1 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
4 fixlevel along with xforms version.
6 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
7 xforms version is strictly less than 0.89.5.
8 * src/lyx_gui.C (LyXGUI): ditto.
9 * src/LyXView.C (show): ditto.
11 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
13 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
14 movement in inset in RTL text.
15 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
16 (workAreaButtonRelease): Do not open a float when there is a selection.
18 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
20 * src/spellchecker.C (RunSpellChecker): Open all floats before
23 * src/text.C (InsertChar): Consider "," as a part of a number
24 (for LTR numbers in RTL text code).
25 (IsBoundary): Fixed (and simplified).
26 (InsertChar): Recalculate cursor boundary.
29 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
31 * src/spellchecker.C: fix figures with pspell enabled
33 * src/insets/figinset.C: workaround for gs hang xforms bug
35 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
37 * lib/bind/??_menus.bind: comment out the entries corresponding to
38 real menus. They should be eventually removed, but I'll let the
39 language maintainers do that.
41 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
43 * src/frontends/kde/parageneraldlg.C:
44 * src/frontends/kde/parageneraldlg.h: don't use
45 a derived class for SpaceAbove/Below
47 * src/frontends/kde/dlg/README: add some info
49 * src/frontends/kde/dlg/*: update data files, update
52 * src/frontends/kde/dlg/moc/Makefile.am: add
55 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
57 * configure.in: add new KDE Makefiles
58 * src/vspace.h: return GlueLength not a normal one
59 * src/support/lstrings.h:
60 * src/support/lstrings.C: add isStrUnsignedInt(),
63 * src/frontends/kde/*: big reorganisation, update
64 FormParagraph, add FormTabCreate
66 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
68 * lib/ui/default.ui: small grammatical change.
70 * src/frontends/xforms/xform_macros.h: removed.
72 * src/frontends/xforms/FormBase.C:
73 * src/frontends/xforms/FormPreferences.C:
74 * src/frontends/xforms/Makefile.am: changes associated with removing
75 xform_macros.h. Should make Lars' debugging a little easier.
77 * src/frontends/xforms/FormPreferences.C:
78 * src/frontends/xforms/FormPreferences.h:
79 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
80 longer use X11 color name database. HSV and RGB dials/sliders.
81 Please let this be the end of this!
83 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
85 * Several files: Allow compilation when the compiler doesn't
88 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
91 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
94 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
96 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
97 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
100 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
102 * src/frontends/xforms/FormRef.C (updateBrowser):
103 * src/frontends/xforms/forms/form_ref.fd: try clicking on
104 different insets with the sort key active. Now apply this patch!
106 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
108 * src/frontends/xforms/FormPrint.C: set to valid()
109 when we update from the passed parameters.
111 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
113 * src/LColor.C (getFromGUIName): internationalise the comparison.
115 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
116 FormPreferences choice.
118 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
121 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
123 * src/lyxrc.C: more detail for the printer program config
126 * src/LColor.C: ert->latex text. LColor needs a big revamp
127 but will have to wait till after 1.1.6
129 * src/buffer.C: bring up a dialog if we load a document
130 with an un-installed text class, rather than just complain
133 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
135 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
136 the browser form for a combox in a tabbed folder. Bug fix courtesy of
137 Steve Lamont <spl@ncmir.ucsd.edu>.
139 * src/frontends/xforms/FormDocument.C (build):
140 * src/frontends/xforms/FormPreferences.C (Language::build):
141 pass tabfolders to Combox::add() in order to use this work around.
143 * src/frontends/xforms/FormCitation.C (connect): remove max size
145 (update): sort list of bibliography keys.
147 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
149 No max size limitation. Same popup for new and existing insets. Fixes
150 bugs reported by Rob Lahaye.
152 * src/frontends/xforms/FormCitation.C (c-tor):
153 * src/frontends/xforms/FormCopyright.C (c-tor):
154 * src/frontends/xforms/FormError.C (c-tor):
155 * src/frontends/xforms/FormGraphics.C (c-tor):
156 * src/frontends/xforms/FormIndex.C (c-tor):
157 * src/frontends/xforms/FormRef.C (c-tor):
158 * src/frontends/xforms/FormToc.C (c-tor):
159 * src/frontends/xforms/FormUrl.C (c-tor):
160 use correct policy for ButtonController.
162 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
164 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
167 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
169 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
170 Some resizing changes.
172 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
174 * configure.in: fix typo
176 * lib/languages: add ukraninian and change no to no_NO
178 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
180 * src/bufferview_funcs.C (FontSize): use setLyXSize
182 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
184 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
185 to check for systems where mkstemp() is available but not declared
186 in headers. The new autoconf macro lyx_CHECK_DECL can be used
187 to check for declarations in headers.
189 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
191 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
193 * forms/makefile: added bibforms.fd, include_form.fd.
194 Removed lyx_sendfax.fd.
196 * src/LaTeXLog.C (ShowLatexLog):
197 * src/LyXAction.C (init):
198 * src/bufferparams.C (readLanguage): altered messages as suggested by
201 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
204 * src/credits.C: made fd_form_credits non-static, so that it can be
205 redrawn should the xforms colors be re-mapped.
206 * src/spellchecker.C ditto fd_form_spell_options.
208 * src/filedlg.[Ch] (redraw):
209 * src/intl.[Ch] (redraw):
210 * src/lyxfr0.[Ch] (redraw):
211 * src/insets/figinset.[Ch] (redraw):
212 * src/insets/insetexternal.[Ch] (redraw):
213 new methods, connected to Dialogs::redrawGUI.
215 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
216 to be connected to Dialogs::redrawGUI.
218 * src/frontends/xforms/FormCitation.C (build):
219 * src/frontends/xforms/FormCopyright.C (build):
220 * src/frontends/xforms/FormError.C (build):
221 * src/frontends/xforms/FormGraphics.C (build):
222 * src/frontends/xforms/FormIndex.C (build):
223 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
224 * src/frontends/xforms/FormToc.C (build):
225 * src/frontends/xforms/FormUrl.C (build):
226 use the ButtonController correctly.
228 * src/frontends/xforms/FormCopyright.C (build):
229 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
230 the .fd file and into build().
232 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
234 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
236 * src/frontends/xforms/forms/form_citation.fd:
237 * src/frontends/xforms/forms/form_copyright.fd:
238 * src/frontends/xforms/forms/form_error.fd:
239 * src/frontends/xforms/forms/form_graphics.fd:
240 * src/frontends/xforms/forms/form_index.fd:
241 * src/frontends/xforms/forms/form_toc.fd:
242 * src/frontends/xforms/forms/form_url.fd:
243 renamed some of the objects. Named others explicitly for the first time.
244 Added Restore and Apply buttons where appropriate.
246 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
249 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
251 * src/version.h: try the pre2 again
253 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
255 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
257 * src/frontends/kde/FormParagraph.C: added using directive.
259 * src/frontends/kde/paradlg.C: added config.h and using directive.
261 * src/frontends/kde/paradlg.h: added std::qualifier.
263 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
265 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
267 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
269 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
271 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
273 * src/version.h: set back to 1.1.6cvs
275 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
277 * src/version.h: set to 1.1.6pre2
279 2000-11-20 Marko Vendelin <markov@ioc.ee>
281 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
283 * src/frontends/gnome/Makefile.am: updated list of XForms object files
285 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
287 * src/LColor.C (init):
288 * src/lyxrc.C (getDescription): changed some comments as suggested by
291 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
292 disconnect the redrawGUI signal in best-practice fashion.
294 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
295 long_opts_tab to reflect the change in name of this tabfolder, as
296 suggested by John Levon.
297 (connect, disconnect): new methods. Don't do much at present other than
298 ensuring that we can't resize the dialog. This just makes xforms go
300 (lots of methods in Colors): made void rather than bool. The idea is
301 to have an isOk() function that keeps track of whether any input is
302 genuinely invalid and should therefore block Save, Apply.
303 Easier to manipulate the counters rapidly.
304 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
305 compiler will like this code. Much cleaner way of doing things.
307 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
309 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
310 rather than simple counters, following suggestion by John Levon.
312 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
313 than engraved frame + text.
315 * src/frontends/xforms/forms/makefile: removed spurious command.
317 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
319 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
321 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
324 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
326 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
327 see what Lars has changed and what is just white space!
328 Now used X directly to ascertain the RGB color associated with the
330 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
332 Added some sort capability.
333 The X11 color name database input is only displayed if the database
334 isn't found in the standard place.
335 Got rid of struct compare_converter; it wasn't used.
336 Probably some other stuff that I've forgotten.
338 * src/frontends/xforms/FormPreferences.h: changed the names of some
339 methods in the Colors struct. Added a couple of structs to help sort
340 colors by name and by RGBColor.
342 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
343 functions into a new class RWInfo.
345 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
346 The dialog is now almost navigable using the keyboard. Unfortunately,
347 the cursor has to be inside a browser for it to be activated. There is
348 no visual feedback for the key shortcuts to the arrow keys (use
349 Alt-appropriate arrow key, Alt-x).
351 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
354 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
355 xform_helpers.[Ch]. See above.
357 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
359 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
361 * src/screen.C (setCursorColor): new method. Sets the color of the
363 (ShowManualCursor): call it.
364 Constify some local variables.
366 * src/LColor.[Ch] (LColor): add entry for cursor
367 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
370 2000-11-19 Juergen Vigna <jug@sad.it>
372 * src/insets/insettabular.C (draw): fixed text border redraw problem.
373 (calculate_dimensions_of_cells): try to boost up when inserting chars.
375 2000-11-15 Rob Lahaye <lahaye@postech.edu>
377 * lib/ui/default.ui: OptItem used for Fax entry
379 2000-11-17 Matej Cepl <cepl@bigfoot.com>
381 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
383 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
385 * src/vspace.C (nextToken): fix so it can handle length phrases like
386 "10mm+-20mm", "40inplus16mmminus10cm" etc.
388 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
390 * src/frontends/xforms/FormPreferences.C: constify several variables
391 (BrowserLyX): rewrite to not need the choice variable
392 (Modify): rewrite to not need the choide variable
393 (compare_converter): make operator const
395 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
396 correct the writing of \set_color
397 (getDescription): return a const string
399 * src/kbsequence.[Ch] (addkey): remove dead code
401 * src/Painter.C (text): remove some commented code
403 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
405 * src/ColorHandler.[Ch]: removed some header files from .h file.
406 Included LColor.h in .C file.
408 * src/LColor.[Ch]: made class copyable so that I could create a
409 system_lcolor instance.
411 * src/Painter.h: removed LColor.h.
413 * src/lyx_gui.C (create_forms): used AddName.
415 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
416 of user preferences/lyxrc file.
418 * src/lyxrc.C (output): output changes to lcolor.
420 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
422 Moved class xformColor to files xform_helpers.[Ch]. These files,
423 Color.[Ch], could now be moved into src if they would be useful to
426 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
427 Also moved FormPreferences::browseFile here as it can be used by any
428 xform dialog with a "Browse" button. FormGraphics is a perfect example.
430 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
431 ReadableFile): changed the FormPreferences methods a little and moved
432 them here as they'll be useful elsewhere also.
434 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
435 Removed some header files and used forward declarations instead.
437 Removed some methods as they'll be useful elsewhere (see above).
439 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
440 Can also now modify the LyX LColors. However, for reasons that I don't
441 yet understand, it appears that we can use
442 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
443 present. The problem appears to lie in ColorHandler, because I can
444 change the color using LColor.SetColor(). Similarly, when reading in a
445 preferences file with some set_color instances, I'll get a warning
446 like: Color sea green is undefined or may not be redefined
447 Bad lyxrc set_color for sea green
449 Once the buffer is loaded, however, I can happily change to this color.
451 Finally, it appears that I have to set the color of "inset frame"
452 explicitly, or it oscillates from "black" to "indian red" with each
455 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
457 * ANNOUNCE: corrected a spelling mistake.
459 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
462 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
464 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
466 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
469 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
470 match the requirements from the standard better. This is required
471 to work with gnu libstdc++-v3
473 * src/frontends/xforms/FormPreferences.C: add explict pair
474 arguments to browse calls. include support/lyxmanip.h remvoe
475 extern fmt. whitespace changes. reorder variables in
476 FormPreferences.h, to match initalizaton order.
478 * several files: constify more local variables.
480 * src/buffer.C: remove some commented functions.
482 * src/DepTable.C (remove_files_with_extension): temporary
483 work around for gcc 2.97
484 * src/filedlg.C (find): ditto
485 * src/Variables.C (set): ditto
486 * src/LyXAction.C (searchActionArg): ditto
487 (retrieveActionArg): ditto
489 * configure.in: check for mktemp too
491 * UPGRADING: prepare for 1.1.6
493 * Makefile.am (lgbtags): add backup tags for when etags are
494 different than usual.
496 * ANNOUNCE: prepare for 1.1.6
498 * src/support/tempname.C (make_tempfile): new function, wrapper
499 around mkstemp and mktemp. Only mkstemp has been tested.
502 2000-11-14 Rob Lahaye <lahaye@postech.edu>
504 * default.ui: capitalized some menu items to improve shortcuts.
506 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
508 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
510 * src/frontends/xforms/Dialogs.C: add "using" directive.
512 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
514 * src/filedlg.C (Select): highlight suggested file in browser, if
517 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
518 each tab folder is encapsulated in its own class.
519 The Language keymaps are now chosen using a text input and a
520 browser button, rather than a Combox.
521 All the browser buttons are now functional, although LyXFileDlg
522 still needs to be modified to make it straighhtforward to return a
523 directory if that is what is desired.
525 * src/frontends/xforms/forms/form_preferences.fd: use text input
526 and browse button to input the Language keymaps. Add a few
527 callbacks for the browse buttons.
529 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
531 * src/support/tempname.C (tempName): small changes to make it
532 safer. remove the '.' before XXXXXX
534 * src/support/filetools.C (TmpFileName): remove func
537 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
538 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
539 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
540 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
542 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
545 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
548 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
549 for bp (this fixes a reproducible hard crash)
551 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
554 * src/frontends/xforms/FormBase.h: make bp_ private
555 (FormBaseBI): remove default for bp
558 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
561 * src/frontends/xforms/Color.C (RGBColor): made several vars
562 const, changed initialization of j to allow it to be const
565 * several files: added const to local variables.
567 * src/lyx_cb.C: removed several function prototypes and moved them
571 (UpdateLayoutPreamble):
573 (MenuInsertLabel): add BufferView as arguemnt
574 (LayoutsCB): make tmp const
576 * src/layout_forms.h: regenerated
578 * src/debug.C: add Debug::FILES
579 (showLevel) (showTags): translate the desc
581 * src/debug.h: add FILES as debug target
583 * src/bufferlist.C: use current_view as an interim measure becuase
584 of added arguments to MenuWrite and MenuWriteAs
586 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
588 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
590 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
591 libstdc++ is compiled with.
593 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
595 * lib/layouts/docbook-book.layout
596 * lib/layouts/docbook.layout
597 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
598 those paragraphs are expresse as SGML comments <!-- -->.
600 * src/LaTeXFeatures.h
601 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
602 parameter, this allows to express all the include files as relative
603 paths to the master buffer. The verbatim insert works as the other
606 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
608 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
610 (MakeDocBookFile): top_element is always written. Some clean up, as
611 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
613 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
614 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
615 a reference is written instead of the name.
616 (Validate): use the relative path for the filename.
618 * src/insets/insetlabel.C (DocBook): write end tag, for XML
621 * src/support/filetools.h
622 * src/support/filetools.C (IsSGMLFilename): added.
625 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
627 * development/OS2/quick_fix.patch:
629 * README.OS2: quick update to the OS/2 port.
631 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
633 * src/converter.C: add "using" directive.
635 * src/frontends/xforms/FormPreferences.C: add "using" directive.
636 (compare_converter): add "int" as return type.
638 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
641 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
643 * src/lyx_gui.C (create_forms): map the xform colours, should a
644 mapping exist. Ie, call XformColor::read().
646 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
647 and struct HSV as HSVColor.
648 (XformColor::read, XformColor::write) : new methods that
649 input/output any changes to the cform GUI colors.
651 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
654 * src/frontends/xforms/FormPreferences.C Lots of little changes
655 associated with the changed name of the RGB and HSV structs. Can
656 now save changes to xforms GUI to file. Commented out
657 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
658 used currently anyway.
660 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
662 * src/converter.C: A lot of changes:
663 - It is no longer possible to choose between two or more ways to
664 export to some format (the new code uses only the shortest path).
665 However, it is still possible to choose between pdflatex/ps2pdf
666 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
667 - Added several methods that makes the FormPreferences code simpler.
668 - Changed the tokens $$FName and $$OutName to $$i and $$o.
670 * src/exporter.C (Export): lyxrc.use_pdf is set before
671 makeLaTeXFile is called. This works but not very nice.
673 * src/frontends/xforms/FormPreferences.C: The formats/converters
674 tabs are now fully functional.
676 * src/buffer.C (getTocList): Add numbers to the captions.
678 * lib/lyxrc.example: Removed fax section
680 * src/support/rename.C (rename): Delete the old file if lyx::copy
683 2000-11-13 Rob Lahaye <lahaye@postech.edu>
685 * lib/ui/default.ui: minor polishing.
687 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
689 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
692 * lib/Makefile.am (DOCINST): do not install everything in the
693 documentation directory.
695 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
697 * src/bufferlist.C (newFile): set the filename to the constructed
700 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
701 constructed "newfileXX.lyx" name to the dialog
703 * src/frontends/DialogBase.h: make update() non-abstract so
704 KDE doesn't need to implement two update methods for every form
706 * src/frontends/kde/Makefile.am: add missing xforms objects
709 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
711 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
713 * src/frontends/xforms/Color.[Ch]: new files, defining the color
714 structs RGB and HSV. May not be the best place for these files.
715 Perhaps move them into src ?
717 * src/frontends/xforms/Makefile.am: added new files.
719 * src/frontends/xforms/forms/form_preferences.fd:
720 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
721 replaced all instances of "colour" with "color"!
723 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
726 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
727 tab. Can now alter the colors of the xform's GUI on the fly. With
728 the aid of a single static Signal (see below), can "Apply" these
729 changes to all currently open dialogs. (Well, to all of the NEW
730 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
731 subsequently opened dialogs will, of course, also have the new
732 color scheme. Cannot yet save (or load) the choices to file, so
733 they are lost when exiting LyX.
735 * src/frontends/Dialogs.h:
736 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
737 Used to trigger a redraw of any dialogs connected to it because,
738 for example, the GUI colours have been re-mapped.
740 * src/frontends/xforms/FormBase.[Ch]:
741 * src/frontends/xforms/FormDocument.[Ch]:
742 * src/frontends/xforms/FormParagraph.[Ch]:
743 * src/frontends/xforms/FormPreferences.[Ch]:
744 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
745 method, to be connected to Dialogs::redrawGUI. Method must be
746 virtual, because dialogs with tabbed folders need to redraw the
747 forms of each tab folder.
749 * src/LyXView.C (d-tor):
750 * src/frontends/xforms/FormBase.C (d-tor): connected
751 Dialogs::redrawGUI signal to redraw().
753 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
754 removed Assert, because it is identical to that in FormBase.
756 2000-11-10 Rob Lahaye <lahaye@postech.edu>
758 * lib/ui/default.ui: minor polishing.
760 2000-11-10 Juergen Vigna <jug@sad.it>
762 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
763 (deleteLyXText): ditto
765 * src/insets/insettabular.C (InsetButtonPress): don't clear the
766 selection on mouse-button-3.
768 * src/insets/insettabular.h: new function clearSelection(), use this
769 functions inside insettabular.C.
771 * src/insets/insettabular.C (TabularFeatures): clear the selection
772 on remove_row/column.
774 * src/insets/inset.C (scroll): fixed some scroll stuff.
776 * src/insets/insettabular.C (draw): fixed another minor draw problem.
778 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
780 * lib/CREDITS: add Yves Bastide
782 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
784 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
785 check whether C library functions are in the global namespace.
787 * configure.in: calls it.
789 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
792 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
794 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
795 iterators to prevent crash.
797 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
799 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
801 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
802 shortcut for xforms CB to the preemptive or post-handler function.
804 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
805 removed the HIDDEN_TIMER as it's no longer used.
806 Various other small changes.
808 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
809 preemptive handler to obtain feedback, rather than the post-handler.
810 (ColoursLoadBrowser): find "black" and "white" based on RGB values
812 Formats tab is now complete. Converters tab is nearly so.
814 2000-11-09 Juergen Vigna <jug@sad.it>
816 * src/insets/insettext.C (~InsetText):
819 (SetParagraphData): set cache.second to 0 after deleting it!
820 (getLyXText): check if cache.second is not 0 if finding it.
822 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
824 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
825 lyxlex to parse the rgb.txt file.
828 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
829 replace the default '#' comment character.
831 * src/support/tempname.C: add "using" directive
832 * src/frontends/ButtonPolicies.C: ditto.
834 * src/support/filetools.C (DirList): add an explicit cast to avoid
835 a compile error (probably not the right fix)
837 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
839 * src/support/filetools.C (DirList): implement using system functions
841 * src/support/tempname.C: new file
843 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
845 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
847 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
850 * src/frontends/xforms/ButtonController.C: new file
852 * src/os2_defines.h: remove getcwd define
854 * src/lyxvc.C: include support/lyxlib.h
855 (showLog): use lyx::tempName
857 * src/lyx_cb.C: comment out includes that we don't need
858 (AutoSave): use lyx::tempName
860 * src/filedlg.C: include support/lyxlib.h
861 (Reread): use lyx::getcwd
863 * src/converter.C: include support/filetools.h
864 (add_options): change to static inline, make tail const
865 (Add): make old_viewer const
866 (GetAllFormats): make it a const method, use const_iterator
867 (enable): make static inline
868 (SplitFormat): make using_format const
870 * src/LaTeX.C (run): use lyx::getcwd
872 * configure.in: check for mkstemp as well
874 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
876 * src/converter.[Ch] (GetAllCommands): new method.
878 * src/support/filetools.[Ch] (DirList): new method.
880 * src/frontends/xforms/FormPreferences.C: started (just!) adding
881 functionality to the converters tab.
882 The formats tab is now nearly complete.
883 The kbmap choices in Languages tab now display the contents of
884 system_lyxdir/kbd/*.kmap in readable form.
886 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
887 Moved some variables into the class.
889 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
890 inactive tab folder to FL_COL1. Haven't yet worked out how to change
891 colour of active folder to lighter grey instead. Any takers?
892 (form_colours): added an "Apply" button.
893 (form_converters): added a "Flags" input field.
894 (form_formats): added a "Shortcut" input field. Note that we can't use
895 names such as "input_shortcut" as this buggers up the sed script stuff.
897 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
905 * src/lyx_sendfax_main.C:
908 * src/spellchecker.C:
909 * src/insets/figinset.C:
910 * src/insets/insetbib.C:
911 * src/insets/insetexternal.C:
912 * src/insets/insetinclude.C:
913 * src/insets/insetinfo.C:
914 * src/mathed/math_panel.C:
915 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
916 all "daughter" dialogs now have identical "feel".
918 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
920 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
921 used (and was only used in one place prior to this patch. Incorrectly!)
923 * src/frontends/xforms/FormDocument.C: changed some instances of
924 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
925 sense. Also added fl_set_input_return() for class_->input_doc_extra and
926 for options_->input_float_placement. This fixes a bug reported by
929 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
930 functionality into d-tor.
932 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
933 input of numerals also.
935 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
936 fl_set_form_atclose(). Can now close dialog from window manager,
937 fixing a bug reported by Rob Lahaye.
939 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
941 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
942 are no longer dark. Haven't yet worked out how to lighten the colour of
943 the active tabfolder. Any ideas anybody?
944 Adjusted Colours tab a little.
945 Added Shortcut field to converters tab. Note that we can't create an
946 fdesign label like "input_shortcut" as this buggers up the sed-script
949 * src/frontends/xforms/FormPreferences.[Ch]:
950 (feedback): fixed crash due to to ob=0.
951 (LanguagesXXX): the kbmap choices now contain the files
952 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
953 be replaced by an input with a file browse button, but since the browse
954 buttons don'y yet work, this'll do for the moment.
955 (FormatsXXX): think that this is now nearly fully functional.
956 Some points/questions though:
957 1. Does "Apply" remove formats if no longer present?
958 2. I think that the browser should list the GUI names rather than the
960 3. Must ensure that we can't delete Formats used by an existing
963 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
964 if this is the best way to do this.
966 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
968 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
970 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
971 for variable assignment.
973 2000-11-07 Rob Lahaye <lahaye@postech.edu>
975 * src/lib/ui/default.ui: added sub/superscripts to menu as
976 Insert->Special characters and cleaned-up the file a bit
978 2000-11-07 Allan Rae <rae@lyx.org>
980 * src/frontends/xforms/FormPreferences.C (feedback): make sure
981 ob isn't 0 before using it. See comments in function.
983 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
985 * src/frontends/xforms/form_*.C: regenerated
987 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
989 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
991 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
992 compiling with gcc-2.96
994 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
996 * src/support/lyxstring.C: add a couple "using" directives.
998 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
999 a .c_str() here too for good measure.
1000 * src/Spacing.C (set): ditto.
1001 * src/lyxfunc.C (Dispatch): ditto.
1003 * src/insets/insettabular.C (copySelection): change .str() to
1004 .str().c_str() to fix problems with lyxstring.
1005 * src/support/filetools.C (GetFileContents): ditto.
1006 * src/buffer.C (asciiParagraph): ditto.
1007 * src/paragraph.C (String): ditto.
1009 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1010 * lib/bind/sciword.bind: ditto.
1012 * src/LyXAction.C (init): remove "symbol-insert" function, which
1013 shared LFUN_INSERT_MATH with "math-insert".
1015 * lib/configure.m4: == is not a valid operator for command test.
1017 * src/lyxrc.C: add using directive.
1019 * src/converter.h: add std:: qualifier.
1021 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1023 * src/converter.[Ch] and other files: Change the Format class to a
1024 real class, and create two instances: formats and system_format.
1026 * src/lyxrc.C (output): Output the difference between formats and
1029 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1030 (buildFormats): Insert formats into browser.
1031 (inputFormats): Made the browser and add button functional.
1032 (applyFormats): Update formats from format_vec.
1034 * src/converter.C: Changed all (*it). to it->
1035 (Format::dummy): New method.
1036 (Format::importer): New format flag.
1037 (Formats::GetAllFormats): New method.
1038 (Formats::Add): Delete format from the map if prettyname is empty.
1039 (Converter::Convert): Print an error message if moving the file fails.
1040 (Converter::GetReachableTo): New method
1042 * src/MenuBackend.[Ch]: Add support for importformats tag.
1044 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1046 * lib/configure.m4: Add word->tex and ps->fax converters.
1048 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1049 Return fax to file menu.
1053 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1055 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1058 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1061 * src/lyxfunc.C (processKeyEvent): removed
1063 * src/bufferlist.C (emergencyWrite): removed the out commented
1064 emergency write code.
1066 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1068 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1070 * many files: change formatting to be a bit more uniform for
1071 if,while,for,switch statements, remove some parantesis not needed.
1074 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1076 * config/kde.m4: make config more robust when KDEDIR is set
1078 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1080 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1081 not returned a pixmap for "math-insert".
1083 * src/LyXAction.C (init): sort the entries a bit.
1085 2000-11-03 Juergen Vigna <jug@sad.it>
1087 * src/insets/insettabular.h: added fixed number to update codes so
1088 that update is only in one direction.
1090 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1093 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1094 before call to edit because of redraw.
1096 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1098 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1100 * lib/ui/default.ui: Populate "edit_float" menu
1102 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1104 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1105 "floats-operate". The name is ugly (and the func also), but this
1106 is just a band-aid until we switch to new insets.
1108 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1110 * lib/ui/default.ui: update again the menu layout (fix some
1113 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1115 * src/MenuBackend.h (fulllabel): new method.
1117 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1118 the menu shortcuts of a menu are unique and whether they
1119 correspond to a letter of the label.
1120 (expand): call checkShortcuts when debugging.
1122 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1124 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1126 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1128 * lib/examples/*.lyx : '\language default' => '\language english'
1130 * lib/examples/it_splash.lyx : except where it should be italian
1132 * lib/templates/*.lyx : the same
1134 * doc/*.lyx* : the same
1136 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1138 * lib/bind/menus.bind: remove the Layout menu entries, which I
1139 somehow forgot earlier.
1141 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1143 * lib/ui/old-default.ui: keep the old one here for reference (to
1146 * lib/ui/default.ui: update the menu layout
1148 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1150 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1151 Can now Apply to different insets without closing the dialog.
1153 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1154 Can't actually DO anything with them yet, but I'd like a little
1157 * src/frontends/xforms/input_validators.[ch]
1158 (fl_lowercase_filter): new.
1160 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1162 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1163 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1165 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1167 2000-11-02 Juergen Vigna <jug@sad.it>
1169 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1170 on char insertion as it has already be updated by bv->updateInset().
1172 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1173 if an inset inside was updated.
1175 * lib/configure.cmd: commented out fax-search code
1177 2000-11-01 Yves Bastide <stid@acm.org>
1179 * src/tabular.C (OldFormatRead): set tabular language to the
1182 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1184 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1185 class names with non-letter characters (from Yves Bastide).
1187 * lib/ui/default.ui: change Item to OptItem in import menu.
1188 Comment out fax stuff.
1190 * lib/configure.m4: comment out fax-related stuff.
1192 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1194 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1195 useful xforms helper functions. At present contains only formatted().
1196 Input a string and it returns it with line breaks so that in fits
1199 * src/frontends/xforms/Makefile.am: add new files.
1201 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1202 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1205 * src/frontends/xforms/FormPreferences.[Ch]:
1206 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1207 but lots of little clean ups. Removed enum State. Make use of
1208 formatted(). Constify lots of methods. Perhaps best of all: removed
1209 requirement for that horrible reinterpret_cast from pointer to long in
1212 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1214 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1215 conditionalize build on xforms < 0.89
1217 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1219 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1221 * src/LyXAction.C (init): comment out fax
1223 * src/lyxrc.h: comment out the fax enums
1224 comment out the fax variables
1226 * src/commandtags.h: comment out LFUN_FAX
1228 * src/lyxrc.C: disable fax variables.
1229 (read): disable parsing of fax variables
1230 (output): disable writing of fax variables
1231 (getFeedback): now description for fax variables
1233 * src/lyxfunc.C: comment out MenuFax
1234 (Dispatch): disable LFUN_FAX
1236 * src/lyx_cb.C (MenuFax): comment out
1238 * src/WorkArea.C: add <cctype>
1239 (work_area_handler): better key handling, should be ok now.
1240 for accented chars + etc
1242 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1243 lyx_sendfax.h and lyx_sendfax_man.C
1245 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1246 (show): don't call InitLyXLookup when using xforms 0.89
1248 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1250 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1252 * src/support/filetools.C (GetFileContents): close to dummy change
1254 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1256 * src/trans.C (AddDeadkey): workaround stupid compilers.
1258 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1260 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1261 of two-sided document.
1263 2000-10-31 Juergen Vigna <jug@sad.it>
1265 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1267 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1268 xposition to the Edit call.
1270 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1272 * src/trans.C (AddDeadkey): cast explicitly to char.
1274 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1276 * src/tabular.C (AsciiBottomHLine): simplify?
1277 (AsciiTopHLine): simplify?
1278 (print_n_chars): simplify
1279 (DocBook): remove most of the << endl; we should flush the stream
1280 as seldom as possible.
1282 (TeXBottomHLine): ditto
1283 (TeXTopHLine): ditto
1285 (write_attribute): try a templified version.
1286 (set_row_column_number_info): lesson scope of variables
1288 * src/support/lstrings.h (tostr): new specialization of tostr
1290 * src/trans.C (AddDeadkey): slightly cleaner fix.
1292 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1294 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1295 '%%' in Toc menu labels.
1298 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1299 font_norm is iso10646-1.
1301 * src/font.C (ascent): Fixed for 16bit fonts
1302 (descent,lbearing,rbearing): ditto
1304 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1306 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1307 (getFeedback): new static method.
1309 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1310 Now use combox rather than choice to display languages.
1311 Feedback is now output using a new timer callback mechanism, identical
1312 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1314 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1316 * src/minibuffer.C: fix for older compilers
1318 2000-10-30 Juergen Vigna <jug@sad.it>
1320 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1321 has to be Left of the inset otherwise LyXText won't find it!
1323 * src/BufferView2.C (open_new_inset): delete the inset if it can
1326 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1328 * lyx.man: fix typo.
1330 2000-10-29 Marko Vendelin <markov@ioc.ee>
1331 * src/frontends/gnome/FormCitation.C
1332 * src/frontends/gnome/FormCitation.h
1333 * src/frontends/gnome/FormCopyright.C
1334 * src/frontends/gnome/FormCopyright.h
1335 * src/frontends/gnome/FormError.C
1336 * src/frontends/gnome/FormError.h
1337 * src/frontends/gnome/FormIndex.C
1338 * src/frontends/gnome/FormIndex.h
1339 * src/frontends/gnome/FormPrint.C
1340 * src/frontends/gnome/FormPrint.h
1341 * src/frontends/gnome/FormRef.C
1342 * src/frontends/gnome/FormRef.h
1343 * src/frontends/gnome/FormToc.C
1344 * src/frontends/gnome/FormToc.h
1345 * src/frontends/gnome/FormUrl.C
1346 * src/frontends/gnome/FormUrl.h
1347 * src/frontends/gnome/Menubar_pimpl.C
1348 * src/frontends/gnome/mainapp.C
1349 * src/frontends/gnome/mainapp.h
1350 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1351 changing update() to updateSlot() where appropriate
1353 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1355 * src/frontends/xforms/FormPreferences.[Ch]:
1356 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1359 2000-10-28 Juergen Vigna <jug@sad.it>
1361 * src/insets/insettabular.C (draw): fixed drawing bug.
1363 * src/insets/insettext.C (clear):
1365 (SetParagraphData): clearing the TEXT buffers when deleting the
1366 paragraphs used by it.
1368 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1370 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1372 2000-10-27 Juergen Vigna <jug@sad.it>
1374 * src/tabular.C (~LyXTabular): removed not needed anymore.
1376 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1379 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1381 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1384 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1387 * src/frontends/xforms/FormPreferences.[Ch]:
1388 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1389 Reorganised as modules based on tabs. Much easier to follow the
1390 flow and to add new tabs. Added warning and feedback messages.
1393 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1395 * src/tabular.h (DocBook): add std:: qualifier.
1397 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1399 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1400 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1403 * insettabular.C (DocBook): uses the tabular methods to export
1406 * src/insets/insettext.h
1407 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1409 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1411 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1414 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1415 moved misplaced AllowInput two lines up.
1417 * src/buffer.C (readFile): compare float with float, not with int
1419 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1421 * src/minibuffer.C: add "using SigC::slot" statement.
1423 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1425 * src/frontends/xforms/forms/README: updated section about make.
1427 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1428 Tidied some forms up, made two of form_tabular's tabs more
1429 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1430 fixed translation problem with "Column".
1432 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1434 * src/minibuffer.h: use Timeout instead of the xforms timer
1436 (setTimer) rewrite for the Timeout, change to unsigned arg
1437 (set): change to unsigned timer arg
1440 * src/minibuffer.C (TimerCB): removed func
1441 (C_MiniBuffer_TimerCB): removed func
1442 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1443 (peek_event): use a switch statement
1444 (add): don't use fl_add_timer.
1445 (Set): rewrite to use the Timeout
1448 * src/Timeout.[Ch] (setType): return a Timeout &
1449 (setTimeout): ditto, change to unsigned arg for timeout
1451 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1453 * src/mathed/formula.C (mathed_string_width): Use string instead
1454 of a constant size char array.
1456 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1458 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1459 the two recently added operator<< for SMInput and State.
1461 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1463 (OkCancelPolicy): ditto
1464 (OkCancelReadOnlyPolicy): ditto
1465 (NoRepeatedApplyReadOnlyPolicy): ditto
1466 (OkApplyCancelReadOnlyPolicy): ditto
1467 (OkApplyCancelPolicy): ditto
1468 (NoRepeatedApplyPolicy): ditto
1470 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1472 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1473 add the usual std:: qualifiers.
1475 2000-10-25 Juergen Vigna <jug@sad.it>
1477 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1479 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1481 * src/support/filetools.C (MakeRelPath): change some types to
1484 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1485 ButtonPolicy::SMInput and ButtonPolicy::State.
1487 * src/FontLoader.C (reset): small cleanup
1488 (unload): small cleanup
1490 * src/FontInfo.C (getFontname): initialize error to 10000.0
1492 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1494 * src/frontends/xforms/FormPreferences.[Ch]:
1495 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1496 TeX encoding and default paper size sections.
1498 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1500 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1503 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1504 make the message_ empty.
1505 (FormError): don't initialize message_ in initializer list.
1507 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1509 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1511 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1513 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1515 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1517 * src/frontends/kde/*data.[Ch]: _("") is not
1520 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1522 * src/buffer.C: removed redundant using directive.
1524 * src/frontends/DialogBase.h: revert to original definition of
1527 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1528 stuff into two classes, one for each dialog, requires a new
1529 element in the dialogs vector, FormTabularCreate.
1531 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1534 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1535 method. Continues Allan's idea, but means that derived classes
1536 don't need to worry about "update or hide?".
1538 * src/frontends/xforms/FormError.C (showInset): add connection
1541 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1542 one for each dialog. FormTabular now contains main tabular dialog
1545 * src/frontends/xforms/FormTabularCreate.[Ch]:
1546 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1549 * src/frontends/xforms/FormGraphics.[Ch]:
1550 * src/frontends/xforms/forms/form_graphics.fd
1551 * src/frontends/xforms/FormTabular.[Ch]:
1552 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1553 classes of FormInset.
1555 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1556 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1558 * src/frontends/xforms/Makefile.am:
1559 * src/frontends/xforms/forms/makefile: added new files.
1561 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1562 variable. added Signal0 hide signal, in keeping with other GUI-I
1565 * src/support/lstrings.h: removed redundant std:: qualifier as
1566 it's already declared in Lsstream.h.
1568 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1570 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1574 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1576 * src/tabular.C (Ascii): minimize scope of cell.
1578 * src/BufferView2.C (nextWord): return string() instead of 0;
1580 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1582 * src/converter.h: add a std:: qualifier
1584 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1586 * src/importer.[Ch]: New files. Used for importing files into LyX.
1588 * src/lyxfunc.C (doImport): Use the new Importer class.
1590 * src/converter.h: Add shortcut member to the Format class.
1591 Used for holding the menu shortcut.
1593 * src/converter.C and other files: Made a distinction between
1594 format name and format extension. New formats can be defined using
1595 the \format lyxrc tag.
1596 Added two new converter flags: latex and disable.
1598 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1600 * src/support/lyxlib.h: unify namespace/struct implementation.
1601 Remove extra declarations.
1603 * src/support/chdir.C (chdir): remove version taking char const *
1605 * src/support/rename.C: ditto.
1606 * src/support/lyxsum.C: ditto.
1608 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1610 * src/frontends/xforms/FormBase.[Ch]:
1611 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1612 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1613 work only for the next call to fl_show_form(). The correct place to set
1614 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1615 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1616 from FormBase have the minimum size set; no more stupid crashes with
1619 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1621 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1623 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1625 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1627 * src/support/lyxlib.h: changed second argument of mkdir to
1628 unsigned long int (unsigned int would probably have been enough,
1629 but...). Removed <sys/types.h> header.
1630 * src/support/mkdir.C (mkdir): ditto.
1634 2000-10-19 Juergen Vigna <jug@sad.it>
1636 * src/lyxfunc.C (MenuNew): small fix (form John)
1638 * src/screen.C (Update): removed unneeded code.
