1 2000-08-11 Juergen Vigna <jug@sad.it>
3 * src/insets/insetgraphics.C (InsetGraphics): changing init
4 order because of warnings.
6 * src/frontends/xforms/forms/makefile: adding patching .C with
9 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
10 from .C.patch to .c.patch
12 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
13 order because of warning.
15 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
17 * src/frontends/Liason.C (setMinibuffer): new helper function
19 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
21 * src/lyxfunc.C (Dispatch): calling new Document-Layout
23 * lib/ui/default.ui: commented out PaperLayout entry
25 * src/frontends/xforms/form_document.[Ch]: new added files
27 * src/frontends/xforms/FormDocument.[Ch]: ditto
29 * src/frontends/xforms/forms/form_document.fd: ditto
31 * src/frontends/xforms/forms/form_document.C.patch: ditto
33 2000-08-10 Juergen Vigna <jug@sad.it>
35 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
36 (InsetGraphics): initialized cacheHandle to 0.
37 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
39 2000-08-10 Baruch Even <baruch.even@writeme.com>
41 * src/graphics/GraphicsCache.h:
42 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
45 * src/graphics/GraphicsCacheItem.h:
46 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
49 * src/graphics/GraphicsCacheItem_pimpl.h:
50 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
53 * src/insets/insetgraphics.h:
54 * src/insets/insetgraphics.C: Changed from using a signal notification
55 to polling when image is not loaded.
57 2000-08-10 Allan Rae <rae@lyx.org>
59 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
60 that there are two functions that have to been taken out of line by
61 hand and aren't taken care of in the script. (Just a reminder note)
63 * sigc++/macros/*.h.m4: Updated as above.
65 2000-08-09 Juergen Vigna <jug@sad.it>
67 * src/insets/insettext.C (draw): small fix for clearing rectangle.
69 * src/insets/insettabular.C: make drawing of single cell smarter.
71 2000-08-09 Marko Vendelin <markov@ioc.ee>
72 * src/frontends/gnome/Menubar_pimpl.C
73 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
74 implementation: new files
76 * src/frontends/gnome/mainapp.C
77 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
80 * src/main.C: create Gnome main window
82 * src/frontends/xforms/Menubar_pimpl.h
83 * src/frontends/Menubar.C
84 * src/frontends/Menubar.h: added method Menubar::update that calls
85 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
87 * src/LyXView.C: calls Menubar::update to update the state
90 * src/frontends/gnome/Makefile.am: added new files
92 * src/frontends/Makefile.am: added frontend compiler options
94 2000-08-08 Juergen Vigna <jug@sad.it>
96 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
98 * src/bufferlist.C (close):
99 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
100 documents if exiting without saving.
102 * src/buffer.C (save): use removeAutosaveFile()
104 * src/support/filetools.C (removeAutosaveFile): new function.
106 * src/lyx_cb.C (MenuWrite): returns a bool now.
107 (MenuWriteAs): check if file could really be saved and revert to the
109 (MenuWriteAs): removing old autosavefile if existant.
111 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
112 before Goto toggle declaration, because of compiler warning.
114 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
116 * src/lyxfunc.C (MenuNew): small fix.
118 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
120 * src/bufferlist.C (newFile):
121 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
123 * src/lyxrc.C: added new_ask_filename tag
125 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
127 * src/lyx.fd: removed code pertaining to form_ref
128 * src/lyx.[Ch]: ditto
129 * src/lyx_cb.C: ditto
130 * src/lyx_gui.C: ditto
131 * src/lyx_gui_misc.C: ditto
133 * src/BufferView_pimpl.C (restorePosition): update buffer only
136 * src/commandtags.h (LFUN_REFTOGGLE): removed
137 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
138 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
139 (LFUN_REFBACK): renamed LFUN_REF_BACK
141 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
143 * src/lyxfunc.C (Dispatch): ditto.
144 InsertRef dialog is now GUI-independent.
146 * src/texrow.C: added using std::endl;
148 * src/insets/insetref.[Ch]: strip out large amounts of code.
149 The inset is now a container and this functionality is now
150 managed by a new FormRef dialog
152 * src/frontends/Dialogs.h (showRef, createRef): new signals
154 * src/frontends/xforms/FormIndex.[Ch],
155 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
156 when setting dialog's min/max size
157 * src/frontends/xforms/FormIndex.[Ch]: ditto
159 * src/frontends/xforms/FormRef.[Ch],
160 src/frontends/xforms/forms/form_ref.fd: new xforms
161 implementation of an InsetRef dialog
163 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
166 * src/graphics/XPM_Renderer.C (isImageFormatOK):
167 ios::nocreate is not part of the standard. Removed.
169 2000-08-07 Baruch Even <baruch.even@writeme.com>
171 * src/graphics/Renderer.h:
172 * src/graphics/Renderer.C: Added base class for rendering of different
173 image formats into Pixmaps.
175 * src/graphics/XPM_Renderer.h:
176 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
177 in a different class.
179 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
180 easily add support for other formats.
182 * src/insets/figinset.C: plugged a leak of an X resource.
184 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
186 * src/CutAndPaste.[Ch]: make all metods static.
188 * development/Code_rules/Rules: more work, added section on
189 Exceptions, and a References section.
191 * a lot of header files: work to make doc++ able to generate the
192 source documentation, some workarounds of doc++ problems. Doc++ is
193 now able to generate the documentation.
195 2000-08-07 Juergen Vigna <jug@sad.it>
197 * src/insets/insettabular.C (recomputeTextInsets): removed function
199 * src/tabular.C (SetWidthOfMulticolCell):
201 (calculate_width_of_column_NMC): fixed return value so that it really
202 only returns true if the column-width has changed (there where
203 problems with muliticolumn-cells in this column).
205 2000-08-04 Juergen Vigna <jug@sad.it>
207 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
208 also on the scrollstatus of the inset.
209 (workAreaMotionNotify): ditto.
211 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
213 2000-08-01 Juergen Vigna <jug@sad.it>
215 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
218 * src/LyXAction.C (init):
219 * src/insets/inset.C (LocalDispatch): added support for
222 * src/insets/inset.C (scroll): new functions.
224 * src/insets/insettext.C (removeNewlines): new function.
225 (SetAutoBreakRows): removes forced newlines in the text of the
226 paragraph if autoBreakRows is set to false.
228 * src/tabular.C (Latex): generates a parbox around the cell contents
231 * src/frontends/xforms/FormTabular.C (local_update): removed
232 the radio_useparbox button.
234 * src/tabular.C (UseParbox): new function
236 2000-08-06 Baruch Even <baruch.even@writeme.com>
238 * src/graphics/GraphicsCache.h:
239 * src/graphics/GraphicsCache.C:
240 * src/graphics/GraphicsCacheItem.h:
241 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
244 * src/insets/insetgraphics.h:
245 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
246 drawing of the inline image.
248 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
249 into the wrong position.
251 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
254 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
256 * src/support/translator.h: move all typedefs to public section
258 * src/support/filetools.C (MakeLatexName): return string const
261 (FileOpenSearch): ditto
263 (LibFileSearch): ditto
264 (i18nLibFileSearch): ditto
267 (CreateTmpDir): ditto
268 (CreateBufferTmpDir): ditto
269 (CreateLyXTmpDir): ditto
274 (OnlyFilename): ditto
276 (NormalizePath): ditto
278 (GetFileContents): ditto
279 (ReplaceEnvironmentPath): ditto
282 (ChangeExtension): ditto
283 (MakeDisplayPath): ditto
284 (do_popen): return cmdret const
285 (findtexfile): return string const
287 * src/support/DebugStream.h: add some /// to please doc++
289 * src/frontends/DialogBase.h (endif): add some /// to please doc++
291 * src/texrow.C (same_rownumber): functor to use with find_if
292 (getIdFromRow): rewritten to use find_if and to not update the
293 positions. return true if row is found
294 (increasePos): new method, use to update positions
296 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
298 * src/lyxlex_pimpl.C (verifyTable): new method
301 (GetString): return string const
302 (pushTable): rewrite to use std::stack
304 (setFile): better check
307 * src/lyxlex.h: make LyXLex noncopyable
309 * src/lyxlex.C (text): return char const * const
310 (GetString): return string const
311 (getLongString): return string const
313 * src/lyx_gui_misc.C (askForText): return pair<...> const
315 * src/lastfiles.[Ch] (operator): return string const
317 * src/buffer.C (parseSingleLyXformat2Token): pass string to
318 istringstream not char const *.
319 move token.end() out of loop.
320 (readFile): move initializaton of token
322 * src/BufferView2.C (insertErrors): run texrow.increasePos if
323 getIdFromRow is successful.
325 * lib/bind/emacs.bind: don't include menus bind
327 * development/Code_rules/Rules: the beginnings of making this
328 better and covering more of the unwritten rules that we have.
330 * development/Code_rules/Recommendations: a couple of wording
333 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
335 * src/support/strerror.c: remove C++ comment.
337 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
339 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
340 LFUN_INDEX_INSERT_LAST
342 * src/texrow.C (getIdFromRow): changed from const_iterator to
343 iterator, allowing code to compile with DEC cxx
345 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
346 stores part of the class, as suggested by Allan. Will allow
348 (apply): test to apply uses InsetCommandParams operator!=
350 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
351 (apply): test to apply uses InsetCommandParams operator!=
353 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
354 stores part of the class.
355 (update): removed limits on min/max size.
357 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
358 (apply): test to apply uses InsetCommandParams operator!=
360 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
361 (Read, Write, scanCommand, getCommand): moved functionality
362 into InsetCommandParams.
364 (getScreenLabel): made pure virtual
365 new InsetCommandParams operators== and !=
367 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
368 c-tors based on InsetCommandParams. Removed others.
369 * src/insets/insetinclude.[Ch]: ditto
370 * src/insets/insetlabel.[Ch]: ditto
371 * src/insets/insetparent.[Ch]: ditto
372 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
374 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
375 insets derived from InsetCommand created using similar c-tors
376 based on InsetCommandParams
377 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
378 * src/menus.C (ShowRefsMenu): ditto
379 * src/paragraph.C (Clone): ditto
380 * src/text2.C (SetCounter): ditto
381 * src/lyxfunc.C (Dispatch) ditto
382 Also recreated old InsetIndex behaviour exactly. Can now
383 index-insert at the start of a paragraph and index-insert-last
384 without launching the pop-up.
386 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
388 * lib/lyxrc.example: mark te pdf options as non functional.
390 * src/support/lstrings.C (strToInt): move initalization of tmpstr
391 (isStrDbl): move tmpstr.end() out of loop.
392 (strToDbl): move intialization of tmpstr
393 (lowercase): return string const and move tmp.end() out of loop.
394 (uppercase): return string const and move tmp.edn() out of loop.
395 (prefixIs): add assertion
400 (containsOnly): ditto
401 (containsOnly): ditto
402 (containsOnly): ditto
403 (countChar): make last arg char not char const
404 (token): return string const
405 (subst): return string const, move tmp.end() out of loop.
406 (subst): return string const, add assertion
407 (strip): return string const
408 (frontStrip): return string const, add assertion
409 (frontStrip): return string const
414 * src/support/lstrings.C: add inclde "LAssert.h"
415 (isStrInt): move tmpstr.end() out of loop.
417 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
418 toollist.end() out of loop.
419 (deactivate): move toollist.end() out of loop.
420 (update): move toollist.end() out of loop.
421 (updateLayoutList): move tc.end() out of loop.
422 (add): move toollist.end() out of loop.
424 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
425 md.end() out of loop.
427 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
429 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
432 * src/paragraph.C (Erase): move fontlist.end() out of loop.
433 (Erase): move insetlist.end() out of loop.
435 * src/lyx_sendfax_main.C: make show_logfile static and to take a
436 ref to const string as first arg. Move initialization of some
437 variables, whitespace changes.
439 * src/kbmap.C (defkey): move table.end() out of loop.
440 (kb_keymap): move table.end() out of loop.
441 (findbinding): move table.end() out of loop.
443 * src/MenuBackend.C (hasMenu): move end() out of loop.
444 (getMenu): move end() out of loop.
445 (getMenu): move menulist_.end() out of loop.
447 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
449 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
452 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
453 (getFromLyXName): move infotab.end() out of loop.
455 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
456 -fvtable-thunks -ffunction-sections -fdata-sections
458 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
460 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
463 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
465 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
467 * src/frontends/xforms/FormCitation.[Ch],
468 src/frontends/xforms/FormIndex.[Ch],
469 src/frontends/xforms/FormToc.[Ch],
470 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
472 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
474 * src/commandtags.h: renamed, created some flags for citation
477 * src/lyx_gui_misc.C: stripped out old FD_index_form code
479 * src/lyxfunc.C (dispatch): use signals to insert index entry
481 * src/frontends/Dialogs.h: new signal createIndex
483 * src/frontends/xforms/FormCommand.[Ch],
484 src/frontends/xforms/FormCitation.[Ch],
485 src/frontends/xforms/FormToc.[Ch],
486 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
488 * src/insets/insetindex.[Ch]: GUI-independent
490 * src/frontends/xforms/FormIndex.[Ch],
491 * src/frontends/xforms/forms/form_index.fd: xforms implementation
494 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
496 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
497 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
499 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
501 * src/insets/insetref.C (Latex): rewrite so that there is now
502 question that a initialization is requested.
504 * src/insets/insetcommand.h: reenable the hide signal
506 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
508 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
509 fix handling of shortcuts (many bugs :)
510 (add_lastfiles): ditto.
512 * lib/ui/default.ui: fix a few shortcuts.
514 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
516 * Makefile.am: Fix ``rpmdist'' target to return the exit
517 status of the ``rpm'' command, instead of the last command in
518 the chain (the ``rm lyx.xpm'' command, which always returns
521 2000-08-02 Allan Rae <rae@lyx.org>
523 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
524 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
525 * src/frontends/xforms/FormToc.C (FormToc): ditto
527 * src/frontends/xforms/Makefile.am: A few forgotten files
529 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
530 Signals-not-copyable-problem Lars' started commenting out.
532 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
534 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
536 * src/insets/insetcommand.h: Signals is not copyable so anoter
537 scheme for automatic hiding of forms must be used.
539 * src/frontends/xforms/FormCitation.h: don't inerit from
540 noncopyable, FormCommand already does that.
541 * src/frontends/xforms/FormToc.h: ditto
542 * src/frontends/xforms/FormUrl.h: ditto
544 * src/frontends/xforms/FormCitation.C: add include <algorithm>
546 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
548 * src/insets/insetcommand.h (hide): new SigC::Signal0
549 (d-tor) new virtual destructor emits hide signal
551 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
552 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
554 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
555 LOF and LOT. Inset is now GUI-independent
557 * src/insets/insetloa.[Ch]: redundant
558 * src/insets/insetlof.[Ch]: ditto
559 * src/insets/insetlot.[Ch]: ditto
561 * src/frontends/xforms/forms/form_url.fd: tweaked!
562 * src/frontends/xforms/forms/form_citation.fd: ditto
564 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
565 dialogs dealing with InsetCommand insets
567 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
568 FormCommand base class
569 * src/frontends/xforms/FormUrl.[Ch]: ditto
571 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
573 * src/frontends/xforms/FormToc.[Ch]: ditto
575 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
576 passed a generic InsetCommand pointer
577 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
579 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
580 and modified InsetTOC class
581 * src/buffer.C: ditto
583 * forms/lyx.fd: strip out old FD_form_toc code
584 * src/lyx_gui_misc.C: ditto
585 * src/lyx_gui.C: ditto
586 * src/lyx_cb.C: ditto
587 * src/lyx.[Ch]: ditto
589 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
591 * src/support/utility.hpp: tr -d '\r'
593 2000-08-01 Juergen Vigna <jug@sad.it>
595 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
598 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
599 LFUN_TABULAR_FEATURES.
601 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
604 * src/insets/insettabular.C (getStatus): implemented helper function.
606 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
608 2000-07-31 Juergen Vigna <jug@sad.it>
610 * src/text.C (draw): fixed screen update problem for text-insets.
612 * src/text2.C (SetParagrpah): call an update of the inset-owner when
613 something changed probably this has to be added in various other
616 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
618 2000-07-31 Baruch Even <baruch.even@writeme.com>
620 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
621 templates to satisfy compaq cxx.
624 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
626 * src/support/translator.h (equal_1st_in_pair::operator()): take
627 const ref pair_type as arg.
628 (equal_2nd_in_pair::operator()): ditto
629 (Translator::~Translator): remove empty d-tor.
631 * src/graphics/GraphicsCache.C: move include config.h to top, also
632 put initialization of GraphicsCache::singleton here.
633 (~GraphicsCache): move here
634 (addFile): take const ref as arg
637 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
639 * src/BufferView2.C (insertLyXFile): change te with/without header
642 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
644 * src/frontends/xforms/FormGraphics.C (apply): add some
645 static_cast. Not very nice, but required by compaq cxx.
647 * src/frontends/xforms/RadioButtonGroup.h: include header
648 <utility> instead of <pair.h>
650 * src/insets/insetgraphicsParams.C: add using directive.
651 (readResize): change return type to void.
654 * src/lyxfunc.C (getStatus): add missing break for build-program
655 function; add test for Literate for export functions.
657 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
658 entries in Options menu.
660 2000-07-31 Baruch Even <baruch.even@writeme.com>
662 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
663 protect against auto-allocation; release icon when needed.
665 2000-07-31 Matej Cepl <CeplM@seznam.cz>
667 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
670 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
671 earlier czech.kmap), useful only for programming.
673 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
675 * src/frontends/xforms/FormCitation.h: fix conditioning around
678 2000-07-31 Juergen Vigna <jug@sad.it>
680 * src/frontends/xforms/FormTabular.C (local_update): changed
681 radio_linebreaks to radio_useparbox and added radio_useminipage.
683 * src/tabular.C: made support for using minipages/parboxes.
685 * src/bufferlist.C (QwriteAll): small fix for asking for save.
687 * src/insets/insetgraphics.C (draw): just draw the inset so that the
689 (descent): so the cursor is in the middle.
690 (width): bit smaller box.
692 * src/insets/insetgraphics.h: added display() function.
694 2000-07-31 Baruch Even <baruch.even@writeme.com>
696 * src/frontends/Dialogs.h: Added showGraphics signals.
698 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
699 xforms form definition of the graphics dialog.
701 * src/frontends/xforms/FormGraphics.h:
702 * src/frontends/xforms/FormGraphics.C: Added files, the
703 GUIndependent code of InsetGraphics
705 * src/insets/insetgraphics.h:
706 * src/insets/insetgraphics.C: Major writing to make it work.
708 * src/insets/insetgraphicsParams.h:
709 * src/insets/insetgraphicsParams.C: Added files, parameter passing
710 struct between InsetGraphics and GUI.
712 * src/LaTeXFeatures.h:
713 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
714 support for graphicx package.
716 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
717 for the graphics inset.
719 * src/support/translator.h: Added file, used in
720 InsetGraphicsParams. this is a template to translate between two
723 * src/frontends/xforms/RadioButtonGroup.h:
724 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
725 way to easily control a radio button group.
727 2000-07-28 Juergen Vigna <jug@sad.it>
729 * src/insets/insettabular.C (LocalDispatch):
730 (TabularFeatures): added support for lyx-functions of tabular features.
731 (cellstart): refixed this function after someone wrongly changed it.
734 * src/LyXAction.C (init): added support for tabular-features
736 2000-07-28 Allan Rae <rae@lyx.org>
738 * src/frontends/xforms/FormPreferences.C (build): Setup input return
739 checking. NOTE: It seems that pressing ESC to cancel the dialog also
740 triggers the callback for input checking. As a result we sometimes get
741 "LyX: This shouldn't happen..." printed to cerr.
742 (input): Started using status variable since I only free() on
743 destruction. Some input checking for paths and font sizes.
745 * src/frontends/xforms/FormPreferences.h: Use status to control
746 activation of Ok and Apply
748 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
749 callback. Also resized to stop segfaults with 0.88. The problem is
750 that xforms-0.88 requires the folder to be wide enough to fit all the
751 tabs. If it isn't it causes all sorts of problems.
753 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
755 * src/frontends/xforms/forms/README: Reflect reality.
757 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
758 * src/frontends/xforms/forms/makefile: ditto.
760 * src/commandtags.h: Get access to new Preferences dialog
761 * src/LyXAction.C: ditto
762 * src/lyxfunc.C: ditto
763 * lib/ui/default.ui: ditto
765 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
767 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
769 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
772 * src/frontends/xforms/form_url.[Ch]: added.
774 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
776 * src/insets/insetbib.h: fixed bug in previous commit
778 * src/frontends/xforms/FormUrl.h: ditto
780 * src/frontends/xforms/FormPrint.h: ditto
782 * src/frontends/xforms/FormPreferences.h: ditto
784 * src/frontends/xforms/FormCopyright.h: ditto
786 * src/frontends/xforms/FormCitation.C: ditto
788 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
789 private copyconstructor and private default contructor
791 * src/support/Makefile.am: add utility.hpp
793 * src/support/utility.hpp: new file from boost
795 * src/insets/insetbib.h: set owner in clone
797 * src/frontends/xforms/FormCitation.C: added missing include
800 * src/insets/form_url.[Ch]: removed
802 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
804 * development/lyx.spec.in
805 * Makefile.am: Fix buglet for LyX RPM generation resulting from
806 file/directory re-organization.
808 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
810 * src/insets/insetcommand.[Ch]: moved the string data and
811 associated manipulation methods into a new stand-alone class
812 InsetCommandParams. This class has two additional methods
813 getAsString() and setFromString() allowing the contents to be
814 moved around as a single string.
815 (addContents) method removed.
816 (setContents) method no longer virtual.
818 * src/buffer.C (readInset): made use of new InsetCitation,
819 InsetUrl constructors based on InsetCommandParams.
821 * src/commandtags.h: add LFUN_INSERT_URL
823 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
824 independent InsetUrl and use InsetCommandParams to extract
825 string info and create new Insets.
827 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
829 * src/frontends/xforms/FormCitation.C (apply): uses
832 * src/frontends/xforms/form_url.C
833 * src/frontends/xforms/form_url.h
834 * src/frontends/xforms/FormUrl.h
835 * src/frontends/xforms/FormUrl.C
836 * src/frontends/xforms/forms/form_url.fd: new files
838 * src/insets/insetcite.[Ch]: removed unused constructors.
840 * src/insets/insetinclude.[Ch]: no longer store filename
842 * src/insets/inseturl.[Ch]: GUI-independent.
844 2000-07-26 Juergen Vigna <jug@sad.it>
845 * renamed frontend from gtk to gnome as it is that what is realized
846 and did the necessary changes in the files.
848 2000-07-26 Marko Vendelin <markov@ioc.ee>
850 * configure.in: cleaning up gnome configuration scripts
852 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
854 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
855 shortcuts syndrom by redrawing them explicitely (a better solution
856 would be appreciated).
858 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
860 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
863 * src/lyx_cb.C (MenuExport): change html export to do the right
864 thing depending of the document type (instead of having
865 html-linuxdoc and html-docbook).
866 * src/lyxfunc.C (getStatus): update for html
867 * lib/ui/default.ui: simplify due to the above change.
868 * src/menus.C (ShowFileMenu): update too (in case we need it).
870 * src/MenuBackend.C (read): if a menu is defined twice, add the
871 new entries to the exiting one.
873 2000-07-26 Juergen Vigna <jug@sad.it>
875 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
877 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
878 and return a bool if it did actual save the file.
879 (AutoSave): don't autosave a unnamed doc.
881 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
882 check if this is an UNNAMED new file and react to it.
883 (newFile): set buffer to unnamed and change to not mark a new
884 buffer dirty if I didn't do anything with it.
886 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
888 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
890 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
891 friend as per Angus's patch posted to lyx-devel.
893 * src/ext_l10n.h: updated
895 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
896 gettext on the style string right before inserting them into the
899 * autogen.sh: add code to extract style strings form layout files,
902 * src/frontends/gtk/.cvsignore: add MAKEFILE
904 * src/MenuBackend.C (read): run the label strings through gettext
905 before storing them in the containers.
907 * src/ext_l10n.h: new file
909 * autogen.sh : generate the ext_l10n.h file here
911 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
913 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
916 * lib/ui/default.ui: fix a couple of typos.
918 * config/gnome/gtk.m4: added (and added to the list of files in
921 * src/insets/insetinclude.C (unique_id): fix when we are using
922 lyxstring instead of basic_string<>.
923 * src/insets/insettext.C (LocalDispatch): ditto.
924 * src/support/filetools.C: ditto.
926 * lib/configure.m4: create the ui/ directory if necessary.
928 * src/LyXView.[Ch] (updateToolbar): new method.
930 * src/BufferView_pimpl.C (buffer): update the toolbar when
931 opening/closing buffer.
933 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
935 * src/LyXAction.C (getActionName): enhance to return also the name
936 and options of pseudo-actions.
937 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
939 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
940 as an example of what is possible). Used in File->Build too (more
941 useful) and in the import/export menus (to mimick the complicated
942 handling of linuxdoc and friends). Try to update all the entries.
944 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
947 * src/MenuBackend.C (read): Parse the new OptItem tag.
949 * src/MenuBackend.h: Add a new optional_ data member (used if the
950 entry should be omitted when the lyxfunc is disabled).
952 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
953 function, used as a shortcut.
954 (create_submenu): align correctly the shortcuts on the widest
957 * src/MenuBackend.h: MenuItem.label() only returns the label of
958 the menu without shortcut; new method shortcut().
