1 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/bind/cua.bind: fix a bit.
4 * lib/bind/emacs.bind: ditto.
6 * lib/bind/menus.bind: remove real menu entries from there.
8 * src/spellchecker.C: make sure we only include strings.h when
11 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
13 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
14 function. It enlarges the maximum number of pup when needed.
15 (add_toc2): Open a new menu if maximum number of items per menu has
18 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
20 * src/frontends/kde/FormPrint.C: fix error reporting
22 * src/frontends/xforms/FormDocument.C: fix compiler
25 * lib/.cvsignore: add Literate.nw
27 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
30 * bufferview_funcs.[Ch]
33 * text2.C: Add support for numbers in RTL text.
35 2000-10-06 Allan Rae <rae@lyx.org>
37 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
38 to be gettext.m4 friendly again. ext_l10n.h is now
39 generated into $top_srcdir instead of $top_builddir
40 so that lyx.pot will be built correctly -- without
41 duplicate parsing of ext_l10n.h.
43 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
45 * src/frontends/kde/FormCitation.C: make the dialog
48 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
50 * config/kde.m4: fix consecutive ./configure runs,
51 look for qtarch, fix library order
53 * src/frontends/kde/Makefile.am: tidy up,
54 add Print dialog, add .dlg dependencies
56 * src/frontends/kde/FormPrint.C:
57 * src/frontends/kde/FormPrint.h:
58 * src/frontends/kde/formprintdialog.C:
59 * src/frontends/kde/formprintdialog.h:
60 * src/frontends/kde/formprintdialogdata.C:
61 * src/frontends/kde/formprintdialogdata.h:
62 * src/frontends/kde/dlg/formprintdialog.dlg: add
65 * src/frontends/kde/dlg/README: Added explanatory readme
67 * src/frontends/kde/dlg/checkinitorder.pl: small perl
68 script to double-check qtarch's output
70 * src/frontends/kde/formindexdialog.C:
71 * src/frontends/kde/formindexdialogdata.C:
72 * src/frontends/kde/formindexdialogdata.h:
73 * src/frontends/kde/dlg/formindexdialog.dlg: update
74 for qtarch, minor fixes
76 2000-10-05 Allan Rae <rae@lyx.org>
78 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
79 dialogs when switching buffers update them instead. It's up to each
80 dialog to decide if it should still be visible or not.
81 update() should return a bool to control visiblity within show().
82 Or perhaps better to set a member variable and use that to control
85 * lib/build-listerrors: create an empty "listerrors" file just to stop
86 make trying to regenerate it all the time if you don't have noweb
89 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
91 * po/Makefile.in.in (ext_l10n.h): added a rule to build
92 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
93 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
94 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
95 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
97 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
99 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
101 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
102 deleting buffer. Closes all buffer-dependent dialogs.
104 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
106 * src/frontends/xforms/FormCitation.[Ch]:
107 * src/frontends/xforms/FormPreferences.[Ch]:
108 * src/frontends/xforms/FormPrint.[Ch]:
109 * src/frontends/xforms/FormRef.[Ch]:
110 * src/frontends/xforms/FormUrl.[Ch]: ditto
112 * src/frontends/xforms/FormDocument.[Ch]:
113 * src/frontends/xforms/forms/form_document.C.patch:
114 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
115 pass through a single input() function.
117 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
119 * lib/build-listerrors: return status as OK
121 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
123 * lib/lyxrc.example: Updated to new export code
125 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
127 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
130 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
133 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
135 * lib/layouts/amsbook.layout: ditto.
137 * boost/Makefile.am: fix typo.
139 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
141 (add_lastfiles): removed.
142 (add_documents): removed.
143 (add_formats): removed.
145 * src/frontends/Menubar.C: remove useless "using" directive.
147 * src/MenuBackend.h: add a new MenuItem constructor.
149 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
152 2000-10-04 Allan Rae <rae@lyx.org>
154 * lib/Makefile.am (listerrors):
155 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
156 I haven't got notangle installed so Kayvan please test. The output
157 should end up in $builddir. This also allows people who don't have
158 noweb installed to complete the make process without error.
160 * src/frontends/xforms/FormCommand.[Ch] (showInset):
161 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
162 by JMarc's picky compiler.
164 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
167 * src/insets/insettabular.C (setPos): change for loop to not use
168 sequencing operator. Please check this Jürgen.
170 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
172 * src/insets/insetcite.C (getScreenLabel): ditto
173 * src/support/filetools.C (QuoteName): ditto
174 (ChangeExtension): ditto
176 * src/BufferView_pimpl.C (scrollCB): make heigt int
178 * src/BufferView2.C (insertInset): comment out unused arg
180 * boost/Makefile.am (EXTRADIST): new variable
182 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
184 * src/exporter.C (IsExportable): Fixed
186 * lib/configure.m4: Small fix
188 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
190 * src/insets/insetbutton.C (width): Changed to work with no GUI.
191 * src/insets/insetbib.C (bibitemWidest): ditto.
192 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
194 2000-10-03 Juergen Vigna <jug@sad.it>
196 * src/BufferView2.C (theLockingInset): removed const because of
197 Agnus's compile problems.
199 * src/insets/insettext.C (LocalDispatch): set the language of the
200 surronding paragraph on inserting the first character.
202 * various files: changed use of BufferView::the_locking_inset.
204 * src/BufferView2.C (theLockingInset):
205 (theLockingInset): new functions.
207 * src/BufferView.h: removed the_locking_inset.
209 * src/lyxtext.h: added the_locking_inset
211 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
213 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
215 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
217 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
218 * src/mathed/math_cursor.C (IsAlpha): ditto.
219 * src/mathed/math_inset.C (strnew): ditto.
220 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
221 (IMetrics): cxp set but never used; removed.
222 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
223 that the variable in question has been removed also!
226 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
227 using the Buffer * passed to Latex(), using the BufferView * passed to
228 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
230 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
231 Linuxdoc() and DocBook() rather than the stored Buffer * master.
233 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
234 * src/buffer.C (readInset): used new InsetBibtex c-tor
235 * (getBibkeyList): used new InsetBibtex::getKeys
237 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
240 * lib/build-listerrors
242 * src/exporter.C: Add literate programming support to the export code
245 * src/lyx_cb.C: Remove old literate code.
247 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
250 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
251 * src/converter.C (View, Convert): Use QuoteName.
253 * src/insets/figinset.C (Preview): Use Formats::View.
255 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
257 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
259 * src/lyxfunc.C (Dispatch): move declaration of text variable at
260 the top of the function, because compaq cxx complains that the
261 "goto exit_with_message" when the function is disabled bypasses
263 (MenuNew): try a better fix for the generation of new file names.
264 This time, I used AddName() instead of AddPath(), hoping Juergen
267 2000-10-03 Allan Rae <rae@lyx.org>
269 * src/frontends/xforms/forms/form_preferences.fd:
270 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
271 nested tabfolders has begun. The old "Miscellaneous" was renamed as
272 "Look and Feel"->"General" but will need to be split up further into
273 general output and general input tabs. Current plan is for four outer
274 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
275 stuff; "Inputs" for input and import configuration; "Outputs" for
276 output and export configuration; and one more whatever is left over
277 called "General". The leftovers at present look like being which
278 viewers to use, spellchecker, language support and might be better
279 named "Support". I've put "Paths" in "Inputs" for the moment as this
280 seems reasonable for now at least.
281 One problem remains: X error kills LyX when you close Preferences.
283 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
285 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
286 qualifier from form()
287 * src/frontends/xforms/FormCitation.[Ch]:
288 * src/frontends/xforms/FormCopyright.[Ch]:
289 * src/frontends/xforms/FormDocument.[Ch]:
290 * src/frontends/xforms/FormError.[Ch]:
291 * src/frontends/xforms/FormIndex.[Ch]:
292 * src/frontends/xforms/FormPreferences.[Ch]:
293 * src/frontends/xforms/FormPrint.[Ch]:
294 * src/frontends/xforms/FormRef.[Ch]:
295 * src/frontends/xforms/FormToc.[Ch]:
296 * src/frontends/xforms/FormUrl.[Ch]: ditto.
298 * src/frontends/xforms/FormCitation.[Ch]:
299 * src/frontends/xforms/FormIndex.[Ch]:
300 * src/frontends/xforms/FormRef.[Ch]:
301 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
302 with Allan's naming policy
304 * src/frontends/xforms/FormCitation.C: some static casts to remove
307 2000-10-02 Juergen Vigna <jug@sad.it>
309 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
310 now you can type or do stuff inside the table-cell also when in dummy
311 position, fixed visible cursor.
313 * src/insets/insettext.C (Edit): fixing cursor-view position.
315 * src/lyxfunc.C (Dispatch): use * text variable so that it can
316 be used for equal functions in lyxfunc and insettext.
318 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
320 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
322 * src/frontends/gnome/FormCitation.h:
323 * src/frontends/gnome/FormCopyright.h:
324 * src/frontends/gnome/FormIndex.h:
325 * src/frontends/gnome/FormPrint.h:
326 * src/frontends/gnome/FormToc.h:
327 * src/frontends/gnome/FormUrl.h:
328 * src/frontends/kde/FormCitation.h:
329 * src/frontends/kde/FormCopyright.h:
330 * src/frontends/kde/FormIndex.h:
331 * src/frontends/kde/FormRef.h:
332 * src/frontends/kde/FormToc.h:
333 * src/frontends/kde/FormUrl.h: fix remaining users of
336 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
338 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
340 (DocBookHandleCaption): ditto.
341 (DocBookHandleFootnote): ditto.
342 (SimpleDocBookOnePar): ditto.
344 * src/frontends/xforms/FormDocument.h (form): remove extra
345 FormDocument:: qualifier.
347 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
349 * sigc++/handle.h: ditto.
351 * src/lyx_gui_misc.C: add "using" directive.
353 * src/cheaders/cstddef: new file, needed by the boost library (for
356 2000-10-02 Juergen Vigna <jug@sad.it>
358 * src/insets/insettext.C (SetFont): better support.
360 * src/insets/insettabular.C (draw): fixed drawing of single cell.
362 * src/screen.C (DrawOneRow): some uint refixes!
364 2000-10-02 Allan Rae <rae@lyx.org>
366 * boost/.cvsignore: ignore Makefile as well
368 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
369 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
371 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
372 Left this one out by accident.
374 * src/frontends/xforms/FormBase.h (restore): default to calling
375 update() since that will restore the original/currently-applied values.
376 Any input() triggered error messages will require the derived classes
377 to redefine restore().
379 * src/frontends/xforms/FormDocument.C: initialize a few variables to
380 avoid a segfault. combo_doc_class is the main concern.
382 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
384 * Simplify build-listerrors in view of GUI-less export ability!
386 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
388 * src/lyx_main.C (easyParse): Disable gui when exporting
390 * src/insets/figinset.C:
394 * src/tabular.C: Changes to allow no-gui.
396 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
398 * src/support/utility.hpp: removed file
399 * src/support/block.h: removed file
401 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
404 * src/mathed/formula.C: add support/lyxlib.h
405 * src/mathed/formulamacro.C: ditto
407 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
408 * src/lyxparagraph.h: ditto
410 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
411 * src/frontends/Makefile.am (INCLUDES): ditto
412 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
413 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
414 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
415 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
416 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
417 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
419 * src/BufferView.h: use boost/utility.hpp
420 * src/LColor.h: ditto
422 * src/LyXAction.h: ditto
423 * src/LyXView.h: ditto
424 * src/bufferlist.h: ditto
425 * src/lastfiles.h: ditto
426 * src/layout.h: ditto
427 * src/lyx_gui.h: ditto
428 * src/lyx_main.h: ditto
429 * src/lyxlex.h: ditto
431 * src/frontends/ButtonPolicies.h: ditto
432 * src/frontends/Dialogs.h: ditto
433 * src/frontends/xforms/FormBase.h: ditto
434 * src/frontends/xforms/FormGraphics.h: ditto
435 * src/frontends/xforms/FormParagraph.h: ditto
436 * src/frontends/xforms/FormTabular.h: ditto
437 * src/graphics/GraphicsCache.h: ditto
438 * src/graphics/Renderer.h: ditto
439 * src/insets/ExternalTemplate.h: ditto
440 * src/insets/insetcommand.h: ditto
441 * src/support/path.h: ditto
443 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
444 and introduce clause for 2.97.
446 * boost/libs/README: new file
448 * boost/boost/utility.hpp: new file
450 * boost/boost/config.hpp: new file
452 * boost/boost/array.hpp: new file
454 * boost/Makefile.am: new file
456 * boost/.cvsignore: new file
458 * configure.in (AC_OUTPUT): add boost/Makefile
460 * Makefile.am (SUBDIRS): add boost
462 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
464 * src/support/lstrings.C (suffixIs): Fixed.
466 2000-10-01 Allan Rae <rae@lyx.org>
468 * src/PrinterParams.h: moved things around to avoid the "can't
469 inline call" warning.
471 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
472 into doc++ documentation.
474 * src/frontends/xforms/FormCommand.[Ch]: support button policy
476 * src/frontends/xforms/FormRef.C: make use of button controller
477 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
478 cleaned up button controller usage.
479 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
480 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
481 use the button controller
483 * src/frontends/xforms/forms/*.fd: and associated generated files
484 updated to reflect changes to FormBase. Some other FormXxxx files
485 also got minor updates to reflect changes to FormBase.
487 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
488 (hide): made virtual.
489 (input): return a bool. true == valid input
490 (RestoreCB, restore): new
491 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
492 Changes to allow derived dialogs to use a ButtonController and
493 make sense when doing so: OK button calls ok() and so on.
495 * src/frontends/xforms/ButtonController.h (class ButtonController):
496 Switch from template implementation to taking Policy parameter.
497 Allows FormBase to provide a ButtonController for any dialog.
499 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
500 Probably should rename connect and disconnect.
501 (apply): use the radio button groups
502 (form): needed by FormBase
503 (build): setup the radio button groups
505 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
507 * several files: type changes to reduce the number of warnings and
508 to unify type hangling a bit. Still much to do.
510 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
512 * lib/images/*: rename a bunch of icons to match Dekel converter
515 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
518 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
520 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
522 * sigc++/handle.h: ditto for class Handle.
524 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
526 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
528 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
530 * src/intl.C (InitKeyMapper): Correct the value of n due to the
531 removal of the "default" language.
533 * src/combox.h (getline): Check that sel > 0
535 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
537 * lib/examples/docbook_example.lyx
538 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
540 * lib/layouts/docbook-book.layout: new docbook book layout.
542 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
544 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
546 * src/insets/figinset.C (DocBook):fixed small typo.
548 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
550 * src/insets/insetinclude.h: string include_label doesn't need to be
553 2000-09-29 Allan Rae <rae@lyx.org>
555 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
556 Allow derived type to control connection and disconnection from signals
557 of its choice if desired.
559 2000-09-28 Juergen Vigna <jug@sad.it>
561 * src/insets/insettabular.C (update): fixed cursor setting when
562 the_locking_inset changed.
563 (draw): made this a bit cleaner.
564 (InsetButtonPress): fixed!
566 * various files: added LyXText Parameter to fitCursor call.
568 * src/BufferView.C (fitCursor): added LyXText parameter.
570 * src/insets/insettabular.C (draw): small draw fix.
572 * src/tabular.C: right setting of left/right celllines.
574 * src/tabular.[Ch]: fixed various types in funcions and structures.
575 * src/insets/insettabular.C: ditto
576 * src/frontends/xforms/FormTabular.C: ditto
578 2000-09-28 Allan Rae <rae@lyx.org>
580 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
581 that the #ifdef's had been applied to part of what should have been
582 a complete condition. It's possible there are other tests that
583 were specific to tables that are also wrong now that InsetTabular is
584 being used. Now we need to fix the output of '\n' after a table in a
585 float for the same reason as the original condition:
586 "don't insert this if we would be adding it before or after a table
587 in a float. This little trick is needed in order to allow use of
588 tables in \subfigures or \subtables."
589 Juergen can you check this?
591 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
593 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
594 outputed to the ostream.
596 * several files: fixed types based on warnings from cxx
598 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
600 * src/frontends/kde/Makefile.am: fix rule for
601 formindexdialogdata_moc.C
603 * src/.cvsignore: add ext_l10n.h to ignore
605 * acconfig.h: stop messing with __STRICT_ANSI__
606 * config/gnome.m4: remove option to set -ansi
607 * config/kde.m4: remove option to set -ansi
608 * config/lyxinclude.m4: don't set -ansi
610 2000-09-27 Juergen Vigna <jug@sad.it>
612 * various files: remove "default" language check.
614 * src/insets/insetquotes.C: removed use of current_view.
616 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
617 the one should have red ears by now!
619 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
620 in more then one paragraph. Fixed cursor-movement/selection.
622 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
623 paragraphs inside a text inset.
625 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
626 text-inset if this owner is an inset.
628 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
630 * src/Bullet.h: changed type of font, character and size to int
632 * src/buffer.C (asciiParagraph): remove actcell and fname1.
634 * src/insets/inseturl.[Ch]:
635 * src/insets/insetref.[Ch]:
636 * src/insets/insetlabel.[Ch]: add linelen to Ascii
638 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
640 * src/buffer.C (readFile): block-if statement rearranged to minimise
641 bloat. Patch does not reverse Jean-Marc's change ;-)
643 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
644 Class rewritten to store pointers to hide/update signals directly,
645 rather than Dialogs *. Also defined an enum to ease use. All xforms
646 forms can now be derived from this class.
648 * src/frontends/xforms/FormCommand.[Ch]
649 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
651 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
654 * src/frontends/xforms/forms/form_citation.fd
655 * src/frontends/xforms/forms/form_copyright.fd
656 * src/frontends/xforms/forms/form_error.fd
657 * src/frontends/xforms/forms/form_index.fd
658 * src/frontends/xforms/forms/form_ref.fd
659 * src/frontends/xforms/forms/form_toc.fd
660 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
662 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
664 * src/insets/insetfoot.C: removed redundent using directive.
666 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
668 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
669 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
671 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
672 created in the constructors in different groups. Then set() just
673 have to show the groups as needed. This fixes the redraw problems
674 (and is how the old menu code worked).
676 * src/support/lyxlib.h: declare the methods as static when we do
679 2000-09-26 Juergen Vigna <jug@sad.it>
681 * src/buffer.C (asciiParagraph): new function.
682 (writeFileAscii): new function with parameter ostream.
683 (writeFileAscii): use now asciiParagraph.
685 * various inset files: added the linelen parameter to the Ascii-func.
687 * src/tabular.C (Write): fixed error in writing file introduced by
688 the last changes from Lars.
690 * lib/bind/menus.bind: removed not supported functions.
692 * src/insets/insettext.C (Ascii): implemented this function.
694 * src/insets/lyxinset.h (Ascii): added linelen parameter.
696 * src/tabular.C (write_attribute[int,string,bool]): new functions.
697 (Write): use of the write_attribute functions.
699 * src/bufferlist.C (close): fixed reasking question!
701 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
703 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
704 new files use the everwhere possible.
707 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
708 src/log_form.C src/lyx.C:
711 * src/buffer.C (runLaTeX): remove func
713 * src/PaperLayout.C: removed file
714 * src/ParagraphExtra.C: likewise
715 * src/bullet_forms.C: likewise
716 * src/bullet_forms.h: likewise
717 * src/bullet_forms_cb.C: likewise
719 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
720 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
723 * several files: remove all traces of the old fd_form_paragraph,
724 and functions belonging to that.
726 * several files: remove all traces of the old fd_form_document,
727 and functions belonging to that.
729 * several files: constify local variables were possible.
731 * several files: remove all code that was dead when NEW_EXPORT was
734 * several files: removed string::c_str in as many places as
737 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
738 (e): be a bit more outspoken when patching
739 (updatesrc): only move files if changed.
741 * forms/layout_forms.h.patch: regenerated
743 * forms/layout_forms.fd: remove form_document and form_paragraph
744 and form_quotes and form_paper and form_table_options and
747 * forms/form1.fd: remove form_table
749 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
750 the fdui->... rewrite. Update some comments to xforms 0.88
752 * forms/bullet_forms.C.patch: removed file
753 * forms/bullet_forms.fd: likewise
754 * forms/bullet_forms.h.patch: likewise
756 * development/Code_rules/Rules: added a section on switch
757 statements. Updated some comment to xforms 0.88.
759 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
761 * src/buffer.C (readFile): make sure that the whole version number
762 is read after \lyxformat (even when it contains a comma)
764 * lib/ui/default.ui: change shortcut of math menu to M-a.
766 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
768 * src/vspace.C (nextToken): use isStrDbl() to check for proper
771 * src/LyXView.C (updateWindowTitle): show the full files name in
772 window title, limited to 30 characters.
774 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
775 When a number of characters has been given, we should not assume
776 that the string is 0-terminated.
778 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
779 calls (fixes some memory leaks)
781 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
782 trans member on exit.
784 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
786 * src/converter.C (GetReachable): fix typo.
788 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
789 understand ',' instead of '.'.
790 (GetInteger): rewrite to use strToInt().
792 2000-09-26 Juergen Vigna <jug@sad.it>
794 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
795 better visibility and error-message on wrong VSpace input.
797 * src/language.C (initL): added english again.
799 2000-09-25 Juergen Vigna <jug@sad.it>
801 * src/frontends/kde/Dialogs.C (Dialogs):
802 * src/frontends/gnome/Dialogs.C (Dialogs):
803 * src/frontends/kde/Makefile.am:
804 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
806 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
808 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
810 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
812 * src/frontends/xforms/FormParagraph.C:
813 * src/frontends/xforms/FormParagraph.h:
814 * src/frontends/xforms/form_paragraph.C:
815 * src/frontends/xforms/form_paragraph.h:
816 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
819 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
821 * src/tabular.C (OldFormatRead): forgot to delete the temporary
822 Paragraph-Data after use.
824 * src/insets/insettext.C (LocalDispatch): don't set the layout on
825 non breakable paragraphs.
827 2000-09-25 Garst R. Reese <reese@isn.net>
829 * src/language.C (initL): added missing language_country codes.
831 2000-09-25 Juergen Vigna <jug@sad.it>
833 * src/insets/insettext.C (InsetText):
834 (deleteLyXText): remove the not released LyXText structure!
836 2000-09-24 Marko Vendelin <markov@ioc.ee>
838 * src/frontends/gnome/mainapp.C
839 * src/frontends/gnome/mainapp.h: added support for keyboard
842 * src/frontends/gnome/FormCitation.C
843 * src/frontends/gnome/FormCitation.h
844 * src/frontends/gnome/Makefile.am
845 * src/frontends/gnome/pixbutton.h: completed the rewrite of
846 FormCitation to use "action area" in mainapp window
848 * src/frontends/gnome/Menubar_pimpl.C
849 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
852 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
854 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
855 width/descent/ascent values if name is empty.
856 (mathed_string_height): Use std::max.
858 2000-09-25 Allan Rae <rae@lyx.org>
860 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
861 segfault. This will be completely redesigned soon.
863 * sigc++: updated libsigc++. Fixes struct timespec bug.
865 * development/tools/makeLyXsigc.sh: .cvsignore addition
867 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
869 * several files: removed almost all traces of the old table
872 * src/TableLayout.C: removed file
874 2000-09-22 Juergen Vigna <jug@sad.it>
876 * src/frontends/kde/Dialogs.C: added credits forms.
878 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
880 * src/frontends/gnome/Dialogs.C: added some forms.
882 * src/spellchecker.C (init_spell_checker): set language in pspell code
883 (RunSpellChecker): some modifications for setting language string.
885 * src/language.[Ch]: added language_country code.
887 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
889 * src/frontends/Dialogs.h: added new signal showError.
890 Rearranged existing signals in some sort of alphabetical order.
892 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
893 FormError.[Ch], form_error.[Ch]
894 * src/frontends/xforms/forms/makefile: added new file form_error.fd
895 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
897 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
898 dialogs. I think that this can be used as the base to all these
901 * src/frontends/xforms/FormError.[Ch]
902 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
903 implementation of InsetError dialog.
905 * src/insets/inseterror.[Ch]: rendered GUI-independent.
907 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
908 * src/frontends/kde/Makefile.am: ditto
910 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
912 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
913 macrobf. This fixes a bug of invisible text.
915 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
917 * lib/doc/LaTeXConfig.lyx.in: updated.
919 * src/language.C (initL): remove language "francais" and change a
920 bit the names of the two other french variations.
922 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
923 string that may not be 0-terminated.
925 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
927 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
929 2000-09-20 Marko Vendelin <markov@ioc.ee>
931 * src/frontends/gnome/FormCitation.C
932 * src/frontends/gnome/FormIndex.C
933 * src/frontends/gnome/FormToc.C
934 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
935 the variable initialization to shut up the warnings
937 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
939 * src/table.[Ch]: deleted files
941 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
944 2000-09-18 Juergen Vigna <jug@sad.it>
946 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
947 problems with selection. Inserted new LFUN_PASTESELECTION.
948 (InsetButtonPress): inserted handling of middle mouse-button paste.
950 * src/spellchecker.C: changed word to word.c_str().
952 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
954 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
955 included in the ``make dist'' tarball.
957 2000-09-15 Juergen Vigna <jug@sad.it>
959 * src/CutAndPaste.C (cutSelection): small fix return the right
960 end position after cut inside one paragraph only.
962 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
963 we are locked as otherwise we don't have a valid cursor position!
965 * src/insets/figinset.C (draw): small bugfix but why is this needed???
967 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
969 * src/frontends/kde/FormRef.C: added using directive.
970 * src/frontends/kde/FormToc.C: ditto
972 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
974 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
976 2000-09-19 Marko Vendelin <markov@ioc.ee>
978 * src/frontends/gnome/Menubar_pimpl.C
979 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
980 Toc, ViewFormats, UpdateFormats, and ExportFormats.
982 * src/frontends/gnome/mainapp.C
983 * src/frontends/gnome/mainapp.h: support for menu update used
986 * src/frontends/gnome/mainapp.C
987 * src/frontends/gnome/mainapp.h: support for "action" area in the
988 main window. This area is used by small simple dialogs, such as
991 * src/frontends/gnome/FormIndex.C
992 * src/frontends/gnome/FormIndex.h
993 * src/frontends/gnome/FormUrl.C
994 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
997 * src/frontends/gnome/FormCitation.C
998 * src/frontends/gnome/FormCitation.h: rewrite to use main window
999 action area. Only "Insert new citation" is implemented.
1001 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1003 * src/buffer.C (Dispatch): fix call to Dispatch
1004 * src/insets/insetref.C (Edit): likewise
1005 * src/insets/insetparent.C (Edit): likewise
1006 * src/insets/insetinclude.C (include_cb): likewise
1007 * src/frontends/xforms/FormUrl.C (apply): likewise
1008 * src/frontends/xforms/FormToc.C (apply): likewise
1009 * src/frontends/xforms/FormRef.C (apply): likewise
1010 * src/frontends/xforms/FormIndex.C (apply): likewise
1011 * src/frontends/xforms/FormCitation.C (apply): likewise
1012 * src/lyxserver.C (callback): likewise
1013 * src/lyxfunc.C (processKeySym): likewise
1014 (Dispatch): likewise
1015 (Dispatch): likewise
1016 * src/lyx_cb.C (LayoutsCB): likewise
1018 * Makefile.am (sourcedoc): small change
1020 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1022 * src/main.C (main): Don't make an empty GUIRunTime object. all
1023 methods are static. constify a bit remove unneded using + headers.
1025 * src/tabular.C: some more const to local vars move some loop vars
1027 * src/spellchecker.C: added some c_str after some word for pspell
1029 * src/frontends/GUIRunTime.h: add new static method setDefaults
1030 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1031 * src/frontends/kde/GUIRunTime.C (setDefaults):
1032 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1034 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1035 with strnew in arg, use correct emptystring when calling SetName.
1037 * several files: remove all commented code with relation to
1038 HAVE_SSTREAM beeing false. We now only support stringstream and
1041 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1043 * src/lyxfunc.C: construct correctly the automatic new file
1046 * src/text2.C (IsStringInText): change type of variable i to shut
1049 * src/support/sstream.h: do not use namespaces if the compiler
1050 does not support them.
1052 2000-09-15 Marko Vendelin <markov@ioc.ee>
1053 * src/frontends/gnome/FormCitation.C
1054 * src/frontends/gnome/FormCitation.h
1055 * src/frontends/gnome/diainsertcitation_interface.c
1056 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1057 regexp support to FormCitation [Gnome].
1059 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1062 * configure.in: remove unused KDE/GTKGUI define
1064 * src/frontends/kde/FormRef.C
1065 * src/frontends/kde/FormRef.h
1066 * src/frontends/kde/formrefdialog.C
1067 * src/frontends/kde/formrefdialog.h: double click will
1068 go to reference, now it is possible to change a cross-ref
1071 * src/frontends/kde/FormToc.C
1072 * src/frontends/kde/FormToc.h
1073 * src/frontends/kde/formtocdialog.C
1074 * src/frontends/kde/formtocdialog.h: add a depth
1077 * src/frontends/kde/Makefile.am: add QtLyXView.h
1080 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1082 * src/frontends/kde/FormCitation.h: added some using directives.
1084 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1086 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1089 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1092 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1094 * src/buffer.C (pop_tag): revert for the second time a change by
1095 Lars, who seems to really hate having non-local loop variables :)
1097 * src/Lsstream.h: add "using" statements.
1099 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1100 * src/buffer.C (writeFile): ditto
1102 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1104 * src/buffer.C (writeFile): try to fix the locale modified format
1105 number to always be as we want it.
1107 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1108 in XForms 0.89. C-space is now working again.
1110 * src/Lsstream.h src/support/sstream.h: new files.
1112 * also commented out all cases where strstream were used.
1114 * src/Bullet.h (c_str): remove method.
1116 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1118 * a lot of files: get rid of "char const *" and "char *" is as
1119 many places as possible. We only want to use them in interaction
1120 with system of other libraries, not inside lyx.
1122 * a lot of files: return const object is not of pod type. This
1123 helps ensure that temporary objects is not modified. And fits well
1124 with "programming by contract".
1126 * configure.in: check for the locale header too
1128 * Makefile.am (sourcedoc): new tag for generation of doc++
1131 2000-09-14 Juergen Vigna <jug@sad.it>
1133 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1134 callback to check which combo called it and do the right action.
1136 * src/combox.C (combo_cb): added combo * to the callbacks.
1137 (Hide): moved call of callback after Ungrab of the pointer.
1139 * src/intl.h: removed LCombo2 function.
1141 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1142 function as this can now be handled in one function.
1144 * src/combox.h: added Combox * to callback prototype.
1146 * src/frontends/xforms/Toolbar_pimpl.C:
1147 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1149 2000-09-14 Garst Reese <reese@isn.net>
1151 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1152 moved usepackage{xxx}'s to beginning of file. Changed left margin
1153 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1154 underlining from title. Thanks to John Culleton for useful suggestions.
