makefile
3296 * Makefile.am (SUBDIRS): add boost
3298 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3300 * src/support/lstrings.C (suffixIs): Fixed.
3302 2000-10-01 Allan Rae <rae@lyx.org>
3304 * src/PrinterParams.h: moved things around to avoid the "can't
3305 inline call" warning.
3307 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3308 into doc++ documentation.
3310 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3312 * src/frontends/xforms/FormRef.C: make use of button controller
3313 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3314 cleaned up button controller usage.
3315 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3316 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3317 use the button controller
3319 * src/frontends/xforms/forms/*.fd: and associated generated files
3320 updated to reflect changes to FormBase. Some other FormXxxx files
3321 also got minor updates to reflect changes to FormBase.
3323 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3324 (hide): made virtual.
3325 (input): return a bool. true == valid input
3326 (RestoreCB, restore): new
3327 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3328 Changes to allow derived dialogs to use a ButtonController and
3329 make sense when doing so: OK button calls ok() and so on.
3331 * src/frontends/xforms/ButtonController.h (class ButtonController):
3332 Switch from template implementation to taking Policy parameter.
3333 Allows FormBase to provide a ButtonController for any dialog.
3335 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3336 Probably should rename connect and disconnect.
3337 (apply): use the radio button groups
3338 (form): needed by FormBase
3339 (build): setup the radio button groups
3341 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3343 * several files: type changes to reduce the number of warnings and
3344 to unify type hangling a bit. Still much to do.
3346 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3348 * lib/images/*: rename a bunch of icons to match Dekel converter
3351 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3354 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3356 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3358 * sigc++/handle.h: ditto for class Handle.
3360 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3362 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3364 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3366 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3367 removal of the "default" language.
3369 * src/combox.h (getline): Check that sel > 0
3371 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3373 * lib/examples/docbook_example.lyx
3374 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3376 * lib/layouts/docbook-book.layout: new docbook book layout.
3378 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3380 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3382 * src/insets/figinset.C (DocBook):fixed small typo.
3384 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3386 * src/insets/insetinclude.h: string include_label doesn't need to be
3389 2000-09-29 Allan Rae <rae@lyx.org>
3391 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3392 Allow derived type to control connection and disconnection from signals
3393 of its choice if desired.
3395 2000-09-28 Juergen Vigna <jug@sad.it>
3397 * src/insets/insettabular.C (update): fixed cursor setting when
3398 the_locking_inset changed.
3399 (draw): made this a bit cleaner.
3400 (InsetButtonPress): fixed!
3402 * various files: added LyXText Parameter to fitCursor call.
3404 * src/BufferView.C (fitCursor): added LyXText parameter.
3406 * src/insets/insettabular.C (draw): small draw fix.
3408 * src/tabular.C: right setting of left/right celllines.
3410 * src/tabular.[Ch]: fixed various types in funcions and structures.
3411 * src/insets/insettabular.C: ditto
3412 * src/frontends/xforms/FormTabular.C: ditto
3414 2000-09-28 Allan Rae <rae@lyx.org>
3416 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3417 that the #ifdef's had been applied to part of what should have been
3418 a complete condition. It's possible there are other tests that
3419 were specific to tables that are also wrong now that InsetTabular is
3420 being used. Now we need to fix the output of '\n' after a table in a
3421 float for the same reason as the original condition:
3422 "don't insert this if we would be adding it before or after a table
3423 in a float. This little trick is needed in order to allow use of
3424 tables in \subfigures or \subtables."
3425 Juergen can you check this?
3427 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3429 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3430 output to the ostream.
3432 * several files: fixed types based on warnings from cxx
3434 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3436 * src/frontends/kde/Makefile.am: fix rule for
3437 formindexdialogdata_moc.C
3439 * src/.cvsignore: add ext_l10n.h to ignore
3441 * acconfig.h: stop messing with __STRICT_ANSI__
3442 * config/gnome.m4: remove option to set -ansi
3443 * config/kde.m4: remove option to set -ansi
3444 * config/lyxinclude.m4: don't set -ansi
3446 2000-09-27 Juergen Vigna <jug@sad.it>
3448 * various files: remove "default" language check.
3450 * src/insets/insetquotes.C: removed use of current_view.
3452 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3453 the one should have red ears by now!
3455 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3456 in more then one paragraph. Fixed cursor-movement/selection.
3458 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3459 paragraphs inside a text inset.
3461 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3462 text-inset if this owner is an inset.
3464 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3466 * src/Bullet.h: changed type of font, character and size to int
3468 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3470 * src/insets/inseturl.[Ch]:
3471 * src/insets/insetref.[Ch]:
3472 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3474 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3476 * src/buffer.C (readFile): block-if statement rearranged to minimise
3477 bloat. Patch does not reverse Jean-Marc's change ;-)
3479 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3480 Class rewritten to store pointers to hide/update signals directly,
3481 rather than Dialogs *. Also defined an enum to ease use. All xforms
3482 forms can now be derived from this class.
3484 * src/frontends/xforms/FormCommand.[Ch]
3485 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3487 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3490 * src/frontends/xforms/forms/form_citation.fd
3491 * src/frontends/xforms/forms/form_copyright.fd
3492 * src/frontends/xforms/forms/form_error.fd
3493 * src/frontends/xforms/forms/form_index.fd
3494 * src/frontends/xforms/forms/form_ref.fd
3495 * src/frontends/xforms/forms/form_toc.fd
3496 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3498 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3500 * src/insets/insetfoot.C: removed redundent using directive.
3502 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3504 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3505 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3507 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3508 created in the constructors in different groups. Then set() just
3509 have to show the groups as needed. This fixes the redraw problems
3510 (and is how the old menu code worked).
3512 * src/support/lyxlib.h: declare the methods as static when we do
3513 not have namespaces.
3515 2000-09-26 Juergen Vigna <jug@sad.it>
3517 * src/buffer.C (asciiParagraph): new function.
3518 (writeFileAscii): new function with parameter ostream.
3519 (writeFileAscii): use now asciiParagraph.
3521 * various inset files: added the linelen parameter to the Ascii-func.
3523 * src/tabular.C (Write): fixed error in writing file introduced by
3524 the last changes from Lars.
3526 * lib/bind/menus.bind: removed not supported functions.
3528 * src/insets/insettext.C (Ascii): implemented this function.
3530 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3532 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3533 (Write): use of the write_attribute functions.
3535 * src/bufferlist.C (close): fixed reasking question!
3537 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3539 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3540 new files use the everwhere possible.
3543 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3544 src/log_form.C src/lyx.C:
3547 * src/buffer.C (runLaTeX): remove func
3549 * src/PaperLayout.C: removed file
3550 * src/ParagraphExtra.C: likewise
3551 * src/bullet_forms.C: likewise
3552 * src/bullet_forms.h: likewise
3553 * src/bullet_forms_cb.C: likewise
3555 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3556 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3559 * several files: remove all traces of the old fd_form_paragraph,
3560 and functions belonging to that.
3562 * several files: remove all traces of the old fd_form_document,
3563 and functions belonging to that.
3565 * several files: constify local variables were possible.
3567 * several files: remove all code that was dead when NEW_EXPORT was
3570 * several files: removed string::c_str in as many places as
3573 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3574 (e): be a bit more outspoken when patching
3575 (updatesrc): only move files if changed.
3577 * forms/layout_forms.h.patch: regenerated
3579 * forms/layout_forms.fd: remove form_document and form_paragraph
3580 and form_quotes and form_paper and form_table_options and
3581 form_paragraph_extra
3583 * forms/form1.fd: remove form_table
3585 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3586 the fdui->... rewrite. Update some comments to xforms 0.88
3588 * forms/bullet_forms.C.patch: removed file
3589 * forms/bullet_forms.fd: likewise
3590 * forms/bullet_forms.h.patch: likewise
3592 * development/Code_rules/Rules: added a section on switch
3593 statements. Updated some comment to xforms 0.88.
3595 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3597 * src/buffer.C (readFile): make sure that the whole version number
3598 is read after \lyxformat (even when it contains a comma)
3600 * lib/ui/default.ui: change shortcut of math menu to M-a.
3602 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3604 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3607 * src/LyXView.C (updateWindowTitle): show the full files name in
3608 window title, limited to 30 characters.
3610 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3611 When a number of characters has been given, we should not assume
3612 that the string is 0-terminated.
3614 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3615 calls (fixes some memory leaks)
3617 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3618 trans member on exit.
3620 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3622 * src/converter.C (GetReachable): fix typo.
3624 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3625 understand ',' instead of '.'.
3626 (GetInteger): rewrite to use strToInt().
3628 2000-09-26 Juergen Vigna <jug@sad.it>
3630 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3631 better visibility and error-message on wrong VSpace input.
3633 * src/language.C (initL): added english again.
3635 2000-09-25 Juergen Vigna <jug@sad.it>
3637 * src/frontends/kde/Dialogs.C (Dialogs):
3638 * src/frontends/gnome/Dialogs.C (Dialogs):
3639 * src/frontends/kde/Makefile.am:
3640 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3642 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3644 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3646 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3648 * src/frontends/xforms/FormParagraph.C:
3649 * src/frontends/xforms/FormParagraph.h:
3650 * src/frontends/xforms/form_paragraph.C:
3651 * src/frontends/xforms/form_paragraph.h:
3652 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3655 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3657 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3658 Paragraph-Data after use.
3660 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3661 non breakable paragraphs.
3663 2000-09-25 Garst R. Reese <reese@isn.net>
3665 * src/language.C (initL): added missing language_country codes.
3667 2000-09-25 Juergen Vigna <jug@sad.it>
3669 * src/insets/insettext.C (InsetText):
3670 (deleteLyXText): remove the not released LyXText structure!
3672 2000-09-24 Marko Vendelin <markov@ioc.ee>
3674 * src/frontends/gnome/mainapp.C
3675 * src/frontends/gnome/mainapp.h: added support for keyboard
3678 * src/frontends/gnome/FormCitation.C
3679 * src/frontends/gnome/FormCitation.h
3680 * src/frontends/gnome/Makefile.am
3681 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3682 FormCitation to use "action area" in mainapp window
3684 * src/frontends/gnome/Menubar_pimpl.C
3685 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3688 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3690 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3691 width/descent/ascent values if name is empty.
3692 (mathed_string_height): Use std::max.
3694 2000-09-25 Allan Rae <rae@lyx.org>
3696 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3697 segfault. This will be completely redesigned soon.
3699 * sigc++: updated libsigc++. Fixes struct timespec bug.
3701 * development/tools/makeLyXsigc.sh: .cvsignore addition
3703 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3705 * several files: removed almost all traces of the old table
3708 * src/TableLayout.C: removed file
3710 2000-09-22 Juergen Vigna <jug@sad.it>
3712 * src/frontends/kde/Dialogs.C: added credits forms.
3714 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3716 * src/frontends/gnome/Dialogs.C: added some forms.
3718 * src/spellchecker.C (init_spell_checker): set language in pspell code
3719 (RunSpellChecker): some modifications for setting language string.
3721 * src/language.[Ch]: added language_country code.
3723 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3725 * src/frontends/Dialogs.h: added new signal showError.
3726 Rearranged existing signals in some sort of alphabetical order.
3728 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3729 FormError.[Ch], form_error.[Ch]
3730 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3731 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3733 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3734 dialogs. I think that this can be used as the base to all these
3737 * src/frontends/xforms/FormError.[Ch]
3738 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3739 implementation of InsetError dialog.
3741 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3743 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3744 * src/frontends/kde/Makefile.am: ditto
3746 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3748 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3749 macrobf. This fixes a bug of invisible text.
3751 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3753 * lib/doc/LaTeXConfig.lyx.in: updated.
3755 * src/language.C (initL): remove language "francais" and change a
3756 bit the names of the two other french variations.
3758 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3759 string that may not be 0-terminated.
3761 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3763 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3765 2000-09-20 Marko Vendelin <markov@ioc.ee>
3767 * src/frontends/gnome/FormCitation.C
3768 * src/frontends/gnome/FormIndex.C
3769 * src/frontends/gnome/FormToc.C
3770 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3771 the variable initialization to shut up the warnings
3773 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3775 * src/table.[Ch]: deleted files
3777 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3780 2000-09-18 Juergen Vigna <jug@sad.it>
3782 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3783 problems with selection. Inserted new LFUN_PASTESELECTION.
3784 (InsetButtonPress): inserted handling of middle mouse-button paste.
3786 * src/spellchecker.C: changed word to word.c_str().
3788 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3790 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3791 included in the ``make dist'' tarball.
3793 2000-09-15 Juergen Vigna <jug@sad.it>
3795 * src/CutAndPaste.C (cutSelection): small fix return the right
3796 end position after cut inside one paragraph only.
3798 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3799 we are locked as otherwise we don't have a valid cursor position!
3801 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3803 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3805 * src/frontends/kde/FormRef.C: added using directive.
3806 * src/frontends/kde/FormToc.C: ditto
3808 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3810 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3812 2000-09-19 Marko Vendelin <markov@ioc.ee>
3814 * src/frontends/gnome/Menubar_pimpl.C
3815 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3816 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3818 * src/frontends/gnome/mainapp.C
3819 * src/frontends/gnome/mainapp.h: support for menu update used
3822 * src/frontends/gnome/mainapp.C
3823 * src/frontends/gnome/mainapp.h: support for "action" area in the
3824 main window. This area is used by small simple dialogs, such as
3827 * src/frontends/gnome/FormIndex.C
3828 * src/frontends/gnome/FormIndex.h
3829 * src/frontends/gnome/FormUrl.C
3830 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3833 * src/frontends/gnome/FormCitation.C
3834 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3835 action area. Only "Insert new citation" is implemented.
3837 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3839 * src/buffer.C (Dispatch): fix call to Dispatch
3840 * src/insets/insetref.C (Edit): likewise
3841 * src/insets/insetparent.C (Edit): likewise
3842 * src/insets/insetinclude.C (include_cb): likewise
3843 * src/frontends/xforms/FormUrl.C (apply): likewise
3844 * src/frontends/xforms/FormToc.C (apply): likewise
3845 * src/frontends/xforms/FormRef.C (apply): likewise
3846 * src/frontends/xforms/FormIndex.C (apply): likewise
3847 * src/frontends/xforms/FormCitation.C (apply): likewise
3848 * src/lyxserver.C (callback): likewise
3849 * src/lyxfunc.C (processKeySym): likewise
3850 (Dispatch): likewise
3851 (Dispatch): likewise
3852 * src/lyx_cb.C (LayoutsCB): likewise
3854 * Makefile.am (sourcedoc): small change
3856 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3858 * src/main.C (main): Don't make an empty GUIRunTime object. all
3859 methods are static. constify a bit remove unneded using + headers.
3861 * src/tabular.C: some more const to local vars move some loop vars
3863 * src/spellchecker.C: added some c_str after some word for pspell
3865 * src/frontends/GUIRunTime.h: add new static method setDefaults
3866 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3867 * src/frontends/kde/GUIRunTime.C (setDefaults):
3868 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3870 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3871 with strnew in arg, use correct emptystring when calling SetName.
3873 * several files: remove all commented code with relation to
3874 HAVE_SSTREAM beeing false. We now only support stringstream and
3877 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3879 * src/lyxfunc.C: construct correctly the automatic new file
3882 * src/text2.C (IsStringInText): change type of variable i to shut
3885 * src/support/sstream.h: do not use namespaces if the compiler
3886 does not support them.
3888 2000-09-15 Marko Vendelin <markov@ioc.ee>
3889 * src/frontends/gnome/FormCitation.C
3890 * src/frontends/gnome/FormCitation.h
3891 * src/frontends/gnome/diainsertcitation_interface.c
3892 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3893 regexp support to FormCitation [Gnome].
3895 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3898 * configure.in: remove unused KDE/GTKGUI define
3900 * src/frontends/kde/FormRef.C
3901 * src/frontends/kde/FormRef.h
3902 * src/frontends/kde/formrefdialog.C
3903 * src/frontends/kde/formrefdialog.h: double click will
3904 go to reference, now it is possible to change a cross-ref
3907 * src/frontends/kde/FormToc.C
3908 * src/frontends/kde/FormToc.h
3909 * src/frontends/kde/formtocdialog.C
3910 * src/frontends/kde/formtocdialog.h: add a depth
3913 * src/frontends/kde/Makefile.am: add QtLyXView.h
3916 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3918 * src/frontends/kde/FormCitation.h: added some using directives.
3920 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3922 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3925 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3928 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3930 * src/buffer.C (pop_tag): revert for the second time a change by
3931 Lars, who seems to really hate having non-local loop variables :)
3933 * src/Lsstream.h: add "using" statements.
3935 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3936 * src/buffer.C (writeFile): ditto
3938 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3940 * src/buffer.C (writeFile): try to fix the locale modified format
3941 number to always be as we want it.
3943 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3944 in XForms 0.89. C-space is now working again.
3946 * src/Lsstream.h src/support/sstream.h: new files.
3948 * also commented out all cases where strstream were used.
3950 * src/Bullet.h (c_str): remove method.
3952 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3954 * a lot of files: get rid of "char const *" and "char *" is as
3955 many places as possible. We only want to use them in interaction
3956 with system of other libraries, not inside lyx.
3958 * a lot of files: return const object is not of pod type. This
3959 helps ensure that temporary objects is not modified. And fits well
3960 with "programming by contract".
3962 * configure.in: check for the locale header too
3964 * Makefile.am (sourcedoc): new tag for generation of doc++
3967 2000-09-14 Juergen Vigna <jug@sad.it>
3969 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3970 callback to check which combo called it and do the right action.
3972 * src/combox.C (combo_cb): added combo * to the callbacks.
3973 (Hide): moved call of callback after Ungrab of the pointer.
3975 * src/intl.h: removed LCombo2 function.
3977 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3978 function as this can now be handled in one function.
3980 * src/combox.h: added Combox * to callback prototype.
3982 * src/frontends/xforms/Toolbar_pimpl.C:
3983 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3985 2000-09-14 Garst Reese <reese@isn.net>
3987 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3988 moved usepackage{xxx}'s to beginning of file. Changed left margin
3989 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3990 underlining from title. Thanks to John Culleton for useful suggestions.
3992 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3994 * src/lyxlex_pimpl.C (setFile): change error message to debug
3997 2000-09-13 Juergen Vigna <jug@sad.it>
3999 * src/frontends/xforms/FormDocument.C: implemented choice_class
4000 as combox and give callback to combo_language so OK/Apply is activated
4003 * src/bufferlist.C (newFile): small fix so already named files
4004 (via an open call) are not requested to be named again on the
4007 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4009 * src/frontends/kde/Makefile.am
4010 * src/frontends/kde/FormRef.C
4011 * src/frontends/kde/FormRef.h
4012 * src/frontends/kde/formrefdialog.C
4013 * src/frontends/kde/formrefdialog.h: implement
4016 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4018 * src/frontends/kde/formtocdialog.C
4019 * src/frontends/kde/formtocdialog.h
4020 * src/frontends/kde/FormToc.C
4021 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4023 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4025 * src/frontends/kde/FormCitation.C: fix thinko
4026 where we didn't always display the reference text
4029 * src/frontends/kde/formurldialog.C
4030 * src/frontends/kde/formurldialog.h
4031 * src/frontends/kde/FormUrl.C
4032 * src/frontends/kde/FormUrl.h: minor cleanups
4034 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4036 * src/frontends/kde/Makefile.am
4037 * src/frontends/kde/FormToc.C
4038 * src/frontends/kde/FormToc.h
4039 * src/frontends/kde/FormCitation.C
4040 * src/frontends/kde/FormCitation.h
4041 * src/frontends/kde/FormIndex.C
4042 * src/frontends/kde/FormIndex.h
4043 * src/frontends/kde/formtocdialog.C
4044 * src/frontends/kde/formtocdialog.h
4045 * src/frontends/kde/formcitationdialog.C
4046 * src/frontends/kde/formcitationdialog.h
4047 * src/frontends/kde/formindexdialog.C
4048 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4050 2000-09-12 Juergen Vigna <jug@sad.it>
4052 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4055 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4057 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4060 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4062 * src/converter.C (Add, Convert): Added support for converter flags:
4063 needaux, resultdir, resultfile.
4064 (Convert): Added new parameter view_file.
4065 (dvips_options): Fixed letter paper option.
4067 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4068 (Export, GetExportableFormats, GetViewableFormats): Added support
4071 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4073 (easyParse): Fixed to work with new export code.
4075 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4078 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4080 * lib/bind/*.bind: Replaced
4081 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4082 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4084 2000-09-11 Juergen Vigna <jug@sad.it>
4086 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4088 * src/main.C (main): now GUII defines global guiruntime!
4090 * src/frontends/gnome/GUIRunTime.C (initApplication):
4091 * src/frontends/kde/GUIRunTime.C (initApplication):
4092 * src/frontends/xforms/GUIRunTime.C (initApplication):
4093 * src/frontends/GUIRunTime.h: added new function initApplication.
4095 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4097 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4099 2000-09-08 Juergen Vigna <jug@sad.it>
4101 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4102 we have already "Reset".
4104 * src/language.C (initL): inserted "default" language and made this
4105 THE default language (and not american!)
4107 * src/paragraph.C: inserted handling of "default" language!
4109 * src/lyxfont.C: ditto
4113 * src/paragraph.C: output the \\par only if we have a following
4114 paragraph otherwise it's not needed.
4116 2000-09-05 Juergen Vigna <jug@sad.it>
4118 * config/pspell.m4: added entry to lyx-flags
4120 * src/spellchecker.C: modified version from Kevin for using pspell
4122 2000-09-01 Marko Vendelin <markov@ioc.ee>
4123 * src/frontends/gnome/Makefile.am
4124 * src/frontends/gnome/FormCitation.C
4125 * src/frontends/gnome/FormCitation.h
4126 * src/frontends/gnome/diainsertcitation_callbacks.c
4127 * src/frontends/gnome/diainsertcitation_callbacks.h
4128 * src/frontends/gnome/diainsertcitation_interface.c
4129 * src/frontends/gnome/diainsertcitation_interface.h
4130 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4131 dialog for Gnome frontend
4133 * src/main.C: Gnome libraries require keeping application name
4134 and its version as strings
4136 * src/frontends/gnome/mainapp.C: Change the name of the main window
4137 from GnomeLyX to PACKAGE
4139 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4141 * src/frontends/Liason.C: add "using: declaration.
4143 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4145 * src/mathed/math_macro.C (Metrics): Set the size of the template
4147 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4149 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4151 * src/converter.C (add_options): New function.
4152 (SetViewer): Change $$FName into '$$FName'.
4153 (View): Add options when running xdvi
4154 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4155 (Convert): The 3rd parameter is now the desired filename. Converts
4156 calls to lyx::rename if necessary.
4157 Add options when running dvips.
4158 (dvi_papersize,dvips_options): New methods.
4160 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4162 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4163 using a call to Converter::dvips_options.
4164 Fixed to work with nex export code.
4166 * src/support/copy.C
4167 * src/support/rename.C: New files
4169 * src/support/syscall.h
4170 * src/support/syscall.C: Added Starttype SystemDontWait.
4172 * lib/ui/default.ui: Changed to work with new export code
4174 * lib/configure.m4: Changed to work with new export code
4176 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4178 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4180 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4181 so that code compiles with DEC cxx.
4183 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4184 to work correctly! Also now supports the additional elements
4187 2000-09-01 Allan Rae <rae@lyx.org>
4189 * src/frontends/ButtonPolicies.C: renamed all the references to
4190 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4192 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4193 since it's a const not a type.
4195 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4197 2000-08-31 Juergen Vigna <jug@sad.it>
4199 * src/insets/figinset.C: Various changes to look if the filename has
4200 an extension and if not add it for inline previewing.
4202 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4204 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4205 make buttonStatus and isReadOnly be const methods. (also reflect
4206 this in derived classes.)
4208 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4209 (nextState): change to be static inline, pass the StateMachine as
4211 (PreferencesPolicy): remove casts
4212 (OkCancelPolicy): remvoe casts
4213 (OkCancelReadOnlyPolicy): remove casts
4214 (NoRepeatedApplyReadOnlyPolicy): remove casts
4215 (OkApplyCancelReadOnlyPolicy): remove casts
4216 (OkApplyCancelPolicy): remove casts
4217 (NoRepeatedApplyPolicy): remove casts
4219 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4221 * src/converter.C: added some using directives
4223 * src/frontends/ButtonPolicies.C: changes to overcome
4224 "need lvalue" error with DEC c++
4226 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4227 to WMHideCB for DEC c++
4229 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4231 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4232 to BulletBMTableCB for DEC c++
4234 2000-08-31 Allan Rae <rae@lyx.org>
4236 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4237 character dialog separately from old document dialogs combo_language.
4240 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4242 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4243 Removed LFUN_REF_CREATE.
4245 * src/MenuBackend.C: Added new tags: toc and references
4247 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4248 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4250 (add_toc, add_references): New methods.
4251 (create_submenu): Handle correctly the case when there is a
4252 seperator after optional menu items.
4254 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4255 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4256 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4258 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4260 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4262 * src/converter.[Ch]: New file for converting between different
4265 * src/export.[Ch]: New file for exporting a LyX file to different
4268 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4269 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4270 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4271 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4272 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4273 RunDocBook, MenuExport.
4275 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4276 Exporter::Preview methods if NEW_EXPORT is defined.
4278 * src/buffer.C (Dispatch): Use Exporter::Export.
4280 * src/lyxrc.C: Added new tags: \converter and \viewer.
4283 * src/LyXAction.C: Define new lyx-function: buffer-update.
4284 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4285 when NEW_EXPORT is defined.
4287 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4289 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4291 * lib/ui/default.ui: Added submenus "view" and "update" to the
4294 * src/filetools.C (GetExtension): New function.
4296 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4298 2000-08-29 Allan Rae <rae@lyx.org>
4300 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4302 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4303 (EnableDocumentLayout): removed
4304 (DisableDocumentLayout): removed
4305 (build): make use of ButtonController's read-only handling to
4306 de/activate various objects. Replaces both of the above functions.
4308 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4309 (readOnly): was read_only
4310 (refresh): fixed dumb mistakes with read_only_ handling
4312 * src/frontends/xforms/forms/form_document.fd:
4313 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4314 tabbed dialogs so the tabs look more like tabs and so its easier to
4315 work out which is the current tab.
4317 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4318 segfault with form_table
4320 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4322 2000-08-28 Juergen Vigna <jug@sad.it>
4324 * acconfig.h: added USE_PSPELL.
4326 * src/config.h.in: added USE_PSPELL.
4328 * autogen.sh: added pspell.m4
4330 * config/pspell.m4: new file.
4332 * src/spellchecker.C: implemented support for pspell libary.
4334 2000-08-25 Juergen Vigna <jug@sad.it>
4336 * src/LyXAction.C (init): renamed LFUN_TABLE to
4337 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4339 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4341 * src/lyxscreen.h: add force_clear variable and fuction to force
4342 a clear area when redrawing in LyXText.
4344 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4346 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4348 * some whitespace and comment changes.
4350 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4352 * src/buffer.C: up te LYX_FORMAT to 2.17
4354 2000-08-23 Juergen Vigna <jug@sad.it>
4356 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4359 * src/insets/insettabular.C (pasteSelection): delete the insets
4360 LyXText as it is not valid anymore.
4361 (copySelection): new function.
4362 (pasteSelection): new function.
4363 (cutSelection): new function.
4364 (LocalDispatch): implemented cut/copy/paste of cell selections.
4366 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4367 don't have a LyXText.
4369 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4371 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4374 2000-08-22 Juergen Vigna <jug@sad.it>
4376 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4377 ifdef form_table out if NEW_TABULAR.
4379 2000-08-21 Juergen Vigna <jug@sad.it>
4381 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4382 (draw): fixed draw position so that the cursor is positioned in the
4384 (InsetMotionNotify): hide/show cursor so the position is updated.
4385 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4386 using cellstart() function where it should be used.
4388 * src/insets/insettext.C (draw): ditto.
4390 * src/tabular.C: fixed initialization of some missing variables and
4391 made BoxType into an enum.
4393 2000-08-22 Marko Vendelin <markov@ioc.ee>
4394 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4395 stock menu item using action numerical value, not its string
4399 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4401 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4402 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4404 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4406 * src/frontends/xforms/GUIRunTime.C: new file
4408 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4409 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4411 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4413 * src/frontends/kde/GUIRunTime.C: new file
4415 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4416 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4418 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4420 * src/frontends/gnome/GUIRunTime.C: new file
4422 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4425 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4426 small change to documetentation.
4428 * src/frontends/GUIRunTime.C: removed file
4430 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4432 * src/lyxparagraph.h: enable NEW_TABULAR as default
4434 * src/lyxfunc.C (processKeySym): remove some commented code
4436 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4437 NEW_TABULAR around the fd_form_table_options.
4439 * src/lyx_gui.C (runTime): call the static member function as
4440 GUIRunTime::runTime().
4442 2000-08-21 Allan Rae <rae@lyx.org>
4444 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4447 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4449 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4451 2000-08-21 Allan Rae <rae@lyx.org>
4453 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4454 keep Garst happy ;-)
4455 * src/frontends/xforms/FormPreferences.C (build): use setOK
4456 * src/frontends/xforms/FormDocument.C (build): use setOK
4457 (FormDocument): use the appropriate policy.
4459 2000-08-21 Allan Rae <rae@lyx.org>
4461 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4462 automatic [de]activation of arbitrary objects when in a read-only state.
4464 * src/frontends/ButtonPolicies.h: More documentation
4465 (isReadOnly): added to support the above.
4467 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4469 2000-08-18 Juergen Vigna <jug@sad.it>
4471 * src/insets/insettabular.C (getStatus): changed to return func_status.
4473 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4474 display toggle menu entries if they are.
4476 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4477 new document layout now.
4479 * src/lyxfunc.C: ditto
4481 * src/lyx_gui_misc.C: ditto
4483 * src/lyx_gui.C: ditto
4485 * lib/ui/default.ui: removed paper and quotes layout as they are now
4486 all in the document layout tabbed folder.
4488 * src/frontends/xforms/forms/form_document.fd: added Restore
4489 button and callbacks for all inputs for Allan's ButtonPolicy.
4491 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4492 (CheckChoiceClass): added missing params setting on class change.
4493 (UpdateLayoutDocument): added for updating the layout on params.
