1 2000-09-25 Allan Rae <rae@lyx.org>
3 * sigc++: updated libsigc++. Fixes struct timespec bug.
5 * development/tools/makeLyXsigc.sh: .cvsignore addition
7 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9 * several files: removed almost all traces of the old table
12 * src/TableLayout.C: removed file
14 2000-09-22 Juergen Vigna <jug@sad.it>
16 * src/frontends/kde/Dialogs.C: added credits forms.
18 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
20 * src/frontends/gnome/Dialogs.C: added some forms.
22 * src/spellchecker.C (init_spell_checker): set language in pspell code
23 (RunSpellChecker): some modifications for setting language string.
25 * src/language.[Ch]: added language_country code.
27 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
29 * src/frontends/Dialogs.h: added new signal showError.
30 Rearranged existing signals in some sort of alphabetical order.
32 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
33 FormError.[Ch], form_error.[Ch]
34 * src/frontends/xforms/forms/makefile: added new file form_error.fd
35 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
37 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
38 dialogs. I think that this can be used as the base to all these
41 * src/frontends/xforms/FormError.[Ch]
42 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
43 implementation of InsetError dialog.
45 * src/insets/inseterror.[Ch]: rendered GUI-independent.
47 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
48 * src/frontends/kde/Makefile.am: ditto
50 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
52 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
53 macrobf. This fixes a bug of invisible text.
55 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
57 * lib/doc/LaTeXConfig.lyx.in: updated.
59 * src/language.C (initL): remove language "francais" and change a
60 bit the names of the two other french variations.
62 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
63 string that may not be 0-terminated.
65 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
67 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
69 2000-09-20 Marko Vendelin <markov@ioc.ee>
71 * src/frontends/gnome/FormCitation.C
72 * src/frontends/gnome/FormIndex.C
73 * src/frontends/gnome/FormToc.C
74 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
75 the variable initialization to shut up the warnings
77 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
79 * src/table.[Ch]: deleted files
81 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
84 2000-09-18 Juergen Vigna <jug@sad.it>
86 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
87 problems with selection. Inserted new LFUN_PASTESELECTION.
88 (InsetButtonPress): inserted handling of middle mouse-button paste.
90 * src/spellchecker.C: changed word to word.c_str().
92 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
94 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
95 included in the ``make dist'' tarball.
97 2000-09-15 Juergen Vigna <jug@sad.it>
99 * src/CutAndPaste.C (cutSelection): small fix return the right
100 end position after cut inside one paragraph only.
102 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
103 we are locked as otherwise we don't have a valid cursor position!
105 * src/insets/figinset.C (draw): small bugfix but why is this needed???
107 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
109 * src/frontends/kde/FormRef.C: added using directive.
110 * src/frontends/kde/FormToc.C: ditto
112 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
114 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
117 2000-09-19 Marko Vendelin <markov@ioc.ee>
119 * src/frontends/gnome/Menubar_pimpl.C
120 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
121 Toc, ViewFormats, UpdateFormats, and ExportFormats.
123 * src/frontends/gnome/mainapp.C
124 * src/frontends/gnome/mainapp.h: support for menu update used
127 * src/frontends/gnome/mainapp.C
128 * src/frontends/gnome/mainapp.h: support for "action" area in the
129 main window. This area is used by small simple dialogs, such as
132 * src/frontends/gnome/FormIndex.C
133 * src/frontends/gnome/FormIndex.h
134 * src/frontends/gnome/FormUrl.C
135 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
138 * src/frontends/gnome/FormCitation.C
139 * src/frontends/gnome/FormCitation.h: rewrite to use main window
140 action area. Only "Insert new citation" is implemented.
144 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
146 * src/buffer.C (Dispatch): fix call to Dispatch
147 * src/insets/insetref.C (Edit): likewise
148 * src/insets/insetparent.C (Edit): likewise
149 * src/insets/insetinclude.C (include_cb): likewise
150 * src/frontends/xforms/FormUrl.C (apply): likewise
151 * src/frontends/xforms/FormToc.C (apply): likewise
152 * src/frontends/xforms/FormRef.C (apply): likewise
153 * src/frontends/xforms/FormIndex.C (apply): likewise
154 * src/frontends/xforms/FormCitation.C (apply): likewise
155 * src/lyxserver.C (callback): likewise
156 * src/lyxfunc.C (processKeySym): likewise
159 * src/lyx_cb.C (LayoutsCB): likewise
161 * Makefile.am (sourcedoc): small change
163 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
165 * src/main.C (main): Don't make an empty GUIRunTime object. all
166 methods are static. constify a bit remove unneded using + headers.
168 * src/tabular.C: some more const to local vars move some loop vars
170 * src/spellchecker.C: added some c_str after some word for pspell
172 * src/frontends/GUIRunTime.h: add new static method setDefaults
173 * src/frontends/xforms/GUIRunTime.C (setDefaults):
174 * src/frontends/kde/GUIRunTime.C (setDefaults):
175 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
177 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
178 with strnew in arg, use correct emptystring when calling SetName.
180 * several files: remove all commented code with relation to
181 HAVE_SSTREAM beeing false. We now only support stringstream and
184 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
186 * src/lyxfunc.C: construct correctly the automatic new file
189 * src/text2.C (IsStringInText): change type of variable i to shut
192 * src/support/sstream.h: do not use namespaces if the compiler
193 does not support them.
195 2000-09-15 Marko Vendelin <markov@ioc.ee>
196 * src/frontends/gnome/FormCitation.C
197 * src/frontends/gnome/FormCitation.h
198 * src/frontends/gnome/diainsertcitation_interface.c
199 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
200 regexp support to FormCitation [Gnome].
202 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
205 * configure.in: remove unused KDE/GTKGUI define
207 * src/frontends/kde/FormRef.C
208 * src/frontends/kde/FormRef.h
209 * src/frontends/kde/formrefdialog.C
210 * src/frontends/kde/formrefdialog.h: double click will
211 go to reference, now it is possible to change a cross-ref
214 * src/frontends/kde/FormToc.C
215 * src/frontends/kde/FormToc.h
216 * src/frontends/kde/formtocdialog.C
217 * src/frontends/kde/formtocdialog.h: add a depth
220 * src/frontends/kde/Makefile.am: add QtLyXView.h
223 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
225 * src/frontends/kde/FormCitation.h: added some using directives.
227 * src/frontends/kde/FormToc.h: corrected definition of doTree.
229 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
232 * src/mathed/math_defs.h: redefine SetAlign to use string rather
235 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
237 * src/buffer.C (pop_tag): revert for the second time a change by
238 Lars, who seems to really hate having non-local loop variables :)
240 * src/Lsstream.h: add "using" statements.
242 * src/support/copy.C (copy): add a bunch of std:: qualifiers
243 * src/buffer.C (writeFile): ditto
245 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
247 * src/buffer.C (writeFile): try to fix the locale modified format
248 number to always be as we want it.
250 * src/WorkArea.C (work_area_handler): try to workaround the bugs
251 in XForms 0.89. C-space is now working again.
253 * src/Lsstream.h src/support/sstream.h: new files.
255 * also commented out all cases where strstream were used.
257 * src/Bullet.h (c_str): remove method.
259 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
261 * a lot of files: get rid of "char const *" and "char *" is as
262 many places as possible. We only want to use them in interaction
263 with system of other libraries, not inside lyx.
265 * a lot of files: return const object is not of pod type. This
266 helps ensure that temporary objects is not modified. And fits well
267 with "programming by contract".
269 * configure.in: check for the locale header too
271 * Makefile.am (sourcedoc): new tag for generation of doc++
274 2000-09-14 Juergen Vigna <jug@sad.it>
276 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
277 callback to check which combo called it and do the right action.
279 * src/combox.C (combo_cb): added combo * to the callbacks.
280 (Hide): moved call of callback after Ungrab of the pointer.
282 * src/intl.h: removed LCombo2 function.
284 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
285 function as this can now be handled in one function.
287 * src/combox.h: added Combox * to callback prototype.
289 * src/frontends/xforms/Toolbar_pimpl.C:
290 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
292 2000-09-14 Garst Reese <reese@isn.net>
294 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
295 moved usepackage{xxx}'s to beginning of file. Changed left margin
296 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
297 underlining from title. Thanks to John Culleton for useful suggestions.
299 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
301 * src/lyxlex_pimpl.C (setFile): change error message to debug
304 2000-09-13 Juergen Vigna <jug@sad.it>
306 * src/frontends/xforms/FormDocument.C: implemented choice_class
307 as combox and give callback to combo_language so OK/Apply is activated
310 * src/bufferlist.C (newFile): small fix so already named files
311 (via an open call) are not requested to be named again on the
314 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
316 * src/frontends/kde/Makefile.am
317 * src/frontends/kde/FormRef.C
318 * src/frontends/kde/FormRef.h
319 * src/frontends/kde/formrefdialog.C
320 * src/frontends/kde/formrefdialog.h: implement
323 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
325 * src/frontends/kde/formtocdialog.C
326 * src/frontends/kde/formtocdialog.h
327 * src/frontends/kde/FormToc.C
328 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
330 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
332 * src/frontends/kde/FormCitation.C: fix thinko
333 where we didn't always display the reference text
336 * src/frontends/kde/formurldialog.C
337 * src/frontends/kde/formurldialog.h
338 * src/frontends/kde/FormUrl.C
339 * src/frontends/kde/FormUrl.h: minor cleanups
341 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
343 * src/frontends/kde/Makefile.am
344 * src/frontends/kde/FormToc.C
345 * src/frontends/kde/FormToc.h
346 * src/frontends/kde/FormCitation.C
347 * src/frontends/kde/FormCitation.h
348 * src/frontends/kde/FormIndex.C
349 * src/frontends/kde/FormIndex.h
350 * src/frontends/kde/formtocdialog.C
351 * src/frontends/kde/formtocdialog.h
352 * src/frontends/kde/formcitationdialog.C
353 * src/frontends/kde/formcitationdialog.h
354 * src/frontends/kde/formindexdialog.C
355 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
357 2000-09-12 Juergen Vigna <jug@sad.it>
359 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
362 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
364 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
367 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
369 * src/converter.C (Add, Convert): Added support for converter flags:
370 needaux, resultdir, resultfile.
371 (Convert): Added new parameter view_file.
372 (dvips_options): Fixed letter paper option.
374 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
375 (Export, GetExportableFormats, GetViewableFormats): Added support
378 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
380 (easyParse): Fixed to work with new export code.
382 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
385 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
387 * lib/bind/*.bind: Replaced
388 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
389 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
391 2000-09-11 Juergen Vigna <jug@sad.it>
393 * src/lyx_gui.C (runTime): uses global guiruntime variable.
395 * src/main.C (main): now GUII defines global guiruntime!
397 * src/frontends/gnome/GUIRunTime.C (initApplication):
398 * src/frontends/kde/GUIRunTime.C (initApplication):
399 * src/frontends/xforms/GUIRunTime.C (initApplication):
400 * src/frontends/GUIRunTime.h: added new function initApplication.
402 * src/spellchecker.C (sc_accept_word): change to add_to_session.
404 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
406 2000-09-08 Juergen Vigna <jug@sad.it>
408 * src/lyx_gui.C (create_forms): don't display the "default" entry as
409 we have already "Reset".
411 * src/language.C (initL): inserted "default" language and made this
412 THE default language (and not american!)
414 * src/paragraph.C: inserted handling of "default" language!
416 * src/lyxfont.C: ditto
420 * src/paragraph.C: output the \\par only if we have a following
421 paragraph otherwise it's not needed.
423 2000-09-05 Juergen Vigna <jug@sad.it>
425 * config/pspell.m4: added entry to lyx-flags
427 * src/spellchecker.C: modified version from Kevin for using pspell
429 2000-09-01 Marko Vendelin <markov@ioc.ee>
430 * src/frontends/gnome/Makefile.am
431 * src/frontends/gnome/FormCitation.C
432 * src/frontends/gnome/FormCitation.h
433 * src/frontends/gnome/diainsertcitation_callbacks.c
434 * src/frontends/gnome/diainsertcitation_callbacks.h
435 * src/frontends/gnome/diainsertcitation_interface.c
436 * src/frontends/gnome/diainsertcitation_interface.h
437 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
438 dialog for Gnome frontend
440 * src/main.C: Gnome libraries require keeping application name
441 and its version as strings
443 * src/frontends/gnome/mainapp.C: Change the name of the main window
444 from GnomeLyX to PACKAGE
446 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
448 * src/frontends/Liason.C: add "using: declaration.
450 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
452 * src/mathed/math_macro.C (Metrics): Set the size of the template
454 * src/mathed/formulamacro.C (Latex): Fixed the returned value
456 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
458 * src/converter.C (add_options): New function.
459 (SetViewer): Change $$FName into '$$FName'.
460 (View): Add options when running xdvi
461 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
462 (Convert): The 3rd parameter is now the desired filename. Converts
463 calls to lyx::rename if necessary.
464 Add options when running dvips.
465 (dvi_papersize,dvips_options): New methods.
467 * src/exporter.C (Export): Use getLatexName() instead of fileName().
469 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
470 using a call to Converter::dvips_options.
471 Fixed to work with nex export code.
474 * src/support/rename.C: New files
476 * src/support/syscall.h
477 * src/support/syscall.C: Added Starttype SystemDontWait.
479 * lib/ui/default.ui: Changed to work with new export code
481 * lib/configure.m4: Changed to work with new export code
483 * src/encoding.C: Changed latex name for iso8859_7 encoding.
485 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
487 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
488 so that code compiles with DEC cxx.
490 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
491 to work correctly! Also now supports the additional elements
494 2000-09-01 Allan Rae <rae@lyx.org>
496 * src/frontends/ButtonPolicies.C: renamed all the references to
497 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
499 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
500 since it's a const not a type.
502 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
504 2000-08-31 Juergen Vigna <jug@sad.it>
506 * src/insets/figinset.C: Various changes to look if the filename has
507 an extension and if not add it for inline previewing.
509 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
511 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
512 make buttonStatus and isReadOnly be const methods. (also reflect
513 this in derived classes.)
515 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
516 (nextState): change to be static inline, pass the StateMachine as
518 (PreferencesPolicy): remove casts
519 (OkCancelPolicy): remvoe casts
520 (OkCancelReadOnlyPolicy): remove casts
521 (NoRepeatedApplyReadOnlyPolicy): remove casts
522 (OkApplyCancelReadOnlyPolicy): remove casts
523 (OkApplyCancelPolicy): remove casts
524 (NoRepeatedApplyPolicy): remove casts
526 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
528 * src/converter.C: added some using directives
530 * src/frontends/ButtonPolicies.C: changes to overcome
531 "need lvalue" error with DEC c++
533 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
534 to WMHideCB for DEC c++
536 * src/frontends/xforms/Menubar_pimpl.C: added using directive
538 * src/frontends/xforms/forms/form_document.C.patch: use C callback
539 to BulletBMTableCB for DEC c++
541 2000-08-31 Allan Rae <rae@lyx.org>
543 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
544 character dialog separately from old document dialogs combo_language.
547 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
549 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
550 Removed LFUN_REF_CREATE.
552 * src/MenuBackend.C: Added new tags: toc and references
554 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
555 (add_lastfiles, add_documents, add_formats): Removed the unused smn
557 (add_toc, add_references): New methods.
558 (create_submenu): Handle correctly the case when there is a
559 seperator after optional menu items.
561 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
562 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
563 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
565 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
567 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
569 * src/converter.[Ch]: New file for converting between different
572 * src/export.[Ch]: New file for exporting a LyX file to different
575 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
576 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
577 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
578 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
579 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
580 RunDocBook, MenuExport.
582 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
583 Exporter::Preview methods if NEW_EXPORT is defined.
585 * src/buffer.C (Dispatch): Use Exporter::Export.
587 * src/lyxrc.C: Added new tags: \converter and \viewer.
590 * src/LyXAction.C: Define new lyx-function: buffer-update.
591 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
592 when NEW_EXPORT is defined.
594 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
596 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
598 * lib/ui/default.ui: Added submenus "view" and "update" to the
601 * src/filetools.C (GetExtension): New function.
603 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
605 2000-08-29 Allan Rae <rae@lyx.org>
607 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
609 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
610 (EnableDocumentLayout): removed
611 (DisableDocumentLayout): removed
612 (build): make use of ButtonController's read-only handling to
613 de/activate various objects. Replaces both of the above functions.
615 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
616 (readOnly): was read_only
617 (refresh): fixed dumb mistakes with read_only_ handling
619 * src/frontends/xforms/forms/form_document.fd:
620 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
621 tabbed dialogs so the tabs look more like tabs and so its easier to
622 work out which is the current tab.
624 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
625 segfault with form_table
627 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
629 2000-08-28 Juergen Vigna <jug@sad.it>
631 * acconfig.h: added USE_PSPELL.
633 * src/config.h.in: added USE_PSPELL.
635 * autogen.sh: added pspell.m4
637 * config/pspell.m4: new file.
639 * src/spellchecker.C: implemented support for pspell libary.
641 2000-08-25 Juergen Vigna <jug@sad.it>
643 * src/LyXAction.C (init): renamed LFUN_TABLE to
644 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
646 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
648 * src/lyxscreen.h: add force_clear variable and fuction to force
649 a clear area when redrawing in LyXText.
651 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
653 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
655 * some whitespace and comment changes.
657 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
659 * src/buffer.C: up te LYX_FORMAT to 2.17
661 2000-08-23 Juergen Vigna <jug@sad.it>
663 * src/BufferView_pimpl.C (tripleClick): disable this when in a
666 * src/insets/insettabular.C (pasteSelection): delete the insets
667 LyXText as it is not valid anymore.
668 (copySelection): new function.
669 (pasteSelection): new function.
670 (cutSelection): new function.
671 (LocalDispatch): implemented cut/copy/paste of cell selections.
673 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
674 don't have a LyXText.
676 * src/LyXAction.C (init): a NEW_TABULAR define too much.
678 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
681 2000-08-22 Juergen Vigna <jug@sad.it>
683 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
684 ifdef form_table out if NEW_TABULAR.
686 2000-08-21 Juergen Vigna <jug@sad.it>
688 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
689 (draw): fixed draw position so that the cursor is positioned in the
691 (InsetMotionNotify): hide/show cursor so the position is updated.
692 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
693 using cellstart() function where it should be used.
695 * src/insets/insettext.C (draw): ditto.
697 * src/tabular.C: fixed initialization of some missing variables and
698 made BoxType into an enum.
700 2000-08-22 Marko Vendelin <markov@ioc.ee>
701 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
702 stock menu item using action numerical value, not its string
706 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
708 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
709 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
711 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
713 * src/frontends/xforms/GUIRunTime.C: new file
715 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
716 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
718 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
720 * src/frontends/kde/GUIRunTime.C: new file
722 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
723 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
725 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
727 * src/frontends/gnome/GUIRunTime.C: new file
729 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
732 * src/frontends/GUIRunTime.h: removed constructor and destructor,
733 small change to documetentation.
735 * src/frontends/GUIRunTime.C: removed file
737 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
739 * src/lyxparagraph.h: enable NEW_TABULAR as default
741 * src/lyxfunc.C (processKeySym): remove some commented code
743 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
744 NEW_TABULAR around the fd_form_table_options.
746 * src/lyx_gui.C (runTime): call the static member function as
747 GUIRunTime::runTime().
749 2000-08-21 Allan Rae <rae@lyx.org>
751 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
754 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
756 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
758 2000-08-21 Allan Rae <rae@lyx.org>
760 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
762 * src/frontends/xforms/FormPreferences.C (build): use setOK
763 * src/frontends/xforms/FormDocument.C (build): use setOK
764 (FormDocument): use the appropriate policy.
766 2000-08-21 Allan Rae <rae@lyx.org>
768 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
769 automatic [de]activation of arbitrary objects when in a read-only state.
771 * src/frontends/ButtonPolicies.h: More documentation
772 (isReadOnly): added to support the above.
774 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
776 2000-08-18 Juergen Vigna <jug@sad.it>
778 * src/insets/insettabular.C (getStatus): changed to return func_status.
780 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
781 display toggle menu entries if they are.
783 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
784 new document layout now.
786 * src/lyxfunc.C: ditto
788 * src/lyx_gui_misc.C: ditto
790 * src/lyx_gui.C: ditto
792 * lib/ui/default.ui: removed paper and quotes layout as they are now
793 all in the document layout tabbed folder.
795 * src/frontends/xforms/forms/form_document.fd: added Restore
796 button and callbacks for all inputs for Allan's ButtonPolicy.
798 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
799 (CheckChoiceClass): added missing params setting on class change.
800 (UpdateLayoutDocument): added for updating the layout on params.
801 (build): forgot to RETURN_ALWAYS input_doc_spacing.
802 (FormDocument): Implemented Allan's ButtonPolicy with the
805 2000-08-17 Allan Rae <rae@lyx.org>
807 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
808 so we can at least see the credits again.
810 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
811 controller calls for the appropriate callbacks. Note that since Ok
812 calls apply followed by cancel, and apply isn't a valid input for the
813 APPLIED state, the bc_ calls have to be made in the static callback not
814 within each of the real callbacks.
816 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
817 (setOk): renamed from setOkay()
819 2000-08-17 Juergen Vigna <jug@sad.it>
821 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
822 in the implementation part.
823 (composeUIInfo): don't show optional menu-items.
825 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
827 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
829 * src/bufferview_funcs.C (CurrentState): fixed to show also the
830 text-state when in a text-inset.
832 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
834 2000-08-17 Marko Vendelin <markov@ioc.ee>
835 * src/frontends/gnome/FormIndex.C
836 * src/frontends/gnome/FormIndex.h
837 * src/frontends/gnome/FormToc.C
838 * src/frontends/gnome/FormToc.h
839 * src/frontends/gnome/dialogs
840 * src/frontends/gnome/diatoc_callbacks.c
841 * src/frontends/gnome/diatoc_callbacks.h
842 * src/frontends/gnome/diainsertindex_callbacks.h
843 * src/frontends/gnome/diainsertindex_callbacks.c
844 * src/frontends/gnome/diainsertindex_interface.c
845 * src/frontends/gnome/diainsertindex_interface.h
846 * src/frontends/gnome/diatoc_interface.h
847 * src/frontends/gnome/diatoc_interface.c
848 * src/frontends/gnome/Makefile.am: Table of Contents and
849 Insert Index dialogs implementation for Gnome frontend
851 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
853 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
855 * src/frontends/gnome/diainserturl_interface.c: make the dialog
858 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
860 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
861 destructor. Don't definde if you don't need it
862 (processEvents): made static, non-blocking events processing for
864 (runTime): static method. event loop for xforms
865 * similar as above for kde and gnome.
867 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
869 (runTime): new method calss the real frontends runtime func.
871 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
873 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
875 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
877 2000-08-16 Juergen Vigna <jug@sad.it>
879 * src/lyx_gui.C (runTime): added GUII RunTime support.
881 * src/frontends/Makefile.am:
882 * src/frontends/GUIRunTime.[Ch]:
883 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
884 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
885 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
887 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
889 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
890 as this is already set in ${FRONTEND_INCLUDE} if needed.
892 * configure.in (CPPFLAGS): setting the include dir for the frontend
893 directory and don't set FRONTEND=xforms for now as this is executed
896 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
898 * src/frontends/kde/Makefile.am:
899 * src/frontends/kde/FormUrl.C:
900 * src/frontends/kde/FormUrl.h:
901 * src/frontends/kde/formurldialog.h:
902 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
904 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
906 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
908 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
910 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
913 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
915 * src/WorkArea.C (work_area_handler): more work to get te
916 FL_KEYBOARD to work with xforms 0.88 too, please test.
918 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
920 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
922 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
925 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
927 * src/Timeout.h: remove Qt::emit hack.
929 * several files: changes to allo doc++ compilation
931 * src/lyxfunc.C (processKeySym): new method
932 (processKeyEvent): comment out if FL_REVISION < 89
934 * src/WorkArea.C: change some debugging levels.
935 (WorkArea): set wantkey to FL_KEY_ALL
936 (work_area_handler): enable the FL_KEYBOARD clause, this enables
937 clearer code and the use of compose with XForms 0.89. Change to
938 use signals instead of calling methods in bufferview directly.
940 * src/Painter.C: change some debugging levels.
942 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
945 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
946 (workAreaKeyPress): new method
948 2000-08-14 Juergen Vigna <jug@sad.it>
950 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
952 * config/kde.m4: addes some features
954 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
955 include missing xforms dialogs.
957 * src/Timeout.h: a hack to be able to compile with qt/kde.
959 * sigc++/.cvsignore: added acinclude.m4
961 * lib/.cvsignore: added listerros
963 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
964 xforms tree as objects are needed for other frontends.
966 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
967 linking with not yet implemented xforms objects.
969 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
971 2000-08-14 Baruch Even <baruch.even@writeme.com>
973 * src/frontends/xforms/FormGraphics.h:
974 * src/frontends/xforms/FormGraphics.C:
975 * src/frontends/xforms/RadioButtonGroup.h:
976 * src/frontends/xforms/RadioButtonGroup.C:
977 * src/insets/insetgraphics.h:
978 * src/insets/insetgraphics.C:
979 * src/insets/insetgraphicsParams.h:
980 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
981 instead of spaces, and various other indentation issues to make the
982 sources more consistent.
984 2000-08-14 Marko Vendelin <markov@ioc.ee>
986 * src/frontends/gnome/dialogs/diaprint.glade
987 * src/frontends/gnome/FormPrint.C
988 * src/frontends/gnome/FormPrint.h
989 * src/frontends/gnome/diaprint_callbacks.c
990 * src/frontends/gnome/diaprint_callbacks.h
991 * src/frontends/gnome/diaprint_interface.c
992 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
995 * src/frontends/gnome/dialogs/diainserturl.glade
996 * src/frontends/gnome/FormUrl.C
997 * src/frontends/gnome/FormUrl.h
998 * src/frontends/gnome/diainserturl_callbacks.c
999 * src/frontends/gnome/diainserturl_callbacks.h
1000 * src/frontends/gnome/diainserturl_interface.c
1001 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1002 Gnome implementation
1004 * src/frontends/gnome/Dialogs.C
1005 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1006 all other dialogs. Copy all unimplemented dialogs from Xforms
1009 * src/frontends/gnome/support.c
1010 * src/frontends/gnome/support.h: support files generated by Glade
1014 * config/gnome.m4: Gnome configuration scripts
1016 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1017 configure --help message
1019 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1020 only if there are no events pendling in Gnome/Gtk. This enhances
1021 the performance of menus.
1024 2000-08-14 Allan Rae <rae@lyx.org>
1026 * lib/Makefile.am: listerrors cleaning
1028 * lib/listerrors: removed -- generated file
1029 * acinclude.m4: ditto
1030 * sigc++/acinclude.m4: ditto
1032 * src/frontends/xforms/forms/form_citation.fd:
1033 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1036 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1037 `updatesrc` and now we have a `test` target that does what `updatesrc`
1038 used to do. I didn't like having an install target that wasn't related
1041 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1042 on all except FormGraphics. This may yet happen. Followed by a major
1043 cleanup including using FL_TRANSIENT for most of the dialogs. More
1044 changes to come when the ButtonController below is introduced.
1046 * src/frontends/xforms/ButtonController.h: New file for managing up to
1047 four buttons on a dialog according to an externally defined policy.
1048 * src/frontends/xforms/Makefile.am: added above
1050 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1051 Apply and Cancel/Close buttons and everything in between and beyond.
1052 * src/frontends/Makefile.am: added above.
1054 * src/frontends/xforms/forms/form_preferences.fd:
1055 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1056 and removed variable 'status' as a result. Fixed the set_minsize thing.
1057 Use the new screen-font-update after checking screen fonts were changed
1058 Added a "Restore" button to restore the original lyxrc values while
1059 editing. This restores everything not just the last input changed.
1060 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1062 * src/LyXAction.C: screen-font-update added for updating buffers after
1063 screen font settings have been changed.
1064 * src/commandtags.h: ditto
1065 * src/lyxfunc.C: ditto
1067 * forms/lyx.fd: removed screen fonts dialog.
1068 * src/lyx_gui.C: ditto
1069 * src/menus.[Ch]: ditto
1070 * src/lyx.[Ch]: ditto
1071 * src/lyx_cb.C: ditto + code from here moved to make
1072 screen-font-update. And people wonder why progress on GUII is
1073 slow. Look at how scattered this stuff was! It takes forever
1076 * forms/fdfix.sh: Fixup the spacing after commas.
1077 * forms/makefile: Remove date from generated files. Fewer clashes now.
1078 * forms/bullet_forms.C.patch: included someones handwritten changes
1080 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1081 once I've discovered why LyXRC was made noncopyable.
1082 * src/lyx_main.C: ditto
1084 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1086 * src/frontends/xforms/forms/fdfix.sh:
1087 * src/frontends/xforms/forms/fdfixh.sed:
1088 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1089 * src/frontends/xforms/Form*.[hC]:
1090 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1091 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1092 provide a destructor for the struct FD_form_xxxx. Another version of
1093 the set_[max|min]size workaround and a few other cleanups. Actually,
1094 Angus' patch from 20000809.
1096 2000-08-13 Baruch Even <baruch.even@writeme.com>
1098 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1101 2000-08-11 Juergen Vigna <jug@sad.it>
1103 * src/insets/insetgraphics.C (InsetGraphics): changing init
1104 order because of warnings.