1156 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1158 * src/lyxlex_pimpl.C (setFile): change error message to debug
1161 2000-09-13 Juergen Vigna <jug@sad.it>
1163 * src/frontends/xforms/FormDocument.C: implemented choice_class
1164 as combox and give callback to combo_language so OK/Apply is activated
1167 * src/bufferlist.C (newFile): small fix so already named files
1168 (via an open call) are not requested to be named again on the
1171 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1173 * src/frontends/kde/Makefile.am
1174 * src/frontends/kde/FormRef.C
1175 * src/frontends/kde/FormRef.h
1176 * src/frontends/kde/formrefdialog.C
1177 * src/frontends/kde/formrefdialog.h: implement
1180 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1182 * src/frontends/kde/formtocdialog.C
1183 * src/frontends/kde/formtocdialog.h
1184 * src/frontends/kde/FormToc.C
1185 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1187 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1189 * src/frontends/kde/FormCitation.C: fix thinko
1190 where we didn't always display the reference text
1193 * src/frontends/kde/formurldialog.C
1194 * src/frontends/kde/formurldialog.h
1195 * src/frontends/kde/FormUrl.C
1196 * src/frontends/kde/FormUrl.h: minor cleanups
1198 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1200 * src/frontends/kde/Makefile.am
1201 * src/frontends/kde/FormToc.C
1202 * src/frontends/kde/FormToc.h
1203 * src/frontends/kde/FormCitation.C
1204 * src/frontends/kde/FormCitation.h
1205 * src/frontends/kde/FormIndex.C
1206 * src/frontends/kde/FormIndex.h
1207 * src/frontends/kde/formtocdialog.C
1208 * src/frontends/kde/formtocdialog.h
1209 * src/frontends/kde/formcitationdialog.C
1210 * src/frontends/kde/formcitationdialog.h
1211 * src/frontends/kde/formindexdialog.C
1212 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1214 2000-09-12 Juergen Vigna <jug@sad.it>
1216 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1219 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1221 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1224 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1226 * src/converter.C (Add, Convert): Added support for converter flags:
1227 needaux, resultdir, resultfile.
1228 (Convert): Added new parameter view_file.
1229 (dvips_options): Fixed letter paper option.
1231 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1232 (Export, GetExportableFormats, GetViewableFormats): Added support
1235 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1237 (easyParse): Fixed to work with new export code.
1239 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1242 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1244 * lib/bind/*.bind: Replaced
1245 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1246 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1248 2000-09-11 Juergen Vigna <jug@sad.it>
1250 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1252 * src/main.C (main): now GUII defines global guiruntime!
1254 * src/frontends/gnome/GUIRunTime.C (initApplication):
1255 * src/frontends/kde/GUIRunTime.C (initApplication):
1256 * src/frontends/xforms/GUIRunTime.C (initApplication):
1257 * src/frontends/GUIRunTime.h: added new function initApplication.
1259 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1261 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1263 2000-09-08 Juergen Vigna <jug@sad.it>
1265 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1266 we have already "Reset".
1268 * src/language.C (initL): inserted "default" language and made this
1269 THE default language (and not american!)
1271 * src/paragraph.C: inserted handling of "default" language!
1273 * src/lyxfont.C: ditto
1277 * src/paragraph.C: output the \\par only if we have a following
1278 paragraph otherwise it's not needed.
1280 2000-09-05 Juergen Vigna <jug@sad.it>
1282 * config/pspell.m4: added entry to lyx-flags
1284 * src/spellchecker.C: modified version from Kevin for using pspell
1286 2000-09-01 Marko Vendelin <markov@ioc.ee>
1287 * src/frontends/gnome/Makefile.am
1288 * src/frontends/gnome/FormCitation.C
1289 * src/frontends/gnome/FormCitation.h
1290 * src/frontends/gnome/diainsertcitation_callbacks.c
1291 * src/frontends/gnome/diainsertcitation_callbacks.h
1292 * src/frontends/gnome/diainsertcitation_interface.c
1293 * src/frontends/gnome/diainsertcitation_interface.h
1294 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1295 dialog for Gnome frontend
1297 * src/main.C: Gnome libraries require keeping application name
1298 and its version as strings
1300 * src/frontends/gnome/mainapp.C: Change the name of the main window
1301 from GnomeLyX to PACKAGE
1303 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1305 * src/frontends/Liason.C: add "using: declaration.
1307 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1309 * src/mathed/math_macro.C (Metrics): Set the size of the template
1311 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1313 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1315 * src/converter.C (add_options): New function.
1316 (SetViewer): Change $$FName into '$$FName'.
1317 (View): Add options when running xdvi
1318 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1319 (Convert): The 3rd parameter is now the desired filename. Converts
1320 calls to lyx::rename if necessary.
1321 Add options when running dvips.
1322 (dvi_papersize,dvips_options): New methods.
1324 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1326 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1327 using a call to Converter::dvips_options.
1328 Fixed to work with nex export code.
1330 * src/support/copy.C
1331 * src/support/rename.C: New files
1333 * src/support/syscall.h
1334 * src/support/syscall.C: Added Starttype SystemDontWait.
1336 * lib/ui/default.ui: Changed to work with new export code
1338 * lib/configure.m4: Changed to work with new export code
1340 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1342 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1344 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1345 so that code compiles with DEC cxx.
1347 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1348 to work correctly! Also now supports the additional elements
1351 2000-09-01 Allan Rae <rae@lyx.org>
1353 * src/frontends/ButtonPolicies.C: renamed all the references to
1354 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1356 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1357 since it's a const not a type.
1359 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1361 2000-08-31 Juergen Vigna <jug@sad.it>
1363 * src/insets/figinset.C: Various changes to look if the filename has
1364 an extension and if not add it for inline previewing.
1366 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1368 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1369 make buttonStatus and isReadOnly be const methods. (also reflect
1370 this in derived classes.)
1372 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1373 (nextState): change to be static inline, pass the StateMachine as
1375 (PreferencesPolicy): remove casts
1376 (OkCancelPolicy): remvoe casts
1377 (OkCancelReadOnlyPolicy): remove casts
1378 (NoRepeatedApplyReadOnlyPolicy): remove casts
1379 (OkApplyCancelReadOnlyPolicy): remove casts
1380 (OkApplyCancelPolicy): remove casts
1381 (NoRepeatedApplyPolicy): remove casts
1383 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1385 * src/converter.C: added some using directives
1387 * src/frontends/ButtonPolicies.C: changes to overcome
1388 "need lvalue" error with DEC c++
1390 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1391 to WMHideCB for DEC c++
1393 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1395 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1396 to BulletBMTableCB for DEC c++
1398 2000-08-31 Allan Rae <rae@lyx.org>
1400 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1401 character dialog separately from old document dialogs combo_language.
1404 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1406 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1407 Removed LFUN_REF_CREATE.
1409 * src/MenuBackend.C: Added new tags: toc and references
1411 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1412 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1414 (add_toc, add_references): New methods.
1415 (create_submenu): Handle correctly the case when there is a
1416 seperator after optional menu items.
1418 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1419 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1420 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1422 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1424 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1426 * src/converter.[Ch]: New file for converting between different
1429 * src/export.[Ch]: New file for exporting a LyX file to different
1432 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1433 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1434 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1435 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1436 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1437 RunDocBook, MenuExport.
1439 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1440 Exporter::Preview methods if NEW_EXPORT is defined.
1442 * src/buffer.C (Dispatch): Use Exporter::Export.
1444 * src/lyxrc.C: Added new tags: \converter and \viewer.
1447 * src/LyXAction.C: Define new lyx-function: buffer-update.
1448 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1449 when NEW_EXPORT is defined.
1451 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1453 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1455 * lib/ui/default.ui: Added submenus "view" and "update" to the
1458 * src/filetools.C (GetExtension): New function.
1460 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1462 2000-08-29 Allan Rae <rae@lyx.org>
1464 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1466 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1467 (EnableDocumentLayout): removed
1468 (DisableDocumentLayout): removed
1469 (build): make use of ButtonController's read-only handling to
1470 de/activate various objects. Replaces both of the above functions.
1472 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1473 (readOnly): was read_only
1474 (refresh): fixed dumb mistakes with read_only_ handling
1476 * src/frontends/xforms/forms/form_document.fd:
1477 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1478 tabbed dialogs so the tabs look more like tabs and so its easier to
1479 work out which is the current tab.
1481 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1482 segfault with form_table
1484 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1486 2000-08-28 Juergen Vigna <jug@sad.it>
1488 * acconfig.h: added USE_PSPELL.
1490 * src/config.h.in: added USE_PSPELL.
1492 * autogen.sh: added pspell.m4
1494 * config/pspell.m4: new file.
1496 * src/spellchecker.C: implemented support for pspell libary.
1498 2000-08-25 Juergen Vigna <jug@sad.it>
1500 * src/LyXAction.C (init): renamed LFUN_TABLE to
1501 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1503 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1505 * src/lyxscreen.h: add force_clear variable and fuction to force
1506 a clear area when redrawing in LyXText.
1508 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1510 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1512 * some whitespace and comment changes.
1514 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1516 * src/buffer.C: up te LYX_FORMAT to 2.17
1518 2000-08-23 Juergen Vigna <jug@sad.it>
1520 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1523 * src/insets/insettabular.C (pasteSelection): delete the insets
1524 LyXText as it is not valid anymore.
1525 (copySelection): new function.
1526 (pasteSelection): new function.
1527 (cutSelection): new function.
1528 (LocalDispatch): implemented cut/copy/paste of cell selections.
1530 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1531 don't have a LyXText.
1533 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1535 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1538 2000-08-22 Juergen Vigna <jug@sad.it>
1540 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1541 ifdef form_table out if NEW_TABULAR.
1543 2000-08-21 Juergen Vigna <jug@sad.it>
1545 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1546 (draw): fixed draw position so that the cursor is positioned in the
1548 (InsetMotionNotify): hide/show cursor so the position is updated.
1549 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1550 using cellstart() function where it should be used.
1552 * src/insets/insettext.C (draw): ditto.
1554 * src/tabular.C: fixed initialization of some missing variables and
1555 made BoxType into an enum.
1557 2000-08-22 Marko Vendelin <markov@ioc.ee>
1558 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1559 stock menu item using action numerical value, not its string
1563 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1565 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1566 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1568 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1570 * src/frontends/xforms/GUIRunTime.C: new file
1572 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1573 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1575 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1577 * src/frontends/kde/GUIRunTime.C: new file
1579 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1580 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1582 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1584 * src/frontends/gnome/GUIRunTime.C: new file
1586 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1589 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1590 small change to documetentation.
1592 * src/frontends/GUIRunTime.C: removed file
1594 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1596 * src/lyxparagraph.h: enable NEW_TABULAR as default
1598 * src/lyxfunc.C (processKeySym): remove some commented code
1600 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1601 NEW_TABULAR around the fd_form_table_options.
1603 * src/lyx_gui.C (runTime): call the static member function as
1604 GUIRunTime::runTime().
1606 2000-08-21 Allan Rae <rae@lyx.org>
1608 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1611 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1613 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1615 2000-08-21 Allan Rae <rae@lyx.org>
1617 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1618 keep Garst happy ;-)
1619 * src/frontends/xforms/FormPreferences.C (build): use setOK
1620 * src/frontends/xforms/FormDocument.C (build): use setOK
1621 (FormDocument): use the appropriate policy.
1623 2000-08-21 Allan Rae <rae@lyx.org>
1625 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1626 automatic [de]activation of arbitrary objects when in a read-only state.
1628 * src/frontends/ButtonPolicies.h: More documentation
1629 (isReadOnly): added to support the above.
1631 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1633 2000-08-18 Juergen Vigna <jug@sad.it>
1635 * src/insets/insettabular.C (getStatus): changed to return func_status.
1637 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1638 display toggle menu entries if they are.
1640 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1641 new document layout now.
1643 * src/lyxfunc.C: ditto
1645 * src/lyx_gui_misc.C: ditto
1647 * src/lyx_gui.C: ditto
1649 * lib/ui/default.ui: removed paper and quotes layout as they are now
1650 all in the document layout tabbed folder.
1652 * src/frontends/xforms/forms/form_document.fd: added Restore
1653 button and callbacks for all inputs for Allan's ButtonPolicy.
1655 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1656 (CheckChoiceClass): added missing params setting on class change.
1657 (UpdateLayoutDocument): added for updating the layout on params.
1658 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1659 (FormDocument): Implemented Allan's ButtonPolicy with the
1662 2000-08-17 Allan Rae <rae@lyx.org>
1664 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1665 so we can at least see the credits again.
1667 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1668 controller calls for the appropriate callbacks. Note that since Ok
1669 calls apply followed by cancel, and apply isn't a valid input for the
1670 APPLIED state, the bc_ calls have to be made in the static callback not
1671 within each of the real callbacks.
1673 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1674 (setOk): renamed from setOkay()
1676 2000-08-17 Juergen Vigna <jug@sad.it>
1678 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1679 in the implementation part.
1680 (composeUIInfo): don't show optional menu-items.
1682 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1684 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1686 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1687 text-state when in a text-inset.
1689 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1691 2000-08-17 Marko Vendelin <markov@ioc.ee>
1692 * src/frontends/gnome/FormIndex.C
1693 * src/frontends/gnome/FormIndex.h
1694 * src/frontends/gnome/FormToc.C
1695 * src/frontends/gnome/FormToc.h
1696 * src/frontends/gnome/dialogs
1697 * src/frontends/gnome/diatoc_callbacks.c
1698 * src/frontends/gnome/diatoc_callbacks.h
1699 * src/frontends/gnome/diainsertindex_callbacks.h
1700 * src/frontends/gnome/diainsertindex_callbacks.c
1701 * src/frontends/gnome/diainsertindex_interface.c
1702 * src/frontends/gnome/diainsertindex_interface.h
1703 * src/frontends/gnome/diatoc_interface.h
1704 * src/frontends/gnome/diatoc_interface.c
1705 * src/frontends/gnome/Makefile.am: Table of Contents and
1706 Insert Index dialogs implementation for Gnome frontend
1708 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1710 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1712 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1715 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1717 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1718 destructor. Don't definde if you don't need it
1719 (processEvents): made static, non-blocking events processing for
1721 (runTime): static method. event loop for xforms
1722 * similar as above for kde and gnome.
1724 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1725 new Pimpl is correct
1726 (runTime): new method calss the real frontends runtime func.
1728 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1730 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1732 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1734 2000-08-16 Juergen Vigna <jug@sad.it>
1736 * src/lyx_gui.C (runTime): added GUII RunTime support.
1738 * src/frontends/Makefile.am:
1739 * src/frontends/GUIRunTime.[Ch]:
1740 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1741 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1742 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1744 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1746 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1747 as this is already set in ${FRONTEND_INCLUDE} if needed.
1749 * configure.in (CPPFLAGS): setting the include dir for the frontend
1750 directory and don't set FRONTEND=xforms for now as this is executed
1753 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1755 * src/frontends/kde/Makefile.am:
1756 * src/frontends/kde/FormUrl.C:
1757 * src/frontends/kde/FormUrl.h:
1758 * src/frontends/kde/formurldialog.h:
1759 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1761 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1763 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1765 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1767 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1770 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1772 * src/WorkArea.C (work_area_handler): more work to get te
1773 FL_KEYBOARD to work with xforms 0.88 too, please test.
1775 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1777 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1779 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1782 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1784 * src/Timeout.h: remove Qt::emit hack.
1786 * several files: changes to allo doc++ compilation
1788 * src/lyxfunc.C (processKeySym): new method
1789 (processKeyEvent): comment out if FL_REVISION < 89
1791 * src/WorkArea.C: change some debugging levels.
1792 (WorkArea): set wantkey to FL_KEY_ALL
1793 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1794 clearer code and the use of compose with XForms 0.89. Change to
1795 use signals instead of calling methods in bufferview directly.
1797 * src/Painter.C: change some debugging levels.
1799 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1802 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1803 (workAreaKeyPress): new method
1805 2000-08-14 Juergen Vigna <jug@sad.it>
1807 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1809 * config/kde.m4: addes some features
1811 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1812 include missing xforms dialogs.
1814 * src/Timeout.h: a hack to be able to compile with qt/kde.
1816 * sigc++/.cvsignore: added acinclude.m4
1818 * lib/.cvsignore: added listerros
1820 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1821 xforms tree as objects are needed for other frontends.
1823 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1824 linking with not yet implemented xforms objects.
1826 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1828 2000-08-14 Baruch Even <baruch.even@writeme.com>
1830 * src/frontends/xforms/FormGraphics.h:
1831 * src/frontends/xforms/FormGraphics.C:
1832 * src/frontends/xforms/RadioButtonGroup.h:
1833 * src/frontends/xforms/RadioButtonGroup.C:
1834 * src/insets/insetgraphics.h:
1835 * src/insets/insetgraphics.C:
1836 * src/insets/insetgraphicsParams.h:
1837 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1838 instead of spaces, and various other indentation issues to make the
1839 sources more consistent.
1841 2000-08-14 Marko Vendelin <markov@ioc.ee>
1843 * src/frontends/gnome/dialogs/diaprint.glade
1844 * src/frontends/gnome/FormPrint.C
1845 * src/frontends/gnome/FormPrint.h
1846 * src/frontends/gnome/diaprint_callbacks.c
1847 * src/frontends/gnome/diaprint_callbacks.h
1848 * src/frontends/gnome/diaprint_interface.c
1849 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1852 * src/frontends/gnome/dialogs/diainserturl.glade
1853 * src/frontends/gnome/FormUrl.C
1854 * src/frontends/gnome/FormUrl.h
1855 * src/frontends/gnome/diainserturl_callbacks.c
1856 * src/frontends/gnome/diainserturl_callbacks.h
1857 * src/frontends/gnome/diainserturl_interface.c
1858 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1859 Gnome implementation
1861 * src/frontends/gnome/Dialogs.C
1862 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1863 all other dialogs. Copy all unimplemented dialogs from Xforms
1866 * src/frontends/gnome/support.c
1867 * src/frontends/gnome/support.h: support files generated by Glade
1871 * config/gnome.m4: Gnome configuration scripts
1873 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1874 configure --help message
1876 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1877 only if there are no events pendling in Gnome/Gtk. This enhances
1878 the performance of menus.
1881 2000-08-14 Allan Rae <rae@lyx.org>
1883 * lib/Makefile.am: listerrors cleaning
1885 * lib/listerrors: removed -- generated file
1886 * acinclude.m4: ditto
1887 * sigc++/acinclude.m4: ditto
1889 * src/frontends/xforms/forms/form_citation.fd:
1890 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1893 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1894 `updatesrc` and now we have a `test` target that does what `updatesrc`
1895 used to do. I didn't like having an install target that wasn't related
1898 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1899 on all except FormGraphics. This may yet happen. Followed by a major
1900 cleanup including using FL_TRANSIENT for most of the dialogs. More
1901 changes to come when the ButtonController below is introduced.
1903 * src/frontends/xforms/ButtonController.h: New file for managing up to
1904 four buttons on a dialog according to an externally defined policy.
1905 * src/frontends/xforms/Makefile.am: added above
1907 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1908 Apply and Cancel/Close buttons and everything in between and beyond.
1909 * src/frontends/Makefile.am: added above.
1911 * src/frontends/xforms/forms/form_preferences.fd:
1912 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1913 and removed variable 'status' as a result. Fixed the set_minsize thing.
1914 Use the new screen-font-update after checking screen fonts were changed
1915 Added a "Restore" button to restore the original lyxrc values while
1916 editing. This restores everything not just the last input changed.
1917 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1919 * src/LyXAction.C: screen-font-update added for updating buffers after
1920 screen font settings have been changed.
1921 * src/commandtags.h: ditto
1922 * src/lyxfunc.C: ditto
1924 * forms/lyx.fd: removed screen fonts dialog.
1925 * src/lyx_gui.C: ditto
1926 * src/menus.[Ch]: ditto
1927 * src/lyx.[Ch]: ditto
1928 * src/lyx_cb.C: ditto + code from here moved to make
1929 screen-font-update. And people wonder why progress on GUII is
1930 slow. Look at how scattered this stuff was! It takes forever
1933 * forms/fdfix.sh: Fixup the spacing after commas.
1934 * forms/makefile: Remove date from generated files. Fewer clashes now.
1935 * forms/bullet_forms.C.patch: included someones handwritten changes
1937 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1938 once I've discovered why LyXRC was made noncopyable.
1939 * src/lyx_main.C: ditto
1941 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1943 * src/frontends/xforms/forms/fdfix.sh:
1944 * src/frontends/xforms/forms/fdfixh.sed:
1945 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1946 * src/frontends/xforms/Form*.[hC]:
1947 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1948 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1949 provide a destructor for the struct FD_form_xxxx. Another version of
1950 the set_[max|min]size workaround and a few other cleanups. Actually,
1951 Angus' patch from 20000809.
1953 2000-08-13 Baruch Even <baruch.even@writeme.com>
1955 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1958 2000-08-11 Juergen Vigna <jug@sad.it>
1960 * src/insets/insetgraphics.C (InsetGraphics): changing init
1961 order because of warnings.
1963 * src/frontends/xforms/forms/makefile: adding patching .C with
1966 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1967 from .C.patch to .c.patch
1969 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1970 order because of warning.
1972 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1974 * src/frontends/Liason.C (setMinibuffer): new helper function
1976 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1978 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1980 * lib/ui/default.ui: commented out PaperLayout entry
1982 * src/frontends/xforms/form_document.[Ch]: new added files
1984 * src/frontends/xforms/FormDocument.[Ch]: ditto
1986 * src/frontends/xforms/forms/form_document.fd: ditto
1988 * src/frontends/xforms/forms/form_document.C.patch: ditto
1990 2000-08-10 Juergen Vigna <jug@sad.it>
1992 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1993 (InsetGraphics): initialized cacheHandle to 0.
1994 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1996 2000-08-10 Baruch Even <baruch.even@writeme.com>
1998 * src/graphics/GraphicsCache.h:
1999 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2000 correctly as a cache.
2002 * src/graphics/GraphicsCacheItem.h:
2003 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2006 * src/graphics/GraphicsCacheItem_pimpl.h:
2007 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2010 * src/insets/insetgraphics.h:
2011 * src/insets/insetgraphics.C: Changed from using a signal notification
2012 to polling when image is not loaded.
2014 2000-08-10 Allan Rae <rae@lyx.org>
2016 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2017 that there are two functions that have to been taken out of line by
2018 hand and aren't taken care of in the script. (Just a reminder note)
2020 * sigc++/macros/*.h.m4: Updated as above.
2022 2000-08-09 Juergen Vigna <jug@sad.it>
2024 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2026 * src/insets/insettabular.C: make drawing of single cell smarter.
2028 2000-08-09 Marko Vendelin <markov@ioc.ee>
2029 * src/frontends/gnome/Menubar_pimpl.C
2030 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2031 implementation: new files
2033 * src/frontends/gnome/mainapp.C
2034 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2037 * src/main.C: create Gnome main window
2039 * src/frontends/xforms/Menubar_pimpl.h
2040 * src/frontends/Menubar.C
2041 * src/frontends/Menubar.h: added method Menubar::update that calls
2042 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2044 * src/LyXView.C: calls Menubar::update to update the state
2047 * src/frontends/gnome/Makefile.am: added new files
2049 * src/frontends/Makefile.am: added frontend compiler options
2051 2000-08-08 Juergen Vigna <jug@sad.it>
2053 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2055 * src/bufferlist.C (close):
2056 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2057 documents if exiting without saving.
2059 * src/buffer.C (save): use removeAutosaveFile()
2061 * src/support/filetools.C (removeAutosaveFile): new function.
2063 * src/lyx_cb.C (MenuWrite): returns a bool now.
2064 (MenuWriteAs): check if file could really be saved and revert to the
2066 (MenuWriteAs): removing old autosavefile if existant.
2068 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2069 before Goto toggle declaration, because of compiler warning.
2071 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2073 * src/lyxfunc.C (MenuNew): small fix.
2075 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2077 * src/bufferlist.C (newFile):
2078 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2080 * src/lyxrc.C: added new_ask_filename tag
2082 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2084 * src/lyx.fd: removed code pertaining to form_ref
2085 * src/lyx.[Ch]: ditto
2086 * src/lyx_cb.C: ditto
2087 * src/lyx_gui.C: ditto
2088 * src/lyx_gui_misc.C: ditto
2090 * src/BufferView_pimpl.C (restorePosition): update buffer only
2093 * src/commandtags.h (LFUN_REFTOGGLE): removed
2094 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2095 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2096 (LFUN_REFBACK): renamed LFUN_REF_BACK
2098 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2099 * src/menus.C: ditto
2100 * src/lyxfunc.C (Dispatch): ditto.
2101 InsertRef dialog is now GUI-independent.
2103 * src/texrow.C: added using std::endl;
2105 * src/insets/insetref.[Ch]: strip out large amounts of code.
2106 The inset is now a container and this functionality is now
2107 managed by a new FormRef dialog
2109 * src/frontends/Dialogs.h (showRef, createRef): new signals
2111 * src/frontends/xforms/FormIndex.[Ch],
2112 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2113 when setting dialog's min/max size
2114 * src/frontends/xforms/FormIndex.[Ch]: ditto
2116 * src/frontends/xforms/FormRef.[Ch],
2117 src/frontends/xforms/forms/form_ref.fd: new xforms
2118 implementation of an InsetRef dialog
2120 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2123 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2124 ios::nocreate is not part of the standard. Removed.
2126 2000-08-07 Baruch Even <baruch.even@writeme.com>
2128 * src/graphics/Renderer.h:
2129 * src/graphics/Renderer.C: Added base class for rendering of different
2130 image formats into Pixmaps.
2132 * src/graphics/XPM_Renderer.h:
2133 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2134 in a different class.
2136 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2137 easily add support for other formats.
2139 * src/insets/figinset.C: plugged a leak of an X resource.
2141 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2143 * src/CutAndPaste.[Ch]: make all metods static.
2145 * development/Code_rules/Rules: more work, added section on
2146 Exceptions, and a References section.
2148 * a lot of header files: work to make doc++ able to generate the
2149 source documentation, some workarounds of doc++ problems. Doc++ is
2150 now able to generate the documentation.
2152 2000-08-07 Juergen Vigna <jug@sad.it>
2154 * src/insets/insettabular.C (recomputeTextInsets): removed function
2156 * src/tabular.C (SetWidthOfMulticolCell):
2158 (calculate_width_of_column_NMC): fixed return value so that it really
2159 only returns true if the column-width has changed (there where
2160 problems with muliticolumn-cells in this column).
2162 2000-08-04 Juergen Vigna <jug@sad.it>
2164 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2165 also on the scrollstatus of the inset.
2166 (workAreaMotionNotify): ditto.
2168 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2170 2000-08-01 Juergen Vigna <jug@sad.it>
2172 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2174 * src/commandtags.h:
2175 * src/LyXAction.C (init):
2176 * src/insets/inset.C (LocalDispatch): added support for
2179 * src/insets/inset.C (scroll): new functions.
2181 * src/insets/insettext.C (removeNewlines): new function.
2182 (SetAutoBreakRows): removes forced newlines in the text of the
2183 paragraph if autoBreakRows is set to false.
2185 * src/tabular.C (Latex): generates a parbox around the cell contents
2188 * src/frontends/xforms/FormTabular.C (local_update): removed
2189 the radio_useparbox button.
2191 * src/tabular.C (UseParbox): new function
2193 2000-08-06 Baruch Even <baruch.even@writeme.com>
2195 * src/graphics/GraphicsCache.h:
2196 * src/graphics/GraphicsCache.C:
2197 * src/graphics/GraphicsCacheItem.h:
2198 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2201 * src/insets/insetgraphics.h:
2202 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2203 drawing of the inline image.
2205 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2206 into the wrong position.
2208 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2211 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2213 * src/support/translator.h: move all typedefs to public section
2215 * src/support/filetools.C (MakeLatexName): return string const
2217 (TmpFileName): ditto
2218 (FileOpenSearch): ditto
2220 (LibFileSearch): ditto
2221 (i18nLibFileSearch): ditto
2224 (CreateTmpDir): ditto
2225 (CreateBufferTmpDir): ditto
2226 (CreateLyXTmpDir): ditto
2229 (MakeAbsPath): ditto
2231 (OnlyFilename): ditto
2233 (NormalizePath): ditto
2234 (CleanupPath): ditto
2235 (GetFileContents): ditto
2236 (ReplaceEnvironmentPath): ditto
2237 (MakeRelPath): ditto
2239 (ChangeExtension): ditto
2240 (MakeDisplayPath): ditto
2241 (do_popen): return cmdret const
2242 (findtexfile): return string const
2244 * src/support/DebugStream.h: add some /// to please doc++
2246 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2248 * src/texrow.C (same_rownumber): functor to use with find_if
2249 (getIdFromRow): rewritten to use find_if and to not update the
2250 positions. return true if row is found
2251 (increasePos): new method, use to update positions
2253 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2255 * src/lyxlex_pimpl.C (verifyTable): new method
2258 (GetString): return string const
2259 (pushTable): rewrite to use std::stack
2261 (setFile): better check
2264 * src/lyxlex.h: make LyXLex noncopyable
2266 * src/lyxlex.C (text): return char const * const
2267 (GetString): return string const
2268 (getLongString): return string const
2270 * src/lyx_gui_misc.C (askForText): return pair<...> const
2272 * src/lastfiles.[Ch] (operator): return string const
2274 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2275 istringstream not char const *.
2276 move token.end() out of loop.
2277 (readFile): move initializaton of token
2279 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2280 getIdFromRow is successful.
2282 * lib/bind/emacs.bind: don't include menus bind
2284 * development/Code_rules/Rules: the beginnings of making this
2285 better and covering more of the unwritten rules that we have.
2287 * development/Code_rules/Recommendations: a couple of wording
2290 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2292 * src/support/strerror.c: remove C++ comment.
2294 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2296 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2297 LFUN_INDEX_INSERT_LAST
2299 * src/texrow.C (getIdFromRow): changed from const_iterator to
2300 iterator, allowing code to compile with DEC cxx
2302 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2303 stores part of the class, as suggested by Allan. Will allow
2305 (apply): test to apply uses InsetCommandParams operator!=
2307 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2308 (apply): test to apply uses InsetCommandParams operator!=
2310 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2311 stores part of the class.
2312 (update): removed limits on min/max size.
2314 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2315 (apply): test to apply uses InsetCommandParams operator!=
2317 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2318 (Read, Write, scanCommand, getCommand): moved functionality
2319 into InsetCommandParams.
2321 (getScreenLabel): made pure virtual
2322 new InsetCommandParams operators== and !=
2324 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2325 c-tors based on InsetCommandParams. Removed others.
2326 * src/insets/insetinclude.[Ch]: ditto
2327 * src/insets/insetlabel.[Ch]: ditto
2328 * src/insets/insetparent.[Ch]: ditto
2329 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2331 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2332 insets derived from InsetCommand created using similar c-tors
2333 based on InsetCommandParams
2334 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2335 * src/menus.C (ShowRefsMenu): ditto
2336 * src/paragraph.C (Clone): ditto
2337 * src/text2.C (SetCounter): ditto
2338 * src/lyxfunc.C (Dispatch) ditto
2339 Also recreated old InsetIndex behaviour exactly. Can now
2340 index-insert at the start of a paragraph and index-insert-last
2341 without launching the pop-up.
2343 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2345 * lib/lyxrc.example: mark te pdf options as non functional.
2347 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2348 (isStrDbl): move tmpstr.end() out of loop.
2349 (strToDbl): move intialization of tmpstr
2350 (lowercase): return string const and move tmp.end() out of loop.
2351 (uppercase): return string const and move tmp.edn() out of loop.
2352 (prefixIs): add assertion
2357 (containsOnly): ditto
2358 (containsOnly): ditto
2359 (containsOnly): ditto
2360 (countChar): make last arg char not char const
2361 (token): return string const
2362 (subst): return string const, move tmp.end() out of loop.
2363 (subst): return string const, add assertion
2364 (strip): return string const
2365 (frontStrip): return string const, add assertion
2366 (frontStrip): return string const
2371 * src/support/lstrings.C: add inclde "LAssert.h"
2372 (isStrInt): move tmpstr.end() out of loop.
2374 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2375 toollist.end() out of loop.
2376 (deactivate): move toollist.end() out of loop.
2377 (update): move toollist.end() out of loop.
2378 (updateLayoutList): move tc.end() out of loop.
2379 (add): move toollist.end() out of loop.
2381 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2382 md.end() out of loop.
2384 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2386 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2389 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2390 (Erase): move insetlist.end() out of loop.
2392 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2393 ref to const string as first arg. Move initialization of some
2394 variables, whitespace changes.
2396 * src/kbmap.C (defkey): move table.end() out of loop.
2397 (kb_keymap): move table.end() out of loop.