4494 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4495 (FormDocument): Implemented Allan's ButtonPolicy with the
4498 2000-08-17 Allan Rae <rae@lyx.org>
4500 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4501 so we can at least see the credits again.
4503 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4504 controller calls for the appropriate callbacks. Note that since Ok
4505 calls apply followed by cancel, and apply isn't a valid input for the
4506 APPLIED state, the bc_ calls have to be made in the static callback not
4507 within each of the real callbacks.
4509 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4510 (setOk): renamed from setOkay()
4512 2000-08-17 Juergen Vigna <jug@sad.it>
4514 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4515 in the implementation part.
4516 (composeUIInfo): don't show optional menu-items.
4518 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4520 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4522 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4523 text-state when in a text-inset.
4525 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4527 2000-08-17 Marko Vendelin <markov@ioc.ee>
4528 * src/frontends/gnome/FormIndex.C
4529 * src/frontends/gnome/FormIndex.h
4530 * src/frontends/gnome/FormToc.C
4531 * src/frontends/gnome/FormToc.h
4532 * src/frontends/gnome/dialogs
4533 * src/frontends/gnome/diatoc_callbacks.c
4534 * src/frontends/gnome/diatoc_callbacks.h
4535 * src/frontends/gnome/diainsertindex_callbacks.h
4536 * src/frontends/gnome/diainsertindex_callbacks.c
4537 * src/frontends/gnome/diainsertindex_interface.c
4538 * src/frontends/gnome/diainsertindex_interface.h
4539 * src/frontends/gnome/diatoc_interface.h
4540 * src/frontends/gnome/diatoc_interface.c
4541 * src/frontends/gnome/Makefile.am: Table of Contents and
4542 Insert Index dialogs implementation for Gnome frontend
4544 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4546 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4548 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4551 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4553 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4554 destructor. Don't definde if you don't need it
4555 (processEvents): made static, non-blocking events processing for
4557 (runTime): static method. event loop for xforms
4558 * similar as above for kde and gnome.
4560 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4561 new Pimpl is correct
4562 (runTime): new method calss the real frontends runtime func.
4564 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4566 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4568 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4570 2000-08-16 Juergen Vigna <jug@sad.it>
4572 * src/lyx_gui.C (runTime): added GUII RunTime support.
4574 * src/frontends/Makefile.am:
4575 * src/frontends/GUIRunTime.[Ch]:
4576 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4577 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4578 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4580 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4582 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4583 as this is already set in ${FRONTEND_INCLUDE} if needed.
4585 * configure.in (CPPFLAGS): setting the include dir for the frontend
4586 directory and don't set FRONTEND=xforms for now as this is executed
4589 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4591 * src/frontends/kde/Makefile.am:
4592 * src/frontends/kde/FormUrl.C:
4593 * src/frontends/kde/FormUrl.h:
4594 * src/frontends/kde/formurldialog.h:
4595 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4597 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4599 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4601 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4603 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4606 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4608 * src/WorkArea.C (work_area_handler): more work to get te
4609 FL_KEYBOARD to work with xforms 0.88 too, please test.
4611 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4613 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4615 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4618 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4620 * src/Timeout.h: remove Qt::emit hack.
4622 * several files: changes to allo doc++ compilation
4624 * src/lyxfunc.C (processKeySym): new method
4625 (processKeyEvent): comment out if FL_REVISION < 89
4627 * src/WorkArea.C: change some debugging levels.
4628 (WorkArea): set wantkey to FL_KEY_ALL
4629 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4630 clearer code and the use of compose with XForms 0.89. Change to
4631 use signals instead of calling methods in bufferview directly.
4633 * src/Painter.C: change some debugging levels.
4635 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4638 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4639 (workAreaKeyPress): new method
4641 2000-08-14 Juergen Vigna <jug@sad.it>
4643 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4645 * config/kde.m4: addes some features
4647 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4648 include missing xforms dialogs.
4650 * src/Timeout.h: a hack to be able to compile with qt/kde.
4652 * sigc++/.cvsignore: added acinclude.m4
4654 * lib/.cvsignore: added listerros
4656 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4657 xforms tree as objects are needed for other frontends.
4659 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4660 linking with not yet implemented xforms objects.
4662 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4664 2000-08-14 Baruch Even <baruch.even@writeme.com>
4666 * src/frontends/xforms/FormGraphics.h:
4667 * src/frontends/xforms/FormGraphics.C:
4668 * src/frontends/xforms/RadioButtonGroup.h:
4669 * src/frontends/xforms/RadioButtonGroup.C:
4670 * src/insets/insetgraphics.h:
4671 * src/insets/insetgraphics.C:
4672 * src/insets/insetgraphicsParams.h:
4673 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4674 instead of spaces, and various other indentation issues to make the
4675 sources more consistent.
4677 2000-08-14 Marko Vendelin <markov@ioc.ee>
4679 * src/frontends/gnome/dialogs/diaprint.glade
4680 * src/frontends/gnome/FormPrint.C
4681 * src/frontends/gnome/FormPrint.h
4682 * src/frontends/gnome/diaprint_callbacks.c
4683 * src/frontends/gnome/diaprint_callbacks.h
4684 * src/frontends/gnome/diaprint_interface.c
4685 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4688 * src/frontends/gnome/dialogs/diainserturl.glade
4689 * src/frontends/gnome/FormUrl.C
4690 * src/frontends/gnome/FormUrl.h
4691 * src/frontends/gnome/diainserturl_callbacks.c
4692 * src/frontends/gnome/diainserturl_callbacks.h
4693 * src/frontends/gnome/diainserturl_interface.c
4694 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4695 Gnome implementation
4697 * src/frontends/gnome/Dialogs.C
4698 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4699 all other dialogs. Copy all unimplemented dialogs from Xforms
4702 * src/frontends/gnome/support.c
4703 * src/frontends/gnome/support.h: support files generated by Glade
4707 * config/gnome.m4: Gnome configuration scripts
4709 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4710 configure --help message
4712 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4713 only if there are no events pendling in Gnome/Gtk. This enhances
4714 the performance of menus.
4717 2000-08-14 Allan Rae <rae@lyx.org>
4719 * lib/Makefile.am: listerrors cleaning
4721 * lib/listerrors: removed -- generated file
4722 * acinclude.m4: ditto
4723 * sigc++/acinclude.m4: ditto
4725 * src/frontends/xforms/forms/form_citation.fd:
4726 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4729 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4730 `updatesrc` and now we have a `test` target that does what `updatesrc`
4731 used to do. I didn't like having an install target that wasn't related
4734 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4735 on all except FormGraphics. This may yet happen. Followed by a major
4736 cleanup including using FL_TRANSIENT for most of the dialogs. More
4737 changes to come when the ButtonController below is introduced.
4739 * src/frontends/xforms/ButtonController.h: New file for managing up to
4740 four buttons on a dialog according to an externally defined policy.
4741 * src/frontends/xforms/Makefile.am: added above
4743 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4744 Apply and Cancel/Close buttons and everything in between and beyond.
4745 * src/frontends/Makefile.am: added above.
4747 * src/frontends/xforms/forms/form_preferences.fd:
4748 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4749 and removed variable 'status' as a result. Fixed the set_minsize thing.
4750 Use the new screen-font-update after checking screen fonts were changed
4751 Added a "Restore" button to restore the original lyxrc values while
4752 editing. This restores everything not just the last input changed.
4753 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4755 * src/LyXAction.C: screen-font-update added for updating buffers after
4756 screen font settings have been changed.
4757 * src/commandtags.h: ditto
4758 * src/lyxfunc.C: ditto
4760 * forms/lyx.fd: removed screen fonts dialog.
4761 * src/lyx_gui.C: ditto
4762 * src/menus.[Ch]: ditto
4763 * src/lyx.[Ch]: ditto
4764 * src/lyx_cb.C: ditto + code from here moved to make
4765 screen-font-update. And people wonder why progress on GUII is
4766 slow. Look at how scattered this stuff was! It takes forever
4769 * forms/fdfix.sh: Fixup the spacing after commas.
4770 * forms/makefile: Remove date from generated files. Fewer clashes now.
4771 * forms/bullet_forms.C.patch: included someones handwritten changes
4773 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4774 once I've discovered why LyXRC was made noncopyable.
4775 * src/lyx_main.C: ditto
4777 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4779 * src/frontends/xforms/forms/fdfix.sh:
4780 * src/frontends/xforms/forms/fdfixh.sed:
4781 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4782 * src/frontends/xforms/Form*.[hC]:
4783 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4784 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4785 provide a destructor for the struct FD_form_xxxx. Another version of
4786 the set_[max|min]size workaround and a few other cleanups. Actually,
4787 Angus' patch from 20000809.
4789 2000-08-13 Baruch Even <baruch.even@writeme.com>
4791 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4794 2000-08-11 Juergen Vigna <jug@sad.it>
4796 * src/insets/insetgraphics.C (InsetGraphics): changing init
4797 order because of warnings.
4799 * src/frontends/xforms/forms/makefile: adding patching .C with
4802 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4803 from .C.patch to .c.patch
4805 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4806 order because of warning.
4808 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4810 * src/frontends/Liason.C (setMinibuffer): new helper function
4812 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4814 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4816 * lib/ui/default.ui: commented out PaperLayout entry
4818 * src/frontends/xforms/form_document.[Ch]: new added files
4820 * src/frontends/xforms/FormDocument.[Ch]: ditto
4822 * src/frontends/xforms/forms/form_document.fd: ditto
4824 * src/frontends/xforms/forms/form_document.C.patch: ditto
4826 2000-08-10 Juergen Vigna <jug@sad.it>
4828 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4829 (InsetGraphics): initialized cacheHandle to 0.
4830 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4832 2000-08-10 Baruch Even <baruch.even@writeme.com>
4834 * src/graphics/GraphicsCache.h:
4835 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4836 correctly as a cache.
4838 * src/graphics/GraphicsCacheItem.h:
4839 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4842 * src/graphics/GraphicsCacheItem_pimpl.h:
4843 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4846 * src/insets/insetgraphics.h:
4847 * src/insets/insetgraphics.C: Changed from using a signal notification
4848 to polling when image is not loaded.
4850 2000-08-10 Allan Rae <rae@lyx.org>
4852 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4853 that there are two functions that have to been taken out of line by
4854 hand and aren't taken care of in the script. (Just a reminder note)
4856 * sigc++/macros/*.h.m4: Updated as above.
4858 2000-08-09 Juergen Vigna <jug@sad.it>
4860 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4862 * src/insets/insettabular.C: make drawing of single cell smarter.
4864 2000-08-09 Marko Vendelin <markov@ioc.ee>
4865 * src/frontends/gnome/Menubar_pimpl.C
4866 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4867 implementation: new files
4869 * src/frontends/gnome/mainapp.C
4870 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4873 * src/main.C: create Gnome main window
4875 * src/frontends/xforms/Menubar_pimpl.h
4876 * src/frontends/Menubar.C
4877 * src/frontends/Menubar.h: added method Menubar::update that calls
4878 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4880 * src/LyXView.C: calls Menubar::update to update the state
4883 * src/frontends/gnome/Makefile.am: added new files
4885 * src/frontends/Makefile.am: added frontend compiler options
4887 2000-08-08 Juergen Vigna <jug@sad.it>
4889 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4891 * src/bufferlist.C (close):
4892 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4893 documents if exiting without saving.
4895 * src/buffer.C (save): use removeAutosaveFile()
4897 * src/support/filetools.C (removeAutosaveFile): new function.
4899 * src/lyx_cb.C (MenuWrite): returns a bool now.
4900 (MenuWriteAs): check if file could really be saved and revert to the
4902 (MenuWriteAs): removing old autosavefile if existant.
4904 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4905 before Goto toggle declaration, because of compiler warning.
4907 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4909 * src/lyxfunc.C (MenuNew): small fix.
4911 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4913 * src/bufferlist.C (newFile):
4914 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4916 * src/lyxrc.C: added new_ask_filename tag
4918 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4920 * src/lyx.fd: removed code pertaining to form_ref
4921 * src/lyx.[Ch]: ditto
4922 * src/lyx_cb.C: ditto
4923 * src/lyx_gui.C: ditto
4924 * src/lyx_gui_misc.C: ditto
4926 * src/BufferView_pimpl.C (restorePosition): update buffer only
4929 * src/commandtags.h (LFUN_REFTOGGLE): removed
4930 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4931 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4932 (LFUN_REFBACK): renamed LFUN_REF_BACK
4934 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4935 * src/menus.C: ditto
4936 * src/lyxfunc.C (Dispatch): ditto.
4937 InsertRef dialog is now GUI-independent.
4939 * src/texrow.C: added using std::endl;
4941 * src/insets/insetref.[Ch]: strip out large amounts of code.
4942 The inset is now a container and this functionality is now
4943 managed by a new FormRef dialog
4945 * src/frontends/Dialogs.h (showRef, createRef): new signals
4947 * src/frontends/xforms/FormIndex.[Ch],
4948 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4949 when setting dialog's min/max size
4950 * src/frontends/xforms/FormIndex.[Ch]: ditto
4952 * src/frontends/xforms/FormRef.[Ch],
4953 src/frontends/xforms/forms/form_ref.fd: new xforms
4954 implementation of an InsetRef dialog
4956 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4959 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4960 ios::nocreate is not part of the standard. Removed.
4962 2000-08-07 Baruch Even <baruch.even@writeme.com>
4964 * src/graphics/Renderer.h:
4965 * src/graphics/Renderer.C: Added base class for rendering of different
4966 image formats into Pixmaps.
4968 * src/graphics/XPM_Renderer.h:
4969 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4970 in a different class.
4972 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4973 easily add support for other formats.
4975 * src/insets/figinset.C: plugged a leak of an X resource.
4977 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4979 * src/CutAndPaste.[Ch]: make all metods static.
4981 * development/Code_rules/Rules: more work, added section on
4982 Exceptions, and a References section.
4984 * a lot of header files: work to make doc++ able to generate the
4985 source documentation, some workarounds of doc++ problems. Doc++ is
4986 now able to generate the documentation.
4988 2000-08-07 Juergen Vigna <jug@sad.it>
4990 * src/insets/insettabular.C (recomputeTextInsets): removed function
4992 * src/tabular.C (SetWidthOfMulticolCell):
4994 (calculate_width_of_column_NMC): fixed return value so that it really
4995 only returns true if the column-width has changed (there where
4996 problems with muliticolumn-cells in this column).
4998 2000-08-04 Juergen Vigna <jug@sad.it>
5000 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5001 also on the scrollstatus of the inset.
5002 (workAreaMotionNotify): ditto.
5004 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5006 2000-08-01 Juergen Vigna <jug@sad.it>
5008 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5010 * src/commandtags.h:
5011 * src/LyXAction.C (init):
5012 * src/insets/inset.C (LocalDispatch): added support for
5015 * src/insets/inset.C (scroll): new functions.
5017 * src/insets/insettext.C (removeNewlines): new function.
5018 (SetAutoBreakRows): removes forced newlines in the text of the
5019 paragraph if autoBreakRows is set to false.
5021 * src/tabular.C (Latex): generates a parbox around the cell contents
5024 * src/frontends/xforms/FormTabular.C (local_update): removed
5025 the radio_useparbox button.
5027 * src/tabular.C (UseParbox): new function
5029 2000-08-06 Baruch Even <baruch.even@writeme.com>
5031 * src/graphics/GraphicsCache.h:
5032 * src/graphics/GraphicsCache.C:
5033 * src/graphics/GraphicsCacheItem.h:
5034 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5037 * src/insets/insetgraphics.h:
5038 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5039 and the drawing of the inline image.
5041 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5042 loaded into the wrong position.
5044 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5047 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5049 * src/support/translator.h: move all typedefs to public section
5051 * src/support/filetools.C (MakeLatexName): return string const
5053 (TmpFileName): ditto
5054 (FileOpenSearch): ditto
5056 (LibFileSearch): ditto
5057 (i18nLibFileSearch): ditto
5060 (CreateTmpDir): ditto
5061 (CreateBufferTmpDir): ditto
5062 (CreateLyXTmpDir): ditto
5065 (MakeAbsPath): ditto
5067 (OnlyFilename): ditto
5069 (NormalizePath): ditto
5070 (CleanupPath): ditto
5071 (GetFileContents): ditto
5072 (ReplaceEnvironmentPath): ditto
5073 (MakeRelPath): ditto
5075 (ChangeExtension): ditto
5076 (MakeDisplayPath): ditto
5077 (do_popen): return cmdret const
5078 (findtexfile): return string const
5080 * src/support/DebugStream.h: add some /// to please doc++
5082 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5084 * src/texrow.C (same_rownumber): functor to use with find_if
5085 (getIdFromRow): rewritten to use find_if and to not update the
5086 positions. return true if row is found
5087 (increasePos): new method, use to update positions
5089 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5091 * src/lyxlex_pimpl.C (verifyTable): new method
5094 (GetString): return string const
5095 (pushTable): rewrite to use std::stack
5097 (setFile): better check
5100 * src/lyxlex.h: make LyXLex noncopyable
5102 * src/lyxlex.C (text): return char const * const
5103 (GetString): return string const
5104 (getLongString): return string const
5106 * src/lyx_gui_misc.C (askForText): return pair<...> const
5108 * src/lastfiles.[Ch] (operator): return string const
5110 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5111 istringstream not char const *.
5112 move token.end() out of loop.
5113 (readFile): move initializaton of token
5115 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5116 getIdFromRow is successful.
5118 * lib/bind/emacs.bind: don't include menus bind
5120 * development/Code_rules/Rules: the beginnings of making this
5121 better and covering more of the unwritten rules that we have.
5123 * development/Code_rules/Recommendations: a couple of wording
5126 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5128 * src/support/strerror.c: remove C++ comment.
5130 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5132 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5133 LFUN_INDEX_INSERT_LAST
5135 * src/texrow.C (getIdFromRow): changed from const_iterator to
5136 iterator, allowing code to compile with DEC cxx
5138 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5139 stores part of the class, as suggested by Allan. Will allow
5141 (apply): test to apply uses InsetCommandParams operator!=
5143 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5144 (apply): test to apply uses InsetCommandParams operator!=
5146 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5147 stores part of the class.
5148 (update): removed limits on min/max size.
5150 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5151 (apply): test to apply uses InsetCommandParams operator!=
5153 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5154 (Read, Write, scanCommand, getCommand): moved functionality
5155 into InsetCommandParams.
5157 (getScreenLabel): made pure virtual
5158 new InsetCommandParams operators== and !=
5160 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5161 c-tors based on InsetCommandParams. Removed others.
5162 * src/insets/insetinclude.[Ch]: ditto
5163 * src/insets/insetlabel.[Ch]: ditto
5164 * src/insets/insetparent.[Ch]: ditto
5165 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5167 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5168 insets derived from InsetCommand created using similar c-tors
5169 based on InsetCommandParams
5170 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5171 * src/menus.C (ShowRefsMenu): ditto
5172 * src/paragraph.C (Clone): ditto
5173 * src/text2.C (SetCounter): ditto
5174 * src/lyxfunc.C (Dispatch) ditto
5175 Also recreated old InsetIndex behaviour exactly. Can now
5176 index-insert at the start of a paragraph and index-insert-last
5177 without launching the pop-up.
5179 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5181 * lib/lyxrc.example: mark te pdf options as non functional.
5183 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5184 (isStrDbl): move tmpstr.end() out of loop.
5185 (strToDbl): move intialization of tmpstr
5186 (lowercase): return string const and move tmp.end() out of loop.
5187 (uppercase): return string const and move tmp.edn() out of loop.
5188 (prefixIs): add assertion
5193 (containsOnly): ditto
5194 (containsOnly): ditto
5195 (containsOnly): ditto
5196 (countChar): make last arg char not char const
5197 (token): return string const
5198 (subst): return string const, move tmp.end() out of loop.
5199 (subst): return string const, add assertion
5200 (strip): return string const
5201 (frontStrip): return string const, add assertion
5202 (frontStrip): return string const
5207 * src/support/lstrings.C: add inclde "LAssert.h"
5208 (isStrInt): move tmpstr.end() out of loop.
5210 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5211 toollist.end() out of loop.
5212 (deactivate): move toollist.end() out of loop.
5213 (update): move toollist.end() out of loop.
5214 (updateLayoutList): move tc.end() out of loop.
5215 (add): move toollist.end() out of loop.
5217 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5218 md.end() out of loop.
5220 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5222 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5225 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5226 (Erase): move insetlist.end() out of loop.
5228 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5229 ref to const string as first arg. Move initialization of some
5230 variables, whitespace changes.
5232 * src/kbmap.C (defkey): move table.end() out of loop.
5233 (kb_keymap): move table.end() out of loop.
5234 (findbinding): move table.end() out of loop.
5236 * src/MenuBackend.C (hasMenu): move end() out of loop.
5237 (getMenu): move end() out of loop.
5238 (getMenu): move menulist_.end() out of loop.
5240 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5242 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5245 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5246 (getFromLyXName): move infotab.end() out of loop.
5248 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5249 -fvtable-thunks -ffunction-sections -fdata-sections
5251 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5253 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5256 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5258 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5260 * src/frontends/xforms/FormCitation.[Ch],
5261 src/frontends/xforms/FormIndex.[Ch],
5262 src/frontends/xforms/FormToc.[Ch],
5263 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5265 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5267 * src/commandtags.h: renamed, created some flags for citation
5270 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5272 * src/lyxfunc.C (dispatch): use signals to insert index entry
5274 * src/frontends/Dialogs.h: new signal createIndex
5276 * src/frontends/xforms/FormCommand.[Ch],
5277 src/frontends/xforms/FormCitation.[Ch],
5278 src/frontends/xforms/FormToc.[Ch],
5279 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5281 * src/insets/insetindex.[Ch]: GUI-independent
5283 * src/frontends/xforms/FormIndex.[Ch],
5284 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5287 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5289 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5290 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5292 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5294 * src/insets/insetref.C (Latex): rewrite so that there is now
5295 question that a initialization is requested.
5297 * src/insets/insetcommand.h: reenable the hide signal
5299 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5301 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5302 fix handling of shortcuts (many bugs :)
5303 (add_lastfiles): ditto.
5305 * lib/ui/default.ui: fix a few shortcuts.
5307 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5309 * Makefile.am: Fix ``rpmdist'' target to return the exit
5310 status of the ``rpm'' command, instead of the last command in
5311 the chain (the ``rm lyx.xpm'' command, which always returns
5314 2000-08-02 Allan Rae <rae@lyx.org>
5316 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5317 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5318 * src/frontends/xforms/FormToc.C (FormToc): ditto
5320 * src/frontends/xforms/Makefile.am: A few forgotten files
5322 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5323 Signals-not-copyable-problem Lars' started commenting out.
5325 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5327 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5329 * src/insets/insetcommand.h: Signals is not copyable so anoter
5330 scheme for automatic hiding of forms must be used.
5332 * src/frontends/xforms/FormCitation.h: don't inerit from
5333 noncopyable, FormCommand already does that.
5334 * src/frontends/xforms/FormToc.h: ditto
5335 * src/frontends/xforms/FormUrl.h: ditto
5337 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5339 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5341 * src/insets/insetcommand.h (hide): new SigC::Signal0
5342 (d-tor) new virtual destructor emits hide signal
5344 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5345 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5347 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5348 LOF and LOT. Inset is now GUI-independent
5350 * src/insets/insetloa.[Ch]: redundant
5351 * src/insets/insetlof.[Ch]: ditto
5352 * src/insets/insetlot.[Ch]: ditto
5354 * src/frontends/xforms/forms/form_url.fd: tweaked!
5355 * src/frontends/xforms/forms/form_citation.fd: ditto
5357 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5358 dialogs dealing with InsetCommand insets
5360 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5361 FormCommand base class
5362 * src/frontends/xforms/FormUrl.[Ch]: ditto
5364 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5366 * src/frontends/xforms/FormToc.[Ch]: ditto
5368 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5369 passed a generic InsetCommand pointer
5370 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5372 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5373 and modified InsetTOC class
5374 * src/buffer.C: ditto
5376 * forms/lyx.fd: strip out old FD_form_toc code
5377 * src/lyx_gui_misc.C: ditto
5378 * src/lyx_gui.C: ditto
5379 * src/lyx_cb.C: ditto
5380 * src/lyx.[Ch]: ditto
5382 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5384 * src/support/utility.hpp: tr -d '\r'
5386 2000-08-01 Juergen Vigna <jug@sad.it>
5388 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5390 * src/commandtags.h:
5391 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5392 LFUN_TABULAR_FEATURES.
5394 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5395 LFUN_LAYOUT_TABULAR.
5397 * src/insets/insettabular.C (getStatus): implemented helper function.
5399 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5401 2000-07-31 Juergen Vigna <jug@sad.it>
5403 * src/text.C (draw): fixed screen update problem for text-insets.
5405 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5406 something changed probably this has to be added in various other
5409 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5411 2000-07-31 Baruch Even <baruch.even@writeme.com>
5413 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5414 templates to satisfy compaq cxx.
5417 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5419 * src/support/translator.h (equal_1st_in_pair::operator()): take
5420 const ref pair_type as arg.
5421 (equal_2nd_in_pair::operator()): ditto
5422 (Translator::~Translator): remove empty d-tor.
5424 * src/graphics/GraphicsCache.C: move include config.h to top, also
5425 put initialization of GraphicsCache::singleton here.
5426 (~GraphicsCache): move here
5427 (addFile): take const ref as arg
5430 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5432 * src/BufferView2.C (insertLyXFile): change te with/without header
5435 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5437 * src/frontends/xforms/FormGraphics.C (apply): add some
5438 static_cast. Not very nice, but required by compaq cxx.
5440 * src/frontends/xforms/RadioButtonGroup.h: include header
5441 <utility> instead of <pair.h>
5443 * src/insets/insetgraphicsParams.C: add using directive.
5444 (readResize): change return type to void.
5445 (readOrigin): ditto.
5447 * src/lyxfunc.C (getStatus): add missing break for build-program
5448 function; add test for Literate for export functions.
5450 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5451 entries in Options menu.
5453 2000-07-31 Baruch Even <baruch.even@writeme.com>
5455 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5456 protect against auto-allocation; release icon when needed.
5458 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5460 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5461 on usual typewriter.
5463 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5464 earlier czech.kmap), useful only for programming.
5466 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5468 * src/frontends/xforms/FormCitation.h: fix conditioning around
5471 2000-07-31 Juergen Vigna <jug@sad.it>
5473 * src/frontends/xforms/FormTabular.C (local_update): changed
5474 radio_linebreaks to radio_useparbox and added radio_useminipage.
5476 * src/tabular.C: made support for using minipages/parboxes.
5478 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5480 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5482 (descent): so the cursor is in the middle.
5483 (width): bit smaller box.
5485 * src/insets/insetgraphics.h: added display() function.
5487 2000-07-31 Baruch Even <baruch.even@writeme.com>
5489 * src/frontends/Dialogs.h: Added showGraphics signals.
5491 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5492 xforms form definition of the graphics dialog.
5494 * src/frontends/xforms/FormGraphics.h:
5495 * src/frontends/xforms/FormGraphics.C: Added files, the
5496 GUIndependent code of InsetGraphics
5498 * src/insets/insetgraphics.h:
5499 * src/insets/insetgraphics.C: Major writing to make it work.
5501 * src/insets/insetgraphicsParams.h:
5502 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5503 struct between InsetGraphics and GUI.
5505 * src/LaTeXFeatures.h:
5506 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5507 support for graphicx package.
5509 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5510 for the graphics inset.
5512 * src/support/translator.h: Added file, used in
5513 InsetGraphicsParams. this is a template to translate between two
5516 * src/frontends/xforms/RadioButtonGroup.h:
5517 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5518 way to easily control a radio button group.
5520 2000-07-28 Juergen Vigna <jug@sad.it>
5522 * src/insets/insettabular.C (LocalDispatch):
5523 (TabularFeatures): added support for lyx-functions of tabular features.
5524 (cellstart): refixed this function after someone wrongly changed it.
5526 * src/commandtags.h:
5527 * src/LyXAction.C (init): added support for tabular-features
5529 2000-07-28 Allan Rae <rae@lyx.org>
5531 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5532 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5533 triggers the callback for input checking. As a result we sometimes get
5534 "LyX: This shouldn't happen..." printed to cerr.
5535 (input): Started using status variable since I only free() on
5536 destruction. Some input checking for paths and font sizes.
5538 * src/frontends/xforms/FormPreferences.h: Use status to control
5539 activation of Ok and Apply
5541 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5542 callback. Also resized to stop segfaults with 0.88. The problem is
5543 that xforms-0.88 requires the folder to be wide enough to fit all the
5544 tabs. If it isn't it causes all sorts of problems.
5546 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5548 * src/frontends/xforms/forms/README: Reflect reality.
5550 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5551 * src/frontends/xforms/forms/makefile: ditto.
5553 * src/commandtags.h: Get access to new Preferences dialog
5554 * src/LyXAction.C: ditto
5555 * src/lyxfunc.C: ditto
5556 * lib/ui/default.ui: ditto
5558 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5560 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5562 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5565 * src/frontends/xforms/form_url.[Ch]: added.
5567 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5569 * src/insets/insetbib.h: fixed bug in previous commit
5571 * src/frontends/xforms/FormUrl.h: ditto
5573 * src/frontends/xforms/FormPrint.h: ditto
5575 * src/frontends/xforms/FormPreferences.h: ditto
5577 * src/frontends/xforms/FormCopyright.h: ditto
5579 * src/frontends/xforms/FormCitation.C: ditto
5581 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5582 private copyconstructor and private default contructor
5584 * src/support/Makefile.am: add utility.hpp
5586 * src/support/utility.hpp: new file from boost
5588 * src/insets/insetbib.h: set owner in clone
5590 * src/frontends/xforms/FormCitation.C: added missing include
5593 * src/insets/form_url.[Ch]: removed
5595 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5597 * development/lyx.spec.in
5598 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5599 file/directory re-organization.
5601 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5603 * src/insets/insetcommand.[Ch]: moved the string data and
5604 associated manipulation methods into a new stand-alone class
5605 InsetCommandParams. This class has two additional methods
5606 getAsString() and setFromString() allowing the contents to be
5607 moved around as a single string.
5608 (addContents) method removed.
5609 (setContents) method no longer virtual.