1106 * src/frontends/xforms/forms/makefile: adding patching .C with
1109 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1110 from .C.patch to .c.patch
1112 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1113 order because of warning.
1115 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1117 * src/frontends/Liason.C (setMinibuffer): new helper function
1119 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1121 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1123 * lib/ui/default.ui: commented out PaperLayout entry
1125 * src/frontends/xforms/form_document.[Ch]: new added files
1127 * src/frontends/xforms/FormDocument.[Ch]: ditto
1129 * src/frontends/xforms/forms/form_document.fd: ditto
1131 * src/frontends/xforms/forms/form_document.C.patch: ditto
1133 2000-08-10 Juergen Vigna <jug@sad.it>
1135 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1136 (InsetGraphics): initialized cacheHandle to 0.
1137 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1139 2000-08-10 Baruch Even <baruch.even@writeme.com>
1141 * src/graphics/GraphicsCache.h:
1142 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1143 correctly as a cache.
1145 * src/graphics/GraphicsCacheItem.h:
1146 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1149 * src/graphics/GraphicsCacheItem_pimpl.h:
1150 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1153 * src/insets/insetgraphics.h:
1154 * src/insets/insetgraphics.C: Changed from using a signal notification
1155 to polling when image is not loaded.
1157 2000-08-10 Allan Rae <rae@lyx.org>
1159 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1160 that there are two functions that have to been taken out of line by
1161 hand and aren't taken care of in the script. (Just a reminder note)
1163 * sigc++/macros/*.h.m4: Updated as above.
1165 2000-08-09 Juergen Vigna <jug@sad.it>
1167 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1169 * src/insets/insettabular.C: make drawing of single cell smarter.
1171 2000-08-09 Marko Vendelin <markov@ioc.ee>
1172 * src/frontends/gnome/Menubar_pimpl.C
1173 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1174 implementation: new files
1176 * src/frontends/gnome/mainapp.C
1177 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1180 * src/main.C: create Gnome main window
1182 * src/frontends/xforms/Menubar_pimpl.h
1183 * src/frontends/Menubar.C
1184 * src/frontends/Menubar.h: added method Menubar::update that calls
1185 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1187 * src/LyXView.C: calls Menubar::update to update the state
1190 * src/frontends/gnome/Makefile.am: added new files
1192 * src/frontends/Makefile.am: added frontend compiler options
1194 2000-08-08 Juergen Vigna <jug@sad.it>
1196 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1198 * src/bufferlist.C (close):
1199 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1200 documents if exiting without saving.
1202 * src/buffer.C (save): use removeAutosaveFile()
1204 * src/support/filetools.C (removeAutosaveFile): new function.
1206 * src/lyx_cb.C (MenuWrite): returns a bool now.
1207 (MenuWriteAs): check if file could really be saved and revert to the
1209 (MenuWriteAs): removing old autosavefile if existant.
1211 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1212 before Goto toggle declaration, because of compiler warning.
1214 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1216 * src/lyxfunc.C (MenuNew): small fix.
1218 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1220 * src/bufferlist.C (newFile):
1221 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1223 * src/lyxrc.C: added new_ask_filename tag
1225 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1227 * src/lyx.fd: removed code pertaining to form_ref
1228 * src/lyx.[Ch]: ditto
1229 * src/lyx_cb.C: ditto
1230 * src/lyx_gui.C: ditto
1231 * src/lyx_gui_misc.C: ditto
1233 * src/BufferView_pimpl.C (restorePosition): update buffer only
1236 * src/commandtags.h (LFUN_REFTOGGLE): removed
1237 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1238 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1239 (LFUN_REFBACK): renamed LFUN_REF_BACK
1241 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1242 * src/menus.C: ditto
1243 * src/lyxfunc.C (Dispatch): ditto.
1244 InsertRef dialog is now GUI-independent.
1246 * src/texrow.C: added using std::endl;
1248 * src/insets/insetref.[Ch]: strip out large amounts of code.
1249 The inset is now a container and this functionality is now
1250 managed by a new FormRef dialog
1252 * src/frontends/Dialogs.h (showRef, createRef): new signals
1254 * src/frontends/xforms/FormIndex.[Ch],
1255 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1256 when setting dialog's min/max size
1257 * src/frontends/xforms/FormIndex.[Ch]: ditto
1259 * src/frontends/xforms/FormRef.[Ch],
1260 src/frontends/xforms/forms/form_ref.fd: new xforms
1261 implementation of an InsetRef dialog
1263 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1266 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1267 ios::nocreate is not part of the standard. Removed.
1269 2000-08-07 Baruch Even <baruch.even@writeme.com>
1271 * src/graphics/Renderer.h:
1272 * src/graphics/Renderer.C: Added base class for rendering of different
1273 image formats into Pixmaps.
1275 * src/graphics/XPM_Renderer.h:
1276 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1277 in a different class.
1279 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1280 easily add support for other formats.
1282 * src/insets/figinset.C: plugged a leak of an X resource.
1284 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1286 * src/CutAndPaste.[Ch]: make all metods static.
1288 * development/Code_rules/Rules: more work, added section on
1289 Exceptions, and a References section.
1291 * a lot of header files: work to make doc++ able to generate the
1292 source documentation, some workarounds of doc++ problems. Doc++ is
1293 now able to generate the documentation.
1295 2000-08-07 Juergen Vigna <jug@sad.it>
1297 * src/insets/insettabular.C (recomputeTextInsets): removed function
1299 * src/tabular.C (SetWidthOfMulticolCell):
1301 (calculate_width_of_column_NMC): fixed return value so that it really
1302 only returns true if the column-width has changed (there where
1303 problems with muliticolumn-cells in this column).
1305 2000-08-04 Juergen Vigna <jug@sad.it>
1307 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1308 also on the scrollstatus of the inset.
1309 (workAreaMotionNotify): ditto.
1311 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1313 2000-08-01 Juergen Vigna <jug@sad.it>
1315 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1317 * src/commandtags.h:
1318 * src/LyXAction.C (init):
1319 * src/insets/inset.C (LocalDispatch): added support for
1322 * src/insets/inset.C (scroll): new functions.
1324 * src/insets/insettext.C (removeNewlines): new function.
1325 (SetAutoBreakRows): removes forced newlines in the text of the
1326 paragraph if autoBreakRows is set to false.
1328 * src/tabular.C (Latex): generates a parbox around the cell contents
1331 * src/frontends/xforms/FormTabular.C (local_update): removed
1332 the radio_useparbox button.
1334 * src/tabular.C (UseParbox): new function
1336 2000-08-06 Baruch Even <baruch.even@writeme.com>
1338 * src/graphics/GraphicsCache.h:
1339 * src/graphics/GraphicsCache.C:
1340 * src/graphics/GraphicsCacheItem.h:
1341 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1344 * src/insets/insetgraphics.h:
1345 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1346 drawing of the inline image.
1348 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1349 into the wrong position.
1351 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1354 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1356 * src/support/translator.h: move all typedefs to public section
1358 * src/support/filetools.C (MakeLatexName): return string const
1360 (TmpFileName): ditto
1361 (FileOpenSearch): ditto
1363 (LibFileSearch): ditto
1364 (i18nLibFileSearch): ditto
1367 (CreateTmpDir): ditto
1368 (CreateBufferTmpDir): ditto
1369 (CreateLyXTmpDir): ditto
1372 (MakeAbsPath): ditto
1374 (OnlyFilename): ditto
1376 (NormalizePath): ditto
1377 (CleanupPath): ditto
1378 (GetFileContents): ditto
1379 (ReplaceEnvironmentPath): ditto
1380 (MakeRelPath): ditto
1382 (ChangeExtension): ditto
1383 (MakeDisplayPath): ditto
1384 (do_popen): return cmdret const
1385 (findtexfile): return string const
1387 * src/support/DebugStream.h: add some /// to please doc++
1389 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1391 * src/texrow.C (same_rownumber): functor to use with find_if
1392 (getIdFromRow): rewritten to use find_if and to not update the
1393 positions. return true if row is found
1394 (increasePos): new method, use to update positions
1396 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1398 * src/lyxlex_pimpl.C (verifyTable): new method
1401 (GetString): return string const
1402 (pushTable): rewrite to use std::stack
1404 (setFile): better check
1407 * src/lyxlex.h: make LyXLex noncopyable
1409 * src/lyxlex.C (text): return char const * const
1410 (GetString): return string const
1411 (getLongString): return string const
1413 * src/lyx_gui_misc.C (askForText): return pair<...> const
1415 * src/lastfiles.[Ch] (operator): return string const
1417 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1418 istringstream not char const *.
1419 move token.end() out of loop.
1420 (readFile): move initializaton of token
1422 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1423 getIdFromRow is successful.
1425 * lib/bind/emacs.bind: don't include menus bind
1427 * development/Code_rules/Rules: the beginnings of making this
1428 better and covering more of the unwritten rules that we have.
1430 * development/Code_rules/Recommendations: a couple of wording
1433 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1435 * src/support/strerror.c: remove C++ comment.
1437 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1439 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1440 LFUN_INDEX_INSERT_LAST
1442 * src/texrow.C (getIdFromRow): changed from const_iterator to
1443 iterator, allowing code to compile with DEC cxx
1445 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1446 stores part of the class, as suggested by Allan. Will allow
1448 (apply): test to apply uses InsetCommandParams operator!=
1450 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1451 (apply): test to apply uses InsetCommandParams operator!=
1453 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1454 stores part of the class.
1455 (update): removed limits on min/max size.
1457 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1458 (apply): test to apply uses InsetCommandParams operator!=
1460 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1461 (Read, Write, scanCommand, getCommand): moved functionality
1462 into InsetCommandParams.
1464 (getScreenLabel): made pure virtual
1465 new InsetCommandParams operators== and !=
1467 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1468 c-tors based on InsetCommandParams. Removed others.
1469 * src/insets/insetinclude.[Ch]: ditto
1470 * src/insets/insetlabel.[Ch]: ditto
1471 * src/insets/insetparent.[Ch]: ditto
1472 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1474 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1475 insets derived from InsetCommand created using similar c-tors
1476 based on InsetCommandParams
1477 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1478 * src/menus.C (ShowRefsMenu): ditto
1479 * src/paragraph.C (Clone): ditto
1480 * src/text2.C (SetCounter): ditto
1481 * src/lyxfunc.C (Dispatch) ditto
1482 Also recreated old InsetIndex behaviour exactly. Can now
1483 index-insert at the start of a paragraph and index-insert-last
1484 without launching the pop-up.
1486 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1488 * lib/lyxrc.example: mark te pdf options as non functional.
1490 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1491 (isStrDbl): move tmpstr.end() out of loop.
1492 (strToDbl): move intialization of tmpstr
1493 (lowercase): return string const and move tmp.end() out of loop.
1494 (uppercase): return string const and move tmp.edn() out of loop.
1495 (prefixIs): add assertion
1500 (containsOnly): ditto
1501 (containsOnly): ditto
1502 (containsOnly): ditto
1503 (countChar): make last arg char not char const
1504 (token): return string const
1505 (subst): return string const, move tmp.end() out of loop.
1506 (subst): return string const, add assertion
1507 (strip): return string const
1508 (frontStrip): return string const, add assertion
1509 (frontStrip): return string const
1514 * src/support/lstrings.C: add inclde "LAssert.h"
1515 (isStrInt): move tmpstr.end() out of loop.
1517 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1518 toollist.end() out of loop.
1519 (deactivate): move toollist.end() out of loop.
1520 (update): move toollist.end() out of loop.
1521 (updateLayoutList): move tc.end() out of loop.
1522 (add): move toollist.end() out of loop.
1524 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1525 md.end() out of loop.
1527 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1529 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1532 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1533 (Erase): move insetlist.end() out of loop.
1535 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1536 ref to const string as first arg. Move initialization of some
1537 variables, whitespace changes.
1539 * src/kbmap.C (defkey): move table.end() out of loop.
1540 (kb_keymap): move table.end() out of loop.
1541 (findbinding): move table.end() out of loop.
1543 * src/MenuBackend.C (hasMenu): move end() out of loop.
1544 (getMenu): move end() out of loop.
1545 (getMenu): move menulist_.end() out of loop.
1547 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1549 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1552 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1553 (getFromLyXName): move infotab.end() out of loop.
1555 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1556 -fvtable-thunks -ffunction-sections -fdata-sections
1558 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1560 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1563 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1565 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1567 * src/frontends/xforms/FormCitation.[Ch],
1568 src/frontends/xforms/FormIndex.[Ch],
1569 src/frontends/xforms/FormToc.[Ch],
1570 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1572 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1574 * src/commandtags.h: renamed, created some flags for citation
1577 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1579 * src/lyxfunc.C (dispatch): use signals to insert index entry
1581 * src/frontends/Dialogs.h: new signal createIndex
1583 * src/frontends/xforms/FormCommand.[Ch],
1584 src/frontends/xforms/FormCitation.[Ch],
1585 src/frontends/xforms/FormToc.[Ch],
1586 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1588 * src/insets/insetindex.[Ch]: GUI-independent
1590 * src/frontends/xforms/FormIndex.[Ch],
1591 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1594 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1596 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1597 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1599 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1601 * src/insets/insetref.C (Latex): rewrite so that there is now
1602 question that a initialization is requested.
1604 * src/insets/insetcommand.h: reenable the hide signal
1606 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1608 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1609 fix handling of shortcuts (many bugs :)
1610 (add_lastfiles): ditto.
1612 * lib/ui/default.ui: fix a few shortcuts.
1614 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1616 * Makefile.am: Fix ``rpmdist'' target to return the exit
1617 status of the ``rpm'' command, instead of the last command in
1618 the chain (the ``rm lyx.xpm'' command, which always returns
1621 2000-08-02 Allan Rae <rae@lyx.org>
1623 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1624 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1625 * src/frontends/xforms/FormToc.C (FormToc): ditto
1627 * src/frontends/xforms/Makefile.am: A few forgotten files
1629 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1630 Signals-not-copyable-problem Lars' started commenting out.
1632 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1634 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1636 * src/insets/insetcommand.h: Signals is not copyable so anoter
1637 scheme for automatic hiding of forms must be used.
1639 * src/frontends/xforms/FormCitation.h: don't inerit from
1640 noncopyable, FormCommand already does that.
1641 * src/frontends/xforms/FormToc.h: ditto
1642 * src/frontends/xforms/FormUrl.h: ditto
1644 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1646 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1648 * src/insets/insetcommand.h (hide): new SigC::Signal0
1649 (d-tor) new virtual destructor emits hide signal
1651 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1652 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1654 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1655 LOF and LOT. Inset is now GUI-independent
1657 * src/insets/insetloa.[Ch]: redundant
1658 * src/insets/insetlof.[Ch]: ditto
1659 * src/insets/insetlot.[Ch]: ditto
1661 * src/frontends/xforms/forms/form_url.fd: tweaked!
1662 * src/frontends/xforms/forms/form_citation.fd: ditto
1664 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1665 dialogs dealing with InsetCommand insets
1667 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1668 FormCommand base class
1669 * src/frontends/xforms/FormUrl.[Ch]: ditto
1671 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1673 * src/frontends/xforms/FormToc.[Ch]: ditto
1675 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1676 passed a generic InsetCommand pointer
1677 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1679 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1680 and modified InsetTOC class
1681 * src/buffer.C: ditto
1683 * forms/lyx.fd: strip out old FD_form_toc code
1684 * src/lyx_gui_misc.C: ditto
1685 * src/lyx_gui.C: ditto
1686 * src/lyx_cb.C: ditto
1687 * src/lyx.[Ch]: ditto
1689 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1691 * src/support/utility.hpp: tr -d '\r'
1693 2000-08-01 Juergen Vigna <jug@sad.it>
1695 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1697 * src/commandtags.h:
1698 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1699 LFUN_TABULAR_FEATURES.
1701 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1702 LFUN_LAYOUT_TABULAR.
1704 * src/insets/insettabular.C (getStatus): implemented helper function.
1706 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1708 2000-07-31 Juergen Vigna <jug@sad.it>
1710 * src/text.C (draw): fixed screen update problem for text-insets.
1712 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1713 something changed probably this has to be added in various other
1716 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1718 2000-07-31 Baruch Even <baruch.even@writeme.com>
1720 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1721 templates to satisfy compaq cxx.
1724 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1726 * src/support/translator.h (equal_1st_in_pair::operator()): take
1727 const ref pair_type as arg.
1728 (equal_2nd_in_pair::operator()): ditto
1729 (Translator::~Translator): remove empty d-tor.
1731 * src/graphics/GraphicsCache.C: move include config.h to top, also
1732 put initialization of GraphicsCache::singleton here.
1733 (~GraphicsCache): move here
1734 (addFile): take const ref as arg
1737 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1739 * src/BufferView2.C (insertLyXFile): change te with/without header
1742 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1744 * src/frontends/xforms/FormGraphics.C (apply): add some
1745 static_cast. Not very nice, but required by compaq cxx.
1747 * src/frontends/xforms/RadioButtonGroup.h: include header
1748 <utility> instead of <pair.h>
1750 * src/insets/insetgraphicsParams.C: add using directive.
1751 (readResize): change return type to void.
1752 (readOrigin): ditto.
1754 * src/lyxfunc.C (getStatus): add missing break for build-program
1755 function; add test for Literate for export functions.
1757 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1758 entries in Options menu.
1760 2000-07-31 Baruch Even <baruch.even@writeme.com>
1762 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1763 protect against auto-allocation; release icon when needed.
1765 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1767 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1768 on usual typewriter.
1770 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1771 earlier czech.kmap), useful only for programming.
1773 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1775 * src/frontends/xforms/FormCitation.h: fix conditioning around
1778 2000-07-31 Juergen Vigna <jug@sad.it>
1780 * src/frontends/xforms/FormTabular.C (local_update): changed
1781 radio_linebreaks to radio_useparbox and added radio_useminipage.
1783 * src/tabular.C: made support for using minipages/parboxes.
1785 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1787 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1789 (descent): so the cursor is in the middle.
1790 (width): bit smaller box.
1792 * src/insets/insetgraphics.h: added display() function.
1794 2000-07-31 Baruch Even <baruch.even@writeme.com>
1796 * src/frontends/Dialogs.h: Added showGraphics signals.
1798 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1799 xforms form definition of the graphics dialog.
1801 * src/frontends/xforms/FormGraphics.h:
1802 * src/frontends/xforms/FormGraphics.C: Added files, the
1803 GUIndependent code of InsetGraphics
1805 * src/insets/insetgraphics.h:
1806 * src/insets/insetgraphics.C: Major writing to make it work.
1808 * src/insets/insetgraphicsParams.h:
1809 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1810 struct between InsetGraphics and GUI.
1812 * src/LaTeXFeatures.h:
1813 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1814 support for graphicx package.
1816 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1817 for the graphics inset.
1819 * src/support/translator.h: Added file, used in
1820 InsetGraphicsParams. this is a template to translate between two
1823 * src/frontends/xforms/RadioButtonGroup.h:
1824 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1825 way to easily control a radio button group.
1827 2000-07-28 Juergen Vigna <jug@sad.it>
1829 * src/insets/insettabular.C (LocalDispatch):
1830 (TabularFeatures): added support for lyx-functions of tabular features.
1831 (cellstart): refixed this function after someone wrongly changed it.
1833 * src/commandtags.h:
1834 * src/LyXAction.C (init): added support for tabular-features
1836 2000-07-28 Allan Rae <rae@lyx.org>
1838 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1839 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1840 triggers the callback for input checking. As a result we sometimes get
1841 "LyX: This shouldn't happen..." printed to cerr.
1842 (input): Started using status variable since I only free() on
1843 destruction. Some input checking for paths and font sizes.
1845 * src/frontends/xforms/FormPreferences.h: Use status to control
1846 activation of Ok and Apply
1848 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1849 callback. Also resized to stop segfaults with 0.88. The problem is
1850 that xforms-0.88 requires the folder to be wide enough to fit all the
1851 tabs. If it isn't it causes all sorts of problems.
1853 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1855 * src/frontends/xforms/forms/README: Reflect reality.
1857 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1858 * src/frontends/xforms/forms/makefile: ditto.
1860 * src/commandtags.h: Get access to new Preferences dialog
1861 * src/LyXAction.C: ditto
1862 * src/lyxfunc.C: ditto
1863 * lib/ui/default.ui: ditto
1865 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1867 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1869 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1872 * src/frontends/xforms/form_url.[Ch]: added.
1874 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1876 * src/insets/insetbib.h: fixed bug in previous commit
1878 * src/frontends/xforms/FormUrl.h: ditto
1880 * src/frontends/xforms/FormPrint.h: ditto
1882 * src/frontends/xforms/FormPreferences.h: ditto
1884 * src/frontends/xforms/FormCopyright.h: ditto
1886 * src/frontends/xforms/FormCitation.C: ditto
1888 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1889 private copyconstructor and private default contructor
1891 * src/support/Makefile.am: add utility.hpp
1893 * src/support/utility.hpp: new file from boost
1895 * src/insets/insetbib.h: set owner in clone
1897 * src/frontends/xforms/FormCitation.C: added missing include
1900 * src/insets/form_url.[Ch]: removed
1902 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1904 * development/lyx.spec.in
1905 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1906 file/directory re-organization.
1908 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1910 * src/insets/insetcommand.[Ch]: moved the string data and
1911 associated manipulation methods into a new stand-alone class
1912 InsetCommandParams. This class has two additional methods
1913 getAsString() and setFromString() allowing the contents to be
1914 moved around as a single string.
1915 (addContents) method removed.
1916 (setContents) method no longer virtual.
1918 * src/buffer.C (readInset): made use of new InsetCitation,
1919 InsetUrl constructors based on InsetCommandParams.
1921 * src/commandtags.h: add LFUN_INSERT_URL
1923 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1924 independent InsetUrl and use InsetCommandParams to extract
1925 string info and create new Insets.
1927 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1929 * src/frontends/xforms/FormCitation.C (apply): uses
1932 * src/frontends/xforms/form_url.C
1933 * src/frontends/xforms/form_url.h
1934 * src/frontends/xforms/FormUrl.h
1935 * src/frontends/xforms/FormUrl.C
1936 * src/frontends/xforms/forms/form_url.fd: new files
1938 * src/insets/insetcite.[Ch]: removed unused constructors.
1940 * src/insets/insetinclude.[Ch]: no longer store filename
1942 * src/insets/inseturl.[Ch]: GUI-independent.
1944 2000-07-26 Juergen Vigna <jug@sad.it>
1945 * renamed frontend from gtk to gnome as it is that what is realized
1946 and did the necessary changes in the files.
1948 2000-07-26 Marko Vendelin <markov@ioc.ee>
1950 * configure.in: cleaning up gnome configuration scripts
1952 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1954 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1955 shortcuts syndrom by redrawing them explicitely (a better solution
1956 would be appreciated).
1958 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1960 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1963 * src/lyx_cb.C (MenuExport): change html export to do the right
1964 thing depending of the document type (instead of having
1965 html-linuxdoc and html-docbook).
1966 * src/lyxfunc.C (getStatus): update for html
1967 * lib/ui/default.ui: simplify due to the above change.
1968 * src/menus.C (ShowFileMenu): update too (in case we need it).
1970 * src/MenuBackend.C (read): if a menu is defined twice, add the
1971 new entries to the exiting one.
1973 2000-07-26 Juergen Vigna <jug@sad.it>
1975 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1977 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1978 and return a bool if it did actual save the file.
1979 (AutoSave): don't autosave a unnamed doc.
1981 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1982 check if this is an UNNAMED new file and react to it.
1983 (newFile): set buffer to unnamed and change to not mark a new
1984 buffer dirty if I didn't do anything with it.
1986 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1988 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1990 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1991 friend as per Angus's patch posted to lyx-devel.
1993 * src/ext_l10n.h: updated
1995 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1996 gettext on the style string right before inserting them into the
1999 * autogen.sh: add code to extract style strings form layout files,
2000 not good enough yet.
2002 * src/frontends/gtk/.cvsignore: add MAKEFILE
2004 * src/MenuBackend.C (read): run the label strings through gettext
2005 before storing them in the containers.
2007 * src/ext_l10n.h: new file
2009 * autogen.sh : generate the ext_l10n.h file here
2011 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2013 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2016 * lib/ui/default.ui: fix a couple of typos.
2018 * config/gnome/gtk.m4: added (and added to the list of files in
2021 * src/insets/insetinclude.C (unique_id): fix when we are using
2022 lyxstring instead of basic_string<>.
2023 * src/insets/insettext.C (LocalDispatch): ditto.
2024 * src/support/filetools.C: ditto.
2026 * lib/configure.m4: create the ui/ directory if necessary.
2028 * src/LyXView.[Ch] (updateToolbar): new method.
2030 * src/BufferView_pimpl.C (buffer): update the toolbar when
2031 opening/closing buffer.
2033 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2035 * src/LyXAction.C (getActionName): enhance to return also the name
2036 and options of pseudo-actions.
2037 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2039 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2040 as an example of what is possible). Used in File->Build too (more
2041 useful) and in the import/export menus (to mimick the complicated
2042 handling of linuxdoc and friends). Try to update all the entries.
2044 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2047 * src/MenuBackend.C (read): Parse the new OptItem tag.
2049 * src/MenuBackend.h: Add a new optional_ data member (used if the
2050 entry should be omitted when the lyxfunc is disabled).
2052 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2053 function, used as a shortcut.
2054 (create_submenu): align correctly the shortcuts on the widest
2057 * src/MenuBackend.h: MenuItem.label() only returns the label of
2058 the menu without shortcut; new method shortcut().
2060 2000-07-14 Marko Vendelin <markov@ioc.ee>
2062 * src/frontends/gtk/Dialogs.C:
2063 * src/frontends/gtk/FormCopyright.C:
2064 * src/frontends/gtk/FormCopyright.h:
2065 * src/frontends/gtk/Makefile.am: added these source-files for the
2066 Gtk/Gnome support of the Copyright-Dialog.
2068 * src/main.C: added Gnome::Main initialization if using
2069 Gtk/Gnome frontend-GUI.
2071 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2073 * config/gnome/aclocal-include.m4
2074 * config/gnome/compiler-flags.m4
2075 * config/gnome/curses.m4
2076 * config/gnome/gnome--.m4
2077 * config/gnome/gnome-bonobo-check.m4
2078 * config/gnome/gnome-common.m4
2079 * config/gnome/gnome-fileutils.m4
2080 * config/gnome/gnome-ghttp-check.m4
2081 * config/gnome/gnome-gnorba-check.m4
2082 * config/gnome/gnome-guile-checks.m4
2083 * config/gnome/gnome-libgtop-check.m4
2084 * config/gnome/gnome-objc-checks.m4
2085 * config/gnome/gnome-orbit-check.m4
2086 * config/gnome/gnome-print-check.m4
2087 * config/gnome/gnome-pthread-check.m4
2088 * config/gnome/gnome-support.m4
2089 * config/gnome/gnome-undelfs.m4
2090 * config/gnome/gnome-vfs.m4
2091 * config/gnome/gnome-x-checks.m4
2092 * config/gnome/gnome-xml-check.m4
2093 * config/gnome/gnome.m4
2094 * config/gnome/gperf-check.m4
2095 * config/gnome/gtk--.m4
2096 * config/gnome/linger.m4
2097 * config/gnome/need-declaration.m4: added configuration scripts
2098 for Gtk/Gnome frontend-GUI
2100 * configure.in: added support for the --with-frontend=gtk option
2102 * autogen.sh: added config/gnome/* to list of config-files
2104 * acconfig.h: added define for GTKGUI-support
2106 * config/lyxinclude.m4: added --with-frontend[=value] option value
2107 for Gtk/Gnome frontend-GUI support.
2109 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2111 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2115 * src/paragraph.C (GetChar): remove non-const version
2117 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2118 (search_kw): use it.
2120 * src/lyx_main.C (init): if "preferences" exist, read that instead
2122 (ReadRcFile): return bool if the file could be read ok.
2123 (ReadUIFile): add a check to see if lex file is set ok.
2125 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2126 bastring can be used instead of lyxstring (still uses the old code
2127 if std::string is good enough or if lyxstring is used.)
2129 * src/encoding.C: make the arrays static, move ininle functions
2131 * src/encoding.h: from here.
2133 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2134 (parseSingleLyXformat2Token): move inset parsing to separate method
2135 (readInset): new private method
2137 * src/Variables.h: remove virtual from get().
2139 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2140 access to NEW_INSETS and NEW_TABULAR
2142 * src/MenuBackend.h: remove superfluous forward declaration of
2143 MenuItem. Add documentations tags "///", remove empty MenuItem
2144 destructor, remove private default contructor.
2146 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2148 (read): more string mlabel and mname to where they are used
2149 (read): remove unused variables mlabel and mname
2150 (defaults): unconditional clear, make menusetup take advantage of
2151 add returning Menu &.