1640 * src/tabular.C (Ascii): refixed int != uint bug!
1642 * src/support/lyxlib.h: added sys/types.h include for now permits
1643 compiling, but I don't like this!
1645 2000-10-18 Juergen Vigna <jug@sad.it>
1647 * src/text2.C (ClearSelection): if we clear the selection we need
1648 more refresh so set the status apropriately
1650 * src/insets/insettext.C (draw): hopefully finally fixed draw
1653 2000-10-12 Juergen Vigna <jug@sad.it>
1655 * src/insets/insettext.C (draw): another small fix and make a block
1656 so that variables are localized.
1658 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1660 * src/support/lstrings.C (lowercase, uppercase):
1661 use explicit casts to remove compiler warnings.
1663 * src/support/LRegex.C (Impl):
1664 * src/support/StrPool.C (add):
1665 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1666 (AddPath, MakeDisplayPath):
1667 * src/support/lstrings.C (prefixIs, subst):
1668 use correct type to remove compiler warnings.
1670 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1672 * src/support/lyxlib.h:
1673 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1674 portability and to remove compiler warning with DEC cxx.
1676 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1678 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1680 * src/minibuffer.C (peek_event): retun 1 when there has been a
1681 mouseclick in the minibuffer.
1685 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1687 * src/frontends/xforms/FormParagraph.C: more space above/below
1690 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1692 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1693 a char only if real_current_font was changed.
1695 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1697 * NEWS: update somewhat for 1.1.6
1699 * lib/ui/default.ui: clean up.
1701 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1703 * lib/CREDITS: clean up
1705 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1707 * src/combox.[Ch] (select): changed argument back to int
1708 * src/combox.C (peek_event): removed num_bytes as it is declared but
1711 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1712 modified calls to Combox::select() to remove warnings about type
1715 * src/insets/insetbutton.C (width): explicit cast to remove warning
1716 about type conversion.
1718 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1721 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1722 sel_pos_end, refering to cursor position are changed to
1723 LyXParagraph::size_type.
1725 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1726 consistent with LyXCursor::pos().
1727 (inset_pos): changed to LyXParagraph::size_type for same reason.
1729 * src/insets/insettext.C (resizeLyXText): changed some temporary
1730 variables refing to cursor position to LyXParagraph::size_type.
1732 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1734 * src/frontends/kde/<various>: The Great Renaming,
1737 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1739 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1741 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1743 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1744 0 when there are no arguments.
1746 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1748 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1749 to segfaults when pressing Ok in InsetBibtex dialog.
1751 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1753 * forms/layout_forms.fd:
1754 * src/layout_forms.C (create_form_form_character): small change to use
1755 labelframe rather than engraved frame + text
1757 * src/lyx_gui.C (create_forms): initialise choice_language with some
1758 arbitrary value to prevent segfault when dialog is shown.
1760 2000-10-16 Baruch Even <baruch.even@writeme.com>
1762 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1763 is no resulting file. This pertains only to LaTeX output.
1765 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1767 * src/text.C (Backspace): Make sure that the row of the cursor is
1770 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1773 * src/lyx_gui.C (init): Prevent a crash when only one font from
1774 menu/popup fonts is not found.
1776 * lib/lyxrc.example: Add an example for binding a key for language
1779 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1781 * src/converter.C (GetReachable): Changed the returned type to
1783 (IsReachable): New method
1785 * src/MenuBackend.C (expand): Handle formats that appear more
1788 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1790 * src/frontends/support/Makefile.am
1791 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1794 * lib/CREDITS: add Garst Reese.
1796 * src/support/snprintf.h: add extern "C" {} around the definitions.
1798 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1800 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1803 * src/frontends/xforms/FormDocument.C:
1804 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1805 compile without "conversion to integral type of smaller size"
1808 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1810 * src/text.C (GetColumnNearX): Fixed disabled code.
1812 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1814 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1817 * src/support/snprintf.[ch]: new files
1819 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1821 * src/frontends/kde/formprintdialog.C: add
1822 file browser for selecting postscript output
1824 * src/frontends/kde/formprintdialogdata.C:
1825 * src/frontends/kde/formprintdialogdata.h: re-generate
1828 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1830 * src/frontends/gnome/Makefile.am:
1831 * src/frontends/kde/Makefile.am: FormCommand.C
1832 disappeared from xforms
1834 * src/frontends/kde/FormCitation.C:
1835 * src/frontends/kde/FormIndex.C: read-only
1838 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1840 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1843 * src/bufferlist.C: add using directive.
1845 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1847 * src/support/lyxfunctional.h: version of class_fun for void
1848 returns added, const versions of back_inseter_fun and compare_fun
1851 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1853 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1855 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1857 * ChangeLog: cleanup.
1859 * lib/CREDITS: update to add all the contributors we've forgotten.
1860 I have obviously missed some, so tell me whether there were
1863 2000-10-13 Marko Vendelin <markov@ioc.ee>
1865 * src/frontends/gnome/FormCitation.C
1866 * src/frontends/gnome/FormCitation.h
1867 * src/frontends/gnome/FormError.C
1868 * src/frontends/gnome/FormIndex.C
1869 * src/frontends/gnome/FormRef.C
1870 * src/frontends/gnome/FormRef.h
1871 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1873 * src/frontends/gnome/FormCitation.C
1874 * src/frontends/gnome/FormCopyright.C
1875 * src/frontends/gnome/FormError.C
1876 * src/frontends/gnome/FormIndex.C
1877 * src/frontends/gnome/FormRef.C
1878 * src/frontends/gnome/FormToc.C
1879 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1882 * src/frontends/gnome/Menubar_pimpl.C
1883 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1886 2000-10-11 Baruch Even <baruch.even@writeme.com>
1889 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1890 to convey its real action.
1892 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1893 clear the minibuffer and prepare to enter a command.
1895 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1896 the rename from ExecCommand to PrepareForCommand.
1897 * src/lyxfunc.C (Dispatch): ditto.
1899 2000-10-11 Baruch Even <baruch.even@writeme.com>
1901 * src/buffer.C (writeFile): Added test for errors on writing, this
1902 catches all errors and not only file system full errors as intended.
1904 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1906 * src/lyx_gui.C (create_forms): better fix for crash with
1907 translated interface.
1909 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1911 * src/frontends/kde/Makefile.am:
1912 * src/frontends/kde/FormCopyright.C:
1913 * src/frontends/kde/formcopyrightdialog.C:
1914 * src/frontends/kde/formcopyrightdialog.h:
1915 * src/frontends/kde/formcopyrightdialogdata.C:
1916 * src/frontends/kde/formcopyrightdialogdata.h:
1917 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1918 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1919 copyright to use qtarch
1921 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1923 * src/encoding.C (read): Fixed bug that caused an error message at
1924 the end of the file.
1926 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1928 * lib/lyxrc.example: Fixed hebrew example.
1930 2000-10-13 Allan Rae <rae@lyx.org>
1932 * src/frontends/xforms/FormPreferences.C (input): reworking the
1934 (build, update, apply): New inputs in various tabfolders
1936 * src/frontends/xforms/FormToc.C: use new button policy.
1937 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1938 dialogs that either can't use any existing policy or where it just
1941 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1944 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1945 added a bool parameter which is ignored.
1947 * src/buffer.C (setReadonly):
1948 * src/BufferView_pimpl.C (buffer):
1949 * src/frontends/kde/FormCopyright.h (update):
1950 * src/frontends/kde/FormCitation.[Ch] (update):
1951 * src/frontends/kde/FormIndex.[Ch] (update):
1952 * src/frontends/kde/FormPrint.[Ch] (update):
1953 * src/frontends/kde/FormRef.[Ch] (update):
1954 * src/frontends/kde/FormToc.[Ch] (update):
1955 * src/frontends/kde/FormUrl.[Ch] (update):
1956 * src/frontends/gnome/FormCopyright.h (update):
1957 * src/frontends/gnome/FormCitation.[Ch] (update):
1958 * src/frontends/gnome/FormError.[Ch] (update):
1959 * src/frontends/gnome/FormIndex.[Ch] (update):
1960 * src/frontends/gnome/FormPrint.[Ch] (update):
1961 * src/frontends/gnome/FormRef.h (update):
1962 * src/frontends/gnome/FormToc.[Ch] (update):
1963 * src/frontends/gnome/FormUrl.[Ch] (update):
1964 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1965 to updateBufferDependent and DialogBase
1967 * src/frontends/xforms/FormCitation.[hC]:
1968 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1969 * src/frontends/xforms/FormError.[Ch]:
1970 * src/frontends/xforms/FormGraphics.[Ch]:
1971 * src/frontends/xforms/FormIndex.[Ch]:
1972 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1973 and fixed readOnly handling.
1974 * src/frontends/xforms/FormPrint.[Ch]:
1975 * src/frontends/xforms/FormRef.[Ch]:
1976 * src/frontends/xforms/FormTabular.[Ch]:
1977 * src/frontends/xforms/FormToc.[Ch]:
1978 * src/frontends/xforms/FormUrl.[Ch]:
1979 * src/frontends/xforms/FormInset.[Ch]:
1980 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1981 form of updateBufferDependent.
1983 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1984 if form()->visible just in case someone does stuff to the form in a
1987 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1988 the buttoncontroller for everything the enum used to be used for.
1989 (update) It would seem we need to force all dialogs to use a bool
1990 parameter or have two update functions. I chose to go with one.
1991 I did try removing update() from here and FormBase and defining the
1992 appropriate update signatures in FormBaseB[DI] but then ran into the
1993 problem of the update() call in FormBase::show(). Whatever I did
1994 to get around that would require another function and that just
1995 got more confusing. Hence the decision to make everyone have an
1996 update(bool). An alternative might have been to override show() in
1997 FormBaseB[DI] and that would allow the different and appropriate
2000 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2001 true == buffer change occurred. I decided against using a default
2002 template parameter since not all compilers support that at present.
2004 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2006 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2007 army knife" by removing functionality.
2008 (clearStore): removed. All such housekeeping on hide()ing the dialog
2009 is to be carried out by overloaded disconnect() methods.
2010 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2011 superceded by Baruch's neat test (FormGraphics) to update an existing
2012 dialog if a new signal is recieved rather than block all new signals
2014 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2015 only to Inset dialogs.
2016 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2017 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2019 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2021 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2022 as a base class to all inset dialogs. Used solely to connect/disconnect
2023 the Inset::hide signal and to define what action to take on receipt of
2024 a UpdateBufferDependent signal.
2025 (FormCommand): now derived from FormInset.
2027 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2030 * src/frontends/xforms/FormCopyright.[Ch]:
2031 * src/frontends/xforms/FormPreferences.[Ch]:
2032 now derived from FormBaseBI.
2034 * src/frontends/xforms/FormDocument.[Ch]:
2035 * src/frontends/xforms/FormParagraph.[Ch]:
2036 * src/frontends/xforms/FormPrint.[Ch]:
2037 now derived from FormBaseBD.
2039 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2041 * src/frontends/xforms/FormCitation.[Ch]:
2042 * src/frontends/xforms/FormError.[Ch]:
2043 * src/frontends/xforms/FormRef.[Ch]:
2044 * src/frontends/xforms/FormToc.[Ch]:
2045 (clearStore): reworked as disconnect().
2047 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2050 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2052 * src/converter.C (runLaTeX): constify buffer argument
2055 * src/frontends/support/Makefile.am (INCLUDES): fix.
2057 * src/buffer.h: add std:: qualifier
2058 * src/insets/figinset.C (addpidwait): ditto
2059 * src/MenuBackend.C: ditto
2060 * src/buffer.C: ditto
2061 * src/bufferlist.C: ditto
2062 * src/layout.C: ditto
2063 * src/lyxfunc.C: ditto
2065 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2067 * src/lyxtext.h (bidi_level): change return type to
2068 LyXParagraph::size_type.
2070 * src/lyxparagraph.h: change size_type to
2071 TextContainer::difference_type. This should really be
2072 TextContainer::size_type, but we need currently to support signed
2075 2000-10-11 Marko Vendelin <markov@ioc.ee>
2076 * src/frontends/gnome/FormError.h
2077 * src/frontends/gnome/FormRef.C
2078 * src/frontends/gnome/FormRef.h
2079 * src/frontends/gnome/FormError.C
2080 * src/frontends/gnome/Makefile.am
2081 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2082 to Gnome frontend. Both dialogs use "action" area.
2084 2000-10-12 Baruch Even <baruch.even@writeme.com>
2086 * src/graphics/GraphicsCacheItem_pimpl.C:
2087 * src/graphics/Renderer.C:
2088 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2091 2000-10-12 Juergen Vigna <jug@sad.it>
2093 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2094 visible when selecting).
2096 * development/Code_rules/Rules: fixed some typos.
2098 2000-10-09 Baruch Even <baruch.even@writeme.com>
2100 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2101 compiling on egcs 1.1.2 possible.
2103 * src/filedlg.C (comp_direntry::operator() ): ditto.
2105 2000-08-31 Baruch Even <baruch.even@writeme.com>
2107 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2110 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2111 transient it now only gets freed when the object is destructed.
2113 2000-08-24 Baruch Even <baruch.even@writeme.com>
2115 * src/frontends/FormGraphics.h:
2116 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2119 2000-08-20 Baruch Even <baruch.even@writeme.com>
2121 * src/insets/insetgraphics.C:
2122 (draw): Added messages to the drawn rectangle to report status.
2123 (updateInset): Disabled the use of the inline graphics,
2126 2000-08-17 Baruch Even <baruch.even@writeme.com>
2128 * src/frontends/support: Directory added for the support of GUII LyX.
2130 * src/frontends/support/LyXImage.h:
2131 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2134 * src/frontends/support/LyXImage_X.h:
2135 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2136 version of LyXImage, this uses the Xlib Pixmap.
2138 * src/PainterBase.h:
2139 * src/PainterBase.C:
2141 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2142 replacement to Pixmap.
2144 * src/insets/insetgraphics.h:
2145 * src/insets/insetgraphics.C:
2146 * src/graphics/GraphicsCacheItem.h:
2147 * src/graphics/GraphicsCacheItem.C:
2148 * src/graphics/GraphicsCacheItem_pimpl.h:
2149 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2152 * src/graphics/GraphicsCacheItem.h:
2153 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2154 another copy of the object.
2156 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2157 of cacheHandle, this fixed a bug that sent LyX crashing.
2159 * src/graphics/XPM_Renderer.h:
2160 * src/graphics/XPM_Renderer.C:
2161 * src/graphics/EPS_Renderer.h:
2162 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2164 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2166 * src/lyxfunc.C (processKeySym): only handle the
2167 lockinginset/inset stuff if we have a buffer and text loaded...
2169 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2171 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2173 * src/support/lyxfunctional.h: add operator= that takes a reference
2175 * src/lyxserver.C (mkfifo): make first arg const
2177 * src/layout.h: renamed name(...) to setName(...) to work around
2180 * src/buffer.C (setFileName): had to change name of function to
2181 work around bugs in egcs. (renamed from fileName)
2183 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2185 * src/support/translator.h: move helper template classes to
2186 lyxfunctional.h, include "support/lyxfunctional.h"
2188 * src/support/lyxmanip.h: add delaration of fmt
2190 * src/support/lyxfunctional.h: new file
2191 (class_fun_t): new template class
2192 (class_fun): helper template function
2193 (back_insert_fun_iterator): new template class
2194 (back_inserter_fun): helper template function
2195 (compare_memfun_t): new template class
2196 (compare_memfun): helper template function
2197 (equal_1st_in_pair): moved here from translator
2198 (equal_2nd_in_pair): moved here from translator
2200 * src/support/fmt.C: new file
2201 (fmt): new func, can be used for a printf substitute when still
2202 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2204 * src/support/StrPool.C: add some comments
2206 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2209 * src/insets/figinset.C (addpidwait): use std::copy with
2210 ostream_iterator to fill the pidwaitlist
2212 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2214 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2217 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2220 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2222 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2223 (class_update): ditto
2224 (BulletPanel): ditto
2225 (CheckChoiceClass): move initialization of tc and tct
2227 * src/tabular.C: remove current_view
2228 (OldFormatRead): similar to right below [istream::ignore]
2230 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2231 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2232 unused [istream::ignore]
2234 * src/lyxfunc.C: include "support/lyxfunctional.h"
2235 (getInsetByCode): use std::find_if and compare_memfun
2237 * src/lyxfont.C (stateText): remove c_str()
2239 * src/lyx_main.C (setDebuggingLevel): make static
2240 (commandLineHelp): make static
2242 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2243 Screen* together with fl_get_display() and fl_screen
2245 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2246 togheter with fl_get_display() and fl_screen
2247 (create_forms): remove c_str()
2249 * src/layout.C: include "support/lyxfunctional.h"
2250 (hasLayout): use std::find_if and compare_memfun
2251 (GetLayout): use std::find_if and comapre_memfun
2252 (delete_layout): use std::remove_if and compare_memfun
2253 (NumberOfClass): use std:.find_if and compare_memfun
2255 * src/gettext.h: change for the new functions
2257 * src/gettext.C: new file, make _(char const * str) and _(string
2258 const & str) real functions.
2260 * src/font.C (width): rewrite slightly to avoid one extra variable
2262 * src/debug.C: initialize Debug::ANY here
2264 * src/commandtags.h: update number comments
2266 * src/combox.h (get): make const func
2268 (getline): make const
2270 * src/combox.C (input_cb): handle case where fl_get_input can
2273 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2274 "support/lyxfunctional.h", remove current_view variable.
2275 (resize): use std::for_each with std::mem_fun
2276 (getFileNames): use std::copy with back_inserter_fun
2277 (getBuffer): change arg type to unsigned int
2278 (emergencyWriteAll): call emergencyWrite with std::for_each and
2280 (emergencyWrite): new method, the for loop in emergencyWriteAll
2282 (exists): use std::find_if with compare_memfun
2283 (getBuffer): use std::find_if and compare_memfun
2285 * src/buffer.h: add typedefs for iterator_category, value_type
2286 difference_type, pointer and reference for inset_iterator
2287 add postfix ++ for inset_iterator
2288 make inset_iterator::getPos() const
2290 * src/buffer.C: added support/lyxmanip.h
2291 (readFile): use lyxerr << fmt instead of printf
2292 (makeLaTeXFile): use std::copy to write out encodings
2294 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2296 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2297 free and the char * temp.
2298 (hasMenu): use std::find_if and compare_memfun
2301 * src/Makefile.am (lyx_SOURCES): added gettext.C
2303 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2304 string::insert small change to avoid temporary
2306 * src/LColor.C (getGUIName): remove c_str()
2308 * several files: change all occurrences of fl_display to
2311 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2312 that -pedantic is not used for gcc 2.97 (cvs gcc)
2314 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2316 2000-10-11 Allan Rae <rae@lyx.org>
2318 * src/frontends/xforms/FormPreferences.C (input): template path must be
2319 a readable directory. It doesn't need to be writeable.
2320 (build, delete, update, apply): New inputs in the various tabfolders
2322 * src/frontends/xforms/forms/form_preferences.fd:
2323 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2324 several new entries to existing folders. Shuffled some existing stuff
2327 * src/frontends/xforms/forms/form_print.fd:
2328 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2329 Should probably rework PrinterParams as well. Note that the switch to
2330 collated is effectively the same as !unsorted so changing PrinterParams
2331 will require a lot of fiddly changes to reverse the existing logic.
2333 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2335 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2337 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2339 2000-10-10 Allan Rae <rae@lyx.org>
2342 * src/lyxfunc.C (Dispatch):
2344 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2347 * src/lyxrc.C (output): Only write the differences between system lyxrc
2348 and the users settings.
2351 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2353 I'll rewrite this later, after 1.1.6 probably, to keep a single
2354 LyXRC but two instances of a LyXRCStruct.
2356 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2358 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2360 * src/tabular.h: add a few std:: qualifiers.
2362 * src/encoding.C: add using directive.
2363 * src/language.C: ditto.
2365 * src/insets/insetquotes.C (Validate): use languages->lang()
2366 instead of only language.
2368 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2370 * lib/languages: New file.
2372 * lib/encodings: New file.
2374 * src/language.C (Languages): New class.
2375 (read): New method. Reads the languages from the 'languages' file.
2377 * src/encoding.C (Encodings): New class.
2378 (read): New method. Reads the encodings from the 'encodings' file.
2380 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2383 * src/bufferparams.h and a lot of files: Deleted the member language,
2384 and renamed language_info to language
2386 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2387 * src/lyxfont.C (latexWriteStartChanges): ditto.
2388 * src/paragraph.C (validate,TeXOnePar): ditto.
2390 * src/lyxfont.C (update): Restored deleted code.
2392 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2394 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2396 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2398 * src/insets/figinset.[Ch]:
2399 * src/insets/insetinclude.[Ch]:
2400 * src/insets/insetinclude.[Ch]:
2401 * src/insets/insetparent.[Ch]:
2402 * src/insets/insetref.[Ch]:
2403 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2405 * src/insets/*.[Ch]:
2406 * src/mathed/formula.[Ch]:
2407 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2409 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2410 * src/lyx_cb.C (FigureApplyCB):
2411 * src/lyxfunc.C (getStatus, Dispatch):
2412 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2415 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2417 * src/converter.[Ch] (Formats::View):
2418 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2420 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2421 *current_view->buffer(). This will change later, but this patch is way
2424 2000-10-09 Juergen Vigna <jug@sad.it>
2426 * src/text.C (GetRow): small fix.
2428 * src/BufferView_pimpl.C (cursorPrevious):
2429 (cursorNext): added LyXText parameter to function.
2431 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2432 keypress depending on cursor position.
2434 2000-10-06 Juergen Vigna <jug@sad.it>
2436 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2437 (copySelection): redone this function and also copy ascii representa-
2440 * src/tabular.C (Ascii):
2444 (print_n_chars): new functions to realize the ascii export of tabulars.
2446 2000-10-05 Juergen Vigna <jug@sad.it>
2448 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2449 if we don't have a buffer.
2451 2000-10-10 Allan Rae <rae@lyx.org>
2453 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2454 with closing dialog. It seems that nested tabfolders require hiding
2455 of inner tabfolders before hiding the dialog itself. Actually all I
2456 did was hide the active outer folder.
2458 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2459 unless there really is a buffer. hideBufferDependent is called
2462 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2463 POTFILES.in stays in $(srcdir).
2465 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2467 * lib/lyxrc.example: Few changes.
2469 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2471 * src/BufferView_pimpl.C (buffer): only need one the
2472 updateBufferDependent signal to be emitted once! Moved to the end of
2473 the method to allow bv_->text to be updated first.
2475 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2476 and hSignal_ with Dialogs * and BufferDependency variables.
2477 New Buffer * parent_, initialised when the dialog is launched. Used to
2478 check whether to update() or hide() dialog in the new, private
2479 updateOrHide() method that is connected to the updateBufferDependent
2480 signal. Daughter classes dictate what to do using the
2481 ChangedBufferAction enum, passed to the c-tor.
2483 * src/frontends/xforms/FormCitation.C:
2484 * src/frontends/xforms/FormCommand.C:
2485 * src/frontends/xforms/FormCopyright.C:
2486 * src/frontends/xforms/FormDocument.C:
2487 * src/frontends/xforms/FormError.C:
2488 * src/frontends/xforms/FormIndex.C:
2489 * src/frontends/xforms/FormPreferences.C:
2490 * src/frontends/xforms/FormPrint.C:
2491 * src/frontends/xforms/FormRef.C:
2492 * src/frontends/xforms/FormToc.C:
2493 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2496 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2497 ChangedBufferAction enum.
2499 * src/frontends/xforms/FormParagraph.[Ch]
2500 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2503 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2505 * lib/bind/cua.bind: fix a bit.
2506 * lib/bind/emacs.bind: ditto.
2508 * lib/bind/menus.bind: remove real menu entries from there.
2510 * src/spellchecker.C: make sure we only include strings.h when
2513 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2515 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2516 function. It enlarges the maximum number of pup when needed.
2517 (add_toc2): Open a new menu if maximum number of items per menu has
2520 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2522 * src/frontends/kde/FormPrint.C: fix error reporting
2524 * src/frontends/xforms/FormDocument.C: fix compiler
2527 * lib/.cvsignore: add Literate.nw
2529 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2532 * bufferview_funcs.[Ch]
2535 * text2.C: Add support for numbers in RTL text.
2537 2000-10-06 Allan Rae <rae@lyx.org>
2539 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2540 to be gettext.m4 friendly again. ext_l10n.h is now
2541 generated into $top_srcdir instead of $top_builddir
2542 so that lyx.pot will be built correctly -- without
2543 duplicate parsing of ext_l10n.h.
2545 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2547 * src/frontends/kde/FormCitation.C: make the dialog
2548 behave more sensibly
2550 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2552 * config/kde.m4: fix consecutive ./configure runs,
2553 look for qtarch, fix library order
2555 * src/frontends/kde/Makefile.am: tidy up,
2556 add Print dialog, add .dlg dependencies
2558 * src/frontends/kde/FormPrint.C:
2559 * src/frontends/kde/FormPrint.h:
2560 * src/frontends/kde/formprintdialog.C:
2561 * src/frontends/kde/formprintdialog.h:
2562 * src/frontends/kde/formprintdialogdata.C:
2563 * src/frontends/kde/formprintdialogdata.h:
2564 * src/frontends/kde/dlg/formprintdialog.dlg: add
2567 * src/frontends/kde/dlg/README: Added explanatory readme
2569 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2570 script to double-check qtarch's output
2572 * src/frontends/kde/formindexdialog.C:
2573 * src/frontends/kde/formindexdialogdata.C:
2574 * src/frontends/kde/formindexdialogdata.h:
2575 * src/frontends/kde/dlg/formindexdialog.dlg: update
2576 for qtarch, minor fixes
2578 2000-10-05 Allan Rae <rae@lyx.org>
2580 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2581 dialogs when switching buffers update them instead. It's up to each
2582 dialog to decide if it should still be visible or not.
2583 update() should return a bool to control visiblity within show().
2584 Or perhaps better to set a member variable and use that to control
2587 * lib/build-listerrors: create an empty "listerrors" file just to stop
2588 make trying to regenerate it all the time if you don't have noweb
2591 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2593 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2594 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2595 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2596 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2597 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2599 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2601 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2603 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2604 deleting buffer. Closes all buffer-dependent dialogs.
2606 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2608 * src/frontends/xforms/FormCitation.[Ch]:
2609 * src/frontends/xforms/FormPreferences.[Ch]:
2610 * src/frontends/xforms/FormPrint.[Ch]:
2611 * src/frontends/xforms/FormRef.[Ch]:
2612 * src/frontends/xforms/FormUrl.[Ch]: ditto
2614 * src/frontends/xforms/FormDocument.[Ch]:
2615 * src/frontends/xforms/forms/form_document.C.patch:
2616 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2617 pass through a single input() function.
2619 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2621 * lib/build-listerrors: return status as OK
2623 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2625 * lib/lyxrc.example: Updated to new export code
2627 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2629 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2632 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2635 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2636 LyX-Code is defined.
2637 * lib/layouts/amsbook.layout: ditto.
2639 * boost/Makefile.am: fix typo.
2641 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2643 (add_lastfiles): removed.
2644 (add_documents): removed.
2645 (add_formats): removed.
2647 * src/frontends/Menubar.C: remove useless "using" directive.
2649 * src/MenuBackend.h: add a new MenuItem constructor.
2651 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2654 2000-10-04 Allan Rae <rae@lyx.org>
2656 * lib/Makefile.am (listerrors):
2657 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2658 I haven't got notangle installed so Kayvan please test. The output
2659 should end up in $builddir. This also allows people who don't have
2660 noweb installed to complete the make process without error.
2662 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2663 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2664 by JMarc's picky compiler.
2666 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2669 * src/insets/insettabular.C (setPos): change for loop to not use
2670 sequencing operator. Please check this Jürgen.
2672 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2674 * src/insets/insetcite.C (getScreenLabel): ditto
2675 * src/support/filetools.C (QuoteName): ditto
2676 (ChangeExtension): ditto
2678 * src/BufferView_pimpl.C (scrollCB): make heigt int
2680 * src/BufferView2.C (insertInset): comment out unused arg
2682 * boost/Makefile.am (EXTRADIST): new variable
2684 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2686 * src/exporter.C (IsExportable): Fixed
2688 * lib/configure.m4: Small fix
2690 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2692 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2693 * src/insets/insetbib.C (bibitemWidest): ditto.
2694 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2696 2000-10-03 Juergen Vigna <jug@sad.it>
2698 * src/BufferView2.C (theLockingInset): removed const because of
2699 Agnus's compile problems.
2701 * src/insets/insettext.C (LocalDispatch): set the language of the
2702 surronding paragraph on inserting the first character.
2704 * various files: changed use of BufferView::the_locking_inset.
2706 * src/BufferView2.C (theLockingInset):
2707 (theLockingInset): new functions.
2709 * src/BufferView.h: removed the_locking_inset.
2711 * src/lyxtext.h: added the_locking_inset
2713 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2715 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2717 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2719 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2720 * src/mathed/math_cursor.C (IsAlpha): ditto.
2721 * src/mathed/math_inset.C (strnew): ditto.
2722 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2723 (IMetrics): cxp set but never used; removed.
2724 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2725 that the variable in question has been removed also!
2728 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2729 using the Buffer * passed to Latex(), using the BufferView * passed to
2730 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2732 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2733 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2735 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2736 * src/buffer.C (readInset): used new InsetBibtex c-tor
2737 * (getBibkeyList): used new InsetBibtex::getKeys
2739 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2742 * lib/build-listerrors
2744 * src/exporter.C: Add literate programming support to the export code
2747 * src/lyx_cb.C: Remove old literate code.
2749 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2752 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2753 * src/converter.C (View, Convert): Use QuoteName.
2755 * src/insets/figinset.C (Preview): Use Formats::View.
2757 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2759 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2761 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2762 the top of the function, because compaq cxx complains that the
2763 "goto exit_with_message" when the function is disabled bypasses
2765 (MenuNew): try a better fix for the generation of new file names.
2766 This time, I used AddName() instead of AddPath(), hoping Juergen
2769 2000-10-03 Allan Rae <rae@lyx.org>
2771 * src/frontends/xforms/forms/form_preferences.fd:
2772 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2773 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2774 "Look and Feel"->"General" but will need to be split up further into
2775 general output and general input tabs. Current plan is for four outer
2776 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2777 stuff; "Inputs" for input and import configuration; "Outputs" for
2778 output and export configuration; and one more whatever is left over
2779 called "General". The leftovers at present look like being which
2780 viewers to use, spellchecker, language support and might be better
2781 named "Support". I've put "Paths" in "Inputs" for the moment as this
2782 seems reasonable for now at least.
2783 One problem remains: X error kills LyX when you close Preferences.
2785 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2787 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2788 qualifier from form()
2789 * src/frontends/xforms/FormCitation.[Ch]:
2790 * src/frontends/xforms/FormCopyright.[Ch]:
2791 * src/frontends/xforms/FormDocument.[Ch]:
2792 * src/frontends/xforms/FormError.[Ch]:
2793 * src/frontends/xforms/FormIndex.[Ch]:
2794 * src/frontends/xforms/FormPreferences.[Ch]:
2795 * src/frontends/xforms/FormPrint.[Ch]:
2796 * src/frontends/xforms/FormRef.[Ch]:
2797 * src/frontends/xforms/FormToc.[Ch]:
2798 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2800 * src/frontends/xforms/FormCitation.[Ch]:
2801 * src/frontends/xforms/FormIndex.[Ch]:
2802 * src/frontends/xforms/FormRef.[Ch]:
2803 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2804 with Allan's naming policy
2806 * src/frontends/xforms/FormCitation.C: some static casts to remove
2809 2000-10-02 Juergen Vigna <jug@sad.it>
2811 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2812 now you can type or do stuff inside the table-cell also when in dummy
2813 position, fixed visible cursor.
2815 * src/insets/insettext.C (Edit): fixing cursor-view position.
2817 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2818 be used for equal functions in lyxfunc and insettext.
2820 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2822 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2824 * src/frontends/gnome/FormCitation.h:
2825 * src/frontends/gnome/FormCopyright.h:
2826 * src/frontends/gnome/FormIndex.h:
2827 * src/frontends/gnome/FormPrint.h:
2828 * src/frontends/gnome/FormToc.h:
2829 * src/frontends/gnome/FormUrl.h:
2830 * src/frontends/kde/FormCitation.h:
2831 * src/frontends/kde/FormCopyright.h:
2832 * src/frontends/kde/FormIndex.h:
2833 * src/frontends/kde/FormRef.h:
2834 * src/frontends/kde/FormToc.h:
2835 * src/frontends/kde/FormUrl.h: fix remaining users of
2838 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2840 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2841 from depth argument.
2842 (DocBookHandleCaption): ditto.
2843 (DocBookHandleFootnote): ditto.
2844 (SimpleDocBookOnePar): ditto.
2846 * src/frontends/xforms/FormDocument.h (form): remove extra
2847 FormDocument:: qualifier.
2849 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2851 * sigc++/handle.h: ditto.
2853 * src/lyx_gui_misc.C: add "using" directive.
2855 * src/cheaders/cstddef: new file, needed by the boost library (for
2858 2000-10-02 Juergen Vigna <jug@sad.it>
2860 * src/insets/insettext.C (SetFont): better support.
2862 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2864 * src/screen.C (DrawOneRow): some uint refixes!
2866 2000-10-02 Allan Rae <rae@lyx.org>
2868 * boost/.cvsignore: ignore Makefile as well
2870 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2871 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2873 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2874 Left this one out by accident.
2876 * src/frontends/xforms/FormBase.h (restore): default to calling
2877 update() since that will restore the original/currently-applied values.
2878 Any input() triggered error messages will require the derived classes
2879 to redefine restore().
2881 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2882 avoid a segfault. combo_doc_class is the main concern.
2884 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2886 * Simplify build-listerrors in view of GUI-less export ability!
2888 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2890 * src/lyx_main.C (easyParse): Disable gui when exporting
2892 * src/insets/figinset.C:
2895 * src/lyx_gui_misc.C
2896 * src/tabular.C: Changes to allow no-gui.
2898 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2900 * src/support/utility.hpp: removed file
2901 * src/support/block.h: removed file
2903 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2906 * src/mathed/formula.C: add support/lyxlib.h
2907 * src/mathed/formulamacro.C: ditto
2909 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2910 * src/lyxparagraph.h: ditto
2912 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2913 * src/frontends/Makefile.am (INCLUDES): ditto
2914 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2915 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2916 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2917 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2918 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2919 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2921 * src/BufferView.h: use boost/utility.hpp
2922 * src/LColor.h: ditto
2923 * src/LaTeX.h: ditto
2924 * src/LyXAction.h: ditto
2925 * src/LyXView.h: ditto
2926 * src/bufferlist.h: ditto
2927 * src/lastfiles.h: ditto
2928 * src/layout.h: ditto
2929 * src/lyx_gui.h: ditto
2930 * src/lyx_main.h: ditto
2931 * src/lyxlex.h: ditto
2932 * src/lyxrc.h: ditto
2933 * src/frontends/ButtonPolicies.h: ditto
2934 * src/frontends/Dialogs.h: ditto
2935 * src/frontends/xforms/FormBase.h: ditto
2936 * src/frontends/xforms/FormGraphics.h: ditto
2937 * src/frontends/xforms/FormParagraph.h: ditto
2938 * src/frontends/xforms/FormTabular.h: ditto
2939 * src/graphics/GraphicsCache.h: ditto
2940 * src/graphics/Renderer.h: ditto
2941 * src/insets/ExternalTemplate.h: ditto
2942 * src/insets/insetcommand.h: ditto
2943 * src/support/path.h: ditto
2945 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2946 and introduce clause for 2.97.
2948 * boost/libs/README: new file
2950 * boost/boost/utility.hpp: new file
2952 * boost/boost/config.hpp: new file
2954 * boost/boost/array.hpp: new file
2956 * boost/Makefile.am: new file
2958 * boost/.cvsignore: new file
2960 * configure.in (AC_OUTPUT): add boost/Makefile
2962 * Makefile.am (SUBDIRS): add boost
2964 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2966 * src/support/lstrings.C (suffixIs): Fixed.
2968 2000-10-01 Allan Rae <rae@lyx.org>
2970 * src/PrinterParams.h: moved things around to avoid the "can't
2971 inline call" warning.
2973 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2974 into doc++ documentation.
2976 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2978 * src/frontends/xforms/FormRef.C: make use of button controller
2979 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2980 cleaned up button controller usage.
2981 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2982 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2983 use the button controller
2985 * src/frontends/xforms/forms/*.fd: and associated generated files
2986 updated to reflect changes to FormBase. Some other FormXxxx files
2987 also got minor updates to reflect changes to FormBase.
2989 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2990 (hide): made virtual.
2991 (input): return a bool. true == valid input
2992 (RestoreCB, restore): new
2993 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2994 Changes to allow derived dialogs to use a ButtonController and
2995 make sense when doing so: OK button calls ok() and so on.
2997 * src/frontends/xforms/ButtonController.h (class ButtonController):
2998 Switch from template implementation to taking Policy parameter.
2999 Allows FormBase to provide a ButtonController for any dialog.
3001 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3002 Probably should rename connect and disconnect.
3003 (apply): use the radio button groups
3004 (form): needed by FormBase
3005 (build): setup the radio button groups
3007 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3009 * several files: type changes to reduce the number of warnings and
3010 to unify type hangling a bit. Still much to do.
3012 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3014 * lib/images/*: rename a bunch of icons to match Dekel converter
3017 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3020 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3022 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3024 * sigc++/handle.h: ditto for class Handle.
3026 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3028 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3030 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3032 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3033 removal of the "default" language.
3035 * src/combox.h (getline): Check that sel > 0
3037 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3039 * lib/examples/docbook_example.lyx
3040 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3042 * lib/layouts/docbook-book.layout: new docbook book layout.
3044 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3046 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3048 * src/insets/figinset.C (DocBook):fixed small typo.
3050 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3052 * src/insets/insetinclude.h: string include_label doesn't need to be
3055 2000-09-29 Allan Rae <rae@lyx.org>
3057 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3058 Allow derived type to control connection and disconnection from signals
3059 of its choice if desired.
3061 2000-09-28 Juergen Vigna <jug@sad.it>
3063 * src/insets/insettabular.C (update): fixed cursor setting when
3064 the_locking_inset changed.
3065 (draw): made this a bit cleaner.
3066 (InsetButtonPress): fixed!
3068 * various files: added LyXText Parameter to fitCursor call.
3070 * src/BufferView.C (fitCursor): added LyXText parameter.
3072 * src/insets/insettabular.C (draw): small draw fix.
3074 * src/tabular.C: right setting of left/right celllines.
3076 * src/tabular.[Ch]: fixed various types in funcions and structures.
3077 * src/insets/insettabular.C: ditto
3078 * src/frontends/xforms/FormTabular.C: ditto
3080 2000-09-28 Allan Rae <rae@lyx.org>
3082 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3083 that the #ifdef's had been applied to part of what should have been
3084 a complete condition. It's possible there are other tests that
3085 were specific to tables that are also wrong now that InsetTabular is
3086 being used. Now we need to fix the output of '\n' after a table in a
3087 float for the same reason as the original condition:
3088 "don't insert this if we would be adding it before or after a table
3089 in a float. This little trick is needed in order to allow use of
3090 tables in \subfigures or \subtables."
3091 Juergen can you check this?
3093 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3095 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3096 output to the ostream.