960 2000-07-14 Marko Vendelin <markov@ioc.ee>
962 * src/frontends/gtk/Dialogs.C:
963 * src/frontends/gtk/FormCopyright.C:
964 * src/frontends/gtk/FormCopyright.h:
965 * src/frontends/gtk/Makefile.am: added these source-files for the
966 Gtk/Gnome support of the Copyright-Dialog.
968 * src/main.C: added Gnome::Main initialization if using
969 Gtk/Gnome frontend-GUI.
971 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
973 * config/gnome/aclocal-include.m4
974 * config/gnome/compiler-flags.m4
975 * config/gnome/curses.m4
976 * config/gnome/gnome--.m4
977 * config/gnome/gnome-bonobo-check.m4
978 * config/gnome/gnome-common.m4
979 * config/gnome/gnome-fileutils.m4
980 * config/gnome/gnome-ghttp-check.m4
981 * config/gnome/gnome-gnorba-check.m4
982 * config/gnome/gnome-guile-checks.m4
983 * config/gnome/gnome-libgtop-check.m4
984 * config/gnome/gnome-objc-checks.m4
985 * config/gnome/gnome-orbit-check.m4
986 * config/gnome/gnome-print-check.m4
987 * config/gnome/gnome-pthread-check.m4
988 * config/gnome/gnome-support.m4
989 * config/gnome/gnome-undelfs.m4
990 * config/gnome/gnome-vfs.m4
991 * config/gnome/gnome-x-checks.m4
992 * config/gnome/gnome-xml-check.m4
993 * config/gnome/gnome.m4
994 * config/gnome/gperf-check.m4
995 * config/gnome/gtk--.m4
996 * config/gnome/linger.m4
997 * config/gnome/need-declaration.m4: added configuration scripts
998 for Gtk/Gnome frontend-GUI
1000 * configure.in: added support for the --with-frontend=gtk option
1002 * autogen.sh: added config/gnome/* to list of config-files
1004 * acconfig.h: added define for GTKGUI-support
1006 * config/lyxinclude.m4: added --with-frontend[=value] option value
1007 for Gtk/Gnome frontend-GUI support.
1009 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1011 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1015 * src/paragraph.C (GetChar): remove non-const version
1017 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1018 (search_kw): use it.
1020 * src/lyx_main.C (init): if "preferences" exist, read that instead
1022 (ReadRcFile): return bool if the file could be read ok.
1023 (ReadUIFile): add a check to see if lex file is set ok.
1025 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1026 bastring can be used instead of lyxstring (still uses the old code
1027 if std::string is good enough or if lyxstring is used.)
1029 * src/encoding.C: make the arrays static, move ininle functions
1031 * src/encoding.h: from here.
1033 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1034 (parseSingleLyXformat2Token): move inset parsing to separate method
1035 (readInset): new private method
1037 * src/Variables.h: remove virtual from get().
1039 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1040 access to NEW_INSETS and NEW_TABULAR
1042 * src/MenuBackend.h: remove superfluous forward declaration of
1043 MenuItem. Add documentations tags "///", remove empty MenuItem
1044 destructor, remove private default contructor.
1046 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1048 (read): more string mlabel and mname to where they are used
1049 (read): remove unused variables mlabel and mname
1050 (defaults): unconditional clear, make menusetup take advantage of
1051 add returning Menu &.
1053 * src/LyXView.h: define NEW_MENUBAR as default
1055 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1056 to NEW_INSETS and NEW_TABULAR.
1057 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1058 defined. Change some of the "xxxx-inset-insert" functions names to
1061 * several files: more enahncements to NEW_INSETS and the resulting
1064 * lib/lyxrc.example (\date_insert_format): move to misc section
1066 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1067 bastring and use AC_CACHE_CHECK.
1068 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1069 the system have the newest methods. uses AC_CACHE_CHECK
1070 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1071 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1072 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1074 * configure.in: add LYX_CXX_GOOD_STD_STRING
1076 * acinclude.m4: recreated
1078 2000-07-24 Amir Karger
1080 * README: add Hebrew, Arabic kmaps
1083 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1085 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1088 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1090 * Lot of files: add pragma interface/implementation.
1092 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1094 * lib/ui/default.ui: new file (ans new directory). Contains the
1095 default menu and toolbar.
1097 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1098 global space. Toolbars are now read (as menus) in ui files.
1100 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1102 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1103 is disabled because the document is read-only. We want to have the
1104 toggle state of the function anyway.
1105 (getStatus): add code for LFUN_VC* functions (mimicking what is
1106 done in old-style menus)
1108 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1109 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1111 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1112 * src/BufferView_pimpl.C: ditto.
1113 * src/lyxfunc.C: ditto.
1115 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1116 default). This replaces old-style menus by new ones.
1118 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1119 MenuItem. Contain the data structure of a menu.
1121 * src/insets/insettext.C: use LyXView::setLayout instead of
1122 accessing directly the toolbar combox.
1123 * src/lyxfunc.C (Dispatch): ditto.
1125 * src/LyXView.C (setLayout): new method, which just calls
1126 Toolbar::setLayout().
1127 (updateLayoutChoice): move part of this method in Toolbar.
1129 * src/toolbar.[Ch]: removed.
1131 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1132 implementation the toolbar.
1134 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1135 the toolbar. It might make sense to merge it with ToolbarDefaults
1137 (setLayout): new function.
1138 (updateLayoutList): ditto.
1139 (openLayoutList): ditto.
1141 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1142 xforms implementation of the toolbar.
1143 (get_toolbar_func): comment out, since I do not
1144 know what it is good for.
1146 * src/ToolbarDefaults.h: Add the ItemType enum.
1148 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1149 for a list of allocated C strings. Used in Menubar xforms
1150 implementation to avoid memory leaks.
1152 * src/support/lstrings.[Ch] (uppercase): new version taking and
1156 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1157 * lib/bind/emacs.bind: ditto.
1159 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1161 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1162 forward decl of LyXView.
1164 * src/toolbar.C (toolbarItem): moved from toolbar.h
1165 (toolbarItem::clean): ditto
1166 (toolbarItem::~toolbarItem): ditto
1167 (toolbarItem::operator): ditto
1169 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1171 * src/paragraph.h: control the NEW_TABULAR define from here
1173 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1174 USE_TABULAR_INSETS to NEW_TABULAR
1176 * src/ToolbarDefaults.C: add include "lyxlex.h"
1178 * files using the old table/tabular: use NEW_TABULAR to control
1179 compilation of old tabular stuff.
1181 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1184 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1185 planemet in reading of old style floats, fix the \end_deeper
1186 problem when reading old style floats.
1188 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1190 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1192 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1194 * lib/bind/sciword.bind: updated.
1196 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1198 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1199 layout write problem
1201 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1203 * src/Makefile.am (INCLUDES): remove image directory from include
1206 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1207 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1209 * src/LyXView.C (create_form_form_main): read the application icon
1212 * lib/images/*.xpm: change the icons to use transparent color for
1215 * src/toolbar.C (update): change the color of the button when it
1218 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1220 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1221 setting explicitely the minibuffer.
1222 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1224 * src/LyXView.C (showState): new function. Shows font information
1225 in minibuffer and update toolbar state.
1226 (LyXView): call Toolbar::update after creating the
1229 * src/toolbar.C: change toollist to be a vector instead of a
1231 (BubbleTimerCB): get help string directly from the callback
1232 argument of the corresponding icon (which is the action)
1233 (set): remove unnecessary ugliness.
1234 (update): new function. update the icons (depressed, disabled)
1235 depending of the status of the corresponding action.
1237 * src/toolbar.h: remove help in toolbarItem
1239 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1241 * src/Painter.C (text): Added code for using symbol glyphs from
1242 iso10646 fonts. Currently diabled.
1244 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1247 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1248 magyar,turkish and usorbian.
1250 * src/paragraph.C (isMultiLingual): Made more efficient.
1252 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1255 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1256 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1257 Also changed the prototype to "bool math_insert_greek(char)".
1259 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1261 * lots of files: apply the NEW_INSETS on all code that will not be
1262 needed when we move to use the new insets. Enable the define in
1263 lyxparagrah.h to try it.
1265 * src/insets/insettabular.C (cellstart): change to be a static
1267 (InsetTabular): initialize buffer in the initializer list.
1269 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1271 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1272 form_print.h out of the header file. Replaced with forward
1273 declarations of the relevant struct.
1275 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1278 * src/commandtags.h: do not include "debug.h" which does not
1279 belong there. #include it in some other places because of this
1282 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1284 * src/insets/insetcaption.C: add a couple "using" directives.
1286 * src/toolbar.C (add): get the help text directly from lyxaction.
1288 (setPixmap): new function. Loads from disk and sets a pixmap on a
1289 botton; the name of the pixmap file is derived from the command
1292 * src/toolbar.h: remove members isBitmap and pixmap from
1295 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1296 * lib/images/: move many files from images/banner.xpm.
1298 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1300 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1301 * src/toolbar.C: ditto.
1302 * configure.in: ditto.
1303 * INSTALL: document.
1305 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1306 the spellchecker popup is closed from the WM.
1308 2000-07-19 Juergen Vigna <jug@sad.it>
1310 * src/insets/insetfloat.C (Write): small fix because we use the
1311 insetname for the type now!
1313 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1315 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1318 * src/frontends/Dialogs.h: removed hideCitation signal
1320 * src/insets/insetcite.h: added hide signal
1322 * src/insets/insetcite.C (~InsetCitation): emits new signal
1323 (getScreenLabel): "intelligent" label should now fit on the screen!
1325 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1327 * src/frontends/xforms/FormCitation.C (showInset): connects
1328 hide() to the inset's hide signal
1329 (show): modified to use fl_set_object_position rather than
1330 fl_set_object_geometry wherever possible
1332 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1334 * src/insets/lyxinset.h: add caption code
1336 * src/insets/insetfloat.C (type): new method
1338 * src/insets/insetcaption.C (Write): new method
1340 (LyxCode): new method
1342 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1343 to get it right together with using the FloatList.
1345 * src/commandtags.h: add LFUN_INSET_CAPTION
1346 * src/lyxfunc.C (Dispatch): handle it
1348 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1351 * src/Variables.[Ch]: make expand take a const reference, remove
1352 the destructor, some whitespace changes.
1354 * src/LyXAction.C (init): add caption-inset-insert
1356 * src/FloatList.C (FloatList): update the default floats a bit.
1358 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1360 * src/Variables.[Ch]: new files. Intended to be used for language
1361 specific strings (like \chaptername) and filename substitution in
1364 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1366 * lib/kbd/american.kmap: update
1368 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1370 * src/bufferparams.[Ch]: remove member allowAccents.
1372 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1374 * src/LaTeXLog.C: use the log_form.h header.
1375 * src/lyx_gui.C: ditto.
1376 * src/lyx_gui_misc.C: ditto.
1377 * src/lyxvc.h: ditto.
1379 * forms/log_form.fd: new file, created from latexoptions.fd. I
1380 kept the log popup and nuked the options form.
1382 * src/{la,}texoptions.[Ch]: removed.
1383 * src/lyx_cb.C (LaTeXOptions): ditto
1385 * src/lyx_gui.C (create_forms): do not handle the
1386 fd_latex_options form.
1388 2000-07-18 Juergen Vigna <jug@sad.it>
1390 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1391 name of the inset so that it can be requested outside (text2.C).
1393 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1396 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1398 * src/mathed/formula.h (ConvertFont): constify
1400 * src/mathed/formula.C (Read): add warning if \end_inset is not
1401 found on expected place.
1403 * src/insets/lyxinset.h (ConvertFont): consify
1405 * src/insets/insetquotes.C (ConvertFont): constify
1406 * src/insets/insetquotes.h: ditto
1408 * src/insets/insetinfo.h: add labelfont
1410 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1411 (ascent): use labelfont
1415 (Write): make .lyx file a bit nicer
1417 * src/insets/insetfloat.C (Write): simplify somewhat...
1418 (Read): add warning if arg is not found
1420 * src/insets/insetcollapsable.C: add using std::max
1421 (Read): move string token and add warning in arg is not found
1422 (draw): use std::max to get the right ty
1423 (getMaxWidth): simplify by using std::max
1425 * src/insets/insetsection.h: new file
1426 * src/insets/insetsection.C: new file
1427 * src/insets/insetcaption.h: new file
1428 * src/insets/insetcaption.C: new file
1430 * src/insets/inset.C (ConvertFont): constify signature
1432 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1433 insetcaption.[Ch] and insetsection.[Ch]
1435 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1436 uses to use LABEL_COUNTER_CHAPTER instead.
1437 * src/text2.C (SetCounter): here
1439 * src/counters.h: new file
1440 * src/counters.C: new file
1441 * src/Sectioning.h: new file
1442 * src/Sectioning.C: new file
1444 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1446 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1448 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1451 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1454 2000-07-17 Juergen Vigna <jug@sad.it>
1456 * src/tabular.C (Validate): check if array-package is needed.
1457 (SetVAlignment): added support for vertical alignment.
1458 (SetLTFoot): better support for longtable header/footers
1459 (Latex): modified to support added features.
1461 * src/LaTeXFeatures.[Ch]: added array-package.
1463 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1465 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1468 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1470 * configure.in: do not forget to put a space after -isystem.
1472 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1474 * lib/kbd/arabic.kmap: a few fixes.
1476 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1478 * some whitespace chagnes to a number of files.
1480 * src/support/DebugStream.h: change to make it easier for
1481 doc++ to parse correctly.
1482 * src/support/lyxstring.h: ditto
1484 * src/mathed/math_utils.C (compara): change to have only one
1486 (MathedLookupBOP): change because of the above.
1488 * src/mathed/math_delim.C (math_deco_compare): change to have only
1490 (search_deco): change becasue of the above.
1492 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1493 instead of manually coded one.
1495 * src/insets/insetquotes.C (Read): read the \end_inset too
1497 * src/insets/insetlatex.h: remove file
1498 * src/insets/insetlatex.C: remove file
1500 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1502 (InsetPrintIndex): remove destructor
1504 * src/insets/insetinclude.h: remove default constructor
1506 * src/insets/insetfloat.C: work to make it work better
1508 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1510 * src/insets/insetcite.h (InsetCitation): remove default constructor
1512 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1514 * src/text.C (GetColumnNearX): comment out some currently unused code.
1516 * src/paragraph.C (writeFile): move some initializations closer to
1518 (CutIntoMinibuffer): small change to use new matchIT operator
1522 (InsertInset): ditto
1525 (InsetIterator): ditto
1526 (Erase): small change to use new matchFT operator
1528 (GetFontSettings): ditto
1529 (HighestFontInRange): ditto
1532 * src/lyxparagraph.h: some chars changed to value_type
1533 (matchIT): because of some stronger checking (perhaps too strong)
1534 in SGI STL, the two operator() unified to one.
1537 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1539 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1540 the last inset read added
1541 (parseSingleLyXformat2Token): some more (future) compability code added
1542 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1543 (parseSingleLyXformat2Token): set last_inset_read
1544 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1545 (parseSingleLyXformat2Token): don't double intializw string next_token
1547 * src/TextCache.C (text_fits::operator()): add const's to the signature
1548 (has_buffer::operator()): ditto
1550 * src/Floating.h: add some comments on the class
1552 * src/FloatList.[Ch] (typeExist): new method
1555 * src/BackStack.h: added default constructor, wanted by Gcc.
1557 2000-07-14 Juergen Vigna <jug@sad.it>
1559 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1561 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1563 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1564 do a redraw when the window is resized!
1565 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1567 * src/insets/insettext.C (resizeLyXText): added function to correctly
1568 being able to resize the LyXWindow.
1570 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1572 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1574 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1575 crashes when closing dialog to a deleted inset.
1577 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1578 method! Now similar to other insets.
1580 2000-07-13 Juergen Vigna <jug@sad.it>
1582 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1584 * lib/examples/Literate.lyx: small patch!
1586 * src/insets/insetbib.C (Read): added this function because of wrong
1587 Write (without [begin|end]_inset).
1589 2000-07-11 Juergen Vigna <jug@sad.it>
1591 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1592 as the insertInset could not be good!
1594 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1595 the bool param should not be last.
1597 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1599 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1600 did submit that to Karl).
1602 * configure.in: use -isystem instead of -I for X headers. This
1603 fixes a problem on solaris with a recent gcc;
1604 put the front-end code after the X detection code;
1605 configure in sigc++ before lib/
1607 * src/lyx_main.C (commandLineHelp): remove -display from command
1610 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
1612 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
1613 Also put in Makefile rules for building the ``listerrors''
1614 program for parsing errors from literate programs written in LyX.
1616 * lib/build-listerrors: Added small shell script as part of compile
1617 process. This builds a working ``listerrors'' binary if noweb is
1618 installed and either 1) the VNC X server is installed on the machine,
1619 or 2) the user is compiling from within a GUI. The existence of a GUI
1620 is necessary to use the ``lyx --export'' feature for now. This
1621 hack can be removed once ``lyx --export'' no longer requires a GUI to
1624 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
1626 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
1627 now passed back correctly from gcc and placed "under" error
1628 buttons in a Literate LyX source.
1630 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1632 * src/text.C (GetColumnNearX): Better behavior when a RTL
1633 paragraph is ended by LTR text.
1635 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
1638 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1640 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
1641 true when clipboard is empty.
1643 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1645 * text.C (Backspace): Prevent rebreaking of a row if it is the last
1646 row of the paragraph.
1647 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
1648 to prevent calculation of bidi tables
1650 2000-07-07 Juergen Vigna <jug@sad.it>
1652 * src/screen.C (ToggleSelection): added y_offset and x_offset
1655 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
1658 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
1660 * src/insets/insettext.C: fixed Layout-Display!
1662 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1664 * configure.in: add check for strings.h header.
1666 * src/spellchecker.C: include <strings.h> in order to have a
1667 definition for bzero().
1669 2000-07-07 Juergen Vigna <jug@sad.it>
1671 * src/insets/insettext.C (draw): set the status of the bv->text to
1672 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
1674 * src/screen.C (DrawOneRow):
1675 (DrawFromTo): redraw the actual row if something has changed in it
1678 * src/text.C (draw): call an update of the toplevel-inset if something
1679 has changed inside while drawing.
1681 * src/lyxtext.h: added CHANGED_IN_DRAW status.
1683 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
1685 * src/insets/insetbib.[Ch] (callback) new method, moving callback
1686 processing inside class.
1688 * src/insets/insetindex.[Ch] (callback) new method, moving callback
1689 processing inside class.
1691 * src/insets/insetindex.h new struct Holder, consistent with other
1694 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
1695 citation dialog from main code and placed it in src/frontends/xforms.
1696 Dialog launched through signals instead of callbacks
1698 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
1700 * lyx.man: update the options description.
1702 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
1704 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
1705 handle neg values, set min width to 590, add doc about -display
1707 2000-07-05 Juergen Vigna <jug@sad.it>
1709 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
1710 calls to BufferView *.
1712 * src/insets/insettext.C (checkAndActivateInset): small fix non
1713 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
1715 * src/insets/insetcommand.C (Read): Fixed as insets should read till
1716 their \end_inset token!
1718 2000-07-04 edscott <edscott@imp.mx>
1720 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
1721 lib/lyxrc.example: added option \wheel_jump
1723 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
1725 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
1726 remove support for -width,-height,-xpos and -ypos.
1728 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
1730 * src/encoding.[Ch]: New files.
1732 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
1733 (text): Call to the underline() method only when needed.
1735 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
1737 * src/buffer.C (makeLaTeXFile): Compute automatically the input
1738 encoding(s) for the document.
1740 * src/bufferparams.C (BufferParams): Changed default value of
1743 * src/language.C (newLang): Removed.
1744 (items[]): Added encoding information for all defined languages.
1746 * src/lyx_gui.C (create_forms): Added "auto" option to the input
1747 encoding choice button.
1749 * src/lyxrc.h (font_norm_type): New member variable.
1750 (set_font_norm_type): New method.
1752 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
1753 paragraphs with different encodings.
1755 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
1756 (TransformChar): Changed to work correctly with Arabic points.
1757 (draw): Added support for drawing Arabic points.
1758 (draw): Removed code for drawing underbars (this is done by
1761 * src/support/textutils.h (IsPrintableNonspace): New function.
1763 * src/BufferView_pimpl.h: Added "using SigC::Object".
1764 * src/LyXView.h: ditto.
1766 * src/insets/insetinclude.h (include_label): Changed to mutable.
1768 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1770 * src/mathed/math_iter.h: remove empty destructor
1772 * src/mathed/math_cursor.h: remove empty destructor
1774 * src/insets/lyxinset.h: add THEOREM_CODE
1776 * src/insets/insettheorem.[Ch]: new files
1778 * src/insets/insetminipage.C: (InsertInset): remove
1780 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
1782 (InsertInset): remove
1784 * src/insets/insetlist.C: (InsertList): remove
1786 * src/insets/insetfootlike.[Ch]: new files
1788 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
1791 (InsertInset): ditto
1793 * src/insets/insetert.C: remove include Painter.h, reindent
1794 (InsertInset): move to header
1796 * src/insets/insetcollapsable.h: remove explicit from default
1797 contructor, remove empty destructor, add InsertInset
1799 * src/insets/insetcollapsable.C (InsertInset): new func
1801 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
1803 * src/vspace.h: add explicit to constructor
1805 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
1806 \textcompwordmark, please test this.
1808 * src/lyxrc.C: set ascii_linelen to 65 by default
1810 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
1812 * src/commandtags.h: add LFUN_INSET_THEOREM
1814 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
1815 (makeLinuxDocFile): remove _some_ of the nice logic
1816 (makeDocBookFile): ditto
1818 * src/Painter.[Ch]: (~Painter): removed
1820 * src/LyXAction.C (init): entry for insettheorem added
1822 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
1824 (deplog): code to detect files generated by LaTeX, needs testing
1827 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1829 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
1831 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1833 * src/LaTeX.C (deplog): Add a check for files that are going to be
1834 created by the first latex run, part of the project to remove the
1837 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
1838 contents to the extension list.
1840 2000-07-04 Juergen Vigna <jug@sad.it>
1842 * src/text.C (NextBreakPoint): added support for needFullRow()
1844 * src/insets/lyxinset.h: added needFullRow()
1846 * src/insets/insetcollapsable.C: redone now this uses a text-inset
1849 * src/insets/insettext.C: lots of changes for update!
1851 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
1853 * src/LaTeXFeatures.h: add a missing std:: qualifier.
1855 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
1857 * src/insets/insetinclude.C (InsetInclude): fixed
1858 initialization of include_label.
1859 (unique_id): now returns a string.
1861 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
1863 * src/LaTeXFeatures.h: new member IncludedFiles, for
1864 a map of key, included file name.
1866 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
1867 with the included files for inclusion in SGML preamble,
1868 i. e., linuxdoc and docbook.
1871 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
1872 nice (is the generated linuxdoc code to be exported?), that
1873 allows to remove column, and only_body that will be true for
1874 slave documents. Insets are allowed inside SGML font type.
1875 New handling of the SGML preamble for included files.
1876 (makeDocBookFile): the same for docbook.
1878 * src/insets/insetinclude.h:
1879 * src/insets/insetinclude.C (Validate): keeps a list of included files.
1881 (DocBook): new export methods.
1883 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
1884 and makeDocBookFile.
1886 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
1887 formats to export with command line argument -x.
1889 2000-06-29 Juergen Vigna <jug@sad.it>
1891 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
1892 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
1894 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
1895 region could already been cleared by an inset!
1897 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
1899 * src/BufferView_pimpl.h: remove member variables lyx_focus and
1902 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
1904 (cursorToggle): remove special handling of lyx focus.
1906 2000-06-28 Juergen Vigna <jug@sad.it>
1908 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
1911 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1913 * src/insets/insetindex.C (Edit): add a callback when popup is
1916 * src/insets/insettext.C (LocalDispatch):
1917 * src/insets/insetmarginal.h:
1918 * src/insets/insetlist.h:
1919 * src/insets/insetfoot.h:
1920 * src/insets/insetfloat.h:
1921 * src/insets/insetert.h: add a missing std:: qualifier.
1923 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
1925 * src/support/lyxsum.C (sum): '\0' teminate file read when using
1928 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
1930 * src/insets/insettext.C (Read): remove tmptok unused variable
1931 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
1932 (InsertInset): change for new InsetInset code
1934 * src/insets/insettext.h: add TEXT inline method
1936 * src/insets/insettext.C: remove TEXT macro
1938 * src/insets/insetmarginal.C (Write): new method
1939 (Latex): change output slightly
1941 * src/insets/insetfoot.C (Write): new method
1942 (Latex): change output slightly (don't use endl when no need)
1944 * src/insets/insetert.C (Write): new method
1946 * src/insets/insetcollapsable.h: make button_length, button_top_y
1947 and button_bottm_y protected.
1949 * src/insets/insetcollapsable.C (Write): simplify code by using
1950 tostr. Also do not output the float name, the children class
1951 should to that to get control over own arguments
1953 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
1954 src/insets/insetminipage.[Ch]:
1957 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
1959 * src/lyxfunc.C (Dispatch): cases for new insets/commands
1961 * src/Makefile.am (lyx_SOURCES): add the new files
1963 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
1964 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
1965 * src/commandtags.h: ditto
1967 * src/LaTeXFeatures.h: add a std::set of used floattypes
1969 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
1971 * src/FloatList.[Ch] src/Floating.h: new files
1973 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
1975 * src/lyx_cb.C (TableApplyCB): ditto
1977 * src/text2.C: ditto
1978 * src/buffer.C (SimpleLinuxDocOnePar): ditto
1979 (parseSingleLyXformat2Token): ditto + add code for
1980 backwards compability for old float styles + add code for new insets
1982 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
1984 (InsertInset(size_type, Inset *, LyXFont)): new method
1985 (InsetChar(size_type, char)): changed to use the other InsetChar
1986 with a LyXFont(ALL_INHERIT).
1987 (InsetInset(size_type, Inset*)): changed to use InsetChar to
1988 insert the META_INSET.
1990 * sigc++/thread.cc (Privete<int>::operator int&): move definition
1992 * sigc++/thread.h (Threads): from here
1994 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
1995 definition out of line
1996 * sigc++/scope.h: from here
1998 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2000 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2001 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2003 * Makefile.am (bindist): new target.
2005 * INSTALL: add instructions for doing a binary distribution.
2007 * development/tools/README.bin.example: update a bit.
2009 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2012 * lib/lyxrc.example: new lyxrc tag \set_color.
2014 * src/lyxfunc.C (Dispatch):
2015 * src/commandtags.h:
2016 * src/LyXAction.C: new lyxfunc "set-color".
2018 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2019 and an x11name given as strings.
2021 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2022 cache when a color is changed.
2024 2000-06-26 Juergen Vigna <jug@sad.it>
2026 * src/lyxrow.C (width): added this functions and variable.
2028 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2031 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2033 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2035 * images/undo_bw.xpm: new icon.