2153 * src/LyXView.h: define NEW_MENUBAR as default
2155 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2156 to NEW_INSETS and NEW_TABULAR.
2157 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2158 defined. Change some of the "xxxx-inset-insert" functions names to
2161 * several files: more enahncements to NEW_INSETS and the resulting
2164 * lib/lyxrc.example (\date_insert_format): move to misc section
2166 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2167 bastring and use AC_CACHE_CHECK.
2168 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2169 the system have the newest methods. uses AC_CACHE_CHECK
2170 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2171 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2172 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2174 * configure.in: add LYX_CXX_GOOD_STD_STRING
2176 * acinclude.m4: recreated
2178 2000-07-24 Amir Karger
2180 * README: add Hebrew, Arabic kmaps
2183 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2185 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2188 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2190 * Lot of files: add pragma interface/implementation.
2192 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2194 * lib/ui/default.ui: new file (ans new directory). Contains the
2195 default menu and toolbar.
2197 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2198 global space. Toolbars are now read (as menus) in ui files.
2200 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2202 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2203 is disabled because the document is read-only. We want to have the
2204 toggle state of the function anyway.
2205 (getStatus): add code for LFUN_VC* functions (mimicking what is
2206 done in old-style menus)
2208 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2209 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2211 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2212 * src/BufferView_pimpl.C: ditto.
2213 * src/lyxfunc.C: ditto.
2215 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2216 default). This replaces old-style menus by new ones.
2218 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2219 MenuItem. Contain the data structure of a menu.
2221 * src/insets/insettext.C: use LyXView::setLayout instead of
2222 accessing directly the toolbar combox.
2223 * src/lyxfunc.C (Dispatch): ditto.
2225 * src/LyXView.C (setLayout): new method, which just calls
2226 Toolbar::setLayout().
2227 (updateLayoutChoice): move part of this method in Toolbar.
2229 * src/toolbar.[Ch]: removed.
2231 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2232 implementation the toolbar.
2234 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2235 the toolbar. It might make sense to merge it with ToolbarDefaults
2237 (setLayout): new function.
2238 (updateLayoutList): ditto.
2239 (openLayoutList): ditto.
2241 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2242 xforms implementation of the toolbar.
2243 (get_toolbar_func): comment out, since I do not
2244 know what it is good for.
2246 * src/ToolbarDefaults.h: Add the ItemType enum.
2248 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2249 for a list of allocated C strings. Used in Menubar xforms
2250 implementation to avoid memory leaks.
2252 * src/support/lstrings.[Ch] (uppercase): new version taking and
2256 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2257 * lib/bind/emacs.bind: ditto.
2259 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2261 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2262 forward decl of LyXView.
2264 * src/toolbar.C (toolbarItem): moved from toolbar.h
2265 (toolbarItem::clean): ditto
2266 (toolbarItem::~toolbarItem): ditto
2267 (toolbarItem::operator): ditto
2269 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2271 * src/paragraph.h: control the NEW_TABULAR define from here
2273 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2274 USE_TABULAR_INSETS to NEW_TABULAR
2276 * src/ToolbarDefaults.C: add include "lyxlex.h"
2278 * files using the old table/tabular: use NEW_TABULAR to control
2279 compilation of old tabular stuff.
2281 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2284 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2285 planemet in reading of old style floats, fix the \end_deeper
2286 problem when reading old style floats.
2288 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2290 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2292 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2294 * lib/bind/sciword.bind: updated.
2296 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2298 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2299 layout write problem
2301 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2303 * src/Makefile.am (INCLUDES): remove image directory from include
2306 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2307 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2309 * src/LyXView.C (create_form_form_main): read the application icon
2312 * lib/images/*.xpm: change the icons to use transparent color for
2315 * src/toolbar.C (update): change the color of the button when it
2318 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2320 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2321 setting explicitely the minibuffer.
2322 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2324 * src/LyXView.C (showState): new function. Shows font information
2325 in minibuffer and update toolbar state.
2326 (LyXView): call Toolbar::update after creating the
2329 * src/toolbar.C: change toollist to be a vector instead of a
2331 (BubbleTimerCB): get help string directly from the callback
2332 argument of the corresponding icon (which is the action)
2333 (set): remove unnecessary ugliness.
2334 (update): new function. update the icons (depressed, disabled)
2335 depending of the status of the corresponding action.
2337 * src/toolbar.h: remove help in toolbarItem
2339 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2341 * src/Painter.C (text): Added code for using symbol glyphs from
2342 iso10646 fonts. Currently diabled.
2344 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2347 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2348 magyar,turkish and usorbian.
2350 * src/paragraph.C (isMultiLingual): Made more efficient.
2352 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2355 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2356 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2357 Also changed the prototype to "bool math_insert_greek(char)".
2359 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2361 * lots of files: apply the NEW_INSETS on all code that will not be
2362 needed when we move to use the new insets. Enable the define in
2363 lyxparagrah.h to try it.
2365 * src/insets/insettabular.C (cellstart): change to be a static
2367 (InsetTabular): initialize buffer in the initializer list.
2369 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2371 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2372 form_print.h out of the header file. Replaced with forward
2373 declarations of the relevant struct.
2375 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2378 * src/commandtags.h: do not include "debug.h" which does not
2379 belong there. #include it in some other places because of this
2382 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2384 * src/insets/insetcaption.C: add a couple "using" directives.
2386 * src/toolbar.C (add): get the help text directly from lyxaction.
2388 (setPixmap): new function. Loads from disk and sets a pixmap on a
2389 botton; the name of the pixmap file is derived from the command
2392 * src/toolbar.h: remove members isBitmap and pixmap from
2395 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2396 * lib/images/: move many files from images/banner.xpm.
2398 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2400 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2401 * src/toolbar.C: ditto.
2402 * configure.in: ditto.
2403 * INSTALL: document.
2405 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2406 the spellchecker popup is closed from the WM.
2408 2000-07-19 Juergen Vigna <jug@sad.it>
2410 * src/insets/insetfloat.C (Write): small fix because we use the
2411 insetname for the type now!
2413 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2415 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2418 * src/frontends/Dialogs.h: removed hideCitation signal
2420 * src/insets/insetcite.h: added hide signal
2422 * src/insets/insetcite.C (~InsetCitation): emits new signal
2423 (getScreenLabel): "intelligent" label should now fit on the screen!
2425 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2427 * src/frontends/xforms/FormCitation.C (showInset): connects
2428 hide() to the inset's hide signal
2429 (show): modified to use fl_set_object_position rather than
2430 fl_set_object_geometry wherever possible
2432 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2434 * src/insets/lyxinset.h: add caption code
2436 * src/insets/insetfloat.C (type): new method
2438 * src/insets/insetcaption.C (Write): new method
2440 (LyxCode): new method
2442 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2443 to get it right together with using the FloatList.
2445 * src/commandtags.h: add LFUN_INSET_CAPTION
2446 * src/lyxfunc.C (Dispatch): handle it
2448 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2451 * src/Variables.[Ch]: make expand take a const reference, remove
2452 the destructor, some whitespace changes.
2454 * src/LyXAction.C (init): add caption-inset-insert
2456 * src/FloatList.C (FloatList): update the default floats a bit.
2458 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2460 * src/Variables.[Ch]: new files. Intended to be used for language
2461 specific strings (like \chaptername) and filename substitution in
2464 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2466 * lib/kbd/american.kmap: update
2468 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2470 * src/bufferparams.[Ch]: remove member allowAccents.
2472 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2474 * src/LaTeXLog.C: use the log_form.h header.
2475 * src/lyx_gui.C: ditto.
2476 * src/lyx_gui_misc.C: ditto.
2477 * src/lyxvc.h: ditto.
2479 * forms/log_form.fd: new file, created from latexoptions.fd. I
2480 kept the log popup and nuked the options form.
2482 * src/{la,}texoptions.[Ch]: removed.
2483 * src/lyx_cb.C (LaTeXOptions): ditto
2485 * src/lyx_gui.C (create_forms): do not handle the
2486 fd_latex_options form.
2488 2000-07-18 Juergen Vigna <jug@sad.it>
2490 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2491 name of the inset so that it can be requested outside (text2.C).
2493 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2496 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2498 * src/mathed/formula.h (ConvertFont): constify
2500 * src/mathed/formula.C (Read): add warning if \end_inset is not
2501 found on expected place.
2503 * src/insets/lyxinset.h (ConvertFont): consify
2505 * src/insets/insetquotes.C (ConvertFont): constify
2506 * src/insets/insetquotes.h: ditto
2508 * src/insets/insetinfo.h: add labelfont
2510 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2511 (ascent): use labelfont
2515 (Write): make .lyx file a bit nicer
2517 * src/insets/insetfloat.C (Write): simplify somewhat...
2518 (Read): add warning if arg is not found
2520 * src/insets/insetcollapsable.C: add using std::max
2521 (Read): move string token and add warning in arg is not found
2522 (draw): use std::max to get the right ty
2523 (getMaxWidth): simplify by using std::max
2525 * src/insets/insetsection.h: new file
2526 * src/insets/insetsection.C: new file
2527 * src/insets/insetcaption.h: new file
2528 * src/insets/insetcaption.C: new file
2530 * src/insets/inset.C (ConvertFont): constify signature
2532 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2533 insetcaption.[Ch] and insetsection.[Ch]
2535 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2536 uses to use LABEL_COUNTER_CHAPTER instead.
2537 * src/text2.C (SetCounter): here
2539 * src/counters.h: new file
2540 * src/counters.C: new file
2541 * src/Sectioning.h: new file
2542 * src/Sectioning.C: new file
2544 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2546 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2548 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2551 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2554 2000-07-17 Juergen Vigna <jug@sad.it>
2556 * src/tabular.C (Validate): check if array-package is needed.
2557 (SetVAlignment): added support for vertical alignment.
2558 (SetLTFoot): better support for longtable header/footers
2559 (Latex): modified to support added features.
2561 * src/LaTeXFeatures.[Ch]: added array-package.
2563 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2565 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2568 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2570 * configure.in: do not forget to put a space after -isystem.
2572 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2574 * lib/kbd/arabic.kmap: a few fixes.
2576 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2578 * some whitespace chagnes to a number of files.
2580 * src/support/DebugStream.h: change to make it easier for
2581 doc++ to parse correctly.
2582 * src/support/lyxstring.h: ditto
2584 * src/mathed/math_utils.C (compara): change to have only one
2586 (MathedLookupBOP): change because of the above.
2588 * src/mathed/math_delim.C (math_deco_compare): change to have only
2590 (search_deco): change becasue of the above.
2592 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2593 instead of manually coded one.
2595 * src/insets/insetquotes.C (Read): read the \end_inset too
2597 * src/insets/insetlatex.h: remove file
2598 * src/insets/insetlatex.C: remove file
2600 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2602 (InsetPrintIndex): remove destructor
2604 * src/insets/insetinclude.h: remove default constructor
2606 * src/insets/insetfloat.C: work to make it work better
2608 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2610 * src/insets/insetcite.h (InsetCitation): remove default constructor
2612 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2614 * src/text.C (GetColumnNearX): comment out some currently unused code.
2616 * src/paragraph.C (writeFile): move some initializations closer to
2618 (CutIntoMinibuffer): small change to use new matchIT operator
2622 (InsertInset): ditto
2625 (InsetIterator): ditto
2626 (Erase): small change to use new matchFT operator
2628 (GetFontSettings): ditto
2629 (HighestFontInRange): ditto
2632 * src/lyxparagraph.h: some chars changed to value_type
2633 (matchIT): because of some stronger checking (perhaps too strong)
2634 in SGI STL, the two operator() unified to one.
2637 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2639 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2640 the last inset read added
2641 (parseSingleLyXformat2Token): some more (future) compability code added
2642 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2643 (parseSingleLyXformat2Token): set last_inset_read
2644 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2645 (parseSingleLyXformat2Token): don't double intializw string next_token
2647 * src/TextCache.C (text_fits::operator()): add const's to the signature
2648 (has_buffer::operator()): ditto
2650 * src/Floating.h: add some comments on the class
2652 * src/FloatList.[Ch] (typeExist): new method
2655 * src/BackStack.h: added default constructor, wanted by Gcc.
2657 2000-07-14 Juergen Vigna <jug@sad.it>
2659 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2661 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2663 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2664 do a redraw when the window is resized!
2665 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2667 * src/insets/insettext.C (resizeLyXText): added function to correctly
2668 being able to resize the LyXWindow.
2670 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2672 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2674 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2675 crashes when closing dialog to a deleted inset.
2677 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2678 method! Now similar to other insets.
2680 2000-07-13 Juergen Vigna <jug@sad.it>
2682 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2684 * lib/examples/Literate.lyx: small patch!
2686 * src/insets/insetbib.C (Read): added this function because of wrong
2687 Write (without [begin|end]_inset).
2689 2000-07-11 Juergen Vigna <jug@sad.it>
2691 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2692 as the insertInset could not be good!
2694 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2695 the bool param should not be last.
2697 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2699 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2700 did submit that to Karl).
2702 * configure.in: use -isystem instead of -I for X headers. This
2703 fixes a problem on solaris with a recent gcc;
2704 put the front-end code after the X detection code;
2705 configure in sigc++ before lib/
2707 * src/lyx_main.C (commandLineHelp): remove -display from command
2710 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2712 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2713 Also put in Makefile rules for building the ``listerrors''
2714 program for parsing errors from literate programs written in LyX.
2716 * lib/build-listerrors: Added small shell script as part of compile
2717 process. This builds a working ``listerrors'' binary if noweb is
2718 installed and either 1) the VNC X server is installed on the machine,
2719 or 2) the user is compiling from within a GUI. The existence of a GUI
2720 is necessary to use the ``lyx --export'' feature for now. This
2721 hack can be removed once ``lyx --export'' no longer requires a GUI to
2724 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2726 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2727 now passed back correctly from gcc and placed "under" error
2728 buttons in a Literate LyX source.
2730 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2732 * src/text.C (GetColumnNearX): Better behavior when a RTL
2733 paragraph is ended by LTR text.
2735 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2738 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2740 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2741 true when clipboard is empty.
2743 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2745 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2746 row of the paragraph.
2747 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2748 to prevent calculation of bidi tables
2750 2000-07-07 Juergen Vigna <jug@sad.it>
2752 * src/screen.C (ToggleSelection): added y_offset and x_offset
2755 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2758 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2760 * src/insets/insettext.C: fixed Layout-Display!
2762 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2764 * configure.in: add check for strings.h header.
2766 * src/spellchecker.C: include <strings.h> in order to have a
2767 definition for bzero().
2769 2000-07-07 Juergen Vigna <jug@sad.it>
2771 * src/insets/insettext.C (draw): set the status of the bv->text to
2772 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2774 * src/screen.C (DrawOneRow):
2775 (DrawFromTo): redraw the actual row if something has changed in it
2778 * src/text.C (draw): call an update of the toplevel-inset if something
2779 has changed inside while drawing.
2781 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2783 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2785 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2786 processing inside class.
2788 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2789 processing inside class.
2791 * src/insets/insetindex.h new struct Holder, consistent with other
2794 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2795 citation dialog from main code and placed it in src/frontends/xforms.
2796 Dialog launched through signals instead of callbacks
2798 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2800 * lyx.man: update the options description.
2802 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2804 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2805 handle neg values, set min width to 590, add doc about -display
2807 2000-07-05 Juergen Vigna <jug@sad.it>
2809 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2810 calls to BufferView *.
2812 * src/insets/insettext.C (checkAndActivateInset): small fix non
2813 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2815 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2816 their \end_inset token!
2818 2000-07-04 edscott <edscott@imp.mx>
2820 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2821 lib/lyxrc.example: added option \wheel_jump
2823 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2825 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2826 remove support for -width,-height,-xpos and -ypos.
2828 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2830 * src/encoding.[Ch]: New files.
2832 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2833 (text): Call to the underline() method only when needed.
2835 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2837 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2838 encoding(s) for the document.
2840 * src/bufferparams.C (BufferParams): Changed default value of
2843 * src/language.C (newLang): Removed.
2844 (items[]): Added encoding information for all defined languages.
2846 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2847 encoding choice button.
2849 * src/lyxrc.h (font_norm_type): New member variable.
2850 (set_font_norm_type): New method.
2852 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2853 paragraphs with different encodings.
2855 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2856 (TransformChar): Changed to work correctly with Arabic points.
2857 (draw): Added support for drawing Arabic points.
2858 (draw): Removed code for drawing underbars (this is done by
2861 * src/support/textutils.h (IsPrintableNonspace): New function.
2863 * src/BufferView_pimpl.h: Added "using SigC::Object".
2864 * src/LyXView.h: ditto.
2866 * src/insets/insetinclude.h (include_label): Changed to mutable.
2868 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2870 * src/mathed/math_iter.h: remove empty destructor
2872 * src/mathed/math_cursor.h: remove empty destructor
2874 * src/insets/lyxinset.h: add THEOREM_CODE
2876 * src/insets/insettheorem.[Ch]: new files
2878 * src/insets/insetminipage.C: (InsertInset): remove
2880 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2882 (InsertInset): remove
2884 * src/insets/insetlist.C: (InsertList): remove
2886 * src/insets/insetfootlike.[Ch]: new files
2888 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2891 (InsertInset): ditto
2893 * src/insets/insetert.C: remove include Painter.h, reindent
2894 (InsertInset): move to header
2896 * src/insets/insetcollapsable.h: remove explicit from default
2897 contructor, remove empty destructor, add InsertInset
2899 * src/insets/insetcollapsable.C (InsertInset): new func
2901 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2903 * src/vspace.h: add explicit to constructor
2905 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2906 \textcompwordmark, please test this.
2908 * src/lyxrc.C: set ascii_linelen to 65 by default
2910 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2912 * src/commandtags.h: add LFUN_INSET_THEOREM
2914 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2915 (makeLinuxDocFile): remove _some_ of the nice logic
2916 (makeDocBookFile): ditto
2918 * src/Painter.[Ch]: (~Painter): removed
2920 * src/LyXAction.C (init): entry for insettheorem added
2922 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2924 (deplog): code to detect files generated by LaTeX, needs testing
2927 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2929 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2931 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2933 * src/LaTeX.C (deplog): Add a check for files that are going to be
2934 created by the first latex run, part of the project to remove the
2937 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2938 contents to the extension list.
2940 2000-07-04 Juergen Vigna <jug@sad.it>
2942 * src/text.C (NextBreakPoint): added support for needFullRow()
2944 * src/insets/lyxinset.h: added needFullRow()
2946 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2949 * src/insets/insettext.C: lots of changes for update!
2951 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2953 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2955 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2957 * src/insets/insetinclude.C (InsetInclude): fixed
2958 initialization of include_label.
2959 (unique_id): now returns a string.
2961 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2963 * src/LaTeXFeatures.h: new member IncludedFiles, for
2964 a map of key, included file name.
2966 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2967 with the included files for inclusion in SGML preamble,
2968 i. e., linuxdoc and docbook.
2971 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2972 nice (is the generated linuxdoc code to be exported?), that
2973 allows to remove column, and only_body that will be true for
2974 slave documents. Insets are allowed inside SGML font type.
2975 New handling of the SGML preamble for included files.
2976 (makeDocBookFile): the same for docbook.
2978 * src/insets/insetinclude.h:
2979 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2981 (DocBook): new export methods.
2983 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2984 and makeDocBookFile.
2986 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2987 formats to export with command line argument -x.
2989 2000-06-29 Juergen Vigna <jug@sad.it>
2991 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2992 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2994 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2995 region could already been cleared by an inset!
2997 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2999 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3002 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3004 (cursorToggle): remove special handling of lyx focus.
3006 2000-06-28 Juergen Vigna <jug@sad.it>
3008 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3011 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3013 * src/insets/insetindex.C (Edit): add a callback when popup is
3016 * src/insets/insettext.C (LocalDispatch):
3017 * src/insets/insetmarginal.h:
3018 * src/insets/insetlist.h:
3019 * src/insets/insetfoot.h:
3020 * src/insets/insetfloat.h:
3021 * src/insets/insetert.h: add a missing std:: qualifier.
3023 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3025 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3028 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3030 * src/insets/insettext.C (Read): remove tmptok unused variable
3031 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3032 (InsertInset): change for new InsetInset code
3034 * src/insets/insettext.h: add TEXT inline method
3036 * src/insets/insettext.C: remove TEXT macro
3038 * src/insets/insetmarginal.C (Write): new method
3039 (Latex): change output slightly
3041 * src/insets/insetfoot.C (Write): new method
3042 (Latex): change output slightly (don't use endl when no need)
3044 * src/insets/insetert.C (Write): new method
3046 * src/insets/insetcollapsable.h: make button_length, button_top_y
3047 and button_bottm_y protected.
3049 * src/insets/insetcollapsable.C (Write): simplify code by using
3050 tostr. Also do not output the float name, the children class
3051 should to that to get control over own arguments
3053 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3054 src/insets/insetminipage.[Ch]:
3057 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3059 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3061 * src/Makefile.am (lyx_SOURCES): add the new files
3063 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3064 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3065 * src/commandtags.h: ditto
3067 * src/LaTeXFeatures.h: add a std::set of used floattypes
3069 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3071 * src/FloatList.[Ch] src/Floating.h: new files
3073 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3075 * src/lyx_cb.C (TableApplyCB): ditto
3077 * src/text2.C: ditto
3078 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3079 (parseSingleLyXformat2Token): ditto + add code for
3080 backwards compability for old float styles + add code for new insets
3082 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3084 (InsertInset(size_type, Inset *, LyXFont)): new method
3085 (InsetChar(size_type, char)): changed to use the other InsetChar
3086 with a LyXFont(ALL_INHERIT).
3087 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3088 insert the META_INSET.
3090 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3092 * sigc++/thread.h (Threads): from here
3094 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3095 definition out of line
3096 * sigc++/scope.h: from here
3098 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3100 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3101 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3103 * Makefile.am (bindist): new target.
3105 * INSTALL: add instructions for doing a binary distribution.
3107 * development/tools/README.bin.example: update a bit.
3109 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3112 * lib/lyxrc.example: new lyxrc tag \set_color.
3114 * src/lyxfunc.C (Dispatch):
3115 * src/commandtags.h:
3116 * src/LyXAction.C: new lyxfunc "set-color".
3118 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3119 and an x11name given as strings.
3121 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3122 cache when a color is changed.
3124 2000-06-26 Juergen Vigna <jug@sad.it>
3126 * src/lyxrow.C (width): added this functions and variable.
3128 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3131 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3133 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3135 * images/undo_bw.xpm: new icon.
3136 * images/redo_bw.xpm: ditto.
3138 * configure.in (INSTALL_SCRIPT): change value to
3139 ${INSTALL} to avoid failures of install-script target.
3140 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3142 * src/BufferView.h: add a magic "friend" declaration to please
3145 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3147 * forms/cite.fd: modified to allow resizing without messing
3150 * src/insetcite.C: Uses code from cite.fd almost without
3152 User can now resize dialog in the x-direction.
3153 Resizing the dialog in the y-direction is prevented, as the
3154 code does this intelligently already.
3156 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3158 * INSTALL: remove obsolete entry in "problems" section.
3160 * lib/examples/sl_*.lyx: update of the slovenian examples.
3162 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3164 2000-06-23 Juergen Vigna <jug@sad.it>
3166 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3168 * src/buffer.C (resize): delete the LyXText of textinsets.
3170 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3172 * src/insets/lyxinset.h: added another parameter 'cleared' to
3173 the draw() function.
3175 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3176 unlocking inset in inset.
3178 2000-06-22 Juergen Vigna <jug@sad.it>
3180 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3181 of insets and moved first to LyXText.
3183 * src/mathed/formulamacro.[Ch]:
3184 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3186 2000-06-21 Juergen Vigna <jug@sad.it>
3188 * src/text.C (GetVisibleRow): look if I should clear the area or not
3189 using Inset::doClearArea() function.
3191 * src/insets/lyxinset.h: added doClearArea() function and
3192 modified draw(Painter &, ...) to draw(BufferView *, ...)
3194 * src/text2.C (UpdateInset): return bool insted of int
3196 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3198 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3199 combox in the character popup
3201 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3202 BufferParams const & params
3204 2000-06-20 Juergen Vigna <jug@sad.it>
3206 * src/insets/insettext.C (SetParagraphData): set insetowner on
3209 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3211 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3212 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3214 (form_main_): remove
3216 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3217 (create_form_form_main): remove FD_form_main stuff, connect to
3218 autosave_timeout signal
3220 * src/LyXView.[Ch] (getMainForm): remove
3221 (UpdateTimerCB): remove
3222 * src/BufferView_pimpl.h: inherit from SigC::Object
3224 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3225 signal instead of callback
3227 * src/BufferView.[Ch] (cursorToggleCB): remove
3229 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3231 * src/BufferView_pimpl.C: changes because of the one below
3233 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3234 instead of storing a pointer to a LyXText.
3236 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3238 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3240 * src/lyxparagraph.h
3242 * src/paragraph.C: Changed fontlist to a sorted vector.
3244 2000-06-19 Juergen Vigna <jug@sad.it>
3246 * src/BufferView.h: added screen() function.
3248 * src/insets/insettext.C (LocalDispatch): some selection code
3251 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3253 * src/insets/insettext.C (SetParagraphData):
3255 (InsetText): fixes for multiple paragraphs.
3257 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3259 * development/lyx.spec.in: Call configure with ``--without-warnings''
3260 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3261 This should be fine, however, since we generally don't want to be
3262 verbose when making an RPM.
3264 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3266 * lib/scripts/fig2pstex.py: New file
3268 2000-06-16 Juergen Vigna <jug@sad.it>
3270 * src/insets/insettabular.C (UpdateLocal):
3271 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3272 (LocalDispatch): Changed all functions to use LyXText.
3274 2000-06-15 Juergen Vigna <jug@sad.it>
3276 * src/text.C (SetHeightOfRow): call inset::update before requesting
3279 * src/insets/insettext.C (update):
3280 * src/insets/insettabular.C (update): added implementation
3282 * src/insets/lyxinset.h: added update function
3284 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3286 * src/text.C (SelectNextWord): protect against null pointers with
3287 old-style string streams. (fix from Paul Theo Gonciari
3290 * src/cite.[Ch]: remove erroneous files.
3292 * lib/configure.m4: update the list of created directories.
3294 * src/lyxrow.C: include <config.h>
3295 * src/lyxcursor.C: ditto.
3297 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3299 * lib/examples/decimal.lyx: new example file from Mike.
3301 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3302 to find template definitions (from Dekel)
3304 * src/frontends/.cvsignore: add a few things.
3306 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3308 * src/Timeout.C (TimeOut): remove default argument.
3310 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3313 * src/insets/ExternalTemplate.C: add a "using" directive.
3315 * src/lyx_main.h: remove the act_ struct, which seems unused
3318 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3320 * LyX Developers Meeting: All files changed, due to random C++ (by
3321 coincidence) code generator script.
3323 - external inset (cool!)
3324 - initial online editing of preferences
3325 - insettabular breaks insettext(s contents)
3327 - some DocBook fixes
3328 - example files update
3329 - other cool stuff, create a diff and look for yourself.
3331 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3333 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3334 -1 this is a non-line-breaking textinset.
3336 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3337 if there is no width set.
3339 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3341 * Lots of files: Merged the dialogbase branch.
3343 2000-06-09 Allan Rae <rae@lyx.org>
3345 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3346 and the Dispatch methods that used it.
3348 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3349 access to functions formerly kept in Dispatch.
3351 2000-05-19 Allan Rae <rae@lyx.org>
3353 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3354 made to_page and count_copies integers again. from_page remains a
3355 string however because I want to allow entry of a print range like
3356 "1,4,22-25" using this field.
3358 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3359 and printer-params-get. These aren't useful from the minibuffer but
3360 could be used by a script/LyXServer app provided it passes a suitable
3361 auto_mem_buffer. I guess I should take a look at how the LyXServer
3362 works and make it support xtl buffers.
3364 * sigc++/: updated to libsigc++-1.0.1
3366 * src/xtl/: updated to xtl-1.3.pl.11
3368 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3369 those changes done to the files in src/ are actually recreated when
3370 they get regenerated. Please don't ever accept a patch that changes a
3371 dialog unless that patch includes the changes to the corresponding *.fd
3374 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3375 stringOnlyContains, renamed it and generalised it.
3377 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3378 branch. Removed the remaining old form_print code.
3380 2000-04-26 Allan Rae <rae@lyx.org>
3382 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3383 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3385 2000-04-25 Allan Rae <rae@lyx.org>
3387 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3388 against a base of xtl-1.3.pl.4
3390 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3391 filter the Id: entries so they still show the xtl version number
3394 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3395 into the src/xtl code. Patch still pending with José (XTL)
3397 2000-04-24 Allan Rae <rae@lyx.org>
3399 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3400 both more generic and much safer. Use the new template functions.
3401 * src/buffer.[Ch] (Dispatch): ditto.
3403 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3404 and mem buffer more intelligently. Also a little general cleanup.