3098 * several files: fixed types based on warnings from cxx
3100 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3102 * src/frontends/kde/Makefile.am: fix rule for
3103 formindexdialogdata_moc.C
3105 * src/.cvsignore: add ext_l10n.h to ignore
3107 * acconfig.h: stop messing with __STRICT_ANSI__
3108 * config/gnome.m4: remove option to set -ansi
3109 * config/kde.m4: remove option to set -ansi
3110 * config/lyxinclude.m4: don't set -ansi
3112 2000-09-27 Juergen Vigna <jug@sad.it>
3114 * various files: remove "default" language check.
3116 * src/insets/insetquotes.C: removed use of current_view.
3118 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3119 the one should have red ears by now!
3121 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3122 in more then one paragraph. Fixed cursor-movement/selection.
3124 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3125 paragraphs inside a text inset.
3127 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3128 text-inset if this owner is an inset.
3130 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3132 * src/Bullet.h: changed type of font, character and size to int
3134 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3136 * src/insets/inseturl.[Ch]:
3137 * src/insets/insetref.[Ch]:
3138 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3140 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3142 * src/buffer.C (readFile): block-if statement rearranged to minimise
3143 bloat. Patch does not reverse Jean-Marc's change ;-)
3145 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3146 Class rewritten to store pointers to hide/update signals directly,
3147 rather than Dialogs *. Also defined an enum to ease use. All xforms
3148 forms can now be derived from this class.
3150 * src/frontends/xforms/FormCommand.[Ch]
3151 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3153 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3156 * src/frontends/xforms/forms/form_citation.fd
3157 * src/frontends/xforms/forms/form_copyright.fd
3158 * src/frontends/xforms/forms/form_error.fd
3159 * src/frontends/xforms/forms/form_index.fd
3160 * src/frontends/xforms/forms/form_ref.fd
3161 * src/frontends/xforms/forms/form_toc.fd
3162 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3164 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3166 * src/insets/insetfoot.C: removed redundent using directive.
3168 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3170 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3171 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3173 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3174 created in the constructors in different groups. Then set() just
3175 have to show the groups as needed. This fixes the redraw problems
3176 (and is how the old menu code worked).
3178 * src/support/lyxlib.h: declare the methods as static when we do
3179 not have namespaces.
3181 2000-09-26 Juergen Vigna <jug@sad.it>
3183 * src/buffer.C (asciiParagraph): new function.
3184 (writeFileAscii): new function with parameter ostream.
3185 (writeFileAscii): use now asciiParagraph.
3187 * various inset files: added the linelen parameter to the Ascii-func.
3189 * src/tabular.C (Write): fixed error in writing file introduced by
3190 the last changes from Lars.
3192 * lib/bind/menus.bind: removed not supported functions.
3194 * src/insets/insettext.C (Ascii): implemented this function.
3196 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3198 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3199 (Write): use of the write_attribute functions.
3201 * src/bufferlist.C (close): fixed reasking question!
3203 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3205 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3206 new files use the everwhere possible.
3209 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3210 src/log_form.C src/lyx.C:
3213 * src/buffer.C (runLaTeX): remove func
3215 * src/PaperLayout.C: removed file
3216 * src/ParagraphExtra.C: likewise
3217 * src/bullet_forms.C: likewise
3218 * src/bullet_forms.h: likewise
3219 * src/bullet_forms_cb.C: likewise
3221 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3222 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3225 * several files: remove all traces of the old fd_form_paragraph,
3226 and functions belonging to that.
3228 * several files: remove all traces of the old fd_form_document,
3229 and functions belonging to that.
3231 * several files: constify local variables were possible.
3233 * several files: remove all code that was dead when NEW_EXPORT was
3236 * several files: removed string::c_str in as many places as
3239 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3240 (e): be a bit more outspoken when patching
3241 (updatesrc): only move files if changed.
3243 * forms/layout_forms.h.patch: regenerated
3245 * forms/layout_forms.fd: remove form_document and form_paragraph
3246 and form_quotes and form_paper and form_table_options and
3247 form_paragraph_extra
3249 * forms/form1.fd: remove form_table
3251 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3252 the fdui->... rewrite. Update some comments to xforms 0.88
3254 * forms/bullet_forms.C.patch: removed file
3255 * forms/bullet_forms.fd: likewise
3256 * forms/bullet_forms.h.patch: likewise
3258 * development/Code_rules/Rules: added a section on switch
3259 statements. Updated some comment to xforms 0.88.
3261 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3263 * src/buffer.C (readFile): make sure that the whole version number
3264 is read after \lyxformat (even when it contains a comma)
3266 * lib/ui/default.ui: change shortcut of math menu to M-a.
3268 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3270 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3273 * src/LyXView.C (updateWindowTitle): show the full files name in
3274 window title, limited to 30 characters.
3276 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3277 When a number of characters has been given, we should not assume
3278 that the string is 0-terminated.
3280 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3281 calls (fixes some memory leaks)
3283 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3284 trans member on exit.
3286 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3288 * src/converter.C (GetReachable): fix typo.
3290 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3291 understand ',' instead of '.'.
3292 (GetInteger): rewrite to use strToInt().
3294 2000-09-26 Juergen Vigna <jug@sad.it>
3296 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3297 better visibility and error-message on wrong VSpace input.
3299 * src/language.C (initL): added english again.
3301 2000-09-25 Juergen Vigna <jug@sad.it>
3303 * src/frontends/kde/Dialogs.C (Dialogs):
3304 * src/frontends/gnome/Dialogs.C (Dialogs):
3305 * src/frontends/kde/Makefile.am:
3306 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3308 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3310 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3312 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3314 * src/frontends/xforms/FormParagraph.C:
3315 * src/frontends/xforms/FormParagraph.h:
3316 * src/frontends/xforms/form_paragraph.C:
3317 * src/frontends/xforms/form_paragraph.h:
3318 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3321 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3323 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3324 Paragraph-Data after use.
3326 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3327 non breakable paragraphs.
3329 2000-09-25 Garst R. Reese <reese@isn.net>
3331 * src/language.C (initL): added missing language_country codes.
3333 2000-09-25 Juergen Vigna <jug@sad.it>
3335 * src/insets/insettext.C (InsetText):
3336 (deleteLyXText): remove the not released LyXText structure!
3338 2000-09-24 Marko Vendelin <markov@ioc.ee>
3340 * src/frontends/gnome/mainapp.C
3341 * src/frontends/gnome/mainapp.h: added support for keyboard
3344 * src/frontends/gnome/FormCitation.C
3345 * src/frontends/gnome/FormCitation.h
3346 * src/frontends/gnome/Makefile.am
3347 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3348 FormCitation to use "action area" in mainapp window
3350 * src/frontends/gnome/Menubar_pimpl.C
3351 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3354 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3356 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3357 width/descent/ascent values if name is empty.
3358 (mathed_string_height): Use std::max.
3360 2000-09-25 Allan Rae <rae@lyx.org>
3362 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3363 segfault. This will be completely redesigned soon.
3365 * sigc++: updated libsigc++. Fixes struct timespec bug.
3367 * development/tools/makeLyXsigc.sh: .cvsignore addition
3369 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3371 * several files: removed almost all traces of the old table
3374 * src/TableLayout.C: removed file
3376 2000-09-22 Juergen Vigna <jug@sad.it>
3378 * src/frontends/kde/Dialogs.C: added credits forms.
3380 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3382 * src/frontends/gnome/Dialogs.C: added some forms.
3384 * src/spellchecker.C (init_spell_checker): set language in pspell code
3385 (RunSpellChecker): some modifications for setting language string.
3387 * src/language.[Ch]: added language_country code.
3389 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3391 * src/frontends/Dialogs.h: added new signal showError.
3392 Rearranged existing signals in some sort of alphabetical order.
3394 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3395 FormError.[Ch], form_error.[Ch]
3396 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3397 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3399 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3400 dialogs. I think that this can be used as the base to all these
3403 * src/frontends/xforms/FormError.[Ch]
3404 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3405 implementation of InsetError dialog.
3407 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3409 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3410 * src/frontends/kde/Makefile.am: ditto
3412 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3414 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3415 macrobf. This fixes a bug of invisible text.
3417 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3419 * lib/doc/LaTeXConfig.lyx.in: updated.
3421 * src/language.C (initL): remove language "francais" and change a
3422 bit the names of the two other french variations.
3424 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3425 string that may not be 0-terminated.
3427 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3429 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3431 2000-09-20 Marko Vendelin <markov@ioc.ee>
3433 * src/frontends/gnome/FormCitation.C
3434 * src/frontends/gnome/FormIndex.C
3435 * src/frontends/gnome/FormToc.C
3436 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3437 the variable initialization to shut up the warnings
3439 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3441 * src/table.[Ch]: deleted files
3443 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3446 2000-09-18 Juergen Vigna <jug@sad.it>
3448 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3449 problems with selection. Inserted new LFUN_PASTESELECTION.
3450 (InsetButtonPress): inserted handling of middle mouse-button paste.
3452 * src/spellchecker.C: changed word to word.c_str().
3454 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3456 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3457 included in the ``make dist'' tarball.
3459 2000-09-15 Juergen Vigna <jug@sad.it>
3461 * src/CutAndPaste.C (cutSelection): small fix return the right
3462 end position after cut inside one paragraph only.
3464 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3465 we are locked as otherwise we don't have a valid cursor position!
3467 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3469 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3471 * src/frontends/kde/FormRef.C: added using directive.
3472 * src/frontends/kde/FormToc.C: ditto
3474 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3476 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3478 2000-09-19 Marko Vendelin <markov@ioc.ee>
3480 * src/frontends/gnome/Menubar_pimpl.C
3481 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3482 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3484 * src/frontends/gnome/mainapp.C
3485 * src/frontends/gnome/mainapp.h: support for menu update used
3488 * src/frontends/gnome/mainapp.C
3489 * src/frontends/gnome/mainapp.h: support for "action" area in the
3490 main window. This area is used by small simple dialogs, such as
3493 * src/frontends/gnome/FormIndex.C
3494 * src/frontends/gnome/FormIndex.h
3495 * src/frontends/gnome/FormUrl.C
3496 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3499 * src/frontends/gnome/FormCitation.C
3500 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3501 action area. Only "Insert new citation" is implemented.
3503 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3505 * src/buffer.C (Dispatch): fix call to Dispatch
3506 * src/insets/insetref.C (Edit): likewise
3507 * src/insets/insetparent.C (Edit): likewise
3508 * src/insets/insetinclude.C (include_cb): likewise
3509 * src/frontends/xforms/FormUrl.C (apply): likewise
3510 * src/frontends/xforms/FormToc.C (apply): likewise
3511 * src/frontends/xforms/FormRef.C (apply): likewise
3512 * src/frontends/xforms/FormIndex.C (apply): likewise
3513 * src/frontends/xforms/FormCitation.C (apply): likewise
3514 * src/lyxserver.C (callback): likewise
3515 * src/lyxfunc.C (processKeySym): likewise
3516 (Dispatch): likewise
3517 (Dispatch): likewise
3518 * src/lyx_cb.C (LayoutsCB): likewise
3520 * Makefile.am (sourcedoc): small change
3522 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3524 * src/main.C (main): Don't make an empty GUIRunTime object. all
3525 methods are static. constify a bit remove unneded using + headers.
3527 * src/tabular.C: some more const to local vars move some loop vars
3529 * src/spellchecker.C: added some c_str after some word for pspell
3531 * src/frontends/GUIRunTime.h: add new static method setDefaults
3532 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3533 * src/frontends/kde/GUIRunTime.C (setDefaults):
3534 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3536 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3537 with strnew in arg, use correct emptystring when calling SetName.
3539 * several files: remove all commented code with relation to
3540 HAVE_SSTREAM beeing false. We now only support stringstream and
3543 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3545 * src/lyxfunc.C: construct correctly the automatic new file
3548 * src/text2.C (IsStringInText): change type of variable i to shut
3551 * src/support/sstream.h: do not use namespaces if the compiler
3552 does not support them.
3554 2000-09-15 Marko Vendelin <markov@ioc.ee>
3555 * src/frontends/gnome/FormCitation.C
3556 * src/frontends/gnome/FormCitation.h
3557 * src/frontends/gnome/diainsertcitation_interface.c
3558 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3559 regexp support to FormCitation [Gnome].
3561 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3564 * configure.in: remove unused KDE/GTKGUI define
3566 * src/frontends/kde/FormRef.C
3567 * src/frontends/kde/FormRef.h
3568 * src/frontends/kde/formrefdialog.C
3569 * src/frontends/kde/formrefdialog.h: double click will
3570 go to reference, now it is possible to change a cross-ref
3573 * src/frontends/kde/FormToc.C
3574 * src/frontends/kde/FormToc.h
3575 * src/frontends/kde/formtocdialog.C
3576 * src/frontends/kde/formtocdialog.h: add a depth
3579 * src/frontends/kde/Makefile.am: add QtLyXView.h
3582 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3584 * src/frontends/kde/FormCitation.h: added some using directives.
3586 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3588 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3591 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3594 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3596 * src/buffer.C (pop_tag): revert for the second time a change by
3597 Lars, who seems to really hate having non-local loop variables :)
3599 * src/Lsstream.h: add "using" statements.
3601 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3602 * src/buffer.C (writeFile): ditto
3604 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3606 * src/buffer.C (writeFile): try to fix the locale modified format
3607 number to always be as we want it.
3609 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3610 in XForms 0.89. C-space is now working again.
3612 * src/Lsstream.h src/support/sstream.h: new files.
3614 * also commented out all cases where strstream were used.
3616 * src/Bullet.h (c_str): remove method.
3618 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3620 * a lot of files: get rid of "char const *" and "char *" is as
3621 many places as possible. We only want to use them in interaction
3622 with system of other libraries, not inside lyx.
3624 * a lot of files: return const object is not of pod type. This
3625 helps ensure that temporary objects is not modified. And fits well
3626 with "programming by contract".
3628 * configure.in: check for the locale header too
3630 * Makefile.am (sourcedoc): new tag for generation of doc++
3633 2000-09-14 Juergen Vigna <jug@sad.it>
3635 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3636 callback to check which combo called it and do the right action.
3638 * src/combox.C (combo_cb): added combo * to the callbacks.
3639 (Hide): moved call of callback after Ungrab of the pointer.
3641 * src/intl.h: removed LCombo2 function.
3643 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3644 function as this can now be handled in one function.
3646 * src/combox.h: added Combox * to callback prototype.
3648 * src/frontends/xforms/Toolbar_pimpl.C:
3649 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3651 2000-09-14 Garst Reese <reese@isn.net>
3653 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3654 moved usepackage{xxx}'s to beginning of file. Changed left margin
3655 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3656 underlining from title. Thanks to John Culleton for useful suggestions.
3658 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3660 * src/lyxlex_pimpl.C (setFile): change error message to debug
3663 2000-09-13 Juergen Vigna <jug@sad.it>
3665 * src/frontends/xforms/FormDocument.C: implemented choice_class
3666 as combox and give callback to combo_language so OK/Apply is activated
3669 * src/bufferlist.C (newFile): small fix so already named files
3670 (via an open call) are not requested to be named again on the
3673 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3675 * src/frontends/kde/Makefile.am
3676 * src/frontends/kde/FormRef.C
3677 * src/frontends/kde/FormRef.h
3678 * src/frontends/kde/formrefdialog.C
3679 * src/frontends/kde/formrefdialog.h: implement
3682 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3684 * src/frontends/kde/formtocdialog.C
3685 * src/frontends/kde/formtocdialog.h
3686 * src/frontends/kde/FormToc.C
3687 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3689 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3691 * src/frontends/kde/FormCitation.C: fix thinko
3692 where we didn't always display the reference text
3695 * src/frontends/kde/formurldialog.C
3696 * src/frontends/kde/formurldialog.h
3697 * src/frontends/kde/FormUrl.C
3698 * src/frontends/kde/FormUrl.h: minor cleanups
3700 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3702 * src/frontends/kde/Makefile.am
3703 * src/frontends/kde/FormToc.C
3704 * src/frontends/kde/FormToc.h
3705 * src/frontends/kde/FormCitation.C
3706 * src/frontends/kde/FormCitation.h
3707 * src/frontends/kde/FormIndex.C
3708 * src/frontends/kde/FormIndex.h
3709 * src/frontends/kde/formtocdialog.C
3710 * src/frontends/kde/formtocdialog.h
3711 * src/frontends/kde/formcitationdialog.C
3712 * src/frontends/kde/formcitationdialog.h
3713 * src/frontends/kde/formindexdialog.C
3714 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3716 2000-09-12 Juergen Vigna <jug@sad.it>
3718 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3721 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3723 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3726 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3728 * src/converter.C (Add, Convert): Added support for converter flags:
3729 needaux, resultdir, resultfile.
3730 (Convert): Added new parameter view_file.
3731 (dvips_options): Fixed letter paper option.
3733 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3734 (Export, GetExportableFormats, GetViewableFormats): Added support
3737 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3739 (easyParse): Fixed to work with new export code.
3741 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3744 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3746 * lib/bind/*.bind: Replaced
3747 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3748 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3750 2000-09-11 Juergen Vigna <jug@sad.it>
3752 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3754 * src/main.C (main): now GUII defines global guiruntime!
3756 * src/frontends/gnome/GUIRunTime.C (initApplication):
3757 * src/frontends/kde/GUIRunTime.C (initApplication):
3758 * src/frontends/xforms/GUIRunTime.C (initApplication):
3759 * src/frontends/GUIRunTime.h: added new function initApplication.
3761 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3763 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3765 2000-09-08 Juergen Vigna <jug@sad.it>
3767 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3768 we have already "Reset".
3770 * src/language.C (initL): inserted "default" language and made this
3771 THE default language (and not american!)
3773 * src/paragraph.C: inserted handling of "default" language!
3775 * src/lyxfont.C: ditto
3779 * src/paragraph.C: output the \\par only if we have a following
3780 paragraph otherwise it's not needed.
3782 2000-09-05 Juergen Vigna <jug@sad.it>
3784 * config/pspell.m4: added entry to lyx-flags
3786 * src/spellchecker.C: modified version from Kevin for using pspell
3788 2000-09-01 Marko Vendelin <markov@ioc.ee>
3789 * src/frontends/gnome/Makefile.am
3790 * src/frontends/gnome/FormCitation.C
3791 * src/frontends/gnome/FormCitation.h
3792 * src/frontends/gnome/diainsertcitation_callbacks.c
3793 * src/frontends/gnome/diainsertcitation_callbacks.h
3794 * src/frontends/gnome/diainsertcitation_interface.c
3795 * src/frontends/gnome/diainsertcitation_interface.h
3796 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3797 dialog for Gnome frontend
3799 * src/main.C: Gnome libraries require keeping application name
3800 and its version as strings
3802 * src/frontends/gnome/mainapp.C: Change the name of the main window
3803 from GnomeLyX to PACKAGE
3805 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3807 * src/frontends/Liason.C: add "using: declaration.
3809 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3811 * src/mathed/math_macro.C (Metrics): Set the size of the template
3813 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3815 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3817 * src/converter.C (add_options): New function.
3818 (SetViewer): Change $$FName into '$$FName'.
3819 (View): Add options when running xdvi
3820 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3821 (Convert): The 3rd parameter is now the desired filename. Converts
3822 calls to lyx::rename if necessary.
3823 Add options when running dvips.
3824 (dvi_papersize,dvips_options): New methods.
3826 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3828 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3829 using a call to Converter::dvips_options.
3830 Fixed to work with nex export code.
3832 * src/support/copy.C
3833 * src/support/rename.C: New files
3835 * src/support/syscall.h
3836 * src/support/syscall.C: Added Starttype SystemDontWait.
3838 * lib/ui/default.ui: Changed to work with new export code
3840 * lib/configure.m4: Changed to work with new export code
3842 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3844 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3846 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3847 so that code compiles with DEC cxx.
3849 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3850 to work correctly! Also now supports the additional elements
3853 2000-09-01 Allan Rae <rae@lyx.org>
3855 * src/frontends/ButtonPolicies.C: renamed all the references to
3856 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3858 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3859 since it's a const not a type.
3861 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3863 2000-08-31 Juergen Vigna <jug@sad.it>
3865 * src/insets/figinset.C: Various changes to look if the filename has
3866 an extension and if not add it for inline previewing.
3868 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3870 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3871 make buttonStatus and isReadOnly be const methods. (also reflect
3872 this in derived classes.)
3874 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3875 (nextState): change to be static inline, pass the StateMachine as
3877 (PreferencesPolicy): remove casts
3878 (OkCancelPolicy): remvoe casts
3879 (OkCancelReadOnlyPolicy): remove casts
3880 (NoRepeatedApplyReadOnlyPolicy): remove casts
3881 (OkApplyCancelReadOnlyPolicy): remove casts
3882 (OkApplyCancelPolicy): remove casts
3883 (NoRepeatedApplyPolicy): remove casts
3885 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3887 * src/converter.C: added some using directives
3889 * src/frontends/ButtonPolicies.C: changes to overcome
3890 "need lvalue" error with DEC c++
3892 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3893 to WMHideCB for DEC c++
3895 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3897 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3898 to BulletBMTableCB for DEC c++
3900 2000-08-31 Allan Rae <rae@lyx.org>
3902 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3903 character dialog separately from old document dialogs combo_language.
3906 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3908 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3909 Removed LFUN_REF_CREATE.
3911 * src/MenuBackend.C: Added new tags: toc and references
3913 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3914 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3916 (add_toc, add_references): New methods.
3917 (create_submenu): Handle correctly the case when there is a
3918 seperator after optional menu items.
3920 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3921 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3922 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3924 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3926 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3928 * src/converter.[Ch]: New file for converting between different
3931 * src/export.[Ch]: New file for exporting a LyX file to different
3934 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3935 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3936 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3937 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3938 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3939 RunDocBook, MenuExport.
3941 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3942 Exporter::Preview methods if NEW_EXPORT is defined.
3944 * src/buffer.C (Dispatch): Use Exporter::Export.
3946 * src/lyxrc.C: Added new tags: \converter and \viewer.
3949 * src/LyXAction.C: Define new lyx-function: buffer-update.
3950 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3951 when NEW_EXPORT is defined.
3953 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3955 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3957 * lib/ui/default.ui: Added submenus "view" and "update" to the
3960 * src/filetools.C (GetExtension): New function.
3962 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3964 2000-08-29 Allan Rae <rae@lyx.org>
3966 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3968 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3969 (EnableDocumentLayout): removed
3970 (DisableDocumentLayout): removed
3971 (build): make use of ButtonController's read-only handling to
3972 de/activate various objects. Replaces both of the above functions.
3974 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3975 (readOnly): was read_only
3976 (refresh): fixed dumb mistakes with read_only_ handling
3978 * src/frontends/xforms/forms/form_document.fd:
3979 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3980 tabbed dialogs so the tabs look more like tabs and so its easier to
3981 work out which is the current tab.
3983 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3984 segfault with form_table
3986 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3988 2000-08-28 Juergen Vigna <jug@sad.it>
3990 * acconfig.h: added USE_PSPELL.
3992 * src/config.h.in: added USE_PSPELL.
3994 * autogen.sh: added pspell.m4
3996 * config/pspell.m4: new file.
3998 * src/spellchecker.C: implemented support for pspell libary.
4000 2000-08-25 Juergen Vigna <jug@sad.it>
4002 * src/LyXAction.C (init): renamed LFUN_TABLE to
4003 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4005 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4007 * src/lyxscreen.h: add force_clear variable and fuction to force
4008 a clear area when redrawing in LyXText.
4010 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4012 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4014 * some whitespace and comment changes.
4016 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4018 * src/buffer.C: up te LYX_FORMAT to 2.17
4020 2000-08-23 Juergen Vigna <jug@sad.it>
4022 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4025 * src/insets/insettabular.C (pasteSelection): delete the insets
4026 LyXText as it is not valid anymore.
4027 (copySelection): new function.
4028 (pasteSelection): new function.
4029 (cutSelection): new function.
4030 (LocalDispatch): implemented cut/copy/paste of cell selections.
4032 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4033 don't have a LyXText.
4035 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4037 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4040 2000-08-22 Juergen Vigna <jug@sad.it>
4042 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4043 ifdef form_table out if NEW_TABULAR.
4045 2000-08-21 Juergen Vigna <jug@sad.it>
4047 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4048 (draw): fixed draw position so that the cursor is positioned in the
4050 (InsetMotionNotify): hide/show cursor so the position is updated.
4051 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4052 using cellstart() function where it should be used.
4054 * src/insets/insettext.C (draw): ditto.
4056 * src/tabular.C: fixed initialization of some missing variables and
4057 made BoxType into an enum.
4059 2000-08-22 Marko Vendelin <markov@ioc.ee>
4060 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4061 stock menu item using action numerical value, not its string
4065 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4067 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4068 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4070 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4072 * src/frontends/xforms/GUIRunTime.C: new file
4074 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4075 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4077 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4079 * src/frontends/kde/GUIRunTime.C: new file
4081 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4082 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4084 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4086 * src/frontends/gnome/GUIRunTime.C: new file
4088 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4091 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4092 small change to documetentation.
4094 * src/frontends/GUIRunTime.C: removed file
4096 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4098 * src/lyxparagraph.h: enable NEW_TABULAR as default
4100 * src/lyxfunc.C (processKeySym): remove some commented code
4102 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4103 NEW_TABULAR around the fd_form_table_options.
4105 * src/lyx_gui.C (runTime): call the static member function as
4106 GUIRunTime::runTime().
4108 2000-08-21 Allan Rae <rae@lyx.org>
4110 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4113 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4115 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4117 2000-08-21 Allan Rae <rae@lyx.org>
4119 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4120 keep Garst happy ;-)
4121 * src/frontends/xforms/FormPreferences.C (build): use setOK
4122 * src/frontends/xforms/FormDocument.C (build): use setOK
4123 (FormDocument): use the appropriate policy.
4125 2000-08-21 Allan Rae <rae@lyx.org>
4127 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4128 automatic [de]activation of arbitrary objects when in a read-only state.
4130 * src/frontends/ButtonPolicies.h: More documentation
4131 (isReadOnly): added to support the above.
4133 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4135 2000-08-18 Juergen Vigna <jug@sad.it>
4137 * src/insets/insettabular.C (getStatus): changed to return func_status.
4139 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4140 display toggle menu entries if they are.
4142 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4143 new document layout now.
4145 * src/lyxfunc.C: ditto
4147 * src/lyx_gui_misc.C: ditto
4149 * src/lyx_gui.C: ditto
4151 * lib/ui/default.ui: removed paper and quotes layout as they are now
4152 all in the document layout tabbed folder.
4154 * src/frontends/xforms/forms/form_document.fd: added Restore
4155 button and callbacks for all inputs for Allan's ButtonPolicy.
4157 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4158 (CheckChoiceClass): added missing params setting on class change.
4159 (UpdateLayoutDocument): added for updating the layout on params.
4160 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4161 (FormDocument): Implemented Allan's ButtonPolicy with the
4164 2000-08-17 Allan Rae <rae@lyx.org>
4166 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4167 so we can at least see the credits again.
4169 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4170 controller calls for the appropriate callbacks. Note that since Ok
4171 calls apply followed by cancel, and apply isn't a valid input for the
4172 APPLIED state, the bc_ calls have to be made in the static callback not
4173 within each of the real callbacks.
4175 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4176 (setOk): renamed from setOkay()
4178 2000-08-17 Juergen Vigna <jug@sad.it>
4180 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4181 in the implementation part.
4182 (composeUIInfo): don't show optional menu-items.
4184 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4186 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4188 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4189 text-state when in a text-inset.
4191 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4193 2000-08-17 Marko Vendelin <markov@ioc.ee>
4194 * src/frontends/gnome/FormIndex.C
4195 * src/frontends/gnome/FormIndex.h
4196 * src/frontends/gnome/FormToc.C
4197 * src/frontends/gnome/FormToc.h
4198 * src/frontends/gnome/dialogs
4199 * src/frontends/gnome/diatoc_callbacks.c
4200 * src/frontends/gnome/diatoc_callbacks.h
4201 * src/frontends/gnome/diainsertindex_callbacks.h
4202 * src/frontends/gnome/diainsertindex_callbacks.c
4203 * src/frontends/gnome/diainsertindex_interface.c
4204 * src/frontends/gnome/diainsertindex_interface.h
4205 * src/frontends/gnome/diatoc_interface.h
4206 * src/frontends/gnome/diatoc_interface.c
4207 * src/frontends/gnome/Makefile.am: Table of Contents and
4208 Insert Index dialogs implementation for Gnome frontend
4210 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4212 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4214 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4217 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4219 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4220 destructor. Don't definde if you don't need it
4221 (processEvents): made static, non-blocking events processing for
4223 (runTime): static method. event loop for xforms
4224 * similar as above for kde and gnome.
4226 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4227 new Pimpl is correct
4228 (runTime): new method calss the real frontends runtime func.
4230 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4232 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4234 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4236 2000-08-16 Juergen Vigna <jug@sad.it>
4238 * src/lyx_gui.C (runTime): added GUII RunTime support.
4240 * src/frontends/Makefile.am:
4241 * src/frontends/GUIRunTime.[Ch]:
4242 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4243 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4244 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4246 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4248 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4249 as this is already set in ${FRONTEND_INCLUDE} if needed.
4251 * configure.in (CPPFLAGS): setting the include dir for the frontend
4252 directory and don't set FRONTEND=xforms for now as this is executed
4255 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4257 * src/frontends/kde/Makefile.am:
4258 * src/frontends/kde/FormUrl.C:
4259 * src/frontends/kde/FormUrl.h:
4260 * src/frontends/kde/formurldialog.h:
4261 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4263 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4265 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4267 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4269 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4272 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4274 * src/WorkArea.C (work_area_handler): more work to get te
4275 FL_KEYBOARD to work with xforms 0.88 too, please test.
4277 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4279 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4281 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4284 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4286 * src/Timeout.h: remove Qt::emit hack.
4288 * several files: changes to allo doc++ compilation
4290 * src/lyxfunc.C (processKeySym): new method
4291 (processKeyEvent): comment out if FL_REVISION < 89
4293 * src/WorkArea.C: change some debugging levels.
4294 (WorkArea): set wantkey to FL_KEY_ALL
4295 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4296 clearer code and the use of compose with XForms 0.89. Change to
4297 use signals instead of calling methods in bufferview directly.
4299 * src/Painter.C: change some debugging levels.
4301 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4304 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4305 (workAreaKeyPress): new method
4307 2000-08-14 Juergen Vigna <jug@sad.it>
4309 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4311 * config/kde.m4: addes some features
4313 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4314 include missing xforms dialogs.
4316 * src/Timeout.h: a hack to be able to compile with qt/kde.
4318 * sigc++/.cvsignore: added acinclude.m4
4320 * lib/.cvsignore: added listerros
4322 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4323 xforms tree as objects are needed for other frontends.
4325 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4326 linking with not yet implemented xforms objects.
4328 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4330 2000-08-14 Baruch Even <baruch.even@writeme.com>
4332 * src/frontends/xforms/FormGraphics.h:
4333 * src/frontends/xforms/FormGraphics.C:
4334 * src/frontends/xforms/RadioButtonGroup.h:
4335 * src/frontends/xforms/RadioButtonGroup.C:
4336 * src/insets/insetgraphics.h:
4337 * src/insets/insetgraphics.C:
4338 * src/insets/insetgraphicsParams.h:
4339 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4340 instead of spaces, and various other indentation issues to make the
4341 sources more consistent.
4343 2000-08-14 Marko Vendelin <markov@ioc.ee>
4345 * src/frontends/gnome/dialogs/diaprint.glade
4346 * src/frontends/gnome/FormPrint.C
4347 * src/frontends/gnome/FormPrint.h
4348 * src/frontends/gnome/diaprint_callbacks.c
4349 * src/frontends/gnome/diaprint_callbacks.h
4350 * src/frontends/gnome/diaprint_interface.c
4351 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4354 * src/frontends/gnome/dialogs/diainserturl.glade
4355 * src/frontends/gnome/FormUrl.C
4356 * src/frontends/gnome/FormUrl.h
4357 * src/frontends/gnome/diainserturl_callbacks.c
4358 * src/frontends/gnome/diainserturl_callbacks.h
4359 * src/frontends/gnome/diainserturl_interface.c
4360 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4361 Gnome implementation
4363 * src/frontends/gnome/Dialogs.C
4364 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4365 all other dialogs. Copy all unimplemented dialogs from Xforms
4368 * src/frontends/gnome/support.c
4369 * src/frontends/gnome/support.h: support files generated by Glade
4373 * config/gnome.m4: Gnome configuration scripts
4375 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4376 configure --help message
4378 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4379 only if there are no events pendling in Gnome/Gtk. This enhances
4380 the performance of menus.
4383 2000-08-14 Allan Rae <rae@lyx.org>
4385 * lib/Makefile.am: listerrors cleaning
4387 * lib/listerrors: removed -- generated file
4388 * acinclude.m4: ditto
4389 * sigc++/acinclude.m4: ditto
4391 * src/frontends/xforms/forms/form_citation.fd:
4392 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4395 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4396 `updatesrc` and now we have a `test` target that does what `updatesrc`
4397 used to do. I didn't like having an install target that wasn't related
4400 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4401 on all except FormGraphics. This may yet happen. Followed by a major
4402 cleanup including using FL_TRANSIENT for most of the dialogs. More
4403 changes to come when the ButtonController below is introduced.
4405 * src/frontends/xforms/ButtonController.h: New file for managing up to
4406 four buttons on a dialog according to an externally defined policy.
4407 * src/frontends/xforms/Makefile.am: added above
4409 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4410 Apply and Cancel/Close buttons and everything in between and beyond.
4411 * src/frontends/Makefile.am: added above.
4413 * src/frontends/xforms/forms/form_preferences.fd:
4414 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4415 and removed variable 'status' as a result. Fixed the set_minsize thing.
4416 Use the new screen-font-update after checking screen fonts were changed
4417 Added a "Restore" button to restore the original lyxrc values while
4418 editing. This restores everything not just the last input changed.
4419 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4421 * src/LyXAction.C: screen-font-update added for updating buffers after
4422 screen font settings have been changed.
4423 * src/commandtags.h: ditto
4424 * src/lyxfunc.C: ditto
4426 * forms/lyx.fd: removed screen fonts dialog.
4427 * src/lyx_gui.C: ditto
4428 * src/menus.[Ch]: ditto
4429 * src/lyx.[Ch]: ditto
4430 * src/lyx_cb.C: ditto + code from here moved to make
4431 screen-font-update. And people wonder why progress on GUII is
4432 slow. Look at how scattered this stuff was! It takes forever
4435 * forms/fdfix.sh: Fixup the spacing after commas.
4436 * forms/makefile: Remove date from generated files. Fewer clashes now.
4437 * forms/bullet_forms.C.patch: included someones handwritten changes
4439 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4440 once I've discovered why LyXRC was made noncopyable.
4441 * src/lyx_main.C: ditto
4443 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4445 * src/frontends/xforms/forms/fdfix.sh:
4446 * src/frontends/xforms/forms/fdfixh.sed:
4447 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4448 * src/frontends/xforms/Form*.[hC]:
4449 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4450 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4451 provide a destructor for the struct FD_form_xxxx. Another version of
4452 the set_[max|min]size workaround and a few other cleanups. Actually,
4453 Angus' patch from 20000809.
4455 2000-08-13 Baruch Even <baruch.even@writeme.com>
4457 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4460 2000-08-11 Juergen Vigna <jug@sad.it>
4462 * src/insets/insetgraphics.C (InsetGraphics): changing init
4463 order because of warnings.
4465 * src/frontends/xforms/forms/makefile: adding patching .C with
4468 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4469 from .C.patch to .c.patch
4471 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4472 order because of warning.
4474 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4476 * src/frontends/Liason.C (setMinibuffer): new helper function
4478 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4480 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4482 * lib/ui/default.ui: commented out PaperLayout entry
4484 * src/frontends/xforms/form_document.[Ch]: new added files
4486 * src/frontends/xforms/FormDocument.[Ch]: ditto
4488 * src/frontends/xforms/forms/form_document.fd: ditto
4490 * src/frontends/xforms/forms/form_document.C.patch: ditto
4492 2000-08-10 Juergen Vigna <jug@sad.it>
4494 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4495 (InsetGraphics): initialized cacheHandle to 0.
4496 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4498 2000-08-10 Baruch Even <baruch.even@writeme.com>
4500 * src/graphics/GraphicsCache.h:
4501 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4502 correctly as a cache.
4504 * src/graphics/GraphicsCacheItem.h:
4505 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4508 * src/graphics/GraphicsCacheItem_pimpl.h:
4509 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4512 * src/insets/insetgraphics.h:
4513 * src/insets/insetgraphics.C: Changed from using a signal notification
4514 to polling when image is not loaded.
4516 2000-08-10 Allan Rae <rae@lyx.org>
4518 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4519 that there are two functions that have to been taken out of line by
4520 hand and aren't taken care of in the script. (Just a reminder note)
4522 * sigc++/macros/*.h.m4: Updated as above.
4524 2000-08-09 Juergen Vigna <jug@sad.it>
4526 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4528 * src/insets/insettabular.C: make drawing of single cell smarter.
4530 2000-08-09 Marko Vendelin <markov@ioc.ee>
4531 * src/frontends/gnome/Menubar_pimpl.C
4532 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4533 implementation: new files
4535 * src/frontends/gnome/mainapp.C
4536 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4539 * src/main.C: create Gnome main window
4541 * src/frontends/xforms/Menubar_pimpl.h
4542 * src/frontends/Menubar.C
4543 * src/frontends/Menubar.h: added method Menubar::update that calls
4544 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4546 * src/LyXView.C: calls Menubar::update to update the state
4549 * src/frontends/gnome/Makefile.am: added new files
4551 * src/frontends/Makefile.am: added frontend compiler options
4553 2000-08-08 Juergen Vigna <jug@sad.it>
4555 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4557 * src/bufferlist.C (close):
4558 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4559 documents if exiting without saving.
4561 * src/buffer.C (save): use removeAutosaveFile()
4563 * src/support/filetools.C (removeAutosaveFile): new function.
4565 * src/lyx_cb.C (MenuWrite): returns a bool now.
4566 (MenuWriteAs): check if file could really be saved and revert to the
4568 (MenuWriteAs): removing old autosavefile if existant.
4570 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4571 before Goto toggle declaration, because of compiler warning.
4573 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4575 * src/lyxfunc.C (MenuNew): small fix.
4577 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4579 * src/bufferlist.C (newFile):
4580 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4582 * src/lyxrc.C: added new_ask_filename tag
4584 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4586 * src/lyx.fd: removed code pertaining to form_ref
4587 * src/lyx.[Ch]: ditto
4588 * src/lyx_cb.C: ditto
4589 * src/lyx_gui.C: ditto
4590 * src/lyx_gui_misc.C: ditto
4592 * src/BufferView_pimpl.C (restorePosition): update buffer only
4595 * src/commandtags.h (LFUN_REFTOGGLE): removed
4596 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4597 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4598 (LFUN_REFBACK): renamed LFUN_REF_BACK
4600 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4601 * src/menus.C: ditto
4602 * src/lyxfunc.C (Dispatch): ditto.
4603 InsertRef dialog is now GUI-independent.
4605 * src/texrow.C: added using std::endl;
4607 * src/insets/insetref.[Ch]: strip out large amounts of code.
4608 The inset is now a container and this functionality is now
4609 managed by a new FormRef dialog
4611 * src/frontends/Dialogs.h (showRef, createRef): new signals
4613 * src/frontends/xforms/FormIndex.[Ch],
4614 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4615 when setting dialog's min/max size
4616 * src/frontends/xforms/FormIndex.[Ch]: ditto
4618 * src/frontends/xforms/FormRef.[Ch],
4619 src/frontends/xforms/forms/form_ref.fd: new xforms
4620 implementation of an InsetRef dialog
4622 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4625 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4626 ios::nocreate is not part of the standard. Removed.