5611 * src/buffer.C (readInset): made use of new InsetCitation,
5612 InsetUrl constructors based on InsetCommandParams.
5614 * src/commandtags.h: add LFUN_INSERT_URL
5616 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5617 independent InsetUrl and use InsetCommandParams to extract
5618 string info and create new Insets.
5620 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5622 * src/frontends/xforms/FormCitation.C (apply): uses
5625 * src/frontends/xforms/form_url.C
5626 * src/frontends/xforms/form_url.h
5627 * src/frontends/xforms/FormUrl.h
5628 * src/frontends/xforms/FormUrl.C
5629 * src/frontends/xforms/forms/form_url.fd: new files
5631 * src/insets/insetcite.[Ch]: removed unused constructors.
5633 * src/insets/insetinclude.[Ch]: no longer store filename
5635 * src/insets/inseturl.[Ch]: GUI-independent.
5637 2000-07-26 Juergen Vigna <jug@sad.it>
5638 * renamed frontend from gtk to gnome as it is that what is realized
5639 and did the necessary changes in the files.
5641 2000-07-26 Marko Vendelin <markov@ioc.ee>
5643 * configure.in: cleaning up gnome configuration scripts
5645 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5647 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5648 shortcuts syndrom by redrawing them explicitely (a better solution
5649 would be appreciated).
5651 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5653 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5656 * src/lyx_cb.C (MenuExport): change html export to do the right
5657 thing depending of the document type (instead of having
5658 html-linuxdoc and html-docbook).
5659 * src/lyxfunc.C (getStatus): update for html
5660 * lib/ui/default.ui: simplify due to the above change.
5661 * src/menus.C (ShowFileMenu): update too (in case we need it).
5663 * src/MenuBackend.C (read): if a menu is defined twice, add the
5664 new entries to the exiting one.
5666 2000-07-26 Juergen Vigna <jug@sad.it>
5668 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5670 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5671 and return a bool if it did actual save the file.
5672 (AutoSave): don't autosave a unnamed doc.
5674 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5675 check if this is an UNNAMED new file and react to it.
5676 (newFile): set buffer to unnamed and change to not mark a new
5677 buffer dirty if I didn't do anything with it.
5679 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5681 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5683 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5684 friend as per Angus's patch posted to lyx-devel.
5686 * src/ext_l10n.h: updated
5688 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5689 gettext on the style string right before inserting them into the
5692 * autogen.sh: add code to extract style strings form layout files,
5693 not good enough yet.
5695 * src/frontends/gtk/.cvsignore: add MAKEFILE
5697 * src/MenuBackend.C (read): run the label strings through gettext
5698 before storing them in the containers.
5700 * src/ext_l10n.h: new file
5702 * autogen.sh : generate the ext_l10n.h file here
5704 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5706 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5709 * lib/ui/default.ui: fix a couple of typos.
5711 * config/gnome/gtk.m4: added (and added to the list of files in
5714 * src/insets/insetinclude.C (unique_id): fix when we are using
5715 lyxstring instead of basic_string<>.
5716 * src/insets/insettext.C (LocalDispatch): ditto.
5717 * src/support/filetools.C: ditto.
5719 * lib/configure.m4: create the ui/ directory if necessary.
5721 * src/LyXView.[Ch] (updateToolbar): new method.
5723 * src/BufferView_pimpl.C (buffer): update the toolbar when
5724 opening/closing buffer.
5726 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5728 * src/LyXAction.C (getActionName): enhance to return also the name
5729 and options of pseudo-actions.
5730 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5732 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5733 as an example of what is possible). Used in File->Build too (more
5734 useful) and in the import/export menus (to mimick the complicated
5735 handling of linuxdoc and friends). Try to update all the entries.
5737 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5740 * src/MenuBackend.C (read): Parse the new OptItem tag.
5742 * src/MenuBackend.h: Add a new optional_ data member (used if the
5743 entry should be omitted when the lyxfunc is disabled).
5745 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5746 function, used as a shortcut.
5747 (create_submenu): align correctly the shortcuts on the widest
5750 * src/MenuBackend.h: MenuItem.label() only returns the label of
5751 the menu without shortcut; new method shortcut().
5753 2000-07-14 Marko Vendelin <markov@ioc.ee>
5755 * src/frontends/gtk/Dialogs.C:
5756 * src/frontends/gtk/FormCopyright.C:
5757 * src/frontends/gtk/FormCopyright.h:
5758 * src/frontends/gtk/Makefile.am: added these source-files for the
5759 Gtk/Gnome support of the Copyright-Dialog.
5761 * src/main.C: added Gnome::Main initialization if using
5762 Gtk/Gnome frontend-GUI.
5764 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5766 * config/gnome/aclocal-include.m4
5767 * config/gnome/compiler-flags.m4
5768 * config/gnome/curses.m4
5769 * config/gnome/gnome--.m4
5770 * config/gnome/gnome-bonobo-check.m4
5771 * config/gnome/gnome-common.m4
5772 * config/gnome/gnome-fileutils.m4
5773 * config/gnome/gnome-ghttp-check.m4
5774 * config/gnome/gnome-gnorba-check.m4
5775 * config/gnome/gnome-guile-checks.m4
5776 * config/gnome/gnome-libgtop-check.m4
5777 * config/gnome/gnome-objc-checks.m4
5778 * config/gnome/gnome-orbit-check.m4
5779 * config/gnome/gnome-print-check.m4
5780 * config/gnome/gnome-pthread-check.m4
5781 * config/gnome/gnome-support.m4
5782 * config/gnome/gnome-undelfs.m4
5783 * config/gnome/gnome-vfs.m4
5784 * config/gnome/gnome-x-checks.m4
5785 * config/gnome/gnome-xml-check.m4
5786 * config/gnome/gnome.m4
5787 * config/gnome/gperf-check.m4
5788 * config/gnome/gtk--.m4
5789 * config/gnome/linger.m4
5790 * config/gnome/need-declaration.m4: added configuration scripts
5791 for Gtk/Gnome frontend-GUI
5793 * configure.in: added support for the --with-frontend=gtk option
5795 * autogen.sh: added config/gnome/* to list of config-files
5797 * acconfig.h: added define for GTKGUI-support
5799 * config/lyxinclude.m4: added --with-frontend[=value] option value
5800 for Gtk/Gnome frontend-GUI support.
5802 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5804 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5808 * src/paragraph.C (GetChar): remove non-const version
5810 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5811 (search_kw): use it.
5813 * src/lyx_main.C (init): if "preferences" exist, read that instead
5815 (ReadRcFile): return bool if the file could be read ok.
5816 (ReadUIFile): add a check to see if lex file is set ok.
5818 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5819 bastring can be used instead of lyxstring (still uses the old code
5820 if std::string is good enough or if lyxstring is used.)
5822 * src/encoding.C: make the arrays static, move ininle functions
5824 * src/encoding.h: from here.
5826 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5827 (parseSingleLyXformat2Token): move inset parsing to separate method
5828 (readInset): new private method
5830 * src/Variables.h: remove virtual from get().
5832 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5833 access to NEW_INSETS and NEW_TABULAR
5835 * src/MenuBackend.h: remove superfluous forward declaration of
5836 MenuItem. Add documentations tags "///", remove empty MenuItem
5837 destructor, remove private default contructor.
5839 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5841 (read): more string mlabel and mname to where they are used
5842 (read): remove unused variables mlabel and mname
5843 (defaults): unconditional clear, make menusetup take advantage of
5844 add returning Menu &.
5846 * src/LyXView.h: define NEW_MENUBAR as default
5848 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5849 to NEW_INSETS and NEW_TABULAR.
5850 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5851 defined. Change some of the "xxxx-inset-insert" functions names to
5854 * several files: more enahncements to NEW_INSETS and the resulting
5857 * lib/lyxrc.example (\date_insert_format): move to misc section
5859 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5860 bastring and use AC_CACHE_CHECK.
5861 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5862 the system have the newest methods. uses AC_CACHE_CHECK
5863 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5864 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5865 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5867 * configure.in: add LYX_CXX_GOOD_STD_STRING
5869 * acinclude.m4: recreated
5871 2000-07-24 Amir Karger <karger@lyx.org>
5873 * README: add Hebrew, Arabic kmaps
5876 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5878 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5881 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5883 * Lot of files: add pragma interface/implementation.
5885 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5887 * lib/ui/default.ui: new file (ans new directory). Contains the
5888 default menu and toolbar.
5890 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5891 global space. Toolbars are now read (as menus) in ui files.
5893 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5895 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5896 is disabled because the document is read-only. We want to have the
5897 toggle state of the function anyway.
5898 (getStatus): add code for LFUN_VC* functions (mimicking what is
5899 done in old-style menus)
5901 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5902 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5904 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5905 * src/BufferView_pimpl.C: ditto.
5906 * src/lyxfunc.C: ditto.
5908 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5909 default). This replaces old-style menus by new ones.
5911 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5912 MenuItem. Contain the data structure of a menu.
5914 * src/insets/insettext.C: use LyXView::setLayout instead of
5915 accessing directly the toolbar combox.
5916 * src/lyxfunc.C (Dispatch): ditto.
5918 * src/LyXView.C (setLayout): new method, which just calls
5919 Toolbar::setLayout().
5920 (updateLayoutChoice): move part of this method in Toolbar.
5922 * src/toolbar.[Ch]: removed.
5924 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5925 implementation the toolbar.
5927 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5928 the toolbar. It might make sense to merge it with ToolbarDefaults
5930 (setLayout): new function.
5931 (updateLayoutList): ditto.
5932 (openLayoutList): ditto.
5934 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5935 xforms implementation of the toolbar.
5936 (get_toolbar_func): comment out, since I do not
5937 know what it is good for.
5939 * src/ToolbarDefaults.h: Add the ItemType enum.
5941 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5942 for a list of allocated C strings. Used in Menubar xforms
5943 implementation to avoid memory leaks.
5945 * src/support/lstrings.[Ch] (uppercase): new version taking and
5949 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5950 * lib/bind/emacs.bind: ditto.
5952 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5954 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5955 forward decl of LyXView.
5957 * src/toolbar.C (toolbarItem): moved from toolbar.h
5958 (toolbarItem::clean): ditto
5959 (toolbarItem::~toolbarItem): ditto
5960 (toolbarItem::operator): ditto
5962 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5964 * src/paragraph.h: control the NEW_TABULAR define from here
5966 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5967 USE_TABULAR_INSETS to NEW_TABULAR
5969 * src/ToolbarDefaults.C: add include "lyxlex.h"
5971 * files using the old table/tabular: use NEW_TABULAR to control
5972 compilation of old tabular stuff.
5974 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5977 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5978 planemet in reading of old style floats, fix the \end_deeper
5979 problem when reading old style floats.
5981 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5983 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5985 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5987 * lib/bind/sciword.bind: updated.
5989 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5991 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5992 layout write problem
5994 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5996 * src/Makefile.am (INCLUDES): remove image directory from include
5999 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6000 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6002 * src/LyXView.C (create_form_form_main): read the application icon
6005 * lib/images/*.xpm: change the icons to use transparent color for
6008 * src/toolbar.C (update): change the color of the button when it
6011 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6013 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6014 setting explicitely the minibuffer.
6015 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6017 * src/LyXView.C (showState): new function. Shows font information
6018 in minibuffer and update toolbar state.
6019 (LyXView): call Toolbar::update after creating the
6022 * src/toolbar.C: change toollist to be a vector instead of a
6024 (BubbleTimerCB): get help string directly from the callback
6025 argument of the corresponding icon (which is the action)
6026 (set): remove unnecessary ugliness.
6027 (update): new function. update the icons (depressed, disabled)
6028 depending of the status of the corresponding action.
6030 * src/toolbar.h: remove help in toolbarItem
6032 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6034 * src/Painter.C (text): Added code for using symbol glyphs from
6035 iso10646 fonts. Currently diabled.
6037 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6040 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6041 magyar,turkish and usorbian.
6043 * src/paragraph.C (isMultiLingual): Made more efficient.
6045 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6048 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6049 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6050 Also changed the prototype to "bool math_insert_greek(char)".
6052 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6054 * lots of files: apply the NEW_INSETS on all code that will not be
6055 needed when we move to use the new insets. Enable the define in
6056 lyxparagrah.h to try it.
6058 * src/insets/insettabular.C (cellstart): change to be a static
6060 (InsetTabular): initialize buffer in the initializer list.
6062 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6064 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6065 form_print.h out of the header file. Replaced with forward
6066 declarations of the relevant struct.
6068 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6071 * src/commandtags.h: do not include "debug.h" which does not
6072 belong there. #include it in some other places because of this
6075 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6077 * src/insets/insetcaption.C: add a couple "using" directives.
6079 * src/toolbar.C (add): get the help text directly from lyxaction.
6081 (setPixmap): new function. Loads from disk and sets a pixmap on a
6082 botton; the name of the pixmap file is derived from the command
6085 * src/toolbar.h: remove members isBitmap and pixmap from
6088 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6089 * lib/images/: move many files from images/banner.xpm.
6091 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6093 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6094 * src/toolbar.C: ditto.
6095 * configure.in: ditto.
6096 * INSTALL: document.
6098 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6099 the spellchecker popup is closed from the WM.
6101 2000-07-19 Juergen Vigna <jug@sad.it>
6103 * src/insets/insetfloat.C (Write): small fix because we use the
6104 insetname for the type now!
6106 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6108 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6111 * src/frontends/Dialogs.h: removed hideCitation signal
6113 * src/insets/insetcite.h: added hide signal
6115 * src/insets/insetcite.C (~InsetCitation): emits new signal
6116 (getScreenLabel): "intelligent" label should now fit on the screen!
6118 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6120 * src/frontends/xforms/FormCitation.C (showInset): connects
6121 hide() to the inset's hide signal
6122 (show): modified to use fl_set_object_position rather than
6123 fl_set_object_geometry wherever possible
6125 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6127 * src/insets/lyxinset.h: add caption code
6129 * src/insets/insetfloat.C (type): new method
6131 * src/insets/insetcaption.C (Write): new method
6133 (LyxCode): new method
6135 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6136 to get it right together with using the FloatList.
6138 * src/commandtags.h: add LFUN_INSET_CAPTION
6139 * src/lyxfunc.C (Dispatch): handle it
6141 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6144 * src/Variables.[Ch]: make expand take a const reference, remove
6145 the destructor, some whitespace changes.
6147 * src/LyXAction.C (init): add caption-inset-insert
6149 * src/FloatList.C (FloatList): update the default floats a bit.
6151 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6153 * src/Variables.[Ch]: new files. Intended to be used for language
6154 specific strings (like \chaptername) and filename substitution in
6157 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6159 * lib/kbd/american.kmap: update
6161 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6163 * src/bufferparams.[Ch]: remove member allowAccents.
6165 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6167 * src/LaTeXLog.C: use the log_form.h header.
6168 * src/lyx_gui.C: ditto.
6169 * src/lyx_gui_misc.C: ditto.
6170 * src/lyxvc.h: ditto.
6172 * forms/log_form.fd: new file, created from latexoptions.fd. I
6173 kept the log popup and nuked the options form.
6175 * src/{la,}texoptions.[Ch]: removed.
6176 * src/lyx_cb.C (LaTeXOptions): ditto
6178 * src/lyx_gui.C (create_forms): do not handle the
6179 fd_latex_options form.
6181 2000-07-18 Juergen Vigna <jug@sad.it>
6183 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6184 name of the inset so that it can be requested outside (text2.C).
6186 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6189 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6191 * src/mathed/formula.h (ConvertFont): constify
6193 * src/mathed/formula.C (Read): add warning if \end_inset is not
6194 found on expected place.
6196 * src/insets/lyxinset.h (ConvertFont): consify
6198 * src/insets/insetquotes.C (ConvertFont): constify
6199 * src/insets/insetquotes.h: ditto
6201 * src/insets/insetinfo.h: add labelfont
6203 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6204 (ascent): use labelfont
6208 (Write): make .lyx file a bit nicer
6210 * src/insets/insetfloat.C (Write): simplify somewhat...
6211 (Read): add warning if arg is not found
6213 * src/insets/insetcollapsable.C: add using std::max
6214 (Read): move string token and add warning in arg is not found
6215 (draw): use std::max to get the right ty
6216 (getMaxWidth): simplify by using std::max
6218 * src/insets/insetsection.h: new file
6219 * src/insets/insetsection.C: new file
6220 * src/insets/insetcaption.h: new file
6221 * src/insets/insetcaption.C: new file
6223 * src/insets/inset.C (ConvertFont): constify signature
6225 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6226 insetcaption.[Ch] and insetsection.[Ch]
6228 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6229 uses to use LABEL_COUNTER_CHAPTER instead.
6230 * src/text2.C (SetCounter): here
6232 * src/counters.h: new file
6233 * src/counters.C: new file
6234 * src/Sectioning.h: new file
6235 * src/Sectioning.C: new file
6237 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6239 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6241 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6244 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6247 2000-07-17 Juergen Vigna <jug@sad.it>
6249 * src/tabular.C (Validate): check if array-package is needed.
6250 (SetVAlignment): added support for vertical alignment.
6251 (SetLTFoot): better support for longtable header/footers
6252 (Latex): modified to support added features.
6254 * src/LaTeXFeatures.[Ch]: added array-package.
6256 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6258 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6261 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6263 * configure.in: do not forget to put a space after -isystem.
6265 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6267 * lib/kbd/arabic.kmap: a few fixes.
6269 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6271 * some whitespace chagnes to a number of files.
6273 * src/support/DebugStream.h: change to make it easier for
6274 doc++ to parse correctly.
6275 * src/support/lyxstring.h: ditto
6277 * src/mathed/math_utils.C (compara): change to have only one
6279 (MathedLookupBOP): change because of the above.
6281 * src/mathed/math_delim.C (math_deco_compare): change to have only
6283 (search_deco): change becasue of the above.
6285 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6286 instead of manually coded one.
6288 * src/insets/insetquotes.C (Read): read the \end_inset too
6290 * src/insets/insetlatex.h: remove file
6291 * src/insets/insetlatex.C: remove file
6293 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6295 (InsetPrintIndex): remove destructor
6297 * src/insets/insetinclude.h: remove default constructor
6299 * src/insets/insetfloat.C: work to make it work better
6301 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6303 * src/insets/insetcite.h (InsetCitation): remove default constructor
6305 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6307 * src/text.C (GetColumnNearX): comment out some currently unused code.
6309 * src/paragraph.C (writeFile): move some initializations closer to
6311 (CutIntoMinibuffer): small change to use new matchIT operator
6315 (InsertInset): ditto
6318 (InsetIterator): ditto
6319 (Erase): small change to use new matchFT operator
6321 (GetFontSettings): ditto
6322 (HighestFontInRange): ditto
6325 * src/lyxparagraph.h: some chars changed to value_type
6326 (matchIT): because of some stronger checking (perhaps too strong)
6327 in SGI STL, the two operator() unified to one.
6330 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6332 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6333 the last inset read added
6334 (parseSingleLyXformat2Token): some more (future) compability code added
6335 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6336 (parseSingleLyXformat2Token): set last_inset_read
6337 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6338 (parseSingleLyXformat2Token): don't double intializw string next_token
6340 * src/TextCache.C (text_fits::operator()): add const's to the signature
6341 (has_buffer::operator()): ditto
6343 * src/Floating.h: add some comments on the class
6345 * src/FloatList.[Ch] (typeExist): new method
6348 * src/BackStack.h: added default constructor, wanted by Gcc.
6350 2000-07-14 Juergen Vigna <jug@sad.it>
6352 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6354 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6356 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6357 do a redraw when the window is resized!
6358 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6360 * src/insets/insettext.C (resizeLyXText): added function to correctly
6361 being able to resize the LyXWindow.
6363 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6365 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6367 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6368 crashes when closing dialog to a deleted inset.
6370 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6371 method! Now similar to other insets.
6373 2000-07-13 Juergen Vigna <jug@sad.it>
6375 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6377 * lib/examples/Literate.lyx: small patch!
6379 * src/insets/insetbib.C (Read): added this function because of wrong
6380 Write (without [begin|end]_inset).
6382 2000-07-11 Juergen Vigna <jug@sad.it>
6384 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6385 as the insertInset could not be good!
6387 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6388 the bool param should not be last.
6390 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6392 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6393 did submit that to Karl).
6395 * configure.in: use -isystem instead of -I for X headers. This
6396 fixes a problem on solaris with a recent gcc;
6397 put the front-end code after the X detection code;
6398 configure in sigc++ before lib/
6400 * src/lyx_main.C (commandLineHelp): remove -display from command
6403 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6405 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6406 Also put in Makefile rules for building the ``listerrors''
6407 program for parsing errors from literate programs written in LyX.
6409 * lib/build-listerrors: Added small shell script as part of compile
6410 process. This builds a working ``listerrors'' binary if noweb is
6411 installed and either 1) the VNC X server is installed on the machine,
6412 or 2) the user is compiling from within a GUI. The existence of a GUI
6413 is necessary to use the ``lyx --export'' feature for now. This
6414 hack can be removed once ``lyx --export'' no longer requires a GUI to
6417 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6419 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6420 now passed back correctly from gcc and placed "under" error
6421 buttons in a Literate LyX source.
6423 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6425 * src/text.C (GetColumnNearX): Better behavior when a RTL
6426 paragraph is ended by LTR text.
6428 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6431 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6433 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6434 true when clipboard is empty.
6436 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6438 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6439 row of the paragraph.
6440 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6441 to prevent calculation of bidi tables
6443 2000-07-07 Juergen Vigna <jug@sad.it>
6445 * src/screen.C (ToggleSelection): added y_offset and x_offset
6448 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6451 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6453 * src/insets/insettext.C: fixed Layout-Display!
6455 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6457 * configure.in: add check for strings.h header.
6459 * src/spellchecker.C: include <strings.h> in order to have a
6460 definition for bzero().
6462 2000-07-07 Juergen Vigna <jug@sad.it>
6464 * src/insets/insettext.C (draw): set the status of the bv->text to
6465 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6467 * src/screen.C (DrawOneRow):
6468 (DrawFromTo): redraw the actual row if something has changed in it
6471 * src/text.C (draw): call an update of the toplevel-inset if something
6472 has changed inside while drawing.
6474 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6476 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6478 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6479 processing inside class.
6481 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6482 processing inside class.
6484 * src/insets/insetindex.h new struct Holder, consistent with other
6487 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6488 citation dialog from main code and placed it in src/frontends/xforms.
6489 Dialog launched through signals instead of callbacks
6491 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6493 * lyx.man: update the options description.
6495 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6497 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6498 handle neg values, set min width to 590, add doc about -display
6500 2000-07-05 Juergen Vigna <jug@sad.it>
6502 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6503 calls to BufferView *.
6505 * src/insets/insettext.C (checkAndActivateInset): small fix non
6506 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6508 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6509 their \end_inset token!
6511 2000-07-04 edscott <edscott@imp.mx>
6513 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6514 lib/lyxrc.example: added option \wheel_jump
6516 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6518 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6519 remove support for -width,-height,-xpos and -ypos.
6521 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6523 * src/encoding.[Ch]: New files.
6525 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6526 (text): Call to the underline() method only when needed.
6528 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6530 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6531 encoding(s) for the document.
6533 * src/bufferparams.C (BufferParams): Changed default value of
6536 * src/language.C (newLang): Removed.
6537 (items[]): Added encoding information for all defined languages.
6539 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6540 encoding choice button.
6542 * src/lyxrc.h (font_norm_type): New member variable.
6543 (set_font_norm_type): New method.
6545 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6546 paragraphs with different encodings.
6548 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6549 (TransformChar): Changed to work correctly with Arabic points.
6550 (draw): Added support for drawing Arabic points.
6551 (draw): Removed code for drawing underbars (this is done by
6554 * src/support/textutils.h (IsPrintableNonspace): New function.
6556 * src/BufferView_pimpl.h: Added "using SigC::Object".
6557 * src/LyXView.h: ditto.
6559 * src/insets/insetinclude.h (include_label): Changed to mutable.
6561 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6563 * src/mathed/math_iter.h: remove empty destructor
6565 * src/mathed/math_cursor.h: remove empty destructor
6567 * src/insets/lyxinset.h: add THEOREM_CODE
6569 * src/insets/insettheorem.[Ch]: new files
6571 * src/insets/insetminipage.C: (InsertInset): remove
6573 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6575 (InsertInset): remove
6577 * src/insets/insetlist.C: (InsertList): remove
6579 * src/insets/insetfootlike.[Ch]: new files
6581 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6584 (InsertInset): ditto
6586 * src/insets/insetert.C: remove include Painter.h, reindent
6587 (InsertInset): move to header
6589 * src/insets/insetcollapsable.h: remove explicit from default
6590 contructor, remove empty destructor, add InsertInset
6592 * src/insets/insetcollapsable.C (InsertInset): new func
6594 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6596 * src/vspace.h: add explicit to constructor
6598 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6599 \textcompwordmark, please test this.
6601 * src/lyxrc.C: set ascii_linelen to 65 by default
6603 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6605 * src/commandtags.h: add LFUN_INSET_THEOREM
6607 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6608 (makeLinuxDocFile): remove _some_ of the nice logic
6609 (makeDocBookFile): ditto
6611 * src/Painter.[Ch]: (~Painter): removed
6613 * src/LyXAction.C (init): entry for insettheorem added
6615 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6617 (deplog): code to detect files generated by LaTeX, needs testing
6620 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6622 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6624 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6626 * src/LaTeX.C (deplog): Add a check for files that are going to be
6627 created by the first latex run, part of the project to remove the
6630 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6631 contents to the extension list.
6633 2000-07-04 Juergen Vigna <jug@sad.it>
6635 * src/text.C (NextBreakPoint): added support for needFullRow()
6637 * src/insets/lyxinset.h: added needFullRow()
6639 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6642 * src/insets/insettext.C: lots of changes for update!
6644 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6646 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6648 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6650 * src/insets/insetinclude.C (InsetInclude): fixed
6651 initialization of include_label.
6652 (unique_id): now returns a string.
6654 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6656 * src/LaTeXFeatures.h: new member IncludedFiles, for
6657 a map of key, included file name.
6659 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6660 with the included files for inclusion in SGML preamble,
6661 i. e., linuxdoc and docbook.
6664 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6665 nice (is the generated linuxdoc code to be exported?), that
6666 allows to remove column, and only_body that will be true for
6667 slave documents. Insets are allowed inside SGML font type.
6668 New handling of the SGML preamble for included files.
6669 (makeDocBookFile): the same for docbook.
6671 * src/insets/insetinclude.h:
6672 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6674 (DocBook): new export methods.
6676 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6677 and makeDocBookFile.
6679 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6680 formats to export with command line argument -x.
6682 2000-06-29 Juergen Vigna <jug@sad.it>
6684 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6685 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6687 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6688 region could already been cleared by an inset!
6690 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6692 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6695 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6697 (cursorToggle): remove special handling of lyx focus.
6699 2000-06-28 Juergen Vigna <jug@sad.it>
6701 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6704 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6706 * src/insets/insetindex.C (Edit): add a callback when popup is
6709 * src/insets/insettext.C (LocalDispatch):
6710 * src/insets/insetmarginal.h:
6711 * src/insets/insetlist.h:
6712 * src/insets/insetfoot.h:
6713 * src/insets/insetfloat.h:
6714 * src/insets/insetert.h: add a missing std:: qualifier.
6716 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6718 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6721 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6723 * src/insets/insettext.C (Read): remove tmptok unused variable
6724 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6725 (InsertInset): change for new InsetInset code
6727 * src/insets/insettext.h: add TEXT inline method
6729 * src/insets/insettext.C: remove TEXT macro
6731 * src/insets/insetmarginal.C (Write): new method
6732 (Latex): change output slightly
6734 * src/insets/insetfoot.C (Write): new method
6735 (Latex): change output slightly (don't use endl when no need)
6737 * src/insets/insetert.C (Write): new method
6739 * src/insets/insetcollapsable.h: make button_length, button_top_y
6740 and button_bottm_y protected.
6742 * src/insets/insetcollapsable.C (Write): simplify code by using
6743 tostr. Also do not output the float name, the children class
6744 should to that to get control over own arguments
6746 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6747 src/insets/insetminipage.[Ch]:
6750 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6752 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6754 * src/Makefile.am (lyx_SOURCES): add the new files
6756 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6757 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6758 * src/commandtags.h: ditto
6760 * src/LaTeXFeatures.h: add a std::set of used floattypes
6762 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6764 * src/FloatList.[Ch] src/Floating.h: new files
6766 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6768 * src/lyx_cb.C (TableApplyCB): ditto
6770 * src/text2.C: ditto
6771 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6772 (parseSingleLyXformat2Token): ditto + add code for
6773 backwards compability for old float styles + add code for new insets
6775 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6777 (InsertInset(size_type, Inset *, LyXFont)): new method
6778 (InsetChar(size_type, char)): changed to use the other InsetChar
6779 with a LyXFont(ALL_INHERIT).
6780 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6781 insert the META_INSET.
6783 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6785 * sigc++/thread.h (Threads): from here
6787 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6788 definition out of line
6789 * sigc++/scope.h: from here
6791 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6793 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6794 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6796 * Makefile.am (bindist): new target.
6798 * INSTALL: add instructions for doing a binary distribution.
6800 * development/tools/README.bin.example: update a bit.
6802 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6805 * lib/lyxrc.example: new lyxrc tag \set_color.
6807 * src/lyxfunc.C (Dispatch):
6808 * src/commandtags.h:
6809 * src/LyXAction.C: new lyxfunc "set-color".
6811 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6812 and an x11name given as strings.
6814 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6815 cache when a color is changed.
6817 2000-06-26 Juergen Vigna <jug@sad.it>
6819 * src/lyxrow.C (width): added this functions and variable.
6821 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6824 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6826 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6828 * images/undo_bw.xpm: new icon.
6829 * images/redo_bw.xpm: ditto.
6831 * configure.in (INSTALL_SCRIPT): change value to
6832 ${INSTALL} to avoid failures of install-script target.
6833 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6835 * src/BufferView.h: add a magic "friend" declaration to please
6838 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6840 * forms/cite.fd: modified to allow resizing without messing
6843 * src/insetcite.C: Uses code from cite.fd almost without
6845 User can now resize dialog in the x-direction.
6846 Resizing the dialog in the y-direction is prevented, as the
6847 code does this intelligently already.
6849 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6851 * INSTALL: remove obsolete entry in "problems" section.