2036 * images/redo_bw.xpm: ditto.
2038 * configure.in (INSTALL_SCRIPT): change value to
2039 ${INSTALL} to avoid failures of install-script target.
2040 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2042 * src/BufferView.h: add a magic "friend" declaration to please
2045 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2047 * forms/cite.fd: modified to allow resizing without messing
2050 * src/insetcite.C: Uses code from cite.fd almost without
2052 User can now resize dialog in the x-direction.
2053 Resizing the dialog in the y-direction is prevented, as the
2054 code does this intelligently already.
2056 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2058 * INSTALL: remove obsolete entry in "problems" section.
2060 * lib/examples/sl_*.lyx: update of the slovenian examples.
2062 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2064 2000-06-23 Juergen Vigna <jug@sad.it>
2066 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2068 * src/buffer.C (resize): delete the LyXText of textinsets.
2070 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2072 * src/insets/lyxinset.h: added another parameter 'cleared' to
2073 the draw() function.
2075 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2076 unlocking inset in inset.
2078 2000-06-22 Juergen Vigna <jug@sad.it>
2080 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2081 of insets and moved first to LyXText.
2083 * src/mathed/formulamacro.[Ch]:
2084 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2086 2000-06-21 Juergen Vigna <jug@sad.it>
2088 * src/text.C (GetVisibleRow): look if I should clear the area or not
2089 using Inset::doClearArea() function.
2091 * src/insets/lyxinset.h: added doClearArea() function and
2092 modified draw(Painter &, ...) to draw(BufferView *, ...)
2094 * src/text2.C (UpdateInset): return bool insted of int
2096 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2098 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2099 combox in the character popup
2101 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2102 BufferParams const & params
2104 2000-06-20 Juergen Vigna <jug@sad.it>
2106 * src/insets/insettext.C (SetParagraphData): set insetowner on
2109 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2111 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2112 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2114 (form_main_): remove
2116 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2117 (create_form_form_main): remove FD_form_main stuff, connect to
2118 autosave_timeout signal
2120 * src/LyXView.[Ch] (getMainForm): remove
2121 (UpdateTimerCB): remove
2122 * src/BufferView_pimpl.h: inherit from SigC::Object
2124 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2125 signal instead of callback
2127 * src/BufferView.[Ch] (cursorToggleCB): remove
2129 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2131 * src/BufferView_pimpl.C: changes because of the one below
2133 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2134 instead of storing a pointer to a LyXText.
2136 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2138 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2140 * src/lyxparagraph.h
2142 * src/paragraph.C: Changed fontlist to a sorted vector.
2144 2000-06-19 Juergen Vigna <jug@sad.it>
2146 * src/BufferView.h: added screen() function.
2148 * src/insets/insettext.C (LocalDispatch): some selection code
2151 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2153 * src/insets/insettext.C (SetParagraphData):
2155 (InsetText): fixes for multiple paragraphs.
2157 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2159 * development/lyx.spec.in: Call configure with ``--without-warnings''
2160 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2161 This should be fine, however, since we generally don't want to be
2162 verbose when making an RPM.
2164 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2166 * lib/scripts/fig2pstex.py: New file
2168 2000-06-16 Juergen Vigna <jug@sad.it>
2170 * src/insets/insettabular.C (UpdateLocal):
2171 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2172 (LocalDispatch): Changed all functions to use LyXText.
2174 2000-06-15 Juergen Vigna <jug@sad.it>
2176 * src/text.C (SetHeightOfRow): call inset::update before requesting
2179 * src/insets/insettext.C (update):
2180 * src/insets/insettabular.C (update): added implementation
2182 * src/insets/lyxinset.h: added update function
2184 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2186 * src/text.C (SelectNextWord): protect against null pointers with
2187 old-style string streams. (fix from Paul Theo Gonciari
2190 * src/cite.[Ch]: remove erroneous files.
2192 * lib/configure.m4: update the list of created directories.
2194 * src/lyxrow.C: include <config.h>
2195 * src/lyxcursor.C: ditto.
2197 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2199 * lib/examples/decimal.lyx: new example file from Mike.
2201 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2202 to find template definitions (from Dekel)
2204 * src/frontends/.cvsignore: add a few things.
2206 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2208 * src/Timeout.C (TimeOut): remove default argument.
2210 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2213 * src/insets/ExternalTemplate.C: add a "using" directive.
2215 * src/lyx_main.h: remove the act_ struct, which seems unused
2218 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2220 * LyX Developers Meeting: All files changed, due to random C++ (by
2221 coincidence) code generator script.
2223 - external inset (cool!)
2224 - initial online editing of preferences
2225 - insettabular breaks insettext(s contents)
2227 - some DocBook fixes
2228 - example files update
2229 - other cool stuff, create a diff and look for yourself.
2231 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2233 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2234 -1 this is a non-line-breaking textinset.
2236 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2237 if there is no width set.
2239 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2241 * Lots of files: Merged the dialogbase branch.
2243 2000-06-09 Allan Rae <rae@lyx.org>
2245 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2246 and the Dispatch methods that used it.
2248 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2249 access to functions formerly kept in Dispatch.
2251 2000-05-19 Allan Rae <rae@lyx.org>
2253 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2254 made to_page and count_copies integers again. from_page remains a
2255 string however because I want to allow entry of a print range like
2256 "1,4,22-25" using this field.
2258 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2259 and printer-params-get. These aren't useful from the minibuffer but
2260 could be used by a script/LyXServer app provided it passes a suitable
2261 auto_mem_buffer. I guess I should take a look at how the LyXServer
2262 works and make it support xtl buffers.
2264 * sigc++/: updated to libsigc++-1.0.1
2266 * src/xtl/: updated to xtl-1.3.pl.11
2268 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2269 those changes done to the files in src/ are actually recreated when
2270 they get regenerated. Please don't ever accept a patch that changes a
2271 dialog unless that patch includes the changes to the corresponding *.fd
2274 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2275 stringOnlyContains, renamed it and generalised it.
2277 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2278 branch. Removed the remaining old form_print code.
2280 2000-04-26 Allan Rae <rae@lyx.org>
2282 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2283 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2285 2000-04-25 Allan Rae <rae@lyx.org>
2287 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2288 against a base of xtl-1.3.pl.4
2290 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2291 filter the Id: entries so they still show the xtl version number
2294 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2295 into the src/xtl code. Patch still pending with José (XTL)
2297 2000-04-24 Allan Rae <rae@lyx.org>
2299 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2300 both more generic and much safer. Use the new template functions.
2301 * src/buffer.[Ch] (Dispatch): ditto.
2303 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2304 and mem buffer more intelligently. Also a little general cleanup.
2307 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2308 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2309 * src/xtl/Makefile.am: ditto.
2310 * src/xtl/.cvsignore: ditto.
2311 * src/Makefile.am: ditto.
2313 * src/PrinterParams.h: Removed the macros member functions. Added a
2314 testInvariant member function. A bit of tidying up and commenting.
2315 Included Angus's idea for fixing operation with egcs-1.1.2.
2317 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2318 cool expansion of XTL's mem_buffer to support automatic memory
2319 management within the buffer itself. Removed the various macros and
2320 replaced them with template functions that use either auto_mem_buffer
2321 or mem_buffer depending on a #define. The mem_buffer support will
2322 disappear as soon as the auto_mem_buffer is confirmed to be good on
2323 other platforms/compilers. That is, it's there so you've got something
2326 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2327 effectively forked XTL. However I expect José will include my code
2328 into the next major release. Also fixed a memory leak.
2329 * src/xtl/text.h: ditto.
2330 * src/xtl/xdr.h: ditto.
2331 * src/xtl/giop.h: ditto.
2333 2000-04-16 Allan Rae <rae@lyx.org>
2335 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2336 by autogen.sh and removed by maintainer-clean anyway.
2337 * .cvsignore, sigc++/.cvsignore: Support the above.
2339 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2341 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2343 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2344 macros, renamed static callback-target member functions to suit new
2345 scheme and made them public.
2346 * src/frontends/xforms/forms/form_print.fd: ditto.
2347 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2349 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2352 * src/xtl/: New directory containing a minimal distribution of XTL.
2353 This is XTL-1.3.pl.4.
2355 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2357 2000-04-15 Allan Rae <rae@lyx.org>
2359 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2361 * sigc++/: Updated to libsigc++-1.0.0
2363 2000-04-14 Allan Rae <rae@lyx.org>
2365 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2366 use the generic ones in future. I'll modify my conversion script.
2368 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2370 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2371 (CloseAllBufferRelatedDialogs): Renamed.
2372 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2374 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2375 of the generic ones. These are the same ones my conversion script
2378 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2379 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2380 * src/buffer.C (Dispatch): ditto
2382 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2383 functions for updating and hiding buffer dependent dialogs.
2384 * src/BufferView.C (buffer): ditto
2385 * src/buffer.C (setReadonly): ditto
2386 * src/lyxfunc.C (CloseBuffer): ditto
2388 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2389 Dialogs.h, and hence all the SigC stuff, into every file that includes
2390 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2392 * src/BufferView2.C: reduce the number of headers included by buffer.h
2394 2000-04-11 Allan Rae <rae@lyx.org>
2396 * src/frontends/xforms/xform_macros.h: A small collection of macros
2397 for building C callbacks.
2399 * src/frontends/xforms/Makefile.am: Added above file.
2401 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2402 scheme again. This time it should work for JMarc. If this is
2403 successful I'll revise my conversion script to automate some of this.
2404 The static member functions in the class also have to be public for
2405 this scheme will work. If the scheme works (it's almost identical to
2406 the way BufferView::cursorToggleCB is handled so it should work) then
2407 FormCopyright and FormPrint will be ready for inclusion into the main
2408 trunk immediately after 1.1.5 is released -- provided we're prepared
2409 for complaints about lame compilers not handling XTL.
2411 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2413 2000-04-07 Allan Rae <rae@lyx.org>
2415 * config/lyxinclude.m4: A bit more tidying up (Angus)
2417 * src/LString.h: JMarc's <string> header fix
2419 * src/PrinterParams.h: Used string for most data to remove some
2420 ugly code in the Print dialog and avoid even uglier code when
2421 appending the ints to a string for output.
2423 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2424 and moved "default:" back to the end of switch statement. Cleaned
2425 up the printing so it uses the right function calls and so the
2426 "print to file" option actually puts the file in the right directory.
2428 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2430 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2431 and Ok+Apply button control into a separate method: input (Angus).
2432 (input) Cleaned it up and improved it to be very thorough now.
2433 (All CB) static_cast used instead of C style cast (Angus). This will
2434 probably change again once we've worked out how to keep gcc-2.8.1 happy
2435 with real C callbacks.
2436 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2437 ignore some of the bool settings and has random numbers instead. Needs
2438 some more investigation. Added other input length checks and checking
2439 of file and printer names.
2441 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2442 would link (Angus). Seems the old code doesn't compile with the pragma
2443 statement either. Separated callback entries from internal methods.
2445 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2447 2000-03-17 Allan Rae <rae@lyx.org>
2449 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2450 need it? Maybe it could go in Dialogs instead? I could make it a
2451 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2452 values to get the bool return value.
2453 (Dispatch): New overloaded method for xtl support.
2455 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2456 extern "C" callback instead of static member functions. Hopefully,
2457 JMarc will be able to compile this. I haven't changed
2458 forms/form_copyright.fd yet. Breaking one of my own rules already.
2460 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2461 because they aren't useful from the minibuffer. Maybe a LyXServer
2462 might want a help message though?
2464 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2466 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2467 xtl which needs both rtti and exceptions.
2469 * src/support/Makefile.am:
2470 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2472 * src/frontends/xforms/input_validators.[ch]: input filters and
2473 validators. These conrol what keys are valid in input boxes.
2474 Use them and write some more. Much better idea than waiting till
2475 after the user has pressed Ok to say that the input fields don't make
2478 * src/frontends/xforms/Makefile.am:
2479 * src/frontends/xforms/forms/form_print.fd:
2480 * src/frontends/xforms/forms/makefile:
2481 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2482 new scheme. Still have to make sure I haven't missed anything from
2483 the current implementation.
2485 * src/Makefile.am, src/PrinterParams.h: New data store.
2487 * other files: Added a couple of copyright notices.
2489 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2491 * src/insets/insetbib.h: move Holder struct in public space.
2493 * src/frontends/include/DialogBase.h: use SigC:: only when
2494 SIGC_CXX_NAMESPACES is defined.
2495 * src/frontends/include/Dialogs.h: ditto.
2497 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2499 * src/frontends/xforms/FormCopyright.[Ch]: do not
2500 mention SigC:: explicitely.
2502 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2504 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2505 deals with testing KDE in main configure.in
2506 * configure.in: ditto.
2508 2000-02-22 Allan Rae <rae@lyx.org>
2510 * Lots of files: Merged from HEAD
2512 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2513 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2515 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2517 * sigc++/: new minidist.
2519 2000-02-14 Allan Rae <rae@lyx.org>
2521 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2523 2000-02-08 Juergen Vigna <jug@sad.it>
2525 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2526 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2528 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2529 for this port and so it is much easier for other people to port
2530 dialogs in a common development environment.
2532 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2533 the QT/KDE implementation.
2535 * src/frontends/kde/Dialogs.C:
2536 * src/frontends/kde/FormCopyright.C:
2537 * src/frontends/kde/FormCopyright.h:
2538 * src/frontends/kde/Makefile.am:
2539 * src/frontends/kde/formcopyrightdialog.C:
2540 * src/frontends/kde/formcopyrightdialog.h:
2541 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2542 for the kde support of the Copyright-Dialog.
2544 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2545 subdir-substitution instead of hardcoded 'xforms' as we now have also
2548 * src/frontends/include/DialogBase.h (Object): just commented the
2549 label after #endif (nasty warning and I don't like warnings ;)
2551 * src/main.C (main): added KApplication initialization if using
2554 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2555 For now only the KDE event-loop is added if frontend==kde.
2557 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2559 * configure.in: added support for the --with-frontend[=value] option
2561 * autogen.sh: added kde.m4 file to list of config-files
2563 * acconfig.h: added define for KDEGUI-support
2565 * config/kde.m4: added configuration functions for KDE-port
2567 * config/lyxinclude.m4: added --with-frontend[=value] option with
2568 support for xforms and KDE.
2570 2000-02-08 Allan Rae <rae@lyx.org>
2572 * all Makefile.am: Fixed up so the make targets dist, distclean,
2573 install and uninstall all work even if builddir != srcdir. Still
2574 have a new sigc++ minidist update to come.
2576 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2578 2000-02-01 Allan Rae <rae@lyx.org>
2580 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2581 Many mods to get builddir != srcdir working.
2583 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2584 for building on NT and so we can do the builddir != srcdir stuff.
2586 2000-01-30 Allan Rae <rae@lyx.org>
2588 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2589 This will stay in "rae" branch. We probably don't really need it in
2590 the main trunk as anyone who wants to help programming it should get
2591 a full library installed also. So they can check both included and
2592 system supplied library compilation.
2594 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2595 Added a 'mini' distribution of libsigc++. If you feel the urge to
2596 change something in these directories - Resist it. If you can't
2597 resist the urge then you should modify the following script and rebuild
2598 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2599 all happen. Still uses a hacked version of libsigc++'s configure.in.
2600 I'm quite happy with the results. I'm not sure the extra work to turn
2601 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2602 worth the trouble and would probably lead to extra maintenance
2604 I haven't tested the following important make targets: install, dist.
2605 Not ready for prime time but very close. Maybe 1.1.5.
2607 * development/tools/makeLyXsigc.sh: A shell script to automatically
2608 generate our mini-dist of libsigc++. It can only be used with a CVS
2609 checkout of libsigc++ not a tarball distribution. It's well commented.
2610 This will end up as part of the libsigc++ distribution so other apps
2611 can easily have an included mini-dist. If someone makes mods to the
2612 sigc++ subpackage without modifying this script to generate those
2613 changes I'll be very upset!
2615 * src/frontends/: Started the gui/system indep structure.
2617 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
2618 to access the gui-indep dialogs are in this class. Much improved
2619 design compared to previous revision. Lars, please refrain from
2620 moving this header into src/ like you did with Popups.h last time.
2622 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
2624 * src/frontends/xforms/: Started the gui-indep system with a single
2625 dialog: FormCopyright. Initial testing of use of libsigc++ was very
2628 * src/frontends/xforms/forms: Repository for the xforms .fd files.
2629 Here you'll find a very useful makefile and automated fdfix.sh that
2630 makes updating dailogs a no-brainer -- provided you follow the rules
2631 set out in the README. I'm thinking about adding another script to
2632 automatically generate skeleton code for a new dialog given just the
2635 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
2636 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
2637 Made FormCopyright gui-indep and added a lyxfunc to get to it.
2639 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
2641 * src/support/LSubstring.C (operator): simplify
2643 * src/lyxtext.h: removed bparams, use buffer_->params instead
2645 * src/lyxrow.h: make Row a real class, move all variables to
2646 private and use accessors.
2648 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
2650 (isRightToLeftPar): ditto
2651 (ChangeLanguage): ditto
2652 (isMultiLingual): ditto
2655 (SimpleTeXOnePar): ditto
2656 (TeXEnvironment): ditto
2657 (GetEndLabel): ditto
2659 (SetOnlyLayout): ditto
2660 (BreakParagraph): ditto
2661 (BreakParagraphConservative): ditto
2662 (GetFontSettings): ditto
2664 (CopyIntoMinibuffer): ditto
2665 (CutIntoMinibuffer): ditto
2666 (PasteParagraph): ditto
2667 (SetPExtraType): ditto
2668 (UnsetPExtraType): ditto
2669 (DocBookContTableRows): ditto
2670 (SimpleDocBookOneTablePar): ditto
2672 (TeXFootnote): ditto
2673 (SimpleTeXOneTablePar): ditto
2674 (TeXContTableRows): ditto
2675 (SimpleTeXSpecialChars): ditto
2678 * src/lyxcursor.h: make LyXCursor a real class, move all variables
2679 to private and use accessors.
2681 * src/lyx_cb.C: remove char updatetimer, and all code that uses
2682 this, we did not use it anymore and has not been for ages. Just a
2683 waste of cpu cycles.
2685 * src/language.h: make Language a real class, move all variables
2686 to private and use accessors.
2688 * src/BufferView_pimpl.C (Pimpl): use new timer code.
2689 (create_view): remove
2690 (update): some changes for new timer
2691 (cursorToggle): use new timer
2692 (beforeChange): change for new timer
2694 * src/BufferView.h (cursorToggleCB): removed last paramter because
2697 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
2698 (cursorToggleCB): change because of new timer code
2700 * lib/CREDITS: updated own mailaddress
2702 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2704 * src/support/filetools.C (PutEnv): fix the code in case neither
2705 putenv() nor setenv() have been found.
2707 * INSTALL: mention the install-strip Makefile target.
2709 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
2710 read-only documents.
2712 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2714 * lib/reLyX/configure.in (VERSION): avoid using a previously
2715 generated reLyX wrapper to find out $prefix.
2717 * lib/examples/eu_adibide_lyx-atua.lyx:
2718 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
2719 translation of the Tutorial (Dooteo)
2721 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
2723 * forms/cite.fd: new citation dialog
2725 * src/insetcite.[Ch]: the new citation dialog is moved into
2728 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
2731 * src/insets/insetcommand.h: data members made private.
2733 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2735 * LyX 1.1.5 released
2737 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2739 * src/version.h (LYX_RELEASE): to 1.1.5
2741 * src/spellchecker.C (RunSpellChecker): return false if the
2742 spellchecker dies upon creation.
2744 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2746 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
2747 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
2751 * lib/CREDITS: update entry for Martin Vermeer.
2753 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
2755 * src/text.C (draw): Draw foreign language bars at the bottom of
2756 the row instead of at the baseline.
2758 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
2760 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2762 * lib/bind/de_menus.bind: updated
2764 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2766 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
2768 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2770 * src/menus.C (Limit_string_length): New function
2771 (ShowTocMenu): Limit the number of items/length of items in the
2774 * src/paragraph.C (String): Correct result for a paragraph inside
2777 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2779 * src/bufferlist.C (close): test of buf->getuser() == NULL
2781 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
2783 * src/BufferView2.C (removeAutoInsets): Fix a bug:
2784 Do not call to SetCursor when the paragraph is a closed footnote!
2786 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
2788 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
2791 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
2793 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2796 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
2797 reference popup, that activates the reference-back action
2799 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
2801 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
2802 the menus. Also fixed a bug.
2804 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
2805 the math panels when switching buffers (unless new buffer is readonly).
2807 * src/BufferView.C (NoSavedPositions)
2808 * src/BufferView_pimpl.C (NoSavedPositions): New methods
2810 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2812 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
2813 less of dvi dirty or not.
2815 * src/trans_mgr.[Ch] (insert): change first parameter to string
2818 * src/chset.[Ch] (encodeString): add const to first parameter
2820 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2822 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
2826 * src/LaTeX.C (deplog): better searching for dependency files in
2827 the latex log. Uses now regexps.
2829 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
2830 instead of the box hack or \hfill.
2832 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2834 * src/lyxfunc.C (doImportHelper): do not create the file before
2835 doing the actual import.
2836 (doImportASCIIasLines): create a new file before doing the insert.
2837 (doImportASCIIasParagraphs): ditto.
2839 * lib/lyxrc.example: remove mention of non-existing commands
2841 * lyx.man: remove mention of color-related switches.
2843 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
2845 * src/lyx_gui.C: remove all the color-related ressources, which
2846 are not used anymore.
2848 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
2851 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2853 * src/lyxrc.C (read): Add a missing break in the switch
2855 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
2857 * src/text2.C (InsertStringA): Fix a bug with insertion into table
2859 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
2862 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
2864 * src/text.C (draw): draw bars under foreign language words.
2866 * src/LColor.[Ch]: add LColor::language
2868 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
2870 * src/lyxcursor.h (boundary): New member variable
2872 * src/text.C (IsBoundary): New methods
2874 * src/text.C: Use the above for currect cursor movement when there
2875 is both RTL & LTR text.
2877 * src/text2.C: ditto
2879 * src/bufferview_funcs.C (ToggleAndShow): ditto
2881 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2883 * src/text.C (DeleteLineForward): set selection to true to avoid
2884 that DeleteEmptyParagraphMechanism does some magic. This is how it
2885 is done in all other functions, and seems reasonable.
2886 (DeleteWordForward): do not jump over non-word stuff, since
2887 CursorRightOneWord() already does it.
2889 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
2890 DeleteWordBackward, since they seem safe to me (since selection is
2891 set to "true") DeleteEmptyParagraphMechanism does nothing.
2893 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2895 * src/lyx_main.C (easyParse): simplify the code by factoring the
2896 part that removes parameters from the command line.
2897 (LyX): check wether wrong command line options have been given.
2899 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
2901 * src/lyx_main.C : add support for specifying user LyX
2902 directory via command line option -userdir.
2904 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
2906 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
2907 the number of items per popup.
2908 (Add_to_refs_menu): Ditto.
2910 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2912 * src/lyxparagraph.h: renamed ClearParagraph() to
2913 StripLeadingSpaces() and moved it to paragraph.C. We pass the
2914 textclass as parameter, and do nothing if free_spacing is
2915 true. This fixes part of the line-delete-forward problems.
2917 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
2918 (pasteSelection): ditto.
2919 (SwitchLayoutsBetweenClasses): more translatable strings.
2921 * src/text2.C (CutSelection): use StripLeadingSpaces.
2922 (PasteSelection): ditto.
2923 (DeleteEmptyParagraphMechanism): ditto.
2925 2000-05-26 Juergen Vigna <jug@sad.it>
2927 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
2928 is not needed in tabular insets.
2930 * src/insets/insettabular.C (TabularFeatures): added missing features.
2932 * src/tabular.C (DeleteColumn):
2934 (AppendRow): implemented this functions
2935 (cellsturct::operator=): clone the inset too;
2937 2000-05-23 Juergen Vigna <jug@sad.it>
2939 * src/insets/insettabular.C (LocalDispatch): better selection support
2940 when having multicolumn-cells.
2942 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
2944 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
2946 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2948 * src/ColorHandler.C (getGCForeground): put more test into _()
2950 * lib/examples/eu_splash.lyx: new file (Basque translation) from
2953 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
2956 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
2958 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
2959 there are no labels, or when buffer is readonly.
2961 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
2962 there are no labels, buffer is SGML, or when buffer is readonly.
2964 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2966 * src/LColor.C (LColor): change a couple of grey40 to grey60
2967 (LColor): rewore initalization to make compiles go some magnitude
2969 (getGUIName): don't use gettext until we need the string.
2971 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
2973 * src/Bullet.[Ch]: Fixed a small bug.
2975 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
2977 * src/paragraph.C (String): Several fixes/improvements
2979 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
2981 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2983 * src/paragraph.C (String): give more correct output.
2985 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
2987 * src/lyxfont.C (stateText) Do not output the language if it is
2988 eqaul to the language of the document.
2990 * src/paragraph.C (TeXOnePar): Do not put language switch commands
2991 between two paragraphs with the same language.
2993 * src/paragraph.C (getParLanguage) Return a correct answer for an
2994 empty dummy paragraph.
2996 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
2999 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3002 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3003 the menus/popup, if requested fonts are unavailable.
3005 2000-05-22 Juergen Vigna <jug@sad.it>
3007 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3008 movement support (Up/Down/Tab/Shift-Tab).
3009 (LocalDispatch): added also preliminari cursor-selection.
3011 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3013 * src/paragraph.C (PasteParagraph): Hopefully now right!
3015 2000-05-22 Garst R. Reese <reese@isn.net>
3017 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3018 of list, change all references to Environment to Command
3019 * tex/hollywood.cls : rewrite environments as commands, add
3020 \uppercase to interiorshot and exteriorshot to force uppecase.
3021 * tex/broadway.cls : rewrite environments as commands. Tweak
3024 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3026 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3027 size of items: use a constant intead of the hardcoded 40, and more
3028 importantly do not remove the %m and %x tags added at the end.
3029 (Add_to_refs_menu): use vector::size_type instead of
3030 unsigned int as basic types for the variables. _Please_ do not
3031 assume that size_t is equal to unsigned int. On an alpha, this is
3032 unsigned long, which is _not_ the same.