4628 2000-08-07 Baruch Even <baruch.even@writeme.com>
4630 * src/graphics/Renderer.h:
4631 * src/graphics/Renderer.C: Added base class for rendering of different
4632 image formats into Pixmaps.
4634 * src/graphics/XPM_Renderer.h:
4635 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4636 in a different class.
4638 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4639 easily add support for other formats.
4641 * src/insets/figinset.C: plugged a leak of an X resource.
4643 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4645 * src/CutAndPaste.[Ch]: make all metods static.
4647 * development/Code_rules/Rules: more work, added section on
4648 Exceptions, and a References section.
4650 * a lot of header files: work to make doc++ able to generate the
4651 source documentation, some workarounds of doc++ problems. Doc++ is
4652 now able to generate the documentation.
4654 2000-08-07 Juergen Vigna <jug@sad.it>
4656 * src/insets/insettabular.C (recomputeTextInsets): removed function
4658 * src/tabular.C (SetWidthOfMulticolCell):
4660 (calculate_width_of_column_NMC): fixed return value so that it really
4661 only returns true if the column-width has changed (there where
4662 problems with muliticolumn-cells in this column).
4664 2000-08-04 Juergen Vigna <jug@sad.it>
4666 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4667 also on the scrollstatus of the inset.
4668 (workAreaMotionNotify): ditto.
4670 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4672 2000-08-01 Juergen Vigna <jug@sad.it>
4674 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4676 * src/commandtags.h:
4677 * src/LyXAction.C (init):
4678 * src/insets/inset.C (LocalDispatch): added support for
4681 * src/insets/inset.C (scroll): new functions.
4683 * src/insets/insettext.C (removeNewlines): new function.
4684 (SetAutoBreakRows): removes forced newlines in the text of the
4685 paragraph if autoBreakRows is set to false.
4687 * src/tabular.C (Latex): generates a parbox around the cell contents
4690 * src/frontends/xforms/FormTabular.C (local_update): removed
4691 the radio_useparbox button.
4693 * src/tabular.C (UseParbox): new function
4695 2000-08-06 Baruch Even <baruch.even@writeme.com>
4697 * src/graphics/GraphicsCache.h:
4698 * src/graphics/GraphicsCache.C:
4699 * src/graphics/GraphicsCacheItem.h:
4700 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4703 * src/insets/insetgraphics.h:
4704 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4705 and the drawing of the inline image.
4707 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4708 loaded into the wrong position.
4710 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4713 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4715 * src/support/translator.h: move all typedefs to public section
4717 * src/support/filetools.C (MakeLatexName): return string const
4719 (TmpFileName): ditto
4720 (FileOpenSearch): ditto
4722 (LibFileSearch): ditto
4723 (i18nLibFileSearch): ditto
4726 (CreateTmpDir): ditto
4727 (CreateBufferTmpDir): ditto
4728 (CreateLyXTmpDir): ditto
4731 (MakeAbsPath): ditto
4733 (OnlyFilename): ditto
4735 (NormalizePath): ditto
4736 (CleanupPath): ditto
4737 (GetFileContents): ditto
4738 (ReplaceEnvironmentPath): ditto
4739 (MakeRelPath): ditto
4741 (ChangeExtension): ditto
4742 (MakeDisplayPath): ditto
4743 (do_popen): return cmdret const
4744 (findtexfile): return string const
4746 * src/support/DebugStream.h: add some /// to please doc++
4748 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4750 * src/texrow.C (same_rownumber): functor to use with find_if
4751 (getIdFromRow): rewritten to use find_if and to not update the
4752 positions. return true if row is found
4753 (increasePos): new method, use to update positions
4755 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4757 * src/lyxlex_pimpl.C (verifyTable): new method
4760 (GetString): return string const
4761 (pushTable): rewrite to use std::stack
4763 (setFile): better check
4766 * src/lyxlex.h: make LyXLex noncopyable
4768 * src/lyxlex.C (text): return char const * const
4769 (GetString): return string const
4770 (getLongString): return string const
4772 * src/lyx_gui_misc.C (askForText): return pair<...> const
4774 * src/lastfiles.[Ch] (operator): return string const
4776 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4777 istringstream not char const *.
4778 move token.end() out of loop.
4779 (readFile): move initializaton of token
4781 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4782 getIdFromRow is successful.
4784 * lib/bind/emacs.bind: don't include menus bind
4786 * development/Code_rules/Rules: the beginnings of making this
4787 better and covering more of the unwritten rules that we have.
4789 * development/Code_rules/Recommendations: a couple of wording
4792 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4794 * src/support/strerror.c: remove C++ comment.
4796 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4798 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4799 LFUN_INDEX_INSERT_LAST
4801 * src/texrow.C (getIdFromRow): changed from const_iterator to
4802 iterator, allowing code to compile with DEC cxx
4804 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4805 stores part of the class, as suggested by Allan. Will allow
4807 (apply): test to apply uses InsetCommandParams operator!=
4809 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4810 (apply): test to apply uses InsetCommandParams operator!=
4812 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4813 stores part of the class.
4814 (update): removed limits on min/max size.
4816 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4817 (apply): test to apply uses InsetCommandParams operator!=
4819 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4820 (Read, Write, scanCommand, getCommand): moved functionality
4821 into InsetCommandParams.
4823 (getScreenLabel): made pure virtual
4824 new InsetCommandParams operators== and !=
4826 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4827 c-tors based on InsetCommandParams. Removed others.
4828 * src/insets/insetinclude.[Ch]: ditto
4829 * src/insets/insetlabel.[Ch]: ditto
4830 * src/insets/insetparent.[Ch]: ditto
4831 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4833 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4834 insets derived from InsetCommand created using similar c-tors
4835 based on InsetCommandParams
4836 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4837 * src/menus.C (ShowRefsMenu): ditto
4838 * src/paragraph.C (Clone): ditto
4839 * src/text2.C (SetCounter): ditto
4840 * src/lyxfunc.C (Dispatch) ditto
4841 Also recreated old InsetIndex behaviour exactly. Can now
4842 index-insert at the start of a paragraph and index-insert-last
4843 without launching the pop-up.
4845 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4847 * lib/lyxrc.example: mark te pdf options as non functional.
4849 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4850 (isStrDbl): move tmpstr.end() out of loop.
4851 (strToDbl): move intialization of tmpstr
4852 (lowercase): return string const and move tmp.end() out of loop.
4853 (uppercase): return string const and move tmp.edn() out of loop.
4854 (prefixIs): add assertion
4859 (containsOnly): ditto
4860 (containsOnly): ditto
4861 (containsOnly): ditto
4862 (countChar): make last arg char not char const
4863 (token): return string const
4864 (subst): return string const, move tmp.end() out of loop.
4865 (subst): return string const, add assertion
4866 (strip): return string const
4867 (frontStrip): return string const, add assertion
4868 (frontStrip): return string const
4873 * src/support/lstrings.C: add inclde "LAssert.h"
4874 (isStrInt): move tmpstr.end() out of loop.
4876 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4877 toollist.end() out of loop.
4878 (deactivate): move toollist.end() out of loop.
4879 (update): move toollist.end() out of loop.
4880 (updateLayoutList): move tc.end() out of loop.
4881 (add): move toollist.end() out of loop.
4883 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4884 md.end() out of loop.
4886 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4888 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4891 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4892 (Erase): move insetlist.end() out of loop.
4894 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4895 ref to const string as first arg. Move initialization of some
4896 variables, whitespace changes.
4898 * src/kbmap.C (defkey): move table.end() out of loop.
4899 (kb_keymap): move table.end() out of loop.
4900 (findbinding): move table.end() out of loop.
4902 * src/MenuBackend.C (hasMenu): move end() out of loop.
4903 (getMenu): move end() out of loop.
4904 (getMenu): move menulist_.end() out of loop.
4906 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4908 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4911 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4912 (getFromLyXName): move infotab.end() out of loop.
4914 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4915 -fvtable-thunks -ffunction-sections -fdata-sections
4917 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4919 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4922 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4924 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4926 * src/frontends/xforms/FormCitation.[Ch],
4927 src/frontends/xforms/FormIndex.[Ch],
4928 src/frontends/xforms/FormToc.[Ch],
4929 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4931 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4933 * src/commandtags.h: renamed, created some flags for citation
4936 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4938 * src/lyxfunc.C (dispatch): use signals to insert index entry
4940 * src/frontends/Dialogs.h: new signal createIndex
4942 * src/frontends/xforms/FormCommand.[Ch],
4943 src/frontends/xforms/FormCitation.[Ch],
4944 src/frontends/xforms/FormToc.[Ch],
4945 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4947 * src/insets/insetindex.[Ch]: GUI-independent
4949 * src/frontends/xforms/FormIndex.[Ch],
4950 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4953 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4955 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4956 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4958 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4960 * src/insets/insetref.C (Latex): rewrite so that there is now
4961 question that a initialization is requested.
4963 * src/insets/insetcommand.h: reenable the hide signal
4965 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4967 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4968 fix handling of shortcuts (many bugs :)
4969 (add_lastfiles): ditto.
4971 * lib/ui/default.ui: fix a few shortcuts.
4973 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4975 * Makefile.am: Fix ``rpmdist'' target to return the exit
4976 status of the ``rpm'' command, instead of the last command in
4977 the chain (the ``rm lyx.xpm'' command, which always returns
4980 2000-08-02 Allan Rae <rae@lyx.org>
4982 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4983 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4984 * src/frontends/xforms/FormToc.C (FormToc): ditto
4986 * src/frontends/xforms/Makefile.am: A few forgotten files
4988 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4989 Signals-not-copyable-problem Lars' started commenting out.
4991 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4993 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4995 * src/insets/insetcommand.h: Signals is not copyable so anoter
4996 scheme for automatic hiding of forms must be used.
4998 * src/frontends/xforms/FormCitation.h: don't inerit from
4999 noncopyable, FormCommand already does that.
5000 * src/frontends/xforms/FormToc.h: ditto
5001 * src/frontends/xforms/FormUrl.h: ditto
5003 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5005 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5007 * src/insets/insetcommand.h (hide): new SigC::Signal0
5008 (d-tor) new virtual destructor emits hide signal
5010 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5011 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5013 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5014 LOF and LOT. Inset is now GUI-independent
5016 * src/insets/insetloa.[Ch]: redundant
5017 * src/insets/insetlof.[Ch]: ditto
5018 * src/insets/insetlot.[Ch]: ditto
5020 * src/frontends/xforms/forms/form_url.fd: tweaked!
5021 * src/frontends/xforms/forms/form_citation.fd: ditto
5023 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5024 dialogs dealing with InsetCommand insets
5026 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5027 FormCommand base class
5028 * src/frontends/xforms/FormUrl.[Ch]: ditto
5030 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5032 * src/frontends/xforms/FormToc.[Ch]: ditto
5034 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5035 passed a generic InsetCommand pointer
5036 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5038 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5039 and modified InsetTOC class
5040 * src/buffer.C: ditto
5042 * forms/lyx.fd: strip out old FD_form_toc code
5043 * src/lyx_gui_misc.C: ditto
5044 * src/lyx_gui.C: ditto
5045 * src/lyx_cb.C: ditto
5046 * src/lyx.[Ch]: ditto
5048 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5050 * src/support/utility.hpp: tr -d '\r'
5052 2000-08-01 Juergen Vigna <jug@sad.it>
5054 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5056 * src/commandtags.h:
5057 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5058 LFUN_TABULAR_FEATURES.
5060 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5061 LFUN_LAYOUT_TABULAR.
5063 * src/insets/insettabular.C (getStatus): implemented helper function.
5065 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5067 2000-07-31 Juergen Vigna <jug@sad.it>
5069 * src/text.C (draw): fixed screen update problem for text-insets.
5071 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5072 something changed probably this has to be added in various other
5075 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5077 2000-07-31 Baruch Even <baruch.even@writeme.com>
5079 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5080 templates to satisfy compaq cxx.
5083 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5085 * src/support/translator.h (equal_1st_in_pair::operator()): take
5086 const ref pair_type as arg.
5087 (equal_2nd_in_pair::operator()): ditto
5088 (Translator::~Translator): remove empty d-tor.
5090 * src/graphics/GraphicsCache.C: move include config.h to top, also
5091 put initialization of GraphicsCache::singleton here.
5092 (~GraphicsCache): move here
5093 (addFile): take const ref as arg
5096 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5098 * src/BufferView2.C (insertLyXFile): change te with/without header
5101 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5103 * src/frontends/xforms/FormGraphics.C (apply): add some
5104 static_cast. Not very nice, but required by compaq cxx.
5106 * src/frontends/xforms/RadioButtonGroup.h: include header
5107 <utility> instead of <pair.h>
5109 * src/insets/insetgraphicsParams.C: add using directive.
5110 (readResize): change return type to void.
5111 (readOrigin): ditto.
5113 * src/lyxfunc.C (getStatus): add missing break for build-program
5114 function; add test for Literate for export functions.
5116 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5117 entries in Options menu.
5119 2000-07-31 Baruch Even <baruch.even@writeme.com>
5121 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5122 protect against auto-allocation; release icon when needed.
5124 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5126 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5127 on usual typewriter.
5129 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5130 earlier czech.kmap), useful only for programming.
5132 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5134 * src/frontends/xforms/FormCitation.h: fix conditioning around
5137 2000-07-31 Juergen Vigna <jug@sad.it>
5139 * src/frontends/xforms/FormTabular.C (local_update): changed
5140 radio_linebreaks to radio_useparbox and added radio_useminipage.
5142 * src/tabular.C: made support for using minipages/parboxes.
5144 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5146 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5148 (descent): so the cursor is in the middle.
5149 (width): bit smaller box.
5151 * src/insets/insetgraphics.h: added display() function.
5153 2000-07-31 Baruch Even <baruch.even@writeme.com>
5155 * src/frontends/Dialogs.h: Added showGraphics signals.
5157 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5158 xforms form definition of the graphics dialog.
5160 * src/frontends/xforms/FormGraphics.h:
5161 * src/frontends/xforms/FormGraphics.C: Added files, the
5162 GUIndependent code of InsetGraphics
5164 * src/insets/insetgraphics.h:
5165 * src/insets/insetgraphics.C: Major writing to make it work.
5167 * src/insets/insetgraphicsParams.h:
5168 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5169 struct between InsetGraphics and GUI.
5171 * src/LaTeXFeatures.h:
5172 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5173 support for graphicx package.
5175 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5176 for the graphics inset.
5178 * src/support/translator.h: Added file, used in
5179 InsetGraphicsParams. this is a template to translate between two
5182 * src/frontends/xforms/RadioButtonGroup.h:
5183 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5184 way to easily control a radio button group.
5186 2000-07-28 Juergen Vigna <jug@sad.it>
5188 * src/insets/insettabular.C (LocalDispatch):
5189 (TabularFeatures): added support for lyx-functions of tabular features.
5190 (cellstart): refixed this function after someone wrongly changed it.
5192 * src/commandtags.h:
5193 * src/LyXAction.C (init): added support for tabular-features
5195 2000-07-28 Allan Rae <rae@lyx.org>
5197 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5198 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5199 triggers the callback for input checking. As a result we sometimes get
5200 "LyX: This shouldn't happen..." printed to cerr.
5201 (input): Started using status variable since I only free() on
5202 destruction. Some input checking for paths and font sizes.
5204 * src/frontends/xforms/FormPreferences.h: Use status to control
5205 activation of Ok and Apply
5207 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5208 callback. Also resized to stop segfaults with 0.88. The problem is
5209 that xforms-0.88 requires the folder to be wide enough to fit all the
5210 tabs. If it isn't it causes all sorts of problems.
5212 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5214 * src/frontends/xforms/forms/README: Reflect reality.
5216 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5217 * src/frontends/xforms/forms/makefile: ditto.
5219 * src/commandtags.h: Get access to new Preferences dialog
5220 * src/LyXAction.C: ditto
5221 * src/lyxfunc.C: ditto
5222 * lib/ui/default.ui: ditto
5224 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5226 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5228 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5231 * src/frontends/xforms/form_url.[Ch]: added.
5233 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5235 * src/insets/insetbib.h: fixed bug in previous commit
5237 * src/frontends/xforms/FormUrl.h: ditto
5239 * src/frontends/xforms/FormPrint.h: ditto
5241 * src/frontends/xforms/FormPreferences.h: ditto
5243 * src/frontends/xforms/FormCopyright.h: ditto
5245 * src/frontends/xforms/FormCitation.C: ditto
5247 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5248 private copyconstructor and private default contructor
5250 * src/support/Makefile.am: add utility.hpp
5252 * src/support/utility.hpp: new file from boost
5254 * src/insets/insetbib.h: set owner in clone
5256 * src/frontends/xforms/FormCitation.C: added missing include
5259 * src/insets/form_url.[Ch]: removed
5261 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5263 * development/lyx.spec.in
5264 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5265 file/directory re-organization.
5267 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5269 * src/insets/insetcommand.[Ch]: moved the string data and
5270 associated manipulation methods into a new stand-alone class
5271 InsetCommandParams. This class has two additional methods
5272 getAsString() and setFromString() allowing the contents to be
5273 moved around as a single string.
5274 (addContents) method removed.
5275 (setContents) method no longer virtual.
5277 * src/buffer.C (readInset): made use of new InsetCitation,
5278 InsetUrl constructors based on InsetCommandParams.
5280 * src/commandtags.h: add LFUN_INSERT_URL
5282 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5283 independent InsetUrl and use InsetCommandParams to extract
5284 string info and create new Insets.
5286 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5288 * src/frontends/xforms/FormCitation.C (apply): uses
5291 * src/frontends/xforms/form_url.C
5292 * src/frontends/xforms/form_url.h
5293 * src/frontends/xforms/FormUrl.h
5294 * src/frontends/xforms/FormUrl.C
5295 * src/frontends/xforms/forms/form_url.fd: new files
5297 * src/insets/insetcite.[Ch]: removed unused constructors.
5299 * src/insets/insetinclude.[Ch]: no longer store filename
5301 * src/insets/inseturl.[Ch]: GUI-independent.
5303 2000-07-26 Juergen Vigna <jug@sad.it>
5304 * renamed frontend from gtk to gnome as it is that what is realized
5305 and did the necessary changes in the files.
5307 2000-07-26 Marko Vendelin <markov@ioc.ee>
5309 * configure.in: cleaning up gnome configuration scripts
5311 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5313 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5314 shortcuts syndrom by redrawing them explicitely (a better solution
5315 would be appreciated).
5317 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5319 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5322 * src/lyx_cb.C (MenuExport): change html export to do the right
5323 thing depending of the document type (instead of having
5324 html-linuxdoc and html-docbook).
5325 * src/lyxfunc.C (getStatus): update for html
5326 * lib/ui/default.ui: simplify due to the above change.
5327 * src/menus.C (ShowFileMenu): update too (in case we need it).
5329 * src/MenuBackend.C (read): if a menu is defined twice, add the
5330 new entries to the exiting one.
5332 2000-07-26 Juergen Vigna <jug@sad.it>
5334 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5336 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5337 and return a bool if it did actual save the file.
5338 (AutoSave): don't autosave a unnamed doc.
5340 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5341 check if this is an UNNAMED new file and react to it.
5342 (newFile): set buffer to unnamed and change to not mark a new
5343 buffer dirty if I didn't do anything with it.
5345 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5347 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5349 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5350 friend as per Angus's patch posted to lyx-devel.
5352 * src/ext_l10n.h: updated
5354 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5355 gettext on the style string right before inserting them into the
5358 * autogen.sh: add code to extract style strings form layout files,
5359 not good enough yet.
5361 * src/frontends/gtk/.cvsignore: add MAKEFILE
5363 * src/MenuBackend.C (read): run the label strings through gettext
5364 before storing them in the containers.
5366 * src/ext_l10n.h: new file
5368 * autogen.sh : generate the ext_l10n.h file here
5370 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5372 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5375 * lib/ui/default.ui: fix a couple of typos.
5377 * config/gnome/gtk.m4: added (and added to the list of files in
5380 * src/insets/insetinclude.C (unique_id): fix when we are using
5381 lyxstring instead of basic_string<>.
5382 * src/insets/insettext.C (LocalDispatch): ditto.
5383 * src/support/filetools.C: ditto.
5385 * lib/configure.m4: create the ui/ directory if necessary.
5387 * src/LyXView.[Ch] (updateToolbar): new method.
5389 * src/BufferView_pimpl.C (buffer): update the toolbar when
5390 opening/closing buffer.
5392 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5394 * src/LyXAction.C (getActionName): enhance to return also the name
5395 and options of pseudo-actions.
5396 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5398 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5399 as an example of what is possible). Used in File->Build too (more
5400 useful) and in the import/export menus (to mimick the complicated
5401 handling of linuxdoc and friends). Try to update all the entries.
5403 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5406 * src/MenuBackend.C (read): Parse the new OptItem tag.
5408 * src/MenuBackend.h: Add a new optional_ data member (used if the
5409 entry should be omitted when the lyxfunc is disabled).
5411 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5412 function, used as a shortcut.
5413 (create_submenu): align correctly the shortcuts on the widest
5416 * src/MenuBackend.h: MenuItem.label() only returns the label of
5417 the menu without shortcut; new method shortcut().
5419 2000-07-14 Marko Vendelin <markov@ioc.ee>
5421 * src/frontends/gtk/Dialogs.C:
5422 * src/frontends/gtk/FormCopyright.C:
5423 * src/frontends/gtk/FormCopyright.h:
5424 * src/frontends/gtk/Makefile.am: added these source-files for the
5425 Gtk/Gnome support of the Copyright-Dialog.
5427 * src/main.C: added Gnome::Main initialization if using
5428 Gtk/Gnome frontend-GUI.
5430 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5432 * config/gnome/aclocal-include.m4
5433 * config/gnome/compiler-flags.m4
5434 * config/gnome/curses.m4
5435 * config/gnome/gnome--.m4
5436 * config/gnome/gnome-bonobo-check.m4
5437 * config/gnome/gnome-common.m4
5438 * config/gnome/gnome-fileutils.m4
5439 * config/gnome/gnome-ghttp-check.m4
5440 * config/gnome/gnome-gnorba-check.m4
5441 * config/gnome/gnome-guile-checks.m4
5442 * config/gnome/gnome-libgtop-check.m4
5443 * config/gnome/gnome-objc-checks.m4
5444 * config/gnome/gnome-orbit-check.m4
5445 * config/gnome/gnome-print-check.m4
5446 * config/gnome/gnome-pthread-check.m4
5447 * config/gnome/gnome-support.m4
5448 * config/gnome/gnome-undelfs.m4
5449 * config/gnome/gnome-vfs.m4
5450 * config/gnome/gnome-x-checks.m4
5451 * config/gnome/gnome-xml-check.m4
5452 * config/gnome/gnome.m4
5453 * config/gnome/gperf-check.m4
5454 * config/gnome/gtk--.m4
5455 * config/gnome/linger.m4
5456 * config/gnome/need-declaration.m4: added configuration scripts
5457 for Gtk/Gnome frontend-GUI
5459 * configure.in: added support for the --with-frontend=gtk option
5461 * autogen.sh: added config/gnome/* to list of config-files
5463 * acconfig.h: added define for GTKGUI-support
5465 * config/lyxinclude.m4: added --with-frontend[=value] option value
5466 for Gtk/Gnome frontend-GUI support.
5468 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5470 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5474 * src/paragraph.C (GetChar): remove non-const version
5476 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5477 (search_kw): use it.
5479 * src/lyx_main.C (init): if "preferences" exist, read that instead
5481 (ReadRcFile): return bool if the file could be read ok.
5482 (ReadUIFile): add a check to see if lex file is set ok.
5484 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5485 bastring can be used instead of lyxstring (still uses the old code
5486 if std::string is good enough or if lyxstring is used.)
5488 * src/encoding.C: make the arrays static, move ininle functions
5490 * src/encoding.h: from here.
5492 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5493 (parseSingleLyXformat2Token): move inset parsing to separate method
5494 (readInset): new private method
5496 * src/Variables.h: remove virtual from get().
5498 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5499 access to NEW_INSETS and NEW_TABULAR
5501 * src/MenuBackend.h: remove superfluous forward declaration of
5502 MenuItem. Add documentations tags "///", remove empty MenuItem
5503 destructor, remove private default contructor.
5505 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5507 (read): more string mlabel and mname to where they are used
5508 (read): remove unused variables mlabel and mname
5509 (defaults): unconditional clear, make menusetup take advantage of
5510 add returning Menu &.
5512 * src/LyXView.h: define NEW_MENUBAR as default
5514 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5515 to NEW_INSETS and NEW_TABULAR.
5516 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5517 defined. Change some of the "xxxx-inset-insert" functions names to
5520 * several files: more enahncements to NEW_INSETS and the resulting
5523 * lib/lyxrc.example (\date_insert_format): move to misc section
5525 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5526 bastring and use AC_CACHE_CHECK.
5527 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5528 the system have the newest methods. uses AC_CACHE_CHECK
5529 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5530 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5531 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5533 * configure.in: add LYX_CXX_GOOD_STD_STRING
5535 * acinclude.m4: recreated
5537 2000-07-24 Amir Karger <karger@lyx.org>
5539 * README: add Hebrew, Arabic kmaps
5542 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5544 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5547 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5549 * Lot of files: add pragma interface/implementation.
5551 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5553 * lib/ui/default.ui: new file (ans new directory). Contains the
5554 default menu and toolbar.
5556 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5557 global space. Toolbars are now read (as menus) in ui files.
5559 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5561 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5562 is disabled because the document is read-only. We want to have the
5563 toggle state of the function anyway.
5564 (getStatus): add code for LFUN_VC* functions (mimicking what is
5565 done in old-style menus)
5567 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5568 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5570 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5571 * src/BufferView_pimpl.C: ditto.
5572 * src/lyxfunc.C: ditto.
5574 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5575 default). This replaces old-style menus by new ones.
5577 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5578 MenuItem. Contain the data structure of a menu.
5580 * src/insets/insettext.C: use LyXView::setLayout instead of
5581 accessing directly the toolbar combox.
5582 * src/lyxfunc.C (Dispatch): ditto.
5584 * src/LyXView.C (setLayout): new method, which just calls
5585 Toolbar::setLayout().
5586 (updateLayoutChoice): move part of this method in Toolbar.
5588 * src/toolbar.[Ch]: removed.
5590 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5591 implementation the toolbar.
5593 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5594 the toolbar. It might make sense to merge it with ToolbarDefaults
5596 (setLayout): new function.
5597 (updateLayoutList): ditto.
5598 (openLayoutList): ditto.
5600 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5601 xforms implementation of the toolbar.
5602 (get_toolbar_func): comment out, since I do not
5603 know what it is good for.
5605 * src/ToolbarDefaults.h: Add the ItemType enum.
5607 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5608 for a list of allocated C strings. Used in Menubar xforms
5609 implementation to avoid memory leaks.
5611 * src/support/lstrings.[Ch] (uppercase): new version taking and
5615 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5616 * lib/bind/emacs.bind: ditto.
5618 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5620 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5621 forward decl of LyXView.
5623 * src/toolbar.C (toolbarItem): moved from toolbar.h
5624 (toolbarItem::clean): ditto
5625 (toolbarItem::~toolbarItem): ditto
5626 (toolbarItem::operator): ditto
5628 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5630 * src/paragraph.h: control the NEW_TABULAR define from here
5632 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5633 USE_TABULAR_INSETS to NEW_TABULAR
5635 * src/ToolbarDefaults.C: add include "lyxlex.h"
5637 * files using the old table/tabular: use NEW_TABULAR to control
5638 compilation of old tabular stuff.
5640 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5643 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5644 planemet in reading of old style floats, fix the \end_deeper
5645 problem when reading old style floats.
5647 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5649 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5651 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5653 * lib/bind/sciword.bind: updated.
5655 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5657 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5658 layout write problem
5660 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5662 * src/Makefile.am (INCLUDES): remove image directory from include
5665 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5666 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5668 * src/LyXView.C (create_form_form_main): read the application icon
5671 * lib/images/*.xpm: change the icons to use transparent color for
5674 * src/toolbar.C (update): change the color of the button when it
5677 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5679 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5680 setting explicitely the minibuffer.
5681 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5683 * src/LyXView.C (showState): new function. Shows font information
5684 in minibuffer and update toolbar state.
5685 (LyXView): call Toolbar::update after creating the
5688 * src/toolbar.C: change toollist to be a vector instead of a
5690 (BubbleTimerCB): get help string directly from the callback
5691 argument of the corresponding icon (which is the action)
5692 (set): remove unnecessary ugliness.
5693 (update): new function. update the icons (depressed, disabled)
5694 depending of the status of the corresponding action.
5696 * src/toolbar.h: remove help in toolbarItem
5698 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5700 * src/Painter.C (text): Added code for using symbol glyphs from
5701 iso10646 fonts. Currently diabled.
5703 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5706 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5707 magyar,turkish and usorbian.
5709 * src/paragraph.C (isMultiLingual): Made more efficient.
5711 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5714 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5715 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5716 Also changed the prototype to "bool math_insert_greek(char)".
5718 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5720 * lots of files: apply the NEW_INSETS on all code that will not be
5721 needed when we move to use the new insets. Enable the define in
5722 lyxparagrah.h to try it.
5724 * src/insets/insettabular.C (cellstart): change to be a static
5726 (InsetTabular): initialize buffer in the initializer list.
5728 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5730 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5731 form_print.h out of the header file. Replaced with forward
5732 declarations of the relevant struct.
5734 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5737 * src/commandtags.h: do not include "debug.h" which does not
5738 belong there. #include it in some other places because of this
5741 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5743 * src/insets/insetcaption.C: add a couple "using" directives.
5745 * src/toolbar.C (add): get the help text directly from lyxaction.
5747 (setPixmap): new function. Loads from disk and sets a pixmap on a
5748 botton; the name of the pixmap file is derived from the command
5751 * src/toolbar.h: remove members isBitmap and pixmap from
5754 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5755 * lib/images/: move many files from images/banner.xpm.
5757 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5759 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5760 * src/toolbar.C: ditto.
5761 * configure.in: ditto.
5762 * INSTALL: document.
5764 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5765 the spellchecker popup is closed from the WM.
5767 2000-07-19 Juergen Vigna <jug@sad.it>
5769 * src/insets/insetfloat.C (Write): small fix because we use the
5770 insetname for the type now!
5772 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5774 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5777 * src/frontends/Dialogs.h: removed hideCitation signal
5779 * src/insets/insetcite.h: added hide signal
5781 * src/insets/insetcite.C (~InsetCitation): emits new signal
5782 (getScreenLabel): "intelligent" label should now fit on the screen!
5784 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5786 * src/frontends/xforms/FormCitation.C (showInset): connects
5787 hide() to the inset's hide signal
5788 (show): modified to use fl_set_object_position rather than
5789 fl_set_object_geometry wherever possible
5791 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5793 * src/insets/lyxinset.h: add caption code
5795 * src/insets/insetfloat.C (type): new method
5797 * src/insets/insetcaption.C (Write): new method
5799 (LyxCode): new method
5801 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5802 to get it right together with using the FloatList.
5804 * src/commandtags.h: add LFUN_INSET_CAPTION
5805 * src/lyxfunc.C (Dispatch): handle it
5807 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5810 * src/Variables.[Ch]: make expand take a const reference, remove
5811 the destructor, some whitespace changes.
5813 * src/LyXAction.C (init): add caption-inset-insert
5815 * src/FloatList.C (FloatList): update the default floats a bit.
5817 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5819 * src/Variables.[Ch]: new files. Intended to be used for language
5820 specific strings (like \chaptername) and filename substitution in
5823 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5825 * lib/kbd/american.kmap: update
5827 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5829 * src/bufferparams.[Ch]: remove member allowAccents.
5831 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5833 * src/LaTeXLog.C: use the log_form.h header.
5834 * src/lyx_gui.C: ditto.
5835 * src/lyx_gui_misc.C: ditto.
5836 * src/lyxvc.h: ditto.
5838 * forms/log_form.fd: new file, created from latexoptions.fd. I
5839 kept the log popup and nuked the options form.
5841 * src/{la,}texoptions.[Ch]: removed.
5842 * src/lyx_cb.C (LaTeXOptions): ditto
5844 * src/lyx_gui.C (create_forms): do not handle the
5845 fd_latex_options form.
5847 2000-07-18 Juergen Vigna <jug@sad.it>
5849 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5850 name of the inset so that it can be requested outside (text2.C).
5852 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5855 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5857 * src/mathed/formula.h (ConvertFont): constify
5859 * src/mathed/formula.C (Read): add warning if \end_inset is not
5860 found on expected place.
5862 * src/insets/lyxinset.h (ConvertFont): consify
5864 * src/insets/insetquotes.C (ConvertFont): constify
5865 * src/insets/insetquotes.h: ditto
5867 * src/insets/insetinfo.h: add labelfont
5869 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5870 (ascent): use labelfont
5874 (Write): make .lyx file a bit nicer
5876 * src/insets/insetfloat.C (Write): simplify somewhat...
5877 (Read): add warning if arg is not found
5879 * src/insets/insetcollapsable.C: add using std::max
5880 (Read): move string token and add warning in arg is not found
5881 (draw): use std::max to get the right ty
5882 (getMaxWidth): simplify by using std::max
5884 * src/insets/insetsection.h: new file
5885 * src/insets/insetsection.C: new file
5886 * src/insets/insetcaption.h: new file
5887 * src/insets/insetcaption.C: new file
5889 * src/insets/inset.C (ConvertFont): constify signature
5891 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5892 insetcaption.[Ch] and insetsection.[Ch]
5894 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5895 uses to use LABEL_COUNTER_CHAPTER instead.
5896 * src/text2.C (SetCounter): here
5898 * src/counters.h: new file
5899 * src/counters.C: new file
5900 * src/Sectioning.h: new file
5901 * src/Sectioning.C: new file
5903 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5905 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5907 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5910 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5913 2000-07-17 Juergen Vigna <jug@sad.it>
5915 * src/tabular.C (Validate): check if array-package is needed.
5916 (SetVAlignment): added support for vertical alignment.
5917 (SetLTFoot): better support for longtable header/footers
5918 (Latex): modified to support added features.
5920 * src/LaTeXFeatures.[Ch]: added array-package.
5922 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5924 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5927 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5929 * configure.in: do not forget to put a space after -isystem.
5931 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5933 * lib/kbd/arabic.kmap: a few fixes.
5935 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5937 * some whitespace chagnes to a number of files.
5939 * src/support/DebugStream.h: change to make it easier for
5940 doc++ to parse correctly.
5941 * src/support/lyxstring.h: ditto
5943 * src/mathed/math_utils.C (compara): change to have only one
5945 (MathedLookupBOP): change because of the above.
5947 * src/mathed/math_delim.C (math_deco_compare): change to have only
5949 (search_deco): change becasue of the above.
5951 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5952 instead of manually coded one.
5954 * src/insets/insetquotes.C (Read): read the \end_inset too
5956 * src/insets/insetlatex.h: remove file
5957 * src/insets/insetlatex.C: remove file
5959 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5961 (InsetPrintIndex): remove destructor
5963 * src/insets/insetinclude.h: remove default constructor
5965 * src/insets/insetfloat.C: work to make it work better
5967 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5969 * src/insets/insetcite.h (InsetCitation): remove default constructor
5971 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5973 * src/text.C (GetColumnNearX): comment out some currently unused code.
5975 * src/paragraph.C (writeFile): move some initializations closer to
5977 (CutIntoMinibuffer): small change to use new matchIT operator
5981 (InsertInset): ditto
5984 (InsetIterator): ditto
5985 (Erase): small change to use new matchFT operator
5987 (GetFontSettings): ditto
5988 (HighestFontInRange): ditto
5991 * src/lyxparagraph.h: some chars changed to value_type
5992 (matchIT): because of some stronger checking (perhaps too strong)
5993 in SGI STL, the two operator() unified to one.
5996 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5998 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5999 the last inset read added
6000 (parseSingleLyXformat2Token): some more (future) compability code added
6001 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6002 (parseSingleLyXformat2Token): set last_inset_read
6003 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6004 (parseSingleLyXformat2Token): don't double intializw string next_token
6006 * src/TextCache.C (text_fits::operator()): add const's to the signature
6007 (has_buffer::operator()): ditto
6009 * src/Floating.h: add some comments on the class
6011 * src/FloatList.[Ch] (typeExist): new method
6014 * src/BackStack.h: added default constructor, wanted by Gcc.
6016 2000-07-14 Juergen Vigna <jug@sad.it>
6018 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6020 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6022 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6023 do a redraw when the window is resized!
6024 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6026 * src/insets/insettext.C (resizeLyXText): added function to correctly
6027 being able to resize the LyXWindow.
6029 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6031 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6033 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6034 crashes when closing dialog to a deleted inset.
6036 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6037 method! Now similar to other insets.
6039 2000-07-13 Juergen Vigna <jug@sad.it>
6041 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6043 * lib/examples/Literate.lyx: small patch!
6045 * src/insets/insetbib.C (Read): added this function because of wrong
6046 Write (without [begin|end]_inset).
6048 2000-07-11 Juergen Vigna <jug@sad.it>
6050 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6051 as the insertInset could not be good!
6053 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6054 the bool param should not be last.
6056 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6058 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6059 did submit that to Karl).
6061 * configure.in: use -isystem instead of -I for X headers. This
6062 fixes a problem on solaris with a recent gcc;
6063 put the front-end code after the X detection code;
6064 configure in sigc++ before lib/
6066 * src/lyx_main.C (commandLineHelp): remove -display from command
6069 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6071 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6072 Also put in Makefile rules for building the ``listerrors''
6073 program for parsing errors from literate programs written in LyX.
6075 * lib/build-listerrors: Added small shell script as part of compile
6076 process. This builds a working ``listerrors'' binary if noweb is
6077 installed and either 1) the VNC X server is installed on the machine,
6078 or 2) the user is compiling from within a GUI. The existence of a GUI
6079 is necessary to use the ``lyx --export'' feature for now. This
6080 hack can be removed once ``lyx --export'' no longer requires a GUI to
6083 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6085 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6086 now passed back correctly from gcc and placed "under" error
6087 buttons in a Literate LyX source.
6089 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6091 * src/text.C (GetColumnNearX): Better behavior when a RTL
6092 paragraph is ended by LTR text.
6094 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6097 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6099 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6100 true when clipboard is empty.
6102 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6104 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6105 row of the paragraph.
6106 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6107 to prevent calculation of bidi tables
6109 2000-07-07 Juergen Vigna <jug@sad.it>
6111 * src/screen.C (ToggleSelection): added y_offset and x_offset
6114 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6117 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6119 * src/insets/insettext.C: fixed Layout-Display!
6121 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6123 * configure.in: add check for strings.h header.
6125 * src/spellchecker.C: include <strings.h> in order to have a
6126 definition for bzero().
6128 2000-07-07 Juergen Vigna <jug@sad.it>
6130 * src/insets/insettext.C (draw): set the status of the bv->text to
6131 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6133 * src/screen.C (DrawOneRow):
6134 (DrawFromTo): redraw the actual row if something has changed in it
6137 * src/text.C (draw): call an update of the toplevel-inset if something
6138 has changed inside while drawing.
6140 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6142 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6144 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6145 processing inside class.
6147 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6148 processing inside class.
6150 * src/insets/insetindex.h new struct Holder, consistent with other
6153 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6154 citation dialog from main code and placed it in src/frontends/xforms.
6155 Dialog launched through signals instead of callbacks
6157 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6159 * lyx.man: update the options description.
6161 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6163 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6164 handle neg values, set min width to 590, add doc about -display
6166 2000-07-05 Juergen Vigna <jug@sad.it>
6168 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6169 calls to BufferView *.
6171 * src/insets/insettext.C (checkAndActivateInset): small fix non
6172 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6174 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6175 their \end_inset token!