3407 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3408 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3409 * src/xtl/Makefile.am: ditto.
3410 * src/xtl/.cvsignore: ditto.
3411 * src/Makefile.am: ditto.
3413 * src/PrinterParams.h: Removed the macros member functions. Added a
3414 testInvariant member function. A bit of tidying up and commenting.
3415 Included Angus's idea for fixing operation with egcs-1.1.2.
3417 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3418 cool expansion of XTL's mem_buffer to support automatic memory
3419 management within the buffer itself. Removed the various macros and
3420 replaced them with template functions that use either auto_mem_buffer
3421 or mem_buffer depending on a #define. The mem_buffer support will
3422 disappear as soon as the auto_mem_buffer is confirmed to be good on
3423 other platforms/compilers. That is, it's there so you've got something
3426 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3427 effectively forked XTL. However I expect José will include my code
3428 into the next major release. Also fixed a memory leak.
3429 * src/xtl/text.h: ditto.
3430 * src/xtl/xdr.h: ditto.
3431 * src/xtl/giop.h: ditto.
3433 2000-04-16 Allan Rae <rae@lyx.org>
3435 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3436 by autogen.sh and removed by maintainer-clean anyway.
3437 * .cvsignore, sigc++/.cvsignore: Support the above.
3439 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3441 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3443 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3444 macros, renamed static callback-target member functions to suit new
3445 scheme and made them public.
3446 * src/frontends/xforms/forms/form_print.fd: ditto.
3447 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3449 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3452 * src/xtl/: New directory containing a minimal distribution of XTL.
3453 This is XTL-1.3.pl.4.
3455 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3457 2000-04-15 Allan Rae <rae@lyx.org>
3459 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3461 * sigc++/: Updated to libsigc++-1.0.0
3463 2000-04-14 Allan Rae <rae@lyx.org>
3465 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3466 use the generic ones in future. I'll modify my conversion script.
3468 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3470 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3471 (CloseAllBufferRelatedDialogs): Renamed.
3472 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3474 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3475 of the generic ones. These are the same ones my conversion script
3478 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3479 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3480 * src/buffer.C (Dispatch): ditto
3482 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3483 functions for updating and hiding buffer dependent dialogs.
3484 * src/BufferView.C (buffer): ditto
3485 * src/buffer.C (setReadonly): ditto
3486 * src/lyxfunc.C (CloseBuffer): ditto
3488 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3489 Dialogs.h, and hence all the SigC stuff, into every file that includes
3490 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3492 * src/BufferView2.C: reduce the number of headers included by buffer.h
3494 2000-04-11 Allan Rae <rae@lyx.org>
3496 * src/frontends/xforms/xform_macros.h: A small collection of macros
3497 for building C callbacks.
3499 * src/frontends/xforms/Makefile.am: Added above file.
3501 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3502 scheme again. This time it should work for JMarc. If this is
3503 successful I'll revise my conversion script to automate some of this.
3504 The static member functions in the class also have to be public for
3505 this scheme will work. If the scheme works (it's almost identical to
3506 the way BufferView::cursorToggleCB is handled so it should work) then
3507 FormCopyright and FormPrint will be ready for inclusion into the main
3508 trunk immediately after 1.1.5 is released -- provided we're prepared
3509 for complaints about lame compilers not handling XTL.
3511 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3513 2000-04-07 Allan Rae <rae@lyx.org>
3515 * config/lyxinclude.m4: A bit more tidying up (Angus)
3517 * src/LString.h: JMarc's <string> header fix
3519 * src/PrinterParams.h: Used string for most data to remove some
3520 ugly code in the Print dialog and avoid even uglier code when
3521 appending the ints to a string for output.
3523 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3524 and moved "default:" back to the end of switch statement. Cleaned
3525 up the printing so it uses the right function calls and so the
3526 "print to file" option actually puts the file in the right directory.
3528 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3530 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3531 and Ok+Apply button control into a separate method: input (Angus).
3532 (input) Cleaned it up and improved it to be very thorough now.
3533 (All CB) static_cast used instead of C style cast (Angus). This will
3534 probably change again once we've worked out how to keep gcc-2.8.1 happy
3535 with real C callbacks.
3536 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3537 ignore some of the bool settings and has random numbers instead. Needs
3538 some more investigation. Added other input length checks and checking
3539 of file and printer names.
3541 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3542 would link (Angus). Seems the old code doesn't compile with the pragma
3543 statement either. Separated callback entries from internal methods.
3545 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3547 2000-03-17 Allan Rae <rae@lyx.org>
3549 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3550 need it? Maybe it could go in Dialogs instead? I could make it a
3551 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3552 values to get the bool return value.
3553 (Dispatch): New overloaded method for xtl support.
3555 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3556 extern "C" callback instead of static member functions. Hopefully,
3557 JMarc will be able to compile this. I haven't changed
3558 forms/form_copyright.fd yet. Breaking one of my own rules already.
3560 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3561 because they aren't useful from the minibuffer. Maybe a LyXServer
3562 might want a help message though?
3564 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3566 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3567 xtl which needs both rtti and exceptions.
3569 * src/support/Makefile.am:
3570 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3572 * src/frontends/xforms/input_validators.[ch]: input filters and
3573 validators. These conrol what keys are valid in input boxes.
3574 Use them and write some more. Much better idea than waiting till
3575 after the user has pressed Ok to say that the input fields don't make
3578 * src/frontends/xforms/Makefile.am:
3579 * src/frontends/xforms/forms/form_print.fd:
3580 * src/frontends/xforms/forms/makefile:
3581 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3582 new scheme. Still have to make sure I haven't missed anything from
3583 the current implementation.
3585 * src/Makefile.am, src/PrinterParams.h: New data store.
3587 * other files: Added a couple of copyright notices.
3589 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3591 * src/insets/insetbib.h: move Holder struct in public space.
3593 * src/frontends/include/DialogBase.h: use SigC:: only when
3594 SIGC_CXX_NAMESPACES is defined.
3595 * src/frontends/include/Dialogs.h: ditto.
3597 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3599 * src/frontends/xforms/FormCopyright.[Ch]: do not
3600 mention SigC:: explicitely.
3602 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3604 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3605 deals with testing KDE in main configure.in
3606 * configure.in: ditto.
3608 2000-02-22 Allan Rae <rae@lyx.org>
3610 * Lots of files: Merged from HEAD
3612 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3613 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3615 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3617 * sigc++/: new minidist.
3619 2000-02-14 Allan Rae <rae@lyx.org>
3621 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3623 2000-02-08 Juergen Vigna <jug@sad.it>
3625 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3626 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3628 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3629 for this port and so it is much easier for other people to port
3630 dialogs in a common development environment.
3632 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3633 the QT/KDE implementation.
3635 * src/frontends/kde/Dialogs.C:
3636 * src/frontends/kde/FormCopyright.C:
3637 * src/frontends/kde/FormCopyright.h:
3638 * src/frontends/kde/Makefile.am:
3639 * src/frontends/kde/formcopyrightdialog.C:
3640 * src/frontends/kde/formcopyrightdialog.h:
3641 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3642 for the kde support of the Copyright-Dialog.
3644 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3645 subdir-substitution instead of hardcoded 'xforms' as we now have also
3648 * src/frontends/include/DialogBase.h (Object): just commented the
3649 label after #endif (nasty warning and I don't like warnings ;)
3651 * src/main.C (main): added KApplication initialization if using
3654 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3655 For now only the KDE event-loop is added if frontend==kde.
3657 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3659 * configure.in: added support for the --with-frontend[=value] option
3661 * autogen.sh: added kde.m4 file to list of config-files
3663 * acconfig.h: added define for KDEGUI-support
3665 * config/kde.m4: added configuration functions for KDE-port
3667 * config/lyxinclude.m4: added --with-frontend[=value] option with
3668 support for xforms and KDE.
3670 2000-02-08 Allan Rae <rae@lyx.org>
3672 * all Makefile.am: Fixed up so the make targets dist, distclean,
3673 install and uninstall all work even if builddir != srcdir. Still
3674 have a new sigc++ minidist update to come.
3676 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3678 2000-02-01 Allan Rae <rae@lyx.org>
3680 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3681 Many mods to get builddir != srcdir working.
3683 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3684 for building on NT and so we can do the builddir != srcdir stuff.
3686 2000-01-30 Allan Rae <rae@lyx.org>
3688 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3689 This will stay in "rae" branch. We probably don't really need it in
3690 the main trunk as anyone who wants to help programming it should get
3691 a full library installed also. So they can check both included and
3692 system supplied library compilation.
3694 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3695 Added a 'mini' distribution of libsigc++. If you feel the urge to
3696 change something in these directories - Resist it. If you can't
3697 resist the urge then you should modify the following script and rebuild
3698 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3699 all happen. Still uses a hacked version of libsigc++'s configure.in.
3700 I'm quite happy with the results. I'm not sure the extra work to turn
3701 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3702 worth the trouble and would probably lead to extra maintenance
3704 I haven't tested the following important make targets: install, dist.
3705 Not ready for prime time but very close. Maybe 1.1.5.
3707 * development/tools/makeLyXsigc.sh: A shell script to automatically
3708 generate our mini-dist of libsigc++. It can only be used with a CVS
3709 checkout of libsigc++ not a tarball distribution. It's well commented.
3710 This will end up as part of the libsigc++ distribution so other apps
3711 can easily have an included mini-dist. If someone makes mods to the
3712 sigc++ subpackage without modifying this script to generate those
3713 changes I'll be very upset!
3715 * src/frontends/: Started the gui/system indep structure.
3717 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3718 to access the gui-indep dialogs are in this class. Much improved
3719 design compared to previous revision. Lars, please refrain from
3720 moving this header into src/ like you did with Popups.h last time.
3722 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3724 * src/frontends/xforms/: Started the gui-indep system with a single
3725 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3728 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3729 Here you'll find a very useful makefile and automated fdfix.sh that
3730 makes updating dailogs a no-brainer -- provided you follow the rules
3731 set out in the README. I'm thinking about adding another script to
3732 automatically generate skeleton code for a new dialog given just the
3735 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3736 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3737 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3739 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3741 * src/support/LSubstring.C (operator): simplify
3743 * src/lyxtext.h: removed bparams, use buffer_->params instead
3745 * src/lyxrow.h: make Row a real class, move all variables to
3746 private and use accessors.
3748 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3750 (isRightToLeftPar): ditto
3751 (ChangeLanguage): ditto
3752 (isMultiLingual): ditto
3755 (SimpleTeXOnePar): ditto
3756 (TeXEnvironment): ditto
3757 (GetEndLabel): ditto
3759 (SetOnlyLayout): ditto
3760 (BreakParagraph): ditto
3761 (BreakParagraphConservative): ditto
3762 (GetFontSettings): ditto
3764 (CopyIntoMinibuffer): ditto
3765 (CutIntoMinibuffer): ditto
3766 (PasteParagraph): ditto
3767 (SetPExtraType): ditto
3768 (UnsetPExtraType): ditto
3769 (DocBookContTableRows): ditto
3770 (SimpleDocBookOneTablePar): ditto
3772 (TeXFootnote): ditto
3773 (SimpleTeXOneTablePar): ditto
3774 (TeXContTableRows): ditto
3775 (SimpleTeXSpecialChars): ditto
3778 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3779 to private and use accessors.
3781 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3782 this, we did not use it anymore and has not been for ages. Just a
3783 waste of cpu cycles.
3785 * src/language.h: make Language a real class, move all variables
3786 to private and use accessors.
3788 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3789 (create_view): remove
3790 (update): some changes for new timer
3791 (cursorToggle): use new timer
3792 (beforeChange): change for new timer
3794 * src/BufferView.h (cursorToggleCB): removed last paramter because
3797 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3798 (cursorToggleCB): change because of new timer code
3800 * lib/CREDITS: updated own mailaddress
3802 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3804 * src/support/filetools.C (PutEnv): fix the code in case neither
3805 putenv() nor setenv() have been found.
3807 * INSTALL: mention the install-strip Makefile target.
3809 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3810 read-only documents.
3812 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3814 * lib/reLyX/configure.in (VERSION): avoid using a previously
3815 generated reLyX wrapper to find out $prefix.
3817 * lib/examples/eu_adibide_lyx-atua.lyx:
3818 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3819 translation of the Tutorial (Dooteo)
3821 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3823 * forms/cite.fd: new citation dialog
3825 * src/insetcite.[Ch]: the new citation dialog is moved into
3828 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3831 * src/insets/insetcommand.h: data members made private.
3833 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3835 * LyX 1.1.5 released
3837 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3839 * src/version.h (LYX_RELEASE): to 1.1.5
3841 * src/spellchecker.C (RunSpellChecker): return false if the
3842 spellchecker dies upon creation.
3844 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3846 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3847 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3851 * lib/CREDITS: update entry for Martin Vermeer.
3853 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3855 * src/text.C (draw): Draw foreign language bars at the bottom of
3856 the row instead of at the baseline.
3858 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3860 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3862 * lib/bind/de_menus.bind: updated
3864 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3866 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3868 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3870 * src/menus.C (Limit_string_length): New function
3871 (ShowTocMenu): Limit the number of items/length of items in the
3874 * src/paragraph.C (String): Correct result for a paragraph inside
3877 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3879 * src/bufferlist.C (close): test of buf->getuser() == NULL
3881 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3883 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3884 Do not call to SetCursor when the paragraph is a closed footnote!
3886 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3888 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3891 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3893 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3896 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3897 reference popup, that activates the reference-back action
3899 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3901 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3902 the menus. Also fixed a bug.
3904 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3905 the math panels when switching buffers (unless new buffer is readonly).
3907 * src/BufferView.C (NoSavedPositions)
3908 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3910 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3912 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3913 less of dvi dirty or not.
3915 * src/trans_mgr.[Ch] (insert): change first parameter to string
3918 * src/chset.[Ch] (encodeString): add const to first parameter
3920 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3922 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3926 * src/LaTeX.C (deplog): better searching for dependency files in
3927 the latex log. Uses now regexps.
3929 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3930 instead of the box hack or \hfill.
3932 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3934 * src/lyxfunc.C (doImportHelper): do not create the file before
3935 doing the actual import.
3936 (doImportASCIIasLines): create a new file before doing the insert.
3937 (doImportASCIIasParagraphs): ditto.
3939 * lib/lyxrc.example: remove mention of non-existing commands
3941 * lyx.man: remove mention of color-related switches.
3943 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3945 * src/lyx_gui.C: remove all the color-related ressources, which
3946 are not used anymore.
3948 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3951 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3953 * src/lyxrc.C (read): Add a missing break in the switch
3955 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3957 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3959 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3962 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3964 * src/text.C (draw): draw bars under foreign language words.
3966 * src/LColor.[Ch]: add LColor::language
3968 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3970 * src/lyxcursor.h (boundary): New member variable
3972 * src/text.C (IsBoundary): New methods
3974 * src/text.C: Use the above for currect cursor movement when there
3975 is both RTL & LTR text.
3977 * src/text2.C: ditto
3979 * src/bufferview_funcs.C (ToggleAndShow): ditto
3981 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3983 * src/text.C (DeleteLineForward): set selection to true to avoid
3984 that DeleteEmptyParagraphMechanism does some magic. This is how it
3985 is done in all other functions, and seems reasonable.
3986 (DeleteWordForward): do not jump over non-word stuff, since
3987 CursorRightOneWord() already does it.
3989 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3990 DeleteWordBackward, since they seem safe to me (since selection is
3991 set to "true") DeleteEmptyParagraphMechanism does nothing.
3993 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3995 * src/lyx_main.C (easyParse): simplify the code by factoring the
3996 part that removes parameters from the command line.
3997 (LyX): check wether wrong command line options have been given.
3999 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4001 * src/lyx_main.C : add support for specifying user LyX
4002 directory via command line option -userdir.
4004 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4006 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4007 the number of items per popup.
4008 (Add_to_refs_menu): Ditto.
4010 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4012 * src/lyxparagraph.h: renamed ClearParagraph() to
4013 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4014 textclass as parameter, and do nothing if free_spacing is
4015 true. This fixes part of the line-delete-forward problems.
4017 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4018 (pasteSelection): ditto.
4019 (SwitchLayoutsBetweenClasses): more translatable strings.
4021 * src/text2.C (CutSelection): use StripLeadingSpaces.
4022 (PasteSelection): ditto.
4023 (DeleteEmptyParagraphMechanism): ditto.
4025 2000-05-26 Juergen Vigna <jug@sad.it>
4027 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4028 is not needed in tabular insets.
4030 * src/insets/insettabular.C (TabularFeatures): added missing features.
4032 * src/tabular.C (DeleteColumn):
4034 (AppendRow): implemented this functions
4035 (cellsturct::operator=): clone the inset too;
4037 2000-05-23 Juergen Vigna <jug@sad.it>
4039 * src/insets/insettabular.C (LocalDispatch): better selection support
4040 when having multicolumn-cells.
4042 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4044 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4046 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4048 * src/ColorHandler.C (getGCForeground): put more test into _()
4050 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4053 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4056 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4058 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4059 there are no labels, or when buffer is readonly.
4061 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4062 there are no labels, buffer is SGML, or when buffer is readonly.
4064 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4066 * src/LColor.C (LColor): change a couple of grey40 to grey60
4067 (LColor): rewore initalization to make compiles go some magnitude
4069 (getGUIName): don't use gettext until we need the string.
4071 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4073 * src/Bullet.[Ch]: Fixed a small bug.
4075 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4077 * src/paragraph.C (String): Several fixes/improvements
4079 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4081 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4083 * src/paragraph.C (String): give more correct output.
4085 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4087 * src/lyxfont.C (stateText) Do not output the language if it is
4088 eqaul to the language of the document.
4090 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4091 between two paragraphs with the same language.
4093 * src/paragraph.C (getParLanguage) Return a correct answer for an
4094 empty dummy paragraph.
4096 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4099 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4102 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4103 the menus/popup, if requested fonts are unavailable.
4105 2000-05-22 Juergen Vigna <jug@sad.it>
4107 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4108 movement support (Up/Down/Tab/Shift-Tab).
4109 (LocalDispatch): added also preliminari cursor-selection.
4111 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4113 * src/paragraph.C (PasteParagraph): Hopefully now right!
4115 2000-05-22 Garst R. Reese <reese@isn.net>
4117 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4118 of list, change all references to Environment to Command
4119 * tex/hollywood.cls : rewrite environments as commands, add
4120 \uppercase to interiorshot and exteriorshot to force uppecase.
4121 * tex/broadway.cls : rewrite environments as commands. Tweak
4124 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4126 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4127 size of items: use a constant intead of the hardcoded 40, and more
4128 importantly do not remove the %m and %x tags added at the end.
4129 (Add_to_refs_menu): use vector::size_type instead of
4130 unsigned int as basic types for the variables. _Please_ do not
4131 assume that size_t is equal to unsigned int. On an alpha, this is
4132 unsigned long, which is _not_ the same.
4134 * src/language.C (initL): remove language "hungarian", since it
4135 seems that "magyar" is better.
4137 2000-05-22 Juergen Vigna <jug@sad.it>
4139 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4141 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4144 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4145 next was deleted but not set to 0.
4147 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4149 * src/language.C (initL): change the initialization of languages
4150 so that compiles goes _fast_.
4152 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4155 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4157 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4161 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4163 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4165 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4169 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4172 * src/insets/insetlo*.[Ch]: Made editable
4174 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4176 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4177 the current selection.
4179 * src/BufferView_pimpl.C (stuffClipboard): new method
4181 * src/BufferView.C (stuffClipboard): new method
4183 * src/paragraph.C (String): new method
4185 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4186 LColor::ignore when lyxname is not found.
4188 * src/BufferView.C (pasteSelection): new method
4190 * src/BufferView_pimpl.C (pasteSelection): new method
4192 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4194 * src/WorkArea.C (request_clipboard_cb): new static function
4195 (getClipboard): new method
4196 (putClipboard): new method
4198 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4200 * LyX 1.1.5pre2 released
4202 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4204 * src/vspace.C (operator=): removed
4205 (operator=): removed
4207 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4209 * src/layout.C (NumberOfClass): manually set the type in make_pair
4210 (NumberOfLayout): ditto
4212 * src/language.C: use the Language constructor for ignore_lang
4214 * src/language.h: add constructors to struct Language
4216 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4218 * src/text2.C (SetCursorIntern): comment out #warning
4220 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4222 * src/mathed/math_iter.h: initialize sx and sw to 0
4224 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4226 * forms/lyx.fd: Redesign of form_ref
4228 * src/LaTeXFeatures.[Ch]
4232 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4235 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4236 and Buffer::inset_iterator.
4238 * src/menus.C: Added new menus: TOC and Refs.
4240 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4242 * src/buffer.C (getTocList): New method.
4244 * src/BufferView2.C (ChangeRefs): New method.
4246 * src/buffer.C (getLabelList): New method. It replaces the old
4247 getReferenceList. The return type is vector<string> instead of
4250 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4251 the old getLabel() and GetNumberOfLabels() methods.
4252 * src/insets/insetlabel.C (getLabelList): ditto
4253 * src/mathed/formula.C (getLabelList): ditto
4255 * src/paragraph.C (String): New method.
4257 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4258 Uses the new getTocList() method.
4259 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4260 which automatically updates the contents of the browser.
4261 (RefUpdateCB): Use the new getLabelList method.
4263 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4265 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4267 * src/spellchecker.C: Added using std::reverse;
4269 2000-05-19 Juergen Vigna <jug@sad.it>
4271 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4273 * src/insets/insettext.C (computeTextRows): small fix for display of
4274 1 character after a newline.
4276 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4279 2000-05-18 Juergen Vigna <jug@sad.it>
4281 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4282 when changing width of column.
4284 * src/tabular.C (set_row_column_number_info): setting of
4285 autobreak rows if necessary.
4287 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4289 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4291 * src/vc-backend.*: renamed stat() to status() and vcstat to
4292 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4293 compilation broke. The new name seems more relevant, anyway.
4295 2000-05-17 Juergen Vigna <jug@sad.it>
4297 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4298 which was wrong if the removing caused removing of rows!
4300 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4301 (pushToken): new function.
4303 * src/text2.C (CutSelection): fix problem discovered with purify
4305 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4307 * src/debug.C (showTags): enlarge the first column, now that we
4308 have 6-digits debug codes.
4310 * lib/layouts/hollywood.layout:
4311 * lib/tex/hollywood.cls:
4312 * lib/tex/brodway.cls:
4313 * lib/layouts/brodway.layout: more commands and fewer
4314 environments. Preambles moved in the .cls files. Broadway now has
4315 more options on scene numbering and less whitespace (from Garst)
4317 * src/insets/insetbib.C (getKeys): make sure that we are in the
4318 document directory, in case the bib file is there.
4320 * src/insets/insetbib.C (Latex): revert bogus change.
4322 2000-05-16 Juergen Vigna <jug@sad.it>
4324 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4325 the TabularLayout on cursor move.
4327 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4329 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4332 (draw): fixed cursor position and drawing so that the cursor is
4333 visible when before the tabular-inset.
4335 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4336 when creating from old insettext.
4338 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4340 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4342 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4343 * lib/tex/brodway.cls: ditto
4345 * lib/layouts/brodway.layout: change alignment of parenthical
4348 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4350 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4351 versions 0.88 and 0.89 are supported.
4353 2000-05-15 Juergen Vigna <jug@sad.it>
4355 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4358 * src/insets/insettext.C (computeTextRows): redone completely this
4359 function in a much cleaner way, because of problems when having a
4361 (draw): added a frame border when the inset is locked.
4362 (SetDrawLockedFrame): this sets if we draw the border or not.
4363 (SetFrameColor): this sets the frame color (default=insetframe).
4365 * src/insets/lyxinset.h: added x() and y() functions which return
4366 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4367 function which is needed to see if we have a locking inset of some
4368 type in this inset (needed for now in insettabular).
4370 * src/vspace.C (inPixels): the same function also without a BufferView
4371 parameter as so it is easier to use it in some ocasions.
4373 * src/lyxfunc.C: changed all places where insertInset was used so
4374 that now if it couldn't be inserted it is deleted!
4376 * src/TabularLayout.C:
4377 * src/TableLayout.C: added support for new tabular-inset!
4379 * src/BufferView2.C (insertInset): this now returns a bool if the
4380 inset was really inserted!!!
4382 * src/tabular.C (GetLastCellInRow):
4383 (GetFirstCellInRow): new helper functions.
4384 (Latex): implemented for new tabular class.
4388 (TeXTopHLine): new Latex() helper functions.
4390 2000-05-12 Juergen Vigna <jug@sad.it>
4392 * src/mathed/formulamacro.C (Read):
4393 * src/mathed/formula.C (Read): read also the \end_inset here!
4395 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4397 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4398 crush when saving formulae with unbalanced parenthesis.
4400 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4402 * src/layout.C: Add new keyword "endlabelstring" to layout file
4404 * src/text.C (GetVisibleRow): Draw endlabel string.
4406 * lib/layouts/broadway.layout
4407 * lib/layouts/hollywood.layout: Added endlabel for the
4408 Parenthetical layout.
4410 * lib/layouts/heb-article.layout: Do not use slanted font shape
4411 for Theorem like environments.
4413 * src/buffer.C (makeLaTeXFile): Always add "american" to
4414 the UsedLanguages list if document language is RTL.
4416 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4418 * add addendum to README.OS2 and small patch (from SMiyata)
4420 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4422 * many files: correct the calls to ChangeExtension().
4424 * src/support/filetools.C (ChangeExtension): remove the no_path
4425 argument, which does not belong there. Use OnlyFileName() instead.
4427 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4428 files when LaTeXing a non-nice latex file.
4430 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4431 a chain of "if". Return false when deadkeys are not handled.
4433 * src/lyx_main.C (LyX): adapted the code for default bindings.
4435 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4436 bindings for basic functionality (except deadkeys).
4437 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4439 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4440 several methods: handle override_x_deadkeys.
4442 * src/lyxrc.h: remove the "bindings" map, which did not make much
4443 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4445 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4447 * src/lyxfont.C (stateText): use a saner method to determine
4448 whether the font is "default". Seems to fix the crash with DEC
4451 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4453 2000-05-08 Juergen Vigna <jug@sad.it>
4455 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4456 TabularLayoutMenu with mouse-button-3
4457 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4459 * src/TabularLayout.C: added this file for having a Layout for
4462 2000-05-05 Juergen Vigna <jug@sad.it>
4464 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4465 recalculating inset-widths.
4466 (TabularFeatures): activated this function so that I can change
4467 tabular-features via menu.
4469 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4470 that I can test some functions with the Table menu.
4472 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4474 * src/lyxfont.C (stateText): guard against stupid c++libs.
4476 * src/tabular.C: add using std::vector
4477 some whitespace changes, + removed som autogenerated code.
4479 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4481 2000-05-05 Juergen Vigna <jug@sad.it>
4483 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4484 row, columns and cellstructures.
4486 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4488 * lib/lyxrc.example: remove obsolete entries.
4490 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4491 reading of protected_separator for free_spacing.
4493 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4495 * src/text.C (draw): do not display an exclamation mark in the
4496 margin for margin notes. This is confusing, ugly and
4499 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4500 AMS math' is checked.
4502 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4503 name to see whether including the amsmath package is needed.
4505 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4507 * src/paragraph.C (validate): Compute UsedLanguages correctly
4508 (don't insert the american language if it doesn't appear in the
4511 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4512 The argument of \thanks{} command is considered moving argument
4514 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4517 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4519 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4520 for appendix/minipage/depth. The lines can be now both in the footnote
4521 frame, and outside the frame.
4523 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4526 2000-05-05 Juergen Vigna <jug@sad.it>
4528 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4529 neede only in tabular.[Ch].
4531 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4533 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4535 (Write): write '~' for PROTECTED_SEPARATOR
4537 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4539 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4542 * src/mathed/formula.C (drawStr): rename size to siz.
4544 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4545 possibly fix a bug by not changing the pflags = flags to piflags =
4548 2000-05-05 Juergen Vigna <jug@sad.it>
4550 * src/insets/insetbib.C: moved using directive
4552 * src/ImportNoweb.C: small fix for being able to compile (missing
4555 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4557 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4558 to use clear, since we don't depend on this in the code. Add test
4561 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4563 * (various *.C files): add using std::foo directives to please dec
4566 * replace calls to string::clear() to string::erase() (Angus)
4568 * src/cheaders/cmath: modified to provide std::abs.
4570 2000-05-04 Juergen Vigna <jug@sad.it>
4572 * src/insets/insettext.C: Prepared all for inserting of multiple
4573 paragraphs. Still display stuff to do (alignment and other things),
4574 but I would like to use LyXText to do this when we cleaned out the
4575 table-support stuff.
4577 * src/insets/insettabular.C: Changed lot of stuff and added lots
4578 of functionality still a lot to do.
4580 * src/tabular.C: Various functions changed name and moved to be
4581 const functions. Added new Read and Write functions and changed
4582 lots of things so it works good with tabular-insets (also removed
4583 some stuff which is not needed anymore * hacks *).
4585 * src/lyxcursor.h: added operators == and != which just look if
4586 par and pos are (not) equal.