2398 (findbinding): move table.end() out of loop.
2400 * src/MenuBackend.C (hasMenu): move end() out of loop.
2401 (getMenu): move end() out of loop.
2402 (getMenu): move menulist_.end() out of loop.
2404 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2406 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2409 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2410 (getFromLyXName): move infotab.end() out of loop.
2412 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2413 -fvtable-thunks -ffunction-sections -fdata-sections
2415 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2417 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2420 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2422 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2424 * src/frontends/xforms/FormCitation.[Ch],
2425 src/frontends/xforms/FormIndex.[Ch],
2426 src/frontends/xforms/FormToc.[Ch],
2427 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2429 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2431 * src/commandtags.h: renamed, created some flags for citation
2434 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2436 * src/lyxfunc.C (dispatch): use signals to insert index entry
2438 * src/frontends/Dialogs.h: new signal createIndex
2440 * src/frontends/xforms/FormCommand.[Ch],
2441 src/frontends/xforms/FormCitation.[Ch],
2442 src/frontends/xforms/FormToc.[Ch],
2443 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2445 * src/insets/insetindex.[Ch]: GUI-independent
2447 * src/frontends/xforms/FormIndex.[Ch],
2448 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2451 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2453 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2454 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2456 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2458 * src/insets/insetref.C (Latex): rewrite so that there is now
2459 question that a initialization is requested.
2461 * src/insets/insetcommand.h: reenable the hide signal
2463 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2465 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2466 fix handling of shortcuts (many bugs :)
2467 (add_lastfiles): ditto.
2469 * lib/ui/default.ui: fix a few shortcuts.
2471 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2473 * Makefile.am: Fix ``rpmdist'' target to return the exit
2474 status of the ``rpm'' command, instead of the last command in
2475 the chain (the ``rm lyx.xpm'' command, which always returns
2478 2000-08-02 Allan Rae <rae@lyx.org>
2480 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2481 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2482 * src/frontends/xforms/FormToc.C (FormToc): ditto
2484 * src/frontends/xforms/Makefile.am: A few forgotten files
2486 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2487 Signals-not-copyable-problem Lars' started commenting out.
2489 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2491 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2493 * src/insets/insetcommand.h: Signals is not copyable so anoter
2494 scheme for automatic hiding of forms must be used.
2496 * src/frontends/xforms/FormCitation.h: don't inerit from
2497 noncopyable, FormCommand already does that.
2498 * src/frontends/xforms/FormToc.h: ditto
2499 * src/frontends/xforms/FormUrl.h: ditto
2501 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2503 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2505 * src/insets/insetcommand.h (hide): new SigC::Signal0
2506 (d-tor) new virtual destructor emits hide signal
2508 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2509 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2511 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2512 LOF and LOT. Inset is now GUI-independent
2514 * src/insets/insetloa.[Ch]: redundant
2515 * src/insets/insetlof.[Ch]: ditto
2516 * src/insets/insetlot.[Ch]: ditto
2518 * src/frontends/xforms/forms/form_url.fd: tweaked!
2519 * src/frontends/xforms/forms/form_citation.fd: ditto
2521 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2522 dialogs dealing with InsetCommand insets
2524 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2525 FormCommand base class
2526 * src/frontends/xforms/FormUrl.[Ch]: ditto
2528 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2530 * src/frontends/xforms/FormToc.[Ch]: ditto
2532 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2533 passed a generic InsetCommand pointer
2534 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2536 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2537 and modified InsetTOC class
2538 * src/buffer.C: ditto
2540 * forms/lyx.fd: strip out old FD_form_toc code
2541 * src/lyx_gui_misc.C: ditto
2542 * src/lyx_gui.C: ditto
2543 * src/lyx_cb.C: ditto
2544 * src/lyx.[Ch]: ditto
2546 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2548 * src/support/utility.hpp: tr -d '\r'
2550 2000-08-01 Juergen Vigna <jug@sad.it>
2552 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2554 * src/commandtags.h:
2555 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2556 LFUN_TABULAR_FEATURES.
2558 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2559 LFUN_LAYOUT_TABULAR.
2561 * src/insets/insettabular.C (getStatus): implemented helper function.
2563 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2565 2000-07-31 Juergen Vigna <jug@sad.it>
2567 * src/text.C (draw): fixed screen update problem for text-insets.
2569 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2570 something changed probably this has to be added in various other
2573 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2575 2000-07-31 Baruch Even <baruch.even@writeme.com>
2577 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2578 templates to satisfy compaq cxx.
2581 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2583 * src/support/translator.h (equal_1st_in_pair::operator()): take
2584 const ref pair_type as arg.
2585 (equal_2nd_in_pair::operator()): ditto
2586 (Translator::~Translator): remove empty d-tor.
2588 * src/graphics/GraphicsCache.C: move include config.h to top, also
2589 put initialization of GraphicsCache::singleton here.
2590 (~GraphicsCache): move here
2591 (addFile): take const ref as arg
2594 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2596 * src/BufferView2.C (insertLyXFile): change te with/without header
2599 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2601 * src/frontends/xforms/FormGraphics.C (apply): add some
2602 static_cast. Not very nice, but required by compaq cxx.
2604 * src/frontends/xforms/RadioButtonGroup.h: include header
2605 <utility> instead of <pair.h>
2607 * src/insets/insetgraphicsParams.C: add using directive.
2608 (readResize): change return type to void.
2609 (readOrigin): ditto.
2611 * src/lyxfunc.C (getStatus): add missing break for build-program
2612 function; add test for Literate for export functions.
2614 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2615 entries in Options menu.
2617 2000-07-31 Baruch Even <baruch.even@writeme.com>
2619 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2620 protect against auto-allocation; release icon when needed.
2622 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2624 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2625 on usual typewriter.
2627 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2628 earlier czech.kmap), useful only for programming.
2630 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2632 * src/frontends/xforms/FormCitation.h: fix conditioning around
2635 2000-07-31 Juergen Vigna <jug@sad.it>
2637 * src/frontends/xforms/FormTabular.C (local_update): changed
2638 radio_linebreaks to radio_useparbox and added radio_useminipage.
2640 * src/tabular.C: made support for using minipages/parboxes.
2642 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2644 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2646 (descent): so the cursor is in the middle.
2647 (width): bit smaller box.
2649 * src/insets/insetgraphics.h: added display() function.
2651 2000-07-31 Baruch Even <baruch.even@writeme.com>
2653 * src/frontends/Dialogs.h: Added showGraphics signals.
2655 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2656 xforms form definition of the graphics dialog.
2658 * src/frontends/xforms/FormGraphics.h:
2659 * src/frontends/xforms/FormGraphics.C: Added files, the
2660 GUIndependent code of InsetGraphics
2662 * src/insets/insetgraphics.h:
2663 * src/insets/insetgraphics.C: Major writing to make it work.
2665 * src/insets/insetgraphicsParams.h:
2666 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2667 struct between InsetGraphics and GUI.
2669 * src/LaTeXFeatures.h:
2670 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2671 support for graphicx package.
2673 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2674 for the graphics inset.
2676 * src/support/translator.h: Added file, used in
2677 InsetGraphicsParams. this is a template to translate between two
2680 * src/frontends/xforms/RadioButtonGroup.h:
2681 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2682 way to easily control a radio button group.
2684 2000-07-28 Juergen Vigna <jug@sad.it>
2686 * src/insets/insettabular.C (LocalDispatch):
2687 (TabularFeatures): added support for lyx-functions of tabular features.
2688 (cellstart): refixed this function after someone wrongly changed it.
2690 * src/commandtags.h:
2691 * src/LyXAction.C (init): added support for tabular-features
2693 2000-07-28 Allan Rae <rae@lyx.org>
2695 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2696 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2697 triggers the callback for input checking. As a result we sometimes get
2698 "LyX: This shouldn't happen..." printed to cerr.
2699 (input): Started using status variable since I only free() on
2700 destruction. Some input checking for paths and font sizes.
2702 * src/frontends/xforms/FormPreferences.h: Use status to control
2703 activation of Ok and Apply
2705 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2706 callback. Also resized to stop segfaults with 0.88. The problem is
2707 that xforms-0.88 requires the folder to be wide enough to fit all the
2708 tabs. If it isn't it causes all sorts of problems.
2710 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2712 * src/frontends/xforms/forms/README: Reflect reality.
2714 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2715 * src/frontends/xforms/forms/makefile: ditto.
2717 * src/commandtags.h: Get access to new Preferences dialog
2718 * src/LyXAction.C: ditto
2719 * src/lyxfunc.C: ditto
2720 * lib/ui/default.ui: ditto
2722 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2724 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2726 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2729 * src/frontends/xforms/form_url.[Ch]: added.
2731 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2733 * src/insets/insetbib.h: fixed bug in previous commit
2735 * src/frontends/xforms/FormUrl.h: ditto
2737 * src/frontends/xforms/FormPrint.h: ditto
2739 * src/frontends/xforms/FormPreferences.h: ditto
2741 * src/frontends/xforms/FormCopyright.h: ditto
2743 * src/frontends/xforms/FormCitation.C: ditto
2745 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2746 private copyconstructor and private default contructor
2748 * src/support/Makefile.am: add utility.hpp
2750 * src/support/utility.hpp: new file from boost
2752 * src/insets/insetbib.h: set owner in clone
2754 * src/frontends/xforms/FormCitation.C: added missing include
2757 * src/insets/form_url.[Ch]: removed
2759 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2761 * development/lyx.spec.in
2762 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2763 file/directory re-organization.
2765 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2767 * src/insets/insetcommand.[Ch]: moved the string data and
2768 associated manipulation methods into a new stand-alone class
2769 InsetCommandParams. This class has two additional methods
2770 getAsString() and setFromString() allowing the contents to be
2771 moved around as a single string.
2772 (addContents) method removed.
2773 (setContents) method no longer virtual.
2775 * src/buffer.C (readInset): made use of new InsetCitation,
2776 InsetUrl constructors based on InsetCommandParams.
2778 * src/commandtags.h: add LFUN_INSERT_URL
2780 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2781 independent InsetUrl and use InsetCommandParams to extract
2782 string info and create new Insets.
2784 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2786 * src/frontends/xforms/FormCitation.C (apply): uses
2789 * src/frontends/xforms/form_url.C
2790 * src/frontends/xforms/form_url.h
2791 * src/frontends/xforms/FormUrl.h
2792 * src/frontends/xforms/FormUrl.C
2793 * src/frontends/xforms/forms/form_url.fd: new files
2795 * src/insets/insetcite.[Ch]: removed unused constructors.
2797 * src/insets/insetinclude.[Ch]: no longer store filename
2799 * src/insets/inseturl.[Ch]: GUI-independent.
2801 2000-07-26 Juergen Vigna <jug@sad.it>
2802 * renamed frontend from gtk to gnome as it is that what is realized
2803 and did the necessary changes in the files.
2805 2000-07-26 Marko Vendelin <markov@ioc.ee>
2807 * configure.in: cleaning up gnome configuration scripts
2809 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2811 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2812 shortcuts syndrom by redrawing them explicitely (a better solution
2813 would be appreciated).
2815 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2817 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2820 * src/lyx_cb.C (MenuExport): change html export to do the right
2821 thing depending of the document type (instead of having
2822 html-linuxdoc and html-docbook).
2823 * src/lyxfunc.C (getStatus): update for html
2824 * lib/ui/default.ui: simplify due to the above change.
2825 * src/menus.C (ShowFileMenu): update too (in case we need it).
2827 * src/MenuBackend.C (read): if a menu is defined twice, add the
2828 new entries to the exiting one.
2830 2000-07-26 Juergen Vigna <jug@sad.it>
2832 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2834 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2835 and return a bool if it did actual save the file.
2836 (AutoSave): don't autosave a unnamed doc.
2838 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2839 check if this is an UNNAMED new file and react to it.
2840 (newFile): set buffer to unnamed and change to not mark a new
2841 buffer dirty if I didn't do anything with it.
2843 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2845 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2847 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2848 friend as per Angus's patch posted to lyx-devel.
2850 * src/ext_l10n.h: updated
2852 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2853 gettext on the style string right before inserting them into the
2856 * autogen.sh: add code to extract style strings form layout files,
2857 not good enough yet.
2859 * src/frontends/gtk/.cvsignore: add MAKEFILE
2861 * src/MenuBackend.C (read): run the label strings through gettext
2862 before storing them in the containers.
2864 * src/ext_l10n.h: new file
2866 * autogen.sh : generate the ext_l10n.h file here
2868 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2870 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2873 * lib/ui/default.ui: fix a couple of typos.
2875 * config/gnome/gtk.m4: added (and added to the list of files in
2878 * src/insets/insetinclude.C (unique_id): fix when we are using
2879 lyxstring instead of basic_string<>.
2880 * src/insets/insettext.C (LocalDispatch): ditto.
2881 * src/support/filetools.C: ditto.
2883 * lib/configure.m4: create the ui/ directory if necessary.
2885 * src/LyXView.[Ch] (updateToolbar): new method.
2887 * src/BufferView_pimpl.C (buffer): update the toolbar when
2888 opening/closing buffer.
2890 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2892 * src/LyXAction.C (getActionName): enhance to return also the name
2893 and options of pseudo-actions.
2894 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2896 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2897 as an example of what is possible). Used in File->Build too (more
2898 useful) and in the import/export menus (to mimick the complicated
2899 handling of linuxdoc and friends). Try to update all the entries.
2901 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2904 * src/MenuBackend.C (read): Parse the new OptItem tag.
2906 * src/MenuBackend.h: Add a new optional_ data member (used if the
2907 entry should be omitted when the lyxfunc is disabled).
2909 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2910 function, used as a shortcut.
2911 (create_submenu): align correctly the shortcuts on the widest
2914 * src/MenuBackend.h: MenuItem.label() only returns the label of
2915 the menu without shortcut; new method shortcut().
2917 2000-07-14 Marko Vendelin <markov@ioc.ee>
2919 * src/frontends/gtk/Dialogs.C:
2920 * src/frontends/gtk/FormCopyright.C:
2921 * src/frontends/gtk/FormCopyright.h:
2922 * src/frontends/gtk/Makefile.am: added these source-files for the
2923 Gtk/Gnome support of the Copyright-Dialog.
2925 * src/main.C: added Gnome::Main initialization if using
2926 Gtk/Gnome frontend-GUI.
2928 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2930 * config/gnome/aclocal-include.m4
2931 * config/gnome/compiler-flags.m4
2932 * config/gnome/curses.m4
2933 * config/gnome/gnome--.m4
2934 * config/gnome/gnome-bonobo-check.m4
2935 * config/gnome/gnome-common.m4
2936 * config/gnome/gnome-fileutils.m4
2937 * config/gnome/gnome-ghttp-check.m4
2938 * config/gnome/gnome-gnorba-check.m4
2939 * config/gnome/gnome-guile-checks.m4
2940 * config/gnome/gnome-libgtop-check.m4
2941 * config/gnome/gnome-objc-checks.m4
2942 * config/gnome/gnome-orbit-check.m4
2943 * config/gnome/gnome-print-check.m4
2944 * config/gnome/gnome-pthread-check.m4
2945 * config/gnome/gnome-support.m4
2946 * config/gnome/gnome-undelfs.m4
2947 * config/gnome/gnome-vfs.m4
2948 * config/gnome/gnome-x-checks.m4
2949 * config/gnome/gnome-xml-check.m4
2950 * config/gnome/gnome.m4
2951 * config/gnome/gperf-check.m4
2952 * config/gnome/gtk--.m4
2953 * config/gnome/linger.m4
2954 * config/gnome/need-declaration.m4: added configuration scripts
2955 for Gtk/Gnome frontend-GUI
2957 * configure.in: added support for the --with-frontend=gtk option
2959 * autogen.sh: added config/gnome/* to list of config-files
2961 * acconfig.h: added define for GTKGUI-support
2963 * config/lyxinclude.m4: added --with-frontend[=value] option value
2964 for Gtk/Gnome frontend-GUI support.
2966 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2968 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2972 * src/paragraph.C (GetChar): remove non-const version
2974 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2975 (search_kw): use it.
2977 * src/lyx_main.C (init): if "preferences" exist, read that instead
2979 (ReadRcFile): return bool if the file could be read ok.
2980 (ReadUIFile): add a check to see if lex file is set ok.
2982 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2983 bastring can be used instead of lyxstring (still uses the old code
2984 if std::string is good enough or if lyxstring is used.)
2986 * src/encoding.C: make the arrays static, move ininle functions
2988 * src/encoding.h: from here.
2990 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2991 (parseSingleLyXformat2Token): move inset parsing to separate method
2992 (readInset): new private method
2994 * src/Variables.h: remove virtual from get().
2996 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2997 access to NEW_INSETS and NEW_TABULAR
2999 * src/MenuBackend.h: remove superfluous forward declaration of
3000 MenuItem. Add documentations tags "///", remove empty MenuItem
3001 destructor, remove private default contructor.
3003 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3005 (read): more string mlabel and mname to where they are used
3006 (read): remove unused variables mlabel and mname
3007 (defaults): unconditional clear, make menusetup take advantage of
3008 add returning Menu &.
3010 * src/LyXView.h: define NEW_MENUBAR as default
3012 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3013 to NEW_INSETS and NEW_TABULAR.
3014 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3015 defined. Change some of the "xxxx-inset-insert" functions names to
3018 * several files: more enahncements to NEW_INSETS and the resulting
3021 * lib/lyxrc.example (\date_insert_format): move to misc section
3023 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3024 bastring and use AC_CACHE_CHECK.
3025 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3026 the system have the newest methods. uses AC_CACHE_CHECK
3027 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3028 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3029 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3031 * configure.in: add LYX_CXX_GOOD_STD_STRING
3033 * acinclude.m4: recreated
3035 2000-07-24 Amir Karger
3037 * README: add Hebrew, Arabic kmaps
3040 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3042 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3045 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3047 * Lot of files: add pragma interface/implementation.
3049 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3051 * lib/ui/default.ui: new file (ans new directory). Contains the
3052 default menu and toolbar.
3054 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3055 global space. Toolbars are now read (as menus) in ui files.
3057 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3059 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3060 is disabled because the document is read-only. We want to have the
3061 toggle state of the function anyway.
3062 (getStatus): add code for LFUN_VC* functions (mimicking what is
3063 done in old-style menus)
3065 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3066 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3068 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3069 * src/BufferView_pimpl.C: ditto.
3070 * src/lyxfunc.C: ditto.
3072 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3073 default). This replaces old-style menus by new ones.
3075 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3076 MenuItem. Contain the data structure of a menu.
3078 * src/insets/insettext.C: use LyXView::setLayout instead of
3079 accessing directly the toolbar combox.
3080 * src/lyxfunc.C (Dispatch): ditto.
3082 * src/LyXView.C (setLayout): new method, which just calls
3083 Toolbar::setLayout().
3084 (updateLayoutChoice): move part of this method in Toolbar.
3086 * src/toolbar.[Ch]: removed.
3088 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3089 implementation the toolbar.
3091 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3092 the toolbar. It might make sense to merge it with ToolbarDefaults
3094 (setLayout): new function.
3095 (updateLayoutList): ditto.
3096 (openLayoutList): ditto.
3098 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3099 xforms implementation of the toolbar.
3100 (get_toolbar_func): comment out, since I do not
3101 know what it is good for.
3103 * src/ToolbarDefaults.h: Add the ItemType enum.
3105 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3106 for a list of allocated C strings. Used in Menubar xforms
3107 implementation to avoid memory leaks.
3109 * src/support/lstrings.[Ch] (uppercase): new version taking and
3113 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3114 * lib/bind/emacs.bind: ditto.
3116 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3118 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3119 forward decl of LyXView.
3121 * src/toolbar.C (toolbarItem): moved from toolbar.h
3122 (toolbarItem::clean): ditto
3123 (toolbarItem::~toolbarItem): ditto
3124 (toolbarItem::operator): ditto
3126 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3128 * src/paragraph.h: control the NEW_TABULAR define from here
3130 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3131 USE_TABULAR_INSETS to NEW_TABULAR
3133 * src/ToolbarDefaults.C: add include "lyxlex.h"
3135 * files using the old table/tabular: use NEW_TABULAR to control
3136 compilation of old tabular stuff.
3138 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3141 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3142 planemet in reading of old style floats, fix the \end_deeper
3143 problem when reading old style floats.
3145 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3147 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3149 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3151 * lib/bind/sciword.bind: updated.
3153 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3155 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3156 layout write problem
3158 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3160 * src/Makefile.am (INCLUDES): remove image directory from include
3163 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3164 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3166 * src/LyXView.C (create_form_form_main): read the application icon
3169 * lib/images/*.xpm: change the icons to use transparent color for
3172 * src/toolbar.C (update): change the color of the button when it
3175 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3177 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3178 setting explicitely the minibuffer.
3179 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3181 * src/LyXView.C (showState): new function. Shows font information
3182 in minibuffer and update toolbar state.
3183 (LyXView): call Toolbar::update after creating the
3186 * src/toolbar.C: change toollist to be a vector instead of a
3188 (BubbleTimerCB): get help string directly from the callback
3189 argument of the corresponding icon (which is the action)
3190 (set): remove unnecessary ugliness.
3191 (update): new function. update the icons (depressed, disabled)
3192 depending of the status of the corresponding action.
3194 * src/toolbar.h: remove help in toolbarItem
3196 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3198 * src/Painter.C (text): Added code for using symbol glyphs from
3199 iso10646 fonts. Currently diabled.
3201 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3204 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3205 magyar,turkish and usorbian.
3207 * src/paragraph.C (isMultiLingual): Made more efficient.
3209 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3212 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3213 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3214 Also changed the prototype to "bool math_insert_greek(char)".
3216 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3218 * lots of files: apply the NEW_INSETS on all code that will not be
3219 needed when we move to use the new insets. Enable the define in
3220 lyxparagrah.h to try it.
3222 * src/insets/insettabular.C (cellstart): change to be a static
3224 (InsetTabular): initialize buffer in the initializer list.
3226 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3228 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3229 form_print.h out of the header file. Replaced with forward
3230 declarations of the relevant struct.
3232 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3235 * src/commandtags.h: do not include "debug.h" which does not
3236 belong there. #include it in some other places because of this
3239 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3241 * src/insets/insetcaption.C: add a couple "using" directives.
3243 * src/toolbar.C (add): get the help text directly from lyxaction.
3245 (setPixmap): new function. Loads from disk and sets a pixmap on a
3246 botton; the name of the pixmap file is derived from the command
3249 * src/toolbar.h: remove members isBitmap and pixmap from
3252 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3253 * lib/images/: move many files from images/banner.xpm.
3255 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3257 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3258 * src/toolbar.C: ditto.
3259 * configure.in: ditto.
3260 * INSTALL: document.
3262 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3263 the spellchecker popup is closed from the WM.
3265 2000-07-19 Juergen Vigna <jug@sad.it>
3267 * src/insets/insetfloat.C (Write): small fix because we use the
3268 insetname for the type now!
3270 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3272 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3275 * src/frontends/Dialogs.h: removed hideCitation signal
3277 * src/insets/insetcite.h: added hide signal
3279 * src/insets/insetcite.C (~InsetCitation): emits new signal
3280 (getScreenLabel): "intelligent" label should now fit on the screen!
3282 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3284 * src/frontends/xforms/FormCitation.C (showInset): connects
3285 hide() to the inset's hide signal
3286 (show): modified to use fl_set_object_position rather than
3287 fl_set_object_geometry wherever possible
3289 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3291 * src/insets/lyxinset.h: add caption code
3293 * src/insets/insetfloat.C (type): new method
3295 * src/insets/insetcaption.C (Write): new method
3297 (LyxCode): new method
3299 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3300 to get it right together with using the FloatList.
3302 * src/commandtags.h: add LFUN_INSET_CAPTION
3303 * src/lyxfunc.C (Dispatch): handle it
3305 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3308 * src/Variables.[Ch]: make expand take a const reference, remove
3309 the destructor, some whitespace changes.
3311 * src/LyXAction.C (init): add caption-inset-insert
3313 * src/FloatList.C (FloatList): update the default floats a bit.
3315 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3317 * src/Variables.[Ch]: new files. Intended to be used for language
3318 specific strings (like \chaptername) and filename substitution in
3321 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3323 * lib/kbd/american.kmap: update
3325 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3327 * src/bufferparams.[Ch]: remove member allowAccents.
3329 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3331 * src/LaTeXLog.C: use the log_form.h header.
3332 * src/lyx_gui.C: ditto.
3333 * src/lyx_gui_misc.C: ditto.
3334 * src/lyxvc.h: ditto.
3336 * forms/log_form.fd: new file, created from latexoptions.fd. I
3337 kept the log popup and nuked the options form.
3339 * src/{la,}texoptions.[Ch]: removed.
3340 * src/lyx_cb.C (LaTeXOptions): ditto
3342 * src/lyx_gui.C (create_forms): do not handle the
3343 fd_latex_options form.
3345 2000-07-18 Juergen Vigna <jug@sad.it>
3347 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3348 name of the inset so that it can be requested outside (text2.C).
3350 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3353 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3355 * src/mathed/formula.h (ConvertFont): constify
3357 * src/mathed/formula.C (Read): add warning if \end_inset is not
3358 found on expected place.
3360 * src/insets/lyxinset.h (ConvertFont): consify
3362 * src/insets/insetquotes.C (ConvertFont): constify
3363 * src/insets/insetquotes.h: ditto
3365 * src/insets/insetinfo.h: add labelfont
3367 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3368 (ascent): use labelfont
3372 (Write): make .lyx file a bit nicer
3374 * src/insets/insetfloat.C (Write): simplify somewhat...
3375 (Read): add warning if arg is not found
3377 * src/insets/insetcollapsable.C: add using std::max
3378 (Read): move string token and add warning in arg is not found
3379 (draw): use std::max to get the right ty
3380 (getMaxWidth): simplify by using std::max
3382 * src/insets/insetsection.h: new file
3383 * src/insets/insetsection.C: new file
3384 * src/insets/insetcaption.h: new file
3385 * src/insets/insetcaption.C: new file
3387 * src/insets/inset.C (ConvertFont): constify signature
3389 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3390 insetcaption.[Ch] and insetsection.[Ch]
3392 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3393 uses to use LABEL_COUNTER_CHAPTER instead.
3394 * src/text2.C (SetCounter): here
3396 * src/counters.h: new file
3397 * src/counters.C: new file
3398 * src/Sectioning.h: new file
3399 * src/Sectioning.C: new file
3401 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3403 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3405 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3408 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3411 2000-07-17 Juergen Vigna <jug@sad.it>
3413 * src/tabular.C (Validate): check if array-package is needed.
3414 (SetVAlignment): added support for vertical alignment.
3415 (SetLTFoot): better support for longtable header/footers
3416 (Latex): modified to support added features.
3418 * src/LaTeXFeatures.[Ch]: added array-package.
3420 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3422 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3425 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3427 * configure.in: do not forget to put a space after -isystem.
3429 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3431 * lib/kbd/arabic.kmap: a few fixes.
3433 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3435 * some whitespace chagnes to a number of files.
3437 * src/support/DebugStream.h: change to make it easier for
3438 doc++ to parse correctly.
3439 * src/support/lyxstring.h: ditto
3441 * src/mathed/math_utils.C (compara): change to have only one
3443 (MathedLookupBOP): change because of the above.
3445 * src/mathed/math_delim.C (math_deco_compare): change to have only
3447 (search_deco): change becasue of the above.
3449 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3450 instead of manually coded one.
3452 * src/insets/insetquotes.C (Read): read the \end_inset too
3454 * src/insets/insetlatex.h: remove file
3455 * src/insets/insetlatex.C: remove file
3457 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3459 (InsetPrintIndex): remove destructor
3461 * src/insets/insetinclude.h: remove default constructor
3463 * src/insets/insetfloat.C: work to make it work better
3465 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3467 * src/insets/insetcite.h (InsetCitation): remove default constructor
3469 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3471 * src/text.C (GetColumnNearX): comment out some currently unused code.
3473 * src/paragraph.C (writeFile): move some initializations closer to
3475 (CutIntoMinibuffer): small change to use new matchIT operator
3479 (InsertInset): ditto
3482 (InsetIterator): ditto
3483 (Erase): small change to use new matchFT operator
3485 (GetFontSettings): ditto
3486 (HighestFontInRange): ditto
3489 * src/lyxparagraph.h: some chars changed to value_type
3490 (matchIT): because of some stronger checking (perhaps too strong)
3491 in SGI STL, the two operator() unified to one.
3494 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3496 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3497 the last inset read added
3498 (parseSingleLyXformat2Token): some more (future) compability code added
3499 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3500 (parseSingleLyXformat2Token): set last_inset_read
3501 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3502 (parseSingleLyXformat2Token): don't double intializw string next_token
3504 * src/TextCache.C (text_fits::operator()): add const's to the signature
3505 (has_buffer::operator()): ditto
3507 * src/Floating.h: add some comments on the class
3509 * src/FloatList.[Ch] (typeExist): new method
3512 * src/BackStack.h: added default constructor, wanted by Gcc.
3514 2000-07-14 Juergen Vigna <jug@sad.it>
3516 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3518 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3520 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3521 do a redraw when the window is resized!
3522 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3524 * src/insets/insettext.C (resizeLyXText): added function to correctly
3525 being able to resize the LyXWindow.
3527 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3529 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3531 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3532 crashes when closing dialog to a deleted inset.
3534 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3535 method! Now similar to other insets.
3537 2000-07-13 Juergen Vigna <jug@sad.it>
3539 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3541 * lib/examples/Literate.lyx: small patch!
3543 * src/insets/insetbib.C (Read): added this function because of wrong
3544 Write (without [begin|end]_inset).
3546 2000-07-11 Juergen Vigna <jug@sad.it>
3548 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3549 as the insertInset could not be good!
3551 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3552 the bool param should not be last.
3554 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3556 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3557 did submit that to Karl).
3559 * configure.in: use -isystem instead of -I for X headers. This
3560 fixes a problem on solaris with a recent gcc;
3561 put the front-end code after the X detection code;
3562 configure in sigc++ before lib/
3564 * src/lyx_main.C (commandLineHelp): remove -display from command
3567 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3569 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3570 Also put in Makefile rules for building the ``listerrors''
3571 program for parsing errors from literate programs written in LyX.
3573 * lib/build-listerrors: Added small shell script as part of compile
3574 process. This builds a working ``listerrors'' binary if noweb is
3575 installed and either 1) the VNC X server is installed on the machine,
3576 or 2) the user is compiling from within a GUI. The existence of a GUI
3577 is necessary to use the ``lyx --export'' feature for now. This
3578 hack can be removed once ``lyx --export'' no longer requires a GUI to
3581 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3583 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3584 now passed back correctly from gcc and placed "under" error
3585 buttons in a Literate LyX source.
3587 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3589 * src/text.C (GetColumnNearX): Better behavior when a RTL
3590 paragraph is ended by LTR text.
3592 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3595 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3597 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3598 true when clipboard is empty.
3600 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3602 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3603 row of the paragraph.
3604 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3605 to prevent calculation of bidi tables
3607 2000-07-07 Juergen Vigna <jug@sad.it>
3609 * src/screen.C (ToggleSelection): added y_offset and x_offset
3612 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3615 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3617 * src/insets/insettext.C: fixed Layout-Display!
3619 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3621 * configure.in: add check for strings.h header.
3623 * src/spellchecker.C: include <strings.h> in order to have a
3624 definition for bzero().
3626 2000-07-07 Juergen Vigna <jug@sad.it>
3628 * src/insets/insettext.C (draw): set the status of the bv->text to
3629 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3631 * src/screen.C (DrawOneRow):
3632 (DrawFromTo): redraw the actual row if something has changed in it
3635 * src/text.C (draw): call an update of the toplevel-inset if something
3636 has changed inside while drawing.
3638 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3640 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3642 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3643 processing inside class.
3645 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3646 processing inside class.