6853 * lib/examples/sl_*.lyx: update of the slovenian examples.
6855 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6857 2000-06-23 Juergen Vigna <jug@sad.it>
6859 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6861 * src/buffer.C (resize): delete the LyXText of textinsets.
6863 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6865 * src/insets/lyxinset.h: added another parameter 'cleared' to
6866 the draw() function.
6868 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6869 unlocking inset in inset.
6871 2000-06-22 Juergen Vigna <jug@sad.it>
6873 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6874 of insets and moved first to LyXText.
6876 * src/mathed/formulamacro.[Ch]:
6877 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6879 2000-06-21 Juergen Vigna <jug@sad.it>
6881 * src/text.C (GetVisibleRow): look if I should clear the area or not
6882 using Inset::doClearArea() function.
6884 * src/insets/lyxinset.h: added doClearArea() function and
6885 modified draw(Painter &, ...) to draw(BufferView *, ...)
6887 * src/text2.C (UpdateInset): return bool insted of int
6889 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6891 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6892 combox in the character popup
6894 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6895 BufferParams const & params
6897 2000-06-20 Juergen Vigna <jug@sad.it>
6899 * src/insets/insettext.C (SetParagraphData): set insetowner on
6902 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6904 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6905 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6907 (form_main_): remove
6909 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6910 (create_form_form_main): remove FD_form_main stuff, connect to
6911 autosave_timeout signal
6913 * src/LyXView.[Ch] (getMainForm): remove
6914 (UpdateTimerCB): remove
6915 * src/BufferView_pimpl.h: inherit from SigC::Object
6917 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6918 signal instead of callback
6920 * src/BufferView.[Ch] (cursorToggleCB): remove
6922 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6924 * src/BufferView_pimpl.C: changes because of the one below
6926 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6927 instead of storing a pointer to a LyXText.
6929 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6931 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6933 * src/lyxparagraph.h
6935 * src/paragraph.C: Changed fontlist to a sorted vector.
6937 2000-06-19 Juergen Vigna <jug@sad.it>
6939 * src/BufferView.h: added screen() function.
6941 * src/insets/insettext.C (LocalDispatch): some selection code
6944 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6946 * src/insets/insettext.C (SetParagraphData):
6948 (InsetText): fixes for multiple paragraphs.
6950 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6952 * development/lyx.spec.in: Call configure with ``--without-warnings''
6953 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6954 This should be fine, however, since we generally don't want to be
6955 verbose when making an RPM.
6957 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6959 * lib/scripts/fig2pstex.py: New file
6961 2000-06-16 Juergen Vigna <jug@sad.it>
6963 * src/insets/insettabular.C (UpdateLocal):
6964 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6965 (LocalDispatch): Changed all functions to use LyXText.
6967 2000-06-15 Juergen Vigna <jug@sad.it>
6969 * src/text.C (SetHeightOfRow): call inset::update before requesting
6972 * src/insets/insettext.C (update):
6973 * src/insets/insettabular.C (update): added implementation
6975 * src/insets/lyxinset.h: added update function
6977 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6979 * src/text.C (SelectNextWord): protect against null pointers with
6980 old-style string streams. (fix from Paul Theo Gonciari
6983 * src/cite.[Ch]: remove erroneous files.
6985 * lib/configure.m4: update the list of created directories.
6987 * src/lyxrow.C: include <config.h>
6988 * src/lyxcursor.C: ditto.
6990 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6992 * lib/examples/decimal.lyx: new example file from Mike.
6994 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6995 to find template definitions (from Dekel)
6997 * src/frontends/.cvsignore: add a few things.
6999 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7001 * src/Timeout.C (TimeOut): remove default argument.
7003 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7006 * src/insets/ExternalTemplate.C: add a "using" directive.
7008 * src/lyx_main.h: remove the act_ struct, which seems unused
7011 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7013 * LyX Developers Meeting: All files changed, due to random C++ (by
7014 coincidence) code generator script.
7016 - external inset (cool!)
7017 - initial online editing of preferences
7018 - insettabular breaks insettext(s contents)
7020 - some DocBook fixes
7021 - example files update
7022 - other cool stuff, create a diff and look for yourself.
7024 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7026 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7027 -1 this is a non-line-breaking textinset.
7029 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7030 if there is no width set.
7032 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7034 * Lots of files: Merged the dialogbase branch.
7036 2000-06-09 Allan Rae <rae@lyx.org>
7038 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7039 and the Dispatch methods that used it.
7041 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7042 access to functions formerly kept in Dispatch.
7044 2000-05-19 Allan Rae <rae@lyx.org>
7046 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7047 made to_page and count_copies integers again. from_page remains a
7048 string however because I want to allow entry of a print range like
7049 "1,4,22-25" using this field.
7051 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7052 and printer-params-get. These aren't useful from the minibuffer but
7053 could be used by a script/LyXServer app provided it passes a suitable
7054 auto_mem_buffer. I guess I should take a look at how the LyXServer
7055 works and make it support xtl buffers.
7057 * sigc++/: updated to libsigc++-1.0.1
7059 * src/xtl/: updated to xtl-1.3.pl.11
7061 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7062 those changes done to the files in src/ are actually recreated when
7063 they get regenerated. Please don't ever accept a patch that changes a
7064 dialog unless that patch includes the changes to the corresponding *.fd
7067 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7068 stringOnlyContains, renamed it and generalised it.
7070 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7071 branch. Removed the remaining old form_print code.
7073 2000-04-26 Allan Rae <rae@lyx.org>
7075 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7076 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7078 2000-04-25 Allan Rae <rae@lyx.org>
7080 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7081 against a base of xtl-1.3.pl.4
7083 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7084 filter the Id: entries so they still show the xtl version number
7087 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7088 into the src/xtl code. Patch still pending with José (XTL)
7090 2000-04-24 Allan Rae <rae@lyx.org>
7092 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7093 both more generic and much safer. Use the new template functions.
7094 * src/buffer.[Ch] (Dispatch): ditto.
7096 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7097 and mem buffer more intelligently. Also a little general cleanup.
7100 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7101 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7102 * src/xtl/Makefile.am: ditto.
7103 * src/xtl/.cvsignore: ditto.
7104 * src/Makefile.am: ditto.
7106 * src/PrinterParams.h: Removed the macros member functions. Added a
7107 testInvariant member function. A bit of tidying up and commenting.
7108 Included Angus's idea for fixing operation with egcs-1.1.2.
7110 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7111 cool expansion of XTL's mem_buffer to support automatic memory
7112 management within the buffer itself. Removed the various macros and
7113 replaced them with template functions that use either auto_mem_buffer
7114 or mem_buffer depending on a #define. The mem_buffer support will
7115 disappear as soon as the auto_mem_buffer is confirmed to be good on
7116 other platforms/compilers. That is, it's there so you've got something
7119 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7120 effectively forked XTL. However I expect José will include my code
7121 into the next major release. Also fixed a memory leak.
7122 * src/xtl/text.h: ditto.
7123 * src/xtl/xdr.h: ditto.
7124 * src/xtl/giop.h: ditto.
7126 2000-04-16 Allan Rae <rae@lyx.org>
7128 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7129 by autogen.sh and removed by maintainer-clean anyway.
7130 * .cvsignore, sigc++/.cvsignore: Support the above.
7132 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7134 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7136 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7137 macros, renamed static callback-target member functions to suit new
7138 scheme and made them public.
7139 * src/frontends/xforms/forms/form_print.fd: ditto.
7140 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7142 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7145 * src/xtl/: New directory containing a minimal distribution of XTL.
7146 This is XTL-1.3.pl.4.
7148 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7150 2000-04-15 Allan Rae <rae@lyx.org>
7152 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7154 * sigc++/: Updated to libsigc++-1.0.0
7156 2000-04-14 Allan Rae <rae@lyx.org>
7158 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7159 use the generic ones in future. I'll modify my conversion script.
7161 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7163 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7164 (CloseAllBufferRelatedDialogs): Renamed.
7165 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7167 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7168 of the generic ones. These are the same ones my conversion script
7171 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7172 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7173 * src/buffer.C (Dispatch): ditto
7175 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7176 functions for updating and hiding buffer dependent dialogs.
7177 * src/BufferView.C (buffer): ditto
7178 * src/buffer.C (setReadonly): ditto
7179 * src/lyxfunc.C (CloseBuffer): ditto
7181 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7182 Dialogs.h, and hence all the SigC stuff, into every file that includes
7183 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7185 * src/BufferView2.C: reduce the number of headers included by buffer.h
7187 2000-04-11 Allan Rae <rae@lyx.org>
7189 * src/frontends/xforms/xform_macros.h: A small collection of macros
7190 for building C callbacks.
7192 * src/frontends/xforms/Makefile.am: Added above file.
7194 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7195 scheme again. This time it should work for JMarc. If this is
7196 successful I'll revise my conversion script to automate some of this.
7197 The static member functions in the class also have to be public for
7198 this scheme will work. If the scheme works (it's almost identical to
7199 the way BufferView::cursorToggleCB is handled so it should work) then
7200 FormCopyright and FormPrint will be ready for inclusion into the main
7201 trunk immediately after 1.1.5 is released -- provided we're prepared
7202 for complaints about lame compilers not handling XTL.
7204 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7206 2000-04-07 Allan Rae <rae@lyx.org>
7208 * config/lyxinclude.m4: A bit more tidying up (Angus)
7210 * src/LString.h: JMarc's <string> header fix
7212 * src/PrinterParams.h: Used string for most data to remove some
7213 ugly code in the Print dialog and avoid even uglier code when
7214 appending the ints to a string for output.
7216 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7217 and moved "default:" back to the end of switch statement. Cleaned
7218 up the printing so it uses the right function calls and so the
7219 "print to file" option actually puts the file in the right directory.
7221 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7223 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7224 and Ok+Apply button control into a separate method: input (Angus).
7225 (input) Cleaned it up and improved it to be very thorough now.
7226 (All CB) static_cast used instead of C style cast (Angus). This will
7227 probably change again once we've worked out how to keep gcc-2.8.1 happy
7228 with real C callbacks.
7229 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7230 ignore some of the bool settings and has random numbers instead. Needs
7231 some more investigation. Added other input length checks and checking
7232 of file and printer names.
7234 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7235 would link (Angus). Seems the old code doesn't compile with the pragma
7236 statement either. Separated callback entries from internal methods.
7238 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7240 2000-03-17 Allan Rae <rae@lyx.org>
7242 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7243 need it? Maybe it could go in Dialogs instead? I could make it a
7244 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7245 values to get the bool return value.
7246 (Dispatch): New overloaded method for xtl support.
7248 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7249 extern "C" callback instead of static member functions. Hopefully,
7250 JMarc will be able to compile this. I haven't changed
7251 forms/form_copyright.fd yet. Breaking one of my own rules already.
7253 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7254 because they aren't useful from the minibuffer. Maybe a LyXServer
7255 might want a help message though?
7257 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7259 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7260 xtl which needs both rtti and exceptions.
7262 * src/support/Makefile.am:
7263 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7265 * src/frontends/xforms/input_validators.[ch]: input filters and
7266 validators. These conrol what keys are valid in input boxes.
7267 Use them and write some more. Much better idea than waiting till
7268 after the user has pressed Ok to say that the input fields don't make
7271 * src/frontends/xforms/Makefile.am:
7272 * src/frontends/xforms/forms/form_print.fd:
7273 * src/frontends/xforms/forms/makefile:
7274 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7275 new scheme. Still have to make sure I haven't missed anything from
7276 the current implementation.
7278 * src/Makefile.am, src/PrinterParams.h: New data store.
7280 * other files: Added a couple of copyright notices.
7282 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7284 * src/insets/insetbib.h: move Holder struct in public space.
7286 * src/frontends/include/DialogBase.h: use SigC:: only when
7287 SIGC_CXX_NAMESPACES is defined.
7288 * src/frontends/include/Dialogs.h: ditto.
7290 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7292 * src/frontends/xforms/FormCopyright.[Ch]: do not
7293 mention SigC:: explicitely.
7295 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7297 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7298 deals with testing KDE in main configure.in
7299 * configure.in: ditto.
7301 2000-02-22 Allan Rae <rae@lyx.org>
7303 * Lots of files: Merged from HEAD
7305 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7306 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7308 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7310 * sigc++/: new minidist.
7312 2000-02-14 Allan Rae <rae@lyx.org>
7314 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7316 2000-02-08 Juergen Vigna <jug@sad.it>
7318 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7319 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7321 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7322 for this port and so it is much easier for other people to port
7323 dialogs in a common development environment.
7325 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7326 the QT/KDE implementation.
7328 * src/frontends/kde/Dialogs.C:
7329 * src/frontends/kde/FormCopyright.C:
7330 * src/frontends/kde/FormCopyright.h:
7331 * src/frontends/kde/Makefile.am:
7332 * src/frontends/kde/formcopyrightdialog.C:
7333 * src/frontends/kde/formcopyrightdialog.h:
7334 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7335 for the kde support of the Copyright-Dialog.
7337 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7338 subdir-substitution instead of hardcoded 'xforms' as we now have also
7341 * src/frontends/include/DialogBase.h (Object): just commented the
7342 label after #endif (nasty warning and I don't like warnings ;)
7344 * src/main.C (main): added KApplication initialization if using
7347 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7348 For now only the KDE event-loop is added if frontend==kde.
7350 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7352 * configure.in: added support for the --with-frontend[=value] option
7354 * autogen.sh: added kde.m4 file to list of config-files
7356 * acconfig.h: added define for KDEGUI-support
7358 * config/kde.m4: added configuration functions for KDE-port
7360 * config/lyxinclude.m4: added --with-frontend[=value] option with
7361 support for xforms and KDE.
7363 2000-02-08 Allan Rae <rae@lyx.org>
7365 * all Makefile.am: Fixed up so the make targets dist, distclean,
7366 install and uninstall all work even if builddir != srcdir. Still
7367 have a new sigc++ minidist update to come.
7369 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7371 2000-02-01 Allan Rae <rae@lyx.org>
7373 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7374 Many mods to get builddir != srcdir working.
7376 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7377 for building on NT and so we can do the builddir != srcdir stuff.
7379 2000-01-30 Allan Rae <rae@lyx.org>
7381 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7382 This will stay in "rae" branch. We probably don't really need it in
7383 the main trunk as anyone who wants to help programming it should get
7384 a full library installed also. So they can check both included and
7385 system supplied library compilation.
7387 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7388 Added a 'mini' distribution of libsigc++. If you feel the urge to
7389 change something in these directories - Resist it. If you can't
7390 resist the urge then you should modify the following script and rebuild
7391 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7392 all happen. Still uses a hacked version of libsigc++'s configure.in.
7393 I'm quite happy with the results. I'm not sure the extra work to turn
7394 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7395 worth the trouble and would probably lead to extra maintenance
7397 I haven't tested the following important make targets: install, dist.
7398 Not ready for prime time but very close. Maybe 1.1.5.
7400 * development/tools/makeLyXsigc.sh: A shell script to automatically
7401 generate our mini-dist of libsigc++. It can only be used with a CVS
7402 checkout of libsigc++ not a tarball distribution. It's well commented.
7403 This will end up as part of the libsigc++ distribution so other apps
7404 can easily have an included mini-dist. If someone makes mods to the
7405 sigc++ subpackage without modifying this script to generate those
7406 changes I'll be very upset!
7408 * src/frontends/: Started the gui/system indep structure.
7410 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7411 to access the gui-indep dialogs are in this class. Much improved
7412 design compared to previous revision. Lars, please refrain from
7413 moving this header into src/ like you did with Popups.h last time.
7415 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7417 * src/frontends/xforms/: Started the gui-indep system with a single
7418 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7421 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7422 Here you'll find a very useful makefile and automated fdfix.sh that
7423 makes updating dailogs a no-brainer -- provided you follow the rules
7424 set out in the README. I'm thinking about adding another script to
7425 automatically generate skeleton code for a new dialog given just the
7428 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7429 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7430 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7432 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7434 * src/support/LSubstring.C (operator): simplify
7436 * src/lyxtext.h: removed bparams, use buffer_->params instead
7438 * src/lyxrow.h: make Row a real class, move all variables to
7439 private and use accessors.
7441 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7443 (isRightToLeftPar): ditto
7444 (ChangeLanguage): ditto
7445 (isMultiLingual): ditto
7448 (SimpleTeXOnePar): ditto
7449 (TeXEnvironment): ditto
7450 (GetEndLabel): ditto
7452 (SetOnlyLayout): ditto
7453 (BreakParagraph): ditto
7454 (BreakParagraphConservative): ditto
7455 (GetFontSettings): ditto
7457 (CopyIntoMinibuffer): ditto
7458 (CutIntoMinibuffer): ditto
7459 (PasteParagraph): ditto
7460 (SetPExtraType): ditto
7461 (UnsetPExtraType): ditto
7462 (DocBookContTableRows): ditto
7463 (SimpleDocBookOneTablePar): ditto
7465 (TeXFootnote): ditto
7466 (SimpleTeXOneTablePar): ditto
7467 (TeXContTableRows): ditto
7468 (SimpleTeXSpecialChars): ditto
7471 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7472 to private and use accessors.
7474 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7475 this, we did not use it anymore and has not been for ages. Just a
7476 waste of cpu cycles.
7478 * src/language.h: make Language a real class, move all variables
7479 to private and use accessors.
7481 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7482 (create_view): remove
7483 (update): some changes for new timer
7484 (cursorToggle): use new timer
7485 (beforeChange): change for new timer
7487 * src/BufferView.h (cursorToggleCB): removed last paramter because
7490 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7491 (cursorToggleCB): change because of new timer code
7493 * lib/CREDITS: updated own mailaddress
7495 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7497 * src/support/filetools.C (PutEnv): fix the code in case neither
7498 putenv() nor setenv() have been found.
7500 * INSTALL: mention the install-strip Makefile target.
7502 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7503 read-only documents.
7505 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7507 * lib/reLyX/configure.in (VERSION): avoid using a previously
7508 generated reLyX wrapper to find out $prefix.
7510 * lib/examples/eu_adibide_lyx-atua.lyx:
7511 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7512 translation of the Tutorial (Dooteo)
7514 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7516 * forms/cite.fd: new citation dialog
7518 * src/insetcite.[Ch]: the new citation dialog is moved into
7521 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7524 * src/insets/insetcommand.h: data members made private.
7526 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7528 * LyX 1.1.5 released
7530 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7532 * src/version.h (LYX_RELEASE): to 1.1.5
7534 * src/spellchecker.C (RunSpellChecker): return false if the
7535 spellchecker dies upon creation.
7537 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7539 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7540 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7544 * lib/CREDITS: update entry for Martin Vermeer.
7546 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7548 * src/text.C (draw): Draw foreign language bars at the bottom of
7549 the row instead of at the baseline.
7551 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7553 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7555 * lib/bind/de_menus.bind: updated
7557 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7559 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7561 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7563 * src/menus.C (Limit_string_length): New function
7564 (ShowTocMenu): Limit the number of items/length of items in the
7567 * src/paragraph.C (String): Correct result for a paragraph inside
7570 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7572 * src/bufferlist.C (close): test of buf->getuser() == NULL
7574 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7576 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7577 Do not call to SetCursor when the paragraph is a closed footnote!
7579 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7581 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7584 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7586 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7589 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7590 reference popup, that activates the reference-back action
7592 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7594 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7595 the menus. Also fixed a bug.
7597 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7598 the math panels when switching buffers (unless new buffer is readonly).
7600 * src/BufferView.C (NoSavedPositions)
7601 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7603 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7605 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7606 less of dvi dirty or not.
7608 * src/trans_mgr.[Ch] (insert): change first parameter to string
7611 * src/chset.[Ch] (encodeString): add const to first parameter
7613 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7615 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7619 * src/LaTeX.C (deplog): better searching for dependency files in
7620 the latex log. Uses now regexps.
7622 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7623 instead of the box hack or \hfill.
7625 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7627 * src/lyxfunc.C (doImportHelper): do not create the file before
7628 doing the actual import.
7629 (doImportASCIIasLines): create a new file before doing the insert.
7630 (doImportASCIIasParagraphs): ditto.
7632 * lib/lyxrc.example: remove mention of non-existing commands
7634 * lyx.man: remove mention of color-related switches.
7636 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7638 * src/lyx_gui.C: remove all the color-related ressources, which
7639 are not used anymore.
7641 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7644 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7646 * src/lyxrc.C (read): Add a missing break in the switch
7648 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7650 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7652 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7655 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7657 * src/text.C (draw): draw bars under foreign language words.
7659 * src/LColor.[Ch]: add LColor::language
7661 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7663 * src/lyxcursor.h (boundary): New member variable
7665 * src/text.C (IsBoundary): New methods
7667 * src/text.C: Use the above for currect cursor movement when there
7668 is both RTL & LTR text.
7670 * src/text2.C: ditto
7672 * src/bufferview_funcs.C (ToggleAndShow): ditto
7674 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7676 * src/text.C (DeleteLineForward): set selection to true to avoid
7677 that DeleteEmptyParagraphMechanism does some magic. This is how it
7678 is done in all other functions, and seems reasonable.
7679 (DeleteWordForward): do not jump over non-word stuff, since
7680 CursorRightOneWord() already does it.
7682 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7683 DeleteWordBackward, since they seem safe to me (since selection is
7684 set to "true") DeleteEmptyParagraphMechanism does nothing.
7686 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7688 * src/lyx_main.C (easyParse): simplify the code by factoring the
7689 part that removes parameters from the command line.
7690 (LyX): check wether wrong command line options have been given.
7692 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7694 * src/lyx_main.C : add support for specifying user LyX
7695 directory via command line option -userdir.
7697 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7699 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7700 the number of items per popup.
7701 (Add_to_refs_menu): Ditto.
7703 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7705 * src/lyxparagraph.h: renamed ClearParagraph() to
7706 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7707 textclass as parameter, and do nothing if free_spacing is
7708 true. This fixes part of the line-delete-forward problems.
7710 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7711 (pasteSelection): ditto.
7712 (SwitchLayoutsBetweenClasses): more translatable strings.
7714 * src/text2.C (CutSelection): use StripLeadingSpaces.
7715 (PasteSelection): ditto.
7716 (DeleteEmptyParagraphMechanism): ditto.
7718 2000-05-26 Juergen Vigna <jug@sad.it>
7720 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7721 is not needed in tabular insets.
7723 * src/insets/insettabular.C (TabularFeatures): added missing features.
7725 * src/tabular.C (DeleteColumn):
7727 (AppendRow): implemented this functions
7728 (cellsturct::operator=): clone the inset too;
7730 2000-05-23 Juergen Vigna <jug@sad.it>
7732 * src/insets/insettabular.C (LocalDispatch): better selection support
7733 when having multicolumn-cells.
7735 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7737 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7739 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7741 * src/ColorHandler.C (getGCForeground): put more test into _()
7743 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7746 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7749 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7751 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7752 there are no labels, or when buffer is readonly.
7754 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7755 there are no labels, buffer is SGML, or when buffer is readonly.
7757 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7759 * src/LColor.C (LColor): change a couple of grey40 to grey60
7760 (LColor): rewore initalization to make compiles go some magnitude
7762 (getGUIName): don't use gettext until we need the string.
7764 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7766 * src/Bullet.[Ch]: Fixed a small bug.
7768 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7770 * src/paragraph.C (String): Several fixes/improvements
7772 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7774 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7776 * src/paragraph.C (String): give more correct output.
7778 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7780 * src/lyxfont.C (stateText) Do not output the language if it is
7781 eqaul to the language of the document.
7783 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7784 between two paragraphs with the same language.
7786 * src/paragraph.C (getParLanguage) Return a correct answer for an
7787 empty dummy paragraph.
7789 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7792 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7795 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7796 the menus/popup, if requested fonts are unavailable.
7798 2000-05-22 Juergen Vigna <jug@sad.it>
7800 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7801 movement support (Up/Down/Tab/Shift-Tab).
7802 (LocalDispatch): added also preliminari cursor-selection.
7804 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7806 * src/paragraph.C (PasteParagraph): Hopefully now right!
7808 2000-05-22 Garst R. Reese <reese@isn.net>
7810 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7811 of list, change all references to Environment to Command
7812 * tex/hollywood.cls : rewrite environments as commands, add
7813 \uppercase to interiorshot and exteriorshot to force uppecase.
7814 * tex/broadway.cls : rewrite environments as commands. Tweak
7817 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7819 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7820 size of items: use a constant intead of the hardcoded 40, and more
7821 importantly do not remove the %m and %x tags added at the end.
7822 (Add_to_refs_menu): use vector::size_type instead of
7823 unsigned int as basic types for the variables. _Please_ do not
7824 assume that size_t is equal to unsigned int. On an alpha, this is
7825 unsigned long, which is _not_ the same.
7827 * src/language.C (initL): remove language "hungarian", since it
7828 seems that "magyar" is better.
7830 2000-05-22 Juergen Vigna <jug@sad.it>
7832 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7834 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7837 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7838 next was deleted but not set to 0.
7840 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7842 * src/language.C (initL): change the initialization of languages
7843 so that compiles goes _fast_.
7845 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7848 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7850 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7854 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7856 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7858 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7862 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7865 * src/insets/insetlo*.[Ch]: Made editable
7867 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7869 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7870 the current selection.
7872 * src/BufferView_pimpl.C (stuffClipboard): new method
7874 * src/BufferView.C (stuffClipboard): new method
7876 * src/paragraph.C (String): new method
7878 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7879 LColor::ignore when lyxname is not found.
7881 * src/BufferView.C (pasteSelection): new method
7883 * src/BufferView_pimpl.C (pasteSelection): new method
7885 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7887 * src/WorkArea.C (request_clipboard_cb): new static function
7888 (getClipboard): new method
7889 (putClipboard): new method
7891 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7893 * LyX 1.1.5pre2 released
7895 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7897 * src/vspace.C (operator=): removed
7898 (operator=): removed
7900 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7902 * src/layout.C (NumberOfClass): manually set the type in make_pair
7903 (NumberOfLayout): ditto
7905 * src/language.C: use the Language constructor for ignore_lang
7907 * src/language.h: add constructors to struct Language
7909 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7911 * src/text2.C (SetCursorIntern): comment out #warning
7913 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7915 * src/mathed/math_iter.h: initialize sx and sw to 0
7917 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7919 * forms/lyx.fd: Redesign of form_ref
7921 * src/LaTeXFeatures.[Ch]
7925 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7928 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7929 and Buffer::inset_iterator.
7931 * src/menus.C: Added new menus: TOC and Refs.
7933 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7935 * src/buffer.C (getTocList): New method.
7937 * src/BufferView2.C (ChangeRefs): New method.
7939 * src/buffer.C (getLabelList): New method. It replaces the old
7940 getReferenceList. The return type is vector<string> instead of
7943 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7944 the old getLabel() and GetNumberOfLabels() methods.
7945 * src/insets/insetlabel.C (getLabelList): ditto
7946 * src/mathed/formula.C (getLabelList): ditto
7948 * src/paragraph.C (String): New method.
7950 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7951 Uses the new getTocList() method.
7952 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7953 which automatically updates the contents of the browser.
7954 (RefUpdateCB): Use the new getLabelList method.
7956 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7958 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7960 * src/spellchecker.C: Added using std::reverse;
7962 2000-05-19 Juergen Vigna <jug@sad.it>
7964 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7966 * src/insets/insettext.C (computeTextRows): small fix for display of
7967 1 character after a newline.
7969 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7972 2000-05-18 Juergen Vigna <jug@sad.it>
7974 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7975 when changing width of column.
7977 * src/tabular.C (set_row_column_number_info): setting of
7978 autobreak rows if necessary.
7980 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7982 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7984 * src/vc-backend.*: renamed stat() to status() and vcstat to
7985 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7986 compilation broke. The new name seems more relevant, anyway.
7988 2000-05-17 Juergen Vigna <jug@sad.it>
7990 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7991 which was wrong if the removing caused removing of rows!
7993 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7994 (pushToken): new function.
7996 * src/text2.C (CutSelection): fix problem discovered with purify
7998 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8000 * src/debug.C (showTags): enlarge the first column, now that we
8001 have 6-digits debug codes.
8003 * lib/layouts/hollywood.layout:
8004 * lib/tex/hollywood.cls:
8005 * lib/tex/brodway.cls:
8006 * lib/layouts/brodway.layout: more commands and fewer
8007 environments. Preambles moved in the .cls files. Broadway now has
8008 more options on scene numbering and less whitespace (from Garst)
8010 * src/insets/insetbib.C (getKeys): make sure that we are in the
8011 document directory, in case the bib file is there.
8013 * src/insets/insetbib.C (Latex): revert bogus change.
8015 2000-05-16 Juergen Vigna <jug@sad.it>
8017 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8018 the TabularLayout on cursor move.
8020 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8022 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8025 (draw): fixed cursor position and drawing so that the cursor is
8026 visible when before the tabular-inset.
8028 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8029 when creating from old insettext.
8031 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8033 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8035 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8036 * lib/tex/brodway.cls: ditto
8038 * lib/layouts/brodway.layout: change alignment of parenthical
8041 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8043 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8044 versions 0.88 and 0.89 are supported.
8046 2000-05-15 Juergen Vigna <jug@sad.it>
8048 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8051 * src/insets/insettext.C (computeTextRows): redone completely this
8052 function in a much cleaner way, because of problems when having a
8054 (draw): added a frame border when the inset is locked.
8055 (SetDrawLockedFrame): this sets if we draw the border or not.
8056 (SetFrameColor): this sets the frame color (default=insetframe).
8058 * src/insets/lyxinset.h: added x() and y() functions which return
8059 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8060 function which is needed to see if we have a locking inset of some
8061 type in this inset (needed for now in insettabular).
8063 * src/vspace.C (inPixels): the same function also without a BufferView
8064 parameter as so it is easier to use it in some ocasions.
8066 * src/lyxfunc.C: changed all places where insertInset was used so
8067 that now if it couldn't be inserted it is deleted!
8069 * src/TabularLayout.C:
8070 * src/TableLayout.C: added support for new tabular-inset!
8072 * src/BufferView2.C (insertInset): this now returns a bool if the
8073 inset was really inserted!!!
8075 * src/tabular.C (GetLastCellInRow):
8076 (GetFirstCellInRow): new helper functions.
8077 (Latex): implemented for new tabular class.
8081 (TeXTopHLine): new Latex() helper functions.