6177 2000-07-04 edscott <edscott@imp.mx>
6179 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6180 lib/lyxrc.example: added option \wheel_jump
6182 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6184 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6185 remove support for -width,-height,-xpos and -ypos.
6187 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6189 * src/encoding.[Ch]: New files.
6191 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6192 (text): Call to the underline() method only when needed.
6194 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6196 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6197 encoding(s) for the document.
6199 * src/bufferparams.C (BufferParams): Changed default value of
6202 * src/language.C (newLang): Removed.
6203 (items[]): Added encoding information for all defined languages.
6205 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6206 encoding choice button.
6208 * src/lyxrc.h (font_norm_type): New member variable.
6209 (set_font_norm_type): New method.
6211 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6212 paragraphs with different encodings.
6214 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6215 (TransformChar): Changed to work correctly with Arabic points.
6216 (draw): Added support for drawing Arabic points.
6217 (draw): Removed code for drawing underbars (this is done by
6220 * src/support/textutils.h (IsPrintableNonspace): New function.
6222 * src/BufferView_pimpl.h: Added "using SigC::Object".
6223 * src/LyXView.h: ditto.
6225 * src/insets/insetinclude.h (include_label): Changed to mutable.
6227 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6229 * src/mathed/math_iter.h: remove empty destructor
6231 * src/mathed/math_cursor.h: remove empty destructor
6233 * src/insets/lyxinset.h: add THEOREM_CODE
6235 * src/insets/insettheorem.[Ch]: new files
6237 * src/insets/insetminipage.C: (InsertInset): remove
6239 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6241 (InsertInset): remove
6243 * src/insets/insetlist.C: (InsertList): remove
6245 * src/insets/insetfootlike.[Ch]: new files
6247 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6250 (InsertInset): ditto
6252 * src/insets/insetert.C: remove include Painter.h, reindent
6253 (InsertInset): move to header
6255 * src/insets/insetcollapsable.h: remove explicit from default
6256 contructor, remove empty destructor, add InsertInset
6258 * src/insets/insetcollapsable.C (InsertInset): new func
6260 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6262 * src/vspace.h: add explicit to constructor
6264 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6265 \textcompwordmark, please test this.
6267 * src/lyxrc.C: set ascii_linelen to 65 by default
6269 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6271 * src/commandtags.h: add LFUN_INSET_THEOREM
6273 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6274 (makeLinuxDocFile): remove _some_ of the nice logic
6275 (makeDocBookFile): ditto
6277 * src/Painter.[Ch]: (~Painter): removed
6279 * src/LyXAction.C (init): entry for insettheorem added
6281 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6283 (deplog): code to detect files generated by LaTeX, needs testing
6286 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6288 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6290 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6292 * src/LaTeX.C (deplog): Add a check for files that are going to be
6293 created by the first latex run, part of the project to remove the
6296 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6297 contents to the extension list.
6299 2000-07-04 Juergen Vigna <jug@sad.it>
6301 * src/text.C (NextBreakPoint): added support for needFullRow()
6303 * src/insets/lyxinset.h: added needFullRow()
6305 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6308 * src/insets/insettext.C: lots of changes for update!
6310 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6312 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6314 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6316 * src/insets/insetinclude.C (InsetInclude): fixed
6317 initialization of include_label.
6318 (unique_id): now returns a string.
6320 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6322 * src/LaTeXFeatures.h: new member IncludedFiles, for
6323 a map of key, included file name.
6325 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6326 with the included files for inclusion in SGML preamble,
6327 i. e., linuxdoc and docbook.
6330 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6331 nice (is the generated linuxdoc code to be exported?), that
6332 allows to remove column, and only_body that will be true for
6333 slave documents. Insets are allowed inside SGML font type.
6334 New handling of the SGML preamble for included files.
6335 (makeDocBookFile): the same for docbook.
6337 * src/insets/insetinclude.h:
6338 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6340 (DocBook): new export methods.
6342 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6343 and makeDocBookFile.
6345 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6346 formats to export with command line argument -x.
6348 2000-06-29 Juergen Vigna <jug@sad.it>
6350 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6351 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6353 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6354 region could already been cleared by an inset!
6356 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6358 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6361 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6363 (cursorToggle): remove special handling of lyx focus.
6365 2000-06-28 Juergen Vigna <jug@sad.it>
6367 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6370 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6372 * src/insets/insetindex.C (Edit): add a callback when popup is
6375 * src/insets/insettext.C (LocalDispatch):
6376 * src/insets/insetmarginal.h:
6377 * src/insets/insetlist.h:
6378 * src/insets/insetfoot.h:
6379 * src/insets/insetfloat.h:
6380 * src/insets/insetert.h: add a missing std:: qualifier.
6382 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6384 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6387 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6389 * src/insets/insettext.C (Read): remove tmptok unused variable
6390 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6391 (InsertInset): change for new InsetInset code
6393 * src/insets/insettext.h: add TEXT inline method
6395 * src/insets/insettext.C: remove TEXT macro
6397 * src/insets/insetmarginal.C (Write): new method
6398 (Latex): change output slightly
6400 * src/insets/insetfoot.C (Write): new method
6401 (Latex): change output slightly (don't use endl when no need)
6403 * src/insets/insetert.C (Write): new method
6405 * src/insets/insetcollapsable.h: make button_length, button_top_y
6406 and button_bottm_y protected.
6408 * src/insets/insetcollapsable.C (Write): simplify code by using
6409 tostr. Also do not output the float name, the children class
6410 should to that to get control over own arguments
6412 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6413 src/insets/insetminipage.[Ch]:
6416 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6418 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6420 * src/Makefile.am (lyx_SOURCES): add the new files
6422 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6423 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6424 * src/commandtags.h: ditto
6426 * src/LaTeXFeatures.h: add a std::set of used floattypes
6428 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6430 * src/FloatList.[Ch] src/Floating.h: new files
6432 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6434 * src/lyx_cb.C (TableApplyCB): ditto
6436 * src/text2.C: ditto
6437 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6438 (parseSingleLyXformat2Token): ditto + add code for
6439 backwards compability for old float styles + add code for new insets
6441 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6443 (InsertInset(size_type, Inset *, LyXFont)): new method
6444 (InsetChar(size_type, char)): changed to use the other InsetChar
6445 with a LyXFont(ALL_INHERIT).
6446 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6447 insert the META_INSET.
6449 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6451 * sigc++/thread.h (Threads): from here
6453 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6454 definition out of line
6455 * sigc++/scope.h: from here
6457 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6459 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6460 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6462 * Makefile.am (bindist): new target.
6464 * INSTALL: add instructions for doing a binary distribution.
6466 * development/tools/README.bin.example: update a bit.
6468 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6471 * lib/lyxrc.example: new lyxrc tag \set_color.
6473 * src/lyxfunc.C (Dispatch):
6474 * src/commandtags.h:
6475 * src/LyXAction.C: new lyxfunc "set-color".
6477 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6478 and an x11name given as strings.
6480 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6481 cache when a color is changed.
6483 2000-06-26 Juergen Vigna <jug@sad.it>
6485 * src/lyxrow.C (width): added this functions and variable.
6487 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6490 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6492 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6494 * images/undo_bw.xpm: new icon.
6495 * images/redo_bw.xpm: ditto.
6497 * configure.in (INSTALL_SCRIPT): change value to
6498 ${INSTALL} to avoid failures of install-script target.
6499 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6501 * src/BufferView.h: add a magic "friend" declaration to please
6504 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6506 * forms/cite.fd: modified to allow resizing without messing
6509 * src/insetcite.C: Uses code from cite.fd almost without
6511 User can now resize dialog in the x-direction.
6512 Resizing the dialog in the y-direction is prevented, as the
6513 code does this intelligently already.
6515 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6517 * INSTALL: remove obsolete entry in "problems" section.
6519 * lib/examples/sl_*.lyx: update of the slovenian examples.
6521 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6523 2000-06-23 Juergen Vigna <jug@sad.it>
6525 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6527 * src/buffer.C (resize): delete the LyXText of textinsets.
6529 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6531 * src/insets/lyxinset.h: added another parameter 'cleared' to
6532 the draw() function.
6534 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6535 unlocking inset in inset.
6537 2000-06-22 Juergen Vigna <jug@sad.it>
6539 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6540 of insets and moved first to LyXText.
6542 * src/mathed/formulamacro.[Ch]:
6543 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6545 2000-06-21 Juergen Vigna <jug@sad.it>
6547 * src/text.C (GetVisibleRow): look if I should clear the area or not
6548 using Inset::doClearArea() function.
6550 * src/insets/lyxinset.h: added doClearArea() function and
6551 modified draw(Painter &, ...) to draw(BufferView *, ...)
6553 * src/text2.C (UpdateInset): return bool insted of int
6555 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6557 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6558 combox in the character popup
6560 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6561 BufferParams const & params
6563 2000-06-20 Juergen Vigna <jug@sad.it>
6565 * src/insets/insettext.C (SetParagraphData): set insetowner on
6568 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6570 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6571 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6573 (form_main_): remove
6575 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6576 (create_form_form_main): remove FD_form_main stuff, connect to
6577 autosave_timeout signal
6579 * src/LyXView.[Ch] (getMainForm): remove
6580 (UpdateTimerCB): remove
6581 * src/BufferView_pimpl.h: inherit from SigC::Object
6583 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6584 signal instead of callback
6586 * src/BufferView.[Ch] (cursorToggleCB): remove
6588 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6590 * src/BufferView_pimpl.C: changes because of the one below
6592 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6593 instead of storing a pointer to a LyXText.
6595 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6597 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6599 * src/lyxparagraph.h
6601 * src/paragraph.C: Changed fontlist to a sorted vector.
6603 2000-06-19 Juergen Vigna <jug@sad.it>
6605 * src/BufferView.h: added screen() function.
6607 * src/insets/insettext.C (LocalDispatch): some selection code
6610 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6612 * src/insets/insettext.C (SetParagraphData):
6614 (InsetText): fixes for multiple paragraphs.
6616 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6618 * development/lyx.spec.in: Call configure with ``--without-warnings''
6619 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6620 This should be fine, however, since we generally don't want to be
6621 verbose when making an RPM.
6623 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6625 * lib/scripts/fig2pstex.py: New file
6627 2000-06-16 Juergen Vigna <jug@sad.it>
6629 * src/insets/insettabular.C (UpdateLocal):
6630 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6631 (LocalDispatch): Changed all functions to use LyXText.
6633 2000-06-15 Juergen Vigna <jug@sad.it>
6635 * src/text.C (SetHeightOfRow): call inset::update before requesting
6638 * src/insets/insettext.C (update):
6639 * src/insets/insettabular.C (update): added implementation
6641 * src/insets/lyxinset.h: added update function
6643 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6645 * src/text.C (SelectNextWord): protect against null pointers with
6646 old-style string streams. (fix from Paul Theo Gonciari
6649 * src/cite.[Ch]: remove erroneous files.
6651 * lib/configure.m4: update the list of created directories.
6653 * src/lyxrow.C: include <config.h>
6654 * src/lyxcursor.C: ditto.
6656 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6658 * lib/examples/decimal.lyx: new example file from Mike.
6660 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6661 to find template definitions (from Dekel)
6663 * src/frontends/.cvsignore: add a few things.
6665 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6667 * src/Timeout.C (TimeOut): remove default argument.
6669 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6672 * src/insets/ExternalTemplate.C: add a "using" directive.
6674 * src/lyx_main.h: remove the act_ struct, which seems unused
6677 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6679 * LyX Developers Meeting: All files changed, due to random C++ (by
6680 coincidence) code generator script.
6682 - external inset (cool!)
6683 - initial online editing of preferences
6684 - insettabular breaks insettext(s contents)
6686 - some DocBook fixes
6687 - example files update
6688 - other cool stuff, create a diff and look for yourself.
6690 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6692 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6693 -1 this is a non-line-breaking textinset.
6695 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6696 if there is no width set.
6698 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6700 * Lots of files: Merged the dialogbase branch.
6702 2000-06-09 Allan Rae <rae@lyx.org>
6704 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6705 and the Dispatch methods that used it.
6707 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6708 access to functions formerly kept in Dispatch.
6710 2000-05-19 Allan Rae <rae@lyx.org>
6712 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6713 made to_page and count_copies integers again. from_page remains a
6714 string however because I want to allow entry of a print range like
6715 "1,4,22-25" using this field.
6717 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6718 and printer-params-get. These aren't useful from the minibuffer but
6719 could be used by a script/LyXServer app provided it passes a suitable
6720 auto_mem_buffer. I guess I should take a look at how the LyXServer
6721 works and make it support xtl buffers.
6723 * sigc++/: updated to libsigc++-1.0.1
6725 * src/xtl/: updated to xtl-1.3.pl.11
6727 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6728 those changes done to the files in src/ are actually recreated when
6729 they get regenerated. Please don't ever accept a patch that changes a
6730 dialog unless that patch includes the changes to the corresponding *.fd
6733 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6734 stringOnlyContains, renamed it and generalised it.
6736 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6737 branch. Removed the remaining old form_print code.
6739 2000-04-26 Allan Rae <rae@lyx.org>
6741 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6742 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6744 2000-04-25 Allan Rae <rae@lyx.org>
6746 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6747 against a base of xtl-1.3.pl.4
6749 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6750 filter the Id: entries so they still show the xtl version number
6753 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6754 into the src/xtl code. Patch still pending with José (XTL)
6756 2000-04-24 Allan Rae <rae@lyx.org>
6758 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6759 both more generic and much safer. Use the new template functions.
6760 * src/buffer.[Ch] (Dispatch): ditto.
6762 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6763 and mem buffer more intelligently. Also a little general cleanup.
6766 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6767 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6768 * src/xtl/Makefile.am: ditto.
6769 * src/xtl/.cvsignore: ditto.
6770 * src/Makefile.am: ditto.
6772 * src/PrinterParams.h: Removed the macros member functions. Added a
6773 testInvariant member function. A bit of tidying up and commenting.
6774 Included Angus's idea for fixing operation with egcs-1.1.2.
6776 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6777 cool expansion of XTL's mem_buffer to support automatic memory
6778 management within the buffer itself. Removed the various macros and
6779 replaced them with template functions that use either auto_mem_buffer
6780 or mem_buffer depending on a #define. The mem_buffer support will
6781 disappear as soon as the auto_mem_buffer is confirmed to be good on
6782 other platforms/compilers. That is, it's there so you've got something
6785 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6786 effectively forked XTL. However I expect José will include my code
6787 into the next major release. Also fixed a memory leak.
6788 * src/xtl/text.h: ditto.
6789 * src/xtl/xdr.h: ditto.
6790 * src/xtl/giop.h: ditto.
6792 2000-04-16 Allan Rae <rae@lyx.org>
6794 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6795 by autogen.sh and removed by maintainer-clean anyway.
6796 * .cvsignore, sigc++/.cvsignore: Support the above.
6798 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6800 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6802 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6803 macros, renamed static callback-target member functions to suit new
6804 scheme and made them public.
6805 * src/frontends/xforms/forms/form_print.fd: ditto.
6806 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6808 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6811 * src/xtl/: New directory containing a minimal distribution of XTL.
6812 This is XTL-1.3.pl.4.
6814 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6816 2000-04-15 Allan Rae <rae@lyx.org>
6818 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6820 * sigc++/: Updated to libsigc++-1.0.0
6822 2000-04-14 Allan Rae <rae@lyx.org>
6824 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6825 use the generic ones in future. I'll modify my conversion script.
6827 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6829 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6830 (CloseAllBufferRelatedDialogs): Renamed.
6831 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6833 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6834 of the generic ones. These are the same ones my conversion script
6837 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6838 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6839 * src/buffer.C (Dispatch): ditto
6841 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6842 functions for updating and hiding buffer dependent dialogs.
6843 * src/BufferView.C (buffer): ditto
6844 * src/buffer.C (setReadonly): ditto
6845 * src/lyxfunc.C (CloseBuffer): ditto
6847 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6848 Dialogs.h, and hence all the SigC stuff, into every file that includes
6849 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6851 * src/BufferView2.C: reduce the number of headers included by buffer.h
6853 2000-04-11 Allan Rae <rae@lyx.org>
6855 * src/frontends/xforms/xform_macros.h: A small collection of macros
6856 for building C callbacks.
6858 * src/frontends/xforms/Makefile.am: Added above file.
6860 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6861 scheme again. This time it should work for JMarc. If this is
6862 successful I'll revise my conversion script to automate some of this.
6863 The static member functions in the class also have to be public for
6864 this scheme will work. If the scheme works (it's almost identical to
6865 the way BufferView::cursorToggleCB is handled so it should work) then
6866 FormCopyright and FormPrint will be ready for inclusion into the main
6867 trunk immediately after 1.1.5 is released -- provided we're prepared
6868 for complaints about lame compilers not handling XTL.
6870 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6872 2000-04-07 Allan Rae <rae@lyx.org>
6874 * config/lyxinclude.m4: A bit more tidying up (Angus)
6876 * src/LString.h: JMarc's <string> header fix
6878 * src/PrinterParams.h: Used string for most data to remove some
6879 ugly code in the Print dialog and avoid even uglier code when
6880 appending the ints to a string for output.
6882 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6883 and moved "default:" back to the end of switch statement. Cleaned
6884 up the printing so it uses the right function calls and so the
6885 "print to file" option actually puts the file in the right directory.
6887 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6889 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6890 and Ok+Apply button control into a separate method: input (Angus).
6891 (input) Cleaned it up and improved it to be very thorough now.
6892 (All CB) static_cast used instead of C style cast (Angus). This will
6893 probably change again once we've worked out how to keep gcc-2.8.1 happy
6894 with real C callbacks.
6895 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6896 ignore some of the bool settings and has random numbers instead. Needs
6897 some more investigation. Added other input length checks and checking
6898 of file and printer names.
6900 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6901 would link (Angus). Seems the old code doesn't compile with the pragma
6902 statement either. Separated callback entries from internal methods.
6904 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6906 2000-03-17 Allan Rae <rae@lyx.org>
6908 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6909 need it? Maybe it could go in Dialogs instead? I could make it a
6910 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6911 values to get the bool return value.
6912 (Dispatch): New overloaded method for xtl support.
6914 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6915 extern "C" callback instead of static member functions. Hopefully,
6916 JMarc will be able to compile this. I haven't changed
6917 forms/form_copyright.fd yet. Breaking one of my own rules already.
6919 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6920 because they aren't useful from the minibuffer. Maybe a LyXServer
6921 might want a help message though?
6923 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6925 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6926 xtl which needs both rtti and exceptions.
6928 * src/support/Makefile.am:
6929 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6931 * src/frontends/xforms/input_validators.[ch]: input filters and
6932 validators. These conrol what keys are valid in input boxes.
6933 Use them and write some more. Much better idea than waiting till
6934 after the user has pressed Ok to say that the input fields don't make
6937 * src/frontends/xforms/Makefile.am:
6938 * src/frontends/xforms/forms/form_print.fd:
6939 * src/frontends/xforms/forms/makefile:
6940 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6941 new scheme. Still have to make sure I haven't missed anything from
6942 the current implementation.
6944 * src/Makefile.am, src/PrinterParams.h: New data store.
6946 * other files: Added a couple of copyright notices.
6948 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6950 * src/insets/insetbib.h: move Holder struct in public space.
6952 * src/frontends/include/DialogBase.h: use SigC:: only when
6953 SIGC_CXX_NAMESPACES is defined.
6954 * src/frontends/include/Dialogs.h: ditto.
6956 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6958 * src/frontends/xforms/FormCopyright.[Ch]: do not
6959 mention SigC:: explicitely.
6961 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6963 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6964 deals with testing KDE in main configure.in
6965 * configure.in: ditto.
6967 2000-02-22 Allan Rae <rae@lyx.org>
6969 * Lots of files: Merged from HEAD
6971 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6972 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6974 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6976 * sigc++/: new minidist.
6978 2000-02-14 Allan Rae <rae@lyx.org>
6980 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6982 2000-02-08 Juergen Vigna <jug@sad.it>
6984 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6985 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6987 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6988 for this port and so it is much easier for other people to port
6989 dialogs in a common development environment.
6991 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6992 the QT/KDE implementation.
6994 * src/frontends/kde/Dialogs.C:
6995 * src/frontends/kde/FormCopyright.C:
6996 * src/frontends/kde/FormCopyright.h:
6997 * src/frontends/kde/Makefile.am:
6998 * src/frontends/kde/formcopyrightdialog.C:
6999 * src/frontends/kde/formcopyrightdialog.h:
7000 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7001 for the kde support of the Copyright-Dialog.
7003 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7004 subdir-substitution instead of hardcoded 'xforms' as we now have also
7007 * src/frontends/include/DialogBase.h (Object): just commented the
7008 label after #endif (nasty warning and I don't like warnings ;)
7010 * src/main.C (main): added KApplication initialization if using
7013 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7014 For now only the KDE event-loop is added if frontend==kde.
7016 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7018 * configure.in: added support for the --with-frontend[=value] option
7020 * autogen.sh: added kde.m4 file to list of config-files
7022 * acconfig.h: added define for KDEGUI-support
7024 * config/kde.m4: added configuration functions for KDE-port
7026 * config/lyxinclude.m4: added --with-frontend[=value] option with
7027 support for xforms and KDE.
7029 2000-02-08 Allan Rae <rae@lyx.org>
7031 * all Makefile.am: Fixed up so the make targets dist, distclean,
7032 install and uninstall all work even if builddir != srcdir. Still
7033 have a new sigc++ minidist update to come.
7035 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7037 2000-02-01 Allan Rae <rae@lyx.org>
7039 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7040 Many mods to get builddir != srcdir working.
7042 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7043 for building on NT and so we can do the builddir != srcdir stuff.
7045 2000-01-30 Allan Rae <rae@lyx.org>
7047 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7048 This will stay in "rae" branch. We probably don't really need it in
7049 the main trunk as anyone who wants to help programming it should get
7050 a full library installed also. So they can check both included and
7051 system supplied library compilation.
7053 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7054 Added a 'mini' distribution of libsigc++. If you feel the urge to
7055 change something in these directories - Resist it. If you can't
7056 resist the urge then you should modify the following script and rebuild
7057 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7058 all happen. Still uses a hacked version of libsigc++'s configure.in.
7059 I'm quite happy with the results. I'm not sure the extra work to turn
7060 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7061 worth the trouble and would probably lead to extra maintenance
7063 I haven't tested the following important make targets: install, dist.
7064 Not ready for prime time but very close. Maybe 1.1.5.
7066 * development/tools/makeLyXsigc.sh: A shell script to automatically
7067 generate our mini-dist of libsigc++. It can only be used with a CVS
7068 checkout of libsigc++ not a tarball distribution. It's well commented.
7069 This will end up as part of the libsigc++ distribution so other apps
7070 can easily have an included mini-dist. If someone makes mods to the
7071 sigc++ subpackage without modifying this script to generate those
7072 changes I'll be very upset!
7074 * src/frontends/: Started the gui/system indep structure.
7076 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7077 to access the gui-indep dialogs are in this class. Much improved
7078 design compared to previous revision. Lars, please refrain from
7079 moving this header into src/ like you did with Popups.h last time.
7081 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7083 * src/frontends/xforms/: Started the gui-indep system with a single
7084 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7087 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7088 Here you'll find a very useful makefile and automated fdfix.sh that
7089 makes updating dailogs a no-brainer -- provided you follow the rules
7090 set out in the README. I'm thinking about adding another script to
7091 automatically generate skeleton code for a new dialog given just the
7094 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7095 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7096 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7098 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7100 * src/support/LSubstring.C (operator): simplify
7102 * src/lyxtext.h: removed bparams, use buffer_->params instead
7104 * src/lyxrow.h: make Row a real class, move all variables to
7105 private and use accessors.
7107 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7109 (isRightToLeftPar): ditto
7110 (ChangeLanguage): ditto
7111 (isMultiLingual): ditto
7114 (SimpleTeXOnePar): ditto
7115 (TeXEnvironment): ditto
7116 (GetEndLabel): ditto
7118 (SetOnlyLayout): ditto
7119 (BreakParagraph): ditto
7120 (BreakParagraphConservative): ditto
7121 (GetFontSettings): ditto
7123 (CopyIntoMinibuffer): ditto
7124 (CutIntoMinibuffer): ditto
7125 (PasteParagraph): ditto
7126 (SetPExtraType): ditto
7127 (UnsetPExtraType): ditto
7128 (DocBookContTableRows): ditto
7129 (SimpleDocBookOneTablePar): ditto
7131 (TeXFootnote): ditto
7132 (SimpleTeXOneTablePar): ditto
7133 (TeXContTableRows): ditto
7134 (SimpleTeXSpecialChars): ditto
7137 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7138 to private and use accessors.
7140 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7141 this, we did not use it anymore and has not been for ages. Just a
7142 waste of cpu cycles.
7144 * src/language.h: make Language a real class, move all variables
7145 to private and use accessors.
7147 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7148 (create_view): remove
7149 (update): some changes for new timer
7150 (cursorToggle): use new timer
7151 (beforeChange): change for new timer
7153 * src/BufferView.h (cursorToggleCB): removed last paramter because
7156 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7157 (cursorToggleCB): change because of new timer code
7159 * lib/CREDITS: updated own mailaddress
7161 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7163 * src/support/filetools.C (PutEnv): fix the code in case neither
7164 putenv() nor setenv() have been found.
7166 * INSTALL: mention the install-strip Makefile target.
7168 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7169 read-only documents.
7171 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7173 * lib/reLyX/configure.in (VERSION): avoid using a previously
7174 generated reLyX wrapper to find out $prefix.
7176 * lib/examples/eu_adibide_lyx-atua.lyx:
7177 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7178 translation of the Tutorial (Dooteo)
7180 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7182 * forms/cite.fd: new citation dialog
7184 * src/insetcite.[Ch]: the new citation dialog is moved into
7187 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7190 * src/insets/insetcommand.h: data members made private.
7192 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7194 * LyX 1.1.5 released
7196 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7198 * src/version.h (LYX_RELEASE): to 1.1.5
7200 * src/spellchecker.C (RunSpellChecker): return false if the
7201 spellchecker dies upon creation.
7203 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7205 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7206 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7210 * lib/CREDITS: update entry for Martin Vermeer.
7212 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7214 * src/text.C (draw): Draw foreign language bars at the bottom of
7215 the row instead of at the baseline.
7217 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7219 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7221 * lib/bind/de_menus.bind: updated
7223 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7225 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7227 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7229 * src/menus.C (Limit_string_length): New function
7230 (ShowTocMenu): Limit the number of items/length of items in the
7233 * src/paragraph.C (String): Correct result for a paragraph inside
7236 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7238 * src/bufferlist.C (close): test of buf->getuser() == NULL
7240 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7242 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7243 Do not call to SetCursor when the paragraph is a closed footnote!
7245 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7247 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7250 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7252 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7255 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7256 reference popup, that activates the reference-back action
7258 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7260 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7261 the menus. Also fixed a bug.
7263 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7264 the math panels when switching buffers (unless new buffer is readonly).
7266 * src/BufferView.C (NoSavedPositions)
7267 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7269 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7271 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7272 less of dvi dirty or not.
7274 * src/trans_mgr.[Ch] (insert): change first parameter to string
7277 * src/chset.[Ch] (encodeString): add const to first parameter
7279 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7281 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7285 * src/LaTeX.C (deplog): better searching for dependency files in
7286 the latex log. Uses now regexps.
7288 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7289 instead of the box hack or \hfill.
7291 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7293 * src/lyxfunc.C (doImportHelper): do not create the file before
7294 doing the actual import.
7295 (doImportASCIIasLines): create a new file before doing the insert.
7296 (doImportASCIIasParagraphs): ditto.
7298 * lib/lyxrc.example: remove mention of non-existing commands
7300 * lyx.man: remove mention of color-related switches.
7302 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7304 * src/lyx_gui.C: remove all the color-related ressources, which
7305 are not used anymore.
7307 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7310 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7312 * src/lyxrc.C (read): Add a missing break in the switch
7314 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7316 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7318 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7321 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7323 * src/text.C (draw): draw bars under foreign language words.
7325 * src/LColor.[Ch]: add LColor::language
7327 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7329 * src/lyxcursor.h (boundary): New member variable
7331 * src/text.C (IsBoundary): New methods
7333 * src/text.C: Use the above for currect cursor movement when there
7334 is both RTL & LTR text.
7336 * src/text2.C: ditto
7338 * src/bufferview_funcs.C (ToggleAndShow): ditto
7340 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7342 * src/text.C (DeleteLineForward): set selection to true to avoid
7343 that DeleteEmptyParagraphMechanism does some magic. This is how it
7344 is done in all other functions, and seems reasonable.
7345 (DeleteWordForward): do not jump over non-word stuff, since
7346 CursorRightOneWord() already does it.
7348 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7349 DeleteWordBackward, since they seem safe to me (since selection is
7350 set to "true") DeleteEmptyParagraphMechanism does nothing.
7352 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7354 * src/lyx_main.C (easyParse): simplify the code by factoring the
7355 part that removes parameters from the command line.
7356 (LyX): check wether wrong command line options have been given.
7358 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7360 * src/lyx_main.C : add support for specifying user LyX
7361 directory via command line option -userdir.
7363 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7365 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7366 the number of items per popup.
7367 (Add_to_refs_menu): Ditto.
7369 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7371 * src/lyxparagraph.h: renamed ClearParagraph() to
7372 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7373 textclass as parameter, and do nothing if free_spacing is
7374 true. This fixes part of the line-delete-forward problems.
7376 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7377 (pasteSelection): ditto.
7378 (SwitchLayoutsBetweenClasses): more translatable strings.
7380 * src/text2.C (CutSelection): use StripLeadingSpaces.
7381 (PasteSelection): ditto.
7382 (DeleteEmptyParagraphMechanism): ditto.
7384 2000-05-26 Juergen Vigna <jug@sad.it>
7386 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7387 is not needed in tabular insets.
7389 * src/insets/insettabular.C (TabularFeatures): added missing features.
7391 * src/tabular.C (DeleteColumn):
7393 (AppendRow): implemented this functions
7394 (cellsturct::operator=): clone the inset too;
7396 2000-05-23 Juergen Vigna <jug@sad.it>
7398 * src/insets/insettabular.C (LocalDispatch): better selection support
7399 when having multicolumn-cells.
7401 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7403 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7405 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7407 * src/ColorHandler.C (getGCForeground): put more test into _()
7409 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7412 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7415 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7417 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7418 there are no labels, or when buffer is readonly.
7420 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7421 there are no labels, buffer is SGML, or when buffer is readonly.
7423 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7425 * src/LColor.C (LColor): change a couple of grey40 to grey60
7426 (LColor): rewore initalization to make compiles go some magnitude
7428 (getGUIName): don't use gettext until we need the string.
7430 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7432 * src/Bullet.[Ch]: Fixed a small bug.
7434 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7436 * src/paragraph.C (String): Several fixes/improvements
7438 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7440 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7442 * src/paragraph.C (String): give more correct output.
7444 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7446 * src/lyxfont.C (stateText) Do not output the language if it is
7447 eqaul to the language of the document.
7449 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7450 between two paragraphs with the same language.
7452 * src/paragraph.C (getParLanguage) Return a correct answer for an
7453 empty dummy paragraph.
7455 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7458 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7461 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7462 the menus/popup, if requested fonts are unavailable.
7464 2000-05-22 Juergen Vigna <jug@sad.it>
7466 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7467 movement support (Up/Down/Tab/Shift-Tab).
7468 (LocalDispatch): added also preliminari cursor-selection.
7470 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7472 * src/paragraph.C (PasteParagraph): Hopefully now right!
7474 2000-05-22 Garst R. Reese <reese@isn.net>
7476 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7477 of list, change all references to Environment to Command
7478 * tex/hollywood.cls : rewrite environments as commands, add
7479 \uppercase to interiorshot and exteriorshot to force uppecase.
7480 * tex/broadway.cls : rewrite environments as commands. Tweak
7483 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7485 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7486 size of items: use a constant intead of the hardcoded 40, and more
7487 importantly do not remove the %m and %x tags added at the end.
7488 (Add_to_refs_menu): use vector::size_type instead of
7489 unsigned int as basic types for the variables. _Please_ do not
7490 assume that size_t is equal to unsigned int. On an alpha, this is
7491 unsigned long, which is _not_ the same.
7493 * src/language.C (initL): remove language "hungarian", since it
7494 seems that "magyar" is better.
7496 2000-05-22 Juergen Vigna <jug@sad.it>
7498 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7500 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7503 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7504 next was deleted but not set to 0.
7506 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7508 * src/language.C (initL): change the initialization of languages
7509 so that compiles goes _fast_.
7511 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7514 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7516 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7520 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7522 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7524 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7528 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7531 * src/insets/insetlo*.[Ch]: Made editable
7533 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7535 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7536 the current selection.
7538 * src/BufferView_pimpl.C (stuffClipboard): new method
7540 * src/BufferView.C (stuffClipboard): new method
7542 * src/paragraph.C (String): new method
7544 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7545 LColor::ignore when lyxname is not found.
7547 * src/BufferView.C (pasteSelection): new method
7549 * src/BufferView_pimpl.C (pasteSelection): new method
7551 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7553 * src/WorkArea.C (request_clipboard_cb): new static function
7554 (getClipboard): new method
7555 (putClipboard): new method
7557 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7559 * LyX 1.1.5pre2 released
7561 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7563 * src/vspace.C (operator=): removed
7564 (operator=): removed
7566 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7568 * src/layout.C (NumberOfClass): manually set the type in make_pair
7569 (NumberOfLayout): ditto
7571 * src/language.C: use the Language constructor for ignore_lang
7573 * src/language.h: add constructors to struct Language
7575 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7577 * src/text2.C (SetCursorIntern): comment out #warning
7579 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7581 * src/mathed/math_iter.h: initialize sx and sw to 0
7583 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7585 * forms/lyx.fd: Redesign of form_ref
7587 * src/LaTeXFeatures.[Ch]
7591 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7594 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7595 and Buffer::inset_iterator.
7597 * src/menus.C: Added new menus: TOC and Refs.
7599 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7601 * src/buffer.C (getTocList): New method.
7603 * src/BufferView2.C (ChangeRefs): New method.
7605 * src/buffer.C (getLabelList): New method. It replaces the old
7606 getReferenceList. The return type is vector<string> instead of
7609 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7610 the old getLabel() and GetNumberOfLabels() methods.
7611 * src/insets/insetlabel.C (getLabelList): ditto
7612 * src/mathed/formula.C (getLabelList): ditto
7614 * src/paragraph.C (String): New method.
7616 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7617 Uses the new getTocList() method.
7618 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7619 which automatically updates the contents of the browser.
7620 (RefUpdateCB): Use the new getLabelList method.
7622 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7624 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7626 * src/spellchecker.C: Added using std::reverse;
7628 2000-05-19 Juergen Vigna <jug@sad.it>
7630 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7632 * src/insets/insettext.C (computeTextRows): small fix for display of
7633 1 character after a newline.
7635 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7638 2000-05-18 Juergen Vigna <jug@sad.it>
7640 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7641 when changing width of column.
7643 * src/tabular.C (set_row_column_number_info): setting of
7644 autobreak rows if necessary.
7646 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7648 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7650 * src/vc-backend.*: renamed stat() to status() and vcstat to
7651 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7652 compilation broke. The new name seems more relevant, anyway.
7654 2000-05-17 Juergen Vigna <jug@sad.it>
7656 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7657 which was wrong if the removing caused removing of rows!
7659 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7660 (pushToken): new function.
7662 * src/text2.C (CutSelection): fix problem discovered with purify
7664 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7666 * src/debug.C (showTags): enlarge the first column, now that we
7667 have 6-digits debug codes.
7669 * lib/layouts/hollywood.layout:
7670 * lib/tex/hollywood.cls:
7671 * lib/tex/brodway.cls:
7672 * lib/layouts/brodway.layout: more commands and fewer
7673 environments. Preambles moved in the .cls files. Broadway now has
7674 more options on scene numbering and less whitespace (from Garst)
7676 * src/insets/insetbib.C (getKeys): make sure that we are in the
7677 document directory, in case the bib file is there.
7679 * src/insets/insetbib.C (Latex): revert bogus change.
7681 2000-05-16 Juergen Vigna <jug@sad.it>
7683 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7684 the TabularLayout on cursor move.
7686 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7688 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7691 (draw): fixed cursor position and drawing so that the cursor is
7692 visible when before the tabular-inset.
7694 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7695 when creating from old insettext.
7697 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7699 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7701 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7702 * lib/tex/brodway.cls: ditto
7704 * lib/layouts/brodway.layout: change alignment of parenthical
7707 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7709 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7710 versions 0.88 and 0.89 are supported.
7712 2000-05-15 Juergen Vigna <jug@sad.it>
7714 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7717 * src/insets/insettext.C (computeTextRows): redone completely this
7718 function in a much cleaner way, because of problems when having a
7720 (draw): added a frame border when the inset is locked.
7721 (SetDrawLockedFrame): this sets if we draw the border or not.
7722 (SetFrameColor): this sets the frame color (default=insetframe).
7724 * src/insets/lyxinset.h: added x() and y() functions which return
7725 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7726 function which is needed to see if we have a locking inset of some
7727 type in this inset (needed for now in insettabular).
7729 * src/vspace.C (inPixels): the same function also without a BufferView
7730 parameter as so it is easier to use it in some ocasions.
7732 * src/lyxfunc.C: changed all places where insertInset was used so
7733 that now if it couldn't be inserted it is deleted!
7735 * src/TabularLayout.C:
7736 * src/TableLayout.C: added support for new tabular-inset!
7738 * src/BufferView2.C (insertInset): this now returns a bool if the
7739 inset was really inserted!!!
7741 * src/tabular.C (GetLastCellInRow):
7742 (GetFirstCellInRow): new helper functions.
7743 (Latex): implemented for new tabular class.
7747 (TeXTopHLine): new Latex() helper functions.
7749 2000-05-12 Juergen Vigna <jug@sad.it>
7751 * src/mathed/formulamacro.C (Read):
7752 * src/mathed/formula.C (Read): read also the \end_inset here!
7754 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7756 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7757 crush when saving formulae with unbalanced parenthesis.
7759 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7761 * src/layout.C: Add new keyword "endlabelstring" to layout file
7763 * src/text.C (GetVisibleRow): Draw endlabel string.
7765 * lib/layouts/broadway.layout
7766 * lib/layouts/hollywood.layout: Added endlabel for the
7767 Parenthetical layout.
7769 * lib/layouts/heb-article.layout: Do not use slanted font shape
7770 for Theorem like environments.
7772 * src/buffer.C (makeLaTeXFile): Always add "american" to
7773 the UsedLanguages list if document language is RTL.
7775 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7777 * add addendum to README.OS2 and small patch (from SMiyata)
7779 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7781 * many files: correct the calls to ChangeExtension().
7783 * src/support/filetools.C (ChangeExtension): remove the no_path
7784 argument, which does not belong there. Use OnlyFileName() instead.
7786 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7787 files when LaTeXing a non-nice latex file.
7789 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7790 a chain of "if". Return false when deadkeys are not handled.
7792 * src/lyx_main.C (LyX): adapted the code for default bindings.
7794 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7795 bindings for basic functionality (except deadkeys).
7796 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7798 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7799 several methods: handle override_x_deadkeys.
7801 * src/lyxrc.h: remove the "bindings" map, which did not make much
7802 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7804 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7806 * src/lyxfont.C (stateText): use a saner method to determine
7807 whether the font is "default". Seems to fix the crash with DEC
7810 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7812 2000-05-08 Juergen Vigna <jug@sad.it>
7814 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7815 TabularLayoutMenu with mouse-button-3
7816 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7818 * src/TabularLayout.C: added this file for having a Layout for
7821 2000-05-05 Juergen Vigna <jug@sad.it>
7823 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7824 recalculating inset-widths.