3648 * src/insets/insetindex.h new struct Holder, consistent with other
3651 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3652 citation dialog from main code and placed it in src/frontends/xforms.
3653 Dialog launched through signals instead of callbacks
3655 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3657 * lyx.man: update the options description.
3659 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3661 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3662 handle neg values, set min width to 590, add doc about -display
3664 2000-07-05 Juergen Vigna <jug@sad.it>
3666 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3667 calls to BufferView *.
3669 * src/insets/insettext.C (checkAndActivateInset): small fix non
3670 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3672 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3673 their \end_inset token!
3675 2000-07-04 edscott <edscott@imp.mx>
3677 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3678 lib/lyxrc.example: added option \wheel_jump
3680 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3682 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3683 remove support for -width,-height,-xpos and -ypos.
3685 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3687 * src/encoding.[Ch]: New files.
3689 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3690 (text): Call to the underline() method only when needed.
3692 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3694 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3695 encoding(s) for the document.
3697 * src/bufferparams.C (BufferParams): Changed default value of
3700 * src/language.C (newLang): Removed.
3701 (items[]): Added encoding information for all defined languages.
3703 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3704 encoding choice button.
3706 * src/lyxrc.h (font_norm_type): New member variable.
3707 (set_font_norm_type): New method.
3709 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3710 paragraphs with different encodings.
3712 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3713 (TransformChar): Changed to work correctly with Arabic points.
3714 (draw): Added support for drawing Arabic points.
3715 (draw): Removed code for drawing underbars (this is done by
3718 * src/support/textutils.h (IsPrintableNonspace): New function.
3720 * src/BufferView_pimpl.h: Added "using SigC::Object".
3721 * src/LyXView.h: ditto.
3723 * src/insets/insetinclude.h (include_label): Changed to mutable.
3725 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3727 * src/mathed/math_iter.h: remove empty destructor
3729 * src/mathed/math_cursor.h: remove empty destructor
3731 * src/insets/lyxinset.h: add THEOREM_CODE
3733 * src/insets/insettheorem.[Ch]: new files
3735 * src/insets/insetminipage.C: (InsertInset): remove
3737 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3739 (InsertInset): remove
3741 * src/insets/insetlist.C: (InsertList): remove
3743 * src/insets/insetfootlike.[Ch]: new files
3745 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3748 (InsertInset): ditto
3750 * src/insets/insetert.C: remove include Painter.h, reindent
3751 (InsertInset): move to header
3753 * src/insets/insetcollapsable.h: remove explicit from default
3754 contructor, remove empty destructor, add InsertInset
3756 * src/insets/insetcollapsable.C (InsertInset): new func
3758 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3760 * src/vspace.h: add explicit to constructor
3762 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3763 \textcompwordmark, please test this.
3765 * src/lyxrc.C: set ascii_linelen to 65 by default
3767 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3769 * src/commandtags.h: add LFUN_INSET_THEOREM
3771 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3772 (makeLinuxDocFile): remove _some_ of the nice logic
3773 (makeDocBookFile): ditto
3775 * src/Painter.[Ch]: (~Painter): removed
3777 * src/LyXAction.C (init): entry for insettheorem added
3779 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3781 (deplog): code to detect files generated by LaTeX, needs testing
3784 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3786 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3788 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3790 * src/LaTeX.C (deplog): Add a check for files that are going to be
3791 created by the first latex run, part of the project to remove the
3794 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3795 contents to the extension list.
3797 2000-07-04 Juergen Vigna <jug@sad.it>
3799 * src/text.C (NextBreakPoint): added support for needFullRow()
3801 * src/insets/lyxinset.h: added needFullRow()
3803 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3806 * src/insets/insettext.C: lots of changes for update!
3808 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3810 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3812 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3814 * src/insets/insetinclude.C (InsetInclude): fixed
3815 initialization of include_label.
3816 (unique_id): now returns a string.
3818 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3820 * src/LaTeXFeatures.h: new member IncludedFiles, for
3821 a map of key, included file name.
3823 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3824 with the included files for inclusion in SGML preamble,
3825 i. e., linuxdoc and docbook.
3828 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3829 nice (is the generated linuxdoc code to be exported?), that
3830 allows to remove column, and only_body that will be true for
3831 slave documents. Insets are allowed inside SGML font type.
3832 New handling of the SGML preamble for included files.
3833 (makeDocBookFile): the same for docbook.
3835 * src/insets/insetinclude.h:
3836 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3838 (DocBook): new export methods.
3840 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3841 and makeDocBookFile.
3843 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3844 formats to export with command line argument -x.
3846 2000-06-29 Juergen Vigna <jug@sad.it>
3848 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3849 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3851 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3852 region could already been cleared by an inset!
3854 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3856 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3859 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3861 (cursorToggle): remove special handling of lyx focus.
3863 2000-06-28 Juergen Vigna <jug@sad.it>
3865 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3868 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3870 * src/insets/insetindex.C (Edit): add a callback when popup is
3873 * src/insets/insettext.C (LocalDispatch):
3874 * src/insets/insetmarginal.h:
3875 * src/insets/insetlist.h:
3876 * src/insets/insetfoot.h:
3877 * src/insets/insetfloat.h:
3878 * src/insets/insetert.h: add a missing std:: qualifier.
3880 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3882 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3885 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3887 * src/insets/insettext.C (Read): remove tmptok unused variable
3888 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3889 (InsertInset): change for new InsetInset code
3891 * src/insets/insettext.h: add TEXT inline method
3893 * src/insets/insettext.C: remove TEXT macro
3895 * src/insets/insetmarginal.C (Write): new method
3896 (Latex): change output slightly
3898 * src/insets/insetfoot.C (Write): new method
3899 (Latex): change output slightly (don't use endl when no need)
3901 * src/insets/insetert.C (Write): new method
3903 * src/insets/insetcollapsable.h: make button_length, button_top_y
3904 and button_bottm_y protected.
3906 * src/insets/insetcollapsable.C (Write): simplify code by using
3907 tostr. Also do not output the float name, the children class
3908 should to that to get control over own arguments
3910 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3911 src/insets/insetminipage.[Ch]:
3914 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3916 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3918 * src/Makefile.am (lyx_SOURCES): add the new files
3920 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3921 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3922 * src/commandtags.h: ditto
3924 * src/LaTeXFeatures.h: add a std::set of used floattypes
3926 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3928 * src/FloatList.[Ch] src/Floating.h: new files
3930 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3932 * src/lyx_cb.C (TableApplyCB): ditto
3934 * src/text2.C: ditto
3935 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3936 (parseSingleLyXformat2Token): ditto + add code for
3937 backwards compability for old float styles + add code for new insets
3939 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3941 (InsertInset(size_type, Inset *, LyXFont)): new method
3942 (InsetChar(size_type, char)): changed to use the other InsetChar
3943 with a LyXFont(ALL_INHERIT).
3944 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3945 insert the META_INSET.
3947 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3949 * sigc++/thread.h (Threads): from here
3951 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3952 definition out of line
3953 * sigc++/scope.h: from here
3955 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3957 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3958 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3960 * Makefile.am (bindist): new target.
3962 * INSTALL: add instructions for doing a binary distribution.
3964 * development/tools/README.bin.example: update a bit.
3966 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3969 * lib/lyxrc.example: new lyxrc tag \set_color.
3971 * src/lyxfunc.C (Dispatch):
3972 * src/commandtags.h:
3973 * src/LyXAction.C: new lyxfunc "set-color".
3975 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3976 and an x11name given as strings.
3978 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3979 cache when a color is changed.
3981 2000-06-26 Juergen Vigna <jug@sad.it>
3983 * src/lyxrow.C (width): added this functions and variable.
3985 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3988 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3990 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3992 * images/undo_bw.xpm: new icon.
3993 * images/redo_bw.xpm: ditto.
3995 * configure.in (INSTALL_SCRIPT): change value to
3996 ${INSTALL} to avoid failures of install-script target.
3997 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3999 * src/BufferView.h: add a magic "friend" declaration to please
4002 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4004 * forms/cite.fd: modified to allow resizing without messing
4007 * src/insetcite.C: Uses code from cite.fd almost without
4009 User can now resize dialog in the x-direction.
4010 Resizing the dialog in the y-direction is prevented, as the
4011 code does this intelligently already.
4013 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4015 * INSTALL: remove obsolete entry in "problems" section.
4017 * lib/examples/sl_*.lyx: update of the slovenian examples.
4019 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4021 2000-06-23 Juergen Vigna <jug@sad.it>
4023 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4025 * src/buffer.C (resize): delete the LyXText of textinsets.
4027 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4029 * src/insets/lyxinset.h: added another parameter 'cleared' to
4030 the draw() function.
4032 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4033 unlocking inset in inset.
4035 2000-06-22 Juergen Vigna <jug@sad.it>
4037 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4038 of insets and moved first to LyXText.
4040 * src/mathed/formulamacro.[Ch]:
4041 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4043 2000-06-21 Juergen Vigna <jug@sad.it>
4045 * src/text.C (GetVisibleRow): look if I should clear the area or not
4046 using Inset::doClearArea() function.
4048 * src/insets/lyxinset.h: added doClearArea() function and
4049 modified draw(Painter &, ...) to draw(BufferView *, ...)
4051 * src/text2.C (UpdateInset): return bool insted of int
4053 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4055 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4056 combox in the character popup
4058 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4059 BufferParams const & params
4061 2000-06-20 Juergen Vigna <jug@sad.it>
4063 * src/insets/insettext.C (SetParagraphData): set insetowner on
4066 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4068 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4069 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4071 (form_main_): remove
4073 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4074 (create_form_form_main): remove FD_form_main stuff, connect to
4075 autosave_timeout signal
4077 * src/LyXView.[Ch] (getMainForm): remove
4078 (UpdateTimerCB): remove
4079 * src/BufferView_pimpl.h: inherit from SigC::Object
4081 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4082 signal instead of callback
4084 * src/BufferView.[Ch] (cursorToggleCB): remove
4086 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4088 * src/BufferView_pimpl.C: changes because of the one below
4090 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4091 instead of storing a pointer to a LyXText.
4093 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4095 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4097 * src/lyxparagraph.h
4099 * src/paragraph.C: Changed fontlist to a sorted vector.
4101 2000-06-19 Juergen Vigna <jug@sad.it>
4103 * src/BufferView.h: added screen() function.
4105 * src/insets/insettext.C (LocalDispatch): some selection code
4108 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4110 * src/insets/insettext.C (SetParagraphData):
4112 (InsetText): fixes for multiple paragraphs.
4114 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4116 * development/lyx.spec.in: Call configure with ``--without-warnings''
4117 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4118 This should be fine, however, since we generally don't want to be
4119 verbose when making an RPM.
4121 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4123 * lib/scripts/fig2pstex.py: New file
4125 2000-06-16 Juergen Vigna <jug@sad.it>
4127 * src/insets/insettabular.C (UpdateLocal):
4128 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4129 (LocalDispatch): Changed all functions to use LyXText.
4131 2000-06-15 Juergen Vigna <jug@sad.it>
4133 * src/text.C (SetHeightOfRow): call inset::update before requesting
4136 * src/insets/insettext.C (update):
4137 * src/insets/insettabular.C (update): added implementation
4139 * src/insets/lyxinset.h: added update function
4141 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4143 * src/text.C (SelectNextWord): protect against null pointers with
4144 old-style string streams. (fix from Paul Theo Gonciari
4147 * src/cite.[Ch]: remove erroneous files.
4149 * lib/configure.m4: update the list of created directories.
4151 * src/lyxrow.C: include <config.h>
4152 * src/lyxcursor.C: ditto.
4154 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4156 * lib/examples/decimal.lyx: new example file from Mike.
4158 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4159 to find template definitions (from Dekel)
4161 * src/frontends/.cvsignore: add a few things.
4163 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4165 * src/Timeout.C (TimeOut): remove default argument.
4167 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4170 * src/insets/ExternalTemplate.C: add a "using" directive.
4172 * src/lyx_main.h: remove the act_ struct, which seems unused
4175 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4177 * LyX Developers Meeting: All files changed, due to random C++ (by
4178 coincidence) code generator script.
4180 - external inset (cool!)
4181 - initial online editing of preferences
4182 - insettabular breaks insettext(s contents)
4184 - some DocBook fixes
4185 - example files update
4186 - other cool stuff, create a diff and look for yourself.
4188 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4190 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4191 -1 this is a non-line-breaking textinset.
4193 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4194 if there is no width set.
4196 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4198 * Lots of files: Merged the dialogbase branch.
4200 2000-06-09 Allan Rae <rae@lyx.org>
4202 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4203 and the Dispatch methods that used it.
4205 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4206 access to functions formerly kept in Dispatch.
4208 2000-05-19 Allan Rae <rae@lyx.org>
4210 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4211 made to_page and count_copies integers again. from_page remains a
4212 string however because I want to allow entry of a print range like
4213 "1,4,22-25" using this field.
4215 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4216 and printer-params-get. These aren't useful from the minibuffer but
4217 could be used by a script/LyXServer app provided it passes a suitable
4218 auto_mem_buffer. I guess I should take a look at how the LyXServer
4219 works and make it support xtl buffers.
4221 * sigc++/: updated to libsigc++-1.0.1
4223 * src/xtl/: updated to xtl-1.3.pl.11
4225 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4226 those changes done to the files in src/ are actually recreated when
4227 they get regenerated. Please don't ever accept a patch that changes a
4228 dialog unless that patch includes the changes to the corresponding *.fd
4231 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4232 stringOnlyContains, renamed it and generalised it.
4234 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4235 branch. Removed the remaining old form_print code.
4237 2000-04-26 Allan Rae <rae@lyx.org>
4239 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4240 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4242 2000-04-25 Allan Rae <rae@lyx.org>
4244 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4245 against a base of xtl-1.3.pl.4
4247 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4248 filter the Id: entries so they still show the xtl version number
4251 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4252 into the src/xtl code. Patch still pending with José (XTL)
4254 2000-04-24 Allan Rae <rae@lyx.org>
4256 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4257 both more generic and much safer. Use the new template functions.
4258 * src/buffer.[Ch] (Dispatch): ditto.
4260 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4261 and mem buffer more intelligently. Also a little general cleanup.
4264 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4265 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4266 * src/xtl/Makefile.am: ditto.
4267 * src/xtl/.cvsignore: ditto.
4268 * src/Makefile.am: ditto.
4270 * src/PrinterParams.h: Removed the macros member functions. Added a
4271 testInvariant member function. A bit of tidying up and commenting.
4272 Included Angus's idea for fixing operation with egcs-1.1.2.
4274 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4275 cool expansion of XTL's mem_buffer to support automatic memory
4276 management within the buffer itself. Removed the various macros and
4277 replaced them with template functions that use either auto_mem_buffer
4278 or mem_buffer depending on a #define. The mem_buffer support will
4279 disappear as soon as the auto_mem_buffer is confirmed to be good on
4280 other platforms/compilers. That is, it's there so you've got something
4283 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4284 effectively forked XTL. However I expect José will include my code
4285 into the next major release. Also fixed a memory leak.
4286 * src/xtl/text.h: ditto.
4287 * src/xtl/xdr.h: ditto.
4288 * src/xtl/giop.h: ditto.
4290 2000-04-16 Allan Rae <rae@lyx.org>
4292 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4293 by autogen.sh and removed by maintainer-clean anyway.
4294 * .cvsignore, sigc++/.cvsignore: Support the above.
4296 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4298 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4300 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4301 macros, renamed static callback-target member functions to suit new
4302 scheme and made them public.
4303 * src/frontends/xforms/forms/form_print.fd: ditto.
4304 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4306 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4309 * src/xtl/: New directory containing a minimal distribution of XTL.
4310 This is XTL-1.3.pl.4.
4312 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4314 2000-04-15 Allan Rae <rae@lyx.org>
4316 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4318 * sigc++/: Updated to libsigc++-1.0.0
4320 2000-04-14 Allan Rae <rae@lyx.org>
4322 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4323 use the generic ones in future. I'll modify my conversion script.
4325 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4327 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4328 (CloseAllBufferRelatedDialogs): Renamed.
4329 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4331 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4332 of the generic ones. These are the same ones my conversion script
4335 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4336 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4337 * src/buffer.C (Dispatch): ditto
4339 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4340 functions for updating and hiding buffer dependent dialogs.
4341 * src/BufferView.C (buffer): ditto
4342 * src/buffer.C (setReadonly): ditto
4343 * src/lyxfunc.C (CloseBuffer): ditto
4345 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4346 Dialogs.h, and hence all the SigC stuff, into every file that includes
4347 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4349 * src/BufferView2.C: reduce the number of headers included by buffer.h
4351 2000-04-11 Allan Rae <rae@lyx.org>
4353 * src/frontends/xforms/xform_macros.h: A small collection of macros
4354 for building C callbacks.
4356 * src/frontends/xforms/Makefile.am: Added above file.
4358 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4359 scheme again. This time it should work for JMarc. If this is
4360 successful I'll revise my conversion script to automate some of this.
4361 The static member functions in the class also have to be public for
4362 this scheme will work. If the scheme works (it's almost identical to
4363 the way BufferView::cursorToggleCB is handled so it should work) then
4364 FormCopyright and FormPrint will be ready for inclusion into the main
4365 trunk immediately after 1.1.5 is released -- provided we're prepared
4366 for complaints about lame compilers not handling XTL.
4368 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4370 2000-04-07 Allan Rae <rae@lyx.org>
4372 * config/lyxinclude.m4: A bit more tidying up (Angus)
4374 * src/LString.h: JMarc's <string> header fix
4376 * src/PrinterParams.h: Used string for most data to remove some
4377 ugly code in the Print dialog and avoid even uglier code when
4378 appending the ints to a string for output.
4380 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4381 and moved "default:" back to the end of switch statement. Cleaned
4382 up the printing so it uses the right function calls and so the
4383 "print to file" option actually puts the file in the right directory.
4385 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4387 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4388 and Ok+Apply button control into a separate method: input (Angus).
4389 (input) Cleaned it up and improved it to be very thorough now.
4390 (All CB) static_cast used instead of C style cast (Angus). This will
4391 probably change again once we've worked out how to keep gcc-2.8.1 happy
4392 with real C callbacks.
4393 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4394 ignore some of the bool settings and has random numbers instead. Needs
4395 some more investigation. Added other input length checks and checking
4396 of file and printer names.
4398 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4399 would link (Angus). Seems the old code doesn't compile with the pragma
4400 statement either. Separated callback entries from internal methods.
4402 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4404 2000-03-17 Allan Rae <rae@lyx.org>
4406 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4407 need it? Maybe it could go in Dialogs instead? I could make it a
4408 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4409 values to get the bool return value.
4410 (Dispatch): New overloaded method for xtl support.
4412 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4413 extern "C" callback instead of static member functions. Hopefully,
4414 JMarc will be able to compile this. I haven't changed
4415 forms/form_copyright.fd yet. Breaking one of my own rules already.
4417 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4418 because they aren't useful from the minibuffer. Maybe a LyXServer
4419 might want a help message though?
4421 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4423 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4424 xtl which needs both rtti and exceptions.
4426 * src/support/Makefile.am:
4427 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4429 * src/frontends/xforms/input_validators.[ch]: input filters and
4430 validators. These conrol what keys are valid in input boxes.
4431 Use them and write some more. Much better idea than waiting till
4432 after the user has pressed Ok to say that the input fields don't make
4435 * src/frontends/xforms/Makefile.am:
4436 * src/frontends/xforms/forms/form_print.fd:
4437 * src/frontends/xforms/forms/makefile:
4438 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4439 new scheme. Still have to make sure I haven't missed anything from
4440 the current implementation.
4442 * src/Makefile.am, src/PrinterParams.h: New data store.
4444 * other files: Added a couple of copyright notices.
4446 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4448 * src/insets/insetbib.h: move Holder struct in public space.
4450 * src/frontends/include/DialogBase.h: use SigC:: only when
4451 SIGC_CXX_NAMESPACES is defined.
4452 * src/frontends/include/Dialogs.h: ditto.
4454 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4456 * src/frontends/xforms/FormCopyright.[Ch]: do not
4457 mention SigC:: explicitely.
4459 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4461 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4462 deals with testing KDE in main configure.in
4463 * configure.in: ditto.
4465 2000-02-22 Allan Rae <rae@lyx.org>
4467 * Lots of files: Merged from HEAD
4469 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4470 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4472 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4474 * sigc++/: new minidist.
4476 2000-02-14 Allan Rae <rae@lyx.org>
4478 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4480 2000-02-08 Juergen Vigna <jug@sad.it>
4482 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4483 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4485 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4486 for this port and so it is much easier for other people to port
4487 dialogs in a common development environment.
4489 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4490 the QT/KDE implementation.
4492 * src/frontends/kde/Dialogs.C:
4493 * src/frontends/kde/FormCopyright.C:
4494 * src/frontends/kde/FormCopyright.h:
4495 * src/frontends/kde/Makefile.am:
4496 * src/frontends/kde/formcopyrightdialog.C:
4497 * src/frontends/kde/formcopyrightdialog.h:
4498 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4499 for the kde support of the Copyright-Dialog.
4501 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4502 subdir-substitution instead of hardcoded 'xforms' as we now have also
4505 * src/frontends/include/DialogBase.h (Object): just commented the
4506 label after #endif (nasty warning and I don't like warnings ;)
4508 * src/main.C (main): added KApplication initialization if using
4511 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4512 For now only the KDE event-loop is added if frontend==kde.
4514 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4516 * configure.in: added support for the --with-frontend[=value] option
4518 * autogen.sh: added kde.m4 file to list of config-files
4520 * acconfig.h: added define for KDEGUI-support
4522 * config/kde.m4: added configuration functions for KDE-port
4524 * config/lyxinclude.m4: added --with-frontend[=value] option with
4525 support for xforms and KDE.
4527 2000-02-08 Allan Rae <rae@lyx.org>
4529 * all Makefile.am: Fixed up so the make targets dist, distclean,
4530 install and uninstall all work even if builddir != srcdir. Still
4531 have a new sigc++ minidist update to come.
4533 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4535 2000-02-01 Allan Rae <rae@lyx.org>
4537 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4538 Many mods to get builddir != srcdir working.
4540 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4541 for building on NT and so we can do the builddir != srcdir stuff.
4543 2000-01-30 Allan Rae <rae@lyx.org>
4545 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4546 This will stay in "rae" branch. We probably don't really need it in
4547 the main trunk as anyone who wants to help programming it should get
4548 a full library installed also. So they can check both included and
4549 system supplied library compilation.
4551 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4552 Added a 'mini' distribution of libsigc++. If you feel the urge to
4553 change something in these directories - Resist it. If you can't
4554 resist the urge then you should modify the following script and rebuild
4555 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4556 all happen. Still uses a hacked version of libsigc++'s configure.in.
4557 I'm quite happy with the results. I'm not sure the extra work to turn
4558 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4559 worth the trouble and would probably lead to extra maintenance
4561 I haven't tested the following important make targets: install, dist.
4562 Not ready for prime time but very close. Maybe 1.1.5.
4564 * development/tools/makeLyXsigc.sh: A shell script to automatically
4565 generate our mini-dist of libsigc++. It can only be used with a CVS
4566 checkout of libsigc++ not a tarball distribution. It's well commented.
4567 This will end up as part of the libsigc++ distribution so other apps
4568 can easily have an included mini-dist. If someone makes mods to the
4569 sigc++ subpackage without modifying this script to generate those
4570 changes I'll be very upset!
4572 * src/frontends/: Started the gui/system indep structure.
4574 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4575 to access the gui-indep dialogs are in this class. Much improved
4576 design compared to previous revision. Lars, please refrain from
4577 moving this header into src/ like you did with Popups.h last time.
4579 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4581 * src/frontends/xforms/: Started the gui-indep system with a single
4582 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4585 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4586 Here you'll find a very useful makefile and automated fdfix.sh that
4587 makes updating dailogs a no-brainer -- provided you follow the rules
4588 set out in the README. I'm thinking about adding another script to
4589 automatically generate skeleton code for a new dialog given just the
4592 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4593 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4594 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4596 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4598 * src/support/LSubstring.C (operator): simplify
4600 * src/lyxtext.h: removed bparams, use buffer_->params instead
4602 * src/lyxrow.h: make Row a real class, move all variables to
4603 private and use accessors.
4605 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4607 (isRightToLeftPar): ditto
4608 (ChangeLanguage): ditto
4609 (isMultiLingual): ditto
4612 (SimpleTeXOnePar): ditto
4613 (TeXEnvironment): ditto
4614 (GetEndLabel): ditto
4616 (SetOnlyLayout): ditto
4617 (BreakParagraph): ditto
4618 (BreakParagraphConservative): ditto
4619 (GetFontSettings): ditto
4621 (CopyIntoMinibuffer): ditto
4622 (CutIntoMinibuffer): ditto
4623 (PasteParagraph): ditto
4624 (SetPExtraType): ditto
4625 (UnsetPExtraType): ditto
4626 (DocBookContTableRows): ditto
4627 (SimpleDocBookOneTablePar): ditto
4629 (TeXFootnote): ditto
4630 (SimpleTeXOneTablePar): ditto
4631 (TeXContTableRows): ditto
4632 (SimpleTeXSpecialChars): ditto
4635 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4636 to private and use accessors.
4638 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4639 this, we did not use it anymore and has not been for ages. Just a
4640 waste of cpu cycles.
4642 * src/language.h: make Language a real class, move all variables
4643 to private and use accessors.
4645 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4646 (create_view): remove
4647 (update): some changes for new timer
4648 (cursorToggle): use new timer
4649 (beforeChange): change for new timer
4651 * src/BufferView.h (cursorToggleCB): removed last paramter because
4654 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4655 (cursorToggleCB): change because of new timer code
4657 * lib/CREDITS: updated own mailaddress
4659 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4661 * src/support/filetools.C (PutEnv): fix the code in case neither
4662 putenv() nor setenv() have been found.
4664 * INSTALL: mention the install-strip Makefile target.
4666 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4667 read-only documents.
4669 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4671 * lib/reLyX/configure.in (VERSION): avoid using a previously
4672 generated reLyX wrapper to find out $prefix.
4674 * lib/examples/eu_adibide_lyx-atua.lyx:
4675 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4676 translation of the Tutorial (Dooteo)
4678 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4680 * forms/cite.fd: new citation dialog
4682 * src/insetcite.[Ch]: the new citation dialog is moved into
4685 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4688 * src/insets/insetcommand.h: data members made private.
4690 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4692 * LyX 1.1.5 released
4694 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4696 * src/version.h (LYX_RELEASE): to 1.1.5
4698 * src/spellchecker.C (RunSpellChecker): return false if the
4699 spellchecker dies upon creation.
4701 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4703 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4704 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4708 * lib/CREDITS: update entry for Martin Vermeer.
4710 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4712 * src/text.C (draw): Draw foreign language bars at the bottom of
4713 the row instead of at the baseline.
4715 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4717 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4719 * lib/bind/de_menus.bind: updated
4721 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4723 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4725 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4727 * src/menus.C (Limit_string_length): New function
4728 (ShowTocMenu): Limit the number of items/length of items in the
4731 * src/paragraph.C (String): Correct result for a paragraph inside
4734 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4736 * src/bufferlist.C (close): test of buf->getuser() == NULL
4738 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4740 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4741 Do not call to SetCursor when the paragraph is a closed footnote!
4743 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4745 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4748 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4750 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4753 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4754 reference popup, that activates the reference-back action
4756 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4758 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4759 the menus. Also fixed a bug.
4761 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4762 the math panels when switching buffers (unless new buffer is readonly).
4764 * src/BufferView.C (NoSavedPositions)
4765 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4767 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4769 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4770 less of dvi dirty or not.
4772 * src/trans_mgr.[Ch] (insert): change first parameter to string
4775 * src/chset.[Ch] (encodeString): add const to first parameter
4777 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4779 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4783 * src/LaTeX.C (deplog): better searching for dependency files in
4784 the latex log. Uses now regexps.
4786 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4787 instead of the box hack or \hfill.
4789 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4791 * src/lyxfunc.C (doImportHelper): do not create the file before
4792 doing the actual import.
4793 (doImportASCIIasLines): create a new file before doing the insert.
4794 (doImportASCIIasParagraphs): ditto.
4796 * lib/lyxrc.example: remove mention of non-existing commands
4798 * lyx.man: remove mention of color-related switches.
4800 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4802 * src/lyx_gui.C: remove all the color-related ressources, which
4803 are not used anymore.
4805 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4808 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4810 * src/lyxrc.C (read): Add a missing break in the switch
4812 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4814 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4816 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4819 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4821 * src/text.C (draw): draw bars under foreign language words.
4823 * src/LColor.[Ch]: add LColor::language
4825 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4827 * src/lyxcursor.h (boundary): New member variable
4829 * src/text.C (IsBoundary): New methods
4831 * src/text.C: Use the above for currect cursor movement when there
4832 is both RTL & LTR text.
4834 * src/text2.C: ditto
4836 * src/bufferview_funcs.C (ToggleAndShow): ditto
4838 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4840 * src/text.C (DeleteLineForward): set selection to true to avoid
4841 that DeleteEmptyParagraphMechanism does some magic. This is how it
4842 is done in all other functions, and seems reasonable.
4843 (DeleteWordForward): do not jump over non-word stuff, since
4844 CursorRightOneWord() already does it.
4846 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4847 DeleteWordBackward, since they seem safe to me (since selection is
4848 set to "true") DeleteEmptyParagraphMechanism does nothing.
4850 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4852 * src/lyx_main.C (easyParse): simplify the code by factoring the
4853 part that removes parameters from the command line.
4854 (LyX): check wether wrong command line options have been given.
4856 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4858 * src/lyx_main.C : add support for specifying user LyX
4859 directory via command line option -userdir.
4861 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4863 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4864 the number of items per popup.
4865 (Add_to_refs_menu): Ditto.
4867 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4869 * src/lyxparagraph.h: renamed ClearParagraph() to
4870 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4871 textclass as parameter, and do nothing if free_spacing is
4872 true. This fixes part of the line-delete-forward problems.
4874 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4875 (pasteSelection): ditto.
4876 (SwitchLayoutsBetweenClasses): more translatable strings.
4878 * src/text2.C (CutSelection): use StripLeadingSpaces.
4879 (PasteSelection): ditto.
4880 (DeleteEmptyParagraphMechanism): ditto.
4882 2000-05-26 Juergen Vigna <jug@sad.it>
4884 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4885 is not needed in tabular insets.
4887 * src/insets/insettabular.C (TabularFeatures): added missing features.
4889 * src/tabular.C (DeleteColumn):
4891 (AppendRow): implemented this functions
4892 (cellsturct::operator=): clone the inset too;
4894 2000-05-23 Juergen Vigna <jug@sad.it>
4896 * src/insets/insettabular.C (LocalDispatch): better selection support
4897 when having multicolumn-cells.
4899 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4901 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4903 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4905 * src/ColorHandler.C (getGCForeground): put more test into _()
4907 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4910 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4913 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4915 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4916 there are no labels, or when buffer is readonly.
4918 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4919 there are no labels, buffer is SGML, or when buffer is readonly.
4921 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4923 * src/LColor.C (LColor): change a couple of grey40 to grey60
4924 (LColor): rewore initalization to make compiles go some magnitude
4926 (getGUIName): don't use gettext until we need the string.
4928 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4930 * src/Bullet.[Ch]: Fixed a small bug.
4932 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4934 * src/paragraph.C (String): Several fixes/improvements
4936 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4938 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4940 * src/paragraph.C (String): give more correct output.
4942 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4944 * src/lyxfont.C (stateText) Do not output the language if it is
4945 eqaul to the language of the document.
4947 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4948 between two paragraphs with the same language.
4950 * src/paragraph.C (getParLanguage) Return a correct answer for an
4951 empty dummy paragraph.
4953 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4956 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4959 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4960 the menus/popup, if requested fonts are unavailable.