8083 2000-05-12 Juergen Vigna <jug@sad.it>
8085 * src/mathed/formulamacro.C (Read):
8086 * src/mathed/formula.C (Read): read also the \end_inset here!
8088 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8090 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8091 crush when saving formulae with unbalanced parenthesis.
8093 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8095 * src/layout.C: Add new keyword "endlabelstring" to layout file
8097 * src/text.C (GetVisibleRow): Draw endlabel string.
8099 * lib/layouts/broadway.layout
8100 * lib/layouts/hollywood.layout: Added endlabel for the
8101 Parenthetical layout.
8103 * lib/layouts/heb-article.layout: Do not use slanted font shape
8104 for Theorem like environments.
8106 * src/buffer.C (makeLaTeXFile): Always add "american" to
8107 the UsedLanguages list if document language is RTL.
8109 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8111 * add addendum to README.OS2 and small patch (from SMiyata)
8113 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8115 * many files: correct the calls to ChangeExtension().
8117 * src/support/filetools.C (ChangeExtension): remove the no_path
8118 argument, which does not belong there. Use OnlyFileName() instead.
8120 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8121 files when LaTeXing a non-nice latex file.
8123 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8124 a chain of "if". Return false when deadkeys are not handled.
8126 * src/lyx_main.C (LyX): adapted the code for default bindings.
8128 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8129 bindings for basic functionality (except deadkeys).
8130 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8132 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8133 several methods: handle override_x_deadkeys.
8135 * src/lyxrc.h: remove the "bindings" map, which did not make much
8136 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8138 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8140 * src/lyxfont.C (stateText): use a saner method to determine
8141 whether the font is "default". Seems to fix the crash with DEC
8144 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8146 2000-05-08 Juergen Vigna <jug@sad.it>
8148 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8149 TabularLayoutMenu with mouse-button-3
8150 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8152 * src/TabularLayout.C: added this file for having a Layout for
8155 2000-05-05 Juergen Vigna <jug@sad.it>
8157 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8158 recalculating inset-widths.
8159 (TabularFeatures): activated this function so that I can change
8160 tabular-features via menu.
8162 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8163 that I can test some functions with the Table menu.
8165 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8167 * src/lyxfont.C (stateText): guard against stupid c++libs.
8169 * src/tabular.C: add using std::vector
8170 some whitespace changes, + removed som autogenerated code.
8172 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8174 2000-05-05 Juergen Vigna <jug@sad.it>
8176 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8177 row, columns and cellstructures.
8179 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8181 * lib/lyxrc.example: remove obsolete entries.
8183 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8184 reading of protected_separator for free_spacing.
8186 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8188 * src/text.C (draw): do not display an exclamation mark in the
8189 margin for margin notes. This is confusing, ugly and
8192 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8193 AMS math' is checked.
8195 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8196 name to see whether including the amsmath package is needed.
8198 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8200 * src/paragraph.C (validate): Compute UsedLanguages correctly
8201 (don't insert the american language if it doesn't appear in the
8204 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8205 The argument of \thanks{} command is considered moving argument
8207 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8210 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8212 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8213 for appendix/minipage/depth. The lines can be now both in the footnote
8214 frame, and outside the frame.
8216 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8219 2000-05-05 Juergen Vigna <jug@sad.it>
8221 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8222 neede only in tabular.[Ch].
8224 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8226 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8228 (Write): write '~' for PROTECTED_SEPARATOR
8230 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8232 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8235 * src/mathed/formula.C (drawStr): rename size to siz.
8237 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8238 possibly fix a bug by not changing the pflags = flags to piflags =
8241 2000-05-05 Juergen Vigna <jug@sad.it>
8243 * src/insets/insetbib.C: moved using directive
8245 * src/ImportNoweb.C: small fix for being able to compile (missing
8248 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8250 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8251 to use clear, since we don't depend on this in the code. Add test
8254 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8256 * (various *.C files): add using std::foo directives to please dec
8259 * replace calls to string::clear() to string::erase() (Angus)
8261 * src/cheaders/cmath: modified to provide std::abs.
8263 2000-05-04 Juergen Vigna <jug@sad.it>
8265 * src/insets/insettext.C: Prepared all for inserting of multiple
8266 paragraphs. Still display stuff to do (alignment and other things),
8267 but I would like to use LyXText to do this when we cleaned out the
8268 table-support stuff.
8270 * src/insets/insettabular.C: Changed lot of stuff and added lots
8271 of functionality still a lot to do.
8273 * src/tabular.C: Various functions changed name and moved to be
8274 const functions. Added new Read and Write functions and changed
8275 lots of things so it works good with tabular-insets (also removed
8276 some stuff which is not needed anymore * hacks *).
8278 * src/lyxcursor.h: added operators == and != which just look if
8279 par and pos are (not) equal.
8281 * src/buffer.C (latexParagraphs): inserted this function to latex
8282 all paragraphs form par to endpar as then I can use this too for
8285 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8286 so that I can call this to from text insets with their own cursor.
8288 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8289 output off all paragraphs (because of the fix below)!
8291 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8292 the very last paragraph (this could be also the last paragraph of an
8295 * src/texrow.h: added rows() call which returns the count-variable.
8297 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8299 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8301 * lib/configure.m4: better autodetection of DocBook tools.
8303 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8305 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8307 * src/lyx_cb.C: add using std::reverse;
8309 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8312 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8313 selected files. Should fix repeated errors from generated files.
8315 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8317 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8319 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8320 the spellchecker popup.
8322 * lib/lyxrc.example: Removed the \number_inset section
8324 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8326 * src/insets/figinset.C (various): Use IsFileReadable() to make
8327 sure that the file actually exist. Relying on ghostscripts errors
8328 is a bad idea since they can lead to X server crashes.
8330 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8332 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8335 * lib/lyxrc.example: smallish typo in description of
8336 \view_dvi_paper_option
8338 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8341 * src/lyxfunc.C: doImportHelper to factor out common code of the
8342 various import methods. New functions doImportASCIIasLines,
8343 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8344 doImportLinuxDoc for the format specific parts.
8347 * buffer.C: Dispatch returns now a bool to indicate success
8350 * lyx_gui.C: Add getLyXView() for member access
8352 * lyx_main.C: Change logic for batch commands: First try
8353 Buffer::Dispatch (possibly without GUI), if that fails, use
8356 * lyx_main.C: Add support for --import command line switch.
8357 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8358 Available Formats: Everything accepted by 'buffer-import <format>'
8360 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8362 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8365 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8366 documents will be reformatted upon reentry.
8368 2000-04-27 Juergen Vigna <jug@sad.it>
8370 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8371 correctly only last pos this was a bug.
8373 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8375 * release of lyx-1.1.5pre1
8377 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8379 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8381 * src/menus.C: revert the change of naming (Figure->Graphic...)
8382 from 2000-04-11. It was incomplete and bad.
8384 * src/LColor.[Ch]: add LColor::depthbar.
8385 * src/text.C (GetVisibleRow): use it.
8387 * README: update the languages list.
8389 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8391 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8394 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8396 * README: remove sections that were just wrong.
8398 * src/text2.C (GetRowNearY): remove currentrow code
8400 * src/text.C (GetRow): remove currentrow code
8402 * src/screen.C (Update): rewritten a bit.
8403 (SmallUpdate): removed func
8405 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8407 (FullRebreak): return bool
8408 (currentrow): remove var
8409 (currentrow_y): ditto
8411 * src/lyxscreen.h (Draw): change arg to unsigned long
8412 (FitCursor): return bool
8413 (FitManualCursor): ditto
8414 (Smallpdate): remove func
8415 (first): change to unsigned long
8416 (DrawOneRow): change second arg to long (from long &)
8417 (screen_refresh_y): remove var
8418 (scree_refresh_row): ditto
8420 * src/lyxrow.h: change baseline to usigned int from unsigned
8421 short, this brings some implicit/unsigned issues out in the open.
8423 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8425 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8426 instead of smallUpdate.
8428 * src/lyxcursor.h: change y to unsigned long
8430 * src/buffer.h: don't call updateScrollbar after fitcursor
8432 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8433 where they are used. Removed "\\direction", this was not present
8434 in 1.1.4 and is already obsolete. Commented out some code that I
8435 believe to never be called.
8436 (runLiterate): don't call updateScrollbar after fitCursor
8438 (buildProgram): ditto
8441 * src/WorkArea.h (workWidth): change return val to unsigned
8444 (redraw): remove the button redraws
8445 (setScrollbarValue): change for scrollbar
8446 (getScrollbarValue): change for scrollbar
8447 (getScrollbarBounds): change for scrollbar
8449 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8450 (C_WorkArea_down_cb): removed func
8451 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8452 (resize): change for scrollbar
8453 (setScrollbar): ditto
8454 (setScrollbarBounds): ditto
8455 (setScrollbarIncrements): ditto
8456 (up_cb): removed func
8457 (down_cb): removed func
8458 (scroll_cb): change for scrollbar
8459 (work_area_handler): ditto
8461 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8462 when FitCursor did something.
8463 (updateScrollbar): some unsigned changes
8464 (downCB): removed func
8465 (scrollUpOnePage): removed func
8466 (scrollDownOnePage): remvoed func
8467 (workAreaMotionNotify): don't call screen->FitCursor but use
8468 fitCursor instead. and bool return val
8469 (workAreaButtonPress): ditto
8470 (workAreaButtonRelease): some unsigned changes
8471 (checkInsetHit): ditto
8472 (workAreaExpose): ditto
8473 (update): parts rewritten, comments about the signed char arg added
8474 (smallUpdate): removed func
8475 (cursorPrevious): call needed updateScrollbar
8478 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8481 * src/BufferView.[Ch] (upCB): removed func
8482 (downCB): removed func
8483 (smallUpdate): removed func
8485 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8487 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8488 currentrow, currentrow_y optimization. This did not help a lot and
8489 if we want to do this kind of optimization we should rather use
8490 cursor.row instead of the currentrow.
8492 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8493 buffer spacing and klyx spacing support.
8495 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8497 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8500 2000-04-26 Juergen Vigna <jug@sad.it>
8502 * src/insets/figinset.C: fixes to Lars sstream changes!
8504 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8506 * A lot of files: Added Ascii(ostream &) methods to all inset
8507 classes. Used when exporting to ASCII.
8509 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8510 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8513 * src/text2.C (ToggleFree): Disabled implicit word selection when
8514 there is a change in the language
8516 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8517 no output was generated for end-of-sentence inset.
8519 * src/insets/lyxinset.h
8522 * src/paragraph.C: Removed the insetnumber code
8524 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8526 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8528 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8529 no_babel and no_epsfig completely from the file.
8530 (parseSingleLyXformat2Token): add handling for per-paragraph
8531 spacing as written by klyx.
8533 * src/insets/figinset.C: applied patch by Andre. Made it work with
8536 2000-04-20 Juergen Vigna <jug@sad.it>
8538 * src/insets/insettext.C (cutSelection):
8539 (copySelection): Fixed with selection from right to left.
8540 (draw): now the rows are not recalculated at every draw.
8541 (computeTextRows): for now reset the inset-owner here (this is
8542 important for an undo or copy where the inset-owner is not set
8545 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8546 motion to the_locking_inset screen->first was forgotten, this was
8547 not important till we got multiline insets.
8549 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8551 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8552 code seems to be alright (it is code changed by Dekel, and the
8553 intent is indeed that all macros should be defined \protect'ed)
8555 * NEWS: a bit of reorganisation of the new user-visible features.
8557 2000-04-19 Juergen Vigna <jug@sad.it>
8559 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8560 position. Set the inset_owner of the used paragraph so that it knows
8561 that it is inside an inset. Fixed cursor handling with mouse and
8562 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8563 and cleanups to make TextInsets work better.
8565 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8566 Changed parameters of various functions and added LockInsetInInset().
8568 * src/insets/insettext.C:
8570 * src/insets/insetcollapsable.h:
8571 * src/insets/insetcollapsable.C:
8572 * src/insets/insetfoot.h:
8573 * src/insets/insetfoot.C:
8574 * src/insets/insetert.h:
8575 * src/insets/insetert.C: cleaned up the code so that it works now
8576 correctly with insettext.
8578 * src/insets/inset.C:
8579 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8580 that insets in insets are supported right.
8583 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8585 * src/paragraph.C: some small fixes
8587 * src/debug.h: inserted INSETS debug info
8589 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8590 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8592 * src/commandtags.h:
8593 * src/LyXAction.C: insert code for InsetTabular.
8595 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8596 not Button1MotionMask.
8597 (workAreaButtonRelease): send always a InsetButtonRelease event to
8599 (checkInsetHit): some setCursor fixes (always with insets).
8601 * src/BufferView2.C (lockInset): returns a bool now and extended for
8602 locking insets inside insets.
8603 (showLockedInsetCursor): it is important to have the cursor always
8604 before the locked inset.
8605 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8607 * src/BufferView.h: made lockInset return a bool.
8609 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8611 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8612 that is used also internally but can be called as public to have back
8613 a cursor pos which is not set internally.
8614 (SetCursorIntern): Changed to use above function.
8616 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8618 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8623 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8624 patches for things that should be in or should be changed.
8626 * src/* [insetfiles]: change "usigned char fragile" to bool
8627 fragile. There was only one point that could that be questioned
8628 and that is commented in formulamacro.C. Grep for "CHECK".
8630 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8631 (DeleteBuffer): take it out of CutAndPaste and make it static.
8633 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8635 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8636 output the spacing envir commands. Also the new commands used in
8637 the LaTeX output makes the result better.
8639 * src/Spacing.C (writeEnvirBegin): new method
8640 (writeEnvirEnd): new method
8642 2000-04-18 Juergen Vigna <jug@sad.it>
8644 * src/CutAndPaste.C: made textclass a static member of the class
8645 as otherwise it is not accesed right!!!
8647 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8649 * forms/layout_forms.fd
8650 * src/layout_forms.h
8651 * src/layout_forms.C (create_form_form_character)
8652 * src/lyx_cb.C (UserFreeFont)
8653 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8654 documents (in the layout->character popup).
8656 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8658 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8659 \spell_command was in fact not honored (from Kevin Atkinson).
8661 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8664 * src/lyx_gui.h: make lyxViews private (Angus)
8666 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8668 * src/mathed/math_write.C
8669 (MathMatrixInset::Write) Put \protect before \begin{array} and
8670 \end{array} if fragile
8671 (MathParInset::Write): Put \protect before \\ if fragile
8673 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8675 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8676 initialization if the LyXColorHandler must be done after the
8677 connections to the XServer has been established.
8679 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8680 get the background pixel from the lyxColorhandler so that the
8681 figures are rendered with the correct background color.
8682 (NextToken): removed functions.
8683 (GetPSSizes): use ifs >> string instead of NextToken.
8685 * src/Painter.[Ch]: the color cache moved out of this file.
8687 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8690 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8692 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8693 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8695 * src/BufferView.C (enterView): new func
8696 (leaveView): new func
8698 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8700 (leaveView): new func, undefines xterm cursor when approp.
8702 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8703 (AllowInput): delete the Workarea cursor handling from this func.
8705 * src/Painter.C (underline): draw a slimer underline in most cases.
8707 * src/lyx_main.C (error_handler): use extern "C"
8709 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8711 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8712 sent directly to me.
8714 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8715 to the list by Dekel.
8717 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8720 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8721 methods from lyx_cb.here.
8723 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8726 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8728 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8729 instead of using current_view directly.
8731 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8733 * src/LyXAction.C (init): add the paragraph-spacing command.
8735 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8737 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8739 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8740 different from the documents.
8742 * src/text.C (SetHeightOfRow): take paragraph spacing into
8743 account, paragraph spacing takes precedence over buffer spacing
8744 (GetVisibleRow): ditto
8746 * src/paragraph.C (writeFile): output the spacing parameter too.
8747 (validate): set the correct features if spacing is used in the
8749 (Clear): set spacing to default
8750 (MakeSameLayout): spacing too
8751 (HasSameLayout): spacing too
8752 (SetLayout): spacing too
8753 (TeXOnePar): output the spacing commands
8755 * src/lyxparagraph.h: added a spacing variable for use with
8756 per-paragraph spacing.
8758 * src/Spacing.h: add a Default spacing and a method to check if
8759 the current spacing is default. also added an operator==
8761 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8764 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8766 * src/lyxserver.C (callback): fix dispatch of functions
8768 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8769 printf() into lyxerr call.
8771 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8774 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8775 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8776 the "Float" from each of the subitems.
8777 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8779 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8780 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8781 documented the change so that the workaround can be nuked later.
8783 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8786 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8788 * src/buffer.C (getLatexName): ditto
8789 (setReadonly): ditto
8791 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8793 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8794 avoid some uses of current_view. Added also a bufferParams()
8795 method to get at this.
8797 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8799 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8801 * src/lyxparagraph.[Ch]: removed
8802 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8803 with operators used by lower_bound and
8804 upper_bound in InsetTable's
8805 Make struct InsetTable private again. Used matchpos.
8807 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8809 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8810 document, the language of existing text is changed (unless the
8811 document is multi-lingual)
8813 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8815 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8817 * A lot of files: A rewrite of the Right-to-Left support.
8819 2000-04-10 Juergen Vigna <jug@sad.it>
8821 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8822 misplaced cursor when inset in inset is locked.
8824 * src/insets/insettext.C (LocalDispatch): small fix so that a
8825 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8827 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8828 footnote font should be decreased in size twice when displaying.
8830 * src/insets/insettext.C (GetDrawFont): inserted this function as
8831 the drawing-font may differ from the real paragraph font.
8833 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8834 insets (inset in inset!).
8836 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8837 function here because we don't want footnotes inside footnotes.
8839 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8841 (init): now set the inset_owner in paragraph.C
8842 (LocalDispatch): added some resetPos() in the right position
8845 (pasteSelection): changed to use the new CutAndPaste-Class.
8847 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8848 which tells if it is allowed to insert another inset inside this one.
8850 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8851 SwitchLayoutsBetweenClasses.
8853 * src/text2.C (InsertInset): checking of the new paragraph-function
8855 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8856 is not needed anymore here!
8859 (PasteSelection): redone (also with #ifdef) so that now this uses
8860 the CutAndPaste-Class.
8861 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8864 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8865 from/to text/insets.
8867 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8868 so that the paragraph knows if it is inside an (text)-inset.
8869 (InsertFromMinibuffer): changed return-value to bool as now it
8870 may happen that an inset is not inserted in the paragraph.
8871 (InsertInsetAllowed): this checks if it is allowed to insert an
8872 inset in this paragraph.
8874 (BreakParagraphConservative):
8875 (BreakParagraph) : small change for the above change of the return
8876 value of InsertFromMinibuffer.
8878 * src/lyxparagraph.h: added inset_owner and the functions to handle
8879 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8881 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8883 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8884 functions from BufferView to BufferView::Pimpl to ease maintence.
8886 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8887 correctly. Also use SetCursorIntern instead of SetCursor.
8889 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8892 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8894 * src/WorkArea.C (belowMouse): manually implement below mouse.
8896 * src/*: Add "explicit" on several constructors, I added probably
8897 some unneeded ones. A couple of changes to code because of this.
8899 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8900 implementation and private parts from the users of BufferView. Not
8903 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8904 implementation and private parts from the users of LyXLex. Not
8907 * src/BufferView_pimpl.[Ch]: new files
8909 * src/lyxlex_pimpl.[Ch]: new files
8911 * src/LyXView.[Ch]: some inline functions move out-of-line
8913 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8915 * src/lyxparagraph.h: make struct InsetTable public.
8917 * src/support/lyxstring.h: change lyxstring::difference_type to be
8918 ptrdiff_t. Add std:: modifiers to streams.
8920 * src/font.C: include the <cctype> header, for islower() and
8923 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8925 * src/font.[Ch]: new files. Contains the metric functions for
8926 fonts, takes a LyXFont as parameter. Better separation of concepts.
8928 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8929 changes because of this.
8931 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8933 * src/*: compile with -Winline and move functions that don't
8936 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8939 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8941 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8942 (various files changed because of this)
8944 * src/Painter.C (text): fixed the drawing of smallcaps.
8946 * src/lyxfont.[Ch] (drawText): removed unused member func.
8949 * src/*.C: added needed "using" statements and "std::" qualifiers.
8951 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8953 * src/*.h: removed all use of "using" from header files use
8954 qualifier std:: instead.
8956 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8958 * src/text.C (Backspace): some additional cleanups (we already
8959 know whether cursor.pos is 0 or not).
8961 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8962 automake does not provide one).
8964 * src/bmtable.h: replace C++ comments with C comments.
8966 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8968 * src/screen.C (ShowCursor): Change the shape of the cursor if
8969 the current language is not equal to the language of the document.
8970 (If the cursor change its shape unexpectedly, then you've found a bug)
8972 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8975 * src/insets/insetnumber.[Ch]: New files.
8977 * src/LyXAction.C (init)
8978 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8981 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8983 * src/lyxparagraph.h
8984 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8985 (the vector is kept sorted).
8987 * src/text.C (GetVisibleRow): Draw selection correctly when there
8988 is both LTR and RTL text.
8990 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8991 which is much faster.
8993 * src/text.C (GetVisibleRow and other): Do not draw the last space
8994 in a row if the direction of the last letter is not equal to the
8995 direction of the paragraph.
8997 * src/lyxfont.C (latexWriteStartChanges):
8998 Check that font language is not equal to basefont language.
8999 (latexWriteEndChanges): ditto
9001 * src/lyx_cb.C (StyleReset): Don't change the language while using
9002 the font-default command.
9004 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9005 empty paragraph before a footnote.
9007 * src/insets/insetcommand.C (draw): Increase x correctly.
9009 * src/screen.C (ShowCursor): Change cursor shape if
9010 current language != document language.
9012 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9014 2000-03-31 Juergen Vigna <jug@sad.it>
9016 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9017 (Clone): changed mode how the paragraph-data is copied to the
9018 new clone-paragraph.
9020 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9021 GetInset(pos) with no inset anymore there (in inset UNDO)
9023 * src/insets/insetcommand.C (draw): small fix as here x is
9024 incremented not as much as width() returns (2 before, 2 behind = 4)
9026 2000-03-30 Juergen Vigna <jug@sad.it>
9028 * src/insets/insettext.C (InsetText): small fix in initialize
9029 widthOffset (should not be done in the init() function)
9031 2000-03-29 Amir Karger <karger@lyx.org>
9033 * lib/examples/it_ItemizeBullets.lyx: translation by
9036 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9038 2000-03-29 Juergen Vigna <jug@sad.it>
9040 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9042 * src/insets/insetfoot.C (Clone): small change as for the below
9043 new init function in the text-inset
9045 * src/insets/insettext.C (init): new function as I've seen that
9046 clone did not copy the Paragraph-Data!
9047 (LocalDispatch): Added code so that now we have some sort of Undo
9048 functionality (well actually we HAVE Undo ;)
9050 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9052 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9054 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9057 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9059 * src/main.C: added a runtime check that verifies that the xforms
9060 header used when building LyX and the library used when running
9061 LyX match. Exit with a message if they don't match. This is a
9062 version number check only.
9064 * src/buffer.C (save): Don't allocate memory on the heap for
9065 struct utimbuf times.
9067 * *: some using changes, use iosfwd instead of the real headers.
9069 * src/lyxfont.C use char const * instead of string for the static
9070 strings. Rewrite some functions to use sstream.
9072 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9074 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9077 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9079 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9080 of Geodesy (from Martin Vermeer)
9082 * lib/layouts/svjour.inc: include file for the Springer svjour
9083 class. It can be used to support journals other than JoG.
9085 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9086 Miskiewicz <misiek@pld.org.pl>)
9087 * lib/reLyX/Makefile.am: ditto.
9089 2000-03-27 Juergen Vigna <jug@sad.it>
9091 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9092 also some modifications with operations on selected text.
9094 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9095 problems with clicking on insets (last famous words ;)
9097 * src/insets/insetcommand.C (draw):
9098 (width): Changed to have a bit of space before and after the inset so
9099 that the blinking cursor can be seen (otherwise it was hidden)
9101 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9103 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9104 would not be added to the link list when an installed gettext (not
9105 part of libc) is found.
9107 2000-03-24 Juergen Vigna <jug@sad.it>
9109 * src/insets/insetcollapsable.C (Edit):
9110 * src/mathed/formula.C (InsetButtonRelease):
9111 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9114 * src/BufferView.C (workAreaButtonPress):
9115 (workAreaButtonRelease):
9116 (checkInsetHit): Finally fixed the clicking on insets be handled
9119 * src/insets/insetert.C (Edit): inserted this call so that ERT
9120 insets work always with LaTeX-font
9122 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9124 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9125 caused lyx to startup with no GUI in place, causing in a crash
9126 upon startup when called with arguments.
9128 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9130 * src/FontLoader.C: better initialization of dummyXFontStruct.
9132 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9134 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9135 for linuxdoc and docbook import and export format options.
9137 * lib/lyxrc.example Example of default values for the previous flags.
9139 * src/lyx_cb.C Use those flags instead of the hardwired values for
9140 linuxdoc and docbook export.
9142 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9145 * src/menus.C Added menus entries for the new import/exports formats.
9147 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9149 * src/lyxrc.*: Added support for running without Gui
9152 * src/FontLoader.C: sensible defaults if no fonts are needed
9154 * src/lyx_cb.C: New function ShowMessage (writes either to the
9155 minibuffer or cout in case of no gui
9156 New function AskOverwrite for common stuff
9157 Consequently various changes to call these functions
9159 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9160 wild guess at sensible screen resolution when having no gui
9162 * src/lyxfont.C: no gui, no fonts... set some defaults
9164 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9166 * src/LColor.C: made the command inset background a bit lighter.
9168 2000-03-20 Hartmut Goebel <goebel@noris.net>
9170 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9171 stdstruct.inc. Koma-Script added some title elements which
9172 otherwise have been listed below "bibliography". This split allows
9173 adding title elements to where they belong.
9175 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9176 define the additional title elements and then include
9179 * many other layout files: changed to include stdtitle.inc just
9180 before stdstruct.inc.
9182 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9184 * src/buffer.C: (save) Added the option to store all backup files
9185 in a single directory
9187 * src/lyxrc.[Ch]: Added variable \backupdir_path
9189 * lib/lyxrc.example: Added descriptions of recently added variables
9191 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9192 bibtex inset, not closing the bibtex popup when deleting the inset)
9194 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9196 * src/lyx_cb.C: add a couple using directives.
9198 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9199 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9200 import based on the filename.
9202 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9203 file would be imported at start, if the filename where of a sgml file.
9205 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9207 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9209 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9210 * src/lyxfont.h Replaced the member variable bits.direction by the
9211 member variable lang. Made many changes in other files.
9212 This allows having a multi-lingual document
9214 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9215 that change the current language to <l>.
9216 Removed the command "font-rtl"
9218 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9219 format for Hebrew documents)
9221 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9222 When auto_mathmode is "true", pressing a digit key in normal mode
9223 will cause entering into mathmode.
9224 If auto_mathmode is "rtl" then this behavior will be active only
9225 when writing right-to-left text.
9227 * src/text2.C (InsertStringA) The string is inserted using the
9230 * src/paragraph.C (GetEndLabel) Gives a correct result for
9231 footnote paragraphs.
9233 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9235 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9237 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9238 front of PasteParagraph. Never insert a ' '. This should at least
9239 fix some cause for the segfaults that we have been experiencing,
9240 it also fixes backspace behaviour slightly. (Phu!)
9242 * src/support/lstrings.C (compare_no_case): some change to make it
9243 compile with gcc 2.95.2 and stdlibc++-v3
9245 * src/text2.C (MeltFootnoteEnvironment): change type o
9246 first_footnote_par_is_not_empty to bool.
9248 * src/lyxparagraph.h: make text private. Changes in other files
9250 (fitToSize): new function
9251 (setContentsFromPar): new function
9252 (clearContents): new function
9253 (SetChar): new function
9255 * src/paragraph.C (readSimpleWholeFile): deleted.
9257 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9258 the file, just use a simple string instead. Also read the file in
9259 a more maintainable manner.
9261 * src/text2.C (InsertStringA): deleted.
9262 (InsertStringB): deleted.
9264 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9266 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9267 RedoParagraphs from the doublespace handling part, just set status
9268 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9269 done, but perhaps not like this.)
9271 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9273 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9274 character when inserting an inset.
9276 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9278 * src/bufferparams.C (readLanguage): now takes "default" into
9281 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9282 also initialize the toplevel_keymap with the default bindings from
9285 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9287 * all files using lyxrc: have lyxrc as a real variable and not a
9288 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9291 * src/lyxrc.C: remove double call to defaultKeyBindings
9293 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9294 toolbar defauls using lyxlex. Remove enums, structs, functions
9297 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9298 toolbar defaults. Also store default keybindings in a map.
9300 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9301 storing the toolbar defaults without any xforms dependencies.
9303 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9304 applied. Changed to use iterators.
9306 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9308 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9309 systems that don't have LINGUAS set to begin with.
9311 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9313 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9314 the list by Dekel Tsur.
9316 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9318 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9319 * src/insets/form_graphics.C: ditto.
9321 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9323 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9325 * src/bufferparams.C (readLanguage): use the new language map
9327 * src/intl.C (InitKeyMapper): use the new language map
9329 * src/lyx_gui.C (create_forms): use the new language map
9331 * src/language.[Ch]: New files. Used for holding the information
9332 about each language. Now! Use this new language map enhance it and
9333 make it really usable for our needs.
9335 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9337 * screen.C (ShowCursor): Removed duplicate code.
9338 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9339 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9341 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9344 * src/text.C Added TransformChar method. Used for rendering Arabic
9345 text correctly (change the glyphs of the letter according to the
9346 position in the word)
9351 * src/lyxrc.C Added lyxrc command {language_command_begin,
9352 language_command_end,language_command_ltr,language_command_rtl,
9353 language_package} which allows the use of either arabtex or Omega
9356 * src/lyx_gui.C (init)
9358 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9359 to use encoding for menu fonts which is different than the encoding
9362 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9363 do not load the babel package.
9364 To write an English document with Hebrew/Arabic, change the document
9365 language to "english".
9367 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9368 (alphaCounter): changed to return char
9369 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9371 * lib/lyxrc.example Added examples for Hebrew/Arabic
9374 * src/layout.C Added layout command endlabeltype
9376 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9378 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9380 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9382 * src/mathed/math_delim.C (search_deco): return a
9383 math_deco_struct* instead of index.