7825 (TabularFeatures): activated this function so that I can change
7826 tabular-features via menu.
7828 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7829 that I can test some functions with the Table menu.
7831 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7833 * src/lyxfont.C (stateText): guard against stupid c++libs.
7835 * src/tabular.C: add using std::vector
7836 some whitespace changes, + removed som autogenerated code.
7838 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7840 2000-05-05 Juergen Vigna <jug@sad.it>
7842 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7843 row, columns and cellstructures.
7845 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7847 * lib/lyxrc.example: remove obsolete entries.
7849 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7850 reading of protected_separator for free_spacing.
7852 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7854 * src/text.C (draw): do not display an exclamation mark in the
7855 margin for margin notes. This is confusing, ugly and
7858 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7859 AMS math' is checked.
7861 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7862 name to see whether including the amsmath package is needed.
7864 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7866 * src/paragraph.C (validate): Compute UsedLanguages correctly
7867 (don't insert the american language if it doesn't appear in the
7870 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7871 The argument of \thanks{} command is considered moving argument
7873 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7876 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7878 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7879 for appendix/minipage/depth. The lines can be now both in the footnote
7880 frame, and outside the frame.
7882 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7885 2000-05-05 Juergen Vigna <jug@sad.it>
7887 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7888 neede only in tabular.[Ch].
7890 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7892 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7894 (Write): write '~' for PROTECTED_SEPARATOR
7896 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7898 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7901 * src/mathed/formula.C (drawStr): rename size to siz.
7903 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7904 possibly fix a bug by not changing the pflags = flags to piflags =
7907 2000-05-05 Juergen Vigna <jug@sad.it>
7909 * src/insets/insetbib.C: moved using directive
7911 * src/ImportNoweb.C: small fix for being able to compile (missing
7914 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7917 to use clear, since we don't depend on this in the code. Add test
7920 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7922 * (various *.C files): add using std::foo directives to please dec
7925 * replace calls to string::clear() to string::erase() (Angus)
7927 * src/cheaders/cmath: modified to provide std::abs.
7929 2000-05-04 Juergen Vigna <jug@sad.it>
7931 * src/insets/insettext.C: Prepared all for inserting of multiple
7932 paragraphs. Still display stuff to do (alignment and other things),
7933 but I would like to use LyXText to do this when we cleaned out the
7934 table-support stuff.
7936 * src/insets/insettabular.C: Changed lot of stuff and added lots
7937 of functionality still a lot to do.
7939 * src/tabular.C: Various functions changed name and moved to be
7940 const functions. Added new Read and Write functions and changed
7941 lots of things so it works good with tabular-insets (also removed
7942 some stuff which is not needed anymore * hacks *).
7944 * src/lyxcursor.h: added operators == and != which just look if
7945 par and pos are (not) equal.
7947 * src/buffer.C (latexParagraphs): inserted this function to latex
7948 all paragraphs form par to endpar as then I can use this too for
7951 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7952 so that I can call this to from text insets with their own cursor.
7954 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7955 output off all paragraphs (because of the fix below)!
7957 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7958 the very last paragraph (this could be also the last paragraph of an
7961 * src/texrow.h: added rows() call which returns the count-variable.
7963 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7965 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7967 * lib/configure.m4: better autodetection of DocBook tools.
7969 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7971 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7973 * src/lyx_cb.C: add using std::reverse;
7975 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7978 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7979 selected files. Should fix repeated errors from generated files.
7981 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7983 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7985 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7986 the spellchecker popup.
7988 * lib/lyxrc.example: Removed the \number_inset section
7990 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7992 * src/insets/figinset.C (various): Use IsFileReadable() to make
7993 sure that the file actually exist. Relying on ghostscripts errors
7994 is a bad idea since they can lead to X server crashes.
7996 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7998 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8001 * lib/lyxrc.example: smallish typo in description of
8002 \view_dvi_paper_option
8004 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8007 * src/lyxfunc.C: doImportHelper to factor out common code of the
8008 various import methods. New functions doImportASCIIasLines,
8009 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8010 doImportLinuxDoc for the format specific parts.
8013 * buffer.C: Dispatch returns now a bool to indicate success
8016 * lyx_gui.C: Add getLyXView() for member access
8018 * lyx_main.C: Change logic for batch commands: First try
8019 Buffer::Dispatch (possibly without GUI), if that fails, use
8022 * lyx_main.C: Add support for --import command line switch.
8023 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8024 Available Formats: Everything accepted by 'buffer-import <format>'
8026 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8028 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8031 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8032 documents will be reformatted upon reentry.
8034 2000-04-27 Juergen Vigna <jug@sad.it>
8036 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8037 correctly only last pos this was a bug.
8039 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8041 * release of lyx-1.1.5pre1
8043 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8045 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8047 * src/menus.C: revert the change of naming (Figure->Graphic...)
8048 from 2000-04-11. It was incomplete and bad.
8050 * src/LColor.[Ch]: add LColor::depthbar.
8051 * src/text.C (GetVisibleRow): use it.
8053 * README: update the languages list.
8055 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8057 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8060 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8062 * README: remove sections that were just wrong.
8064 * src/text2.C (GetRowNearY): remove currentrow code
8066 * src/text.C (GetRow): remove currentrow code
8068 * src/screen.C (Update): rewritten a bit.
8069 (SmallUpdate): removed func
8071 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8073 (FullRebreak): return bool
8074 (currentrow): remove var
8075 (currentrow_y): ditto
8077 * src/lyxscreen.h (Draw): change arg to unsigned long
8078 (FitCursor): return bool
8079 (FitManualCursor): ditto
8080 (Smallpdate): remove func
8081 (first): change to unsigned long
8082 (DrawOneRow): change second arg to long (from long &)
8083 (screen_refresh_y): remove var
8084 (scree_refresh_row): ditto
8086 * src/lyxrow.h: change baseline to usigned int from unsigned
8087 short, this brings some implicit/unsigned issues out in the open.
8089 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8091 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8092 instead of smallUpdate.
8094 * src/lyxcursor.h: change y to unsigned long
8096 * src/buffer.h: don't call updateScrollbar after fitcursor
8098 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8099 where they are used. Removed "\\direction", this was not present
8100 in 1.1.4 and is already obsolete. Commented out some code that I
8101 believe to never be called.
8102 (runLiterate): don't call updateScrollbar after fitCursor
8104 (buildProgram): ditto
8107 * src/WorkArea.h (workWidth): change return val to unsigned
8110 (redraw): remove the button redraws
8111 (setScrollbarValue): change for scrollbar
8112 (getScrollbarValue): change for scrollbar
8113 (getScrollbarBounds): change for scrollbar
8115 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8116 (C_WorkArea_down_cb): removed func
8117 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8118 (resize): change for scrollbar
8119 (setScrollbar): ditto
8120 (setScrollbarBounds): ditto
8121 (setScrollbarIncrements): ditto
8122 (up_cb): removed func
8123 (down_cb): removed func
8124 (scroll_cb): change for scrollbar
8125 (work_area_handler): ditto
8127 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8128 when FitCursor did something.
8129 (updateScrollbar): some unsigned changes
8130 (downCB): removed func
8131 (scrollUpOnePage): removed func
8132 (scrollDownOnePage): remvoed func
8133 (workAreaMotionNotify): don't call screen->FitCursor but use
8134 fitCursor instead. and bool return val
8135 (workAreaButtonPress): ditto
8136 (workAreaButtonRelease): some unsigned changes
8137 (checkInsetHit): ditto
8138 (workAreaExpose): ditto
8139 (update): parts rewritten, comments about the signed char arg added
8140 (smallUpdate): removed func
8141 (cursorPrevious): call needed updateScrollbar
8144 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8147 * src/BufferView.[Ch] (upCB): removed func
8148 (downCB): removed func
8149 (smallUpdate): removed func
8151 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8153 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8154 currentrow, currentrow_y optimization. This did not help a lot and
8155 if we want to do this kind of optimization we should rather use
8156 cursor.row instead of the currentrow.
8158 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8159 buffer spacing and klyx spacing support.
8161 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8163 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8166 2000-04-26 Juergen Vigna <jug@sad.it>
8168 * src/insets/figinset.C: fixes to Lars sstream changes!
8170 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8172 * A lot of files: Added Ascii(ostream &) methods to all inset
8173 classes. Used when exporting to ASCII.
8175 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8176 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8179 * src/text2.C (ToggleFree): Disabled implicit word selection when
8180 there is a change in the language
8182 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8183 no output was generated for end-of-sentence inset.
8185 * src/insets/lyxinset.h
8188 * src/paragraph.C: Removed the insetnumber code
8190 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8192 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8194 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8195 no_babel and no_epsfig completely from the file.
8196 (parseSingleLyXformat2Token): add handling for per-paragraph
8197 spacing as written by klyx.
8199 * src/insets/figinset.C: applied patch by Andre. Made it work with
8202 2000-04-20 Juergen Vigna <jug@sad.it>
8204 * src/insets/insettext.C (cutSelection):
8205 (copySelection): Fixed with selection from right to left.
8206 (draw): now the rows are not recalculated at every draw.
8207 (computeTextRows): for now reset the inset-owner here (this is
8208 important for an undo or copy where the inset-owner is not set
8211 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8212 motion to the_locking_inset screen->first was forgotten, this was
8213 not important till we got multiline insets.
8215 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8217 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8218 code seems to be alright (it is code changed by Dekel, and the
8219 intent is indeed that all macros should be defined \protect'ed)
8221 * NEWS: a bit of reorganisation of the new user-visible features.
8223 2000-04-19 Juergen Vigna <jug@sad.it>
8225 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8226 position. Set the inset_owner of the used paragraph so that it knows
8227 that it is inside an inset. Fixed cursor handling with mouse and
8228 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8229 and cleanups to make TextInsets work better.
8231 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8232 Changed parameters of various functions and added LockInsetInInset().
8234 * src/insets/insettext.C:
8236 * src/insets/insetcollapsable.h:
8237 * src/insets/insetcollapsable.C:
8238 * src/insets/insetfoot.h:
8239 * src/insets/insetfoot.C:
8240 * src/insets/insetert.h:
8241 * src/insets/insetert.C: cleaned up the code so that it works now
8242 correctly with insettext.
8244 * src/insets/inset.C:
8245 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8246 that insets in insets are supported right.
8249 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8251 * src/paragraph.C: some small fixes
8253 * src/debug.h: inserted INSETS debug info
8255 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8256 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8258 * src/commandtags.h:
8259 * src/LyXAction.C: insert code for InsetTabular.
8261 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8262 not Button1MotionMask.
8263 (workAreaButtonRelease): send always a InsetButtonRelease event to
8265 (checkInsetHit): some setCursor fixes (always with insets).
8267 * src/BufferView2.C (lockInset): returns a bool now and extended for
8268 locking insets inside insets.
8269 (showLockedInsetCursor): it is important to have the cursor always
8270 before the locked inset.
8271 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8273 * src/BufferView.h: made lockInset return a bool.
8275 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8277 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8278 that is used also internally but can be called as public to have back
8279 a cursor pos which is not set internally.
8280 (SetCursorIntern): Changed to use above function.
8282 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8284 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8289 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8290 patches for things that should be in or should be changed.
8292 * src/* [insetfiles]: change "usigned char fragile" to bool
8293 fragile. There was only one point that could that be questioned
8294 and that is commented in formulamacro.C. Grep for "CHECK".
8296 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8297 (DeleteBuffer): take it out of CutAndPaste and make it static.
8299 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8301 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8302 output the spacing envir commands. Also the new commands used in
8303 the LaTeX output makes the result better.
8305 * src/Spacing.C (writeEnvirBegin): new method
8306 (writeEnvirEnd): new method
8308 2000-04-18 Juergen Vigna <jug@sad.it>
8310 * src/CutAndPaste.C: made textclass a static member of the class
8311 as otherwise it is not accesed right!!!
8313 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8315 * forms/layout_forms.fd
8316 * src/layout_forms.h
8317 * src/layout_forms.C (create_form_form_character)
8318 * src/lyx_cb.C (UserFreeFont)
8319 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8320 documents (in the layout->character popup).
8322 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8324 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8325 \spell_command was in fact not honored (from Kevin Atkinson).
8327 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8330 * src/lyx_gui.h: make lyxViews private (Angus)
8332 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8334 * src/mathed/math_write.C
8335 (MathMatrixInset::Write) Put \protect before \begin{array} and
8336 \end{array} if fragile
8337 (MathParInset::Write): Put \protect before \\ if fragile
8339 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8341 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8342 initialization if the LyXColorHandler must be done after the
8343 connections to the XServer has been established.
8345 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8346 get the background pixel from the lyxColorhandler so that the
8347 figures are rendered with the correct background color.
8348 (NextToken): removed functions.
8349 (GetPSSizes): use ifs >> string instead of NextToken.
8351 * src/Painter.[Ch]: the color cache moved out of this file.
8353 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8356 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8358 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8359 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8361 * src/BufferView.C (enterView): new func
8362 (leaveView): new func
8364 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8366 (leaveView): new func, undefines xterm cursor when approp.
8368 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8369 (AllowInput): delete the Workarea cursor handling from this func.
8371 * src/Painter.C (underline): draw a slimer underline in most cases.
8373 * src/lyx_main.C (error_handler): use extern "C"
8375 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8377 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8378 sent directly to me.
8380 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8381 to the list by Dekel.
8383 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8386 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8387 methods from lyx_cb.here.
8389 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8392 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8394 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8395 instead of using current_view directly.
8397 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8399 * src/LyXAction.C (init): add the paragraph-spacing command.
8401 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8403 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8405 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8406 different from the documents.
8408 * src/text.C (SetHeightOfRow): take paragraph spacing into
8409 account, paragraph spacing takes precedence over buffer spacing
8410 (GetVisibleRow): ditto
8412 * src/paragraph.C (writeFile): output the spacing parameter too.
8413 (validate): set the correct features if spacing is used in the
8415 (Clear): set spacing to default
8416 (MakeSameLayout): spacing too
8417 (HasSameLayout): spacing too
8418 (SetLayout): spacing too
8419 (TeXOnePar): output the spacing commands
8421 * src/lyxparagraph.h: added a spacing variable for use with
8422 per-paragraph spacing.
8424 * src/Spacing.h: add a Default spacing and a method to check if
8425 the current spacing is default. also added an operator==
8427 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8430 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8432 * src/lyxserver.C (callback): fix dispatch of functions
8434 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8435 printf() into lyxerr call.
8437 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8440 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8441 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8442 the "Float" from each of the subitems.
8443 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8445 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8446 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8447 documented the change so that the workaround can be nuked later.
8449 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8452 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8454 * src/buffer.C (getLatexName): ditto
8455 (setReadonly): ditto
8457 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8459 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8460 avoid some uses of current_view. Added also a bufferParams()
8461 method to get at this.
8463 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8465 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8467 * src/lyxparagraph.[Ch]: removed
8468 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8469 with operators used by lower_bound and
8470 upper_bound in InsetTable's
8471 Make struct InsetTable private again. Used matchpos.
8473 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8475 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8476 document, the language of existing text is changed (unless the
8477 document is multi-lingual)
8479 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8481 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8483 * A lot of files: A rewrite of the Right-to-Left support.
8485 2000-04-10 Juergen Vigna <jug@sad.it>
8487 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8488 misplaced cursor when inset in inset is locked.
8490 * src/insets/insettext.C (LocalDispatch): small fix so that a
8491 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8493 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8494 footnote font should be decreased in size twice when displaying.
8496 * src/insets/insettext.C (GetDrawFont): inserted this function as
8497 the drawing-font may differ from the real paragraph font.
8499 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8500 insets (inset in inset!).
8502 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8503 function here because we don't want footnotes inside footnotes.
8505 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8507 (init): now set the inset_owner in paragraph.C
8508 (LocalDispatch): added some resetPos() in the right position
8511 (pasteSelection): changed to use the new CutAndPaste-Class.
8513 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8514 which tells if it is allowed to insert another inset inside this one.
8516 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8517 SwitchLayoutsBetweenClasses.
8519 * src/text2.C (InsertInset): checking of the new paragraph-function
8521 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8522 is not needed anymore here!
8525 (PasteSelection): redone (also with #ifdef) so that now this uses
8526 the CutAndPaste-Class.
8527 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8530 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8531 from/to text/insets.
8533 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8534 so that the paragraph knows if it is inside an (text)-inset.
8535 (InsertFromMinibuffer): changed return-value to bool as now it
8536 may happen that an inset is not inserted in the paragraph.
8537 (InsertInsetAllowed): this checks if it is allowed to insert an
8538 inset in this paragraph.
8540 (BreakParagraphConservative):
8541 (BreakParagraph) : small change for the above change of the return
8542 value of InsertFromMinibuffer.
8544 * src/lyxparagraph.h: added inset_owner and the functions to handle
8545 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8547 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8549 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8550 functions from BufferView to BufferView::Pimpl to ease maintence.
8552 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8553 correctly. Also use SetCursorIntern instead of SetCursor.
8555 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8558 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8560 * src/WorkArea.C (belowMouse): manually implement below mouse.
8562 * src/*: Add "explicit" on several constructors, I added probably
8563 some unneeded ones. A couple of changes to code because of this.
8565 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8566 implementation and private parts from the users of BufferView. Not
8569 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8570 implementation and private parts from the users of LyXLex. Not
8573 * src/BufferView_pimpl.[Ch]: new files
8575 * src/lyxlex_pimpl.[Ch]: new files
8577 * src/LyXView.[Ch]: some inline functions move out-of-line
8579 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8581 * src/lyxparagraph.h: make struct InsetTable public.
8583 * src/support/lyxstring.h: change lyxstring::difference_type to be
8584 ptrdiff_t. Add std:: modifiers to streams.
8586 * src/font.C: include the <cctype> header, for islower() and
8589 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8591 * src/font.[Ch]: new files. Contains the metric functions for
8592 fonts, takes a LyXFont as parameter. Better separation of concepts.
8594 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8595 changes because of this.
8597 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8599 * src/*: compile with -Winline and move functions that don't
8602 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8605 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8607 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8608 (various files changed because of this)
8610 * src/Painter.C (text): fixed the drawing of smallcaps.
8612 * src/lyxfont.[Ch] (drawText): removed unused member func.
8615 * src/*.C: added needed "using" statements and "std::" qualifiers.
8617 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8619 * src/*.h: removed all use of "using" from header files use
8620 qualifier std:: instead.
8622 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8624 * src/text.C (Backspace): some additional cleanups (we already
8625 know whether cursor.pos is 0 or not).
8627 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8628 automake does not provide one).
8630 * src/bmtable.h: replace C++ comments with C comments.
8632 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8634 * src/screen.C (ShowCursor): Change the shape of the cursor if
8635 the current language is not equal to the language of the document.
8636 (If the cursor change its shape unexpectedly, then you've found a bug)
8638 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8641 * src/insets/insetnumber.[Ch]: New files.
8643 * src/LyXAction.C (init)
8644 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8647 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8649 * src/lyxparagraph.h
8650 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8651 (the vector is kept sorted).
8653 * src/text.C (GetVisibleRow): Draw selection correctly when there
8654 is both LTR and RTL text.
8656 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8657 which is much faster.
8659 * src/text.C (GetVisibleRow and other): Do not draw the last space
8660 in a row if the direction of the last letter is not equal to the
8661 direction of the paragraph.
8663 * src/lyxfont.C (latexWriteStartChanges):
8664 Check that font language is not equal to basefont language.
8665 (latexWriteEndChanges): ditto
8667 * src/lyx_cb.C (StyleReset): Don't change the language while using
8668 the font-default command.
8670 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8671 empty paragraph before a footnote.
8673 * src/insets/insetcommand.C (draw): Increase x correctly.
8675 * src/screen.C (ShowCursor): Change cursor shape if
8676 current language != document language.
8678 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8680 2000-03-31 Juergen Vigna <jug@sad.it>
8682 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8683 (Clone): changed mode how the paragraph-data is copied to the
8684 new clone-paragraph.
8686 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8687 GetInset(pos) with no inset anymore there (in inset UNDO)
8689 * src/insets/insetcommand.C (draw): small fix as here x is
8690 incremented not as much as width() returns (2 before, 2 behind = 4)
8692 2000-03-30 Juergen Vigna <jug@sad.it>
8694 * src/insets/insettext.C (InsetText): small fix in initialize
8695 widthOffset (should not be done in the init() function)
8697 2000-03-29 Amir Karger <karger@lyx.org>
8699 * lib/examples/it_ItemizeBullets.lyx: translation by
8702 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8704 2000-03-29 Juergen Vigna <jug@sad.it>
8706 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8708 * src/insets/insetfoot.C (Clone): small change as for the below
8709 new init function in the text-inset
8711 * src/insets/insettext.C (init): new function as I've seen that
8712 clone did not copy the Paragraph-Data!
8713 (LocalDispatch): Added code so that now we have some sort of Undo
8714 functionality (well actually we HAVE Undo ;)
8716 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8718 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8720 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8723 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8725 * src/main.C: added a runtime check that verifies that the xforms
8726 header used when building LyX and the library used when running
8727 LyX match. Exit with a message if they don't match. This is a
8728 version number check only.
8730 * src/buffer.C (save): Don't allocate memory on the heap for
8731 struct utimbuf times.
8733 * *: some using changes, use iosfwd instead of the real headers.
8735 * src/lyxfont.C use char const * instead of string for the static
8736 strings. Rewrite some functions to use sstream.
8738 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8740 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8743 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8745 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8746 of Geodesy (from Martin Vermeer)
8748 * lib/layouts/svjour.inc: include file for the Springer svjour
8749 class. It can be used to support journals other than JoG.
8751 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8752 Miskiewicz <misiek@pld.org.pl>)
8753 * lib/reLyX/Makefile.am: ditto.
8755 2000-03-27 Juergen Vigna <jug@sad.it>
8757 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8758 also some modifications with operations on selected text.
8760 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8761 problems with clicking on insets (last famous words ;)
8763 * src/insets/insetcommand.C (draw):
8764 (width): Changed to have a bit of space before and after the inset so
8765 that the blinking cursor can be seen (otherwise it was hidden)
8767 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8769 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8770 would not be added to the link list when an installed gettext (not
8771 part of libc) is found.
8773 2000-03-24 Juergen Vigna <jug@sad.it>
8775 * src/insets/insetcollapsable.C (Edit):
8776 * src/mathed/formula.C (InsetButtonRelease):
8777 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8780 * src/BufferView.C (workAreaButtonPress):
8781 (workAreaButtonRelease):
8782 (checkInsetHit): Finally fixed the clicking on insets be handled
8785 * src/insets/insetert.C (Edit): inserted this call so that ERT
8786 insets work always with LaTeX-font
8788 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8790 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8791 caused lyx to startup with no GUI in place, causing in a crash
8792 upon startup when called with arguments.
8794 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8796 * src/FontLoader.C: better initialization of dummyXFontStruct.
8798 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8800 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8801 for linuxdoc and docbook import and export format options.
8803 * lib/lyxrc.example Example of default values for the previous flags.
8805 * src/lyx_cb.C Use those flags instead of the hardwired values for
8806 linuxdoc and docbook export.
8808 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8811 * src/menus.C Added menus entries for the new import/exports formats.
8813 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8815 * src/lyxrc.*: Added support for running without Gui
8818 * src/FontLoader.C: sensible defaults if no fonts are needed
8820 * src/lyx_cb.C: New function ShowMessage (writes either to the
8821 minibuffer or cout in case of no gui
8822 New function AskOverwrite for common stuff
8823 Consequently various changes to call these functions
8825 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8826 wild guess at sensible screen resolution when having no gui
8828 * src/lyxfont.C: no gui, no fonts... set some defaults
8830 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8832 * src/LColor.C: made the command inset background a bit lighter.
8834 2000-03-20 Hartmut Goebel <goebel@noris.net>
8836 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8837 stdstruct.inc. Koma-Script added some title elements which
8838 otherwise have been listed below "bibliography". This split allows
8839 adding title elements to where they belong.
8841 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8842 define the additional title elements and then include
8845 * many other layout files: changed to include stdtitle.inc just
8846 before stdstruct.inc.
8848 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8850 * src/buffer.C: (save) Added the option to store all backup files
8851 in a single directory
8853 * src/lyxrc.[Ch]: Added variable \backupdir_path
8855 * lib/lyxrc.example: Added descriptions of recently added variables
8857 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8858 bibtex inset, not closing the bibtex popup when deleting the inset)
8860 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8862 * src/lyx_cb.C: add a couple using directives.
8864 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8865 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8866 import based on the filename.
8868 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8869 file would be imported at start, if the filename where of a sgml file.
8871 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8873 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8875 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8876 * src/lyxfont.h Replaced the member variable bits.direction by the
8877 member variable lang. Made many changes in other files.
8878 This allows having a multi-lingual document
8880 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8881 that change the current language to <l>.
8882 Removed the command "font-rtl"
8884 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8885 format for Hebrew documents)
8887 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8888 When auto_mathmode is "true", pressing a digit key in normal mode
8889 will cause entering into mathmode.
8890 If auto_mathmode is "rtl" then this behavior will be active only
8891 when writing right-to-left text.
8893 * src/text2.C (InsertStringA) The string is inserted using the
8896 * src/paragraph.C (GetEndLabel) Gives a correct result for
8897 footnote paragraphs.
8899 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8901 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8903 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8904 front of PasteParagraph. Never insert a ' '. This should at least
8905 fix some cause for the segfaults that we have been experiencing,
8906 it also fixes backspace behaviour slightly. (Phu!)
8908 * src/support/lstrings.C (compare_no_case): some change to make it
8909 compile with gcc 2.95.2 and stdlibc++-v3
8911 * src/text2.C (MeltFootnoteEnvironment): change type o
8912 first_footnote_par_is_not_empty to bool.
8914 * src/lyxparagraph.h: make text private. Changes in other files
8916 (fitToSize): new function
8917 (setContentsFromPar): new function
8918 (clearContents): new function
8919 (SetChar): new function
8921 * src/paragraph.C (readSimpleWholeFile): deleted.
8923 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8924 the file, just use a simple string instead. Also read the file in
8925 a more maintainable manner.
8927 * src/text2.C (InsertStringA): deleted.
8928 (InsertStringB): deleted.
8930 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8932 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8933 RedoParagraphs from the doublespace handling part, just set status
8934 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8935 done, but perhaps not like this.)
8937 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8939 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8940 character when inserting an inset.
8942 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8944 * src/bufferparams.C (readLanguage): now takes "default" into
8947 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8948 also initialize the toplevel_keymap with the default bindings from
8951 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8953 * all files using lyxrc: have lyxrc as a real variable and not a
8954 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8957 * src/lyxrc.C: remove double call to defaultKeyBindings
8959 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8960 toolbar defauls using lyxlex. Remove enums, structs, functions
8963 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8964 toolbar defaults. Also store default keybindings in a map.
8966 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8967 storing the toolbar defaults without any xforms dependencies.
8969 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8970 applied. Changed to use iterators.
8972 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8974 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8975 systems that don't have LINGUAS set to begin with.
8977 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8979 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8980 the list by Dekel Tsur.
8982 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8984 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8985 * src/insets/form_graphics.C: ditto.
8987 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8989 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8991 * src/bufferparams.C (readLanguage): use the new language map
8993 * src/intl.C (InitKeyMapper): use the new language map
8995 * src/lyx_gui.C (create_forms): use the new language map
8997 * src/language.[Ch]: New files. Used for holding the information
8998 about each language. Now! Use this new language map enhance it and
8999 make it really usable for our needs.
9001 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9003 * screen.C (ShowCursor): Removed duplicate code.
9004 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9005 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9007 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9010 * src/text.C Added TransformChar method. Used for rendering Arabic
9011 text correctly (change the glyphs of the letter according to the
9012 position in the word)
9017 * src/lyxrc.C Added lyxrc command {language_command_begin,
9018 language_command_end,language_command_ltr,language_command_rtl,
9019 language_package} which allows the use of either arabtex or Omega
9022 * src/lyx_gui.C (init)
9024 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9025 to use encoding for menu fonts which is different than the encoding
9028 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9029 do not load the babel package.
9030 To write an English document with Hebrew/Arabic, change the document
9031 language to "english".
9033 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9034 (alphaCounter): changed to return char
9035 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9037 * lib/lyxrc.example Added examples for Hebrew/Arabic
9040 * src/layout.C Added layout command endlabeltype
9042 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9044 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9046 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9048 * src/mathed/math_delim.C (search_deco): return a
9049 math_deco_struct* instead of index.
9051 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9053 * All files with a USE_OSTREAM_ONLY within: removed all code that
9054 was unused when USE_OSTREAM_ONLY is defined.
9056 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9057 of any less. Removed header and using.
9059 * src/text.C (GetVisibleRow): draw the string "Page Break
9060 (top/bottom)" on screen when drawing a pagebreak line.
9062 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9064 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9066 * src/mathed/math_macro.C (draw): do some cast magic.
9069 * src/mathed/math_defs.h: change byte* argument to byte const*.
9071 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9073 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9074 know it is right to return InsetFoot* too, but cxx does not like
9077 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9079 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9081 * src/mathed/math_delim.C: change == to proper assignment.
9083 2000-03-09 Juergen Vigna <jug@sad.it>
9085 * src/insets/insettext.C (setPos): fixed various cursor positioning
9086 problems (via mouse and cursor-keys)
9087 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9088 inset (still a small display problem but it works ;)
9090 * src/insets/insetcollapsable.C (draw): added button_top_y and
9091 button_bottom_y to have correct values for clicking on the inset.
9093 * src/support/lyxalgo.h: commented out 'using std::less'
9095 2000-03-08 Juergen Vigna <jug@sad.it>
9097 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9098 Button-Release event closes as it is alos the Release-Event
9101 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9103 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9105 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9106 can add multiple spaces in Scrap (literate programming) styles...
9107 which, by the way, is how I got hooked on LyX to begin with.
9109 * src/mathed/formula.C (Write): Added dummy variable to an
9110 inset::Latex() call.
9111 (Latex): Add free_spacing boolean to inset::Latex()
9113 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9115 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9116 virtual function to include the free_spacing boolean from
9117 the containing paragraph's style.
9119 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9120 Added free_spacing boolean arg to match inset.h
9122 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9123 Added free_spacing boolean arg to match inset.h
9125 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9126 Added free_spacing boolean and made sure that if in a free_spacing
9127 paragraph, that we output normal space if there is a protected space.
9129 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9130 Added free_spacing boolean arg to match inset.h
9132 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9133 Added free_spacing boolean arg to match inset.h
9135 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9136 Added free_spacing boolean arg to match inset.h
9138 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9139 Added free_spacing boolean arg to match inset.h
9141 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9142 Added free_spacing boolean arg to match inset.h
9144 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9145 free_spacing boolean arg to match inset.h
9147 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9148 Added free_spacing boolean arg to match inset.h
9150 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9151 Added free_spacing boolean arg to match inset.h
9153 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9154 Added free_spacing boolean arg to match inset.h
9156 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9157 Added free_spacing boolean arg to match inset.h
9159 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9160 Added free_spacing boolean arg to match inset.h
9162 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9163 free_spacing boolean arg to match inset.h
9165 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9166 free_spacing boolean arg to match inset.h
9168 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9169 ignore free_spacing paragraphs. The user's spaces are left
9172 * src/text.C (InsertChar): Fixed the free_spacing layout
9173 attribute behavior. Now, if free_spacing is set, you can
9174 add multiple spaces in a paragraph with impunity (and they
9175 get output verbatim).
9176 (SelectSelectedWord): Added dummy argument to inset::Latex()
9179 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9182 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9183 paragraph layouts now only input a simple space instead.
9184 Special character insets don't make any sense in free-spacing
9187 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9188 hard-spaces in the *input* file to simple spaces if the layout
9189 is free-spacing. This converts old files which had to have
9190 hard-spaces in free-spacing layouts where a simple space was
9192 (writeFileAscii): Added free_spacing check to pass to the newly
9193 reworked inset::Latex(...) methods. The inset::Latex() code
9194 ensures that hard-spaces in free-spacing paragraphs get output
9195 as spaces (rather than "~").
9197 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9199 * src/mathed/math_delim.C (draw): draw the empty placeholder
9200 delims with a onoffdash line.
9201 (struct math_deco_compare): struct that holds the "functors" used
9202 for the sort and the binary search in math_deco_table.
9203 (class init_deco_table): class used for initial sort of the
9205 (search_deco): use lower_bound to do a binary search in the
9208 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9210 * src/lyxrc.C: a small secret thingie...
9212 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9213 and to not flush the stream as often as it used to.
9215 * src/support/lyxalgo.h: new file
9216 (sorted): template function used for checking if a sequence is
9217 sorted or not. Two versions with and without user supplied
9218 compare. Uses same compare as std::sort.
9220 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9221 it and give warning on lyxerr.
9223 (struct compare_tags): struct with function operators used for
9224 checking if sorted, sorting and lower_bound.
9225 (search_kw): use lower_bound instead of manually implemented
9228 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9230 * src/insets/insetcollapsable.h: fix Clone() declaration.
9231 * src/insets/insetfoot.h: ditto.
9233 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9235 2000-03-08 Juergen Vigna <jug@sad.it>
9237 * src/insets/lyxinset.h: added owner call which tells us if
9238 this inset is inside another inset. Changed also the return-type
9239 of Editable to an enum so it tells clearer what the return-value is.
9241 * src/insets/insettext.C (computeTextRows): fixed computing of
9242 textinsets which split automatically on more rows.
9244 * src/insets/insetert.[Ch]: changed this to be of BaseType
9247 * src/insets/insetfoot.[Ch]: added footnote inset
9249 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9250 collapsable insets (like footnote, ert, ...)
9252 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9254 * src/lyxdraw.h: remvoe file
9256 * src/lyxdraw.C: remove file
9258 * src/insets/insettext.C: added <algorithm>.
9260 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9262 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9263 (matrix_cb): case MM_OK use string stream
9265 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9268 * src/mathed/math_macro.C (draw): use string stream
9269 (Metrics): use string stream
9271 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9272 directly to the ostream.
9274 * src/vspace.C (asString): use string stream.
9275 (asString): use string stream
9276 (asLatexString): use string stream
9278 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9279 setting Spacing::Other.
9281 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9282 sprintf when creating the stretch vale.
9284 * src/text2.C (alphaCounter): changed to return a string and to
9285 not use a static variable internally. Also fixed a one-off bug.
9286 (SetCounter): changed the drawing of the labels to use string
9287 streams instead of sprintf.
9289 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9290 manipulator to use a scheme that does not require library support.
9291 This is also the way it is done in the new GNU libstdc++. Should
9292 work with DEC cxx now.
9294 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9296 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9297 end. This fixes a bug.
9299 * src/mathed (all files concerned with file writing): apply the
9300 USE_OSTREAM_ONLY changes to mathed too.
9302 * src/support/DebugStream.h: make the constructor explicit.
9304 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9305 count and ostream squashed.
9307 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9309 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9311 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9312 ostringstream uses STL strings, and we might not.
9314 * src/insets/insetspecialchar.C: add using directive.
9315 * src/insets/insettext.C: ditto.
9317 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9319 * lib/layouts/seminar.layout: feeble attempt at a layout for
9320 seminar.cls, far from completet and could really use some looking
9321 at from people used to write layout files.
9323 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9324 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9325 a lot nicer and works nicely with ostreams.
9327 * src/mathed/formula.C (draw): a slightly different solution that
9328 the one posted to the list, but I think this one works too. (font
9329 size wrong in headers.)
9331 * src/insets/insettext.C (computeTextRows): some fiddling on
9332 Jürgens turf, added some comments that he should read.
9334 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9335 used and it gave compiler warnings.
9336 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9339 * src/lyx_gui.C (create_forms): do the right thing when
9340 show_banner is true/false.
9342 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9343 show_banner is false.
9345 * most file writing files: Now use iostreams to do almost all of
9346 the writing. Also instead of passing string &, we now use
9347 stringstreams. mathed output is still not adapted to iostreams.
9348 This change can be turned off by commenting out all the occurences
9349 of the "#define USE_OSTREAM_ONLY 1" lines.
9351 * src/WorkArea.C (createPixmap): don't output debug messages.
9352 (WorkArea): don't output debug messages.
9354 * lib/lyxrc.example: added a comment about the new variable
9357 * development/Code_rules/Rules: Added some more commente about how
9358 to build class interfaces and on how better encapsulation can be
9361 2000-03-03 Juergen Vigna <jug@sad.it>
9363 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9364 automatically with the width of the LyX-Window
9366 * src/insets/insettext.C (computeTextRows): fixed update bug in
9367 displaying text-insets (scrollvalues where not initialized!)
9369 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9371 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9372 id in the check of the result from lower_bound is not enough since
9373 lower_bound can return last too, and then res->id will not be a
9376 * all insets and some code that use them: I have conditionalized
9377 removed the Latex(string & out, ...) this means that only the
9378 Latex(ostream &, ...) will be used. This is a work in progress to
9379 move towards using streams for all output of files.
9381 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9384 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9386 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9387 routine (this fixes bug where greek letters were surrounded by too
9390 * src/support/filetools.C (findtexfile): change a bit the search
9391 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9392 no longer passed to kpsewhich, we may have to change that later.
9394 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9395 warning options to avoid problems with X header files (from Angus
9397 * acinclude.m4: regenerated.
9399 2000-03-02 Juergen Vigna <jug@sad.it>
9401 * src/insets/insettext.C (WriteParagraphData): Using the
9402 par->writeFile() function for writing paragraph-data.
9403 (Read): Using buffer->parseSingleLyXformat2Token()-function
9404 for parsing paragraph data!
9406 * src/buffer.C (readLyXformat2): removed all parse data and using
9407 the new parseSingleLyXformat2Token()-function.
9408 (parseSingleLyXformat2Token): added this function to parse (read)
9409 lyx-file-format (this is called also from text-insets now!)
9411 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9413 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9416 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9417 directly instead of going through a func. One very bad thing: a
9418 static LyXFindReplace, but I don't know where to place it.
9420 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9421 string instead of char[]. Also changed to static.
9422 (GetSelectionOrWordAtCursor): changed to static inline
9423 (SetSelectionOverLenChars): ditto.
9425 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9426 current_view and global variables. both classes has changed names
9427 and LyXFindReplace is not inherited from SearchForm.
9429 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9430 fl_form_search form.
9432 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9434 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9436 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9437 bound (from Kayvan).
9439 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9441 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9443 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9445 * some things that I should comment but the local pub says head to
9448 * comment out all code that belongs to the Roff code for Ascii
9449 export of tables. (this is unused)
9451 * src/LyXView.C: use correct type for global variable
9452 current_layout. (LyXTextClass::size_type)
9454 * some code to get the new insetgraphics closer to working I'd be
9455 grateful for any help.
9457 * src/BufferView2.C (insertInset): use the return type of
9458 NumberOfLayout properly. (also changes in other files)
9460 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9461 this as a test. I want to know what breaks because of this.
9463 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9465 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9467 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9468 to use a \makebox in the label, this allows proper justification
9469 with out using protected spaces or multiple hfills. Now it is
9470 "label" for left justified, "\hfill label\hfill" for center, and
9471 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9472 should be changed accordingly.
9474 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9476 * src/lyxtext.h: change SetLayout() to take a
9477 LyXTextClass::size_type instead of a char (when there is more than
9478 127 layouts in a class); also change type of copylayouttype.
9479 * src/text2.C (SetLayout): ditto.
9480 * src/LyXView.C (updateLayoutChoice): ditto.
9482 * src/LaTeX.C (scanLogFile): errors where the line number was not
9483 given just after the '!'-line were ignored (from Dekel Tsur).