3034 * src/language.C (initL): remove language "hungarian", since it
3035 seems that "magyar" is better.
3037 2000-05-22 Juergen Vigna <jug@sad.it>
3039 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3041 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3044 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3045 next was deleted but not set to 0.
3047 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3049 * src/language.C (initL): change the initialization of languages
3050 so that compiles goes _fast_.
3052 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3055 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3057 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3061 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3063 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3065 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3069 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3072 * src/insets/insetlo*.[Ch]: Made editable
3074 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3076 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3077 the current selection.
3079 * src/BufferView_pimpl.C (stuffClipboard): new method
3081 * src/BufferView.C (stuffClipboard): new method
3083 * src/paragraph.C (String): new method
3085 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3086 LColor::ignore when lyxname is not found.
3088 * src/BufferView.C (pasteSelection): new method
3090 * src/BufferView_pimpl.C (pasteSelection): new method
3092 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3094 * src/WorkArea.C (request_clipboard_cb): new static function
3095 (getClipboard): new method
3096 (putClipboard): new method
3098 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3100 * LyX 1.1.5pre2 released
3102 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3104 * src/vspace.C (operator=): removed
3105 (operator=): removed
3107 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3109 * src/layout.C (NumberOfClass): manually set the type in make_pair
3110 (NumberOfLayout): ditto
3112 * src/language.C: use the Language constructor for ignore_lang
3114 * src/language.h: add constructors to struct Language
3116 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3118 * src/text2.C (SetCursorIntern): comment out #warning
3120 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3122 * src/mathed/math_iter.h: initialize sx and sw to 0
3124 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3126 * forms/lyx.fd: Redesign of form_ref
3128 * src/LaTeXFeatures.[Ch]
3132 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3135 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3136 and Buffer::inset_iterator.
3138 * src/menus.C: Added new menus: TOC and Refs.
3140 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3142 * src/buffer.C (getTocList): New method.
3144 * src/BufferView2.C (ChangeRefs): New method.
3146 * src/buffer.C (getLabelList): New method. It replaces the old
3147 getReferenceList. The return type is vector<string> instead of
3150 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3151 the old getLabel() and GetNumberOfLabels() methods.
3152 * src/insets/insetlabel.C (getLabelList): ditto
3153 * src/mathed/formula.C (getLabelList): ditto
3155 * src/paragraph.C (String): New method.
3157 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3158 Uses the new getTocList() method.
3159 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3160 which automatically updates the contents of the browser.
3161 (RefUpdateCB): Use the new getLabelList method.
3163 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3165 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3167 * src/spellchecker.C: Added using std::reverse;
3169 2000-05-19 Juergen Vigna <jug@sad.it>
3171 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3173 * src/insets/insettext.C (computeTextRows): small fix for display of
3174 1 character after a newline.
3176 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3179 2000-05-18 Juergen Vigna <jug@sad.it>
3181 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3182 when changing width of column.
3184 * src/tabular.C (set_row_column_number_info): setting of
3185 autobreak rows if necessary.
3187 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3189 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3191 * src/vc-backend.*: renamed stat() to status() and vcstat to
3192 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3193 compilation broke. The new name seems more relevant, anyway.
3195 2000-05-17 Juergen Vigna <jug@sad.it>
3197 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3198 which was wrong if the removing caused removing of rows!
3200 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3201 (pushToken): new function.
3203 * src/text2.C (CutSelection): fix problem discovered with purify
3205 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3207 * src/debug.C (showTags): enlarge the first column, now that we
3208 have 6-digits debug codes.
3210 * lib/layouts/hollywood.layout:
3211 * lib/tex/hollywood.cls:
3212 * lib/tex/brodway.cls:
3213 * lib/layouts/brodway.layout: more commands and fewer
3214 environments. Preambles moved in the .cls files. Broadway now has
3215 more options on scene numbering and less whitespace (from Garst)
3217 * src/insets/insetbib.C (getKeys): make sure that we are in the
3218 document directory, in case the bib file is there.
3220 * src/insets/insetbib.C (Latex): revert bogus change.
3222 2000-05-16 Juergen Vigna <jug@sad.it>
3224 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3225 the TabularLayout on cursor move.
3227 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3229 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3232 (draw): fixed cursor position and drawing so that the cursor is
3233 visible when before the tabular-inset.
3235 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3236 when creating from old insettext.
3238 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3240 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3242 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3243 * lib/tex/brodway.cls: ditto
3245 * lib/layouts/brodway.layout: change alignment of parenthical
3248 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3250 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3251 versions 0.88 and 0.89 are supported.
3253 2000-05-15 Juergen Vigna <jug@sad.it>
3255 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3258 * src/insets/insettext.C (computeTextRows): redone completely this
3259 function in a much cleaner way, because of problems when having a
3261 (draw): added a frame border when the inset is locked.
3262 (SetDrawLockedFrame): this sets if we draw the border or not.
3263 (SetFrameColor): this sets the frame color (default=insetframe).
3265 * src/insets/lyxinset.h: added x() and y() functions which return
3266 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3267 function which is needed to see if we have a locking inset of some
3268 type in this inset (needed for now in insettabular).
3270 * src/vspace.C (inPixels): the same function also without a BufferView
3271 parameter as so it is easier to use it in some ocasions.
3273 * src/lyxfunc.C: changed all places where insertInset was used so
3274 that now if it couldn't be inserted it is deleted!
3276 * src/TabularLayout.C:
3277 * src/TableLayout.C: added support for new tabular-inset!
3279 * src/BufferView2.C (insertInset): this now returns a bool if the
3280 inset was really inserted!!!
3282 * src/tabular.C (GetLastCellInRow):
3283 (GetFirstCellInRow): new helper functions.
3284 (Latex): implemented for new tabular class.
3288 (TeXTopHLine): new Latex() helper functions.
3290 2000-05-12 Juergen Vigna <jug@sad.it>
3292 * src/mathed/formulamacro.C (Read):
3293 * src/mathed/formula.C (Read): read also the \end_inset here!
3295 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3297 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3298 crush when saving formulae with unbalanced parenthesis.
3300 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3302 * src/layout.C: Add new keyword "endlabelstring" to layout file
3304 * src/text.C (GetVisibleRow): Draw endlabel string.
3306 * lib/layouts/broadway.layout
3307 * lib/layouts/hollywood.layout: Added endlabel for the
3308 Parenthetical layout.
3310 * lib/layouts/heb-article.layout: Do not use slanted font shape
3311 for Theorem like environments.
3313 * src/buffer.C (makeLaTeXFile): Always add "american" to
3314 the UsedLanguages list if document language is RTL.
3316 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3318 * add addendum to README.OS2 and small patch (from SMiyata)
3320 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3322 * many files: correct the calls to ChangeExtension().
3324 * src/support/filetools.C (ChangeExtension): remove the no_path
3325 argument, which does not belong there. Use OnlyFileName() instead.
3327 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3328 files when LaTeXing a non-nice latex file.
3330 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3331 a chain of "if". Return false when deadkeys are not handled.
3333 * src/lyx_main.C (LyX): adapted the code for default bindings.
3335 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3336 bindings for basic functionality (except deadkeys).
3337 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3339 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3340 several methods: handle override_x_deadkeys.
3342 * src/lyxrc.h: remove the "bindings" map, which did not make much
3343 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3345 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3347 * src/lyxfont.C (stateText): use a saner method to determine
3348 whether the font is "default". Seems to fix the crash with DEC
3351 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3353 2000-05-08 Juergen Vigna <jug@sad.it>
3355 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3356 TabularLayoutMenu with mouse-button-3
3357 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3359 * src/TabularLayout.C: added this file for having a Layout for
3362 2000-05-05 Juergen Vigna <jug@sad.it>
3364 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3365 recalculating inset-widths.
3366 (TabularFeatures): activated this function so that I can change
3367 tabular-features via menu.
3369 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3370 that I can test some functions with the Table menu.
3372 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3374 * src/lyxfont.C (stateText): guard against stupid c++libs.
3376 * src/tabular.C: add using std::vector
3377 some whitespace changes, + removed som autogenerated code.
3379 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3381 2000-05-05 Juergen Vigna <jug@sad.it>
3383 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3384 row, columns and cellstructures.
3386 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3388 * lib/lyxrc.example: remove obsolete entries.
3390 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3391 reading of protected_separator for free_spacing.
3393 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3395 * src/text.C (draw): do not display an exclamation mark in the
3396 margin for margin notes. This is confusing, ugly and
3399 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3400 AMS math' is checked.
3402 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3403 name to see whether including the amsmath package is needed.
3405 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3407 * src/paragraph.C (validate): Compute UsedLanguages correctly
3408 (don't insert the american language if it doesn't appear in the
3411 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3412 The argument of \thanks{} command is considered moving argument
3414 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3417 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3419 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3420 for appendix/minipage/depth. The lines can be now both in the footnote
3421 frame, and outside the frame.
3423 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3426 2000-05-05 Juergen Vigna <jug@sad.it>
3428 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3429 neede only in tabular.[Ch].
3431 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3433 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3435 (Write): write '~' for PROTECTED_SEPARATOR
3437 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3439 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3442 * src/mathed/formula.C (drawStr): rename size to siz.
3444 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3445 possibly fix a bug by not changing the pflags = flags to piflags =
3448 2000-05-05 Juergen Vigna <jug@sad.it>
3450 * src/insets/insetbib.C: moved using directive
3452 * src/ImportNoweb.C: small fix for being able to compile (missing
3455 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3457 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3458 to use clear, since we don't depend on this in the code. Add test
3461 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3463 * (various *.C files): add using std::foo directives to please dec
3466 * replace calls to string::clear() to string::erase() (Angus)
3468 * src/cheaders/cmath: modified to provide std::abs.
3470 2000-05-04 Juergen Vigna <jug@sad.it>
3472 * src/insets/insettext.C: Prepared all for inserting of multiple
3473 paragraphs. Still display stuff to do (alignment and other things),
3474 but I would like to use LyXText to do this when we cleaned out the
3475 table-support stuff.
3477 * src/insets/insettabular.C: Changed lot of stuff and added lots
3478 of functionality still a lot to do.
3480 * src/tabular.C: Various functions changed name and moved to be
3481 const functions. Added new Read and Write functions and changed
3482 lots of things so it works good with tabular-insets (also removed
3483 some stuff which is not needed anymore * hacks *).
3485 * src/lyxcursor.h: added operators == and != which just look if
3486 par and pos are (not) equal.
3488 * src/buffer.C (latexParagraphs): inserted this function to latex
3489 all paragraphs form par to endpar as then I can use this too for
3492 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3493 so that I can call this to from text insets with their own cursor.
3495 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3496 output off all paragraphs (because of the fix below)!
3498 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3499 the very last paragraph (this could be also the last paragraph of an
3502 * src/texrow.h: added rows() call which returns the count-variable.
3504 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3506 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3508 * lib/configure.m4: better autodetection of DocBook tools.
3510 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3512 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3514 * src/lyx_cb.C: add using std::reverse;
3516 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3519 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3520 selected files. Should fix repeated errors from generated files.
3522 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3524 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3526 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3527 the spellchecker popup.
3529 * lib/lyxrc.example: Removed the \number_inset section
3531 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3533 * src/insets/figinset.C (various): Use IsFileReadable() to make
3534 sure that the file actually exist. Relying on ghostscripts errors
3535 is a bad idea since they can lead to X server crashes.
3537 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3539 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3542 * lib/lyxrc.example: smallish typo in description of
3543 \view_dvi_paper_option
3545 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3548 * src/lyxfunc.C: doImportHelper to factor out common code of the
3549 various import methods. New functions doImportASCIIasLines,
3550 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3551 doImportLinuxDoc for the format specific parts.
3554 * buffer.C: Dispatch returns now a bool to indicate success
3557 * lyx_gui.C: Add getLyXView() for member access
3559 * lyx_main.C: Change logic for batch commands: First try
3560 Buffer::Dispatch (possibly without GUI), if that fails, use
3563 * lyx_main.C: Add support for --import command line switch.
3564 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3565 Available Formats: Everything accepted by 'buffer-import <format>'
3567 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3569 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3572 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3573 documents will be reformatted upon reentry.
3575 2000-04-27 Juergen Vigna <jug@sad.it>
3577 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3578 correctly only last pos this was a bug.
3580 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3582 * release of lyx-1.1.5pre1
3584 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3586 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3588 * src/menus.C: revert the change of naming (Figure->Graphic...)
3589 from 2000-04-11. It was incomplete and bad.
3591 * src/LColor.[Ch]: add LColor::depthbar.
3592 * src/text.C (GetVisibleRow): use it.
3594 * README: update the languages list.
3596 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3598 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3601 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3603 * README: remove sections that were just wrong.
3605 * src/text2.C (GetRowNearY): remove currentrow code
3607 * src/text.C (GetRow): remove currentrow code
3609 * src/screen.C (Update): rewritten a bit.
3610 (SmallUpdate): removed func
3612 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
3614 (FullRebreak): return bool
3615 (currentrow): remove var
3616 (currentrow_y): ditto
3618 * src/lyxscreen.h (Draw): change arg to unsigned long
3619 (FitCursor): return bool
3620 (FitManualCursor): ditto
3621 (Smallpdate): remove func
3622 (first): change to unsigned long
3623 (DrawOneRow): change second arg to long (from long &)
3624 (screen_refresh_y): remove var
3625 (scree_refresh_row): ditto
3627 * src/lyxrow.h: change baseline to usigned int from unsigned
3628 short, this brings some implicit/unsigned issues out in the open.
3630 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
3632 (Dispatch): don't call updateScrollbar after fitCursor. Use update
3633 instead of smallUpdate.
3635 * src/lyxcursor.h: change y to unsigned long
3637 * src/buffer.h: don't call updateScrollbar after fitcursor
3639 * src/buffer.C (parseSingleLyXformat2Token): move variables to
3640 where they are used. Removed "\\direction", this was not present
3641 in 1.1.4 and is already obsolete. Commented out some code that I
3642 believe to never be called.
3643 (runLiterate): don't call updateScrollbar after fitCursor
3645 (buildProgram): ditto
3648 * src/WorkArea.h (workWidth): change return val to unsigned
3651 (redraw): remove the button redraws
3652 (setScrollbarValue): change for scrollbar
3653 (getScrollbarValue): change for scrollbar
3654 (getScrollbarBounds): change for scrollbar
3656 * src/WorkArea.C (C_WorkArea_up_cb): removed func
3657 (C_WorkArea_down_cb): removed func
3658 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
3659 (resize): change for scrollbar
3660 (setScrollbar): ditto
3661 (setScrollbarBounds): ditto
3662 (setScrollbarIncrements): ditto
3663 (up_cb): removed func
3664 (down_cb): removed func
3665 (scroll_cb): change for scrollbar
3666 (work_area_handler): ditto
3668 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
3669 when FitCursor did something.
3670 (updateScrollbar): some unsigned changes
3671 (downCB): removed func
3672 (scrollUpOnePage): removed func
3673 (scrollDownOnePage): remvoed func
3674 (workAreaMotionNotify): don't call screen->FitCursor but use
3675 fitCursor instead. and bool return val
3676 (workAreaButtonPress): ditto
3677 (workAreaButtonRelease): some unsigned changes
3678 (checkInsetHit): ditto
3679 (workAreaExpose): ditto
3680 (update): parts rewritten, comments about the signed char arg added
3681 (smallUpdate): removed func
3682 (cursorPrevious): call needed updateScrollbar
3685 * src/BufferView2.C (allFloats): don't call updateScrollbar after
3688 * src/BufferView.[Ch] (upCB): removed func
3689 (downCB): removed func
3690 (smallUpdate): removed func
3692 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3694 * src/lyxtext.h src/text.C src/text2.C: removed support for the
3695 currentrow, currentrow_y optimization. This did not help a lot and
3696 if we want to do this kind of optimization we should rather use
3697 cursor.row instead of the currentrow.
3699 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
3700 buffer spacing and klyx spacing support.
3702 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3704 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
3707 2000-04-26 Juergen Vigna <jug@sad.it>
3709 * src/insets/figinset.C: fixes to Lars sstream changes!
3711 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
3713 * A lot of files: Added Ascii(ostream &) methods to all inset
3714 classes. Used when exporting to ASCII.
3716 * src/buffer.C (writeFileAscii,RoffAsciiTable)
3717 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
3720 * src/text2.C (ToggleFree): Disabled implicit word selection when
3721 there is a change in the language
3723 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
3724 no output was generated for end-of-sentence inset.
3726 * src/insets/lyxinset.h
3729 * src/paragraph.C: Removed the insetnumber code
3731 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
3733 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3735 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
3736 no_babel and no_epsfig completely from the file.
3737 (parseSingleLyXformat2Token): add handling for per-paragraph
3738 spacing as written by klyx.
3740 * src/insets/figinset.C: applied patch by Andre. Made it work with
3743 2000-04-20 Juergen Vigna <jug@sad.it>
3745 * src/insets/insettext.C (cutSelection):
3746 (copySelection): Fixed with selection from right to left.
3747 (draw): now the rows are not recalculated at every draw.
3748 (computeTextRows): for now reset the inset-owner here (this is
3749 important for an undo or copy where the inset-owner is not set
3752 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
3753 motion to the_locking_inset screen->first was forgotten, this was
3754 not important till we got multiline insets.
3756 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3758 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
3759 code seems to be alright (it is code changed by Dekel, and the
3760 intent is indeed that all macros should be defined \protect'ed)
3762 * NEWS: a bit of reorganisation of the new user-visible features.
3764 2000-04-19 Juergen Vigna <jug@sad.it>
3766 * src/insets/insettext.C (init): using a LyXCursor now for cursor
3767 position. Set the inset_owner of the used paragraph so that it knows
3768 that it is inside an inset. Fixed cursor handling with mouse and
3769 cursor keys. Fixed wrong timed inset redraws and lots of other changes
3770 and cleanups to make TextInsets work better.
3772 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
3773 Changed parameters of various functions and added LockInsetInInset().
3775 * src/insets/insettext.C:
3777 * src/insets/insetcollapsable.h:
3778 * src/insets/insetcollapsable.C:
3779 * src/insets/insetfoot.h:
3780 * src/insets/insetfoot.C:
3781 * src/insets/insetert.h:
3782 * src/insets/insetert.C: cleaned up the code so that it works now
3783 correctly with insettext.
3785 * src/insets/inset.C:
3786 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
3787 that insets in insets are supported right.
3790 * src/table.C: lots of changes for use with inset tabular (and cleanup)
3792 * src/paragraph.C: some small fixes
3794 * src/debug.h: inserted INSETS debug info
3796 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
3797 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
3799 * src/commandtags.h:
3800 * src/LyXAction.C: insert code for InsetTabular.
3802 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
3803 not Button1MotionMask.
3804 (workAreaButtonRelease): send always a InsetButtonRelease event to
3806 (checkInsetHit): some setCursor fixes (always with insets).
3808 * src/BufferView2.C (lockInset): returns a bool now and extended for
3809 locking insets inside insets.
3810 (showLockedInsetCursor): it is important to have the cursor always
3811 before the locked inset.
3812 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
3814 * src/BufferView.h: made lockInset return a bool.
3816 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
3818 * src/text2.C (SetCursor): This now has a version with a LyXCursor
3819 that is used also internally but can be called as public to have back
3820 a cursor pos which is not set internally.
3821 (SetCursorIntern): Changed to use above function.
3823 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
3825 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3830 * NEWS: updated for prerelease of 1.1.5. Please comment and send
3831 patches for things that should be in or should be changed.
3833 * src/* [insetfiles]: change "usigned char fragile" to bool
3834 fragile. There was only one point that could that be questioned
3835 and that is commented in formulamacro.C. Grep for "CHECK".
3837 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
3838 (DeleteBuffer): take it out of CutAndPaste and make it static.
3840 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3842 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
3843 output the spacing envir commands. Also the new commands used in
3844 the LaTeX output makes the result better.
3846 * src/Spacing.C (writeEnvirBegin): new method
3847 (writeEnvirEnd): new method
3849 2000-04-18 Juergen Vigna <jug@sad.it>
3851 * src/CutAndPaste.C: made textclass a static member of the class
3852 as otherwise it is not accesed right!!!
3854 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
3856 * forms/layout_forms.fd
3857 * src/layout_forms.h
3858 * src/layout_forms.C (create_form_form_character)
3859 * src/lyx_cb.C (UserFreeFont)
3860 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
3861 documents (in the layout->character popup).
3863 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3865 * src/spellchecker.C (create_ispell_pipe): fix a bug where
3866 \spell_command was in fact not honored (from Kevin Atkinson).
3868 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
3871 * src/lyx_gui.h: make lyxViews private (Angus)
3873 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
3875 * src/mathed/math_write.C
3876 (MathMatrixInset::Write) Put \protect before \begin{array} and
3877 \end{array} if fragile
3878 (MathParInset::Write): Put \protect before \\ if fragile
3880 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3882 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
3883 initialization if the LyXColorHandler must be done after the
3884 connections to the XServer has been established.
3886 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
3887 get the background pixel from the lyxColorhandler so that the
3888 figures are rendered with the correct background color.
3889 (NextToken): removed functions.
3890 (GetPSSizes): use ifs >> string instead of NextToken.
3892 * src/Painter.[Ch]: the color cache moved out of this file.
3894 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
3897 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3899 * src/WorkArea.C (work_area_handler): call BufferView::enterView
3900 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
3902 * src/BufferView.C (enterView): new func
3903 (leaveView): new func
3905 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
3907 (leaveView): new func, undefines xterm cursor when approp.
3909 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
3910 (AllowInput): delete the Workarea cursor handling from this func.
3912 * src/Painter.C (underline): draw a slimer underline in most cases.
3914 * src/lyx_main.C (error_handler): use extern "C"
3916 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3918 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
3919 sent directly to me.
3921 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
3922 to the list by Dekel.
3924 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
3927 * src/bufferview_funcs.[Ch]: two new files, moved several of the
3928 methods from lyx_cb.here.
3930 * src/lyx_cb.C: in addition to the above; removed input_prohibited
3933 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
3935 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
3936 instead of using current_view directly.
3938 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
3940 * src/LyXAction.C (init): add the paragraph-spacing command.
3942 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
3944 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
3946 * src/lyx_cb.C (CurrentState): output a string when the spacing is
3947 different from the documents.
3949 * src/text.C (SetHeightOfRow): take paragraph spacing into
3950 account, paragraph spacing takes precedence over buffer spacing
3951 (GetVisibleRow): ditto
3953 * src/paragraph.C (writeFile): output the spacing parameter too.
3954 (validate): set the correct features if spacing is used in the
3956 (Clear): set spacing to default
3957 (MakeSameLayout): spacing too
3958 (HasSameLayout): spacing too
3959 (SetLayout): spacing too
3960 (TeXOnePar): output the spacing commands
3962 * src/lyxparagraph.h: added a spacing variable for use with
3963 per-paragraph spacing.
3965 * src/Spacing.h: add a Default spacing and a method to check if
3966 the current spacing is default. also added an operator==
3968 * src/text2.C (DeleteEmptyParagraphMechanism): added a
3971 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3973 * src/lyxserver.C (callback): fix dispatch of functions
3975 * src/insets/insetlatexaccent.C (checkContents): turn bogus
3976 printf() into lyxerr call.
3978 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
3981 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
3982 "Table" to "Table Box", "Float" to "Floating Material"; deletes
3983 the "Float" from each of the subitems.
3984 (ShowHelpMenu): add entry for "FAQ" and "TOC".
3986 * src/support/DebugStream.h: add an #ifdef to work around a gcc
3987 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
3988 documented the change so that the workaround can be nuked later.
3990 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
3993 * src/lyxlex_pimpl.C (next): do not re-declare the default value
3995 * src/buffer.C (getLatexName): ditto
3996 (setReadonly): ditto
3998 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4000 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4001 avoid some uses of current_view. Added also a bufferParams()
4002 method to get at this.
4004 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4006 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4008 * src/lyxparagraph.[Ch]: removed
4009 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4010 with operators used by lower_bound and
4011 upper_bound in InsetTable's
4012 Make struct InsetTable private again. Used matchpos.
4014 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4016 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4017 document, the language of existing text is changed (unless the
4018 document is multi-lingual)
4020 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4022 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4024 * A lot of files: A rewrite of the Right-to-Left support.
4026 2000-04-10 Juergen Vigna <jug@sad.it>
4028 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4029 misplaced cursor when inset in inset is locked.
4031 * src/insets/insettext.C (LocalDispatch): small fix so that a
4032 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4034 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4035 footnote font should be decreased in size twice when displaying.
4037 * src/insets/insettext.C (GetDrawFont): inserted this function as
4038 the drawing-font may differ from the real paragraph font.
4040 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4041 insets (inset in inset!).
4043 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4044 function here because we don't want footnotes inside footnotes.
4046 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4048 (init): now set the inset_owner in paragraph.C
4049 (LocalDispatch): added some resetPos() in the right position
4052 (pasteSelection): changed to use the new CutAndPaste-Class.
4054 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4055 which tells if it is allowed to insert another inset inside this one.
4057 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4058 SwitchLayoutsBetweenClasses.
4060 * src/text2.C (InsertInset): checking of the new paragraph-function
4062 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4063 is not needed anymore here!
4066 (PasteSelection): redone (also with #ifdef) so that now this uses
4067 the CutAndPaste-Class.
4068 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4071 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4072 from/to text/insets.
4074 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4075 so that the paragraph knows if it is inside an (text)-inset.
4076 (InsertFromMinibuffer): changed return-value to bool as now it
4077 may happen that an inset is not inserted in the paragraph.
4078 (InsertInsetAllowed): this checks if it is allowed to insert an
4079 inset in this paragraph.
4081 (BreakParagraphConservative):
4082 (BreakParagraph) : small change for the above change of the return
4083 value of InsertFromMinibuffer.
4085 * src/lyxparagraph.h: added inset_owner and the functions to handle
4086 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4088 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4090 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4091 functions from BufferView to BufferView::Pimpl to ease maintence.
4093 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4094 correctly. Also use SetCursorIntern instead of SetCursor.
4096 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4099 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4101 * src/WorkArea.C (belowMouse): manually implement below mouse.