4962 2000-05-22 Juergen Vigna <jug@sad.it>
4964 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4965 movement support (Up/Down/Tab/Shift-Tab).
4966 (LocalDispatch): added also preliminari cursor-selection.
4968 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4970 * src/paragraph.C (PasteParagraph): Hopefully now right!
4972 2000-05-22 Garst R. Reese <reese@isn.net>
4974 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4975 of list, change all references to Environment to Command
4976 * tex/hollywood.cls : rewrite environments as commands, add
4977 \uppercase to interiorshot and exteriorshot to force uppecase.
4978 * tex/broadway.cls : rewrite environments as commands. Tweak
4981 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4983 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4984 size of items: use a constant intead of the hardcoded 40, and more
4985 importantly do not remove the %m and %x tags added at the end.
4986 (Add_to_refs_menu): use vector::size_type instead of
4987 unsigned int as basic types for the variables. _Please_ do not
4988 assume that size_t is equal to unsigned int. On an alpha, this is
4989 unsigned long, which is _not_ the same.
4991 * src/language.C (initL): remove language "hungarian", since it
4992 seems that "magyar" is better.
4994 2000-05-22 Juergen Vigna <jug@sad.it>
4996 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4998 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5001 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5002 next was deleted but not set to 0.
5004 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5006 * src/language.C (initL): change the initialization of languages
5007 so that compiles goes _fast_.
5009 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5012 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5014 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5018 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5020 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5022 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5026 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5029 * src/insets/insetlo*.[Ch]: Made editable
5031 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5033 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5034 the current selection.
5036 * src/BufferView_pimpl.C (stuffClipboard): new method
5038 * src/BufferView.C (stuffClipboard): new method
5040 * src/paragraph.C (String): new method
5042 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5043 LColor::ignore when lyxname is not found.
5045 * src/BufferView.C (pasteSelection): new method
5047 * src/BufferView_pimpl.C (pasteSelection): new method
5049 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5051 * src/WorkArea.C (request_clipboard_cb): new static function
5052 (getClipboard): new method
5053 (putClipboard): new method
5055 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5057 * LyX 1.1.5pre2 released
5059 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5061 * src/vspace.C (operator=): removed
5062 (operator=): removed
5064 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5066 * src/layout.C (NumberOfClass): manually set the type in make_pair
5067 (NumberOfLayout): ditto
5069 * src/language.C: use the Language constructor for ignore_lang
5071 * src/language.h: add constructors to struct Language
5073 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5075 * src/text2.C (SetCursorIntern): comment out #warning
5077 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5079 * src/mathed/math_iter.h: initialize sx and sw to 0
5081 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5083 * forms/lyx.fd: Redesign of form_ref
5085 * src/LaTeXFeatures.[Ch]
5089 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5092 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5093 and Buffer::inset_iterator.
5095 * src/menus.C: Added new menus: TOC and Refs.
5097 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5099 * src/buffer.C (getTocList): New method.
5101 * src/BufferView2.C (ChangeRefs): New method.
5103 * src/buffer.C (getLabelList): New method. It replaces the old
5104 getReferenceList. The return type is vector<string> instead of
5107 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5108 the old getLabel() and GetNumberOfLabels() methods.
5109 * src/insets/insetlabel.C (getLabelList): ditto
5110 * src/mathed/formula.C (getLabelList): ditto
5112 * src/paragraph.C (String): New method.
5114 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5115 Uses the new getTocList() method.
5116 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5117 which automatically updates the contents of the browser.
5118 (RefUpdateCB): Use the new getLabelList method.
5120 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5122 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5124 * src/spellchecker.C: Added using std::reverse;
5126 2000-05-19 Juergen Vigna <jug@sad.it>
5128 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5130 * src/insets/insettext.C (computeTextRows): small fix for display of
5131 1 character after a newline.
5133 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5136 2000-05-18 Juergen Vigna <jug@sad.it>
5138 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5139 when changing width of column.
5141 * src/tabular.C (set_row_column_number_info): setting of
5142 autobreak rows if necessary.
5144 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5146 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5148 * src/vc-backend.*: renamed stat() to status() and vcstat to
5149 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5150 compilation broke. The new name seems more relevant, anyway.
5152 2000-05-17 Juergen Vigna <jug@sad.it>
5154 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5155 which was wrong if the removing caused removing of rows!
5157 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5158 (pushToken): new function.
5160 * src/text2.C (CutSelection): fix problem discovered with purify
5162 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5164 * src/debug.C (showTags): enlarge the first column, now that we
5165 have 6-digits debug codes.
5167 * lib/layouts/hollywood.layout:
5168 * lib/tex/hollywood.cls:
5169 * lib/tex/brodway.cls:
5170 * lib/layouts/brodway.layout: more commands and fewer
5171 environments. Preambles moved in the .cls files. Broadway now has
5172 more options on scene numbering and less whitespace (from Garst)
5174 * src/insets/insetbib.C (getKeys): make sure that we are in the
5175 document directory, in case the bib file is there.
5177 * src/insets/insetbib.C (Latex): revert bogus change.
5179 2000-05-16 Juergen Vigna <jug@sad.it>
5181 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5182 the TabularLayout on cursor move.
5184 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5186 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5189 (draw): fixed cursor position and drawing so that the cursor is
5190 visible when before the tabular-inset.
5192 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5193 when creating from old insettext.
5195 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5197 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5199 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5200 * lib/tex/brodway.cls: ditto
5202 * lib/layouts/brodway.layout: change alignment of parenthical
5205 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5207 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5208 versions 0.88 and 0.89 are supported.
5210 2000-05-15 Juergen Vigna <jug@sad.it>
5212 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5215 * src/insets/insettext.C (computeTextRows): redone completely this
5216 function in a much cleaner way, because of problems when having a
5218 (draw): added a frame border when the inset is locked.
5219 (SetDrawLockedFrame): this sets if we draw the border or not.
5220 (SetFrameColor): this sets the frame color (default=insetframe).
5222 * src/insets/lyxinset.h: added x() and y() functions which return
5223 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5224 function which is needed to see if we have a locking inset of some
5225 type in this inset (needed for now in insettabular).
5227 * src/vspace.C (inPixels): the same function also without a BufferView
5228 parameter as so it is easier to use it in some ocasions.
5230 * src/lyxfunc.C: changed all places where insertInset was used so
5231 that now if it couldn't be inserted it is deleted!
5233 * src/TabularLayout.C:
5234 * src/TableLayout.C: added support for new tabular-inset!
5236 * src/BufferView2.C (insertInset): this now returns a bool if the
5237 inset was really inserted!!!
5239 * src/tabular.C (GetLastCellInRow):
5240 (GetFirstCellInRow): new helper functions.
5241 (Latex): implemented for new tabular class.
5245 (TeXTopHLine): new Latex() helper functions.
5247 2000-05-12 Juergen Vigna <jug@sad.it>
5249 * src/mathed/formulamacro.C (Read):
5250 * src/mathed/formula.C (Read): read also the \end_inset here!
5252 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5254 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5255 crush when saving formulae with unbalanced parenthesis.
5257 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5259 * src/layout.C: Add new keyword "endlabelstring" to layout file
5261 * src/text.C (GetVisibleRow): Draw endlabel string.
5263 * lib/layouts/broadway.layout
5264 * lib/layouts/hollywood.layout: Added endlabel for the
5265 Parenthetical layout.
5267 * lib/layouts/heb-article.layout: Do not use slanted font shape
5268 for Theorem like environments.
5270 * src/buffer.C (makeLaTeXFile): Always add "american" to
5271 the UsedLanguages list if document language is RTL.
5273 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5275 * add addendum to README.OS2 and small patch (from SMiyata)
5277 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5279 * many files: correct the calls to ChangeExtension().
5281 * src/support/filetools.C (ChangeExtension): remove the no_path
5282 argument, which does not belong there. Use OnlyFileName() instead.
5284 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5285 files when LaTeXing a non-nice latex file.
5287 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5288 a chain of "if". Return false when deadkeys are not handled.
5290 * src/lyx_main.C (LyX): adapted the code for default bindings.
5292 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5293 bindings for basic functionality (except deadkeys).
5294 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5296 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5297 several methods: handle override_x_deadkeys.
5299 * src/lyxrc.h: remove the "bindings" map, which did not make much
5300 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5302 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5304 * src/lyxfont.C (stateText): use a saner method to determine
5305 whether the font is "default". Seems to fix the crash with DEC
5308 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5310 2000-05-08 Juergen Vigna <jug@sad.it>
5312 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5313 TabularLayoutMenu with mouse-button-3
5314 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5316 * src/TabularLayout.C: added this file for having a Layout for
5319 2000-05-05 Juergen Vigna <jug@sad.it>
5321 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5322 recalculating inset-widths.
5323 (TabularFeatures): activated this function so that I can change
5324 tabular-features via menu.
5326 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5327 that I can test some functions with the Table menu.
5329 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5331 * src/lyxfont.C (stateText): guard against stupid c++libs.
5333 * src/tabular.C: add using std::vector
5334 some whitespace changes, + removed som autogenerated code.
5336 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5338 2000-05-05 Juergen Vigna <jug@sad.it>
5340 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5341 row, columns and cellstructures.
5343 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5345 * lib/lyxrc.example: remove obsolete entries.
5347 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5348 reading of protected_separator for free_spacing.
5350 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5352 * src/text.C (draw): do not display an exclamation mark in the
5353 margin for margin notes. This is confusing, ugly and
5356 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5357 AMS math' is checked.
5359 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5360 name to see whether including the amsmath package is needed.
5362 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5364 * src/paragraph.C (validate): Compute UsedLanguages correctly
5365 (don't insert the american language if it doesn't appear in the
5368 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5369 The argument of \thanks{} command is considered moving argument
5371 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5374 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5376 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5377 for appendix/minipage/depth. The lines can be now both in the footnote
5378 frame, and outside the frame.
5380 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5383 2000-05-05 Juergen Vigna <jug@sad.it>
5385 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5386 neede only in tabular.[Ch].
5388 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5390 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5392 (Write): write '~' for PROTECTED_SEPARATOR
5394 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5396 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5399 * src/mathed/formula.C (drawStr): rename size to siz.
5401 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5402 possibly fix a bug by not changing the pflags = flags to piflags =
5405 2000-05-05 Juergen Vigna <jug@sad.it>
5407 * src/insets/insetbib.C: moved using directive
5409 * src/ImportNoweb.C: small fix for being able to compile (missing
5412 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5414 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5415 to use clear, since we don't depend on this in the code. Add test
5418 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5420 * (various *.C files): add using std::foo directives to please dec
5423 * replace calls to string::clear() to string::erase() (Angus)
5425 * src/cheaders/cmath: modified to provide std::abs.
5427 2000-05-04 Juergen Vigna <jug@sad.it>
5429 * src/insets/insettext.C: Prepared all for inserting of multiple
5430 paragraphs. Still display stuff to do (alignment and other things),
5431 but I would like to use LyXText to do this when we cleaned out the
5432 table-support stuff.
5434 * src/insets/insettabular.C: Changed lot of stuff and added lots
5435 of functionality still a lot to do.
5437 * src/tabular.C: Various functions changed name and moved to be
5438 const functions. Added new Read and Write functions and changed
5439 lots of things so it works good with tabular-insets (also removed
5440 some stuff which is not needed anymore * hacks *).
5442 * src/lyxcursor.h: added operators == and != which just look if
5443 par and pos are (not) equal.
5445 * src/buffer.C (latexParagraphs): inserted this function to latex
5446 all paragraphs form par to endpar as then I can use this too for
5449 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5450 so that I can call this to from text insets with their own cursor.
5452 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5453 output off all paragraphs (because of the fix below)!
5455 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5456 the very last paragraph (this could be also the last paragraph of an
5459 * src/texrow.h: added rows() call which returns the count-variable.
5461 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5463 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5465 * lib/configure.m4: better autodetection of DocBook tools.
5467 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5469 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5471 * src/lyx_cb.C: add using std::reverse;
5473 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5476 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5477 selected files. Should fix repeated errors from generated files.
5479 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5481 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5483 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5484 the spellchecker popup.
5486 * lib/lyxrc.example: Removed the \number_inset section
5488 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5490 * src/insets/figinset.C (various): Use IsFileReadable() to make
5491 sure that the file actually exist. Relying on ghostscripts errors
5492 is a bad idea since they can lead to X server crashes.
5494 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5496 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5499 * lib/lyxrc.example: smallish typo in description of
5500 \view_dvi_paper_option
5502 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5505 * src/lyxfunc.C: doImportHelper to factor out common code of the
5506 various import methods. New functions doImportASCIIasLines,
5507 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5508 doImportLinuxDoc for the format specific parts.
5511 * buffer.C: Dispatch returns now a bool to indicate success
5514 * lyx_gui.C: Add getLyXView() for member access
5516 * lyx_main.C: Change logic for batch commands: First try
5517 Buffer::Dispatch (possibly without GUI), if that fails, use
5520 * lyx_main.C: Add support for --import command line switch.
5521 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5522 Available Formats: Everything accepted by 'buffer-import <format>'
5524 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5526 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5529 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5530 documents will be reformatted upon reentry.
5532 2000-04-27 Juergen Vigna <jug@sad.it>
5534 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5535 correctly only last pos this was a bug.
5537 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5539 * release of lyx-1.1.5pre1
5541 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5543 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5545 * src/menus.C: revert the change of naming (Figure->Graphic...)
5546 from 2000-04-11. It was incomplete and bad.
5548 * src/LColor.[Ch]: add LColor::depthbar.
5549 * src/text.C (GetVisibleRow): use it.
5551 * README: update the languages list.
5553 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5555 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5558 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5560 * README: remove sections that were just wrong.
5562 * src/text2.C (GetRowNearY): remove currentrow code
5564 * src/text.C (GetRow): remove currentrow code
5566 * src/screen.C (Update): rewritten a bit.
5567 (SmallUpdate): removed func
5569 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5571 (FullRebreak): return bool
5572 (currentrow): remove var
5573 (currentrow_y): ditto
5575 * src/lyxscreen.h (Draw): change arg to unsigned long
5576 (FitCursor): return bool
5577 (FitManualCursor): ditto
5578 (Smallpdate): remove func
5579 (first): change to unsigned long
5580 (DrawOneRow): change second arg to long (from long &)
5581 (screen_refresh_y): remove var
5582 (scree_refresh_row): ditto
5584 * src/lyxrow.h: change baseline to usigned int from unsigned
5585 short, this brings some implicit/unsigned issues out in the open.
5587 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5589 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5590 instead of smallUpdate.
5592 * src/lyxcursor.h: change y to unsigned long
5594 * src/buffer.h: don't call updateScrollbar after fitcursor
5596 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5597 where they are used. Removed "\\direction", this was not present
5598 in 1.1.4 and is already obsolete. Commented out some code that I
5599 believe to never be called.
5600 (runLiterate): don't call updateScrollbar after fitCursor
5602 (buildProgram): ditto
5605 * src/WorkArea.h (workWidth): change return val to unsigned
5608 (redraw): remove the button redraws
5609 (setScrollbarValue): change for scrollbar
5610 (getScrollbarValue): change for scrollbar
5611 (getScrollbarBounds): change for scrollbar
5613 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5614 (C_WorkArea_down_cb): removed func
5615 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5616 (resize): change for scrollbar
5617 (setScrollbar): ditto
5618 (setScrollbarBounds): ditto
5619 (setScrollbarIncrements): ditto
5620 (up_cb): removed func
5621 (down_cb): removed func
5622 (scroll_cb): change for scrollbar
5623 (work_area_handler): ditto
5625 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5626 when FitCursor did something.
5627 (updateScrollbar): some unsigned changes
5628 (downCB): removed func
5629 (scrollUpOnePage): removed func
5630 (scrollDownOnePage): remvoed func
5631 (workAreaMotionNotify): don't call screen->FitCursor but use
5632 fitCursor instead. and bool return val
5633 (workAreaButtonPress): ditto
5634 (workAreaButtonRelease): some unsigned changes
5635 (checkInsetHit): ditto
5636 (workAreaExpose): ditto
5637 (update): parts rewritten, comments about the signed char arg added
5638 (smallUpdate): removed func
5639 (cursorPrevious): call needed updateScrollbar
5642 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5645 * src/BufferView.[Ch] (upCB): removed func
5646 (downCB): removed func
5647 (smallUpdate): removed func
5649 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5651 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5652 currentrow, currentrow_y optimization. This did not help a lot and
5653 if we want to do this kind of optimization we should rather use
5654 cursor.row instead of the currentrow.
5656 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5657 buffer spacing and klyx spacing support.
5659 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5661 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5664 2000-04-26 Juergen Vigna <jug@sad.it>
5666 * src/insets/figinset.C: fixes to Lars sstream changes!
5668 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5670 * A lot of files: Added Ascii(ostream &) methods to all inset
5671 classes. Used when exporting to ASCII.
5673 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5674 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5677 * src/text2.C (ToggleFree): Disabled implicit word selection when
5678 there is a change in the language
5680 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5681 no output was generated for end-of-sentence inset.
5683 * src/insets/lyxinset.h
5686 * src/paragraph.C: Removed the insetnumber code
5688 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5690 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5692 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5693 no_babel and no_epsfig completely from the file.
5694 (parseSingleLyXformat2Token): add handling for per-paragraph
5695 spacing as written by klyx.
5697 * src/insets/figinset.C: applied patch by Andre. Made it work with
5700 2000-04-20 Juergen Vigna <jug@sad.it>
5702 * src/insets/insettext.C (cutSelection):
5703 (copySelection): Fixed with selection from right to left.
5704 (draw): now the rows are not recalculated at every draw.
5705 (computeTextRows): for now reset the inset-owner here (this is
5706 important for an undo or copy where the inset-owner is not set
5709 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5710 motion to the_locking_inset screen->first was forgotten, this was
5711 not important till we got multiline insets.
5713 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5715 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5716 code seems to be alright (it is code changed by Dekel, and the
5717 intent is indeed that all macros should be defined \protect'ed)
5719 * NEWS: a bit of reorganisation of the new user-visible features.
5721 2000-04-19 Juergen Vigna <jug@sad.it>
5723 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5724 position. Set the inset_owner of the used paragraph so that it knows
5725 that it is inside an inset. Fixed cursor handling with mouse and
5726 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5727 and cleanups to make TextInsets work better.
5729 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5730 Changed parameters of various functions and added LockInsetInInset().
5732 * src/insets/insettext.C:
5734 * src/insets/insetcollapsable.h:
5735 * src/insets/insetcollapsable.C:
5736 * src/insets/insetfoot.h:
5737 * src/insets/insetfoot.C:
5738 * src/insets/insetert.h:
5739 * src/insets/insetert.C: cleaned up the code so that it works now
5740 correctly with insettext.
5742 * src/insets/inset.C:
5743 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5744 that insets in insets are supported right.
5747 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5749 * src/paragraph.C: some small fixes
5751 * src/debug.h: inserted INSETS debug info
5753 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5754 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5756 * src/commandtags.h:
5757 * src/LyXAction.C: insert code for InsetTabular.
5759 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5760 not Button1MotionMask.
5761 (workAreaButtonRelease): send always a InsetButtonRelease event to
5763 (checkInsetHit): some setCursor fixes (always with insets).
5765 * src/BufferView2.C (lockInset): returns a bool now and extended for
5766 locking insets inside insets.
5767 (showLockedInsetCursor): it is important to have the cursor always
5768 before the locked inset.
5769 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5771 * src/BufferView.h: made lockInset return a bool.
5773 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5775 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5776 that is used also internally but can be called as public to have back
5777 a cursor pos which is not set internally.
5778 (SetCursorIntern): Changed to use above function.
5780 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5782 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5787 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5788 patches for things that should be in or should be changed.
5790 * src/* [insetfiles]: change "usigned char fragile" to bool
5791 fragile. There was only one point that could that be questioned
5792 and that is commented in formulamacro.C. Grep for "CHECK".
5794 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5795 (DeleteBuffer): take it out of CutAndPaste and make it static.
5797 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5799 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5800 output the spacing envir commands. Also the new commands used in
5801 the LaTeX output makes the result better.
5803 * src/Spacing.C (writeEnvirBegin): new method
5804 (writeEnvirEnd): new method
5806 2000-04-18 Juergen Vigna <jug@sad.it>
5808 * src/CutAndPaste.C: made textclass a static member of the class
5809 as otherwise it is not accesed right!!!
5811 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5813 * forms/layout_forms.fd
5814 * src/layout_forms.h
5815 * src/layout_forms.C (create_form_form_character)
5816 * src/lyx_cb.C (UserFreeFont)
5817 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5818 documents (in the layout->character popup).
5820 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5822 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5823 \spell_command was in fact not honored (from Kevin Atkinson).
5825 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5828 * src/lyx_gui.h: make lyxViews private (Angus)
5830 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5832 * src/mathed/math_write.C
5833 (MathMatrixInset::Write) Put \protect before \begin{array} and
5834 \end{array} if fragile
5835 (MathParInset::Write): Put \protect before \\ if fragile
5837 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5839 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5840 initialization if the LyXColorHandler must be done after the
5841 connections to the XServer has been established.
5843 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5844 get the background pixel from the lyxColorhandler so that the
5845 figures are rendered with the correct background color.
5846 (NextToken): removed functions.
5847 (GetPSSizes): use ifs >> string instead of NextToken.
5849 * src/Painter.[Ch]: the color cache moved out of this file.
5851 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5854 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5856 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5857 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5859 * src/BufferView.C (enterView): new func
5860 (leaveView): new func
5862 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5864 (leaveView): new func, undefines xterm cursor when approp.
5866 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5867 (AllowInput): delete the Workarea cursor handling from this func.
5869 * src/Painter.C (underline): draw a slimer underline in most cases.
5871 * src/lyx_main.C (error_handler): use extern "C"
5873 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5875 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5876 sent directly to me.
5878 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5879 to the list by Dekel.
5881 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5884 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5885 methods from lyx_cb.here.
5887 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5890 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5892 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5893 instead of using current_view directly.
5895 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5897 * src/LyXAction.C (init): add the paragraph-spacing command.
5899 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5901 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5903 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5904 different from the documents.
5906 * src/text.C (SetHeightOfRow): take paragraph spacing into
5907 account, paragraph spacing takes precedence over buffer spacing
5908 (GetVisibleRow): ditto
5910 * src/paragraph.C (writeFile): output the spacing parameter too.
5911 (validate): set the correct features if spacing is used in the
5913 (Clear): set spacing to default
5914 (MakeSameLayout): spacing too
5915 (HasSameLayout): spacing too
5916 (SetLayout): spacing too
5917 (TeXOnePar): output the spacing commands
5919 * src/lyxparagraph.h: added a spacing variable for use with
5920 per-paragraph spacing.
5922 * src/Spacing.h: add a Default spacing and a method to check if
5923 the current spacing is default. also added an operator==
5925 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5928 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5930 * src/lyxserver.C (callback): fix dispatch of functions
5932 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5933 printf() into lyxerr call.
5935 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5938 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5939 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5940 the "Float" from each of the subitems.
5941 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5943 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5944 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5945 documented the change so that the workaround can be nuked later.
5947 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5950 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5952 * src/buffer.C (getLatexName): ditto
5953 (setReadonly): ditto
5955 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5957 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5958 avoid some uses of current_view. Added also a bufferParams()
5959 method to get at this.
5961 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5963 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5965 * src/lyxparagraph.[Ch]: removed
5966 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5967 with operators used by lower_bound and
5968 upper_bound in InsetTable's
5969 Make struct InsetTable private again. Used matchpos.
5971 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5973 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5974 document, the language of existing text is changed (unless the
5975 document is multi-lingual)
5977 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5979 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5981 * A lot of files: A rewrite of the Right-to-Left support.
5983 2000-04-10 Juergen Vigna <jug@sad.it>
5985 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5986 misplaced cursor when inset in inset is locked.
5988 * src/insets/insettext.C (LocalDispatch): small fix so that a
5989 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5991 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5992 footnote font should be decreased in size twice when displaying.
5994 * src/insets/insettext.C (GetDrawFont): inserted this function as
5995 the drawing-font may differ from the real paragraph font.
5997 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5998 insets (inset in inset!).
6000 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6001 function here because we don't want footnotes inside footnotes.
6003 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6005 (init): now set the inset_owner in paragraph.C
6006 (LocalDispatch): added some resetPos() in the right position
6009 (pasteSelection): changed to use the new CutAndPaste-Class.
6011 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6012 which tells if it is allowed to insert another inset inside this one.
6014 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6015 SwitchLayoutsBetweenClasses.
6017 * src/text2.C (InsertInset): checking of the new paragraph-function
6019 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6020 is not needed anymore here!
6023 (PasteSelection): redone (also with #ifdef) so that now this uses
6024 the CutAndPaste-Class.
6025 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6028 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6029 from/to text/insets.
6031 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6032 so that the paragraph knows if it is inside an (text)-inset.
6033 (InsertFromMinibuffer): changed return-value to bool as now it
6034 may happen that an inset is not inserted in the paragraph.
6035 (InsertInsetAllowed): this checks if it is allowed to insert an
6036 inset in this paragraph.
6038 (BreakParagraphConservative):
6039 (BreakParagraph) : small change for the above change of the return
6040 value of InsertFromMinibuffer.
6042 * src/lyxparagraph.h: added inset_owner and the functions to handle
6043 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6045 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6047 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6048 functions from BufferView to BufferView::Pimpl to ease maintence.
6050 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6051 correctly. Also use SetCursorIntern instead of SetCursor.
6053 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6056 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6058 * src/WorkArea.C (belowMouse): manually implement below mouse.
6060 * src/*: Add "explicit" on several constructors, I added probably
6061 some unneeded ones. A couple of changes to code because of this.
6063 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6064 implementation and private parts from the users of BufferView. Not
6067 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6068 implementation and private parts from the users of LyXLex. Not
6071 * src/BufferView_pimpl.[Ch]: new files
6073 * src/lyxlex_pimpl.[Ch]: new files
6075 * src/LyXView.[Ch]: some inline functions move out-of-line
6077 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6079 * src/lyxparagraph.h: make struct InsetTable public.
6081 * src/support/lyxstring.h: change lyxstring::difference_type to be
6082 ptrdiff_t. Add std:: modifiers to streams.
6084 * src/font.C: include the <cctype> header, for islower() and
6087 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6089 * src/font.[Ch]: new files. Contains the metric functions for
6090 fonts, takes a LyXFont as parameter. Better separation of concepts.
6092 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6093 changes because of this.
6095 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6097 * src/*: compile with -Winline and move functions that don't
6100 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6103 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6105 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6106 (various files changed because of this)
6108 * src/Painter.C (text): fixed the drawing of smallcaps.
6110 * src/lyxfont.[Ch] (drawText): removed unused member func.
6113 * src/*.C: added needed "using" statements and "std::" qualifiers.
6115 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6117 * src/*.h: removed all use of "using" from header files use
6118 qualifier std:: instead.
6120 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6122 * src/text.C (Backspace): some additional cleanups (we already
6123 know whether cursor.pos is 0 or not).
6125 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6126 automake does not provide one).
6128 * src/bmtable.h: replace C++ comments with C comments.
6130 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6132 * src/screen.C (ShowCursor): Change the shape of the cursor if
6133 the current language is not equal to the language of the document.
6134 (If the cursor change its shape unexpectedly, then you've found a bug)
6136 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6139 * src/insets/insetnumber.[Ch]: New files.
6141 * src/LyXAction.C (init)
6142 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6145 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6147 * src/lyxparagraph.h
6148 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6149 (the vector is kept sorted).
6151 * src/text.C (GetVisibleRow): Draw selection correctly when there
6152 is both LTR and RTL text.
6154 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6155 which is much faster.
6157 * src/text.C (GetVisibleRow and other): Do not draw the last space
6158 in a row if the direction of the last letter is not equal to the
6159 direction of the paragraph.
6161 * src/lyxfont.C (latexWriteStartChanges):
6162 Check that font language is not equal to basefont language.
6163 (latexWriteEndChanges): ditto
6165 * src/lyx_cb.C (StyleReset): Don't change the language while using
6166 the font-default command.
6168 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6169 empty paragraph before a footnote.
6171 * src/insets/insetcommand.C (draw): Increase x correctly.
6173 * src/screen.C (ShowCursor): Change cursor shape if
6174 current language != document language.
6176 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6178 2000-03-31 Juergen Vigna <jug@sad.it>
6180 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6181 (Clone): changed mode how the paragraph-data is copied to the
6182 new clone-paragraph.
6184 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6185 GetInset(pos) with no inset anymore there (in inset UNDO)
6187 * src/insets/insetcommand.C (draw): small fix as here x is
6188 incremented not as much as width() returns (2 before, 2 behind = 4)
6190 2000-03-30 Juergen Vigna <jug@sad.it>
6192 * src/insets/insettext.C (InsetText): small fix in initialize
6193 widthOffset (should not be done in the init() function)
6195 2000-03-29 Amir Karger <karger@lyx.org>
6197 * lib/examples/it_ItemizeBullets.lyx: translation by
6200 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6202 2000-03-29 Juergen Vigna <jug@sad.it>
6204 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6206 * src/insets/insetfoot.C (Clone): small change as for the below
6207 new init function in the text-inset
6209 * src/insets/insettext.C (init): new function as I've seen that
6210 clone did not copy the Paragraph-Data!
6211 (LocalDispatch): Added code so that now we have some sort of Undo
6212 functionality (well actually we HAVE Undo ;)
6214 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6216 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6218 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6221 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6223 * src/main.C: added a runtime check that verifies that the xforms
6224 header used when building LyX and the library used when running
6225 LyX match. Exit with a message if they don't match. This is a
6226 version number check only.
6228 * src/buffer.C (save): Don't allocate memory on the heap for
6229 struct utimbuf times.
6231 * *: some using changes, use iosfwd instead of the real headers.
6233 * src/lyxfont.C use char const * instead of string for the static
6234 strings. Rewrite some functions to use sstream.
6236 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6238 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6241 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6243 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6244 of Geodesy (from Martin Vermeer)
6246 * lib/layouts/svjour.inc: include file for the Springer svjour
6247 class. It can be used to support journals other than JoG.
6249 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6250 Miskiewicz <misiek@pld.org.pl>)
6251 * lib/reLyX/Makefile.am: ditto.
6253 2000-03-27 Juergen Vigna <jug@sad.it>
6255 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6256 also some modifications with operations on selected text.
6258 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6259 problems with clicking on insets (last famous words ;)
6261 * src/insets/insetcommand.C (draw):
6262 (width): Changed to have a bit of space before and after the inset so
6263 that the blinking cursor can be seen (otherwise it was hidden)
6265 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6267 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6268 would not be added to the link list when an installed gettext (not
6269 part of libc) is found.
6271 2000-03-24 Juergen Vigna <jug@sad.it>
6273 * src/insets/insetcollapsable.C (Edit):
6274 * src/mathed/formula.C (InsetButtonRelease):
6275 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6278 * src/BufferView.C (workAreaButtonPress):
6279 (workAreaButtonRelease):
6280 (checkInsetHit): Finally fixed the clicking on insets be handled
6283 * src/insets/insetert.C (Edit): inserted this call so that ERT
6284 insets work always with LaTeX-font
6286 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6288 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6289 caused lyx to startup with no GUI in place, causing in a crash
6290 upon startup when called with arguments.
6292 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6294 * src/FontLoader.C: better initialization of dummyXFontStruct.
6296 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6298 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6299 for linuxdoc and docbook import and export format options.
6301 * lib/lyxrc.example Example of default values for the previous flags.
6303 * src/lyx_cb.C Use those flags instead of the hardwired values for
6304 linuxdoc and docbook export.
6306 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6309 * src/menus.C Added menus entries for the new import/exports formats.