9385 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9387 * All files with a USE_OSTREAM_ONLY within: removed all code that
9388 was unused when USE_OSTREAM_ONLY is defined.
9390 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9391 of any less. Removed header and using.
9393 * src/text.C (GetVisibleRow): draw the string "Page Break
9394 (top/bottom)" on screen when drawing a pagebreak line.
9396 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9398 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9400 * src/mathed/math_macro.C (draw): do some cast magic.
9403 * src/mathed/math_defs.h: change byte* argument to byte const*.
9405 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9407 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9408 know it is right to return InsetFoot* too, but cxx does not like
9411 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9413 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9415 * src/mathed/math_delim.C: change == to proper assignment.
9417 2000-03-09 Juergen Vigna <jug@sad.it>
9419 * src/insets/insettext.C (setPos): fixed various cursor positioning
9420 problems (via mouse and cursor-keys)
9421 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9422 inset (still a small display problem but it works ;)
9424 * src/insets/insetcollapsable.C (draw): added button_top_y and
9425 button_bottom_y to have correct values for clicking on the inset.
9427 * src/support/lyxalgo.h: commented out 'using std::less'
9429 2000-03-08 Juergen Vigna <jug@sad.it>
9431 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9432 Button-Release event closes as it is alos the Release-Event
9435 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9437 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9439 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9440 can add multiple spaces in Scrap (literate programming) styles...
9441 which, by the way, is how I got hooked on LyX to begin with.
9443 * src/mathed/formula.C (Write): Added dummy variable to an
9444 inset::Latex() call.
9445 (Latex): Add free_spacing boolean to inset::Latex()
9447 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9449 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9450 virtual function to include the free_spacing boolean from
9451 the containing paragraph's style.
9453 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9454 Added free_spacing boolean arg to match inset.h
9456 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9457 Added free_spacing boolean arg to match inset.h
9459 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9460 Added free_spacing boolean and made sure that if in a free_spacing
9461 paragraph, that we output normal space if there is a protected space.
9463 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9464 Added free_spacing boolean arg to match inset.h
9466 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9467 Added free_spacing boolean arg to match inset.h
9469 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9470 Added free_spacing boolean arg to match inset.h
9472 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9473 Added free_spacing boolean arg to match inset.h
9475 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9476 Added free_spacing boolean arg to match inset.h
9478 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9479 free_spacing boolean arg to match inset.h
9481 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9482 Added free_spacing boolean arg to match inset.h
9484 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9485 Added free_spacing boolean arg to match inset.h
9487 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9488 Added free_spacing boolean arg to match inset.h
9490 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9491 Added free_spacing boolean arg to match inset.h
9493 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9494 Added free_spacing boolean arg to match inset.h
9496 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9497 free_spacing boolean arg to match inset.h
9499 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9500 free_spacing boolean arg to match inset.h
9502 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9503 ignore free_spacing paragraphs. The user's spaces are left
9506 * src/text.C (InsertChar): Fixed the free_spacing layout
9507 attribute behavior. Now, if free_spacing is set, you can
9508 add multiple spaces in a paragraph with impunity (and they
9509 get output verbatim).
9510 (SelectSelectedWord): Added dummy argument to inset::Latex()
9513 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9516 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9517 paragraph layouts now only input a simple space instead.
9518 Special character insets don't make any sense in free-spacing
9521 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9522 hard-spaces in the *input* file to simple spaces if the layout
9523 is free-spacing. This converts old files which had to have
9524 hard-spaces in free-spacing layouts where a simple space was
9526 (writeFileAscii): Added free_spacing check to pass to the newly
9527 reworked inset::Latex(...) methods. The inset::Latex() code
9528 ensures that hard-spaces in free-spacing paragraphs get output
9529 as spaces (rather than "~").
9531 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9533 * src/mathed/math_delim.C (draw): draw the empty placeholder
9534 delims with a onoffdash line.
9535 (struct math_deco_compare): struct that holds the "functors" used
9536 for the sort and the binary search in math_deco_table.
9537 (class init_deco_table): class used for initial sort of the
9539 (search_deco): use lower_bound to do a binary search in the
9542 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9544 * src/lyxrc.C: a small secret thingie...
9546 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9547 and to not flush the stream as often as it used to.
9549 * src/support/lyxalgo.h: new file
9550 (sorted): template function used for checking if a sequence is
9551 sorted or not. Two versions with and without user supplied
9552 compare. Uses same compare as std::sort.
9554 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9555 it and give warning on lyxerr.
9557 (struct compare_tags): struct with function operators used for
9558 checking if sorted, sorting and lower_bound.
9559 (search_kw): use lower_bound instead of manually implemented
9562 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9564 * src/insets/insetcollapsable.h: fix Clone() declaration.
9565 * src/insets/insetfoot.h: ditto.
9567 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9569 2000-03-08 Juergen Vigna <jug@sad.it>
9571 * src/insets/lyxinset.h: added owner call which tells us if
9572 this inset is inside another inset. Changed also the return-type
9573 of Editable to an enum so it tells clearer what the return-value is.
9575 * src/insets/insettext.C (computeTextRows): fixed computing of
9576 textinsets which split automatically on more rows.
9578 * src/insets/insetert.[Ch]: changed this to be of BaseType
9581 * src/insets/insetfoot.[Ch]: added footnote inset
9583 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9584 collapsable insets (like footnote, ert, ...)
9586 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9588 * src/lyxdraw.h: remvoe file
9590 * src/lyxdraw.C: remove file
9592 * src/insets/insettext.C: added <algorithm>.
9594 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9596 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9597 (matrix_cb): case MM_OK use string stream
9599 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9602 * src/mathed/math_macro.C (draw): use string stream
9603 (Metrics): use string stream
9605 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9606 directly to the ostream.
9608 * src/vspace.C (asString): use string stream.
9609 (asString): use string stream
9610 (asLatexString): use string stream
9612 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9613 setting Spacing::Other.
9615 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9616 sprintf when creating the stretch vale.
9618 * src/text2.C (alphaCounter): changed to return a string and to
9619 not use a static variable internally. Also fixed a one-off bug.
9620 (SetCounter): changed the drawing of the labels to use string
9621 streams instead of sprintf.
9623 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9624 manipulator to use a scheme that does not require library support.
9625 This is also the way it is done in the new GNU libstdc++. Should
9626 work with DEC cxx now.
9628 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9630 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9631 end. This fixes a bug.
9633 * src/mathed (all files concerned with file writing): apply the
9634 USE_OSTREAM_ONLY changes to mathed too.
9636 * src/support/DebugStream.h: make the constructor explicit.
9638 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9639 count and ostream squashed.
9641 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9643 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9645 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9646 ostringstream uses STL strings, and we might not.
9648 * src/insets/insetspecialchar.C: add using directive.
9649 * src/insets/insettext.C: ditto.
9651 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9653 * lib/layouts/seminar.layout: feeble attempt at a layout for
9654 seminar.cls, far from completet and could really use some looking
9655 at from people used to write layout files.
9657 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9658 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9659 a lot nicer and works nicely with ostreams.
9661 * src/mathed/formula.C (draw): a slightly different solution that
9662 the one posted to the list, but I think this one works too. (font
9663 size wrong in headers.)
9665 * src/insets/insettext.C (computeTextRows): some fiddling on
9666 Jürgens turf, added some comments that he should read.
9668 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9669 used and it gave compiler warnings.
9670 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9673 * src/lyx_gui.C (create_forms): do the right thing when
9674 show_banner is true/false.
9676 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9677 show_banner is false.
9679 * most file writing files: Now use iostreams to do almost all of
9680 the writing. Also instead of passing string &, we now use
9681 stringstreams. mathed output is still not adapted to iostreams.
9682 This change can be turned off by commenting out all the occurences
9683 of the "#define USE_OSTREAM_ONLY 1" lines.
9685 * src/WorkArea.C (createPixmap): don't output debug messages.
9686 (WorkArea): don't output debug messages.
9688 * lib/lyxrc.example: added a comment about the new variable
9691 * development/Code_rules/Rules: Added some more commente about how
9692 to build class interfaces and on how better encapsulation can be
9695 2000-03-03 Juergen Vigna <jug@sad.it>
9697 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9698 automatically with the width of the LyX-Window
9700 * src/insets/insettext.C (computeTextRows): fixed update bug in
9701 displaying text-insets (scrollvalues where not initialized!)
9703 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9705 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9706 id in the check of the result from lower_bound is not enough since
9707 lower_bound can return last too, and then res->id will not be a
9710 * all insets and some code that use them: I have conditionalized
9711 removed the Latex(string & out, ...) this means that only the
9712 Latex(ostream &, ...) will be used. This is a work in progress to
9713 move towards using streams for all output of files.
9715 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9718 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9720 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9721 routine (this fixes bug where greek letters were surrounded by too
9724 * src/support/filetools.C (findtexfile): change a bit the search
9725 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9726 no longer passed to kpsewhich, we may have to change that later.
9728 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9729 warning options to avoid problems with X header files (from Angus
9731 * acinclude.m4: regenerated.
9733 2000-03-02 Juergen Vigna <jug@sad.it>
9735 * src/insets/insettext.C (WriteParagraphData): Using the
9736 par->writeFile() function for writing paragraph-data.
9737 (Read): Using buffer->parseSingleLyXformat2Token()-function
9738 for parsing paragraph data!
9740 * src/buffer.C (readLyXformat2): removed all parse data and using
9741 the new parseSingleLyXformat2Token()-function.
9742 (parseSingleLyXformat2Token): added this function to parse (read)
9743 lyx-file-format (this is called also from text-insets now!)
9745 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9747 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9750 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9751 directly instead of going through a func. One very bad thing: a
9752 static LyXFindReplace, but I don't know where to place it.
9754 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9755 string instead of char[]. Also changed to static.
9756 (GetSelectionOrWordAtCursor): changed to static inline
9757 (SetSelectionOverLenChars): ditto.
9759 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9760 current_view and global variables. both classes has changed names
9761 and LyXFindReplace is not inherited from SearchForm.
9763 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9764 fl_form_search form.
9766 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9768 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9770 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9771 bound (from Kayvan).
9773 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9775 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9777 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9779 * some things that I should comment but the local pub says head to
9782 * comment out all code that belongs to the Roff code for Ascii
9783 export of tables. (this is unused)
9785 * src/LyXView.C: use correct type for global variable
9786 current_layout. (LyXTextClass::size_type)
9788 * some code to get the new insetgraphics closer to working I'd be
9789 grateful for any help.
9791 * src/BufferView2.C (insertInset): use the return type of
9792 NumberOfLayout properly. (also changes in other files)
9794 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9795 this as a test. I want to know what breaks because of this.
9797 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9799 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9801 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9802 to use a \makebox in the label, this allows proper justification
9803 with out using protected spaces or multiple hfills. Now it is
9804 "label" for left justified, "\hfill label\hfill" for center, and
9805 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9806 should be changed accordingly.
9808 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9810 * src/lyxtext.h: change SetLayout() to take a
9811 LyXTextClass::size_type instead of a char (when there is more than
9812 127 layouts in a class); also change type of copylayouttype.
9813 * src/text2.C (SetLayout): ditto.
9814 * src/LyXView.C (updateLayoutChoice): ditto.
9816 * src/LaTeX.C (scanLogFile): errors where the line number was not
9817 given just after the '!'-line were ignored (from Dekel Tsur).
9819 * lib/lyxrc.example: fix description of \date_insert_format
9821 * lib/layouts/llncs.layout: new layout, contributed by Martin
9824 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9826 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9827 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9828 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9829 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9830 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9831 paragraph.C, text.C, text2.C)
9833 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9835 * src/insets/insettext.C (LocalDispatch): remove extra break
9838 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9839 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9841 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9842 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9844 * src/insets/insetbib.h: move InsetBibkey::Holder and
9845 InsetCitation::Holder in public space.
9847 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9849 * src/insets/insettext.h: small change to get the new files from
9850 Juergen to compile (use "string", not "class string").
9852 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9853 const & as parameter to LocalDispatch, use LyXFont const & as
9854 paramter to some other func. This also had impacto on lyxinsets.h
9855 and the two mathed insets.
9857 2000-02-24 Juergen Vigna <jug@sad.it>
9860 * src/commandtags.h:
9862 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9866 * src/BufferView2.C: added/updated code for various inset-functions
9868 * src/insets/insetert.[Ch]: added implementation of InsetERT
9870 * src/insets/insettext.[Ch]: added implementation of InsetText
9872 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9873 (draw): added preliminary code for inset scrolling not finshed yet
9875 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9876 as it is in lyxfunc.C now
9878 * src/insets/lyxinset.h: Added functions for text-insets
9880 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9882 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9883 BufferView and reimplement the list as a queue put inside its own
9886 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9888 * several files: use the new interface to the "updateinsetlist"
9890 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9892 (work_area_handler): call BufferView::trippleClick on trippleclick.
9894 * src/BufferView.C (doubleClick): new function, selects word on
9896 (trippleClick): new function, selects line on trippleclick.
9898 2000-02-22 Allan Rae <rae@lyx.org>
9900 * lib/bind/xemacs.bind: buffer-previous not supported
9902 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9904 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9907 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9909 * src/bufferlist.C: get rid of current_view from this file
9911 * src/spellchecker.C: get rid of current_view from this file
9913 * src/vspace.C: get rid of current_view from this file
9914 (inPixels): added BufferView parameter for this func
9915 (asLatexCommand): added a BufferParams for this func
9917 * src/text.C src/text2.C: get rid of current_view from these
9920 * src/lyxfont.C (getFontDirection): move this function here from
9923 * src/bufferparams.C (getDocumentDirection): move this function
9926 * src/paragraph.C (getParDirection): move this function here from
9928 (getLetterDirection): ditto
9930 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9932 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9933 resize due to wrong pixmap beeing used. Also took the opurtunity
9934 to make the LyXScreen stateless on regard to WorkArea and some
9935 general cleanup in the same files.
9937 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9939 * src/Makefile.am: add missing direction.h
9941 * src/PainterBase.h: made the width functions const.
9943 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9946 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9948 * src/insets/insetlatexaccent.C (draw): make the accents draw
9949 better, at present this will only work well with iso8859-1.
9951 * several files: remove the old drawing code, now we use the new
9954 * several files: remove support for mono_video, reverse_video and
9957 2000-02-17 Juergen Vigna <jug@sad.it>
9959 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9960 int ** as we have to return the pointer, otherwise we have only
9961 NULL pointers in the returning function.
9963 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9965 * src/LaTeX.C (operator()): quote file name when running latex.
9967 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9969 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9970 (bubble tip), this removes our special handling of this.
9972 * Remove all code that is unused now that we have the new
9973 workarea. (Code that are not active when NEW_WA is defined.)
9975 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9977 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9979 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9980 nonexisting layout; correctly redirect obsoleted layouts.
9982 * lib/lyxrc.example: document \view_dvi_paper_option
9984 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9987 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9988 (PreviewDVI): handle the view_dvi_paper_option variable.
9989 [Both from Roland Krause]
9991 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9993 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9994 char const *, int, LyXFont)
9995 (text(int, int, string, LyXFont)): ditto
9997 * src/text.C (InsertCharInTable): attempt to fix the double-space
9998 feature in tables too.
9999 (BackspaceInTable): ditto.
10000 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10002 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10004 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10006 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10007 newly found text in textcache to this.
10008 (buffer): set the owner of the text put into the textcache to 0
10010 * src/insets/figinset.C (draw): fixed the drawing of figures with
10013 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10014 drawing of mathframe, hfills, protected space, table lines. I have
10015 now no outstanding drawing problems with the new Painter code.
10017 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10019 * src/PainterBase.C (ellipse, circle): do not specify the default
10022 * src/LColor.h: add using directive.
10024 * src/Painter.[Ch]: change return type of methods from Painter& to
10025 PainterBase&. Add a using directive.
10027 * src/WorkArea.C: wrap xforms callbacks in C functions
10030 * lib/layouts/foils.layout: font fix and simplifications from Carl
10033 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10035 * a lot of files: The Painter, LColor and WorkArea from the old
10036 devel branch has been ported to lyx-devel. Some new files and a
10037 lot of #ifdeffed code. The new workarea is enabled by default, but
10038 if you want to test the new Painter and LColor you have to compile
10039 with USE_PAINTER defined (do this in config.h f.ex.) There are
10040 still some rought edges, and I'd like some help to clear those
10041 out. It looks stable (loads and displays the Userguide very well).
10044 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10046 * src/buffer.C (pop_tag): revert to the previous implementation
10047 (use a global variable for both loops).
10049 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10051 * src/lyxrc.C (LyXRC): change slightly default date format.
10053 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10054 there is an English text with a footnote that starts with a Hebrew
10055 paragraph, or vice versa.
10056 (TeXFootnote): ditto.
10058 * src/text.C (LeftMargin): allow for negative values for
10059 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10062 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10063 for input encoding (cyrillic)
10065 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10067 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10070 * src/toolbar.C (set): ditto
10071 * src/insets/insetbib.C (create_form_citation_form): ditto
10073 * lib/CREDITS: added Dekel Tsur.
10075 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10076 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10077 hebrew supports files from Dekel Tsur.
10079 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10080 <tzafrir@technion.ac.il>
10082 * src/lyxrc.C: put \date_insert_format at the right place.
10084 * src/buffer.C (makeLaTeXFile): fix the handling of
10085 BufferParams::sides when writing out latex files.
10087 * src/BufferView2.C: add a "using" directive.
10089 * src/support/lyxsum.C (sum): when we use lyxstring,
10090 ostringstream::str needs an additional .c_str().
10092 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10094 * src/support/filetools.C (ChangeExtension): patch from Etienne
10097 * src/TextCache.C (show): remove const_cast and make second
10098 parameter non-const LyXText *.
10100 * src/TextCache.h: use non const LyXText in show.
10102 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10105 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10107 * src/support/lyxsum.C: rework to be more flexible.
10109 * several places: don't check if a pointer is 0 if you are going
10112 * src/text.C: remove some dead code.
10114 * src/insets/figinset.C: remove some dead code
10116 * src/buffer.C: move the BufferView funcs to BufferView2.C
10117 remove all support for insetlatexdel
10118 remove support for oldpapersize stuff
10119 made some member funcs const
10121 * src/kbmap.C: use a std::list to store the bindings in.
10123 * src/BufferView2.C: new file
10125 * src/kbsequence.[Ch]: new files
10127 * src/LyXAction.C + others: remove all trace of buffer-previous
10129 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10130 only have one copy in the binary of this table.
10132 * hebrew patch: moved some functions from LyXText to more
10133 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10135 * several files: remove support for XForms older than 0.88
10136 whitespace changes.
10137 remove some #if 0 #endif code
10139 * src/TextCache.[Ch]: new file. Holds the textcache.
10141 * src/BufferView.C: changes to use the new TextCache interface.
10142 (waitForX): remove the now unused code.
10144 * src/BackStack.h: remove some commented code
10146 * lib/bind/emacs.bind: remove binding for buffer-previous
10148 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10150 * applied the hebrew patch.
10152 * src/lyxrow.h: make sure that all Row variables are initialized.
10154 * src/text2.C (TextHandleUndo): comment out a delete, this might
10155 introduce a memory leak, but should also help us to not try to
10156 read freed memory. We need to look at this one.
10158 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10159 (LyXParagraph): initalize footnotekind.
10161 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10162 forgot this when applying the patch. Please heed the warnings.
10164 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10165 (aka. reformat problem)
10167 * src/bufferlist.C (exists): made const, and use const_iterator
10168 (isLoaded): new func.
10169 (release): use std::find to find the correct buffer.
10171 * src/bufferlist.h: made getState a const func.
10172 made empty a const func.
10173 made exists a const func.
10176 2000-02-01 Juergen Vigna <jug@sad.it>
10178 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10180 * po/it.po: updated a bit the italian po file and also changed the
10181 'file nuovo' for newfile to 'filenuovo' without a space, this did
10184 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10185 for the new insert_date command.
10187 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10188 from jdblair, to insert a date into the current text conforming to
10189 a strftime format (for now only considering the locale-set and not
10190 the document-language).
10192 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10194 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10195 Bounds Read error seen by purify. The problem was that islower is
10196 a macros which takes an unsigned char and uses it as an index for
10197 in array of characters properties (and is thus subject to the
10201 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10202 correctly the paper sides radio buttons.
10203 (UpdateDocumentButtons): ditto.
10205 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10207 * src/kbmap.C (getsym + others): change to return unsigned int,
10208 returning a long can give problems on 64 bit systems. (I assume
10209 that int is 32bit on 64bit systems)
10211 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10213 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10214 LyXLookupString to be zero-terminated. Really fixes problems seen
10215 by purify, I think.
10217 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10219 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10220 write a (char*)0 to the lyxerr stream.
10222 * src/lastfiles.C: move algorithm before the using statemets.
10224 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10226 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10227 complains otherwise).
10228 * src/table.C: ditto
10230 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10233 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10234 that I removed earlier... It is really needed.
10236 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10238 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10240 * INSTALL: update xforms home page URL.
10242 * lib/configure.m4: fix a bug with unreadable layout files.
10244 * src/table.C (calculate_width_of_column): add "using std::max"
10247 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10249 * several files: marked several lines with "DEL LINE", this is
10250 lines that can be deleted without changing anything.
10251 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10252 checks this anyway */
10255 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10257 * src/DepTable.C (update): add a "+" at the end when the checksum
10258 is different. (debugging string only)
10260 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10261 the next inset to not be displayed. This should also fix the list
10262 of labels in the "Insert Crossreference" dialog.
10264 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10266 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10267 when regex was not found.
10269 * src/support/lstrings.C (lowercase): use handcoded transform always.
10272 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10273 old_cursor.par->prev could be 0.
10275 * several files: changed post inc/dec to pre inc/dec
10277 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10278 write the lastfiles to file.
10280 * src/BufferView.C (buffer): only show TextCache info when debugging
10282 (resizeCurrentBuffer): ditto
10283 (workAreaExpose): ditto
10285 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10287 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10289 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10290 a bit better by removing the special case for \i and \j.
10292 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10294 * src/lyx_main.C (easyParse): remove test for bad comand line
10295 options, since this broke all xforms-related parsing.
10297 * src/kbmap.C (getsym): set return type to unsigned long, as
10298 declared in header. On an alpha, long is _not_ the same as int.
10300 * src/support/LOstream.h: add a "using std::flush;"
10302 * src/insets/figinset.C: ditto.
10304 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10306 * src/bufferlist.C (write): use blinding fast file copy instead of
10307 "a char at a time", now we are doing it the C++ way.
10309 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10310 std::list<int> instead.
10311 (addpidwait): reflect move to std::list<int>
10312 (sigchldchecker): ditto
10314 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10317 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10318 that obviously was wrong...
10320 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10321 c, this avoids warnings with purify and islower.
10323 * src/insets/figinset.C: rename struct queue to struct
10324 queue_element and rewrite to use a std::queue. gsqueue is now a
10325 std::queue<queue_element>
10326 (runqueue): reflect move to std::queue
10329 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10330 we would get "1" "0" instead of "true" "false. Also make the tostr
10333 2000-01-21 Juergen Vigna <jug@sad.it>
10335 * src/buffer.C (writeFileAscii): Disabled code for special groff
10336 handling of tabulars till I fix this in table.C
10338 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10340 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10342 * src/support/lyxlib.h: ditto.
10344 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10346 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10347 and 'j' look better. This might fix the "macron" bug that has been
10350 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10351 functions as one template function. Delete the old versions.
10353 * src/support/lyxsum.C: move using std::ifstream inside
10356 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10359 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10361 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10363 * src/insets/figinset.C (InitFigures): use new instead of malloc
10364 to allocate memory for figures and bitmaps.
10365 (DoneFigures): use delete[] instead of free to deallocate memory
10366 for figures and bitmaps.
10367 (runqueue): use new to allocate
10368 (getfigdata): use new/delete[] instead of malloc/free
10369 (RegisterFigure): ditto
10371 * some files: moved some declarations closer to first use, small
10372 whitespace changes use preincrement instead of postincrement where
10373 it does not make a difference.
10375 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10376 step on the way to use stl::containers for key maps.
10378 * src/bufferlist.h: add a typedef for const_iterator and const
10379 versions of begin and end.
10381 * src/bufferlist.[Ch]: change name of member variable _state to
10382 state_. (avoid reserved names)
10384 (getFileNames): returns the filenames of the buffers in a vector.
10386 * configure.in (ALL_LINGUAS): added ro
10388 * src/support/putenv.C: new file
10390 * src/support/mkdir.C: new file
10392 2000-01-20 Allan Rae <rae@lyx.org>
10394 * lib/layouts/IEEEtran.layout: Added several theorem environments
10396 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10397 couple of minor additions.
10399 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10400 (except for those in footnotes of course)
10402 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10404 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10406 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10407 std::sort and std::lower_bound instead of qsort and handwritten
10409 (struct compara): struct that holds the functors used by std::sort
10410 and std::lower_bound in MathedLookupBOP.
10412 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10414 * src/support/LAssert.h: do not do partial specialization. We do
10415 not really need it.
10417 * src/support/lyxlib.h: note that lyx::getUserName() and
10418 lyx::date() are not in use right now. Should these be suppressed?
10420 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10421 (makeLinuxDocFile): do not put date and user name in linuxdoc
10424 * src/support/lyxlib.h (kill): change first argument to long int,
10425 since that's what solaris uses.
10427 * src/support/kill.C (kill): fix declaration to match prototype.
10429 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10430 actually check whether namespaces are supported. This is not what
10433 * src/support/lyxsum.C: add a using directive.
10435 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10437 * src/support/kill.C: if we have namespace support we don't have
10438 to include lyxlib.h.
10440 * src/support/lyxlib.h: use namespace lyx if supported.
10442 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10444 * src/support/date.C: new file
10446 * src/support/chdir.C: new file
10448 * src/support/getUserName.C: new file
10450 * src/support/getcwd.C: new file
10452 * src/support/abort.C: new file
10454 * src/support/kill.C: new file
10456 * src/support/lyxlib.h: moved all the functions in this file
10457 insede struct lyx. Added also kill and abort to this struct. This
10458 is a way to avoid the "kill is not defined in <csignal>", we make
10459 C++ wrappers for functions that are not ANSI C or ANSI C++.
10461 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10462 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10463 lyx it has been renamed to sum.
10465 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10467 * src/text.C: add using directives for std::min and std::max.
10469 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10471 * src/texrow.C (getIdFromRow): actually return something useful in
10472 id and pos. Hopefully fixes the bug with positionning of errorbox
10475 * src/lyx_main.C (easyParse): output an error and exit if an
10476 incorrect command line option has been given.
10478 * src/spellchecker.C (ispell_check_word): document a memory leak.
10480 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10481 where a "struct utimbuf" is allocated with "new" and deleted with
10484 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10486 * src/text2.C (CutSelection): don't delete double spaces.
10487 (PasteSelection): ditto
10488 (CopySelection): ditto
10490 * src/text.C (Backspace): don't delete double spaces.
10492 * src/lyxlex.C (next): fix a bug that were only present with
10493 conformant std::istream::get to read comment lines, use
10494 std::istream::getline instead. This seems to fix the problem.
10496 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10498 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10499 allowed to insert space before space" editing problem. Please read
10500 commends at the beginning of the function. Comments about usage
10503 * src/text.C (InsertChar): fix for the "not allowed to insert
10504 space before space" editing problem.
10506 * src/text2.C (DeleteEmptyParagraphMechanism): when
10507 IsEmptyTableRow can only return false this last "else if" will
10508 always be a no-op. Commented out.
10510 * src/text.C (RedoParagraph): As far as I can understand tmp
10511 cursor is not really needed.
10513 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10514 present it could only return false anyway.
10515 (several functions): Did something not so smart...added a const
10516 specifier on a lot of methods.
10518 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10519 and add a tmp->text.resize. The LyXParagraph constructor does the
10521 (BreakParagraphConservative): ditto
10523 * src/support/path.h (Path): add a define so that the wrong usage
10524 "Path("/tmp") will be flagged as a compilation error:
10525 "`unnamed_Path' undeclared (first use this function)"
10527 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10529 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10530 which was bogus for several reasons.
10532 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10534 (runBibTeX): ditto.
10536 * autogen.sh: do not use "type -path" (what's that anyway?).
10538 * src/support/filetools.C (findtexfile): remove extraneous space
10539 which caused a kpsewhich warning (at least with kpathsea version
10542 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10544 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10546 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10548 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10550 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10552 * src/paragraph.C (BreakParagraph): do not reserve space on text
10553 if we don't need to (otherwise, if pos_end < pos, we end up
10554 reserving huge amounts of memory due to bad unsigned karma).
10555 (BreakParagraphConservative): ditto, although I have not seen
10556 evidence the bug can happen here.
10558 * src/lyxparagraph.h: add a using std::list.
10560 2000-01-11 Juergen Vigna <jug@sad.it>
10562 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10563 could not be found.
10565 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10567 * src/vc-backend.C (doVCCommand): change to be static and take one
10568 more parameter: the path to chdir too be fore executing the command.
10569 (retrive): new function equiv to "co -r"
10571 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10572 file_not_found_hook is true.
10574 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10576 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10577 if a file is readwrite,readonly...anything else.
10579 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10581 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10582 (CreatePostscript): name change from MenuRunDVIPS (or something)
10583 (PreviewPostscript): name change from MenuPreviewPS
10584 (PreviewDVI): name change from MenuPreviewDVI
10586 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10587 \view_pdf_command., \pdf_to_ps_command
10589 * lib/configure.m4: added search for PDF viewer, and search for
10590 PDF to PS converter.
10591 (lyxrc.defaults output): add \pdflatex_command,
10592 \view_pdf_command and \pdf_to_ps_command.
10594 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10596 * src/bufferlist.C (write): we don't use blocksize for anything so
10599 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10601 * src/support/block.h: disable operator T* (), since it causes
10602 problems with both compilers I tried. See comments in the file.
10604 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10607 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10608 variable LYX_DIR_10x to LYX_DIR_11x.
10610 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10612 * INSTALL: document --with-lyxname.
10615 * configure.in: new configure flag --with-lyxname which allows to
10616 choose the name under which lyx is installed. Default is "lyx", of
10617 course. It used to be possible to do this with --program-suffix,
10618 but the later has in fact a different meaning for autoconf.