4103 * src/*: Add "explicit" on several constructors, I added probably
4104 some unneeded ones. A couple of changes to code because of this.
4106 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4107 implementation and private parts from the users of BufferView. Not
4110 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4111 implementation and private parts from the users of LyXLex. Not
4114 * src/BufferView_pimpl.[Ch]: new files
4116 * src/lyxlex_pimpl.[Ch]: new files
4118 * src/LyXView.[Ch]: some inline functions move out-of-line
4120 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4122 * src/lyxparagraph.h: make struct InsetTable public.
4124 * src/support/lyxstring.h: change lyxstring::difference_type to be
4125 ptrdiff_t. Add std:: modifiers to streams.
4127 * src/font.C: include the <cctype> header, for islower() and
4130 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4132 * src/font.[Ch]: new files. Contains the metric functions for
4133 fonts, takes a LyXFont as parameter. Better separation of concepts.
4135 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4136 changes because of this.
4138 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4140 * src/*: compile with -Winline and move functions that don't
4143 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4146 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4148 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4149 (various files changed because of this)
4151 * src/Painter.C (text): fixed the drawing of smallcaps.
4153 * src/lyxfont.[Ch] (drawText): removed unused member func.
4156 * src/*.C: added needed "using" statements and "std::" qualifiers.
4158 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4160 * src/*.h: removed all use of "using" from header files use
4161 qualifier std:: instead.
4163 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4165 * src/text.C (Backspace): some additional cleanups (we already
4166 know whether cursor.pos is 0 or not).
4168 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4169 automake does not provide one).
4171 * src/bmtable.h: replace C++ comments with C comments.
4173 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4175 * src/screen.C (ShowCursor): Change the shape of the cursor if
4176 the current language is not equal to the language of the document.
4177 (If the cursor change its shape unexpectedly, then you've found a bug)
4179 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4182 * src/insets/insetnumber.[Ch]: New files.
4184 * src/LyXAction.C (init)
4185 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4188 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4190 * src/lyxparagraph.h
4191 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4192 (the vector is kept sorted).
4194 * src/text.C (GetVisibleRow): Draw selection correctly when there
4195 is both LTR and RTL text.
4197 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4198 which is much faster.
4200 * src/text.C (GetVisibleRow and other): Do not draw the last space
4201 in a row if the direction of the last letter is not equal to the
4202 direction of the paragraph.
4204 * src/lyxfont.C (latexWriteStartChanges):
4205 Check that font language is not equal to basefont language.
4206 (latexWriteEndChanges): ditto
4208 * src/lyx_cb.C (StyleReset): Don't change the language while using
4209 the font-default command.
4211 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4212 empty paragraph before a footnote.
4214 * src/insets/insetcommand.C (draw): Increase x correctly.
4216 * src/screen.C (ShowCursor): Change cursor shape if
4217 current language != document language.
4219 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4221 2000-03-31 Juergen Vigna <jug@sad.it>
4223 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4224 (Clone): changed mode how the paragraph-data is copied to the
4225 new clone-paragraph.
4227 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4228 GetInset(pos) with no inset anymore there (in inset UNDO)
4230 * src/insets/insetcommand.C (draw): small fix as here x is
4231 incremented not as much as width() returns (2 before, 2 behind = 4)
4233 2000-03-30 Juergen Vigna <jug@sad.it>
4235 * src/insets/insettext.C (InsetText): small fix in initialize
4236 widthOffset (should not be done in the init() function)
4238 2000-03-29 Amir Karger <karger@lyx.org>
4240 * lib/examples/it_ItemizeBullets.lyx: translation by
4243 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4245 2000-03-29 Juergen Vigna <jug@sad.it>
4247 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4249 * src/insets/insetfoot.C (Clone): small change as for the below
4250 new init function in the text-inset
4252 * src/insets/insettext.C (init): new function as I've seen that
4253 clone did not copy the Paragraph-Data!
4254 (LocalDispatch): Added code so that now we have some sort of Undo
4255 functionality (well actually we HAVE Undo ;)
4257 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4259 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4261 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4264 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4266 * src/main.C: added a runtime check that verifies that the xforms
4267 header used when building LyX and the library used when running
4268 LyX match. Exit with a message if they don't match. This is a
4269 version number check only.
4271 * src/buffer.C (save): Don't allocate memory on the heap for
4272 struct utimbuf times.
4274 * *: some using changes, use iosfwd instead of the real headers.
4276 * src/lyxfont.C use char const * instead of string for the static
4277 strings. Rewrite some functions to use sstream.
4279 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4281 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4284 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4286 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4287 of Geodesy (from Martin Vermeer)
4289 * lib/layouts/svjour.inc: include file for the Springer svjour
4290 class. It can be used to support journals other than JoG.
4292 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4293 Miskiewicz <misiek@pld.org.pl>)
4294 * lib/reLyX/Makefile.am: ditto.
4296 2000-03-27 Juergen Vigna <jug@sad.it>
4298 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4299 also some modifications with operations on selected text.
4301 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4302 problems with clicking on insets (last famous words ;)
4304 * src/insets/insetcommand.C (draw):
4305 (width): Changed to have a bit of space before and after the inset so
4306 that the blinking cursor can be seen (otherwise it was hidden)
4308 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4310 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4311 would not be added to the link list when an installed gettext (not
4312 part of libc) is found.
4314 2000-03-24 Juergen Vigna <jug@sad.it>
4316 * src/insets/insetcollapsable.C (Edit):
4317 * src/mathed/formula.C (InsetButtonRelease):
4318 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4321 * src/BufferView.C (workAreaButtonPress):
4322 (workAreaButtonRelease):
4323 (checkInsetHit): Finally fixed the clicking on insets be handled
4326 * src/insets/insetert.C (Edit): inserted this call so that ERT
4327 insets work always with LaTeX-font
4329 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4331 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4332 caused lyx to startup with no GUI in place, causing in a crash
4333 upon startup when called with arguments.
4335 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4337 * src/FontLoader.C: better initialization of dummyXFontStruct.
4339 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4341 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4342 for linuxdoc and docbook import and export format options.
4344 * lib/lyxrc.example Example of default values for the previous flags.
4346 * src/lyx_cb.C Use those flags instead of the hardwired values for
4347 linuxdoc and docbook export.
4349 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4352 * src/menus.C Added menus entries for the new import/exports formats.
4354 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4356 * src/lyxrc.*: Added support for running without Gui
4359 * src/FontLoader.C: sensible defaults if no fonts are needed
4361 * src/lyx_cb.C: New function ShowMessage (writes either to the
4362 minibuffer or cout in case of no gui
4363 New function AskOverwrite for common stuff
4364 Consequently various changes to call these functions
4366 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4367 wild guess at sensible screen resolution when having no gui
4369 * src/lyxfont.C: no gui, no fonts... set some defaults
4371 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4373 * src/LColor.C: made the command inset background a bit lighter.
4375 2000-03-20 Hartmut Goebel <goebel@noris.net>
4377 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4378 stdstruct.inc. Koma-Script added some title elements which
4379 otherwise have been listed below "bibliography". This split allows
4380 adding title elements to where they belong.
4382 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4383 define the additional tilte elements and then include
4386 * many other layout files: changed to include stdtitle.inc just
4387 before stdstruct.inc.
4389 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4391 * src/buffer.C: (save) Added the option to store all backup files
4392 in a single directory
4394 * src/lyxrc.[Ch]: Added variable \backupdir_path
4396 * lib/lyxrc.example: Added descriptions of recently added variables
4398 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4399 bibtex inset, not closing the bibtex popup when deleting the inset)
4401 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4403 * src/lyx_cb.C: add a couple using directives.
4405 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4406 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4407 import based on the filename.
4409 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4410 file would be imported at start, if the filename where of a sgml file.
4412 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4414 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4416 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4417 * src/lyxfont.h Replaced the member variable bits.direction by the
4418 member variable lang. Made many changes in other files.
4419 This allows having a multi-lingual document
4421 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4422 that change the current language to <l>.
4423 Removed the command "font-rtl"
4425 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4426 format for Hebrew documents)
4428 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4429 When auto_mathmode is "true", pressing a digit key in normal mode
4430 will cause entering into mathmode.
4431 If auto_mathmode is "rtl" then this behavior will be active only
4432 when writing right-to-left text.
4434 * src/text2.C (InsertStringA) The string is inserted using the
4437 * src/paragraph.C (GetEndLabel) Gives a correct result for
4438 footnote paragraphs.
4440 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4442 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4444 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4445 front of PasteParagraph. Never insert a ' '. This should at least
4446 fix some cause for the segfaults that we have been experiencing,
4447 it also fixes backspace behaviour slightly. (Phu!)
4449 * src/support/lstrings.C (compare_no_case): some change to make it
4450 compile with gcc 2.95.2 and stdlibc++-v3
4452 * src/text2.C (MeltFootnoteEnvironment): change type o
4453 first_footnote_par_is_not_empty to bool.
4455 * src/lyxparagraph.h: make text private. Changes in other files
4457 (fitToSize): new function
4458 (setContentsFromPar): new function
4459 (clearContents): new function
4460 (SetChar): new function
4462 * src/paragraph.C (readSimpleWholeFile): deleted.
4464 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4465 the file, just use a simple string instead. Also read the file in
4466 a more maintainable manner.
4468 * src/text2.C (InsertStringA): deleted.
4469 (InsertStringB): deleted.
4471 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4473 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4474 RedoParagraphs from the doublespace handling part, just set status
4475 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4476 done, but perhaps not like this.)
4478 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4480 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4481 character when inserting an inset.
4483 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4485 * src/bufferparams.C (readLanguage): now takes "default" into
4488 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4489 also initialize the toplevel_keymap with the default bindings from
4492 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4494 * all files using lyxrc: have lyxrc as a real variable and not a
4495 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4498 * src/lyxrc.C: remove double call to defaultKeyBindings
4500 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4501 toolbar defauls using lyxlex. Remove enums, structs, functions
4504 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4505 toolbar defaults. Also store default keybindings in a map.
4507 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4508 storing the toolbar defaults without any xforms dependencies.
4510 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4511 applied. Changed to use iterators.
4513 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4515 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4516 systems that don't have LINGUAS set to begin with.
4518 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4520 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4521 the list by Dekel Tsur.
4523 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4525 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4526 * src/insets/form_graphics.C: ditto.
4528 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4530 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4532 * src/bufferparams.C (readLanguage): use the new language map
4534 * src/intl.C (InitKeyMapper): use the new language map
4536 * src/lyx_gui.C (create_forms): use the new language map
4538 * src/language.[Ch]: New files. Used for holding the information
4539 about each language. Now! Use this new language map enhance it and
4540 make it really usable for our needs.
4542 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4544 * screen.C (ShowCursor): Removed duplicate code.
4545 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4546 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4548 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4551 * src/text.C Added TransformChar method. Used for rendering Arabic
4552 text correctly (change the glyphs of the letter according to the
4553 position in the word)
4558 * src/lyxrc.C Added lyxrc command {language_command_begin,
4559 language_command_end,language_command_ltr,language_command_rtl,
4560 language_package} which allows the use of either arabtex or Omega
4563 * src/lyx_gui.C (init)
4565 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4566 to use encoding for menu fonts which is different than the encoding
4569 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4570 do not load the babel package.
4571 To write an English document with Hebrew/Arabic, change the document
4572 language to "english".
4574 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4575 (alphaCounter): changed to return char
4576 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4578 * lib/lyxrc.example Added examples for Hebrew/Arabic
4581 * src/layout.C Added layout command endlabeltype
4583 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4585 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4587 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4589 * src/mathed/math_delim.C (search_deco): return a
4590 math_deco_struct* instead of index.
4592 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4594 * All files with a USE_OSTREAM_ONLY within: removed all code that
4595 was unused when USE_OSTREAM_ONLY is defined.
4597 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4598 of any less. Removed header and using.
4600 * src/text.C (GetVisibleRow): draw the string "Page Break
4601 (top/bottom)" on screen when drawing a pagebreak line.
4603 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4605 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
4607 * src/mathed/math_macro.C (draw): do some cast magic.
4610 * src/mathed/math_defs.h: change byte* argument to byte const*.
4612 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
4614 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
4615 know it is right to return InsetFoot* too, but cxx does not like
4618 * src/insets/insetcollapsable.[Ch] (Clone): make const.
4620 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
4622 * src/mathed/math_delim.C: change == to proper assignment.
4624 2000-03-09 Juergen Vigna <jug@sad.it>
4626 * src/insets/insettext.C (setPos): fixed various cursor positioning
4627 problems (via mouse and cursor-keys)
4628 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
4629 inset (still a small display problem but it works ;)
4631 * src/insets/insetcollapsable.C (draw): added button_top_y and
4632 button_bottom_y to have correct values for clicking on the inset.
4634 * src/support/lyxalgo.h: commented out 'using std::less'
4636 2000-03-08 Juergen Vigna <jug@sad.it>
4638 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
4639 Button-Release event closes as it is alos the Release-Event
4642 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
4644 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4646 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
4647 can add multiple spaces in Scrap (literate programming) styles...
4648 which, by the way, is how I got hooked on LyX to begin with.
4650 * src/mathed/formula.C (Write): Added dummy variable to an
4651 inset::Latex() call.
4652 (Latex): Add free_spacing boolean to inset::Latex()
4654 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
4656 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
4657 virtual function to include the free_spacing boolean from
4658 the containing paragraph's style.
4660 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
4661 Added free_spacing boolean arg to match inset.h
4663 * src/insets/insettext.C, src/insets/insettext.h (Latex):
4664 Added free_spacing boolean arg to match inset.h
4666 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
4667 Added free_spacing boolean and made sure that if in a free_spacing
4668 paragraph, that we output normal space if there is a protected space.
4670 * src/insets/insetref.C, src/insets/insetref.h (Latex):
4671 Added free_spacing boolean arg to match inset.h
4673 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
4674 Added free_spacing boolean arg to match inset.h
4676 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
4677 Added free_spacing boolean arg to match inset.h
4679 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
4680 Added free_spacing boolean arg to match inset.h
4682 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
4683 Added free_spacing boolean arg to match inset.h
4685 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
4686 free_spacing boolean arg to match inset.h
4688 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
4689 Added free_spacing boolean arg to match inset.h
4691 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
4692 Added free_spacing boolean arg to match inset.h
4694 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
4695 Added free_spacing boolean arg to match inset.h
4697 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
4698 Added free_spacing boolean arg to match inset.h
4700 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
4701 Added free_spacing boolean arg to match inset.h
4703 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
4704 free_spacing boolean arg to match inset.h
4706 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
4707 free_spacing boolean arg to match inset.h
4709 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
4710 ignore free_spacing paragraphs. The user's spaces are left
4713 * src/text.C (InsertChar): Fixed the free_spacing layout
4714 attribute behavior. Now, if free_spacing is set, you can
4715 add multiple spaces in a paragraph with impunity (and they
4716 get output verbatim).
4717 (SelectSelectedWord): Added dummy argument to inset::Latex()
4720 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
4723 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
4724 paragraph layouts now only input a simple space instead.
4725 Special character insets don't make any sense in free-spacing
4728 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
4729 hard-spaces in the *input* file to simple spaces if the layout
4730 is free-spacing. This converts old files which had to have
4731 hard-spaces in free-spacing layouts where a simple space was
4733 (writeFileAscii): Added free_spacing check to pass to the newly
4734 reworked inset::Latex(...) methods. The inset::Latex() code
4735 ensures that hard-spaces in free-spacing paragraphs get output
4736 as spaces (rather than "~").
4738 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4740 * src/mathed/math_delim.C (draw): draw the empty placeholder
4741 delims with a onoffdash line.
4742 (struct math_deco_compare): struct that holds the "functors" used
4743 for the sort and the binary search in math_deco_table.
4744 (class init_deco_table): class used for initial sort of the
4746 (search_deco): use lower_bound to do a binary search in the
4749 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4751 * src/lyxrc.C: a small secret thingie...
4753 * src/lyxlex.C (printTable): changed to take a ostream as paramter
4754 and to not flush the stream as often as it used to.
4756 * src/support/lyxalgo.h: new file
4757 (sorted): template function used for checking if a sequence is
4758 sorted or not. Two versions with and without user supplied
4759 compare. Uses same compare as std::sort.
4761 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
4762 it and give warning on lyxerr.
4764 (struct compare_tags): struct with function operators used for
4765 checking if sorted, sorting and lower_bound.
4766 (search_kw): use lower_bound instead of manually implemented
4769 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4771 * src/insets/insetcollapsable.h: fix Clone() declaration.
4772 * src/insets/insetfoot.h: ditto.
4774 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
4776 2000-03-08 Juergen Vigna <jug@sad.it>
4778 * src/insets/lyxinset.h: added owner call which tells us if
4779 this inset is inside another inset. Changed also the return-type
4780 of Editable to an enum so it tells clearer what the return-value is.
4782 * src/insets/insettext.C (computeTextRows): fixed computing of
4783 textinsets which split automatically on more rows.
4785 * src/insets/insetert.[Ch]: changed this to be of BaseType
4788 * src/insets/insetfoot.[Ch]: added footnote inset
4790 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
4791 collapsable insets (like footnote, ert, ...)
4793 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4795 * src/lyxdraw.h: remvoe file
4797 * src/lyxdraw.C: remove file
4799 * src/insets/insettext.C: added <algorithm>.
4801 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4803 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
4804 (matrix_cb): case MM_OK use string stream
4806 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
4809 * src/mathed/math_macro.C (draw): use string stream
4810 (Metrics): use string stream
4812 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
4813 directly to the ostream.
4815 * src/vspace.C (asString): use string stream.
4816 (asString): use string stream
4817 (asLatexString): use string stream
4819 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
4820 setting Spacing::Other.
4822 * src/LaTeXFeatures.C (getPackages): use string stream instead of
4823 sprintf when creating the stretch vale.
4825 * src/text2.C (alphaCounter): changed to return a string and to
4826 not use a static variable internally. Also fixed a one-off bug.
4827 (SetCounter): changed the drawing of the labels to use string
4828 streams instead of sprintf.
4830 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
4831 manipulator to use a scheme that does not require library support.
4832 This is also the way it is done in the new GNU libstdc++. Should
4833 work with DEC cxx now.
4835 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4837 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
4838 end. This fixes a bug.
4840 * src/mathed (all files concerned with file writing): apply the
4841 USE_OSTREAM_ONLY changes to mathed too.
4843 * src/support/DebugStream.h: make the constructor explicit.
4845 * src/lyxfont.C (latexWriteStartChanges): small bug related to
4846 count and ostream squashed.
4848 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4850 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
4852 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
4853 ostringstream uses STL strings, and we might not.
4855 * src/insets/insetspecialchar.C: add using directive.
4856 * src/insets/insettext.C: ditto.
4858 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4860 * lib/layouts/seminar.layout: feeble attempt at a layout for
4861 seminar.cls, far from completet and could really use some looking
4862 at from people used to write layout files.
4864 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
4865 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
4866 a lot nicer and works nicely with ostreams.
4868 * src/mathed/formula.C (draw): a slightly different solution that
4869 the one posted to the list, but I think this one works too. (font
4870 size wrong in headers.)
4872 * src/insets/insettext.C (computeTextRows): some fiddling on
4873 Jürgens turf, added some comments that he should read.
4875 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
4876 used and it gave compiler warnings.
4877 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
4880 * src/lyx_gui.C (create_forms): do the right thing when
4881 show_banner is true/false.
4883 * src/lyx_cb.C (TimerCB): no need to close or do anything if
4884 show_banner is false.
4886 * most file writing files: Now use iostreams to do almost all of
4887 the writing. Also instead of passing string &, we now use
4888 stringstreams. mathed output is still not adapted to iostreams.
4889 This change can be turned off by commenting out all the occurences
4890 of the "#define USE_OSTREAM_ONLY 1" lines.
4892 * src/WorkArea.C (createPixmap): don't output debug messages.
4893 (WorkArea): don't output debug messages.
4895 * lib/lyxrc.example: added a comment about the new variable
4898 * development/Code_rules/Rules: Added some more commente about how
4899 to build class interfaces and on how better encapsulation can be
4902 2000-03-03 Juergen Vigna <jug@sad.it>
4904 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
4905 automatically with the width of the LyX-Window
4907 * src/insets/insettext.C (computeTextRows): fixed update bug in
4908 displaying text-insets (scrollvalues where not initialized!)
4910 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4912 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
4913 id in the check of the result from lower_bound is not enough since
4914 lower_bound can return last too, and then res->id will not be a
4917 * all insets and some code that use them: I have conditionalized
4918 removed the Latex(string & out, ...) this means that only the
4919 Latex(ostream &, ...) will be used. This is a work in progress to
4920 move towards using streams for all output of files.
4922 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
4925 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4927 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
4928 routine (this fixes bug where greek letters were surrounded by too
4931 * src/support/filetools.C (findtexfile): change a bit the search
4932 algorithm, to fix bug introduced in 1.1.4. Note that --format is
4933 no longer passed to kpsewhich, we may have to change that later.
4935 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
4936 warning options to avoid problems with X header files (from Angus
4938 * acinclude.m4: regenerated.
4940 2000-03-02 Juergen Vigna <jug@sad.it>
4942 * src/insets/insettext.C (WriteParagraphData): Using the
4943 par->writeFile() function for writing paragraph-data.
4944 (Read): Using buffer->parseSingleLyXformat2Token()-function
4945 for parsing paragraph data!
4947 * src/buffer.C (readLyXformat2): removed all parse data and using
4948 the new parseSingleLyXformat2Token()-function.
4949 (parseSingleLyXformat2Token): added this function to parse (read)
4950 lyx-file-format (this is called also from text-insets now!)
4952 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4954 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
4957 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
4958 directly instead of going through a func. One very bad thing: a
4959 static LyXFindReplace, but I don't know where to place it.
4961 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
4962 string instead of char[]. Also changed to static.
4963 (GetSelectionOrWordAtCursor): changed to static inline
4964 (SetSelectionOverLenChars): ditto.
4966 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
4967 current_view and global variables. both classes has changed names
4968 and LyXFindReplace is not inherited from SearchForm.
4970 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
4971 fl_form_search form.
4973 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
4975 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4977 * lib/bind/*.bind: make sure 'buffer-previous' function is not
4978 bound (from Kayvan).
4980 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
4982 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
4984 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4986 * some things that I should comment but the local pub says head to
4989 * comment out all code that belongs to the Roff code for Ascii
4990 export of tables. (this is unused)
4992 * src/LyXView.C: use correct type for global variable
4993 current_layout. (LyXTextClass::size_type)
4995 * some code to get the new insetgraphics closer to working I'd be
4996 grateful for any help.
4998 * src/BufferView2.C (insertInset): use the return type of
4999 NumberOfLayout properly. (also changes in other files)
5001 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5002 this as a test. I want to know what breaks because of this.
5004 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5006 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5008 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5009 to use a \makebox in the label, this allows proper justification
5010 with out using protected spaces or multiple hfills. Now it is
5011 "label" for left justified, "\hfill label\hfill" for center, and
5012 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5013 should be changed accordingly.
5015 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5017 * src/lyxtext.h: change SetLayout() to take a
5018 LyXTextClass::size_type instead of a char (when there is more than
5019 127 layouts in a class); also change type of copylayouttype.
5020 * src/text2.C (SetLayout): ditto.
5021 * src/LyXView.C (updateLayoutChoice): ditto.
5023 * src/LaTeX.C (scanLogFile): errors where the line number was not
5024 given just after the '!'-line were ignored (from Dekel Tsur).
5026 * lib/lyxrc.example: fix description of \date_insert_format
5028 * lib/layouts/llncs.layout: new layout, contributed by Martin
5031 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5033 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5034 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5035 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5036 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5037 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5038 paragraph.C, text.C, text2.C)
5040 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5042 * src/insets/insettext.C (LocalDispatch): remove extra break
5045 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5046 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5048 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5049 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5051 * src/insets/insetbib.h: move InsetBibkey::Holder and
5052 InsetCitation::Holder in public space.
5054 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5056 * src/insets/insettext.h: small change to get the new files from
5057 Juergen to compile (use "string", not "class string").
5059 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5060 const & as parameter to LocalDispatch, use LyXFont const & as
5061 paramter to some other func. This also had impacto on lyxinsets.h
5062 and the two mathed insets.
5064 2000-02-24 Juergen Vigna <jug@sad.it>
5067 * src/commandtags.h:
5069 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5073 * src/BufferView2.C: added/updated code for various inset-functions
5075 * src/insets/insetert.[Ch]: added implementation of InsetERT
5077 * src/insets/insettext.[Ch]: added implementation of InsetText
5079 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5080 (draw): added preliminary code for inset scrolling not finshed yet
5082 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5083 as it is in lyxfunc.C now
5085 * src/insets/lyxinset.h: Added functions for text-insets
5087 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5089 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5090 BufferView and reimplement the list as a queue put inside its own
5093 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5095 * several files: use the new interface to the "updateinsetlist"
5097 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5099 (work_area_handler): call BufferView::trippleClick on trippleclick.
5101 * src/BufferView.C (doubleClick): new function, selects word on
5103 (trippleClick): new function, selects line on trippleclick.
5105 2000-02-22 Allan Rae <rae@lyx.org>
5107 * lib/bind/xemacs.bind: buffer-previous not supported
5109 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5111 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5114 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5116 * src/bufferlist.C: get rid of current_view from this file
5118 * src/spellchecker.C: get rid of current_view from this file
5120 * src/vspace.C: get rid of current_view from this file
5121 (inPixels): added BufferView parameter for this func
5122 (asLatexCommand): added a BufferParams for this func
5124 * src/text.C src/text2.C: get rid of current_view from these
5127 * src/lyxfont.C (getFontDirection): move this function here from
5130 * src/bufferparams.C (getDocumentDirection): move this function
5133 * src/paragraph.C (getParDirection): move this function here from
5135 (getLetterDirection): ditto
5137 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5139 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5140 resize due to wrong pixmap beeing used. Also took the opurtunity
5141 to make the LyXScreen stateless on regard to WorkArea and some
5142 general cleanup in the same files.
5144 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5146 * src/Makefile.am: add missing direction.h
5148 * src/PainterBase.h: made the width functions const.