4588 * src/buffer.C (latexParagraphs): inserted this function to latex
4589 all paragraphs form par to endpar as then I can use this too for
4592 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4593 so that I can call this to from text insets with their own cursor.
4595 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4596 output off all paragraphs (because of the fix below)!
4598 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4599 the very last paragraph (this could be also the last paragraph of an
4602 * src/texrow.h: added rows() call which returns the count-variable.
4604 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4606 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4608 * lib/configure.m4: better autodetection of DocBook tools.
4610 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4612 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4614 * src/lyx_cb.C: add using std::reverse;
4616 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4619 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4620 selected files. Should fix repeated errors from generated files.
4622 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4624 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4626 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4627 the spellchecker popup.
4629 * lib/lyxrc.example: Removed the \number_inset section
4631 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4633 * src/insets/figinset.C (various): Use IsFileReadable() to make
4634 sure that the file actually exist. Relying on ghostscripts errors
4635 is a bad idea since they can lead to X server crashes.
4637 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4639 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4642 * lib/lyxrc.example: smallish typo in description of
4643 \view_dvi_paper_option
4645 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4648 * src/lyxfunc.C: doImportHelper to factor out common code of the
4649 various import methods. New functions doImportASCIIasLines,
4650 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4651 doImportLinuxDoc for the format specific parts.
4654 * buffer.C: Dispatch returns now a bool to indicate success
4657 * lyx_gui.C: Add getLyXView() for member access
4659 * lyx_main.C: Change logic for batch commands: First try
4660 Buffer::Dispatch (possibly without GUI), if that fails, use
4663 * lyx_main.C: Add support for --import command line switch.
4664 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4665 Available Formats: Everything accepted by 'buffer-import <format>'
4667 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4669 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4672 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4673 documents will be reformatted upon reentry.
4675 2000-04-27 Juergen Vigna <jug@sad.it>
4677 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4678 correctly only last pos this was a bug.
4680 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4682 * release of lyx-1.1.5pre1
4684 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4686 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4688 * src/menus.C: revert the change of naming (Figure->Graphic...)
4689 from 2000-04-11. It was incomplete and bad.
4691 * src/LColor.[Ch]: add LColor::depthbar.
4692 * src/text.C (GetVisibleRow): use it.
4694 * README: update the languages list.
4696 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4698 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4701 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4703 * README: remove sections that were just wrong.
4705 * src/text2.C (GetRowNearY): remove currentrow code
4707 * src/text.C (GetRow): remove currentrow code
4709 * src/screen.C (Update): rewritten a bit.
4710 (SmallUpdate): removed func
4712 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4714 (FullRebreak): return bool
4715 (currentrow): remove var
4716 (currentrow_y): ditto
4718 * src/lyxscreen.h (Draw): change arg to unsigned long
4719 (FitCursor): return bool
4720 (FitManualCursor): ditto
4721 (Smallpdate): remove func
4722 (first): change to unsigned long
4723 (DrawOneRow): change second arg to long (from long &)
4724 (screen_refresh_y): remove var
4725 (scree_refresh_row): ditto
4727 * src/lyxrow.h: change baseline to usigned int from unsigned
4728 short, this brings some implicit/unsigned issues out in the open.
4730 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4732 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4733 instead of smallUpdate.
4735 * src/lyxcursor.h: change y to unsigned long
4737 * src/buffer.h: don't call updateScrollbar after fitcursor
4739 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4740 where they are used. Removed "\\direction", this was not present
4741 in 1.1.4 and is already obsolete. Commented out some code that I
4742 believe to never be called.
4743 (runLiterate): don't call updateScrollbar after fitCursor
4745 (buildProgram): ditto
4748 * src/WorkArea.h (workWidth): change return val to unsigned
4751 (redraw): remove the button redraws
4752 (setScrollbarValue): change for scrollbar
4753 (getScrollbarValue): change for scrollbar
4754 (getScrollbarBounds): change for scrollbar
4756 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4757 (C_WorkArea_down_cb): removed func
4758 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4759 (resize): change for scrollbar
4760 (setScrollbar): ditto
4761 (setScrollbarBounds): ditto
4762 (setScrollbarIncrements): ditto
4763 (up_cb): removed func
4764 (down_cb): removed func
4765 (scroll_cb): change for scrollbar
4766 (work_area_handler): ditto
4768 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4769 when FitCursor did something.
4770 (updateScrollbar): some unsigned changes
4771 (downCB): removed func
4772 (scrollUpOnePage): removed func
4773 (scrollDownOnePage): remvoed func
4774 (workAreaMotionNotify): don't call screen->FitCursor but use
4775 fitCursor instead. and bool return val
4776 (workAreaButtonPress): ditto
4777 (workAreaButtonRelease): some unsigned changes
4778 (checkInsetHit): ditto
4779 (workAreaExpose): ditto
4780 (update): parts rewritten, comments about the signed char arg added
4781 (smallUpdate): removed func
4782 (cursorPrevious): call needed updateScrollbar
4785 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4788 * src/BufferView.[Ch] (upCB): removed func
4789 (downCB): removed func
4790 (smallUpdate): removed func
4792 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4794 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4795 currentrow, currentrow_y optimization. This did not help a lot and
4796 if we want to do this kind of optimization we should rather use
4797 cursor.row instead of the currentrow.
4799 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4800 buffer spacing and klyx spacing support.
4802 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4804 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4807 2000-04-26 Juergen Vigna <jug@sad.it>
4809 * src/insets/figinset.C: fixes to Lars sstream changes!
4811 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4813 * A lot of files: Added Ascii(ostream &) methods to all inset
4814 classes. Used when exporting to ASCII.
4816 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4817 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4820 * src/text2.C (ToggleFree): Disabled implicit word selection when
4821 there is a change in the language
4823 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4824 no output was generated for end-of-sentence inset.
4826 * src/insets/lyxinset.h
4829 * src/paragraph.C: Removed the insetnumber code
4831 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4833 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4835 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4836 no_babel and no_epsfig completely from the file.
4837 (parseSingleLyXformat2Token): add handling for per-paragraph
4838 spacing as written by klyx.
4840 * src/insets/figinset.C: applied patch by Andre. Made it work with
4843 2000-04-20 Juergen Vigna <jug@sad.it>
4845 * src/insets/insettext.C (cutSelection):
4846 (copySelection): Fixed with selection from right to left.
4847 (draw): now the rows are not recalculated at every draw.
4848 (computeTextRows): for now reset the inset-owner here (this is
4849 important for an undo or copy where the inset-owner is not set
4852 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4853 motion to the_locking_inset screen->first was forgotten, this was
4854 not important till we got multiline insets.
4856 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4858 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4859 code seems to be alright (it is code changed by Dekel, and the
4860 intent is indeed that all macros should be defined \protect'ed)
4862 * NEWS: a bit of reorganisation of the new user-visible features.
4864 2000-04-19 Juergen Vigna <jug@sad.it>
4866 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4867 position. Set the inset_owner of the used paragraph so that it knows
4868 that it is inside an inset. Fixed cursor handling with mouse and
4869 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4870 and cleanups to make TextInsets work better.
4872 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4873 Changed parameters of various functions and added LockInsetInInset().
4875 * src/insets/insettext.C:
4877 * src/insets/insetcollapsable.h:
4878 * src/insets/insetcollapsable.C:
4879 * src/insets/insetfoot.h:
4880 * src/insets/insetfoot.C:
4881 * src/insets/insetert.h:
4882 * src/insets/insetert.C: cleaned up the code so that it works now
4883 correctly with insettext.
4885 * src/insets/inset.C:
4886 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4887 that insets in insets are supported right.
4890 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4892 * src/paragraph.C: some small fixes
4894 * src/debug.h: inserted INSETS debug info
4896 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4897 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4899 * src/commandtags.h:
4900 * src/LyXAction.C: insert code for InsetTabular.
4902 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4903 not Button1MotionMask.
4904 (workAreaButtonRelease): send always a InsetButtonRelease event to
4906 (checkInsetHit): some setCursor fixes (always with insets).
4908 * src/BufferView2.C (lockInset): returns a bool now and extended for
4909 locking insets inside insets.
4910 (showLockedInsetCursor): it is important to have the cursor always
4911 before the locked inset.
4912 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4914 * src/BufferView.h: made lockInset return a bool.
4916 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4918 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4919 that is used also internally but can be called as public to have back
4920 a cursor pos which is not set internally.
4921 (SetCursorIntern): Changed to use above function.
4923 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4925 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4930 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4931 patches for things that should be in or should be changed.
4933 * src/* [insetfiles]: change "usigned char fragile" to bool
4934 fragile. There was only one point that could that be questioned
4935 and that is commented in formulamacro.C. Grep for "CHECK".
4937 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4938 (DeleteBuffer): take it out of CutAndPaste and make it static.
4940 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4942 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4943 output the spacing envir commands. Also the new commands used in
4944 the LaTeX output makes the result better.
4946 * src/Spacing.C (writeEnvirBegin): new method
4947 (writeEnvirEnd): new method
4949 2000-04-18 Juergen Vigna <jug@sad.it>
4951 * src/CutAndPaste.C: made textclass a static member of the class
4952 as otherwise it is not accesed right!!!
4954 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4956 * forms/layout_forms.fd
4957 * src/layout_forms.h
4958 * src/layout_forms.C (create_form_form_character)
4959 * src/lyx_cb.C (UserFreeFont)
4960 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4961 documents (in the layout->character popup).
4963 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4965 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4966 \spell_command was in fact not honored (from Kevin Atkinson).
4968 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4971 * src/lyx_gui.h: make lyxViews private (Angus)
4973 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4975 * src/mathed/math_write.C
4976 (MathMatrixInset::Write) Put \protect before \begin{array} and
4977 \end{array} if fragile
4978 (MathParInset::Write): Put \protect before \\ if fragile
4980 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4982 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4983 initialization if the LyXColorHandler must be done after the
4984 connections to the XServer has been established.
4986 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4987 get the background pixel from the lyxColorhandler so that the
4988 figures are rendered with the correct background color.
4989 (NextToken): removed functions.
4990 (GetPSSizes): use ifs >> string instead of NextToken.
4992 * src/Painter.[Ch]: the color cache moved out of this file.
4994 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4997 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4999 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5000 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5002 * src/BufferView.C (enterView): new func
5003 (leaveView): new func
5005 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5007 (leaveView): new func, undefines xterm cursor when approp.
5009 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5010 (AllowInput): delete the Workarea cursor handling from this func.
5012 * src/Painter.C (underline): draw a slimer underline in most cases.
5014 * src/lyx_main.C (error_handler): use extern "C"
5016 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5018 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5019 sent directly to me.
5021 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5022 to the list by Dekel.
5024 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5027 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5028 methods from lyx_cb.here.
5030 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5033 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5035 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5036 instead of using current_view directly.
5038 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5040 * src/LyXAction.C (init): add the paragraph-spacing command.
5042 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5044 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5046 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5047 different from the documents.
5049 * src/text.C (SetHeightOfRow): take paragraph spacing into
5050 account, paragraph spacing takes precedence over buffer spacing
5051 (GetVisibleRow): ditto
5053 * src/paragraph.C (writeFile): output the spacing parameter too.
5054 (validate): set the correct features if spacing is used in the
5056 (Clear): set spacing to default
5057 (MakeSameLayout): spacing too
5058 (HasSameLayout): spacing too
5059 (SetLayout): spacing too
5060 (TeXOnePar): output the spacing commands
5062 * src/lyxparagraph.h: added a spacing variable for use with
5063 per-paragraph spacing.
5065 * src/Spacing.h: add a Default spacing and a method to check if
5066 the current spacing is default. also added an operator==
5068 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5071 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5073 * src/lyxserver.C (callback): fix dispatch of functions
5075 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5076 printf() into lyxerr call.
5078 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5081 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5082 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5083 the "Float" from each of the subitems.
5084 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5086 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5087 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5088 documented the change so that the workaround can be nuked later.
5090 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5093 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5095 * src/buffer.C (getLatexName): ditto
5096 (setReadonly): ditto
5098 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5100 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5101 avoid some uses of current_view. Added also a bufferParams()
5102 method to get at this.
5104 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5106 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5108 * src/lyxparagraph.[Ch]: removed
5109 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5110 with operators used by lower_bound and
5111 upper_bound in InsetTable's
5112 Make struct InsetTable private again. Used matchpos.
5114 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5116 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5117 document, the language of existing text is changed (unless the
5118 document is multi-lingual)
5120 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5122 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5124 * A lot of files: A rewrite of the Right-to-Left support.
5126 2000-04-10 Juergen Vigna <jug@sad.it>
5128 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5129 misplaced cursor when inset in inset is locked.
5131 * src/insets/insettext.C (LocalDispatch): small fix so that a
5132 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5134 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5135 footnote font should be decreased in size twice when displaying.
5137 * src/insets/insettext.C (GetDrawFont): inserted this function as
5138 the drawing-font may differ from the real paragraph font.
5140 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5141 insets (inset in inset!).
5143 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5144 function here because we don't want footnotes inside footnotes.
5146 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5148 (init): now set the inset_owner in paragraph.C
5149 (LocalDispatch): added some resetPos() in the right position
5152 (pasteSelection): changed to use the new CutAndPaste-Class.
5154 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5155 which tells if it is allowed to insert another inset inside this one.
5157 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5158 SwitchLayoutsBetweenClasses.
5160 * src/text2.C (InsertInset): checking of the new paragraph-function
5162 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5163 is not needed anymore here!
5166 (PasteSelection): redone (also with #ifdef) so that now this uses
5167 the CutAndPaste-Class.
5168 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5171 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5172 from/to text/insets.
5174 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5175 so that the paragraph knows if it is inside an (text)-inset.
5176 (InsertFromMinibuffer): changed return-value to bool as now it
5177 may happen that an inset is not inserted in the paragraph.
5178 (InsertInsetAllowed): this checks if it is allowed to insert an
5179 inset in this paragraph.
5181 (BreakParagraphConservative):
5182 (BreakParagraph) : small change for the above change of the return
5183 value of InsertFromMinibuffer.
5185 * src/lyxparagraph.h: added inset_owner and the functions to handle
5186 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5188 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5190 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5191 functions from BufferView to BufferView::Pimpl to ease maintence.
5193 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5194 correctly. Also use SetCursorIntern instead of SetCursor.
5196 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5199 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5201 * src/WorkArea.C (belowMouse): manually implement below mouse.
5203 * src/*: Add "explicit" on several constructors, I added probably
5204 some unneeded ones. A couple of changes to code because of this.
5206 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5207 implementation and private parts from the users of BufferView. Not
5210 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5211 implementation and private parts from the users of LyXLex. Not
5214 * src/BufferView_pimpl.[Ch]: new files
5216 * src/lyxlex_pimpl.[Ch]: new files
5218 * src/LyXView.[Ch]: some inline functions move out-of-line
5220 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5222 * src/lyxparagraph.h: make struct InsetTable public.
5224 * src/support/lyxstring.h: change lyxstring::difference_type to be
5225 ptrdiff_t. Add std:: modifiers to streams.
5227 * src/font.C: include the <cctype> header, for islower() and
5230 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5232 * src/font.[Ch]: new files. Contains the metric functions for
5233 fonts, takes a LyXFont as parameter. Better separation of concepts.
5235 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5236 changes because of this.
5238 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5240 * src/*: compile with -Winline and move functions that don't
5243 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5246 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5248 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5249 (various files changed because of this)
5251 * src/Painter.C (text): fixed the drawing of smallcaps.
5253 * src/lyxfont.[Ch] (drawText): removed unused member func.
5256 * src/*.C: added needed "using" statements and "std::" qualifiers.
5258 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5260 * src/*.h: removed all use of "using" from header files use
5261 qualifier std:: instead.
5263 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5265 * src/text.C (Backspace): some additional cleanups (we already
5266 know whether cursor.pos is 0 or not).
5268 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5269 automake does not provide one).
5271 * src/bmtable.h: replace C++ comments with C comments.
5273 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5275 * src/screen.C (ShowCursor): Change the shape of the cursor if
5276 the current language is not equal to the language of the document.
5277 (If the cursor change its shape unexpectedly, then you've found a bug)
5279 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5282 * src/insets/insetnumber.[Ch]: New files.
5284 * src/LyXAction.C (init)
5285 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5288 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5290 * src/lyxparagraph.h
5291 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5292 (the vector is kept sorted).
5294 * src/text.C (GetVisibleRow): Draw selection correctly when there
5295 is both LTR and RTL text.
5297 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5298 which is much faster.
5300 * src/text.C (GetVisibleRow and other): Do not draw the last space
5301 in a row if the direction of the last letter is not equal to the
5302 direction of the paragraph.
5304 * src/lyxfont.C (latexWriteStartChanges):
5305 Check that font language is not equal to basefont language.
5306 (latexWriteEndChanges): ditto
5308 * src/lyx_cb.C (StyleReset): Don't change the language while using
5309 the font-default command.
5311 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5312 empty paragraph before a footnote.
5314 * src/insets/insetcommand.C (draw): Increase x correctly.
5316 * src/screen.C (ShowCursor): Change cursor shape if
5317 current language != document language.
5319 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5321 2000-03-31 Juergen Vigna <jug@sad.it>
5323 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5324 (Clone): changed mode how the paragraph-data is copied to the
5325 new clone-paragraph.
5327 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5328 GetInset(pos) with no inset anymore there (in inset UNDO)
5330 * src/insets/insetcommand.C (draw): small fix as here x is
5331 incremented not as much as width() returns (2 before, 2 behind = 4)
5333 2000-03-30 Juergen Vigna <jug@sad.it>
5335 * src/insets/insettext.C (InsetText): small fix in initialize
5336 widthOffset (should not be done in the init() function)
5338 2000-03-29 Amir Karger <karger@lyx.org>
5340 * lib/examples/it_ItemizeBullets.lyx: translation by
5343 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5345 2000-03-29 Juergen Vigna <jug@sad.it>
5347 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5349 * src/insets/insetfoot.C (Clone): small change as for the below
5350 new init function in the text-inset
5352 * src/insets/insettext.C (init): new function as I've seen that
5353 clone did not copy the Paragraph-Data!
5354 (LocalDispatch): Added code so that now we have some sort of Undo
5355 functionality (well actually we HAVE Undo ;)
5357 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5359 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5361 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5364 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5366 * src/main.C: added a runtime check that verifies that the xforms
5367 header used when building LyX and the library used when running
5368 LyX match. Exit with a message if they don't match. This is a
5369 version number check only.
5371 * src/buffer.C (save): Don't allocate memory on the heap for
5372 struct utimbuf times.
5374 * *: some using changes, use iosfwd instead of the real headers.
5376 * src/lyxfont.C use char const * instead of string for the static
5377 strings. Rewrite some functions to use sstream.
5379 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5381 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5384 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5386 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5387 of Geodesy (from Martin Vermeer)
5389 * lib/layouts/svjour.inc: include file for the Springer svjour
5390 class. It can be used to support journals other than JoG.
5392 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5393 Miskiewicz <misiek@pld.org.pl>)
5394 * lib/reLyX/Makefile.am: ditto.
5396 2000-03-27 Juergen Vigna <jug@sad.it>
5398 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5399 also some modifications with operations on selected text.
5401 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5402 problems with clicking on insets (last famous words ;)
5404 * src/insets/insetcommand.C (draw):
5405 (width): Changed to have a bit of space before and after the inset so
5406 that the blinking cursor can be seen (otherwise it was hidden)
5408 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5410 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5411 would not be added to the link list when an installed gettext (not
5412 part of libc) is found.
5414 2000-03-24 Juergen Vigna <jug@sad.it>
5416 * src/insets/insetcollapsable.C (Edit):
5417 * src/mathed/formula.C (InsetButtonRelease):
5418 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5421 * src/BufferView.C (workAreaButtonPress):
5422 (workAreaButtonRelease):
5423 (checkInsetHit): Finally fixed the clicking on insets be handled
5426 * src/insets/insetert.C (Edit): inserted this call so that ERT
5427 insets work always with LaTeX-font
5429 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5431 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5432 caused lyx to startup with no GUI in place, causing in a crash
5433 upon startup when called with arguments.
5435 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5437 * src/FontLoader.C: better initialization of dummyXFontStruct.
5439 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5441 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5442 for linuxdoc and docbook import and export format options.
5444 * lib/lyxrc.example Example of default values for the previous flags.
5446 * src/lyx_cb.C Use those flags instead of the hardwired values for
5447 linuxdoc and docbook export.
5449 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5452 * src/menus.C Added menus entries for the new import/exports formats.
5454 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5456 * src/lyxrc.*: Added support for running without Gui
5459 * src/FontLoader.C: sensible defaults if no fonts are needed
5461 * src/lyx_cb.C: New function ShowMessage (writes either to the
5462 minibuffer or cout in case of no gui
5463 New function AskOverwrite for common stuff
5464 Consequently various changes to call these functions
5466 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5467 wild guess at sensible screen resolution when having no gui
5469 * src/lyxfont.C: no gui, no fonts... set some defaults
5471 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5473 * src/LColor.C: made the command inset background a bit lighter.
5475 2000-03-20 Hartmut Goebel <goebel@noris.net>
5477 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5478 stdstruct.inc. Koma-Script added some title elements which
5479 otherwise have been listed below "bibliography". This split allows
5480 adding title elements to where they belong.
5482 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5483 define the additional tilte elements and then include
5486 * many other layout files: changed to include stdtitle.inc just
5487 before stdstruct.inc.
5489 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5491 * src/buffer.C: (save) Added the option to store all backup files
5492 in a single directory
5494 * src/lyxrc.[Ch]: Added variable \backupdir_path
5496 * lib/lyxrc.example: Added descriptions of recently added variables
5498 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5499 bibtex inset, not closing the bibtex popup when deleting the inset)
5501 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5503 * src/lyx_cb.C: add a couple using directives.
5505 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5506 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5507 import based on the filename.
5509 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5510 file would be imported at start, if the filename where of a sgml file.
5512 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5514 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5516 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5517 * src/lyxfont.h Replaced the member variable bits.direction by the
5518 member variable lang. Made many changes in other files.
5519 This allows having a multi-lingual document
5521 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5522 that change the current language to <l>.
5523 Removed the command "font-rtl"
5525 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5526 format for Hebrew documents)
5528 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5529 When auto_mathmode is "true", pressing a digit key in normal mode
5530 will cause entering into mathmode.
5531 If auto_mathmode is "rtl" then this behavior will be active only
5532 when writing right-to-left text.
5534 * src/text2.C (InsertStringA) The string is inserted using the
5537 * src/paragraph.C (GetEndLabel) Gives a correct result for
5538 footnote paragraphs.
5540 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5542 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5544 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5545 front of PasteParagraph. Never insert a ' '. This should at least
5546 fix some cause for the segfaults that we have been experiencing,
5547 it also fixes backspace behaviour slightly. (Phu!)
5549 * src/support/lstrings.C (compare_no_case): some change to make it
5550 compile with gcc 2.95.2 and stdlibc++-v3
5552 * src/text2.C (MeltFootnoteEnvironment): change type o
5553 first_footnote_par_is_not_empty to bool.
5555 * src/lyxparagraph.h: make text private. Changes in other files
5557 (fitToSize): new function
5558 (setContentsFromPar): new function
5559 (clearContents): new function
5560 (SetChar): new function
5562 * src/paragraph.C (readSimpleWholeFile): deleted.
5564 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5565 the file, just use a simple string instead. Also read the file in
5566 a more maintainable manner.
5568 * src/text2.C (InsertStringA): deleted.
5569 (InsertStringB): deleted.
5571 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5573 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5574 RedoParagraphs from the doublespace handling part, just set status
5575 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5576 done, but perhaps not like this.)
5578 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5580 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5581 character when inserting an inset.
5583 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5585 * src/bufferparams.C (readLanguage): now takes "default" into
5588 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5589 also initialize the toplevel_keymap with the default bindings from
5592 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5594 * all files using lyxrc: have lyxrc as a real variable and not a
5595 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5598 * src/lyxrc.C: remove double call to defaultKeyBindings
5600 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5601 toolbar defauls using lyxlex. Remove enums, structs, functions
5604 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5605 toolbar defaults. Also store default keybindings in a map.
5607 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5608 storing the toolbar defaults without any xforms dependencies.
5610 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5611 applied. Changed to use iterators.
5613 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5615 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5616 systems that don't have LINGUAS set to begin with.
5618 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5620 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5621 the list by Dekel Tsur.
5623 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5625 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5626 * src/insets/form_graphics.C: ditto.
5628 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5630 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5632 * src/bufferparams.C (readLanguage): use the new language map
5634 * src/intl.C (InitKeyMapper): use the new language map
5636 * src/lyx_gui.C (create_forms): use the new language map
5638 * src/language.[Ch]: New files. Used for holding the information
5639 about each language. Now! Use this new language map enhance it and
5640 make it really usable for our needs.
5642 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5644 * screen.C (ShowCursor): Removed duplicate code.
5645 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5646 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5648 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5651 * src/text.C Added TransformChar method. Used for rendering Arabic
5652 text correctly (change the glyphs of the letter according to the
5653 position in the word)
5658 * src/lyxrc.C Added lyxrc command {language_command_begin,
5659 language_command_end,language_command_ltr,language_command_rtl,
5660 language_package} which allows the use of either arabtex or Omega
5663 * src/lyx_gui.C (init)
5665 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5666 to use encoding for menu fonts which is different than the encoding
5669 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5670 do not load the babel package.
5671 To write an English document with Hebrew/Arabic, change the document
5672 language to "english".
5674 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5675 (alphaCounter): changed to return char
5676 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5678 * lib/lyxrc.example Added examples for Hebrew/Arabic
5681 * src/layout.C Added layout command endlabeltype
5683 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5685 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5687 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5689 * src/mathed/math_delim.C (search_deco): return a
5690 math_deco_struct* instead of index.
5692 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5694 * All files with a USE_OSTREAM_ONLY within: removed all code that
5695 was unused when USE_OSTREAM_ONLY is defined.
5697 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5698 of any less. Removed header and using.
5700 * src/text.C (GetVisibleRow): draw the string "Page Break
5701 (top/bottom)" on screen when drawing a pagebreak line.
5703 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5705 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5707 * src/mathed/math_macro.C (draw): do some cast magic.
5710 * src/mathed/math_defs.h: change byte* argument to byte const*.
5712 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5714 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5715 know it is right to return InsetFoot* too, but cxx does not like
5718 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5720 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5722 * src/mathed/math_delim.C: change == to proper assignment.
5724 2000-03-09 Juergen Vigna <jug@sad.it>
5726 * src/insets/insettext.C (setPos): fixed various cursor positioning
5727 problems (via mouse and cursor-keys)
5728 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5729 inset (still a small display problem but it works ;)
5731 * src/insets/insetcollapsable.C (draw): added button_top_y and
5732 button_bottom_y to have correct values for clicking on the inset.
5734 * src/support/lyxalgo.h: commented out 'using std::less'
5736 2000-03-08 Juergen Vigna <jug@sad.it>
5738 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5739 Button-Release event closes as it is alos the Release-Event
5742 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5744 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5746 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5747 can add multiple spaces in Scrap (literate programming) styles...
5748 which, by the way, is how I got hooked on LyX to begin with.
5750 * src/mathed/formula.C (Write): Added dummy variable to an
5751 inset::Latex() call.
5752 (Latex): Add free_spacing boolean to inset::Latex()
5754 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5756 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5757 virtual function to include the free_spacing boolean from
5758 the containing paragraph's style.
5760 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5761 Added free_spacing boolean arg to match inset.h
5763 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5764 Added free_spacing boolean arg to match inset.h
5766 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5767 Added free_spacing boolean and made sure that if in a free_spacing
5768 paragraph, that we output normal space if there is a protected space.
5770 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5771 Added free_spacing boolean arg to match inset.h
5773 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5774 Added free_spacing boolean arg to match inset.h
5776 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5777 Added free_spacing boolean arg to match inset.h
5779 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5780 Added free_spacing boolean arg to match inset.h
5782 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5783 Added free_spacing boolean arg to match inset.h
5785 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5786 free_spacing boolean arg to match inset.h
5788 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5789 Added free_spacing boolean arg to match inset.h
5791 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5792 Added free_spacing boolean arg to match inset.h
5794 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5795 Added free_spacing boolean arg to match inset.h
5797 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5798 Added free_spacing boolean arg to match inset.h
5800 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5801 Added free_spacing boolean arg to match inset.h
5803 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5804 free_spacing boolean arg to match inset.h
5806 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5807 free_spacing boolean arg to match inset.h
5809 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5810 ignore free_spacing paragraphs. The user's spaces are left
5813 * src/text.C (InsertChar): Fixed the free_spacing layout
5814 attribute behavior. Now, if free_spacing is set, you can
5815 add multiple spaces in a paragraph with impunity (and they
5816 get output verbatim).
5817 (SelectSelectedWord): Added dummy argument to inset::Latex()
5820 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5823 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5824 paragraph layouts now only input a simple space instead.