10620 * src/support/lstrings.h (lstrchr): reformat a bit.
10622 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10623 * src/mathed/math_defs.h: ditto.
10625 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10627 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10628 true, decides if we create a backup file or not when saving. New
10629 tag and variable \pdf_mode, defaults to false. New tag and
10630 variable \pdflatex_command, defaults to pdflatex. New tag and
10631 variable \view_pdf_command, defaults to xpdf. New tag and variable
10632 \pdf_to_ps_command, defaults to pdf2ps.
10634 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10636 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10637 does not have a BufferView.
10638 (unlockInset): ditto + don't access the_locking_inset if the
10639 buffer does not have a BufferView.
10641 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10642 certain circumstances so that we don't continue a keyboard
10643 operation long after the key was released. Try f.ex. to load a
10644 large document, press PageDown for some seconds and then release
10645 it. Before this change the document would contine to scroll for
10646 some time, with this change it stops imidiatly.
10648 * src/support/block.h: don't allocate more space than needed. As
10649 long as we don't try to write to the arr[x] in a array_type arr[x]
10650 it is perfectly ok. (if you write to it you might segfault).
10651 added operator value_type*() so that is possible to pass the array
10652 to functions expecting a C-pointer.
10654 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10657 * intl/*: updated to gettext 0.10.35, tried to add our own
10658 required modifications. Please verify.
10660 * po/*: updated to gettext 0.10.35, tried to add our own required
10661 modifications. Please verify.
10663 * src/support/lstrings.C (tostr): go at fixing the problem with
10664 cxx and stringstream. When stringstream is used return
10665 oss.str().c_str() so that problems with lyxstring and basic_string
10666 are avoided. Note that the best solution would be for cxx to use
10667 basic_string all the way, but it is not conformant yet. (it seems)
10669 * src/lyx_cb.C + other files: moved several global functions to
10670 class BufferView, some have been moved to BufferView.[Ch] others
10671 are still located in lyx_cb.C. Code changes because of this. (part
10672 of "get rid of current_view project".)
10674 * src/buffer.C + other files: moved several Buffer functions to
10675 class BufferView, the functions are still present in buffer.C.
10676 Code changes because of this.
10678 * config/lcmessage.m4: updated to most recent. used when creating
10681 * config/progtest.m4: updated to most recent. used when creating
10684 * config/gettext.m4: updated to most recent. applied patch for
10687 * config/gettext.m4.patch: new file that shows what changes we
10688 have done to the local copy of gettext.m4.
10690 * config/libtool.m4: new file, used in creation of acinclude.m4
10692 * config/lyxinclude.m4: new file, this is the lyx created m4
10693 macros, used in making acinclude.m4.
10695 * autogen.sh: GNU m4 discovered as a separate task not as part of
10696 the lib/configure creation.
10697 Generate acinlucde from files in config. Actually cat
10698 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10699 easier to upgrade .m4 files that really are external.
10701 * src/Spacing.h: moved using std::istringstream to right after
10702 <sstream>. This should fix the problem seen with some compilers.
10704 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10706 * src/lyx_cb.C: began some work to remove the dependency a lot of
10707 functions have on BufferView::text, even if not really needed.
10708 (GetCurrentTextClass): removed this func, it only hid the
10711 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10712 forgot this in last commit.
10714 * src/Bullet.C (bulletEntry): use static char const *[] for the
10715 tables, becuase of this the return arg had to change to string.
10716 (bulletSize): ditto
10717 (~Bullet): removed unneeded destructor
10719 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10720 (insetSleep): moved from Buffer
10721 (insetWakeup): moved from Buffer
10722 (insetUnlock): moved from Buffer
10724 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10725 from Buffer to BufferView.
10727 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10729 * config/ltmain.sh: updated to version 1.3.4 of libtool
10731 * config/ltconfig: updated to version 1.3.4 of libtool
10733 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10736 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10737 Did I get that right?
10739 * src/lyxlex.h: add a "using" directive or two.
10740 * src/Spacing.h: ditto.
10741 * src/insets/figinset.C: ditto.
10742 * src/support/filetools.C: ditto.
10743 * src/support/lstrings.C: ditto.
10744 * src/BufferView.C: ditto.
10745 * src/bufferlist.C: ditto.
10746 * src/lyx_cb.C: ditto.
10747 * src/lyxlex.C: ditto.
10749 * NEWS: add some changes for 1.1.4.
10751 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10753 * src/BufferView.C: first go at a TextCache to speed up switching
10756 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10758 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10759 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10760 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10761 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10764 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10765 members of the struct are correctly initialized to 0 (detected by
10767 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10768 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10770 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10771 pidwait, since it was allocated with "new". This was potentially
10772 very bad. Thanks to Michael Schmitt for running purify for us.
10775 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10777 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10779 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10781 1999-12-30 Allan Rae <rae@lyx.org>
10783 * lib/templates/IEEEtran.lyx: minor change
10785 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10786 src/mathed/formula.C (LocalDispatch): askForText changes
10788 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10789 know when a user has cancelled input. Fixes annoying problems with
10790 inserting labels and version control.
10792 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10794 * src/support/lstrings.C (tostr): rewritten to use strstream and
10797 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10799 * src/support/filetools.C (IsFileWriteable): use fstream to check
10800 (IsDirWriteable): use fileinfo to check
10802 * src/support/filetools.h (FilePtr): whole class deleted
10804 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10806 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10808 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10810 * src/bufferlist.C (write): use ifstream and ofstream instead of
10813 * src/Spacing.h: use istrstream instead of sscanf
10815 * src/mathed/math_defs.h: change first arg to istream from FILE*
10817 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10819 * src/mathed/math_parser.C: have yyis to be an istream
10820 (LexGetArg): use istream (yyis)
10822 (mathed_parse): ditto
10823 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10825 * src/mathed/formula.C (Read): rewritten to use istream
10827 * src/mathed/formulamacro.C (Read): rewritten to use istream
10829 * src/lyxlex.h (~LyXLex): deleted desturctor
10830 (getStream): new function, returns an istream
10831 (getFile): deleted funtion
10832 (IsOK): return is.good();
10834 * src/lyxlex.C (LyXLex): delete file and owns_file
10835 (setFile): open an filebuf and assign that to a istream instead of
10837 (setStream): new function, takes an istream as arg.
10838 (setFile): deleted function
10839 (EatLine): rewritten us use istream instead of FILE*
10843 * src/table.C (LyXTable): use istream instead of FILE*
10844 (Read): rewritten to take an istream instead of FILE*
10846 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10848 * src/buffer.C (Dispatch): remove an extraneous break statement.
10850 * src/support/filetools.C (QuoteName): change to do simple
10851 'quoting'. More work is necessary. Also changed to do nothing
10852 under emx (needs fix too).
10853 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10855 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10856 config.h.in to the AC_DEFINE_UNQUOTED() call.
10857 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10858 needs char * as argument (because Solaris 7 declares it like
10861 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10862 remove definition of BZERO.
10864 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10866 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10867 defined, "lyxregex.h" if not.
10869 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10871 (REGEX): new variable that is set to regex.c lyxregex.h when
10872 AM_CONDITIONAL USE_REGEX is set.
10873 (libsupport_la_SOURCES): add $(REGEX)
10875 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10878 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10881 * configure.in: add call to LYX_REGEX
10883 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10884 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10886 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10888 * lib/bind/fi_menus.bind: new file, from
10889 pauli.virtanen@saunalahti.fi.
10891 * src/buffer.C (getBibkeyList): pass the parameter delim to
10892 InsetInclude::getKeys and InsetBibtex::getKeys.
10894 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10895 is passed to Buffer::getBibkeyList
10897 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10898 instead of the hardcoded comma.
10900 * src/insets/insetbib.C (getKeys): make sure that there are not
10901 leading blanks in bibtex keys. Normal latex does not care, but
10902 harvard.sty seems to dislike blanks at the beginning of citation
10903 keys. In particular, the retturn value of the function is
10905 * INSTALL: make it clear that libstdc++ is needed and that gcc
10906 2.7.x probably does not work.
10908 * src/support/filetools.C (findtexfile): make debug message go to
10910 * src/insets/insetbib.C (getKeys): ditto
10912 * src/debug.C (showTags): make sure that the output is correctly
10915 * configure.in: add a comment for TWO_COLOR_ICON define.
10917 * acconfig.h: remove all the entries that already defined in
10918 configure.in or acinclude.m4.
10920 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10921 to avoid user name, date and copyright.
10923 1999-12-21 Juergen Vigna <jug@sad.it>
10925 * src/table.C (Read): Now read bogus row format informations
10926 if the format is < 5 so that afterwards the table can
10927 be read by lyx but without any format-info. Fixed the
10928 crash we experienced when not doing this.
10930 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10932 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10933 (RedoDrawingOfParagraph): ditto
10934 (RedoParagraphs): ditto
10935 (RemoveTableRow): ditto
10937 * src/text.C (Fill): rename arg paperwidth -> paper_width
10939 * src/buffer.C (insertLyXFile): rename var filename -> fname
10940 (writeFile): rename arg filename -> fname
10941 (writeFileAscii): ditto
10942 (makeLaTeXFile): ditto
10943 (makeLinuxDocFile): ditto
10944 (makeDocBookFile): ditto
10946 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10949 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10951 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10954 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10955 compiled by a C compiler not C++.
10957 * src/layout.h (LyXTextClass): added typedef for const_iterator
10958 (LyXTextClassList): added typedef for const_iterator + member
10959 functions begin and end.
10961 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10962 iterators to fill the choice_class.
10963 (updateLayoutChoice): rewritten to use iterators to fill the
10964 layoutlist in the toolbar.
10966 * src/BufferView.h (BufferView::work_area_width): removed unused
10969 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10971 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10972 (sgmlCloseTag): ditto
10974 * src/support/lstrings.h: return type of countChar changed to
10977 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10978 what version of this func to use. Also made to return unsigned int.
10980 * configure.in: call LYX_STD_COUNT
10982 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10983 conforming std::count.
10985 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10987 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10988 and a subscript would give bad display (patch from Dekel Tsur
10989 <dekel@math.tau.ac.il>).
10991 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10993 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10996 * src/chset.h: add a few 'using' directives
10998 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10999 triggered when no buffer is active
11001 * src/layout.C: removed `break' after `return' in switch(), since
11004 * src/lyx_main.C (init): make sure LyX can be ran in place even
11005 when libtool has done its magic with shared libraries. Fix the
11006 test for the case when the system directory has not been found.
11008 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11009 name for the latex file.
11010 (MenuMakeHTML): ditto
11012 * src/buffer.h: add an optional boolean argument, which is passed
11013 to ChangeExtension.
11015 1999-12-20 Allan Rae <rae@lyx.org>
11017 * lib/templates/IEEEtran.lyx: small correction and update.
11019 * configure.in: Attempted to use LYX_PATH_HEADER
11021 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11023 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11024 input from JMarc. Now use preprocessor to find the header.
11025 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11026 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11027 LYX_STL_STRING_FWD. See comments in file.
11029 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11031 * The global MiniBuffer * minibuffer variable is dead.
11033 * The global FD_form_main * fd_form_main variable is dead.
11035 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11037 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11039 * src/table.h: add the LOstream.h header
11040 * src/debug.h: ditto
11042 * src/LyXAction.h: change the explaination of the ReadOnly
11043 attribute: is indicates that the function _can_ be used.
11045 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11048 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11050 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11056 * src/paragraph.C (GetWord): assert on pos>=0
11059 * src/support/lyxstring.C: condition the use of an invariant on
11061 * src/support/lyxstring.h: ditto
11063 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11064 Use LAssert.h instead of plain assert().
11066 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11068 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11069 * src/support/filetools.C: ditto
11071 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11074 * INSTALL: document the new configure flags
11076 * configure.in: suppress --with-debug; add --enable-assertions
11078 * acinclude.m4: various changes in alignment of help strings.
11080 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11082 * src/kbmap.C: commented out the use of the hash map in kb_map,
11083 beginning of movement to a stl::container.
11085 * several files: removed code that was not in effect when
11086 MOVE_TEXT was defined.
11088 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11089 for escaping should not be used. We can discuss if the string
11090 should be enclosed in f.ex. [] instead of "".
11092 * src/trans_mgr.C (insert): use the new returned value from
11093 encodeString to get deadkeys and keymaps done correctly.
11095 * src/chset.C (encodeString): changed to return a pair, to tell
11096 what to use if we know the string.
11098 * src/lyxscreen.h (fillArc): new function.
11100 * src/FontInfo.C (resize): rewritten to use more std::string like
11101 structore, especially string::replace.
11103 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11106 * configure.in (chmod +x some scripts): remove config/gcc-hack
11108 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11110 * src/buffer.C (writeFile): change once again the top comment in a
11111 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11112 instead of an hardcoded version number.
11113 (makeDocBookFile): ditto
11115 * src/version.h: add new define LYX_DOCVERSION
11117 * po/de.po: update from Pit Sütterlin
11118 * lib/bind/de_menus.bind: ditto.
11120 * src/lyxfunc.C (Dispatch): call MenuExport()
11121 * src/buffer.C (Dispatch): ditto
11123 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11124 LyXFunc::Dispatch().
11125 (MenuExport): new function, moved from
11126 LyXFunc::Dispatch().
11128 * src/trans_mgr.C (insert): small cleanup
11129 * src/chset.C (loadFile): ditto
11131 * lib/kbd/iso8859-1.cdef: add missing backslashes
11133 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11135 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11136 help with placing the manually drawn accents better.
11138 (Draw): x2 and hg changed to float to minimize rounding errors and
11139 help place the accents better.
11141 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11142 unsigned short to char is just wrong...cast the char to unsigned
11143 char instead so that the two values can compare sanely. This
11144 should also make the display of insetlatexaccents better and
11145 perhaps also some other insets.
11147 (lbearing): new function
11150 1999-12-15 Allan Rae <rae@lyx.org>
11152 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11153 header that provides a wrapper around the very annoying SGI STL header
11156 * src/support/lyxstring.C, src/LString.h:
11157 removed old SGI-STL-compatability attempts.
11159 * configure.in: Use LYX_STL_STRING_FWD.
11161 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11162 stl_string_fwd.h is around and try to determine it's location.
11163 Major improvement over previous SGI STL 3.2 compatability.
11164 Three small problems remain with this function due to my zero
11165 knowledge of autoconf. JMarc and lgb see the comments in the code.
11167 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11169 * src/broken_const.h, config/hack-gcc, config/README: removed
11171 * configure.in: remove --with-gcc-hack option; do not call
11174 * INSTALL: remove documentation of --with-broken-const and
11177 * acconfig.h: remove all trace of BROKEN_CONST define
11179 * src/buffer.C (makeDocBookFile): update version number in output
11181 (SimpleDocBookOnePar): fix an assert when trying to a character
11182 access beyond string length
11185 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11187 * po/de.po: fix the Export menu
11189 * lyx.man: update the description of -dbg
11191 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11192 (commandLineHelp): updated
11193 (easyParse): show list of available debug levels if -dbg is passed
11196 * src/Makefile.am: add debug.C
11198 * src/debug.h: moved some code to debug.C
11200 * src/debug.C: new file. Contains code to set and show debug
11203 * src/layout.C: remove 'break' after 'continue' in switch
11204 statements, since these cannot be reached.
11206 1999-12-13 Allan Rae <rae@lyx.org>
11208 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11209 (in_word_set): hash() -> math_hash()
11211 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11213 * acconfig.h: Added a test for whether we are using exceptions in the
11214 current compilation run. If so USING_EXCEPTIONS is defined.
11216 * config.in: Check for existance of stl_string_fwd.h
11217 * src/LString.h: If compiling --with-included-string and SGI's
11218 STL version 3.2 is present (see above test) we need to block their
11219 forward declaration of string and supply a __get_c_string().
11220 However, it turns out this is only necessary if compiling with
11221 exceptions enabled so I've a bit more to add yet.
11223 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11224 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11225 src/support/LRegex.h, src/undo.h:
11226 Shuffle the order of the included files a little to ensure that
11227 LString.h gets included before anything that includes stl_string_fwd.h
11229 * src/support/lyxstring.C: We need to #include LString.h instead of
11230 lyxstring.h to get the necessary definition of __get_c_string.
11231 (__get_c_string): New function. This is defined static just like SGI's
11232 although why they need to do this I'm not sure. Perhaps it should be
11233 in lstrings.C instead.
11235 * lib/templates/IEEEtran.lyx: New template file.
11237 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11239 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11240 * intl/Makefile.in (MKINSTALLDIRS): ditto
11242 * src/LyXAction.C (init): changed to hold the LFUN data in a
11243 automatic array in stead of in callso to newFunc, this speeds up
11244 compilation a lot. Also all the memory used by the array is
11245 returned when the init is completed.
11247 * a lot of files: compiled with -Wold-style-cast, changed most of
11248 the reported offenders to C++ style casts. Did not change the
11249 offenders in C files.
11251 * src/trans.h (Match): change argument type to unsigned int.
11253 * src/support/DebugStream.C: fix some types on the streambufs so
11254 that it works on a conforming implementation.
11256 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11258 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11260 * src/support/lyxstring.C: remove the inline added earlier since
11261 they cause a bunch of unsatisfied symbols when linking with dec
11262 cxx. Cxx likes to have the body of inlines at the place where they
11265 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11266 accessing negative bounds in array. This fixes the crash when
11267 inserting accented characters.
11268 * src/trans.h (Match): ditto
11270 * src/buffer.C (Dispatch): since this is a void, it should not try
11271 to return anything...
11273 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11275 * src/buffer.h: removed the two friends from Buffer. Some changes
11276 because of this. Buffer::getFileName and Buffer::setFileName
11277 renamed to Buffer::fileName() and Buffer::fileName(...).
11279 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11281 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11282 and Buffer::update(short) to BufferView. This move is currently
11283 controlled by a define MOVE_TEXT, this will be removed when all
11284 shows to be ok. This move paves the way for better separation
11285 between buffer contents and buffer view. One side effect is that
11286 the BufferView needs a rebreak when swiching buffers, if we want
11287 to avoid this we can add a cache that holds pointers to LyXText's
11288 that is not currently in use.
11290 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11293 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11295 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11297 * lyx_main.C: new command line option -x (or --execute) and
11298 -e (or --export). Now direct conversion from .lyx to .tex
11299 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11300 Unfortunately, X is still needed and the GUI pops up during the
11303 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11305 * src/Spacing.C: add a using directive to bring stream stuff into
11307 * src/paragraph.C: ditto
11308 * src/buffer.C: ditto
11310 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11311 from Lars' announcement).
11313 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11314 example files from Tino Meinen.
11316 1999-12-06 Allan Rae <rae@lyx.org>
11318 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11320 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11322 * src/support/lyxstring.C: added a lot of inline for no good
11325 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11326 latexWriteEndChanges, they were not used.
11328 * src/layout.h (operator<<): output operator for PageSides
11330 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11332 * some example files: loaded in LyX 1.0.4 and saved again to update
11333 certain constructs (table format)
11335 * a lot of files: did the change to use fstream/iostream for all
11336 writing of files. Done with a close look at Andre Poenitz's patch.
11338 * some files: whitespace changes.
11340 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11342 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11343 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11344 architecture, we provide our own. It is used unconditionnally, but
11345 I do not think this is a performance problem. Thanks to Angus
11346 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11347 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11349 (GetInset): use my_memcpy.
11353 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11354 it is easier to understand, but it uses less TeX-only constructs now.
11356 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11357 elements contain spaces
11359 * lib/configure: regenerated
11361 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11362 elements contain spaces; display the list of programs that are
11365 * autogen.sh: make sure lib/configure is executable
11367 * lib/examples/*: rename the tutorial examples to begin with the
11368 two-letters language code.
11370 * src/lyxfunc.C (getStatus): do not query current font if no
11373 * src/lyx_cb.C (RunScript): use QuoteName
11374 (MenuRunDvips): ditto
11375 (PrintApplyCB): ditto
11377 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11378 around argument, so that it works well with the current shell.
11379 Does not work properly with OS/2 shells currently.
11381 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11382 * src/LyXSendto.C (SendtoApplyCB): ditto
11383 * src/lyxfunc.C (Dispatch): ditto
11384 * src/buffer.C (runLaTeX): ditto
11385 (runLiterate): ditto
11386 (buildProgram): ditto
11388 * src/lyx_cb.C (RunScript): ditto
11389 (MenuMakeLaTeX): ditto
11391 * src/buffer.h (getLatexName): new method
11393 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11395 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11397 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11398 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11399 (create_math_panel): ditto
11401 * src/lyxfunc.C (getStatus): re-activate the code which gets
11402 current font and cursor; add test for export to html.
11404 * src/lyxrc.C (read): remove unreachable break statements; add a
11407 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11409 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11411 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11412 introduced by faulty regex.
11413 * src/buffer.C: ditto
11414 * src/lastfiles.C: ditto
11415 * src/paragraph.C: ditto
11416 * src/table.C: ditto
11417 * src/vspace.C: ditto
11418 * src/insets/figinset.C: ditto
11419 Note: most of these is absolutely harmless, except the one in
11420 src/mathed formula.C.
11422 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11424 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11425 operation, yielding correct results for the reLyX command.
11427 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11429 * src/support/filetools.C (ExpandPath): removed an over eager
11431 (ReplaceEnvironmentPath): ditto
11433 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11434 shows that we are doing something fishy in our code...
11435 (BubblePost): ditto
11438 * src/lyxrc.C (read): use a double switch trick to get more help
11439 from the compiler. (the same trick is used in layout.C)
11440 (write): new function. opens a ofstream and pass that to output
11441 (output): new function, takes a ostream and writes the lyxrc
11442 elemts to it. uses a dummy switch to make sure no elements are
11445 * src/lyxlex.h: added a struct pushpophelper for use in functions
11446 with more than one exit point.
11448 * src/lyxlex.[Ch] (GetInteger): made it const
11452 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11454 * src/layout.[hC] : LayoutTags splitted into several enums, new
11455 methods created, better error handling cleaner use of lyxlex. Read
11458 * src/bmtable.[Ch]: change some member prototypes because of the
11459 image const changes.
11461 * commandtags.h, src/LyXAction.C (init): new function:
11462 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11463 This file is not read automatically but you can add \input
11464 preferences to your lyxrc if you want to. We need to discuss how
11467 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11468 in .aux, also remove .bib and .bst files from dependencies when
11471 * src/BufferView.C, src/LyXView.C: add const_cast several places
11472 because of changes to images.
11474 * lib/images/*: same change as for images/*
11476 * lib/lyxrc.example: Default for accept_compound is false not no.
11478 * images/*: changed to be const, however I have som misgivings
11479 about this change so it might be changed back.
11481 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11483 * lib/configure, po/POTFILES.in: regenerated
11485 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11487 * config/lib_configure.m4: removed
11489 * lib/configure.m4: new file (was config/lib_configure.m4)
11491 * configure.in: do not test for rtti, since we do not use it.
11493 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11495 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11496 doubling of allocated space scheme. This makes it faster for large
11497 strings end to use less memory for small strings. xtra rememoved.
11499 * src/insets/figinset.C (waitalarm): commented out.
11500 (GhostscriptMsg): use static_cast
11501 (GhostscriptMsg): use new instead of malloc to allocate memory for
11502 cmap. also delete the memory after use.
11504 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11506 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11507 for changes in bibtex database or style.
11508 (runBibTeX): remove all .bib and .bst files from dep before we
11510 (run): use scanAuc in when dep file already exist.
11512 * src/DepTable.C (remove_files_with_extension): new method
11513 (exist): new method
11515 * src/DepTable.[Ch]: made many of the methods const.
11517 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11519 * src/bufferparams.C: make sure that the default textclass is
11520 "article". It used to be the first one by description order, but
11521 now the first one is "docbook".
11523 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11524 string; call Debug::value.
11525 (easyParse): pass complete argument to setDebuggingLevel().
11527 * src/debug.h (value): fix the code that parses debug levels.
11529 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11532 * src/LyXAction.C: use Debug::ACTION as debug channel.
11534 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11536 * NEWS: updated for the future 1.1.3 release.
11538 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11539 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11540 it should. This is of course a controversial change (since many
11541 people will find that their lyx workscreen is suddenly full of
11542 red), but done for the sake of correctness.
11544 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11545 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11547 * src/insets/inseterror.h, src/insets/inseturl.h,
11548 src/insets/insetinfo.h, src/insets/figinset.h,
11549 src/mathed/formulamacro.h, src/mathed/math_macro.h
11550 (EditMessage): add a missing const and add _() to make sure that
11551 translation happens
11553 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11554 src/insets/insetbib.C, src/support/filetools.C: add `using'
11555 directives for cxx.
11557 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11558 doing 'Insert index of last word' at the beginning of a paragraph.
11560 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11562 * several files: white-space changes.
11564 * src/mathed/formula.C: removed IsAlpha and IsDigit
11566 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11567 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11570 * src/insets/figinset.C (GetPSSizes): don't break when
11571 "EndComments" is seen. But break when a boundingbox is read.
11573 * all classes inherited from Inset: return value of Clone
11574 changed back to Inset *.
11576 * all classes inherited form MathInset: return value of Clone
11577 changed back to MathedInset *.
11579 * src/insets/figinset.C (runqueue): use a ofstream to output the
11580 gs/ps file. Might need some setpresicion or setw. However I can
11581 see no problem with the current code.
11582 (runqueue): use sleep instead of the alarm/signal code. I just
11583 can't see the difference.
11585 * src/paragraph.C (LyXParagraph): reserve space in the new
11586 paragraph and resize the inserted paragraph to just fit.
11588 * src/lyxfunc.h (operator|=): added operator for func_status.
11590 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11591 check for readable file.
11593 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11594 check for readable file.
11595 (MenuMakeLinuxDoc): ditto
11596 (MenuMakeDocBook): ditto
11597 (MenuMakeAscii): ditto
11598 (InsertAsciiFile): split the test for openable and readable
11600 * src/bmtable.C (draw_bitmaptable): use
11601 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11603 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11604 findtexfile from LaTeX to filetools.
11606 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11607 instead of FilePtr. Needs to be verified by a literate user.
11609 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11611 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11612 (EditMessage): likewise.
11614 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11615 respectively as \textasciitilde and \textasciicircum.
11617 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11619 * src/support/lyxstring.h: made the methods that take iterators
11620 use const_iterator.
11622 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11623 (regexMatch): made is use the real regex class.
11625 * src/support/Makefile.am: changed to use libtool
11627 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11629 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11631 (MathIsInset ++): changed several macros to be inline functions
11634 * src/mathed/Makefile.am: changed to use libtool
11636 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11638 * src/insets/inset* : Clone changed to const and return type is
11639 the true insettype not just Inset*.
11641 * src/insets/Makefile.am: changed to use libtool
11643 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11645 * src/undo.[Ch] : added empty() and changed some of the method
11648 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11650 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11651 setID use block<> for the bullets array, added const several places.
11653 * src/lyxfunc.C (getStatus): new function
11655 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11656 LyXAction, added const to several funtions.
11658 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11659 a std::map, and to store the dir items in a vector.
11661 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11664 * src/LyXView.[Ch] + other files : changed currentView to view.
11666 * src/LyXAction.[Ch] : ported from the old devel branch.
11668 * src/.cvsignore: added .libs and a.out
11670 * configure.in : changes to use libtool.
11672 * acinclude.m4 : inserted libtool.m4
11674 * .cvsignore: added libtool
11676 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11678 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11679 file name in insets and mathed directories (otherwise the
11680 dependency is not taken in account under cygwin).
11682 * src/text2.C (InsertString[AB]): make sure that we do not try to
11683 read characters past the string length.
11685 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11687 * lib/doc/LaTeXConfig.lyx.in,
11688 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11690 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11691 file saying who created them and when this heppened; this is
11692 useless and annoys tools like cvs.
11694 * lib/layouts/g-brief-{en,de}.layout,
11695 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11696 from Thomas Hartkens <thomas@hartkens.de>.
11698 * src/{insets,mathed}/Makefile.am: do not declare an empty
11699 LDFLAGS, so that it can be set at configure time (useful on Irix
11702 * lib/reLyX/configure.in: make sure that the prefix is set
11703 correctly in LYX_DIR.
11705 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11707 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11708 be used by 'command-sequence' this allows to bind a key to a
11709 sequence of LyX-commands
11710 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11712 * src/LyXAction.C: add "command-sequence"
11714 * src/LyXFunction.C: handling of "command-sequence"
11716 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11717 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11719 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11721 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11723 * src/buffer.C (writeFile): Do not output a comment giving user
11724 and date at the beginning of a .lyx file. This is useless and
11725 annoys cvs anyway; update version number to 1.1.
11727 * src/Makefile.am (LYX_DIR): add this definition, so that a
11728 default path is hardcoded in LyX.
11730 * configure.in: Use LYX_GNU_GETTEXT.
11732 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11733 AM_GNU_GETTEXT with a bug fixed.
11735 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11737 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11739 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11740 which is used to point to LyX data is now LYX_DIR_11x.
11742 * lyx.man: convert to a unix text file; small updates.
11744 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11746 * src/support/LSubstring.[Ch]: made the second arg of most of the
11747 constructors be a const reference.
11749 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11752 * src/support/lyxstring.[Ch] (swap): added missing member function
11753 and specialization of swap(str, str);
11755 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11757 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11758 trace of the old one.
11760 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11761 put the member definitions in undo.C.
11763 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11764 NEW_TEXT and have now only code that was included when this was
11767 * src/intl.C (LCombo): use static_cast
11769 (DispatchCallback): ditto
11771 * src/definitions.h: removed whole file
11773 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11775 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11776 parsing and stores in a std:map. a regex defines the file format.
11777 removed unneeded members.
11779 * src/bufferparams.h: added several enums from definitions.h here.
11780 Removed unsused destructor. Changed some types to use proper enum
11781 types. use block to have the temp_bullets and user_defined_bullets
11782 and to make the whole class assignable.
11784 * src/bufferparams.C (Copy): removed this functions, use a default
11785 assignment instead.
11787 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11790 * src/buffer.C (readLyXformat2): commend out all that have with
11791 oldpapersize to do. also comment out all that hve to do with
11792 insetlatex and insetlatexdel.
11793 (setOldPaperStuff): commented out
11795 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11797 * src/LyXAction.C: remove use of inset-latex-insert
11799 * src/mathed/math_panel.C (button_cb): use static_cast
11801 * src/insets/Makefile.am (insets_o_SOURCES): removed
11804 * src/support/lyxstring.C (helper): use the unsigned long
11805 specifier, UL, instead of a static_cast.