9485 * lib/lyxrc.example: fix description of \date_insert_format
9487 * lib/layouts/llncs.layout: new layout, contributed by Martin
9490 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9492 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9493 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9494 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9495 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9496 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9497 paragraph.C, text.C, text2.C)
9499 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9501 * src/insets/insettext.C (LocalDispatch): remove extra break
9504 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9505 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9507 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9508 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9510 * src/insets/insetbib.h: move InsetBibkey::Holder and
9511 InsetCitation::Holder in public space.
9513 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9515 * src/insets/insettext.h: small change to get the new files from
9516 Juergen to compile (use "string", not "class string").
9518 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9519 const & as parameter to LocalDispatch, use LyXFont const & as
9520 paramter to some other func. This also had impacto on lyxinsets.h
9521 and the two mathed insets.
9523 2000-02-24 Juergen Vigna <jug@sad.it>
9526 * src/commandtags.h:
9528 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9532 * src/BufferView2.C: added/updated code for various inset-functions
9534 * src/insets/insetert.[Ch]: added implementation of InsetERT
9536 * src/insets/insettext.[Ch]: added implementation of InsetText
9538 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9539 (draw): added preliminary code for inset scrolling not finshed yet
9541 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9542 as it is in lyxfunc.C now
9544 * src/insets/lyxinset.h: Added functions for text-insets
9546 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9548 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9549 BufferView and reimplement the list as a queue put inside its own
9552 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9554 * several files: use the new interface to the "updateinsetlist"
9556 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9558 (work_area_handler): call BufferView::trippleClick on trippleclick.
9560 * src/BufferView.C (doubleClick): new function, selects word on
9562 (trippleClick): new function, selects line on trippleclick.
9564 2000-02-22 Allan Rae <rae@lyx.org>
9566 * lib/bind/xemacs.bind: buffer-previous not supported
9568 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9570 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9573 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9575 * src/bufferlist.C: get rid of current_view from this file
9577 * src/spellchecker.C: get rid of current_view from this file
9579 * src/vspace.C: get rid of current_view from this file
9580 (inPixels): added BufferView parameter for this func
9581 (asLatexCommand): added a BufferParams for this func
9583 * src/text.C src/text2.C: get rid of current_view from these
9586 * src/lyxfont.C (getFontDirection): move this function here from
9589 * src/bufferparams.C (getDocumentDirection): move this function
9592 * src/paragraph.C (getParDirection): move this function here from
9594 (getLetterDirection): ditto
9596 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9598 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9599 resize due to wrong pixmap beeing used. Also took the opurtunity
9600 to make the LyXScreen stateless on regard to WorkArea and some
9601 general cleanup in the same files.
9603 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9605 * src/Makefile.am: add missing direction.h
9607 * src/PainterBase.h: made the width functions const.
9609 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9612 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9614 * src/insets/insetlatexaccent.C (draw): make the accents draw
9615 better, at present this will only work well with iso8859-1.
9617 * several files: remove the old drawing code, now we use the new
9620 * several files: remove support for mono_video, reverse_video and
9623 2000-02-17 Juergen Vigna <jug@sad.it>
9625 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9626 int ** as we have to return the pointer, otherwise we have only
9627 NULL pointers in the returning function.
9629 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9631 * src/LaTeX.C (operator()): quote file name when running latex.
9633 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9635 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9636 (bubble tip), this removes our special handling of this.
9638 * Remove all code that is unused now that we have the new
9639 workarea. (Code that are not active when NEW_WA is defined.)
9641 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9643 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9645 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9646 nonexisting layout; correctly redirect obsoleted layouts.
9648 * lib/lyxrc.example: document \view_dvi_paper_option
9650 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9653 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9654 (PreviewDVI): handle the view_dvi_paper_option variable.
9655 [Both from Roland Krause]
9657 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9659 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9660 char const *, int, LyXFont)
9661 (text(int, int, string, LyXFont)): ditto
9663 * src/text.C (InsertCharInTable): attempt to fix the double-space
9664 feature in tables too.
9665 (BackspaceInTable): ditto.
9666 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9668 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9670 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9672 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9673 newly found text in textcache to this.
9674 (buffer): set the owner of the text put into the textcache to 0
9676 * src/insets/figinset.C (draw): fixed the drawing of figures with
9679 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9680 drawing of mathframe, hfills, protected space, table lines. I have
9681 now no outstanding drawing problems with the new Painter code.
9683 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9685 * src/PainterBase.C (ellipse, circle): do not specify the default
9688 * src/LColor.h: add using directive.
9690 * src/Painter.[Ch]: change return type of methods from Painter& to
9691 PainterBase&. Add a using directive.
9693 * src/WorkArea.C: wrap xforms callbacks in C functions
9696 * lib/layouts/foils.layout: font fix and simplifications from Carl
9699 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9701 * a lot of files: The Painter, LColor and WorkArea from the old
9702 devel branch has been ported to lyx-devel. Some new files and a
9703 lot of #ifdeffed code. The new workarea is enabled by default, but
9704 if you want to test the new Painter and LColor you have to compile
9705 with USE_PAINTER defined (do this in config.h f.ex.) There are
9706 still some rought edges, and I'd like some help to clear those
9707 out. It looks stable (loads and displays the Userguide very well).
9710 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9712 * src/buffer.C (pop_tag): revert to the previous implementation
9713 (use a global variable for both loops).
9715 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9717 * src/lyxrc.C (LyXRC): change slightly default date format.
9719 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9720 there is an English text with a footnote that starts with a Hebrew
9721 paragraph, or vice versa.
9722 (TeXFootnote): ditto.
9724 * src/text.C (LeftMargin): allow for negative values for
9725 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9728 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9729 for input encoding (cyrillic)
9731 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9733 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9736 * src/toolbar.C (set): ditto
9737 * src/insets/insetbib.C (create_form_citation_form): ditto
9739 * lib/CREDITS: added Dekel Tsur.
9741 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9742 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9743 hebrew supports files from Dekel Tsur.
9745 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9746 <tzafrir@technion.ac.il>
9748 * src/lyxrc.C: put \date_insert_format at the right place.
9750 * src/buffer.C (makeLaTeXFile): fix the handling of
9751 BufferParams::sides when writing out latex files.
9753 * src/BufferView2.C: add a "using" directive.
9755 * src/support/lyxsum.C (sum): when we use lyxstring,
9756 ostringstream::str needs an additional .c_str().
9758 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9760 * src/support/filetools.C (ChangeExtension): patch from Etienne
9763 * src/TextCache.C (show): remove const_cast and make second
9764 parameter non-const LyXText *.
9766 * src/TextCache.h: use non const LyXText in show.
9768 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9771 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9773 * src/support/lyxsum.C: rework to be more flexible.
9775 * several places: don't check if a pointer is 0 if you are going
9778 * src/text.C: remove some dead code.
9780 * src/insets/figinset.C: remove some dead code
9782 * src/buffer.C: move the BufferView funcs to BufferView2.C
9783 remove all support for insetlatexdel
9784 remove support for oldpapersize stuff
9785 made some member funcs const
9787 * src/kbmap.C: use a std::list to store the bindings in.
9789 * src/BufferView2.C: new file
9791 * src/kbsequence.[Ch]: new files
9793 * src/LyXAction.C + others: remove all trace of buffer-previous
9795 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9796 only have one copy in the binary of this table.
9798 * hebrew patch: moved some functions from LyXText to more
9799 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9801 * several files: remove support for XForms older than 0.88
9803 remove some #if 0 #endif code
9805 * src/TextCache.[Ch]: new file. Holds the textcache.
9807 * src/BufferView.C: changes to use the new TextCache interface.
9808 (waitForX): remove the now unused code.
9810 * src/BackStack.h: remove some commented code
9812 * lib/bind/emacs.bind: remove binding for buffer-previous
9814 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9816 * applied the hebrew patch.
9818 * src/lyxrow.h: make sure that all Row variables are initialized.
9820 * src/text2.C (TextHandleUndo): comment out a delete, this might
9821 introduce a memory leak, but should also help us to not try to
9822 read freed memory. We need to look at this one.
9824 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9825 (LyXParagraph): initalize footnotekind.
9827 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9828 forgot this when applying the patch. Please heed the warnings.
9830 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9831 (aka. reformat problem)
9833 * src/bufferlist.C (exists): made const, and use const_iterator
9834 (isLoaded): new func.
9835 (release): use std::find to find the correct buffer.
9837 * src/bufferlist.h: made getState a const func.
9838 made empty a const func.
9839 made exists a const func.
9842 2000-02-01 Juergen Vigna <jug@sad.it>
9844 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9846 * po/it.po: updated a bit the italian po file and also changed the
9847 'file nuovo' for newfile to 'filenuovo' without a space, this did
9850 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9851 for the new insert_date command.
9853 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9854 from jdblair, to insert a date into the current text conforming to
9855 a strftime format (for now only considering the locale-set and not
9856 the document-language).
9858 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9860 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9861 Bounds Read error seen by purify. The problem was that islower is
9862 a macros which takes an unsigned char and uses it as an index for
9863 in array of characters properties (and is thus subject to the
9867 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9868 correctly the paper sides radio buttons.
9869 (UpdateDocumentButtons): ditto.
9871 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9873 * src/kbmap.C (getsym + others): change to return unsigned int,
9874 returning a long can give problems on 64 bit systems. (I assume
9875 that int is 32bit on 64bit systems)
9877 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9879 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9880 LyXLookupString to be zero-terminated. Really fixes problems seen
9883 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9885 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9886 write a (char*)0 to the lyxerr stream.
9888 * src/lastfiles.C: move algorithm before the using statemets.
9890 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9892 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9893 complains otherwise).
9894 * src/table.C: ditto
9896 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9899 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9900 that I removed earlier... It is really needed.
9902 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9904 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9906 * INSTALL: update xforms home page URL.
9908 * lib/configure.m4: fix a bug with unreadable layout files.
9910 * src/table.C (calculate_width_of_column): add "using std::max"
9913 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9915 * several files: marked several lines with "DEL LINE", this is
9916 lines that can be deleted without changing anything.
9917 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9918 checks this anyway */
9921 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9923 * src/DepTable.C (update): add a "+" at the end when the checksum
9924 is different. (debugging string only)
9926 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9927 the next inset to not be displayed. This should also fix the list
9928 of labels in the "Insert Crossreference" dialog.
9930 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9932 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9933 when regex was not found.
9935 * src/support/lstrings.C (lowercase): use handcoded transform always.
9938 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9939 old_cursor.par->prev could be 0.
9941 * several files: changed post inc/dec to pre inc/dec
9943 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9944 write the lastfiles to file.
9946 * src/BufferView.C (buffer): only show TextCache info when debugging
9948 (resizeCurrentBuffer): ditto
9949 (workAreaExpose): ditto
9951 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9953 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9955 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9956 a bit better by removing the special case for \i and \j.
9958 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9960 * src/lyx_main.C (easyParse): remove test for bad comand line
9961 options, since this broke all xforms-related parsing.
9963 * src/kbmap.C (getsym): set return type to unsigned long, as
9964 declared in header. On an alpha, long is _not_ the same as int.
9966 * src/support/LOstream.h: add a "using std::flush;"
9968 * src/insets/figinset.C: ditto.
9970 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9972 * src/bufferlist.C (write): use blinding fast file copy instead of
9973 "a char at a time", now we are doing it the C++ way.
9975 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9976 std::list<int> instead.
9977 (addpidwait): reflect move to std::list<int>
9978 (sigchldchecker): ditto
9980 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9983 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9984 that obviously was wrong...
9986 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9987 c, this avoids warnings with purify and islower.
9989 * src/insets/figinset.C: rename struct queue to struct
9990 queue_element and rewrite to use a std::queue. gsqueue is now a
9991 std::queue<queue_element>
9992 (runqueue): reflect move to std::queue
9995 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9996 we would get "1" "0" instead of "true" "false. Also make the tostr
9999 2000-01-21 Juergen Vigna <jug@sad.it>
10001 * src/buffer.C (writeFileAscii): Disabled code for special groff
10002 handling of tabulars till I fix this in table.C
10004 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10006 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10008 * src/support/lyxlib.h: ditto.
10010 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10012 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10013 and 'j' look better. This might fix the "macron" bug that has been
10016 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10017 functions as one template function. Delete the old versions.
10019 * src/support/lyxsum.C: move using std::ifstream inside
10022 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10025 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10027 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10029 * src/insets/figinset.C (InitFigures): use new instead of malloc
10030 to allocate memory for figures and bitmaps.
10031 (DoneFigures): use delete[] instead of free to deallocate memory
10032 for figures and bitmaps.
10033 (runqueue): use new to allocate
10034 (getfigdata): use new/delete[] instead of malloc/free
10035 (RegisterFigure): ditto
10037 * some files: moved some declarations closer to first use, small
10038 whitespace changes use preincrement instead of postincrement where
10039 it does not make a difference.
10041 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10042 step on the way to use stl::containers for key maps.
10044 * src/bufferlist.h: add a typedef for const_iterator and const
10045 versions of begin and end.
10047 * src/bufferlist.[Ch]: change name of member variable _state to
10048 state_. (avoid reserved names)
10050 (getFileNames): returns the filenames of the buffers in a vector.
10052 * configure.in (ALL_LINGUAS): added ro
10054 * src/support/putenv.C: new file
10056 * src/support/mkdir.C: new file
10058 2000-01-20 Allan Rae <rae@lyx.org>
10060 * lib/layouts/IEEEtran.layout: Added several theorem environments
10062 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10063 couple of minor additions.
10065 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10066 (except for those in footnotes of course)
10068 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10070 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10072 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10073 std::sort and std::lower_bound instead of qsort and handwritten
10075 (struct compara): struct that holds the functors used by std::sort
10076 and std::lower_bound in MathedLookupBOP.
10078 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10080 * src/support/LAssert.h: do not do partial specialization. We do
10081 not really need it.
10083 * src/support/lyxlib.h: note that lyx::getUserName() and
10084 lyx::date() are not in use right now. Should these be suppressed?
10086 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10087 (makeLinuxDocFile): do not put date and user name in linuxdoc
10090 * src/support/lyxlib.h (kill): change first argument to long int,
10091 since that's what solaris uses.
10093 * src/support/kill.C (kill): fix declaration to match prototype.
10095 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10096 actually check whether namespaces are supported. This is not what
10099 * src/support/lyxsum.C: add a using directive.
10101 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10103 * src/support/kill.C: if we have namespace support we don't have
10104 to include lyxlib.h.
10106 * src/support/lyxlib.h: use namespace lyx if supported.
10108 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10110 * src/support/date.C: new file
10112 * src/support/chdir.C: new file
10114 * src/support/getUserName.C: new file
10116 * src/support/getcwd.C: new file
10118 * src/support/abort.C: new file
10120 * src/support/kill.C: new file
10122 * src/support/lyxlib.h: moved all the functions in this file
10123 insede struct lyx. Added also kill and abort to this struct. This
10124 is a way to avoid the "kill is not defined in <csignal>", we make
10125 C++ wrappers for functions that are not ANSI C or ANSI C++.
10127 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10128 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10129 lyx it has been renamed to sum.
10131 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10133 * src/text.C: add using directives for std::min and std::max.
10135 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10137 * src/texrow.C (getIdFromRow): actually return something useful in
10138 id and pos. Hopefully fixes the bug with positionning of errorbox
10141 * src/lyx_main.C (easyParse): output an error and exit if an
10142 incorrect command line option has been given.
10144 * src/spellchecker.C (ispell_check_word): document a memory leak.
10146 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10147 where a "struct utimbuf" is allocated with "new" and deleted with
10150 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10152 * src/text2.C (CutSelection): don't delete double spaces.
10153 (PasteSelection): ditto
10154 (CopySelection): ditto
10156 * src/text.C (Backspace): don't delete double spaces.
10158 * src/lyxlex.C (next): fix a bug that were only present with
10159 conformant std::istream::get to read comment lines, use
10160 std::istream::getline instead. This seems to fix the problem.
10162 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10164 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10165 allowed to insert space before space" editing problem. Please read
10166 commends at the beginning of the function. Comments about usage
10169 * src/text.C (InsertChar): fix for the "not allowed to insert
10170 space before space" editing problem.
10172 * src/text2.C (DeleteEmptyParagraphMechanism): when
10173 IsEmptyTableRow can only return false this last "else if" will
10174 always be a no-op. Commented out.
10176 * src/text.C (RedoParagraph): As far as I can understand tmp
10177 cursor is not really needed.
10179 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10180 present it could only return false anyway.
10181 (several functions): Did something not so smart...added a const
10182 specifier on a lot of methods.
10184 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10185 and add a tmp->text.resize. The LyXParagraph constructor does the
10187 (BreakParagraphConservative): ditto
10189 * src/support/path.h (Path): add a define so that the wrong usage
10190 "Path("/tmp") will be flagged as a compilation error:
10191 "`unnamed_Path' undeclared (first use this function)"
10193 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10195 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10196 which was bogus for several reasons.
10198 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10200 (runBibTeX): ditto.
10202 * autogen.sh: do not use "type -path" (what's that anyway?).
10204 * src/support/filetools.C (findtexfile): remove extraneous space
10205 which caused a kpsewhich warning (at least with kpathsea version
10208 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10210 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10212 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10214 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10216 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10218 * src/paragraph.C (BreakParagraph): do not reserve space on text
10219 if we don't need to (otherwise, if pos_end < pos, we end up
10220 reserving huge amounts of memory due to bad unsigned karma).
10221 (BreakParagraphConservative): ditto, although I have not seen
10222 evidence the bug can happen here.
10224 * src/lyxparagraph.h: add a using std::list.
10226 2000-01-11 Juergen Vigna <jug@sad.it>
10228 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10229 could not be found.
10231 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10233 * src/vc-backend.C (doVCCommand): change to be static and take one
10234 more parameter: the path to chdir too be fore executing the command.
10235 (retrive): new function equiv to "co -r"
10237 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10238 file_not_found_hook is true.
10240 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10242 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10243 if a file is readwrite,readonly...anything else.
10245 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10247 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10248 (CreatePostscript): name change from MenuRunDVIPS (or something)
10249 (PreviewPostscript): name change from MenuPreviewPS
10250 (PreviewDVI): name change from MenuPreviewDVI
10252 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10253 \view_pdf_command., \pdf_to_ps_command
10255 * lib/configure.m4: added search for PDF viewer, and search for
10256 PDF to PS converter.
10257 (lyxrc.defaults output): add \pdflatex_command,
10258 \view_pdf_command and \pdf_to_ps_command.
10260 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10262 * src/bufferlist.C (write): we don't use blocksize for anything so
10265 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10267 * src/support/block.h: disable operator T* (), since it causes
10268 problems with both compilers I tried. See comments in the file.
10270 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10273 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10274 variable LYX_DIR_10x to LYX_DIR_11x.
10276 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10278 * INSTALL: document --with-lyxname.
10281 * configure.in: new configure flag --with-lyxname which allows to
10282 choose the name under which lyx is installed. Default is "lyx", of
10283 course. It used to be possible to do this with --program-suffix,
10284 but the later has in fact a different meaning for autoconf.
10286 * src/support/lstrings.h (lstrchr): reformat a bit.
10288 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10289 * src/mathed/math_defs.h: ditto.
10291 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10293 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10294 true, decides if we create a backup file or not when saving. New
10295 tag and variable \pdf_mode, defaults to false. New tag and
10296 variable \pdflatex_command, defaults to pdflatex. New tag and
10297 variable \view_pdf_command, defaults to xpdf. New tag and variable
10298 \pdf_to_ps_command, defaults to pdf2ps.
10300 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10302 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10303 does not have a BufferView.
10304 (unlockInset): ditto + don't access the_locking_inset if the
10305 buffer does not have a BufferView.
10307 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10308 certain circumstances so that we don't continue a keyboard
10309 operation long after the key was released. Try f.ex. to load a
10310 large document, press PageDown for some seconds and then release
10311 it. Before this change the document would contine to scroll for
10312 some time, with this change it stops imidiatly.
10314 * src/support/block.h: don't allocate more space than needed. As
10315 long as we don't try to write to the arr[x] in a array_type arr[x]
10316 it is perfectly ok. (if you write to it you might segfault).
10317 added operator value_type*() so that is possible to pass the array
10318 to functions expecting a C-pointer.
10320 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10323 * intl/*: updated to gettext 0.10.35, tried to add our own
10324 required modifications. Please verify.
10326 * po/*: updated to gettext 0.10.35, tried to add our own required
10327 modifications. Please verify.
10329 * src/support/lstrings.C (tostr): go at fixing the problem with
10330 cxx and stringstream. When stringstream is used return
10331 oss.str().c_str() so that problems with lyxstring and basic_string
10332 are avoided. Note that the best solution would be for cxx to use
10333 basic_string all the way, but it is not conformant yet. (it seems)
10335 * src/lyx_cb.C + other files: moved several global functions to
10336 class BufferView, some have been moved to BufferView.[Ch] others
10337 are still located in lyx_cb.C. Code changes because of this. (part
10338 of "get rid of current_view project".)
10340 * src/buffer.C + other files: moved several Buffer functions to
10341 class BufferView, the functions are still present in buffer.C.
10342 Code changes because of this.
10344 * config/lcmessage.m4: updated to most recent. used when creating
10347 * config/progtest.m4: updated to most recent. used when creating
10350 * config/gettext.m4: updated to most recent. applied patch for
10353 * config/gettext.m4.patch: new file that shows what changes we
10354 have done to the local copy of gettext.m4.
10356 * config/libtool.m4: new file, used in creation of acinclude.m4
10358 * config/lyxinclude.m4: new file, this is the lyx created m4
10359 macros, used in making acinclude.m4.
10361 * autogen.sh: GNU m4 discovered as a separate task not as part of
10362 the lib/configure creation.
10363 Generate acinlucde from files in config. Actually cat
10364 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10365 easier to upgrade .m4 files that really are external.
10367 * src/Spacing.h: moved using std::istringstream to right after
10368 <sstream>. This should fix the problem seen with some compilers.
10370 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10372 * src/lyx_cb.C: began some work to remove the dependency a lot of
10373 functions have on BufferView::text, even if not really needed.
10374 (GetCurrentTextClass): removed this func, it only hid the
10377 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10378 forgot this in last commit.
10380 * src/Bullet.C (bulletEntry): use static char const *[] for the
10381 tables, becuase of this the return arg had to change to string.
10382 (bulletSize): ditto
10383 (~Bullet): removed unneeded destructor
10385 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10386 (insetSleep): moved from Buffer
10387 (insetWakeup): moved from Buffer
10388 (insetUnlock): moved from Buffer
10390 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10391 from Buffer to BufferView.
10393 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10395 * config/ltmain.sh: updated to version 1.3.4 of libtool
10397 * config/ltconfig: updated to version 1.3.4 of libtool
10399 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10402 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10403 Did I get that right?
10405 * src/lyxlex.h: add a "using" directive or two.
10406 * src/Spacing.h: ditto.
10407 * src/insets/figinset.C: ditto.
10408 * src/support/filetools.C: ditto.
10409 * src/support/lstrings.C: ditto.
10410 * src/BufferView.C: ditto.
10411 * src/bufferlist.C: ditto.
10412 * src/lyx_cb.C: ditto.
10413 * src/lyxlex.C: ditto.
10415 * NEWS: add some changes for 1.1.4.
10417 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10419 * src/BufferView.C: first go at a TextCache to speed up switching
10422 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10424 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10425 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10426 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10427 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10430 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10431 members of the struct are correctly initialized to 0 (detected by
10433 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10434 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10436 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10437 pidwait, since it was allocated with "new". This was potentially
10438 very bad. Thanks to Michael Schmitt for running purify for us.
10441 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10443 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10445 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10447 1999-12-30 Allan Rae <rae@lyx.org>
10449 * lib/templates/IEEEtran.lyx: minor change
10451 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10452 src/mathed/formula.C (LocalDispatch): askForText changes
10454 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10455 know when a user has cancelled input. Fixes annoying problems with
10456 inserting labels and version control.
10458 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10460 * src/support/lstrings.C (tostr): rewritten to use strstream and
10463 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10465 * src/support/filetools.C (IsFileWriteable): use fstream to check
10466 (IsDirWriteable): use fileinfo to check
10468 * src/support/filetools.h (FilePtr): whole class deleted
10470 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10472 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10474 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10476 * src/bufferlist.C (write): use ifstream and ofstream instead of
10479 * src/Spacing.h: use istrstream instead of sscanf
10481 * src/mathed/math_defs.h: change first arg to istream from FILE*
10483 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10485 * src/mathed/math_parser.C: have yyis to be an istream
10486 (LexGetArg): use istream (yyis)
10488 (mathed_parse): ditto
10489 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10491 * src/mathed/formula.C (Read): rewritten to use istream
10493 * src/mathed/formulamacro.C (Read): rewritten to use istream
10495 * src/lyxlex.h (~LyXLex): deleted desturctor
10496 (getStream): new function, returns an istream
10497 (getFile): deleted funtion
10498 (IsOK): return is.good();
10500 * src/lyxlex.C (LyXLex): delete file and owns_file
10501 (setFile): open an filebuf and assign that to a istream instead of
10503 (setStream): new function, takes an istream as arg.
10504 (setFile): deleted function
10505 (EatLine): rewritten us use istream instead of FILE*
10509 * src/table.C (LyXTable): use istream instead of FILE*
10510 (Read): rewritten to take an istream instead of FILE*
10512 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10514 * src/buffer.C (Dispatch): remove an extraneous break statement.
10516 * src/support/filetools.C (QuoteName): change to do simple
10517 'quoting'. More work is necessary. Also changed to do nothing
10518 under emx (needs fix too).
10519 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10521 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10522 config.h.in to the AC_DEFINE_UNQUOTED() call.
10523 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10524 needs char * as argument (because Solaris 7 declares it like
10527 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10528 remove definition of BZERO.
10530 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10532 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10533 defined, "lyxregex.h" if not.
10535 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10537 (REGEX): new variable that is set to regex.c lyxregex.h when
10538 AM_CONDITIONAL USE_REGEX is set.
10539 (libsupport_la_SOURCES): add $(REGEX)
10541 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10544 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10547 * configure.in: add call to LYX_REGEX
10549 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10550 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10552 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10554 * lib/bind/fi_menus.bind: new file, from
10555 pauli.virtanen@saunalahti.fi.
10557 * src/buffer.C (getBibkeyList): pass the parameter delim to
10558 InsetInclude::getKeys and InsetBibtex::getKeys.
10560 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10561 is passed to Buffer::getBibkeyList
10563 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10564 instead of the hardcoded comma.
10566 * src/insets/insetbib.C (getKeys): make sure that there are not
10567 leading blanks in bibtex keys. Normal latex does not care, but
10568 harvard.sty seems to dislike blanks at the beginning of citation
10569 keys. In particular, the retturn value of the function is
10571 * INSTALL: make it clear that libstdc++ is needed and that gcc
10572 2.7.x probably does not work.
10574 * src/support/filetools.C (findtexfile): make debug message go to
10576 * src/insets/insetbib.C (getKeys): ditto
10578 * src/debug.C (showTags): make sure that the output is correctly
10581 * configure.in: add a comment for TWO_COLOR_ICON define.
10583 * acconfig.h: remove all the entries that already defined in
10584 configure.in or acinclude.m4.
10586 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10587 to avoid user name, date and copyright.
10589 1999-12-21 Juergen Vigna <jug@sad.it>
10591 * src/table.C (Read): Now read bogus row format informations
10592 if the format is < 5 so that afterwards the table can
10593 be read by lyx but without any format-info. Fixed the
10594 crash we experienced when not doing this.
10596 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10598 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10599 (RedoDrawingOfParagraph): ditto
10600 (RedoParagraphs): ditto
10601 (RemoveTableRow): ditto
10603 * src/text.C (Fill): rename arg paperwidth -> paper_width
10605 * src/buffer.C (insertLyXFile): rename var filename -> fname
10606 (writeFile): rename arg filename -> fname
10607 (writeFileAscii): ditto
10608 (makeLaTeXFile): ditto
10609 (makeLinuxDocFile): ditto
10610 (makeDocBookFile): ditto
10612 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10615 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10617 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10620 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10621 compiled by a C compiler not C++.
10623 * src/layout.h (LyXTextClass): added typedef for const_iterator
10624 (LyXTextClassList): added typedef for const_iterator + member
10625 functions begin and end.
10627 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10628 iterators to fill the choice_class.
10629 (updateLayoutChoice): rewritten to use iterators to fill the
10630 layoutlist in the toolbar.
10632 * src/BufferView.h (BufferView::work_area_width): removed unused
10635 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10637 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10638 (sgmlCloseTag): ditto
10640 * src/support/lstrings.h: return type of countChar changed to
10643 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10644 what version of this func to use. Also made to return unsigned int.
10646 * configure.in: call LYX_STD_COUNT
10648 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10649 conforming std::count.
10651 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10653 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10654 and a subscript would give bad display (patch from Dekel Tsur
10655 <dekel@math.tau.ac.il>).
10657 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10659 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10662 * src/chset.h: add a few 'using' directives
10664 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10665 triggered when no buffer is active
10667 * src/layout.C: removed `break' after `return' in switch(), since
10670 * src/lyx_main.C (init): make sure LyX can be ran in place even
10671 when libtool has done its magic with shared libraries. Fix the
10672 test for the case when the system directory has not been found.
10674 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10675 name for the latex file.
10676 (MenuMakeHTML): ditto
10678 * src/buffer.h: add an optional boolean argument, which is passed
10679 to ChangeExtension.
10681 1999-12-20 Allan Rae <rae@lyx.org>
10683 * lib/templates/IEEEtran.lyx: small correction and update.
10685 * configure.in: Attempted to use LYX_PATH_HEADER
10687 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10689 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10690 input from JMarc. Now use preprocessor to find the header.
10691 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10692 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10693 LYX_STL_STRING_FWD. See comments in file.
10695 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10697 * The global MiniBuffer * minibuffer variable is dead.
10699 * The global FD_form_main * fd_form_main variable is dead.
10701 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10703 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10705 * src/table.h: add the LOstream.h header
10706 * src/debug.h: ditto
10708 * src/LyXAction.h: change the explaination of the ReadOnly
10709 attribute: is indicates that the function _can_ be used.
10711 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10714 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10716 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10722 * src/paragraph.C (GetWord): assert on pos>=0
10725 * src/support/lyxstring.C: condition the use of an invariant on
10727 * src/support/lyxstring.h: ditto
10729 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10730 Use LAssert.h instead of plain assert().
10732 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10734 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10735 * src/support/filetools.C: ditto
10737 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10740 * INSTALL: document the new configure flags
10742 * configure.in: suppress --with-debug; add --enable-assertions
10744 * acinclude.m4: various changes in alignment of help strings.
10746 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10748 * src/kbmap.C: commented out the use of the hash map in kb_map,
10749 beginning of movement to a stl::container.
10751 * several files: removed code that was not in effect when
10752 MOVE_TEXT was defined.
10754 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10755 for escaping should not be used. We can discuss if the string
10756 should be enclosed in f.ex. [] instead of "".
10758 * src/trans_mgr.C (insert): use the new returned value from
10759 encodeString to get deadkeys and keymaps done correctly.
10761 * src/chset.C (encodeString): changed to return a pair, to tell
10762 what to use if we know the string.
10764 * src/lyxscreen.h (fillArc): new function.
10766 * src/FontInfo.C (resize): rewritten to use more std::string like
10767 structore, especially string::replace.
10769 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10772 * configure.in (chmod +x some scripts): remove config/gcc-hack
10774 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10776 * src/buffer.C (writeFile): change once again the top comment in a
10777 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10778 instead of an hardcoded version number.
10779 (makeDocBookFile): ditto
10781 * src/version.h: add new define LYX_DOCVERSION
10783 * po/de.po: update from Pit Sütterlin
10784 * lib/bind/de_menus.bind: ditto.
10786 * src/lyxfunc.C (Dispatch): call MenuExport()
10787 * src/buffer.C (Dispatch): ditto
10789 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10790 LyXFunc::Dispatch().
10791 (MenuExport): new function, moved from
10792 LyXFunc::Dispatch().
10794 * src/trans_mgr.C (insert): small cleanup
10795 * src/chset.C (loadFile): ditto
10797 * lib/kbd/iso8859-1.cdef: add missing backslashes
10799 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10801 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10802 help with placing the manually drawn accents better.
10804 (Draw): x2 and hg changed to float to minimize rounding errors and
10805 help place the accents better.
10807 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10808 unsigned short to char is just wrong...cast the char to unsigned
10809 char instead so that the two values can compare sanely. This
10810 should also make the display of insetlatexaccents better and
10811 perhaps also some other insets.
10813 (lbearing): new function
10816 1999-12-15 Allan Rae <rae@lyx.org>
10818 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10819 header that provides a wrapper around the very annoying SGI STL header
10822 * src/support/lyxstring.C, src/LString.h:
10823 removed old SGI-STL-compatability attempts.
10825 * configure.in: Use LYX_STL_STRING_FWD.
10827 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10828 stl_string_fwd.h is around and try to determine it's location.
10829 Major improvement over previous SGI STL 3.2 compatability.
10830 Three small problems remain with this function due to my zero
10831 knowledge of autoconf. JMarc and lgb see the comments in the code.
10833 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10835 * src/broken_const.h, config/hack-gcc, config/README: removed
10837 * configure.in: remove --with-gcc-hack option; do not call
10840 * INSTALL: remove documentation of --with-broken-const and
10843 * acconfig.h: remove all trace of BROKEN_CONST define
10845 * src/buffer.C (makeDocBookFile): update version number in output
10847 (SimpleDocBookOnePar): fix an assert when trying to a character
10848 access beyond string length
10851 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10853 * po/de.po: fix the Export menu
10855 * lyx.man: update the description of -dbg
10857 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10858 (commandLineHelp): updated
10859 (easyParse): show list of available debug levels if -dbg is passed
10862 * src/Makefile.am: add debug.C
10864 * src/debug.h: moved some code to debug.C
10866 * src/debug.C: new file. Contains code to set and show debug
10869 * src/layout.C: remove 'break' after 'continue' in switch
10870 statements, since these cannot be reached.
10872 1999-12-13 Allan Rae <rae@lyx.org>
10874 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10875 (in_word_set): hash() -> math_hash()
10877 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10879 * acconfig.h: Added a test for whether we are using exceptions in the
10880 current compilation run. If so USING_EXCEPTIONS is defined.
10882 * config.in: Check for existance of stl_string_fwd.h
10883 * src/LString.h: If compiling --with-included-string and SGI's
10884 STL version 3.2 is present (see above test) we need to block their
10885 forward declaration of string and supply a __get_c_string().
10886 However, it turns out this is only necessary if compiling with
10887 exceptions enabled so I've a bit more to add yet.
10889 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10890 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10891 src/support/LRegex.h, src/undo.h:
10892 Shuffle the order of the included files a little to ensure that
10893 LString.h gets included before anything that includes stl_string_fwd.h
10895 * src/support/lyxstring.C: We need to #include LString.h instead of
10896 lyxstring.h to get the necessary definition of __get_c_string.
10897 (__get_c_string): New function. This is defined static just like SGI's
10898 although why they need to do this I'm not sure. Perhaps it should be
10899 in lstrings.C instead.
10901 * lib/templates/IEEEtran.lyx: New template file.
10903 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10905 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10906 * intl/Makefile.in (MKINSTALLDIRS): ditto
10908 * src/LyXAction.C (init): changed to hold the LFUN data in a
10909 automatic array in stead of in callso to newFunc, this speeds up
10910 compilation a lot. Also all the memory used by the array is
10911 returned when the init is completed.
10913 * a lot of files: compiled with -Wold-style-cast, changed most of
10914 the reported offenders to C++ style casts. Did not change the
10915 offenders in C files.
10917 * src/trans.h (Match): change argument type to unsigned int.
10919 * src/support/DebugStream.C: fix some types on the streambufs so
10920 that it works on a conforming implementation.
10922 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10924 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10926 * src/support/lyxstring.C: remove the inline added earlier since
10927 they cause a bunch of unsatisfied symbols when linking with dec
10928 cxx. Cxx likes to have the body of inlines at the place where they
10931 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10932 accessing negative bounds in array. This fixes the crash when
10933 inserting accented characters.
10934 * src/trans.h (Match): ditto
10936 * src/buffer.C (Dispatch): since this is a void, it should not try
10937 to return anything...
10939 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10941 * src/buffer.h: removed the two friends from Buffer. Some changes
10942 because of this. Buffer::getFileName and Buffer::setFileName
10943 renamed to Buffer::fileName() and Buffer::fileName(...).
10945 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10947 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10948 and Buffer::update(short) to BufferView. This move is currently
10949 controlled by a define MOVE_TEXT, this will be removed when all
10950 shows to be ok. This move paves the way for better separation
10951 between buffer contents and buffer view. One side effect is that
10952 the BufferView needs a rebreak when swiching buffers, if we want
10953 to avoid this we can add a cache that holds pointers to LyXText's
10954 that is not currently in use.
10956 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10959 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10961 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10963 * lyx_main.C: new command line option -x (or --execute) and
10964 -e (or --export). Now direct conversion from .lyx to .tex
10965 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10966 Unfortunately, X is still needed and the GUI pops up during the
10969 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10971 * src/Spacing.C: add a using directive to bring stream stuff into
10973 * src/paragraph.C: ditto
10974 * src/buffer.C: ditto
10976 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10977 from Lars' announcement).
10979 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10980 example files from Tino Meinen.
10982 1999-12-06 Allan Rae <rae@lyx.org>
10984 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10986 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10988 * src/support/lyxstring.C: added a lot of inline for no good
10991 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10992 latexWriteEndChanges, they were not used.
10994 * src/layout.h (operator<<): output operator for PageSides
10996 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10998 * some example files: loaded in LyX 1.0.4 and saved again to update
10999 certain constructs (table format)
11001 * a lot of files: did the change to use fstream/iostream for all
11002 writing of files. Done with a close look at Andre Poenitz's patch.
11004 * some files: whitespace changes.
11006 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11008 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11009 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11010 architecture, we provide our own. It is used unconditionnally, but
11011 I do not think this is a performance problem. Thanks to Angus
11012 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11013 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11015 (GetInset): use my_memcpy.
11019 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11020 it is easier to understand, but it uses less TeX-only constructs now.
11022 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11023 elements contain spaces
11025 * lib/configure: regenerated
11027 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11028 elements contain spaces; display the list of programs that are
11031 * autogen.sh: make sure lib/configure is executable
11033 * lib/examples/*: rename the tutorial examples to begin with the
11034 two-letters language code.
11036 * src/lyxfunc.C (getStatus): do not query current font if no
11039 * src/lyx_cb.C (RunScript): use QuoteName
11040 (MenuRunDvips): ditto
11041 (PrintApplyCB): ditto
11043 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11044 around argument, so that it works well with the current shell.
11045 Does not work properly with OS/2 shells currently.
11047 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11048 * src/LyXSendto.C (SendtoApplyCB): ditto
11049 * src/lyxfunc.C (Dispatch): ditto
11050 * src/buffer.C (runLaTeX): ditto
11051 (runLiterate): ditto
11052 (buildProgram): ditto
11054 * src/lyx_cb.C (RunScript): ditto
11055 (MenuMakeLaTeX): ditto
11057 * src/buffer.h (getLatexName): new method
11059 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11061 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11063 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11064 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11065 (create_math_panel): ditto
11067 * src/lyxfunc.C (getStatus): re-activate the code which gets
11068 current font and cursor; add test for export to html.
11070 * src/lyxrc.C (read): remove unreachable break statements; add a
11073 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11075 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11077 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11078 introduced by faulty regex.
11079 * src/buffer.C: ditto
11080 * src/lastfiles.C: ditto
11081 * src/paragraph.C: ditto
11082 * src/table.C: ditto
11083 * src/vspace.C: ditto
11084 * src/insets/figinset.C: ditto
11085 Note: most of these is absolutely harmless, except the one in
11086 src/mathed formula.C.