6311 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6313 * src/lyxrc.*: Added support for running without Gui
6316 * src/FontLoader.C: sensible defaults if no fonts are needed
6318 * src/lyx_cb.C: New function ShowMessage (writes either to the
6319 minibuffer or cout in case of no gui
6320 New function AskOverwrite for common stuff
6321 Consequently various changes to call these functions
6323 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6324 wild guess at sensible screen resolution when having no gui
6326 * src/lyxfont.C: no gui, no fonts... set some defaults
6328 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6330 * src/LColor.C: made the command inset background a bit lighter.
6332 2000-03-20 Hartmut Goebel <goebel@noris.net>
6334 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6335 stdstruct.inc. Koma-Script added some title elements which
6336 otherwise have been listed below "bibliography". This split allows
6337 adding title elements to where they belong.
6339 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6340 define the additional tilte elements and then include
6343 * many other layout files: changed to include stdtitle.inc just
6344 before stdstruct.inc.
6346 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6348 * src/buffer.C: (save) Added the option to store all backup files
6349 in a single directory
6351 * src/lyxrc.[Ch]: Added variable \backupdir_path
6353 * lib/lyxrc.example: Added descriptions of recently added variables
6355 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6356 bibtex inset, not closing the bibtex popup when deleting the inset)
6358 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6360 * src/lyx_cb.C: add a couple using directives.
6362 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6363 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6364 import based on the filename.
6366 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6367 file would be imported at start, if the filename where of a sgml file.
6369 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6371 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6373 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6374 * src/lyxfont.h Replaced the member variable bits.direction by the
6375 member variable lang. Made many changes in other files.
6376 This allows having a multi-lingual document
6378 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6379 that change the current language to <l>.
6380 Removed the command "font-rtl"
6382 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6383 format for Hebrew documents)
6385 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6386 When auto_mathmode is "true", pressing a digit key in normal mode
6387 will cause entering into mathmode.
6388 If auto_mathmode is "rtl" then this behavior will be active only
6389 when writing right-to-left text.
6391 * src/text2.C (InsertStringA) The string is inserted using the
6394 * src/paragraph.C (GetEndLabel) Gives a correct result for
6395 footnote paragraphs.
6397 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6399 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6401 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6402 front of PasteParagraph. Never insert a ' '. This should at least
6403 fix some cause for the segfaults that we have been experiencing,
6404 it also fixes backspace behaviour slightly. (Phu!)
6406 * src/support/lstrings.C (compare_no_case): some change to make it
6407 compile with gcc 2.95.2 and stdlibc++-v3
6409 * src/text2.C (MeltFootnoteEnvironment): change type o
6410 first_footnote_par_is_not_empty to bool.
6412 * src/lyxparagraph.h: make text private. Changes in other files
6414 (fitToSize): new function
6415 (setContentsFromPar): new function
6416 (clearContents): new function
6417 (SetChar): new function
6419 * src/paragraph.C (readSimpleWholeFile): deleted.
6421 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6422 the file, just use a simple string instead. Also read the file in
6423 a more maintainable manner.
6425 * src/text2.C (InsertStringA): deleted.
6426 (InsertStringB): deleted.
6428 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6430 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6431 RedoParagraphs from the doublespace handling part, just set status
6432 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6433 done, but perhaps not like this.)
6435 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6437 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6438 character when inserting an inset.
6440 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6442 * src/bufferparams.C (readLanguage): now takes "default" into
6445 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6446 also initialize the toplevel_keymap with the default bindings from
6449 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6451 * all files using lyxrc: have lyxrc as a real variable and not a
6452 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6455 * src/lyxrc.C: remove double call to defaultKeyBindings
6457 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6458 toolbar defauls using lyxlex. Remove enums, structs, functions
6461 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6462 toolbar defaults. Also store default keybindings in a map.
6464 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6465 storing the toolbar defaults without any xforms dependencies.
6467 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6468 applied. Changed to use iterators.
6470 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6472 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6473 systems that don't have LINGUAS set to begin with.
6475 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6477 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6478 the list by Dekel Tsur.
6480 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6482 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6483 * src/insets/form_graphics.C: ditto.
6485 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6487 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6489 * src/bufferparams.C (readLanguage): use the new language map
6491 * src/intl.C (InitKeyMapper): use the new language map
6493 * src/lyx_gui.C (create_forms): use the new language map
6495 * src/language.[Ch]: New files. Used for holding the information
6496 about each language. Now! Use this new language map enhance it and
6497 make it really usable for our needs.
6499 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6501 * screen.C (ShowCursor): Removed duplicate code.
6502 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6503 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6505 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6508 * src/text.C Added TransformChar method. Used for rendering Arabic
6509 text correctly (change the glyphs of the letter according to the
6510 position in the word)
6515 * src/lyxrc.C Added lyxrc command {language_command_begin,
6516 language_command_end,language_command_ltr,language_command_rtl,
6517 language_package} which allows the use of either arabtex or Omega
6520 * src/lyx_gui.C (init)
6522 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6523 to use encoding for menu fonts which is different than the encoding
6526 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6527 do not load the babel package.
6528 To write an English document with Hebrew/Arabic, change the document
6529 language to "english".
6531 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6532 (alphaCounter): changed to return char
6533 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6535 * lib/lyxrc.example Added examples for Hebrew/Arabic
6538 * src/layout.C Added layout command endlabeltype
6540 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6542 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6544 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6546 * src/mathed/math_delim.C (search_deco): return a
6547 math_deco_struct* instead of index.
6549 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6551 * All files with a USE_OSTREAM_ONLY within: removed all code that
6552 was unused when USE_OSTREAM_ONLY is defined.
6554 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6555 of any less. Removed header and using.
6557 * src/text.C (GetVisibleRow): draw the string "Page Break
6558 (top/bottom)" on screen when drawing a pagebreak line.
6560 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6562 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6564 * src/mathed/math_macro.C (draw): do some cast magic.
6567 * src/mathed/math_defs.h: change byte* argument to byte const*.
6569 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6571 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6572 know it is right to return InsetFoot* too, but cxx does not like
6575 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6577 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6579 * src/mathed/math_delim.C: change == to proper assignment.
6581 2000-03-09 Juergen Vigna <jug@sad.it>
6583 * src/insets/insettext.C (setPos): fixed various cursor positioning
6584 problems (via mouse and cursor-keys)
6585 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6586 inset (still a small display problem but it works ;)
6588 * src/insets/insetcollapsable.C (draw): added button_top_y and
6589 button_bottom_y to have correct values for clicking on the inset.
6591 * src/support/lyxalgo.h: commented out 'using std::less'
6593 2000-03-08 Juergen Vigna <jug@sad.it>
6595 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6596 Button-Release event closes as it is alos the Release-Event
6599 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6601 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6603 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6604 can add multiple spaces in Scrap (literate programming) styles...
6605 which, by the way, is how I got hooked on LyX to begin with.
6607 * src/mathed/formula.C (Write): Added dummy variable to an
6608 inset::Latex() call.
6609 (Latex): Add free_spacing boolean to inset::Latex()
6611 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6613 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6614 virtual function to include the free_spacing boolean from
6615 the containing paragraph's style.
6617 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6618 Added free_spacing boolean arg to match inset.h
6620 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6621 Added free_spacing boolean arg to match inset.h
6623 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6624 Added free_spacing boolean and made sure that if in a free_spacing
6625 paragraph, that we output normal space if there is a protected space.
6627 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6628 Added free_spacing boolean arg to match inset.h
6630 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6631 Added free_spacing boolean arg to match inset.h
6633 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6634 Added free_spacing boolean arg to match inset.h
6636 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6637 Added free_spacing boolean arg to match inset.h
6639 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6640 Added free_spacing boolean arg to match inset.h
6642 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6643 free_spacing boolean arg to match inset.h
6645 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6646 Added free_spacing boolean arg to match inset.h
6648 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6649 Added free_spacing boolean arg to match inset.h
6651 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6652 Added free_spacing boolean arg to match inset.h
6654 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6655 Added free_spacing boolean arg to match inset.h
6657 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6658 Added free_spacing boolean arg to match inset.h
6660 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6661 free_spacing boolean arg to match inset.h
6663 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6664 free_spacing boolean arg to match inset.h
6666 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6667 ignore free_spacing paragraphs. The user's spaces are left
6670 * src/text.C (InsertChar): Fixed the free_spacing layout
6671 attribute behavior. Now, if free_spacing is set, you can
6672 add multiple spaces in a paragraph with impunity (and they
6673 get output verbatim).
6674 (SelectSelectedWord): Added dummy argument to inset::Latex()
6677 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6680 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6681 paragraph layouts now only input a simple space instead.
6682 Special character insets don't make any sense in free-spacing
6685 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6686 hard-spaces in the *input* file to simple spaces if the layout
6687 is free-spacing. This converts old files which had to have
6688 hard-spaces in free-spacing layouts where a simple space was
6690 (writeFileAscii): Added free_spacing check to pass to the newly
6691 reworked inset::Latex(...) methods. The inset::Latex() code
6692 ensures that hard-spaces in free-spacing paragraphs get output
6693 as spaces (rather than "~").
6695 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6697 * src/mathed/math_delim.C (draw): draw the empty placeholder
6698 delims with a onoffdash line.
6699 (struct math_deco_compare): struct that holds the "functors" used
6700 for the sort and the binary search in math_deco_table.
6701 (class init_deco_table): class used for initial sort of the
6703 (search_deco): use lower_bound to do a binary search in the
6706 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6708 * src/lyxrc.C: a small secret thingie...
6710 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6711 and to not flush the stream as often as it used to.
6713 * src/support/lyxalgo.h: new file
6714 (sorted): template function used for checking if a sequence is
6715 sorted or not. Two versions with and without user supplied
6716 compare. Uses same compare as std::sort.
6718 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6719 it and give warning on lyxerr.
6721 (struct compare_tags): struct with function operators used for
6722 checking if sorted, sorting and lower_bound.
6723 (search_kw): use lower_bound instead of manually implemented
6726 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6728 * src/insets/insetcollapsable.h: fix Clone() declaration.
6729 * src/insets/insetfoot.h: ditto.
6731 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6733 2000-03-08 Juergen Vigna <jug@sad.it>
6735 * src/insets/lyxinset.h: added owner call which tells us if
6736 this inset is inside another inset. Changed also the return-type
6737 of Editable to an enum so it tells clearer what the return-value is.
6739 * src/insets/insettext.C (computeTextRows): fixed computing of
6740 textinsets which split automatically on more rows.
6742 * src/insets/insetert.[Ch]: changed this to be of BaseType
6745 * src/insets/insetfoot.[Ch]: added footnote inset
6747 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6748 collapsable insets (like footnote, ert, ...)
6750 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6752 * src/lyxdraw.h: remvoe file
6754 * src/lyxdraw.C: remove file
6756 * src/insets/insettext.C: added <algorithm>.
6758 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6760 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6761 (matrix_cb): case MM_OK use string stream
6763 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6766 * src/mathed/math_macro.C (draw): use string stream
6767 (Metrics): use string stream
6769 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6770 directly to the ostream.
6772 * src/vspace.C (asString): use string stream.
6773 (asString): use string stream
6774 (asLatexString): use string stream
6776 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6777 setting Spacing::Other.
6779 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6780 sprintf when creating the stretch vale.
6782 * src/text2.C (alphaCounter): changed to return a string and to
6783 not use a static variable internally. Also fixed a one-off bug.
6784 (SetCounter): changed the drawing of the labels to use string
6785 streams instead of sprintf.
6787 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6788 manipulator to use a scheme that does not require library support.
6789 This is also the way it is done in the new GNU libstdc++. Should
6790 work with DEC cxx now.
6792 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6794 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6795 end. This fixes a bug.
6797 * src/mathed (all files concerned with file writing): apply the
6798 USE_OSTREAM_ONLY changes to mathed too.
6800 * src/support/DebugStream.h: make the constructor explicit.
6802 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6803 count and ostream squashed.
6805 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6807 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6809 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6810 ostringstream uses STL strings, and we might not.
6812 * src/insets/insetspecialchar.C: add using directive.
6813 * src/insets/insettext.C: ditto.
6815 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6817 * lib/layouts/seminar.layout: feeble attempt at a layout for
6818 seminar.cls, far from completet and could really use some looking
6819 at from people used to write layout files.
6821 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6822 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6823 a lot nicer and works nicely with ostreams.
6825 * src/mathed/formula.C (draw): a slightly different solution that
6826 the one posted to the list, but I think this one works too. (font
6827 size wrong in headers.)
6829 * src/insets/insettext.C (computeTextRows): some fiddling on
6830 Jürgens turf, added some comments that he should read.
6832 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6833 used and it gave compiler warnings.
6834 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6837 * src/lyx_gui.C (create_forms): do the right thing when
6838 show_banner is true/false.
6840 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6841 show_banner is false.
6843 * most file writing files: Now use iostreams to do almost all of
6844 the writing. Also instead of passing string &, we now use
6845 stringstreams. mathed output is still not adapted to iostreams.
6846 This change can be turned off by commenting out all the occurences
6847 of the "#define USE_OSTREAM_ONLY 1" lines.
6849 * src/WorkArea.C (createPixmap): don't output debug messages.
6850 (WorkArea): don't output debug messages.
6852 * lib/lyxrc.example: added a comment about the new variable
6855 * development/Code_rules/Rules: Added some more commente about how
6856 to build class interfaces and on how better encapsulation can be
6859 2000-03-03 Juergen Vigna <jug@sad.it>
6861 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6862 automatically with the width of the LyX-Window
6864 * src/insets/insettext.C (computeTextRows): fixed update bug in
6865 displaying text-insets (scrollvalues where not initialized!)
6867 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6869 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6870 id in the check of the result from lower_bound is not enough since
6871 lower_bound can return last too, and then res->id will not be a
6874 * all insets and some code that use them: I have conditionalized
6875 removed the Latex(string & out, ...) this means that only the
6876 Latex(ostream &, ...) will be used. This is a work in progress to
6877 move towards using streams for all output of files.
6879 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6882 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6884 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6885 routine (this fixes bug where greek letters were surrounded by too
6888 * src/support/filetools.C (findtexfile): change a bit the search
6889 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6890 no longer passed to kpsewhich, we may have to change that later.
6892 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6893 warning options to avoid problems with X header files (from Angus
6895 * acinclude.m4: regenerated.
6897 2000-03-02 Juergen Vigna <jug@sad.it>
6899 * src/insets/insettext.C (WriteParagraphData): Using the
6900 par->writeFile() function for writing paragraph-data.
6901 (Read): Using buffer->parseSingleLyXformat2Token()-function
6902 for parsing paragraph data!
6904 * src/buffer.C (readLyXformat2): removed all parse data and using
6905 the new parseSingleLyXformat2Token()-function.
6906 (parseSingleLyXformat2Token): added this function to parse (read)
6907 lyx-file-format (this is called also from text-insets now!)
6909 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6911 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6914 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6915 directly instead of going through a func. One very bad thing: a
6916 static LyXFindReplace, but I don't know where to place it.
6918 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6919 string instead of char[]. Also changed to static.
6920 (GetSelectionOrWordAtCursor): changed to static inline
6921 (SetSelectionOverLenChars): ditto.
6923 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6924 current_view and global variables. both classes has changed names
6925 and LyXFindReplace is not inherited from SearchForm.
6927 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6928 fl_form_search form.
6930 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6932 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6934 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6935 bound (from Kayvan).
6937 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6939 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6941 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * some things that I should comment but the local pub says head to
6946 * comment out all code that belongs to the Roff code for Ascii
6947 export of tables. (this is unused)
6949 * src/LyXView.C: use correct type for global variable
6950 current_layout. (LyXTextClass::size_type)
6952 * some code to get the new insetgraphics closer to working I'd be
6953 grateful for any help.
6955 * src/BufferView2.C (insertInset): use the return type of
6956 NumberOfLayout properly. (also changes in other files)
6958 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6959 this as a test. I want to know what breaks because of this.
6961 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6963 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6965 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6966 to use a \makebox in the label, this allows proper justification
6967 with out using protected spaces or multiple hfills. Now it is
6968 "label" for left justified, "\hfill label\hfill" for center, and
6969 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6970 should be changed accordingly.
6972 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6974 * src/lyxtext.h: change SetLayout() to take a
6975 LyXTextClass::size_type instead of a char (when there is more than
6976 127 layouts in a class); also change type of copylayouttype.
6977 * src/text2.C (SetLayout): ditto.
6978 * src/LyXView.C (updateLayoutChoice): ditto.
6980 * src/LaTeX.C (scanLogFile): errors where the line number was not
6981 given just after the '!'-line were ignored (from Dekel Tsur).
6983 * lib/lyxrc.example: fix description of \date_insert_format
6985 * lib/layouts/llncs.layout: new layout, contributed by Martin
6988 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6990 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6991 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6992 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6993 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6994 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6995 paragraph.C, text.C, text2.C)
6997 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6999 * src/insets/insettext.C (LocalDispatch): remove extra break
7002 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7003 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7005 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7006 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7008 * src/insets/insetbib.h: move InsetBibkey::Holder and
7009 InsetCitation::Holder in public space.
7011 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7013 * src/insets/insettext.h: small change to get the new files from
7014 Juergen to compile (use "string", not "class string").
7016 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7017 const & as parameter to LocalDispatch, use LyXFont const & as
7018 paramter to some other func. This also had impacto on lyxinsets.h
7019 and the two mathed insets.
7021 2000-02-24 Juergen Vigna <jug@sad.it>
7024 * src/commandtags.h:
7026 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7030 * src/BufferView2.C: added/updated code for various inset-functions
7032 * src/insets/insetert.[Ch]: added implementation of InsetERT
7034 * src/insets/insettext.[Ch]: added implementation of InsetText
7036 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7037 (draw): added preliminary code for inset scrolling not finshed yet
7039 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7040 as it is in lyxfunc.C now
7042 * src/insets/lyxinset.h: Added functions for text-insets
7044 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7046 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7047 BufferView and reimplement the list as a queue put inside its own
7050 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7052 * several files: use the new interface to the "updateinsetlist"
7054 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7056 (work_area_handler): call BufferView::trippleClick on trippleclick.
7058 * src/BufferView.C (doubleClick): new function, selects word on
7060 (trippleClick): new function, selects line on trippleclick.
7062 2000-02-22 Allan Rae <rae@lyx.org>
7064 * lib/bind/xemacs.bind: buffer-previous not supported
7066 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7068 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7071 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7073 * src/bufferlist.C: get rid of current_view from this file
7075 * src/spellchecker.C: get rid of current_view from this file
7077 * src/vspace.C: get rid of current_view from this file
7078 (inPixels): added BufferView parameter for this func
7079 (asLatexCommand): added a BufferParams for this func
7081 * src/text.C src/text2.C: get rid of current_view from these
7084 * src/lyxfont.C (getFontDirection): move this function here from
7087 * src/bufferparams.C (getDocumentDirection): move this function
7090 * src/paragraph.C (getParDirection): move this function here from
7092 (getLetterDirection): ditto
7094 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7096 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7097 resize due to wrong pixmap beeing used. Also took the opurtunity
7098 to make the LyXScreen stateless on regard to WorkArea and some
7099 general cleanup in the same files.
7101 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7103 * src/Makefile.am: add missing direction.h
7105 * src/PainterBase.h: made the width functions const.
7107 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7110 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7112 * src/insets/insetlatexaccent.C (draw): make the accents draw
7113 better, at present this will only work well with iso8859-1.
7115 * several files: remove the old drawing code, now we use the new
7118 * several files: remove support for mono_video, reverse_video and
7121 2000-02-17 Juergen Vigna <jug@sad.it>
7123 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7124 int ** as we have to return the pointer, otherwise we have only
7125 NULL pointers in the returning function.
7127 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7129 * src/LaTeX.C (operator()): quote file name when running latex.
7131 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7133 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7134 (bubble tip), this removes our special handling of this.
7136 * Remove all code that is unused now that we have the new
7137 workarea. (Code that are not active when NEW_WA is defined.)
7139 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7141 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7143 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7144 nonexisting layout; correctly redirect obsoleted layouts.
7146 * lib/lyxrc.example: document \view_dvi_paper_option
7148 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7151 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7152 (PreviewDVI): handle the view_dvi_paper_option variable.
7153 [Both from Roland Krause]
7155 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7157 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7158 char const *, int, LyXFont)
7159 (text(int, int, string, LyXFont)): ditto
7161 * src/text.C (InsertCharInTable): attempt to fix the double-space
7162 feature in tables too.
7163 (BackspaceInTable): ditto.
7164 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7166 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7168 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7170 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7171 newly found text in textcache to this.
7172 (buffer): set the owner of the text put into the textcache to 0
7174 * src/insets/figinset.C (draw): fixed the drawing of figures with
7177 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7178 drawing of mathframe, hfills, protected space, table lines. I have
7179 now no outstanding drawing problems with the new Painter code.
7181 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7183 * src/PainterBase.C (ellipse, circle): do not specify the default
7186 * src/LColor.h: add using directive.
7188 * src/Painter.[Ch]: change return type of methods from Painter& to
7189 PainterBase&. Add a using directive.
7191 * src/WorkArea.C: wrap xforms callbacks in C functions
7194 * lib/layouts/foils.layout: font fix and simplifications from Carl
7197 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7199 * a lot of files: The Painter, LColor and WorkArea from the old
7200 devel branch has been ported to lyx-devel. Some new files and a
7201 lot of #ifdeffed code. The new workarea is enabled by default, but
7202 if you want to test the new Painter and LColor you have to compile
7203 with USE_PAINTER defined (do this in config.h f.ex.) There are
7204 still some rought edges, and I'd like some help to clear those
7205 out. It looks stable (loads and displays the Userguide very well).
7208 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7210 * src/buffer.C (pop_tag): revert to the previous implementation
7211 (use a global variable for both loops).
7213 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7215 * src/lyxrc.C (LyXRC): change slightly default date format.
7217 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7218 there is an English text with a footnote that starts with a Hebrew
7219 paragraph, or vice versa.
7220 (TeXFootnote): ditto.
7222 * src/text.C (LeftMargin): allow for negative values for
7223 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7226 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7227 for input encoding (cyrillic)
7229 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7231 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7234 * src/toolbar.C (set): ditto
7235 * src/insets/insetbib.C (create_form_citation_form): ditto
7237 * lib/CREDITS: added Dekel Tsur.
7239 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7240 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7241 hebrew supports files from Dekel Tsur.
7243 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7244 <tzafrir@technion.ac.il>
7246 * src/lyxrc.C: put \date_insert_format at the right place.
7248 * src/buffer.C (makeLaTeXFile): fix the handling of
7249 BufferParams::sides when writing out latex files.
7251 * src/BufferView2.C: add a "using" directive.
7253 * src/support/lyxsum.C (sum): when we use lyxstring,
7254 ostringstream::str needs an additional .c_str().
7256 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7258 * src/support/filetools.C (ChangeExtension): patch from Etienne
7261 * src/TextCache.C (show): remove const_cast and make second
7262 parameter non-const LyXText *.
7264 * src/TextCache.h: use non const LyXText in show.
7266 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7269 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7271 * src/support/lyxsum.C: rework to be more flexible.
7273 * several places: don't check if a pointer is 0 if you are going
7276 * src/text.C: remove some dead code.
7278 * src/insets/figinset.C: remove some dead code
7280 * src/buffer.C: move the BufferView funcs to BufferView2.C
7281 remove all support for insetlatexdel
7282 remove support for oldpapersize stuff
7283 made some member funcs const
7285 * src/kbmap.C: use a std::list to store the bindings in.
7287 * src/BufferView2.C: new file
7289 * src/kbsequence.[Ch]: new files
7291 * src/LyXAction.C + others: remove all trace of buffer-previous
7293 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7294 only have one copy in the binary of this table.
7296 * hebrew patch: moved some functions from LyXText to more
7297 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7299 * several files: remove support for XForms older than 0.88
7301 remove some #if 0 #endif code
7303 * src/TextCache.[Ch]: new file. Holds the textcache.
7305 * src/BufferView.C: changes to use the new TextCache interface.
7306 (waitForX): remove the now unused code.
7308 * src/BackStack.h: remove some commented code
7310 * lib/bind/emacs.bind: remove binding for buffer-previous
7312 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7314 * applied the hebrew patch.
7316 * src/lyxrow.h: make sure that all Row variables are initialized.
7318 * src/text2.C (TextHandleUndo): comment out a delete, this might
7319 introduce a memory leak, but should also help us to not try to
7320 read freed memory. We need to look at this one.
7322 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7323 (LyXParagraph): initalize footnotekind.
7325 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7326 forgot this when applying the patch. Please heed the warnings.
7328 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7329 (aka. reformat problem)
7331 * src/bufferlist.C (exists): made const, and use const_iterator
7332 (isLoaded): new func.
7333 (release): use std::find to find the correct buffer.
7335 * src/bufferlist.h: made getState a const func.
7336 made empty a const func.
7337 made exists a const func.
7340 2000-02-01 Juergen Vigna <jug@sad.it>
7342 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7344 * po/it.po: updated a bit the italian po file and also changed the
7345 'file nuovo' for newfile to 'filenuovo' without a space, this did
7348 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7349 for the new insert_date command.
7351 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7352 from jdblair, to insert a date into the current text conforming to
7353 a strftime format (for now only considering the locale-set and not
7354 the document-language).
7356 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7358 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7359 Bounds Read error seen by purify. The problem was that islower is
7360 a macros which takes an unsigned char and uses it as an index for
7361 in array of characters properties (and is thus subject to the
7365 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7366 correctly the paper sides radio buttons.
7367 (UpdateDocumentButtons): ditto.
7369 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7371 * src/kbmap.C (getsym + others): change to return unsigned int,
7372 returning a long can give problems on 64 bit systems. (I assume
7373 that int is 32bit on 64bit systems)
7375 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7377 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7378 LyXLookupString to be zero-terminated. Really fixes problems seen
7381 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7383 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7384 write a (char*)0 to the lyxerr stream.
7386 * src/lastfiles.C: move algorithm before the using statemets.
7388 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7390 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7391 complains otherwise).
7392 * src/table.C: ditto
7394 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7397 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7398 that I removed earlier... It is really needed.
7400 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7402 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7404 * INSTALL: update xforms home page URL.
7406 * lib/configure.m4: fix a bug with unreadable layout files.
7408 * src/table.C (calculate_width_of_column): add "using std::max"
7411 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7413 * several files: marked several lines with "DEL LINE", this is
7414 lines that can be deleted without changing anything.
7415 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7416 checks this anyway */
7419 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7421 * src/DepTable.C (update): add a "+" at the end when the checksum
7422 is different. (debugging string only)
7424 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7425 the next inset to not be displayed. This should also fix the list
7426 of labels in the "Insert Crossreference" dialog.
7428 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7430 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7431 when regex was not found.
7433 * src/support/lstrings.C (lowercase): use handcoded transform always.
7436 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7437 old_cursor.par->prev could be 0.
7439 * several files: changed post inc/dec to pre inc/dec
7441 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7442 write the lastfiles to file.
7444 * src/BufferView.C (buffer): only show TextCache info when debugging
7446 (resizeCurrentBuffer): ditto
7447 (workAreaExpose): ditto
7449 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7451 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7453 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7454 a bit better by removing the special case for \i and \j.
7456 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7458 * src/lyx_main.C (easyParse): remove test for bad comand line
7459 options, since this broke all xforms-related parsing.
7461 * src/kbmap.C (getsym): set return type to unsigned long, as
7462 declared in header. On an alpha, long is _not_ the same as int.
7464 * src/support/LOstream.h: add a "using std::flush;"
7466 * src/insets/figinset.C: ditto.
7468 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7470 * src/bufferlist.C (write): use blinding fast file copy instead of
7471 "a char at a time", now we are doing it the C++ way.
7473 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7474 std::list<int> instead.
7475 (addpidwait): reflect move to std::list<int>
7476 (sigchldchecker): ditto
7478 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7481 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7482 that obviously was wrong...
7484 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7485 c, this avoids warnings with purify and islower.
7487 * src/insets/figinset.C: rename struct queue to struct
7488 queue_element and rewrite to use a std::queue. gsqueue is now a
7489 std::queue<queue_element>
7490 (runqueue): reflect move to std::queue
7493 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7494 we would get "1" "0" instead of "true" "false. Also make the tostr
7497 2000-01-21 Juergen Vigna <jug@sad.it>
7499 * src/buffer.C (writeFileAscii): Disabled code for special groff
7500 handling of tabulars till I fix this in table.C
7502 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7504 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7506 * src/support/lyxlib.h: ditto.
7508 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7510 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7511 and 'j' look better. This might fix the "macron" bug that has been
7514 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7515 functions as one template function. Delete the old versions.
7517 * src/support/lyxsum.C: move using std::ifstream inside
7520 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7523 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7525 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7527 * src/insets/figinset.C (InitFigures): use new instead of malloc
7528 to allocate memory for figures and bitmaps.
7529 (DoneFigures): use delete[] instead of free to deallocate memory
7530 for figures and bitmaps.
7531 (runqueue): use new to allocate
7532 (getfigdata): use new/delete[] instead of malloc/free
7533 (RegisterFigure): ditto
7535 * some files: moved some declarations closer to first use, small
7536 whitespace changes use preincrement instead of postincrement where
7537 it does not make a difference.
7539 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7540 step on the way to use stl::containers for key maps.
7542 * src/bufferlist.h: add a typedef for const_iterator and const
7543 versions of begin and end.
7545 * src/bufferlist.[Ch]: change name of member variable _state to
7546 state_. (avoid reserved names)
7548 (getFileNames): returns the filenames of the buffers in a vector.
7550 * configure.in (ALL_LINGUAS): added ro
7552 * src/support/putenv.C: new file
7554 * src/support/mkdir.C: new file
7556 2000-01-20 Allan Rae <rae@lyx.org>
7558 * lib/layouts/IEEEtran.layout: Added several theorem environments
7560 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7561 couple of minor additions.
7563 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7564 (except for those in footnotes of course)
7566 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7568 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7570 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7571 std::sort and std::lower_bound instead of qsort and handwritten
7573 (struct compara): struct that holds the functors used by std::sort
7574 and std::lower_bound in MathedLookupBOP.
7576 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7578 * src/support/LAssert.h: do not do partial specialization. We do
7581 * src/support/lyxlib.h: note that lyx::getUserName() and
7582 lyx::date() are not in use right now. Should these be suppressed?
7584 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7585 (makeLinuxDocFile): do not put date and user name in linuxdoc
7588 * src/support/lyxlib.h (kill): change first argument to long int,
7589 since that's what solaris uses.
7591 * src/support/kill.C (kill): fix declaration to match prototype.
7593 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7594 actually check whether namespaces are supported. This is not what
7597 * src/support/lyxsum.C: add a using directive.
7599 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7601 * src/support/kill.C: if we have namespace support we don't have
7602 to include lyxlib.h.
7604 * src/support/lyxlib.h: use namespace lyx if supported.
7606 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7608 * src/support/date.C: new file
7610 * src/support/chdir.C: new file
7612 * src/support/getUserName.C: new file
7614 * src/support/getcwd.C: new file
7616 * src/support/abort.C: new file
7618 * src/support/kill.C: new file
7620 * src/support/lyxlib.h: moved all the functions in this file
7621 insede struct lyx. Added also kill and abort to this struct. This
7622 is a way to avoid the "kill is not defined in <csignal>", we make
7623 C++ wrappers for functions that are not ANSI C or ANSI C++.
7625 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7626 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7627 lyx it has been renamed to sum.
7629 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7631 * src/text.C: add using directives for std::min and std::max.
7633 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7635 * src/texrow.C (getIdFromRow): actually return something useful in
7636 id and pos. Hopefully fixes the bug with positionning of errorbox
7639 * src/lyx_main.C (easyParse): output an error and exit if an
7640 incorrect command line option has been given.
7642 * src/spellchecker.C (ispell_check_word): document a memory leak.
7644 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7645 where a "struct utimbuf" is allocated with "new" and deleted with
7648 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7650 * src/text2.C (CutSelection): don't delete double spaces.