5150 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5153 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5155 * src/insets/insetlatexaccent.C (draw): make the accents draw
5156 better, at present this will only work well with iso8859-1.
5158 * several files: remove the old drawing code, now we use the new
5161 * several files: remove support for mono_video, reverse_video and
5164 2000-02-17 Juergen Vigna <jug@sad.it>
5166 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5167 int ** as we have to return the pointer, otherwise we have only
5168 NULL pointers in the returning function.
5170 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5172 * src/LaTeX.C (operator()): quote file name when running latex.
5174 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5176 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5177 (bubble tip), this removes our special handling of this.
5179 * Remove all code that is unused now that we have the new
5180 workarea. (Code that are not active when NEW_WA is defined.)
5182 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5184 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5186 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5187 nonexisting layout; correctly redirect obsoleted layouts.
5189 * lib/lyxrc.example: document \view_dvi_paper_option
5191 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5194 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5195 (PreviewDVI): handle the view_dvi_paper_option variable.
5196 [Both from Roland Krause]
5198 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5200 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5201 char const *, int, LyXFont)
5202 (text(int, int, string, LyXFont)): ditto
5204 * src/text.C (InsertCharInTable): attempt to fix the double-space
5205 feature in tables too.
5206 (BackspaceInTable): ditto.
5207 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5209 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5211 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5213 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5214 newly found text in textcache to this.
5215 (buffer): set the owner of the text put into the textcache to 0
5217 * src/insets/figinset.C (draw): fixed the drawing of figures with
5220 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5221 drawing of mathframe, hfills, protected space, table lines. I have
5222 now no outstanding drawing problems with the new Painter code.
5224 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5226 * src/PainterBase.C (ellipse, circle): do not specify the default
5229 * src/LColor.h: add using directive.
5231 * src/Painter.[Ch]: change return type of methods from Painter& to
5232 PainterBase&. Add a using directive.
5234 * src/WorkArea.C: wrap xforms callbacks in C functions
5237 * lib/layouts/foils.layout: font fix and simplifications from Carl
5240 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5242 * a lot of files: The Painter, LColor and WorkArea from the old
5243 devel branch has been ported to lyx-devel. Some new files and a
5244 lot of #ifdeffed code. The new workarea is enabled by default, but
5245 if you want to test the new Painter and LColor you have to compile
5246 with USE_PAINTER defined (do this in config.h f.ex.) There are
5247 still some rought edges, and I'd like some help to clear those
5248 out. It looks stable (loads and displays the Userguide very well).
5251 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5253 * src/buffer.C (pop_tag): revert to the previous implementation
5254 (use a global variable for both loops).
5256 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5258 * src/lyxrc.C (LyXRC): change slightly default date format.
5260 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5261 there is an English text with a footnote that starts with a Hebrew
5262 paragraph, or vice versa.
5263 (TeXFootnote): ditto.
5265 * src/text.C (LeftMargin): allow for negative values for
5266 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5269 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5270 for input encoding (cyrillic)
5272 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5274 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5277 * src/toolbar.C (set): ditto
5278 * src/insets/insetbib.C (create_form_citation_form): ditto
5280 * lib/CREDITS: added Dekel Tsur.
5282 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5283 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5284 hebrew supports files from Dekel Tsur.
5286 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5287 <tzafrir@technion.ac.il>
5289 * src/lyxrc.C: put \date_insert_format at the right place.
5291 * src/buffer.C (makeLaTeXFile): fix the handling of
5292 BufferParams::sides when writing out latex files.
5294 * src/BufferView2.C: add a "using" directive.
5296 * src/support/lyxsum.C (sum): when we use lyxstring,
5297 ostringstream::str needs an additional .c_str().
5299 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5301 * src/support/filetools.C (ChangeExtension): patch from Etienne
5304 * src/TextCache.C (show): remove const_cast and make second
5305 parameter non-const LyXText *.
5307 * src/TextCache.h: use non const LyXText in show.
5309 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5312 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5314 * src/support/lyxsum.C: rework to be more flexible.
5316 * several places: don't check if a pointer is 0 if you are going
5319 * src/text.C: remove some dead code.
5321 * src/insets/figinset.C: remove some dead code
5323 * src/buffer.C: move the BufferView funcs to BufferView2.C
5324 remove all support for insetlatexdel
5325 remove support for oldpapersize stuff
5326 made some member funcs const
5328 * src/kbmap.C: use a std::list to store the bindings in.
5330 * src/BufferView2.C: new file
5332 * src/kbsequence.[Ch]: new files
5334 * src/LyXAction.C + others: remove all trace of buffer-previous
5336 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5337 only have one copy in the binary of this table.
5339 * hebrew patch: moved some functions from LyXText to more
5340 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5342 * several files: remove support for XForms older than 0.88
5344 remove some #if 0 #endif code
5346 * src/TextCache.[Ch]: new file. Holds the textcache.
5348 * src/BufferView.C: changes to use the new TextCache interface.
5349 (waitForX): remove the now unused code.
5351 * src/BackStack.h: remove some commented code
5353 * lib/bind/emacs.bind: remove binding for buffer-previous
5355 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5357 * applied the hebrew patch.
5359 * src/lyxrow.h: make sure that all Row variables are initialized.
5361 * src/text2.C (TextHandleUndo): comment out a delete, this might
5362 introduce a memory leak, but should also help us to not try to
5363 read freed memory. We need to look at this one.
5365 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5366 (LyXParagraph): initalize footnotekind.
5368 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5369 forgot this when applying the patch. Please heed the warnings.
5371 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5372 (aka. reformat problem)
5374 * src/bufferlist.C (exists): made const, and use const_iterator
5375 (isLoaded): new func.
5376 (release): use std::find to find the correct buffer.
5378 * src/bufferlist.h: made getState a const func.
5379 made empty a const func.
5380 made exists a const func.
5383 2000-02-01 Juergen Vigna <jug@sad.it>
5385 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5387 * po/it.po: updated a bit the italian po file and also changed the
5388 'file nuovo' for newfile to 'filenuovo' without a space, this did
5391 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5392 for the new insert_date command.
5394 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5395 from jdblair, to insert a date into the current text conforming to
5396 a strftime format (for now only considering the locale-set and not
5397 the document-language).
5399 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5401 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5402 Bounds Read error seen by purify. The problem was that islower is
5403 a macros which takes an unsigned char and uses it as an index for
5404 in array of characters properties (and is thus subject to the
5408 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5409 correctly the paper sides radio buttons.
5410 (UpdateDocumentButtons): ditto.
5412 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5414 * src/kbmap.C (getsym + others): change to return unsigned int,
5415 returning a long can give problems on 64 bit systems. (I assume
5416 that int is 32bit on 64bit systems)
5418 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5420 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5421 LyXLookupString to be zero-terminated. Really fixes problems seen
5424 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5426 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5427 write a (char*)0 to the lyxerr stream.
5429 * src/lastfiles.C: move algorithm before the using statemets.
5431 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5433 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5434 complains otherwise).
5435 * src/table.C: ditto
5437 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5440 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5441 that I removed earlier... It is really needed.
5443 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5445 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5447 * INSTALL: update xforms home page URL.
5449 * lib/configure.m4: fix a bug with unreadable layout files.
5451 * src/table.C (calculate_width_of_column): add "using std::max"
5454 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5456 * several files: marked several lines with "DEL LINE", this is
5457 lines that can be deleted without changing anything.
5458 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5459 checks this anyway */
5462 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5464 * src/DepTable.C (update): add a "+" at the end when the checksum
5465 is different. (debugging string only)
5467 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5468 the next inset to not be displayed. This should also fix the list
5469 of labels in the "Insert Crossreference" dialog.
5471 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5473 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5474 when regex was not found.
5476 * src/support/lstrings.C (lowercase): use handcoded transform always.
5479 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5480 old_cursor.par->prev could be 0.
5482 * several files: changed post inc/dec to pre inc/dec
5484 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5485 write the lastfiles to file.
5487 * src/BufferView.C (buffer): only show TextCache info when debugging
5489 (resizeCurrentBuffer): ditto
5490 (workAreaExpose): ditto
5492 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5494 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5496 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5497 a bit better by removing the special case for \i and \j.
5499 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5501 * src/lyx_main.C (easyParse): remove test for bad comand line
5502 options, since this broke all xforms-related parsing.
5504 * src/kbmap.C (getsym): set return type to unsigned long, as
5505 declared in header. On an alpha, long is _not_ the same as int.
5507 * src/support/LOstream.h: add a "using std::flush;"
5509 * src/insets/figinset.C: ditto.
5511 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5513 * src/bufferlist.C (write): use blinding fast file copy instead of
5514 "a char at a time", now we are doing it the C++ way.
5516 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5517 std::list<int> instead.
5518 (addpidwait): reflect move to std::list<int>
5519 (sigchldchecker): ditto
5521 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5524 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5525 that obviously was wrong...
5527 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5528 c, this avoids warnings with purify and islower.
5530 * src/insets/figinset.C: rename struct queue to struct
5531 queue_element and rewrite to use a std::queue. gsqueue is now a
5532 std::queue<queue_element>
5533 (runqueue): reflect move to std::queue
5536 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5537 we would get "1" "0" instead of "true" "false. Also make the tostr
5540 2000-01-21 Juergen Vigna <jug@sad.it>
5542 * src/buffer.C (writeFileAscii): Disabled code for special groff
5543 handling of tabulars till I fix this in table.C
5545 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5547 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5549 * src/support/lyxlib.h: ditto.
5551 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5553 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5554 and 'j' look better. This might fix the "macron" bug that has been
5557 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5558 functions as one template function. Delete the old versions.
5560 * src/support/lyxsum.C: move using std::ifstream inside
5563 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5566 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5568 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5570 * src/insets/figinset.C (InitFigures): use new instead of malloc
5571 to allocate memory for figures and bitmaps.
5572 (DoneFigures): use delete[] instead of free to deallocate memory
5573 for figures and bitmaps.
5574 (runqueue): use new to allocate
5575 (getfigdata): use new/delete[] instead of malloc/free
5576 (RegisterFigure): ditto
5578 * some files: moved some declarations closer to first use, small
5579 whitespace changes use preincrement instead of postincrement where
5580 it does not make a difference.
5582 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5583 step on the way to use stl::containers for key maps.
5585 * src/bufferlist.h: add a typedef for const_iterator and const
5586 versions of begin and end.
5588 * src/bufferlist.[Ch]: change name of member variable _state to
5589 state_. (avoid reserved names)
5591 (getFileNames): returns the filenames of the buffers in a vector.
5593 * configure.in (ALL_LINGUAS): added ro
5595 * src/support/putenv.C: new file
5597 * src/support/mkdir.C: new file
5599 2000-01-20 Allan Rae <rae@lyx.org>
5601 * lib/layouts/IEEEtran.layout: Added several theorem environments
5603 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5604 couple of minor additions.
5606 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
5607 (except for those in footnotes of course)
5609 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5611 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
5613 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
5614 std::sort and std::lower_bound instead of qsort and handwritten
5616 (struct compara): struct that holds the functors used by std::sort
5617 and std::lower_bound in MathedLookupBOP.
5619 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5621 * src/support/LAssert.h: do not do partial specialization. We do
5624 * src/support/lyxlib.h: note that lyx::getUserName() and
5625 lyx::date() are not in use right now. Should these be suppressed?
5627 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
5628 (makeLinuxDocFile): do not put date and user name in linuxdoc
5631 * src/support/lyxlib.h (kill): change first argument to long int,
5632 since that's what solaris uses.
5634 * src/support/kill.C (kill): fix declaration to match prototype.
5636 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
5637 actually check whether namespaces are supported. This is not what
5640 * src/support/lyxsum.C: add a using directive.
5642 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5644 * src/support/kill.C: if we have namespace support we don't have
5645 to include lyxlib.h.
5647 * src/support/lyxlib.h: use namespace lyx if supported.
5649 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5651 * src/support/date.C: new file
5653 * src/support/chdir.C: new file
5655 * src/support/getUserName.C: new file
5657 * src/support/getcwd.C: new file
5659 * src/support/abort.C: new file
5661 * src/support/kill.C: new file
5663 * src/support/lyxlib.h: moved all the functions in this file
5664 insede struct lyx. Added also kill and abort to this struct. This
5665 is a way to avoid the "kill is not defined in <csignal>", we make
5666 C++ wrappers for functions that are not ANSI C or ANSI C++.
5668 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
5669 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
5670 lyx it has been renamed to sum.
5672 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5674 * src/text.C: add using directives for std::min and std::max.
5676 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5678 * src/texrow.C (getIdFromRow): actually return something useful in
5679 id and pos. Hopefully fixes the bug with positionning of errorbox
5682 * src/lyx_main.C (easyParse): output an error and exit if an
5683 incorrect command line option has been given.
5685 * src/spellchecker.C (ispell_check_word): document a memory leak.
5687 * src/bufferlist.C (write): fix mismatched allocation/deletion,
5688 where a "struct utimbuf" is allocated with "new" and deleted with
5691 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
5693 * src/text2.C (CutSelection): don't delete double spaces.
5694 (PasteSelection): ditto
5695 (CopySelection): ditto
5697 * src/text.C (Backspace): don't delete double spaces.
5699 * src/lyxlex.C (next): fix a bug that were only present with
5700 conformant std::istream::get to read comment lines, use
5701 std::istream::getline instead. This seems to fix the problem.
5703 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5705 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
5706 allowed to insert space before space" editing problem. Please read
5707 commends at the beginning of the function. Comments about usage
5710 * src/text.C (InsertChar): fix for the "not allowed to insert
5711 space before space" editing problem.
5713 * src/text2.C (DeleteEmptyParagraphMechanism): when
5714 IsEmptyTableRow can only return false this last "else if" will
5715 always be a no-op. Commented out.
5717 * src/text.C (RedoParagraph): As far as I can understand tmp
5718 cursor is not really needed.
5720 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
5721 present it could only return false anyway.
5722 (several functions): Did something not so smart...added a const
5723 specifier on a lot of methods.
5725 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
5726 and add a tmp->text.resize. The LyXParagraph constructor does the
5728 (BreakParagraphConservative): ditto
5730 * src/support/path.h (Path): add a define so that the wrong usage
5731 "Path("/tmp") will be flagged as a compilation error:
5732 "`unnamed_Path' undeclared (first use this function)"
5734 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5736 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
5737 which was bogus for several reasons.
5739 * src/LaTeX.C (scanAux): fix the regular expression used to scan
5743 * autogen.sh: do not use "type -path" (what's that anyway?).
5745 * src/support/filetools.C (findtexfile): remove extraneous space
5746 which caused a kpsewhich warning (at least with kpathsea version
5749 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5751 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
5753 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
5755 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
5757 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5759 * src/paragraph.C (BreakParagraph): do not reserve space on text
5760 if we don't need to (otherwise, if pos_end < pos, we end up
5761 reserving huge amounts of memory due to bad unsigned karma).
5762 (BreakParagraphConservative): ditto, although I have not seen
5763 evidence the bug can happen here.
5765 * src/lyxparagraph.h: add a using std::list.
5767 2000-01-11 Juergen Vigna <jug@sad.it>
5769 * src/menus.C (MenuDocu): output an Alert if the documentation-file
5772 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5774 * src/vc-backend.C (doVCCommand): change to be static and take one
5775 more parameter: the path to chdir too be fore executing the command.
5776 (retrive): new function equiv to "co -r"
5778 * src/bufferlist.C (loadLyXFile): implement the missing parts if
5779 file_not_found_hook is true.
5781 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
5783 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
5784 if a file is readwrite,readonly...anything else.
5786 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5788 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
5789 (CreatePostscript): name change from MenuRunDVIPS (or something)
5790 (PreviewPostscript): name change from MenuPreviewPS
5791 (PreviewDVI): name change from MenuPreviewDVI
5793 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
5794 \view_pdf_command., \pdf_to_ps_command
5796 * lib/configure.m4: added search for PDF viewer, and search for
5797 PDF to PS converter.
5798 (lyxrc.defaults output): add \pdflatex_command,
5799 \view_pdf_command and \pdf_to_ps_command.
5801 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
5803 * src/bufferlist.C (write): we don't use blocksize for anything so
5806 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5808 * src/support/block.h: disable operator T* (), since it causes
5809 problems with both compilers I tried. See comments in the file.
5811 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
5814 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
5815 variable LYX_DIR_10x to LYX_DIR_11x.
5817 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
5819 * INSTALL: document --with-lyxname.
5822 * configure.in: new configure flag --with-lyxname which allows to
5823 choose the name under which lyx is installed. Default is "lyx", of
5824 course. It used to be possible to do this with --program-suffix,
5825 but the later has in fact a different meaning for autoconf.
5827 * src/support/lstrings.h (lstrchr): reformat a bit.
5829 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
5830 * src/mathed/math_defs.h: ditto.
5832 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5834 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
5835 true, decides if we create a backup file or not when saving. New
5836 tag and variable \pdf_mode, defaults to false. New tag and
5837 variable \pdflatex_command, defaults to pdflatex. New tag and
5838 variable \view_pdf_command, defaults to xpdf. New tag and variable
5839 \pdf_to_ps_command, defaults to pdf2ps.
5841 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5843 * src/bufferlist.C (close): don't call insetUnlock if the buffer
5844 does not have a BufferView.
5845 (unlockInset): ditto + don't access the_locking_inset if the
5846 buffer does not have a BufferView.
5848 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
5849 certain circumstances so that we don't continue a keyboard
5850 operation long after the key was released. Try f.ex. to load a
5851 large document, press PageDown for some seconds and then release
5852 it. Before this change the document would contine to scroll for
5853 some time, with this change it stops imidiatly.
5855 * src/support/block.h: don't allocate more space than needed. As
5856 long as we don't try to write to the arr[x] in a array_type arr[x]
5857 it is perfectly ok. (if you write to it you might segfault).
5858 added operator value_type*() so that is possible to pass the array
5859 to functions expecting a C-pointer.
5861 * lib/Makefile.am (dist-hook): don't fail completely if unable to
5864 * intl/*: updated to gettext 0.10.35, tried to add our own
5865 required modifications. Please verify.
5867 * po/*: updated to gettext 0.10.35, tried to add our own required
5868 modifications. Please verify.
5870 * src/support/lstrings.C (tostr): go at fixing the problem with
5871 cxx and stringstream. When stringstream is used return
5872 oss.str().c_str() so that problems with lyxstring and basic_string
5873 are avoided. Note that the best solution would be for cxx to use
5874 basic_string all the way, but it is not conformant yet. (it seems)
5876 * src/lyx_cb.C + other files: moved several global functions to
5877 class BufferView, some have been moved to BufferView.[Ch] others
5878 are still located in lyx_cb.C. Code changes because of this. (part
5879 of "get rid of current_view project".)
5881 * src/buffer.C + other files: moved several Buffer functions to
5882 class BufferView, the functions are still present in buffer.C.
5883 Code changes because of this.
5885 * config/lcmessage.m4: updated to most recent. used when creating
5888 * config/progtest.m4: updated to most recent. used when creating
5891 * config/gettext.m4: updated to most recent. applied patch for
5894 * config/gettext.m4.patch: new file that shows what changes we
5895 have done to the local copy of gettext.m4.
5897 * config/libtool.m4: new file, used in creation of acinclude.m4
5899 * config/lyxinclude.m4: new file, this is the lyx created m4
5900 macros, used in making acinclude.m4.
5902 * autogen.sh: GNU m4 discovered as a separate task not as part of
5903 the lib/configure creation.
5904 Generate acinlucde from files in config. Actually cat
5905 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
5906 easier to upgrade .m4 files that really are external.
5908 * src/Spacing.h: moved using std::istringstream to right after
5909 <sstream>. This should fix the problem seen with some compilers.
5911 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5913 * src/lyx_cb.C: began some work to remove the dependency a lot of
5914 functions have on BufferView::text, even if not really needed.
5915 (GetCurrentTextClass): removed this func, it only hid the
5918 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
5919 forgot this in last commit.
5921 * src/Bullet.C (bulletEntry): use static char const *[] for the
5922 tables, becuase of this the return arg had to change to string.
5924 (~Bullet): removed unneeded destructor
5926 * src/BufferView.C (beforeChange): moved from lyx_cb.C
5927 (insetSleep): moved from Buffer
5928 (insetWakeup): moved from Buffer
5929 (insetUnlock): moved from Buffer
5931 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
5932 from Buffer to BufferView.
5934 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
5936 * config/ltmain.sh: updated to version 1.3.4 of libtool
5938 * config/ltconfig: updated to version 1.3.4 of libtool
5940 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5943 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
5944 Did I get that right?
5946 * src/lyxlex.h: add a "using" directive or two.
5947 * src/Spacing.h: ditto.
5948 * src/insets/figinset.C: ditto.
5949 * src/support/filetools.C: ditto.
5950 * src/support/lstrings.C: ditto.
5951 * src/BufferView.C: ditto.
5952 * src/bufferlist.C: ditto.
5953 * src/lyx_cb.C: ditto.
5954 * src/lyxlex.C: ditto.
5956 * NEWS: add some changes for 1.1.4.
5958 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5960 * src/BufferView.C: first go at a TextCache to speed up switching
5963 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5965 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
5966 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
5967 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
5968 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
5971 * src/mathed/math_defs.h (MathedRowSt): make sure that all
5972 members of the struct are correctly initialized to 0 (detected by
5974 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
5975 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
5977 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
5978 pidwait, since it was allocated with "new". This was potentially
5979 very bad. Thanks to Michael Schmitt for running purify for us.
5982 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5984 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
5986 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
5988 1999-12-30 Allan Rae <rae@lyx.org>
5990 * lib/templates/IEEEtran.lyx: minor change
5992 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
5993 src/mathed/formula.C (LocalDispatch): askForText changes
5995 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
5996 know when a user has cancelled input. Fixes annoying problems with
5997 inserting labels and version control.
5999 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6001 * src/support/lstrings.C (tostr): rewritten to use strstream and
6004 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6006 * src/support/filetools.C (IsFileWriteable): use fstream to check
6007 (IsDirWriteable): use fileinfo to check
6009 * src/support/filetools.h (FilePtr): whole class deleted
6011 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6013 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6015 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6017 * src/bufferlist.C (write): use ifstream and ofstream instead of
6020 * src/Spacing.h: use istrstream instead of sscanf
6022 * src/mathed/math_defs.h: change first arg to istream from FILE*
6024 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6026 * src/mathed/math_parser.C: have yyis to be an istream
6027 (LexGetArg): use istream (yyis)
6029 (mathed_parse): ditto
6030 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6032 * src/mathed/formula.C (Read): rewritten to use istream
6034 * src/mathed/formulamacro.C (Read): rewritten to use istream
6036 * src/lyxlex.h (~LyXLex): deleted desturctor
6037 (getStream): new function, returns an istream
6038 (getFile): deleted funtion
6039 (IsOK): return is.good();
6041 * src/lyxlex.C (LyXLex): delete file and owns_file
6042 (setFile): open an filebuf and assign that to a istream instead of
6044 (setStream): new function, takes an istream as arg.
6045 (setFile): deleted function
6046 (EatLine): rewritten us use istream instead of FILE*
6050 * src/table.C (LyXTable): use istream instead of FILE*
6051 (Read): rewritten to take an istream instead of FILE*
6053 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6055 * src/buffer.C (Dispatch): remove an extraneous break statement.
6057 * src/support/filetools.C (QuoteName): change to do simple
6058 'quoting'. More work is necessary. Also changed to do nothing
6059 under emx (needs fix too).
6060 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6062 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6063 config.h.in to the AC_DEFINE_UNQUOTED() call.
6064 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6065 needs char * as argument (because Solaris 7 declares it like
6068 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6069 remove definition of BZERO.
6071 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6073 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6074 defined, "lyxregex.h" if not.
6076 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6078 (REGEX): new variable that is set to regex.c lyxregex.h when
6079 AM_CONDITIONAL USE_REGEX is set.
6080 (libsupport_la_SOURCES): add $(REGEX)
6082 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6085 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6088 * configure.in: add call to LYX_REGEX
6090 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6091 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6093 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6095 * lib/bind/fi_menus.bind: new file, from
6096 pauli.virtanen@saunalahti.fi.
6098 * src/buffer.C (getBibkeyList): pass the parameter delim to
6099 InsetInclude::getKeys and InsetBibtex::getKeys.
6101 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6102 is passed to Buffer::getBibkeyList
6104 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6105 instead of the hardcoded comma.
6107 * src/insets/insetbib.C (getKeys): make sure that there are not
6108 leading blanks in bibtex keys. Normal latex does not care, but
6109 harvard.sty seems to dislike blanks at the beginning of citation
6110 keys. In particular, the retturn value of the function is
6112 * INSTALL: make it clear that libstdc++ is needed and that gcc
6113 2.7.x probably does not work.
6115 * src/support/filetools.C (findtexfile): make debug message go to
6117 * src/insets/insetbib.C (getKeys): ditto
6119 * src/debug.C (showTags): make sure that the output is correctly
6122 * configure.in: add a comment for TWO_COLOR_ICON define.
6124 * acconfig.h: remove all the entries that already defined in
6125 configure.in or acinclude.m4.
6127 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6128 to avoid user name, date and copyright.
6130 1999-12-21 Juergen Vigna <jug@sad.it>
6132 * src/table.C (Read): Now read bogus row format informations
6133 if the format is < 5 so that afterwards the table can
6134 be read by lyx but without any format-info. Fixed the
6135 crash we experienced when not doing this.
6137 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6139 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6140 (RedoDrawingOfParagraph): ditto
6141 (RedoParagraphs): ditto
6142 (RemoveTableRow): ditto
6144 * src/text.C (Fill): rename arg paperwidth -> paper_width
6146 * src/buffer.C (insertLyXFile): rename var filename -> fname
6147 (writeFile): rename arg filename -> fname
6148 (writeFileAscii): ditto
6149 (makeLaTeXFile): ditto
6150 (makeLinuxDocFile): ditto
6151 (makeDocBookFile): ditto
6153 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6156 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6158 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6161 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6162 compiled by a C compiler not C++.
6164 * src/layout.h (LyXTextClass): added typedef for const_iterator
6165 (LyXTextClassList): added typedef for const_iterator + member
6166 functions begin and end.