11807 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11809 * src/support/block.h: new file. to be used as a c-style array in
11810 classes, so that the class can be assignable.
11812 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11814 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11815 NULL, make sure to return an empty string (it is not possible to
11816 set a string to NULL).
11818 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11820 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11822 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11824 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11825 link line, so that Irix users (for example) can set it explicitely to
11828 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11829 it can be overidden at make time (static or dynamic link, for
11832 * src/vc-backend.C, src/LaTeXFeatures.h,
11833 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11834 statements to bring templates to global namespace.
11836 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11838 * src/support/lyxstring.C (operator[] const): make it standard
11841 * src/minibuffer.C (Init): changed to reflect that more
11842 information is given from the lyxvc and need not be provided here.
11844 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11846 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11848 * src/LyXView.C (UpdateTimerCB): use static_cast
11849 (KeyPressMask_raw_callback): ditto
11851 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11852 buffer_, a lot of changes because of this. currentBuffer() ->
11853 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11854 also changes to other files because of this.
11856 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11858 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11859 have no support for RCS and partial support for CVS, will be
11862 * src/insets/ several files: changes because of function name
11863 changes in Bufferview and LyXView.
11865 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11867 * src/support/LSubstring.[Ch]: new files. These implement a
11868 Substring that can be very convenient to use. i.e. is this
11870 string a = "Mary had a little sheep";
11871 Substring(a, "sheep") = "lamb";
11872 a is now "Mary has a little lamb".
11874 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11875 out patterns and subpatterns of strings. It is used by LSubstring
11876 and also by vc-backend.C
11878 * src/support/lyxstring.C: went over all the assertions used and
11879 tried to correct the wrong ones and flag which of them is required
11880 by the standard. some bugs found because of this. Also removed a
11881 couple of assertions.
11883 * src/support/Makefile.am (libsupport_a_SOURCES): added
11884 LSubstring.[Ch] and LRegex.[Ch]
11886 * src/support/FileInfo.h: have struct stat buf as an object and
11887 not a pointer to one, some changes because of this.
11889 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11890 information in layout when adding the layouts preamble to the
11891 textclass preamble.
11893 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11896 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11897 because of bug in OS/2.
11899 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11901 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11902 \verbatim@font instead of \ttfamily, so that it can be redefined.
11904 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11905 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11906 src/layout.h, src/text2.C: add 'using' directive to bring the
11907 STL templates we need from the std:: namespace to the global one.
11908 Needed by DEC cxx in strict ansi mode.
11910 * src/support/LIstream.h,src/support/LOstream.h,
11911 src/support/lyxstring.h,src/table.h,
11912 src/lyxlookup.h: do not include <config.h> in header
11913 files. This should be done in the .C files only.
11915 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11919 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11921 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11922 from Kayvan to fix the tth invokation.
11924 * development/lyx.spec.in: updates from Kayvan to reflect the
11925 changes of file names.
11927 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11929 * src/text2.C (InsertStringB): use std::copy
11930 (InsertStringA): use std::copy
11932 * src/bufferlist.C: use a vector to store the buffers in. This is
11933 an internal change and should not affect any other thing.
11935 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11938 * src/text.C (Fill): fix potential bug, one off bug.
11940 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11942 * src/Makefile.am (lyx_main.o): add more files it depends on.
11944 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11946 * src/support/lyxstring.C: use size_t for the reference count,
11947 size, reserved memory and xtra.
11948 (internal_compare): new private member function. Now the compare
11949 functions should work for std::strings that have embedded '\0'
11951 (compare): all compare functions rewritten to use
11954 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11956 * src/support/lyxstring.C (compare): pass c_str()
11957 (compare): pass c_str
11958 (compare): pass c_str
11960 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11962 * src/support/DebugStream.C: <config.h> was not included correctly.
11964 * lib/configure: forgot to re-generate it :( I'll make this file
11965 auto generated soon.
11967 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11969 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11972 * src/support/lyxstring.C: some changes from length() to rep->sz.
11973 avoids a function call.
11975 * src/support/filetools.C (SpaceLess): yet another version of the
11976 algorithm...now per Jean-Marc's suggestions.
11978 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11980 * src/layout.C (less_textclass_desc): functor for use in sorting
11982 (LyXTextClass::Read): sort the textclasses after reading.
11984 * src/support/filetools.C (SpaceLess): new version of the
11985 SpaceLess functions. What problems does this one give? Please
11988 * images/banner_bw.xbm: made the arrays unsigned char *
11990 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11992 * src/support/lyxstring.C (find): remove bogus assertion in the
11993 two versions of find where this has not been done yet.
11995 * src/support/lyxlib.h: add missing int return type to
11998 * src/menus.C (ShowFileMenu): disable exporting to html if no
11999 html export command is present.
12001 * config/lib_configure.m4: add a test for an HTML converter. The
12002 programs checked for are, in this order: tth, latex2html and
12005 * lib/configure: generated from config/lib_configure.m4.
12007 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12008 html converter. The parameters are now passed through $$FName and
12009 $$OutName, instead of standard input/output.
12011 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12013 * lib/lyxrc.example: update description of \html_command.
12014 add "quotes" around \screen_font_xxx font setting examples to help
12015 people who use fonts with spaces in their names.
12017 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12019 * Distribution files: updates for v1.1.2
12021 * src/support/lyxstring.C (find): remove bogus assert and return
12022 npos for the same condition.
12024 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12026 * added patch for OS/2 from SMiyata.
12028 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12030 * src/text2.C (CutSelection): make space_wrapped a bool
12031 (CutSelection): dont declare int i until we have to.
12032 (alphaCounter): return a char const *.
12034 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12036 * src/support/syscall.C (Systemcalls::kill):
12037 src/support/filetools.C (PutEnv, PutEnvPath):
12038 src/lyx_cb.C (addNewlineAndDepth):
12039 src/FontInfo.C (FontInfo::resize): condition some #warning
12040 directives with WITH_WARNINGS.
12043 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12045 * src/layout.[Ch] + several files: access to class variables
12046 limited and made accessor functions instead a lot of code changed
12047 becuase of this. Also instead of returning pointers often a const
12048 reference is returned instead.
12050 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12052 * src/Makefile.am (dist-hook): added used to remove the CVS from
12053 cheaders upon creating a dist
12054 (EXTRA_DIST): added cheaders
12056 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12057 a character not as a small integer.
12059 * src/support/lyxstring.C (find): removed Assert and added i >=
12060 rep->sz to the first if.
12062 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12064 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12065 src/LyXView.C src/buffer.C src/bufferparams.C
12066 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12067 src/text2.C src/insets/insetinclude.C:
12068 lyxlayout renamed to textclasslist.
12070 * src/layout.C: some lyxerr changes.
12072 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12073 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12074 (LyXLayoutList): removed all traces of this class.
12075 (LyXTextClass::Read): rewrote LT_STYLE
12076 (LyXTextClass::hasLayout): new function
12077 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12078 both const and nonconst version.
12079 (LyXTextClass::delete_layout): new function.
12080 (LyXTextClassList::Style): bug fix. do the right thing if layout
12082 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12083 (LyXTextClassList::NameOfLayout): ditto
12084 (LyXTextClassList::Load): ditto
12086 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12088 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12090 * src/LyXAction.C (LookupFunc): added a workaround for sun
12091 compiler, on the other hand...we don't know if the current code
12092 compiles on sun at all...
12094 * src/support/filetools.C (CleanupPath): subst fix
12096 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12099 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12100 complained about this one?
12102 * src/insets/insetinclude.C (Latex): subst fix
12104 * src/insets/insetbib.C (getKeys): subst fix
12106 * src/LyXSendto.C (SendtoApplyCB): subst fix
12108 * src/lyx_main.C (init): subst fix
12110 * src/layout.C (Read): subst fix
12112 * src/lyx_sendfax_main.C (button_send): subst fix
12114 * src/buffer.C (RoffAsciiTable): subst fix
12116 * src/lyx_cb.C (MenuFax): subst fix
12117 (PrintApplyCB): subst fix
12119 1999-10-26 Juergen Vigna <jug@sad.it>
12121 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12123 (Read): Cleaned up this code so now we read only format vestion >= 5
12125 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12127 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12128 come nobody has complained about this one?
12130 * src/insets/insetinclude.C (Latex): subst fix
12132 * src/insets/insetbib.C (getKeys): subst fix
12134 * src/lyx_main.C (init): subst fix
12136 * src/layout.C (Read): subst fix
12138 * src/buffer.C (RoffAsciiTable): subst fix
12140 * src/lyx_cb.C (MenuFax): subst fix.
12142 * src/layout.[hC] + some other files: rewrote to use
12143 std::container to store textclasses and layouts in.
12144 Simplified, removed a lot of code. Make all classes
12145 assignable. Further simplifications and review of type
12146 use still to be one.
12148 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12149 lastfiles to create the lastfiles partr of the menu.
12151 * src/lastfiles.[Ch]: rewritten to use deque to store the
12152 lastfiles in. Uses fstream for reading and writing. Simplifies
12155 * src/support/syscall.C: remove explicit cast.
12157 * src/BufferView.C (CursorToggleCB): removed code snippets that
12158 were commented out.
12159 use explicat C++ style casts instead of C style casts. also use
12160 u_vdata instea of passing pointers in longs.
12162 * src/PaperLayout.C: removed code snippets that were commented out.
12164 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12166 * src/lyx_main.C: removed code snippets that wer commented out.
12168 * src/paragraph.C: removed code snippets that were commented out.
12170 * src/lyxvc.C (logClose): use static_cast
12172 (viewLog): remove explicit cast to void*
12173 (showLog): removed old commented code
12175 * src/menus.C: use static_cast instead of C style casts. use
12176 u_vdata instead of u_ldata. remove explicit cast to (long) for
12177 pointers. Removed old code that was commented out.
12179 * src/insets/inset.C: removed old commented func
12181 * src/insets/insetref.C (InsetRef): removed old code that had been
12182 commented out for a long time.
12184 (escape): removed C style cast
12186 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12188 * src/insets/insetlatex.C (Draw): removed old commented code
12189 (Read): rewritten to use string
12191 * src/insets/insetlabel.C (escape): removed C style cast
12193 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12195 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12196 old commented code.
12198 * src/insets/insetinclude.h: removed a couple of stupid bools
12200 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12201 (Clone): remove C style cast
12202 (getKeys): changed list to lst because of std::list
12204 * src/insets/inseterror.C (Draw): removed som old commented code.
12206 * src/insets/insetcommand.C (Draw): removed some old commented code.
12208 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12209 commented out forever.
12210 (bibitem_cb): use static_cast instead of C style cast
12211 use of vdata changed to u_vdata.
12213 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12215 (CloseUrlCB): use static_cast instead of C style cast.
12216 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12218 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12219 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12220 (CloseInfoCB): static_cast from ob->u_vdata instead.
12221 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12224 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12225 (C_InsetError_CloseErrorCB): forward the ob parameter
12226 (CloseErrorCB): static_cast from ob->u_vdata instead.
12228 * src/vspace.h: include LString.h since we use string in this class.
12230 * src/vspace.C (lyx_advance): changed name from advance because of
12231 nameclash with stl. And since we cannot use namespaces yet...I
12232 used a lyx_ prefix instead. Expect this to change when we begin
12235 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12237 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12238 and removed now defunct constructor and deconstructor.
12240 * src/BufferView.h: have backstack as a object not as a pointer.
12241 removed initialization from constructor. added include for BackStack
12243 * development/lyx.spec.in (%build): add CFLAGS also.
12245 * src/screen.C (drawFrame): removed another warning.
12247 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12249 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12250 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12251 README and ANNOUNCE a bit for the next release. More work is
12254 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12255 unbreakable if we are in freespacing mode (LyX-Code), but not in
12258 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12260 * src/BackStack.h: fixed initialization order in constructor
12262 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12264 * acinclude.m4 (VERSION): new rules for when a version is
12265 development, added also a variable for prerelease.
12266 (warnings): we set with_warnings=yes for prereleases
12267 (lyx_opt): prereleases compile with same optimization as development
12268 (CXXFLAGS): only use pedantic if we are a development version
12270 * src/BufferView.C (restorePosition): don't do anything if the
12271 backstack is empty.
12273 * src/BackStack.h: added member empty, use this to test if there
12274 is anything to pop...
12276 1999-10-25 Juergen Vigna <jug@sad.it>
12279 * forms/layout_forms.fd +
12280 * forms/latexoptions.fd +
12281 * lyx.fd: changed for various form resize issues
12283 * src/mathed/math_panel.C +
12284 * src/insets/inseterror.C +
12285 * src/insets/insetinfo.C +
12286 * src/insets/inseturl.C +
12287 * src/insets/inseturl.h +
12289 * src/LyXSendto.C +
12290 * src/PaperLayout.C +
12291 * src/ParagraphExtra.C +
12292 * src/TableLayout.C +
12294 * src/layout_forms.C +
12301 * src/menus.C: fixed various resize issues. So now forms can be
12302 resized savely or not be resized at all.
12304 * forms/form_url.fd +
12305 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12308 * src/insets/Makefile.am: added files form_url.[Ch]
12310 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12312 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12313 (and presumably 6.2).
12315 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12316 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12317 remaining static member callbacks.
12319 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12322 * src/support/lyxstring.h: declare struct Srep as friend of
12323 lyxstring, since DEC cxx complains otherwise.
12325 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12327 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12329 * src/LaTeX.C (run): made run_bibtex also depend on files with
12331 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12332 are put into the dependency file.
12334 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12335 the code has shown itself to work
12336 (create_ispell_pipe): removed another warning, added a comment
12339 * src/minibuffer.C (ExecutingCB): removed code that has been
12340 commented out a long time
12342 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12343 out code + a warning.
12345 * src/support/lyxstring.h: comment out the three private
12346 operators, when compiling with string ansi conforming compilers
12347 they make problems.
12349 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12351 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12352 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12355 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12358 * src/mathed/math_panel.C (create_math_panel): remove explicit
12361 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12364 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12365 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12366 to XCreatePixmapFromBitmapData
12367 (fl_set_bmtable_data): change the last argument to be unsigned
12369 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12370 and bh to be unsigned int, remove explicit casts in call to
12371 XReadBitmapFileData.
12373 * images/arrows.xbm: made the arrays unsigned char *
12374 * images/varsz.xbm: ditto
12375 * images/misc.xbm: ditto
12376 * images/greek.xbm: ditto
12377 * images/dots.xbm: ditto
12378 * images/brel.xbm: ditto
12379 * images/bop.xbm: ditto
12381 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12383 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12384 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12385 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12387 (LYX_CXX_CHEADERS): added <clocale> to the test.
12389 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12391 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12393 * src/support/lyxstring.C (append): fixed something that must be a
12394 bug, rep->assign was used instead of rep->append.
12396 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12399 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12400 lyx insert double chars. Fix spotted by Kayvan.
12402 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12404 * Fixed the tth support. I messed up with the Emacs patch apply feature
12405 and omitted the changes in lyxrc.C.
12407 1999-10-22 Juergen Vigna <jug@sad.it>
12409 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12411 * src/lyx_cb.C (MenuInsertRef) +
12412 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12413 the form cannot be resized under it limits (fixes a segfault)
12415 * src/lyx.C (create_form_form_ref) +
12416 * forms/lyx.fd: Changed Gravity on name input field so that it is
12419 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12421 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12422 <ostream> and <istream>.
12424 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12425 whether <fstream> provides the latest standard features, or if we
12426 have an oldstyle library (like in egcs).
12427 (LYX_CXX_STL_STRING): fix the test.
12429 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12430 code on MODERN_STL_STREAM.
12432 * src/support/lyxstring.h: use L{I,O}stream.h.
12434 * src/support/L{I,O}stream.h: new files, designed to setup
12435 correctly streams for our use
12436 - includes the right header depending on STL capabilities
12437 - puts std::ostream and std::endl (for LOStream.h) or
12438 std::istream (LIStream.h) in toplevel namespace.
12440 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12442 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12443 was a bib file that had been changed we ensure that bibtex is run.
12444 (runBibTeX): enhanced to extract the names of the bib files and
12445 getting their absolute path and enter them into the dep file.
12446 (findtexfile): static func that is used to look for tex-files,
12447 checks for absolute patchs and tries also with kpsewhich.
12448 Alternative ways of finding the correct files are wanted. Will
12450 (do_popen): function that runs a command using popen and returns
12451 the whole output of that command in a string. Should be moved to
12454 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12455 file with extension ext has changed.
12457 * src/insets/figinset.C: added ifdef guards around the fl_free
12458 code that jug commented out. Now it is commented out when
12459 compiling with XForms == 0.89.
12461 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12462 to lyxstring.C, and only keep a forward declaration in
12463 lyxstring.h. Simplifies the header file a bit and should help a
12464 bit on compile time too. Also changes to Srep will not mandate a
12465 recompile of code just using string.
12466 (~lyxstring): definition moved here since it uses srep.
12467 (size): definition moved here since it uses srep.
12469 * src/support/lyxstring.h: removed a couple of "inline" that should
12472 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12474 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12477 1999-10-21 Juergen Vigna <jug@sad.it>
12479 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12480 set to left if I just remove the width entry (or it is empty).
12482 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12483 paragraph when having dummy paragraphs.
12485 1999-10-20 Juergen Vigna <jug@sad.it>
12487 * src/insets/figinset.C: just commented some fl_free_form calls
12488 and added warnings so that this calls should be activated later
12489 again. This avoids for now a segfault, but we have a memory leak!
12491 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12492 'const char * argument' to 'string argument', this should
12493 fix some Asserts() in lyxstring.C.
12495 * src/lyxfunc.h: Removed the function argAsString(const char *)
12496 as it is not used anymore.
12498 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12500 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12503 * src/Literate.h: some funcs moved from public to private to make
12504 interface clearer. Unneeded args removed.
12506 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12508 (scanBuildLogFile): ditto
12510 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12511 normal TeX Error. Still room for improvement.
12513 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12515 * src/buffer.C (insertErrors): changes to make the error
12516 desctription show properly.
12518 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12521 * src/support/lyxstring.C (helper): changed to use
12522 sizeof(object->rep->ref).
12523 (operator>>): changed to use a pointer instead.
12525 * src/support/lyxstring.h: changed const reference & to value_type
12526 const & lets see if that helps.
12528 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12530 * Makefile.am (rpmdist): fixed to have non static package and
12533 * src/support/lyxstring.C: removed the compilation guards
12535 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12538 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12539 conditional compile of lyxstring.Ch
12541 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12542 stupid check, but it is a lot better than the bastring hack.
12543 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12545 * several files: changed string::erase into string::clear. Not
12548 * src/chset.C (encodeString): use a char temporary instead
12550 * src/table.C (TexEndOfCell): added tostr around
12551 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12552 (TexEndOfCell): ditto
12553 (TexEndOfCell): ditto
12554 (TexEndOfCell): ditto
12555 (DocBookEndOfCell): ditto
12556 (DocBookEndOfCell): ditto
12557 (DocBookEndOfCell): ditto
12558 (DocBookEndOfCell): ditto
12560 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12562 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12564 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12565 (MenuBuildProg): added tostr around ret
12566 (MenuRunChktex): added tostr around ret
12567 (DocumentApplyCB): added tostr around ret
12569 * src/chset.C (encodeString): added tostr around t->ic
12571 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12572 (makeLaTeXFile): added tostr around tocdepth
12573 (makeLaTeXFile): added tostr around ftcound - 1
12575 * src/insets/insetbib.C (setCounter): added tostr around counter.
12577 * src/support/lyxstring.h: added an operator+=(int) to catch more
12580 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12581 (lyxstring): We DON'T allow NULL pointers.
12583 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12585 * src/mathed/math_macro.C (MathMacroArgument::Write,
12586 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12587 when writing them out.
12589 * src/LString.C: remove, since it is not used anymore.
12591 * src/support/lyxstring.C: condition the content to
12592 USE_INCLUDED_STRING macro.
12594 * src/mathed/math_symbols.C, src/support/lstrings.C,
12595 src/support/lyxstring.C: add `using' directive to specify what
12596 we need in <algorithm>. I do not think that we need to
12597 conditionalize this, but any thought is appreciated.
12599 * many files: change all callback functions to "C" linkage
12600 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12601 strict_ansi. Those who were static are now global.
12602 The case of callbacks which are static class members is
12603 trickier, since we have to make C wrappers around them (see
12604 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12605 did not finish this yet, since it defeats the purpose of
12606 encapsulation, and I am not sure what the best route is.
12608 1999-10-19 Juergen Vigna <jug@sad.it>
12610 * src/support/lyxstring.C (lyxstring): we permit to have a null
12611 pointer as assignment value and just don't assign it.
12613 * src/vspace.C (nextToken): corrected this function substituting
12614 find_first(_not)_of with find_last_of.
12616 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12617 (TableOptCloseCB) (TableSpeCloseCB):
12618 inserted fl_set_focus call for problem with fl_hide_form() in
12621 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12623 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12626 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12628 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12629 LyXLex::next() and not eatline() to get its argument.
12631 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12633 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12634 instead, use fstreams for io of the depfile, removed unneeded
12635 functions and variables.
12637 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12638 vector instead, removed all functions and variables that is not in
12641 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12643 * src/buffer.C (insertErrors): use new interface to TeXError
12645 * Makefile.am (rpmdist): added a rpmdist target
12647 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12648 per Kayvan's instructions.
12650 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12652 * src/Makefile.am: add a definition for localedir, so that locales
12653 are found after installation (Kayvan)
12655 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12657 * development/.cvsignore: new file.
12659 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12661 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12662 C++ compiler provides wrappers for C headers and use our alternate
12665 * configure.in: use LYX_CXX_CHEADERS.
12667 * src/cheader/: new directory, populated with cname headers from
12668 libstdc++-2.8.1. They are a bit old, but probably good enough for
12669 what we want (support compilers who lack them).
12671 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12672 from includes. It turns out is was stupid.
12674 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12676 * lib/Makefile.am (install-data-local): forgot a ';'
12677 (install-data-local): forgot a '\'
12678 (libinstalldirs): needed after all. reintroduced.
12680 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12682 * configure.in (AC_OUTPUT): added lyx.spec
12684 * development/lyx.spec: removed file
12686 * development/lyx.spec.in: new file
12688 * po/*.po: merged with lyx.pot becuase of make distcheck
12690 * lib/Makefile.am (dist-hook): added dist-hook so that
12691 documentation files will be included when doing a make
12692 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12693 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12695 more: tried to make install do the right thing, exclude CVS dirs
12698 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12699 Path would fit in more nicely.
12701 * all files that used to use pathstack: uses now Path instead.
12702 This change was a lot easier than expected.
12704 * src/support/path.h: new file
12706 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12708 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12710 * src/support/lyxstring.C (getline): Default arg was given for
12713 * Configure.cmd: removed file
12715 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12717 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12718 streams classes and types, add the proper 'using' statements when
12719 MODERN_STL is defined.
12721 * src/debug.h: move the << operator definition after the inclusion
12724 * src/support/filetools.C: include "LAssert.h", which is needed
12727 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12730 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12731 include "debug.h" to define a proper ostream.
12733 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12735 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12736 method to the SystemCall class which can kill a process, but it's
12737 not fully implemented yet.
12739 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12741 * src/support/FileInfo.h: Better documentation
12743 * src/lyxfunc.C: Added support for buffer-export html
12745 * src/menus.C: Added Export->As HTML...
12747 * lib/bind/*.bind: Added short-cut for buffer-export html
12749 * src/lyxrc.*: Added support for new \tth_command
12751 * lib/lyxrc.example: Added stuff for new \tth_command
12753 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12755 * lib/Makefile.am (IMAGES): removed images/README
12756 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12757 installes in correct place. Check permisions is installed
12760 * src/LaTeX.C: some no-op changes moved declaration of some
12763 * src/LaTeX.h (LATEX_H): changed include guard name
12765 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12767 * lib/reLyX/Makefile.am: install noweb2lyx.
12769 * lib/Makefile.am: install configure.
12771 * lib/reLyX/configure.in: declare a config aux dir; set package
12772 name to lyx (not sure what the best solution is); generate noweb2lyx.
12774 * lib/layouts/egs.layout: fix the bibliography layout.
12776 1999-10-08 Jürgen Vigna <jug@sad.it>
12778 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12779 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12780 it returned without continuing to search the path.
12782 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12784 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12785 also fixes a bug. It is not allowed to do tricks with std::strings
12786 like: string a("hei"); &a[e]; this will not give what you
12787 think... Any reason for the complexity in this func?
12789 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12791 * Updated README and INSTALL a bit, mostly to check that my
12792 CVS rights are correctly set up.
12794 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12796 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12797 does not allow '\0' chars but lyxstring and std::string does.
12799 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12801 * autogen.sh (AUTOCONF): let the autogen script create the
12802 POTFILES.in file too. POTFILES.in should perhaps now not be
12803 included in the cvs module.
12805 * some more files changed to use C++ includes instead of C ones.
12807 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12809 (Reread): added tostr to nlink. buggy output otherwise.
12810 (Reread): added a string() around szMode when assigning to Buffer,
12811 without this I got a log of garbled info strings.
12813 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12816 * I have added several ostream & operator<<(ostream &, some_type)
12817 functions. This has been done to avoid casting and warnings when
12818 outputting enums to lyxerr. This as thus eliminated a lot of
12819 explicit casts and has made the code clearer. Among the enums
12820 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12821 mathed enums, some font enum the Debug::type enum.
12823 * src/support/lyxstring.h (clear): missing method. equivalent of
12826 * all files that contained "stderr": rewrote constructs that used
12827 stderr to use lyxerr instead. (except bmtable)
12829 * src/support/DebugStream.h (level): and the passed t with
12830 Debug::ANY to avoid spurious bits set.
12832 * src/debug.h (Debug::type value): made it accept strings of the
12833 type INFO,INIT,KEY.
12835 * configure.in (Check for programs): Added a check for kpsewhich,
12836 the latex generation will use this later to better the dicovery of
12839 * src/BufferView.C (create_view): we don't need to cast this to
12840 (void*) that is done automatically.
12841 (WorkAreaButtonPress): removed some dead code.
12843 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12845 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12846 is not overwritten when translated (David Sua'rez de Lis).
12848 * lib/CREDITS: Added David Sua'rez de Lis
12850 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12852 * src/bufferparams.C (BufferParams): default input encoding is now
12855 * acinclude.m4 (cross_compiling): comment out macro
12856 LYX_GXX_STRENGTH_REDUCE.
12858 * acconfig.h: make sure that const is not defined (to empty) when
12859 we are compiling C++. Remove commented out code using SIZEOF_xx
12862 * configure.in : move the test for const and inline as late as
12863 possible so that these C tests do not interefere with C++ ones.
12864 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12865 has not been proven.
12867 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12869 * src/table.C (getDocBookAlign): remove bad default value for
12870 isColumn parameter.
12872 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12874 (ShowFileMenu2): ditto.
12876 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12877 of files to ignore.
12879 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12881 * Most files: finished the change from the old error code to use
12882 DebugStream for all lyxerr debugging. Only minor changes remain
12883 (e.g. the setting of debug levels using strings instead of number)
12885 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12887 * src/layout.C (Add): Changed to use compare_no_case instead of
12890 * src/FontInfo.C: changed loop variable type too string::size_type.
12892 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12894 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12895 set ETAGS_ARGS to --c++
12897 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12899 * src/table.C (DocBookEndOfCell): commented out two unused variables
12901 * src/paragraph.C: commented out four unused variables.
12903 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12904 insed a if clause with type string::size_type.
12906 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12909 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12911 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12912 variable, also changed loop to go from 0 to lenght + 1, instead of
12913 -1 to length. This should be correct.
12915 * src/LaTeX.C (scanError): use string::size_type as loop variable
12918 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12919 (l.896) since y_tmp and row was not used anyway.
12921 * src/insets/insetref.C (escape): use string::size_type as loop
12924 * src/insets/insetquotes.C (Width): use string::size_type as loop
12926 (Draw): use string::size_type as loop variable type.
12928 * src/insets/insetlatexaccent.C (checkContents): use
12929 string::size_type as loop variable type.
12931 * src/insets/insetlabel.C (escape): use string::size_type as loop
12934 * src/insets/insetinfo.C: added an extern for current_view.
12936 * src/insets/insetcommand.C (scanCommand): use string::size_type
12937 as loop variable type.
12939 * most files: removed the RCS tags. With them we had to recompile
12940 a lot of files after a simple cvs commit. Also we have never used
12941 them for anything meaningful.
12943 * most files: tags-query-replace NULL 0. As adviced several plases
12944 we now use "0" instead of "NULL" in our code.
12946 * src/support/filetools.C (SpaceLess): use string::size_type as
12947 loop variable type.
12949 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12951 * src/paragraph.C: fixed up some more string stuff.
12953 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12955 * src/support/filetools.h: make modestr a std::string.
12957 * src/filetools.C (GetEnv): made ch really const.
12959 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12960 made code that used these use max/min from <algorithm> instead.
12962 * changed several c library include files to their equivalent c++
12963 library include files. All is not changed yet.
12965 * created a support subdir in src, put lyxstring and lstrings
12966 there + the extra files atexit, fileblock, strerror. Created
12967 Makefile.am. edited configure.in and src/Makefile.am to use this
12968 new subdir. More files moved to support.
12970 * imported som of the functions from repository lyx, filetools
12972 * ran tags-query-replace on LString -> string, corrected the bogus
12973 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12974 is still some errors in there. This is errors where too much or
12975 too litle get deleted from strings (string::erase, string::substr,
12976 string::replace), there can also be some off by one errors, or
12977 just plain wrong use of functions from lstrings. Viewing of quotes
12980 * LyX is now running fairly well with string, but there are
12981 certainly some bugs yet (see above) also string is quite different
12982 from LString among others in that it does not allow null pointers
12983 passed in and will abort if it gets any.
12985 * Added the revtex4 files I forgot when setting up the repository.
12987 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12989 * All over: Tried to clean everything up so that only the files
12990 that we really need are included in the cvs repository.
12991 * Switched to use automake.
12992 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12993 * Install has not been checked.
12995 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12997 * po/pt.po: Three errors:
12998 l.533 and l.538 format specification error
12999 l. 402 duplicate entry, I just deleted it.