11088 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11090 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11091 operation, yielding correct results for the reLyX command.
11093 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11095 * src/support/filetools.C (ExpandPath): removed an over eager
11097 (ReplaceEnvironmentPath): ditto
11099 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11100 shows that we are doing something fishy in our code...
11101 (BubblePost): ditto
11104 * src/lyxrc.C (read): use a double switch trick to get more help
11105 from the compiler. (the same trick is used in layout.C)
11106 (write): new function. opens a ofstream and pass that to output
11107 (output): new function, takes a ostream and writes the lyxrc
11108 elemts to it. uses a dummy switch to make sure no elements are
11111 * src/lyxlex.h: added a struct pushpophelper for use in functions
11112 with more than one exit point.
11114 * src/lyxlex.[Ch] (GetInteger): made it const
11118 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11120 * src/layout.[hC] : LayoutTags splitted into several enums, new
11121 methods created, better error handling cleaner use of lyxlex. Read
11124 * src/bmtable.[Ch]: change some member prototypes because of the
11125 image const changes.
11127 * commandtags.h, src/LyXAction.C (init): new function:
11128 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11129 This file is not read automatically but you can add \input
11130 preferences to your lyxrc if you want to. We need to discuss how
11133 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11134 in .aux, also remove .bib and .bst files from dependencies when
11137 * src/BufferView.C, src/LyXView.C: add const_cast several places
11138 because of changes to images.
11140 * lib/images/*: same change as for images/*
11142 * lib/lyxrc.example: Default for accept_compound is false not no.
11144 * images/*: changed to be const, however I have som misgivings
11145 about this change so it might be changed back.
11147 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11149 * lib/configure, po/POTFILES.in: regenerated
11151 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11153 * config/lib_configure.m4: removed
11155 * lib/configure.m4: new file (was config/lib_configure.m4)
11157 * configure.in: do not test for rtti, since we do not use it.
11159 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11161 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11162 doubling of allocated space scheme. This makes it faster for large
11163 strings end to use less memory for small strings. xtra rememoved.
11165 * src/insets/figinset.C (waitalarm): commented out.
11166 (GhostscriptMsg): use static_cast
11167 (GhostscriptMsg): use new instead of malloc to allocate memory for
11168 cmap. also delete the memory after use.
11170 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11172 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11173 for changes in bibtex database or style.
11174 (runBibTeX): remove all .bib and .bst files from dep before we
11176 (run): use scanAuc in when dep file already exist.
11178 * src/DepTable.C (remove_files_with_extension): new method
11179 (exist): new method
11181 * src/DepTable.[Ch]: made many of the methods const.
11183 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11185 * src/bufferparams.C: make sure that the default textclass is
11186 "article". It used to be the first one by description order, but
11187 now the first one is "docbook".
11189 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11190 string; call Debug::value.
11191 (easyParse): pass complete argument to setDebuggingLevel().
11193 * src/debug.h (value): fix the code that parses debug levels.
11195 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11198 * src/LyXAction.C: use Debug::ACTION as debug channel.
11200 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11202 * NEWS: updated for the future 1.1.3 release.
11204 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11205 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11206 it should. This is of course a controversial change (since many
11207 people will find that their lyx workscreen is suddenly full of
11208 red), but done for the sake of correctness.
11210 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11211 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11213 * src/insets/inseterror.h, src/insets/inseturl.h,
11214 src/insets/insetinfo.h, src/insets/figinset.h,
11215 src/mathed/formulamacro.h, src/mathed/math_macro.h
11216 (EditMessage): add a missing const and add _() to make sure that
11217 translation happens
11219 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11220 src/insets/insetbib.C, src/support/filetools.C: add `using'
11221 directives for cxx.
11223 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11224 doing 'Insert index of last word' at the beginning of a paragraph.
11226 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11228 * several files: white-space changes.
11230 * src/mathed/formula.C: removed IsAlpha and IsDigit
11232 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11233 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11236 * src/insets/figinset.C (GetPSSizes): don't break when
11237 "EndComments" is seen. But break when a boundingbox is read.
11239 * all classes inherited from Inset: return value of Clone
11240 changed back to Inset *.
11242 * all classes inherited form MathInset: return value of Clone
11243 changed back to MathedInset *.
11245 * src/insets/figinset.C (runqueue): use a ofstream to output the
11246 gs/ps file. Might need some setpresicion or setw. However I can
11247 see no problem with the current code.
11248 (runqueue): use sleep instead of the alarm/signal code. I just
11249 can't see the difference.
11251 * src/paragraph.C (LyXParagraph): reserve space in the new
11252 paragraph and resize the inserted paragraph to just fit.
11254 * src/lyxfunc.h (operator|=): added operator for func_status.
11256 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11257 check for readable file.
11259 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11260 check for readable file.
11261 (MenuMakeLinuxDoc): ditto
11262 (MenuMakeDocBook): ditto
11263 (MenuMakeAscii): ditto
11264 (InsertAsciiFile): split the test for openable and readable
11266 * src/bmtable.C (draw_bitmaptable): use
11267 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11269 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11270 findtexfile from LaTeX to filetools.
11272 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11273 instead of FilePtr. Needs to be verified by a literate user.
11275 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11277 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11278 (EditMessage): likewise.
11280 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11281 respectively as \textasciitilde and \textasciicircum.
11283 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11285 * src/support/lyxstring.h: made the methods that take iterators
11286 use const_iterator.
11288 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11289 (regexMatch): made is use the real regex class.
11291 * src/support/Makefile.am: changed to use libtool
11293 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11295 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11297 (MathIsInset ++): changed several macros to be inline functions
11300 * src/mathed/Makefile.am: changed to use libtool
11302 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11304 * src/insets/inset* : Clone changed to const and return type is
11305 the true insettype not just Inset*.
11307 * src/insets/Makefile.am: changed to use libtool
11309 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11311 * src/undo.[Ch] : added empty() and changed some of the method
11314 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11316 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11317 setID use block<> for the bullets array, added const several places.
11319 * src/lyxfunc.C (getStatus): new function
11321 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11322 LyXAction, added const to several funtions.
11324 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11325 a std::map, and to store the dir items in a vector.
11327 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11330 * src/LyXView.[Ch] + other files : changed currentView to view.
11332 * src/LyXAction.[Ch] : ported from the old devel branch.
11334 * src/.cvsignore: added .libs and a.out
11336 * configure.in : changes to use libtool.
11338 * acinclude.m4 : inserted libtool.m4
11340 * .cvsignore: added libtool
11342 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11344 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11345 file name in insets and mathed directories (otherwise the
11346 dependency is not taken in account under cygwin).
11348 * src/text2.C (InsertString[AB]): make sure that we do not try to
11349 read characters past the string length.
11351 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11353 * lib/doc/LaTeXConfig.lyx.in,
11354 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11356 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11357 file saying who created them and when this heppened; this is
11358 useless and annoys tools like cvs.
11360 * lib/layouts/g-brief-{en,de}.layout,
11361 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11362 from Thomas Hartkens <thomas@hartkens.de>.
11364 * src/{insets,mathed}/Makefile.am: do not declare an empty
11365 LDFLAGS, so that it can be set at configure time (useful on Irix
11368 * lib/reLyX/configure.in: make sure that the prefix is set
11369 correctly in LYX_DIR.
11371 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11373 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11374 be used by 'command-sequence' this allows to bind a key to a
11375 sequence of LyX-commands
11376 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11378 * src/LyXAction.C: add "command-sequence"
11380 * src/LyXFunction.C: handling of "command-sequence"
11382 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11383 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11385 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11387 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11389 * src/buffer.C (writeFile): Do not output a comment giving user
11390 and date at the beginning of a .lyx file. This is useless and
11391 annoys cvs anyway; update version number to 1.1.
11393 * src/Makefile.am (LYX_DIR): add this definition, so that a
11394 default path is hardcoded in LyX.
11396 * configure.in: Use LYX_GNU_GETTEXT.
11398 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11399 AM_GNU_GETTEXT with a bug fixed.
11401 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11403 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11405 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11406 which is used to point to LyX data is now LYX_DIR_11x.
11408 * lyx.man: convert to a unix text file; small updates.
11410 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11412 * src/support/LSubstring.[Ch]: made the second arg of most of the
11413 constructors be a const reference.
11415 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11418 * src/support/lyxstring.[Ch] (swap): added missing member function
11419 and specialization of swap(str, str);
11421 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11423 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11424 trace of the old one.
11426 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11427 put the member definitions in undo.C.
11429 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11430 NEW_TEXT and have now only code that was included when this was
11433 * src/intl.C (LCombo): use static_cast
11435 (DispatchCallback): ditto
11437 * src/definitions.h: removed whole file
11439 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11441 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11442 parsing and stores in a std:map. a regex defines the file format.
11443 removed unneeded members.
11445 * src/bufferparams.h: added several enums from definitions.h here.
11446 Removed unsused destructor. Changed some types to use proper enum
11447 types. use block to have the temp_bullets and user_defined_bullets
11448 and to make the whole class assignable.
11450 * src/bufferparams.C (Copy): removed this functions, use a default
11451 assignment instead.
11453 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11456 * src/buffer.C (readLyXformat2): commend out all that have with
11457 oldpapersize to do. also comment out all that hve to do with
11458 insetlatex and insetlatexdel.
11459 (setOldPaperStuff): commented out
11461 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11463 * src/LyXAction.C: remove use of inset-latex-insert
11465 * src/mathed/math_panel.C (button_cb): use static_cast
11467 * src/insets/Makefile.am (insets_o_SOURCES): removed
11470 * src/support/lyxstring.C (helper): use the unsigned long
11471 specifier, UL, instead of a static_cast.
11473 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11475 * src/support/block.h: new file. to be used as a c-style array in
11476 classes, so that the class can be assignable.
11478 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11480 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11481 NULL, make sure to return an empty string (it is not possible to
11482 set a string to NULL).
11484 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11486 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11488 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11490 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11491 link line, so that Irix users (for example) can set it explicitely to
11494 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11495 it can be overidden at make time (static or dynamic link, for
11498 * src/vc-backend.C, src/LaTeXFeatures.h,
11499 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11500 statements to bring templates to global namespace.
11502 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11504 * src/support/lyxstring.C (operator[] const): make it standard
11507 * src/minibuffer.C (Init): changed to reflect that more
11508 information is given from the lyxvc and need not be provided here.
11510 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11512 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11514 * src/LyXView.C (UpdateTimerCB): use static_cast
11515 (KeyPressMask_raw_callback): ditto
11517 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11518 buffer_, a lot of changes because of this. currentBuffer() ->
11519 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11520 also changes to other files because of this.
11522 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11524 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11525 have no support for RCS and partial support for CVS, will be
11528 * src/insets/ several files: changes because of function name
11529 changes in Bufferview and LyXView.
11531 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11533 * src/support/LSubstring.[Ch]: new files. These implement a
11534 Substring that can be very convenient to use. i.e. is this
11536 string a = "Mary had a little sheep";
11537 Substring(a, "sheep") = "lamb";
11538 a is now "Mary has a little lamb".
11540 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11541 out patterns and subpatterns of strings. It is used by LSubstring
11542 and also by vc-backend.C
11544 * src/support/lyxstring.C: went over all the assertions used and
11545 tried to correct the wrong ones and flag which of them is required
11546 by the standard. some bugs found because of this. Also removed a
11547 couple of assertions.
11549 * src/support/Makefile.am (libsupport_a_SOURCES): added
11550 LSubstring.[Ch] and LRegex.[Ch]
11552 * src/support/FileInfo.h: have struct stat buf as an object and
11553 not a pointer to one, some changes because of this.
11555 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11556 information in layout when adding the layouts preamble to the
11557 textclass preamble.
11559 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11562 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11563 because of bug in OS/2.
11565 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11567 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11568 \verbatim@font instead of \ttfamily, so that it can be redefined.
11570 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11571 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11572 src/layout.h, src/text2.C: add 'using' directive to bring the
11573 STL templates we need from the std:: namespace to the global one.
11574 Needed by DEC cxx in strict ansi mode.
11576 * src/support/LIstream.h,src/support/LOstream.h,
11577 src/support/lyxstring.h,src/table.h,
11578 src/lyxlookup.h: do not include <config.h> in header
11579 files. This should be done in the .C files only.
11581 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11585 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11587 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11588 from Kayvan to fix the tth invokation.
11590 * development/lyx.spec.in: updates from Kayvan to reflect the
11591 changes of file names.
11593 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11595 * src/text2.C (InsertStringB): use std::copy
11596 (InsertStringA): use std::copy
11598 * src/bufferlist.C: use a vector to store the buffers in. This is
11599 an internal change and should not affect any other thing.
11601 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11604 * src/text.C (Fill): fix potential bug, one off bug.
11606 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11608 * src/Makefile.am (lyx_main.o): add more files it depends on.
11610 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11612 * src/support/lyxstring.C: use size_t for the reference count,
11613 size, reserved memory and xtra.
11614 (internal_compare): new private member function. Now the compare
11615 functions should work for std::strings that have embedded '\0'
11617 (compare): all compare functions rewritten to use
11620 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11622 * src/support/lyxstring.C (compare): pass c_str()
11623 (compare): pass c_str
11624 (compare): pass c_str
11626 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11628 * src/support/DebugStream.C: <config.h> was not included correctly.
11630 * lib/configure: forgot to re-generate it :( I'll make this file
11631 auto generated soon.
11633 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11635 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11638 * src/support/lyxstring.C: some changes from length() to rep->sz.
11639 avoids a function call.
11641 * src/support/filetools.C (SpaceLess): yet another version of the
11642 algorithm...now per Jean-Marc's suggestions.
11644 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11646 * src/layout.C (less_textclass_desc): functor for use in sorting
11648 (LyXTextClass::Read): sort the textclasses after reading.
11650 * src/support/filetools.C (SpaceLess): new version of the
11651 SpaceLess functions. What problems does this one give? Please
11654 * images/banner_bw.xbm: made the arrays unsigned char *
11656 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11658 * src/support/lyxstring.C (find): remove bogus assertion in the
11659 two versions of find where this has not been done yet.
11661 * src/support/lyxlib.h: add missing int return type to
11664 * src/menus.C (ShowFileMenu): disable exporting to html if no
11665 html export command is present.
11667 * config/lib_configure.m4: add a test for an HTML converter. The
11668 programs checked for are, in this order: tth, latex2html and
11671 * lib/configure: generated from config/lib_configure.m4.
11673 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11674 html converter. The parameters are now passed through $$FName and
11675 $$OutName, instead of standard input/output.
11677 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11679 * lib/lyxrc.example: update description of \html_command.
11680 add "quotes" around \screen_font_xxx font setting examples to help
11681 people who use fonts with spaces in their names.
11683 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11685 * Distribution files: updates for v1.1.2
11687 * src/support/lyxstring.C (find): remove bogus assert and return
11688 npos for the same condition.
11690 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11692 * added patch for OS/2 from SMiyata.
11694 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11696 * src/text2.C (CutSelection): make space_wrapped a bool
11697 (CutSelection): dont declare int i until we have to.
11698 (alphaCounter): return a char const *.
11700 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11702 * src/support/syscall.C (Systemcalls::kill):
11703 src/support/filetools.C (PutEnv, PutEnvPath):
11704 src/lyx_cb.C (addNewlineAndDepth):
11705 src/FontInfo.C (FontInfo::resize): condition some #warning
11706 directives with WITH_WARNINGS.
11709 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11711 * src/layout.[Ch] + several files: access to class variables
11712 limited and made accessor functions instead a lot of code changed
11713 becuase of this. Also instead of returning pointers often a const
11714 reference is returned instead.
11716 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11718 * src/Makefile.am (dist-hook): added used to remove the CVS from
11719 cheaders upon creating a dist
11720 (EXTRA_DIST): added cheaders
11722 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11723 a character not as a small integer.
11725 * src/support/lyxstring.C (find): removed Assert and added i >=
11726 rep->sz to the first if.
11728 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11730 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11731 src/LyXView.C src/buffer.C src/bufferparams.C
11732 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11733 src/text2.C src/insets/insetinclude.C:
11734 lyxlayout renamed to textclasslist.
11736 * src/layout.C: some lyxerr changes.
11738 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11739 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11740 (LyXLayoutList): removed all traces of this class.
11741 (LyXTextClass::Read): rewrote LT_STYLE
11742 (LyXTextClass::hasLayout): new function
11743 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11744 both const and nonconst version.
11745 (LyXTextClass::delete_layout): new function.
11746 (LyXTextClassList::Style): bug fix. do the right thing if layout
11748 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11749 (LyXTextClassList::NameOfLayout): ditto
11750 (LyXTextClassList::Load): ditto
11752 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11754 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11756 * src/LyXAction.C (LookupFunc): added a workaround for sun
11757 compiler, on the other hand...we don't know if the current code
11758 compiles on sun at all...
11760 * src/support/filetools.C (CleanupPath): subst fix
11762 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11765 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11766 complained about this one?
11768 * src/insets/insetinclude.C (Latex): subst fix
11770 * src/insets/insetbib.C (getKeys): subst fix
11772 * src/LyXSendto.C (SendtoApplyCB): subst fix
11774 * src/lyx_main.C (init): subst fix
11776 * src/layout.C (Read): subst fix
11778 * src/lyx_sendfax_main.C (button_send): subst fix
11780 * src/buffer.C (RoffAsciiTable): subst fix
11782 * src/lyx_cb.C (MenuFax): subst fix
11783 (PrintApplyCB): subst fix
11785 1999-10-26 Juergen Vigna <jug@sad.it>
11787 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11789 (Read): Cleaned up this code so now we read only format vestion >= 5
11791 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11793 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11794 come nobody has complained about this one?
11796 * src/insets/insetinclude.C (Latex): subst fix
11798 * src/insets/insetbib.C (getKeys): subst fix
11800 * src/lyx_main.C (init): subst fix
11802 * src/layout.C (Read): subst fix
11804 * src/buffer.C (RoffAsciiTable): subst fix
11806 * src/lyx_cb.C (MenuFax): subst fix.
11808 * src/layout.[hC] + some other files: rewrote to use
11809 std::container to store textclasses and layouts in.
11810 Simplified, removed a lot of code. Make all classes
11811 assignable. Further simplifications and review of type
11812 use still to be one.
11814 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11815 lastfiles to create the lastfiles partr of the menu.
11817 * src/lastfiles.[Ch]: rewritten to use deque to store the
11818 lastfiles in. Uses fstream for reading and writing. Simplifies
11821 * src/support/syscall.C: remove explicit cast.
11823 * src/BufferView.C (CursorToggleCB): removed code snippets that
11824 were commented out.
11825 use explicat C++ style casts instead of C style casts. also use
11826 u_vdata instea of passing pointers in longs.
11828 * src/PaperLayout.C: removed code snippets that were commented out.
11830 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11832 * src/lyx_main.C: removed code snippets that wer commented out.
11834 * src/paragraph.C: removed code snippets that were commented out.
11836 * src/lyxvc.C (logClose): use static_cast
11838 (viewLog): remove explicit cast to void*
11839 (showLog): removed old commented code
11841 * src/menus.C: use static_cast instead of C style casts. use
11842 u_vdata instead of u_ldata. remove explicit cast to (long) for
11843 pointers. Removed old code that was commented out.
11845 * src/insets/inset.C: removed old commented func
11847 * src/insets/insetref.C (InsetRef): removed old code that had been
11848 commented out for a long time.
11850 (escape): removed C style cast
11852 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11854 * src/insets/insetlatex.C (Draw): removed old commented code
11855 (Read): rewritten to use string
11857 * src/insets/insetlabel.C (escape): removed C style cast
11859 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11861 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11862 old commented code.
11864 * src/insets/insetinclude.h: removed a couple of stupid bools
11866 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11867 (Clone): remove C style cast
11868 (getKeys): changed list to lst because of std::list
11870 * src/insets/inseterror.C (Draw): removed som old commented code.
11872 * src/insets/insetcommand.C (Draw): removed some old commented code.
11874 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11875 commented out forever.
11876 (bibitem_cb): use static_cast instead of C style cast
11877 use of vdata changed to u_vdata.
11879 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11881 (CloseUrlCB): use static_cast instead of C style cast.
11882 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11884 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11885 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11886 (CloseInfoCB): static_cast from ob->u_vdata instead.
11887 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11890 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11891 (C_InsetError_CloseErrorCB): forward the ob parameter
11892 (CloseErrorCB): static_cast from ob->u_vdata instead.
11894 * src/vspace.h: include LString.h since we use string in this class.
11896 * src/vspace.C (lyx_advance): changed name from advance because of
11897 nameclash with stl. And since we cannot use namespaces yet...I
11898 used a lyx_ prefix instead. Expect this to change when we begin
11901 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11903 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11904 and removed now defunct constructor and deconstructor.
11906 * src/BufferView.h: have backstack as a object not as a pointer.
11907 removed initialization from constructor. added include for BackStack
11909 * development/lyx.spec.in (%build): add CFLAGS also.
11911 * src/screen.C (drawFrame): removed another warning.
11913 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11915 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11916 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11917 README and ANNOUNCE a bit for the next release. More work is
11920 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11921 unbreakable if we are in freespacing mode (LyX-Code), but not in
11924 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11926 * src/BackStack.h: fixed initialization order in constructor
11928 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11930 * acinclude.m4 (VERSION): new rules for when a version is
11931 development, added also a variable for prerelease.
11932 (warnings): we set with_warnings=yes for prereleases
11933 (lyx_opt): prereleases compile with same optimization as development
11934 (CXXFLAGS): only use pedantic if we are a development version
11936 * src/BufferView.C (restorePosition): don't do anything if the
11937 backstack is empty.
11939 * src/BackStack.h: added member empty, use this to test if there
11940 is anything to pop...
11942 1999-10-25 Juergen Vigna <jug@sad.it>
11945 * forms/layout_forms.fd +
11946 * forms/latexoptions.fd +
11947 * lyx.fd: changed for various form resize issues
11949 * src/mathed/math_panel.C +
11950 * src/insets/inseterror.C +
11951 * src/insets/insetinfo.C +
11952 * src/insets/inseturl.C +
11953 * src/insets/inseturl.h +
11955 * src/LyXSendto.C +
11956 * src/PaperLayout.C +
11957 * src/ParagraphExtra.C +
11958 * src/TableLayout.C +
11960 * src/layout_forms.C +
11967 * src/menus.C: fixed various resize issues. So now forms can be
11968 resized savely or not be resized at all.
11970 * forms/form_url.fd +
11971 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11974 * src/insets/Makefile.am: added files form_url.[Ch]
11976 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11978 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11979 (and presumably 6.2).
11981 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11982 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11983 remaining static member callbacks.
11985 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11988 * src/support/lyxstring.h: declare struct Srep as friend of
11989 lyxstring, since DEC cxx complains otherwise.
11991 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11993 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11995 * src/LaTeX.C (run): made run_bibtex also depend on files with
11997 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11998 are put into the dependency file.
12000 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12001 the code has shown itself to work
12002 (create_ispell_pipe): removed another warning, added a comment
12005 * src/minibuffer.C (ExecutingCB): removed code that has been
12006 commented out a long time
12008 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12009 out code + a warning.
12011 * src/support/lyxstring.h: comment out the three private
12012 operators, when compiling with string ansi conforming compilers
12013 they make problems.
12015 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12017 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12018 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12021 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12024 * src/mathed/math_panel.C (create_math_panel): remove explicit
12027 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12030 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12031 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12032 to XCreatePixmapFromBitmapData
12033 (fl_set_bmtable_data): change the last argument to be unsigned
12035 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12036 and bh to be unsigned int, remove explicit casts in call to
12037 XReadBitmapFileData.
12039 * images/arrows.xbm: made the arrays unsigned char *
12040 * images/varsz.xbm: ditto
12041 * images/misc.xbm: ditto
12042 * images/greek.xbm: ditto
12043 * images/dots.xbm: ditto
12044 * images/brel.xbm: ditto
12045 * images/bop.xbm: ditto
12047 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12049 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12050 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12051 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12053 (LYX_CXX_CHEADERS): added <clocale> to the test.
12055 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12057 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12059 * src/support/lyxstring.C (append): fixed something that must be a
12060 bug, rep->assign was used instead of rep->append.
12062 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12065 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12066 lyx insert double chars. Fix spotted by Kayvan.
12068 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12070 * Fixed the tth support. I messed up with the Emacs patch apply feature
12071 and omitted the changes in lyxrc.C.
12073 1999-10-22 Juergen Vigna <jug@sad.it>
12075 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12077 * src/lyx_cb.C (MenuInsertRef) +
12078 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12079 the form cannot be resized under it limits (fixes a segfault)
12081 * src/lyx.C (create_form_form_ref) +
12082 * forms/lyx.fd: Changed Gravity on name input field so that it is
12085 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12087 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12088 <ostream> and <istream>.
12090 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12091 whether <fstream> provides the latest standard features, or if we
12092 have an oldstyle library (like in egcs).
12093 (LYX_CXX_STL_STRING): fix the test.
12095 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12096 code on MODERN_STL_STREAM.
12098 * src/support/lyxstring.h: use L{I,O}stream.h.
12100 * src/support/L{I,O}stream.h: new files, designed to setup
12101 correctly streams for our use
12102 - includes the right header depending on STL capabilities
12103 - puts std::ostream and std::endl (for LOStream.h) or
12104 std::istream (LIStream.h) in toplevel namespace.
12106 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12108 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12109 was a bib file that had been changed we ensure that bibtex is run.
12110 (runBibTeX): enhanced to extract the names of the bib files and
12111 getting their absolute path and enter them into the dep file.
12112 (findtexfile): static func that is used to look for tex-files,
12113 checks for absolute patchs and tries also with kpsewhich.
12114 Alternative ways of finding the correct files are wanted. Will
12116 (do_popen): function that runs a command using popen and returns
12117 the whole output of that command in a string. Should be moved to
12120 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12121 file with extension ext has changed.
12123 * src/insets/figinset.C: added ifdef guards around the fl_free
12124 code that jug commented out. Now it is commented out when
12125 compiling with XForms == 0.89.
12127 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12128 to lyxstring.C, and only keep a forward declaration in
12129 lyxstring.h. Simplifies the header file a bit and should help a
12130 bit on compile time too. Also changes to Srep will not mandate a
12131 recompile of code just using string.
12132 (~lyxstring): definition moved here since it uses srep.
12133 (size): definition moved here since it uses srep.
12135 * src/support/lyxstring.h: removed a couple of "inline" that should
12138 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12140 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12143 1999-10-21 Juergen Vigna <jug@sad.it>
12145 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12146 set to left if I just remove the width entry (or it is empty).
12148 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12149 paragraph when having dummy paragraphs.
12151 1999-10-20 Juergen Vigna <jug@sad.it>
12153 * src/insets/figinset.C: just commented some fl_free_form calls
12154 and added warnings so that this calls should be activated later
12155 again. This avoids for now a segfault, but we have a memory leak!
12157 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12158 'const char * argument' to 'string argument', this should
12159 fix some Asserts() in lyxstring.C.
12161 * src/lyxfunc.h: Removed the function argAsString(const char *)
12162 as it is not used anymore.
12164 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12166 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12169 * src/Literate.h: some funcs moved from public to private to make
12170 interface clearer. Unneeded args removed.
12172 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12174 (scanBuildLogFile): ditto
12176 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12177 normal TeX Error. Still room for improvement.
12179 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12181 * src/buffer.C (insertErrors): changes to make the error
12182 desctription show properly.
12184 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12187 * src/support/lyxstring.C (helper): changed to use
12188 sizeof(object->rep->ref).
12189 (operator>>): changed to use a pointer instead.
12191 * src/support/lyxstring.h: changed const reference & to value_type
12192 const & lets see if that helps.
12194 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12196 * Makefile.am (rpmdist): fixed to have non static package and
12199 * src/support/lyxstring.C: removed the compilation guards
12201 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12204 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12205 conditional compile of lyxstring.Ch
12207 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12208 stupid check, but it is a lot better than the bastring hack.
12209 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12211 * several files: changed string::erase into string::clear. Not
12214 * src/chset.C (encodeString): use a char temporary instead
12216 * src/table.C (TexEndOfCell): added tostr around
12217 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12218 (TexEndOfCell): ditto
12219 (TexEndOfCell): ditto
12220 (TexEndOfCell): ditto
12221 (DocBookEndOfCell): ditto
12222 (DocBookEndOfCell): ditto
12223 (DocBookEndOfCell): ditto
12224 (DocBookEndOfCell): ditto
12226 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12228 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12230 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12231 (MenuBuildProg): added tostr around ret
12232 (MenuRunChktex): added tostr around ret
12233 (DocumentApplyCB): added tostr around ret
12235 * src/chset.C (encodeString): added tostr around t->ic
12237 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12238 (makeLaTeXFile): added tostr around tocdepth
12239 (makeLaTeXFile): added tostr around ftcound - 1
12241 * src/insets/insetbib.C (setCounter): added tostr around counter.
12243 * src/support/lyxstring.h: added an operator+=(int) to catch more
12246 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12247 (lyxstring): We DON'T allow NULL pointers.
12249 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12251 * src/mathed/math_macro.C (MathMacroArgument::Write,
12252 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12253 when writing them out.
12255 * src/LString.C: remove, since it is not used anymore.
12257 * src/support/lyxstring.C: condition the content to
12258 USE_INCLUDED_STRING macro.
12260 * src/mathed/math_symbols.C, src/support/lstrings.C,
12261 src/support/lyxstring.C: add `using' directive to specify what
12262 we need in <algorithm>. I do not think that we need to
12263 conditionalize this, but any thought is appreciated.
12265 * many files: change all callback functions to "C" linkage
12266 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12267 strict_ansi. Those who were static are now global.
12268 The case of callbacks which are static class members is
12269 trickier, since we have to make C wrappers around them (see
12270 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12271 did not finish this yet, since it defeats the purpose of
12272 encapsulation, and I am not sure what the best route is.
12274 1999-10-19 Juergen Vigna <jug@sad.it>
12276 * src/support/lyxstring.C (lyxstring): we permit to have a null
12277 pointer as assignment value and just don't assign it.
12279 * src/vspace.C (nextToken): corrected this function substituting
12280 find_first(_not)_of with find_last_of.
12282 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12283 (TableOptCloseCB) (TableSpeCloseCB):
12284 inserted fl_set_focus call for problem with fl_hide_form() in
12287 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12289 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12292 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12294 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12295 LyXLex::next() and not eatline() to get its argument.
12297 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12299 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12300 instead, use fstreams for io of the depfile, removed unneeded
12301 functions and variables.
12303 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12304 vector instead, removed all functions and variables that is not in
12307 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12309 * src/buffer.C (insertErrors): use new interface to TeXError
12311 * Makefile.am (rpmdist): added a rpmdist target
12313 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12314 per Kayvan's instructions.
12316 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12318 * src/Makefile.am: add a definition for localedir, so that locales
12319 are found after installation (Kayvan)
12321 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12323 * development/.cvsignore: new file.
12325 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12327 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12328 C++ compiler provides wrappers for C headers and use our alternate
12331 * configure.in: use LYX_CXX_CHEADERS.
12333 * src/cheader/: new directory, populated with cname headers from
12334 libstdc++-2.8.1. They are a bit old, but probably good enough for
12335 what we want (support compilers who lack them).
12337 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12338 from includes. It turns out is was stupid.
12340 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12342 * lib/Makefile.am (install-data-local): forgot a ';'
12343 (install-data-local): forgot a '\'
12344 (libinstalldirs): needed after all. reintroduced.
12346 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12348 * configure.in (AC_OUTPUT): added lyx.spec
12350 * development/lyx.spec: removed file
12352 * development/lyx.spec.in: new file
12354 * po/*.po: merged with lyx.pot becuase of make distcheck
12356 * lib/Makefile.am (dist-hook): added dist-hook so that
12357 documentation files will be included when doing a make
12358 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12359 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12361 more: tried to make install do the right thing, exclude CVS dirs
12364 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12365 Path would fit in more nicely.
12367 * all files that used to use pathstack: uses now Path instead.
12368 This change was a lot easier than expected.
12370 * src/support/path.h: new file
12372 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12374 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12376 * src/support/lyxstring.C (getline): Default arg was given for
12379 * Configure.cmd: removed file
12381 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12383 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12384 streams classes and types, add the proper 'using' statements when
12385 MODERN_STL is defined.
12387 * src/debug.h: move the << operator definition after the inclusion
12390 * src/support/filetools.C: include "LAssert.h", which is needed
12393 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12396 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12397 include "debug.h" to define a proper ostream.
12399 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12401 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12402 method to the SystemCall class which can kill a process, but it's
12403 not fully implemented yet.
12405 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12407 * src/support/FileInfo.h: Better documentation
12409 * src/lyxfunc.C: Added support for buffer-export html
12411 * src/menus.C: Added Export->As HTML...
12413 * lib/bind/*.bind: Added short-cut for buffer-export html
12415 * src/lyxrc.*: Added support for new \tth_command
12417 * lib/lyxrc.example: Added stuff for new \tth_command
12419 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12421 * lib/Makefile.am (IMAGES): removed images/README
12422 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12423 installes in correct place. Check permisions is installed
12426 * src/LaTeX.C: some no-op changes moved declaration of some
12429 * src/LaTeX.h (LATEX_H): changed include guard name
12431 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12433 * lib/reLyX/Makefile.am: install noweb2lyx.
12435 * lib/Makefile.am: install configure.
12437 * lib/reLyX/configure.in: declare a config aux dir; set package
12438 name to lyx (not sure what the best solution is); generate noweb2lyx.
12440 * lib/layouts/egs.layout: fix the bibliography layout.
12442 1999-10-08 Jürgen Vigna <jug@sad.it>
12444 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12445 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12446 it returned without continuing to search the path.
12448 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12450 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12451 also fixes a bug. It is not allowed to do tricks with std::strings
12452 like: string a("hei"); &a[e]; this will not give what you
12453 think... Any reason for the complexity in this func?
12455 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12457 * Updated README and INSTALL a bit, mostly to check that my
12458 CVS rights are correctly set up.
12460 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12462 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12463 does not allow '\0' chars but lyxstring and std::string does.
12465 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12467 * autogen.sh (AUTOCONF): let the autogen script create the
12468 POTFILES.in file too. POTFILES.in should perhaps now not be
12469 included in the cvs module.
12471 * some more files changed to use C++ includes instead of C ones.
12473 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12475 (Reread): added tostr to nlink. buggy output otherwise.
12476 (Reread): added a string() around szMode when assigning to Buffer,
12477 without this I got a log of garbled info strings.
12479 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12482 * I have added several ostream & operator<<(ostream &, some_type)
12483 functions. This has been done to avoid casting and warnings when
12484 outputting enums to lyxerr. This as thus eliminated a lot of
12485 explicit casts and has made the code clearer. Among the enums
12486 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12487 mathed enums, some font enum the Debug::type enum.
12489 * src/support/lyxstring.h (clear): missing method. equivalent of
12492 * all files that contained "stderr": rewrote constructs that used
12493 stderr to use lyxerr instead. (except bmtable)
12495 * src/support/DebugStream.h (level): and the passed t with
12496 Debug::ANY to avoid spurious bits set.
12498 * src/debug.h (Debug::type value): made it accept strings of the
12499 type INFO,INIT,KEY.
12501 * configure.in (Check for programs): Added a check for kpsewhich,
12502 the latex generation will use this later to better the dicovery of
12505 * src/BufferView.C (create_view): we don't need to cast this to
12506 (void*) that is done automatically.
12507 (WorkAreaButtonPress): removed some dead code.
12509 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12511 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12512 is not overwritten when translated (David Sua'rez de Lis).
12514 * lib/CREDITS: Added David Sua'rez de Lis
12516 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12518 * src/bufferparams.C (BufferParams): default input encoding is now
12521 * acinclude.m4 (cross_compiling): comment out macro
12522 LYX_GXX_STRENGTH_REDUCE.
12524 * acconfig.h: make sure that const is not defined (to empty) when
12525 we are compiling C++. Remove commented out code using SIZEOF_xx
12528 * configure.in : move the test for const and inline as late as
12529 possible so that these C tests do not interefere with C++ ones.
12530 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12531 has not been proven.
12533 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12535 * src/table.C (getDocBookAlign): remove bad default value for
12536 isColumn parameter.
12538 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12540 (ShowFileMenu2): ditto.
12542 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12543 of files to ignore.
12545 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12547 * Most files: finished the change from the old error code to use
12548 DebugStream for all lyxerr debugging. Only minor changes remain
12549 (e.g. the setting of debug levels using strings instead of number)
12551 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12553 * src/layout.C (Add): Changed to use compare_no_case instead of
12556 * src/FontInfo.C: changed loop variable type too string::size_type.
12558 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12560 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12561 set ETAGS_ARGS to --c++
12563 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12565 * src/table.C (DocBookEndOfCell): commented out two unused variables
12567 * src/paragraph.C: commented out four unused variables.
12569 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12570 insed a if clause with type string::size_type.
12572 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12575 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12577 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12578 variable, also changed loop to go from 0 to lenght + 1, instead of
12579 -1 to length. This should be correct.
12581 * src/LaTeX.C (scanError): use string::size_type as loop variable
12584 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12585 (l.896) since y_tmp and row was not used anyway.
12587 * src/insets/insetref.C (escape): use string::size_type as loop
12590 * src/insets/insetquotes.C (Width): use string::size_type as loop
12592 (Draw): use string::size_type as loop variable type.
12594 * src/insets/insetlatexaccent.C (checkContents): use
12595 string::size_type as loop variable type.
12597 * src/insets/insetlabel.C (escape): use string::size_type as loop
12600 * src/insets/insetinfo.C: added an extern for current_view.
12602 * src/insets/insetcommand.C (scanCommand): use string::size_type
12603 as loop variable type.
12605 * most files: removed the RCS tags. With them we had to recompile
12606 a lot of files after a simple cvs commit. Also we have never used
12607 them for anything meaningful.
12609 * most files: tags-query-replace NULL 0. As adviced several plases
12610 we now use "0" instead of "NULL" in our code.
12612 * src/support/filetools.C (SpaceLess): use string::size_type as
12613 loop variable type.
12615 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12617 * src/paragraph.C: fixed up some more string stuff.
12619 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12621 * src/support/filetools.h: make modestr a std::string.
12623 * src/filetools.C (GetEnv): made ch really const.
12625 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12626 made code that used these use max/min from <algorithm> instead.
12628 * changed several c library include files to their equivalent c++
12629 library include files. All is not changed yet.
12631 * created a support subdir in src, put lyxstring and lstrings
12632 there + the extra files atexit, fileblock, strerror. Created
12633 Makefile.am. edited configure.in and src/Makefile.am to use this
12634 new subdir. More files moved to support.
12636 * imported som of the functions from repository lyx, filetools
12638 * ran tags-query-replace on LString -> string, corrected the bogus
12639 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12640 is still some errors in there. This is errors where too much or
12641 too litle get deleted from strings (string::erase, string::substr,
12642 string::replace), there can also be some off by one errors, or
12643 just plain wrong use of functions from lstrings. Viewing of quotes
12646 * LyX is now running fairly well with string, but there are
12647 certainly some bugs yet (see above) also string is quite different
12648 from LString among others in that it does not allow null pointers
12649 passed in and will abort if it gets any.
12651 * Added the revtex4 files I forgot when setting up the repository.
12653 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12655 * All over: Tried to clean everything up so that only the files
12656 that we really need are included in the cvs repository.
12657 * Switched to use automake.
12658 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12659 * Install has not been checked.
12661 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12663 * po/pt.po: Three errors:
12664 l.533 and l.538 format specification error
12665 l. 402 duplicate entry, I just deleted it.