6168 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6169 iterators to fill the choice_class.
6170 (updateLayoutChoice): rewritten to use iterators to fill the
6171 layoutlist in the toolbar.
6173 * src/BufferView.h (BufferView::work_area_width): removed unused
6176 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6178 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6179 (sgmlCloseTag): ditto
6181 * src/support/lstrings.h: return type of countChar changed to
6184 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6185 what version of this func to use. Also made to return unsigned int.
6187 * configure.in: call LYX_STD_COUNT
6189 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6190 conforming std::count.
6192 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6194 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6195 and a subscript would give bad display (patch from Dekel Tsur
6196 <dekel@math.tau.ac.il>).
6198 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6200 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6203 * src/chset.h: add a few 'using' directives
6205 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6206 triggered when no buffer is active
6208 * src/layout.C: removed `break' after `return' in switch(), since
6211 * src/lyx_main.C (init): make sure LyX can be ran in place even
6212 when libtool has done its magic with shared libraries. Fix the
6213 test for the case when the system directory has not been found.
6215 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6216 name for the latex file.
6217 (MenuMakeHTML): ditto
6219 * src/buffer.h: add an optional boolean argument, which is passed
6222 1999-12-20 Allan Rae <rae@lyx.org>
6224 * lib/templates/IEEEtran.lyx: small correction and update.
6226 * configure.in: Attempted to use LYX_PATH_HEADER
6228 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6230 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6231 input from JMarc. Now use preprocessor to find the header.
6232 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6233 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6234 LYX_STL_STRING_FWD. See comments in file.
6236 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6238 * The global MiniBuffer * minibuffer variable is dead.
6240 * The global FD_form_main * fd_form_main variable is dead.
6242 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6244 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6246 * src/table.h: add the LOstream.h header
6247 * src/debug.h: ditto
6249 * src/LyXAction.h: change the explaination of the ReadOnly
6250 attribute: is indicates that the function _can_ be used.
6252 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6255 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6257 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6263 * src/paragraph.C (GetWord): assert on pos>=0
6266 * src/support/lyxstring.C: condition the use of an invariant on
6268 * src/support/lyxstring.h: ditto
6270 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6271 Use LAssert.h instead of plain assert().
6273 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6275 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6276 * src/support/filetools.C: ditto
6278 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6281 * INSTALL: document the new configure flags
6283 * configure.in: suppress --with-debug; add --enable-assertions
6285 * acinclude.m4: various changes in alignment of help strings.
6287 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6289 * src/kbmap.C: commented out the use of the hash map in kb_map,
6290 beginning of movement to a stl::container.
6292 * several files: removed code that was not in effect when
6293 MOVE_TEXT was defined.
6295 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6296 for escaping should not be used. We can discuss if the string
6297 should be enclosed in f.ex. [] instead of "".
6299 * src/trans_mgr.C (insert): use the new returned value from
6300 encodeString to get deadkeys and keymaps done correctly.
6302 * src/chset.C (encodeString): changed to return a pair, to tell
6303 what to use if we know the string.
6305 * src/lyxscreen.h (fillArc): new function.
6307 * src/FontInfo.C (resize): rewritten to use more std::string like
6308 structore, especially string::replace.
6310 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6313 * configure.in (chmod +x some scripts): remove config/gcc-hack
6315 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6317 * src/buffer.C (writeFile): change once again the top comment in a
6318 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6319 instead of an hardcoded version number.
6320 (makeDocBookFile): ditto
6322 * src/version.h: add new define LYX_DOCVERSION
6324 * po/de.po: update from Pit Sütterlin
6325 * lib/bind/de_menus.bind: ditto.
6327 * src/lyxfunc.C (Dispatch): call MenuExport()
6328 * src/buffer.C (Dispatch): ditto
6330 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6331 LyXFunc::Dispatch().
6332 (MenuExport): new function, moved from
6333 LyXFunc::Dispatch().
6335 * src/trans_mgr.C (insert): small cleanup
6336 * src/chset.C (loadFile): ditto
6338 * lib/kbd/iso8859-1.cdef: add missing backslashes
6340 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6342 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6343 help with placing the manually drawn accents better.
6345 (Draw): x2 and hg changed to float to minimize rounding errors and
6346 help place the accents better.
6348 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6349 unsigned short to char is just wrong...cast the char to unsigned
6350 char instead so that the two values can compare sanely. This
6351 should also make the display of insetlatexaccents better and
6352 perhaps also some other insets.
6354 (lbearing): new function
6357 1999-12-15 Allan Rae <rae@lyx.org>
6359 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6360 header that provides a wrapper around the very annoying SGI STL header
6363 * src/support/lyxstring.C, src/LString.h:
6364 removed old SGI-STL-compatability attempts.
6366 * configure.in: Use LYX_STL_STRING_FWD.
6368 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6369 stl_string_fwd.h is around and try to determine it's location.
6370 Major improvement over previous SGI STL 3.2 compatability.
6371 Three small problems remain with this function due to my zero
6372 knowledge of autoconf. JMarc and lgb see the comments in the code.
6374 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6376 * src/broken_const.h, config/hack-gcc, config/README: removed
6378 * configure.in: remove --with-gcc-hack option; do not call
6381 * INSTALL: remove documentation of --with-broken-const and
6384 * acconfig.h: remove all trace of BROKEN_CONST define
6386 * src/buffer.C (makeDocBookFile): update version number in output
6388 (SimpleDocBookOnePar): fix an assert when trying to a character
6389 access beyond string length
6392 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6394 * po/de.po: fix the Export menu
6396 * lyx.man: update the description of -dbg
6398 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6399 (commandLineHelp): updated
6400 (easyParse): show list of available debug levels if -dbg is passed
6403 * src/Makefile.am: add debug.C
6405 * src/debug.h: moved some code to debug.C
6407 * src/debug.C: new file. Contains code to set and show debug
6410 * src/layout.C: remove 'break' after 'continue' in switch
6411 statements, since these cannot be reached.
6413 1999-12-13 Allan Rae <rae@lyx.org>
6415 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6416 (in_word_set): hash() -> math_hash()
6418 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6420 * acconfig.h: Added a test for whether we are using exceptions in the
6421 current compilation run. If so USING_EXCEPTIONS is defined.
6423 * config.in: Check for existance of stl_string_fwd.h
6424 * src/LString.h: If compiling --with-included-string and SGI's
6425 STL version 3.2 is present (see above test) we need to block their
6426 forward declaration of string and supply a __get_c_string().
6427 However, it turns out this is only necessary if compiling with
6428 exceptions enabled so I've a bit more to add yet.
6430 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6431 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6432 src/support/LRegex.h, src/undo.h:
6433 Shuffle the order of the included files a little to ensure that
6434 LString.h gets included before anything that includes stl_string_fwd.h
6436 * src/support/lyxstring.C: We need to #include LString.h instead of
6437 lyxstring.h to get the necessary definition of __get_c_string.
6438 (__get_c_string): New function. This is defined static just like SGI's
6439 although why they need to do this I'm not sure. Perhaps it should be
6440 in lstrings.C instead.
6442 * lib/templates/IEEEtran.lyx: New template file.
6444 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6446 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6447 * intl/Makefile.in (MKINSTALLDIRS): ditto
6449 * src/LyXAction.C (init): changed to hold the LFUN data in a
6450 automatic array in stead of in callso to newFunc, this speeds up
6451 compilation a lot. Also all the memory used by the array is
6452 returned when the init is completed.
6454 * a lot of files: compiled with -Wold-style-cast, changed most of
6455 the reported offenders to C++ style casts. Did not change the
6456 offenders in C files.
6458 * src/trans.h (Match): change argument type to unsigned int.
6460 * src/support/DebugStream.C: fix some types on the streambufs so
6461 that it works on a conforming implementation.
6463 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6465 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6467 * src/support/lyxstring.C: remove the inline added earlier since
6468 they cause a bunch of unsatisfied symbols when linking with dec
6469 cxx. Cxx likes to have the body of inlines at the place where they
6472 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6473 accessing negative bounds in array. This fixes the crash when
6474 inserting accented characters.
6475 * src/trans.h (Match): ditto
6477 * src/buffer.C (Dispatch): since this is a void, it should not try
6478 to return anything...
6480 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6482 * src/buffer.h: removed the two friends from Buffer. Some changes
6483 because of this. Buffer::getFileName and Buffer::setFileName
6484 renamed to Buffer::fileName() and Buffer::fileName(...).
6486 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6488 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6489 and Buffer::update(short) to BufferView. This move is currently
6490 controlled by a define MOVE_TEXT, this will be removed when all
6491 shows to be ok. This move paves the way for better separation
6492 between buffer contents and buffer view. One side effect is that
6493 the BufferView needs a rebreak when swiching buffers, if we want
6494 to avoid this we can add a cache that holds pointers to LyXText's
6495 that is not currently in use.
6497 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6500 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6502 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6504 * lyx_main.C: new command line option -x (or --execute) and
6505 -e (or --export). Now direct conversion from .lyx to .tex
6506 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6507 Unfortunately, X is still needed and the GUI pops up during the
6510 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6512 * src/Spacing.C: add a using directive to bring stream stuff into
6514 * src/paragraph.C: ditto
6515 * src/buffer.C: ditto
6517 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6518 from Lars' announcement).
6520 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6521 example files from Tino Meinen.
6523 1999-12-06 Allan Rae <rae@lyx.org>
6525 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6527 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6529 * src/support/lyxstring.C: added a lot of inline for no good
6532 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6533 latexWriteEndChanges, they were not used.
6535 * src/layout.h (operator<<): output operator for PageSides
6537 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6539 * some example files: loaded in LyX 1.0.4 and saved again to update
6540 certain constructs (table format)
6542 * a lot of files: did the change to use fstream/iostream for all
6543 writing of files. Done with a close look at Andre Poenitz's patch.
6545 * some files: whitespace changes.
6547 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6549 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6550 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6551 architecture, we provide our own. It is used unconditionnally, but
6552 I do not think this is a performance problem. Thanks to Angus
6553 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6554 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6556 (GetInset): use my_memcpy.
6560 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6561 it is easier to understand, but it uses less TeX-only constructs now.
6563 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6564 elements contain spaces
6566 * lib/configure: regenerated
6568 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6569 elements contain spaces; display the list of programs that are
6572 * autogen.sh: make sure lib/configure is executable
6574 * lib/examples/*: rename the tutorial examples to begin with the
6575 two-letters language code.
6577 * src/lyxfunc.C (getStatus): do not query current font if no
6580 * src/lyx_cb.C (RunScript): use QuoteName
6581 (MenuRunDvips): ditto
6582 (PrintApplyCB): ditto
6584 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6585 around argument, so that it works well with the current shell.
6586 Does not work properly with OS/2 shells currently.
6588 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6589 * src/LyXSendto.C (SendtoApplyCB): ditto
6590 * src/lyxfunc.C (Dispatch): ditto
6591 * src/buffer.C (runLaTeX): ditto
6592 (runLiterate): ditto
6593 (buildProgram): ditto
6595 * src/lyx_cb.C (RunScript): ditto
6596 (MenuMakeLaTeX): ditto
6598 * src/buffer.h (getLatexName): new method
6600 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6602 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6604 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
6605 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
6606 (create_math_panel): ditto
6608 * src/lyxfunc.C (getStatus): re-activate the code which gets
6609 current font and cursor; add test for export to html.
6611 * src/lyxrc.C (read): remove unreachable break statements; add a
6614 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
6616 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6618 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
6619 introduced by faulty regex.
6620 * src/buffer.C: ditto
6621 * src/lastfiles.C: ditto
6622 * src/paragraph.C: ditto
6623 * src/table.C: ditto
6624 * src/vspace.C: ditto
6625 * src/insets/figinset.C: ditto
6626 Note: most of these is absolutely harmless, except the one in
6627 src/mathed formula.C.
6629 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6631 * src/ImportNoweb.C (documentclass): fixed bounds for substr
6632 operation, yielding correct results for the reLyX command.
6634 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6636 * src/support/filetools.C (ExpandPath): removed an over eager
6638 (ReplaceEnvironmentPath): ditto
6640 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
6641 shows that we are doing something fishy in our code...
6645 * src/lyxrc.C (read): use a double switch trick to get more help
6646 from the compiler. (the same trick is used in layout.C)
6647 (write): new function. opens a ofstream and pass that to output
6648 (output): new function, takes a ostream and writes the lyxrc
6649 elemts to it. uses a dummy switch to make sure no elements are
6652 * src/lyxlex.h: added a struct pushpophelper for use in functions
6653 with more than one exit point.
6655 * src/lyxlex.[Ch] (GetInteger): made it const
6659 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
6661 * src/layout.[hC] : LayoutTags splitted into several enums, new
6662 methods created, better error handling cleaner use of lyxlex. Read
6665 * src/bmtable.[Ch]: change some member prototypes because of the
6666 image const changes.
6668 * commandtags.h, src/LyXAction.C (init): new function:
6669 "preferences-save", saves the lyxrc entries into .lyx/preferences.
6670 This file is not read automatically but you can add \input
6671 preferences to your lyxrc if you want to. We need to discuss how
6674 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
6675 in .aux, also remove .bib and .bst files from dependencies when
6678 * src/BufferView.C, src/LyXView.C: add const_cast several places
6679 because of changes to images.
6681 * lib/images/*: same change as for images/*
6683 * lib/lyxrc.example: Default for accept_compound is false not no.
6685 * images/*: changed to be const, however I have som misgivings
6686 about this change so it might be changed back.
6688 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6690 * lib/configure, po/POTFILES.in: regenerated
6692 * autogen.sh: autogenerate lib/configure from lib/configure.m4
6694 * config/lib_configure.m4: removed
6696 * lib/configure.m4: new file (was config/lib_configure.m4)
6698 * configure.in: do not test for rtti, since we do not use it.
6700 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6702 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
6703 doubling of allocated space scheme. This makes it faster for large
6704 strings end to use less memory for small strings. xtra rememoved.
6706 * src/insets/figinset.C (waitalarm): commented out.
6707 (GhostscriptMsg): use static_cast
6708 (GhostscriptMsg): use new instead of malloc to allocate memory for
6709 cmap. also delete the memory after use.
6711 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
6713 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
6714 for changes in bibtex database or style.
6715 (runBibTeX): remove all .bib and .bst files from dep before we
6717 (run): use scanAuc in when dep file already exist.
6719 * src/DepTable.C (remove_files_with_extension): new method
6722 * src/DepTable.[Ch]: made many of the methods const.
6724 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6726 * src/bufferparams.C: make sure that the default textclass is
6727 "article". It used to be the first one by description order, but
6728 now the first one is "docbook".
6730 * src/lyx_main.C (setDebuggingLevel): change type of argument to
6731 string; call Debug::value.
6732 (easyParse): pass complete argument to setDebuggingLevel().
6734 * src/debug.h (value): fix the code that parses debug levels.
6736 * src/debug.h: add new debug type ACTION, reserved for LyXAction
6739 * src/LyXAction.C: use Debug::ACTION as debug channel.
6741 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
6743 * NEWS: updated for the future 1.1.3 release.
6745 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
6746 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
6747 it should. This is of course a controversial change (since many
6748 people will find that their lyx workscreen is suddenly full of
6749 red), but done for the sake of correctness.
6751 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
6752 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
6754 * src/insets/inseterror.h, src/insets/inseturl.h,
6755 src/insets/insetinfo.h, src/insets/figinset.h,
6756 src/mathed/formulamacro.h, src/mathed/math_macro.h
6757 (EditMessage): add a missing const and add _() to make sure that
6760 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
6761 src/insets/insetbib.C, src/support/filetools.C: add `using'
6764 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
6765 doing 'Insert index of last word' at the beginning of a paragraph.
6767 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6769 * several files: white-space changes.
6771 * src/mathed/formula.C: removed IsAlpha and IsDigit
6773 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
6774 .bib file. use a ifstream instead of FilePtr when parsing the .bib
6777 * src/insets/figinset.C (GetPSSizes): don't break when
6778 "EndComments" is seen. But break when a boundingbox is read.
6780 * all classes inherited from Inset: return value of Clone
6781 changed back to Inset *.
6783 * all classes inherited form MathInset: return value of Clone
6784 changed back to MathedInset *.
6786 * src/insets/figinset.C (runqueue): use a ofstream to output the
6787 gs/ps file. Might need some setpresicion or setw. However I can
6788 see no problem with the current code.
6789 (runqueue): use sleep instead of the alarm/signal code. I just
6790 can't see the difference.
6792 * src/paragraph.C (LyXParagraph): reserve space in the new
6793 paragraph and resize the inserted paragraph to just fit.
6795 * src/lyxfunc.h (operator|=): added operator for func_status.
6797 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
6798 check for readable file.
6800 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
6801 check for readable file.
6802 (MenuMakeLinuxDoc): ditto
6803 (MenuMakeDocBook): ditto
6804 (MenuMakeAscii): ditto
6805 (InsertAsciiFile): split the test for openable and readable
6807 * src/bmtable.C (draw_bitmaptable): use
6808 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
6810 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
6811 findtexfile from LaTeX to filetools.
6813 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
6814 instead of FilePtr. Needs to be verified by a literate user.
6816 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6818 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
6819 (EditMessage): likewise.
6821 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
6822 respectively as \textasciitilde and \textasciicircum.
6824 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6826 * src/support/lyxstring.h: made the methods that take iterators
6829 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
6830 (regexMatch): made is use the real regex class.
6832 * src/support/Makefile.am: changed to use libtool
6834 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
6836 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
6838 (MathIsInset ++): changed several macros to be inline functions
6841 * src/mathed/Makefile.am: changed to use libtool
6843 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
6845 * src/insets/inset* : Clone changed to const and return type is
6846 the true insettype not just Inset*.
6848 * src/insets/Makefile.am: changed to use libtool
6850 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
6852 * src/undo.[Ch] : added empty() and changed some of the method
6855 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
6857 * src/lyxparagraph.h: use id() and id(...) instead of getID and
6858 setID use block<> for the bullets array, added const several places.
6860 * src/lyxfunc.C (getStatus): new function
6862 * src/lyxfunc.[Ch] : small changes to take advantage of the new
6863 LyXAction, added const to several funtions.
6865 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
6866 a std::map, and to store the dir items in a vector.
6868 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
6871 * src/LyXView.[Ch] + other files : changed currentView to view.
6873 * src/LyXAction.[Ch] : ported from the old devel branch.
6875 * src/.cvsignore: added .libs and a.out
6877 * configure.in : changes to use libtool.
6879 * acinclude.m4 : inserted libtool.m4
6881 * .cvsignore: added libtool
6883 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6885 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
6886 file name in insets and mathed directories (otherwise the
6887 dependency is not taken in account under cygwin).
6889 * src/text2.C (InsertString[AB]): make sure that we do not try to
6890 read characters past the string length.
6892 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6894 * lib/doc/LaTeXConfig.lyx.in,
6895 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
6897 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
6898 file saying who created them and when this heppened; this is
6899 useless and annoys tools like cvs.
6901 * lib/layouts/g-brief-{en,de}.layout,
6902 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
6903 from Thomas Hartkens <thomas@hartkens.de>.
6905 * src/{insets,mathed}/Makefile.am: do not declare an empty
6906 LDFLAGS, so that it can be set at configure time (useful on Irix
6909 * lib/reLyX/configure.in: make sure that the prefix is set
6910 correctly in LYX_DIR.
6912 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6914 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
6915 be used by 'command-sequence' this allows to bind a key to a
6916 sequence of LyX-commands
6917 (Example: 'command-sequence math-insert alpha; math-insert beta;")
6919 * src/LyXAction.C: add "command-sequence"
6921 * src/LyXFunction.C: handling of "command-sequence"
6923 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
6924 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
6926 * src/lyxserver.C, src/minibuffer.C: Use this new interface
6928 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6930 * src/buffer.C (writeFile): Do not output a comment giving user
6931 and date at the beginning of a .lyx file. This is useless and
6932 annoys cvs anyway; update version number to 1.1.
6934 * src/Makefile.am (LYX_DIR): add this definition, so that a
6935 default path is hardcoded in LyX.
6937 * configure.in: Use LYX_GNU_GETTEXT.
6939 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
6940 AM_GNU_GETTEXT with a bug fixed.
6942 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
6944 * src/chset.C: add "using std::ifstream;" to please dec cxx.
6946 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
6947 which is used to point to LyX data is now LYX_DIR_11x.
6949 * lyx.man: convert to a unix text file; small updates.
6951 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6953 * src/support/LSubstring.[Ch]: made the second arg of most of the
6954 constructors be a const reference.
6956 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
6959 * src/support/lyxstring.[Ch] (swap): added missing member function
6960 and specialization of swap(str, str);
6962 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
6964 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
6965 trace of the old one.
6967 * src/undo.[Ch]: made the undostack use std::list to store undo's in
6968 put the member definitions in undo.C.
6970 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
6971 NEW_TEXT and have now only code that was included when this was
6974 * src/intl.C (LCombo): use static_cast
6976 (DispatchCallback): ditto
6978 * src/definitions.h: removed whole file
6980 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
6982 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
6983 parsing and stores in a std:map. a regex defines the file format.
6984 removed unneeded members.
6986 * src/bufferparams.h: added several enums from definitions.h here.
6987 Removed unsused destructor. Changed some types to use proper enum
6988 types. use block to have the temp_bullets and user_defined_bullets
6989 and to make the whole class assignable.
6991 * src/bufferparams.C (Copy): removed this functions, use a default
6994 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
6997 * src/buffer.C (readLyXformat2): commend out all that have with
6998 oldpapersize to do. also comment out all that hve to do with
6999 insetlatex and insetlatexdel.
7000 (setOldPaperStuff): commented out
7002 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7004 * src/LyXAction.C: remove use of inset-latex-insert
7006 * src/mathed/math_panel.C (button_cb): use static_cast
7008 * src/insets/Makefile.am (insets_o_SOURCES): removed
7011 * src/support/lyxstring.C (helper): use the unsigned long
7012 specifier, UL, instead of a static_cast.
7014 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7016 * src/support/block.h: new file. to be used as a c-style array in
7017 classes, so that the class can be assignable.
7019 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7021 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7022 NULL, make sure to return an empty string (it is not possible to
7023 set a string to NULL).
7025 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7027 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7029 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7031 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7032 link line, so that Irix users (for example) can set it explicitely to
7035 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7036 it can be overidden at make time (static or dynamic link, for
7039 * src/vc-backend.C, src/LaTeXFeatures.h,
7040 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7041 statements to bring templates to global namespace.
7043 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7045 * src/support/lyxstring.C (operator[] const): make it standard
7048 * src/minibuffer.C (Init): changed to reflect that more
7049 information is given from the lyxvc and need not be provided here.
7051 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7053 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7055 * src/LyXView.C (UpdateTimerCB): use static_cast
7056 (KeyPressMask_raw_callback): ditto
7058 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7059 buffer_, a lot of changes because of this. currentBuffer() ->
7060 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7061 also changes to other files because of this.
7063 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7065 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7066 have no support for RCS and partial support for CVS, will be
7069 * src/insets/ several files: changes because of function name
7070 changes in Bufferview and LyXView.
7072 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7074 * src/support/LSubstring.[Ch]: new files. These implement a
7075 Substring that can be very convenient to use. i.e. is this
7077 string a = "Mary had a little sheep";
7078 Substring(a, "sheep") = "lamb";
7079 a is now "Mary has a little lamb".
7081 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7082 out patterns and subpatterns of strings. It is used by LSubstring
7083 and also by vc-backend.C
7085 * src/support/lyxstring.C: went over all the assertions used and
7086 tried to correct the wrong ones and flag which of them is required
7087 by the standard. some bugs found because of this. Also removed a
7088 couple of assertions.
7090 * src/support/Makefile.am (libsupport_a_SOURCES): added
7091 LSubstring.[Ch] and LRegex.[Ch]
7093 * src/support/FileInfo.h: have struct stat buf as an object and
7094 not a pointer to one, some changes because of this.
7096 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7097 information in layout when adding the layouts preamble to the
7100 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7103 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7104 because of bug in OS/2.
7106 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7108 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7109 \verbatim@font instead of \ttfamily, so that it can be redefined.
7111 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7112 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7113 src/layout.h, src/text2.C: add 'using' directive to bring the
7114 STL templates we need from the std:: namespace to the global one.
7115 Needed by DEC cxx in strict ansi mode.
7117 * src/support/LIstream.h,src/support/LOstream.h,
7118 src/support/lyxstring.h,src/table.h,
7119 src/lyxlookup.h: do not include <config.h> in header
7120 files. This should be done in the .C files only.
7122 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7126 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7128 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7129 from Kayvan to fix the tth invokation.
7131 * development/lyx.spec.in: updates from Kayvan to reflect the
7132 changes of file names.
7134 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7136 * src/text2.C (InsertStringB): use std::copy
7137 (InsertStringA): use std::copy
7139 * src/bufferlist.C: use a vector to store the buffers in. This is
7140 an internal change and should not affect any other thing.
7142 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7145 * src/text.C (Fill): fix potential bug, one off bug.
7147 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7149 * src/Makefile.am (lyx_main.o): add more files it depends on.
7151 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7153 * src/support/lyxstring.C: use size_t for the reference count,
7154 size, reserved memory and xtra.
7155 (internal_compare): new private member function. Now the compare
7156 functions should work for std::strings that have embedded '\0'
7158 (compare): all compare functions rewritten to use
7161 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7163 * src/support/lyxstring.C (compare): pass c_str()
7164 (compare): pass c_str
7165 (compare): pass c_str
7167 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7169 * src/support/DebugStream.C: <config.h> was not included correctly.
7171 * lib/configure: forgot to re-generate it :( I'll make this file
7172 auto generated soon.
7174 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7176 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7179 * src/support/lyxstring.C: some changes from length() to rep->sz.
7180 avoids a function call.
7182 * src/support/filetools.C (SpaceLess): yet another version of the
7183 algorithm...now per Jean-Marc's suggestions.
7185 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7187 * src/layout.C (less_textclass_desc): functor for use in sorting
7189 (LyXTextClass::Read): sort the textclasses after reading.