5825 Special character insets don't make any sense in free-spacing
5828 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5829 hard-spaces in the *input* file to simple spaces if the layout
5830 is free-spacing. This converts old files which had to have
5831 hard-spaces in free-spacing layouts where a simple space was
5833 (writeFileAscii): Added free_spacing check to pass to the newly
5834 reworked inset::Latex(...) methods. The inset::Latex() code
5835 ensures that hard-spaces in free-spacing paragraphs get output
5836 as spaces (rather than "~").
5838 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5840 * src/mathed/math_delim.C (draw): draw the empty placeholder
5841 delims with a onoffdash line.
5842 (struct math_deco_compare): struct that holds the "functors" used
5843 for the sort and the binary search in math_deco_table.
5844 (class init_deco_table): class used for initial sort of the
5846 (search_deco): use lower_bound to do a binary search in the
5849 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5851 * src/lyxrc.C: a small secret thingie...
5853 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5854 and to not flush the stream as often as it used to.
5856 * src/support/lyxalgo.h: new file
5857 (sorted): template function used for checking if a sequence is
5858 sorted or not. Two versions with and without user supplied
5859 compare. Uses same compare as std::sort.
5861 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5862 it and give warning on lyxerr.
5864 (struct compare_tags): struct with function operators used for
5865 checking if sorted, sorting and lower_bound.
5866 (search_kw): use lower_bound instead of manually implemented
5869 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5871 * src/insets/insetcollapsable.h: fix Clone() declaration.
5872 * src/insets/insetfoot.h: ditto.
5874 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5876 2000-03-08 Juergen Vigna <jug@sad.it>
5878 * src/insets/lyxinset.h: added owner call which tells us if
5879 this inset is inside another inset. Changed also the return-type
5880 of Editable to an enum so it tells clearer what the return-value is.
5882 * src/insets/insettext.C (computeTextRows): fixed computing of
5883 textinsets which split automatically on more rows.
5885 * src/insets/insetert.[Ch]: changed this to be of BaseType
5888 * src/insets/insetfoot.[Ch]: added footnote inset
5890 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5891 collapsable insets (like footnote, ert, ...)
5893 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5895 * src/lyxdraw.h: remvoe file
5897 * src/lyxdraw.C: remove file
5899 * src/insets/insettext.C: added <algorithm>.
5901 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5903 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5904 (matrix_cb): case MM_OK use string stream
5906 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5909 * src/mathed/math_macro.C (draw): use string stream
5910 (Metrics): use string stream
5912 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5913 directly to the ostream.
5915 * src/vspace.C (asString): use string stream.
5916 (asString): use string stream
5917 (asLatexString): use string stream
5919 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5920 setting Spacing::Other.
5922 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5923 sprintf when creating the stretch vale.
5925 * src/text2.C (alphaCounter): changed to return a string and to
5926 not use a static variable internally. Also fixed a one-off bug.
5927 (SetCounter): changed the drawing of the labels to use string
5928 streams instead of sprintf.
5930 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5931 manipulator to use a scheme that does not require library support.
5932 This is also the way it is done in the new GNU libstdc++. Should
5933 work with DEC cxx now.
5935 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5937 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5938 end. This fixes a bug.
5940 * src/mathed (all files concerned with file writing): apply the
5941 USE_OSTREAM_ONLY changes to mathed too.
5943 * src/support/DebugStream.h: make the constructor explicit.
5945 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5946 count and ostream squashed.
5948 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5950 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5952 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5953 ostringstream uses STL strings, and we might not.
5955 * src/insets/insetspecialchar.C: add using directive.
5956 * src/insets/insettext.C: ditto.
5958 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5960 * lib/layouts/seminar.layout: feeble attempt at a layout for
5961 seminar.cls, far from completet and could really use some looking
5962 at from people used to write layout files.
5964 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5965 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5966 a lot nicer and works nicely with ostreams.
5968 * src/mathed/formula.C (draw): a slightly different solution that
5969 the one posted to the list, but I think this one works too. (font
5970 size wrong in headers.)
5972 * src/insets/insettext.C (computeTextRows): some fiddling on
5973 Jürgens turf, added some comments that he should read.
5975 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5976 used and it gave compiler warnings.
5977 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5980 * src/lyx_gui.C (create_forms): do the right thing when
5981 show_banner is true/false.
5983 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5984 show_banner is false.
5986 * most file writing files: Now use iostreams to do almost all of
5987 the writing. Also instead of passing string &, we now use
5988 stringstreams. mathed output is still not adapted to iostreams.
5989 This change can be turned off by commenting out all the occurences
5990 of the "#define USE_OSTREAM_ONLY 1" lines.
5992 * src/WorkArea.C (createPixmap): don't output debug messages.
5993 (WorkArea): don't output debug messages.
5995 * lib/lyxrc.example: added a comment about the new variable
5998 * development/Code_rules/Rules: Added some more commente about how
5999 to build class interfaces and on how better encapsulation can be
6002 2000-03-03 Juergen Vigna <jug@sad.it>
6004 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6005 automatically with the width of the LyX-Window
6007 * src/insets/insettext.C (computeTextRows): fixed update bug in
6008 displaying text-insets (scrollvalues where not initialized!)
6010 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6012 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6013 id in the check of the result from lower_bound is not enough since
6014 lower_bound can return last too, and then res->id will not be a
6017 * all insets and some code that use them: I have conditionalized
6018 removed the Latex(string & out, ...) this means that only the
6019 Latex(ostream &, ...) will be used. This is a work in progress to
6020 move towards using streams for all output of files.
6022 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6025 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6027 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6028 routine (this fixes bug where greek letters were surrounded by too
6031 * src/support/filetools.C (findtexfile): change a bit the search
6032 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6033 no longer passed to kpsewhich, we may have to change that later.
6035 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6036 warning options to avoid problems with X header files (from Angus
6038 * acinclude.m4: regenerated.
6040 2000-03-02 Juergen Vigna <jug@sad.it>
6042 * src/insets/insettext.C (WriteParagraphData): Using the
6043 par->writeFile() function for writing paragraph-data.
6044 (Read): Using buffer->parseSingleLyXformat2Token()-function
6045 for parsing paragraph data!
6047 * src/buffer.C (readLyXformat2): removed all parse data and using
6048 the new parseSingleLyXformat2Token()-function.
6049 (parseSingleLyXformat2Token): added this function to parse (read)
6050 lyx-file-format (this is called also from text-insets now!)
6052 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6054 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6057 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6058 directly instead of going through a func. One very bad thing: a
6059 static LyXFindReplace, but I don't know where to place it.
6061 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6062 string instead of char[]. Also changed to static.
6063 (GetSelectionOrWordAtCursor): changed to static inline
6064 (SetSelectionOverLenChars): ditto.
6066 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6067 current_view and global variables. both classes has changed names
6068 and LyXFindReplace is not inherited from SearchForm.
6070 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6071 fl_form_search form.
6073 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6075 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6077 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6078 bound (from Kayvan).
6080 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6082 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6084 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6086 * some things that I should comment but the local pub says head to
6089 * comment out all code that belongs to the Roff code for Ascii
6090 export of tables. (this is unused)
6092 * src/LyXView.C: use correct type for global variable
6093 current_layout. (LyXTextClass::size_type)
6095 * some code to get the new insetgraphics closer to working I'd be
6096 grateful for any help.
6098 * src/BufferView2.C (insertInset): use the return type of
6099 NumberOfLayout properly. (also changes in other files)
6101 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6102 this as a test. I want to know what breaks because of this.
6104 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6106 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6108 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6109 to use a \makebox in the label, this allows proper justification
6110 with out using protected spaces or multiple hfills. Now it is
6111 "label" for left justified, "\hfill label\hfill" for center, and
6112 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6113 should be changed accordingly.
6115 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6117 * src/lyxtext.h: change SetLayout() to take a
6118 LyXTextClass::size_type instead of a char (when there is more than
6119 127 layouts in a class); also change type of copylayouttype.
6120 * src/text2.C (SetLayout): ditto.
6121 * src/LyXView.C (updateLayoutChoice): ditto.
6123 * src/LaTeX.C (scanLogFile): errors where the line number was not
6124 given just after the '!'-line were ignored (from Dekel Tsur).
6126 * lib/lyxrc.example: fix description of \date_insert_format
6128 * lib/layouts/llncs.layout: new layout, contributed by Martin
6131 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6133 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6134 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6135 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6136 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6137 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6138 paragraph.C, text.C, text2.C)
6140 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6142 * src/insets/insettext.C (LocalDispatch): remove extra break
6145 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6146 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6148 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6149 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6151 * src/insets/insetbib.h: move InsetBibkey::Holder and
6152 InsetCitation::Holder in public space.
6154 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6156 * src/insets/insettext.h: small change to get the new files from
6157 Juergen to compile (use "string", not "class string").
6159 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6160 const & as parameter to LocalDispatch, use LyXFont const & as
6161 paramter to some other func. This also had impacto on lyxinsets.h
6162 and the two mathed insets.
6164 2000-02-24 Juergen Vigna <jug@sad.it>
6167 * src/commandtags.h:
6169 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6173 * src/BufferView2.C: added/updated code for various inset-functions
6175 * src/insets/insetert.[Ch]: added implementation of InsetERT
6177 * src/insets/insettext.[Ch]: added implementation of InsetText
6179 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6180 (draw): added preliminary code for inset scrolling not finshed yet
6182 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6183 as it is in lyxfunc.C now
6185 * src/insets/lyxinset.h: Added functions for text-insets
6187 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6189 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6190 BufferView and reimplement the list as a queue put inside its own
6193 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6195 * several files: use the new interface to the "updateinsetlist"
6197 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6199 (work_area_handler): call BufferView::trippleClick on trippleclick.
6201 * src/BufferView.C (doubleClick): new function, selects word on
6203 (trippleClick): new function, selects line on trippleclick.
6205 2000-02-22 Allan Rae <rae@lyx.org>
6207 * lib/bind/xemacs.bind: buffer-previous not supported
6209 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6211 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6214 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6216 * src/bufferlist.C: get rid of current_view from this file
6218 * src/spellchecker.C: get rid of current_view from this file
6220 * src/vspace.C: get rid of current_view from this file
6221 (inPixels): added BufferView parameter for this func
6222 (asLatexCommand): added a BufferParams for this func
6224 * src/text.C src/text2.C: get rid of current_view from these
6227 * src/lyxfont.C (getFontDirection): move this function here from
6230 * src/bufferparams.C (getDocumentDirection): move this function
6233 * src/paragraph.C (getParDirection): move this function here from
6235 (getLetterDirection): ditto
6237 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6239 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6240 resize due to wrong pixmap beeing used. Also took the opurtunity
6241 to make the LyXScreen stateless on regard to WorkArea and some
6242 general cleanup in the same files.
6244 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6246 * src/Makefile.am: add missing direction.h
6248 * src/PainterBase.h: made the width functions const.
6250 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6253 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6255 * src/insets/insetlatexaccent.C (draw): make the accents draw
6256 better, at present this will only work well with iso8859-1.
6258 * several files: remove the old drawing code, now we use the new
6261 * several files: remove support for mono_video, reverse_video and
6264 2000-02-17 Juergen Vigna <jug@sad.it>
6266 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6267 int ** as we have to return the pointer, otherwise we have only
6268 NULL pointers in the returning function.
6270 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6272 * src/LaTeX.C (operator()): quote file name when running latex.
6274 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6276 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6277 (bubble tip), this removes our special handling of this.
6279 * Remove all code that is unused now that we have the new
6280 workarea. (Code that are not active when NEW_WA is defined.)
6282 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6284 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6286 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6287 nonexisting layout; correctly redirect obsoleted layouts.
6289 * lib/lyxrc.example: document \view_dvi_paper_option
6291 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6294 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6295 (PreviewDVI): handle the view_dvi_paper_option variable.
6296 [Both from Roland Krause]
6298 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6300 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6301 char const *, int, LyXFont)
6302 (text(int, int, string, LyXFont)): ditto
6304 * src/text.C (InsertCharInTable): attempt to fix the double-space
6305 feature in tables too.
6306 (BackspaceInTable): ditto.
6307 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6309 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6311 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6313 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6314 newly found text in textcache to this.
6315 (buffer): set the owner of the text put into the textcache to 0
6317 * src/insets/figinset.C (draw): fixed the drawing of figures with
6320 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6321 drawing of mathframe, hfills, protected space, table lines. I have
6322 now no outstanding drawing problems with the new Painter code.
6324 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6326 * src/PainterBase.C (ellipse, circle): do not specify the default
6329 * src/LColor.h: add using directive.
6331 * src/Painter.[Ch]: change return type of methods from Painter& to
6332 PainterBase&. Add a using directive.
6334 * src/WorkArea.C: wrap xforms callbacks in C functions
6337 * lib/layouts/foils.layout: font fix and simplifications from Carl
6340 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6342 * a lot of files: The Painter, LColor and WorkArea from the old
6343 devel branch has been ported to lyx-devel. Some new files and a
6344 lot of #ifdeffed code. The new workarea is enabled by default, but
6345 if you want to test the new Painter and LColor you have to compile
6346 with USE_PAINTER defined (do this in config.h f.ex.) There are
6347 still some rought edges, and I'd like some help to clear those
6348 out. It looks stable (loads and displays the Userguide very well).
6351 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6353 * src/buffer.C (pop_tag): revert to the previous implementation
6354 (use a global variable for both loops).
6356 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6358 * src/lyxrc.C (LyXRC): change slightly default date format.
6360 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6361 there is an English text with a footnote that starts with a Hebrew
6362 paragraph, or vice versa.
6363 (TeXFootnote): ditto.
6365 * src/text.C (LeftMargin): allow for negative values for
6366 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6369 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6370 for input encoding (cyrillic)
6372 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6374 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6377 * src/toolbar.C (set): ditto
6378 * src/insets/insetbib.C (create_form_citation_form): ditto
6380 * lib/CREDITS: added Dekel Tsur.
6382 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6383 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6384 hebrew supports files from Dekel Tsur.
6386 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6387 <tzafrir@technion.ac.il>
6389 * src/lyxrc.C: put \date_insert_format at the right place.
6391 * src/buffer.C (makeLaTeXFile): fix the handling of
6392 BufferParams::sides when writing out latex files.
6394 * src/BufferView2.C: add a "using" directive.
6396 * src/support/lyxsum.C (sum): when we use lyxstring,
6397 ostringstream::str needs an additional .c_str().
6399 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6401 * src/support/filetools.C (ChangeExtension): patch from Etienne
6404 * src/TextCache.C (show): remove const_cast and make second
6405 parameter non-const LyXText *.
6407 * src/TextCache.h: use non const LyXText in show.
6409 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6412 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6414 * src/support/lyxsum.C: rework to be more flexible.
6416 * several places: don't check if a pointer is 0 if you are going
6419 * src/text.C: remove some dead code.
6421 * src/insets/figinset.C: remove some dead code
6423 * src/buffer.C: move the BufferView funcs to BufferView2.C
6424 remove all support for insetlatexdel
6425 remove support for oldpapersize stuff
6426 made some member funcs const
6428 * src/kbmap.C: use a std::list to store the bindings in.
6430 * src/BufferView2.C: new file
6432 * src/kbsequence.[Ch]: new files
6434 * src/LyXAction.C + others: remove all trace of buffer-previous
6436 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6437 only have one copy in the binary of this table.
6439 * hebrew patch: moved some functions from LyXText to more
6440 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6442 * several files: remove support for XForms older than 0.88
6444 remove some #if 0 #endif code
6446 * src/TextCache.[Ch]: new file. Holds the textcache.
6448 * src/BufferView.C: changes to use the new TextCache interface.
6449 (waitForX): remove the now unused code.
6451 * src/BackStack.h: remove some commented code
6453 * lib/bind/emacs.bind: remove binding for buffer-previous
6455 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6457 * applied the hebrew patch.
6459 * src/lyxrow.h: make sure that all Row variables are initialized.
6461 * src/text2.C (TextHandleUndo): comment out a delete, this might
6462 introduce a memory leak, but should also help us to not try to
6463 read freed memory. We need to look at this one.
6465 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6466 (LyXParagraph): initalize footnotekind.
6468 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6469 forgot this when applying the patch. Please heed the warnings.
6471 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6472 (aka. reformat problem)
6474 * src/bufferlist.C (exists): made const, and use const_iterator
6475 (isLoaded): new func.
6476 (release): use std::find to find the correct buffer.
6478 * src/bufferlist.h: made getState a const func.
6479 made empty a const func.
6480 made exists a const func.
6483 2000-02-01 Juergen Vigna <jug@sad.it>
6485 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6487 * po/it.po: updated a bit the italian po file and also changed the
6488 'file nuovo' for newfile to 'filenuovo' without a space, this did
6491 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6492 for the new insert_date command.
6494 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6495 from jdblair, to insert a date into the current text conforming to
6496 a strftime format (for now only considering the locale-set and not
6497 the document-language).
6499 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6501 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6502 Bounds Read error seen by purify. The problem was that islower is
6503 a macros which takes an unsigned char and uses it as an index for
6504 in array of characters properties (and is thus subject to the
6508 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6509 correctly the paper sides radio buttons.
6510 (UpdateDocumentButtons): ditto.
6512 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6514 * src/kbmap.C (getsym + others): change to return unsigned int,
6515 returning a long can give problems on 64 bit systems. (I assume
6516 that int is 32bit on 64bit systems)
6518 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6520 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6521 LyXLookupString to be zero-terminated. Really fixes problems seen
6524 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6526 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6527 write a (char*)0 to the lyxerr stream.
6529 * src/lastfiles.C: move algorithm before the using statemets.
6531 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6533 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6534 complains otherwise).
6535 * src/table.C: ditto
6537 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6540 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6541 that I removed earlier... It is really needed.
6543 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6545 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6547 * INSTALL: update xforms home page URL.
6549 * lib/configure.m4: fix a bug with unreadable layout files.
6551 * src/table.C (calculate_width_of_column): add "using std::max"
6554 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6556 * several files: marked several lines with "DEL LINE", this is
6557 lines that can be deleted without changing anything.
6558 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6559 checks this anyway */
6562 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6564 * src/DepTable.C (update): add a "+" at the end when the checksum
6565 is different. (debugging string only)
6567 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6568 the next inset to not be displayed. This should also fix the list
6569 of labels in the "Insert Crossreference" dialog.
6571 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6573 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6574 when regex was not found.
6576 * src/support/lstrings.C (lowercase): use handcoded transform always.
6579 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6580 old_cursor.par->prev could be 0.
6582 * several files: changed post inc/dec to pre inc/dec
6584 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6585 write the lastfiles to file.
6587 * src/BufferView.C (buffer): only show TextCache info when debugging
6589 (resizeCurrentBuffer): ditto
6590 (workAreaExpose): ditto
6592 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6594 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6596 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6597 a bit better by removing the special case for \i and \j.
6599 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6601 * src/lyx_main.C (easyParse): remove test for bad comand line
6602 options, since this broke all xforms-related parsing.
6604 * src/kbmap.C (getsym): set return type to unsigned long, as
6605 declared in header. On an alpha, long is _not_ the same as int.
6607 * src/support/LOstream.h: add a "using std::flush;"
6609 * src/insets/figinset.C: ditto.
6611 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6613 * src/bufferlist.C (write): use blinding fast file copy instead of
6614 "a char at a time", now we are doing it the C++ way.
6616 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6617 std::list<int> instead.
6618 (addpidwait): reflect move to std::list<int>
6619 (sigchldchecker): ditto
6621 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6624 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6625 that obviously was wrong...
6627 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6628 c, this avoids warnings with purify and islower.
6630 * src/insets/figinset.C: rename struct queue to struct
6631 queue_element and rewrite to use a std::queue. gsqueue is now a
6632 std::queue<queue_element>
6633 (runqueue): reflect move to std::queue
6636 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6637 we would get "1" "0" instead of "true" "false. Also make the tostr
6640 2000-01-21 Juergen Vigna <jug@sad.it>
6642 * src/buffer.C (writeFileAscii): Disabled code for special groff
6643 handling of tabulars till I fix this in table.C
6645 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6647 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6649 * src/support/lyxlib.h: ditto.
6651 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6653 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6654 and 'j' look better. This might fix the "macron" bug that has been
6657 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6658 functions as one template function. Delete the old versions.
6660 * src/support/lyxsum.C: move using std::ifstream inside
6663 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6666 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6668 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6670 * src/insets/figinset.C (InitFigures): use new instead of malloc
6671 to allocate memory for figures and bitmaps.
6672 (DoneFigures): use delete[] instead of free to deallocate memory
6673 for figures and bitmaps.
6674 (runqueue): use new to allocate
6675 (getfigdata): use new/delete[] instead of malloc/free
6676 (RegisterFigure): ditto
6678 * some files: moved some declarations closer to first use, small
6679 whitespace changes use preincrement instead of postincrement where
6680 it does not make a difference.
6682 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6683 step on the way to use stl::containers for key maps.
6685 * src/bufferlist.h: add a typedef for const_iterator and const
6686 versions of begin and end.
6688 * src/bufferlist.[Ch]: change name of member variable _state to
6689 state_. (avoid reserved names)
6691 (getFileNames): returns the filenames of the buffers in a vector.
6693 * configure.in (ALL_LINGUAS): added ro
6695 * src/support/putenv.C: new file
6697 * src/support/mkdir.C: new file
6699 2000-01-20 Allan Rae <rae@lyx.org>
6701 * lib/layouts/IEEEtran.layout: Added several theorem environments
6703 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6704 couple of minor additions.
6706 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6707 (except for those in footnotes of course)
6709 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6711 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6713 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6714 std::sort and std::lower_bound instead of qsort and handwritten
6716 (struct compara): struct that holds the functors used by std::sort
6717 and std::lower_bound in MathedLookupBOP.
6719 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6721 * src/support/LAssert.h: do not do partial specialization. We do
6724 * src/support/lyxlib.h: note that lyx::getUserName() and
6725 lyx::date() are not in use right now. Should these be suppressed?
6727 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6728 (makeLinuxDocFile): do not put date and user name in linuxdoc
6731 * src/support/lyxlib.h (kill): change first argument to long int,
6732 since that's what solaris uses.
6734 * src/support/kill.C (kill): fix declaration to match prototype.
6736 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6737 actually check whether namespaces are supported. This is not what
6740 * src/support/lyxsum.C: add a using directive.
6742 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6744 * src/support/kill.C: if we have namespace support we don't have
6745 to include lyxlib.h.
6747 * src/support/lyxlib.h: use namespace lyx if supported.
6749 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6751 * src/support/date.C: new file
6753 * src/support/chdir.C: new file
6755 * src/support/getUserName.C: new file
6757 * src/support/getcwd.C: new file
6759 * src/support/abort.C: new file
6761 * src/support/kill.C: new file
6763 * src/support/lyxlib.h: moved all the functions in this file
6764 insede struct lyx. Added also kill and abort to this struct. This
6765 is a way to avoid the "kill is not defined in <csignal>", we make
6766 C++ wrappers for functions that are not ANSI C or ANSI C++.
6768 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6769 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6770 lyx it has been renamed to sum.
6772 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6774 * src/text.C: add using directives for std::min and std::max.
6776 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6778 * src/texrow.C (getIdFromRow): actually return something useful in
6779 id and pos. Hopefully fixes the bug with positionning of errorbox
6782 * src/lyx_main.C (easyParse): output an error and exit if an
6783 incorrect command line option has been given.
6785 * src/spellchecker.C (ispell_check_word): document a memory leak.
6787 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6788 where a "struct utimbuf" is allocated with "new" and deleted with
6791 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6793 * src/text2.C (CutSelection): don't delete double spaces.
6794 (PasteSelection): ditto
6795 (CopySelection): ditto
6797 * src/text.C (Backspace): don't delete double spaces.
6799 * src/lyxlex.C (next): fix a bug that were only present with
6800 conformant std::istream::get to read comment lines, use
6801 std::istream::getline instead. This seems to fix the problem.
6803 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6805 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6806 allowed to insert space before space" editing problem. Please read
6807 commends at the beginning of the function. Comments about usage
6810 * src/text.C (InsertChar): fix for the "not allowed to insert
6811 space before space" editing problem.
6813 * src/text2.C (DeleteEmptyParagraphMechanism): when
6814 IsEmptyTableRow can only return false this last "else if" will
6815 always be a no-op. Commented out.
6817 * src/text.C (RedoParagraph): As far as I can understand tmp
6818 cursor is not really needed.
6820 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6821 present it could only return false anyway.
6822 (several functions): Did something not so smart...added a const
6823 specifier on a lot of methods.
6825 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6826 and add a tmp->text.resize. The LyXParagraph constructor does the
6828 (BreakParagraphConservative): ditto
6830 * src/support/path.h (Path): add a define so that the wrong usage
6831 "Path("/tmp") will be flagged as a compilation error:
6832 "`unnamed_Path' undeclared (first use this function)"
6834 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6836 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6837 which was bogus for several reasons.
6839 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6843 * autogen.sh: do not use "type -path" (what's that anyway?).
6845 * src/support/filetools.C (findtexfile): remove extraneous space
6846 which caused a kpsewhich warning (at least with kpathsea version
6849 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6851 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6853 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6855 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6857 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6859 * src/paragraph.C (BreakParagraph): do not reserve space on text
6860 if we don't need to (otherwise, if pos_end < pos, we end up
6861 reserving huge amounts of memory due to bad unsigned karma).
6862 (BreakParagraphConservative): ditto, although I have not seen
6863 evidence the bug can happen here.
6865 * src/lyxparagraph.h: add a using std::list.
6867 2000-01-11 Juergen Vigna <jug@sad.it>
6869 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6872 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6874 * src/vc-backend.C (doVCCommand): change to be static and take one
6875 more parameter: the path to chdir too be fore executing the command.
6876 (retrive): new function equiv to "co -r"
6878 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6879 file_not_found_hook is true.
6881 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6883 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6884 if a file is readwrite,readonly...anything else.
6886 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6888 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6889 (CreatePostscript): name change from MenuRunDVIPS (or something)
6890 (PreviewPostscript): name change from MenuPreviewPS
6891 (PreviewDVI): name change from MenuPreviewDVI
6893 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6894 \view_pdf_command., \pdf_to_ps_command
6896 * lib/configure.m4: added search for PDF viewer, and search for
6897 PDF to PS converter.
6898 (lyxrc.defaults output): add \pdflatex_command,
6899 \view_pdf_command and \pdf_to_ps_command.
6901 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6903 * src/bufferlist.C (write): we don't use blocksize for anything so
6906 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6908 * src/support/block.h: disable operator T* (), since it causes
6909 problems with both compilers I tried. See comments in the file.
6911 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6914 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6915 variable LYX_DIR_10x to LYX_DIR_11x.
6917 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6919 * INSTALL: document --with-lyxname.
6922 * configure.in: new configure flag --with-lyxname which allows to
6923 choose the name under which lyx is installed. Default is "lyx", of
6924 course. It used to be possible to do this with --program-suffix,
6925 but the later has in fact a different meaning for autoconf.
6927 * src/support/lstrings.h (lstrchr): reformat a bit.
6929 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6930 * src/mathed/math_defs.h: ditto.
6932 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6934 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6935 true, decides if we create a backup file or not when saving. New
6936 tag and variable \pdf_mode, defaults to false. New tag and
6937 variable \pdflatex_command, defaults to pdflatex. New tag and
6938 variable \view_pdf_command, defaults to xpdf. New tag and variable
6939 \pdf_to_ps_command, defaults to pdf2ps.
6941 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6944 does not have a BufferView.
6945 (unlockInset): ditto + don't access the_locking_inset if the
6946 buffer does not have a BufferView.
6948 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6949 certain circumstances so that we don't continue a keyboard
6950 operation long after the key was released. Try f.ex. to load a
6951 large document, press PageDown for some seconds and then release
6952 it. Before this change the document would contine to scroll for
6953 some time, with this change it stops imidiatly.
6955 * src/support/block.h: don't allocate more space than needed. As
6956 long as we don't try to write to the arr[x] in a array_type arr[x]
6957 it is perfectly ok. (if you write to it you might segfault).
6958 added operator value_type*() so that is possible to pass the array
6959 to functions expecting a C-pointer.
6961 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6964 * intl/*: updated to gettext 0.10.35, tried to add our own
6965 required modifications. Please verify.
6967 * po/*: updated to gettext 0.10.35, tried to add our own required
6968 modifications. Please verify.
6970 * src/support/lstrings.C (tostr): go at fixing the problem with
6971 cxx and stringstream. When stringstream is used return
6972 oss.str().c_str() so that problems with lyxstring and basic_string
6973 are avoided. Note that the best solution would be for cxx to use
6974 basic_string all the way, but it is not conformant yet. (it seems)
6976 * src/lyx_cb.C + other files: moved several global functions to
6977 class BufferView, some have been moved to BufferView.[Ch] others
6978 are still located in lyx_cb.C. Code changes because of this. (part
6979 of "get rid of current_view project".)
6981 * src/buffer.C + other files: moved several Buffer functions to
6982 class BufferView, the functions are still present in buffer.C.