7651 (PasteSelection): ditto
7652 (CopySelection): ditto
7654 * src/text.C (Backspace): don't delete double spaces.
7656 * src/lyxlex.C (next): fix a bug that were only present with
7657 conformant std::istream::get to read comment lines, use
7658 std::istream::getline instead. This seems to fix the problem.
7660 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7662 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7663 allowed to insert space before space" editing problem. Please read
7664 commends at the beginning of the function. Comments about usage
7667 * src/text.C (InsertChar): fix for the "not allowed to insert
7668 space before space" editing problem.
7670 * src/text2.C (DeleteEmptyParagraphMechanism): when
7671 IsEmptyTableRow can only return false this last "else if" will
7672 always be a no-op. Commented out.
7674 * src/text.C (RedoParagraph): As far as I can understand tmp
7675 cursor is not really needed.
7677 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7678 present it could only return false anyway.
7679 (several functions): Did something not so smart...added a const
7680 specifier on a lot of methods.
7682 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7683 and add a tmp->text.resize. The LyXParagraph constructor does the
7685 (BreakParagraphConservative): ditto
7687 * src/support/path.h (Path): add a define so that the wrong usage
7688 "Path("/tmp") will be flagged as a compilation error:
7689 "`unnamed_Path' undeclared (first use this function)"
7691 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7693 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7694 which was bogus for several reasons.
7696 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7700 * autogen.sh: do not use "type -path" (what's that anyway?).
7702 * src/support/filetools.C (findtexfile): remove extraneous space
7703 which caused a kpsewhich warning (at least with kpathsea version
7706 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7708 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7710 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7712 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7714 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7716 * src/paragraph.C (BreakParagraph): do not reserve space on text
7717 if we don't need to (otherwise, if pos_end < pos, we end up
7718 reserving huge amounts of memory due to bad unsigned karma).
7719 (BreakParagraphConservative): ditto, although I have not seen
7720 evidence the bug can happen here.
7722 * src/lyxparagraph.h: add a using std::list.
7724 2000-01-11 Juergen Vigna <jug@sad.it>
7726 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7729 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7731 * src/vc-backend.C (doVCCommand): change to be static and take one
7732 more parameter: the path to chdir too be fore executing the command.
7733 (retrive): new function equiv to "co -r"
7735 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7736 file_not_found_hook is true.
7738 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7740 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7741 if a file is readwrite,readonly...anything else.
7743 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7745 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7746 (CreatePostscript): name change from MenuRunDVIPS (or something)
7747 (PreviewPostscript): name change from MenuPreviewPS
7748 (PreviewDVI): name change from MenuPreviewDVI
7750 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7751 \view_pdf_command., \pdf_to_ps_command
7753 * lib/configure.m4: added search for PDF viewer, and search for
7754 PDF to PS converter.
7755 (lyxrc.defaults output): add \pdflatex_command,
7756 \view_pdf_command and \pdf_to_ps_command.
7758 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7760 * src/bufferlist.C (write): we don't use blocksize for anything so
7763 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7765 * src/support/block.h: disable operator T* (), since it causes
7766 problems with both compilers I tried. See comments in the file.
7768 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7771 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7772 variable LYX_DIR_10x to LYX_DIR_11x.
7774 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7776 * INSTALL: document --with-lyxname.
7779 * configure.in: new configure flag --with-lyxname which allows to
7780 choose the name under which lyx is installed. Default is "lyx", of
7781 course. It used to be possible to do this with --program-suffix,
7782 but the later has in fact a different meaning for autoconf.
7784 * src/support/lstrings.h (lstrchr): reformat a bit.
7786 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7787 * src/mathed/math_defs.h: ditto.
7789 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7791 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7792 true, decides if we create a backup file or not when saving. New
7793 tag and variable \pdf_mode, defaults to false. New tag and
7794 variable \pdflatex_command, defaults to pdflatex. New tag and
7795 variable \view_pdf_command, defaults to xpdf. New tag and variable
7796 \pdf_to_ps_command, defaults to pdf2ps.
7798 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7800 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7801 does not have a BufferView.
7802 (unlockInset): ditto + don't access the_locking_inset if the
7803 buffer does not have a BufferView.
7805 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7806 certain circumstances so that we don't continue a keyboard
7807 operation long after the key was released. Try f.ex. to load a
7808 large document, press PageDown for some seconds and then release
7809 it. Before this change the document would contine to scroll for
7810 some time, with this change it stops imidiatly.
7812 * src/support/block.h: don't allocate more space than needed. As
7813 long as we don't try to write to the arr[x] in a array_type arr[x]
7814 it is perfectly ok. (if you write to it you might segfault).
7815 added operator value_type*() so that is possible to pass the array
7816 to functions expecting a C-pointer.
7818 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7821 * intl/*: updated to gettext 0.10.35, tried to add our own
7822 required modifications. Please verify.
7824 * po/*: updated to gettext 0.10.35, tried to add our own required
7825 modifications. Please verify.
7827 * src/support/lstrings.C (tostr): go at fixing the problem with
7828 cxx and stringstream. When stringstream is used return
7829 oss.str().c_str() so that problems with lyxstring and basic_string
7830 are avoided. Note that the best solution would be for cxx to use
7831 basic_string all the way, but it is not conformant yet. (it seems)
7833 * src/lyx_cb.C + other files: moved several global functions to
7834 class BufferView, some have been moved to BufferView.[Ch] others
7835 are still located in lyx_cb.C. Code changes because of this. (part
7836 of "get rid of current_view project".)
7838 * src/buffer.C + other files: moved several Buffer functions to
7839 class BufferView, the functions are still present in buffer.C.
7840 Code changes because of this.
7842 * config/lcmessage.m4: updated to most recent. used when creating
7845 * config/progtest.m4: updated to most recent. used when creating
7848 * config/gettext.m4: updated to most recent. applied patch for
7851 * config/gettext.m4.patch: new file that shows what changes we
7852 have done to the local copy of gettext.m4.
7854 * config/libtool.m4: new file, used in creation of acinclude.m4
7856 * config/lyxinclude.m4: new file, this is the lyx created m4
7857 macros, used in making acinclude.m4.
7859 * autogen.sh: GNU m4 discovered as a separate task not as part of
7860 the lib/configure creation.
7861 Generate acinlucde from files in config. Actually cat
7862 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7863 easier to upgrade .m4 files that really are external.
7865 * src/Spacing.h: moved using std::istringstream to right after
7866 <sstream>. This should fix the problem seen with some compilers.
7868 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7870 * src/lyx_cb.C: began some work to remove the dependency a lot of
7871 functions have on BufferView::text, even if not really needed.
7872 (GetCurrentTextClass): removed this func, it only hid the
7875 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7876 forgot this in last commit.
7878 * src/Bullet.C (bulletEntry): use static char const *[] for the
7879 tables, becuase of this the return arg had to change to string.
7881 (~Bullet): removed unneeded destructor
7883 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7884 (insetSleep): moved from Buffer
7885 (insetWakeup): moved from Buffer
7886 (insetUnlock): moved from Buffer
7888 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7889 from Buffer to BufferView.
7891 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7893 * config/ltmain.sh: updated to version 1.3.4 of libtool
7895 * config/ltconfig: updated to version 1.3.4 of libtool
7897 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7900 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7901 Did I get that right?
7903 * src/lyxlex.h: add a "using" directive or two.
7904 * src/Spacing.h: ditto.
7905 * src/insets/figinset.C: ditto.
7906 * src/support/filetools.C: ditto.
7907 * src/support/lstrings.C: ditto.
7908 * src/BufferView.C: ditto.
7909 * src/bufferlist.C: ditto.
7910 * src/lyx_cb.C: ditto.
7911 * src/lyxlex.C: ditto.
7913 * NEWS: add some changes for 1.1.4.
7915 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7917 * src/BufferView.C: first go at a TextCache to speed up switching
7920 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7922 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7923 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7924 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7925 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7928 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7929 members of the struct are correctly initialized to 0 (detected by
7931 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7932 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7934 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7935 pidwait, since it was allocated with "new". This was potentially
7936 very bad. Thanks to Michael Schmitt for running purify for us.
7939 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7941 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7943 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7945 1999-12-30 Allan Rae <rae@lyx.org>
7947 * lib/templates/IEEEtran.lyx: minor change
7949 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7950 src/mathed/formula.C (LocalDispatch): askForText changes
7952 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7953 know when a user has cancelled input. Fixes annoying problems with
7954 inserting labels and version control.
7956 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7958 * src/support/lstrings.C (tostr): rewritten to use strstream and
7961 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7963 * src/support/filetools.C (IsFileWriteable): use fstream to check
7964 (IsDirWriteable): use fileinfo to check
7966 * src/support/filetools.h (FilePtr): whole class deleted
7968 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7970 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7972 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7974 * src/bufferlist.C (write): use ifstream and ofstream instead of
7977 * src/Spacing.h: use istrstream instead of sscanf
7979 * src/mathed/math_defs.h: change first arg to istream from FILE*
7981 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7983 * src/mathed/math_parser.C: have yyis to be an istream
7984 (LexGetArg): use istream (yyis)
7986 (mathed_parse): ditto
7987 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7989 * src/mathed/formula.C (Read): rewritten to use istream
7991 * src/mathed/formulamacro.C (Read): rewritten to use istream
7993 * src/lyxlex.h (~LyXLex): deleted desturctor
7994 (getStream): new function, returns an istream
7995 (getFile): deleted funtion
7996 (IsOK): return is.good();
7998 * src/lyxlex.C (LyXLex): delete file and owns_file
7999 (setFile): open an filebuf and assign that to a istream instead of
8001 (setStream): new function, takes an istream as arg.
8002 (setFile): deleted function
8003 (EatLine): rewritten us use istream instead of FILE*
8007 * src/table.C (LyXTable): use istream instead of FILE*
8008 (Read): rewritten to take an istream instead of FILE*
8010 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8012 * src/buffer.C (Dispatch): remove an extraneous break statement.
8014 * src/support/filetools.C (QuoteName): change to do simple
8015 'quoting'. More work is necessary. Also changed to do nothing
8016 under emx (needs fix too).
8017 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8019 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8020 config.h.in to the AC_DEFINE_UNQUOTED() call.
8021 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8022 needs char * as argument (because Solaris 7 declares it like
8025 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8026 remove definition of BZERO.
8028 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8030 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8031 defined, "lyxregex.h" if not.
8033 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8035 (REGEX): new variable that is set to regex.c lyxregex.h when
8036 AM_CONDITIONAL USE_REGEX is set.
8037 (libsupport_la_SOURCES): add $(REGEX)
8039 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8042 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8045 * configure.in: add call to LYX_REGEX
8047 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8048 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8050 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8052 * lib/bind/fi_menus.bind: new file, from
8053 pauli.virtanen@saunalahti.fi.
8055 * src/buffer.C (getBibkeyList): pass the parameter delim to
8056 InsetInclude::getKeys and InsetBibtex::getKeys.
8058 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8059 is passed to Buffer::getBibkeyList
8061 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8062 instead of the hardcoded comma.
8064 * src/insets/insetbib.C (getKeys): make sure that there are not
8065 leading blanks in bibtex keys. Normal latex does not care, but
8066 harvard.sty seems to dislike blanks at the beginning of citation
8067 keys. In particular, the retturn value of the function is
8069 * INSTALL: make it clear that libstdc++ is needed and that gcc
8070 2.7.x probably does not work.
8072 * src/support/filetools.C (findtexfile): make debug message go to
8074 * src/insets/insetbib.C (getKeys): ditto
8076 * src/debug.C (showTags): make sure that the output is correctly
8079 * configure.in: add a comment for TWO_COLOR_ICON define.
8081 * acconfig.h: remove all the entries that already defined in
8082 configure.in or acinclude.m4.
8084 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8085 to avoid user name, date and copyright.
8087 1999-12-21 Juergen Vigna <jug@sad.it>
8089 * src/table.C (Read): Now read bogus row format informations
8090 if the format is < 5 so that afterwards the table can
8091 be read by lyx but without any format-info. Fixed the
8092 crash we experienced when not doing this.
8094 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8096 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8097 (RedoDrawingOfParagraph): ditto
8098 (RedoParagraphs): ditto
8099 (RemoveTableRow): ditto
8101 * src/text.C (Fill): rename arg paperwidth -> paper_width
8103 * src/buffer.C (insertLyXFile): rename var filename -> fname
8104 (writeFile): rename arg filename -> fname
8105 (writeFileAscii): ditto
8106 (makeLaTeXFile): ditto
8107 (makeLinuxDocFile): ditto
8108 (makeDocBookFile): ditto
8110 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8113 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8115 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8118 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8119 compiled by a C compiler not C++.
8121 * src/layout.h (LyXTextClass): added typedef for const_iterator
8122 (LyXTextClassList): added typedef for const_iterator + member
8123 functions begin and end.
8125 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8126 iterators to fill the choice_class.
8127 (updateLayoutChoice): rewritten to use iterators to fill the
8128 layoutlist in the toolbar.
8130 * src/BufferView.h (BufferView::work_area_width): removed unused
8133 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8135 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8136 (sgmlCloseTag): ditto
8138 * src/support/lstrings.h: return type of countChar changed to
8141 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8142 what version of this func to use. Also made to return unsigned int.
8144 * configure.in: call LYX_STD_COUNT
8146 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8147 conforming std::count.
8149 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8151 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8152 and a subscript would give bad display (patch from Dekel Tsur
8153 <dekel@math.tau.ac.il>).
8155 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8157 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8160 * src/chset.h: add a few 'using' directives
8162 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8163 triggered when no buffer is active
8165 * src/layout.C: removed `break' after `return' in switch(), since
8168 * src/lyx_main.C (init): make sure LyX can be ran in place even
8169 when libtool has done its magic with shared libraries. Fix the
8170 test for the case when the system directory has not been found.
8172 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8173 name for the latex file.
8174 (MenuMakeHTML): ditto
8176 * src/buffer.h: add an optional boolean argument, which is passed
8179 1999-12-20 Allan Rae <rae@lyx.org>
8181 * lib/templates/IEEEtran.lyx: small correction and update.
8183 * configure.in: Attempted to use LYX_PATH_HEADER
8185 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8187 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8188 input from JMarc. Now use preprocessor to find the header.
8189 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8190 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8191 LYX_STL_STRING_FWD. See comments in file.
8193 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8195 * The global MiniBuffer * minibuffer variable is dead.
8197 * The global FD_form_main * fd_form_main variable is dead.
8199 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8201 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8203 * src/table.h: add the LOstream.h header
8204 * src/debug.h: ditto
8206 * src/LyXAction.h: change the explaination of the ReadOnly
8207 attribute: is indicates that the function _can_ be used.
8209 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8212 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8214 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8220 * src/paragraph.C (GetWord): assert on pos>=0
8223 * src/support/lyxstring.C: condition the use of an invariant on
8225 * src/support/lyxstring.h: ditto
8227 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8228 Use LAssert.h instead of plain assert().
8230 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8232 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8233 * src/support/filetools.C: ditto
8235 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8238 * INSTALL: document the new configure flags
8240 * configure.in: suppress --with-debug; add --enable-assertions
8242 * acinclude.m4: various changes in alignment of help strings.
8244 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8246 * src/kbmap.C: commented out the use of the hash map in kb_map,
8247 beginning of movement to a stl::container.
8249 * several files: removed code that was not in effect when
8250 MOVE_TEXT was defined.
8252 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8253 for escaping should not be used. We can discuss if the string
8254 should be enclosed in f.ex. [] instead of "".
8256 * src/trans_mgr.C (insert): use the new returned value from
8257 encodeString to get deadkeys and keymaps done correctly.
8259 * src/chset.C (encodeString): changed to return a pair, to tell
8260 what to use if we know the string.
8262 * src/lyxscreen.h (fillArc): new function.
8264 * src/FontInfo.C (resize): rewritten to use more std::string like
8265 structore, especially string::replace.
8267 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8270 * configure.in (chmod +x some scripts): remove config/gcc-hack
8272 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8274 * src/buffer.C (writeFile): change once again the top comment in a
8275 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8276 instead of an hardcoded version number.
8277 (makeDocBookFile): ditto
8279 * src/version.h: add new define LYX_DOCVERSION
8281 * po/de.po: update from Pit Sütterlin
8282 * lib/bind/de_menus.bind: ditto.
8284 * src/lyxfunc.C (Dispatch): call MenuExport()
8285 * src/buffer.C (Dispatch): ditto
8287 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8288 LyXFunc::Dispatch().
8289 (MenuExport): new function, moved from
8290 LyXFunc::Dispatch().
8292 * src/trans_mgr.C (insert): small cleanup
8293 * src/chset.C (loadFile): ditto
8295 * lib/kbd/iso8859-1.cdef: add missing backslashes
8297 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8299 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8300 help with placing the manually drawn accents better.
8302 (Draw): x2 and hg changed to float to minimize rounding errors and
8303 help place the accents better.
8305 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8306 unsigned short to char is just wrong...cast the char to unsigned
8307 char instead so that the two values can compare sanely. This
8308 should also make the display of insetlatexaccents better and
8309 perhaps also some other insets.
8311 (lbearing): new function
8314 1999-12-15 Allan Rae <rae@lyx.org>
8316 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8317 header that provides a wrapper around the very annoying SGI STL header
8320 * src/support/lyxstring.C, src/LString.h:
8321 removed old SGI-STL-compatability attempts.
8323 * configure.in: Use LYX_STL_STRING_FWD.
8325 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8326 stl_string_fwd.h is around and try to determine it's location.
8327 Major improvement over previous SGI STL 3.2 compatability.
8328 Three small problems remain with this function due to my zero
8329 knowledge of autoconf. JMarc and lgb see the comments in the code.
8331 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8333 * src/broken_const.h, config/hack-gcc, config/README: removed
8335 * configure.in: remove --with-gcc-hack option; do not call
8338 * INSTALL: remove documentation of --with-broken-const and
8341 * acconfig.h: remove all trace of BROKEN_CONST define
8343 * src/buffer.C (makeDocBookFile): update version number in output
8345 (SimpleDocBookOnePar): fix an assert when trying to a character
8346 access beyond string length
8349 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8351 * po/de.po: fix the Export menu
8353 * lyx.man: update the description of -dbg
8355 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8356 (commandLineHelp): updated
8357 (easyParse): show list of available debug levels if -dbg is passed
8360 * src/Makefile.am: add debug.C
8362 * src/debug.h: moved some code to debug.C
8364 * src/debug.C: new file. Contains code to set and show debug
8367 * src/layout.C: remove 'break' after 'continue' in switch
8368 statements, since these cannot be reached.
8370 1999-12-13 Allan Rae <rae@lyx.org>
8372 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8373 (in_word_set): hash() -> math_hash()
8375 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8377 * acconfig.h: Added a test for whether we are using exceptions in the
8378 current compilation run. If so USING_EXCEPTIONS is defined.
8380 * config.in: Check for existance of stl_string_fwd.h
8381 * src/LString.h: If compiling --with-included-string and SGI's
8382 STL version 3.2 is present (see above test) we need to block their
8383 forward declaration of string and supply a __get_c_string().
8384 However, it turns out this is only necessary if compiling with
8385 exceptions enabled so I've a bit more to add yet.
8387 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8388 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8389 src/support/LRegex.h, src/undo.h:
8390 Shuffle the order of the included files a little to ensure that
8391 LString.h gets included before anything that includes stl_string_fwd.h
8393 * src/support/lyxstring.C: We need to #include LString.h instead of
8394 lyxstring.h to get the necessary definition of __get_c_string.
8395 (__get_c_string): New function. This is defined static just like SGI's
8396 although why they need to do this I'm not sure. Perhaps it should be
8397 in lstrings.C instead.
8399 * lib/templates/IEEEtran.lyx: New template file.
8401 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8403 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8404 * intl/Makefile.in (MKINSTALLDIRS): ditto
8406 * src/LyXAction.C (init): changed to hold the LFUN data in a
8407 automatic array in stead of in callso to newFunc, this speeds up
8408 compilation a lot. Also all the memory used by the array is
8409 returned when the init is completed.
8411 * a lot of files: compiled with -Wold-style-cast, changed most of
8412 the reported offenders to C++ style casts. Did not change the
8413 offenders in C files.
8415 * src/trans.h (Match): change argument type to unsigned int.
8417 * src/support/DebugStream.C: fix some types on the streambufs so
8418 that it works on a conforming implementation.
8420 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8422 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8424 * src/support/lyxstring.C: remove the inline added earlier since
8425 they cause a bunch of unsatisfied symbols when linking with dec
8426 cxx. Cxx likes to have the body of inlines at the place where they
8429 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8430 accessing negative bounds in array. This fixes the crash when
8431 inserting accented characters.
8432 * src/trans.h (Match): ditto
8434 * src/buffer.C (Dispatch): since this is a void, it should not try
8435 to return anything...
8437 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8439 * src/buffer.h: removed the two friends from Buffer. Some changes
8440 because of this. Buffer::getFileName and Buffer::setFileName
8441 renamed to Buffer::fileName() and Buffer::fileName(...).
8443 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8445 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8446 and Buffer::update(short) to BufferView. This move is currently
8447 controlled by a define MOVE_TEXT, this will be removed when all
8448 shows to be ok. This move paves the way for better separation
8449 between buffer contents and buffer view. One side effect is that
8450 the BufferView needs a rebreak when swiching buffers, if we want
8451 to avoid this we can add a cache that holds pointers to LyXText's
8452 that is not currently in use.
8454 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8457 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8459 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8461 * lyx_main.C: new command line option -x (or --execute) and
8462 -e (or --export). Now direct conversion from .lyx to .tex
8463 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8464 Unfortunately, X is still needed and the GUI pops up during the
8467 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8469 * src/Spacing.C: add a using directive to bring stream stuff into
8471 * src/paragraph.C: ditto
8472 * src/buffer.C: ditto
8474 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8475 from Lars' announcement).
8477 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8478 example files from Tino Meinen.
8480 1999-12-06 Allan Rae <rae@lyx.org>
8482 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8484 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8486 * src/support/lyxstring.C: added a lot of inline for no good
8489 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8490 latexWriteEndChanges, they were not used.
8492 * src/layout.h (operator<<): output operator for PageSides
8494 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8496 * some example files: loaded in LyX 1.0.4 and saved again to update
8497 certain constructs (table format)
8499 * a lot of files: did the change to use fstream/iostream for all
8500 writing of files. Done with a close look at Andre Poenitz's patch.
8502 * some files: whitespace changes.
8504 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8506 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8507 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8508 architecture, we provide our own. It is used unconditionnally, but
8509 I do not think this is a performance problem. Thanks to Angus
8510 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8511 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8513 (GetInset): use my_memcpy.
8517 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8518 it is easier to understand, but it uses less TeX-only constructs now.
8520 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8521 elements contain spaces
8523 * lib/configure: regenerated
8525 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8526 elements contain spaces; display the list of programs that are
8529 * autogen.sh: make sure lib/configure is executable
8531 * lib/examples/*: rename the tutorial examples to begin with the
8532 two-letters language code.
8534 * src/lyxfunc.C (getStatus): do not query current font if no
8537 * src/lyx_cb.C (RunScript): use QuoteName
8538 (MenuRunDvips): ditto
8539 (PrintApplyCB): ditto
8541 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8542 around argument, so that it works well with the current shell.
8543 Does not work properly with OS/2 shells currently.
8545 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8546 * src/LyXSendto.C (SendtoApplyCB): ditto
8547 * src/lyxfunc.C (Dispatch): ditto
8548 * src/buffer.C (runLaTeX): ditto
8549 (runLiterate): ditto
8550 (buildProgram): ditto
8552 * src/lyx_cb.C (RunScript): ditto
8553 (MenuMakeLaTeX): ditto
8555 * src/buffer.h (getLatexName): new method
8557 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8559 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8561 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8562 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8563 (create_math_panel): ditto
8565 * src/lyxfunc.C (getStatus): re-activate the code which gets
8566 current font and cursor; add test for export to html.
8568 * src/lyxrc.C (read): remove unreachable break statements; add a
8571 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8573 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8575 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8576 introduced by faulty regex.
8577 * src/buffer.C: ditto
8578 * src/lastfiles.C: ditto
8579 * src/paragraph.C: ditto
8580 * src/table.C: ditto
8581 * src/vspace.C: ditto
8582 * src/insets/figinset.C: ditto
8583 Note: most of these is absolutely harmless, except the one in
8584 src/mathed formula.C.
8586 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8588 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8589 operation, yielding correct results for the reLyX command.
8591 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8593 * src/support/filetools.C (ExpandPath): removed an over eager
8595 (ReplaceEnvironmentPath): ditto
8597 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8598 shows that we are doing something fishy in our code...
8602 * src/lyxrc.C (read): use a double switch trick to get more help
8603 from the compiler. (the same trick is used in layout.C)
8604 (write): new function. opens a ofstream and pass that to output
8605 (output): new function, takes a ostream and writes the lyxrc
8606 elemts to it. uses a dummy switch to make sure no elements are
8609 * src/lyxlex.h: added a struct pushpophelper for use in functions
8610 with more than one exit point.
8612 * src/lyxlex.[Ch] (GetInteger): made it const
8616 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8618 * src/layout.[hC] : LayoutTags splitted into several enums, new
8619 methods created, better error handling cleaner use of lyxlex. Read
8622 * src/bmtable.[Ch]: change some member prototypes because of the
8623 image const changes.
8625 * commandtags.h, src/LyXAction.C (init): new function:
8626 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8627 This file is not read automatically but you can add \input
8628 preferences to your lyxrc if you want to. We need to discuss how
8631 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8632 in .aux, also remove .bib and .bst files from dependencies when
8635 * src/BufferView.C, src/LyXView.C: add const_cast several places
8636 because of changes to images.
8638 * lib/images/*: same change as for images/*
8640 * lib/lyxrc.example: Default for accept_compound is false not no.
8642 * images/*: changed to be const, however I have som misgivings
8643 about this change so it might be changed back.
8645 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8647 * lib/configure, po/POTFILES.in: regenerated
8649 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8651 * config/lib_configure.m4: removed
8653 * lib/configure.m4: new file (was config/lib_configure.m4)
8655 * configure.in: do not test for rtti, since we do not use it.
8657 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8659 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8660 doubling of allocated space scheme. This makes it faster for large
8661 strings end to use less memory for small strings. xtra rememoved.
8663 * src/insets/figinset.C (waitalarm): commented out.
8664 (GhostscriptMsg): use static_cast
8665 (GhostscriptMsg): use new instead of malloc to allocate memory for
8666 cmap. also delete the memory after use.
8668 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8670 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8671 for changes in bibtex database or style.
8672 (runBibTeX): remove all .bib and .bst files from dep before we
8674 (run): use scanAuc in when dep file already exist.
8676 * src/DepTable.C (remove_files_with_extension): new method
8679 * src/DepTable.[Ch]: made many of the methods const.
8681 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8683 * src/bufferparams.C: make sure that the default textclass is
8684 "article". It used to be the first one by description order, but
8685 now the first one is "docbook".
8687 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8688 string; call Debug::value.
8689 (easyParse): pass complete argument to setDebuggingLevel().
8691 * src/debug.h (value): fix the code that parses debug levels.
8693 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8696 * src/LyXAction.C: use Debug::ACTION as debug channel.
8698 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8700 * NEWS: updated for the future 1.1.3 release.
8702 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8703 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8704 it should. This is of course a controversial change (since many
8705 people will find that their lyx workscreen is suddenly full of
8706 red), but done for the sake of correctness.
8708 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8709 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8711 * src/insets/inseterror.h, src/insets/inseturl.h,
8712 src/insets/insetinfo.h, src/insets/figinset.h,
8713 src/mathed/formulamacro.h, src/mathed/math_macro.h
8714 (EditMessage): add a missing const and add _() to make sure that
8717 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8718 src/insets/insetbib.C, src/support/filetools.C: add `using'
8721 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8722 doing 'Insert index of last word' at the beginning of a paragraph.
8724 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8726 * several files: white-space changes.
8728 * src/mathed/formula.C: removed IsAlpha and IsDigit
8730 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8731 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8734 * src/insets/figinset.C (GetPSSizes): don't break when
8735 "EndComments" is seen. But break when a boundingbox is read.
8737 * all classes inherited from Inset: return value of Clone
8738 changed back to Inset *.
8740 * all classes inherited form MathInset: return value of Clone
8741 changed back to MathedInset *.
8743 * src/insets/figinset.C (runqueue): use a ofstream to output the
8744 gs/ps file. Might need some setpresicion or setw. However I can
8745 see no problem with the current code.
8746 (runqueue): use sleep instead of the alarm/signal code. I just
8747 can't see the difference.
8749 * src/paragraph.C (LyXParagraph): reserve space in the new
8750 paragraph and resize the inserted paragraph to just fit.
8752 * src/lyxfunc.h (operator|=): added operator for func_status.
8754 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8755 check for readable file.
8757 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8758 check for readable file.
8759 (MenuMakeLinuxDoc): ditto
8760 (MenuMakeDocBook): ditto
8761 (MenuMakeAscii): ditto
8762 (InsertAsciiFile): split the test for openable and readable
8764 * src/bmtable.C (draw_bitmaptable): use
8765 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8767 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8768 findtexfile from LaTeX to filetools.
8770 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8771 instead of FilePtr. Needs to be verified by a literate user.
8773 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8775 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8776 (EditMessage): likewise.
8778 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8779 respectively as \textasciitilde and \textasciicircum.
8781 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8783 * src/support/lyxstring.h: made the methods that take iterators
8786 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8787 (regexMatch): made is use the real regex class.
8789 * src/support/Makefile.am: changed to use libtool
8791 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8793 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8795 (MathIsInset ++): changed several macros to be inline functions
8798 * src/mathed/Makefile.am: changed to use libtool
8800 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8802 * src/insets/inset* : Clone changed to const and return type is
8803 the true insettype not just Inset*.
8805 * src/insets/Makefile.am: changed to use libtool
8807 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8809 * src/undo.[Ch] : added empty() and changed some of the method
8812 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8814 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8815 setID use block<> for the bullets array, added const several places.
8817 * src/lyxfunc.C (getStatus): new function
8819 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8820 LyXAction, added const to several funtions.
8822 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8823 a std::map, and to store the dir items in a vector.
8825 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8828 * src/LyXView.[Ch] + other files : changed currentView to view.
8830 * src/LyXAction.[Ch] : ported from the old devel branch.
8832 * src/.cvsignore: added .libs and a.out
8834 * configure.in : changes to use libtool.
8836 * acinclude.m4 : inserted libtool.m4
8838 * .cvsignore: added libtool
8840 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8842 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8843 file name in insets and mathed directories (otherwise the
8844 dependency is not taken in account under cygwin).
8846 * src/text2.C (InsertString[AB]): make sure that we do not try to
8847 read characters past the string length.
8849 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8851 * lib/doc/LaTeXConfig.lyx.in,
8852 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8854 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8855 file saying who created them and when this heppened; this is
8856 useless and annoys tools like cvs.
8858 * lib/layouts/g-brief-{en,de}.layout,
8859 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8860 from Thomas Hartkens <thomas@hartkens.de>.
8862 * src/{insets,mathed}/Makefile.am: do not declare an empty
8863 LDFLAGS, so that it can be set at configure time (useful on Irix
8866 * lib/reLyX/configure.in: make sure that the prefix is set
8867 correctly in LYX_DIR.
8869 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8871 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8872 be used by 'command-sequence' this allows to bind a key to a
8873 sequence of LyX-commands
8874 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8876 * src/LyXAction.C: add "command-sequence"
8878 * src/LyXFunction.C: handling of "command-sequence"
8880 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8881 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8883 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8885 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8887 * src/buffer.C (writeFile): Do not output a comment giving user
8888 and date at the beginning of a .lyx file. This is useless and
8889 annoys cvs anyway; update version number to 1.1.