7191 * src/support/filetools.C (SpaceLess): new version of the
7192 SpaceLess functions. What problems does this one give? Please
7195 * images/banner_bw.xbm: made the arrays unsigned char *
7197 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7199 * src/support/lyxstring.C (find): remove bogus assertion in the
7200 two versions of find where this has not been done yet.
7202 * src/support/lyxlib.h: add missing int return type to
7205 * src/menus.C (ShowFileMenu): disable exporting to html if no
7206 html export command is present.
7208 * config/lib_configure.m4: add a test for an HTML converter. The
7209 programs checked for are, in this order: tth, latex2html and
7212 * lib/configure: generated from config/lib_configure.m4.
7214 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7215 html converter. The parameters are now passed through $$FName and
7216 $$OutName, instead of standard input/output.
7218 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7220 * lib/lyxrc.example: update description of \html_command.
7221 add "quotes" around \screen_font_xxx font setting examples to help
7222 people who use fonts with spaces in their names.
7224 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7226 * Distribution files: updates for v1.1.2
7228 * src/support/lyxstring.C (find): remove bogus assert and return
7229 npos for the same condition.
7231 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7233 * added patch for OS/2 from SMiyata.
7235 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7237 * src/text2.C (CutSelection): make space_wrapped a bool
7238 (CutSelection): dont declare int i until we have to.
7239 (alphaCounter): return a char const *.
7241 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7243 * src/support/syscall.C (Systemcalls::kill):
7244 src/support/filetools.C (PutEnv, PutEnvPath):
7245 src/lyx_cb.C (addNewlineAndDepth):
7246 src/FontInfo.C (FontInfo::resize): condition some #warning
7247 directives with WITH_WARNINGS.
7250 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7252 * src/layout.[Ch] + several files: access to class variables
7253 limited and made accessor functions instead a lot of code changed
7254 becuase of this. Also instead of returning pointers often a const
7255 reference is returned instead.
7257 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7259 * src/Makefile.am (dist-hook): added used to remove the CVS from
7260 cheaders upon creating a dist
7261 (EXTRA_DIST): added cheaders
7263 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7264 a character not as a small integer.
7266 * src/support/lyxstring.C (find): removed Assert and added i >=
7267 rep->sz to the first if.
7269 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7271 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7272 src/LyXView.C src/buffer.C src/bufferparams.C
7273 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7274 src/text2.C src/insets/insetinclude.C:
7275 lyxlayout renamed to textclasslist.
7277 * src/layout.C: some lyxerr changes.
7279 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7280 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7281 (LyXLayoutList): removed all traces of this class.
7282 (LyXTextClass::Read): rewrote LT_STYLE
7283 (LyXTextClass::hasLayout): new function
7284 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7285 both const and nonconst version.
7286 (LyXTextClass::delete_layout): new function.
7287 (LyXTextClassList::Style): bug fix. do the right thing if layout
7289 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7290 (LyXTextClassList::NameOfLayout): ditto
7291 (LyXTextClassList::Load): ditto
7293 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7295 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7297 * src/LyXAction.C (LookupFunc): added a workaround for sun
7298 compiler, on the other hand...we don't know if the current code
7299 compiles on sun at all...
7301 * src/support/filetools.C (CleanupPath): subst fix
7303 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7306 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7307 complained about this one?
7309 * src/insets/insetinclude.C (Latex): subst fix
7311 * src/insets/insetbib.C (getKeys): subst fix
7313 * src/LyXSendto.C (SendtoApplyCB): subst fix
7315 * src/lyx_main.C (init): subst fix
7317 * src/layout.C (Read): subst fix
7319 * src/lyx_sendfax_main.C (button_send): subst fix
7321 * src/buffer.C (RoffAsciiTable): subst fix
7323 * src/lyx_cb.C (MenuFax): subst fix
7324 (PrintApplyCB): subst fix
7326 1999-10-26 Juergen Vigna <jug@sad.it>
7328 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7330 (Read): Cleaned up this code so now we read only format vestion >= 5
7332 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7334 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7335 come nobody has complained about this one?
7337 * src/insets/insetinclude.C (Latex): subst fix
7339 * src/insets/insetbib.C (getKeys): subst fix
7341 * src/lyx_main.C (init): subst fix
7343 * src/layout.C (Read): subst fix
7345 * src/buffer.C (RoffAsciiTable): subst fix
7347 * src/lyx_cb.C (MenuFax): subst fix.
7349 * src/layout.[hC] + some other files: rewrote to use
7350 std::container to store textclasses and layouts in.
7351 Simplified, removed a lot of code. Make all classes
7352 assignable. Further simplifications and review of type
7353 use still to be one.
7355 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7356 lastfiles to create the lastfiles partr of the menu.
7358 * src/lastfiles.[Ch]: rewritten to use deque to store the
7359 lastfiles in. Uses fstream for reading and writing. Simplifies
7362 * src/support/syscall.C: remove explicit cast.
7364 * src/BufferView.C (CursorToggleCB): removed code snippets that
7366 use explicat C++ style casts instead of C style casts. also use
7367 u_vdata instea of passing pointers in longs.
7369 * src/PaperLayout.C: removed code snippets that were commented out.
7371 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7373 * src/lyx_main.C: removed code snippets that wer commented out.
7375 * src/paragraph.C: removed code snippets that were commented out.
7377 * src/lyxvc.C (logClose): use static_cast
7379 (viewLog): remove explicit cast to void*
7380 (showLog): removed old commented code
7382 * src/menus.C: use static_cast instead of C style casts. use
7383 u_vdata instead of u_ldata. remove explicit cast to (long) for
7384 pointers. Removed old code that was commented out.
7386 * src/insets/inset.C: removed old commented func
7388 * src/insets/insetref.C (InsetRef): removed old code that had been
7389 commented out for a long time.
7391 (escape): removed C style cast
7393 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7395 * src/insets/insetlatex.C (Draw): removed old commented code
7396 (Read): rewritten to use string
7398 * src/insets/insetlabel.C (escape): removed C style cast
7400 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7402 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7405 * src/insets/insetinclude.h: removed a couple of stupid bools
7407 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7408 (Clone): remove C style cast
7409 (getKeys): changed list to lst because of std::list
7411 * src/insets/inseterror.C (Draw): removed som old commented code.
7413 * src/insets/insetcommand.C (Draw): removed some old commented code.
7415 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7416 commented out forever.
7417 (bibitem_cb): use static_cast instead of C style cast
7418 use of vdata changed to u_vdata.
7420 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7422 (CloseUrlCB): use static_cast instead of C style cast.
7423 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7425 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7426 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7427 (CloseInfoCB): static_cast from ob->u_vdata instead.
7428 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7431 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7432 (C_InsetError_CloseErrorCB): forward the ob parameter
7433 (CloseErrorCB): static_cast from ob->u_vdata instead.
7435 * src/vspace.h: include LString.h since we use string in this class.
7437 * src/vspace.C (lyx_advance): changed name from advance because of
7438 nameclash with stl. And since we cannot use namespaces yet...I
7439 used a lyx_ prefix instead. Expect this to change when we begin
7442 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7444 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7445 and removed now defunct constructor and deconstructor.
7447 * src/BufferView.h: have backstack as a object not as a pointer.
7448 removed initialization from constructor. added include for BackStack
7450 * development/lyx.spec.in (%build): add CFLAGS also.
7452 * src/screen.C (drawFrame): removed another warning.
7454 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7456 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7457 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7458 README and ANNOUNCE a bit for the next release. More work is
7461 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7462 unbreakable if we are in freespacing mode (LyX-Code), but not in
7465 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7467 * src/BackStack.h: fixed initialization order in constructor
7469 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7471 * acinclude.m4 (VERSION): new rules for when a version is
7472 development, added also a variable for prerelease.
7473 (warnings): we set with_warnings=yes for prereleases
7474 (lyx_opt): prereleases compile with same optimization as development
7475 (CXXFLAGS): only use pedantic if we are a development version
7477 * src/BufferView.C (restorePosition): don't do anything if the
7480 * src/BackStack.h: added member empty, use this to test if there
7481 is anything to pop...
7483 1999-10-25 Juergen Vigna <jug@sad.it>
7486 * forms/layout_forms.fd +
7487 * forms/latexoptions.fd +
7488 * lyx.fd: changed for various form resize issues
7490 * src/mathed/math_panel.C +
7491 * src/insets/inseterror.C +
7492 * src/insets/insetinfo.C +
7493 * src/insets/inseturl.C +
7494 * src/insets/inseturl.h +
7497 * src/PaperLayout.C +
7498 * src/ParagraphExtra.C +
7499 * src/TableLayout.C +
7501 * src/layout_forms.C +
7508 * src/menus.C: fixed various resize issues. So now forms can be
7509 resized savely or not be resized at all.
7511 * forms/form_url.fd +
7512 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7515 * src/insets/Makefile.am: added files form_url.[Ch]
7517 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7519 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7520 (and presumably 6.2).
7522 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7523 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7524 remaining static member callbacks.
7526 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7529 * src/support/lyxstring.h: declare struct Srep as friend of
7530 lyxstring, since DEC cxx complains otherwise.
7532 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7534 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7536 * src/LaTeX.C (run): made run_bibtex also depend on files with
7538 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7539 are put into the dependency file.
7541 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7542 the code has shown itself to work
7543 (create_ispell_pipe): removed another warning, added a comment
7546 * src/minibuffer.C (ExecutingCB): removed code that has been
7547 commented out a long time
7549 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7550 out code + a warning.
7552 * src/support/lyxstring.h: comment out the three private
7553 operators, when compiling with string ansi conforming compilers
7556 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7558 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7559 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7562 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7565 * src/mathed/math_panel.C (create_math_panel): remove explicit
7568 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7571 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7572 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7573 to XCreatePixmapFromBitmapData
7574 (fl_set_bmtable_data): change the last argument to be unsigned
7576 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7577 and bh to be unsigned int, remove explicit casts in call to
7578 XReadBitmapFileData.
7580 * images/arrows.xbm: made the arrays unsigned char *
7581 * images/varsz.xbm: ditto
7582 * images/misc.xbm: ditto
7583 * images/greek.xbm: ditto
7584 * images/dots.xbm: ditto
7585 * images/brel.xbm: ditto
7586 * images/bop.xbm: ditto
7588 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7590 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7591 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7592 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7594 (LYX_CXX_CHEADERS): added <clocale> to the test.
7596 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7598 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7600 * src/support/lyxstring.C (append): fixed something that must be a
7601 bug, rep->assign was used instead of rep->append.
7603 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
7606 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
7607 lyx insert double chars. Fix spotted by Kayvan.
7609 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7611 * Fixed the tth support. I messed up with the Emacs patch apply feature
7612 and omitted the changes in lyxrc.C.
7614 1999-10-22 Juergen Vigna <jug@sad.it>
7616 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
7618 * src/lyx_cb.C (MenuInsertRef) +
7619 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
7620 the form cannot be resized under it limits (fixes a segfault)
7622 * src/lyx.C (create_form_form_ref) +
7623 * forms/lyx.fd: Changed Gravity on name input field so that it is
7626 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7628 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
7629 <ostream> and <istream>.
7631 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
7632 whether <fstream> provides the latest standard features, or if we
7633 have an oldstyle library (like in egcs).
7634 (LYX_CXX_STL_STRING): fix the test.
7636 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
7637 code on MODERN_STL_STREAM.
7639 * src/support/lyxstring.h: use L{I,O}stream.h.
7641 * src/support/L{I,O}stream.h: new files, designed to setup
7642 correctly streams for our use
7643 - includes the right header depending on STL capabilities
7644 - puts std::ostream and std::endl (for LOStream.h) or
7645 std::istream (LIStream.h) in toplevel namespace.
7647 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7649 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
7650 was a bib file that had been changed we ensure that bibtex is run.
7651 (runBibTeX): enhanced to extract the names of the bib files and
7652 getting their absolute path and enter them into the dep file.
7653 (findtexfile): static func that is used to look for tex-files,
7654 checks for absolute patchs and tries also with kpsewhich.
7655 Alternative ways of finding the correct files are wanted. Will
7657 (do_popen): function that runs a command using popen and returns
7658 the whole output of that command in a string. Should be moved to
7661 * src/DepTable.[Ch] (extchanged): new function that returns true if a
7662 file with extension ext has changed.
7664 * src/insets/figinset.C: added ifdef guards around the fl_free
7665 code that jug commented out. Now it is commented out when
7666 compiling with XForms == 0.89.
7668 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
7669 to lyxstring.C, and only keep a forward declaration in
7670 lyxstring.h. Simplifies the header file a bit and should help a
7671 bit on compile time too. Also changes to Srep will not mandate a
7672 recompile of code just using string.
7673 (~lyxstring): definition moved here since it uses srep.
7674 (size): definition moved here since it uses srep.
7676 * src/support/lyxstring.h: removed a couple of "inline" that should
7679 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7681 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
7684 1999-10-21 Juergen Vigna <jug@sad.it>
7686 * src/table.C (SetPWidth): Just a small fix so the alignment is not
7687 set to left if I just remove the width entry (or it is empty).
7689 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
7690 paragraph when having dummy paragraphs.
7692 1999-10-20 Juergen Vigna <jug@sad.it>
7694 * src/insets/figinset.C: just commented some fl_free_form calls
7695 and added warnings so that this calls should be activated later
7696 again. This avoids for now a segfault, but we have a memory leak!
7698 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
7699 'const char * argument' to 'string argument', this should
7700 fix some Asserts() in lyxstring.C.
7702 * src/lyxfunc.h: Removed the function argAsString(const char *)
7703 as it is not used anymore.
7705 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7707 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
7710 * src/Literate.h: some funcs moved from public to private to make
7711 interface clearer. Unneeded args removed.
7713 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
7715 (scanBuildLogFile): ditto
7717 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
7718 normal TeX Error. Still room for improvement.
7720 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
7722 * src/buffer.C (insertErrors): changes to make the error
7723 desctription show properly.
7725 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
7728 * src/support/lyxstring.C (helper): changed to use
7729 sizeof(object->rep->ref).
7730 (operator>>): changed to use a pointer instead.
7732 * src/support/lyxstring.h: changed const reference & to value_type
7733 const & lets see if that helps.
7735 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7737 * Makefile.am (rpmdist): fixed to have non static package and
7740 * src/support/lyxstring.C: removed the compilation guards
7742 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
7745 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
7746 conditional compile of lyxstring.Ch
7748 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
7749 stupid check, but it is a lot better than the bastring hack.
7750 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
7752 * several files: changed string::erase into string::clear. Not
7755 * src/chset.C (encodeString): use a char temporary instead
7757 * src/table.C (TexEndOfCell): added tostr around
7758 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
7759 (TexEndOfCell): ditto
7760 (TexEndOfCell): ditto
7761 (TexEndOfCell): ditto
7762 (DocBookEndOfCell): ditto
7763 (DocBookEndOfCell): ditto
7764 (DocBookEndOfCell): ditto
7765 (DocBookEndOfCell): ditto
7767 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
7769 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
7771 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
7772 (MenuBuildProg): added tostr around ret
7773 (MenuRunChktex): added tostr around ret
7774 (DocumentApplyCB): added tostr around ret
7776 * src/chset.C (encodeString): added tostr around t->ic
7778 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
7779 (makeLaTeXFile): added tostr around tocdepth
7780 (makeLaTeXFile): added tostr around ftcound - 1
7782 * src/insets/insetbib.C (setCounter): added tostr around counter.
7784 * src/support/lyxstring.h: added an operator+=(int) to catch more
7787 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
7788 (lyxstring): We DON'T allow NULL pointers.
7790 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7792 * src/mathed/math_macro.C (MathMacroArgument::Write,
7793 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
7794 when writing them out.
7796 * src/LString.C: remove, since it is not used anymore.
7798 * src/support/lyxstring.C: condition the content to
7799 USE_INCLUDED_STRING macro.
7801 * src/mathed/math_symbols.C, src/support/lstrings.C,
7802 src/support/lyxstring.C: add `using' directive to specify what
7803 we need in <algorithm>. I do not think that we need to
7804 conditionalize this, but any thought is appreciated.
7806 * many files: change all callback functions to "C" linkage
7807 functions to please strict C++ compilers like DEC cxx 6.1 in mode
7808 strict_ansi. Those who were static are now global.
7809 The case of callbacks which are static class members is
7810 trickier, since we have to make C wrappers around them (see
7811 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
7812 did not finish this yet, since it defeats the purpose of
7813 encapsulation, and I am not sure what the best route is.
7815 1999-10-19 Juergen Vigna <jug@sad.it>
7817 * src/support/lyxstring.C (lyxstring): we permit to have a null
7818 pointer as assignment value and just don't assign it.
7820 * src/vspace.C (nextToken): corrected this function substituting
7821 find_first(_not)_of with find_last_of.
7823 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
7824 (TableOptCloseCB) (TableSpeCloseCB):
7825 inserted fl_set_focus call for problem with fl_hide_form() in
7828 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7830 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
7833 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7835 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
7836 LyXLex::next() and not eatline() to get its argument.
7838 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7840 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
7841 instead, use fstreams for io of the depfile, removed unneeded
7842 functions and variables.
7844 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
7845 vector instead, removed all functions and variables that is not in
7848 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7850 * src/buffer.C (insertErrors): use new interface to TeXError
7852 * Makefile.am (rpmdist): added a rpmdist target
7854 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
7855 per Kayvan's instructions.
7857 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7859 * src/Makefile.am: add a definition for localedir, so that locales
7860 are found after installation (Kayvan)
7862 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7864 * development/.cvsignore: new file.
7866 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7868 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
7869 C++ compiler provides wrappers for C headers and use our alternate
7872 * configure.in: use LYX_CXX_CHEADERS.
7874 * src/cheader/: new directory, populated with cname headers from
7875 libstdc++-2.8.1. They are a bit old, but probably good enough for
7876 what we want (support compilers who lack them).
7878 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
7879 from includes. It turns out is was stupid.
7881 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7883 * lib/Makefile.am (install-data-local): forgot a ';'
7884 (install-data-local): forgot a '\'
7885 (libinstalldirs): needed after all. reintroduced.
7887 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7889 * configure.in (AC_OUTPUT): added lyx.spec
7891 * development/lyx.spec: removed file
7893 * development/lyx.spec.in: new file
7895 * po/*.po: merged with lyx.pot becuase of make distcheck
7897 * lib/Makefile.am (dist-hook): added dist-hook so that
7898 documentation files will be included when doing a make
7899 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
7900 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
7902 more: tried to make install do the right thing, exclude CVS dirs
7905 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
7906 Path would fit in more nicely.
7908 * all files that used to use pathstack: uses now Path instead.
7909 This change was a lot easier than expected.
7911 * src/support/path.h: new file
7913 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
7915 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
7917 * src/support/lyxstring.C (getline): Default arg was given for
7920 * Configure.cmd: removed file
7922 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7924 * src/support/DebugStream.[Ch]: remove the explicit std:: before
7925 streams classes and types, add the proper 'using' statements when
7926 MODERN_STL is defined.
7928 * src/debug.h: move the << operator definition after the inclusion
7931 * src/support/filetools.C: include "LAssert.h", which is needed
7934 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
7937 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
7938 include "debug.h" to define a proper ostream.
7940 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7942 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
7943 method to the SystemCall class which can kill a process, but it's
7944 not fully implemented yet.
7946 * src/*.C: Changed Systemcalls::Startscript() to startscript()
7948 * src/support/FileInfo.h: Better documentation
7950 * src/lyxfunc.C: Added support for buffer-export html
7952 * src/menus.C: Added Export->As HTML...
7954 * lib/bind/*.bind: Added short-cut for buffer-export html
7956 * src/lyxrc.*: Added support for new \tth_command
7958 * lib/lyxrc.example: Added stuff for new \tth_command
7960 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7962 * lib/Makefile.am (IMAGES): removed images/README
7963 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
7964 installes in correct place. Check permisions is installed
7967 * src/LaTeX.C: some no-op changes moved declaration of some
7970 * src/LaTeX.h (LATEX_H): changed include guard name
7972 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7974 * lib/reLyX/Makefile.am: install noweb2lyx.
7976 * lib/Makefile.am: install configure.
7978 * lib/reLyX/configure.in: declare a config aux dir; set package
7979 name to lyx (not sure what the best solution is); generate noweb2lyx.
7981 * lib/layouts/egs.layout: fix the bibliography layout.
7983 1999-10-08 Jürgen Vigna <jug@sad.it>
7985 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
7986 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
7987 it returned without continuing to search the path.
7989 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7991 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
7992 also fixes a bug. It is not allowed to do tricks with std::strings
7993 like: string a("hei"); &a[e]; this will not give what you
7994 think... Any reason for the complexity in this func?
7996 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
7998 * Updated README and INSTALL a bit, mostly to check that my
7999 CVS rights are correctly set up.
8001 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8003 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8004 does not allow '\0' chars but lyxstring and std::string does.
8006 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8008 * autogen.sh (AUTOCONF): let the autogen script create the
8009 POTFILES.in file too. POTFILES.in should perhaps now not be
8010 included in the cvs module.
8012 * some more files changed to use C++ includes instead of C ones.
8014 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8016 (Reread): added tostr to nlink. buggy output otherwise.
8017 (Reread): added a string() around szMode when assigning to Buffer,
8018 without this I got a log of garbled info strings.
8020 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8023 * I have added several ostream & operator<<(ostream &, some_type)
8024 functions. This has been done to avoid casting and warnings when
8025 outputting enums to lyxerr. This as thus eliminated a lot of
8026 explicit casts and has made the code clearer. Among the enums
8027 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8028 mathed enums, some font enum the Debug::type enum.
8030 * src/support/lyxstring.h (clear): missing method. equivalent of
8033 * all files that contained "stderr": rewrote constructs that used
8034 stderr to use lyxerr instead. (except bmtable)
8036 * src/support/DebugStream.h (level): and the passed t with
8037 Debug::ANY to avoid spurious bits set.
8039 * src/debug.h (Debug::type value): made it accept strings of the
8042 * configure.in (Check for programs): Added a check for kpsewhich,
8043 the latex generation will use this later to better the dicovery of
8046 * src/BufferView.C (create_view): we don't need to cast this to
8047 (void*) that is done automatically.
8048 (WorkAreaButtonPress): removed some dead code.
8050 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8052 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8053 is not overwritten when translated (David Sua'rez de Lis).
8055 * lib/CREDITS: Added David Sua'rez de Lis
8057 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8059 * src/bufferparams.C (BufferParams): default input encoding is now
8062 * acinclude.m4 (cross_compiling): comment out macro
8063 LYX_GXX_STRENGTH_REDUCE.
8065 * acconfig.h: make sure that const is not defined (to empty) when
8066 we are compiling C++. Remove commented out code using SIZEOF_xx
8069 * configure.in : move the test for const and inline as late as
8070 possible so that these C tests do not interefere with C++ ones.
8071 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8072 has not been proven.
8074 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8076 * src/table.C (getDocBookAlign): remove bad default value for
8079 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8081 (ShowFileMenu2): ditto.
8083 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8086 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8088 * Most files: finished the change from the old error code to use
8089 DebugStream for all lyxerr debugging. Only minor changes remain
8090 (e.g. the setting of debug levels using strings instead of number)
8092 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8094 * src/layout.C (Add): Changed to use compare_no_case instead of
8097 * src/FontInfo.C: changed loop variable type too string::size_type.
8099 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8101 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8102 set ETAGS_ARGS to --c++
8104 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8106 * src/table.C (DocBookEndOfCell): commented out two unused variables
8108 * src/paragraph.C: commented out four unused variables.
8110 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8111 insed a if clause with type string::size_type.
8113 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8116 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8118 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8119 variable, also changed loop to go from 0 to lenght + 1, instead of
8120 -1 to length. This should be correct.
8122 * src/LaTeX.C (scanError): use string::size_type as loop variable
8125 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8126 (l.896) since y_tmp and row was not used anyway.
8128 * src/insets/insetref.C (escape): use string::size_type as loop
8131 * src/insets/insetquotes.C (Width): use string::size_type as loop
8133 (Draw): use string::size_type as loop variable type.
8135 * src/insets/insetlatexaccent.C (checkContents): use
8136 string::size_type as loop variable type.
8138 * src/insets/insetlabel.C (escape): use string::size_type as loop
8141 * src/insets/insetinfo.C: added an extern for current_view.
8143 * src/insets/insetcommand.C (scanCommand): use string::size_type
8144 as loop variable type.
8146 * most files: removed the RCS tags. With them we had to recompile
8147 a lot of files after a simple cvs commit. Also we have never used
8148 them for anything meaningful.
8150 * most files: tags-query-replace NULL 0. As adviced several plases
8151 we now use "0" instead of "NULL" in our code.
8153 * src/support/filetools.C (SpaceLess): use string::size_type as
8156 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8158 * src/paragraph.C: fixed up some more string stuff.
8160 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8162 * src/support/filetools.h: make modestr a std::string.
8164 * src/filetools.C (GetEnv): made ch really const.
8166 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8167 made code that used these use max/min from <algorithm> instead.
8169 * changed several c library include files to their equivalent c++
8170 library include files. All is not changed yet.
8172 * created a support subdir in src, put lyxstring and lstrings
8173 there + the extra files atexit, fileblock, strerror. Created
8174 Makefile.am. edited configure.in and src/Makefile.am to use this
8175 new subdir. More files moved to support.
8177 * imported som of the functions from repository lyx, filetools
8179 * ran tags-query-replace on LString -> string, corrected the bogus
8180 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8181 is still some errors in there. This is errors where too much or
8182 too litle get deleted from strings (string::erase, string::substr,
8183 string::replace), there can also be some off by one errors, or
8184 just plain wrong use of functions from lstrings. Viewing of quotes
8187 * LyX is now running fairly well with string, but there are
8188 certainly some bugs yet (see above) also string is quite different
8189 from LString among others in that it does not allow null pointers
8190 passed in and will abort if it gets any.
8192 * Added the revtex4 files I forgot when setting up the repository.
8194 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8196 * All over: Tried to clean everything up so that only the files
8197 that we really need are included in the cvs repository.
8198 * Switched to use automake.
8199 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8200 * Install has not been checked.
8202 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8204 * po/pt.po: Three errors:
8205 l.533 and l.538 format specification error
8206 l. 402 duplicate entry, I just deleted it.