6983 Code changes because of this.
6985 * config/lcmessage.m4: updated to most recent. used when creating
6988 * config/progtest.m4: updated to most recent. used when creating
6991 * config/gettext.m4: updated to most recent. applied patch for
6994 * config/gettext.m4.patch: new file that shows what changes we
6995 have done to the local copy of gettext.m4.
6997 * config/libtool.m4: new file, used in creation of acinclude.m4
6999 * config/lyxinclude.m4: new file, this is the lyx created m4
7000 macros, used in making acinclude.m4.
7002 * autogen.sh: GNU m4 discovered as a separate task not as part of
7003 the lib/configure creation.
7004 Generate acinlucde from files in config. Actually cat
7005 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7006 easier to upgrade .m4 files that really are external.
7008 * src/Spacing.h: moved using std::istringstream to right after
7009 <sstream>. This should fix the problem seen with some compilers.
7011 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7013 * src/lyx_cb.C: began some work to remove the dependency a lot of
7014 functions have on BufferView::text, even if not really needed.
7015 (GetCurrentTextClass): removed this func, it only hid the
7018 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7019 forgot this in last commit.
7021 * src/Bullet.C (bulletEntry): use static char const *[] for the
7022 tables, becuase of this the return arg had to change to string.
7024 (~Bullet): removed unneeded destructor
7026 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7027 (insetSleep): moved from Buffer
7028 (insetWakeup): moved from Buffer
7029 (insetUnlock): moved from Buffer
7031 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7032 from Buffer to BufferView.
7034 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7036 * config/ltmain.sh: updated to version 1.3.4 of libtool
7038 * config/ltconfig: updated to version 1.3.4 of libtool
7040 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7043 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7044 Did I get that right?
7046 * src/lyxlex.h: add a "using" directive or two.
7047 * src/Spacing.h: ditto.
7048 * src/insets/figinset.C: ditto.
7049 * src/support/filetools.C: ditto.
7050 * src/support/lstrings.C: ditto.
7051 * src/BufferView.C: ditto.
7052 * src/bufferlist.C: ditto.
7053 * src/lyx_cb.C: ditto.
7054 * src/lyxlex.C: ditto.
7056 * NEWS: add some changes for 1.1.4.
7058 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7060 * src/BufferView.C: first go at a TextCache to speed up switching
7063 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7065 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7066 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7067 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7068 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7071 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7072 members of the struct are correctly initialized to 0 (detected by
7074 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7075 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7077 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7078 pidwait, since it was allocated with "new". This was potentially
7079 very bad. Thanks to Michael Schmitt for running purify for us.
7082 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7084 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7086 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7088 1999-12-30 Allan Rae <rae@lyx.org>
7090 * lib/templates/IEEEtran.lyx: minor change
7092 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7093 src/mathed/formula.C (LocalDispatch): askForText changes
7095 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7096 know when a user has cancelled input. Fixes annoying problems with
7097 inserting labels and version control.
7099 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7101 * src/support/lstrings.C (tostr): rewritten to use strstream and
7104 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7106 * src/support/filetools.C (IsFileWriteable): use fstream to check
7107 (IsDirWriteable): use fileinfo to check
7109 * src/support/filetools.h (FilePtr): whole class deleted
7111 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7113 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7115 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7117 * src/bufferlist.C (write): use ifstream and ofstream instead of
7120 * src/Spacing.h: use istrstream instead of sscanf
7122 * src/mathed/math_defs.h: change first arg to istream from FILE*
7124 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7126 * src/mathed/math_parser.C: have yyis to be an istream
7127 (LexGetArg): use istream (yyis)
7129 (mathed_parse): ditto
7130 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7132 * src/mathed/formula.C (Read): rewritten to use istream
7134 * src/mathed/formulamacro.C (Read): rewritten to use istream
7136 * src/lyxlex.h (~LyXLex): deleted desturctor
7137 (getStream): new function, returns an istream
7138 (getFile): deleted funtion
7139 (IsOK): return is.good();
7141 * src/lyxlex.C (LyXLex): delete file and owns_file
7142 (setFile): open an filebuf and assign that to a istream instead of
7144 (setStream): new function, takes an istream as arg.
7145 (setFile): deleted function
7146 (EatLine): rewritten us use istream instead of FILE*
7150 * src/table.C (LyXTable): use istream instead of FILE*
7151 (Read): rewritten to take an istream instead of FILE*
7153 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7155 * src/buffer.C (Dispatch): remove an extraneous break statement.
7157 * src/support/filetools.C (QuoteName): change to do simple
7158 'quoting'. More work is necessary. Also changed to do nothing
7159 under emx (needs fix too).
7160 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7162 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7163 config.h.in to the AC_DEFINE_UNQUOTED() call.
7164 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7165 needs char * as argument (because Solaris 7 declares it like
7168 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7169 remove definition of BZERO.
7171 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7173 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7174 defined, "lyxregex.h" if not.
7176 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7178 (REGEX): new variable that is set to regex.c lyxregex.h when
7179 AM_CONDITIONAL USE_REGEX is set.
7180 (libsupport_la_SOURCES): add $(REGEX)
7182 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7185 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7188 * configure.in: add call to LYX_REGEX
7190 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7191 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7193 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7195 * lib/bind/fi_menus.bind: new file, from
7196 pauli.virtanen@saunalahti.fi.
7198 * src/buffer.C (getBibkeyList): pass the parameter delim to
7199 InsetInclude::getKeys and InsetBibtex::getKeys.
7201 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7202 is passed to Buffer::getBibkeyList
7204 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7205 instead of the hardcoded comma.
7207 * src/insets/insetbib.C (getKeys): make sure that there are not
7208 leading blanks in bibtex keys. Normal latex does not care, but
7209 harvard.sty seems to dislike blanks at the beginning of citation
7210 keys. In particular, the retturn value of the function is
7212 * INSTALL: make it clear that libstdc++ is needed and that gcc
7213 2.7.x probably does not work.
7215 * src/support/filetools.C (findtexfile): make debug message go to
7217 * src/insets/insetbib.C (getKeys): ditto
7219 * src/debug.C (showTags): make sure that the output is correctly
7222 * configure.in: add a comment for TWO_COLOR_ICON define.
7224 * acconfig.h: remove all the entries that already defined in
7225 configure.in or acinclude.m4.
7227 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7228 to avoid user name, date and copyright.
7230 1999-12-21 Juergen Vigna <jug@sad.it>
7232 * src/table.C (Read): Now read bogus row format informations
7233 if the format is < 5 so that afterwards the table can
7234 be read by lyx but without any format-info. Fixed the
7235 crash we experienced when not doing this.
7237 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7239 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7240 (RedoDrawingOfParagraph): ditto
7241 (RedoParagraphs): ditto
7242 (RemoveTableRow): ditto
7244 * src/text.C (Fill): rename arg paperwidth -> paper_width
7246 * src/buffer.C (insertLyXFile): rename var filename -> fname
7247 (writeFile): rename arg filename -> fname
7248 (writeFileAscii): ditto
7249 (makeLaTeXFile): ditto
7250 (makeLinuxDocFile): ditto
7251 (makeDocBookFile): ditto
7253 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7256 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7258 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7261 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7262 compiled by a C compiler not C++.
7264 * src/layout.h (LyXTextClass): added typedef for const_iterator
7265 (LyXTextClassList): added typedef for const_iterator + member
7266 functions begin and end.
7268 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7269 iterators to fill the choice_class.
7270 (updateLayoutChoice): rewritten to use iterators to fill the
7271 layoutlist in the toolbar.
7273 * src/BufferView.h (BufferView::work_area_width): removed unused
7276 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7278 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7279 (sgmlCloseTag): ditto
7281 * src/support/lstrings.h: return type of countChar changed to
7284 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7285 what version of this func to use. Also made to return unsigned int.
7287 * configure.in: call LYX_STD_COUNT
7289 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7290 conforming std::count.
7292 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7294 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7295 and a subscript would give bad display (patch from Dekel Tsur
7296 <dekel@math.tau.ac.il>).
7298 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7300 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7303 * src/chset.h: add a few 'using' directives
7305 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7306 triggered when no buffer is active
7308 * src/layout.C: removed `break' after `return' in switch(), since
7311 * src/lyx_main.C (init): make sure LyX can be ran in place even
7312 when libtool has done its magic with shared libraries. Fix the
7313 test for the case when the system directory has not been found.
7315 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7316 name for the latex file.
7317 (MenuMakeHTML): ditto
7319 * src/buffer.h: add an optional boolean argument, which is passed
7322 1999-12-20 Allan Rae <rae@lyx.org>
7324 * lib/templates/IEEEtran.lyx: small correction and update.
7326 * configure.in: Attempted to use LYX_PATH_HEADER
7328 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7330 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7331 input from JMarc. Now use preprocessor to find the header.
7332 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7333 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7334 LYX_STL_STRING_FWD. See comments in file.
7336 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7338 * The global MiniBuffer * minibuffer variable is dead.
7340 * The global FD_form_main * fd_form_main variable is dead.
7342 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7344 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7346 * src/table.h: add the LOstream.h header
7347 * src/debug.h: ditto
7349 * src/LyXAction.h: change the explaination of the ReadOnly
7350 attribute: is indicates that the function _can_ be used.
7352 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7355 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7357 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7363 * src/paragraph.C (GetWord): assert on pos>=0
7366 * src/support/lyxstring.C: condition the use of an invariant on
7368 * src/support/lyxstring.h: ditto
7370 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7371 Use LAssert.h instead of plain assert().
7373 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7375 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7376 * src/support/filetools.C: ditto
7378 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7381 * INSTALL: document the new configure flags
7383 * configure.in: suppress --with-debug; add --enable-assertions
7385 * acinclude.m4: various changes in alignment of help strings.
7387 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7389 * src/kbmap.C: commented out the use of the hash map in kb_map,
7390 beginning of movement to a stl::container.
7392 * several files: removed code that was not in effect when
7393 MOVE_TEXT was defined.
7395 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7396 for escaping should not be used. We can discuss if the string
7397 should be enclosed in f.ex. [] instead of "".
7399 * src/trans_mgr.C (insert): use the new returned value from
7400 encodeString to get deadkeys and keymaps done correctly.
7402 * src/chset.C (encodeString): changed to return a pair, to tell
7403 what to use if we know the string.
7405 * src/lyxscreen.h (fillArc): new function.
7407 * src/FontInfo.C (resize): rewritten to use more std::string like
7408 structore, especially string::replace.
7410 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7413 * configure.in (chmod +x some scripts): remove config/gcc-hack
7415 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7417 * src/buffer.C (writeFile): change once again the top comment in a
7418 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7419 instead of an hardcoded version number.
7420 (makeDocBookFile): ditto
7422 * src/version.h: add new define LYX_DOCVERSION
7424 * po/de.po: update from Pit Sütterlin
7425 * lib/bind/de_menus.bind: ditto.
7427 * src/lyxfunc.C (Dispatch): call MenuExport()
7428 * src/buffer.C (Dispatch): ditto
7430 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7431 LyXFunc::Dispatch().
7432 (MenuExport): new function, moved from
7433 LyXFunc::Dispatch().
7435 * src/trans_mgr.C (insert): small cleanup
7436 * src/chset.C (loadFile): ditto
7438 * lib/kbd/iso8859-1.cdef: add missing backslashes
7440 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7442 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7443 help with placing the manually drawn accents better.
7445 (Draw): x2 and hg changed to float to minimize rounding errors and
7446 help place the accents better.
7448 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7449 unsigned short to char is just wrong...cast the char to unsigned
7450 char instead so that the two values can compare sanely. This
7451 should also make the display of insetlatexaccents better and
7452 perhaps also some other insets.
7454 (lbearing): new function
7457 1999-12-15 Allan Rae <rae@lyx.org>
7459 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7460 header that provides a wrapper around the very annoying SGI STL header
7463 * src/support/lyxstring.C, src/LString.h:
7464 removed old SGI-STL-compatability attempts.
7466 * configure.in: Use LYX_STL_STRING_FWD.
7468 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7469 stl_string_fwd.h is around and try to determine it's location.
7470 Major improvement over previous SGI STL 3.2 compatability.
7471 Three small problems remain with this function due to my zero
7472 knowledge of autoconf. JMarc and lgb see the comments in the code.
7474 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7476 * src/broken_const.h, config/hack-gcc, config/README: removed
7478 * configure.in: remove --with-gcc-hack option; do not call
7481 * INSTALL: remove documentation of --with-broken-const and
7484 * acconfig.h: remove all trace of BROKEN_CONST define
7486 * src/buffer.C (makeDocBookFile): update version number in output
7488 (SimpleDocBookOnePar): fix an assert when trying to a character
7489 access beyond string length
7492 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7494 * po/de.po: fix the Export menu
7496 * lyx.man: update the description of -dbg
7498 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7499 (commandLineHelp): updated
7500 (easyParse): show list of available debug levels if -dbg is passed
7503 * src/Makefile.am: add debug.C
7505 * src/debug.h: moved some code to debug.C
7507 * src/debug.C: new file. Contains code to set and show debug
7510 * src/layout.C: remove 'break' after 'continue' in switch
7511 statements, since these cannot be reached.
7513 1999-12-13 Allan Rae <rae@lyx.org>
7515 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7516 (in_word_set): hash() -> math_hash()
7518 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7520 * acconfig.h: Added a test for whether we are using exceptions in the
7521 current compilation run. If so USING_EXCEPTIONS is defined.
7523 * config.in: Check for existance of stl_string_fwd.h
7524 * src/LString.h: If compiling --with-included-string and SGI's
7525 STL version 3.2 is present (see above test) we need to block their
7526 forward declaration of string and supply a __get_c_string().
7527 However, it turns out this is only necessary if compiling with
7528 exceptions enabled so I've a bit more to add yet.
7530 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7531 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7532 src/support/LRegex.h, src/undo.h:
7533 Shuffle the order of the included files a little to ensure that
7534 LString.h gets included before anything that includes stl_string_fwd.h
7536 * src/support/lyxstring.C: We need to #include LString.h instead of
7537 lyxstring.h to get the necessary definition of __get_c_string.
7538 (__get_c_string): New function. This is defined static just like SGI's
7539 although why they need to do this I'm not sure. Perhaps it should be
7540 in lstrings.C instead.
7542 * lib/templates/IEEEtran.lyx: New template file.
7544 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7546 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7547 * intl/Makefile.in (MKINSTALLDIRS): ditto
7549 * src/LyXAction.C (init): changed to hold the LFUN data in a
7550 automatic array in stead of in callso to newFunc, this speeds up
7551 compilation a lot. Also all the memory used by the array is
7552 returned when the init is completed.
7554 * a lot of files: compiled with -Wold-style-cast, changed most of
7555 the reported offenders to C++ style casts. Did not change the
7556 offenders in C files.
7558 * src/trans.h (Match): change argument type to unsigned int.
7560 * src/support/DebugStream.C: fix some types on the streambufs so
7561 that it works on a conforming implementation.
7563 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7565 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7567 * src/support/lyxstring.C: remove the inline added earlier since
7568 they cause a bunch of unsatisfied symbols when linking with dec
7569 cxx. Cxx likes to have the body of inlines at the place where they
7572 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7573 accessing negative bounds in array. This fixes the crash when
7574 inserting accented characters.
7575 * src/trans.h (Match): ditto
7577 * src/buffer.C (Dispatch): since this is a void, it should not try
7578 to return anything...
7580 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7582 * src/buffer.h: removed the two friends from Buffer. Some changes
7583 because of this. Buffer::getFileName and Buffer::setFileName
7584 renamed to Buffer::fileName() and Buffer::fileName(...).
7586 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7588 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7589 and Buffer::update(short) to BufferView. This move is currently
7590 controlled by a define MOVE_TEXT, this will be removed when all
7591 shows to be ok. This move paves the way for better separation
7592 between buffer contents and buffer view. One side effect is that
7593 the BufferView needs a rebreak when swiching buffers, if we want
7594 to avoid this we can add a cache that holds pointers to LyXText's
7595 that is not currently in use.
7597 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7600 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7602 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7604 * lyx_main.C: new command line option -x (or --execute) and
7605 -e (or --export). Now direct conversion from .lyx to .tex
7606 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7607 Unfortunately, X is still needed and the GUI pops up during the
7610 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7612 * src/Spacing.C: add a using directive to bring stream stuff into
7614 * src/paragraph.C: ditto
7615 * src/buffer.C: ditto
7617 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7618 from Lars' announcement).
7620 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7621 example files from Tino Meinen.
7623 1999-12-06 Allan Rae <rae@lyx.org>
7625 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7627 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7629 * src/support/lyxstring.C: added a lot of inline for no good
7632 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7633 latexWriteEndChanges, they were not used.
7635 * src/layout.h (operator<<): output operator for PageSides
7637 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7639 * some example files: loaded in LyX 1.0.4 and saved again to update
7640 certain constructs (table format)
7642 * a lot of files: did the change to use fstream/iostream for all
7643 writing of files. Done with a close look at Andre Poenitz's patch.
7645 * some files: whitespace changes.
7647 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7649 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7650 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7651 architecture, we provide our own. It is used unconditionnally, but
7652 I do not think this is a performance problem. Thanks to Angus
7653 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7654 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7656 (GetInset): use my_memcpy.
7660 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7661 it is easier to understand, but it uses less TeX-only constructs now.
7663 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7664 elements contain spaces
7666 * lib/configure: regenerated
7668 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7669 elements contain spaces; display the list of programs that are
7672 * autogen.sh: make sure lib/configure is executable
7674 * lib/examples/*: rename the tutorial examples to begin with the
7675 two-letters language code.
7677 * src/lyxfunc.C (getStatus): do not query current font if no
7680 * src/lyx_cb.C (RunScript): use QuoteName
7681 (MenuRunDvips): ditto
7682 (PrintApplyCB): ditto
7684 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7685 around argument, so that it works well with the current shell.
7686 Does not work properly with OS/2 shells currently.
7688 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7689 * src/LyXSendto.C (SendtoApplyCB): ditto
7690 * src/lyxfunc.C (Dispatch): ditto
7691 * src/buffer.C (runLaTeX): ditto
7692 (runLiterate): ditto
7693 (buildProgram): ditto
7695 * src/lyx_cb.C (RunScript): ditto
7696 (MenuMakeLaTeX): ditto
7698 * src/buffer.h (getLatexName): new method
7700 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7702 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7704 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7705 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7706 (create_math_panel): ditto
7708 * src/lyxfunc.C (getStatus): re-activate the code which gets
7709 current font and cursor; add test for export to html.
7711 * src/lyxrc.C (read): remove unreachable break statements; add a
7714 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7716 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7718 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7719 introduced by faulty regex.
7720 * src/buffer.C: ditto
7721 * src/lastfiles.C: ditto
7722 * src/paragraph.C: ditto
7723 * src/table.C: ditto
7724 * src/vspace.C: ditto
7725 * src/insets/figinset.C: ditto
7726 Note: most of these is absolutely harmless, except the one in
7727 src/mathed formula.C.
7729 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7731 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7732 operation, yielding correct results for the reLyX command.
7734 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7736 * src/support/filetools.C (ExpandPath): removed an over eager
7738 (ReplaceEnvironmentPath): ditto
7740 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7741 shows that we are doing something fishy in our code...
7745 * src/lyxrc.C (read): use a double switch trick to get more help
7746 from the compiler. (the same trick is used in layout.C)
7747 (write): new function. opens a ofstream and pass that to output
7748 (output): new function, takes a ostream and writes the lyxrc
7749 elemts to it. uses a dummy switch to make sure no elements are
7752 * src/lyxlex.h: added a struct pushpophelper for use in functions
7753 with more than one exit point.
7755 * src/lyxlex.[Ch] (GetInteger): made it const
7759 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7761 * src/layout.[hC] : LayoutTags splitted into several enums, new
7762 methods created, better error handling cleaner use of lyxlex. Read
7765 * src/bmtable.[Ch]: change some member prototypes because of the
7766 image const changes.
7768 * commandtags.h, src/LyXAction.C (init): new function:
7769 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7770 This file is not read automatically but you can add \input
7771 preferences to your lyxrc if you want to. We need to discuss how
7774 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7775 in .aux, also remove .bib and .bst files from dependencies when
7778 * src/BufferView.C, src/LyXView.C: add const_cast several places
7779 because of changes to images.
7781 * lib/images/*: same change as for images/*
7783 * lib/lyxrc.example: Default for accept_compound is false not no.
7785 * images/*: changed to be const, however I have som misgivings
7786 about this change so it might be changed back.
7788 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7790 * lib/configure, po/POTFILES.in: regenerated
7792 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7794 * config/lib_configure.m4: removed
7796 * lib/configure.m4: new file (was config/lib_configure.m4)
7798 * configure.in: do not test for rtti, since we do not use it.
7800 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7802 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7803 doubling of allocated space scheme. This makes it faster for large
7804 strings end to use less memory for small strings. xtra rememoved.
7806 * src/insets/figinset.C (waitalarm): commented out.
7807 (GhostscriptMsg): use static_cast
7808 (GhostscriptMsg): use new instead of malloc to allocate memory for
7809 cmap. also delete the memory after use.
7811 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7813 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7814 for changes in bibtex database or style.
7815 (runBibTeX): remove all .bib and .bst files from dep before we
7817 (run): use scanAuc in when dep file already exist.
7819 * src/DepTable.C (remove_files_with_extension): new method
7822 * src/DepTable.[Ch]: made many of the methods const.
7824 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7826 * src/bufferparams.C: make sure that the default textclass is
7827 "article". It used to be the first one by description order, but
7828 now the first one is "docbook".
7830 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7831 string; call Debug::value.
7832 (easyParse): pass complete argument to setDebuggingLevel().
7834 * src/debug.h (value): fix the code that parses debug levels.
7836 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7839 * src/LyXAction.C: use Debug::ACTION as debug channel.
7841 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7843 * NEWS: updated for the future 1.1.3 release.
7845 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7846 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7847 it should. This is of course a controversial change (since many
7848 people will find that their lyx workscreen is suddenly full of
7849 red), but done for the sake of correctness.
7851 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7852 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7854 * src/insets/inseterror.h, src/insets/inseturl.h,
7855 src/insets/insetinfo.h, src/insets/figinset.h,
7856 src/mathed/formulamacro.h, src/mathed/math_macro.h
7857 (EditMessage): add a missing const and add _() to make sure that
7860 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7861 src/insets/insetbib.C, src/support/filetools.C: add `using'
7864 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7865 doing 'Insert index of last word' at the beginning of a paragraph.
7867 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7869 * several files: white-space changes.
7871 * src/mathed/formula.C: removed IsAlpha and IsDigit
7873 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7874 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7877 * src/insets/figinset.C (GetPSSizes): don't break when
7878 "EndComments" is seen. But break when a boundingbox is read.
7880 * all classes inherited from Inset: return value of Clone
7881 changed back to Inset *.
7883 * all classes inherited form MathInset: return value of Clone
7884 changed back to MathedInset *.
7886 * src/insets/figinset.C (runqueue): use a ofstream to output the
7887 gs/ps file. Might need some setpresicion or setw. However I can
7888 see no problem with the current code.
7889 (runqueue): use sleep instead of the alarm/signal code. I just
7890 can't see the difference.
7892 * src/paragraph.C (LyXParagraph): reserve space in the new
7893 paragraph and resize the inserted paragraph to just fit.
7895 * src/lyxfunc.h (operator|=): added operator for func_status.
7897 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7898 check for readable file.
7900 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7901 check for readable file.
7902 (MenuMakeLinuxDoc): ditto
7903 (MenuMakeDocBook): ditto
7904 (MenuMakeAscii): ditto
7905 (InsertAsciiFile): split the test for openable and readable
7907 * src/bmtable.C (draw_bitmaptable): use
7908 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7910 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7911 findtexfile from LaTeX to filetools.
7913 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7914 instead of FilePtr. Needs to be verified by a literate user.
7916 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7918 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7919 (EditMessage): likewise.
7921 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7922 respectively as \textasciitilde and \textasciicircum.
7924 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7926 * src/support/lyxstring.h: made the methods that take iterators
7929 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7930 (regexMatch): made is use the real regex class.
7932 * src/support/Makefile.am: changed to use libtool
7934 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7936 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7938 (MathIsInset ++): changed several macros to be inline functions
7941 * src/mathed/Makefile.am: changed to use libtool
7943 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7945 * src/insets/inset* : Clone changed to const and return type is
7946 the true insettype not just Inset*.
7948 * src/insets/Makefile.am: changed to use libtool
7950 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7952 * src/undo.[Ch] : added empty() and changed some of the method
7955 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7957 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7958 setID use block<> for the bullets array, added const several places.
7960 * src/lyxfunc.C (getStatus): new function
7962 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7963 LyXAction, added const to several funtions.
7965 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7966 a std::map, and to store the dir items in a vector.
7968 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7971 * src/LyXView.[Ch] + other files : changed currentView to view.
7973 * src/LyXAction.[Ch] : ported from the old devel branch.
7975 * src/.cvsignore: added .libs and a.out
7977 * configure.in : changes to use libtool.
7979 * acinclude.m4 : inserted libtool.m4
7981 * .cvsignore: added libtool
7983 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7985 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7986 file name in insets and mathed directories (otherwise the
7987 dependency is not taken in account under cygwin).
7989 * src/text2.C (InsertString[AB]): make sure that we do not try to
7990 read characters past the string length.
7992 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7994 * lib/doc/LaTeXConfig.lyx.in,
7995 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7997 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7998 file saying who created them and when this heppened; this is
7999 useless and annoys tools like cvs.
8001 * lib/layouts/g-brief-{en,de}.layout,
8002 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8003 from Thomas Hartkens <thomas@hartkens.de>.
8005 * src/{insets,mathed}/Makefile.am: do not declare an empty
8006 LDFLAGS, so that it can be set at configure time (useful on Irix
8009 * lib/reLyX/configure.in: make sure that the prefix is set
8010 correctly in LYX_DIR.
8012 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8014 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8015 be used by 'command-sequence' this allows to bind a key to a
8016 sequence of LyX-commands
8017 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8019 * src/LyXAction.C: add "command-sequence"
8021 * src/LyXFunction.C: handling of "command-sequence"
8023 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8024 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8026 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8028 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8030 * src/buffer.C (writeFile): Do not output a comment giving user
8031 and date at the beginning of a .lyx file. This is useless and
8032 annoys cvs anyway; update version number to 1.1.
8034 * src/Makefile.am (LYX_DIR): add this definition, so that a
8035 default path is hardcoded in LyX.
8037 * configure.in: Use LYX_GNU_GETTEXT.
8039 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8040 AM_GNU_GETTEXT with a bug fixed.
8042 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8044 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8046 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8047 which is used to point to LyX data is now LYX_DIR_11x.
8049 * lyx.man: convert to a unix text file; small updates.
8051 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8053 * src/support/LSubstring.[Ch]: made the second arg of most of the
8054 constructors be a const reference.
8056 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8059 * src/support/lyxstring.[Ch] (swap): added missing member function
8060 and specialization of swap(str, str);
8062 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8064 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8065 trace of the old one.
8067 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8068 put the member definitions in undo.C.
8070 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8071 NEW_TEXT and have now only code that was included when this was
8074 * src/intl.C (LCombo): use static_cast
8076 (DispatchCallback): ditto
8078 * src/definitions.h: removed whole file
8080 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8082 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8083 parsing and stores in a std:map. a regex defines the file format.
8084 removed unneeded members.
8086 * src/bufferparams.h: added several enums from definitions.h here.
8087 Removed unsused destructor. Changed some types to use proper enum
8088 types. use block to have the temp_bullets and user_defined_bullets
8089 and to make the whole class assignable.
8091 * src/bufferparams.C (Copy): removed this functions, use a default
8094 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8097 * src/buffer.C (readLyXformat2): commend out all that have with
8098 oldpapersize to do. also comment out all that hve to do with
8099 insetlatex and insetlatexdel.
8100 (setOldPaperStuff): commented out
8102 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8104 * src/LyXAction.C: remove use of inset-latex-insert
8106 * src/mathed/math_panel.C (button_cb): use static_cast
8108 * src/insets/Makefile.am (insets_o_SOURCES): removed
8111 * src/support/lyxstring.C (helper): use the unsigned long
8112 specifier, UL, instead of a static_cast.
8114 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8116 * src/support/block.h: new file. to be used as a c-style array in
8117 classes, so that the class can be assignable.
8119 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8121 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8122 NULL, make sure to return an empty string (it is not possible to
8123 set a string to NULL).
8125 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8127 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8129 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8131 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8132 link line, so that Irix users (for example) can set it explicitely to
8135 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8136 it can be overidden at make time (static or dynamic link, for
8139 * src/vc-backend.C, src/LaTeXFeatures.h,
8140 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8141 statements to bring templates to global namespace.
8143 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8145 * src/support/lyxstring.C (operator[] const): make it standard
8148 * src/minibuffer.C (Init): changed to reflect that more
8149 information is given from the lyxvc and need not be provided here.
8151 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8153 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8155 * src/LyXView.C (UpdateTimerCB): use static_cast
8156 (KeyPressMask_raw_callback): ditto
8158 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8159 buffer_, a lot of changes because of this. currentBuffer() ->
8160 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8161 also changes to other files because of this.