8891 * src/Makefile.am (LYX_DIR): add this definition, so that a
8892 default path is hardcoded in LyX.
8894 * configure.in: Use LYX_GNU_GETTEXT.
8896 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8897 AM_GNU_GETTEXT with a bug fixed.
8899 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8901 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8903 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8904 which is used to point to LyX data is now LYX_DIR_11x.
8906 * lyx.man: convert to a unix text file; small updates.
8908 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8910 * src/support/LSubstring.[Ch]: made the second arg of most of the
8911 constructors be a const reference.
8913 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8916 * src/support/lyxstring.[Ch] (swap): added missing member function
8917 and specialization of swap(str, str);
8919 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8921 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8922 trace of the old one.
8924 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8925 put the member definitions in undo.C.
8927 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8928 NEW_TEXT and have now only code that was included when this was
8931 * src/intl.C (LCombo): use static_cast
8933 (DispatchCallback): ditto
8935 * src/definitions.h: removed whole file
8937 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8939 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8940 parsing and stores in a std:map. a regex defines the file format.
8941 removed unneeded members.
8943 * src/bufferparams.h: added several enums from definitions.h here.
8944 Removed unsused destructor. Changed some types to use proper enum
8945 types. use block to have the temp_bullets and user_defined_bullets
8946 and to make the whole class assignable.
8948 * src/bufferparams.C (Copy): removed this functions, use a default
8951 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8954 * src/buffer.C (readLyXformat2): commend out all that have with
8955 oldpapersize to do. also comment out all that hve to do with
8956 insetlatex and insetlatexdel.
8957 (setOldPaperStuff): commented out
8959 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8961 * src/LyXAction.C: remove use of inset-latex-insert
8963 * src/mathed/math_panel.C (button_cb): use static_cast
8965 * src/insets/Makefile.am (insets_o_SOURCES): removed
8968 * src/support/lyxstring.C (helper): use the unsigned long
8969 specifier, UL, instead of a static_cast.
8971 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8973 * src/support/block.h: new file. to be used as a c-style array in
8974 classes, so that the class can be assignable.
8976 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8978 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8979 NULL, make sure to return an empty string (it is not possible to
8980 set a string to NULL).
8982 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8984 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8986 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8988 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8989 link line, so that Irix users (for example) can set it explicitely to
8992 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8993 it can be overidden at make time (static or dynamic link, for
8996 * src/vc-backend.C, src/LaTeXFeatures.h,
8997 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8998 statements to bring templates to global namespace.
9000 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9002 * src/support/lyxstring.C (operator[] const): make it standard
9005 * src/minibuffer.C (Init): changed to reflect that more
9006 information is given from the lyxvc and need not be provided here.
9008 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9010 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9012 * src/LyXView.C (UpdateTimerCB): use static_cast
9013 (KeyPressMask_raw_callback): ditto
9015 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9016 buffer_, a lot of changes because of this. currentBuffer() ->
9017 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9018 also changes to other files because of this.
9020 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9022 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9023 have no support for RCS and partial support for CVS, will be
9026 * src/insets/ several files: changes because of function name
9027 changes in Bufferview and LyXView.
9029 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9031 * src/support/LSubstring.[Ch]: new files. These implement a
9032 Substring that can be very convenient to use. i.e. is this
9034 string a = "Mary had a little sheep";
9035 Substring(a, "sheep") = "lamb";
9036 a is now "Mary has a little lamb".
9038 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9039 out patterns and subpatterns of strings. It is used by LSubstring
9040 and also by vc-backend.C
9042 * src/support/lyxstring.C: went over all the assertions used and
9043 tried to correct the wrong ones and flag which of them is required
9044 by the standard. some bugs found because of this. Also removed a
9045 couple of assertions.
9047 * src/support/Makefile.am (libsupport_a_SOURCES): added
9048 LSubstring.[Ch] and LRegex.[Ch]
9050 * src/support/FileInfo.h: have struct stat buf as an object and
9051 not a pointer to one, some changes because of this.
9053 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9054 information in layout when adding the layouts preamble to the
9057 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9060 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9061 because of bug in OS/2.
9063 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9065 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9066 \verbatim@font instead of \ttfamily, so that it can be redefined.
9068 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9069 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9070 src/layout.h, src/text2.C: add 'using' directive to bring the
9071 STL templates we need from the std:: namespace to the global one.
9072 Needed by DEC cxx in strict ansi mode.
9074 * src/support/LIstream.h,src/support/LOstream.h,
9075 src/support/lyxstring.h,src/table.h,
9076 src/lyxlookup.h: do not include <config.h> in header
9077 files. This should be done in the .C files only.
9079 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9083 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9085 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9086 from Kayvan to fix the tth invokation.
9088 * development/lyx.spec.in: updates from Kayvan to reflect the
9089 changes of file names.
9091 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9093 * src/text2.C (InsertStringB): use std::copy
9094 (InsertStringA): use std::copy
9096 * src/bufferlist.C: use a vector to store the buffers in. This is
9097 an internal change and should not affect any other thing.
9099 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9102 * src/text.C (Fill): fix potential bug, one off bug.
9104 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9106 * src/Makefile.am (lyx_main.o): add more files it depends on.
9108 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9110 * src/support/lyxstring.C: use size_t for the reference count,
9111 size, reserved memory and xtra.
9112 (internal_compare): new private member function. Now the compare
9113 functions should work for std::strings that have embedded '\0'
9115 (compare): all compare functions rewritten to use
9118 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9120 * src/support/lyxstring.C (compare): pass c_str()
9121 (compare): pass c_str
9122 (compare): pass c_str
9124 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9126 * src/support/DebugStream.C: <config.h> was not included correctly.
9128 * lib/configure: forgot to re-generate it :( I'll make this file
9129 auto generated soon.
9131 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9133 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9136 * src/support/lyxstring.C: some changes from length() to rep->sz.
9137 avoids a function call.
9139 * src/support/filetools.C (SpaceLess): yet another version of the
9140 algorithm...now per Jean-Marc's suggestions.
9142 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9144 * src/layout.C (less_textclass_desc): functor for use in sorting
9146 (LyXTextClass::Read): sort the textclasses after reading.
9148 * src/support/filetools.C (SpaceLess): new version of the
9149 SpaceLess functions. What problems does this one give? Please
9152 * images/banner_bw.xbm: made the arrays unsigned char *
9154 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9156 * src/support/lyxstring.C (find): remove bogus assertion in the
9157 two versions of find where this has not been done yet.
9159 * src/support/lyxlib.h: add missing int return type to
9162 * src/menus.C (ShowFileMenu): disable exporting to html if no
9163 html export command is present.
9165 * config/lib_configure.m4: add a test for an HTML converter. The
9166 programs checked for are, in this order: tth, latex2html and
9169 * lib/configure: generated from config/lib_configure.m4.
9171 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9172 html converter. The parameters are now passed through $$FName and
9173 $$OutName, instead of standard input/output.
9175 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9177 * lib/lyxrc.example: update description of \html_command.
9178 add "quotes" around \screen_font_xxx font setting examples to help
9179 people who use fonts with spaces in their names.
9181 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9183 * Distribution files: updates for v1.1.2
9185 * src/support/lyxstring.C (find): remove bogus assert and return
9186 npos for the same condition.
9188 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9190 * added patch for OS/2 from SMiyata.
9192 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9194 * src/text2.C (CutSelection): make space_wrapped a bool
9195 (CutSelection): dont declare int i until we have to.
9196 (alphaCounter): return a char const *.
9198 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9200 * src/support/syscall.C (Systemcalls::kill):
9201 src/support/filetools.C (PutEnv, PutEnvPath):
9202 src/lyx_cb.C (addNewlineAndDepth):
9203 src/FontInfo.C (FontInfo::resize): condition some #warning
9204 directives with WITH_WARNINGS.
9207 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9209 * src/layout.[Ch] + several files: access to class variables
9210 limited and made accessor functions instead a lot of code changed
9211 becuase of this. Also instead of returning pointers often a const
9212 reference is returned instead.
9214 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9216 * src/Makefile.am (dist-hook): added used to remove the CVS from
9217 cheaders upon creating a dist
9218 (EXTRA_DIST): added cheaders
9220 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9221 a character not as a small integer.
9223 * src/support/lyxstring.C (find): removed Assert and added i >=
9224 rep->sz to the first if.
9226 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9228 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9229 src/LyXView.C src/buffer.C src/bufferparams.C
9230 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9231 src/text2.C src/insets/insetinclude.C:
9232 lyxlayout renamed to textclasslist.
9234 * src/layout.C: some lyxerr changes.
9236 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9237 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9238 (LyXLayoutList): removed all traces of this class.
9239 (LyXTextClass::Read): rewrote LT_STYLE
9240 (LyXTextClass::hasLayout): new function
9241 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9242 both const and nonconst version.
9243 (LyXTextClass::delete_layout): new function.
9244 (LyXTextClassList::Style): bug fix. do the right thing if layout
9246 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9247 (LyXTextClassList::NameOfLayout): ditto
9248 (LyXTextClassList::Load): ditto
9250 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9252 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9254 * src/LyXAction.C (LookupFunc): added a workaround for sun
9255 compiler, on the other hand...we don't know if the current code
9256 compiles on sun at all...
9258 * src/support/filetools.C (CleanupPath): subst fix
9260 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9263 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9264 complained about this one?
9266 * src/insets/insetinclude.C (Latex): subst fix
9268 * src/insets/insetbib.C (getKeys): subst fix
9270 * src/LyXSendto.C (SendtoApplyCB): subst fix
9272 * src/lyx_main.C (init): subst fix
9274 * src/layout.C (Read): subst fix
9276 * src/lyx_sendfax_main.C (button_send): subst fix
9278 * src/buffer.C (RoffAsciiTable): subst fix
9280 * src/lyx_cb.C (MenuFax): subst fix
9281 (PrintApplyCB): subst fix
9283 1999-10-26 Juergen Vigna <jug@sad.it>
9285 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9287 (Read): Cleaned up this code so now we read only format vestion >= 5
9289 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9291 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9292 come nobody has complained about this one?
9294 * src/insets/insetinclude.C (Latex): subst fix
9296 * src/insets/insetbib.C (getKeys): subst fix
9298 * src/lyx_main.C (init): subst fix
9300 * src/layout.C (Read): subst fix
9302 * src/buffer.C (RoffAsciiTable): subst fix
9304 * src/lyx_cb.C (MenuFax): subst fix.
9306 * src/layout.[hC] + some other files: rewrote to use
9307 std::container to store textclasses and layouts in.
9308 Simplified, removed a lot of code. Make all classes
9309 assignable. Further simplifications and review of type
9310 use still to be one.
9312 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9313 lastfiles to create the lastfiles partr of the menu.
9315 * src/lastfiles.[Ch]: rewritten to use deque to store the
9316 lastfiles in. Uses fstream for reading and writing. Simplifies
9319 * src/support/syscall.C: remove explicit cast.
9321 * src/BufferView.C (CursorToggleCB): removed code snippets that
9323 use explicat C++ style casts instead of C style casts. also use
9324 u_vdata instea of passing pointers in longs.
9326 * src/PaperLayout.C: removed code snippets that were commented out.
9328 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9330 * src/lyx_main.C: removed code snippets that wer commented out.
9332 * src/paragraph.C: removed code snippets that were commented out.
9334 * src/lyxvc.C (logClose): use static_cast
9336 (viewLog): remove explicit cast to void*
9337 (showLog): removed old commented code
9339 * src/menus.C: use static_cast instead of C style casts. use
9340 u_vdata instead of u_ldata. remove explicit cast to (long) for
9341 pointers. Removed old code that was commented out.
9343 * src/insets/inset.C: removed old commented func
9345 * src/insets/insetref.C (InsetRef): removed old code that had been
9346 commented out for a long time.
9348 (escape): removed C style cast
9350 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9352 * src/insets/insetlatex.C (Draw): removed old commented code
9353 (Read): rewritten to use string
9355 * src/insets/insetlabel.C (escape): removed C style cast
9357 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9359 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9362 * src/insets/insetinclude.h: removed a couple of stupid bools
9364 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9365 (Clone): remove C style cast
9366 (getKeys): changed list to lst because of std::list
9368 * src/insets/inseterror.C (Draw): removed som old commented code.
9370 * src/insets/insetcommand.C (Draw): removed some old commented code.
9372 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9373 commented out forever.
9374 (bibitem_cb): use static_cast instead of C style cast
9375 use of vdata changed to u_vdata.
9377 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9379 (CloseUrlCB): use static_cast instead of C style cast.
9380 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9382 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9383 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9384 (CloseInfoCB): static_cast from ob->u_vdata instead.
9385 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9388 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9389 (C_InsetError_CloseErrorCB): forward the ob parameter
9390 (CloseErrorCB): static_cast from ob->u_vdata instead.
9392 * src/vspace.h: include LString.h since we use string in this class.
9394 * src/vspace.C (lyx_advance): changed name from advance because of
9395 nameclash with stl. And since we cannot use namespaces yet...I
9396 used a lyx_ prefix instead. Expect this to change when we begin
9399 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9401 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9402 and removed now defunct constructor and deconstructor.
9404 * src/BufferView.h: have backstack as a object not as a pointer.
9405 removed initialization from constructor. added include for BackStack
9407 * development/lyx.spec.in (%build): add CFLAGS also.
9409 * src/screen.C (drawFrame): removed another warning.
9411 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9413 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9414 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9415 README and ANNOUNCE a bit for the next release. More work is
9418 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9419 unbreakable if we are in freespacing mode (LyX-Code), but not in
9422 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9424 * src/BackStack.h: fixed initialization order in constructor
9426 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9428 * acinclude.m4 (VERSION): new rules for when a version is
9429 development, added also a variable for prerelease.
9430 (warnings): we set with_warnings=yes for prereleases
9431 (lyx_opt): prereleases compile with same optimization as development
9432 (CXXFLAGS): only use pedantic if we are a development version
9434 * src/BufferView.C (restorePosition): don't do anything if the
9437 * src/BackStack.h: added member empty, use this to test if there
9438 is anything to pop...
9440 1999-10-25 Juergen Vigna <jug@sad.it>
9443 * forms/layout_forms.fd +
9444 * forms/latexoptions.fd +
9445 * lyx.fd: changed for various form resize issues
9447 * src/mathed/math_panel.C +
9448 * src/insets/inseterror.C +
9449 * src/insets/insetinfo.C +
9450 * src/insets/inseturl.C +
9451 * src/insets/inseturl.h +
9454 * src/PaperLayout.C +
9455 * src/ParagraphExtra.C +
9456 * src/TableLayout.C +
9458 * src/layout_forms.C +
9465 * src/menus.C: fixed various resize issues. So now forms can be
9466 resized savely or not be resized at all.
9468 * forms/form_url.fd +
9469 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9472 * src/insets/Makefile.am: added files form_url.[Ch]
9474 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9476 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9477 (and presumably 6.2).
9479 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9480 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9481 remaining static member callbacks.
9483 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9486 * src/support/lyxstring.h: declare struct Srep as friend of
9487 lyxstring, since DEC cxx complains otherwise.
9489 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9491 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9493 * src/LaTeX.C (run): made run_bibtex also depend on files with
9495 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9496 are put into the dependency file.
9498 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9499 the code has shown itself to work
9500 (create_ispell_pipe): removed another warning, added a comment
9503 * src/minibuffer.C (ExecutingCB): removed code that has been
9504 commented out a long time
9506 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9507 out code + a warning.
9509 * src/support/lyxstring.h: comment out the three private
9510 operators, when compiling with string ansi conforming compilers
9513 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9515 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9516 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9519 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9522 * src/mathed/math_panel.C (create_math_panel): remove explicit
9525 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9528 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9529 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9530 to XCreatePixmapFromBitmapData
9531 (fl_set_bmtable_data): change the last argument to be unsigned
9533 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9534 and bh to be unsigned int, remove explicit casts in call to
9535 XReadBitmapFileData.
9537 * images/arrows.xbm: made the arrays unsigned char *
9538 * images/varsz.xbm: ditto
9539 * images/misc.xbm: ditto
9540 * images/greek.xbm: ditto
9541 * images/dots.xbm: ditto
9542 * images/brel.xbm: ditto
9543 * images/bop.xbm: ditto
9545 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9547 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9548 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9549 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9551 (LYX_CXX_CHEADERS): added <clocale> to the test.
9553 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9555 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9557 * src/support/lyxstring.C (append): fixed something that must be a
9558 bug, rep->assign was used instead of rep->append.
9560 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9563 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9564 lyx insert double chars. Fix spotted by Kayvan.
9566 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9568 * Fixed the tth support. I messed up with the Emacs patch apply feature
9569 and omitted the changes in lyxrc.C.
9571 1999-10-22 Juergen Vigna <jug@sad.it>
9573 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9575 * src/lyx_cb.C (MenuInsertRef) +
9576 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9577 the form cannot be resized under it limits (fixes a segfault)
9579 * src/lyx.C (create_form_form_ref) +
9580 * forms/lyx.fd: Changed Gravity on name input field so that it is
9583 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9585 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9586 <ostream> and <istream>.
9588 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9589 whether <fstream> provides the latest standard features, or if we
9590 have an oldstyle library (like in egcs).
9591 (LYX_CXX_STL_STRING): fix the test.
9593 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9594 code on MODERN_STL_STREAM.
9596 * src/support/lyxstring.h: use L{I,O}stream.h.
9598 * src/support/L{I,O}stream.h: new files, designed to setup
9599 correctly streams for our use
9600 - includes the right header depending on STL capabilities
9601 - puts std::ostream and std::endl (for LOStream.h) or
9602 std::istream (LIStream.h) in toplevel namespace.
9604 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9606 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9607 was a bib file that had been changed we ensure that bibtex is run.
9608 (runBibTeX): enhanced to extract the names of the bib files and
9609 getting their absolute path and enter them into the dep file.
9610 (findtexfile): static func that is used to look for tex-files,
9611 checks for absolute patchs and tries also with kpsewhich.
9612 Alternative ways of finding the correct files are wanted. Will
9614 (do_popen): function that runs a command using popen and returns
9615 the whole output of that command in a string. Should be moved to
9618 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9619 file with extension ext has changed.
9621 * src/insets/figinset.C: added ifdef guards around the fl_free
9622 code that jug commented out. Now it is commented out when
9623 compiling with XForms == 0.89.
9625 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9626 to lyxstring.C, and only keep a forward declaration in
9627 lyxstring.h. Simplifies the header file a bit and should help a
9628 bit on compile time too. Also changes to Srep will not mandate a
9629 recompile of code just using string.
9630 (~lyxstring): definition moved here since it uses srep.
9631 (size): definition moved here since it uses srep.
9633 * src/support/lyxstring.h: removed a couple of "inline" that should
9636 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9638 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9641 1999-10-21 Juergen Vigna <jug@sad.it>
9643 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9644 set to left if I just remove the width entry (or it is empty).
9646 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9647 paragraph when having dummy paragraphs.
9649 1999-10-20 Juergen Vigna <jug@sad.it>
9651 * src/insets/figinset.C: just commented some fl_free_form calls
9652 and added warnings so that this calls should be activated later
9653 again. This avoids for now a segfault, but we have a memory leak!
9655 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9656 'const char * argument' to 'string argument', this should
9657 fix some Asserts() in lyxstring.C.
9659 * src/lyxfunc.h: Removed the function argAsString(const char *)
9660 as it is not used anymore.
9662 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9664 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9667 * src/Literate.h: some funcs moved from public to private to make
9668 interface clearer. Unneeded args removed.
9670 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9672 (scanBuildLogFile): ditto
9674 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9675 normal TeX Error. Still room for improvement.
9677 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9679 * src/buffer.C (insertErrors): changes to make the error
9680 desctription show properly.
9682 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9685 * src/support/lyxstring.C (helper): changed to use
9686 sizeof(object->rep->ref).
9687 (operator>>): changed to use a pointer instead.
9689 * src/support/lyxstring.h: changed const reference & to value_type
9690 const & lets see if that helps.
9692 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9694 * Makefile.am (rpmdist): fixed to have non static package and
9697 * src/support/lyxstring.C: removed the compilation guards
9699 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9702 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9703 conditional compile of lyxstring.Ch
9705 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9706 stupid check, but it is a lot better than the bastring hack.
9707 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9709 * several files: changed string::erase into string::clear. Not
9712 * src/chset.C (encodeString): use a char temporary instead
9714 * src/table.C (TexEndOfCell): added tostr around
9715 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9716 (TexEndOfCell): ditto
9717 (TexEndOfCell): ditto
9718 (TexEndOfCell): ditto
9719 (DocBookEndOfCell): ditto
9720 (DocBookEndOfCell): ditto
9721 (DocBookEndOfCell): ditto
9722 (DocBookEndOfCell): ditto
9724 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9726 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9728 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9729 (MenuBuildProg): added tostr around ret
9730 (MenuRunChktex): added tostr around ret
9731 (DocumentApplyCB): added tostr around ret
9733 * src/chset.C (encodeString): added tostr around t->ic
9735 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9736 (makeLaTeXFile): added tostr around tocdepth
9737 (makeLaTeXFile): added tostr around ftcound - 1
9739 * src/insets/insetbib.C (setCounter): added tostr around counter.
9741 * src/support/lyxstring.h: added an operator+=(int) to catch more
9744 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9745 (lyxstring): We DON'T allow NULL pointers.
9747 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9749 * src/mathed/math_macro.C (MathMacroArgument::Write,
9750 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9751 when writing them out.
9753 * src/LString.C: remove, since it is not used anymore.
9755 * src/support/lyxstring.C: condition the content to
9756 USE_INCLUDED_STRING macro.
9758 * src/mathed/math_symbols.C, src/support/lstrings.C,
9759 src/support/lyxstring.C: add `using' directive to specify what
9760 we need in <algorithm>. I do not think that we need to
9761 conditionalize this, but any thought is appreciated.
9763 * many files: change all callback functions to "C" linkage
9764 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9765 strict_ansi. Those who were static are now global.
9766 The case of callbacks which are static class members is
9767 trickier, since we have to make C wrappers around them (see
9768 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9769 did not finish this yet, since it defeats the purpose of
9770 encapsulation, and I am not sure what the best route is.
9772 1999-10-19 Juergen Vigna <jug@sad.it>
9774 * src/support/lyxstring.C (lyxstring): we permit to have a null
9775 pointer as assignment value and just don't assign it.
9777 * src/vspace.C (nextToken): corrected this function substituting
9778 find_first(_not)_of with find_last_of.
9780 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9781 (TableOptCloseCB) (TableSpeCloseCB):
9782 inserted fl_set_focus call for problem with fl_hide_form() in
9785 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9787 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9790 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9792 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9793 LyXLex::next() and not eatline() to get its argument.
9795 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9797 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9798 instead, use fstreams for io of the depfile, removed unneeded
9799 functions and variables.
9801 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9802 vector instead, removed all functions and variables that is not in
9805 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9807 * src/buffer.C (insertErrors): use new interface to TeXError
9809 * Makefile.am (rpmdist): added a rpmdist target
9811 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9812 per Kayvan's instructions.
9814 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9816 * src/Makefile.am: add a definition for localedir, so that locales
9817 are found after installation (Kayvan)
9819 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9821 * development/.cvsignore: new file.
9823 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9825 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9826 C++ compiler provides wrappers for C headers and use our alternate
9829 * configure.in: use LYX_CXX_CHEADERS.
9831 * src/cheader/: new directory, populated with cname headers from
9832 libstdc++-2.8.1. They are a bit old, but probably good enough for
9833 what we want (support compilers who lack them).
9835 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9836 from includes. It turns out is was stupid.
9838 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9840 * lib/Makefile.am (install-data-local): forgot a ';'
9841 (install-data-local): forgot a '\'
9842 (libinstalldirs): needed after all. reintroduced.
9844 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9846 * configure.in (AC_OUTPUT): added lyx.spec
9848 * development/lyx.spec: removed file
9850 * development/lyx.spec.in: new file
9852 * po/*.po: merged with lyx.pot becuase of make distcheck
9854 * lib/Makefile.am (dist-hook): added dist-hook so that
9855 documentation files will be included when doing a make
9856 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9857 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9859 more: tried to make install do the right thing, exclude CVS dirs
9862 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9863 Path would fit in more nicely.
9865 * all files that used to use pathstack: uses now Path instead.
9866 This change was a lot easier than expected.
9868 * src/support/path.h: new file
9870 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9872 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9874 * src/support/lyxstring.C (getline): Default arg was given for
9877 * Configure.cmd: removed file
9879 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9881 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9882 streams classes and types, add the proper 'using' statements when
9883 MODERN_STL is defined.
9885 * src/debug.h: move the << operator definition after the inclusion
9888 * src/support/filetools.C: include "LAssert.h", which is needed
9891 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9894 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9895 include "debug.h" to define a proper ostream.
9897 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9899 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9900 method to the SystemCall class which can kill a process, but it's
9901 not fully implemented yet.
9903 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9905 * src/support/FileInfo.h: Better documentation
9907 * src/lyxfunc.C: Added support for buffer-export html
9909 * src/menus.C: Added Export->As HTML...
9911 * lib/bind/*.bind: Added short-cut for buffer-export html
9913 * src/lyxrc.*: Added support for new \tth_command
9915 * lib/lyxrc.example: Added stuff for new \tth_command
9917 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9919 * lib/Makefile.am (IMAGES): removed images/README
9920 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9921 installes in correct place. Check permisions is installed
9924 * src/LaTeX.C: some no-op changes moved declaration of some
9927 * src/LaTeX.h (LATEX_H): changed include guard name
9929 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9931 * lib/reLyX/Makefile.am: install noweb2lyx.
9933 * lib/Makefile.am: install configure.
9935 * lib/reLyX/configure.in: declare a config aux dir; set package
9936 name to lyx (not sure what the best solution is); generate noweb2lyx.
9938 * lib/layouts/egs.layout: fix the bibliography layout.
9940 1999-10-08 Jürgen Vigna <jug@sad.it>
9942 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9943 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9944 it returned without continuing to search the path.
9946 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9948 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9949 also fixes a bug. It is not allowed to do tricks with std::strings
9950 like: string a("hei"); &a[e]; this will not give what you
9951 think... Any reason for the complexity in this func?
9953 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9955 * Updated README and INSTALL a bit, mostly to check that my
9956 CVS rights are correctly set up.
9958 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9960 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9961 does not allow '\0' chars but lyxstring and std::string does.
9963 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9965 * autogen.sh (AUTOCONF): let the autogen script create the
9966 POTFILES.in file too. POTFILES.in should perhaps now not be
9967 included in the cvs module.
9969 * some more files changed to use C++ includes instead of C ones.
9971 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9973 (Reread): added tostr to nlink. buggy output otherwise.
9974 (Reread): added a string() around szMode when assigning to Buffer,
9975 without this I got a log of garbled info strings.
9977 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9980 * I have added several ostream & operator<<(ostream &, some_type)
9981 functions. This has been done to avoid casting and warnings when
9982 outputting enums to lyxerr. This as thus eliminated a lot of
9983 explicit casts and has made the code clearer. Among the enums
9984 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9985 mathed enums, some font enum the Debug::type enum.
9987 * src/support/lyxstring.h (clear): missing method. equivalent of
9990 * all files that contained "stderr": rewrote constructs that used
9991 stderr to use lyxerr instead. (except bmtable)
9993 * src/support/DebugStream.h (level): and the passed t with
9994 Debug::ANY to avoid spurious bits set.
9996 * src/debug.h (Debug::type value): made it accept strings of the
9999 * configure.in (Check for programs): Added a check for kpsewhich,
10000 the latex generation will use this later to better the dicovery of
10003 * src/BufferView.C (create_view): we don't need to cast this to
10004 (void*) that is done automatically.
10005 (WorkAreaButtonPress): removed some dead code.
10007 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10009 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10010 is not overwritten when translated (David Sua'rez de Lis).
10012 * lib/CREDITS: Added David Sua'rez de Lis
10014 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10016 * src/bufferparams.C (BufferParams): default input encoding is now
10019 * acinclude.m4 (cross_compiling): comment out macro
10020 LYX_GXX_STRENGTH_REDUCE.
10022 * acconfig.h: make sure that const is not defined (to empty) when
10023 we are compiling C++. Remove commented out code using SIZEOF_xx
10026 * configure.in : move the test for const and inline as late as
10027 possible so that these C tests do not interefere with C++ ones.
10028 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10029 has not been proven.
10031 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10033 * src/table.C (getDocBookAlign): remove bad default value for
10034 isColumn parameter.
10036 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10038 (ShowFileMenu2): ditto.
10040 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10041 of files to ignore.
10043 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10045 * Most files: finished the change from the old error code to use
10046 DebugStream for all lyxerr debugging. Only minor changes remain
10047 (e.g. the setting of debug levels using strings instead of number)
10049 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10051 * src/layout.C (Add): Changed to use compare_no_case instead of
10054 * src/FontInfo.C: changed loop variable type too string::size_type.
10056 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10058 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10059 set ETAGS_ARGS to --c++
10061 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10063 * src/table.C (DocBookEndOfCell): commented out two unused variables
10065 * src/paragraph.C: commented out four unused variables.
10067 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10068 insed a if clause with type string::size_type.
10070 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10073 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10075 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10076 variable, also changed loop to go from 0 to lenght + 1, instead of
10077 -1 to length. This should be correct.
10079 * src/LaTeX.C (scanError): use string::size_type as loop variable
10082 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10083 (l.896) since y_tmp and row was not used anyway.
10085 * src/insets/insetref.C (escape): use string::size_type as loop
10088 * src/insets/insetquotes.C (Width): use string::size_type as loop
10090 (Draw): use string::size_type as loop variable type.
10092 * src/insets/insetlatexaccent.C (checkContents): use
10093 string::size_type as loop variable type.
10095 * src/insets/insetlabel.C (escape): use string::size_type as loop
10098 * src/insets/insetinfo.C: added an extern for current_view.
10100 * src/insets/insetcommand.C (scanCommand): use string::size_type
10101 as loop variable type.
10103 * most files: removed the RCS tags. With them we had to recompile
10104 a lot of files after a simple cvs commit. Also we have never used
10105 them for anything meaningful.
10107 * most files: tags-query-replace NULL 0. As adviced several plases
10108 we now use "0" instead of "NULL" in our code.
10110 * src/support/filetools.C (SpaceLess): use string::size_type as
10111 loop variable type.
10113 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10115 * src/paragraph.C: fixed up some more string stuff.
10117 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10119 * src/support/filetools.h: make modestr a std::string.
10121 * src/filetools.C (GetEnv): made ch really const.
10123 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10124 made code that used these use max/min from <algorithm> instead.
10126 * changed several c library include files to their equivalent c++
10127 library include files. All is not changed yet.
10129 * created a support subdir in src, put lyxstring and lstrings
10130 there + the extra files atexit, fileblock, strerror. Created
10131 Makefile.am. edited configure.in and src/Makefile.am to use this
10132 new subdir. More files moved to support.
10134 * imported som of the functions from repository lyx, filetools
10136 * ran tags-query-replace on LString -> string, corrected the bogus
10137 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10138 is still some errors in there. This is errors where too much or
10139 too litle get deleted from strings (string::erase, string::substr,
10140 string::replace), there can also be some off by one errors, or
10141 just plain wrong use of functions from lstrings. Viewing of quotes
10144 * LyX is now running fairly well with string, but there are
10145 certainly some bugs yet (see above) also string is quite different
10146 from LString among others in that it does not allow null pointers
10147 passed in and will abort if it gets any.
10149 * Added the revtex4 files I forgot when setting up the repository.
10151 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10153 * All over: Tried to clean everything up so that only the files
10154 that we really need are included in the cvs repository.
10155 * Switched to use automake.
10156 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10157 * Install has not been checked.
10159 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10161 * po/pt.po: Three errors:
10162 l.533 and l.538 format specification error
10163 l. 402 duplicate entry, I just deleted it.