8163 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8165 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8166 have no support for RCS and partial support for CVS, will be
8169 * src/insets/ several files: changes because of function name
8170 changes in Bufferview and LyXView.
8172 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8174 * src/support/LSubstring.[Ch]: new files. These implement a
8175 Substring that can be very convenient to use. i.e. is this
8177 string a = "Mary had a little sheep";
8178 Substring(a, "sheep") = "lamb";
8179 a is now "Mary has a little lamb".
8181 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8182 out patterns and subpatterns of strings. It is used by LSubstring
8183 and also by vc-backend.C
8185 * src/support/lyxstring.C: went over all the assertions used and
8186 tried to correct the wrong ones and flag which of them is required
8187 by the standard. some bugs found because of this. Also removed a
8188 couple of assertions.
8190 * src/support/Makefile.am (libsupport_a_SOURCES): added
8191 LSubstring.[Ch] and LRegex.[Ch]
8193 * src/support/FileInfo.h: have struct stat buf as an object and
8194 not a pointer to one, some changes because of this.
8196 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8197 information in layout when adding the layouts preamble to the
8200 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8203 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8204 because of bug in OS/2.
8206 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8208 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8209 \verbatim@font instead of \ttfamily, so that it can be redefined.
8211 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8212 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8213 src/layout.h, src/text2.C: add 'using' directive to bring the
8214 STL templates we need from the std:: namespace to the global one.
8215 Needed by DEC cxx in strict ansi mode.
8217 * src/support/LIstream.h,src/support/LOstream.h,
8218 src/support/lyxstring.h,src/table.h,
8219 src/lyxlookup.h: do not include <config.h> in header
8220 files. This should be done in the .C files only.
8222 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8226 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8228 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8229 from Kayvan to fix the tth invokation.
8231 * development/lyx.spec.in: updates from Kayvan to reflect the
8232 changes of file names.
8234 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8236 * src/text2.C (InsertStringB): use std::copy
8237 (InsertStringA): use std::copy
8239 * src/bufferlist.C: use a vector to store the buffers in. This is
8240 an internal change and should not affect any other thing.
8242 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8245 * src/text.C (Fill): fix potential bug, one off bug.
8247 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8249 * src/Makefile.am (lyx_main.o): add more files it depends on.
8251 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8253 * src/support/lyxstring.C: use size_t for the reference count,
8254 size, reserved memory and xtra.
8255 (internal_compare): new private member function. Now the compare
8256 functions should work for std::strings that have embedded '\0'
8258 (compare): all compare functions rewritten to use
8261 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8263 * src/support/lyxstring.C (compare): pass c_str()
8264 (compare): pass c_str
8265 (compare): pass c_str
8267 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8269 * src/support/DebugStream.C: <config.h> was not included correctly.
8271 * lib/configure: forgot to re-generate it :( I'll make this file
8272 auto generated soon.
8274 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8276 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8279 * src/support/lyxstring.C: some changes from length() to rep->sz.
8280 avoids a function call.
8282 * src/support/filetools.C (SpaceLess): yet another version of the
8283 algorithm...now per Jean-Marc's suggestions.
8285 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8287 * src/layout.C (less_textclass_desc): functor for use in sorting
8289 (LyXTextClass::Read): sort the textclasses after reading.
8291 * src/support/filetools.C (SpaceLess): new version of the
8292 SpaceLess functions. What problems does this one give? Please
8295 * images/banner_bw.xbm: made the arrays unsigned char *
8297 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8299 * src/support/lyxstring.C (find): remove bogus assertion in the
8300 two versions of find where this has not been done yet.
8302 * src/support/lyxlib.h: add missing int return type to
8305 * src/menus.C (ShowFileMenu): disable exporting to html if no
8306 html export command is present.
8308 * config/lib_configure.m4: add a test for an HTML converter. The
8309 programs checked for are, in this order: tth, latex2html and
8312 * lib/configure: generated from config/lib_configure.m4.
8314 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8315 html converter. The parameters are now passed through $$FName and
8316 $$OutName, instead of standard input/output.
8318 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8320 * lib/lyxrc.example: update description of \html_command.
8321 add "quotes" around \screen_font_xxx font setting examples to help
8322 people who use fonts with spaces in their names.
8324 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8326 * Distribution files: updates for v1.1.2
8328 * src/support/lyxstring.C (find): remove bogus assert and return
8329 npos for the same condition.
8331 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8333 * added patch for OS/2 from SMiyata.
8335 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8337 * src/text2.C (CutSelection): make space_wrapped a bool
8338 (CutSelection): dont declare int i until we have to.
8339 (alphaCounter): return a char const *.
8341 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8343 * src/support/syscall.C (Systemcalls::kill):
8344 src/support/filetools.C (PutEnv, PutEnvPath):
8345 src/lyx_cb.C (addNewlineAndDepth):
8346 src/FontInfo.C (FontInfo::resize): condition some #warning
8347 directives with WITH_WARNINGS.
8350 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8352 * src/layout.[Ch] + several files: access to class variables
8353 limited and made accessor functions instead a lot of code changed
8354 becuase of this. Also instead of returning pointers often a const
8355 reference is returned instead.
8357 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8359 * src/Makefile.am (dist-hook): added used to remove the CVS from
8360 cheaders upon creating a dist
8361 (EXTRA_DIST): added cheaders
8363 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8364 a character not as a small integer.
8366 * src/support/lyxstring.C (find): removed Assert and added i >=
8367 rep->sz to the first if.
8369 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8371 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8372 src/LyXView.C src/buffer.C src/bufferparams.C
8373 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8374 src/text2.C src/insets/insetinclude.C:
8375 lyxlayout renamed to textclasslist.
8377 * src/layout.C: some lyxerr changes.
8379 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8380 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8381 (LyXLayoutList): removed all traces of this class.
8382 (LyXTextClass::Read): rewrote LT_STYLE
8383 (LyXTextClass::hasLayout): new function
8384 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8385 both const and nonconst version.
8386 (LyXTextClass::delete_layout): new function.
8387 (LyXTextClassList::Style): bug fix. do the right thing if layout
8389 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8390 (LyXTextClassList::NameOfLayout): ditto
8391 (LyXTextClassList::Load): ditto
8393 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8395 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8397 * src/LyXAction.C (LookupFunc): added a workaround for sun
8398 compiler, on the other hand...we don't know if the current code
8399 compiles on sun at all...
8401 * src/support/filetools.C (CleanupPath): subst fix
8403 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8406 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8407 complained about this one?
8409 * src/insets/insetinclude.C (Latex): subst fix
8411 * src/insets/insetbib.C (getKeys): subst fix
8413 * src/LyXSendto.C (SendtoApplyCB): subst fix
8415 * src/lyx_main.C (init): subst fix
8417 * src/layout.C (Read): subst fix
8419 * src/lyx_sendfax_main.C (button_send): subst fix
8421 * src/buffer.C (RoffAsciiTable): subst fix
8423 * src/lyx_cb.C (MenuFax): subst fix
8424 (PrintApplyCB): subst fix
8426 1999-10-26 Juergen Vigna <jug@sad.it>
8428 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8430 (Read): Cleaned up this code so now we read only format vestion >= 5
8432 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8434 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8435 come nobody has complained about this one?
8437 * src/insets/insetinclude.C (Latex): subst fix
8439 * src/insets/insetbib.C (getKeys): subst fix
8441 * src/lyx_main.C (init): subst fix
8443 * src/layout.C (Read): subst fix
8445 * src/buffer.C (RoffAsciiTable): subst fix
8447 * src/lyx_cb.C (MenuFax): subst fix.
8449 * src/layout.[hC] + some other files: rewrote to use
8450 std::container to store textclasses and layouts in.
8451 Simplified, removed a lot of code. Make all classes
8452 assignable. Further simplifications and review of type
8453 use still to be one.
8455 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8456 lastfiles to create the lastfiles partr of the menu.
8458 * src/lastfiles.[Ch]: rewritten to use deque to store the
8459 lastfiles in. Uses fstream for reading and writing. Simplifies
8462 * src/support/syscall.C: remove explicit cast.
8464 * src/BufferView.C (CursorToggleCB): removed code snippets that
8466 use explicat C++ style casts instead of C style casts. also use
8467 u_vdata instea of passing pointers in longs.
8469 * src/PaperLayout.C: removed code snippets that were commented out.
8471 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8473 * src/lyx_main.C: removed code snippets that wer commented out.
8475 * src/paragraph.C: removed code snippets that were commented out.
8477 * src/lyxvc.C (logClose): use static_cast
8479 (viewLog): remove explicit cast to void*
8480 (showLog): removed old commented code
8482 * src/menus.C: use static_cast instead of C style casts. use
8483 u_vdata instead of u_ldata. remove explicit cast to (long) for
8484 pointers. Removed old code that was commented out.
8486 * src/insets/inset.C: removed old commented func
8488 * src/insets/insetref.C (InsetRef): removed old code that had been
8489 commented out for a long time.
8491 (escape): removed C style cast
8493 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8495 * src/insets/insetlatex.C (Draw): removed old commented code
8496 (Read): rewritten to use string
8498 * src/insets/insetlabel.C (escape): removed C style cast
8500 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8502 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8505 * src/insets/insetinclude.h: removed a couple of stupid bools
8507 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8508 (Clone): remove C style cast
8509 (getKeys): changed list to lst because of std::list
8511 * src/insets/inseterror.C (Draw): removed som old commented code.
8513 * src/insets/insetcommand.C (Draw): removed some old commented code.
8515 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8516 commented out forever.
8517 (bibitem_cb): use static_cast instead of C style cast
8518 use of vdata changed to u_vdata.
8520 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8522 (CloseUrlCB): use static_cast instead of C style cast.
8523 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8525 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8526 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8527 (CloseInfoCB): static_cast from ob->u_vdata instead.
8528 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8531 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8532 (C_InsetError_CloseErrorCB): forward the ob parameter
8533 (CloseErrorCB): static_cast from ob->u_vdata instead.
8535 * src/vspace.h: include LString.h since we use string in this class.
8537 * src/vspace.C (lyx_advance): changed name from advance because of
8538 nameclash with stl. And since we cannot use namespaces yet...I
8539 used a lyx_ prefix instead. Expect this to change when we begin
8542 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8544 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8545 and removed now defunct constructor and deconstructor.
8547 * src/BufferView.h: have backstack as a object not as a pointer.
8548 removed initialization from constructor. added include for BackStack
8550 * development/lyx.spec.in (%build): add CFLAGS also.
8552 * src/screen.C (drawFrame): removed another warning.
8554 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8556 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8557 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8558 README and ANNOUNCE a bit for the next release. More work is
8561 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8562 unbreakable if we are in freespacing mode (LyX-Code), but not in
8565 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8567 * src/BackStack.h: fixed initialization order in constructor
8569 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8571 * acinclude.m4 (VERSION): new rules for when a version is
8572 development, added also a variable for prerelease.
8573 (warnings): we set with_warnings=yes for prereleases
8574 (lyx_opt): prereleases compile with same optimization as development
8575 (CXXFLAGS): only use pedantic if we are a development version
8577 * src/BufferView.C (restorePosition): don't do anything if the
8580 * src/BackStack.h: added member empty, use this to test if there
8581 is anything to pop...
8583 1999-10-25 Juergen Vigna <jug@sad.it>
8586 * forms/layout_forms.fd +
8587 * forms/latexoptions.fd +
8588 * lyx.fd: changed for various form resize issues
8590 * src/mathed/math_panel.C +
8591 * src/insets/inseterror.C +
8592 * src/insets/insetinfo.C +
8593 * src/insets/inseturl.C +
8594 * src/insets/inseturl.h +
8597 * src/PaperLayout.C +
8598 * src/ParagraphExtra.C +
8599 * src/TableLayout.C +
8601 * src/layout_forms.C +
8608 * src/menus.C: fixed various resize issues. So now forms can be
8609 resized savely or not be resized at all.
8611 * forms/form_url.fd +
8612 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8615 * src/insets/Makefile.am: added files form_url.[Ch]
8617 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8619 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8620 (and presumably 6.2).
8622 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8623 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8624 remaining static member callbacks.
8626 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8629 * src/support/lyxstring.h: declare struct Srep as friend of
8630 lyxstring, since DEC cxx complains otherwise.
8632 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8634 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8636 * src/LaTeX.C (run): made run_bibtex also depend on files with
8638 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8639 are put into the dependency file.
8641 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8642 the code has shown itself to work
8643 (create_ispell_pipe): removed another warning, added a comment
8646 * src/minibuffer.C (ExecutingCB): removed code that has been
8647 commented out a long time
8649 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8650 out code + a warning.
8652 * src/support/lyxstring.h: comment out the three private
8653 operators, when compiling with string ansi conforming compilers
8656 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8658 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8659 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8662 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8665 * src/mathed/math_panel.C (create_math_panel): remove explicit
8668 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8671 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8672 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8673 to XCreatePixmapFromBitmapData
8674 (fl_set_bmtable_data): change the last argument to be unsigned
8676 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8677 and bh to be unsigned int, remove explicit casts in call to
8678 XReadBitmapFileData.
8680 * images/arrows.xbm: made the arrays unsigned char *
8681 * images/varsz.xbm: ditto
8682 * images/misc.xbm: ditto
8683 * images/greek.xbm: ditto
8684 * images/dots.xbm: ditto
8685 * images/brel.xbm: ditto
8686 * images/bop.xbm: ditto
8688 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8690 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8691 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8692 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8694 (LYX_CXX_CHEADERS): added <clocale> to the test.
8696 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8698 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8700 * src/support/lyxstring.C (append): fixed something that must be a
8701 bug, rep->assign was used instead of rep->append.
8703 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8706 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8707 lyx insert double chars. Fix spotted by Kayvan.
8709 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8711 * Fixed the tth support. I messed up with the Emacs patch apply feature
8712 and omitted the changes in lyxrc.C.
8714 1999-10-22 Juergen Vigna <jug@sad.it>
8716 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8718 * src/lyx_cb.C (MenuInsertRef) +
8719 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8720 the form cannot be resized under it limits (fixes a segfault)
8722 * src/lyx.C (create_form_form_ref) +
8723 * forms/lyx.fd: Changed Gravity on name input field so that it is
8726 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8728 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8729 <ostream> and <istream>.
8731 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8732 whether <fstream> provides the latest standard features, or if we
8733 have an oldstyle library (like in egcs).
8734 (LYX_CXX_STL_STRING): fix the test.
8736 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8737 code on MODERN_STL_STREAM.
8739 * src/support/lyxstring.h: use L{I,O}stream.h.
8741 * src/support/L{I,O}stream.h: new files, designed to setup
8742 correctly streams for our use
8743 - includes the right header depending on STL capabilities
8744 - puts std::ostream and std::endl (for LOStream.h) or
8745 std::istream (LIStream.h) in toplevel namespace.
8747 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8749 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8750 was a bib file that had been changed we ensure that bibtex is run.
8751 (runBibTeX): enhanced to extract the names of the bib files and
8752 getting their absolute path and enter them into the dep file.
8753 (findtexfile): static func that is used to look for tex-files,
8754 checks for absolute patchs and tries also with kpsewhich.
8755 Alternative ways of finding the correct files are wanted. Will
8757 (do_popen): function that runs a command using popen and returns
8758 the whole output of that command in a string. Should be moved to
8761 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8762 file with extension ext has changed.
8764 * src/insets/figinset.C: added ifdef guards around the fl_free
8765 code that jug commented out. Now it is commented out when
8766 compiling with XForms == 0.89.
8768 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8769 to lyxstring.C, and only keep a forward declaration in
8770 lyxstring.h. Simplifies the header file a bit and should help a
8771 bit on compile time too. Also changes to Srep will not mandate a
8772 recompile of code just using string.
8773 (~lyxstring): definition moved here since it uses srep.
8774 (size): definition moved here since it uses srep.
8776 * src/support/lyxstring.h: removed a couple of "inline" that should
8779 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8781 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8784 1999-10-21 Juergen Vigna <jug@sad.it>
8786 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8787 set to left if I just remove the width entry (or it is empty).
8789 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8790 paragraph when having dummy paragraphs.
8792 1999-10-20 Juergen Vigna <jug@sad.it>
8794 * src/insets/figinset.C: just commented some fl_free_form calls
8795 and added warnings so that this calls should be activated later
8796 again. This avoids for now a segfault, but we have a memory leak!
8798 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8799 'const char * argument' to 'string argument', this should
8800 fix some Asserts() in lyxstring.C.
8802 * src/lyxfunc.h: Removed the function argAsString(const char *)
8803 as it is not used anymore.
8805 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8807 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8810 * src/Literate.h: some funcs moved from public to private to make
8811 interface clearer. Unneeded args removed.
8813 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8815 (scanBuildLogFile): ditto
8817 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8818 normal TeX Error. Still room for improvement.
8820 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8822 * src/buffer.C (insertErrors): changes to make the error
8823 desctription show properly.
8825 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8828 * src/support/lyxstring.C (helper): changed to use
8829 sizeof(object->rep->ref).
8830 (operator>>): changed to use a pointer instead.
8832 * src/support/lyxstring.h: changed const reference & to value_type
8833 const & lets see if that helps.
8835 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8837 * Makefile.am (rpmdist): fixed to have non static package and
8840 * src/support/lyxstring.C: removed the compilation guards
8842 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8845 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8846 conditional compile of lyxstring.Ch
8848 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8849 stupid check, but it is a lot better than the bastring hack.
8850 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8852 * several files: changed string::erase into string::clear. Not
8855 * src/chset.C (encodeString): use a char temporary instead
8857 * src/table.C (TexEndOfCell): added tostr around
8858 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8859 (TexEndOfCell): ditto
8860 (TexEndOfCell): ditto
8861 (TexEndOfCell): ditto
8862 (DocBookEndOfCell): ditto
8863 (DocBookEndOfCell): ditto
8864 (DocBookEndOfCell): ditto
8865 (DocBookEndOfCell): ditto
8867 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8869 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8871 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8872 (MenuBuildProg): added tostr around ret
8873 (MenuRunChktex): added tostr around ret
8874 (DocumentApplyCB): added tostr around ret
8876 * src/chset.C (encodeString): added tostr around t->ic
8878 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8879 (makeLaTeXFile): added tostr around tocdepth
8880 (makeLaTeXFile): added tostr around ftcound - 1
8882 * src/insets/insetbib.C (setCounter): added tostr around counter.
8884 * src/support/lyxstring.h: added an operator+=(int) to catch more
8887 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8888 (lyxstring): We DON'T allow NULL pointers.
8890 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8892 * src/mathed/math_macro.C (MathMacroArgument::Write,
8893 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8894 when writing them out.
8896 * src/LString.C: remove, since it is not used anymore.
8898 * src/support/lyxstring.C: condition the content to
8899 USE_INCLUDED_STRING macro.
8901 * src/mathed/math_symbols.C, src/support/lstrings.C,
8902 src/support/lyxstring.C: add `using' directive to specify what
8903 we need in <algorithm>. I do not think that we need to
8904 conditionalize this, but any thought is appreciated.
8906 * many files: change all callback functions to "C" linkage
8907 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8908 strict_ansi. Those who were static are now global.
8909 The case of callbacks which are static class members is
8910 trickier, since we have to make C wrappers around them (see
8911 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8912 did not finish this yet, since it defeats the purpose of
8913 encapsulation, and I am not sure what the best route is.
8915 1999-10-19 Juergen Vigna <jug@sad.it>
8917 * src/support/lyxstring.C (lyxstring): we permit to have a null
8918 pointer as assignment value and just don't assign it.
8920 * src/vspace.C (nextToken): corrected this function substituting
8921 find_first(_not)_of with find_last_of.
8923 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8924 (TableOptCloseCB) (TableSpeCloseCB):
8925 inserted fl_set_focus call for problem with fl_hide_form() in
8928 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8930 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8933 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8935 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8936 LyXLex::next() and not eatline() to get its argument.
8938 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8940 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8941 instead, use fstreams for io of the depfile, removed unneeded
8942 functions and variables.
8944 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8945 vector instead, removed all functions and variables that is not in
8948 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8950 * src/buffer.C (insertErrors): use new interface to TeXError
8952 * Makefile.am (rpmdist): added a rpmdist target
8954 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8955 per Kayvan's instructions.
8957 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8959 * src/Makefile.am: add a definition for localedir, so that locales
8960 are found after installation (Kayvan)
8962 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8964 * development/.cvsignore: new file.
8966 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8968 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8969 C++ compiler provides wrappers for C headers and use our alternate
8972 * configure.in: use LYX_CXX_CHEADERS.
8974 * src/cheader/: new directory, populated with cname headers from
8975 libstdc++-2.8.1. They are a bit old, but probably good enough for
8976 what we want (support compilers who lack them).
8978 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8979 from includes. It turns out is was stupid.
8981 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8983 * lib/Makefile.am (install-data-local): forgot a ';'
8984 (install-data-local): forgot a '\'
8985 (libinstalldirs): needed after all. reintroduced.
8987 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8989 * configure.in (AC_OUTPUT): added lyx.spec
8991 * development/lyx.spec: removed file
8993 * development/lyx.spec.in: new file
8995 * po/*.po: merged with lyx.pot becuase of make distcheck
8997 * lib/Makefile.am (dist-hook): added dist-hook so that
8998 documentation files will be included when doing a make
8999 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9000 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9002 more: tried to make install do the right thing, exclude CVS dirs
9005 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9006 Path would fit in more nicely.
9008 * all files that used to use pathstack: uses now Path instead.
9009 This change was a lot easier than expected.
9011 * src/support/path.h: new file
9013 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9015 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9017 * src/support/lyxstring.C (getline): Default arg was given for
9020 * Configure.cmd: removed file
9022 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9024 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9025 streams classes and types, add the proper 'using' statements when
9026 MODERN_STL is defined.
9028 * src/debug.h: move the << operator definition after the inclusion
9031 * src/support/filetools.C: include "LAssert.h", which is needed
9034 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9037 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9038 include "debug.h" to define a proper ostream.
9040 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9042 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9043 method to the SystemCall class which can kill a process, but it's
9044 not fully implemented yet.
9046 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9048 * src/support/FileInfo.h: Better documentation
9050 * src/lyxfunc.C: Added support for buffer-export html
9052 * src/menus.C: Added Export->As HTML...
9054 * lib/bind/*.bind: Added short-cut for buffer-export html
9056 * src/lyxrc.*: Added support for new \tth_command
9058 * lib/lyxrc.example: Added stuff for new \tth_command
9060 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9062 * lib/Makefile.am (IMAGES): removed images/README
9063 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9064 installes in correct place. Check permisions is installed
9067 * src/LaTeX.C: some no-op changes moved declaration of some
9070 * src/LaTeX.h (LATEX_H): changed include guard name
9072 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9074 * lib/reLyX/Makefile.am: install noweb2lyx.
9076 * lib/Makefile.am: install configure.
9078 * lib/reLyX/configure.in: declare a config aux dir; set package
9079 name to lyx (not sure what the best solution is); generate noweb2lyx.
9081 * lib/layouts/egs.layout: fix the bibliography layout.
9083 1999-10-08 Jürgen Vigna <jug@sad.it>
9085 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9086 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9087 it returned without continuing to search the path.
9089 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9091 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9092 also fixes a bug. It is not allowed to do tricks with std::strings
9093 like: string a("hei"); &a[e]; this will not give what you
9094 think... Any reason for the complexity in this func?
9096 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9098 * Updated README and INSTALL a bit, mostly to check that my
9099 CVS rights are correctly set up.
9101 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9103 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9104 does not allow '\0' chars but lyxstring and std::string does.
9106 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9108 * autogen.sh (AUTOCONF): let the autogen script create the
9109 POTFILES.in file too. POTFILES.in should perhaps now not be
9110 included in the cvs module.
9112 * some more files changed to use C++ includes instead of C ones.
9114 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9116 (Reread): added tostr to nlink. buggy output otherwise.
9117 (Reread): added a string() around szMode when assigning to Buffer,
9118 without this I got a log of garbled info strings.
9120 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9123 * I have added several ostream & operator<<(ostream &, some_type)
9124 functions. This has been done to avoid casting and warnings when
9125 outputting enums to lyxerr. This as thus eliminated a lot of
9126 explicit casts and has made the code clearer. Among the enums
9127 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9128 mathed enums, some font enum the Debug::type enum.
9130 * src/support/lyxstring.h (clear): missing method. equivalent of
9133 * all files that contained "stderr": rewrote constructs that used
9134 stderr to use lyxerr instead. (except bmtable)
9136 * src/support/DebugStream.h (level): and the passed t with
9137 Debug::ANY to avoid spurious bits set.
9139 * src/debug.h (Debug::type value): made it accept strings of the
9142 * configure.in (Check for programs): Added a check for kpsewhich,
9143 the latex generation will use this later to better the dicovery of
9146 * src/BufferView.C (create_view): we don't need to cast this to
9147 (void*) that is done automatically.
9148 (WorkAreaButtonPress): removed some dead code.
9150 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9152 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9153 is not overwritten when translated (David Sua'rez de Lis).
9155 * lib/CREDITS: Added David Sua'rez de Lis
9157 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9159 * src/bufferparams.C (BufferParams): default input encoding is now
9162 * acinclude.m4 (cross_compiling): comment out macro
9163 LYX_GXX_STRENGTH_REDUCE.
9165 * acconfig.h: make sure that const is not defined (to empty) when
9166 we are compiling C++. Remove commented out code using SIZEOF_xx
9169 * configure.in : move the test for const and inline as late as
9170 possible so that these C tests do not interefere with C++ ones.
9171 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9172 has not been proven.
9174 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9176 * src/table.C (getDocBookAlign): remove bad default value for
9179 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9181 (ShowFileMenu2): ditto.
9183 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9186 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9188 * Most files: finished the change from the old error code to use
9189 DebugStream for all lyxerr debugging. Only minor changes remain
9190 (e.g. the setting of debug levels using strings instead of number)
9192 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9194 * src/layout.C (Add): Changed to use compare_no_case instead of
9197 * src/FontInfo.C: changed loop variable type too string::size_type.
9199 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9201 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9202 set ETAGS_ARGS to --c++
9204 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9206 * src/table.C (DocBookEndOfCell): commented out two unused variables
9208 * src/paragraph.C: commented out four unused variables.
9210 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9211 insed a if clause with type string::size_type.
9213 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9216 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9218 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9219 variable, also changed loop to go from 0 to lenght + 1, instead of
9220 -1 to length. This should be correct.
9222 * src/LaTeX.C (scanError): use string::size_type as loop variable
9225 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9226 (l.896) since y_tmp and row was not used anyway.
9228 * src/insets/insetref.C (escape): use string::size_type as loop
9231 * src/insets/insetquotes.C (Width): use string::size_type as loop
9233 (Draw): use string::size_type as loop variable type.
9235 * src/insets/insetlatexaccent.C (checkContents): use
9236 string::size_type as loop variable type.
9238 * src/insets/insetlabel.C (escape): use string::size_type as loop
9241 * src/insets/insetinfo.C: added an extern for current_view.
9243 * src/insets/insetcommand.C (scanCommand): use string::size_type
9244 as loop variable type.
9246 * most files: removed the RCS tags. With them we had to recompile
9247 a lot of files after a simple cvs commit. Also we have never used
9248 them for anything meaningful.
9250 * most files: tags-query-replace NULL 0. As adviced several plases
9251 we now use "0" instead of "NULL" in our code.
9253 * src/support/filetools.C (SpaceLess): use string::size_type as
9256 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9258 * src/paragraph.C: fixed up some more string stuff.
9260 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9262 * src/support/filetools.h: make modestr a std::string.
9264 * src/filetools.C (GetEnv): made ch really const.
9266 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9267 made code that used these use max/min from <algorithm> instead.
9269 * changed several c library include files to their equivalent c++
9270 library include files. All is not changed yet.
9272 * created a support subdir in src, put lyxstring and lstrings
9273 there + the extra files atexit, fileblock, strerror. Created
9274 Makefile.am. edited configure.in and src/Makefile.am to use this
9275 new subdir. More files moved to support.
9277 * imported som of the functions from repository lyx, filetools
9279 * ran tags-query-replace on LString -> string, corrected the bogus
9280 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9281 is still some errors in there. This is errors where too much or
9282 too litle get deleted from strings (string::erase, string::substr,
9283 string::replace), there can also be some off by one errors, or
9284 just plain wrong use of functions from lstrings. Viewing of quotes
9287 * LyX is now running fairly well with string, but there are
9288 certainly some bugs yet (see above) also string is quite different
9289 from LString among others in that it does not allow null pointers
9290 passed in and will abort if it gets any.
9292 * Added the revtex4 files I forgot when setting up the repository.
9294 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9296 * All over: Tried to clean everything up so that only the files
9297 that we really need are included in the cvs repository.
9298 * Switched to use automake.
9299 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9300 * Install has not been checked.
9302 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9304 * po/pt.po: Three errors:
9305 l.533 and l.538 format specification error
9306 l. 402 duplicate entry, I just deleted it.